diff options
author | Daniel Baumann <daniel.baumann@progress-linux.org> | 2024-04-07 15:49:25 +0000 |
---|---|---|
committer | Daniel Baumann <daniel.baumann@progress-linux.org> | 2024-04-07 15:49:25 +0000 |
commit | 464df1d5e5ab1322e2dd0a7796939fff1aeefa9a (patch) | |
tree | 6a403684e0978f0287d7f0ec0e5aab1fd31a59e1 /lib/ext2fs | |
parent | Initial commit. (diff) | |
download | e2fsprogs-upstream/1.47.0.tar.xz e2fsprogs-upstream/1.47.0.zip |
Adding upstream version 1.47.0.upstream/1.47.0upstream
Signed-off-by: Daniel Baumann <daniel.baumann@progress-linux.org>
Diffstat (limited to '')
150 files changed, 60455 insertions, 0 deletions
diff --git a/lib/ext2fs/Android.bp b/lib/ext2fs/Android.bp new file mode 100644 index 0000000..db8b3b7 --- /dev/null +++ b/lib/ext2fs/Android.bp @@ -0,0 +1,129 @@ +// Copyright 2017 The Android Open Source Project + +package { + // See: http://go/android-license-faq + // A large-scale-change added 'default_applicable_licenses' to import + // all of the 'license_kinds' from "external_e2fsprogs_license" + // to get the below license kinds: + // SPDX-license-identifier-GPL + // SPDX-license-identifier-GPL-2.0 + // SPDX-license-identifier-LGPL + // SPDX-license-identifier-LGPL-2.1 + // SPDX-license-identifier-LGPL-3.0 + // legacy_unencumbered + default_applicable_licenses: ["external_e2fsprogs_license"], +} + +cc_library { + name: "libext2fs", + host_supported: true, + ramdisk_available: true, + vendor_ramdisk_available: true, + recovery_available: true, + unique_host_soname: true, + defaults: ["e2fsprogs-defaults"], + srcs: [ + "ext2_err.c", + "alloc.c", + "alloc_sb.c", + "alloc_stats.c", + "alloc_tables.c", + "atexit.c", + "badblocks.c", + "bb_inode.c", + "bitmaps.c", + "bitops.c", + "blkmap64_ba.c", + "blkmap64_rb.c", + "blknum.c", + "block.c", + "bmap.c", + "check_desc.c", + "crc16.c", + "crc32c.c", + "csum.c", + "closefs.c", + "dblist.c", + "dblist_dir.c", + "digest_encode.c", + "dirblock.c", + "dirhash.c", + "dir_iterate.c", + "dupfs.c", + "expanddir.c", + "ext_attr.c", + "extent.c", + "fallocate.c", + "fileio.c", + "finddev.c", + "flushb.c", + "freefs.c", + "gen_bitmap.c", + "gen_bitmap64.c", + "get_num_dirs.c", + "get_pathname.c", + "getsize.c", + "getsectsize.c", + "hashmap.c", + "i_block.c", + "icount.c", + "imager.c", + "ind_block.c", + "initialize.c", + "inline.c", + "inline_data.c", + "inode.c", + "io_manager.c", + "ismounted.c", + "link.c", + "llseek.c", + "lookup.c", + "mmp.c", + "mkdir.c", + "mkjournal.c", + "namei.c", + "native.c", + "newdir.c", + "nls_utf8.c", + "openfs.c", + "progress.c", + "punch.c", + "qcow2.c", + "rbtree.c", + "read_bb.c", + "read_bb_file.c", + "res_gdt.c", + "rw_bitmaps.c", + "sha256.c", + "sha512.c", + "swapfs.c", + "symlink.c", + "undo_io.c", + "unix_io.c", + "sparse_io.c", + "unlink.c", + "valid_blk.c", + "version.c", + // get rid of this?! + "test_io.c", + ], + shared_libs: [ + "libext2_com_err", + "libsparse", + "libz", + ], + target: { + android: { + shared_libs: ["libext2_uuid"], + }, + windows: { + enabled: true, + srcs: ["windows_io.c"], + exclude_srcs: ["unix_io.c"], + }, + }, + + header_libs: ["libext2-headers"], + export_include_dirs: ["."], + export_header_lib_headers: ["libext2-headers"], +} diff --git a/lib/ext2fs/Makefile.in b/lib/ext2fs/Makefile.in new file mode 100644 index 0000000..798ff60 --- /dev/null +++ b/lib/ext2fs/Makefile.in @@ -0,0 +1,1459 @@ +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +top_builddir = ../.. +my_dir = lib/ext2fs +INSTALL = @INSTALL@ +MKDIR_P = @MKDIR_P@ +DEPEND_CFLAGS = -I$(top_srcdir)/debugfs -I$(srcdir)/../../e2fsck -DDEBUGFS +# This nastiness is needed because of jfs_user.h hackery; when we finally +# clean up this mess, we should be able to drop it +DEBUGFS_CFLAGS = -I$(srcdir)/../../e2fsck $(ALL_CFLAGS) -DDEBUGFS + +@MCONFIG@ + +@DEBUGFS_CMT@DEBUGFS_LIB_OBJS = bb_compat.o inode_io.o write_bb_file.o + +MK_CMDS= _SS_DIR_OVERRIDE=$(srcdir)/../ss ../ss/mk_cmds +COMPILE_ET= _ET_DIR_OVERRIDE=$(srcdir)/../et ../et/compile_et + +@RESIZER_CMT@RESIZE_LIB_OBJS = dupfs.o +@TEST_IO_CMT@TEST_IO_LIB_OBJS = test_io.o +@IMAGER_CMT@E2IMAGE_LIB_OBJS = imager.o + +DEBUG_OBJS= debug_cmds.o extent_cmds.o tst_cmds.o debugfs.o util.o \ + ncheck.o icheck.o ls.o lsdel.o dump.o set_fields.o logdump.o \ + htree.o unused.o e2freefrag.o filefrag.o extent_inode.o zap.o \ + xattrs.o quota.o tst_libext2fs.o create_inode.o journal.o \ + revoke.o recovery.o do_journal.o + +DEBUG_SRCS= debug_cmds.c extent_cmds.c tst_cmds.c \ + $(top_srcdir)/debugfs/debugfs.c \ + $(top_srcdir)/debugfs/util.c \ + $(top_srcdir)/debugfs/ncheck.c \ + $(top_srcdir)/debugfs/icheck.c \ + $(top_srcdir)/debugfs/ls.c \ + $(top_srcdir)/debugfs/lsdel.c \ + $(top_srcdir)/debugfs/dump.c \ + $(top_srcdir)/debugfs/set_fields.c \ + $(top_srcdir)/debugfs/logdump.c \ + $(top_srcdir)/debugfs/htree.c \ + $(top_srcdir)/debugfs/unused.c \ + $(top_srcdir)/debugfs/filefrag.c \ + $(top_srcdir)/debugfs/extent_inode.c \ + $(top_srcdir)/debugfs/zap.c \ + $(top_srcdir)/debugfs/quota.c \ + $(top_srcdir)/debugfs/xattrs.c \ + $(top_srcdir)/misc/e2freefrag.c \ + $(top_srcdir)/misc/create_inode.c \ + $(top_srcdir)/debugfs/journal.c \ + $(top_srcdir)/e2fsck/revoke.c \ + $(top_srcdir)/e2fsck/recovery.c \ + $(top_srcdir)/debugfs/do_journal.c + +@TDB_CMT@TDB_OBJ= tdb.o + +OBJS= $(DEBUGFS_LIB_OBJS) $(RESIZE_LIB_OBJS) $(E2IMAGE_LIB_OBJS) \ + $(TEST_IO_LIB_OBJS) \ + ext2_err.o \ + alloc.o \ + alloc_sb.o \ + alloc_stats.o \ + alloc_tables.o \ + atexit.o \ + badblocks.o \ + bb_inode.o \ + bitmaps.o \ + bitops.o \ + blkmap64_ba.o \ + blkmap64_rb.o \ + blknum.o \ + block.o \ + bmap.o \ + check_desc.o \ + closefs.o \ + crc16.o \ + crc32c.o \ + csum.o \ + dblist.o \ + dblist_dir.o \ + dirblock.o \ + dirhash.o \ + dir_iterate.o \ + expanddir.o \ + ext_attr.o \ + extent.o \ + fallocate.o \ + fileio.o \ + finddev.o \ + flushb.o \ + freefs.o \ + gen_bitmap.o \ + gen_bitmap64.o \ + get_num_dirs.o \ + get_pathname.o \ + getsize.o \ + getsectsize.o \ + hashmap.o \ + i_block.o \ + icount.o \ + ind_block.o \ + initialize.o \ + inline.o \ + inline_data.o \ + inode.o \ + io_manager.o \ + ismounted.o \ + link.o \ + llseek.o \ + lookup.o \ + mkdir.o \ + mkjournal.o \ + mmp.o \ + namei.o \ + native.o \ + newdir.o \ + nls_utf8.o \ + openfs.o \ + orphan.o \ + progress.o \ + punch.o \ + qcow2.o \ + read_bb.o \ + read_bb_file.o \ + res_gdt.o \ + rw_bitmaps.o \ + sha512.o \ + swapfs.o \ + symlink.o \ + $(TDB_OBJ) \ + undo_io.o \ + @OS_IO_FILE@.o \ + sparse_io.o \ + unlink.o \ + valid_blk.o \ + version.o \ + rbtree.o + +SRCS= ext2_err.c \ + $(srcdir)/alloc.c \ + $(srcdir)/alloc_sb.c \ + $(srcdir)/alloc_stats.c \ + $(srcdir)/alloc_tables.c \ + $(srcdir)/atexit.c \ + $(srcdir)/badblocks.c \ + $(srcdir)/bb_compat.c \ + $(srcdir)/bb_inode.c \ + $(srcdir)/bitmaps.c \ + $(srcdir)/bitops.c \ + $(srcdir)/blkmap64_ba.c \ + $(srcdir)/blkmap64_rb.c \ + $(srcdir)/block.c \ + $(srcdir)/bmap.c \ + $(srcdir)/check_desc.c \ + $(srcdir)/closefs.c \ + $(srcdir)/crc16.c \ + $(srcdir)/crc32c.c \ + $(srcdir)/gen_crc32ctable.c \ + $(srcdir)/csum.c \ + $(srcdir)/dblist.c \ + $(srcdir)/dblist_dir.c \ + $(srcdir)/digest_encode.c \ + $(srcdir)/dirblock.c \ + $(srcdir)/dirhash.c \ + $(srcdir)/dir_iterate.c \ + $(srcdir)/dupfs.c \ + $(srcdir)/expanddir.c \ + $(srcdir)/ext_attr.c \ + $(srcdir)/extent.c \ + $(srcdir)/fileio.c \ + $(srcdir)/finddev.c \ + $(srcdir)/flushb.c \ + $(srcdir)/freefs.c \ + $(srcdir)/gen_bitmap.c \ + $(srcdir)/gen_bitmap64.c \ + $(srcdir)/get_num_dirs.c \ + $(srcdir)/get_pathname.c \ + $(srcdir)/getsize.c \ + $(srcdir)/getsectsize.c \ + $(srcdir)/hashmap.c \ + $(srcdir)/i_block.c \ + $(srcdir)/icount.c \ + $(srcdir)/ind_block.c \ + $(srcdir)/initialize.c \ + $(srcdir)/inline.c \ + $(srcdir)/inline_data.c \ + $(srcdir)/inode.c \ + $(srcdir)/inode_io.c \ + $(srcdir)/imager.c \ + $(srcdir)/io_manager.c \ + $(srcdir)/ismounted.c \ + $(srcdir)/link.c \ + $(srcdir)/llseek.c \ + $(srcdir)/lookup.c \ + $(srcdir)/mkdir.c \ + $(srcdir)/mkjournal.c \ + $(srcdir)/mmp.c \ + $(srcdir)/namei.c \ + $(srcdir)/native.c \ + $(srcdir)/newdir.c \ + $(srcdir)/nls_utf8.c \ + $(srcdir)/openfs.c \ + $(srcdir)/orphan.c \ + $(srcdir)/progress.c \ + $(srcdir)/punch.c \ + $(srcdir)/qcow2.c \ + $(srcdir)/read_bb.c \ + $(srcdir)/read_bb_file.c \ + $(srcdir)/res_gdt.c \ + $(srcdir)/rw_bitmaps.c \ + $(srcdir)/sha256.c \ + $(srcdir)/sha512.c \ + $(srcdir)/swapfs.c \ + $(srcdir)/symlink.c \ + $(srcdir)/tdb.c \ + $(srcdir)/test_io.c \ + $(srcdir)/tst_badblocks.c \ + $(srcdir)/tst_bitops.c \ + $(srcdir)/tst_byteswap.c \ + $(srcdir)/tst_getsize.c \ + $(srcdir)/tst_iscan.c \ + $(srcdir)/undo_io.c \ + $(srcdir)/@OS_IO_FILE@.c \ + $(srcdir)/sparse_io.c \ + $(srcdir)/unlink.c \ + $(srcdir)/valid_blk.c \ + $(srcdir)/version.c \ + $(srcdir)/write_bb_file.c \ + $(srcdir)/rbtree.c \ + $(srcdir)/tst_libext2fs.c \ + $(DEBUG_SRCS) + +HFILES= bitops.h ext2fs.h ext2_io.h ext2_fs.h ext2_ext_attr.h ext3_extents.h \ + tdb.h qcow2.h hashmap.h +HFILES_IN= ext2_err.h ext2_types.h + +LIBRARY= libext2fs +LIBDIR= ext2fs + +ELF_VERSION = 2.4 +ELF_SO_VERSION = 2 +ELF_IMAGE = libext2fs +ELF_MYDIR = ext2fs +ELF_INSTALL_DIR = $(root_libdir) +ELF_OTHER_LIBS = -lcom_err + +BSDLIB_VERSION = 2.1 +BSDLIB_IMAGE = libext2fs +BSDLIB_MYDIR = ext2fs +BSDLIB_INSTALL_DIR = $(root_libdir) + +@MAKEFILE_LIBRARY@ +@MAKEFILE_ELF@ +@MAKEFILE_BSDLIB@ +@MAKEFILE_PROFILE@ + +all:: ext2fs.pc + +.c.o: + $(E) " CC $<" + $(Q) $(CC) $(ALL_CFLAGS_STLIB) -c $< -o $@ + $(Q) $(CHECK_CMD) $(ALL_CFLAGS) $< + $(Q) $(CPPCHECK_CMD) $(CPPFLAGS) $< +@PROFILE_CMT@ $(Q) $(CC) $(ALL_CFLAGS_STLIB) -g -pg -o profiled/$*.o -c $< +@ELF_CMT@ $(Q) $(CC) $(ALL_CFLAGS_SHLIB) -fPIC -shared -o elfshared/$*.o -c $< +@BSDLIB_CMT@ $(Q) $(CC) $(ALL_CFLAGS_SHLIB) $(BSDLIB_PIC_FLAG) -o pic/$*.o -c $< + +DISTFILES= Makefile *.c *.h image + +ext2_err.et: $(DEP_SUBSTITUTE) $(srcdir)/ext2_err.et.in + $(E) " SUBST $@" + $(Q) $(SUBSTITUTE) $(srcdir)/ext2_err.et.in ext2_err.et + +ext2_err.c ext2_err.h: ext2_err.et + $(E) " COMPILE_ET ext2_err.et" + $(Q) $(COMPILE_ET) ext2_err.et + +ext2fs.pc: $(srcdir)/ext2fs.pc.in $(top_builddir)/config.status + $(E) " CONFIG.STATUS $@" + $(Q) cd $(top_builddir); CONFIG_FILES=lib/ext2fs/ext2fs.pc ./config.status + +tst_badblocks: tst_badblocks.o $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o tst_badblocks tst_badblocks.o $(ALL_LDFLAGS) \ + $(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS) + +tst_digest_encode: $(srcdir)/digest_encode.c $(srcdir)/ext2_fs.h + $(E) " CC $@" + $(Q) $(CC) $(ALL_LDFLAGS) $(ALL_CFLAGS) -o tst_digest_encode \ + $(srcdir)/digest_encode.c -DUNITTEST $(SYSLIBS) + +tst_icount: $(srcdir)/icount.c $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o tst_icount $(srcdir)/icount.c -DDEBUG \ + $(ALL_CFLAGS) $(ALL_LDFLAGS) \ + $(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS) + +tst_iscan: tst_iscan.o $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o tst_iscan tst_iscan.o $(ALL_LDFLAGS) \ + $(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS) + +tst_getsize: tst_getsize.o $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o tst_getsize tst_getsize.o $(ALL_LDFLAGS) \ + $(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS) + +tst_ismounted: $(srcdir)/ismounted.c $(STATIC_LIBEXT2FS) \ + $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o tst_ismounted $(srcdir)/ismounted.c \ + $(STATIC_LIBEXT2FS) -DDEBUG $(ALL_CFLAGS) $(ALL_LDFLAGS) \ + $(STATIC_LIBCOM_ERR) $(SYSLIBS) + +tst_byteswap: tst_byteswap.o $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o tst_byteswap tst_byteswap.o $(ALL_LDFLAGS) \ + $(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS) + +tst_bitops: tst_bitops.o $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o tst_bitops tst_bitops.o $(ALL_CFLAGS) $(ALL_LDFLAGS) \ + $(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS) + +tst_getsectsize: tst_getsectsize.o getsectsize.o $(STATIC_LIBEXT2FS) \ + $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o tst_getsectsize tst_getsectsize.o getsectsize.o \ + $(ALL_LDFLAGS) $(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) \ + $(SYSLIBS) + +tst_types.o: $(srcdir)/tst_types.c ext2_types.h + +tst_types: tst_types.o ext2_types.h + $(E) " LD $@" + $(Q) $(CC) -o tst_types tst_types.o $(ALL_LDFLAGS) $(SYSLIBS) + +tst_super_size.o: $(srcdir)/tst_super_size.c $(srcdir)/ext2_fs.h + +tst_super_size: tst_super_size.o + $(E) " LD $@" + $(Q) $(CC) -o tst_super_size tst_super_size.o $(ALL_LDFLAGS) $(SYSLIBS) + +tst_fs_struct.o: $(srcdir)/tst_fs_struct.c $(srcdir)/ext2fs.h + +tst_fs_struct: tst_fs_struct.o + $(E) " LD $@" + $(Q) $(CC) -o tst_fs_struct tst_fs_struct.o $(ALL_LDFLAGS) $(SYSLIBS) + +tst_inode_size.o: $(srcdir)/tst_inode_size.c $(srcdir)/ext2_fs.h + +tst_inode_size: tst_inode_size.o + $(E) " LD $@" + $(Q) $(CC) -o tst_inode_size tst_inode_size.o $(ALL_LDFLAGS) $(SYSLIBS) + +tst_sha256: $(srcdir)/sha256.c $(srcdir)/ext2_fs.h + $(E) " CC $@" + $(Q) $(CC) $(ALL_LDFLAGS) $(ALL_CFLAGS) -o tst_sha256 \ + $(srcdir)/sha256.c -DUNITTEST $(SYSLIBS) + +tst_sha512: $(srcdir)/sha512.c $(srcdir)/ext2_fs.h + $(E) " CC $@" + $(Q) $(CC) $(ALL_LDFLAGS) $(ALL_CFLAGS) -o tst_sha512 \ + $(srcdir)/sha512.c -DUNITTEST $(SYSLIBS) + +ext2_tdbtool: tdbtool.o + $(E) " LD $@" + $(Q) $(CC) -o ext2_tdbtool tdbtool.o tdb.o $(ALL_LDFLAGS) $(SYSLIBS) + +tst_cmds.c tst_cmds.h: tst_cmds.ct + $(E) " MK_CMDS $@" + $(Q) $(MK_CMDS) $(srcdir)/tst_cmds.ct + +debug_cmds.c debug_cmds.h: $(top_srcdir)/debugfs/debug_cmds.ct + $(E) " MK_CMDS $<" + $(Q) $(MK_CMDS) $(top_srcdir)/debugfs/debug_cmds.ct + +extent_cmds.c extent_cmds.h: $(top_srcdir)/debugfs/extent_cmds.ct + $(E) " MK_CMDS $<" + $(Q) $(MK_CMDS) $(top_srcdir)/debugfs/extent_cmds.ct + +debugfs.o: $(top_srcdir)/debugfs/debugfs.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -DSKIP_GLOBDEFS -c $< -o $@ + +extent_inode.o: $(top_srcdir)/debugfs/extent_inode.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +util.o: $(top_srcdir)/debugfs/util.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +ncheck.o: $(top_srcdir)/debugfs/ncheck.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +icheck.o: $(top_srcdir)/debugfs/icheck.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +ls.o: $(top_srcdir)/debugfs/ls.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +lsdel.o: $(top_srcdir)/debugfs/lsdel.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +dump.o: $(top_srcdir)/debugfs/dump.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +set_fields.o: $(top_srcdir)/debugfs/set_fields.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +logdump.o: $(top_srcdir)/debugfs/logdump.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +htree.o: $(top_srcdir)/debugfs/htree.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +unused.o: $(top_srcdir)/debugfs/unused.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +zap.o: $(top_srcdir)/debugfs/zap.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +quota.o: $(top_srcdir)/debugfs/quota.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +journal.o: $(top_srcdir)/debugfs/journal.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +revoke.o: $(top_srcdir)/e2fsck/revoke.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +recovery.o: $(top_srcdir)/e2fsck/recovery.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +do_journal.o: $(top_srcdir)/debugfs/do_journal.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +xattrs.o: $(top_srcdir)/debugfs/xattrs.c + $(E) " CC $<" + $(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@ + +e2freefrag.o: $(top_srcdir)/misc/e2freefrag.c + $(E) " CC $<" + $(Q) $(CC) $(ALL_CFLAGS) -DDEBUGFS -I$(top_srcdir)/debugfs -c $< -o $@ + +create_inode.o: $(top_srcdir)/misc/create_inode.c + $(E) " CC $<" + $(Q) $(CC) $(ALL_CFLAGS) -DDEBUGFS -c $< -o $@ + +filefrag.o: $(top_srcdir)/debugfs/filefrag.c + $(E) " CC $<" + $(Q) $(CC) $(ALL_CFLAGS) -c $< -o $@ + +tst_libext2fs.o: $(srcdir)/tst_libext2fs.c + $(E) " CC $<" + $(Q) $(CC) $(ALL_CFLAGS) $(ALL_LDFLAGS) $(DEPEND_CFLAGS) -c $< -o $@ + +tst_bitmaps_cmd.c: tst_bitmaps_cmd.ct + $(E) " MK_CMDS $@" + $(Q) DIR=$(srcdir) $(MK_CMDS) $(srcdir)/tst_bitmaps_cmd.ct + +tst_bitmaps: tst_bitmaps.o tst_bitmaps_cmd.o $(srcdir)/blkmap64_rb.c \ + $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBSS) $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o $@ tst_bitmaps.o tst_bitmaps_cmd.o \ + -DDEBUG_RB $(srcdir)/blkmap64_rb.c $(ALL_CFLAGS) \ + $(ALL_LDFLAGS) $(STATIC_LIBEXT2FS) $(STATIC_LIBSS) \ + $(STATIC_LIBCOM_ERR) $(SYSLIBS) + +tst_extents: $(srcdir)/extent.c $(DEBUG_OBJS) $(DEPSTATIC_LIBSS) libext2fs.a \ + $(STATIC_LIBE2P) $(DEPLIBUUID) $(DEPLIBBLKID) $(DEPSTATIC_LIBCOM_ERR) \ + $(DEPLIBSUPPORT) + $(E) " LD $@" + $(Q) $(CC) -o tst_extents $(srcdir)/extent.c \ + $(ALL_CFLAGS) $(ALL_LDFLAGS) -DDEBUG $(DEBUG_OBJS) \ + $(STATIC_LIBSS) $(STATIC_LIBE2P) $(LIBSUPPORT) \ + $(STATIC_LIBEXT2FS) $(LIBBLKID) $(LIBUUID) \ + $(STATIC_LIBCOM_ERR) $(SYSLIBS) -I $(top_srcdir)/debugfs + +tst_libext2fs: $(DEBUG_OBJS) \ + $(DEPSTATIC_LIBSS) $(STATIC_LIBE2P) $(DEPLIBUUID) libext2fs.a \ + $(DEPLIBBLKID) $(DEPSTATIC_LIBCOM_ERR) $(DEPLIBSUPPORT) + $(E) " LD $@" + $(Q) $(CC) -o tst_libext2fs $(ALL_LDFLAGS) -DDEBUG $(DEBUG_OBJS) \ + $(STATIC_LIBSS) $(STATIC_LIBE2P) $(LIBSUPPORT) \ + $(STATIC_LIBEXT2FS) $(LIBBLKID) $(LIBUUID) $(LIBMAGIC) \ + $(STATIC_LIBCOM_ERR) $(SYSLIBS) -I $(top_srcdir)/debugfs + +tst_inline: $(srcdir)/inline.c $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o tst_inline $(srcdir)/inline.c $(ALL_CFLAGS) \ + $(ALL_LDFLAGS) -DDEBUG $(STATIC_LIBEXT2FS) \ + $(STATIC_LIBCOM_ERR) $(SYSLIBS) + +tst_inline_data: inline_data.c $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o tst_inline_data $(srcdir)/inline_data.c $(ALL_CFLAGS) \ + $(ALL_LDFLAGS) -DDEBUG $(STATIC_LIBEXT2FS) \ + $(STATIC_LIBCOM_ERR) $(SYSLIBS) + +tst_csum: csum.c $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) $(STATIC_LIBE2P) \ + $(top_srcdir)/lib/e2p/e2p.h + $(E) " LD $@" + $(Q) $(CC) -o tst_csum $(srcdir)/csum.c -DDEBUG \ + $(ALL_CFLAGS) $(ALL_LDFLAGS) $(STATIC_LIBEXT2FS) \ + $(STATIC_LIBCOM_ERR) $(STATIC_LIBE2P) $(SYSLIBS) + +tst_crc32c: $(srcdir)/crc32c.c $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) + $(Q) $(CC) $(ALL_LDFLAGS) $(ALL_CFLAGS) -o tst_crc32c $(srcdir)/crc32c.c \ + -DUNITTEST $(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) \ + $(SYSLIBS) + +mkjournal: mkjournal.c $(STATIC_LIBEXT2FS) $(DEPLIBCOM_ERR) + $(E) " LD $@" + $(Q) $(CC) -o mkjournal $(srcdir)/mkjournal.c -DDEBUG \ + $(STATIC_LIBEXT2FS) $(LIBCOM_ERR) $(ALL_CFLAGS) $(SYSLIBS) + +fullcheck check:: tst_bitops tst_badblocks tst_iscan tst_types tst_icount \ + tst_super_size tst_types tst_inode_size tst_csum tst_crc32c tst_bitmaps \ + tst_inline tst_inline_data tst_libext2fs tst_sha256 tst_sha512 \ + tst_digest_encode tst_getsize tst_getsectsize + $(TESTENV) ./tst_bitops + $(TESTENV) ./tst_badblocks + $(TESTENV) ./tst_iscan + $(TESTENV) ./tst_types + $(TESTENV) ./tst_icount + $(TESTENV) ./tst_super_size + $(TESTENV) ./tst_inode_size + $(TESTENV) ./tst_csum + $(TESTENV) ./tst_inline + $(TESTENV) ./tst_inline_data + $(TESTENV) ./tst_crc32c + $(TESTENV) ./tst_sha256 + $(TESTENV) ./tst_sha512 + $(TESTENV) ./tst_bitmaps -f $(srcdir)/tst_bitmaps_cmds > tst_bitmaps_out + diff $(srcdir)/tst_bitmaps_exp tst_bitmaps_out + $(TESTENV) ./tst_bitmaps -t 2 -f $(srcdir)/tst_bitmaps_cmds > tst_bitmaps_out + diff $(srcdir)/tst_bitmaps_exp tst_bitmaps_out + $(TESTENV) ./tst_bitmaps -t 3 -f $(srcdir)/tst_bitmaps_cmds > tst_bitmaps_out + diff $(srcdir)/tst_bitmaps_exp tst_bitmaps_out + $(TESTENV) ./tst_bitmaps -l -f $(srcdir)/tst_bitmaps_cmds > tst_bitmaps_out + diff $(srcdir)/tst_bitmaps_exp tst_bitmaps_out + $(TESTENV) ./tst_digest_encode + +installdirs:: + $(E) " MKDIR_P $(libdir) $(includedir)/ext2fs" + $(Q) $(MKDIR_P) $(DESTDIR)$(libdir) \ + $(DESTDIR)$(includedir)/ext2fs $(DESTDIR)$(pkgconfigdir) + +install:: all $(HFILES) $(HFILES_IN) installdirs ext2fs.pc + $(E) " INSTALL_DATA $(libdir)/libext2fs.a" + $(Q) $(INSTALL_DATA) libext2fs.a $(DESTDIR)$(libdir)/libext2fs.a + -$(Q) $(RANLIB) $(DESTDIR)$(libdir)/libext2fs.a + $(Q) $(CHMOD) $(LIBMODE) $(DESTDIR)$(libdir)/libext2fs.a + $(Q) for i in $(HFILES); do \ + echo " INSTALL_DATA $(includedir)/ext2fs/$$i"; \ + $(INSTALL_DATA) $(srcdir)/$$i $(DESTDIR)$(includedir)/ext2fs/$$i; \ + done + $(Q) for i in $(HFILES_IN); do \ + echo " INSTALL_DATA $(includedir)/ext2fs/$$i"; \ + $(INSTALL_DATA) $$i $(DESTDIR)$(includedir)/ext2fs/$$i; \ + done + $(E) " INSTALL_DATA $(pkgconfigdir)/ext2fs.pc" + $(Q) $(INSTALL_DATA) ext2fs.pc $(DESTDIR)$(pkgconfigdir)/ext2fs.pc + +uninstall:: + $(RM) -f $(DESTDIR)$(libdir)/libext2fs.a \ + $(DESTDIR)$(pkgconfigdir)/ext2fs.pc + $(RM) -rf $(DESTDIR)$(includedir)/ext2fs + +clean:: + $(RM) -f \#* *.s *.o *.a *~ *.bak core profiled/* \ + tst_badblocks tst_iscan ext2_err.et ext2_err.c ext2_err.h \ + tst_byteswap tst_ismounted tst_getsize tst_getsectsize \ + tst_bitops tst_types tst_icount tst_super_size tst_csum \ + tst_bitmaps tst_bitmaps_out tst_extents tst_inline \ + tst_inline_data tst_inode_size tst_bitmaps_cmd.c \ + tst_digest_encode tst_sha256 tst_sha512 \ + ext2_tdbtool mkjournal debug_cmds.c tst_cmds.c extent_cmds.c \ + ../libext2fs.a ../libext2fs_p.a ../libext2fs_chk.a \ + crc32c_table.h gen_crc32ctable tst_crc32c tst_libext2fs \ + ext2fs.pc ext2_types.h + +mostlyclean:: clean +distclean:: clean + $(RM) -f .depend ext2_err.c ext2_err.h Makefile ext2fs.pc \ + $(srcdir)/TAGS $(srcdir)/Makefile.in.old +# +# Hack to parallel makes recognize dependencies correctly. +# +$(top_builddir)/lib/ext2fs/ext2_err.h: ext2_err.h + +$(OBJS): subdirs + +gen_crc32ctable: $(srcdir)/gen_crc32ctable.c + $(E) " CC $@" + $(Q) $(BUILD_CC) $(BUILD_CFLAGS) $(BUILD_LDFLAGS) -o gen_crc32ctable \ + $(srcdir)/gen_crc32ctable.c + +crc32c_table.h: gen_crc32ctable + $(E) " GEN32CTABLE $@" + $(Q) ./gen_crc32ctable > crc32c_table.h + +$(top_builddir)/$(my_dir)/ext2_types.h: $(srcdir)/ext2_types.h.in \ + $(top_builddir)/config.status + cd $(top_builddir); CONFIG_FILES=$(my_dir)/ext2_types.h ./config.status + +$(srcdir)/utf8data.h: + $(Q) $(MAKE) $(MKUTF8DATA) + $(E) "MKUTF8DATA $@" + $(Q) $(MKUTF8DATA) -a $(top_srcdir)/util/ucd/DerivedAge-11.0.0.txt \ + -c $(top_srcdir)/util/ucd/DerivedCombiningClass-11.0.0.txt \ + -p $(top_srcdir)/util/ucd/DerivedCoreProperties-11.0.0.txt \ + -d $(top_srcdir)/util/ucd/UnicodeData-11.0.0.txt \ + -f $(top_srcdir)/util/ucd/CaseFolding-11.0.0.txt \ + -n $(top_srcdir)/util/ucd/NormalizationCorrections-11.0.0.txt \ + -t $(top_srcdir)/util/ucd/NormalizationTest-11.0.0.txt \ + -o $@ + +# +# This needs to be manually maintained since "make depend" on a +# Linux system is going to blow up due to the lack of windows.h +# header file. If someone on Windows tries to run "make depend", +# they will need to comment this chunk below. +# +windows_io.o: $(srcdir)/windows_io.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/bitops.h $(srcdir)/ext2fsP.h + +# +++ Dependency line eater +++ +# +# Makefile dependencies follow. This must be the last section in +# the Makefile.in file +# +ext2_err.o: ext2_err.c +alloc.o: $(srcdir)/alloc.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +alloc_sb.o: $(srcdir)/alloc_sb.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +alloc_stats.o: $(srcdir)/alloc_stats.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +alloc_tables.o: $(srcdir)/alloc_tables.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +atexit.o: $(srcdir)/atexit.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +badblocks.o: $(srcdir)/badblocks.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +bb_compat.o: $(srcdir)/bb_compat.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +bb_inode.o: $(srcdir)/bb_inode.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +bitmaps.o: $(srcdir)/bitmaps.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h $(srcdir)/bmap64.h +bitops.o: $(srcdir)/bitops.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +blkmap64_ba.o: $(srcdir)/blkmap64_ba.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/bmap64.h +blkmap64_rb.o: $(srcdir)/blkmap64_rb.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/bmap64.h $(srcdir)/rbtree.h \ + $(srcdir)/compiler.h +block.o: $(srcdir)/block.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +bmap.o: $(srcdir)/bmap.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +check_desc.o: $(srcdir)/check_desc.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +closefs.o: $(srcdir)/closefs.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +crc16.o: $(srcdir)/crc16.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_builddir)/lib/ext2fs/ext2_types.h \ + $(srcdir)/crc16.h +crc32c.o: $(srcdir)/crc32c.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/crc32c_defs.h $(srcdir)/ext2fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \ + $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h crc32c_table.h +gen_crc32ctable.o: $(srcdir)/gen_crc32ctable.c $(srcdir)/crc32c_defs.h +csum.o: $(srcdir)/csum.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/crc16.h +dblist.o: $(srcdir)/dblist.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +dblist_dir.o: $(srcdir)/dblist_dir.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +digest_encode.o: $(srcdir)/digest_encode.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \ + $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +dirblock.o: $(srcdir)/dirblock.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +dirhash.o: $(srcdir)/dirhash.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +dir_iterate.o: $(srcdir)/dir_iterate.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +dupfs.o: $(srcdir)/dupfs.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +expanddir.o: $(srcdir)/expanddir.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +ext_attr.o: $(srcdir)/ext_attr.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/ext4_acl.h $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h \ + $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +extent.o: $(srcdir)/extent.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/e2image.h +fileio.o: $(srcdir)/fileio.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +finddev.o: $(srcdir)/finddev.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +flushb.o: $(srcdir)/flushb.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +freefs.o: $(srcdir)/freefs.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +gen_bitmap.o: $(srcdir)/gen_bitmap.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +gen_bitmap64.o: $(srcdir)/gen_bitmap64.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/bmap64.h +get_num_dirs.o: $(srcdir)/get_num_dirs.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +get_pathname.o: $(srcdir)/get_pathname.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +getsize.o: $(srcdir)/getsize.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +getsectsize.o: $(srcdir)/getsectsize.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +hashmap.o: $(srcdir)/hashmap.c $(srcdir)/hashmap.h +i_block.o: $(srcdir)/i_block.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +icount.o: $(srcdir)/icount.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/tdb.h +ind_block.o: $(srcdir)/ind_block.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +initialize.o: $(srcdir)/initialize.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +inline.o: $(srcdir)/inline.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +inline_data.o: $(srcdir)/inline_data.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/ext2fsP.h +inode.o: $(srcdir)/inode.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/e2image.h +inode_io.o: $(srcdir)/inode_io.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +imager.o: $(srcdir)/imager.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +io_manager.o: $(srcdir)/io_manager.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +ismounted.o: $(srcdir)/ismounted.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +link.o: $(srcdir)/link.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +llseek.o: $(srcdir)/llseek.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_types.h +lookup.o: $(srcdir)/lookup.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +mkdir.o: $(srcdir)/mkdir.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +mkjournal.o: $(srcdir)/mkjournal.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(top_srcdir)/lib/e2p/e2p.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext2fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/kernel-jbd.h \ + $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h $(srcdir)/compiler.h +mmp.o: $(srcdir)/mmp.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +namei.o: $(srcdir)/namei.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +native.o: $(srcdir)/native.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +newdir.o: $(srcdir)/newdir.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +nls_utf8.o: $(srcdir)/nls_utf8.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h $(srcdir)/utf8data.h +openfs.o: $(srcdir)/openfs.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/e2image.h +progress.o: $(srcdir)/progress.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \ + $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/ext2fsP.h +punch.o: $(srcdir)/punch.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +qcow2.o: $(srcdir)/qcow2.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \ + $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/qcow2.h +read_bb.o: $(srcdir)/read_bb.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +read_bb_file.o: $(srcdir)/read_bb_file.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +res_gdt.o: $(srcdir)/res_gdt.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +rw_bitmaps.o: $(srcdir)/rw_bitmaps.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/e2image.h +sha256.o: $(srcdir)/sha256.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \ + $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +sha512.o: $(srcdir)/sha512.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \ + $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h +swapfs.o: $(srcdir)/swapfs.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +symlink.o: $(srcdir)/symlink.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +tdb.o: $(srcdir)/tdb.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/tdb.h +test_io.o: $(srcdir)/test_io.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +tst_badblocks.o: $(srcdir)/tst_badblocks.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +tst_bitops.o: $(srcdir)/tst_bitops.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +tst_byteswap.o: $(srcdir)/tst_byteswap.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +tst_getsize.o: $(srcdir)/tst_getsize.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +tst_iscan.o: $(srcdir)/tst_iscan.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +undo_io.o: $(srcdir)/undo_io.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +unix_io.o: $(srcdir)/unix_io.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/ext2fsP.h +sparse_io.o: $(srcdir)/sparse_io.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +unlink.o: $(srcdir)/unlink.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +valid_blk.o: $(srcdir)/valid_blk.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +version.o: $(srcdir)/version.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/version.h +write_bb_file.o: $(srcdir)/write_bb_file.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h +rbtree.o: $(srcdir)/rbtree.c $(srcdir)/rbtree.h $(srcdir)/compiler.h +tst_libext2fs.o: $(srcdir)/tst_libext2fs.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(top_srcdir)/lib/ss/ss.h \ + $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/debugfs/debugfs.h \ + $(srcdir)/ext2fs.h $(top_srcdir)/debugfs/../misc/create_inode.h \ + $(top_srcdir)/lib/e2p/e2p.h $(top_srcdir)/lib/support/quotaio.h \ + $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +debug_cmds.o: debug_cmds.c $(top_srcdir)/lib/ss/ss.h \ + $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h +extent_cmds.o: extent_cmds.c $(top_srcdir)/lib/ss/ss.h \ + $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h +tst_cmds.o: tst_cmds.c $(top_srcdir)/lib/ss/ss.h \ + $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h +debugfs.o: $(top_srcdir)/debugfs/debugfs.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h $(top_srcdir)/debugfs/../version.h \ + $(srcdir)/../../e2fsck/jfs_user.h $(srcdir)/kernel-jbd.h \ + $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h $(srcdir)/compiler.h \ + $(top_srcdir)/lib/support/plausible.h +util.o: $(top_srcdir)/debugfs/util.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/lib/ss/ss.h \ + $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h \ + $(top_srcdir)/debugfs/debugfs.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +ncheck.o: $(top_srcdir)/debugfs/ncheck.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +icheck.o: $(top_srcdir)/debugfs/icheck.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +ls.o: $(top_srcdir)/debugfs/ls.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +lsdel.o: $(top_srcdir)/debugfs/lsdel.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +dump.o: $(top_srcdir)/debugfs/dump.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +set_fields.o: $(top_srcdir)/debugfs/set_fields.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +logdump.o: $(top_srcdir)/debugfs/logdump.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h $(srcdir)/../../e2fsck/jfs_user.h \ + $(srcdir)/kernel-jbd.h $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h \ + $(srcdir)/compiler.h $(srcdir)/fast_commit.h +htree.o: $(top_srcdir)/debugfs/htree.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +unused.o: $(top_srcdir)/debugfs/unused.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +filefrag.o: $(top_srcdir)/debugfs/filefrag.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +extent_inode.o: $(top_srcdir)/debugfs/extent_inode.c \ + $(top_builddir)/lib/config.h $(top_builddir)/lib/dirpaths.h \ + $(top_srcdir)/debugfs/debugfs.h $(top_srcdir)/lib/ss/ss.h \ + $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_fs.h $(top_builddir)/lib/ext2fs/ext2_types.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +zap.o: $(top_srcdir)/debugfs/zap.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +quota.o: $(top_srcdir)/debugfs/quota.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +xattrs.o: $(top_srcdir)/debugfs/xattrs.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/lib/support/cstring.h \ + $(top_srcdir)/debugfs/debugfs.h $(top_srcdir)/lib/ss/ss.h \ + $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_fs.h $(top_builddir)/lib/ext2fs/ext2_types.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +e2freefrag.o: $(top_srcdir)/misc/e2freefrag.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(top_srcdir)/misc/e2freefrag.h \ + $(top_srcdir)/debugfs/debugfs.h $(top_srcdir)/lib/ss/ss.h \ + $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/debugfs/../misc/create_inode.h \ + $(top_srcdir)/lib/e2p/e2p.h $(top_srcdir)/lib/support/quotaio.h \ + $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h +create_inode.o: $(top_srcdir)/misc/create_inode.c \ + $(top_builddir)/lib/config.h $(top_builddir)/lib/dirpaths.h \ + $(srcdir)/ext2fs.h $(top_builddir)/lib/ext2fs/ext2_types.h \ + $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/fiemap.h $(top_srcdir)/misc/create_inode.h \ + $(top_srcdir)/lib/e2p/e2p.h $(top_srcdir)/lib/support/nls-enable.h +journal.o: $(top_srcdir)/debugfs/journal.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/journal.h \ + $(srcdir)/../../e2fsck/jfs_user.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/kernel-jbd.h \ + $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h $(srcdir)/compiler.h +revoke.o: $(top_srcdir)/e2fsck/revoke.c $(top_srcdir)/e2fsck/jfs_user.h \ + $(top_builddir)/lib/config.h $(top_builddir)/lib/dirpaths.h \ + $(srcdir)/ext2_fs.h $(top_builddir)/lib/ext2fs/ext2_types.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/kernel-jbd.h $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h \ + $(srcdir)/compiler.h +recovery.o: $(top_srcdir)/e2fsck/recovery.c $(top_srcdir)/e2fsck/jfs_user.h \ + $(top_builddir)/lib/config.h $(top_builddir)/lib/dirpaths.h \ + $(srcdir)/ext2_fs.h $(top_builddir)/lib/ext2fs/ext2_types.h \ + $(srcdir)/ext2fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \ + $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \ + $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(srcdir)/kernel-jbd.h $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h \ + $(srcdir)/compiler.h +do_journal.o: $(top_srcdir)/debugfs/do_journal.c $(top_builddir)/lib/config.h \ + $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \ + $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \ + $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \ + $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \ + $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \ + $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \ + $(srcdir)/hashmap.h $(srcdir)/bitops.h \ + $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \ + $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \ + $(top_srcdir)/lib/support/quotaio_tree.h $(srcdir)/kernel-jbd.h \ + $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h $(srcdir)/compiler.h \ + $(top_srcdir)/debugfs/journal.h $(srcdir)/../../e2fsck/jfs_user.h diff --git a/lib/ext2fs/alloc.c b/lib/ext2fs/alloc.c new file mode 100644 index 0000000..3fd9216 --- /dev/null +++ b/lib/ext2fs/alloc.c @@ -0,0 +1,554 @@ +/* + * alloc.c --- allocate new inodes, blocks for ext2fs + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <time.h> +#include <string.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +#define min(a, b) ((a) < (b) ? (a) : (b)) + +#undef DEBUG + +#ifdef DEBUG +# define dbg_printf(f, a...) do {printf(f, ## a); fflush(stdout); } while (0) +#else +# define dbg_printf(f, a...) +#endif + +/* + * Clear the uninit block bitmap flag if necessary + */ +void ext2fs_clear_block_uninit(ext2_filsys fs, dgrp_t group) +{ + if (group >= fs->group_desc_count || + !ext2fs_has_group_desc_csum(fs) || + !(ext2fs_bg_flags_test(fs, group, EXT2_BG_BLOCK_UNINIT))) + return; + + /* uninit block bitmaps are now initialized in read_bitmaps() */ + + ext2fs_bg_flags_clear(fs, group, EXT2_BG_BLOCK_UNINIT); + ext2fs_group_desc_csum_set(fs, group); + ext2fs_mark_super_dirty(fs); + ext2fs_mark_bb_dirty(fs); +} + +/* + * Check for uninit inode bitmaps and deal with them appropriately + */ +static void check_inode_uninit(ext2_filsys fs, ext2fs_inode_bitmap map, + dgrp_t group) +{ + ext2_ino_t i, ino; + + if (group >= fs->group_desc_count || + !ext2fs_has_group_desc_csum(fs) || + !(ext2fs_bg_flags_test(fs, group, EXT2_BG_INODE_UNINIT))) + return; + + ino = (group * fs->super->s_inodes_per_group) + 1; + for (i=0; i < fs->super->s_inodes_per_group; i++, ino++) + ext2fs_fast_unmark_inode_bitmap2(map, ino); + + ext2fs_bg_flags_clear(fs, group, EXT2_BG_INODE_UNINIT); + /* Mimics what the kernel does */ + ext2fs_bg_flags_clear(fs, group, EXT2_BG_BLOCK_UNINIT); + ext2fs_group_desc_csum_set(fs, group); + ext2fs_mark_ib_dirty(fs); + ext2fs_mark_super_dirty(fs); +} + +/* + * Right now, just search forward from the parent directory's block + * group to find the next free inode. + * + * Should have a special policy for directories. + */ +errcode_t ext2fs_new_inode(ext2_filsys fs, ext2_ino_t dir, + int mode EXT2FS_ATTR((unused)), + ext2fs_inode_bitmap map, ext2_ino_t *ret) +{ + ext2_ino_t start_inode = 0; + ext2_ino_t i, ino_in_group, upto, first_zero; + errcode_t retval; + dgrp_t group; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!map) + map = fs->inode_map; + if (!map) + return EXT2_ET_NO_INODE_BITMAP; + + if (dir > 0) { + group = (dir - 1) / EXT2_INODES_PER_GROUP(fs->super); + start_inode = (group * EXT2_INODES_PER_GROUP(fs->super)) + 1; + } + if (start_inode < EXT2_FIRST_INODE(fs->super)) + start_inode = EXT2_FIRST_INODE(fs->super); + if (start_inode > fs->super->s_inodes_count) + return EXT2_ET_INODE_ALLOC_FAIL; + i = start_inode; + do { + ino_in_group = (i - 1) % EXT2_INODES_PER_GROUP(fs->super); + group = (i - 1) / EXT2_INODES_PER_GROUP(fs->super); + + check_inode_uninit(fs, map, group); + upto = i + (EXT2_INODES_PER_GROUP(fs->super) - ino_in_group); + if (i < start_inode && upto >= start_inode) + upto = start_inode - 1; + if (upto > fs->super->s_inodes_count) + upto = fs->super->s_inodes_count; + + retval = ext2fs_find_first_zero_inode_bitmap2(map, i, upto, + &first_zero); + if (retval == 0) { + i = first_zero; + break; + } + if (retval != ENOENT) + return EXT2_ET_INODE_ALLOC_FAIL; + i = upto + 1; + if (i > fs->super->s_inodes_count) + i = EXT2_FIRST_INODE(fs->super); + } while (i != start_inode); + + if (ext2fs_test_inode_bitmap2(map, i)) + return EXT2_ET_INODE_ALLOC_FAIL; + *ret = i; + return 0; +} + +/* + * Stupid algorithm --- we now just search forward starting from the + * goal. Should put in a smarter one someday.... + */ +errcode_t ext2fs_new_block3(ext2_filsys fs, blk64_t goal, + ext2fs_block_bitmap map, blk64_t *ret, + struct blk_alloc_ctx *ctx) +{ + errcode_t retval; + blk64_t b = 0; + errcode_t (*gab)(ext2_filsys fs, blk64_t goal, blk64_t *ret); + errcode_t (*gab2)(ext2_filsys, blk64_t, blk64_t *, + struct blk_alloc_ctx *); + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!map) { + /* + * In case there are clients out there whose get_alloc_block + * handlers call ext2fs_new_block2 with a NULL block map, + * temporarily swap out the function pointer so that we don't + * end up in an infinite loop. + */ + if (fs->get_alloc_block2) { + gab2 = fs->get_alloc_block2; + fs->get_alloc_block2 = NULL; + retval = gab2(fs, goal, &b, ctx); + fs->get_alloc_block2 = gab2; + goto allocated; + } else if (fs->get_alloc_block) { + gab = fs->get_alloc_block; + fs->get_alloc_block = NULL; + retval = gab(fs, goal, &b); + fs->get_alloc_block = gab; + goto allocated; + } + } + if (!map) + map = fs->block_map; + if (!map) + return EXT2_ET_NO_BLOCK_BITMAP; + if (!goal || (goal >= ext2fs_blocks_count(fs->super))) + goal = fs->super->s_first_data_block; + goal &= ~EXT2FS_CLUSTER_MASK(fs); + + retval = ext2fs_find_first_zero_block_bitmap2(map, + goal, ext2fs_blocks_count(fs->super) - 1, &b); + if ((retval == ENOENT) && (goal != fs->super->s_first_data_block)) + retval = ext2fs_find_first_zero_block_bitmap2(map, + fs->super->s_first_data_block, goal - 1, &b); +allocated: + if (retval == ENOENT) + return EXT2_ET_BLOCK_ALLOC_FAIL; + if (retval) + return retval; + + ext2fs_clear_block_uninit(fs, ext2fs_group_of_blk2(fs, b)); + *ret = b; + return 0; +} + +errcode_t ext2fs_new_block2(ext2_filsys fs, blk64_t goal, + ext2fs_block_bitmap map, blk64_t *ret) +{ + return ext2fs_new_block3(fs, goal, map, ret, NULL); +} + +errcode_t ext2fs_new_block(ext2_filsys fs, blk_t goal, + ext2fs_block_bitmap map, blk_t *ret) +{ + errcode_t retval; + blk64_t val; + retval = ext2fs_new_block2(fs, goal, map, &val); + if (!retval) + *ret = (blk_t) val; + return retval; +} + +/* + * This function zeros out the allocated block, and updates all of the + * appropriate filesystem records. + */ +errcode_t ext2fs_alloc_block3(ext2_filsys fs, blk64_t goal, char *block_buf, + blk64_t *ret, struct blk_alloc_ctx *ctx) +{ + errcode_t retval; + blk64_t block; + + if (fs->get_alloc_block2) { + retval = (fs->get_alloc_block2)(fs, goal, &block, ctx); + if (retval) + goto fail; + } else if (fs->get_alloc_block) { + retval = (fs->get_alloc_block)(fs, goal, &block); + if (retval) + goto fail; + } else { + if (!fs->block_map) { + retval = ext2fs_read_block_bitmap(fs); + if (retval) + goto fail; + } + + retval = ext2fs_new_block3(fs, goal, 0, &block, ctx); + if (retval) + goto fail; + } + + if (block_buf) { + memset(block_buf, 0, fs->blocksize); + retval = io_channel_write_blk64(fs->io, block, 1, block_buf); + } else + retval = ext2fs_zero_blocks2(fs, block, 1, NULL, NULL); + if (retval) + goto fail; + + ext2fs_block_alloc_stats2(fs, block, +1); + *ret = block; + +fail: + return retval; +} + +errcode_t ext2fs_alloc_block2(ext2_filsys fs, blk64_t goal, + char *block_buf, blk64_t *ret) +{ + return ext2fs_alloc_block3(fs, goal, block_buf, ret, NULL); +} + +errcode_t ext2fs_alloc_block(ext2_filsys fs, blk_t goal, + char *block_buf, blk_t *ret) +{ + errcode_t retval; + blk64_t ret64, goal64 = goal; + retval = ext2fs_alloc_block3(fs, goal64, block_buf, &ret64, NULL); + if (!retval) + *ret = (blk_t)ret64; + return retval; +} + +errcode_t ext2fs_get_free_blocks2(ext2_filsys fs, blk64_t start, blk64_t finish, + int num, ext2fs_block_bitmap map, blk64_t *ret) +{ + blk64_t b = start; + int c_ratio; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!map) + map = fs->block_map; + if (!map) + return EXT2_ET_NO_BLOCK_BITMAP; + if (!b) + b = fs->super->s_first_data_block; + if (!finish) + finish = start; + if (!num) + num = 1; + c_ratio = 1 << ext2fs_get_bitmap_granularity(map); + b &= ~(c_ratio - 1); + finish &= ~(c_ratio -1); + do { + if (b + num - 1 >= ext2fs_blocks_count(fs->super)) { + if (finish > start) + return EXT2_ET_BLOCK_ALLOC_FAIL; + b = fs->super->s_first_data_block; + } + if (ext2fs_fast_test_block_bitmap_range2(map, b, num)) { + *ret = b; + return 0; + } + b += c_ratio; + } while (b != finish); + return EXT2_ET_BLOCK_ALLOC_FAIL; +} + +errcode_t ext2fs_get_free_blocks(ext2_filsys fs, blk_t start, blk_t finish, + int num, ext2fs_block_bitmap map, blk_t *ret) +{ + errcode_t retval; + blk64_t val; + retval = ext2fs_get_free_blocks2(fs, start, finish, num, map, &val); + if(!retval) + *ret = (blk_t) val; + return retval; +} + +void ext2fs_set_alloc_block_callback(ext2_filsys fs, + errcode_t (*func)(ext2_filsys fs, + blk64_t goal, + blk64_t *ret), + errcode_t (**old)(ext2_filsys fs, + blk64_t goal, + blk64_t *ret)) +{ + if (!fs || fs->magic != EXT2_ET_MAGIC_EXT2FS_FILSYS) + return; + + if (old) + *old = fs->get_alloc_block; + + fs->get_alloc_block = func; +} + +blk64_t ext2fs_find_inode_goal(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, blk64_t lblk) +{ + dgrp_t group; + __u8 log_flex; + struct ext2fs_extent extent; + ext2_extent_handle_t handle = NULL; + errcode_t err; + + /* Make sure data stored in inode->i_block is neither fast symlink nor + * inline data. + */ + if (inode == NULL || ext2fs_is_fast_symlink(inode) || + inode->i_flags & EXT4_INLINE_DATA_FL) + goto no_blocks; + + if (inode->i_flags & EXT4_EXTENTS_FL) { + err = ext2fs_extent_open2(fs, ino, inode, &handle); + if (err) + goto no_blocks; + err = ext2fs_extent_goto2(handle, 0, lblk); + if (err) + goto no_blocks; + err = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent); + if (err) + goto no_blocks; + ext2fs_extent_free(handle); + return extent.e_pblk + (lblk - extent.e_lblk); + } + + /* block mapped file; see if block zero is mapped? */ + if (inode->i_block[0]) + return inode->i_block[0]; + +no_blocks: + ext2fs_extent_free(handle); + log_flex = fs->super->s_log_groups_per_flex; + group = ext2fs_group_of_ino(fs, ino); + if (log_flex) + group = group & ~((1 << (log_flex)) - 1); + return ext2fs_group_first_block2(fs, group); +} + +/* + * Starting at _goal_, scan around the filesystem to find a run of free blocks + * that's at least _len_ blocks long. Possible flags: + * - EXT2_NEWRANGE_EXACT_GOAL: The range of blocks must start at _goal_. + * - EXT2_NEWRANGE_MIN_LENGTH: do not return a allocation shorter than _len_. + * - EXT2_NEWRANGE_ZERO_BLOCKS: Zero blocks pblk to pblk+plen before returning. + * + * The starting block is returned in _pblk_ and the length is returned via + * _plen_. The blocks are not marked in the bitmap; the caller must mark + * however much of the returned run they actually use, hopefully via + * ext2fs_block_alloc_stats_range(). + * + * This function can return a range that is longer than what was requested. + */ +errcode_t ext2fs_new_range(ext2_filsys fs, int flags, blk64_t goal, + blk64_t len, ext2fs_block_bitmap map, blk64_t *pblk, + blk64_t *plen) +{ + errcode_t retval; + blk64_t start, end, b; + int looped = 0; + blk64_t max_blocks = ext2fs_blocks_count(fs->super); + errcode_t (*nrf)(ext2_filsys fs, int flags, blk64_t goal, + blk64_t len, blk64_t *pblk, blk64_t *plen); + + dbg_printf("%s: flags=0x%x goal=%llu len=%llu\n", __func__, flags, + goal, len); + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + if (len == 0 || (flags & ~EXT2_NEWRANGE_ALL_FLAGS)) + return EXT2_ET_INVALID_ARGUMENT; + + if (!map && fs->new_range) { + /* + * In case there are clients out there whose new_range + * handlers call ext2fs_new_range with a NULL block map, + * temporarily swap out the function pointer so that we don't + * end up in an infinite loop. + */ + nrf = fs->new_range; + fs->new_range = NULL; + retval = nrf(fs, flags, goal, len, pblk, plen); + fs->new_range = nrf; + if (retval) + return retval; + start = *pblk; + end = *pblk + *plen; + goto allocated; + } + if (!map) + map = fs->block_map; + if (!map) + return EXT2_ET_NO_BLOCK_BITMAP; + if (!goal || goal >= ext2fs_blocks_count(fs->super)) + goal = fs->super->s_first_data_block; + + start = goal; + while (!looped || start <= goal) { + retval = ext2fs_find_first_zero_block_bitmap2(map, start, + max_blocks - 1, + &start); + if (retval == ENOENT) { + /* + * If there are no free blocks beyond the starting + * point, try scanning the whole filesystem, unless the + * user told us only to allocate from _goal_, or if + * we're already scanning the whole filesystem. + */ + if (flags & EXT2_NEWRANGE_FIXED_GOAL || + start == fs->super->s_first_data_block) + goto fail; + start = fs->super->s_first_data_block; + continue; + } else if (retval) + goto errout; + + if (flags & EXT2_NEWRANGE_FIXED_GOAL && start != goal) + goto fail; + + b = min(start + len - 1, max_blocks - 1); + retval = ext2fs_find_first_set_block_bitmap2(map, start, b, + &end); + if (retval == ENOENT) + end = b + 1; + else if (retval) + goto errout; + + if (!(flags & EXT2_NEWRANGE_MIN_LENGTH) || + (end - start) >= len) { + /* Success! */ + *pblk = start; + *plen = end - start; + dbg_printf("%s: new_range goal=%llu--%llu " + "blk=%llu--%llu %llu\n", + __func__, goal, goal + len - 1, + *pblk, *pblk + *plen - 1, *plen); +allocated: + for (b = start; b < end; + b += fs->super->s_blocks_per_group) + ext2fs_clear_block_uninit(fs, + ext2fs_group_of_blk2(fs, b)); + return 0; + } + + if (flags & EXT2_NEWRANGE_FIXED_GOAL) + goto fail; + start = end; + if (start >= max_blocks) { + if (looped) + goto fail; + looped = 1; + start = fs->super->s_first_data_block; + } + } + +fail: + retval = EXT2_ET_BLOCK_ALLOC_FAIL; +errout: + return retval; +} + +void ext2fs_set_new_range_callback(ext2_filsys fs, + errcode_t (*func)(ext2_filsys fs, int flags, blk64_t goal, + blk64_t len, blk64_t *pblk, blk64_t *plen), + errcode_t (**old)(ext2_filsys fs, int flags, blk64_t goal, + blk64_t len, blk64_t *pblk, blk64_t *plen)) +{ + if (!fs || fs->magic != EXT2_ET_MAGIC_EXT2FS_FILSYS) + return; + + if (old) + *old = fs->new_range; + + fs->new_range = func; +} + +errcode_t ext2fs_alloc_range(ext2_filsys fs, int flags, blk64_t goal, + blk_t len, blk64_t *ret) +{ + int newr_flags = EXT2_NEWRANGE_MIN_LENGTH; + errcode_t retval; + blk64_t plen; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + if (len == 0 || (flags & ~EXT2_ALLOCRANGE_ALL_FLAGS)) + return EXT2_ET_INVALID_ARGUMENT; + + if (flags & EXT2_ALLOCRANGE_FIXED_GOAL) + newr_flags |= EXT2_NEWRANGE_FIXED_GOAL; + + retval = ext2fs_new_range(fs, newr_flags, goal, len, NULL, ret, &plen); + if (retval) + return retval; + + if (plen < len) + return EXT2_ET_BLOCK_ALLOC_FAIL; + + if (flags & EXT2_ALLOCRANGE_ZERO_BLOCKS) { + retval = ext2fs_zero_blocks2(fs, *ret, len, NULL, NULL); + if (retval) + return retval; + } + + ext2fs_block_alloc_stats_range(fs, *ret, len, +1); + return retval; +} diff --git a/lib/ext2fs/alloc_sb.c b/lib/ext2fs/alloc_sb.c new file mode 100644 index 0000000..8530b40 --- /dev/null +++ b/lib/ext2fs/alloc_sb.c @@ -0,0 +1,81 @@ +/* + * alloc_sb.c --- Allocate the superblock and block group descriptors for a + * newly initialized filesystem. Used by mke2fs when initializing a filesystem + * + * Copyright (C) 1994, 1995, 1996, 2003 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +/* + * This function reserves the superblock and block group descriptors + * for a given block group. It currently returns the number of free + * blocks assuming that inode table and allocation bitmaps will be in + * the group. This is not necessarily the case when the flex_bg + * feature is enabled, so callers should take care! It was only + * really intended for use by mke2fs, and even there it's not that + * useful. In the future, when we redo this function for 64-bit block + * numbers, we should probably return the number of blocks used by the + * super block and group descriptors instead. + * + * See also the comment for ext2fs_super_and_bgd_loc() + */ +int ext2fs_reserve_super_and_bgd(ext2_filsys fs, + dgrp_t group, + ext2fs_block_bitmap bmap) +{ + blk64_t super_blk, old_desc_blk, new_desc_blk; + blk_t used_blks; + int old_desc_blocks, num_blocks; + + ext2fs_super_and_bgd_loc2(fs, group, &super_blk, + &old_desc_blk, &new_desc_blk, &used_blks); + + if (ext2fs_has_feature_meta_bg(fs->super)) + old_desc_blocks = fs->super->s_first_meta_bg; + else + old_desc_blocks = + fs->desc_blocks + fs->super->s_reserved_gdt_blocks; + + if (super_blk || (group == 0)) + ext2fs_mark_block_bitmap2(bmap, super_blk); + if ((group == 0) && (fs->blocksize == 1024) && + EXT2FS_CLUSTER_RATIO(fs) > 1) + ext2fs_mark_block_bitmap2(bmap, 0); + + if (old_desc_blk) { + num_blocks = old_desc_blocks; + if (old_desc_blk + num_blocks >= ext2fs_blocks_count(fs->super)) + num_blocks = ext2fs_blocks_count(fs->super) - + old_desc_blk; + ext2fs_mark_block_bitmap_range2(bmap, old_desc_blk, num_blocks); + } + if (new_desc_blk) + ext2fs_mark_block_bitmap2(bmap, new_desc_blk); + + num_blocks = ext2fs_group_blocks_count(fs, group); + num_blocks -= 2 + fs->inode_blocks_per_group + used_blks; + + return num_blocks ; +} diff --git a/lib/ext2fs/alloc_stats.c b/lib/ext2fs/alloc_stats.c new file mode 100644 index 0000000..6f98bcc --- /dev/null +++ b/lib/ext2fs/alloc_stats.c @@ -0,0 +1,165 @@ +/* + * alloc_stats.c --- Update allocation statistics for ext2fs + * + * Copyright (C) 2001 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> + +#include "ext2_fs.h" +#include "ext2fs.h" + +void ext2fs_inode_alloc_stats2(ext2_filsys fs, ext2_ino_t ino, + int inuse, int isdir) +{ + int group = ext2fs_group_of_ino(fs, ino); + + if (ino > fs->super->s_inodes_count) { +#ifndef OMIT_COM_ERR + com_err("ext2fs_inode_alloc_stats2", 0, + "Illegal inode number: %lu", (unsigned long) ino); +#endif + return; + } + if (inuse > 0) + ext2fs_mark_inode_bitmap2(fs->inode_map, ino); + else + ext2fs_unmark_inode_bitmap2(fs->inode_map, ino); + ext2fs_bg_free_inodes_count_set(fs, group, ext2fs_bg_free_inodes_count(fs, group) - inuse); + if (isdir) + ext2fs_bg_used_dirs_count_set(fs, group, ext2fs_bg_used_dirs_count(fs, group) + inuse); + + /* We don't strictly need to be clearing the uninit flag if inuse < 0 + * (i.e. freeing inodes) but it also means something is bad. */ + ext2fs_bg_flags_clear(fs, group, EXT2_BG_INODE_UNINIT); + if (ext2fs_has_group_desc_csum(fs)) { + ext2_ino_t first_unused_inode = fs->super->s_inodes_per_group - + ext2fs_bg_itable_unused(fs, group) + + group * fs->super->s_inodes_per_group + 1; + + if (ino >= first_unused_inode) + ext2fs_bg_itable_unused_set(fs, group, group * fs->super->s_inodes_per_group + fs->super->s_inodes_per_group - ino); + ext2fs_group_desc_csum_set(fs, group); + } + + fs->super->s_free_inodes_count -= inuse; + ext2fs_mark_super_dirty(fs); + ext2fs_mark_ib_dirty(fs); +} + +void ext2fs_inode_alloc_stats(ext2_filsys fs, ext2_ino_t ino, int inuse) +{ + ext2fs_inode_alloc_stats2(fs, ino, inuse, 0); +} + +void ext2fs_block_alloc_stats2(ext2_filsys fs, blk64_t blk, int inuse) +{ + int group = ext2fs_group_of_blk2(fs, blk); + + if (blk < fs->super->s_first_data_block || + blk >= ext2fs_blocks_count(fs->super)) { +#ifndef OMIT_COM_ERR + com_err("ext2fs_block_alloc_stats", 0, + "Illegal block number: %lu", (unsigned long) blk); +#endif + return; + } + if (inuse > 0) + ext2fs_mark_block_bitmap2(fs->block_map, blk); + else + ext2fs_unmark_block_bitmap2(fs->block_map, blk); + ext2fs_bg_free_blocks_count_set(fs, group, ext2fs_bg_free_blocks_count(fs, group) - inuse); + ext2fs_bg_flags_clear(fs, group, EXT2_BG_BLOCK_UNINIT); + ext2fs_group_desc_csum_set(fs, group); + + ext2fs_free_blocks_count_add(fs->super, + -inuse * (blk64_t) EXT2FS_CLUSTER_RATIO(fs)); + ext2fs_mark_super_dirty(fs); + ext2fs_mark_bb_dirty(fs); + if (fs->block_alloc_stats) + (fs->block_alloc_stats)(fs, (blk64_t) blk, inuse); +} + +void ext2fs_block_alloc_stats(ext2_filsys fs, blk_t blk, int inuse) +{ + ext2fs_block_alloc_stats2(fs, blk, inuse); +} + +void ext2fs_set_block_alloc_stats_callback(ext2_filsys fs, + void (*func)(ext2_filsys fs, + blk64_t blk, + int inuse), + void (**old)(ext2_filsys fs, + blk64_t blk, + int inuse)) +{ + if (!fs || fs->magic != EXT2_ET_MAGIC_EXT2FS_FILSYS) + return; + if (old) + *old = fs->block_alloc_stats; + + fs->block_alloc_stats = func; +} + +void ext2fs_block_alloc_stats_range(ext2_filsys fs, blk64_t blk, + blk_t num, int inuse) +{ +#ifndef OMIT_COM_ERR + if (blk + num > ext2fs_blocks_count(fs->super)) { + com_err("ext2fs_block_alloc_stats_range", 0, + "Illegal block range: %llu (%u) ", + (unsigned long long) blk, num); + return; + } +#endif + if (inuse == 0) + return; + if (inuse > 0) { + ext2fs_mark_block_bitmap_range2(fs->block_map, blk, num); + inuse = 1; + } else { + ext2fs_unmark_block_bitmap_range2(fs->block_map, blk, num); + inuse = -1; + } + while (num) { + int group = ext2fs_group_of_blk2(fs, blk); + blk64_t last_blk = ext2fs_group_last_block2(fs, group); + blk64_t n = num; + + if (blk + num > last_blk) + n = last_blk - blk + 1; + + ext2fs_bg_free_blocks_count_set(fs, group, + ext2fs_bg_free_blocks_count(fs, group) - + inuse*n/EXT2FS_CLUSTER_RATIO(fs)); + ext2fs_bg_flags_clear(fs, group, EXT2_BG_BLOCK_UNINIT); + ext2fs_group_desc_csum_set(fs, group); + ext2fs_free_blocks_count_add(fs->super, -inuse * (blk64_t) n); + blk += n; + num -= n; + } + ext2fs_mark_super_dirty(fs); + ext2fs_mark_bb_dirty(fs); + if (fs->block_alloc_stats_range) + (fs->block_alloc_stats_range)(fs, blk, num, inuse); +} + +void ext2fs_set_block_alloc_stats_range_callback(ext2_filsys fs, + void (*func)(ext2_filsys fs, blk64_t blk, + blk_t num, int inuse), + void (**old)(ext2_filsys fs, blk64_t blk, + blk_t num, int inuse)) +{ + if (!fs || fs->magic != EXT2_ET_MAGIC_EXT2FS_FILSYS) + return; + if (old) + *old = fs->block_alloc_stats_range; + + fs->block_alloc_stats_range = func; +} diff --git a/lib/ext2fs/alloc_tables.c b/lib/ext2fs/alloc_tables.c new file mode 100644 index 0000000..e8a1fef --- /dev/null +++ b/lib/ext2fs/alloc_tables.c @@ -0,0 +1,278 @@ +/* + * alloc_tables.c --- Allocate tables for a newly initialized + * filesystem. Used by mke2fs when initializing a filesystem + * + * Copyright (C) 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +/* + * This routine searches for free blocks that can allocate a full + * group of bitmaps or inode tables for a flexbg group. Returns the + * block number with a correct offset were the bitmaps and inode + * tables can be allocated continuously and in order. + */ +static blk64_t flexbg_offset(ext2_filsys fs, dgrp_t group, blk64_t start_blk, + ext2fs_block_bitmap bmap, int rem_grp, + int elem_size) +{ + int flexbg, flexbg_size, size; + blk64_t last_blk, first_free = 0; + dgrp_t last_grp; + + flexbg_size = 1U << fs->super->s_log_groups_per_flex; + flexbg = group / flexbg_size; + size = rem_grp * elem_size; + + if (size > (int) (fs->super->s_blocks_per_group / 4)) + size = (int) fs->super->s_blocks_per_group / 4; + + /* + * Don't do a long search if the previous block search is still valid, + * but skip minor obstructions such as group descriptor backups. + */ + if (start_blk && start_blk < ext2fs_blocks_count(fs->super) && + ext2fs_get_free_blocks2(fs, start_blk, start_blk + size, elem_size, + bmap, &first_free) == 0) + return first_free; + + start_blk = ext2fs_group_first_block2(fs, flexbg_size * flexbg); + last_grp = group | (flexbg_size - 1); + if (last_grp > fs->group_desc_count-1) + last_grp = fs->group_desc_count-1; + last_blk = ext2fs_group_last_block2(fs, last_grp); + + /* Find the first available block */ + if (ext2fs_get_free_blocks2(fs, start_blk, last_blk, size, + bmap, &first_free) == 0) + return first_free; + + if (ext2fs_get_free_blocks2(fs, start_blk, last_blk, elem_size, + bmap, &first_free) == 0) + return first_free; + + if (ext2fs_get_free_blocks2(fs, 0, last_blk, elem_size, bmap, + &first_free) == 0) + return first_free; + + return first_free; +} + +errcode_t ext2fs_allocate_group_table(ext2_filsys fs, dgrp_t group, + ext2fs_block_bitmap bmap) +{ + errcode_t retval; + blk64_t group_blk, start_blk, last_blk, new_blk; + dgrp_t last_grp = 0; + int rem_grps = 0, flexbg_size = 0, table_offset = 0; + + group_blk = ext2fs_group_first_block2(fs, group); + last_blk = ext2fs_group_last_block2(fs, group); + + if (!bmap) + bmap = fs->block_map; + + if (ext2fs_has_feature_flex_bg(fs->super) && + fs->super->s_log_groups_per_flex) { + flexbg_size = 1U << fs->super->s_log_groups_per_flex; + last_grp = group | (flexbg_size - 1); + if (last_grp > fs->group_desc_count-1) + last_grp = fs->group_desc_count-1; + rem_grps = last_grp - group + 1; + } + + /* + * Allocate the block and inode bitmaps, if necessary + */ + if (fs->stride && !flexbg_size) { + retval = ext2fs_get_free_blocks2(fs, group_blk, last_blk, + 1, bmap, &start_blk); + if (retval) + return retval; + start_blk += fs->inode_blocks_per_group; + start_blk += ((fs->stride * group) % + (last_blk - start_blk + 1)); + if (start_blk >= last_blk) + start_blk = group_blk; + } else + start_blk = group_blk; + + if (flexbg_size) { + blk64_t prev_block = 0; + + table_offset = flexbg_size; + if (group % flexbg_size) + prev_block = ext2fs_block_bitmap_loc(fs, group - 1) + 1; + else if (last_grp == fs->group_desc_count-1) { + /* + * If we are allocating for the last flex_bg + * keep the metadata tables contiguous + */ + table_offset = last_grp & (flexbg_size - 1); + if (table_offset == 0) + table_offset = flexbg_size; + else + table_offset++; + } + /* FIXME: Take backup group descriptor blocks into account + * if the flexbg allocations will grow to overlap them... */ + start_blk = flexbg_offset(fs, group, prev_block, bmap, + rem_grps, 1); + last_blk = ext2fs_group_last_block2(fs, last_grp); + } + + if (!ext2fs_block_bitmap_loc(fs, group)) { + retval = ext2fs_get_free_blocks2(fs, start_blk, last_blk, + 1, bmap, &new_blk); + if (retval == EXT2_ET_BLOCK_ALLOC_FAIL) + retval = ext2fs_get_free_blocks2(fs, group_blk, + last_blk, 1, bmap, &new_blk); + if (retval) + return retval; + ext2fs_mark_block_bitmap2(bmap, new_blk); + ext2fs_block_bitmap_loc_set(fs, group, new_blk); + if (flexbg_size) { + dgrp_t gr = ext2fs_group_of_blk2(fs, new_blk); + ext2fs_bg_free_blocks_count_set(fs, gr, ext2fs_bg_free_blocks_count(fs, gr) - 1); + ext2fs_free_blocks_count_add(fs->super, -1); + ext2fs_bg_flags_clear(fs, gr, EXT2_BG_BLOCK_UNINIT); + ext2fs_group_desc_csum_set(fs, gr); + } + } + + if (flexbg_size) { + blk64_t prev_block = 0; + if (group % flexbg_size) + prev_block = ext2fs_inode_bitmap_loc(fs, group - 1) + 1; + else + prev_block = ext2fs_block_bitmap_loc(fs, group) + + table_offset; + /* FIXME: Take backup group descriptor blocks into account + * if the flexbg allocations will grow to overlap them... */ + start_blk = flexbg_offset(fs, group, prev_block, bmap, + rem_grps, 1); + last_blk = ext2fs_group_last_block2(fs, last_grp); + } + + if (!ext2fs_inode_bitmap_loc(fs, group)) { + retval = ext2fs_get_free_blocks2(fs, start_blk, last_blk, + 1, bmap, &new_blk); + if (retval == EXT2_ET_BLOCK_ALLOC_FAIL) + retval = ext2fs_get_free_blocks2(fs, group_blk, + last_blk, 1, bmap, &new_blk); + if (retval) + return retval; + ext2fs_mark_block_bitmap2(bmap, new_blk); + ext2fs_inode_bitmap_loc_set(fs, group, new_blk); + if (flexbg_size) { + dgrp_t gr = ext2fs_group_of_blk2(fs, new_blk); + ext2fs_bg_free_blocks_count_set(fs, gr, ext2fs_bg_free_blocks_count(fs, gr) - 1); + ext2fs_free_blocks_count_add(fs->super, -1); + ext2fs_bg_flags_clear(fs, gr, EXT2_BG_BLOCK_UNINIT); + ext2fs_group_desc_csum_set(fs, gr); + } + } + + /* + * Allocate the inode table + */ + if (flexbg_size) { + blk64_t prev_block = 0; + + if (group % flexbg_size) + prev_block = ext2fs_inode_table_loc(fs, group - 1) + + fs->inode_blocks_per_group; + else + prev_block = ext2fs_inode_bitmap_loc(fs, group) + + table_offset; + + /* FIXME: Take backup group descriptor blocks into account + * if the flexbg allocations will grow to overlap them... */ + group_blk = flexbg_offset(fs, group, prev_block, bmap, + rem_grps, fs->inode_blocks_per_group); + last_blk = ext2fs_group_last_block2(fs, last_grp); + } + + if (!ext2fs_inode_table_loc(fs, group)) { + retval = ext2fs_get_free_blocks2(fs, group_blk, last_blk, + fs->inode_blocks_per_group, + bmap, &new_blk); + if (retval) + return retval; + + ext2fs_mark_block_bitmap_range2(bmap, + new_blk, fs->inode_blocks_per_group); + if (flexbg_size) { + blk64_t num, blk; + num = fs->inode_blocks_per_group; + blk = new_blk; + while (num) { + int gr = ext2fs_group_of_blk2(fs, blk); + last_blk = ext2fs_group_last_block2(fs, gr); + blk64_t n = num; + + if (blk + num > last_blk) + n = last_blk - blk + 1; + + ext2fs_bg_free_blocks_count_set(fs, gr, + ext2fs_bg_free_blocks_count(fs, gr) - + n/EXT2FS_CLUSTER_RATIO(fs)); + ext2fs_bg_flags_clear(fs, gr, + EXT2_BG_BLOCK_UNINIT); + ext2fs_group_desc_csum_set(fs, gr); + ext2fs_free_blocks_count_add(fs->super, -n); + blk += n; + num -= n; + } + } + ext2fs_inode_table_loc_set(fs, group, new_blk); + } + ext2fs_group_desc_csum_set(fs, group); + return 0; +} + +errcode_t ext2fs_allocate_tables(ext2_filsys fs) +{ + errcode_t retval; + dgrp_t i; + struct ext2fs_numeric_progress_struct progress; + + if (fs->progress_ops && fs->progress_ops->init) + (fs->progress_ops->init)(fs, &progress, NULL, + fs->group_desc_count); + + for (i = 0; i < fs->group_desc_count; i++) { + if (fs->progress_ops && fs->progress_ops->update) + (fs->progress_ops->update)(fs, &progress, i); + retval = ext2fs_allocate_group_table(fs, i, fs->block_map); + if (retval) + return retval; + } + if (fs->progress_ops && fs->progress_ops->close) + (fs->progress_ops->close)(fs, &progress, NULL); + return 0; +} + diff --git a/lib/ext2fs/atexit.c b/lib/ext2fs/atexit.c new file mode 100644 index 0000000..b3be1d5 --- /dev/null +++ b/lib/ext2fs/atexit.c @@ -0,0 +1,116 @@ +/* + * atexit.c --- Clean things up when we exit normally. + * + * Copyright Oracle, 2014 + * Author Darrick J. Wong <darrick.wong@oracle.com> + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef _LARGEFILE_SOURCE +#define _LARGEFILE_SOURCE +#endif +#ifndef _LARGEFILE64_SOURCE +#define _LARGEFILE64_SOURCE +#endif + +#include "config.h" +#include <stdlib.h> + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +struct exit_data { + ext2_exit_fn func; + void *data; +}; + +static struct exit_data *items; +static size_t nr_items; + +static void handle_exit(void) +{ + struct exit_data *ed; + + for (ed = items + nr_items - 1; ed >= items; ed--) { + if (ed->func == NULL) + continue; + ed->func(ed->data); + } + + ext2fs_free_mem(&items); + nr_items = 0; +} + +/* + * Schedule a function to be called at (normal) program termination. + * If you want this to be called during a signal exit, you must capture + * the signal and call exit() yourself! + */ +errcode_t ext2fs_add_exit_fn(ext2_exit_fn func, void *data) +{ + struct exit_data *ed, *free_ed = NULL; + size_t x; + errcode_t ret; + + if (func == NULL) + return EXT2_ET_INVALID_ARGUMENT; + + for (x = 0, ed = items; x < nr_items; x++, ed++) { + if (ed->func == func && ed->data == data) + return EXT2_ET_FILE_EXISTS; + if (ed->func == NULL) + free_ed = ed; + } + + if (free_ed) { + free_ed->func = func; + free_ed->data = data; + return 0; + } + + if (nr_items == 0) { + ret = atexit(handle_exit); + if (ret) + return ret; + } + + ret = ext2fs_resize_mem(0, (nr_items + 1) * sizeof(struct exit_data), + &items); + if (ret) + return ret; + + items[nr_items].func = func; + items[nr_items].data = data; + nr_items++; + + return 0; +} + +/* Remove a function from the exit cleanup list. */ +errcode_t ext2fs_remove_exit_fn(ext2_exit_fn func, void *data) +{ + struct exit_data *ed; + size_t x; + + if (func == NULL) + return EXT2_ET_INVALID_ARGUMENT; + + for (x = 0, ed = items; x < nr_items; x++, ed++) { + if (ed->func == NULL) + return 0; + if (ed->func == func && ed->data == data) { + size_t sz = (nr_items - (x + 1)) * + sizeof(struct exit_data); + memmove(ed, ed + 1, sz); + memset(items + nr_items - 1, 0, + sizeof(struct exit_data)); + } + } + + return 0; +} diff --git a/lib/ext2fs/badblocks.c b/lib/ext2fs/badblocks.c new file mode 100644 index 0000000..a306bc0 --- /dev/null +++ b/lib/ext2fs/badblocks.c @@ -0,0 +1,328 @@ +/* + * badblocks.c --- routines to manipulate the bad block structure + * + * Copyright (C) 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" + +/* + * Helper function for making a badblocks list + */ +static errcode_t make_u32_list(int size, int num, __u32 *list, + ext2_u32_list *ret) +{ + ext2_u32_list bb; + errcode_t retval; + + retval = ext2fs_get_mem(sizeof(struct ext2_struct_u32_list), &bb); + if (retval) + return retval; + memset(bb, 0, sizeof(struct ext2_struct_u32_list)); + bb->magic = EXT2_ET_MAGIC_BADBLOCKS_LIST; + bb->size = size ? size : 10; + bb->num = num; + retval = ext2fs_get_array(bb->size, sizeof(blk_t), &bb->list); + if (retval) { + ext2fs_free_mem(&bb); + return retval; + } + if (list) + memcpy(bb->list, list, bb->size * sizeof(blk_t)); + else + memset(bb->list, 0, bb->size * sizeof(blk_t)); + *ret = bb; + return 0; +} + + +/* + * This procedure creates an empty u32 list. + */ +errcode_t ext2fs_u32_list_create(ext2_u32_list *ret, int size) +{ + return make_u32_list(size, 0, 0, ret); +} + +/* + * This procedure creates an empty badblocks list. + */ +errcode_t ext2fs_badblocks_list_create(ext2_badblocks_list *ret, int size) +{ + return make_u32_list(size, 0, 0, (ext2_badblocks_list *) ret); +} + + +/* + * This procedure copies a badblocks list + */ +errcode_t ext2fs_u32_copy(ext2_u32_list src, ext2_u32_list *dest) +{ + errcode_t retval; + + retval = make_u32_list(src->size, src->num, src->list, dest); + if (retval) + return retval; + (*dest)->badblocks_flags = src->badblocks_flags; + return 0; +} + +errcode_t ext2fs_badblocks_copy(ext2_badblocks_list src, + ext2_badblocks_list *dest) +{ + return ext2fs_u32_copy((ext2_u32_list) src, + (ext2_u32_list *) dest); +} + +/* + * This procedure frees a badblocks list. + * + * (note: moved to closefs.c) + */ + + +/* + * This procedure adds an item to a tracking list (e.g. badblocks or casefold). + */ +errcode_t ext2fs_u32_list_add(ext2_u32_list bb, __u32 blk) +{ + errcode_t retval; + int i, j; + unsigned long old_size; + + EXT2_CHECK_MAGIC(bb, EXT2_ET_MAGIC_BADBLOCKS_LIST); + + if (bb->num >= bb->size) { + old_size = bb->size * sizeof(__u32); + bb->size += 100; + retval = ext2fs_resize_mem(old_size, bb->size * sizeof(__u32), + &bb->list); + if (retval) { + bb->size -= 100; + return retval; + } + } + + /* + * Add special case code for appending to the end of the list + */ + i = bb->num-1; + if ((bb->num != 0) && (bb->list[i] == blk)) + return 0; + if ((bb->num == 0) || (bb->list[i] < blk)) { + bb->list[bb->num++] = blk; + return 0; + } + + j = bb->num; + for (i=0; i < bb->num; i++) { + if (bb->list[i] == blk) + return 0; + if (bb->list[i] > blk) { + j = i; + break; + } + } + for (i=bb->num; i > j; i--) + bb->list[i] = bb->list[i-1]; + bb->list[j] = blk; + bb->num++; + return 0; +} + +errcode_t ext2fs_badblocks_list_add(ext2_badblocks_list bb, blk_t blk) +{ + return ext2fs_u32_list_add((ext2_u32_list) bb, (__u32) blk); +} + +/* + * This procedure finds a particular block is on a badblocks + * list. + */ +int ext2fs_u32_list_find(ext2_u32_list bb, __u32 blk) +{ + int low, high, mid; + + if (bb->magic != EXT2_ET_MAGIC_BADBLOCKS_LIST) + return -1; + + if (bb->num == 0) + return -1; + + low = 0; + high = bb->num-1; + if (blk == bb->list[low]) + return low; + if (blk == bb->list[high]) + return high; + + while (low < high) { + mid = ((unsigned)low + (unsigned)high)/2; + if (mid == low || mid == high) + break; + if (blk == bb->list[mid]) + return mid; + if (blk < bb->list[mid]) + high = mid; + else + low = mid; + } + return -1; +} + +/* + * This procedure tests to see if a particular block is on a badblocks + * list. + */ +int ext2fs_u32_list_test(ext2_u32_list bb, __u32 blk) +{ + if (ext2fs_u32_list_find(bb, blk) < 0) + return 0; + else + return 1; +} + +int ext2fs_badblocks_list_test(ext2_badblocks_list bb, blk_t blk) +{ + return ext2fs_u32_list_test((ext2_u32_list) bb, (__u32) blk); +} + + +/* + * Remove a block from the badblock list + */ +int ext2fs_u32_list_del(ext2_u32_list bb, __u32 blk) +{ + int remloc, i; + + if (bb->num == 0) + return -1; + + remloc = ext2fs_u32_list_find(bb, blk); + if (remloc < 0) + return -1; + + for (i = remloc ; i < bb->num-1; i++) + bb->list[i] = bb->list[i+1]; + bb->num--; + return 0; +} + +void ext2fs_badblocks_list_del(ext2_u32_list bb, __u32 blk) +{ + ext2fs_u32_list_del(bb, blk); +} + +errcode_t ext2fs_u32_list_iterate_begin(ext2_u32_list bb, + ext2_u32_iterate *ret) +{ + ext2_u32_iterate iter; + errcode_t retval; + + EXT2_CHECK_MAGIC(bb, EXT2_ET_MAGIC_BADBLOCKS_LIST); + + retval = ext2fs_get_mem(sizeof(struct ext2_struct_u32_iterate), &iter); + if (retval) + return retval; + + iter->magic = EXT2_ET_MAGIC_BADBLOCKS_ITERATE; + iter->bb = bb; + iter->ptr = 0; + *ret = iter; + return 0; +} + +errcode_t ext2fs_badblocks_list_iterate_begin(ext2_badblocks_list bb, + ext2_badblocks_iterate *ret) +{ + return ext2fs_u32_list_iterate_begin((ext2_u32_list) bb, + (ext2_u32_iterate *) ret); +} + + +int ext2fs_u32_list_iterate(ext2_u32_iterate iter, __u32 *blk) +{ + ext2_u32_list bb; + + if (iter->magic != EXT2_ET_MAGIC_BADBLOCKS_ITERATE) + return 0; + + bb = iter->bb; + + if (bb->magic != EXT2_ET_MAGIC_BADBLOCKS_LIST) + return 0; + + if (iter->ptr < bb->num) { + *blk = bb->list[iter->ptr++]; + return 1; + } + *blk = 0; + return 0; +} + +int ext2fs_badblocks_list_iterate(ext2_badblocks_iterate iter, blk_t *blk) +{ + return ext2fs_u32_list_iterate((ext2_u32_iterate) iter, + (__u32 *) blk); +} + + +void ext2fs_u32_list_iterate_end(ext2_u32_iterate iter) +{ + if (!iter || (iter->magic != EXT2_ET_MAGIC_BADBLOCKS_ITERATE)) + return; + + iter->bb = 0; + ext2fs_free_mem(&iter); +} + +void ext2fs_badblocks_list_iterate_end(ext2_badblocks_iterate iter) +{ + ext2fs_u32_list_iterate_end((ext2_u32_iterate) iter); +} + + +int ext2fs_u32_list_equal(ext2_u32_list bb1, ext2_u32_list bb2) +{ + EXT2_CHECK_MAGIC(bb1, EXT2_ET_MAGIC_BADBLOCKS_LIST); + EXT2_CHECK_MAGIC(bb2, EXT2_ET_MAGIC_BADBLOCKS_LIST); + + if (bb1->num != bb2->num) + return 0; + + if (memcmp(bb1->list, bb2->list, bb1->num * sizeof(blk_t)) != 0) + return 0; + return 1; +} + +int ext2fs_badblocks_equal(ext2_badblocks_list bb1, ext2_badblocks_list bb2) +{ + return ext2fs_u32_list_equal((ext2_u32_list) bb1, + (ext2_u32_list) bb2); +} + +int ext2fs_u32_list_count(ext2_u32_list bb) +{ + return bb->num; +} diff --git a/lib/ext2fs/bb_compat.c b/lib/ext2fs/bb_compat.c new file mode 100644 index 0000000..373792a --- /dev/null +++ b/lib/ext2fs/bb_compat.c @@ -0,0 +1,64 @@ +/* + * bb_compat.c --- compatibility badblocks routines + * + * Copyright (C) 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" + +errcode_t badblocks_list_create(badblocks_list *ret, int size) +{ + return ext2fs_badblocks_list_create(ret, size); +} + +void badblocks_list_free(badblocks_list bb) +{ + ext2fs_badblocks_list_free(bb); +} + +errcode_t badblocks_list_add(badblocks_list bb, blk_t blk) +{ + return ext2fs_badblocks_list_add(bb, blk); +} + +int badblocks_list_test(badblocks_list bb, blk_t blk) +{ + return ext2fs_badblocks_list_test(bb, blk); +} + +errcode_t badblocks_list_iterate_begin(badblocks_list bb, + badblocks_iterate *ret) +{ + return ext2fs_badblocks_list_iterate_begin(bb, ret); +} + +int badblocks_list_iterate(badblocks_iterate iter, blk_t *blk) +{ + return ext2fs_badblocks_list_iterate(iter, blk); +} + +void badblocks_list_iterate_end(badblocks_iterate iter) +{ + ext2fs_badblocks_list_iterate_end(iter); +} diff --git a/lib/ext2fs/bb_inode.c b/lib/ext2fs/bb_inode.c new file mode 100644 index 0000000..11f10eb --- /dev/null +++ b/lib/ext2fs/bb_inode.c @@ -0,0 +1,270 @@ +/* + * bb_inode.c --- routines to update the bad block inode. + * + * WARNING: This routine modifies a lot of state in the filesystem; if + * this routine returns an error, the bad block inode may be in an + * inconsistent state. + * + * Copyright (C) 1994, 1995 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +struct set_badblock_record { + ext2_badblocks_iterate bb_iter; + int bad_block_count; + blk_t *ind_blocks; + int max_ind_blocks; + int ind_blocks_size; + int ind_blocks_ptr; + char *block_buf; + errcode_t err; +}; + +static int set_bad_block_proc(ext2_filsys fs, blk_t *block_nr, + e2_blkcnt_t blockcnt, + blk_t ref_block, int ref_offset, + void *priv_data); +static int clear_bad_block_proc(ext2_filsys fs, blk_t *block_nr, + e2_blkcnt_t blockcnt, + blk_t ref_block, int ref_offset, + void *priv_data); + +/* + * Given a bad blocks bitmap, update the bad blocks inode to reflect + * the map. + */ +errcode_t ext2fs_update_bb_inode(ext2_filsys fs, ext2_badblocks_list bb_list) +{ + errcode_t retval; + struct set_badblock_record rec; + struct ext2_inode inode; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!fs->block_map) + return EXT2_ET_NO_BLOCK_BITMAP; + + memset(&rec, 0, sizeof(rec)); + rec.max_ind_blocks = 10; + retval = ext2fs_get_array(rec.max_ind_blocks, sizeof(blk_t), + &rec.ind_blocks); + if (retval) + return retval; + memset(rec.ind_blocks, 0, rec.max_ind_blocks * sizeof(blk_t)); + retval = ext2fs_get_mem(fs->blocksize, &rec.block_buf); + if (retval) + goto cleanup; + memset(rec.block_buf, 0, fs->blocksize); + rec.err = 0; + + /* + * First clear the old bad blocks (while saving the indirect blocks) + */ + retval = ext2fs_block_iterate2(fs, EXT2_BAD_INO, + BLOCK_FLAG_DEPTH_TRAVERSE, 0, + clear_bad_block_proc, &rec); + if (retval) + goto cleanup; + if (rec.err) { + retval = rec.err; + goto cleanup; + } + + /* + * Now set the bad blocks! + * + * First, mark the bad blocks as used. This prevents a bad + * block from being used as an indirect block for the bad + * block inode (!). + */ + if (bb_list) { + retval = ext2fs_badblocks_list_iterate_begin(bb_list, + &rec.bb_iter); + if (retval) + goto cleanup; + retval = ext2fs_block_iterate2(fs, EXT2_BAD_INO, + BLOCK_FLAG_APPEND, 0, + set_bad_block_proc, &rec); + ext2fs_badblocks_list_iterate_end(rec.bb_iter); + if (retval) + goto cleanup; + if (rec.err) { + retval = rec.err; + goto cleanup; + } + } + + /* + * Update the bad block inode's mod time and block count + * field. + */ + retval = ext2fs_read_inode(fs, EXT2_BAD_INO, &inode); + if (retval) + goto cleanup; + + inode.i_atime = inode.i_mtime = fs->now ? fs->now : time(0); + if (!inode.i_ctime) + inode.i_ctime = fs->now ? fs->now : time(0); + ext2fs_iblk_set(fs, &inode, rec.bad_block_count); + retval = ext2fs_inode_size_set(fs, &inode, + rec.bad_block_count * fs->blocksize); + if (retval) + goto cleanup; + + retval = ext2fs_write_inode(fs, EXT2_BAD_INO, &inode); + if (retval) + goto cleanup; + +cleanup: + ext2fs_free_mem(&rec.ind_blocks); + ext2fs_free_mem(&rec.block_buf); + return retval; +} + +/* + * Helper function for update_bb_inode() + * + * Clear the bad blocks in the bad block inode, while saving the + * indirect blocks. + */ +#ifdef __TURBOC__ + #pragma argsused +#endif +static int clear_bad_block_proc(ext2_filsys fs, blk_t *block_nr, + e2_blkcnt_t blockcnt, + blk_t ref_block EXT2FS_ATTR((unused)), + int ref_offset EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct set_badblock_record *rec = (struct set_badblock_record *) + priv_data; + errcode_t retval; + unsigned long old_size; + + if (!*block_nr) + return 0; + + /* + * If the block number is outrageous, clear it and ignore it. + */ + if (*block_nr >= ext2fs_blocks_count(fs->super) || + *block_nr < fs->super->s_first_data_block) { + *block_nr = 0; + return BLOCK_CHANGED; + } + + if (blockcnt < 0) { + if (rec->ind_blocks_size >= rec->max_ind_blocks) { + old_size = rec->max_ind_blocks * sizeof(blk_t); + rec->max_ind_blocks += 10; + retval = ext2fs_resize_mem(old_size, + rec->max_ind_blocks * sizeof(blk_t), + &rec->ind_blocks); + if (retval) { + rec->max_ind_blocks -= 10; + rec->err = retval; + return BLOCK_ABORT; + } + } + rec->ind_blocks[rec->ind_blocks_size++] = *block_nr; + } + + /* + * Mark the block as unused, and update accounting information + */ + ext2fs_block_alloc_stats2(fs, *block_nr, -1); + + *block_nr = 0; + return BLOCK_CHANGED; +} + + +/* + * Helper function for update_bb_inode() + * + * Set the block list in the bad block inode, using the supplied bitmap. + */ +#ifdef __TURBOC__ + #pragma argsused +#endif +static int set_bad_block_proc(ext2_filsys fs, blk_t *block_nr, + e2_blkcnt_t blockcnt, + blk_t ref_block EXT2FS_ATTR((unused)), + int ref_offset EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct set_badblock_record *rec = (struct set_badblock_record *) + priv_data; + errcode_t retval; + blk_t blk; + + if (blockcnt >= 0) { + /* + * Get the next bad block. + */ + if (!ext2fs_badblocks_list_iterate(rec->bb_iter, &blk)) + return BLOCK_ABORT; + rec->bad_block_count++; + } else { + /* + * An indirect block; fetch a block from the + * previously used indirect block list. The block + * most be not marked as used; if so, get another one. + * If we run out of reserved indirect blocks, allocate + * a new one. + */ + retry: + if (rec->ind_blocks_ptr < rec->ind_blocks_size) { + blk = rec->ind_blocks[rec->ind_blocks_ptr++]; + if (ext2fs_test_block_bitmap2(fs->block_map, blk)) + goto retry; + } else { + retval = ext2fs_new_block(fs, 0, 0, &blk); + if (retval) { + rec->err = retval; + return BLOCK_ABORT; + } + } + retval = io_channel_write_blk64(fs->io, blk, 1, rec->block_buf); + if (retval) { + rec->err = retval; + return BLOCK_ABORT; + } + } + + /* + * Update block counts + */ + ext2fs_block_alloc_stats2(fs, blk, +1); + + *block_nr = blk; + return BLOCK_CHANGED; +} + + + + + + diff --git a/lib/ext2fs/bitmaps.c b/lib/ext2fs/bitmaps.c new file mode 100644 index 0000000..8bfa24b --- /dev/null +++ b/lib/ext2fs/bitmaps.c @@ -0,0 +1,320 @@ +/* + * bitmaps.c --- routines to read, write, and manipulate the inode and + * block bitmaps. + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" +#include "bmap64.h" + +void ext2fs_free_inode_bitmap(ext2fs_inode_bitmap bitmap) +{ + ext2fs_free_generic_bmap(bitmap); +} + +void ext2fs_free_block_bitmap(ext2fs_block_bitmap bitmap) +{ + ext2fs_free_generic_bmap(bitmap); +} + +errcode_t ext2fs_copy_bitmap(ext2fs_generic_bitmap src, + ext2fs_generic_bitmap *dest) +{ + return (ext2fs_copy_generic_bmap(src, dest)); +} +void ext2fs_set_bitmap_padding(ext2fs_generic_bitmap map) +{ + ext2fs_set_generic_bmap_padding(map); +} + +errcode_t ext2fs_allocate_inode_bitmap(ext2_filsys fs, + const char *descr, + ext2fs_inode_bitmap *ret) +{ + __u64 start, end, real_end; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (ext2fs_has_feature_journal_dev(fs->super)) + return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP; + + fs->write_bitmaps = ext2fs_write_bitmaps; + + start = 1; + end = fs->super->s_inodes_count; + real_end = (__u64)EXT2_INODES_PER_GROUP(fs->super) * + fs->group_desc_count; + + /* Are we permitted to use new-style bitmaps? */ + if (fs->flags & EXT2_FLAG_64BITS) + return (ext2fs_alloc_generic_bmap(fs, + EXT2_ET_MAGIC_INODE_BITMAP64, + fs->default_bitmap_type, + start, end, real_end, descr, ret)); + + /* Otherwise, check to see if the file system is small enough + * to use old-style 32-bit bitmaps */ + if ((end > ~0U) || (real_end > ~0U)) + return EXT2_ET_CANT_USE_LEGACY_BITMAPS; + + return (ext2fs_make_generic_bitmap(EXT2_ET_MAGIC_INODE_BITMAP, fs, + start, end, real_end, + descr, 0, + (ext2fs_generic_bitmap *) ret)); +} + +errcode_t ext2fs_allocate_block_bitmap(ext2_filsys fs, + const char *descr, + ext2fs_block_bitmap *ret) +{ + __u64 start, end, real_end; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (ext2fs_has_feature_journal_dev(fs->super)) + return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP; + + fs->write_bitmaps = ext2fs_write_bitmaps; + + start = EXT2FS_B2C(fs, fs->super->s_first_data_block); + end = EXT2FS_B2C(fs, ext2fs_blocks_count(fs->super)-1); + real_end = ((__u64) EXT2_CLUSTERS_PER_GROUP(fs->super) + * (__u64) fs->group_desc_count)-1 + start; + + if (fs->flags & EXT2_FLAG_64BITS) + return (ext2fs_alloc_generic_bmap(fs, + EXT2_ET_MAGIC_BLOCK_BITMAP64, + fs->default_bitmap_type, + start, end, real_end, descr, ret)); + + if ((end > ~0U) || (real_end > ~0U)) + return EXT2_ET_CANT_USE_LEGACY_BITMAPS; + + return (ext2fs_make_generic_bitmap(EXT2_ET_MAGIC_BLOCK_BITMAP, fs, + start, end, real_end, + descr, 0, + (ext2fs_generic_bitmap *) ret)); +} + +/* + * ext2fs_allocate_block_bitmap() really allocates a per-cluster + * bitmap for backwards compatibility. This function allocates a + * block bitmap which is truly per-block, even if clusters/bigalloc + * are enabled. mke2fs and e2fsck need this for tracking the + * allocation of the file system metadata blocks. + */ +errcode_t ext2fs_allocate_subcluster_bitmap(ext2_filsys fs, + const char *descr, + ext2fs_block_bitmap *ret) +{ + __u64 start, end, real_end; + ext2fs_generic_bitmap bmap; + ext2fs_generic_bitmap_64 bmap64; + errcode_t retval; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (ext2fs_has_feature_journal_dev(fs->super)) + return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP; + + fs->write_bitmaps = ext2fs_write_bitmaps; + + if (!fs->cluster_ratio_bits) + return ext2fs_allocate_block_bitmap(fs, descr, ret); + + if ((fs->flags & EXT2_FLAG_64BITS) == 0) + return EXT2_ET_CANT_USE_LEGACY_BITMAPS; + + start = fs->super->s_first_data_block; + end = ext2fs_blocks_count(fs->super)-1; + real_end = ((__u64) EXT2_BLOCKS_PER_GROUP(fs->super) + * (__u64) fs->group_desc_count)-1 + start; + + retval = ext2fs_alloc_generic_bmap(fs, EXT2_ET_MAGIC_BLOCK_BITMAP64, + fs->default_bitmap_type, start, + end, real_end, descr, &bmap); + if (retval) + return retval; + bmap64 = (ext2fs_generic_bitmap_64) bmap; + bmap64->cluster_bits = 0; + *ret = bmap; + return 0; +} + +int ext2fs_get_bitmap_granularity(ext2fs_block_bitmap bitmap) +{ + ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) bitmap; + + if (!EXT2FS_IS_64_BITMAP(bmap)) + return 0; + + return bmap->cluster_bits; +} + +errcode_t ext2fs_fudge_inode_bitmap_end(ext2fs_inode_bitmap bitmap, + ext2_ino_t end, ext2_ino_t *oend) +{ + __u64 tmp_oend; + int retval; + + retval = ext2fs_fudge_generic_bmap_end((ext2fs_generic_bitmap) bitmap, + EXT2_ET_FUDGE_INODE_BITMAP_END, + end, &tmp_oend); + if (oend) + *oend = tmp_oend; + return retval; +} + +errcode_t ext2fs_fudge_block_bitmap_end(ext2fs_block_bitmap bitmap, + blk_t end, blk_t *oend) +{ + return (ext2fs_fudge_generic_bitmap_end(bitmap, + EXT2_ET_MAGIC_BLOCK_BITMAP, + EXT2_ET_FUDGE_BLOCK_BITMAP_END, + end, oend)); +} + +errcode_t ext2fs_fudge_block_bitmap_end2(ext2fs_block_bitmap bitmap, + blk64_t end, blk64_t *oend) +{ + return (ext2fs_fudge_generic_bmap_end(bitmap, + EXT2_ET_FUDGE_BLOCK_BITMAP_END, + end, oend)); +} + +void ext2fs_clear_inode_bitmap(ext2fs_inode_bitmap bitmap) +{ + ext2fs_clear_generic_bmap(bitmap); +} + +void ext2fs_clear_block_bitmap(ext2fs_block_bitmap bitmap) +{ + ext2fs_clear_generic_bmap(bitmap); +} + +errcode_t ext2fs_resize_inode_bitmap(__u32 new_end, __u32 new_real_end, + ext2fs_inode_bitmap bmap) +{ + return (ext2fs_resize_generic_bitmap(EXT2_ET_MAGIC_INODE_BITMAP, + new_end, new_real_end, bmap)); +} + +errcode_t ext2fs_resize_inode_bitmap2(__u64 new_end, __u64 new_real_end, + ext2fs_inode_bitmap bmap) +{ + return (ext2fs_resize_generic_bmap(bmap, new_end, new_real_end)); +} + +errcode_t ext2fs_resize_block_bitmap(__u32 new_end, __u32 new_real_end, + ext2fs_block_bitmap bmap) +{ + return (ext2fs_resize_generic_bitmap(EXT2_ET_MAGIC_BLOCK_BITMAP, + new_end, new_real_end, bmap)); +} + +errcode_t ext2fs_resize_block_bitmap2(__u64 new_end, __u64 new_real_end, + ext2fs_block_bitmap bmap) +{ + return (ext2fs_resize_generic_bmap(bmap, new_end, new_real_end)); +} + +errcode_t ext2fs_compare_block_bitmap(ext2fs_block_bitmap bm1, + ext2fs_block_bitmap bm2) +{ + return (ext2fs_compare_generic_bmap(EXT2_ET_NEQ_BLOCK_BITMAP, + bm1, bm2)); +} + +errcode_t ext2fs_compare_inode_bitmap(ext2fs_inode_bitmap bm1, + ext2fs_inode_bitmap bm2) +{ + return (ext2fs_compare_generic_bmap(EXT2_ET_NEQ_INODE_BITMAP, + bm1, bm2)); +} + +errcode_t ext2fs_set_inode_bitmap_range(ext2fs_inode_bitmap bmap, + ext2_ino_t start, unsigned int num, + void *in) +{ + return (ext2fs_set_generic_bitmap_range(bmap, + EXT2_ET_MAGIC_INODE_BITMAP, + start, num, in)); +} + +errcode_t ext2fs_set_inode_bitmap_range2(ext2fs_inode_bitmap bmap, + __u64 start, size_t num, + void *in) +{ + return (ext2fs_set_generic_bmap_range(bmap, start, num, in)); +} + +errcode_t ext2fs_get_inode_bitmap_range(ext2fs_inode_bitmap bmap, + ext2_ino_t start, unsigned int num, + void *out) +{ + return (ext2fs_get_generic_bitmap_range(bmap, + EXT2_ET_MAGIC_INODE_BITMAP, + start, num, out)); +} + +errcode_t ext2fs_get_inode_bitmap_range2(ext2fs_inode_bitmap bmap, + __u64 start, size_t num, + void *out) +{ + return (ext2fs_get_generic_bmap_range(bmap, start, num, out)); +} + +errcode_t ext2fs_set_block_bitmap_range(ext2fs_block_bitmap bmap, + blk_t start, unsigned int num, + void *in) +{ + return (ext2fs_set_generic_bitmap_range(bmap, + EXT2_ET_MAGIC_BLOCK_BITMAP, + start, num, in)); +} + +errcode_t ext2fs_set_block_bitmap_range2(ext2fs_block_bitmap bmap, + blk64_t start, size_t num, + void *in) +{ + return (ext2fs_set_generic_bmap_range(bmap, start, num, in)); +} + +errcode_t ext2fs_get_block_bitmap_range(ext2fs_block_bitmap bmap, + blk_t start, unsigned int num, + void *out) +{ + return (ext2fs_get_generic_bitmap_range(bmap, + EXT2_ET_MAGIC_BLOCK_BITMAP, + start, num, out)); +} + +errcode_t ext2fs_get_block_bitmap_range2(ext2fs_block_bitmap bmap, + blk64_t start, size_t num, + void *out) +{ + return (ext2fs_get_generic_bmap_range(bmap, start, num, out)); +} diff --git a/lib/ext2fs/bitops.c b/lib/ext2fs/bitops.c new file mode 100644 index 0000000..ce2acc4 --- /dev/null +++ b/lib/ext2fs/bitops.c @@ -0,0 +1,148 @@ +/* + * bitops.c --- Bitmap frobbing code. See bitops.h for the inlined + * routines. + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +/* + * C language bitmap functions written by Theodore Ts'o, 9/26/92. + * Modified by Pete A. Zaitcev 7/14/95 to be portable to big endian + * systems, as well as non-32 bit systems. + */ + +int ext2fs_set_bit(unsigned int nr,void * addr) +{ + int mask, retval; + unsigned char *ADDR = (unsigned char *) addr; + + ADDR += nr >> 3; + mask = 1 << (nr & 0x07); + retval = mask & *ADDR; + *ADDR |= mask; + return retval; +} + +int ext2fs_clear_bit(unsigned int nr, void * addr) +{ + int mask, retval; + unsigned char *ADDR = (unsigned char *) addr; + + ADDR += nr >> 3; + mask = 1 << (nr & 0x07); + retval = mask & *ADDR; + *ADDR &= ~mask; + return retval; +} + +int ext2fs_test_bit(unsigned int nr, const void * addr) +{ + int mask; + const unsigned char *ADDR = (const unsigned char *) addr; + + ADDR += nr >> 3; + mask = 1 << (nr & 0x07); + return (mask & *ADDR); +} + +void ext2fs_warn_bitmap(errcode_t errcode, unsigned long arg, + const char *description) +{ +#ifndef OMIT_COM_ERR + if (description) + com_err(0, errcode, "#%lu for %s", arg, description); + else + com_err(0, errcode, "#%lu", arg); +#endif +} + +/* Bitmap functions that take a 64-bit offset */ + +int ext2fs_set_bit64(__u64 nr, void * addr) +{ + int mask, retval; + unsigned char *ADDR = (unsigned char *) addr; + + ADDR += nr >> 3; + mask = 1 << (nr & 0x07); + retval = mask & *ADDR; + *ADDR |= mask; + return retval; +} + +int ext2fs_clear_bit64(__u64 nr, void * addr) +{ + int mask, retval; + unsigned char *ADDR = (unsigned char *) addr; + + ADDR += nr >> 3; + mask = 1 << (nr & 0x07); + retval = mask & *ADDR; + *ADDR &= ~mask; + return retval; +} + +int ext2fs_test_bit64(__u64 nr, const void * addr) +{ + int mask; + const unsigned char *ADDR = (const unsigned char *) addr; + + ADDR += nr >> 3; + mask = 1 << (nr & 0x07); + return (mask & *ADDR); +} + +static unsigned int popcount8(unsigned int w) +{ + unsigned int res = w - ((w >> 1) & 0x55); + res = (res & 0x33) + ((res >> 2) & 0x33); + return (res + (res >> 4)) & 0x0F; +} + +static unsigned int popcount32(unsigned int w) +{ + unsigned int res = w - ((w >> 1) & 0x55555555); + res = (res & 0x33333333) + ((res >> 2) & 0x33333333); + res = (res + (res >> 4)) & 0x0F0F0F0F; + res = res + (res >> 8); + return (res + (res >> 16)) & 0x000000FF; +} + +unsigned int ext2fs_bitcount(const void *addr, unsigned int nbytes) +{ + const unsigned char *cp = addr; + const __u32 *p; + unsigned int res = 0; + + while (((((uintptr_t) cp) & 3) != 0) && (nbytes > 0)) { + res += popcount8(*cp++); + nbytes--; + } + p = (const __u32 *) cp; + + while (nbytes > 4) { + res += popcount32(*p++); + nbytes -= 4; + } + cp = (const unsigned char *) p; + + while (nbytes > 0) { + res += popcount8(*cp++); + nbytes--; + } + return res; +} diff --git a/lib/ext2fs/bitops.h b/lib/ext2fs/bitops.h new file mode 100644 index 0000000..9edf594 --- /dev/null +++ b/lib/ext2fs/bitops.h @@ -0,0 +1,606 @@ +/* + * bitops.h --- Bitmap frobbing code. The byte swapping routines are + * also included here. + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifdef WORDS_BIGENDIAN +#define ext2fs_cpu_to_le64(x) ((__force __le64)ext2fs_swab64((__u64)(x))) +#define ext2fs_le64_to_cpu(x) ext2fs_swab64((__force __u64)(__le64)(x)) +#define ext2fs_cpu_to_le32(x) ((__force __le32)ext2fs_swab32((__u32)(x))) +#define ext2fs_le32_to_cpu(x) ext2fs_swab32((__force __u32)(__le32)(x)) +#define ext2fs_cpu_to_le16(x) ((__force __le16)ext2fs_swab16((__u16)(x))) +#define ext2fs_le16_to_cpu(x) ext2fs_swab16((__force __u16)(__le16)(x)) + +#define ext2fs_cpu_to_be64(x) ((__force __be64)(__u64)(x)) +#define ext2fs_be64_to_cpu(x) ((__force __u64)(__be64)(x)) +#define ext2fs_cpu_to_be32(x) ((__force __be32)(__u32)(x)) +#define ext2fs_be32_to_cpu(x) ((__force __u32)(__be32)(x)) +#define ext2fs_cpu_to_be16(x) ((__force __be16)(__u16)(x)) +#define ext2fs_be16_to_cpu(x) ((__force __u16)(__be16)(x)) +#else +#define ext2fs_cpu_to_le64(x) ((__force __le64)(__u64)(x)) +#define ext2fs_le64_to_cpu(x) ((__force __u64)(__le64)(x)) +#define ext2fs_cpu_to_le32(x) ((__force __le32)(__u32)(x)) +#define ext2fs_le32_to_cpu(x) ((__force __u32)(__le32)(x)) +#define ext2fs_cpu_to_le16(x) ((__force __le16)(__u16)(x)) +#define ext2fs_le16_to_cpu(x) ((__force __u16)(__le16)(x)) + +#define ext2fs_cpu_to_be64(x) ((__force __be64)ext2fs_swab64((__u64)(x))) +#define ext2fs_be64_to_cpu(x) ext2fs_swab64((__force __u64)(__be64)(x)) +#define ext2fs_cpu_to_be32(x) ((__force __be32)ext2fs_swab32((__u32)(x))) +#define ext2fs_be32_to_cpu(x) ext2fs_swab32((__force __u32)(__be32)(x)) +#define ext2fs_cpu_to_be16(x) ((__force __be16)ext2fs_swab16((__u16)(x))) +#define ext2fs_be16_to_cpu(x) ext2fs_swab16((__force __u16)(__be16)(x)) +#endif + +/* + * EXT2FS bitmap manipulation routines. + */ + +/* Support for sending warning messages from the inline subroutines */ +extern const char *ext2fs_block_string; +extern const char *ext2fs_inode_string; +extern const char *ext2fs_mark_string; +extern const char *ext2fs_unmark_string; +extern const char *ext2fs_test_string; +extern void ext2fs_warn_bitmap(errcode_t errcode, unsigned long arg, + const char *description); +extern void ext2fs_warn_bitmap2(ext2fs_generic_bitmap bitmap, + int code, unsigned long arg); + +#ifdef NO_INLINE_FUNCS +extern void ext2fs_fast_set_bit(unsigned int nr,void * addr); +extern void ext2fs_fast_clear_bit(unsigned int nr, void * addr); +extern void ext2fs_fast_set_bit64(__u64 nr,void * addr); +extern void ext2fs_fast_clear_bit64(__u64 nr, void * addr); +extern __u16 ext2fs_swab16(__u16 val); +extern __u32 ext2fs_swab32(__u32 val); +extern __u64 ext2fs_swab64(__u64 val); + +extern int ext2fs_mark_block_bitmap(ext2fs_block_bitmap bitmap, blk_t block); +extern int ext2fs_unmark_block_bitmap(ext2fs_block_bitmap bitmap, + blk_t block); +extern int ext2fs_test_block_bitmap(ext2fs_block_bitmap bitmap, blk_t block); + +extern int ext2fs_mark_inode_bitmap(ext2fs_inode_bitmap bitmap, ext2_ino_t inode); +extern int ext2fs_unmark_inode_bitmap(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode); +extern int ext2fs_test_inode_bitmap(ext2fs_inode_bitmap bitmap, ext2_ino_t inode); + +extern void ext2fs_fast_mark_block_bitmap(ext2fs_block_bitmap bitmap, + blk_t block); +extern void ext2fs_fast_unmark_block_bitmap(ext2fs_block_bitmap bitmap, + blk_t block); +extern int ext2fs_fast_test_block_bitmap(ext2fs_block_bitmap bitmap, + blk_t block); + +extern void ext2fs_fast_mark_inode_bitmap(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode); +extern void ext2fs_fast_unmark_inode_bitmap(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode); +extern int ext2fs_fast_test_inode_bitmap(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode); +extern blk_t ext2fs_get_block_bitmap_start(ext2fs_block_bitmap bitmap); +extern ext2_ino_t ext2fs_get_inode_bitmap_start(ext2fs_inode_bitmap bitmap); +extern blk_t ext2fs_get_block_bitmap_end(ext2fs_block_bitmap bitmap); +extern ext2_ino_t ext2fs_get_inode_bitmap_end(ext2fs_inode_bitmap bitmap); + +extern void ext2fs_fast_mark_block_bitmap_range(ext2fs_block_bitmap bitmap, + blk_t block, int num); +extern void ext2fs_fast_unmark_block_bitmap_range(ext2fs_block_bitmap bitmap, + blk_t block, int num); +extern int ext2fs_fast_test_block_bitmap_range(ext2fs_block_bitmap bitmap, + blk_t block, int num); +#endif + +/* These functions routines moved to gen_bitmap.c */ +extern void ext2fs_mark_block_bitmap_range(ext2fs_block_bitmap bitmap, + blk_t block, int num); +extern void ext2fs_unmark_block_bitmap_range(ext2fs_block_bitmap bitmap, + blk_t block, int num); +extern int ext2fs_test_block_bitmap_range(ext2fs_block_bitmap bitmap, + blk_t block, int num); +extern int ext2fs_test_inode_bitmap_range(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode, int num); +extern int ext2fs_mark_generic_bitmap(ext2fs_generic_bitmap bitmap, + __u32 bitno); +extern int ext2fs_unmark_generic_bitmap(ext2fs_generic_bitmap bitmap, + blk_t bitno); +extern int ext2fs_test_generic_bitmap(ext2fs_generic_bitmap bitmap, + blk_t bitno); +extern int ext2fs_test_block_bitmap_range(ext2fs_block_bitmap bitmap, + blk_t block, int num); +extern void ext2fs_set_bitmap_padding(ext2fs_generic_bitmap map); +extern __u32 ext2fs_get_generic_bitmap_start(ext2fs_generic_bitmap bitmap); +extern __u32 ext2fs_get_generic_bitmap_end(ext2fs_generic_bitmap bitmap); + +/* 64-bit versions */ + +#ifdef NO_INLINE_FUNCS +extern int ext2fs_mark_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block); +extern int ext2fs_unmark_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block); +extern int ext2fs_test_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block); + +extern int ext2fs_mark_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode); +extern int ext2fs_unmark_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode); +extern int ext2fs_test_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode); + +extern void ext2fs_fast_mark_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block); +extern void ext2fs_fast_unmark_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block); +extern int ext2fs_fast_test_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block); + +extern void ext2fs_fast_mark_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode); +extern void ext2fs_fast_unmark_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode); +extern int ext2fs_fast_test_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode); +extern errcode_t ext2fs_find_first_zero_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t start, + blk64_t end, + blk64_t *out); +extern errcode_t ext2fs_find_first_zero_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t start, + ext2_ino_t end, + ext2_ino_t *out); +extern errcode_t ext2fs_find_first_set_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t start, + blk64_t end, + blk64_t *out); +extern errcode_t ext2fs_find_first_set_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t start, + ext2_ino_t end, + ext2_ino_t *out); +extern blk64_t ext2fs_get_block_bitmap_start2(ext2fs_block_bitmap bitmap); +extern ext2_ino_t ext2fs_get_inode_bitmap_start2(ext2fs_inode_bitmap bitmap); +extern blk64_t ext2fs_get_block_bitmap_end2(ext2fs_block_bitmap bitmap); +extern ext2_ino_t ext2fs_get_inode_bitmap_end2(ext2fs_inode_bitmap bitmap); + +extern int ext2fs_fast_test_block_bitmap_range2(ext2fs_block_bitmap bitmap, + blk64_t block, + unsigned int num); +extern void ext2fs_fast_mark_block_bitmap_range2(ext2fs_block_bitmap bitmap, + blk64_t block, + unsigned int num); +extern void ext2fs_fast_unmark_block_bitmap_range2(ext2fs_block_bitmap bitmap, + blk64_t block, + unsigned int num); +#endif + +/* These routines moved to gen_bitmap64.c */ +extern void ext2fs_clear_generic_bmap(ext2fs_generic_bitmap bitmap); +extern errcode_t ext2fs_compare_generic_bmap(errcode_t neq, + ext2fs_generic_bitmap bm1, + ext2fs_generic_bitmap bm2); +extern void ext2fs_set_generic_bmap_padding(ext2fs_generic_bitmap bmap); +extern int ext2fs_mark_generic_bmap(ext2fs_generic_bitmap bitmap, + blk64_t bitno); +extern int ext2fs_unmark_generic_bmap(ext2fs_generic_bitmap bitmap, + blk64_t bitno); +extern int ext2fs_test_generic_bmap(ext2fs_generic_bitmap bitmap, + blk64_t bitno); +extern int ext2fs_test_block_bitmap_range2(ext2fs_block_bitmap bitmap, + blk64_t block, unsigned int num); +extern __u64 ext2fs_get_generic_bmap_start(ext2fs_generic_bitmap bitmap); +extern __u64 ext2fs_get_generic_bmap_end(ext2fs_generic_bitmap bitmap); +extern int ext2fs_test_block_bitmap_range2(ext2fs_block_bitmap bitmap, + blk64_t block, unsigned int num); +extern void ext2fs_mark_block_bitmap_range2(ext2fs_block_bitmap bitmap, + blk64_t block, unsigned int num); +extern void ext2fs_unmark_block_bitmap_range2(ext2fs_block_bitmap bitmap, + blk64_t block, unsigned int num); +extern errcode_t ext2fs_find_first_zero_generic_bmap(ext2fs_generic_bitmap bitmap, + __u64 start, __u64 end, + __u64 *out); +extern errcode_t ext2fs_find_first_set_generic_bmap(ext2fs_generic_bitmap bitmap, + __u64 start, __u64 end, + __u64 *out); + +/* + * The inline routines themselves... + * + * If NO_INLINE_FUNCS is defined, then we won't try to do inline + * functions at all; they will be included as normal functions in + * inline.c + */ + +#if (defined(INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS)) +#ifdef INCLUDE_INLINE_FUNCS +#if (__STDC_VERSION__ >= 199901L) +#define _INLINE_ extern inline +#else +#define _INLINE_ inline +#endif +#else /* !INCLUDE_INLINE FUNCS */ +#if (__STDC_VERSION__ >= 199901L) +#define _INLINE_ inline +#else /* not C99 */ +#ifdef __GNUC__ +#define _INLINE_ extern __inline__ +#else /* For Watcom C */ +#define _INLINE_ extern inline +#endif /* __GNUC__ */ +#endif /* __STDC_VERSION__ >= 199901L */ +#endif /* INCLUDE_INLINE_FUNCS */ + +/* + * Fast bit set/clear functions that doesn't need to return the + * previous bit value. + */ + +_INLINE_ void ext2fs_fast_set_bit(unsigned int nr,void * addr) +{ + unsigned char *ADDR = (unsigned char *) addr; + + ADDR += nr >> 3; + *ADDR |= (unsigned char) (1 << (nr & 0x07)); +} + +_INLINE_ void ext2fs_fast_clear_bit(unsigned int nr, void * addr) +{ + unsigned char *ADDR = (unsigned char *) addr; + + ADDR += nr >> 3; + *ADDR &= (unsigned char) ~(1 << (nr & 0x07)); +} + + +_INLINE_ void ext2fs_fast_set_bit64(__u64 nr, void * addr) +{ + unsigned char *ADDR = (unsigned char *) addr; + + ADDR += nr >> 3; + *ADDR |= (unsigned char) (1 << (nr & 0x07)); +} + +_INLINE_ void ext2fs_fast_clear_bit64(__u64 nr, void * addr) +{ + unsigned char *ADDR = (unsigned char *) addr; + + ADDR += nr >> 3; + *ADDR &= (unsigned char) ~(1 << (nr & 0x07)); +} + +_INLINE_ __u16 ext2fs_swab16(__u16 val) +{ + return (val >> 8) | (__u16) (val << 8); +} + +_INLINE_ __u32 ext2fs_swab32(__u32 val) +{ + return ((val>>24) | ((val>>8)&0xFF00) | + ((val<<8)&0xFF0000) | (val<<24)); +} + +_INLINE_ __u64 ext2fs_swab64(__u64 val) +{ + return (ext2fs_swab32((__u32) (val >> 32)) | + (((__u64)ext2fs_swab32(val & 0xFFFFFFFFUL)) << 32)); +} + +_INLINE_ int ext2fs_mark_block_bitmap(ext2fs_block_bitmap bitmap, + blk_t block) +{ + return ext2fs_mark_generic_bitmap((ext2fs_generic_bitmap) bitmap, + block); +} + +_INLINE_ int ext2fs_unmark_block_bitmap(ext2fs_block_bitmap bitmap, + blk_t block) +{ + return ext2fs_unmark_generic_bitmap((ext2fs_generic_bitmap) bitmap, + block); +} + +_INLINE_ int ext2fs_test_block_bitmap(ext2fs_block_bitmap bitmap, + blk_t block) +{ + return ext2fs_test_generic_bitmap((ext2fs_generic_bitmap) bitmap, + block); +} + +_INLINE_ int ext2fs_mark_inode_bitmap(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + return ext2fs_mark_generic_bitmap((ext2fs_generic_bitmap) bitmap, + inode); +} + +_INLINE_ int ext2fs_unmark_inode_bitmap(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + return ext2fs_unmark_generic_bitmap((ext2fs_generic_bitmap) bitmap, + inode); +} + +_INLINE_ int ext2fs_test_inode_bitmap(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + return ext2fs_test_generic_bitmap((ext2fs_generic_bitmap) bitmap, + inode); +} + +_INLINE_ void ext2fs_fast_mark_block_bitmap(ext2fs_block_bitmap bitmap, + blk_t block) +{ + ext2fs_mark_generic_bitmap((ext2fs_generic_bitmap) bitmap, block); +} + +_INLINE_ void ext2fs_fast_unmark_block_bitmap(ext2fs_block_bitmap bitmap, + blk_t block) +{ + ext2fs_unmark_generic_bitmap((ext2fs_generic_bitmap) bitmap, block); +} + +_INLINE_ int ext2fs_fast_test_block_bitmap(ext2fs_block_bitmap bitmap, + blk_t block) +{ + return ext2fs_test_generic_bitmap((ext2fs_generic_bitmap) bitmap, + block); +} + +_INLINE_ void ext2fs_fast_mark_inode_bitmap(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + ext2fs_mark_generic_bitmap((ext2fs_generic_bitmap) bitmap, inode); +} + +_INLINE_ void ext2fs_fast_unmark_inode_bitmap(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + ext2fs_unmark_generic_bitmap((ext2fs_generic_bitmap) bitmap, inode); +} + +_INLINE_ int ext2fs_fast_test_inode_bitmap(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + return ext2fs_test_generic_bitmap((ext2fs_generic_bitmap) bitmap, + inode); +} + +_INLINE_ blk_t ext2fs_get_block_bitmap_start(ext2fs_block_bitmap bitmap) +{ + return ext2fs_get_generic_bitmap_start((ext2fs_generic_bitmap) bitmap); +} + +_INLINE_ ext2_ino_t ext2fs_get_inode_bitmap_start(ext2fs_inode_bitmap bitmap) +{ + return ext2fs_get_generic_bitmap_start((ext2fs_generic_bitmap) bitmap); +} + +_INLINE_ blk_t ext2fs_get_block_bitmap_end(ext2fs_block_bitmap bitmap) +{ + return ext2fs_get_generic_bitmap_end((ext2fs_generic_bitmap) bitmap); +} + +_INLINE_ ext2_ino_t ext2fs_get_inode_bitmap_end(ext2fs_inode_bitmap bitmap) +{ + return ext2fs_get_generic_bitmap_end((ext2fs_generic_bitmap) bitmap); +} + +_INLINE_ int ext2fs_fast_test_block_bitmap_range(ext2fs_block_bitmap bitmap, + blk_t block, int num) +{ + return ext2fs_test_block_bitmap_range(bitmap, block, num); +} + +_INLINE_ void ext2fs_fast_mark_block_bitmap_range(ext2fs_block_bitmap bitmap, + blk_t block, int num) +{ + ext2fs_mark_block_bitmap_range(bitmap, block, num); +} + +_INLINE_ void ext2fs_fast_unmark_block_bitmap_range(ext2fs_block_bitmap bitmap, + blk_t block, int num) +{ + ext2fs_unmark_block_bitmap_range(bitmap, block, num); +} + +/* 64-bit versions */ + +_INLINE_ int ext2fs_mark_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block) +{ + return ext2fs_mark_generic_bmap((ext2fs_generic_bitmap) bitmap, + block); +} + +_INLINE_ int ext2fs_unmark_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block) +{ + return ext2fs_unmark_generic_bmap((ext2fs_generic_bitmap) bitmap, block); +} + +_INLINE_ int ext2fs_test_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block) +{ + return ext2fs_test_generic_bmap((ext2fs_generic_bitmap) bitmap, + block); +} + +_INLINE_ int ext2fs_mark_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + return ext2fs_mark_generic_bmap((ext2fs_generic_bitmap) bitmap, + inode); +} + +_INLINE_ int ext2fs_unmark_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + return ext2fs_unmark_generic_bmap((ext2fs_generic_bitmap) bitmap, + inode); +} + +_INLINE_ int ext2fs_test_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + return ext2fs_test_generic_bmap((ext2fs_generic_bitmap) bitmap, + inode); +} + +_INLINE_ void ext2fs_fast_mark_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block) +{ + ext2fs_mark_generic_bmap((ext2fs_generic_bitmap) bitmap, block); +} + +_INLINE_ void ext2fs_fast_unmark_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block) +{ + ext2fs_unmark_generic_bmap((ext2fs_generic_bitmap) bitmap, block); +} + +_INLINE_ int ext2fs_fast_test_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t block) +{ + return ext2fs_test_generic_bmap((ext2fs_generic_bitmap) bitmap, + block); +} + +_INLINE_ void ext2fs_fast_mark_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + ext2fs_mark_generic_bmap((ext2fs_generic_bitmap) bitmap, inode); +} + +_INLINE_ void ext2fs_fast_unmark_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + ext2fs_unmark_generic_bmap((ext2fs_generic_bitmap) bitmap, inode); +} + +_INLINE_ int ext2fs_fast_test_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t inode) +{ + return ext2fs_test_generic_bmap((ext2fs_generic_bitmap) bitmap, + inode); +} + +_INLINE_ errcode_t ext2fs_find_first_zero_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t start, + blk64_t end, + blk64_t *out) +{ + __u64 o; + errcode_t rv; + + rv = ext2fs_find_first_zero_generic_bmap((ext2fs_generic_bitmap) bitmap, + start, end, &o); + if (!rv) + *out = o; + return rv; +} + +_INLINE_ errcode_t ext2fs_find_first_zero_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t start, + ext2_ino_t end, + ext2_ino_t *out) +{ + __u64 o; + errcode_t rv; + + rv = ext2fs_find_first_zero_generic_bmap((ext2fs_generic_bitmap) bitmap, + start, end, &o); + if (!rv) + *out = (ext2_ino_t) o; + return rv; +} + +_INLINE_ errcode_t ext2fs_find_first_set_block_bitmap2(ext2fs_block_bitmap bitmap, + blk64_t start, + blk64_t end, + blk64_t *out) +{ + __u64 o; + errcode_t rv; + + rv = ext2fs_find_first_set_generic_bmap((ext2fs_generic_bitmap) bitmap, + start, end, &o); + if (!rv) + *out = o; + return rv; +} + +_INLINE_ errcode_t ext2fs_find_first_set_inode_bitmap2(ext2fs_inode_bitmap bitmap, + ext2_ino_t start, + ext2_ino_t end, + ext2_ino_t *out) +{ + __u64 o; + errcode_t rv; + + rv = ext2fs_find_first_set_generic_bmap((ext2fs_generic_bitmap) bitmap, + start, end, &o); + if (!rv) + *out = (ext2_ino_t) o; + return rv; +} + +_INLINE_ blk64_t ext2fs_get_block_bitmap_start2(ext2fs_block_bitmap bitmap) +{ + return ext2fs_get_generic_bmap_start((ext2fs_generic_bitmap) bitmap); +} + +_INLINE_ ext2_ino_t ext2fs_get_inode_bitmap_start2(ext2fs_inode_bitmap bitmap) +{ + return (ext2_ino_t) ext2fs_get_generic_bmap_start((ext2fs_generic_bitmap) bitmap); +} + +_INLINE_ blk64_t ext2fs_get_block_bitmap_end2(ext2fs_block_bitmap bitmap) +{ + return ext2fs_get_generic_bmap_end((ext2fs_generic_bitmap) bitmap); +} + +_INLINE_ ext2_ino_t ext2fs_get_inode_bitmap_end2(ext2fs_inode_bitmap bitmap) +{ + return (ext2_ino_t) ext2fs_get_generic_bmap_end((ext2fs_generic_bitmap) bitmap); +} + +_INLINE_ int ext2fs_fast_test_block_bitmap_range2(ext2fs_block_bitmap bitmap, + blk64_t block, + unsigned int num) +{ + return ext2fs_test_block_bitmap_range2(bitmap, block, num); +} + +_INLINE_ void ext2fs_fast_mark_block_bitmap_range2(ext2fs_block_bitmap bitmap, + blk64_t block, + unsigned int num) +{ + ext2fs_mark_block_bitmap_range2(bitmap, block, num); +} + +_INLINE_ void ext2fs_fast_unmark_block_bitmap_range2(ext2fs_block_bitmap bitmap, + blk64_t block, + unsigned int num) +{ + ext2fs_unmark_block_bitmap_range2(bitmap, block, num); +} + +#undef _INLINE_ +#endif + +extern int ext2fs_set_bit(unsigned int nr,void * addr); +extern int ext2fs_clear_bit(unsigned int nr, void * addr); +extern int ext2fs_test_bit(unsigned int nr, const void * addr); +extern int ext2fs_set_bit64(__u64 nr,void * addr); +extern int ext2fs_clear_bit64(__u64 nr, void * addr); +extern int ext2fs_test_bit64(__u64 nr, const void * addr); +extern unsigned int ext2fs_bitcount(const void *addr, unsigned int nbytes); diff --git a/lib/ext2fs/blkmap64_ba.c b/lib/ext2fs/blkmap64_ba.c new file mode 100644 index 0000000..5d8f154 --- /dev/null +++ b/lib/ext2fs/blkmap64_ba.c @@ -0,0 +1,492 @@ +/* + * blkmap64_ba.c --- Simple bitarray implementation for bitmaps + * + * Copyright (C) 2008 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Public + * License. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" +#include "bmap64.h" + +/* + * Private data for bit array implementation of bitmap ops. + * Currently, this is just a pointer to our big flat hunk of memory, + * exactly equivalent to the old-skool char * bitmap member. + */ + +struct ext2fs_ba_private_struct { + char *bitarray; +}; + +typedef struct ext2fs_ba_private_struct *ext2fs_ba_private; + +static errcode_t ba_alloc_private_data (ext2fs_generic_bitmap_64 bitmap) +{ + ext2fs_ba_private bp; + errcode_t retval; + size_t size; + + /* + * Since we only have the one pointer, we could just shove our + * private data in the void *private field itself, but then + * we'd have to do a fair bit of rewriting if we ever added a + * field. I'm agnostic. + */ + retval = ext2fs_get_mem(sizeof (ext2fs_ba_private), &bp); + if (retval) + return retval; + + size = (size_t) (((bitmap->real_end - bitmap->start) / 8) + 1); + + retval = ext2fs_get_mem(size, &bp->bitarray); + if (retval) { + ext2fs_free_mem(&bp); + bp = 0; + return retval; + } + bitmap->private = (void *) bp; + return 0; +} + +static errcode_t ba_new_bmap(ext2_filsys fs EXT2FS_ATTR((unused)), + ext2fs_generic_bitmap_64 bitmap) +{ + ext2fs_ba_private bp; + errcode_t retval; + size_t size; + + retval = ba_alloc_private_data (bitmap); + if (retval) + return retval; + + bp = (ext2fs_ba_private) bitmap->private; + size = (size_t) (((bitmap->real_end - bitmap->start) / 8) + 1); + memset(bp->bitarray, 0, size); + + return 0; +} + +static void ba_free_bmap(ext2fs_generic_bitmap_64 bitmap) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private; + + if (!bp) + return; + + if (bp->bitarray) { + ext2fs_free_mem (&bp->bitarray); + bp->bitarray = 0; + } + ext2fs_free_mem (&bp); + bp = 0; +} + +static errcode_t ba_copy_bmap(ext2fs_generic_bitmap_64 src, + ext2fs_generic_bitmap_64 dest) +{ + ext2fs_ba_private src_bp = (ext2fs_ba_private) src->private; + ext2fs_ba_private dest_bp; + errcode_t retval; + size_t size; + + retval = ba_alloc_private_data (dest); + if (retval) + return retval; + + dest_bp = (ext2fs_ba_private) dest->private; + + size = (size_t) (((src->real_end - src->start) / 8) + 1); + memcpy (dest_bp->bitarray, src_bp->bitarray, size); + + return 0; +} + +static errcode_t ba_resize_bmap(ext2fs_generic_bitmap_64 bmap, + __u64 new_end, __u64 new_real_end) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bmap->private; + errcode_t retval; + size_t size, new_size; + __u64 bitno; + + /* + * If we're expanding the bitmap, make sure all of the new + * parts of the bitmap are zero. + */ + if (new_end > bmap->end) { + bitno = bmap->real_end; + if (bitno > new_end) + bitno = new_end; + for (; bitno > bmap->end; bitno--) + ext2fs_clear_bit64(bitno - bmap->start, bp->bitarray); + } + if (new_real_end == bmap->real_end) { + bmap->end = new_end; + return 0; + } + + size = ((bmap->real_end - bmap->start) / 8) + 1; + new_size = ((new_real_end - bmap->start) / 8) + 1; + + if (size != new_size) { + retval = ext2fs_resize_mem(size, new_size, &bp->bitarray); + if (retval) + return retval; + } + if (new_size > size) + memset(bp->bitarray + size, 0, new_size - size); + + bmap->end = new_end; + bmap->real_end = new_real_end; + return 0; + +} + +static int ba_mark_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private; + blk64_t bitno = (blk64_t) arg; + + return ext2fs_set_bit64(bitno - bitmap->start, bp->bitarray); +} + +static int ba_unmark_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private; + blk64_t bitno = (blk64_t) arg; + + return ext2fs_clear_bit64(bitno - bitmap->start, bp->bitarray); +} + +static int ba_test_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private; + blk64_t bitno = (blk64_t) arg; + + return ext2fs_test_bit64(bitno - bitmap->start, bp->bitarray); +} + +static void ba_mark_bmap_extent(ext2fs_generic_bitmap_64 bitmap, __u64 arg, + unsigned int num) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private; + blk64_t bitno = (blk64_t) arg; + unsigned int i; + + for (i = 0; i < num; i++) + ext2fs_fast_set_bit64(bitno + i - bitmap->start, bp->bitarray); +} + +static void ba_unmark_bmap_extent(ext2fs_generic_bitmap_64 bitmap, __u64 arg, + unsigned int num) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private; + blk64_t bitno = (blk64_t) arg; + unsigned int i; + + for (i = 0; i < num; i++) + ext2fs_fast_clear_bit64(bitno + i - bitmap->start, bp->bitarray); +} + +static int ba_test_clear_bmap_extent(ext2fs_generic_bitmap_64 bitmap, + __u64 start, unsigned int len) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private; + __u64 start_byte, len_byte = len >> 3; + unsigned int start_bit, len_bit = len % 8; + unsigned int first_bit = 0; + unsigned int last_bit = 0; + int mark_count = 0; + int mark_bit = 0; + int i; + const char *ADDR; + + ADDR = bp->bitarray; + start -= bitmap->start; + start_byte = start >> 3; + start_bit = start % 8; + + if (start_bit != 0) { + /* + * The compared start block number or start inode number + * is not the first bit in a byte. + */ + mark_count = 8 - start_bit; + if (len < 8 - start_bit) { + mark_count = (int)len; + mark_bit = len + start_bit - 1; + } else + mark_bit = 7; + + for (i = mark_count; i > 0; i--, mark_bit--) + first_bit |= 1 << mark_bit; + + /* + * Compare blocks or inodes in the first byte. + * If there is any marked bit, this function returns 0. + */ + if (first_bit & ADDR[start_byte]) + return 0; + else if (len <= 8 - start_bit) + return 1; + + start_byte++; + len_bit = (len - mark_count) % 8; + len_byte = (len - mark_count) >> 3; + } + + /* + * The compared start block number or start inode number is + * the first bit in a byte. + */ + if (len_bit != 0) { + /* + * The compared end block number or end inode number is + * not the last bit in a byte. + */ + for (mark_bit = len_bit - 1; mark_bit >= 0; mark_bit--) + last_bit |= 1 << mark_bit; + + /* + * Compare blocks or inodes in the last byte. + * If there is any marked bit, this function returns 0. + */ + if (last_bit & ADDR[start_byte + len_byte]) + return 0; + else if (len_byte == 0) + return 1; + } + + /* Check whether all bytes are 0 */ + return ext2fs_mem_is_zero(ADDR + start_byte, len_byte); +} + + +static errcode_t ba_set_bmap_range(ext2fs_generic_bitmap_64 bitmap, + __u64 start, size_t num, void *in) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private; + + memcpy (bp->bitarray + (start >> 3), in, (num + 7) >> 3); + + return 0; +} + +static errcode_t ba_get_bmap_range(ext2fs_generic_bitmap_64 bitmap, + __u64 start, size_t num, void *out) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private; + + memcpy (out, bp->bitarray + (start >> 3), (num + 7) >> 3); + + return 0; +} + +static void ba_clear_bmap(ext2fs_generic_bitmap_64 bitmap) +{ + ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private; + + memset(bp->bitarray, 0, + (size_t) (((bitmap->real_end - bitmap->start) / 8) + 1)); +} + +#ifdef ENABLE_BMAP_STATS +static void ba_print_stats(ext2fs_generic_bitmap_64 bitmap) +{ + fprintf(stderr, "%16llu Bytes used by bitarray\n", (unsigned long long) + ((bitmap->real_end - bitmap->start) >> 3) + 1 + + sizeof(struct ext2fs_ba_private_struct)); +} +#else +static void ba_print_stats(ext2fs_generic_bitmap_64 bitmap EXT2FS_ATTR((unused))) +{ +} +#endif + +/* Find the first zero bit between start and end, inclusive. */ +static errcode_t ba_find_first_zero(ext2fs_generic_bitmap_64 bitmap, + __u64 start, __u64 end, __u64 *out) +{ + ext2fs_ba_private bp = (ext2fs_ba_private)bitmap->private; + unsigned long bitpos = start - bitmap->start; + unsigned long count = end - start + 1; + int byte_found = 0; /* whether a != 0xff byte has been found */ + const unsigned char *pos; + unsigned long max_loop_count, i; + + /* scan bits until we hit a byte boundary */ + while ((bitpos & 0x7) != 0 && count > 0) { + if (!ext2fs_test_bit64(bitpos, bp->bitarray)) { + *out = bitpos + bitmap->start; + return 0; + } + bitpos++; + count--; + } + + if (!count) + return ENOENT; + + pos = ((unsigned char *)bp->bitarray) + (bitpos >> 3); + /* scan bytes until 8-byte (64-bit) aligned */ + while (count >= 8 && (((uintptr_t)pos) & 0x07)) { + if (*pos != 0xff) { + byte_found = 1; + break; + } + pos++; + count -= 8; + bitpos += 8; + } + + if (!byte_found) { + max_loop_count = count >> 6; /* 8-byte blocks */ + i = max_loop_count; + while (i) { + if (*((const __u64 *)pos) != ((__u64)-1)) + break; + pos += 8; + i--; + } + count -= 64 * (max_loop_count - i); + bitpos += 64 * (max_loop_count - i); + + max_loop_count = count >> 3; + i = max_loop_count; + while (i) { + if (*pos != 0xff) { + byte_found = 1; + break; + } + pos++; + i--; + } + count -= 8 * (max_loop_count - i); + bitpos += 8 * (max_loop_count - i); + } + + /* Here either count < 8 or byte_found == 1. */ + while (count-- > 0) { + if (!ext2fs_test_bit64(bitpos, bp->bitarray)) { + *out = bitpos + bitmap->start; + return 0; + } + bitpos++; + } + + return ENOENT; +} + +/* Find the first one bit between start and end, inclusive. */ +static errcode_t ba_find_first_set(ext2fs_generic_bitmap_64 bitmap, + __u64 start, __u64 end, __u64 *out) +{ + ext2fs_ba_private bp = (ext2fs_ba_private)bitmap->private; + unsigned long bitpos = start - bitmap->start; + unsigned long count = end - start + 1; + int byte_found = 0; /* whether a != 0xff byte has been found */ + const unsigned char *pos; + unsigned long max_loop_count, i; + + /* scan bits until we hit a byte boundary */ + while ((bitpos & 0x7) != 0 && count > 0) { + if (ext2fs_test_bit64(bitpos, bp->bitarray)) { + *out = bitpos + bitmap->start; + return 0; + } + bitpos++; + count--; + } + + if (!count) + return ENOENT; + + pos = ((unsigned char *)bp->bitarray) + (bitpos >> 3); + /* scan bytes until 8-byte (64-bit) aligned */ + while (count >= 8 && (((uintptr_t)pos) & 0x07)) { + if (*pos != 0) { + byte_found = 1; + break; + } + pos++; + count -= 8; + bitpos += 8; + } + + if (!byte_found) { + max_loop_count = count >> 6; /* 8-byte blocks */ + i = max_loop_count; + while (i) { + if (*((const __u64 *)pos) != 0) + break; + pos += 8; + i--; + } + count -= 64 * (max_loop_count - i); + bitpos += 64 * (max_loop_count - i); + + max_loop_count = count >> 3; + i = max_loop_count; + while (i) { + if (*pos != 0) { + byte_found = 1; + break; + } + pos++; + i--; + } + count -= 8 * (max_loop_count - i); + bitpos += 8 * (max_loop_count - i); + } + + /* Here either count < 8 or byte_found == 1. */ + while (count-- > 0) { + if (ext2fs_test_bit64(bitpos, bp->bitarray)) { + *out = bitpos + bitmap->start; + return 0; + } + bitpos++; + } + + return ENOENT; +} + +struct ext2_bitmap_ops ext2fs_blkmap64_bitarray = { + .type = EXT2FS_BMAP64_BITARRAY, + .new_bmap = ba_new_bmap, + .free_bmap = ba_free_bmap, + .copy_bmap = ba_copy_bmap, + .resize_bmap = ba_resize_bmap, + .mark_bmap = ba_mark_bmap, + .unmark_bmap = ba_unmark_bmap, + .test_bmap = ba_test_bmap, + .test_clear_bmap_extent = ba_test_clear_bmap_extent, + .mark_bmap_extent = ba_mark_bmap_extent, + .unmark_bmap_extent = ba_unmark_bmap_extent, + .set_bmap_range = ba_set_bmap_range, + .get_bmap_range = ba_get_bmap_range, + .clear_bmap = ba_clear_bmap, + .print_stats = ba_print_stats, + .find_first_zero = ba_find_first_zero, + .find_first_set = ba_find_first_set +}; diff --git a/lib/ext2fs/blkmap64_rb.c b/lib/ext2fs/blkmap64_rb.c new file mode 100644 index 0000000..0df58dc --- /dev/null +++ b/lib/ext2fs/blkmap64_rb.c @@ -0,0 +1,998 @@ +/* + * blkmap64_rb.c --- Simple rb-tree implementation for bitmaps + * + * (C)2010 Red Hat, Inc., Lukas Czerner <lczerner@redhat.com> + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Public + * License. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#if HAVE_LINUX_TYPES_H +#include <linux/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" +#include "bmap64.h" +#include "rbtree.h" + +#include <limits.h> + +struct bmap_rb_extent { + struct rb_node node; + __u64 start; + __u64 count; +}; + +struct ext2fs_rb_private { + struct rb_root root; + struct bmap_rb_extent *wcursor; + struct bmap_rb_extent *rcursor; + struct bmap_rb_extent *rcursor_next; +#ifdef ENABLE_BMAP_STATS_OPS + __u64 mark_hit; + __u64 test_hit; +#endif +}; + +inline static struct bmap_rb_extent *node_to_extent(struct rb_node *node) +{ + /* + * This depends on the fact the struct rb_node is at the + * beginning of the bmap_rb_extent structure. We use this + * instead of the ext2fs_rb_entry macro because it causes gcc + * -Wall to generate a huge amount of noise. + */ + return (struct bmap_rb_extent *) node; +} + +static int rb_insert_extent(__u64 start, __u64 count, + struct ext2fs_rb_private *); +static void rb_get_new_extent(struct bmap_rb_extent **, __u64, __u64); + +/* #define DEBUG_RB */ + +#ifdef DEBUG_RB +static void print_tree(struct rb_root *root) +{ + struct rb_node *node = NULL; + struct bmap_rb_extent *ext; + + fprintf(stderr, "\t\t\t=================================\n"); + node = ext2fs_rb_first(root); + for (node = ext2fs_rb_first(root); node != NULL; + node = ext2fs_rb_next(node)) { + ext = node_to_extent(node); + fprintf(stderr, "\t\t\t--> (%llu -> %llu)\n", + (unsigned long long) ext->start, + (unsigned long long) ext->start + ext->count); + } + fprintf(stderr, "\t\t\t=================================\n"); +} + +static void check_tree(struct rb_root *root, const char *msg) +{ + struct rb_node *node; + struct bmap_rb_extent *ext, *old = NULL; + + for (node = ext2fs_rb_first(root); node; + node = ext2fs_rb_next(node)) { + ext = node_to_extent(node); + if (ext->count == 0) { + fprintf(stderr, "Tree Error: count is zero\n"); + fprintf(stderr, "extent: %llu -> %llu (%llu)\n", + (unsigned long long) ext->start, + (unsigned long long) ext->start + ext->count, + (unsigned long long) ext->count); + goto err_out; + } + if (ext->start + ext->count < ext->start) { + fprintf(stderr, + "Tree Error: start or count is crazy\n"); + fprintf(stderr, "extent: %llu -> %llu (%llu)\n", + (unsigned long long) ext->start, + (unsigned long long) ext->start + ext->count, + (unsigned long long) ext->count); + goto err_out; + } + + if (old) { + if (old->start > ext->start) { + fprintf(stderr, "Tree Error: start is crazy\n"); + fprintf(stderr, "extent: %llu -> %llu (%llu)\n", + (unsigned long long) old->start, + (unsigned long long) old->start + old->count, + (unsigned long long) old->count); + fprintf(stderr, + "extent next: %llu -> %llu (%llu)\n", + (unsigned long long) ext->start, + (unsigned long long) ext->start + ext->count, + (unsigned long long) ext->count); + goto err_out; + } + if ((old->start + old->count) >= ext->start) { + fprintf(stderr, + "Tree Error: extent is crazy\n"); + fprintf(stderr, "extent: %llu -> %llu (%llu)\n", + (unsigned long long) old->start, + (unsigned long long) old->start + old->count, + (unsigned long long) old->count); + fprintf(stderr, + "extent next: %llu -> %llu (%llu)\n", + (unsigned long long) ext->start, + (unsigned long long) ext->start + ext->count, + (unsigned long long) ext->count); + goto err_out; + } + } + old = ext; + } + return; + +err_out: + fprintf(stderr, "%s\n", msg); + print_tree(root); + exit(1); +} +#else +#define check_tree(root, msg) do {} while (0) +#define print_tree(root) do {} while (0) +#endif + +static void rb_get_new_extent(struct bmap_rb_extent **ext, __u64 start, + __u64 count) +{ + struct bmap_rb_extent *new_ext; + int retval; + + retval = ext2fs_get_mem(sizeof (struct bmap_rb_extent), + &new_ext); + if (retval) + abort(); + + new_ext->start = start; + new_ext->count = count; + *ext = new_ext; +} + +inline +static void rb_free_extent(struct ext2fs_rb_private *bp, + struct bmap_rb_extent *ext) +{ + if (bp->wcursor == ext) + bp->wcursor = NULL; + if (bp->rcursor == ext) + bp->rcursor = NULL; + if (bp->rcursor_next == ext) + bp->rcursor_next = NULL; + ext2fs_free_mem(&ext); +} + +static errcode_t rb_alloc_private_data (ext2fs_generic_bitmap_64 bitmap) +{ + struct ext2fs_rb_private *bp; + errcode_t retval; + + retval = ext2fs_get_mem(sizeof (struct ext2fs_rb_private), &bp); + if (retval) + return retval; + + bp->root = RB_ROOT; + bp->rcursor = NULL; + bp->rcursor_next = NULL; + bp->wcursor = NULL; + +#ifdef ENABLE_BMAP_STATS_OPS + bp->test_hit = 0; + bp->mark_hit = 0; +#endif + + bitmap->private = (void *) bp; + return 0; +} + +static errcode_t rb_new_bmap(ext2_filsys fs EXT2FS_ATTR((unused)), + ext2fs_generic_bitmap_64 bitmap) +{ + errcode_t retval; + + retval = rb_alloc_private_data (bitmap); + if (retval) + return retval; + + return 0; +} + +static void rb_free_tree(struct rb_root *root) +{ + struct bmap_rb_extent *ext; + struct rb_node *node, *next; + + for (node = ext2fs_rb_first(root); node; node = next) { + next = ext2fs_rb_next(node); + ext = node_to_extent(node); + ext2fs_rb_erase(node, root); + ext2fs_free_mem(&ext); + } +} + +static void rb_free_bmap(ext2fs_generic_bitmap_64 bitmap) +{ + struct ext2fs_rb_private *bp; + + bp = (struct ext2fs_rb_private *) bitmap->private; + + rb_free_tree(&bp->root); + ext2fs_free_mem(&bp); + bp = 0; +} + +static errcode_t rb_copy_bmap(ext2fs_generic_bitmap_64 src, + ext2fs_generic_bitmap_64 dest) +{ + struct ext2fs_rb_private *src_bp, *dest_bp; + struct bmap_rb_extent *src_ext, *dest_ext; + struct rb_node *dest_node, *src_node, *dest_last, **n; + errcode_t retval = 0; + + retval = rb_alloc_private_data (dest); + if (retval) + return retval; + + src_bp = (struct ext2fs_rb_private *) src->private; + dest_bp = (struct ext2fs_rb_private *) dest->private; + src_bp->rcursor = NULL; + dest_bp->rcursor = NULL; + + src_node = ext2fs_rb_first(&src_bp->root); + while (src_node) { + src_ext = node_to_extent(src_node); + retval = ext2fs_get_mem(sizeof (struct bmap_rb_extent), + &dest_ext); + if (retval) + break; + + memcpy(dest_ext, src_ext, sizeof(struct bmap_rb_extent)); + + dest_node = &dest_ext->node; + n = &dest_bp->root.rb_node; + + dest_last = NULL; + if (*n) { + dest_last = ext2fs_rb_last(&dest_bp->root); + n = &(dest_last)->rb_right; + } + + ext2fs_rb_link_node(dest_node, dest_last, n); + ext2fs_rb_insert_color(dest_node, &dest_bp->root); + + src_node = ext2fs_rb_next(src_node); + } + + return retval; +} + +static void rb_truncate(__u64 new_max, struct rb_root *root) +{ + struct bmap_rb_extent *ext; + struct rb_node *node; + + node = ext2fs_rb_last(root); + while (node) { + ext = node_to_extent(node); + + if ((ext->start + ext->count - 1) <= new_max) + break; + else if (ext->start > new_max) { + ext2fs_rb_erase(node, root); + ext2fs_free_mem(&ext); + node = ext2fs_rb_last(root); + continue; + } else + ext->count = new_max - ext->start + 1; + } +} + +static errcode_t rb_resize_bmap(ext2fs_generic_bitmap_64 bmap, + __u64 new_end, __u64 new_real_end) +{ + struct ext2fs_rb_private *bp; + + bp = (struct ext2fs_rb_private *) bmap->private; + bp->rcursor = NULL; + bp->wcursor = NULL; + + rb_truncate(((new_end < bmap->end) ? new_end : bmap->end) - bmap->start, + &bp->root); + + bmap->end = new_end; + bmap->real_end = new_real_end; + + if (bmap->end < bmap->real_end) + rb_insert_extent(bmap->end + 1 - bmap->start, + bmap->real_end - bmap->end, bp); + return 0; + +} + +inline static int +rb_test_bit(struct ext2fs_rb_private *bp, __u64 bit) +{ + struct bmap_rb_extent *rcursor, *next_ext = NULL; + struct rb_node *parent = NULL, *next; + struct rb_node **n = &bp->root.rb_node; + struct bmap_rb_extent *ext; + + rcursor = bp->rcursor; + if (!rcursor) + goto search_tree; + + if (bit >= rcursor->start && bit < rcursor->start + rcursor->count) { +#ifdef ENABLE_BMAP_STATS_OPS + bp->test_hit++; +#endif + return 1; + } + + next_ext = bp->rcursor_next; + if (!next_ext) { + next = ext2fs_rb_next(&rcursor->node); + if (next) + next_ext = node_to_extent(next); + bp->rcursor_next = next_ext; + } + if (next_ext) { + if ((bit >= rcursor->start + rcursor->count) && + (bit < next_ext->start)) { +#ifdef BMAP_STATS_OPS + bp->test_hit++; +#endif + return 0; + } + } + bp->rcursor = NULL; + bp->rcursor_next = NULL; + + rcursor = bp->wcursor; + if (!rcursor) + goto search_tree; + + if (bit >= rcursor->start && bit < rcursor->start + rcursor->count) + return 1; + +search_tree: + + while (*n) { + parent = *n; + ext = node_to_extent(parent); + if (bit < ext->start) + n = &(*n)->rb_left; + else if (bit >= (ext->start + ext->count)) + n = &(*n)->rb_right; + else { + bp->rcursor = ext; + bp->rcursor_next = NULL; + return 1; + } + } + return 0; +} + +static int rb_insert_extent(__u64 start, __u64 count, + struct ext2fs_rb_private *bp) +{ + struct rb_root *root = &bp->root; + struct rb_node *parent = NULL, **n = &root->rb_node; + struct rb_node *new_node, *node, *next; + struct bmap_rb_extent *new_ext; + struct bmap_rb_extent *ext; + int retval = 0; + + if (count == 0) + return 0; + + bp->rcursor_next = NULL; + ext = bp->wcursor; + if (ext) { + if (start >= ext->start && + start <= (ext->start + ext->count)) { +#ifdef ENABLE_BMAP_STATS_OPS + bp->mark_hit++; +#endif + goto got_extent; + } + } + + while (*n) { + parent = *n; + ext = node_to_extent(parent); + + if (start < ext->start) { + n = &(*n)->rb_left; + } else if (start > (ext->start + ext->count)) { + n = &(*n)->rb_right; + } else { +got_extent: + if ((start + count) <= (ext->start + ext->count)) + return 1; + + if ((ext->start + ext->count) == start) + retval = 0; + else + retval = 1; + + count += (start - ext->start); + start = ext->start; + new_ext = ext; + new_node = &ext->node; + + goto skip_insert; + } + } + + rb_get_new_extent(&new_ext, start, count); + + new_node = &new_ext->node; + ext2fs_rb_link_node(new_node, parent, n); + ext2fs_rb_insert_color(new_node, root); + bp->wcursor = new_ext; + + node = ext2fs_rb_prev(new_node); + if (node) { + ext = node_to_extent(node); + if ((ext->start + ext->count) == start) { + start = ext->start; + count += ext->count; + ext2fs_rb_erase(node, root); + rb_free_extent(bp, ext); + } + } + +skip_insert: + /* See if we can merge extent to the right */ + for (node = ext2fs_rb_next(new_node); node != NULL; node = next) { + next = ext2fs_rb_next(node); + ext = node_to_extent(node); + + if ((ext->start + ext->count) <= start) + continue; + + /* No more merging */ + if ((start + count) < ext->start) + break; + + /* ext is embedded in new_ext interval */ + if ((start + count) >= (ext->start + ext->count)) { + ext2fs_rb_erase(node, root); + rb_free_extent(bp, ext); + continue; + } else { + /* merge ext with new_ext */ + count += ((ext->start + ext->count) - + (start + count)); + ext2fs_rb_erase(node, root); + rb_free_extent(bp, ext); + break; + } + } + + new_ext->start = start; + new_ext->count = count; + + return retval; +} + +static int rb_remove_extent(__u64 start, __u64 count, + struct ext2fs_rb_private *bp) +{ + struct rb_root *root = &bp->root; + struct rb_node *parent = NULL, **n = &root->rb_node; + struct rb_node *node; + struct bmap_rb_extent *ext; + __u64 new_start, new_count; + int retval = 0; + + if (ext2fs_rb_empty_root(root)) + return 0; + + while (*n) { + parent = *n; + ext = node_to_extent(parent); + if (start < ext->start) { + n = &(*n)->rb_left; + continue; + } else if (start >= (ext->start + ext->count)) { + n = &(*n)->rb_right; + continue; + } + + if ((start > ext->start) && + (start + count) < (ext->start + ext->count)) { + /* We have to split extent into two */ + new_start = start + count; + new_count = (ext->start + ext->count) - new_start; + + ext->count = start - ext->start; + + rb_insert_extent(new_start, new_count, bp); + return 1; + } + + if ((start + count) >= (ext->start + ext->count)) { + ext->count = start - ext->start; + retval = 1; + } + + if (0 == ext->count) { + parent = ext2fs_rb_next(&ext->node); + ext2fs_rb_erase(&ext->node, root); + rb_free_extent(bp, ext); + break; + } + + if (start == ext->start) { + ext->start += count; + ext->count -= count; + return 1; + } + } + + /* See if we should delete or truncate extent on the right */ + for (; parent != NULL; parent = node) { + node = ext2fs_rb_next(parent); + ext = node_to_extent(parent); + if ((ext->start + ext->count) <= start) + continue; + + /* No more extents to be removed/truncated */ + if ((start + count) < ext->start) + break; + + /* The entire extent is within the region to be removed */ + if ((start + count) >= (ext->start + ext->count)) { + ext2fs_rb_erase(parent, root); + rb_free_extent(bp, ext); + retval = 1; + continue; + } else { + /* modify the last extent in region to be removed */ + ext->count -= ((start + count) - ext->start); + ext->start = start + count; + retval = 1; + break; + } + } + + return retval; +} + +static int rb_mark_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg) +{ + struct ext2fs_rb_private *bp; + int retval; + + bp = (struct ext2fs_rb_private *) bitmap->private; + arg -= bitmap->start; + + retval = rb_insert_extent(arg, 1, bp); + check_tree(&bp->root, __func__); + return retval; +} + +static int rb_unmark_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg) +{ + struct ext2fs_rb_private *bp; + int retval; + + bp = (struct ext2fs_rb_private *) bitmap->private; + arg -= bitmap->start; + + retval = rb_remove_extent(arg, 1, bp); + check_tree(&bp->root, __func__); + + return retval; +} + +inline +static int rb_test_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg) +{ + struct ext2fs_rb_private *bp; + + bp = (struct ext2fs_rb_private *) bitmap->private; + arg -= bitmap->start; + + return rb_test_bit(bp, arg); +} + +static void rb_mark_bmap_extent(ext2fs_generic_bitmap_64 bitmap, __u64 arg, + unsigned int num) +{ + struct ext2fs_rb_private *bp; + + bp = (struct ext2fs_rb_private *) bitmap->private; + arg -= bitmap->start; + + rb_insert_extent(arg, num, bp); + check_tree(&bp->root, __func__); +} + +static void rb_unmark_bmap_extent(ext2fs_generic_bitmap_64 bitmap, __u64 arg, + unsigned int num) +{ + struct ext2fs_rb_private *bp; + + bp = (struct ext2fs_rb_private *) bitmap->private; + arg -= bitmap->start; + + rb_remove_extent(arg, num, bp); + check_tree(&bp->root, __func__); +} + +static int rb_test_clear_bmap_extent(ext2fs_generic_bitmap_64 bitmap, + __u64 start, unsigned int len) +{ + struct rb_node *parent = NULL, **n; + struct rb_node *node, *next; + struct ext2fs_rb_private *bp; + struct bmap_rb_extent *ext; + int retval = 1; + + bp = (struct ext2fs_rb_private *) bitmap->private; + n = &bp->root.rb_node; + start -= bitmap->start; + + if (len == 0 || ext2fs_rb_empty_root(&bp->root)) + return 1; + + /* + * If we find nothing, we should examine whole extent, but + * when we find match, the extent is not clean, thus be return + * false. + */ + while (*n) { + parent = *n; + ext = node_to_extent(parent); + if (start < ext->start) { + n = &(*n)->rb_left; + } else if (start >= (ext->start + ext->count)) { + n = &(*n)->rb_right; + } else { + /* + * We found extent int the tree -> extent is not + * clean + */ + return 0; + } + } + + node = parent; + while (node) { + next = ext2fs_rb_next(node); + ext = node_to_extent(node); + node = next; + + if ((ext->start + ext->count) <= start) + continue; + + /* No more merging */ + if ((start + len) <= ext->start) + break; + + retval = 0; + break; + } + return retval; +} + +static errcode_t rb_set_bmap_range(ext2fs_generic_bitmap_64 bitmap, + __u64 start, size_t num, void *in) +{ + struct ext2fs_rb_private *bp; + unsigned char *cp = in; + size_t i; + int first_set = -1; + + bp = (struct ext2fs_rb_private *) bitmap->private; + + for (i = 0; i < num; i++) { + if ((i & 7) == 0) { + unsigned char c = cp[i/8]; + if (c == 0xFF) { + if (first_set == -1) + first_set = i; + i += 7; + continue; + } + if ((c == 0x00) && (first_set == -1)) { + i += 7; + continue; + } + } + if (ext2fs_test_bit(i, in)) { + if (first_set == -1) + first_set = i; + continue; + } + if (first_set == -1) + continue; + + rb_insert_extent(start + first_set - bitmap->start, + i - first_set, bp); + check_tree(&bp->root, __func__); + first_set = -1; + } + if (first_set != -1) { + rb_insert_extent(start + first_set - bitmap->start, + num - first_set, bp); + check_tree(&bp->root, __func__); + } + + return 0; +} + +static errcode_t rb_get_bmap_range(ext2fs_generic_bitmap_64 bitmap, + __u64 start, size_t num, void *out) +{ + + struct rb_node *parent = NULL, *next, **n; + struct ext2fs_rb_private *bp; + struct bmap_rb_extent *ext; + __u64 count, pos; + + bp = (struct ext2fs_rb_private *) bitmap->private; + n = &bp->root.rb_node; + start -= bitmap->start; + + if (ext2fs_rb_empty_root(&bp->root)) + return 0; + + while (*n) { + parent = *n; + ext = node_to_extent(parent); + if (start < ext->start) { + n = &(*n)->rb_left; + } else if (start >= (ext->start + ext->count)) { + n = &(*n)->rb_right; + } else + break; + } + + memset(out, 0, (num + 7) >> 3); + + for (; parent != NULL; parent = next) { + next = ext2fs_rb_next(parent); + ext = node_to_extent(parent); + + pos = ext->start; + count = ext->count; + if (pos >= start + num) + break; + if (pos < start) { + if (pos + count < start) + continue; + count -= start - pos; + pos = start; + } + if (pos + count > start + num) + count = start + num - pos; + + while (count > 0) { + if ((count >= 8) && + ((pos - start) % 8) == 0) { + int nbytes = count >> 3; + int offset = (pos - start) >> 3; + + memset(((char *) out) + offset, 0xFF, nbytes); + pos += nbytes << 3; + count -= nbytes << 3; + continue; + } + ext2fs_fast_set_bit64((pos - start), out); + pos++; + count--; + } + } + return 0; +} + +static void rb_clear_bmap(ext2fs_generic_bitmap_64 bitmap) +{ + struct ext2fs_rb_private *bp; + + bp = (struct ext2fs_rb_private *) bitmap->private; + + rb_free_tree(&bp->root); + bp->rcursor = NULL; + bp->rcursor_next = NULL; + bp->wcursor = NULL; + check_tree(&bp->root, __func__); +} + +static errcode_t rb_find_first_zero(ext2fs_generic_bitmap_64 bitmap, + __u64 start, __u64 end, __u64 *out) +{ + struct rb_node *parent = NULL, **n; + struct ext2fs_rb_private *bp; + struct bmap_rb_extent *ext; + + bp = (struct ext2fs_rb_private *) bitmap->private; + n = &bp->root.rb_node; + start -= bitmap->start; + end -= bitmap->start; + + if (start > end) + return EINVAL; + + if (ext2fs_rb_empty_root(&bp->root)) + return ENOENT; + + while (*n) { + parent = *n; + ext = node_to_extent(parent); + if (start < ext->start) { + n = &(*n)->rb_left; + } else if (start >= (ext->start + ext->count)) { + n = &(*n)->rb_right; + } else if (ext->start + ext->count <= end) { + *out = ext->start + ext->count + bitmap->start; + return 0; + } else + return ENOENT; + } + + *out = start + bitmap->start; + return 0; +} + +static errcode_t rb_find_first_set(ext2fs_generic_bitmap_64 bitmap, + __u64 start, __u64 end, __u64 *out) +{ + struct rb_node *parent = NULL, **n; + struct rb_node *node; + struct ext2fs_rb_private *bp; + struct bmap_rb_extent *ext; + + bp = (struct ext2fs_rb_private *) bitmap->private; + n = &bp->root.rb_node; + start -= bitmap->start; + end -= bitmap->start; + + if (start > end) + return EINVAL; + + if (ext2fs_rb_empty_root(&bp->root)) + return ENOENT; + + while (*n) { + parent = *n; + ext = node_to_extent(parent); + if (start < ext->start) { + n = &(*n)->rb_left; + } else if (start >= (ext->start + ext->count)) { + n = &(*n)->rb_right; + } else { + /* The start bit is set */ + *out = start + bitmap->start; + return 0; + } + } + + node = parent; + ext = node_to_extent(node); + if (ext->start < start) { + node = ext2fs_rb_next(node); + if (node == NULL) + return ENOENT; + ext = node_to_extent(node); + } + if (ext->start <= end) { + *out = ext->start + bitmap->start; + return 0; + } + return ENOENT; +} + +#ifdef ENABLE_BMAP_STATS +static void rb_print_stats(ext2fs_generic_bitmap_64 bitmap) +{ + struct ext2fs_rb_private *bp; + struct rb_node *node = NULL; + struct bmap_rb_extent *ext; + __u64 count = 0; + __u64 max_size = 0; + __u64 min_size = ULONG_MAX; + __u64 size = 0, avg_size = 0; + double eff; +#ifdef ENABLE_BMAP_STATS_OPS + __u64 mark_all, test_all; + double m_hit = 0.0, t_hit = 0.0; +#endif + + bp = (struct ext2fs_rb_private *) bitmap->private; + + for (node = ext2fs_rb_first(&bp->root); node != NULL; + node = ext2fs_rb_next(node)) { + ext = node_to_extent(node); + count++; + if (ext->count > max_size) + max_size = ext->count; + if (ext->count < min_size) + min_size = ext->count; + size += ext->count; + } + + if (count) + avg_size = size / count; + if (min_size == ULONG_MAX) + min_size = 0; + eff = (double)((count * sizeof(struct bmap_rb_extent)) << 3) / + (bitmap->real_end - bitmap->start); +#ifdef ENABLE_BMAP_STATS_OPS + mark_all = bitmap->stats.mark_count + bitmap->stats.mark_ext_count; + test_all = bitmap->stats.test_count + bitmap->stats.test_ext_count; + if (mark_all) + m_hit = ((double)bp->mark_hit / mark_all) * 100; + if (test_all) + t_hit = ((double)bp->test_hit / test_all) * 100; + + fprintf(stderr, "%16llu cache hits on test (%.2f%%)\n" + "%16llu cache hits on mark (%.2f%%)\n", + bp->test_hit, t_hit, bp->mark_hit, m_hit); +#endif + fprintf(stderr, "%16llu extents (%llu bytes)\n", + (unsigned long long) count, (unsigned long long) + ((count * sizeof(struct bmap_rb_extent)) + + sizeof(struct ext2fs_rb_private))); + fprintf(stderr, "%16llu bits minimum size\n", + (unsigned long long) min_size); + fprintf(stderr, "%16llu bits maximum size\n" + "%16llu bits average size\n", + (unsigned long long) max_size, (unsigned long long) avg_size); + fprintf(stderr, "%16llu bits set in bitmap (out of %llu)\n", + (unsigned long long) size, + (unsigned long long) bitmap->real_end - bitmap->start); + fprintf(stderr, + "%16.4lf memory / bitmap bit memory ratio (bitarray = 1)\n", + eff); +} +#else +static void rb_print_stats(ext2fs_generic_bitmap_64 bitmap EXT2FS_ATTR((unused))) +{ +} +#endif + +struct ext2_bitmap_ops ext2fs_blkmap64_rbtree = { + .type = EXT2FS_BMAP64_RBTREE, + .new_bmap = rb_new_bmap, + .free_bmap = rb_free_bmap, + .copy_bmap = rb_copy_bmap, + .resize_bmap = rb_resize_bmap, + .mark_bmap = rb_mark_bmap, + .unmark_bmap = rb_unmark_bmap, + .test_bmap = rb_test_bmap, + .test_clear_bmap_extent = rb_test_clear_bmap_extent, + .mark_bmap_extent = rb_mark_bmap_extent, + .unmark_bmap_extent = rb_unmark_bmap_extent, + .set_bmap_range = rb_set_bmap_range, + .get_bmap_range = rb_get_bmap_range, + .clear_bmap = rb_clear_bmap, + .print_stats = rb_print_stats, + .find_first_zero = rb_find_first_zero, + .find_first_set = rb_find_first_set, +}; diff --git a/lib/ext2fs/blknum.c b/lib/ext2fs/blknum.c new file mode 100644 index 0000000..04839d8 --- /dev/null +++ b/lib/ext2fs/blknum.c @@ -0,0 +1,606 @@ +/* + * blknum.c --- Functions to handle blk64_t and high/low 64-bit block + * number. + * + * Copyright IBM Corporation, 2007 + * Author Jose R. Santos <jrs@us.ibm.com> + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Public + * License. + * %End-Header% + */ + +#include "config.h" +#include "ext2fs.h" + +/* + * Return the group # of a block + */ +dgrp_t ext2fs_group_of_blk2(ext2_filsys fs, blk64_t blk) +{ + return (blk - fs->super->s_first_data_block) / + fs->super->s_blocks_per_group; +} + +/* + * Return the first block (inclusive) in a group + */ +blk64_t ext2fs_group_first_block2(ext2_filsys fs, dgrp_t group) +{ + return fs->super->s_first_data_block + + EXT2_GROUPS_TO_BLOCKS(fs->super, group); +} + +/* + * Return the last block (inclusive) in a group + */ +blk64_t ext2fs_group_last_block2(ext2_filsys fs, dgrp_t group) +{ + return (group == fs->group_desc_count - 1 ? + ext2fs_blocks_count(fs->super) - 1 : + ext2fs_group_first_block2(fs, group) + + (fs->super->s_blocks_per_group - 1)); +} + +/* + * Return the number of blocks in a group + */ +int ext2fs_group_blocks_count(ext2_filsys fs, dgrp_t group) +{ + int num_blocks; + + if (group == fs->group_desc_count - 1) { + num_blocks = (ext2fs_blocks_count(fs->super) - + fs->super->s_first_data_block) % + fs->super->s_blocks_per_group; + if (!num_blocks) + num_blocks = fs->super->s_blocks_per_group; + } else + num_blocks = fs->super->s_blocks_per_group; + + return num_blocks; +} + +/* + * Return the inode data block count + */ +blk64_t ext2fs_inode_data_blocks2(ext2_filsys fs, + struct ext2_inode *inode) +{ + return (inode->i_blocks | + (ext2fs_has_feature_huge_file(fs->super) ? + (__u64) inode->osd2.linux2.l_i_blocks_hi << 32 : 0)) - + (inode->i_file_acl ? EXT2_CLUSTER_SIZE(fs->super) >> 9 : 0); +} + +/* + * Return the inode i_blocks count + */ +blk64_t ext2fs_inode_i_blocks(ext2_filsys fs, + struct ext2_inode *inode) +{ + return (inode->i_blocks | + (ext2fs_has_feature_huge_file(fs->super) ? + (__u64)inode->osd2.linux2.l_i_blocks_hi << 32 : 0)); +} + +/* + * Return the inode i_blocks in stat (512 byte) units + */ +blk64_t ext2fs_get_stat_i_blocks(ext2_filsys fs, + struct ext2_inode *inode) +{ + blk64_t ret = inode->i_blocks; + + if (ext2fs_has_feature_huge_file(fs->super)) { + ret += ((long long) inode->osd2.linux2.l_i_blocks_hi) << 32; + if (inode->i_flags & EXT4_HUGE_FILE_FL) + ret *= (fs->blocksize / 512); + } + return ret; +} + +/* + * Return the fs block count + */ +blk64_t ext2fs_blocks_count(struct ext2_super_block *super) +{ + return super->s_blocks_count | + (ext2fs_has_feature_64bit(super) ? + (__u64) super->s_blocks_count_hi << 32 : 0); +} + +/* + * Set the fs block count + */ +void ext2fs_blocks_count_set(struct ext2_super_block *super, blk64_t blk) +{ + super->s_blocks_count = blk; + if (ext2fs_has_feature_64bit(super)) + super->s_blocks_count_hi = (__u64) blk >> 32; +} + +/* + * Add to the current fs block count + */ +void ext2fs_blocks_count_add(struct ext2_super_block *super, blk64_t blk) +{ + blk64_t tmp; + tmp = ext2fs_blocks_count(super) + blk; + ext2fs_blocks_count_set(super, tmp); +} + +/* + * Return the fs reserved block count + */ +blk64_t ext2fs_r_blocks_count(struct ext2_super_block *super) +{ + return super->s_r_blocks_count | + (ext2fs_has_feature_64bit(super) ? + (__u64) super->s_r_blocks_count_hi << 32 : 0); +} + +/* + * Set the fs reserved block count + */ +void ext2fs_r_blocks_count_set(struct ext2_super_block *super, blk64_t blk) +{ + super->s_r_blocks_count = blk; + if (ext2fs_has_feature_64bit(super)) + super->s_r_blocks_count_hi = (__u64) blk >> 32; +} + +/* + * Add to the current reserved fs block count + */ +void ext2fs_r_blocks_count_add(struct ext2_super_block *super, blk64_t blk) +{ + blk64_t tmp; + tmp = ext2fs_r_blocks_count(super) + blk; + ext2fs_r_blocks_count_set(super, tmp); +} + +/* + * Return the fs free block count + */ +blk64_t ext2fs_free_blocks_count(struct ext2_super_block *super) +{ + return super->s_free_blocks_count | + (ext2fs_has_feature_64bit(super) ? + (__u64) super->s_free_blocks_hi << 32 : 0); +} + +/* + * Set the fs free block count + */ +void ext2fs_free_blocks_count_set(struct ext2_super_block *super, blk64_t blk) +{ + super->s_free_blocks_count = blk; + if (ext2fs_has_feature_64bit(super)) + super->s_free_blocks_hi = (__u64) blk >> 32; +} + +/* + * Add to the current free fs block count + */ +void ext2fs_free_blocks_count_add(struct ext2_super_block *super, blk64_t blk) +{ + blk64_t tmp; + tmp = ext2fs_free_blocks_count(super) + blk; + ext2fs_free_blocks_count_set(super, tmp); +} + +/* + * Get a pointer to a block group descriptor. We need the explicit + * pointer to the group desc for code that swaps block group + * descriptors before writing them out, as it wants to make a copy and + * do the swap there. + */ +struct ext2_group_desc *ext2fs_group_desc(ext2_filsys fs, + struct opaque_ext2_group_desc *gdp, + dgrp_t group) +{ + struct ext2_group_desc *ret_gdp; + errcode_t retval; + static char *buf = 0; + static unsigned bufsize = 0; + blk64_t blk; + int desc_size = EXT2_DESC_SIZE(fs->super) & ~7; + int desc_per_blk = EXT2_DESC_PER_BLOCK(fs->super); + + if (group > fs->group_desc_count) + return NULL; + if (gdp) + return (struct ext2_group_desc *)((char *)gdp + + group * desc_size); + /* + * If fs->group_desc wasn't read in when the file system was + * opened, then read it on demand here. + */ + if (bufsize < fs->blocksize) + ext2fs_free_mem(&buf); + if (!buf) { + retval = ext2fs_get_mem(fs->blocksize, &buf); + if (retval) + return NULL; + bufsize = fs->blocksize; + } + blk = ext2fs_descriptor_block_loc2(fs, fs->super->s_first_data_block, + group / desc_per_blk); + retval = io_channel_read_blk(fs->io, blk, 1, buf); + if (retval) + return NULL; + ret_gdp = (struct ext2_group_desc *) + (buf + ((group % desc_per_blk) * desc_size)); +#ifdef WORDS_BIGENDIAN + ext2fs_swap_group_desc2(fs, ret_gdp); +#endif + return ret_gdp; +} + +/* Do the same but as an ext4 group desc for internal use here */ +static struct ext4_group_desc *ext4fs_group_desc(ext2_filsys fs, + struct opaque_ext2_group_desc *gdp, + dgrp_t group) +{ + return (struct ext4_group_desc *)ext2fs_group_desc(fs, gdp, group); +} + +/* + * Return the block bitmap checksum of a group + */ +__u32 ext2fs_block_bitmap_checksum(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + __u32 csum; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + csum = gdp->bg_block_bitmap_csum_lo; + if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_BLOCK_BITMAP_CSUM_HI_LOCATION) + csum |= ((__u32)gdp->bg_block_bitmap_csum_hi << 16); + return csum; +} + +/* + * Return the block bitmap block of a group + */ +blk64_t ext2fs_block_bitmap_loc(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + return gdp->bg_block_bitmap | + (ext2fs_has_feature_64bit(fs->super) ? + (__u64)gdp->bg_block_bitmap_hi << 32 : 0); +} + +/* + * Set the block bitmap block of a group + */ +void ext2fs_block_bitmap_loc_set(ext2_filsys fs, dgrp_t group, blk64_t blk) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_block_bitmap = blk; + if (ext2fs_has_feature_64bit(fs->super)) + gdp->bg_block_bitmap_hi = (__u64) blk >> 32; +} + +/* + * Return the inode bitmap checksum of a group + */ +__u32 ext2fs_inode_bitmap_checksum(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + __u32 csum; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + csum = gdp->bg_inode_bitmap_csum_lo; + if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_INODE_BITMAP_CSUM_HI_END) + csum |= ((__u32)gdp->bg_inode_bitmap_csum_hi << 16); + return csum; +} + +/* + * Return the inode bitmap block of a group + */ +blk64_t ext2fs_inode_bitmap_loc(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + return gdp->bg_inode_bitmap | + (ext2fs_has_feature_64bit(fs->super) ? + (__u64) gdp->bg_inode_bitmap_hi << 32 : 0); +} + +/* + * Set the inode bitmap block of a group + */ +void ext2fs_inode_bitmap_loc_set(ext2_filsys fs, dgrp_t group, blk64_t blk) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_inode_bitmap = blk; + if (ext2fs_has_feature_64bit(fs->super)) + gdp->bg_inode_bitmap_hi = (__u64) blk >> 32; +} + +/* + * Return the inode table block of a group + */ +blk64_t ext2fs_inode_table_loc(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + return gdp->bg_inode_table | + (ext2fs_has_feature_64bit(fs->super) ? + (__u64) gdp->bg_inode_table_hi << 32 : 0); +} + +/* + * Set the inode table block of a group + */ +void ext2fs_inode_table_loc_set(ext2_filsys fs, dgrp_t group, blk64_t blk) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_inode_table = blk; + if (ext2fs_has_feature_64bit(fs->super)) + gdp->bg_inode_table_hi = (__u64) blk >> 32; +} + +/* + * Return the free blocks count of a group + */ +__u32 ext2fs_bg_free_blocks_count(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + return gdp->bg_free_blocks_count | + (ext2fs_has_feature_64bit(fs->super) ? + (__u32) gdp->bg_free_blocks_count_hi << 16 : 0); +} + +/* + * Set the free blocks count of a group + */ +void ext2fs_bg_free_blocks_count_set(ext2_filsys fs, dgrp_t group, __u32 n) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_free_blocks_count = n; + + if (ext2fs_has_feature_64bit(fs->super)) + gdp->bg_free_blocks_count_hi = (__u32) n >> 16; +} + +/* + * Return the free inodes count of a group + */ +__u32 ext2fs_bg_free_inodes_count(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + return gdp->bg_free_inodes_count | + (ext2fs_has_feature_64bit(fs->super) ? + (__u32) gdp->bg_free_inodes_count_hi << 16 : 0); +} + +/* + * Set the free inodes count of a group + */ +void ext2fs_bg_free_inodes_count_set(ext2_filsys fs, dgrp_t group, __u32 n) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_free_inodes_count = n; + if (ext2fs_has_feature_64bit(fs->super)) + gdp->bg_free_inodes_count_hi = (__u32) n >> 16; +} + +/* + * Return the used dirs count of a group + */ +__u32 ext2fs_bg_used_dirs_count(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + return gdp->bg_used_dirs_count | + (ext2fs_has_feature_64bit(fs->super) ? + (__u32) gdp->bg_used_dirs_count_hi << 16 : 0); +} + +/* + * Set the used dirs count of a group + */ +void ext2fs_bg_used_dirs_count_set(ext2_filsys fs, dgrp_t group, __u32 n) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_used_dirs_count = n; + if (ext2fs_has_feature_64bit(fs->super)) + gdp->bg_used_dirs_count_hi = (__u32) n >> 16; +} + +/* + * Return the unused inodes count of a group + */ +__u32 ext2fs_bg_itable_unused(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + return gdp->bg_itable_unused | + (ext2fs_has_feature_64bit(fs->super) ? + (__u32) gdp->bg_itable_unused_hi << 16 : 0); +} + +/* + * Set the unused inodes count of a group + */ +void ext2fs_bg_itable_unused_set(ext2_filsys fs, dgrp_t group, __u32 n) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_itable_unused = n; + if (ext2fs_has_feature_64bit(fs->super)) + gdp->bg_itable_unused_hi = (__u32) n >> 16; +} + +/* + * Get the flags for this block group + */ +__u16 ext2fs_bg_flags(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + return gdp->bg_flags; +} + +/* + * Zero out the flags for this block group + */ +void ext2fs_bg_flags_zap(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_flags = 0; + return; +} + +/* + * Get the value of a particular flag for this block group + */ +int ext2fs_bg_flags_test(ext2_filsys fs, dgrp_t group, __u16 bg_flag) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + return gdp->bg_flags & bg_flag; +} + +/* + * Set a flag or set of flags for this block group + */ +void ext2fs_bg_flags_set(ext2_filsys fs, dgrp_t group, __u16 bg_flags) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_flags |= bg_flags; + return; +} + +/* + * Clear a flag or set of flags for this block group + */ +void ext2fs_bg_flags_clear(ext2_filsys fs, dgrp_t group, __u16 bg_flags) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_flags &= ~bg_flags; + return; +} + +/* + * Get the checksum for this block group + */ +__u16 ext2fs_bg_checksum(ext2_filsys fs, dgrp_t group) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + return gdp->bg_checksum; +} + +/* + * Set the checksum for this block group to a previously calculated value + */ +void ext2fs_bg_checksum_set(ext2_filsys fs, dgrp_t group, __u16 checksum) +{ + struct ext4_group_desc *gdp; + + gdp = ext4fs_group_desc(fs, fs->group_desc, group); + gdp->bg_checksum = checksum; + return; +} + +/* + * Get the acl block of a file + */ +blk64_t ext2fs_file_acl_block(ext2_filsys fs, const struct ext2_inode *inode) +{ + blk64_t blk = inode->i_file_acl; + + if (fs && ext2fs_has_feature_64bit(fs->super)) + blk |= ((__u64) inode->osd2.linux2.l_i_file_acl_high) << 32; + return blk; +} + +/* + * Set the acl block of a file + */ +void ext2fs_file_acl_block_set(ext2_filsys fs, struct ext2_inode *inode, + blk64_t blk) +{ + inode->i_file_acl = blk; + if (fs && ext2fs_has_feature_64bit(fs->super)) + inode->osd2.linux2.l_i_file_acl_high = (__u64) blk >> 32; +} + +/* + * Set the size of the inode + */ +errcode_t ext2fs_inode_size_set(ext2_filsys fs, struct ext2_inode *inode, + ext2_off64_t size) +{ + if (size < 0) + return EINVAL; + + /* If writing a large inode, set the large_file or large_dir flag */ + if (ext2fs_needs_large_file_feature(size)) { + int dirty_sb = 0; + + if (LINUX_S_ISREG(inode->i_mode)) { + if (!ext2fs_has_feature_large_file(fs->super)) { + ext2fs_set_feature_large_file(fs->super); + dirty_sb = 1; + } + } else if (LINUX_S_ISDIR(inode->i_mode)) { + if (!ext2fs_has_feature_largedir(fs->super)) { + ext2fs_set_feature_largedir(fs->super); + dirty_sb = 1; + } + } else { + /* Only regular files get to be larger than 4GB */ + return EXT2_ET_FILE_TOO_BIG; + } + if (dirty_sb) { + if (fs->super->s_rev_level == EXT2_GOOD_OLD_REV) + ext2fs_update_dynamic_rev(fs); + ext2fs_mark_super_dirty(fs); + } + } + + inode->i_size = size & 0xffffffff; + inode->i_size_high = (size >> 32); + + return 0; +} + diff --git a/lib/ext2fs/block.c b/lib/ext2fs/block.c new file mode 100644 index 0000000..06eed6e --- /dev/null +++ b/lib/ext2fs/block.c @@ -0,0 +1,659 @@ +/* + * block.c --- iterate over all blocks in an inode + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +struct block_context { + ext2_filsys fs; + int (*func)(ext2_filsys fs, + blk64_t *blocknr, + e2_blkcnt_t bcount, + blk64_t ref_blk, + int ref_offset, + void *priv_data); + e2_blkcnt_t bcount; + int bsize; + int flags; + errcode_t errcode; + char *ind_buf; + char *dind_buf; + char *tind_buf; + void *priv_data; +}; + +#define check_for_ro_violation_return(ctx, ret) \ + do { \ + if (((ctx)->flags & BLOCK_FLAG_READ_ONLY) && \ + ((ret) & BLOCK_CHANGED)) { \ + (ctx)->errcode = EXT2_ET_RO_BLOCK_ITERATE; \ + ret |= BLOCK_ABORT | BLOCK_ERROR; \ + return ret; \ + } \ + } while (0) + +#define check_for_ro_violation_goto(ctx, ret, label) \ + do { \ + if (((ctx)->flags & BLOCK_FLAG_READ_ONLY) && \ + ((ret) & BLOCK_CHANGED)) { \ + (ctx)->errcode = EXT2_ET_RO_BLOCK_ITERATE; \ + ret |= BLOCK_ABORT | BLOCK_ERROR; \ + goto label; \ + } \ + } while (0) + +static int block_iterate_ind(blk_t *ind_block, blk_t ref_block, + int ref_offset, struct block_context *ctx) +{ + int ret = 0, changed = 0; + int i, flags, limit, offset; + blk_t *block_nr; + blk64_t blk64; + + limit = ctx->fs->blocksize >> 2; + if (!(ctx->flags & BLOCK_FLAG_DEPTH_TRAVERSE) && + !(ctx->flags & BLOCK_FLAG_DATA_ONLY)) { + blk64 = *ind_block; + ret = (*ctx->func)(ctx->fs, &blk64, + BLOCK_COUNT_IND, ref_block, + ref_offset, ctx->priv_data); + *ind_block = blk64; + } + check_for_ro_violation_return(ctx, ret); + if (!*ind_block || (ret & BLOCK_ABORT)) { + ctx->bcount += limit; + return ret; + } + if (*ind_block >= ext2fs_blocks_count(ctx->fs->super) || + *ind_block < ctx->fs->super->s_first_data_block) { + ctx->errcode = EXT2_ET_BAD_IND_BLOCK; + ret |= BLOCK_ERROR; + return ret; + } + ctx->errcode = ext2fs_read_ind_block(ctx->fs, *ind_block, + ctx->ind_buf); + if (ctx->errcode) { + ret |= BLOCK_ERROR; + return ret; + } + + block_nr = (blk_t *) ctx->ind_buf; + offset = 0; + if (ctx->flags & BLOCK_FLAG_APPEND) { + for (i = 0; i < limit; i++, ctx->bcount++, block_nr++) { + blk64 = *block_nr; + flags = (*ctx->func)(ctx->fs, &blk64, ctx->bcount, + *ind_block, offset, + ctx->priv_data); + *block_nr = blk64; + changed |= flags; + if (flags & BLOCK_ABORT) { + ret |= BLOCK_ABORT; + break; + } + offset += sizeof(blk_t); + } + } else { + for (i = 0; i < limit; i++, ctx->bcount++, block_nr++) { + if (*block_nr == 0) + goto skip_sparse; + blk64 = *block_nr; + flags = (*ctx->func)(ctx->fs, &blk64, ctx->bcount, + *ind_block, offset, + ctx->priv_data); + *block_nr = blk64; + changed |= flags; + if (flags & BLOCK_ABORT) { + ret |= BLOCK_ABORT; + break; + } + skip_sparse: + offset += sizeof(blk_t); + } + } + check_for_ro_violation_return(ctx, changed); + if (changed & BLOCK_CHANGED) { + ctx->errcode = ext2fs_write_ind_block(ctx->fs, *ind_block, + ctx->ind_buf); + if (ctx->errcode) + ret |= BLOCK_ERROR | BLOCK_ABORT; + } + if ((ctx->flags & BLOCK_FLAG_DEPTH_TRAVERSE) && + !(ctx->flags & BLOCK_FLAG_DATA_ONLY) && + !(ret & BLOCK_ABORT)) { + blk64 = *ind_block; + ret |= (*ctx->func)(ctx->fs, &blk64, + BLOCK_COUNT_IND, ref_block, + ref_offset, ctx->priv_data); + *ind_block = blk64; + } + check_for_ro_violation_return(ctx, ret); + return ret; +} + +static int block_iterate_dind(blk_t *dind_block, blk_t ref_block, + int ref_offset, struct block_context *ctx) +{ + int ret = 0, changed = 0; + int i, flags, limit, offset; + blk_t *block_nr; + blk64_t blk64; + + limit = ctx->fs->blocksize >> 2; + if (!(ctx->flags & (BLOCK_FLAG_DEPTH_TRAVERSE | + BLOCK_FLAG_DATA_ONLY))) { + blk64 = *dind_block; + ret = (*ctx->func)(ctx->fs, &blk64, + BLOCK_COUNT_DIND, ref_block, + ref_offset, ctx->priv_data); + *dind_block = blk64; + } + check_for_ro_violation_return(ctx, ret); + if (!*dind_block || (ret & BLOCK_ABORT)) { + ctx->bcount += limit*limit; + return ret; + } + if (*dind_block >= ext2fs_blocks_count(ctx->fs->super) || + *dind_block < ctx->fs->super->s_first_data_block) { + ctx->errcode = EXT2_ET_BAD_DIND_BLOCK; + ret |= BLOCK_ERROR; + return ret; + } + ctx->errcode = ext2fs_read_ind_block(ctx->fs, *dind_block, + ctx->dind_buf); + if (ctx->errcode) { + ret |= BLOCK_ERROR; + return ret; + } + + block_nr = (blk_t *) ctx->dind_buf; + offset = 0; + if (ctx->flags & BLOCK_FLAG_APPEND) { + for (i = 0; i < limit; i++, block_nr++) { + flags = block_iterate_ind(block_nr, + *dind_block, offset, + ctx); + changed |= flags; + if (flags & (BLOCK_ABORT | BLOCK_ERROR)) { + ret |= flags & (BLOCK_ABORT | BLOCK_ERROR); + break; + } + offset += sizeof(blk_t); + } + } else { + for (i = 0; i < limit; i++, block_nr++) { + if (*block_nr == 0) { + ctx->bcount += limit; + continue; + } + flags = block_iterate_ind(block_nr, + *dind_block, offset, + ctx); + changed |= flags; + if (flags & (BLOCK_ABORT | BLOCK_ERROR)) { + ret |= flags & (BLOCK_ABORT | BLOCK_ERROR); + break; + } + offset += sizeof(blk_t); + } + } + check_for_ro_violation_return(ctx, changed); + if (changed & BLOCK_CHANGED) { + ctx->errcode = ext2fs_write_ind_block(ctx->fs, *dind_block, + ctx->dind_buf); + if (ctx->errcode) + ret |= BLOCK_ERROR | BLOCK_ABORT; + } + if ((ctx->flags & BLOCK_FLAG_DEPTH_TRAVERSE) && + !(ctx->flags & BLOCK_FLAG_DATA_ONLY) && + !(ret & BLOCK_ABORT)) { + blk64 = *dind_block; + ret |= (*ctx->func)(ctx->fs, &blk64, + BLOCK_COUNT_DIND, ref_block, + ref_offset, ctx->priv_data); + *dind_block = blk64; + } + check_for_ro_violation_return(ctx, ret); + return ret; +} + +static int block_iterate_tind(blk_t *tind_block, blk_t ref_block, + int ref_offset, struct block_context *ctx) +{ + int ret = 0, changed = 0; + int i, flags, limit, offset; + blk_t *block_nr; + blk64_t blk64; + + limit = ctx->fs->blocksize >> 2; + if (!(ctx->flags & (BLOCK_FLAG_DEPTH_TRAVERSE | + BLOCK_FLAG_DATA_ONLY))) { + blk64 = *tind_block; + ret = (*ctx->func)(ctx->fs, &blk64, + BLOCK_COUNT_TIND, ref_block, + ref_offset, ctx->priv_data); + *tind_block = blk64; + } + check_for_ro_violation_return(ctx, ret); + if (!*tind_block || (ret & BLOCK_ABORT)) { + ctx->bcount += ((unsigned long long) limit)*limit*limit; + return ret; + } + if (*tind_block >= ext2fs_blocks_count(ctx->fs->super) || + *tind_block < ctx->fs->super->s_first_data_block) { + ctx->errcode = EXT2_ET_BAD_TIND_BLOCK; + ret |= BLOCK_ERROR; + return ret; + } + ctx->errcode = ext2fs_read_ind_block(ctx->fs, *tind_block, + ctx->tind_buf); + if (ctx->errcode) { + ret |= BLOCK_ERROR; + return ret; + } + + block_nr = (blk_t *) ctx->tind_buf; + offset = 0; + if (ctx->flags & BLOCK_FLAG_APPEND) { + for (i = 0; i < limit; i++, block_nr++) { + flags = block_iterate_dind(block_nr, + *tind_block, + offset, ctx); + changed |= flags; + if (flags & (BLOCK_ABORT | BLOCK_ERROR)) { + ret |= flags & (BLOCK_ABORT | BLOCK_ERROR); + break; + } + offset += sizeof(blk_t); + } + } else { + for (i = 0; i < limit; i++, block_nr++) { + if (*block_nr == 0) { + ctx->bcount += limit*limit; + continue; + } + flags = block_iterate_dind(block_nr, + *tind_block, + offset, ctx); + changed |= flags; + if (flags & (BLOCK_ABORT | BLOCK_ERROR)) { + ret |= flags & (BLOCK_ABORT | BLOCK_ERROR); + break; + } + offset += sizeof(blk_t); + } + } + check_for_ro_violation_return(ctx, changed); + if (changed & BLOCK_CHANGED) { + ctx->errcode = ext2fs_write_ind_block(ctx->fs, *tind_block, + ctx->tind_buf); + if (ctx->errcode) + ret |= BLOCK_ERROR | BLOCK_ABORT; + } + if ((ctx->flags & BLOCK_FLAG_DEPTH_TRAVERSE) && + !(ctx->flags & BLOCK_FLAG_DATA_ONLY) && + !(ret & BLOCK_ABORT)) { + blk64 = *tind_block; + ret |= (*ctx->func)(ctx->fs, &blk64, + BLOCK_COUNT_TIND, ref_block, + ref_offset, ctx->priv_data); + *tind_block = blk64; + } + check_for_ro_violation_return(ctx, ret); + return ret; +} + +errcode_t ext2fs_block_iterate3(ext2_filsys fs, + ext2_ino_t ino, + int flags, + char *block_buf, + int (*func)(ext2_filsys fs, + blk64_t *blocknr, + e2_blkcnt_t blockcnt, + blk64_t ref_blk, + int ref_offset, + void *priv_data), + void *priv_data) +{ + int i; + int r, ret = 0; + struct ext2_inode inode; + errcode_t retval; + struct block_context ctx; + int limit; + blk64_t blk64; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + ctx.errcode = ext2fs_read_inode(fs, ino, &inode); + if (ctx.errcode) + return ctx.errcode; + + /* + * An inode with inline data has no blocks over which to + * iterate, so return an error code indicating this fact. + */ + if (inode.i_flags & EXT4_INLINE_DATA_FL) + return EXT2_ET_INLINE_DATA_CANT_ITERATE; + + /* + * Check to see if we need to limit large files + */ + if (flags & BLOCK_FLAG_NO_LARGE) { + if (!LINUX_S_ISDIR(inode.i_mode) && + (inode.i_size_high != 0)) + return EXT2_ET_FILE_TOO_BIG; + } + + limit = fs->blocksize >> 2; + + ctx.fs = fs; + ctx.func = func; + ctx.priv_data = priv_data; + ctx.flags = flags; + ctx.bcount = 0; + if (block_buf) { + ctx.ind_buf = block_buf; + } else { + retval = ext2fs_get_array(3, fs->blocksize, &ctx.ind_buf); + if (retval) + return retval; + } + ctx.dind_buf = ctx.ind_buf + fs->blocksize; + ctx.tind_buf = ctx.dind_buf + fs->blocksize; + + /* + * Iterate over the HURD translator block (if present) + */ + if ((fs->super->s_creator_os == EXT2_OS_HURD) && + !(flags & BLOCK_FLAG_DATA_ONLY)) { + if (inode.osd1.hurd1.h_i_translator) { + blk64 = inode.osd1.hurd1.h_i_translator; + ret |= (*ctx.func)(fs, &blk64, + BLOCK_COUNT_TRANSLATOR, + 0, 0, priv_data); + inode.osd1.hurd1.h_i_translator = (blk_t) blk64; + if (ret & BLOCK_ABORT) + goto abort_exit; + check_for_ro_violation_goto(&ctx, ret, abort_exit); + } + } + + if (inode.i_flags & EXT4_EXTENTS_FL) { + ext2_extent_handle_t handle; + struct ext2fs_extent extent, next; + e2_blkcnt_t blockcnt = 0; + blk64_t blk, new_blk; + int op = EXT2_EXTENT_ROOT; + int uninit; + unsigned int j; + + ctx.errcode = ext2fs_extent_open2(fs, ino, &inode, &handle); + if (ctx.errcode) + goto abort_exit; + + while (1) { + if (op == EXT2_EXTENT_CURRENT) + ctx.errcode = 0; + else + ctx.errcode = ext2fs_extent_get(handle, op, + &extent); + if (ctx.errcode) { + if (ctx.errcode != EXT2_ET_EXTENT_NO_NEXT) + break; + ctx.errcode = 0; + if (!(flags & BLOCK_FLAG_APPEND)) + break; + next_block_set: + blk = 0; + r = (*ctx.func)(fs, &blk, blockcnt, + 0, 0, priv_data); + ret |= r; + check_for_ro_violation_goto(&ctx, ret, + extent_done); + if (r & BLOCK_CHANGED) { + ctx.errcode = + ext2fs_extent_set_bmap(handle, + (blk64_t) blockcnt++, + (blk64_t) blk, 0); + if (ctx.errcode || (ret & BLOCK_ABORT)) + break; + if (blk) + goto next_block_set; + } + break; + } + + op = EXT2_EXTENT_NEXT; + blk = extent.e_pblk; + if (!(extent.e_flags & EXT2_EXTENT_FLAGS_LEAF)) { + if (ctx.flags & BLOCK_FLAG_DATA_ONLY) + continue; + if ((!(extent.e_flags & + EXT2_EXTENT_FLAGS_SECOND_VISIT) && + !(ctx.flags & BLOCK_FLAG_DEPTH_TRAVERSE)) || + ((extent.e_flags & + EXT2_EXTENT_FLAGS_SECOND_VISIT) && + (ctx.flags & BLOCK_FLAG_DEPTH_TRAVERSE))) { + ret |= (*ctx.func)(fs, &blk, + -1, 0, 0, priv_data); + if (ret & BLOCK_CHANGED) { + extent.e_pblk = blk; + ctx.errcode = + ext2fs_extent_replace(handle, 0, &extent); + if (ctx.errcode) + break; + } + if (ret & BLOCK_ABORT) + break; + } + continue; + } + uninit = 0; + if (extent.e_flags & EXT2_EXTENT_FLAGS_UNINIT) + uninit = EXT2_EXTENT_SET_BMAP_UNINIT; + + /* + * Get the next extent before we start messing + * with the current extent + */ + retval = ext2fs_extent_get(handle, op, &next); + +#if 0 + printf("lblk %llu pblk %llu len %d blockcnt %llu\n", + extent.e_lblk, extent.e_pblk, + extent.e_len, blockcnt); +#endif + if (extent.e_lblk + extent.e_len <= (blk64_t) blockcnt) + continue; + if (extent.e_lblk > (blk64_t) blockcnt) + blockcnt = extent.e_lblk; + j = blockcnt - extent.e_lblk; + blk += j; + for (blockcnt = extent.e_lblk, j = 0; + j < extent.e_len; + blk++, blockcnt++, j++) { + new_blk = blk; + r = (*ctx.func)(fs, &new_blk, blockcnt, + 0, 0, priv_data); + ret |= r; + check_for_ro_violation_goto(&ctx, ret, + extent_done); + if (r & BLOCK_CHANGED) { + ctx.errcode = + ext2fs_extent_set_bmap(handle, + (blk64_t) blockcnt, + new_blk, uninit); + if (ctx.errcode) + goto extent_done; + } + if (ret & BLOCK_ABORT) + goto extent_done; + } + if (retval == 0) { + extent = next; + op = EXT2_EXTENT_CURRENT; + } + } + + extent_done: + ext2fs_extent_free(handle); + ret |= BLOCK_ERROR; /* ctx.errcode is always valid here */ + goto errout; + } + + /* + * Iterate over normal data blocks + */ + for (i = 0; i < EXT2_NDIR_BLOCKS ; i++, ctx.bcount++) { + if (inode.i_block[i] || (flags & BLOCK_FLAG_APPEND)) { + blk64 = inode.i_block[i]; + ret |= (*ctx.func)(fs, &blk64, ctx.bcount, 0, i, + priv_data); + inode.i_block[i] = (blk_t) blk64; + if (ret & BLOCK_ABORT) + goto abort_exit; + } + } + check_for_ro_violation_goto(&ctx, ret, abort_exit); + if (inode.i_block[EXT2_IND_BLOCK] || (flags & BLOCK_FLAG_APPEND)) { + ret |= block_iterate_ind(&inode.i_block[EXT2_IND_BLOCK], + 0, EXT2_IND_BLOCK, &ctx); + if (ret & BLOCK_ABORT) + goto abort_exit; + } else + ctx.bcount += limit; + if (inode.i_block[EXT2_DIND_BLOCK] || (flags & BLOCK_FLAG_APPEND)) { + ret |= block_iterate_dind(&inode.i_block[EXT2_DIND_BLOCK], + 0, EXT2_DIND_BLOCK, &ctx); + if (ret & BLOCK_ABORT) + goto abort_exit; + } else + ctx.bcount += limit * limit; + if (inode.i_block[EXT2_TIND_BLOCK] || (flags & BLOCK_FLAG_APPEND)) { + ret |= block_iterate_tind(&inode.i_block[EXT2_TIND_BLOCK], + 0, EXT2_TIND_BLOCK, &ctx); + if (ret & BLOCK_ABORT) + goto abort_exit; + } + +abort_exit: + if (ret & BLOCK_CHANGED) { + retval = ext2fs_write_inode(fs, ino, &inode); + if (retval) { + ret |= BLOCK_ERROR; + ctx.errcode = retval; + } + } +errout: + if (!block_buf) + ext2fs_free_mem(&ctx.ind_buf); + + return (ret & BLOCK_ERROR) ? ctx.errcode : 0; +} + +/* + * Emulate the old ext2fs_block_iterate function! + */ + +struct xlate64 { + int (*func)(ext2_filsys fs, + blk_t *blocknr, + e2_blkcnt_t blockcnt, + blk_t ref_blk, + int ref_offset, + void *priv_data); + void *real_private; +}; + +static int xlate64_func(ext2_filsys fs, blk64_t *blocknr, + e2_blkcnt_t blockcnt, blk64_t ref_blk, + int ref_offset, void *priv_data) +{ + struct xlate64 *xl = (struct xlate64 *) priv_data; + int ret; + blk_t block32 = *blocknr; + + ret = (*xl->func)(fs, &block32, blockcnt, (blk_t) ref_blk, ref_offset, + xl->real_private); + *blocknr = block32; + return ret; +} + +errcode_t ext2fs_block_iterate2(ext2_filsys fs, + ext2_ino_t ino, + int flags, + char *block_buf, + int (*func)(ext2_filsys fs, + blk_t *blocknr, + e2_blkcnt_t blockcnt, + blk_t ref_blk, + int ref_offset, + void *priv_data), + void *priv_data) +{ + struct xlate64 xl; + + xl.real_private = priv_data; + xl.func = func; + + return ext2fs_block_iterate3(fs, ino, flags, block_buf, + xlate64_func, &xl); +} + + +struct xlate { + int (*func)(ext2_filsys fs, + blk_t *blocknr, + int bcount, + void *priv_data); + void *real_private; +}; + +#ifdef __TURBOC__ + #pragma argsused +#endif +static int xlate_func(ext2_filsys fs, blk_t *blocknr, e2_blkcnt_t blockcnt, + blk_t ref_block EXT2FS_ATTR((unused)), + int ref_offset EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct xlate *xl = (struct xlate *) priv_data; + + return (*xl->func)(fs, blocknr, (int) blockcnt, xl->real_private); +} + +errcode_t ext2fs_block_iterate(ext2_filsys fs, + ext2_ino_t ino, + int flags, + char *block_buf, + int (*func)(ext2_filsys fs, + blk_t *blocknr, + int blockcnt, + void *priv_data), + void *priv_data) +{ + struct xlate xl; + + xl.real_private = priv_data; + xl.func = func; + + return ext2fs_block_iterate2(fs, ino, BLOCK_FLAG_NO_LARGE | flags, + block_buf, xlate_func, &xl); +} + diff --git a/lib/ext2fs/bmap.c b/lib/ext2fs/bmap.c new file mode 100644 index 0000000..65c45c5 --- /dev/null +++ b/lib/ext2fs/bmap.c @@ -0,0 +1,499 @@ +/* + * bmap.c --- logical to physical block mapping + * + * Copyright (C) 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <errno.h> + +#include "ext2_fs.h" +#include "ext2fsP.h" + +#if defined(__GNUC__) && !defined(NO_INLINE_FUNCS) +#define _BMAP_INLINE_ __inline__ +#else +#define _BMAP_INLINE_ +#endif + +extern errcode_t ext2fs_bmap(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + char *block_buf, int bmap_flags, + blk_t block, blk_t *phys_blk); + +#define inode_bmap(inode, nr) ((inode)->i_block[(nr)]) + +static _BMAP_INLINE_ errcode_t block_ind_bmap(ext2_filsys fs, int flags, + blk_t ind, char *block_buf, + int *blocks_alloc, + blk_t nr, blk_t *ret_blk) +{ + errcode_t retval; + blk_t b; + + if (!ind) { + if (flags & BMAP_SET) + return EXT2_ET_SET_BMAP_NO_IND; + *ret_blk = 0; + return 0; + } + retval = io_channel_read_blk(fs->io, ind, 1, block_buf); + if (retval) + return retval; + + if (flags & BMAP_SET) { + b = *ret_blk; +#ifdef WORDS_BIGENDIAN + b = ext2fs_swab32(b); +#endif + ((blk_t *) block_buf)[nr] = b; + return io_channel_write_blk(fs->io, ind, 1, block_buf); + } + + b = ((blk_t *) block_buf)[nr]; + +#ifdef WORDS_BIGENDIAN + b = ext2fs_swab32(b); +#endif + + if (!b && (flags & BMAP_ALLOC)) { + b = nr ? ext2fs_le32_to_cpu(((blk_t *)block_buf)[nr - 1]) : ind; + retval = ext2fs_alloc_block(fs, b, + block_buf + fs->blocksize, &b); + if (retval) + return retval; + +#ifdef WORDS_BIGENDIAN + ((blk_t *) block_buf)[nr] = ext2fs_swab32(b); +#else + ((blk_t *) block_buf)[nr] = b; +#endif + + retval = io_channel_write_blk(fs->io, ind, 1, block_buf); + if (retval) + return retval; + + (*blocks_alloc)++; + } + + *ret_blk = b; + return 0; +} + +static _BMAP_INLINE_ errcode_t block_dind_bmap(ext2_filsys fs, int flags, + blk_t dind, char *block_buf, + int *blocks_alloc, + blk_t nr, blk_t *ret_blk) +{ + blk_t b = 0; + errcode_t retval; + blk_t addr_per_block; + + addr_per_block = (blk_t) fs->blocksize >> 2; + + retval = block_ind_bmap(fs, flags & ~BMAP_SET, dind, block_buf, + blocks_alloc, nr / addr_per_block, &b); + if (retval) + return retval; + retval = block_ind_bmap(fs, flags, b, block_buf, blocks_alloc, + nr % addr_per_block, ret_blk); + return retval; +} + +static _BMAP_INLINE_ errcode_t block_tind_bmap(ext2_filsys fs, int flags, + blk_t tind, char *block_buf, + int *blocks_alloc, + blk_t nr, blk_t *ret_blk) +{ + blk_t b = 0; + errcode_t retval; + blk_t addr_per_block; + + addr_per_block = (blk_t) fs->blocksize >> 2; + + retval = block_dind_bmap(fs, flags & ~BMAP_SET, tind, block_buf, + blocks_alloc, nr / addr_per_block, &b); + if (retval) + return retval; + retval = block_ind_bmap(fs, flags, b, block_buf, blocks_alloc, + nr % addr_per_block, ret_blk); + return retval; +} + +static errcode_t extent_bmap(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + ext2_extent_handle_t handle, + char *block_buf, int bmap_flags, blk64_t block, + int *ret_flags, int *blocks_alloc, + blk64_t *phys_blk); + +static errcode_t implied_cluster_alloc(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + ext2_extent_handle_t handle, + blk64_t lblk, blk64_t *phys_blk) +{ + blk64_t base_block, pblock = 0; + int i; + + if (!ext2fs_has_feature_bigalloc(fs->super)) + return 0; + + base_block = lblk & ~EXT2FS_CLUSTER_MASK(fs); + /* + * Except for the logical block (lblk) that was passed in, search all + * blocks in this logical cluster for a mapping to a physical cluster. + * If any such map exists, calculate the physical block that maps to + * the logical block and return that. + * + * The old code wouldn't even look if (block % cluster_ratio) == 0; + * this is incorrect if we're allocating blocks in reverse order. + */ + for (i = 0; i < EXT2FS_CLUSTER_RATIO(fs); i++) { + if (base_block + i == lblk) + continue; + extent_bmap(fs, ino, inode, handle, 0, 0, + base_block + i, 0, 0, &pblock); + if (pblock) + break; + } + if (pblock == 0) + return 0; + *phys_blk = pblock - i + (lblk - base_block); + return 0; +} + +/* Try to map a logical block to an already-allocated physical cluster. */ +errcode_t ext2fs_map_cluster_block(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, blk64_t lblk, + blk64_t *pblk) +{ + ext2_extent_handle_t handle; + errcode_t retval; + + /* Need bigalloc and extents to be enabled */ + *pblk = 0; + if (!ext2fs_has_feature_bigalloc(fs->super) || + !(inode->i_flags & EXT4_EXTENTS_FL)) + return 0; + + retval = ext2fs_extent_open2(fs, ino, inode, &handle); + if (retval) + goto out; + + retval = implied_cluster_alloc(fs, ino, inode, handle, lblk, pblk); + if (retval) + goto out2; + +out2: + ext2fs_extent_free(handle); +out: + return retval; +} + +static errcode_t extent_bmap(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + ext2_extent_handle_t handle, + char *block_buf, int bmap_flags, blk64_t block, + int *ret_flags, int *blocks_alloc, + blk64_t *phys_blk) +{ + struct blk_alloc_ctx alloc_ctx; + struct ext2fs_extent extent; + unsigned int offset; + errcode_t retval = 0; + blk64_t blk64 = 0; + int alloc = 0; + int set_flags; + + set_flags = bmap_flags & BMAP_UNINIT ? EXT2_EXTENT_SET_BMAP_UNINIT : 0; + + if (bmap_flags & BMAP_SET) { + retval = ext2fs_extent_set_bmap(handle, block, + *phys_blk, set_flags); + return retval; + } + retval = ext2fs_extent_goto(handle, block); + if (retval) { + /* If the extent is not found, return phys_blk = 0 */ + if (retval == EXT2_ET_EXTENT_NOT_FOUND) { + extent.e_lblk = block; + goto got_block; + } + return retval; + } + retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent); + if (retval) + return retval; + offset = block - extent.e_lblk; + if (block >= extent.e_lblk && (offset <= extent.e_len)) { + *phys_blk = extent.e_pblk + offset; + if (ret_flags && extent.e_flags & EXT2_EXTENT_FLAGS_UNINIT) + *ret_flags |= BMAP_RET_UNINIT; + } +got_block: + if ((*phys_blk == 0) && (bmap_flags & BMAP_ALLOC)) { + implied_cluster_alloc(fs, ino, inode, handle, block, &blk64); + if (blk64) + goto set_extent; + retval = extent_bmap(fs, ino, inode, handle, block_buf, + 0, block-1, 0, blocks_alloc, &blk64); + if (retval) + blk64 = ext2fs_find_inode_goal(fs, ino, inode, block); + alloc_ctx.ino = ino; + alloc_ctx.inode = inode; + alloc_ctx.lblk = extent.e_lblk; + alloc_ctx.flags = BLOCK_ALLOC_DATA; + retval = ext2fs_alloc_block3(fs, blk64, block_buf, &blk64, + &alloc_ctx); + if (retval) + return retval; + blk64 &= ~EXT2FS_CLUSTER_MASK(fs); + blk64 += EXT2FS_CLUSTER_MASK(fs) & block; + alloc++; + set_extent: + retval = ext2fs_extent_set_bmap(handle, block, + blk64, set_flags); + if (retval) { + ext2fs_block_alloc_stats2(fs, blk64, -1); + return retval; + } + /* Update inode after setting extent */ + retval = ext2fs_read_inode(fs, ino, inode); + if (retval) + return retval; + *blocks_alloc += alloc; + *phys_blk = blk64; + } + return 0; +} + +int ext2fs_file_block_offset_too_big(ext2_filsys fs, + struct ext2_inode *inode, + blk64_t offset) +{ + blk64_t addr_per_block, max_map_block; + + /* Kernel seems to cut us off at 4294967294 blocks */ + if (offset >= (1ULL << 32) - 1) + return 1; + + if (inode->i_flags & EXT4_EXTENTS_FL) + return 0; + + addr_per_block = fs->blocksize >> 2; + max_map_block = addr_per_block; + max_map_block += addr_per_block * addr_per_block; + max_map_block += addr_per_block * addr_per_block * addr_per_block; + max_map_block += 12; + + return offset >= max_map_block; +} + +errcode_t ext2fs_bmap2(ext2_filsys fs, ext2_ino_t ino, struct ext2_inode *inode, + char *block_buf, int bmap_flags, blk64_t block, + int *ret_flags, blk64_t *phys_blk) +{ + struct ext2_inode inode_buf; + ext2_extent_handle_t handle = 0; + blk_t addr_per_block; + blk_t b, blk32; + blk64_t b64; + char *buf = 0; + errcode_t retval = 0; + int blocks_alloc = 0, inode_dirty = 0; + struct blk_alloc_ctx alloc_ctx = { + .ino = ino, + .inode = inode, + .lblk = 0, + .flags = BLOCK_ALLOC_DATA, + }; + + if (!(bmap_flags & BMAP_SET)) + *phys_blk = 0; + + if (ret_flags) + *ret_flags = 0; + + /* Read inode structure if necessary */ + if (!inode) { + retval = ext2fs_read_inode(fs, ino, &inode_buf); + if (retval) + return retval; + inode = &inode_buf; + } + addr_per_block = (blk_t) fs->blocksize >> 2; + + if (ext2fs_file_block_offset_too_big(fs, inode, block)) + return EXT2_ET_FILE_TOO_BIG; + + /* + * If an inode has inline data, that means that it doesn't have + * any blocks and we shouldn't map any blocks for it. + */ + if (inode->i_flags & EXT4_INLINE_DATA_FL) + return EXT2_ET_INLINE_DATA_NO_BLOCK; + + if (!block_buf) { + retval = ext2fs_get_array(2, fs->blocksize, &buf); + if (retval) + return retval; + block_buf = buf; + } + + if (inode->i_flags & EXT4_EXTENTS_FL) { + retval = ext2fs_extent_open2(fs, ino, inode, &handle); + if (retval) + goto done; + retval = extent_bmap(fs, ino, inode, handle, block_buf, + bmap_flags, block, ret_flags, + &blocks_alloc, phys_blk); + goto done; + } + + if (block < EXT2_NDIR_BLOCKS) { + if (bmap_flags & BMAP_SET) { + b = *phys_blk; + inode_bmap(inode, block) = b; + inode_dirty++; + goto done; + } + + *phys_blk = inode_bmap(inode, block); + b = block ? inode_bmap(inode, block - 1) : + ext2fs_find_inode_goal(fs, ino, inode, block); + + if ((*phys_blk == 0) && (bmap_flags & BMAP_ALLOC)) { + b64 = b; + retval = ext2fs_alloc_block3(fs, b64, block_buf, &b64, + &alloc_ctx); + b = b64; + if (retval) + goto done; + inode_bmap(inode, block) = b; + blocks_alloc++; + *phys_blk = b; + } + goto done; + } + + /* Indirect block */ + block -= EXT2_NDIR_BLOCKS; + blk32 = *phys_blk; + if (block < addr_per_block) { + b = inode_bmap(inode, EXT2_IND_BLOCK); + if (!b) { + if (!(bmap_flags & BMAP_ALLOC)) { + if (bmap_flags & BMAP_SET) + retval = EXT2_ET_SET_BMAP_NO_IND; + goto done; + } + + b = inode_bmap(inode, EXT2_IND_BLOCK-1); + b64 = b; + retval = ext2fs_alloc_block3(fs, b64, block_buf, &b64, + &alloc_ctx); + b = b64; + if (retval) + goto done; + inode_bmap(inode, EXT2_IND_BLOCK) = b; + blocks_alloc++; + } + retval = block_ind_bmap(fs, bmap_flags, b, block_buf, + &blocks_alloc, block, &blk32); + if (retval == 0) + *phys_blk = blk32; + goto done; + } + + /* Doubly indirect block */ + block -= addr_per_block; + if (block < addr_per_block * addr_per_block) { + b = inode_bmap(inode, EXT2_DIND_BLOCK); + if (!b) { + if (!(bmap_flags & BMAP_ALLOC)) { + if (bmap_flags & BMAP_SET) + retval = EXT2_ET_SET_BMAP_NO_IND; + goto done; + } + + b = inode_bmap(inode, EXT2_IND_BLOCK); + b64 = b; + retval = ext2fs_alloc_block3(fs, b64, block_buf, &b64, + &alloc_ctx); + b = b64; + if (retval) + goto done; + inode_bmap(inode, EXT2_DIND_BLOCK) = b; + blocks_alloc++; + } + retval = block_dind_bmap(fs, bmap_flags, b, block_buf, + &blocks_alloc, block, &blk32); + if (retval == 0) + *phys_blk = blk32; + goto done; + } + + /* Triply indirect block */ + block -= addr_per_block * addr_per_block; + b = inode_bmap(inode, EXT2_TIND_BLOCK); + if (!b) { + if (!(bmap_flags & BMAP_ALLOC)) { + if (bmap_flags & BMAP_SET) + retval = EXT2_ET_SET_BMAP_NO_IND; + goto done; + } + + b = inode_bmap(inode, EXT2_DIND_BLOCK); + b64 = b; + retval = ext2fs_alloc_block3(fs, b64, block_buf, &b64, + &alloc_ctx); + b = b64; + if (retval) + goto done; + inode_bmap(inode, EXT2_TIND_BLOCK) = b; + blocks_alloc++; + } + retval = block_tind_bmap(fs, bmap_flags, b, block_buf, + &blocks_alloc, block, &blk32); + if (retval == 0) + *phys_blk = blk32; +done: + if (*phys_blk && retval == 0 && (bmap_flags & BMAP_ZERO)) + retval = ext2fs_zero_blocks2(fs, *phys_blk, 1, NULL, NULL); + if (buf) + ext2fs_free_mem(&buf); + if (handle) + ext2fs_extent_free(handle); + if ((retval == 0) && (blocks_alloc || inode_dirty)) { + ext2fs_iblk_add_blocks(fs, inode, blocks_alloc); + retval = ext2fs_write_inode(fs, ino, inode); + } + return retval; +} + +errcode_t ext2fs_bmap(ext2_filsys fs, ext2_ino_t ino, struct ext2_inode *inode, + char *block_buf, int bmap_flags, blk_t block, + blk_t *phys_blk) +{ + errcode_t ret; + blk64_t ret_blk = *phys_blk; + + ret = ext2fs_bmap2(fs, ino, inode, block_buf, bmap_flags, block, + 0, &ret_blk); + if (ret) + return ret; + if (ret_blk >= ((long long) 1 << 32)) + return EOVERFLOW; + *phys_blk = ret_blk; + return 0; +} diff --git a/lib/ext2fs/bmap64.h b/lib/ext2fs/bmap64.h new file mode 100644 index 0000000..de33454 --- /dev/null +++ b/lib/ext2fs/bmap64.h @@ -0,0 +1,106 @@ +/* + * bmap64.h --- 64-bit bitmap structure + * + * Copyright (C) 2007, 2008 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Public + * License. + * %End-Header% + */ + +struct ext2_bmap_statistics { + int type; + struct timeval created; + +#ifdef ENABLE_BMAP_STATS_OPS + unsigned long copy_count; + unsigned long resize_count; + unsigned long mark_count; + unsigned long unmark_count; + unsigned long test_count; + unsigned long mark_ext_count; + unsigned long unmark_ext_count; + unsigned long test_ext_count; + unsigned long set_range_count; + unsigned long get_range_count; + unsigned long clear_count; + + blk64_t last_marked; + blk64_t last_tested; + blk64_t mark_back; + blk64_t test_back; + + unsigned long mark_seq; + unsigned long test_seq; +#endif /* ENABLE_BMAP_STATS_OPS */ +}; + + +struct ext2fs_struct_generic_bitmap_64 { + errcode_t magic; + ext2_filsys fs; + struct ext2_bitmap_ops *bitmap_ops; + int flags; + __u64 start, end; + __u64 real_end; + int cluster_bits; + char *description; + void *private; + errcode_t base_error_code; +#ifdef ENABLE_BMAP_STATS + struct ext2_bmap_statistics stats; +#endif +}; + +typedef struct ext2fs_struct_generic_bitmap_64 *ext2fs_generic_bitmap_64; + +#define EXT2FS_IS_32_BITMAP(bmap) \ + (((bmap)->magic == EXT2_ET_MAGIC_GENERIC_BITMAP) || \ + ((bmap)->magic == EXT2_ET_MAGIC_BLOCK_BITMAP) || \ + ((bmap)->magic == EXT2_ET_MAGIC_INODE_BITMAP)) + +#define EXT2FS_IS_64_BITMAP(bmap) \ + (((bmap)->magic == EXT2_ET_MAGIC_GENERIC_BITMAP64) || \ + ((bmap)->magic == EXT2_ET_MAGIC_BLOCK_BITMAP64) || \ + ((bmap)->magic == EXT2_ET_MAGIC_INODE_BITMAP64)) + +struct ext2_bitmap_ops { + int type; + /* Generic bmap operators */ + errcode_t (*new_bmap)(ext2_filsys fs, ext2fs_generic_bitmap_64 bmap); + void (*free_bmap)(ext2fs_generic_bitmap_64 bitmap); + errcode_t (*copy_bmap)(ext2fs_generic_bitmap_64 src, + ext2fs_generic_bitmap_64 dest); + errcode_t (*resize_bmap)(ext2fs_generic_bitmap_64 bitmap, + __u64 new_end, + __u64 new_real_end); + /* bit set/test operators */ + int (*mark_bmap)(ext2fs_generic_bitmap_64 bitmap, __u64 arg); + int (*unmark_bmap)(ext2fs_generic_bitmap_64 bitmap, __u64 arg); + int (*test_bmap)(ext2fs_generic_bitmap_64 bitmap, __u64 arg); + void (*mark_bmap_extent)(ext2fs_generic_bitmap_64 bitmap, __u64 arg, + unsigned int num); + void (*unmark_bmap_extent)(ext2fs_generic_bitmap_64 bitmap, __u64 arg, + unsigned int num); + int (*test_clear_bmap_extent)(ext2fs_generic_bitmap_64 bitmap, + __u64 arg, unsigned int num); + errcode_t (*set_bmap_range)(ext2fs_generic_bitmap_64 bitmap, + __u64 start, size_t num, void *in); + errcode_t (*get_bmap_range)(ext2fs_generic_bitmap_64 bitmap, + __u64 start, size_t num, void *out); + void (*clear_bmap)(ext2fs_generic_bitmap_64 bitmap); + void (*print_stats)(ext2fs_generic_bitmap_64); + + /* Find the first zero bit between start and end, inclusive. + * May be NULL, in which case a generic function is used. */ + errcode_t (*find_first_zero)(ext2fs_generic_bitmap_64 bitmap, + __u64 start, __u64 end, __u64 *out); + /* Find the first set bit between start and end, inclusive. + * May be NULL, in which case a generic function is used. */ + errcode_t (*find_first_set)(ext2fs_generic_bitmap_64 bitmap, + __u64 start, __u64 end, __u64 *out); +}; + +extern struct ext2_bitmap_ops ext2fs_blkmap64_bitarray; +extern struct ext2_bitmap_ops ext2fs_blkmap64_rbtree; diff --git a/lib/ext2fs/bmove.c b/lib/ext2fs/bmove.c new file mode 100644 index 0000000..e2ea405 --- /dev/null +++ b/lib/ext2fs/bmove.c @@ -0,0 +1,167 @@ +/* + * bmove.c --- Move blocks around to make way for a particular + * filesystem structure. + * + * Copyright (C) 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#if HAVE_SYS_TIME_H +#include <sys/time.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" + +struct process_block_struct { + ext2_ino_t ino; + struct ext2_inode * inode; + ext2fs_block_bitmap reserve; + ext2fs_block_bitmap alloc_map; + errcode_t error; + char *buf; + int add_dir; + int flags; +}; + +static int process_block(ext2_filsys fs, blk64_t *block_nr, + e2_blkcnt_t blockcnt, blk64_t ref_block, + int ref_offset, void *priv_data) +{ + struct process_block_struct *pb; + errcode_t retval; + int ret; + blk64_t block, orig; + + pb = (struct process_block_struct *) priv_data; + block = orig = *block_nr; + ret = 0; + + /* + * Let's see if this is one which we need to relocate + */ + if (ext2fs_test_block_bitmap2(pb->reserve, block)) { + do { + if (++block >= ext2fs_blocks_count(fs->super)) + block = fs->super->s_first_data_block; + if (block == orig) { + pb->error = EXT2_ET_BLOCK_ALLOC_FAIL; + return BLOCK_ABORT; + } + } while (ext2fs_test_block_bitmap2(pb->reserve, block) || + ext2fs_test_block_bitmap2(pb->alloc_map, block)); + + retval = io_channel_read_blk64(fs->io, orig, 1, pb->buf); + if (retval) { + pb->error = retval; + return BLOCK_ABORT; + } + retval = io_channel_write_blk64(fs->io, block, 1, pb->buf); + if (retval) { + pb->error = retval; + return BLOCK_ABORT; + } + *block_nr = block; + ext2fs_mark_block_bitmap2(pb->alloc_map, block); + ret = BLOCK_CHANGED; + if (pb->flags & EXT2_BMOVE_DEBUG) + printf("ino=%u, blockcnt=%lld, %llu->%llu\n", + (unsigned) pb->ino, blockcnt, + (unsigned long long) orig, + (unsigned long long) block); + } + if (pb->add_dir) { + retval = ext2fs_add_dir_block2(fs->dblist, pb->ino, + block, blockcnt); + if (retval) { + pb->error = retval; + ret |= BLOCK_ABORT; + } + } + return ret; +} + +errcode_t ext2fs_move_blocks(ext2_filsys fs, + ext2fs_block_bitmap reserve, + ext2fs_block_bitmap alloc_map, + int flags) +{ + ext2_ino_t ino; + struct ext2_inode inode; + errcode_t retval; + struct process_block_struct pb; + ext2_inode_scan scan; + char *block_buf; + + retval = ext2fs_open_inode_scan(fs, 0, &scan); + if (retval) + return retval; + + pb.reserve = reserve; + pb.error = 0; + pb.alloc_map = alloc_map ? alloc_map : fs->block_map; + pb.flags = flags; + + retval = ext2fs_get_array(4, fs->blocksize, &block_buf); + if (retval) + return retval; + pb.buf = block_buf + fs->blocksize * 3; + + /* + * If GET_DBLIST is set in the flags field, then we should + * gather directory block information while we're doing the + * block move. + */ + if (flags & EXT2_BMOVE_GET_DBLIST) { + if (fs->dblist) { + ext2fs_free_dblist(fs->dblist); + fs->dblist = NULL; + } + retval = ext2fs_init_dblist(fs, 0); + if (retval) + return retval; + } + + retval = ext2fs_get_next_inode(scan, &ino, &inode); + if (retval) + return retval; + + while (ino) { + if ((inode.i_links_count == 0) || + !ext2fs_inode_has_valid_blocks2(fs, &inode)) + goto next; + + pb.ino = ino; + pb.inode = &inode; + + pb.add_dir = (LINUX_S_ISDIR(inode.i_mode) && + flags & EXT2_BMOVE_GET_DBLIST); + + retval = ext2fs_block_iterate3(fs, ino, 0, block_buf, + process_block, &pb); + if (retval) + return retval; + if (pb.error) + return pb.error; + + next: + retval = ext2fs_get_next_inode(scan, &ino, &inode); + if (retval == EXT2_ET_BAD_BLOCK_IN_INODE_TABLE) + goto next; + } + return 0; +} + diff --git a/lib/ext2fs/brel.h b/lib/ext2fs/brel.h new file mode 100644 index 0000000..9fdddd4 --- /dev/null +++ b/lib/ext2fs/brel.h @@ -0,0 +1,86 @@ +/* + * brel.h + * + * Copyright (C) 1996, 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +struct ext2_block_relocate_entry { + blk64_t new; + __s16 offset; + __u16 flags; + union { + blk64_t block_ref; + ext2_ino_t inode_ref; + } owner; +}; + +#define RELOCATE_TYPE_REF 0x0007 +#define RELOCATE_BLOCK_REF 0x0001 +#define RELOCATE_INODE_REF 0x0002 + +typedef struct ext2_block_relocation_table *ext2_brel; + +struct ext2_block_relocation_table { + __u32 magic; + char *name; + blk64_t current; + void *priv_data; + + /* + * Add a block relocation entry. + */ + errcode_t (*put)(ext2_brel brel, blk64_t old, + struct ext2_block_relocate_entry *ent); + + /* + * Get a block relocation entry. + */ + errcode_t (*get)(ext2_brel brel, blk64_t old, + struct ext2_block_relocate_entry *ent); + + /* + * Initialize for iterating over the block relocation entries. + */ + errcode_t (*start_iter)(ext2_brel brel); + + /* + * The iterator function for the inode relocation entries. + * Returns an inode number of 0 when out of entries. + */ + errcode_t (*next)(ext2_brel brel, blk64_t *old, + struct ext2_block_relocate_entry *ent); + + /* + * Move the inode relocation table from one block number to + * another. + */ + errcode_t (*move)(ext2_brel brel, blk64_t old, blk_t new); + + /* + * Remove a block relocation entry. + */ + errcode_t (*delete)(ext2_brel brel, blk64_t old); + + + /* + * Free the block relocation table. + */ + errcode_t (*free)(ext2_brel brel); +}; + +errcode_t ext2fs_brel_memarray_create(char *name, blk64_t max_block, + ext2_brel *brel); + +#define ext2fs_brel_put(brel, old, ent) ((brel)->put((brel), old, ent)) +#define ext2fs_brel_get(brel, old, ent) ((brel)->get((brel), old, ent)) +#define ext2fs_brel_start_iter(brel) ((brel)->start_iter((brel))) +#define ext2fs_brel_next(brel, old, ent) ((brel)->next((brel), old, ent)) +#define ext2fs_brel_move(brel, old, new) ((brel)->move((brel), old, new)) +#define ext2fs_brel_delete(brel, old) ((brel)->delete((brel), old)) +#define ext2fs_brel_free(brel) ((brel)->free((brel))) + diff --git a/lib/ext2fs/brel_ma.c b/lib/ext2fs/brel_ma.c new file mode 100644 index 0000000..a12afae --- /dev/null +++ b/lib/ext2fs/brel_ma.c @@ -0,0 +1,199 @@ +/* + * brel_ma.c + * + * Copyright (C) 1996, 1997 Theodore Ts'o. + * + * TODO: rewrite to not use a direct array!!! (Fortunately this + * module isn't really used yet.) + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <fcntl.h> +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "brel.h" + +static errcode_t bma_put(ext2_brel brel, blk64_t old, + struct ext2_block_relocate_entry *ent); +static errcode_t bma_get(ext2_brel brel, blk64_t old, + struct ext2_block_relocate_entry *ent); +static errcode_t bma_start_iter(ext2_brel brel); +static errcode_t bma_next(ext2_brel brel, blk64_t *old, + struct ext2_block_relocate_entry *ent); +static errcode_t bma_move(ext2_brel brel, blk64_t old, blk64_t new); +static errcode_t bma_delete(ext2_brel brel, blk64_t old); +static errcode_t bma_free(ext2_brel brel); + +struct brel_ma { + __u32 magic; + blk64_t max_block; + struct ext2_block_relocate_entry *entries; +}; + +errcode_t ext2fs_brel_memarray_create(char *name, blk64_t max_block, + ext2_brel *new_brel) +{ + ext2_brel brel = 0; + errcode_t retval; + struct brel_ma *ma = 0; + size_t size; + + *new_brel = 0; + + /* + * Allocate memory structures + */ + retval = ext2fs_get_mem(sizeof(struct ext2_block_relocation_table), + &brel); + if (retval) + goto errout; + memset(brel, 0, sizeof(struct ext2_block_relocation_table)); + + retval = ext2fs_get_mem(strlen(name)+1, &brel->name); + if (retval) + goto errout; + strcpy(brel->name, name); + + retval = ext2fs_get_mem(sizeof(struct brel_ma), &ma); + if (retval) + goto errout; + memset(ma, 0, sizeof(struct brel_ma)); + brel->priv_data = ma; + + size = (size_t) (sizeof(struct ext2_block_relocate_entry) * + (max_block+1)); + retval = ext2fs_get_array(max_block+1, + sizeof(struct ext2_block_relocate_entry), &ma->entries); + if (retval) + goto errout; + memset(ma->entries, 0, size); + ma->max_block = max_block; + + /* + * Fill in the brel data structure + */ + brel->put = bma_put; + brel->get = bma_get; + brel->start_iter = bma_start_iter; + brel->next = bma_next; + brel->move = bma_move; + brel->delete = bma_delete; + brel->free = bma_free; + + *new_brel = brel; + return 0; + +errout: + bma_free(brel); + return retval; +} + +static errcode_t bma_put(ext2_brel brel, blk64_t old, + struct ext2_block_relocate_entry *ent) +{ + struct brel_ma *ma; + + ma = brel->priv_data; + if (old > ma->max_block) + return EXT2_ET_INVALID_ARGUMENT; + ma->entries[(unsigned)old] = *ent; + return 0; +} + +static errcode_t bma_get(ext2_brel brel, blk64_t old, + struct ext2_block_relocate_entry *ent) +{ + struct brel_ma *ma; + + ma = brel->priv_data; + if (old > ma->max_block) + return EXT2_ET_INVALID_ARGUMENT; + if (ma->entries[(unsigned)old].new == 0) + return ENOENT; + *ent = ma->entries[old]; + return 0; +} + +static errcode_t bma_start_iter(ext2_brel brel) +{ + brel->current = 0; + return 0; +} + +static errcode_t bma_next(ext2_brel brel, blk64_t *old, + struct ext2_block_relocate_entry *ent) +{ + struct brel_ma *ma; + + ma = brel->priv_data; + while (++brel->current < ma->max_block) { + if (ma->entries[(unsigned)brel->current].new == 0) + continue; + *old = brel->current; + *ent = ma->entries[(unsigned)brel->current]; + return 0; + } + *old = 0; + return 0; +} + +static errcode_t bma_move(ext2_brel brel, blk64_t old, blk64_t new) +{ + struct brel_ma *ma; + + ma = brel->priv_data; + if ((old > ma->max_block) || (new > ma->max_block)) + return EXT2_ET_INVALID_ARGUMENT; + if (ma->entries[(unsigned)old].new == 0) + return ENOENT; + ma->entries[(unsigned)new] = ma->entries[old]; + ma->entries[(unsigned)old].new = 0; + return 0; +} + +static errcode_t bma_delete(ext2_brel brel, blk64_t old) +{ + struct brel_ma *ma; + + ma = brel->priv_data; + if (old > ma->max_block) + return EXT2_ET_INVALID_ARGUMENT; + if (ma->entries[(unsigned)old].new == 0) + return ENOENT; + ma->entries[(unsigned)old].new = 0; + return 0; +} + +static errcode_t bma_free(ext2_brel brel) +{ + struct brel_ma *ma; + + if (!brel) + return 0; + + ma = brel->priv_data; + + if (ma) { + if (ma->entries) + ext2fs_free_mem(&ma->entries); + ext2fs_free_mem(&ma); + } + if (brel->name) + ext2fs_free_mem(&brel->name); + ext2fs_free_mem(&brel); + return 0; +} diff --git a/lib/ext2fs/check_desc.c b/lib/ext2fs/check_desc.c new file mode 100644 index 0000000..3e3fa94 --- /dev/null +++ b/lib/ext2fs/check_desc.c @@ -0,0 +1,104 @@ +/* + * check_desc.c --- Check the group descriptors of an ext2 filesystem + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +/* + * This routine sanity checks the group descriptors + */ +errcode_t ext2fs_check_desc(ext2_filsys fs) +{ + ext2fs_block_bitmap bmap; + errcode_t retval; + dgrp_t i; + blk64_t first_block = fs->super->s_first_data_block; + blk64_t last_block = ext2fs_blocks_count(fs->super)-1; + blk64_t blk, b; + unsigned int j; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (EXT2_DESC_SIZE(fs->super) & (EXT2_DESC_SIZE(fs->super) - 1)) + return EXT2_ET_BAD_DESC_SIZE; + + retval = ext2fs_allocate_subcluster_bitmap(fs, "check_desc map", &bmap); + if (retval) + return retval; + + for (i = 0; i < fs->group_desc_count; i++) + ext2fs_reserve_super_and_bgd(fs, i, bmap); + + for (i = 0; i < fs->group_desc_count; i++) { + if (!ext2fs_has_feature_flex_bg(fs->super)) { + first_block = ext2fs_group_first_block2(fs, i); + last_block = ext2fs_group_last_block2(fs, i); + } + + /* + * Check to make sure the block bitmap for group is sane + */ + blk = ext2fs_block_bitmap_loc(fs, i); + if (blk < first_block || blk > last_block || + ext2fs_test_block_bitmap2(bmap, blk)) { + retval = EXT2_ET_GDESC_BAD_BLOCK_MAP; + goto errout; + } + ext2fs_mark_block_bitmap2(bmap, blk); + + /* + * Check to make sure the inode bitmap for group is sane + */ + blk = ext2fs_inode_bitmap_loc(fs, i); + if (blk < first_block || blk > last_block || + ext2fs_test_block_bitmap2(bmap, blk)) { + retval = EXT2_ET_GDESC_BAD_INODE_MAP; + goto errout; + } + ext2fs_mark_block_bitmap2(bmap, blk); + + /* + * Check to make sure the inode table for group is sane + */ + blk = ext2fs_inode_table_loc(fs, i); + if (blk < first_block || + ((blk + fs->inode_blocks_per_group - 1) > last_block)) { + retval = EXT2_ET_GDESC_BAD_INODE_TABLE; + goto errout; + } + for (j = 0, b = blk; j < fs->inode_blocks_per_group; + j++, b++) { + if (ext2fs_test_block_bitmap2(bmap, b)) { + retval = EXT2_ET_GDESC_BAD_INODE_TABLE; + goto errout; + } + ext2fs_mark_block_bitmap2(bmap, b); + } + } +errout: + ext2fs_free_block_bitmap(bmap); + return retval; +} diff --git a/lib/ext2fs/closefs.c b/lib/ext2fs/closefs.c new file mode 100644 index 0000000..69cbdd8 --- /dev/null +++ b/lib/ext2fs/closefs.c @@ -0,0 +1,521 @@ +/* + * closefs.c --- close an ext2 filesystem + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <time.h> +#include <string.h> + +#include "ext2_fs.h" +#include "ext2fsP.h" + +static int test_root(unsigned int a, unsigned int b) +{ + while (1) { + if (a < b) + return 0; + if (a == b) + return 1; + if (a % b) + return 0; + a = a / b; + } +} + +int ext2fs_bg_has_super(ext2_filsys fs, dgrp_t group) +{ + if (group == 0) + return 1; + if (ext2fs_has_feature_sparse_super2(fs->super)) { + if (group == fs->super->s_backup_bgs[0] || + group == fs->super->s_backup_bgs[1]) + return 1; + return 0; + } + if ((group <= 1) || !ext2fs_has_feature_sparse_super(fs->super)) + return 1; + if (!(group & 1)) + return 0; + if (test_root(group, 3) || (test_root(group, 5)) || + test_root(group, 7)) + return 1; + + return 0; +} + +/* + * ext2fs_super_and_bgd_loc2() + * @fs: ext2 fs pointer + * @group given block group + * @ret_super_blk: if !NULL, returns super block location + * @ret_old_desc_blk: if !NULL, returns location of the old block + * group descriptor + * @ret_new_desc_blk: if !NULL, returns location of meta_bg block + * group descriptor + * @ret_used_blks: if !NULL, returns number of blocks used by + * super block and group_descriptors. + * + * Returns errcode_t of 0 + */ +errcode_t ext2fs_super_and_bgd_loc2(ext2_filsys fs, + dgrp_t group, + blk64_t *ret_super_blk, + blk64_t *ret_old_desc_blk, + blk64_t *ret_new_desc_blk, + blk_t *ret_used_blks) +{ + blk64_t group_block, super_blk = 0, old_desc_blk = 0, new_desc_blk = 0; + unsigned int meta_bg, meta_bg_size; + blk_t numblocks = 0; + blk64_t old_desc_blocks; + int has_super; + + group_block = ext2fs_group_first_block2(fs, group); + if (group_block == 0 && fs->blocksize == 1024) + group_block = 1; /* Deal with 1024 blocksize && bigalloc */ + + if (ext2fs_has_feature_meta_bg(fs->super)) + old_desc_blocks = fs->super->s_first_meta_bg; + else + old_desc_blocks = + fs->desc_blocks + fs->super->s_reserved_gdt_blocks; + + has_super = ext2fs_bg_has_super(fs, group); + + if (has_super) { + super_blk = group_block; + numblocks++; + } + meta_bg_size = EXT2_DESC_PER_BLOCK(fs->super); + meta_bg = group / meta_bg_size; + + if (!ext2fs_has_feature_meta_bg(fs->super) || + (meta_bg < fs->super->s_first_meta_bg)) { + if (has_super) { + old_desc_blk = group_block + 1; + numblocks += old_desc_blocks; + } + } else { + if (((group % meta_bg_size) == 0) || + ((group % meta_bg_size) == 1) || + ((group % meta_bg_size) == (meta_bg_size-1))) { + if (has_super) + has_super = 1; + new_desc_blk = group_block + has_super; + numblocks++; + } + } + + if (ret_super_blk) + *ret_super_blk = super_blk; + if (ret_old_desc_blk) + *ret_old_desc_blk = old_desc_blk; + if (ret_new_desc_blk) + *ret_new_desc_blk = new_desc_blk; + if (ret_used_blks) + *ret_used_blks = numblocks; + + return 0; +} + +/* + * This function returns the location of the superblock, block group + * descriptors for a given block group. It currently returns the + * number of free blocks assuming that inode table and allocation + * bitmaps will be in the group. This is not necessarily the case + * when the flex_bg feature is enabled, so callers should take care! + * It was only really intended for use by mke2fs, and even there it's + * not that useful. + * + * The ext2fs_super_and_bgd_loc2() function is 64-bit block number + * capable and returns the number of blocks used by super block and + * group descriptors. + */ +int ext2fs_super_and_bgd_loc(ext2_filsys fs, + dgrp_t group, + blk_t *ret_super_blk, + blk_t *ret_old_desc_blk, + blk_t *ret_new_desc_blk, + int *ret_meta_bg) +{ + blk64_t ret_super_blk2; + blk64_t ret_old_desc_blk2; + blk64_t ret_new_desc_blk2; + blk_t ret_used_blks; + blk_t numblocks; + unsigned int meta_bg_size; + + ext2fs_super_and_bgd_loc2(fs, group, &ret_super_blk2, + &ret_old_desc_blk2, + &ret_new_desc_blk2, + &ret_used_blks); + + numblocks = ext2fs_group_blocks_count(fs, group); + + if (ret_super_blk) + *ret_super_blk = (blk_t)ret_super_blk2; + if (ret_old_desc_blk) + *ret_old_desc_blk = (blk_t)ret_old_desc_blk2; + if (ret_new_desc_blk) + *ret_new_desc_blk = (blk_t)ret_new_desc_blk2; + if (ret_meta_bg) { + meta_bg_size = EXT2_DESC_PER_BLOCK(fs->super); + *ret_meta_bg = group / meta_bg_size; + } + + numblocks -= 2 + fs->inode_blocks_per_group + ret_used_blks; + + return numblocks; +} + +/* + * This function forces out the primary superblock. We need to only + * write out those fields which we have changed, since if the + * filesystem is mounted, it may have changed some of the other + * fields. + * + * It takes as input a superblock which has already been byte swapped + * (if necessary). + * + */ +static errcode_t write_primary_superblock(ext2_filsys fs, + struct ext2_super_block *super) +{ + __u16 *old_super, *new_super; + int check_idx, write_idx, size; + errcode_t retval; + + if (!fs->io->manager->write_byte || !fs->orig_super) { + fallback: + io_channel_set_blksize(fs->io, SUPERBLOCK_OFFSET); + retval = io_channel_write_blk64(fs->io, 1, -SUPERBLOCK_SIZE, + super); + io_channel_set_blksize(fs->io, fs->blocksize); + return retval; + } + + old_super = (__u16 *) fs->orig_super; + new_super = (__u16 *) super; + + for (check_idx = 0; check_idx < SUPERBLOCK_SIZE/2; check_idx++) { + if (old_super[check_idx] == new_super[check_idx]) + continue; + write_idx = check_idx; + for (check_idx++; check_idx < SUPERBLOCK_SIZE/2; check_idx++) + if (old_super[check_idx] == new_super[check_idx]) + break; + size = 2 * (check_idx - write_idx); +#if 0 + printf("Writing %d bytes starting at %d\n", + size, write_idx*2); +#endif + retval = io_channel_write_byte(fs->io, + SUPERBLOCK_OFFSET + (2 * write_idx), size, + new_super + write_idx); + if (retval == EXT2_ET_UNIMPLEMENTED) + goto fallback; + if (retval) + return retval; + } + memcpy(fs->orig_super, super, SUPERBLOCK_SIZE); + return 0; +} + + +/* + * Updates the revision to EXT2_DYNAMIC_REV + */ +void ext2fs_update_dynamic_rev(ext2_filsys fs) +{ + struct ext2_super_block *sb = fs->super; + + if (sb->s_rev_level > EXT2_GOOD_OLD_REV) + return; + + sb->s_rev_level = EXT2_DYNAMIC_REV; + sb->s_first_ino = EXT2_GOOD_OLD_FIRST_INO; + sb->s_inode_size = EXT2_GOOD_OLD_INODE_SIZE; + /* s_uuid is handled by e2fsck already */ + /* other fields should be left alone */ +} + +static errcode_t write_backup_super(ext2_filsys fs, dgrp_t group, + blk64_t group_block, + struct ext2_super_block *super_shadow) +{ + errcode_t retval; + dgrp_t sgrp = group; + + if (sgrp > ((1 << 16) - 1)) + sgrp = (1 << 16) - 1; + + super_shadow->s_block_group_nr = ext2fs_cpu_to_le16(sgrp); + + retval = ext2fs_superblock_csum_set(fs, super_shadow); + if (retval) + return retval; + + return io_channel_write_blk64(fs->io, group_block, -SUPERBLOCK_SIZE, + super_shadow); +} + +errcode_t ext2fs_flush(ext2_filsys fs) +{ + return ext2fs_flush2(fs, 0); +} + +errcode_t ext2fs_flush2(ext2_filsys fs, int flags) +{ + dgrp_t i; + errcode_t retval; + unsigned long fs_state; + __u32 feature_incompat; + struct ext2_super_block *super_shadow = 0; + struct opaque_ext2_group_desc *group_shadow = 0; +#ifdef WORDS_BIGENDIAN + struct ext2_group_desc *gdp; + dgrp_t j; +#endif + char *group_ptr; + blk64_t old_desc_blocks; + struct ext2fs_numeric_progress_struct progress; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if ((fs->flags & EXT2_FLAG_SUPER_ONLY) == 0 && + !ext2fs_has_feature_journal_dev(fs->super) && + fs->group_desc == NULL) + return EXT2_ET_NO_GDESC; + + fs_state = fs->super->s_state; + feature_incompat = fs->super->s_feature_incompat; + + fs->super->s_wtime = fs->now ? fs->now : time(NULL); + fs->super->s_block_group_nr = 0; + + /* + * If the write_bitmaps() function is present, call it to + * flush the bitmaps. This is done this way so that a simple + * program that doesn't mess with the bitmaps doesn't need to + * drag in the bitmaps.c code. + * + * Bitmap checksums live in the group descriptor, so the + * bitmaps need to be written before the descriptors. + */ + if (fs->write_bitmaps) { + retval = fs->write_bitmaps(fs); + if (retval) + goto errout; + } + + /* + * Set the state of the FS to be non-valid. (The state has + * already been backed up earlier, and will be restored after + * we write out the backup superblocks.) + */ + fs->super->s_state &= ~EXT2_VALID_FS; + ext2fs_clear_feature_journal_needs_recovery(fs->super); + + /* Byte swap the superblock and the group descriptors if necessary */ +#ifdef WORDS_BIGENDIAN + retval = EXT2_ET_NO_MEMORY; + retval = ext2fs_get_mem(SUPERBLOCK_SIZE, &super_shadow); + if (retval) + goto errout; + memcpy(super_shadow, fs->super, sizeof(struct ext2_super_block)); + ext2fs_swap_super(super_shadow); + + if (((fs->flags & EXT2_FLAG_SUPER_ONLY) == 0) && + !ext2fs_has_feature_journal_dev(fs->super)) { + retval = ext2fs_get_array(fs->desc_blocks, fs->blocksize, + &group_shadow); + if (retval) + goto errout; + memcpy(group_shadow, fs->group_desc, (size_t) fs->blocksize * + fs->desc_blocks); + + for (j = 0; j < fs->group_desc_count; j++) { + gdp = ext2fs_group_desc(fs, group_shadow, j); + ext2fs_swap_group_desc2(fs, gdp); + } + } +#else + super_shadow = fs->super; + group_shadow = fs->group_desc; +#endif + + /* + * If this is an external journal device, don't write out the + * block group descriptors or any of the backup superblocks + */ + if (ext2fs_has_feature_journal_dev(fs->super)) + goto write_primary_superblock_only; + + /* + * Write out the master group descriptors, and the backup + * superblocks and group descriptors. + */ + group_ptr = (char *) group_shadow; + if (ext2fs_has_feature_meta_bg(fs->super)) { + old_desc_blocks = fs->super->s_first_meta_bg; + if (old_desc_blocks > fs->desc_blocks) + old_desc_blocks = fs->desc_blocks; + } else + old_desc_blocks = fs->desc_blocks; + + if (fs->progress_ops && fs->progress_ops->init) + (fs->progress_ops->init)(fs, &progress, NULL, + fs->group_desc_count); + + + for (i = 0; i < fs->group_desc_count; i++) { + blk64_t super_blk, old_desc_blk, new_desc_blk; + + if (fs->progress_ops && fs->progress_ops->update) + (fs->progress_ops->update)(fs, &progress, i); + ext2fs_super_and_bgd_loc2(fs, i, &super_blk, &old_desc_blk, + &new_desc_blk, 0); + + if (!(fs->flags & EXT2_FLAG_MASTER_SB_ONLY) &&i && super_blk) { + retval = write_backup_super(fs, i, super_blk, + super_shadow); + if (retval) + goto errout; + } + if (fs->flags & EXT2_FLAG_SUPER_ONLY) + continue; + if ((old_desc_blk) && + (!(fs->flags & EXT2_FLAG_MASTER_SB_ONLY) || (i == 0))) { + retval = io_channel_write_blk64(fs->io, + old_desc_blk, old_desc_blocks, group_ptr); + if (retval) + goto errout; + } + if (new_desc_blk) { + int meta_bg = i / EXT2_DESC_PER_BLOCK(fs->super); + + retval = io_channel_write_blk64(fs->io, new_desc_blk, + 1, group_ptr + (meta_bg*fs->blocksize)); + if (retval) + goto errout; + } + } + + if (fs->progress_ops && fs->progress_ops->close) + (fs->progress_ops->close)(fs, &progress, NULL); + +write_primary_superblock_only: + /* + * Write out master superblock. This has to be done + * separately, since it is located at a fixed location + * (SUPERBLOCK_OFFSET). We flush all other pending changes + * out to disk first, just to avoid a race condition with an + * insy-tinsy window.... + */ + + fs->super->s_block_group_nr = 0; + fs->super->s_state = fs_state; + fs->super->s_feature_incompat = feature_incompat; +#ifdef WORDS_BIGENDIAN + *super_shadow = *fs->super; + ext2fs_swap_super(super_shadow); +#endif + + retval = ext2fs_superblock_csum_set(fs, super_shadow); + if (retval) + return retval; + + if (!(flags & EXT2_FLAG_FLUSH_NO_SYNC)) { + retval = io_channel_flush(fs->io); + if (retval) + goto errout; + } + retval = write_primary_superblock(fs, super_shadow); + if (retval) + goto errout; + + fs->flags &= ~EXT2_FLAG_DIRTY; + + if (!(flags & EXT2_FLAG_FLUSH_NO_SYNC)) { + retval = io_channel_flush(fs->io); + if (retval) + goto errout; + } +errout: + fs->super->s_state = fs_state; +#ifdef WORDS_BIGENDIAN + if (super_shadow) + ext2fs_free_mem(&super_shadow); + if (group_shadow) + ext2fs_free_mem(&group_shadow); +#endif + return retval; +} + +errcode_t ext2fs_close_free(ext2_filsys *fs_ptr) +{ + errcode_t ret; + ext2_filsys fs = *fs_ptr; + + ret = ext2fs_close2(fs, 0); + if (ret) + ext2fs_free(fs); + *fs_ptr = NULL; + return ret; +} + +errcode_t ext2fs_close(ext2_filsys fs) +{ + return ext2fs_close2(fs, 0); +} + +errcode_t ext2fs_close2(ext2_filsys fs, int flags) +{ + errcode_t retval; + int meta_blks; + io_stats stats = 0; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (fs->write_bitmaps) { + retval = fs->write_bitmaps(fs); + if (retval) + return retval; + } + if (fs->super->s_kbytes_written && + fs->io->manager->get_stats) + fs->io->manager->get_stats(fs->io, &stats); + if (stats && stats->bytes_written && (fs->flags & EXT2_FLAG_RW)) { + fs->super->s_kbytes_written += stats->bytes_written >> 10; + meta_blks = fs->desc_blocks + 1; + if (!(fs->flags & EXT2_FLAG_SUPER_ONLY)) + fs->super->s_kbytes_written += meta_blks / + (fs->blocksize / 1024); + if ((fs->flags & EXT2_FLAG_DIRTY) == 0) + fs->flags |= EXT2_FLAG_SUPER_ONLY | EXT2_FLAG_DIRTY; + } + if (fs->flags & EXT2_FLAG_DIRTY) { + retval = ext2fs_flush2(fs, flags); + if (retval) + return retval; + } + + retval = ext2fs_mmp_stop(fs); + if (retval) + return retval; + + ext2fs_free(fs); + return 0; +} + diff --git a/lib/ext2fs/compiler.h b/lib/ext2fs/compiler.h new file mode 100644 index 0000000..3bb3521 --- /dev/null +++ b/lib/ext2fs/compiler.h @@ -0,0 +1,26 @@ +#ifndef _EXT2FS_COMPILER_H +#define _EXT2FS_COMPILER_H + +#include <stddef.h> + +#ifdef __GNUC__ + +#ifndef __GNUC_PREREQ +#if defined(__GNUC__) && defined(__GNUC_MINOR__) +#define __GNUC_PREREQ(maj, min) \ + ((__GNUC__ << 16) + __GNUC_MINOR__ >= ((maj) << 16) + (min)) +#else +#define __GNUC_PREREQ(maj, min) 0 +#endif +#endif + +#define container_of(ptr, type, member) ({ \ + __typeof__( ((type *)0)->member ) *__mptr = (ptr); \ + (type *)( (char *)__mptr - offsetof(type,member) );}) +#else +#define container_of(ptr, type, member) \ + ((type *)((char *)(ptr) - offsetof(type, member))) +#endif + + +#endif /* _EXT2FS_COMPILER_H */ diff --git a/lib/ext2fs/crc16.c b/lib/ext2fs/crc16.c new file mode 100644 index 0000000..2fdeb24 --- /dev/null +++ b/lib/ext2fs/crc16.c @@ -0,0 +1,74 @@ +/* + * crc16.c + * + * This source code is licensed under the GNU General Public License, + * Version 2. See the file COPYING for more details. + */ + +#include "config.h" +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#include <ext2fs/ext2_types.h> + +#include "crc16.h" + +/** CRC table for the CRC-16. The poly is 0x8005 (x16 + x15 + x2 + 1) */ +static __u16 const crc16_table[256] = { + 0x0000, 0xC0C1, 0xC181, 0x0140, 0xC301, 0x03C0, 0x0280, 0xC241, + 0xC601, 0x06C0, 0x0780, 0xC741, 0x0500, 0xC5C1, 0xC481, 0x0440, + 0xCC01, 0x0CC0, 0x0D80, 0xCD41, 0x0F00, 0xCFC1, 0xCE81, 0x0E40, + 0x0A00, 0xCAC1, 0xCB81, 0x0B40, 0xC901, 0x09C0, 0x0880, 0xC841, + 0xD801, 0x18C0, 0x1980, 0xD941, 0x1B00, 0xDBC1, 0xDA81, 0x1A40, + 0x1E00, 0xDEC1, 0xDF81, 0x1F40, 0xDD01, 0x1DC0, 0x1C80, 0xDC41, + 0x1400, 0xD4C1, 0xD581, 0x1540, 0xD701, 0x17C0, 0x1680, 0xD641, + 0xD201, 0x12C0, 0x1380, 0xD341, 0x1100, 0xD1C1, 0xD081, 0x1040, + 0xF001, 0x30C0, 0x3180, 0xF141, 0x3300, 0xF3C1, 0xF281, 0x3240, + 0x3600, 0xF6C1, 0xF781, 0x3740, 0xF501, 0x35C0, 0x3480, 0xF441, + 0x3C00, 0xFCC1, 0xFD81, 0x3D40, 0xFF01, 0x3FC0, 0x3E80, 0xFE41, + 0xFA01, 0x3AC0, 0x3B80, 0xFB41, 0x3900, 0xF9C1, 0xF881, 0x3840, + 0x2800, 0xE8C1, 0xE981, 0x2940, 0xEB01, 0x2BC0, 0x2A80, 0xEA41, + 0xEE01, 0x2EC0, 0x2F80, 0xEF41, 0x2D00, 0xEDC1, 0xEC81, 0x2C40, + 0xE401, 0x24C0, 0x2580, 0xE541, 0x2700, 0xE7C1, 0xE681, 0x2640, + 0x2200, 0xE2C1, 0xE381, 0x2340, 0xE101, 0x21C0, 0x2080, 0xE041, + 0xA001, 0x60C0, 0x6180, 0xA141, 0x6300, 0xA3C1, 0xA281, 0x6240, + 0x6600, 0xA6C1, 0xA781, 0x6740, 0xA501, 0x65C0, 0x6480, 0xA441, + 0x6C00, 0xACC1, 0xAD81, 0x6D40, 0xAF01, 0x6FC0, 0x6E80, 0xAE41, + 0xAA01, 0x6AC0, 0x6B80, 0xAB41, 0x6900, 0xA9C1, 0xA881, 0x6840, + 0x7800, 0xB8C1, 0xB981, 0x7940, 0xBB01, 0x7BC0, 0x7A80, 0xBA41, + 0xBE01, 0x7EC0, 0x7F80, 0xBF41, 0x7D00, 0xBDC1, 0xBC81, 0x7C40, + 0xB401, 0x74C0, 0x7580, 0xB541, 0x7700, 0xB7C1, 0xB681, 0x7640, + 0x7200, 0xB2C1, 0xB381, 0x7340, 0xB101, 0x71C0, 0x7080, 0xB041, + 0x5000, 0x90C1, 0x9181, 0x5140, 0x9301, 0x53C0, 0x5280, 0x9241, + 0x9601, 0x56C0, 0x5780, 0x9741, 0x5500, 0x95C1, 0x9481, 0x5440, + 0x9C01, 0x5CC0, 0x5D80, 0x9D41, 0x5F00, 0x9FC1, 0x9E81, 0x5E40, + 0x5A00, 0x9AC1, 0x9B81, 0x5B40, 0x9901, 0x59C0, 0x5880, 0x9841, + 0x8801, 0x48C0, 0x4980, 0x8941, 0x4B00, 0x8BC1, 0x8A81, 0x4A40, + 0x4E00, 0x8EC1, 0x8F81, 0x4F40, 0x8D01, 0x4DC0, 0x4C80, 0x8C41, + 0x4400, 0x84C1, 0x8581, 0x4540, 0x8701, 0x47C0, 0x4680, 0x8641, + 0x8201, 0x42C0, 0x4380, 0x8341, 0x4100, 0x81C1, 0x8081, 0x4040 +}; + +/** + * Compute the CRC-16 for the data buffer + * + * @param crc previous CRC value + * @param buffer data pointer + * @param len number of bytes in the buffer + * @return the updated CRC value + */ +crc16_t ext2fs_crc16(crc16_t crc, const void *buffer, unsigned int len) +{ + const unsigned char *cp = buffer; + + while (len--) + /* + * for an unknown reason, PPC treats __u16 as signed + * and keeps doing sign extension on the value. + * Instead, use only the low 16 bits of an unsigned + * int for holding the CRC value to avoid this. + */ + crc = (((crc >> 8) & 0xffU) ^ + crc16_table[(crc ^ *cp++) & 0xffU]) & 0x0000ffffU; + return crc; +} diff --git a/lib/ext2fs/crc16.h b/lib/ext2fs/crc16.h new file mode 100644 index 0000000..322e68d --- /dev/null +++ b/lib/ext2fs/crc16.h @@ -0,0 +1,26 @@ +/* + * crc16.h - CRC-16 routine + * + * Implements the standard CRC-16: + * Width 16 + * Poly 0x8005 (x16 + x15 + x2 + 1) + * Init 0 + * + * Copyright (c) 2005 Ben Gardner <bgardner@wabtec.com> + * + * This source code is licensed under the GNU General Public License, + * Version 2. See the file COPYING for more details. + */ + +#ifndef __CRC16_H +#define __CRC16_H + +/* for an unknown reason, PPC treats __u16 as signed and keeps doing sign + * extension on the value. Instead, use only the low 16 bits of an + * unsigned int for holding the CRC value to avoid this. + */ +typedef unsigned int crc16_t; + +extern crc16_t ext2fs_crc16(crc16_t crc, const void *buffer, unsigned int len); + +#endif /* __CRC16_H */ diff --git a/lib/ext2fs/crc32c.c b/lib/ext2fs/crc32c.c new file mode 100644 index 0000000..df5cf9b --- /dev/null +++ b/lib/ext2fs/crc32c.c @@ -0,0 +1,938 @@ +/* + * crc32c.c + * + * August 26, 2011 Darrick J. Wong <djwong at us.ibm.com> + * Reuse Bob Pearson's slice-by-8 implementation for e2fsprogs. + * + * July 20, 2011 Bob Pearson <rpearson at systemfabricworks.com> + * added slice by 8 algorithm to the existing conventional and + * slice by 4 algorithms. + * + * Oct 15, 2000 Matt Domsch <Matt_Domsch@dell.com> + * Nicer crc32 functions/docs submitted by linux@horizon.com. Thanks! + * Code was from the public domain, copyright abandoned. Code was + * subsequently included in the kernel, thus was re-licensed under the + * GNU GPL v2. + * + * Oct 12, 2000 Matt Domsch <Matt_Domsch@dell.com> + * Same crc32 function was used in 5 other places in the kernel. + * I made one version, and deleted the others. + * There are various incantations of crc32(). Some use a seed of 0 or ~0. + * Some xor at the end with ~0. The generic crc32() function takes + * seed as an argument, and doesn't xor at the end. Then individual + * users can do whatever they need. + * drivers/net/smc9194.c uses seed ~0, doesn't xor with ~0. + * fs/jffs2 uses seed 0, doesn't xor with ~0. + * fs/partitions/efi.c uses seed ~0, xor's with ~0. + * + * This source code is licensed under the GNU General Public License, + * Version 2. See the file COPYING for more details. + */ +#include "config.h" +#include <stdint.h> +#include <stdlib.h> +#include <stdio.h> +#define min(x, y) ((x) > (y) ? (y) : (x)) +#define __ALIGN_KERNEL_MASK(x, mask) (((x) + (mask)) & ~(mask)) +#define __ALIGN_KERNEL(x, a) __ALIGN_KERNEL_MASK(x, (__typeof__(x))(a) - 1) +#define ALIGN(x, a) __ALIGN_KERNEL((x), (a)) +#define PTR_ALIGN(p, a) ((__typeof__(p))ALIGN((unsigned long)(p), (a))) +#include "crc32c_defs.h" + +#include "ext2fs.h" +#ifdef WORDS_BIGENDIAN +#define __constant_cpu_to_le32(x) ___constant_swab32((x)) +#define __constant_cpu_to_be32(x) (x) +#define __be32_to_cpu(x) (x) +#define __cpu_to_be32(x) (x) +#define __cpu_to_le32(x) (ext2fs_cpu_to_le32((x))) +#define __le32_to_cpu(x) (ext2fs_le32_to_cpu((x))) +#else +#define __constant_cpu_to_le32(x) (x) +#define __constant_cpu_to_be32(x) ___constant_swab32((x)) +#define __be32_to_cpu(x) (ext2fs_be32_to_cpu((x))) +#define __cpu_to_be32(x) (ext2fs_cpu_to_be32((x))) +#define __cpu_to_le32(x) (x) +#define __le32_to_cpu(x) (x) +#endif + +#if CRC_LE_BITS > 8 +# define tole(x) __constant_cpu_to_le32(x) +#else +# define tole(x) (x) +#endif + +#if CRC_BE_BITS > 8 +# define tobe(x) __constant_cpu_to_be32(x) +#else +# define tobe(x) (x) +#endif + +#include "crc32c_table.h" + +#if CRC_LE_BITS > 8 || CRC_BE_BITS > 8 + +#if CRC_LE_BITS < 64 && CRC_BE_BITS < 64 +#define CRC_INLINE inline +#else +#define CRC_INLINE +#endif + +/* implements slicing-by-4 or slicing-by-8 algorithm */ +static CRC_INLINE uint32_t +crc32_body(uint32_t crc, unsigned char const *buf, size_t len, + const uint32_t (*tab)[256]) +{ +# ifndef WORDS_BIGENDIAN +# define DO_CRC(x) (crc = t0[(crc ^ (x)) & 255] ^ (crc >> 8)) +# define DO_CRC4 (t3[(q) & 255] ^ t2[(q >> 8) & 255] ^ \ + t1[(q >> 16) & 255] ^ t0[(q >> 24) & 255]) +# define DO_CRC8 (t7[(q) & 255] ^ t6[(q >> 8) & 255] ^ \ + t5[(q >> 16) & 255] ^ t4[(q >> 24) & 255]) +# else +# define DO_CRC(x) (crc = t0[((crc >> 24) ^ (x)) & 255] ^ (crc << 8)) +# define DO_CRC4 (t0[(q) & 255] ^ t1[(q >> 8) & 255] ^ \ + t2[(q >> 16) & 255] ^ t3[(q >> 24) & 255]) +# define DO_CRC8 (t4[(q) & 255] ^ t5[(q >> 8) & 255] ^ \ + t6[(q >> 16) & 255] ^ t7[(q >> 24) & 255]) +# endif + const uint32_t *b; + size_t rem_len; + const uint32_t *t0 = tab[0], *t1 = tab[1], *t2 = tab[2], *t3 = tab[3]; + const uint32_t *t4 = tab[4], *t5 = tab[5], *t6 = tab[6], *t7 = tab[7]; + uint32_t q; + + /* Align it */ + if (unlikely((uintptr_t)buf & 3 && len)) { + do { + DO_CRC(*buf++); + } while ((--len) && ((uintptr_t)buf)&3); + } + +# if CRC_LE_BITS == 32 + rem_len = len & 3; + len = len >> 2; +# else + rem_len = len & 7; + len = len >> 3; +# endif + + b = (const uint32_t *)buf; + for (--b; len; --len) { + q = crc ^ *++b; /* use pre increment for speed */ +# if CRC_LE_BITS == 32 + crc = DO_CRC4; +# else + crc = DO_CRC8; + q = *++b; + crc ^= DO_CRC4; +# endif + } + len = rem_len; + /* And the last few bytes */ + if (len) { + const uint8_t *p = (const uint8_t *)(b + 1) - 1; + do { + DO_CRC(*++p); /* use pre increment for speed */ + } while (--len); + } + return crc; +#undef DO_CRC +#undef DO_CRC4 +#undef DO_CRC8 +} +#endif + +/** + * crc32_le() - Calculate bitwise little-endian Ethernet AUTODIN II CRC32 + * @crc: seed value for computation. ~0 for Ethernet, sometimes 0 for + * other uses, or the previous crc32 value if computing incrementally. + * @p: pointer to buffer over which CRC is run + * @len: length of buffer @p + */ +static inline uint32_t crc32_le_generic(uint32_t crc, unsigned char const *p, + size_t len, const uint32_t (*tab)[256], + uint32_t polynomial EXT2FS_ATTR((unused))) +{ +#if CRC_LE_BITS == 1 + int i; + while (len--) { + crc ^= *p++; + for (i = 0; i < 8; i++) + crc = (crc >> 1) ^ ((crc & 1) ? polynomial : 0); + } +# elif CRC_LE_BITS == 2 + while (len--) { + crc ^= *p++; + crc = (crc >> 2) ^ tab[0][crc & 3]; + crc = (crc >> 2) ^ tab[0][crc & 3]; + crc = (crc >> 2) ^ tab[0][crc & 3]; + crc = (crc >> 2) ^ tab[0][crc & 3]; + } +# elif CRC_LE_BITS == 4 + while (len--) { + crc ^= *p++; + crc = (crc >> 4) ^ tab[0][crc & 15]; + crc = (crc >> 4) ^ tab[0][crc & 15]; + } +# elif CRC_LE_BITS == 8 + /* aka Sarwate algorithm */ + while (len--) { + crc ^= *p++; + crc = (crc >> 8) ^ tab[0][crc & 255]; + } +# else + crc = __cpu_to_le32(crc); + crc = crc32_body(crc, p, len, tab); + crc = __le32_to_cpu(crc); +#endif + return crc; +} + +uint32_t ext2fs_crc32c_le(uint32_t crc, unsigned char const *p, size_t len) +{ + return crc32_le_generic(crc, p, len, crc32ctable_le, CRC32C_POLY_LE); +} + +/** + * crc32_be() - Calculate bitwise big-endian Ethernet AUTODIN II CRC32 + * @crc: seed value for computation. ~0 for Ethernet, sometimes 0 for + * other uses, or the previous crc32 value if computing incrementally. + * @p: pointer to buffer over which CRC is run + * @len: length of buffer @p + */ +static inline uint32_t crc32_be_generic(uint32_t crc, unsigned char const *p, + size_t len, const uint32_t (*tab)[256], + uint32_t polynomial EXT2FS_ATTR((unused))) +{ +#if CRC_BE_BITS == 1 + int i; + while (len--) { + crc ^= *p++ << 24; + for (i = 0; i < 8; i++) + crc = + (crc << 1) ^ ((crc & 0x80000000) ? polynomial : + 0); + } +# elif CRC_BE_BITS == 2 + while (len--) { + crc ^= *p++ << 24; + crc = (crc << 2) ^ tab[0][crc >> 30]; + crc = (crc << 2) ^ tab[0][crc >> 30]; + crc = (crc << 2) ^ tab[0][crc >> 30]; + crc = (crc << 2) ^ tab[0][crc >> 30]; + } +# elif CRC_BE_BITS == 4 + while (len--) { + crc ^= *p++ << 24; + crc = (crc << 4) ^ tab[0][crc >> 28]; + crc = (crc << 4) ^ tab[0][crc >> 28]; + } +# elif CRC_BE_BITS == 8 + while (len--) { + crc ^= *p++ << 24; + crc = (crc << 8) ^ tab[0][crc >> 24]; + } +# else + crc = __cpu_to_be32(crc); + crc = crc32_body(crc, p, len, tab); + crc = __be32_to_cpu(crc); +# endif + return crc; +} + +uint32_t ext2fs_crc32_be(uint32_t crc, unsigned char const *p, size_t len) +{ + return crc32_be_generic(crc, p, len, crc32table_be, CRCPOLY_BE); +} + +#ifdef UNITTEST +static uint8_t test_buf[] = { + 0xd9, 0xd7, 0x6a, 0x13, 0x3a, 0xb1, 0x05, 0x48, + 0xda, 0xad, 0x14, 0xbd, 0x03, 0x3a, 0x58, 0x5e, + 0x6e, 0xd1, 0x56, 0xc9, 0x2e, 0xc4, 0xcb, 0x6b, + 0xe8, 0x77, 0x52, 0x37, 0x4e, 0x0f, 0x55, 0xd2, + 0x12, 0x65, 0x90, 0xc2, 0x41, 0x49, 0x81, 0x01, + 0xf5, 0x01, 0xeb, 0x2d, 0x78, 0x74, 0x23, 0x5d, + 0x84, 0x5c, 0x81, 0x92, 0x21, 0xe9, 0x8d, 0x1d, + 0x89, 0xf2, 0x4a, 0xac, 0xdd, 0xf9, 0xaf, 0xee, + 0x44, 0xe7, 0x6e, 0xed, 0xfb, 0xd8, 0x89, 0x0e, + 0x96, 0x62, 0xcd, 0xa4, 0x4b, 0xa9, 0xe5, 0x45, + 0xb1, 0x29, 0x9b, 0x0f, 0xfc, 0xbd, 0x83, 0xab, + 0xa8, 0x54, 0x96, 0x44, 0x2c, 0x7f, 0xbb, 0xe7, + 0x52, 0x29, 0x08, 0xee, 0x14, 0xc5, 0xc2, 0xec, + 0x5a, 0xeb, 0x40, 0x40, 0xea, 0xd1, 0x3d, 0x15, + 0x73, 0xaa, 0x8c, 0x73, 0xfc, 0xf2, 0x2b, 0x49, + 0x0b, 0x13, 0x96, 0xd9, 0x8e, 0x4b, 0xbc, 0xe0, + 0xf4, 0xd2, 0xe0, 0x2e, 0x7a, 0xf0, 0x5d, 0x1f, + 0xd2, 0x92, 0x97, 0xe0, 0xaa, 0x59, 0xab, 0xc9, + 0x5c, 0xa6, 0x51, 0x1a, 0xe3, 0xd6, 0x06, 0xb9, + 0xae, 0xb8, 0x76, 0x36, 0x79, 0x37, 0x52, 0xf6, + 0x34, 0xaf, 0x27, 0x19, 0xe1, 0xc0, 0x2b, 0xdd, + 0x01, 0x15, 0xcd, 0xce, 0x44, 0xf6, 0x4c, 0x18, + 0x92, 0x69, 0xbe, 0x8a, 0x76, 0x23, 0x52, 0x13, + 0x3f, 0xf9, 0xe0, 0xf5, 0x06, 0x28, 0x7c, 0xc7, + 0xf3, 0x42, 0x0f, 0xdd, 0x40, 0x33, 0xf7, 0x99, + 0xe2, 0xad, 0x26, 0xd9, 0x53, 0x10, 0x72, 0x0c, + 0x4e, 0x43, 0x4c, 0x61, 0xfe, 0xd9, 0xc1, 0x16, + 0xa1, 0x93, 0xca, 0x3c, 0x75, 0x7f, 0x07, 0x7a, + 0x65, 0xb3, 0x53, 0x2a, 0x52, 0x00, 0xa0, 0x62, + 0xe0, 0xa3, 0x1f, 0xad, 0xd7, 0xbb, 0xc0, 0x83, + 0x5d, 0x54, 0x87, 0x5f, 0xc8, 0x2f, 0xc8, 0xbf, + 0x69, 0x04, 0x91, 0xc8, 0xa6, 0x1d, 0x4d, 0x46, + 0x91, 0xfc, 0x26, 0xf4, 0x16, 0xd1, 0xa4, 0xbf, + 0x5c, 0xa2, 0x6c, 0xdd, 0xb4, 0x40, 0xf2, 0x2e, + 0xa2, 0xad, 0xf7, 0xf4, 0xa5, 0x8a, 0x3e, 0x23, + 0x64, 0x08, 0xc8, 0xa1, 0xa0, 0xf0, 0x5d, 0x70, + 0xd2, 0x77, 0xfd, 0xc8, 0x50, 0x83, 0x0f, 0xd6, + 0x2b, 0xe4, 0x1f, 0x52, 0x34, 0x33, 0x68, 0xfd, + 0x92, 0xbe, 0x9f, 0x97, 0x6b, 0x8d, 0x81, 0x91, + 0x0f, 0xef, 0x65, 0xc8, 0x0d, 0x15, 0x01, 0x77, + 0x58, 0xb2, 0xf4, 0x1b, 0x06, 0x7e, 0xf5, 0xca, + 0x15, 0x2e, 0x38, 0xd8, 0x81, 0x1c, 0x1c, 0xa0, + 0xb6, 0x13, 0x6a, 0x2b, 0x71, 0x34, 0x52, 0xd7, + 0x1d, 0xbd, 0x37, 0x59, 0xbc, 0x86, 0x25, 0x2b, + 0xa8, 0x93, 0xce, 0x1a, 0x03, 0x16, 0xfe, 0x01, + 0x57, 0x99, 0x24, 0x25, 0x2c, 0xb3, 0xab, 0x1e, + 0x2d, 0x65, 0x20, 0x89, 0x17, 0x02, 0x0e, 0x0a, + 0xf5, 0x1e, 0xc7, 0xff, 0x1f, 0x61, 0xa9, 0x54, + 0x18, 0xd4, 0xba, 0x50, 0x57, 0x02, 0xa1, 0xab, + 0x22, 0x2e, 0x07, 0xea, 0xa9, 0xa3, 0x83, 0x4f, + 0x27, 0xf5, 0xc5, 0xee, 0x3c, 0x3b, 0x10, 0xad, + 0x32, 0x2b, 0x1c, 0x03, 0xcb, 0xaf, 0x98, 0x83, + 0x54, 0xc3, 0x68, 0x63, 0xd4, 0xe0, 0x0e, 0x3c, + 0x1a, 0x4e, 0xc0, 0x81, 0xd0, 0xe8, 0x6a, 0x62, + 0x6b, 0x3e, 0x6f, 0xc4, 0xc6, 0x33, 0x4e, 0x26, + 0x21, 0xf5, 0x04, 0xdf, 0xfa, 0xce, 0x45, 0xaf, + 0xdc, 0x5e, 0x1b, 0xad, 0x93, 0xca, 0xf5, 0xcf, + 0xd7, 0xee, 0x0c, 0x5c, 0x5e, 0xb4, 0xf0, 0x92, + 0xd2, 0xf2, 0xf0, 0xa9, 0x1e, 0xab, 0x80, 0x68, + 0x46, 0xef, 0xcc, 0x26, 0x0c, 0x5c, 0xdd, 0x4e, + 0x83, 0xb8, 0xb9, 0x53, 0x6e, 0xf8, 0x93, 0x38, + 0x67, 0xa4, 0x41, 0x87, 0x72, 0xe7, 0x7e, 0x86, + 0xc9, 0x49, 0x00, 0x33, 0xb1, 0x38, 0x6c, 0x71, + 0xd7, 0x1d, 0x8e, 0x61, 0x01, 0xb6, 0x57, 0xa9, + 0xf1, 0xac, 0x15, 0xc2, 0x83, 0x77, 0xca, 0x64, + 0xca, 0x7b, 0x6c, 0xa1, 0x10, 0x1b, 0x13, 0xd0, + 0xd3, 0x9e, 0x9e, 0x10, 0x70, 0xc8, 0x1a, 0xbb, + 0x3f, 0x19, 0x86, 0xab, 0x01, 0x0e, 0xea, 0x34, + 0x22, 0xea, 0xe2, 0x15, 0xb7, 0xed, 0x21, 0x21, + 0x75, 0xa5, 0xe7, 0x08, 0xa1, 0x38, 0xe0, 0x91, + 0x05, 0x60, 0xea, 0xa7, 0x50, 0x27, 0x18, 0x07, + 0x9d, 0xe0, 0x18, 0x2b, 0xd4, 0x07, 0x59, 0x00, + 0xe6, 0x45, 0x18, 0x2a, 0x30, 0x6e, 0xf3, 0xb4, + 0xd0, 0xef, 0xa6, 0x5b, 0x71, 0xa2, 0x5a, 0x3b, + 0x89, 0x4c, 0xaf, 0x3f, 0xcb, 0x9f, 0x03, 0xfb, + 0x43, 0x7c, 0x6b, 0xd3, 0x6a, 0xea, 0xce, 0x4a, + 0x5f, 0x64, 0xb5, 0x62, 0xda, 0x5d, 0x27, 0xb7, + 0xb8, 0x11, 0xca, 0x33, 0x30, 0xec, 0x70, 0xf0, + 0x1b, 0x03, 0x50, 0xff, 0x5e, 0xa6, 0x08, 0xde, + 0x37, 0x70, 0xc0, 0x81, 0x55, 0x60, 0x17, 0xa1, + 0x85, 0xae, 0x26, 0x44, 0xe4, 0x67, 0x3c, 0x91, + 0xfd, 0xc4, 0x3d, 0x97, 0x72, 0x23, 0xf3, 0x3c, + 0x8f, 0xe0, 0xe2, 0xf2, 0x09, 0x96, 0x10, 0x67, + 0xb5, 0xfe, 0xff, 0x3d, 0x4a, 0xc8, 0x62, 0x11, + 0xa5, 0x98, 0xc1, 0x2d, 0x40, 0x82, 0x88, 0x8b, + 0xe5, 0xb0, 0x75, 0xbf, 0x2f, 0xa8, 0x6a, 0x55, + 0x49, 0x2e, 0x9c, 0x29, 0xd2, 0x7c, 0xbf, 0xf3, + 0xaa, 0x3a, 0x16, 0x4a, 0xa4, 0x15, 0xf3, 0x48, + 0xde, 0x38, 0x13, 0x44, 0x26, 0x02, 0xe6, 0xe9, + 0xa8, 0x24, 0x89, 0xb5, 0x43, 0x95, 0xe4, 0x4c, + 0xc3, 0xa0, 0xdf, 0xcc, 0x42, 0xf8, 0x8d, 0xb0, + 0x3b, 0xea, 0x10, 0xb7, 0xe1, 0x40, 0x54, 0xb9, + 0xa3, 0x2d, 0xfb, 0xb4, 0x91, 0xc0, 0x3e, 0x94, + 0xf1, 0xa1, 0x3c, 0xbe, 0xef, 0xb8, 0x70, 0x55, + 0x0a, 0x26, 0x93, 0xbf, 0xe6, 0x21, 0x92, 0x32, + 0x3c, 0x39, 0x27, 0x6a, 0x23, 0x48, 0x02, 0x35, + 0x3c, 0xd4, 0xcc, 0x04, 0xc0, 0x4e, 0xa7, 0x02, + 0x63, 0x37, 0xc2, 0xb8, 0x56, 0x1d, 0x57, 0x57, + 0x42, 0x04, 0x8d, 0xee, 0xcf, 0x8b, 0xc9, 0xc3, + 0xba, 0x3b, 0x15, 0xd7, 0xaf, 0xbf, 0x9e, 0xcd, + 0x44, 0xcf, 0xf0, 0x00, 0xb7, 0x3a, 0xfc, 0xa8, + 0x12, 0xab, 0x3a, 0x62, 0x01, 0x21, 0x46, 0xe9, + 0x1e, 0x48, 0x37, 0xfc, 0x13, 0x4d, 0xf6, 0x2a, + 0x72, 0x40, 0x75, 0x38, 0x71, 0xf2, 0x17, 0x20, + 0x2c, 0xdd, 0xc0, 0x49, 0xbc, 0x63, 0x33, 0xea, + 0x06, 0x75, 0x41, 0xe7, 0x5c, 0x1f, 0xfb, 0xf9, + 0x68, 0x83, 0xc2, 0x5a, 0x4a, 0x1e, 0x61, 0x08, + 0x57, 0xf3, 0x00, 0xba, 0x77, 0x92, 0x63, 0xa5, + 0xb7, 0xfe, 0x97, 0x22, 0xda, 0x5e, 0xd3, 0xaf, + 0xbc, 0x89, 0x0d, 0x4c, 0x37, 0xa9, 0x27, 0x4a, + 0x7f, 0xdb, 0x81, 0x39, 0x11, 0x86, 0x12, 0xf9, + 0x10, 0x50, 0xe4, 0xdb, 0x72, 0xf9, 0xae, 0x10, + 0x7c, 0xed, 0x50, 0x5c, 0x61, 0xeb, 0x42, 0x1e, + 0xa4, 0xf4, 0xf0, 0xfa, 0x45, 0x4d, 0x95, 0x2b, + 0xd4, 0x67, 0x4a, 0xe3, 0x8a, 0x15, 0x55, 0x92, + 0x77, 0x64, 0x8c, 0x51, 0x38, 0xf9, 0x26, 0x3e, + 0x68, 0xe2, 0xac, 0xbb, 0x64, 0x77, 0xe2, 0x82, + 0xa4, 0x42, 0x41, 0x38, 0xa0, 0xf0, 0xc9, 0xd8, + 0x6c, 0xe0, 0xef, 0x4c, 0xda, 0xb4, 0x92, 0xef, + 0x1b, 0xe3, 0x9b, 0xc1, 0x44, 0x3c, 0xb9, 0xb7, + 0x39, 0xac, 0x5c, 0x32, 0x39, 0xb4, 0x21, 0x85, + 0x93, 0xbc, 0xf2, 0x51, 0x43, 0xb7, 0xae, 0x1e, + 0x61, 0x9c, 0x38, 0x9c, 0xaa, 0xff, 0xde, 0xfc, + 0xbf, 0x85, 0xef, 0x17, 0x34, 0x36, 0x71, 0x5f, + 0x04, 0x16, 0xa6, 0x9e, 0xfd, 0x3a, 0x03, 0xd8, + 0xbf, 0x71, 0x70, 0x20, 0x8f, 0x7c, 0xfb, 0xff, + 0x61, 0xe0, 0xe2, 0x60, 0xa7, 0xb1, 0xc0, 0xe0, + 0xd9, 0x3f, 0xdc, 0x8d, 0x4a, 0xa4, 0x52, 0x61, + 0xaf, 0x9d, 0xdf, 0x8a, 0x0d, 0x41, 0xc0, 0x25, + 0x68, 0x12, 0x7b, 0xd5, 0xc7, 0xdb, 0x68, 0x70, + 0x2d, 0x7d, 0x95, 0x12, 0x03, 0x23, 0x0c, 0xe8, + 0x14, 0x41, 0x11, 0x28, 0xec, 0x9d, 0xd3, 0x28, + 0x77, 0x7a, 0x3c, 0x93, 0x8e, 0x5c, 0x7e, 0xb3, + 0x42, 0x9a, 0x18, 0x25, 0x93, 0xc8, 0xea, 0x43, + 0x1b, 0xbe, 0xd5, 0x27, 0xf1, 0xd4, 0xe0, 0x1e, + 0xce, 0xc7, 0xc7, 0x2c, 0x25, 0x35, 0x58, 0xb8, + 0x6c, 0xf3, 0xa2, 0xad, 0xe7, 0x58, 0x49, 0x47, + 0xf7, 0xca, 0xde, 0x8b, 0x81, 0xb7, 0x75, 0xf4, + 0x95, 0xa7, 0x5c, 0xc3, 0x2c, 0x0e, 0x1c, 0x52, + 0x9a, 0xc3, 0x2a, 0x00, 0x21, 0xa7, 0x51, 0x6b, + 0xf0, 0x05, 0x87, 0x8c, 0x42, 0x1b, 0xc3, 0x2e, + 0xa3, 0x76, 0x22, 0xd5, 0x7f, 0x56, 0x10, 0xef, + 0x98, 0x85, 0x65, 0x86, 0x71, 0x87, 0xd2, 0x8c, + 0xc0, 0x47, 0x20, 0xe8, 0xb5, 0x1c, 0xe3, 0xdd, + 0x3c, 0x5c, 0x03, 0xbb, 0x0e, 0x97, 0x3b, 0xe1, + 0x56, 0x9a, 0xd5, 0x0a, 0x63, 0xd5, 0x33, 0xaf, + 0x36, 0xca, 0xcf, 0x8f, 0x00, 0x28, 0xa3, 0x45, + 0xb8, 0xcd, 0xde, 0x73, 0xd4, 0xfa, 0x2d, 0x6f, + 0xdb, 0x93, 0xaa, 0xdd, 0x7f, 0xd2, 0x22, 0x9c, + 0x96, 0x48, 0x1e, 0xa8, 0x63, 0xbe, 0xbc, 0x0d, + 0x14, 0x3c, 0x2e, 0x11, 0x1f, 0xd2, 0xf4, 0x57, + 0xb3, 0x47, 0xf8, 0xa6, 0x1b, 0xc3, 0xa7, 0x95, + 0x2d, 0xd4, 0xca, 0xb8, 0x0d, 0xfb, 0x06, 0x85, + 0xda, 0x63, 0xf0, 0x3e, 0x9d, 0x5e, 0xee, 0xce, + 0xed, 0x74, 0x1d, 0x2c, 0x97, 0x3f, 0x71, 0x95, + 0x12, 0x03, 0xc5, 0x92, 0x46, 0x84, 0x1b, 0x07, + 0xe6, 0xb4, 0x1d, 0x3a, 0xf1, 0x89, 0x90, 0x50, + 0x10, 0x29, 0x34, 0xc0, 0x90, 0xbe, 0x4a, 0xa9, + 0x0d, 0xb0, 0x7b, 0xfb, 0x35, 0xee, 0x4e, 0x34, + 0xec, 0x5a, 0x58, 0xbc, 0xb8, 0xda, 0x38, 0x88, + 0x8c, 0x74, 0x1e, 0xc9, 0xab, 0x78, 0x2e, 0x2a, + 0x17, 0x8a, 0x43, 0x3d, 0xa1, 0x2a, 0x41, 0xb5, + 0xd6, 0xe8, 0x5b, 0xc5, 0x4a, 0x1c, 0x3c, 0x9f, + 0x8d, 0x3a, 0x69, 0x88, 0xf8, 0x80, 0xd2, 0x11, + 0xfc, 0x7e, 0x80, 0x8e, 0x7f, 0x85, 0x64, 0x9c, + 0x46, 0x58, 0xc8, 0x48, 0x98, 0x4b, 0xf5, 0x73, + 0x3f, 0x49, 0xce, 0x53, 0x2c, 0xd5, 0xfc, 0x33, + 0xf1, 0x6f, 0xd8, 0xe9, 0x2e, 0x70, 0x2e, 0xdc, + 0xe5, 0x43, 0x80, 0x38, 0xf2, 0x87, 0xed, 0x85, + 0xe4, 0x3e, 0x45, 0x14, 0x20, 0xcf, 0xa0, 0x61, + 0x4f, 0xe8, 0xd7, 0x5b, 0xb3, 0x0d, 0x0e, 0x4e, + 0x4d, 0xce, 0xbe, 0xba, 0xaa, 0x90, 0x09, 0xcb, + 0x4b, 0x5d, 0x08, 0xff, 0x52, 0xd5, 0x23, 0xbc, + 0xad, 0x8d, 0xd3, 0x06, 0x4a, 0xa0, 0x51, 0x56, + 0xa7, 0xd8, 0x33, 0xab, 0xbc, 0xd0, 0xdf, 0x92, + 0x87, 0x20, 0x2d, 0x7b, 0x5e, 0xfa, 0x30, 0xa7, + 0x06, 0x06, 0xe5, 0x4f, 0x2c, 0xb5, 0x61, 0xd7, + 0x54, 0xd3, 0xdf, 0xd0, 0x0a, 0xb0, 0x06, 0xce, + 0xf6, 0x86, 0xb7, 0x8e, 0xaa, 0x7b, 0x78, 0xd5, + 0xb9, 0xeb, 0x07, 0xac, 0x5f, 0xc5, 0xd2, 0x8c, + 0x40, 0xe0, 0x7f, 0x98, 0xd4, 0xe5, 0x4b, 0xca, + 0xfb, 0x47, 0xef, 0xef, 0xb9, 0x4d, 0x6d, 0x8f, + 0x82, 0x68, 0x74, 0x84, 0xe0, 0x0a, 0x93, 0x0f, + 0xb2, 0x01, 0xa9, 0x9f, 0x68, 0x6a, 0xe8, 0xf7, + 0xfb, 0x0b, 0xde, 0x17, 0xe0, 0x30, 0x38, 0x51, + 0xbc, 0x07, 0xb8, 0x2c, 0x91, 0x0f, 0xc1, 0x0e, + 0xa6, 0xf9, 0xf0, 0xd5, 0x48, 0x76, 0x8a, 0xde, + 0x74, 0xe3, 0x30, 0x65, 0x56, 0xb3, 0x5c, 0xe2, + 0x89, 0x8d, 0xda, 0x80, 0xad, 0x0f, 0x22, 0xfb, + 0x24, 0x1d, 0x16, 0xdd, 0x34, 0x4b, 0x90, 0x58, + 0x4e, 0x0c, 0x13, 0x28, 0xcf, 0x1d, 0xa4, 0xaa, + 0xb7, 0xf3, 0xb1, 0x66, 0xad, 0x3b, 0xcf, 0x79, + 0x12, 0x04, 0xd7, 0x79, 0xd9, 0x5f, 0xdf, 0x89, + 0xb2, 0x5b, 0xa7, 0x9a, 0x26, 0x1e, 0x67, 0x46, + 0x7c, 0x66, 0x95, 0x67, 0xe6, 0x45, 0x8b, 0x1f, + 0x65, 0x79, 0x9f, 0x6d, 0x11, 0x81, 0x17, 0x0d, + 0x11, 0xb0, 0x5c, 0xb4, 0xc7, 0x27, 0x87, 0xab, + 0x5d, 0x0a, 0x18, 0xae, 0x4e, 0x06, 0xa3, 0x3d, + 0xc7, 0xb0, 0x22, 0xba, 0x03, 0xa4, 0x0f, 0xe5, + 0x1c, 0x72, 0x2a, 0x04, 0xce, 0x83, 0xe9, 0xf3, + 0xd7, 0xc9, 0x67, 0x6c, 0x1e, 0x6b, 0x3c, 0x9b, + 0x0b, 0x5e, 0x6a, 0xa6, 0x79, 0x0a, 0xf1, 0xbe, + 0xd7, 0xb4, 0x6f, 0x45, 0x1e, 0xfb, 0x78, 0x97, + 0xaf, 0x34, 0x76, 0x95, 0x52, 0xf7, 0x3d, 0x5d, + 0x07, 0x28, 0x57, 0x9c, 0x4a, 0x0f, 0xcf, 0x0b, + 0x1b, 0xc4, 0xc2, 0x72, 0xd7, 0x72, 0x38, 0x9b, + 0xea, 0xeb, 0xee, 0xae, 0x34, 0xc8, 0x01, 0xd7, + 0xa5, 0xe3, 0xce, 0x41, 0xad, 0x02, 0x60, 0x23, + 0x18, 0x36, 0xba, 0x17, 0xfa, 0xcf, 0xe4, 0xda, + 0xdc, 0xfc, 0x82, 0xdc, 0x7c, 0x11, 0xf4, 0xb8, + 0x52, 0x5d, 0xf7, 0x2f, 0xc8, 0xfe, 0x4a, 0xe6, + 0xb9, 0xaf, 0x4b, 0x17, 0x18, 0x91, 0xc2, 0xfe, + 0xd7, 0x3a, 0x77, 0x0c, 0xa0, 0x43, 0x9c, 0x6f, + 0x13, 0x06, 0xbe, 0x6e, 0xe0, 0x1a, 0x3c, 0xf3, + 0xf5, 0xcc, 0x78, 0xfb, 0x5d, 0xd5, 0xda, 0xb7, + 0x58, 0xea, 0x86, 0x42, 0x6b, 0x32, 0xff, 0xb2, + 0xe2, 0xee, 0x03, 0x1f, 0xf4, 0xef, 0xdb, 0x53, + 0x79, 0xd5, 0x4e, 0xaf, 0x60, 0x8e, 0x02, 0xc2, + 0xcc, 0x39, 0x97, 0x7b, 0xfd, 0xa1, 0xf8, 0x7a, + 0x26, 0xe8, 0x55, 0xd6, 0xa4, 0x8b, 0xa0, 0x1b, + 0x2d, 0x63, 0xaa, 0x73, 0x71, 0x6e, 0xbf, 0x8b, + 0x3b, 0xe3, 0x1b, 0x0d, 0xbb, 0x2e, 0x44, 0x09, + 0x64, 0xac, 0xc7, 0x9e, 0xb5, 0xc6, 0x77, 0xb0, + 0x79, 0xb3, 0xaa, 0xfc, 0x67, 0x57, 0x9a, 0x50, + 0x81, 0x37, 0x14, 0x7c, 0xd7, 0xa0, 0xd4, 0x6a, + 0x79, 0x84, 0x51, 0x0e, 0x95, 0x0a, 0x30, 0xa3, + 0x60, 0x55, 0x48, 0x05, 0x16, 0xae, 0x43, 0x90, + 0xdc, 0x8e, 0x09, 0xbe, 0x79, 0xf6, 0x90, 0x74, + 0xf8, 0x20, 0x96, 0x4d, 0xa7, 0xf5, 0x1a, 0x2b, + 0xc7, 0x15, 0x9d, 0x18, 0xf7, 0x94, 0x87, 0xf7, + 0xf4, 0xfb, 0x0d, 0x61, 0xb6, 0xd7, 0xbe, 0x10, + 0x8e, 0x47, 0x3c, 0x10, 0x44, 0x90, 0x52, 0x21, + 0x83, 0xc0, 0xf5, 0x99, 0xaa, 0xbc, 0xf6, 0x55, + 0xae, 0xf5, 0xb2, 0xa4, 0xcd, 0x4d, 0xb9, 0x38, + 0x6c, 0xbc, 0x80, 0xc3, 0xad, 0xf4, 0x46, 0x31, + 0x01, 0x58, 0x2d, 0x88, 0x57, 0xc3, 0x23, 0xd1, + 0x64, 0xc9, 0xa3, 0x21, 0x6b, 0x8b, 0x8a, 0x23, + 0x2c, 0x4f, 0xa9, 0xcd, 0x67, 0xfa, 0x77, 0xad, + 0xa3, 0x16, 0xa2, 0xe5, 0x19, 0x14, 0x70, 0x41, + 0x5b, 0xda, 0x14, 0xde, 0xe3, 0xe5, 0xc1, 0x15, + 0xb4, 0x77, 0xa4, 0x9b, 0xb8, 0xb1, 0x28, 0x51, + 0x30, 0xb4, 0xf1, 0xf3, 0xf8, 0x6d, 0xd0, 0xc3, + 0x8c, 0x4c, 0x76, 0xb0, 0x9a, 0xdf, 0xc8, 0xbe, + 0xf8, 0x4a, 0x61, 0x6e, 0x3e, 0xd6, 0x3c, 0xe8, + 0xde, 0x56, 0xa0, 0x9c, 0x25, 0xbe, 0xce, 0x93, + 0x1f, 0x88, 0xfb, 0x9a, 0x1a, 0xe2, 0xff, 0x88, + 0xad, 0x10, 0xcb, 0x6c, 0xd6, 0xe7, 0x39, 0x0b, + 0xe5, 0x1a, 0x06, 0x05, 0x64, 0x5b, 0x0a, 0xdf, + 0x22, 0x58, 0xd7, 0xfb, 0x88, 0x12, 0xdd, 0xb7, + 0x52, 0x3a, 0xc9, 0xbf, 0x49, 0xdf, 0x8c, 0x87, + 0x9f, 0x84, 0xb5, 0x0a, 0xf6, 0x00, 0x52, 0xae, + 0x67, 0x12, 0x1a, 0x8c, 0x71, 0x15, 0xf5, 0xa1, + 0x13, 0x39, 0xf0, 0x91, 0x7e, 0x88, 0x7c, 0xb3, + 0x95, 0x50, 0x02, 0xa6, 0x63, 0xb5, 0x64, 0xfb, + 0x90, 0x87, 0x61, 0xe2, 0x27, 0xaf, 0x11, 0x0c, + 0x73, 0x83, 0xef, 0xa9, 0x28, 0xfe, 0xc8, 0x85, + 0x1a, 0x3a, 0xde, 0xf2, 0xe5, 0x25, 0x64, 0x6d, + 0xaa, 0x41, 0x4c, 0x80, 0x2e, 0x84, 0xff, 0xc1, + 0xc0, 0x54, 0x0c, 0x29, 0x1b, 0xa3, 0x07, 0x7c, + 0x33, 0x4c, 0x10, 0xf6, 0x6f, 0x79, 0xdf, 0xd3, + 0xf0, 0x24, 0x57, 0xf1, 0x60, 0xe1, 0xf0, 0xbd, + 0xc4, 0x1f, 0xf4, 0x67, 0xd2, 0xd3, 0xcc, 0x6a, + 0x07, 0x72, 0x44, 0x16, 0x85, 0x46, 0xd0, 0x73, + 0x87, 0xa9, 0xc7, 0x2f, 0xd1, 0xf5, 0xec, 0xe3, + 0x28, 0xa3, 0x93, 0x4f, 0xd7, 0x76, 0xc1, 0x3c, + 0x0d, 0x13, 0x33, 0xcf, 0x5b, 0xbd, 0x6a, 0x52, + 0x4e, 0xee, 0xc8, 0x5e, 0xa1, 0x58, 0x4a, 0x08, + 0x81, 0xd9, 0x23, 0xcc, 0xfb, 0x1c, 0xb2, 0xd8, + 0xa3, 0xe4, 0x53, 0xfe, 0xf4, 0x4b, 0x48, 0xc1, + 0x20, 0xa4, 0x97, 0xf8, 0x38, 0xa3, 0x69, 0xc1, + 0x11, 0xf0, 0xa1, 0x3b, 0xa9, 0x9a, 0x12, 0x61, + 0xe8, 0x8d, 0x99, 0x44, 0x3f, 0x94, 0x72, 0x82, + 0x19, 0x96, 0x62, 0xb0, 0xa6, 0x64, 0x05, 0x19, + 0x8f, 0xd6, 0x5d, 0x05, 0xbf, 0x79, 0x9e, 0x9d, + 0xe4, 0x93, 0x4c, 0xad, 0x61, 0x8c, 0x18, 0xda, + 0xb6, 0x2e, 0xb3, 0xca, 0x14, 0x4d, 0x53, 0xa4, + 0x97, 0x27, 0x10, 0x56, 0xa2, 0x67, 0x5a, 0x5a, + 0x5e, 0x13, 0xc0, 0xdb, 0xa7, 0x9f, 0x45, 0x5b, + 0xeb, 0x1a, 0x14, 0x0c, 0x8c, 0x38, 0x5e, 0x77, + 0x9a, 0xec, 0x75, 0x68, 0x93, 0x65, 0x02, 0x9c, + 0xfb, 0x62, 0x60, 0x49, 0xdd, 0xb2, 0x2a, 0x67, + 0x86, 0xe3, 0x8a, 0x7d, 0x8c, 0x46, 0x78, 0x81, + 0x60, 0x69, 0xf2, 0x3f, 0x74, 0x11, 0x35, 0xff, + 0x77, 0xa3, 0x66, 0x20, 0xfc, 0x98, 0x4a, 0x35, + 0x7a, 0x52, 0xe4, 0x90, 0x13, 0x80, 0xb9, 0xa6, + 0x73, 0x7a, 0x7d, 0x66, 0x6e, 0x6b, 0xb6, 0x43, + 0x10, 0xd5, 0x91, 0x2b, 0x66, 0xdd, 0x89, 0x87, + 0xe3, 0x8c, 0x58, 0x53, 0x2f, 0x40, 0x74, 0x45, + 0x1b, 0x77, 0x7a, 0xa4, 0x44, 0x19, 0x78, 0xba, + 0x87, 0x10, 0x41, 0x31, 0x32, 0x5f, 0x87, 0x68, + 0xde, 0x43, 0x4a, 0xef, 0x33, 0xb3, 0x11, 0x83, + 0xa9, 0xc2, 0x6f, 0x8d, 0x34, 0xe2, 0x95, 0x84, + 0x3a, 0x4f, 0x6f, 0x8c, 0x31, 0x1d, 0xb6, 0xf5, + 0x95, 0x0d, 0x01, 0x11, 0x20, 0xdf, 0x72, 0xf3, + 0x3f, 0x9a, 0x33, 0xaa, 0xb1, 0x06, 0x6a, 0x63, + 0x47, 0x91, 0x01, 0xdf, 0xb3, 0x54, 0x36, 0xfd, + 0x06, 0x2d, 0xb8, 0x08, 0xe3, 0xd3, 0x65, 0xac, + 0x66, 0x03, 0xee, 0xa4, 0x63, 0xbd, 0xd4, 0xce, + 0xbd, 0x79, 0xa7, 0x48, 0x38, 0xc5, 0x7d, 0xb5, + 0x71, 0x9a, 0x3c, 0x11, 0x7c, 0x6c, 0xe2, 0x54, + 0x02, 0x5d, 0x42, 0xab, 0x25, 0x93, 0x66, 0x01, + 0x37, 0x78, 0x35, 0x4a, 0x8c, 0x19, 0x4d, 0x00, + 0x75, 0x4f, 0xcc, 0xc0, 0x26, 0x82, 0xc1, 0x35, + 0x8c, 0xc7, 0xc2, 0x59, 0x01, 0x3e, 0x98, 0x22, + 0x88, 0x9c, 0x90, 0x75, 0x05, 0x33, 0x07, 0xb9, + 0x39, 0x81, 0x38, 0x58, 0x10, 0x29, 0xcf, 0xc8, + 0x98, 0xb2, 0x03, 0xd7, 0x5b, 0xb3, 0x18, 0xba, + 0x34, 0x0c, 0x9f, 0xab, 0xd7, 0xed, 0x29, 0x82, + 0x41, 0xe0, 0x20, 0x97, 0x57, 0x92, 0xb2, 0xb8, + 0x10, 0x2d, 0x0b, 0xa2, 0xc5, 0x8f, 0x90, 0x6f, + 0xed, 0x12, 0x56, 0x25, 0xbe, 0xfd, 0x75, 0xf7, + 0xb6, 0xf8, 0x40, 0x67, 0x39, 0x11, 0xfa, 0x15, + 0xae, 0x6a, 0x54, 0x5f, 0x32, 0x2b, 0xf8, 0x48, + 0x55, 0xbe, 0x86, 0x2f, 0x69, 0x48, 0x5b, 0x5d, + 0x4d, 0xb7, 0x35, 0xaa, 0xb6, 0x91, 0x88, 0x19, + 0x96, 0x1c, 0x68, 0xf6, 0x85, 0x9e, 0xb3, 0xb2, + 0xa3, 0x32, 0xd4, 0x52, 0x70, 0xb7, 0x62, 0xe3, + 0x14, 0xb6, 0x78, 0x5f, 0x1b, 0x1d, 0x04, 0x9c, + 0x26, 0x0c, 0x33, 0x94, 0xb1, 0x97, 0x08, 0xdb, + 0x0b, 0x39, 0x29, 0xd4, 0xbc, 0x6d, 0xdf, 0x02, + 0xc6, 0x99, 0xab, 0x99, 0x32, 0xe5, 0xce, 0x51, + 0x4f, 0xae, 0xb8, 0x8b, 0xe0, 0xaf, 0x07, 0xc4, + 0xf9, 0x41, 0x7c, 0x59, 0xa0, 0xac, 0x74, 0x4d, + 0x7e, 0x43, 0x77, 0x9c, 0x06, 0x49, 0x79, 0x8a, + 0x14, 0x73, 0x93, 0xa8, 0x5b, 0x1b, 0x34, 0x29, + 0x78, 0x04, 0x2f, 0xd7, 0x1f, 0x13, 0x90, 0xe0, + 0xdd, 0x3b, 0x42, 0x6b, 0x79, 0x6e, 0x52, 0xc7, + 0x0f, 0x38, 0xda, 0x01, 0x2c, 0x8d, 0xe6, 0x94, + 0x5d, 0x59, 0x27, 0x1d, 0x10, 0x4e, 0x11, 0x36, + 0xfb, 0x53, 0x16, 0x05, 0x25, 0xf2, 0x64, 0xd8, + 0xf9, 0xcd, 0x5c, 0xfe, 0xb4, 0x18, 0x44, 0x80, + 0x10, 0xbc, 0x3d, 0xf3, 0x1d, 0x5a, 0xf0, 0xc1, + 0xc3, 0x55, 0xff, 0x41, 0x3e, 0xe3, 0xef, 0x44, + 0xb2, 0xc0, 0x01, 0x18, 0xa2, 0x49, 0x88, 0x78, + 0x0d, 0x4c, 0xc8, 0x73, 0xcf, 0x30, 0x85, 0x3a, + 0x88, 0x90, 0x01, 0xcf, 0x69, 0x53, 0xa3, 0x18, + 0x3f, 0xd6, 0xe7, 0x94, 0x14, 0xa7, 0xae, 0xcd, + 0x6f, 0x11, 0x72, 0xfe, 0x2b, 0xb0, 0x81, 0x53, + 0xea, 0x67, 0xd6, 0xe4, 0xca, 0x42, 0xa0, 0xf9, + 0xb1, 0xd4, 0xb5, 0x3b, 0xc9, 0xf0, 0x36, 0xc1, + 0x1c, 0xf4, 0xb1, 0xf6, 0x84, 0xd0, 0x86, 0x6c, + 0x76, 0x9a, 0x03, 0xc2, 0xb6, 0x2e, 0x9a, 0x46, + 0xf5, 0x5f, 0x2c, 0x38, 0xac, 0xad, 0x6f, 0x2e, + 0x7a, 0x18, 0x2d, 0x22, 0x95, 0x5e, 0x5e, 0xc9, + 0x7a, 0x0a, 0x56, 0xe1, 0xc7, 0x15, 0xfd, 0xbf, + 0xff, 0xf7, 0x7e, 0x85, 0x20, 0xa9, 0x8a, 0x9c, + 0xa9, 0x7d, 0xe8, 0xed, 0xfc, 0x7f, 0xbb, 0xf0, + 0x05, 0x3f, 0xce, 0x4f, 0x4c, 0xee, 0xa4, 0xa0, + 0xcc, 0x9c, 0x62, 0x1e, 0xd6, 0xd0, 0x30, 0x37, + 0xb8, 0x98, 0x56, 0x1d, 0xaa, 0xd6, 0x5e, 0x73, + 0x12, 0xe4, 0x88, 0x82, 0x48, 0x64, 0x06, 0xd7, + 0x2a, 0x31, 0x50, 0x7b, 0x10, 0x17, 0xb8, 0x4c, + 0x5a, 0x8d, 0xf1, 0xfc, 0xf1, 0x33, 0x3b, 0x98, + 0x42, 0x18, 0x5b, 0x35, 0x78, 0xca, 0x8e, 0x41, + 0x52, 0xae, 0x6d, 0xe1, 0xa2, 0x9d, 0x5b, 0xbd, + 0xf3, 0x5f, 0x49, 0xc1, 0x27, 0x06, 0xc1, 0xaf, + 0xc0, 0xa3, 0x9d, 0xf3, 0x1c, 0x8e, 0x90, 0x8a, + 0xb0, 0x69, 0xb0, 0xc5, 0x11, 0x0c, 0x91, 0x14, + 0x1f, 0x5e, 0x10, 0xe1, 0x1d, 0x14, 0x30, 0x54, + 0x1e, 0x17, 0x3d, 0x31, 0x7b, 0xbf, 0x2f, 0x9d, + 0x6d, 0x63, 0x32, 0xf0, 0x9d, 0x9f, 0x95, 0x3d, + 0x0b, 0xd2, 0x4d, 0x10, 0xe2, 0x3f, 0x67, 0x69, + 0x43, 0x9a, 0x4a, 0x2c, 0x54, 0x71, 0xa8, 0xa0, + 0x9e, 0x9f, 0x10, 0xaf, 0x1b, 0xce, 0x99, 0xe3, + 0x25, 0x32, 0x10, 0x54, 0x80, 0xfe, 0xda, 0x57, + 0xd0, 0xb2, 0x92, 0x7f, 0xbb, 0x5f, 0xe7, 0x4d, + 0x1b, 0x3d, 0x46, 0x4d, 0xe4, 0x4c, 0xd6, 0xaf, + 0x1a, 0x32, 0x12, 0x40, 0xb8, 0x84, 0x8e, 0xe4, + 0x80, 0xce, 0x7e, 0xc1, 0x13, 0x8b, 0xb0, 0xb7, + 0x6f, 0x24, 0xba, 0x85, 0x50, 0x83, 0xc3, 0xcf, + 0x19, 0xb3, 0xf0, 0xc7, 0xee, 0x68, 0xbe, 0x9e, + 0x6d, 0xb9, 0xfb, 0xd5, 0x29, 0xce, 0x82, 0xcd, + 0x69, 0x16, 0x68, 0x6b, 0x6a, 0xf4, 0x02, 0x32, + 0xce, 0x60, 0x37, 0x0c, 0xb9, 0x38, 0x92, 0x9c, + 0x42, 0xa9, 0x0b, 0x53, 0x96, 0xfe, 0x39, 0xc1, + 0x24, 0x65, 0x9b, 0xcd, 0xe7, 0x8d, 0x36, 0x07, + 0x9f, 0x1d, 0x35, 0x8e, 0xdc, 0x4c, 0xb5, 0x68, + 0xc5, 0xfd, 0x44, 0x19, 0xf2, 0x6c, 0x59, 0x1c, + 0xb1, 0x0b, 0x35, 0x48, 0x86, 0x1a, 0x05, 0x22, + 0x03, 0x0c, 0x0c, 0xa2, 0x92, 0x90, 0x35, 0xfb, + 0x37, 0x94, 0xc7, 0x15, 0x84, 0xae, 0xe8, 0x05, + 0xa0, 0xf7, 0x30, 0x11, 0x5c, 0xe4, 0x5d, 0x3e, + 0x12, 0x54, 0x80, 0x54, 0x6b, 0x09, 0x8c, 0xce, + 0x80, 0x5e, 0xa7, 0xc8, 0x6a, 0x0c, 0x56, 0xe1, + 0x18, 0x7d, 0xc9, 0x39, 0xc1, 0xef, 0xe3, 0x25, + 0xa0, 0x8b, 0x2f, 0x60, 0x3a, 0x43, 0x39, 0xa6, + 0x28, 0x28, 0x7b, 0x4c, 0x77, 0xd4, 0x49, 0x61, + 0x46, 0xe9, 0x1b, 0x45, 0xd6, 0xb1, 0x56, 0xe1, + 0x7d, 0x34, 0xcd, 0x06, 0xb6, 0x67, 0x8d, 0x7d, + 0x7a, 0xe2, 0xbe, 0x68, 0x35, 0xa6, 0x78, 0xe5, + 0x47, 0x48, 0xb7, 0xc7, 0xde, 0xcd, 0xc9, 0x05, + 0xb4, 0xe7, 0x50, 0x48, 0xe1, 0x4b, 0xfe, 0x76, + 0x77, 0xc6, 0xf7, 0x5f, 0xcb, 0xc2, 0xa8, 0xd7, + 0xd6, 0x8a, 0xe5, 0x49, 0xd9, 0xca, 0x45, 0xf4, + 0xda, 0xcd, 0x33, 0xd1, 0x59, 0x2d, 0x9e, 0xc1, + 0x5c, 0xe6, 0x01, 0x18, 0xb8, 0xf0, 0x5e, 0xb1, + 0x69, 0x95, 0x2f, 0x02, 0x2a, 0xe7, 0x4a, 0xd7, + 0xd1, 0xc3, 0xd5, 0x6f, 0x15, 0xc8, 0xdc, 0x29, + 0xde, 0xb9, 0x3f, 0x8b, 0xa6, 0xbc, 0xdd, 0x25, + 0x84, 0x35, 0x3c, 0x90, 0x2d, 0xc2, 0x1e, 0x98, + 0x8a, 0x50, 0x09, 0x77, 0x42, 0xe9, 0x35, 0x8a, + 0x7c, 0x97, 0xbf, 0xe8, 0xbf, 0x56, 0xd0, 0x8b, + 0x65, 0xd3, 0xaf, 0x1e, 0x05, 0x94, 0xfa, 0xac, + 0xa8, 0x2b, 0x28, 0xcb, 0x37, 0x3e, 0xe8, 0xbb, + 0x66, 0x3a, 0xed, 0xb2, 0x48, 0x10, 0x0f, 0x3a, + 0x5a, 0xc5, 0xdb, 0x26, 0x0e, 0xaa, 0x5e, 0x69, + 0x15, 0xd6, 0x81, 0xae, 0xbd, 0xe6, 0x03, 0xf1, + 0xf6, 0x37, 0xc8, 0xde, 0x70, 0x1f, 0x64, 0xb9, + 0x5e, 0xbf, 0x2e, 0x4f, 0xb1, 0xea, 0xa0, 0x17, + 0xe6, 0x7c, 0xf9, 0x2f, 0x1e, 0xd8, 0x58, 0xde, + 0xa7, 0xf0, 0x46, 0x52, 0x95, 0xdf, 0xa4, 0x96, + 0xd0, 0xc4, 0x97, 0x2b, 0x95, 0xcd, 0x5e, 0x40, + 0x23, 0x5c, 0x10, 0xee, 0xba, 0x72, 0x9b, 0xcf, + 0x0b, 0xe8, 0x18, 0x3a, 0x70, 0xd2, 0x5e, 0x07, + 0x68, 0x93, 0xef, 0x4a, 0x5b, 0x8d, 0x72, 0x41, + 0x4e, 0xea, 0x33, 0x6a, 0x0a, 0x5e, 0xfb, 0x02, + 0x3f, 0xd4, 0xed, 0x5b, 0xe0, 0x42, 0x84, 0xd4, + 0xaa, 0x85, 0xdc, 0x5b, 0x67, 0xee, 0x71, 0x67, + 0xba, 0x8e, 0xd2, 0xbe, 0x61, 0xdf, 0x5a, 0x26, + 0xb9, 0xf0, 0x77, 0x81, 0x53, 0x24, 0x16, 0xcb, + 0x8c, 0xb8, 0x06, 0x6e, 0x68, 0xda, 0xc8, 0x2d, + 0x17, 0x54, 0xdb, 0x46, 0xcb, 0xfd, 0x1f, 0x3d, + 0x94, 0x81, 0x09, 0x4b, 0xfa, 0xb1, 0x46, 0xd9, + 0x11, 0xa3, 0xb7, 0x31, 0x9c, 0xd2, 0x38, 0xd6, + 0xba, 0x3d, 0xa3, 0x74, 0xd8, 0xf1, 0x24, 0xe8, + 0x9c, 0xcb, 0x1d, 0xf9, 0x4a, 0xf7, 0xc8, 0x4b, + 0xfe, 0x97, 0x7c, 0xa1, 0x02, 0xeb, 0x40, 0xc3, + 0x89, 0x71, 0x01, 0xcd, 0x33, 0x2a, 0xc2, 0x82, + 0xce, 0x62, 0x8d, 0x53, 0x7c, 0xdf, 0xce, 0xd7, + 0xf5, 0xa8, 0x4f, 0xf2, 0xf2, 0x2e, 0xc1, 0xeb, + 0x97, 0x99, 0x37, 0x3c, 0x53, 0xa6, 0xb4, 0x46, + 0x05, 0x64, 0x92, 0x87, 0x08, 0x3c, 0x23, 0x4b, + 0x9d, 0x67, 0x18, 0xf9, 0xe2, 0x0b, 0x1c, 0x39, + 0xd3, 0x87, 0x70, 0xc0, 0xb9, 0x1e, 0x52, 0x0a, + 0x0f, 0x48, 0xe2, 0xe7, 0x51, 0x72, 0x94, 0xf7, + 0xa3, 0xdc, 0xe5, 0x66, 0x33, 0x39, 0x54, 0x06, + 0x55, 0x93, 0x30, 0xf9, 0x5e, 0x76, 0x8f, 0xe0, + 0x59, 0x4d, 0x0d, 0xa7, 0xf5, 0xbe, 0xdb, 0x20, + 0xad, 0x0d, 0x76, 0x88, 0x5f, 0x9c, 0x7c, 0x75, + 0x2f, 0x2a, 0x0b, 0x79, 0x6e, 0xd3, 0xe2, 0x66, + 0xf5, 0x4a, 0x2d, 0x87, 0x87, 0x49, 0x84, 0x17, + 0xa2, 0x62, 0x4c, 0xbb, 0xe4, 0x6e, 0x98, 0x10, + 0xc9, 0xfb, 0x8a, 0x04, 0x68, 0x8d, 0x22, 0x66, + 0xad, 0xea, 0x2a, 0xc9, 0x97, 0x2d, 0x3c, 0xbc, + 0xd0, 0x77, 0x5f, 0xe6, 0xb8, 0x7f, 0xe6, 0xf6, + 0x39, 0xbf, 0x56, 0x0e, 0x26, 0x6d, 0xc5, 0x3e, + 0x53, 0x19, 0xd6, 0xb4, 0x57, 0x36, 0xa3, 0xc6, + 0xd3, 0x3d, 0x66, 0x79, 0x30, 0x5c, 0x14, 0x0c, + 0x0f, 0x3e, 0x96, 0xae, 0x90, 0x97, 0xab, 0x0d, + 0x9f, 0xc3, 0xe7, 0x66, 0x3e, 0xe0, 0x31, 0x43, + 0x4b, 0x01, 0xb3, 0x0e, 0x9e, 0x8c, 0x82, 0x4a, + 0x8c, 0xc7, 0x79, 0x85, 0xdf, 0x75, 0x0d, 0xb4, + 0x2b, 0x03, 0x14, 0xef, 0x72, 0x58, 0xfd, 0x64, + 0xc8, 0xe3, 0x0d, 0x9a, 0x14, 0x6f, 0x76, 0xf9, + 0x46, 0xd1, 0xd2, 0x81, 0xb3, 0x16, 0x6e, 0xc7, + 0x76, 0x82, 0xce, 0xf4, 0xee, 0x33, 0x00, 0xe6, + 0x77, 0xc4, 0xad, 0x4f, 0x06, 0xa7, 0x48, 0x80, + 0x9e, 0x21, 0x66, 0xca, 0x75, 0x69, 0x57, 0xcb, + 0xf0, 0x67, 0x6a, 0xaa, 0x8f, 0x88, 0x14, 0xbd, + 0x65, 0x62, 0xe2, 0xad, 0xcc, 0x22, 0x88, 0x7b, + 0x94, 0xbd, 0x0e, 0xcd, 0xb6, 0x69, 0xa2, 0xcb, + 0x7d, 0x57, 0x5c, 0xb4, 0x92, 0x80, 0x13, 0x99, + 0x84, 0xf3, 0x79, 0x0a, 0x2d, 0x70, 0xa4, 0xe0, + 0xde, 0xc6, 0x32, 0xb0, 0x8a, 0x62, 0xb5, 0xcf, + 0xfa, 0x5e, 0x5a, 0x92, 0x32, 0x7d, 0x34, 0x07, + 0xb5, 0x52, 0x3a, 0xb5, 0x7d, 0x0f, 0xa1, 0xba, + 0x56, 0xd0, 0x07, 0x76, 0x11, 0xf2, 0xc3, 0x33, + 0x9d, 0xbd, 0x12, 0x35, 0x5e, 0xf7, 0x05, 0x88, + 0x76, 0x94, 0xa6, 0xbf, 0xed, 0xb8, 0xa4, 0xa2, + 0x0c, 0xbe, 0x0f, 0x6a, 0xaf, 0xf3, 0x1b, 0x33, + 0x4a, 0xb7, 0x68, 0x3f, 0xbe, 0x95, 0x13, 0x97, + 0x0f, 0x15, 0x17, 0x1b, 0x23, 0xaa, 0x08, 0x78, + 0xa6, 0x5b, 0x08, 0xa2, 0x9d, 0x03, 0xa8, 0xa7, + 0x39, 0xdc, 0xbc, 0x9a, 0x85, 0xf5, 0xe5, 0x55, + 0x59, 0x3c, 0xef, 0xf9, 0x3f, 0x22, 0x8e, 0xf8, + 0xd8, 0x3e, 0x02, 0x0b, 0xd8, 0x78, 0x4b, 0x15, + 0x7f, 0xaa, 0x2c, 0xff, 0xbe, 0x77, 0x33, 0xc7, + 0x6a, 0x12, 0xaa, 0xa4, 0xbe, 0xc0, 0x3b, 0xcb, + 0x13, 0x9d, 0x9c, 0x5a, 0x9f, 0x8a, 0x57, 0x36, + 0x4f, 0x02, 0x5a, 0xf8, 0x1d, 0x97, 0x77, 0x43, + 0xc8, 0xa5, 0xb7, 0x9b, 0x10, 0x98, 0xfd, 0x58, + 0xbf, 0x42, 0xf6, 0xbf, 0xff, 0x6c, 0x40, 0x18, + 0x18, 0xdf, 0xac, 0x57, 0x71, 0xea, 0xcc, 0x8e, + 0xfd, 0xfe, 0x10, 0xfb, 0xb9, 0xfe, 0xbc, 0x9a, + 0x9c, 0x27, 0xe4, 0x10, 0x15, 0x94, 0x41, 0xa1, + 0xcc, 0xf6, 0x25, 0x49, 0x4f, 0x96, 0xc1, 0x8c, + 0x9e, 0x3e, 0x18, 0x29, 0x49, 0x92, 0xe7, 0xfe, + 0x22, 0xff, 0xed, 0x02, 0x16, 0x90, 0xef, 0xac, + 0xec, 0x95, 0x1d, 0x5b, 0x94, 0x9c, 0xf6, 0x7c, + 0x1b, 0x5a, 0x9d, 0xb0, 0x9b, 0x05, 0x36, 0xbf, + 0xef, 0xec, 0x63, 0x35, 0x40, 0x24, 0x45, 0x40, + 0x30, 0x1a, 0x9b, 0x90, 0xc3, 0xc2, 0xf7, 0x37, + 0xfb, 0x08, 0x8e, 0x48, 0x19, 0x48, 0xed, 0xa8, + 0xa8, 0x04, 0x6f, 0xd0, 0x33, 0xe9, 0xb8, 0x8d, + 0xe7, 0x1e, 0x5c, 0x47, 0x74, 0xc0, 0x66, 0x30, + 0x4e, 0xa7, 0x86, 0x73, 0xf1, 0xe5, 0x78, 0xa6, + 0xe0, 0xc1, 0xda, 0x13, 0x72, 0x07, 0x85, 0x34, + 0x63, 0x95, 0x49, 0x30, 0x4b, 0x9d, 0x03, 0xf1, + 0x7a, 0x6b, 0x91, 0xa2, 0x85, 0x41, 0xf9, 0x4a, + 0xd6, 0xff, 0xff, 0x86, 0xf7, 0xf0, 0xce, 0xb9, + 0x07, 0xf1, 0x88, 0x04, 0x33, 0xaa, 0xeb, 0x54, + 0xb2, 0x1c, 0x8e, 0x2e, 0x7b, 0x04, 0xa8, 0xcc, + 0x2c, 0x7a, 0xb3, 0xad, 0x1a, 0x89, 0x38, 0x89, + 0xd7, 0x11, 0x3a, 0x8c, 0xcf, 0xe3, 0xc5, 0xba, + 0xb0, 0xcc, 0xc4, 0xe3, 0x33, 0xf3, 0x18, 0xba, + 0xec, 0x56, 0xd9, 0x1c, 0x40, 0x70, 0x0d, 0x4e, + 0x97, 0x01, 0x23, 0xf3, 0x5a, 0xdc, 0xbf, 0x68, + 0x93, 0xc2, 0x1d, 0x8a, 0x96, 0xb7, 0xac, 0x18, + 0x6f, 0xf7, 0x84, 0x71, 0x0d, 0x3d, 0xf8, 0xba, + 0xdf, 0xb6, 0x89, 0x1d, 0x78, 0x19, 0xf2, 0x59, + 0xe9, 0x15, 0x55, 0x29, 0x73, 0x50, 0x59, 0x14, + 0x02, 0x21, 0x16, 0x8f, 0x0f, 0xdf, 0xa5, 0xf0, +}; + +static struct crc_test { + uint32_t crc; /* random starting crc */ + uint32_t start; /* random offset in buf */ + uint32_t length; /* random length of test */ + uint32_t crc32c_le; /* expected crc32c_le result */ + uint32_t crc32_be; /* expected crc32_be result */ +} test[] = { + {0xffffffff, 0x00000000, 0x00001000, 0x13934bef, 0xd8ddcdc3}, + {0xfe7328ea, 0x00000763, 0x00000717, 0xed2c0d70, 0xc863aef8}, + {0x4c40684e, 0x00000721, 0x0000011e, 0xd7f46ccc, 0x173a11c4}, + {0x6b487f90, 0x00000264, 0x000007bc, 0x759e9939, 0xd6307c56}, + {0x9f5810db, 0x00000afa, 0x00000255, 0x2685197f, 0x2e5c9201}, + {0xb15c4755, 0x00000d5b, 0x000002a4, 0xd8fadcb5, 0xf682c4be}, + {0x06518253, 0x00000ffb, 0x00000004, 0xabee2433, 0x3d8abdf9}, + {0xd9e71c55, 0x00000a2a, 0x00000259, 0x96682af2, 0x47b4d26c}, + {0x0c1ae843, 0x00000ce4, 0x0000031b, 0x7b637c43, 0x62b47e8b}, + {0xec3cd517, 0x000002ff, 0x00000566, 0x5d719a77, 0xff5bc5b7}, + {0x77828e95, 0x0000067f, 0x0000038f, 0x43ee5b6c, 0x1a0cfacd}, + {0xec87b4e3, 0x00000d1c, 0x000002e3, 0x2ddd2eee, 0x275118a7}, + {0x412158bb, 0x00000eee, 0x00000111, 0x67b38ba2, 0xa74ecff5}, + {0x2e52de3e, 0x00000c4a, 0x000003b5, 0xbcc5d61d, 0xbd800707}, + {0x6ddaae8b, 0x00000d99, 0x00000266, 0x8b535544, 0xecbde1a1}, + {0x049b6cb1, 0x000009c5, 0x000000b0, 0xfc22cabc, 0xfb78eb9f}, + {0x77d4b954, 0x0000028a, 0x000007fa, 0x71d00923, 0x8c116f85}, + {0x5e192355, 0x00000ac1, 0x000001fa, 0xb966b81a, 0x5aa17bbe}, + {0x7d80b71d, 0x00000213, 0x000001e0, 0x2bba371a, 0xb5906aa6}, + {0x01f6f1e4, 0x000001d6, 0x00000395, 0xb7e8a647, 0x3ad112b1}, + {0x1dfabb13, 0x00000e14, 0x000001eb, 0x53917fba, 0xbaee0339}, + {0xb00a4449, 0x00000bf6, 0x00000409, 0xedecb577, 0x6f3a3979}, + {0x7ecd3981, 0x0000083f, 0x0000016b, 0xefef62b9, 0xe3e52eed}, + {0xf8f330d2, 0x000004be, 0x00000757, 0x9357c9f3, 0x0835bc1b}, + {0x03c38af2, 0x00000d23, 0x000002dc, 0x360fa8c0, 0x2ca885e6}, + {0x687bb79b, 0x00000f3d, 0x000000c2, 0x448d3be2, 0x79be2f78}, + {0x6710f550, 0x000009e9, 0x00000603, 0xdbfd1998, 0x1d25f627}, + {0x873171d1, 0x00000787, 0x000004d5, 0xab7f1b62, 0xa76a5656}, + {0x373b1314, 0x00000f0f, 0x000000f0, 0x184098ab, 0xba273974}, + {0x90fad9cd, 0x00000ead, 0x00000152, 0x23ce52ff, 0xb7bc958c}, + {0x19676fe7, 0x0000007d, 0x0000070d, 0xf8a76f1e, 0xf882b644}, + {0x89facd45, 0x000005f3, 0x00000473, 0x4331a006, 0xe9dc1396}, + {0x6f173747, 0x00000fc3, 0x0000003c, 0xb012f08e, 0xc6b888ee}, + {0x4b44a106, 0x0000075a, 0x0000008b, 0xf6f7ac38, 0x60cd2b74}, + {0xb620ad06, 0x00000774, 0x0000017e, 0xd34558e6, 0x3a0a615b}, + {0x976f21e9, 0x000008d7, 0x0000034a, 0xe533aa3a, 0xa99e60be}, + {0x687628c0, 0x000006c5, 0x0000061b, 0x3a840b15, 0x9bfcaef2}, + {0xe24ac108, 0x00000cd0, 0x0000032f, 0x51010ae8, 0x20958672}, + {0x361c44a3, 0x00000304, 0x00000719, 0xfd7bd481, 0xd70ff2b2}, + {0xd93ff95e, 0x00000db7, 0x0000008e, 0xcfbbc304, 0xad716acd}, + {0xed752d12, 0x00000883, 0x00000091, 0x65a6c868, 0x95c71c7b}, + {0xb4ff4b54, 0x000003d3, 0x000001c1, 0xf82597e7, 0x44b7f99b}, + {0x111b520f, 0x00000708, 0x000000eb, 0xc3e109f3, 0x71bc01ee}, + {0x62c806f2, 0x00000ba3, 0x0000045c, 0x874d3a72, 0xc539b753}, + {0x40d97470, 0x000005e1, 0x0000058d, 0x87a9684f, 0xea6073a5}, + {0x4312179c, 0x00000056, 0x0000070e, 0x809a00f5, 0x209aea3b}, + {0x13d5f84c, 0x00000a2d, 0x00000104, 0xf3d27578, 0xe087a8b6}, + {0x1f302cb2, 0x00000151, 0x00000014, 0x1e162693, 0x95e4b90e}, + {0xe491db24, 0x00000600, 0x000006f6, 0x7ff09615, 0x77611523}, + {0xf9a98069, 0x000002ba, 0x000002ad, 0x01af7387, 0xea925faa}, + {0xe9c477ad, 0x0000015f, 0x00000778, 0x6facf9a0, 0x1130f736}, + {0x353f32b2, 0x0000087c, 0x00000783, 0x6cc964ea, 0x32459994}, + {0x78e1b24f, 0x00000650, 0x000006a8, 0xb3bb7c27, 0x5a632f78}, + {0x61aa400e, 0x00000049, 0x00000254, 0xb8cd1681, 0xdf2652d5}, + {0xb84b10b0, 0x00000f73, 0x0000008c, 0x406a6450, 0x3619d31b}, + {0x9fa99c9c, 0x00000a7c, 0x000004d7, 0xfb3d21b4, 0xea31c743}, + {0x3fc9ebe3, 0x00000cd9, 0x000000d6, 0x43803f9c, 0x1f76a809}, + {0x529879cd, 0x000002f2, 0x00000595, 0x78b4c6a6, 0x63b9b93f}, + {0x3a933019, 0x00000516, 0x00000266, 0xdcb45436, 0x8f99c98c}, + {0x887b4977, 0x00000227, 0x0000038d, 0xc5f7c3d9, 0xaf5e3091}, + {0x770745de, 0x000008c6, 0x00000739, 0xf69145e8, 0x53d0dce1}, + {0x28be3b47, 0x00000c46, 0x0000032b, 0x764c028f, 0x106d0905}, + {0x5013a050, 0x00000cf6, 0x00000309, 0xea8fe164, 0x62180b57}, + {0x2ec4c9ba, 0x000006e8, 0x0000078d, 0xa35557a9, 0xf44430a4}, + {0xa9f950c9, 0x00000d33, 0x000002cc, 0x41ea8618, 0x587b4eb3}, + {0x5b520229, 0x000007b2, 0x00000484, 0x44569f1f, 0x92406c32}, + {0xd8dcbbfc, 0x0000002f, 0x0000048c, 0xdb88ab8b, 0x13bfe70e}, + {0x25529792, 0x00000d1d, 0x000002e2, 0x20cda404, 0x19d3b4e4}, + {0x9f3f6d71, 0x00000238, 0x0000079a, 0x0720443e, 0x3c107021}, + {0x64121215, 0x000007ff, 0x0000038f, 0x6aacff2c, 0xb82fdc3e}, + {0xfb6cdde0, 0x00000ef8, 0x00000107, 0xbd43a0f1, 0xab0d3c1d}, + {0x221c9d6f, 0x000007b6, 0x0000014f, 0xb67f834b, 0x1371ad05}, + {0x030e1de4, 0x00000836, 0x000004b4, 0x0d67d26a, 0xe2e72df1}, + {0xb56fa6cf, 0x00000c07, 0x000003f8, 0x60601ac1, 0x039de73e}, + {0xb55c89f5, 0x0000098e, 0x000001d4, 0x2400efbe, 0xfe39a2bb}, + {0x5e90b6d5, 0x0000070b, 0x000003ea, 0x3bb5d6ea, 0xf0f794a0}, + {0x2a7045ae, 0x00000961, 0x00000633, 0xfca89e4b, 0xe66ce41c}, + {0x8b374ea9, 0x000006ba, 0x00000780, 0xbce036ed, 0x4cb28ef7}, + {0x8bd90bc9, 0x00000562, 0x00000369, 0xcb26a24b, 0x40236d1d}, + {0x5b1b1762, 0x000000fd, 0x0000051a, 0x33cdda07, 0xc32e420a}, + {0xa4153555, 0x0000058f, 0x000005c7, 0xbe50eeca, 0x83a67f35}, + {0x0be1f931, 0x00000651, 0x00000672, 0x95a25753, 0x88f1aac1}, + {0xb7e78618, 0x00000a7f, 0x000002bb, 0xe06bcc1c, 0x74274f66}, + {0x4a9bc41b, 0x00000e51, 0x000001ae, 0x709e8d2c, 0x54eff534}, + {0xfc359d13, 0x00000440, 0x000002f8, 0x0a58451f, 0x55e9363f}, + {0x5aa48619, 0x000006d1, 0x00000284, 0x928ead83, 0x31041c06}, + {0xa609afa8, 0x0000053e, 0x00000272, 0xb048c141, 0x4704efba}, + {0x3f108afb, 0x00000949, 0x00000150, 0x9a6bb5bc, 0x4e4430c8}, + {0x79bec2d3, 0x000008ed, 0x00000712, 0x32692d57, 0x11d52a7b}, + {0x9429e067, 0x00000bc3, 0x0000043c, 0x5295ceff, 0x04640f4d}, + {0xae58b96a, 0x0000082d, 0x000007d2, 0xc2a681ba, 0xf7ca4a2c}, + {0x95df24be, 0x00000985, 0x000004c1, 0x3a287765, 0x2c4af003}, + {0x5e94976f, 0x00000596, 0x000004ed, 0xff00c489, 0x5ae11687}, + {0xf5e5f1de, 0x00000d31, 0x000002ce, 0x35f28e91, 0x30d47957}, + {0xa2c219cf, 0x00000a3c, 0x00000374, 0x707d21eb, 0x2a14a255}, + {0xf21b6ceb, 0x00000919, 0x00000135, 0x0847fb8b, 0xcb8d3b93}, + {0xaa988728, 0x00000787, 0x00000771, 0x885aeaa4, 0x6531b509}, + {0xaa5dfaac, 0x000003e5, 0x0000051b, 0x52c48ab7, 0xe43cc5e9}, + {0x0a053968, 0x00000d2a, 0x000002d5, 0x7a90256d, 0x8004765c}, + {0x1421dc20, 0x00000eef, 0x00000110, 0x97d6da24, 0x1378f6ff}, + {0xb47c2166, 0x00000a6a, 0x00000209, 0xcfd6cc52, 0x676e14a5}, + {0x77dd1955, 0x000000de, 0x00000266, 0xba74bcaa, 0xc71b429c}, + {0x68a03cc2, 0x0000082f, 0x000007b0, 0x752bd5d8, 0x19ed14aa}, + {0x0226b0a3, 0x00000a5f, 0x000005a0, 0x82de4970, 0xf654d3ed}, + {0x637bf3b1, 0x00000d93, 0x0000026c, 0x5c7115cb, 0x3cccb57e}, + {0x3b120edf, 0x00000c13, 0x000003ec, 0x80d7d20f, 0x92132798}, + {0xe2456780, 0x000002eb, 0x00000641, 0xc0a5d289, 0x6160c87a}, + {0x9b2e7125, 0x00000c0c, 0x000003f3, 0xcc15f57e, 0x6f00f637}, + {0x153033ef, 0x00000787, 0x000006b6, 0x3cde443b, 0xb46caa6e}, + {0x18458b3f, 0x0000066c, 0x00000561, 0x9a2bd8c6, 0xb6c29121}, + {0x4ff9d4b9, 0x00000c8f, 0x0000033a, 0xd0ee6d6d, 0xc81cf380}, + {0xdf84b5d9, 0x00000802, 0x0000029a, 0xdab0d74a, 0xb2464559}, + {0x81ee15df, 0x000003ce, 0x00000725, 0x9942e2de, 0x4ccf571b}, + {0x5c768e04, 0x00000afd, 0x00000160, 0x36110831, 0xae0b305a}, + {0xe5e18094, 0x00000b4b, 0x000000a0, 0xffa3e4a7, 0x6c8a4f09}, + {0xed7263b6, 0x00000d0d, 0x000002f2, 0xb0006a35, 0x7e04af8c}, + {0x5bfde7d7, 0x000006fb, 0x00000554, 0xa4193b76, 0xb3a91d12}, + {0x67f4a743, 0x00000b85, 0x0000047a, 0xf05c8d8f, 0xfb472fdf}, + {0xf13bdf22, 0x00000ff7, 0x00000008, 0x816351eb, 0xf347f235}, + {0x08ecc608, 0x00000d5d, 0x00000098, 0x90492772, 0x0b7f1521}, + {0x296f52ba, 0x000004f9, 0x00000788, 0x5e5a4896, 0x1cc67088}, + {0xbe4624c2, 0x00000427, 0x000004ef, 0xcd267b94, 0x550caefd}, + {0x906f7c7c, 0x00000a05, 0x0000003f, 0x03fcfc33, 0x9ed82a02}, + {0x8f7b323e, 0x00000458, 0x000004c7, 0xcd4969c8, 0x633c38a8}, + {0x88d6593d, 0x00000597, 0x000005b5, 0xf199cd3b, 0x0491452f}, + {0x978a7768, 0x00000268, 0x000001d3, 0xb28c95bd, 0x1a42fe61}, + {0x857a621e, 0x000007a7, 0x000003a8, 0xf4bf84ab, 0xcd0694c6}, + {0xb0e121ef, 0x000005be, 0x00000644, 0x28747c14, 0xf0510c72}, + {0, 0, 0, 0, 0}, +}; + +static int test_crc32c(void) +{ + struct crc_test *t = test; + int failures = 0; + + while (t->length) { + uint32_t be, le; + le = ext2fs_crc32c_le(t->crc, test_buf + t->start, t->length); + be = ext2fs_crc32_be(t->crc, test_buf + t->start, t->length); + if (le != t->crc32c_le) { + printf("Test %d LE fails, %x != %x\n", + (int) (t - test), le, t->crc32c_le); + failures++; + } + if (be != t->crc32_be) { + printf("Test %d BE fails, %x != %x\n", + (int) (t - test), be, t->crc32_be); + failures++; + } + t++; + } + + return failures; +} + +int main(int argc, char *argv[]) +{ + int ret; + + ret = test_crc32c(); + if (!ret) + printf("No failures.\n"); + + return ret; +} +#endif /* UNITTEST */ diff --git a/lib/ext2fs/crc32c_defs.h b/lib/ext2fs/crc32c_defs.h new file mode 100644 index 0000000..3f9a09e --- /dev/null +++ b/lib/ext2fs/crc32c_defs.h @@ -0,0 +1,59 @@ +/* + * There are multiple 16-bit CRC polynomials in common use, but this is + * *the* standard CRC-32 polynomial, first popularized by Ethernet. + * x^32+x^26+x^23+x^22+x^16+x^12+x^11+x^10+x^8+x^7+x^5+x^4+x^2+x^1+x^0 + */ +#define CRCPOLY_LE 0xedb88320 +#define CRCPOLY_BE 0x04c11db7 + +/* + * This is the CRC32c polynomial, as outlined by Castagnoli. + * x^32+x^28+x^27+x^26+x^25+x^23+x^22+x^20+x^19+x^18+x^14+x^13+x^11+x^10+x^9+ + * x^8+x^6+x^0 + */ +#define CRC32C_POLY_LE 0x82F63B78 +#define CRC32C_POLY_BE 0x1EDC6F41 + +/* How many bits at a time to use. Valid values are 1, 2, 4, 8, 32 and 64. */ +/* For less performance-sensitive, use 4 */ +#ifndef CRC_LE_BITS +# define CRC_LE_BITS 64 +#endif +#ifndef CRC_BE_BITS +# define CRC_BE_BITS 64 +#endif + +/* + * Little-endian CRC computation. Used with serial bit streams sent + * lsbit-first. Be sure to use cpu_to_le32() to append the computed CRC. + */ +#if CRC_LE_BITS > 64 || CRC_LE_BITS < 1 || CRC_LE_BITS == 16 || \ + CRC_LE_BITS & CRC_LE_BITS-1 +# error "CRC_LE_BITS must be one of {1, 2, 4, 8, 32, 64}" +#endif + +/* + * Big-endian CRC computation. Used with serial bit streams sent + * msbit-first. Be sure to use cpu_to_be32() to append the computed CRC. + */ +#if CRC_BE_BITS > 64 || CRC_BE_BITS < 1 || CRC_BE_BITS == 16 || \ + CRC_BE_BITS & CRC_BE_BITS-1 +# error "CRC_BE_BITS must be one of {1, 2, 4, 8, 32, 64}" +#endif + + +#define ___constant_swab32(x) \ + ((uint32_t)( \ + (((uint32_t)(x) & (uint32_t)0x000000ffUL) << 24) | \ + (((uint32_t)(x) & (uint32_t)0x0000ff00UL) << 8) | \ + (((uint32_t)(x) & (uint32_t)0x00ff0000UL) >> 8) | \ + (((uint32_t)(x) & (uint32_t)0xff000000UL) >> 24))) + + +#if (__GNUC__ >= 3) +#define likely(x) __builtin_expect(!!(x), 1) +#define unlikely(x) __builtin_expect(!!(x), 0) +#else +#define likely(x) (x) +#define unlikely(x) (x) +#endif diff --git a/lib/ext2fs/csum.c b/lib/ext2fs/csum.c new file mode 100644 index 0000000..da32d94 --- /dev/null +++ b/lib/ext2fs/csum.c @@ -0,0 +1,1011 @@ +/* + * csum.c --- checksumming of ext3 structures + * + * Copyright (C) 2006 Cluster File Systems, Inc. + * Copyright (C) 2006, 2007 by Andreas Dilger <adilger@clusterfs.com> + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "crc16.h" +#include <assert.h> + +#ifndef offsetof +#define offsetof(TYPE, MEMBER) ((size_t) &((TYPE *)0)->MEMBER) +#endif + +#ifdef DEBUG +#define STATIC +#else +#define STATIC static +#endif + +void ext2fs_init_csum_seed(ext2_filsys fs) +{ + if (ext2fs_has_feature_csum_seed(fs->super)) + fs->csum_seed = fs->super->s_checksum_seed; + else if (ext2fs_has_feature_metadata_csum(fs->super) || + ext2fs_has_feature_ea_inode(fs->super)) + fs->csum_seed = ext2fs_crc32c_le(~0, fs->super->s_uuid, + sizeof(fs->super->s_uuid)); +} + +static __u32 ext2fs_mmp_csum(ext2_filsys fs, struct mmp_struct *mmp) +{ + int offset = offsetof(struct mmp_struct, mmp_checksum); + + return ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)mmp, offset); +} + +int ext2fs_mmp_csum_verify(ext2_filsys fs, struct mmp_struct *mmp) +{ + __u32 calculated; + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 1; + + calculated = ext2fs_mmp_csum(fs, mmp); + + return ext2fs_le32_to_cpu(mmp->mmp_checksum) == calculated; +} + +errcode_t ext2fs_mmp_csum_set(ext2_filsys fs, struct mmp_struct *mmp) +{ + __u32 crc; + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 0; + + crc = ext2fs_mmp_csum(fs, mmp); + mmp->mmp_checksum = ext2fs_cpu_to_le32(crc); + + return 0; +} + +int ext2fs_verify_csum_type(ext2_filsys fs, struct ext2_super_block *sb) +{ + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 1; + + return sb->s_checksum_type == EXT2_CRC32C_CHKSUM; +} + +static __u32 ext2fs_superblock_csum(ext2_filsys fs EXT2FS_ATTR((unused)), + struct ext2_super_block *sb) +{ + int offset = offsetof(struct ext2_super_block, s_checksum); + + return ext2fs_crc32c_le(~0, (unsigned char *)sb, offset); +} + +/* NOTE: The input to this function MUST be in LE order */ +int ext2fs_superblock_csum_verify(ext2_filsys fs, struct ext2_super_block *sb) +{ + __u32 flag, calculated; + + if (fs->flags & EXT2_FLAG_SWAP_BYTES) + flag = EXT4_FEATURE_RO_COMPAT_METADATA_CSUM; + else + flag = ext2fs_cpu_to_le32(EXT4_FEATURE_RO_COMPAT_METADATA_CSUM); + + if (!EXT2_HAS_RO_COMPAT_FEATURE(fs->super, flag)) + return 1; + + calculated = ext2fs_superblock_csum(fs, sb); + + return ext2fs_le32_to_cpu(sb->s_checksum) == calculated; +} + +/* NOTE: The input to this function MUST be in LE order */ +errcode_t ext2fs_superblock_csum_set(ext2_filsys fs, + struct ext2_super_block *sb) +{ + __u32 flag, crc; + + if (fs->flags & EXT2_FLAG_SWAP_BYTES) + flag = EXT4_FEATURE_RO_COMPAT_METADATA_CSUM; + else + flag = ext2fs_cpu_to_le32(EXT4_FEATURE_RO_COMPAT_METADATA_CSUM); + + if (!EXT2_HAS_RO_COMPAT_FEATURE(fs->super, flag)) + return 0; + + crc = ext2fs_superblock_csum(fs, sb); + sb->s_checksum = ext2fs_cpu_to_le32(crc); + + return 0; +} + +static errcode_t ext2fs_ext_attr_block_csum(ext2_filsys fs, + ext2_ino_t inum EXT2FS_ATTR((unused)), + blk64_t block, + struct ext2_ext_attr_header *hdr, + __u32 *crc) +{ + char *buf = (char *)hdr; + __u32 old_crc = hdr->h_checksum; + + hdr->h_checksum = 0; + block = ext2fs_cpu_to_le64(block); + *crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&block, + sizeof(block)); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)buf, fs->blocksize); + hdr->h_checksum = old_crc; + + return 0; +} + +int ext2fs_ext_attr_block_csum_verify(ext2_filsys fs, ext2_ino_t inum, + blk64_t block, + struct ext2_ext_attr_header *hdr) +{ + __u32 calculated; + errcode_t retval; + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 1; + + retval = ext2fs_ext_attr_block_csum(fs, inum, block, hdr, &calculated); + if (retval) + return 0; + + return ext2fs_le32_to_cpu(hdr->h_checksum) == calculated; +} + +errcode_t ext2fs_ext_attr_block_csum_set(ext2_filsys fs, ext2_ino_t inum, + blk64_t block, + struct ext2_ext_attr_header *hdr) +{ + errcode_t retval; + __u32 crc; + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 0; + + retval = ext2fs_ext_attr_block_csum(fs, inum, block, hdr, &crc); + if (retval) + return retval; + hdr->h_checksum = ext2fs_cpu_to_le32(crc); + return 0; +} + +static __u16 do_nothing16(__u16 x) +{ + return x; +} + +static __u16 disk_to_host16(__u16 x) +{ + return ext2fs_le16_to_cpu(x); +} + +static errcode_t __get_dx_countlimit(ext2_filsys fs, + struct ext2_dir_entry *dirent, + struct ext2_dx_countlimit **cc, + int *offset, + int need_swab) +{ + struct ext2_dir_entry *dp; + struct ext2_dx_root_info *root; + struct ext2_dx_countlimit *c; + int count_offset, max_sane_entries; + unsigned int rec_len; + __u16 (*translate)(__u16) = (need_swab ? disk_to_host16 : do_nothing16); + + rec_len = translate(dirent->rec_len); + + if (rec_len == fs->blocksize && translate(dirent->name_len) == 0) + count_offset = 8; + else if (rec_len == 12) { + dp = (struct ext2_dir_entry *)(((char *)dirent) + rec_len); + rec_len = translate(dp->rec_len); + if (rec_len != fs->blocksize - 12) + return EXT2_ET_DB_NOT_FOUND; + root = (struct ext2_dx_root_info *)(((char *)dp + 12)); + if (root->reserved_zero || + root->info_length != sizeof(struct ext2_dx_root_info)) + return EXT2_ET_DB_NOT_FOUND; + count_offset = 32; + } else + return EXT2_ET_DB_NOT_FOUND; + + c = (struct ext2_dx_countlimit *)(((char *)dirent) + count_offset); + max_sane_entries = (fs->blocksize - count_offset) / + sizeof(struct ext2_dx_entry); + if (ext2fs_le16_to_cpu(c->limit) > max_sane_entries || + ext2fs_le16_to_cpu(c->count) > max_sane_entries) + return EXT2_ET_DIR_NO_SPACE_FOR_CSUM; + + if (offset) + *offset = count_offset; + if (cc) + *cc = c; + + return 0; +} + +errcode_t ext2fs_get_dx_countlimit(ext2_filsys fs, + struct ext2_dir_entry *dirent, + struct ext2_dx_countlimit **cc, + int *offset) +{ + return __get_dx_countlimit(fs, dirent, cc, offset, 0); +} + +void ext2fs_initialize_dirent_tail(ext2_filsys fs, + struct ext2_dir_entry_tail *t) +{ + memset(t, 0, sizeof(struct ext2_dir_entry_tail)); + ext2fs_set_rec_len(fs, sizeof(struct ext2_dir_entry_tail), + (struct ext2_dir_entry *)t); + t->det_reserved_name_len = EXT2_DIR_NAME_LEN_CSUM; +} + +static errcode_t __get_dirent_tail(ext2_filsys fs, + struct ext2_dir_entry *dirent, + struct ext2_dir_entry_tail **tt, + int need_swab) +{ + struct ext2_dir_entry *d; + void *top; + struct ext2_dir_entry_tail *t; + unsigned int rec_len; + errcode_t retval = 0; + __u16 (*translate)(__u16) = (need_swab ? disk_to_host16 : do_nothing16); + + if (fs->blocksize < 1024) + return EXT2_FILSYS_CORRUPTED; /* Should never happen */ + + d = dirent; + top = EXT2_DIRENT_TAIL(dirent, fs->blocksize); + + while ((void *) d < top) { + rec_len = translate(d->rec_len); + if ((rec_len < 8) || (rec_len & 0x03)) + return EXT2_ET_DIR_CORRUPTED; + d = (struct ext2_dir_entry *)(((char *)d) + rec_len); + } + + if ((char *)d > ((char *)dirent + fs->blocksize)) + return EXT2_ET_DIR_CORRUPTED; + if (d != top) + return EXT2_ET_DIR_NO_SPACE_FOR_CSUM; + + t = (struct ext2_dir_entry_tail *)d; + if (t->det_reserved_zero1 || + translate(t->det_rec_len) != sizeof(struct ext2_dir_entry_tail) || + translate(t->det_reserved_name_len) != EXT2_DIR_NAME_LEN_CSUM) + return EXT2_ET_DIR_NO_SPACE_FOR_CSUM; + + if (tt) + *tt = t; + return retval; +} + +int ext2fs_dirent_has_tail(ext2_filsys fs, struct ext2_dir_entry *dirent) +{ + return __get_dirent_tail(fs, dirent, NULL, 0) != + EXT2_ET_DIR_NO_SPACE_FOR_CSUM; +} + +static errcode_t ext2fs_dirent_csum(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent, __u32 *crc, + int size) +{ + errcode_t retval; + char *buf = (char *)dirent; + __u32 gen; + struct ext2_inode inode; + + retval = ext2fs_read_inode(fs, inum, &inode); + if (retval) + return retval; + + inum = ext2fs_cpu_to_le32(inum); + gen = ext2fs_cpu_to_le32(inode.i_generation); + *crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&inum, + sizeof(inum)); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)&gen, sizeof(gen)); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)buf, size); + + return 0; +} + +int ext2fs_dirent_csum_verify(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent) +{ + errcode_t retval; + __u32 calculated; + struct ext2_dir_entry_tail *t; + + retval = __get_dirent_tail(fs, dirent, &t, 1); + if (retval) + return 1; + + /* + * The checksum field is overlaid with the dirent->name field + * so the swapfs.c functions won't change the endianness. + */ + retval = ext2fs_dirent_csum(fs, inum, dirent, &calculated, + (char *)t - (char *)dirent); + if (retval) + return 0; + return ext2fs_le32_to_cpu(t->det_checksum) == calculated; +} + +static errcode_t ext2fs_dirent_csum_set(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent) +{ + errcode_t retval; + __u32 crc; + struct ext2_dir_entry_tail *t; + + retval = __get_dirent_tail(fs, dirent, &t, 1); + if (retval) + return retval; + + /* swapfs.c functions don't change the checksum endianness */ + retval = ext2fs_dirent_csum(fs, inum, dirent, &crc, + (char *)t - (char *)dirent); + if (retval) + return retval; + t->det_checksum = ext2fs_cpu_to_le32(crc); + return 0; +} + +errcode_t ext2fs_dx_csum(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent, + __u32 *crc, struct ext2_dx_tail **ret_t) +{ + errcode_t retval; + char *buf = (char *)dirent; + int size; + __u32 gen, dummy_csum = 0; + struct ext2_inode inode; + struct ext2_dx_tail *t; + struct ext2_dx_countlimit *c; + int count_offset, limit, count; + + retval = __get_dx_countlimit(fs, dirent, &c, &count_offset, 1); + if (retval) + return retval; + limit = ext2fs_le16_to_cpu(c->limit); + count = ext2fs_le16_to_cpu(c->count); + if (count_offset + (limit * sizeof(struct ext2_dx_entry)) > + fs->blocksize - sizeof(struct ext2_dx_tail)) + return EXT2_ET_DIR_NO_SPACE_FOR_CSUM; + /* htree structs are accessed in LE order */ + t = (struct ext2_dx_tail *)(((struct ext2_dx_entry *)c) + limit); + + size = count_offset + (count * sizeof(struct ext2_dx_entry)); + + retval = ext2fs_read_inode(fs, inum, &inode); + if (retval) + return retval; + + inum = ext2fs_cpu_to_le32(inum); + gen = ext2fs_cpu_to_le32(inode.i_generation); + *crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&inum, + sizeof(inum)); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)&gen, sizeof(gen)); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)buf, size); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)t, 4); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)&dummy_csum, 4); + + if (ret_t) + *ret_t = t; + return 0; +} + +static int ext2fs_dx_csum_verify(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent) +{ + __u32 calculated; + errcode_t retval; + struct ext2_dx_tail *t; + + retval = ext2fs_dx_csum(fs, inum, dirent, &calculated, &t); + if (retval) + return 0; + + return ext2fs_le32_to_cpu(t->dt_checksum) == calculated; +} + +static errcode_t ext2fs_dx_csum_set(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent) +{ + __u32 crc; + errcode_t retval = 0; + struct ext2_dx_tail *t; + + retval = ext2fs_dx_csum(fs, inum, dirent, &crc, &t); + if (retval) + return retval; + t->dt_checksum = ext2fs_cpu_to_le32(crc); + return retval; +} + +int ext2fs_dir_block_csum_verify(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent) +{ + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 1; + + if (__get_dirent_tail(fs, dirent, NULL, 1) == 0) + return ext2fs_dirent_csum_verify(fs, inum, dirent); + if (__get_dx_countlimit(fs, dirent, NULL, NULL, 1) == 0) + return ext2fs_dx_csum_verify(fs, inum, dirent); + + return 0; +} + +errcode_t ext2fs_dir_block_csum_set(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent) +{ + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 0; + + if (__get_dirent_tail(fs, dirent, NULL, 1) == 0) + return ext2fs_dirent_csum_set(fs, inum, dirent); + if (__get_dx_countlimit(fs, dirent, NULL, NULL, 1) == 0) + return ext2fs_dx_csum_set(fs, inum, dirent); + + if (fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) + return 0; + return EXT2_ET_DIR_NO_SPACE_FOR_CSUM; +} + +#define EXT3_EXTENT_TAIL_OFFSET(hdr) (sizeof(struct ext3_extent_header) + \ + (sizeof(struct ext3_extent) * ext2fs_le16_to_cpu((hdr)->eh_max))) + +static struct ext3_extent_tail *get_extent_tail(struct ext3_extent_header *h) +{ + return (struct ext3_extent_tail *)(((char *)h) + + EXT3_EXTENT_TAIL_OFFSET(h)); +} + +static errcode_t ext2fs_extent_block_csum(ext2_filsys fs, ext2_ino_t inum, + struct ext3_extent_header *eh, + __u32 *crc) +{ + int size; + __u32 gen; + errcode_t retval; + struct ext2_inode inode; + + size = EXT3_EXTENT_TAIL_OFFSET(eh) + offsetof(struct ext3_extent_tail, + et_checksum); + + retval = ext2fs_read_inode(fs, inum, &inode); + if (retval) + return retval; + inum = ext2fs_cpu_to_le32(inum); + gen = ext2fs_cpu_to_le32(inode.i_generation); + *crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&inum, + sizeof(inum)); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)&gen, sizeof(gen)); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)eh, size); + + return 0; +} + +int ext2fs_extent_block_csum_verify(ext2_filsys fs, ext2_ino_t inum, + struct ext3_extent_header *eh) +{ + errcode_t retval; + __u32 provided, calculated; + struct ext3_extent_tail *t = get_extent_tail(eh); + + /* + * The extent tree structures are accessed in LE order, so we must + * swap the checksum bytes here. + */ + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 1; + + provided = ext2fs_le32_to_cpu(t->et_checksum); + retval = ext2fs_extent_block_csum(fs, inum, eh, &calculated); + if (retval) + return 0; + + return provided == calculated; +} + +errcode_t ext2fs_extent_block_csum_set(ext2_filsys fs, ext2_ino_t inum, + struct ext3_extent_header *eh) +{ + errcode_t retval; + __u32 crc; + struct ext3_extent_tail *t = get_extent_tail(eh); + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 0; + + /* + * The extent tree structures are accessed in LE order, so we must + * swap the checksum bytes here. + */ + retval = ext2fs_extent_block_csum(fs, inum, eh, &crc); + if (retval) + return retval; + t->et_checksum = ext2fs_cpu_to_le32(crc); + return retval; +} + +int ext2fs_inode_bitmap_csum_verify(ext2_filsys fs, dgrp_t group, + char *bitmap, int size) +{ + struct ext4_group_desc *gdp = (struct ext4_group_desc *) + ext2fs_group_desc(fs, fs->group_desc, group); + __u32 provided, calculated; + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 1; + provided = gdp->bg_inode_bitmap_csum_lo; + calculated = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)bitmap, + size); + if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_INODE_BITMAP_CSUM_HI_END) + provided |= (__u32)gdp->bg_inode_bitmap_csum_hi << 16; + else + calculated &= 0xFFFF; + + return provided == calculated; +} + +errcode_t ext2fs_inode_bitmap_csum_set(ext2_filsys fs, dgrp_t group, + char *bitmap, int size) +{ + __u32 crc; + struct ext4_group_desc *gdp = (struct ext4_group_desc *) + ext2fs_group_desc(fs, fs->group_desc, group); + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 0; + + crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)bitmap, size); + gdp->bg_inode_bitmap_csum_lo = crc & 0xFFFF; + if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_INODE_BITMAP_CSUM_HI_END) + gdp->bg_inode_bitmap_csum_hi = crc >> 16; + + return 0; +} + +int ext2fs_block_bitmap_csum_verify(ext2_filsys fs, dgrp_t group, + char *bitmap, int size) +{ + struct ext4_group_desc *gdp = (struct ext4_group_desc *) + ext2fs_group_desc(fs, fs->group_desc, group); + __u32 provided, calculated; + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 1; + provided = gdp->bg_block_bitmap_csum_lo; + calculated = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)bitmap, + size); + if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_BLOCK_BITMAP_CSUM_HI_LOCATION) + provided |= (__u32)gdp->bg_block_bitmap_csum_hi << 16; + else + calculated &= 0xFFFF; + + return provided == calculated; +} + +errcode_t ext2fs_block_bitmap_csum_set(ext2_filsys fs, dgrp_t group, + char *bitmap, int size) +{ + __u32 crc; + struct ext4_group_desc *gdp = (struct ext4_group_desc *) + ext2fs_group_desc(fs, fs->group_desc, group); + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 0; + + crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)bitmap, size); + gdp->bg_block_bitmap_csum_lo = crc & 0xFFFF; + if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_BLOCK_BITMAP_CSUM_HI_LOCATION) + gdp->bg_block_bitmap_csum_hi = crc >> 16; + + return 0; +} + +static errcode_t ext2fs_inode_csum(ext2_filsys fs, ext2_ino_t inum, + struct ext2_inode_large *inode, + __u32 *crc, int has_hi) +{ + __u32 gen; + struct ext2_inode_large *desc = inode; + size_t size = EXT2_INODE_SIZE(fs->super); + __u16 old_lo; + __u16 old_hi = 0; + + old_lo = inode->i_checksum_lo; + inode->i_checksum_lo = 0; + if (has_hi) { + old_hi = inode->i_checksum_hi; + inode->i_checksum_hi = 0; + } + + inum = ext2fs_cpu_to_le32(inum); + gen = inode->i_generation; + *crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&inum, + sizeof(inum)); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)&gen, sizeof(gen)); + *crc = ext2fs_crc32c_le(*crc, (unsigned char *)desc, size); + + inode->i_checksum_lo = old_lo; + if (has_hi) + inode->i_checksum_hi = old_hi; + return 0; +} + +int ext2fs_inode_csum_verify(ext2_filsys fs, ext2_ino_t inum, + struct ext2_inode_large *inode) +{ + errcode_t retval; + __u32 provided, calculated; + unsigned int i, has_hi; + char *cp; + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 1; + + has_hi = (EXT2_INODE_SIZE(fs->super) > EXT2_GOOD_OLD_INODE_SIZE && + inode->i_extra_isize >= EXT4_INODE_CSUM_HI_EXTRA_END); + + provided = ext2fs_le16_to_cpu(inode->i_checksum_lo); + retval = ext2fs_inode_csum(fs, inum, inode, &calculated, has_hi); + if (retval) + return 0; + if (has_hi) { + __u32 hi = ext2fs_le16_to_cpu(inode->i_checksum_hi); + provided |= hi << 16; + } else + calculated &= 0xFFFF; + + if (provided == calculated) + return 1; + + /* + * If the checksum didn't match, it's possible it was due to + * the inode being all zero's. It's unlikely this is the + * case, but it can happen. So check for it here. (We only + * check the base inode since that's good enough, and it's not + * worth the bother to figure out how much of the extended + * inode, if any, is present.) + */ + for (cp = (char *) inode, i = 0; + i < sizeof(struct ext2_inode); + cp++, i++) + if (*cp) + return 0; + return 1; /* Inode must have been all zero's */ +} + +errcode_t ext2fs_inode_csum_set(ext2_filsys fs, ext2_ino_t inum, + struct ext2_inode_large *inode) +{ + errcode_t retval; + __u32 crc; + int has_hi; + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 0; + + has_hi = (EXT2_INODE_SIZE(fs->super) > EXT2_GOOD_OLD_INODE_SIZE && + inode->i_extra_isize >= EXT4_INODE_CSUM_HI_EXTRA_END); + + retval = ext2fs_inode_csum(fs, inum, inode, &crc, has_hi); + if (retval) + return retval; + inode->i_checksum_lo = ext2fs_cpu_to_le16(crc & 0xFFFF); + if (has_hi) + inode->i_checksum_hi = ext2fs_cpu_to_le16(crc >> 16); + return 0; +} + +__u16 ext2fs_group_desc_csum(ext2_filsys fs, dgrp_t group) +{ + struct ext2_group_desc *desc = ext2fs_group_desc(fs, fs->group_desc, + group); + size_t offset, size = EXT2_DESC_SIZE(fs->super); + __u16 crc = 0; +#ifdef WORDS_BIGENDIAN + struct ext4_group_desc swabdesc; + size_t save_size = size; + const size_t ext4_bg_size = sizeof(struct ext4_group_desc); + struct ext2_group_desc *save_desc = desc; + + /* Have to swab back to little-endian to do the checksum */ + if (size > ext4_bg_size) + size = ext4_bg_size; + memcpy(&swabdesc, desc, size); + ext2fs_swap_group_desc2(fs, (struct ext2_group_desc *) &swabdesc); + desc = (struct ext2_group_desc *) &swabdesc; + group = ext2fs_swab32(group); +#endif + + if (ext2fs_has_feature_metadata_csum(fs->super)) { + /* new metadata csum code */ + __u16 old_crc; + __u32 crc32; + + old_crc = desc->bg_checksum; + desc->bg_checksum = 0; + crc32 = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&group, + sizeof(group)); + crc32 = ext2fs_crc32c_le(crc32, (unsigned char *)desc, + size); + desc->bg_checksum = old_crc; +#ifdef WORDS_BIGENDIAN + if (save_size > ext4_bg_size) + crc32 = ext2fs_crc32c_le(crc32, + (unsigned char *)save_desc + ext4_bg_size, + save_size - ext4_bg_size); +#endif + crc = crc32 & 0xFFFF; + goto out; + } + + /* old crc16 code */ + offset = offsetof(struct ext2_group_desc, bg_checksum); + crc = ext2fs_crc16(~0, fs->super->s_uuid, + sizeof(fs->super->s_uuid)); + crc = ext2fs_crc16(crc, &group, sizeof(group)); + crc = ext2fs_crc16(crc, desc, offset); + offset += sizeof(desc->bg_checksum); /* skip checksum */ + /* for checksum of struct ext4_group_desc do the rest...*/ + if (offset < size) { + crc = ext2fs_crc16(crc, (char *)desc + offset, + size - offset); + } +#ifdef WORDS_BIGENDIAN + /* + * If the size of the bg descriptor is greater than 64 + * bytes, which is the size of the traditional ext4 bg + * descriptor, checksum the rest of the descriptor here + */ + if (save_size > ext4_bg_size) + crc = ext2fs_crc16(crc, (char *)save_desc + ext4_bg_size, + save_size - ext4_bg_size); +#endif + +out: + return crc; +} + +int ext2fs_group_desc_csum_verify(ext2_filsys fs, dgrp_t group) +{ + if (ext2fs_has_group_desc_csum(fs) && + (ext2fs_bg_checksum(fs, group) != + ext2fs_group_desc_csum(fs, group))) + return 0; + + return 1; +} + +void ext2fs_group_desc_csum_set(ext2_filsys fs, dgrp_t group) +{ + if (!ext2fs_has_group_desc_csum(fs)) + return; + + /* ext2fs_bg_checksum_set() sets the actual checksum field but + * does not calculate the checksum itself. */ + ext2fs_bg_checksum_set(fs, group, ext2fs_group_desc_csum(fs, group)); +} + +static __u32 find_last_inode_ingrp(ext2fs_inode_bitmap bitmap, + __u32 inodes_per_grp, dgrp_t grp_no) +{ + ext2_ino_t i, start_ino, end_ino; + + start_ino = grp_no * inodes_per_grp + 1; + end_ino = start_ino + inodes_per_grp - 1; + + for (i = end_ino; i >= start_ino; i--) { + if (ext2fs_fast_test_inode_bitmap2(bitmap, i)) + return i - start_ino + 1; + } + return inodes_per_grp; +} + +/* update the bitmap flags, set the itable high watermark, and calculate + * checksums for the group descriptors */ +errcode_t ext2fs_set_gdt_csum(ext2_filsys fs) +{ + struct ext2_super_block *sb = fs->super; + int dirty = 0; + dgrp_t i; + + if (!fs->inode_map) + return EXT2_ET_NO_INODE_BITMAP; + + if (!ext2fs_has_group_desc_csum(fs)) + return 0; + + for (i = 0; i < fs->group_desc_count; i++) { + __u32 old_csum = ext2fs_bg_checksum(fs, i); + __u32 old_unused = ext2fs_bg_itable_unused(fs, i); + __u32 old_flags = ext2fs_bg_flags(fs, i); + __u32 old_free_inodes_count = ext2fs_bg_free_inodes_count(fs, i); + __u32 old_free_blocks_count = ext2fs_bg_free_blocks_count(fs, i); + + if (old_free_blocks_count == sb->s_blocks_per_group && + i != fs->group_desc_count - 1) + ext2fs_bg_flags_set(fs, i, EXT2_BG_BLOCK_UNINIT); + + if (old_free_inodes_count == sb->s_inodes_per_group) { + ext2fs_bg_flags_set(fs, i, EXT2_BG_INODE_UNINIT); + ext2fs_bg_itable_unused_set(fs, i, sb->s_inodes_per_group); + } else { + int unused = + sb->s_inodes_per_group - + find_last_inode_ingrp(fs->inode_map, + sb->s_inodes_per_group, i); + + ext2fs_bg_flags_clear(fs, i, EXT2_BG_INODE_UNINIT); + ext2fs_bg_itable_unused_set(fs, i, unused); + } + + ext2fs_group_desc_csum_set(fs, i); + if (old_flags != ext2fs_bg_flags(fs, i)) + dirty = 1; + if (old_unused != ext2fs_bg_itable_unused(fs, i)) + dirty = 1; + if (old_csum != ext2fs_bg_checksum(fs, i)) + dirty = 1; + } + if (dirty) + ext2fs_mark_super_dirty(fs); + return 0; +} + +#ifdef DEBUG +#include "e2p/e2p.h" + +void print_csum(const char *msg, ext2_filsys fs, dgrp_t group) +{ + __u16 crc1, crc2, crc3; + dgrp_t swabgroup; + struct ext2_group_desc *desc = ext2fs_group_desc(fs, fs->group_desc, + group); + size_t size = EXT2_DESC_SIZE(fs->super); + struct ext2_super_block *sb = fs->super; + int offset = offsetof(struct ext2_group_desc, bg_checksum); +#ifdef WORDS_BIGENDIAN + struct ext4_group_desc swabdesc; + struct ext2_group_desc *save_desc = desc; + const size_t ext4_bg_size = sizeof(struct ext4_group_desc); + size_t save_size = size; +#endif + +#ifdef WORDS_BIGENDIAN + /* Have to swab back to little-endian to do the checksum */ + if (size > ext4_bg_size) + size = ext4_bg_size; + memcpy(&swabdesc, desc, size); + ext2fs_swap_group_desc2(fs, (struct ext2_group_desc *) &swabdesc); + desc = (struct ext2_group_desc *) &swabdesc; + + swabgroup = ext2fs_swab32(group); +#else + swabgroup = group; +#endif + + crc1 = ext2fs_crc16(~0, sb->s_uuid, sizeof(fs->super->s_uuid)); + crc2 = ext2fs_crc16(crc1, &swabgroup, sizeof(swabgroup)); + crc3 = ext2fs_crc16(crc2, desc, offset); + offset += sizeof(desc->bg_checksum); /* skip checksum */ + /* for checksum of struct ext4_group_desc do the rest...*/ + if (offset < size) + crc3 = ext2fs_crc16(crc3, (char *)desc + offset, size - offset); +#ifdef WORDS_BIGENDIAN + if (save_size > ext4_bg_size) + crc3 = ext2fs_crc16(crc3, (char *)save_desc + ext4_bg_size, + save_size - ext4_bg_size); +#endif + + printf("%s UUID %s=%04x, grp %u=%04x: %04x=%04x\n", + msg, e2p_uuid2str(sb->s_uuid), crc1, group, crc2, crc3, + ext2fs_group_desc_csum(fs, group)); +} + +unsigned char sb_uuid[16] = { 0x4f, 0x25, 0xe8, 0xcf, 0xe7, 0x97, 0x48, 0x23, + 0xbe, 0xfa, 0xa7, 0x88, 0x4b, 0xae, 0xec, 0xdb }; + +int main(int argc, char **argv) +{ + struct ext2_super_block param; + errcode_t retval; + ext2_filsys fs; + int i; + __u16 csum1, csum2, csum_known = 0xd3a4; + + memset(¶m, 0, sizeof(param)); + ext2fs_blocks_count_set(¶m, 32768); +#if 0 + param.s_feature_incompat |= EXT4_FEATURE_INCOMPAT_64BIT; + param.s_desc_size = 128; + csum_known = 0x5b6e; +#endif + + retval = ext2fs_initialize("test fs", EXT2_FLAG_64BITS, ¶m, + test_io_manager, &fs); + if (retval) { + com_err("setup", retval, + "While initializing filesystem"); + exit(1); + } + memcpy(fs->super->s_uuid, sb_uuid, 16); + fs->super->s_feature_ro_compat = EXT4_FEATURE_RO_COMPAT_GDT_CSUM; + + for (i=0; i < fs->group_desc_count; i++) { + ext2fs_block_bitmap_loc_set(fs, i, 124); + ext2fs_inode_bitmap_loc_set(fs, i, 125); + ext2fs_inode_table_loc_set(fs, i, 126); + ext2fs_bg_free_blocks_count_set(fs, i, 31119); + ext2fs_bg_free_inodes_count_set(fs, i, 15701); + ext2fs_bg_used_dirs_count_set(fs, i, 2); + ext2fs_bg_flags_zap(fs, i); + }; + + csum1 = ext2fs_group_desc_csum(fs, 0); + print_csum("csum0000", fs, 0); + + if (csum1 != csum_known) { + printf("checksum for group 0 should be %04x\n", csum_known); + exit(1); + } + csum2 = ext2fs_group_desc_csum(fs, 1); + print_csum("csum0001", fs, 1); + if (csum1 == csum2) { + printf("checksums for different groups shouldn't match\n"); + exit(1); + } + csum2 = ext2fs_group_desc_csum(fs, 2); + print_csum("csumffff", fs, 2); + if (csum1 == csum2) { + printf("checksums for different groups shouldn't match\n"); + exit(1); + } + ext2fs_bg_checksum_set(fs, 0, csum1); + csum2 = ext2fs_group_desc_csum(fs, 0); + print_csum("csum_set", fs, 0); + if (csum1 != csum2) { + printf("checksums should not depend on checksum field\n"); + exit(1); + } + if (!ext2fs_group_desc_csum_verify(fs, 0)) { + printf("checksums should verify against gd_checksum\n"); + exit(1); + } + memset(fs->super->s_uuid, 0x30, sizeof(fs->super->s_uuid)); + print_csum("new_uuid", fs, 0); + if (ext2fs_group_desc_csum_verify(fs, 0) != 0) { + printf("checksums for different filesystems shouldn't match\n"); + exit(1); + } + csum1 = ext2fs_group_desc_csum(fs, 0); + ext2fs_bg_checksum_set(fs, 0, csum1); + print_csum("csum_new", fs, 0); + ext2fs_bg_free_blocks_count_set(fs, 0, 1); + csum2 = ext2fs_group_desc_csum(fs, 0); + print_csum("csum_blk", fs, 0); + if (csum1 == csum2) { + printf("checksums for different data shouldn't match\n"); + exit(1); + } + ext2fs_free(fs); + + return 0; +} +#endif diff --git a/lib/ext2fs/dblist.c b/lib/ext2fs/dblist.c new file mode 100644 index 0000000..bbdb221 --- /dev/null +++ b/lib/ext2fs/dblist.c @@ -0,0 +1,403 @@ +/* + * dblist.c -- directory block list functions + * + * Copyright 1997 by Theodore Ts'o + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <string.h> +#include <time.h> + +#include "ext2_fs.h" +#include "ext2fsP.h" + +static EXT2_QSORT_TYPE dir_block_cmp(const void *a, const void *b); +static EXT2_QSORT_TYPE dir_block_cmp2(const void *a, const void *b); +static EXT2_QSORT_TYPE (*sortfunc32)(const void *a, const void *b); + +/* + * helper function for making a new directory block list (for + * initialize and copy). + */ +static errcode_t make_dblist(ext2_filsys fs, ext2_ino_t size, + ext2_ino_t count, + struct ext2_db_entry2 *list, + ext2_dblist *ret_dblist) +{ + ext2_dblist dblist = NULL; + errcode_t retval; + ext2_ino_t num_dirs; + size_t len; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if ((ret_dblist == 0) && fs->dblist && + (fs->dblist->magic == EXT2_ET_MAGIC_DBLIST)) + return 0; + + retval = ext2fs_get_mem(sizeof(struct ext2_struct_dblist), &dblist); + if (retval) + goto cleanup; + memset(dblist, 0, sizeof(struct ext2_struct_dblist)); + + dblist->magic = EXT2_ET_MAGIC_DBLIST; + dblist->fs = fs; + if (size) + dblist->size = size; + else { + retval = ext2fs_get_num_dirs(fs, &num_dirs); + if (retval) + goto cleanup; + dblist->size = (num_dirs * 2) + 12; + } + len = (size_t) sizeof(struct ext2_db_entry2) * dblist->size; + dblist->count = count; + retval = ext2fs_get_array(dblist->size, sizeof(struct ext2_db_entry2), + &dblist->list); + if (retval) + goto cleanup; + + if (list) + memcpy(dblist->list, list, len); + else + memset(dblist->list, 0, len); + if (ret_dblist) + *ret_dblist = dblist; + else + fs->dblist = dblist; + return 0; +cleanup: + if (dblist) + ext2fs_free_mem(&dblist); + return retval; +} + +/* + * Initialize a directory block list + */ +errcode_t ext2fs_init_dblist(ext2_filsys fs, ext2_dblist *ret_dblist) +{ + ext2_dblist dblist; + errcode_t retval; + + retval = make_dblist(fs, 0, 0, 0, &dblist); + if (retval) + return retval; + + dblist->sorted = 1; + if (ret_dblist) + *ret_dblist = dblist; + else + fs->dblist = dblist; + + return 0; +} + +/* + * Copy a directory block list + */ +errcode_t ext2fs_copy_dblist(ext2_dblist src, ext2_dblist *dest) +{ + ext2_dblist dblist; + errcode_t retval; + + retval = make_dblist(src->fs, src->size, src->count, src->list, + &dblist); + if (retval) + return retval; + dblist->sorted = src->sorted; + *dest = dblist; + return 0; +} + +/* + * Close a directory block list + * + * (moved to closefs.c) + */ + + +/* + * Add a directory block to the directory block list + */ +errcode_t ext2fs_add_dir_block2(ext2_dblist dblist, ext2_ino_t ino, + blk64_t blk, e2_blkcnt_t blockcnt) +{ + struct ext2_db_entry2 *new_entry; + errcode_t retval; + unsigned long old_size; + + EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST); + + if (dblist->count >= dblist->size) { + old_size = dblist->size * sizeof(struct ext2_db_entry2); + dblist->size += dblist->size > 200 ? dblist->size / 2 : 100; + retval = ext2fs_resize_mem(old_size, (size_t) dblist->size * + sizeof(struct ext2_db_entry2), + &dblist->list); + if (retval) { + dblist->size = old_size / sizeof(struct ext2_db_entry2); + return retval; + } + } + new_entry = dblist->list + ( dblist->count++); + new_entry->blk = blk; + new_entry->ino = ino; + new_entry->blockcnt = blockcnt; + + dblist->sorted = 0; + + return 0; +} + +/* + * Change the directory block to the directory block list + */ +errcode_t ext2fs_set_dir_block2(ext2_dblist dblist, ext2_ino_t ino, + blk64_t blk, e2_blkcnt_t blockcnt) +{ + dgrp_t i; + + EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST); + + for (i=0; i < dblist->count; i++) { + if ((dblist->list[i].ino != ino) || + (dblist->list[i].blockcnt != blockcnt)) + continue; + dblist->list[i].blk = blk; + dblist->sorted = 0; + return 0; + } + return EXT2_ET_DB_NOT_FOUND; +} + +void ext2fs_dblist_sort2(ext2_dblist dblist, + EXT2_QSORT_TYPE (*sortfunc)(const void *, + const void *)) +{ + if (!sortfunc) + sortfunc = dir_block_cmp2; + qsort(dblist->list, (size_t) dblist->count, + sizeof(struct ext2_db_entry2), sortfunc); + dblist->sorted = 1; +} + +/* + * This function iterates over the directory block list + */ +errcode_t ext2fs_dblist_iterate3(ext2_dblist dblist, + int (*func)(ext2_filsys fs, + struct ext2_db_entry2 *db_info, + void *priv_data), + unsigned long long start, + unsigned long long count, + void *priv_data) +{ + unsigned long long i, end; + int ret; + + EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST); + + end = start + count; + if (!dblist->sorted) + ext2fs_dblist_sort2(dblist, 0); + if (end > dblist->count) + end = dblist->count; + for (i = start; i < end; i++) { + ret = (*func)(dblist->fs, &dblist->list[i], priv_data); + if (ret & DBLIST_ABORT) + return 0; + } + return 0; +} + +errcode_t ext2fs_dblist_iterate2(ext2_dblist dblist, + int (*func)(ext2_filsys fs, + struct ext2_db_entry2 *db_info, + void *priv_data), + void *priv_data) +{ + return ext2fs_dblist_iterate3(dblist, func, 0, dblist->count, + priv_data); +} + +static EXT2_QSORT_TYPE dir_block_cmp2(const void *a, const void *b) +{ + const struct ext2_db_entry2 *db_a = + (const struct ext2_db_entry2 *) a; + const struct ext2_db_entry2 *db_b = + (const struct ext2_db_entry2 *) b; + + if (db_a->blk != db_b->blk) + return (int) (db_a->blk - db_b->blk); + + if (db_a->ino != db_b->ino) + return (int) (db_a->ino - db_b->ino); + + return (db_a->blockcnt - db_b->blockcnt); +} + +blk64_t ext2fs_dblist_count2(ext2_dblist dblist) +{ + return dblist->count; +} + +errcode_t ext2fs_dblist_get_last2(ext2_dblist dblist, + struct ext2_db_entry2 **entry) +{ + EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST); + + if (dblist->count == 0) + return EXT2_ET_DBLIST_EMPTY; + + if (entry) + *entry = dblist->list + ( dblist->count-1); + return 0; +} + +errcode_t ext2fs_dblist_drop_last(ext2_dblist dblist) +{ + EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST); + + if (dblist->count == 0) + return EXT2_ET_DBLIST_EMPTY; + + dblist->count--; + return 0; +} + +/* + * Legacy 32-bit versions + */ + +/* + * Add a directory block to the directory block list + */ +errcode_t ext2fs_add_dir_block(ext2_dblist dblist, ext2_ino_t ino, blk_t blk, + int blockcnt) +{ + return ext2fs_add_dir_block2(dblist, ino, blk, blockcnt); +} + +/* + * Change the directory block to the directory block list + */ +errcode_t ext2fs_set_dir_block(ext2_dblist dblist, ext2_ino_t ino, blk_t blk, + int blockcnt) +{ + return ext2fs_set_dir_block2(dblist, ino, blk, blockcnt); +} + +void ext2fs_dblist_sort(ext2_dblist dblist, + EXT2_QSORT_TYPE (*sortfunc)(const void *, + const void *)) +{ + if (sortfunc) { + sortfunc32 = sortfunc; + sortfunc = dir_block_cmp; + } else + sortfunc = dir_block_cmp2; + qsort(dblist->list, (size_t) dblist->count, + sizeof(struct ext2_db_entry2), sortfunc); + dblist->sorted = 1; +} + +/* + * This function iterates over the directory block list + */ +struct iterate_passthrough { + int (*func)(ext2_filsys fs, + struct ext2_db_entry *db_info, + void *priv_data); + void *priv_data; +}; + +static int passthrough_func(ext2_filsys fs, + struct ext2_db_entry2 *db_info, + void *priv_data) +{ + struct iterate_passthrough *p = priv_data; + struct ext2_db_entry db; + int ret; + + db.ino = db_info->ino; + db.blk = (blk_t) db_info->blk; + db.blockcnt = (int) db_info->blockcnt; + ret = (p->func)(fs, &db, p->priv_data); + db_info->ino = db.ino; + db_info->blk = db.blk; + db_info->blockcnt = db.blockcnt; + return ret; +} + +errcode_t ext2fs_dblist_iterate(ext2_dblist dblist, + int (*func)(ext2_filsys fs, + struct ext2_db_entry *db_info, + void *priv_data), + void *priv_data) +{ + struct iterate_passthrough pass; + + EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST); + pass.func = func; + pass.priv_data = priv_data; + + return ext2fs_dblist_iterate2(dblist, passthrough_func, &pass); +} + +static EXT2_QSORT_TYPE dir_block_cmp(const void *a, const void *b) +{ + const struct ext2_db_entry2 *db_a = + (const struct ext2_db_entry2 *) a; + const struct ext2_db_entry2 *db_b = + (const struct ext2_db_entry2 *) b; + + struct ext2_db_entry a32, b32; + + a32.ino = db_a->ino; a32.blk = db_a->blk; + a32.blockcnt = db_a->blockcnt; + + b32.ino = db_b->ino; b32.blk = db_b->blk; + b32.blockcnt = db_b->blockcnt; + + return sortfunc32(&a32, &b32); +} + +int ext2fs_dblist_count(ext2_dblist dblist) +{ + return dblist->count; +} + +errcode_t ext2fs_dblist_get_last(ext2_dblist dblist, + struct ext2_db_entry **entry) +{ + static struct ext2_db_entry ret_entry; + struct ext2_db_entry2 *last; + + EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST); + + if (dblist->count == 0) + return EXT2_ET_DBLIST_EMPTY; + + if (!entry) + return 0; + + last = dblist->list + dblist->count -1; + + ret_entry.ino = last->ino; + ret_entry.blk = last->blk; + ret_entry.blockcnt = last->blockcnt; + *entry = &ret_entry; + + return 0; +} + diff --git a/lib/ext2fs/dblist_dir.c b/lib/ext2fs/dblist_dir.c new file mode 100644 index 0000000..864a3ca --- /dev/null +++ b/lib/ext2fs/dblist_dir.c @@ -0,0 +1,88 @@ +/* + * dblist_dir.c --- iterate by directory entry + * + * Copyright 1997 by Theodore Ts'o + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <string.h> +#include <time.h> + +#include "ext2_fs.h" +#include "ext2fsP.h" + +static int db_dir_proc(ext2_filsys fs, struct ext2_db_entry2 *db_info, + void *priv_data); + +errcode_t ext2fs_dblist_dir_iterate(ext2_dblist dblist, + int flags, + char *block_buf, + int (*func)(ext2_ino_t dir, + int entry, + struct ext2_dir_entry *dirent, + int offset, + int blocksize, + char *buf, + void *priv_data), + void *priv_data) +{ + errcode_t retval; + struct dir_context ctx; + + EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST); + + ctx.dir = 0; + ctx.flags = flags; + if (block_buf) + ctx.buf = block_buf; + else { + retval = ext2fs_get_mem(dblist->fs->blocksize, &ctx.buf); + if (retval) + return retval; + } + ctx.func = func; + ctx.priv_data = priv_data; + ctx.errcode = 0; + + retval = ext2fs_dblist_iterate2(dblist, db_dir_proc, &ctx); + + if (!block_buf) + ext2fs_free_mem(&ctx.buf); + if (retval) + return retval; + return ctx.errcode; +} + +static int db_dir_proc(ext2_filsys fs, struct ext2_db_entry2 *db_info, + void *priv_data) +{ + struct ext2_inode inode; + struct dir_context *ctx; + int ret; + + ctx = (struct dir_context *) priv_data; + ctx->dir = db_info->ino; + ctx->errcode = 0; + + ctx->errcode = ext2fs_read_inode(fs, ctx->dir, &inode); + if (ctx->errcode) + return DBLIST_ABORT; + if (inode.i_flags & EXT4_INLINE_DATA_FL) + ret = ext2fs_inline_data_dir_iterate(fs, ctx->dir, ctx); + else + ret = ext2fs_process_dir_block(fs, &db_info->blk, + db_info->blockcnt, 0, 0, + priv_data); + if ((ret & BLOCK_ABORT) && !ctx->errcode) + return DBLIST_ABORT; + return 0; +} diff --git a/lib/ext2fs/digest_encode.c b/lib/ext2fs/digest_encode.c new file mode 100644 index 0000000..075963f --- /dev/null +++ b/lib/ext2fs/digest_encode.c @@ -0,0 +1,187 @@ +/* + * lib/ext2fs/digest_encode.c + * + * A function to encode a digest using 64 characters that are valid in a + * filename per ext2fs rules. + * + * Written by Uday Savagaonkar, 2014. + * + * Copyright 2014 Google Inc. All Rights Reserved. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#include "ext2fs.h" + +static const char *lookup_table = + "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+,"; + +/** + * ext2fs_digest_encode() - + * + * Encodes the input digest using characters from the set [a-zA-Z0-9_+]. + * The encoded string is roughly 4/3 times the size of the input string. + */ +int ext2fs_digest_encode(const char *src, int len, char *dst) +{ + int i = 0, bits = 0, ac = 0; + char *cp = dst; + + while (i < len) { + ac += (((unsigned char) src[i]) << bits); + bits += 8; + do { + *cp++ = lookup_table[ac & 0x3f]; + ac >>= 6; + bits -= 6; + } while (bits >= 6); + i++; + } + if (bits) + *cp++ = lookup_table[ac & 0x3f]; + return cp - dst; +} + +int ext2fs_digest_decode(const char *src, int len, char *dst) +{ + int i = 0, bits = 0, ac = 0; + const char *p; + char *cp = dst; + + while (i < len) { + p = strchr(lookup_table, src[i]); + if (p == NULL || src[i] == 0) + return -1; + ac += (p - lookup_table) << bits; + bits += 6; + if (bits >= 8) { + *cp++ = ac & 0xff; + ac >>= 8; + bits -= 8; + } + i++; + } + if (ac) + return -1; + return cp - dst; +} + + +#ifdef UNITTEST +static const struct { + unsigned char d[32]; + unsigned int len; + const char *ed; +} tests[] = { + { { 0xe3, 0xb0, 0xc4, 0x42, 0x98, 0xfc, 0x1c, 0x14, + 0x9a, 0xfb, 0xf4, 0xc8, 0x99, 0x6f, 0xb9, 0x24, + 0x27, 0xae, 0x41, 0xe4, 0x64, 0x9b, 0x93, 0x4c, + 0xa4, 0x95, 0x99, 0x1b, 0x78, 0x52, 0xb8, 0x55 }, 32, + "jDLxChJ,cQhm7TPyZ+WukcirBROZbOJTkWZmbgnU4WF" + }, + { { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea, + 0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23, + 0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c, + 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad }, 32, + "6inF,+YAPreQBBk3d5qIjA7AhNqlXoHn0Cx,hJPAV0K" + }, + { { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, + 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39, + 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, + 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 }, 32, + "k0oahJtB4gb5AbykM4DY5MKPknFZ,HyZ2ze7Unx2GEM" + }, + { { 0x00, }, 1, + "AA" + }, + { { 0x01, }, 1, + "BA" + }, + { { 0x01, 0x02 }, 2, + "BIA" + }, + { { 0x01, 0x02, 0x03 }, 3, + "BIwA" + }, + { { 0x01, 0x02, 0x03, 0x04 }, 4, + "BIwAEA" + }, + { { 0x01, 0x02, 0x03, 0x04, 0xff }, 5, + "BIwAE8P" + }, + { { 0x01, 0x02, 0x03, 0x04, 0xff, 0xfe }, 6, + "BIwAE8v," + }, + { { 0x01, 0x02, 0x03, 0x04, 0xff, 0xfe, 0xfd }, 7, + "BIwAE8v,9D" + }, +}; + +int main(int argc, char **argv) +{ + int i, ret, len; + int errors = 0; + char tmp[1024], tmp2[1024]; + + if (argc == 3 && !strcmp(argv[1], "encode")) { + memset(tmp, 0, sizeof(tmp)); + ext2fs_digest_encode(argv[2], strlen(argv[2]), tmp); + puts(tmp); + exit(0); + } + if (argc == 3 && !strcmp(argv[1], "decode")) { + memset(tmp, 0, sizeof(tmp)); + ret = ext2fs_digest_decode(argv[2], strlen(argv[2]), tmp); + puts(tmp); + fprintf(stderr, "returned %d\n", ret); + exit(0); + } + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + memset(tmp, 0, sizeof(tmp)); + ret = ext2fs_digest_encode((const char *) tests[i].d, + tests[i].len, tmp); + len = strlen(tmp); + printf("Test Digest %d (returned %d): ", i, ret); + if (ret != len) { + printf("FAILED returned %d, string length was %d\n", + ret, len); + errors++; + continue; + } else if (strcmp(tmp, tests[i].ed) != 0) { + printf("FAILED: got %s, expected %s\n", tmp, + tests[i].ed); + errors++; + continue; + } + ret = ext2fs_digest_decode(tmp, len, tmp2); + if (ret != tests[i].len) { + printf("FAILED decode returned %d, expected %d\n", + ret, tests[i].len); + errors++; + continue; + } + if (memcmp(tmp2, tests[i].d, ret) != 0) { + puts("FAILED: decode mismatched"); + errors++; + continue; + } + printf("OK\n"); + } + for (i = 1; i < argc; i++) { + memset(tmp, 0, sizeof(tmp)); + ret = ext2fs_digest_encode(argv[i], strlen(argv[i]), tmp); + len = strlen(tmp); + printf("Digest of '%s' is '%s' (returned %d, length %d)\n", + argv[i], tmp, ret, len); + } + return errors; +} + +#endif /* UNITTEST */ diff --git a/lib/ext2fs/dir_iterate.c b/lib/ext2fs/dir_iterate.c new file mode 100644 index 0000000..7798a48 --- /dev/null +++ b/lib/ext2fs/dir_iterate.c @@ -0,0 +1,315 @@ +/* + * dir_iterate.c --- ext2fs directory iteration operations + * + * Copyright (C) 1993, 1994, 1994, 1995, 1996, 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" + +#define EXT4_MAX_REC_LEN ((1<<16)-1) + +errcode_t ext2fs_get_rec_len(ext2_filsys fs, + struct ext2_dir_entry *dirent, + unsigned int *rec_len) +{ + unsigned int len = dirent->rec_len; + + if (fs->blocksize < 65536) + *rec_len = len; + else if (len == EXT4_MAX_REC_LEN || len == 0) + *rec_len = fs->blocksize; + else + *rec_len = (len & 65532) | ((len & 3) << 16); + return 0; +} + +errcode_t ext2fs_set_rec_len(ext2_filsys fs, + unsigned int len, + struct ext2_dir_entry *dirent) +{ + if ((len > fs->blocksize) || (fs->blocksize > (1 << 18)) || (len & 3)) + return EINVAL; + if (len < 65536) { + dirent->rec_len = len; + return 0; + } + if (len == fs->blocksize) { + if (fs->blocksize == 65536) + dirent->rec_len = EXT4_MAX_REC_LEN; + else + dirent->rec_len = 0; + } else + dirent->rec_len = (len & 65532) | ((len >> 16) & 3); + return 0; +} + +/* + * This function checks to see whether or not a potential deleted + * directory entry looks valid. What we do is check the deleted entry + * and each successive entry to make sure that they all look valid and + * that the last deleted entry ends at the beginning of the next + * undeleted entry. Returns 1 if the deleted entry looks valid, zero + * if not valid. + */ +static int ext2fs_validate_entry(ext2_filsys fs, char *buf, + unsigned int offset, + unsigned int final_offset) +{ + struct ext2_dir_entry *dirent; + unsigned int rec_len; +#define DIRENT_MIN_LENGTH 12 + + while ((offset < final_offset) && + (offset <= fs->blocksize - DIRENT_MIN_LENGTH)) { + dirent = (struct ext2_dir_entry *)(buf + offset); + if (ext2fs_get_rec_len(fs, dirent, &rec_len)) + return 0; + offset += rec_len; + if ((rec_len < 8) || + ((rec_len % 4) != 0) || + ((ext2fs_dirent_name_len(dirent)+8) > (int) rec_len)) + return 0; + } + return (offset == final_offset); +} + +errcode_t ext2fs_dir_iterate2(ext2_filsys fs, + ext2_ino_t dir, + int flags, + char *block_buf, + int (*func)(ext2_ino_t dir, + int entry, + struct ext2_dir_entry *dirent, + int offset, + int blocksize, + char *buf, + void *priv_data), + void *priv_data) +{ + struct dir_context ctx; + errcode_t retval; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + retval = ext2fs_check_directory(fs, dir); + if (retval) + return retval; + + ctx.dir = dir; + ctx.flags = flags; + if (block_buf) + ctx.buf = block_buf; + else { + retval = ext2fs_get_mem(fs->blocksize, &ctx.buf); + if (retval) + return retval; + } + ctx.func = func; + ctx.priv_data = priv_data; + ctx.errcode = 0; + retval = ext2fs_block_iterate3(fs, dir, BLOCK_FLAG_READ_ONLY, 0, + ext2fs_process_dir_block, &ctx); + if (!block_buf) + ext2fs_free_mem(&ctx.buf); + if (retval == EXT2_ET_INLINE_DATA_CANT_ITERATE) { + (void) ext2fs_inline_data_dir_iterate(fs, dir, &ctx); + retval = 0; + } + if (retval) + return retval; + return ctx.errcode; +} + +struct xlate { + int (*func)(struct ext2_dir_entry *dirent, + int offset, + int blocksize, + char *buf, + void *priv_data); + void *real_private; +}; + +static int xlate_func(ext2_ino_t dir EXT2FS_ATTR((unused)), + int entry EXT2FS_ATTR((unused)), + struct ext2_dir_entry *dirent, int offset, + int blocksize, char *buf, void *priv_data) +{ + struct xlate *xl = (struct xlate *) priv_data; + + return (*xl->func)(dirent, offset, blocksize, buf, xl->real_private); +} + +errcode_t ext2fs_dir_iterate(ext2_filsys fs, + ext2_ino_t dir, + int flags, + char *block_buf, + int (*func)(struct ext2_dir_entry *dirent, + int offset, + int blocksize, + char *buf, + void *priv_data), + void *priv_data) +{ + struct xlate xl; + + xl.real_private = priv_data; + xl.func = func; + + return ext2fs_dir_iterate2(fs, dir, flags, block_buf, + xlate_func, &xl); +} + + +/* + * Helper function which is private to this module. Used by + * ext2fs_dir_iterate() and ext2fs_dblist_dir_iterate() + */ +int ext2fs_process_dir_block(ext2_filsys fs, + blk64_t *blocknr, + e2_blkcnt_t blockcnt, + blk64_t ref_block EXT2FS_ATTR((unused)), + int ref_offset EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct dir_context *ctx = (struct dir_context *) priv_data; + unsigned int offset = 0; + unsigned int next_real_entry = 0; + int ret = 0; + int changed = 0; + int do_abort = 0; + unsigned int rec_len, size, buflen; + int entry; + struct ext2_dir_entry *dirent; + int csum_size = 0; + int inline_data; + errcode_t retval = 0; + + if (blockcnt < 0) + return 0; + + entry = blockcnt ? DIRENT_OTHER_FILE : DIRENT_DOT_FILE; + + /* If a dir has inline data, we don't need to read block */ + inline_data = !!(ctx->flags & DIRENT_FLAG_INCLUDE_INLINE_DATA); + if (!inline_data) { + ctx->errcode = ext2fs_read_dir_block4(fs, *blocknr, ctx->buf, 0, + ctx->dir); + if (ctx->errcode) + return BLOCK_ABORT; + /* If we handle a normal dir, we traverse the entire block */ + buflen = fs->blocksize; + } else { + buflen = ctx->buflen; + } + + if (ext2fs_has_feature_metadata_csum(fs->super)) + csum_size = sizeof(struct ext2_dir_entry_tail); + + if (buflen < 8) { + ctx->errcode = EXT2_ET_DIR_CORRUPTED; + return BLOCK_ABORT; + } + while (offset < buflen - 8) { + dirent = (struct ext2_dir_entry *) (ctx->buf + offset); + if (ext2fs_get_rec_len(fs, dirent, &rec_len)) + return BLOCK_ABORT; + if (((offset + rec_len) > buflen) || + (rec_len < 8) || + ((rec_len % 4) != 0) || + ((ext2fs_dirent_name_len(dirent)+8) > (int) rec_len)) { + ctx->errcode = EXT2_ET_DIR_CORRUPTED; + return BLOCK_ABORT; + } + if (!dirent->inode) { + /* + * We just need to check metadata_csum when this + * dir hasn't inline data. That means that 'buflen' + * should be blocksize. + */ + if (!inline_data && + (offset == buflen - csum_size) && + (dirent->rec_len == csum_size) && + (dirent->name_len == EXT2_DIR_NAME_LEN_CSUM)) { + if (!(ctx->flags & DIRENT_FLAG_INCLUDE_CSUM)) + goto next; + entry = DIRENT_CHECKSUM; + } else if (!(ctx->flags & DIRENT_FLAG_INCLUDE_EMPTY)) + goto next; + } + + ret = (ctx->func)(ctx->dir, + (next_real_entry > offset) ? + DIRENT_DELETED_FILE : entry, + dirent, offset, + buflen, ctx->buf, + ctx->priv_data); + if (entry < DIRENT_OTHER_FILE) + entry++; + + if (ret & DIRENT_CHANGED) { + if (ext2fs_get_rec_len(fs, dirent, &rec_len)) + return BLOCK_ABORT; + changed++; + } + if (ret & DIRENT_ABORT) { + do_abort++; + break; + } +next: + if (next_real_entry == offset) + next_real_entry += rec_len; + + if (ctx->flags & DIRENT_FLAG_INCLUDE_REMOVED) { + size = (ext2fs_dirent_name_len(dirent) + 11) & ~3; + + if (rec_len != size) { + unsigned int final_offset; + + final_offset = offset + rec_len; + offset += size; + while (offset < final_offset && + !ext2fs_validate_entry(fs, ctx->buf, + offset, + final_offset)) + offset += 4; + continue; + } + } + offset += rec_len; + } + + if (changed) { + if (!inline_data) { + ctx->errcode = ext2fs_write_dir_block4(fs, *blocknr, + ctx->buf, + 0, ctx->dir); + if (ctx->errcode) + return BLOCK_ABORT; + } else { + /* + * return BLOCK_INLINE_DATA_CHANGED to notify caller + * that inline data has been changed. + */ + retval = BLOCK_INLINE_DATA_CHANGED; + } + } + if (do_abort) + return retval | BLOCK_ABORT; + return retval; +} diff --git a/lib/ext2fs/dirblock.c b/lib/ext2fs/dirblock.c new file mode 100644 index 0000000..54b2777 --- /dev/null +++ b/lib/ext2fs/dirblock.c @@ -0,0 +1,113 @@ +/* + * dirblock.c --- directory block routines. + * + * Copyright (C) 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <string.h> +#include <time.h> + +#include "ext2_fs.h" +#include "ext2fs.h" + +errcode_t ext2fs_read_dir_block4(ext2_filsys fs, blk64_t block, + void *buf, int flags EXT2FS_ATTR((unused)), + ext2_ino_t ino) +{ + errcode_t retval; + int corrupt = 0; + + retval = io_channel_read_blk64(fs->io, block, 1, buf); + if (retval) + return retval; + + if (!(fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) && + !ext2fs_dir_block_csum_verify(fs, ino, + (struct ext2_dir_entry *)buf)) + corrupt = 1; + +#ifdef WORDS_BIGENDIAN + retval = ext2fs_dirent_swab_in(fs, buf, flags); +#endif + if (!retval && corrupt) + retval = EXT2_ET_DIR_CSUM_INVALID; + return retval; +} + +errcode_t ext2fs_read_dir_block3(ext2_filsys fs, blk64_t block, + void *buf, int flags EXT2FS_ATTR((unused))) +{ + return ext2fs_read_dir_block4(fs, block, buf, flags, 0); +} + +errcode_t ext2fs_read_dir_block2(ext2_filsys fs, blk_t block, + void *buf, int flags EXT2FS_ATTR((unused))) +{ + return ext2fs_read_dir_block3(fs, block, buf, flags); +} + +errcode_t ext2fs_read_dir_block(ext2_filsys fs, blk_t block, + void *buf) +{ + return ext2fs_read_dir_block3(fs, block, buf, 0); +} + + +errcode_t ext2fs_write_dir_block4(ext2_filsys fs, blk64_t block, + void *inbuf, int flags EXT2FS_ATTR((unused)), + ext2_ino_t ino) +{ + errcode_t retval; + char *buf = inbuf; + +#ifdef WORDS_BIGENDIAN + retval = ext2fs_get_mem(fs->blocksize, &buf); + if (retval) + return retval; + memcpy(buf, inbuf, fs->blocksize); + retval = ext2fs_dirent_swab_out(fs, buf, flags); + if (retval) + return retval; +#endif + retval = ext2fs_dir_block_csum_set(fs, ino, + (struct ext2_dir_entry *)buf); + if (retval) + goto out; + + retval = io_channel_write_blk64(fs->io, block, 1, buf); + +out: +#ifdef WORDS_BIGENDIAN + ext2fs_free_mem(&buf); +#endif + return retval; +} + +errcode_t ext2fs_write_dir_block3(ext2_filsys fs, blk64_t block, + void *inbuf, int flags EXT2FS_ATTR((unused))) +{ + return ext2fs_write_dir_block4(fs, block, inbuf, flags, 0); +} + +errcode_t ext2fs_write_dir_block2(ext2_filsys fs, blk_t block, + void *inbuf, int flags EXT2FS_ATTR((unused))) +{ + return ext2fs_write_dir_block3(fs, block, inbuf, flags); +} + +errcode_t ext2fs_write_dir_block(ext2_filsys fs, blk_t block, + void *inbuf) +{ + return ext2fs_write_dir_block3(fs, block, inbuf, 0); +} + diff --git a/lib/ext2fs/dirhash.c b/lib/ext2fs/dirhash.c new file mode 100644 index 0000000..42fe98b --- /dev/null +++ b/lib/ext2fs/dirhash.c @@ -0,0 +1,307 @@ +/* + * dirhash.c -- Calculate the hash of a directory entry + * + * Copyright (c) 2001 Daniel Phillips + * + * Copyright (c) 2002 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#include <limits.h> + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +#ifndef PATH_MAX +#define PATH_MAX 4096 +#endif + +/* + * Keyed 32-bit hash function using TEA in a Davis-Meyer function + * H0 = Key + * Hi = E Mi(Hi-1) + Hi-1 + * + * (see Applied Cryptography, 2nd edition, p448). + * + * Jeremy Fitzhardinge <jeremy@zip.com.au> 1998 + * + * This code is made available under the terms of the GPL + */ +#define DELTA 0x9E3779B9 + +static void TEA_transform(__u32 buf[4], __u32 const in[]) +{ + __u32 sum = 0; + __u32 b0 = buf[0], b1 = buf[1]; + __u32 a = in[0], b = in[1], c = in[2], d = in[3]; + int n = 16; + + do { + sum += DELTA; + b0 += ((b1 << 4)+a) ^ (b1+sum) ^ ((b1 >> 5)+b); + b1 += ((b0 << 4)+c) ^ (b0+sum) ^ ((b0 >> 5)+d); + } while(--n); + + buf[0] += b0; + buf[1] += b1; +} + +/* F, G and H are basic MD4 functions: selection, majority, parity */ +#define F(x, y, z) ((z) ^ ((x) & ((y) ^ (z)))) +#define G(x, y, z) (((x) & (y)) + (((x) ^ (y)) & (z))) +#define H(x, y, z) ((x) ^ (y) ^ (z)) + +/* + * The generic round function. The application is so specific that + * we don't bother protecting all the arguments with parens, as is generally + * good macro practice, in favor of extra legibility. + * Rotation is separate from addition to prevent recomputation + */ +#define ROUND(f, a, b, c, d, x, s) \ + (a += f(b, c, d) + x, a = (a << s) | (a >> (32-s))) +#define K1 0 +#define K2 013240474631UL +#define K3 015666365641UL + +/* + * Basic cut-down MD4 transform. Returns only 32 bits of result. + */ +static void halfMD4Transform (__u32 buf[4], __u32 const in[]) +{ + __u32 a = buf[0], b = buf[1], c = buf[2], d = buf[3]; + + /* Round 1 */ + ROUND(F, a, b, c, d, in[0] + K1, 3); + ROUND(F, d, a, b, c, in[1] + K1, 7); + ROUND(F, c, d, a, b, in[2] + K1, 11); + ROUND(F, b, c, d, a, in[3] + K1, 19); + ROUND(F, a, b, c, d, in[4] + K1, 3); + ROUND(F, d, a, b, c, in[5] + K1, 7); + ROUND(F, c, d, a, b, in[6] + K1, 11); + ROUND(F, b, c, d, a, in[7] + K1, 19); + + /* Round 2 */ + ROUND(G, a, b, c, d, in[1] + K2, 3); + ROUND(G, d, a, b, c, in[3] + K2, 5); + ROUND(G, c, d, a, b, in[5] + K2, 9); + ROUND(G, b, c, d, a, in[7] + K2, 13); + ROUND(G, a, b, c, d, in[0] + K2, 3); + ROUND(G, d, a, b, c, in[2] + K2, 5); + ROUND(G, c, d, a, b, in[4] + K2, 9); + ROUND(G, b, c, d, a, in[6] + K2, 13); + + /* Round 3 */ + ROUND(H, a, b, c, d, in[3] + K3, 3); + ROUND(H, d, a, b, c, in[7] + K3, 9); + ROUND(H, c, d, a, b, in[2] + K3, 11); + ROUND(H, b, c, d, a, in[6] + K3, 15); + ROUND(H, a, b, c, d, in[1] + K3, 3); + ROUND(H, d, a, b, c, in[5] + K3, 9); + ROUND(H, c, d, a, b, in[0] + K3, 11); + ROUND(H, b, c, d, a, in[4] + K3, 15); + + buf[0] += a; + buf[1] += b; + buf[2] += c; + buf[3] += d; +} + +#undef ROUND +#undef F +#undef G +#undef H +#undef K1 +#undef K2 +#undef K3 + +/* The old legacy hash */ +static ext2_dirhash_t dx_hack_hash (const char *name, int len, + int unsigned_flag) +{ + __u32 hash, hash0 = 0x12a3fe2d, hash1 = 0x37abe8f9; + const unsigned char *ucp = (const unsigned char *) name; + const signed char *scp = (const signed char *) name; + int c; + + while (len--) { + if (unsigned_flag) + c = (int) *ucp++; + else + c = (int) *scp++; + hash = hash1 + (hash0 ^ (c * 7152373)); + + if (hash & 0x80000000) hash -= 0x7fffffff; + hash1 = hash0; + hash0 = hash; + } + return (hash0 << 1); +} + +static void str2hashbuf(const char *msg, int len, __u32 *buf, int num, + int unsigned_flag) +{ + __u32 pad, val; + int i, c; + const unsigned char *ucp = (const unsigned char *) msg; + const signed char *scp = (const signed char *) msg; + + pad = (__u32)len | ((__u32)len << 8); + pad |= pad << 16; + + val = pad; + if (len > num*4) + len = num * 4; + for (i=0; i < len; i++) { + if (unsigned_flag) + c = (int) ucp[i]; + else + c = (int) scp[i]; + + val = c + (val << 8); + if ((i % 4) == 3) { + *buf++ = val; + val = pad; + num--; + } + } + if (--num >= 0) + *buf++ = val; + while (--num >= 0) + *buf++ = pad; +} + +/* + * Returns the hash of a filename. If len is 0 and name is NULL, then + * this function can be used to test whether or not a hash version is + * supported. + * + * The seed is an 4 longword (32 bits) "secret" which can be used to + * uniquify a hash. If the seed is all zero's, then some default seed + * may be used. + * + * A particular hash version specifies whether or not the seed is + * represented, and whether or not the returned hash is 32 bits or 64 + * bits. 32 bit hashes will return 0 for the minor hash. + * + * This function doesn't do any normalization or casefolding of the + * input string. To take charset encoding into account, use + * ext2fs_dirhash2. + * + */ +errcode_t ext2fs_dirhash(int version, const char *name, int len, + const __u32 *seed, + ext2_dirhash_t *ret_hash, + ext2_dirhash_t *ret_minor_hash) +{ + __u32 hash; + __u32 minor_hash = 0; + const char *p; + int i; + __u32 in[8], buf[4]; + int unsigned_flag = 0; + + /* Initialize the default seed for the hash checksum functions */ + buf[0] = 0x67452301; + buf[1] = 0xefcdab89; + buf[2] = 0x98badcfe; + buf[3] = 0x10325476; + + /* Check to see if the seed is all zero's */ + if (seed) { + for (i=0; i < 4; i++) { + if (seed[i]) + break; + } + if (i < 4) + memcpy(buf, seed, sizeof(buf)); + } + + switch (version) { + case EXT2_HASH_LEGACY_UNSIGNED: + unsigned_flag++; + /* fallthrough */ + case EXT2_HASH_LEGACY: + hash = dx_hack_hash(name, len, unsigned_flag); + break; + case EXT2_HASH_HALF_MD4_UNSIGNED: + unsigned_flag++; + /* fallthrough */ + case EXT2_HASH_HALF_MD4: + p = name; + while (len > 0) { + str2hashbuf(p, len, in, 8, unsigned_flag); + halfMD4Transform(buf, in); + len -= 32; + p += 32; + } + minor_hash = buf[2]; + hash = buf[1]; + break; + case EXT2_HASH_TEA_UNSIGNED: + unsigned_flag++; + /* fallthrough */ + case EXT2_HASH_TEA: + p = name; + while (len > 0) { + str2hashbuf(p, len, in, 4, unsigned_flag); + TEA_transform(buf, in); + len -= 16; + p += 16; + } + hash = buf[0]; + minor_hash = buf[1]; + break; + default: + *ret_hash = 0; + return EXT2_ET_DIRHASH_UNSUPP; + } + *ret_hash = hash & ~1; + if (ret_minor_hash) + *ret_minor_hash = minor_hash; + return 0; +} + +/* + * Returns the hash of a filename considering normalization and + * casefolding. This is a wrapper around ext2fs_dirhash with string + * encoding support based on the nls_table and the flags. Check + * ext2fs_dirhash for documentation on the input and output parameters. + */ +errcode_t ext2fs_dirhash2(int version, const char *name, int len, + const struct ext2fs_nls_table *charset, + int hash_flags, const __u32 *seed, + ext2_dirhash_t *ret_hash, + ext2_dirhash_t *ret_minor_hash) +{ + errcode_t r; + int dlen; + + if (len && charset && (hash_flags & EXT4_CASEFOLD_FL)) { + char buff[PATH_MAX]; + + dlen = charset->ops->casefold(charset, + (const unsigned char *) name, len, + (unsigned char *) buff, sizeof(buff)); + if (dlen < 0) { + if (dlen == -EINVAL) + goto opaque_seq; + + return dlen; + } + r = ext2fs_dirhash(version, buff, dlen, seed, ret_hash, + ret_minor_hash); + return r; + } + +opaque_seq: + return ext2fs_dirhash(version, name, len, seed, ret_hash, + ret_minor_hash); +} diff --git a/lib/ext2fs/dosio.c b/lib/ext2fs/dosio.c new file mode 100644 index 0000000..d0cf269 --- /dev/null +++ b/lib/ext2fs/dosio.c @@ -0,0 +1,459 @@ +/* + * dosio.c -- Disk I/O module for the ext2fs/DOS library. + * + * Copyright (c) 1997 by Theodore Ts'o. + * + * Copyright (c) 1997 Mark Habersack + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <bios.h> +#include <string.h> +#include <ctype.h> +#include <io.h> +#ifdef HAVE_ERRNO_H +#include <errno.h> +#endif + +#include <ext2fs/ext2_types.h> +#include "utils.h" +#include "dosio.h" +#include "et/com_err.h" +#include "ext2_err.h" +#include "ext2fs/io.h" + +/* + * Some helper macros + */ +#define LINUX_EXT2FS 0x83 +#define LINUX_SWAP 0x82 +#define WRITE_ERR(_msg_) write(2, _msg_, strlen(_msg_)) +#define WRITE_ERR_S(_msg_) write(2, _msg_, sizeof(_msg_)) + +/* + * Exported variables + */ +unsigned long _dio_error; +unsigned long _dio_hw_error; + +/* + * Array of all opened partitions + */ +static PARTITION **partitions = NULL; +static unsigned short npart = 0; /* Number of mapped partitions */ +static PARTITION *active = NULL; + +/* + * I/O Manager routine prototypes + */ +static errcode_t dos_open(const char *dev, int flags, io_channel *channel); +static errcode_t dos_close(io_channel channel); +static errcode_t dos_set_blksize(io_channel channel, int blksize); +static errcode_t dos_read_blk(io_channel channel, unsigned long block, + int count, void *buf); +static errcode_t dos_write_blk(io_channel channel, unsigned long block, + int count, const void *buf); +static errcode_t dos_flush(io_channel channel); + +static struct struct_io_manager struct_dos_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "DOS I/O Manager", + .open = dos_open, + .close = dos_close, + .set_blksize = dos_set_blksize, + .read_blk = dos_read_blk, + .write_blk = dos_write_blk, + .flush = dos_flush +}; + +io_manager dos_io_manager = &struct_dos_manager; + +/* + * Macro taken from unix_io.c + */ +/* + * For checking structure magic numbers... + */ + +#define EXT2_CHECK_MAGIC(struct, code) \ + if ((struct)->magic != (code)) return (code) + +/* + * Calculates a CHS address of a sector from its LBA + * offset for the given partition. + */ +static void lba2chs(unsigned long lba_addr, CHS *chs, PARTITION *part) +{ + unsigned long abss; + + chs->offset = lba_addr & 0x000001FF; + abss = (lba_addr >> 9) + part->start; + chs->cyl = abss / (part->sects * part->heads); + chs->head = (abss / part->sects) % part->heads; + chs->sector = (abss % part->sects) + 1; +} + +#ifdef __TURBOC__ +#pragma argsused +#endif +/* + * Scans the passed partition table looking for *pno partition + * that has LINUX_EXT2FS type. + * + * TODO: + * For partition numbers >5 Linux uses DOS extended partitions - + * dive into them an return an appropriate entry. Also dive into + * extended partitions when scanning for a first Linux/ext2fs. + */ +static PTABLE_ENTRY *scan_partition_table(PTABLE_ENTRY *pentry, + unsigned short phys, + unsigned char *pno) +{ + unsigned i; + + if(*pno != 0xFF && *pno >= 5) + return NULL; /* We don't support extended partitions for now */ + + if(*pno != 0xFF) + { + if(pentry[*pno].type == LINUX_EXT2FS) + return &pentry[*pno]; + else + { + if(!pentry[*pno].type) + *pno = 0xFE; + else if(pentry[*pno].type == LINUX_SWAP) + *pno = 0xFD; + return NULL; + } + } + + for(i = 0; i < 4; i++) + if(pentry[i].type == LINUX_EXT2FS) + { + *pno = i; + return &pentry[i]; + } + + return NULL; +} + +/* + * Allocate libext2fs structures associated with I/O manager + */ +static io_channel alloc_io_channel(PARTITION *part) +{ + io_channel ioch; + + ioch = (io_channel)malloc(sizeof(struct struct_io_channel)); + if (!ioch) + return NULL; + memset(ioch, 0, sizeof(struct struct_io_channel)); + ioch->magic = EXT2_ET_MAGIC_IO_CHANNEL; + ioch->manager = dos_io_manager; + ioch->name = (char *)malloc(strlen(part->dev)+1); + if (!ioch->name) { + free(ioch); + return NULL; + } + strcpy(ioch->name, part->dev); + ioch->private_data = part; + ioch->block_size = 1024; /* The smallest ext2fs block size */ + ioch->read_error = 0; + ioch->write_error = 0; + + return ioch; +} + +#ifdef __TURBOC__ +#pragma argsused +#endif +/* + * Open the 'name' partition, initialize all information structures + * we need to keep and create libext2fs I/O manager. + */ +static errcode_t dos_open(const char *dev, int flags, io_channel *channel) +{ + unsigned char *tmp, sec[512]; + PARTITION *part; + PTABLE_ENTRY *pent; + PARTITION **newparts; + + if(!dev) + { + _dio_error = ERR_BADDEV; + return EXT2_ET_BAD_DEVICE_NAME; + } + + /* + * First check whether the dev name is OK + */ + tmp = (unsigned char*)strrchr(dev, '/'); + if(!tmp) + { + _dio_error = ERR_BADDEV; + return EXT2_ET_BAD_DEVICE_NAME; + } + *tmp = 0; + if(strcmp(dev, "/dev")) + { + _dio_error = ERR_BADDEV; + return EXT2_ET_BAD_DEVICE_NAME; + } + *tmp++ = '/'; + + /* + * Check whether the partition data is already in cache + */ + + part = (PARTITION*)malloc(sizeof(PARTITION)); + if (!part) + return ENOMEM; + { + int i = 0; + + for(;i < npart; i++) + if(!strcmp(partitions[i]->dev, dev)) + { + /* Found it! Make it the active one */ + active = partitions[i]; + *channel = alloc_io_channel(active); + if (!*channel) + return ENOMEM; + return 0; + } + } + + /* + * Drive number & optionally partn number + */ + switch(tmp[0]) + { + case 'h': + case 's': + part->phys = 0x80; + part->phys += toupper(tmp[2]) - 'A'; + /* + * Do we have the partition number? + */ + if(tmp[3]) + part->pno = isdigit((int)tmp[3]) ? tmp[3] - '0' - 1: 0; + else + part->pno = 0xFF; + break; + + case 'f': + if(tmp[2]) + part->phys = isdigit((int)tmp[2]) ? tmp[2] - '0' : 0; + else + part->phys = 0x00; /* We'll assume /dev/fd0 */ + break; + + default: + _dio_error = ERR_BADDEV; + return ENODEV; + } + + if(part->phys < 0x80) + { + /* We don't support floppies for now */ + _dio_error = ERR_NOTSUPP; + return EINVAL; + } + + part->dev = strdup(dev); + + /* + * Get drive's geometry + */ + _dio_hw_error = biosdisk(DISK_GET_GEOMETRY, + part->phys, + 0, /* head */ + 0, /* cylinder */ + 1, /* sector */ + 1, /* just one sector */ + sec); + + if(!HW_OK()) + { + _dio_error = ERR_HARDWARE; + free(part->dev); + free(part); + return EFAULT; + } + + /* + * Calculate the geometry + */ + part->cyls = (unsigned short)(((sec[0] >> 6) << 8) + sec[1] + 1); + part->heads = sec[3] + 1; + part->sects = sec[0] & 0x3F; + + /* + * Now that we know all we need, let's look for the partition + */ + _dio_hw_error = biosdisk(DISK_READ, part->phys, 0, 0, 1, 1, sec); + + if(!HW_OK()) + { + _dio_error = ERR_HARDWARE; + free(part->dev); + free(part); + return EFAULT; + } + + pent = (PTABLE_ENTRY*)&sec[0x1BE]; + pent = scan_partition_table(pent, part->phys, &part->pno); + + if(!pent) + { + _dio_error = part->pno == 0xFE ? ERR_EMPTYPART : + part->pno == 0xFD ? ERR_LINUXSWAP : ERR_NOTEXT2FS; + free(part->dev); + free(part); + return ENODEV; + } + + /* + * Calculate the remaining figures + */ + { + unsigned long fsec, fhead, fcyl; + + fsec = (unsigned long)(pent->start_sec & 0x3F); + fhead = (unsigned long)pent->start_head; + fcyl = ((pent->start_sec >> 6) << 8) + pent->start_cyl; + part->start = fsec + fhead * part->sects + fcyl * + (part->heads * part->sects) - 1; + part->len = pent->size; + } + + /* + * Add the partition to the table + */ + newparts = (PARTITION**)realloc(partitions, sizeof(PARTITION) * npart); + if (!newparts) { + free(part); + return ENOMEM; + } + partitions = newparts; + partitions[npart++] = active = part; + + /* + * Now alloc all libe2fs structures + */ + *channel = alloc_io_channel(active); + if (!*channel) + return ENOMEM; + + return 0; +} + +static errcode_t dos_close(io_channel channel) +{ + free(channel->name); + free(channel); + + return 0; +} + +static errcode_t dos_set_blksize(io_channel channel, int blksize) +{ + channel->block_size = blksize; + + return 0; +} + +static errcode_t dos_read_blk(io_channel channel, unsigned long block, + int count, void *buf) +{ + PARTITION *part; + size_t size; + ext2_loff_t loc; + CHS chs; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + part = (PARTITION*)channel->private_data; + + size = (size_t)((count < 0) ? -count : count * channel->block_size); + loc = (ext2_loff_t) block * channel->block_size; + + lba2chs(loc, &chs, part); + /* + * Potential bug here: + * If DJGPP is used then reads of >18 sectors will fail! + * Have to rewrite biosdisk. + */ + _dio_hw_error = biosdisk(DISK_READ, + part->phys, + chs.head, + chs.cyl, + chs.sector, + size < 512 ? 1 : size/512, + buf); + + if(!HW_OK()) + { + _dio_error = ERR_HARDWARE; + return EFAULT; + } + + return 0; +} + +static errcode_t dos_write_blk(io_channel channel, unsigned long block, + int count, const void *buf) +{ + PARTITION *part; + size_t size; + ext2_loff_t loc; + CHS chs; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + part = (PARTITION*)channel->private_data; + + if(count == 1) + size = (size_t)channel->block_size; + else + { + if (count < 0) + size = (size_t)-count; + else + size = (size_t)(count * channel->block_size); + } + + loc = (ext2_loff_t)block * channel->block_size; + lba2chs(loc, &chs, part); + _dio_hw_error = biosdisk(DISK_WRITE, + part->phys, + chs.head, + chs.cyl, + chs.sector, + size < 512 ? 1 : size/512, + (void*)buf); + + if(!HW_OK()) + { + _dio_error = ERR_HARDWARE; + return EFAULT; + } + + return 0; +} + +#ifdef __TURBOC__ +#pragma argsused +#endif +static errcode_t dos_flush(io_channel channel) +{ + /* + * No buffers, no flush... + */ + return 0; +} diff --git a/lib/ext2fs/dosio.h b/lib/ext2fs/dosio.h new file mode 100644 index 0000000..d2a8f03 --- /dev/null +++ b/lib/ext2fs/dosio.h @@ -0,0 +1,157 @@ +/* + * v1.0 + * + * Disk I/O include file for the ext2fs/DOS library. + * + * Copyright (c) 1997 Mark Habersack + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef __diskio_h +#define __diskio_h +#ifdef __TURBOC__ +#ifndef __LARGE__ +# error "ext2fs/DOS library requires LARGE model!" +#endif +#endif + +#ifdef __TURBOC__ +#include "msdos.h" +#endif + +/* + * A helper structure used in LBA => CHS conversion + */ +typedef struct +{ + unsigned short cyl; /* Cylinder (or track) */ + unsigned short head; + unsigned short sector; + unsigned short offset; /* Offset of byte within the sector */ +} CHS; + +/* + * All partition data we need is here + */ +typedef struct +{ + char *dev; /* _Linux_ device name (like "/dev/hda1") */ + unsigned char phys; /* Physical DOS drive number */ + unsigned long start; /* LBA address of partition start */ + unsigned long len; /* length of partition in sectors */ + unsigned char pno; /* Partition number (read from *dev) */ + + /* This partition's drive geometry */ + unsigned short cyls; + unsigned short heads; + unsigned short sects; +} PARTITION; + +/* + * PC partition table entry format + */ +#ifdef __DJGPP__ +#pragma pack(1) +#endif +typedef struct +{ + unsigned char active; + unsigned char start_head; + unsigned char start_sec; + unsigned char start_cyl; + unsigned char type; + unsigned char end_head; + unsigned char end_sec; + unsigned char end_cyl; + unsigned long first_sec_rel; + unsigned long size; +} PTABLE_ENTRY; +#ifdef __DJGPP__ +#pragma pack() +#endif + +/* + * INT 0x13 operation codes + */ +#define DISK_READ 0x02 +#define DISK_WRITE 0x03 +#define DISK_GET_GEOMETRY 0x08 +#define DISK_READY 0x10 + +/* + * Errors to put in _dio_error + */ +#define ERR_BADDEV 0x00000001L +#define ERR_HARDWARE 0x00000002L +#define ERR_NOTSUPP 0x00000003L +#define ERR_NOTEXT2FS 0x00000004L +#define ERR_EMPTYPART 0x00000005L +#define ERR_LINUXSWAP 0x00000006L + +/* + * Functions in diskio.c + */ + +/* + * Variable contains last module's error + */ +extern unsigned long _dio_error; + +/* + * This one contains last hardware error (if _dio_error == ERR_HARDWARE) + */ +extern unsigned long _dio_hw_error; + +/* + * Macros to check for disk hardware errors + */ +#define HW_OK() ((unsigned char)_dio_hw_error == 0x00) +#define HW_BAD_CMD() ((unsigned char)_dio_hw_error == 0x01) +#define HW_NO_ADDR_MARK() ((unsigned char)_dio_hw_error == 0x02) +#define HW_WRITE_PROT() ((unsigned char)_dio_hw_error == 0x03) +#define HW_NO_SECTOR() ((unsigned char)_dio_hw_error == 0x04) +#define HW_RESET_FAIL() ((unsigned char)_dio_hw_error == 0x05) +#define HW_DISK_CHANGED() ((unsigned char)_dio_hw_error == 0x06) +#define HW_DRIVE_FAIL() ((unsigned char)_dio_hw_error == 0x07) +#define HW_DMA_OVERRUN() ((unsigned char)_dio_hw_error == 0x08) +#define HW_DMA_BOUNDARY() ((unsigned char)_dio_hw_error == 0x09) +#define HW_BAD_SECTOR() ((unsigned char)_dio_hw_error == 0x0A) +#define HW_BAD_TRACK() ((unsigned char)_dio_hw_error == 0x0B) +#define HW_UNSUPP_TRACK() ((unsigned char)_dio_hw_error == 0x0C) +#define HW_BAD_CRC_ECC() ((unsigned char)_dio_hw_error == 0x10) +#define HW_CRC_ECC_CORR() ((unsigned char)_dio_hw_error == 0x11) +#define HW_CONTR_FAIL() ((unsigned char)_dio_hw_error == 0x20) +#define HW_SEEK_FAIL() ((unsigned char)_dio_hw_error == 0x40) +#define HW_ATTACH_FAIL() ((unsigned char)_dio_hw_error == 0x80) +#define HW_DRIVE_NREADY() ((unsigned char)_dio_hw_error == 0xAA) +#define HW_UNDEF_ERROR() ((unsigned char)_dio_hw_error == 0xBB) +#define HW_WRITE_FAULT() ((unsigned char)_dio_hw_error == 0xCC) +#define HW_STATUS_ERROR() ((unsigned char)_dio_hw_error == 0xE0) +#define HW_SENSE_FAIL() ((unsigned char)_dio_hw_error == 0xFF) + + +/* + * Open the specified partition. + * String 'dev' must have a format: + * + * /dev/{sd|hd|fd}[X] + * + * where, + * + * only one of the option in curly braces can be used and X is an optional + * partition number for the given device. If X is not specified, function + * scans the drive's partition table in search for the first Linux ext2fs + * partition (signature 0x83). Along the way it dives into every extended + * partition encountered. + * Scan ends if either (a) there are no more used partition entries, or + * (b) there is no Xth partition. + * + * Routine returns 0 on success and !=0 otherwise. + */ +int open_partition(char *dev); + +#endif /* __diskio_h */ diff --git a/lib/ext2fs/dupfs.c b/lib/ext2fs/dupfs.c new file mode 100644 index 0000000..02721e1 --- /dev/null +++ b/lib/ext2fs/dupfs.c @@ -0,0 +1,122 @@ +/* + * dupfs.c --- duplicate a ext2 filesystem handle + * + * Copyright (C) 1997, 1998, 2001, 2003, 2005 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <time.h> +#include <string.h> + +#include "ext2_fs.h" +#include "ext2fsP.h" + +errcode_t ext2fs_dup_handle(ext2_filsys src, ext2_filsys *dest) +{ + ext2_filsys fs; + errcode_t retval; + + EXT2_CHECK_MAGIC(src, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + retval = ext2fs_get_mem(sizeof(struct struct_ext2_filsys), &fs); + if (retval) + return retval; + + *fs = *src; + fs->device_name = 0; + fs->super = 0; + fs->orig_super = 0; + fs->group_desc = 0; + fs->inode_map = 0; + fs->block_map = 0; + fs->badblocks = 0; + fs->dblist = 0; + fs->mmp_buf = 0; + fs->mmp_cmp = 0; + fs->mmp_fd = -1; + + io_channel_bumpcount(fs->io); + if (fs->icache) + fs->icache->refcount++; + + retval = ext2fs_get_mem(strlen(src->device_name)+1, &fs->device_name); + if (retval) + goto errout; + strcpy(fs->device_name, src->device_name); + + retval = ext2fs_get_mem(SUPERBLOCK_SIZE, &fs->super); + if (retval) + goto errout; + memcpy(fs->super, src->super, SUPERBLOCK_SIZE); + + retval = ext2fs_get_mem(SUPERBLOCK_SIZE, &fs->orig_super); + if (retval) + goto errout; + memcpy(fs->orig_super, src->orig_super, SUPERBLOCK_SIZE); + + retval = ext2fs_get_array(fs->desc_blocks, fs->blocksize, + &fs->group_desc); + if (retval) + goto errout; + memcpy(fs->group_desc, src->group_desc, + (size_t) fs->desc_blocks * fs->blocksize); + + if (src->inode_map) { + retval = ext2fs_copy_bitmap(src->inode_map, &fs->inode_map); + if (retval) + goto errout; + } + if (src->block_map) { + retval = ext2fs_copy_bitmap(src->block_map, &fs->block_map); + if (retval) + goto errout; + } + if (src->badblocks) { + retval = ext2fs_badblocks_copy(src->badblocks, &fs->badblocks); + if (retval) + goto errout; + } + if (src->dblist) { + retval = ext2fs_copy_dblist(src->dblist, &fs->dblist); + if (retval) + goto errout; + } + if (src->mmp_buf) { + retval = ext2fs_get_mem(src->blocksize, &fs->mmp_buf); + if (retval) + goto errout; + memcpy(fs->mmp_buf, src->mmp_buf, src->blocksize); + } + if (src->mmp_fd >= 0) { + fs->mmp_fd = dup(src->mmp_fd); + if (fs->mmp_fd < 0) { + retval = EXT2_ET_MMP_OPEN_DIRECT; + goto errout; + } + } + if (src->mmp_cmp) { + int align = ext2fs_get_dio_alignment(src->mmp_fd); + + retval = ext2fs_get_memalign(src->blocksize, align, + &fs->mmp_cmp); + if (retval) + goto errout; + memcpy(fs->mmp_cmp, src->mmp_cmp, src->blocksize); + } + *dest = fs; + return 0; +errout: + ext2fs_free(fs); + return retval; + +} + diff --git a/lib/ext2fs/e2image.h b/lib/ext2fs/e2image.h new file mode 100644 index 0000000..53b20cc --- /dev/null +++ b/lib/ext2fs/e2image.h @@ -0,0 +1,37 @@ +/* + * e2image.h --- header file describing the ext2 image format + * + * Copyright (C) 2000 Theodore Ts'o. + * + * Note: this uses the POSIX IO interfaces, unlike most of the other + * functions in this library. So sue me. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +struct ext2_image_hdr { + __u32 magic_number; /* This must be EXT2_ET_MAGIC_E2IMAGE */ + char magic_descriptor[16]; /* "Ext2 Image 1.0", w/ null padding */ + char fs_hostname[64];/* Hostname of machine of image */ + char fs_netaddr[32]; /* Network address */ + __u32 fs_netaddr_type;/* 0 = IPV4, 1 = IPV6, etc. */ + __u32 fs_device; /* Device number of image */ + char fs_device_name[64]; /* Device name */ + char fs_uuid[16]; /* UUID of filesystem */ + __u32 fs_blocksize; /* Block size of the filesystem */ + __u32 fs_reserved[8]; + + __u32 image_device; /* Device number of image file */ + __u32 image_inode; /* Inode number of image file */ + __u32 image_time; /* Time of image creation */ + __u32 image_reserved[8]; + + __u32 offset_super; /* Byte offset of the sb and descriptors */ + __u32 offset_inode; /* Byte offset of the inode table */ + __u32 offset_inodemap; /* Byte offset of the inode bitmaps */ + __u32 offset_blockmap; /* Byte offset of the inode bitmaps */ + __u32 offset_reserved[8]; +}; diff --git a/lib/ext2fs/expanddir.c b/lib/ext2fs/expanddir.c new file mode 100644 index 0000000..b5d5abd --- /dev/null +++ b/lib/ext2fs/expanddir.c @@ -0,0 +1,143 @@ +/* + * expand.c --- expand an ext2fs directory + * + * Copyright (C) 1993, 1994, 1995, 1996, 1997, 1998, 1999 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +struct expand_dir_struct { + int done; + int newblocks; + blk64_t goal; + errcode_t err; + ext2_ino_t dir; +}; + +static int expand_dir_proc(ext2_filsys fs, + blk64_t *blocknr, + e2_blkcnt_t blockcnt, + blk64_t ref_block EXT2FS_ATTR((unused)), + int ref_offset EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct expand_dir_struct *es = (struct expand_dir_struct *) priv_data; + blk64_t new_blk; + char *block; + errcode_t retval; + + if (*blocknr) { + if (blockcnt >= 0) + es->goal = *blocknr; + return 0; + } + if (blockcnt && + (EXT2FS_B2C(fs, es->goal) == EXT2FS_B2C(fs, es->goal+1))) + new_blk = es->goal+1; + else { + es->goal &= ~EXT2FS_CLUSTER_MASK(fs); + retval = ext2fs_new_block2(fs, es->goal, 0, &new_blk); + if (retval) { + es->err = retval; + return BLOCK_ABORT; + } + es->newblocks++; + ext2fs_block_alloc_stats2(fs, new_blk, +1); + } + if (blockcnt > 0) { + retval = ext2fs_new_dir_block(fs, 0, 0, &block); + if (retval) { + es->err = retval; + return BLOCK_ABORT; + } + es->done = 1; + retval = ext2fs_write_dir_block4(fs, new_blk, block, 0, + es->dir); + ext2fs_free_mem(&block); + } else + retval = ext2fs_zero_blocks2(fs, new_blk, 1, NULL, NULL); + if (blockcnt >= 0) + es->goal = new_blk; + if (retval) { + es->err = retval; + return BLOCK_ABORT; + } + *blocknr = new_blk; + + if (es->done) + return (BLOCK_CHANGED | BLOCK_ABORT); + else + return BLOCK_CHANGED; +} + +errcode_t ext2fs_expand_dir(ext2_filsys fs, ext2_ino_t dir) +{ + errcode_t retval; + struct expand_dir_struct es; + struct ext2_inode inode; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!(fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + if (!fs->block_map) + return EXT2_ET_NO_BLOCK_BITMAP; + + retval = ext2fs_check_directory(fs, dir); + if (retval) + return retval; + + retval = ext2fs_read_inode(fs, dir, &inode); + if (retval) + return retval; + + es.done = 0; + es.err = 0; + es.goal = ext2fs_find_inode_goal(fs, dir, &inode, 0); + es.newblocks = 0; + es.dir = dir; + + retval = ext2fs_block_iterate3(fs, dir, BLOCK_FLAG_APPEND, + 0, expand_dir_proc, &es); + if (retval == EXT2_ET_INLINE_DATA_CANT_ITERATE) + return ext2fs_inline_data_expand(fs, dir); + + if (es.err) + return es.err; + if (!es.done) + return EXT2_ET_EXPAND_DIR_ERR; + + /* + * Update the size and block count fields in the inode. + */ + retval = ext2fs_read_inode(fs, dir, &inode); + if (retval) + return retval; + + retval = ext2fs_inode_size_set(fs, &inode, + EXT2_I_SIZE(&inode) + fs->blocksize); + if (retval) + return retval; + ext2fs_iblk_add_blocks(fs, &inode, es.newblocks); + + retval = ext2fs_write_inode(fs, dir, &inode); + if (retval) + return retval; + + return 0; +} diff --git a/lib/ext2fs/ext2_err.et.in b/lib/ext2fs/ext2_err.et.in new file mode 100644 index 0000000..de14019 --- /dev/null +++ b/lib/ext2fs/ext2_err.et.in @@ -0,0 +1,560 @@ +# +# Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. +# +# %Begin-Header% +# This file may be redistributed under the terms of the GNU Public +# License. +# %End-Header% +# + error_table ext2 + +ec EXT2_ET_BASE, + "EXT2FS Library version @E2FSPROGS_VERSION@" + +ec EXT2_ET_MAGIC_EXT2FS_FILSYS, + "Wrong magic number for ext2_filsys structure" + +ec EXT2_ET_MAGIC_BADBLOCKS_LIST, + "Wrong magic number for badblocks_list structure" + +ec EXT2_ET_MAGIC_BADBLOCKS_ITERATE, + "Wrong magic number for badblocks_iterate structure" + +ec EXT2_ET_MAGIC_INODE_SCAN, + "Wrong magic number for inode_scan structure" + +ec EXT2_ET_MAGIC_IO_CHANNEL, + "Wrong magic number for io_channel structure" + +ec EXT2_ET_MAGIC_UNIX_IO_CHANNEL, + "Wrong magic number for unix io_channel structure" + +ec EXT2_ET_MAGIC_IO_MANAGER, + "Wrong magic number for io_manager structure" + +ec EXT2_ET_MAGIC_BLOCK_BITMAP, + "Wrong magic number for block_bitmap structure" + +ec EXT2_ET_MAGIC_INODE_BITMAP, + "Wrong magic number for inode_bitmap structure" + +ec EXT2_ET_MAGIC_GENERIC_BITMAP, + "Wrong magic number for generic_bitmap structure" + +ec EXT2_ET_MAGIC_TEST_IO_CHANNEL, + "Wrong magic number for test io_channel structure" + +ec EXT2_ET_MAGIC_DBLIST, + "Wrong magic number for directory block list structure" + +ec EXT2_ET_MAGIC_ICOUNT, + "Wrong magic number for icount structure" + +ec EXT2_ET_MAGIC_PQ_IO_CHANNEL, + "Wrong magic number for Powerquest io_channel structure" + +ec EXT2_ET_MAGIC_EXT2_FILE, + "Wrong magic number for ext2 file structure" + +ec EXT2_ET_MAGIC_E2IMAGE, + "Wrong magic number for Ext2 Image Header" + +ec EXT2_ET_MAGIC_INODE_IO_CHANNEL, + "Wrong magic number for inode io_channel structure" + +ec EXT2_ET_MAGIC_EXTENT_HANDLE, + "Wrong magic number for ext4 extent handle" + +ec EXT2_ET_BAD_MAGIC, + "Bad magic number in super-block" + +ec EXT2_ET_REV_TOO_HIGH, + "Filesystem revision too high" + +ec EXT2_ET_RO_FILSYS, + "Attempt to write to filesystem opened read-only" + +ec EXT2_ET_GDESC_READ, + "Can't read group descriptors" + +ec EXT2_ET_GDESC_WRITE, + "Can't write group descriptors" + +ec EXT2_ET_GDESC_BAD_BLOCK_MAP, + "Corrupt group descriptor: bad block for block bitmap" + +ec EXT2_ET_GDESC_BAD_INODE_MAP, + "Corrupt group descriptor: bad block for inode bitmap" + +ec EXT2_ET_GDESC_BAD_INODE_TABLE, + "Corrupt group descriptor: bad block for inode table" + +ec EXT2_ET_INODE_BITMAP_WRITE, + "Can't write an inode bitmap" + +ec EXT2_ET_INODE_BITMAP_READ, + "Can't read an inode bitmap" + +ec EXT2_ET_BLOCK_BITMAP_WRITE, + "Can't write a block bitmap" + +ec EXT2_ET_BLOCK_BITMAP_READ, + "Can't read a block bitmap" + +ec EXT2_ET_INODE_TABLE_WRITE, + "Can't write an inode table" + +ec EXT2_ET_INODE_TABLE_READ, + "Can't read an inode table" + +ec EXT2_ET_NEXT_INODE_READ, + "Can't read next inode" + +ec EXT2_ET_UNEXPECTED_BLOCK_SIZE, + "Filesystem has unexpected block size" + +ec EXT2_ET_DIR_CORRUPTED, + "EXT2 directory corrupted" + +ec EXT2_ET_SHORT_READ, + "Attempt to read block from filesystem resulted in short read" + +ec EXT2_ET_SHORT_WRITE, + "Attempt to write block to filesystem resulted in short write" + +ec EXT2_ET_DIR_NO_SPACE, + "No free space in the directory" + +ec EXT2_ET_NO_INODE_BITMAP, + "Inode bitmap not loaded" + +ec EXT2_ET_NO_BLOCK_BITMAP, + "Block bitmap not loaded" + +ec EXT2_ET_BAD_INODE_NUM, + "Illegal inode number" + +ec EXT2_ET_BAD_BLOCK_NUM, + "Illegal block number" + +ec EXT2_ET_EXPAND_DIR_ERR, + "Internal error in ext2fs_expand_dir" + +ec EXT2_ET_TOOSMALL, + "Not enough space to build proposed filesystem" + +ec EXT2_ET_BAD_BLOCK_MARK, + "Illegal block number passed to ext2fs_mark_block_bitmap" + +ec EXT2_ET_BAD_BLOCK_UNMARK, + "Illegal block number passed to ext2fs_unmark_block_bitmap" + +ec EXT2_ET_BAD_BLOCK_TEST, + "Illegal block number passed to ext2fs_test_block_bitmap" + +ec EXT2_ET_BAD_INODE_MARK, + "Illegal inode number passed to ext2fs_mark_inode_bitmap" + +ec EXT2_ET_BAD_INODE_UNMARK, + "Illegal inode number passed to ext2fs_unmark_inode_bitmap" + +ec EXT2_ET_BAD_INODE_TEST, + "Illegal inode number passed to ext2fs_test_inode_bitmap" + +ec EXT2_ET_FUDGE_BLOCK_BITMAP_END, + "Attempt to fudge end of block bitmap past the real end" + +ec EXT2_ET_FUDGE_INODE_BITMAP_END, + "Attempt to fudge end of inode bitmap past the real end" + +ec EXT2_ET_BAD_IND_BLOCK, + "Illegal indirect block found" + +ec EXT2_ET_BAD_DIND_BLOCK, + "Illegal doubly indirect block found" + +ec EXT2_ET_BAD_TIND_BLOCK, + "Illegal triply indirect block found" + +ec EXT2_ET_NEQ_BLOCK_BITMAP, + "Block bitmaps are not the same" + +ec EXT2_ET_NEQ_INODE_BITMAP, + "Inode bitmaps are not the same" + +ec EXT2_ET_BAD_DEVICE_NAME, + "Illegal or malformed device name" + +ec EXT2_ET_MISSING_INODE_TABLE, + "A block group is missing an inode table" + +ec EXT2_ET_CORRUPT_SUPERBLOCK, + "The ext2 superblock is corrupt" + +ec EXT2_ET_BAD_GENERIC_MARK, + "Illegal generic bit number passed to ext2fs_mark_generic_bitmap" + +ec EXT2_ET_BAD_GENERIC_UNMARK, + "Illegal generic bit number passed to ext2fs_unmark_generic_bitmap" + +ec EXT2_ET_BAD_GENERIC_TEST, + "Illegal generic bit number passed to ext2fs_test_generic_bitmap" + +ec EXT2_ET_SYMLINK_LOOP, + "Too many symbolic links encountered." + +ec EXT2_ET_CALLBACK_NOTHANDLED, + "The callback function will not handle this case" + +ec EXT2_ET_BAD_BLOCK_IN_INODE_TABLE, + "The inode is from a bad block in the inode table" + +ec EXT2_ET_UNSUPP_FEATURE, + "Filesystem has unsupported feature(s)" + +ec EXT2_ET_RO_UNSUPP_FEATURE, + "Filesystem has unsupported read-only feature(s)" + +ec EXT2_ET_LLSEEK_FAILED, + "IO Channel failed to seek on read or write" + +ec EXT2_ET_NO_MEMORY, + "Memory allocation failed" + +ec EXT2_ET_INVALID_ARGUMENT, + "Invalid argument passed to ext2 library" + +ec EXT2_ET_BLOCK_ALLOC_FAIL, + "Could not allocate block in ext2 filesystem" + +ec EXT2_ET_INODE_ALLOC_FAIL, + "Could not allocate inode in ext2 filesystem" + +ec EXT2_ET_NO_DIRECTORY, + "Ext2 inode is not a directory" + +ec EXT2_ET_TOO_MANY_REFS, + "Too many references in table" + +ec EXT2_ET_FILE_NOT_FOUND, + "File not found by ext2_lookup" + +ec EXT2_ET_FILE_RO, + "File open read-only" + +ec EXT2_ET_DB_NOT_FOUND, + "Ext2 directory block not found" + +ec EXT2_ET_DIR_EXISTS, + "Ext2 directory already exists" + +ec EXT2_ET_UNIMPLEMENTED, + "Unimplemented ext2 library function" + +ec EXT2_ET_CANCEL_REQUESTED, + "User cancel requested" + +ec EXT2_ET_FILE_TOO_BIG, + "Ext2 file too big" + +ec EXT2_ET_JOURNAL_NOT_BLOCK, + "Supplied journal device not a block device" + +ec EXT2_ET_NO_JOURNAL_SB, + "Journal superblock not found" + +ec EXT2_ET_JOURNAL_TOO_SMALL, + "Journal must be at least 1024 blocks" + +ec EXT2_ET_JOURNAL_UNSUPP_VERSION, + "Unsupported journal version" + +ec EXT2_ET_LOAD_EXT_JOURNAL, + "Error loading external journal" + +ec EXT2_ET_NO_JOURNAL, + "Journal not found" + +ec EXT2_ET_DIRHASH_UNSUPP, + "Directory hash unsupported" + +ec EXT2_ET_BAD_EA_BLOCK_NUM, + "Illegal extended attribute block number" + +ec EXT2_ET_TOO_MANY_INODES, + "Cannot create filesystem with requested number of inodes" + +ec EXT2_ET_NOT_IMAGE_FILE, + "E2image snapshot not in use" + +ec EXT2_ET_RES_GDT_BLOCKS, + "Too many reserved group descriptor blocks" + +ec EXT2_ET_RESIZE_INODE_CORRUPT, + "Resize inode is corrupt" + +ec EXT2_ET_SET_BMAP_NO_IND, + "Tried to set block bmap with missing indirect block" + +ec EXT2_ET_TDB_SUCCESS, + "TDB: Success" + +ec EXT2_ET_TDB_ERR_CORRUPT, + "TDB: Corrupt database" + +ec EXT2_ET_TDB_ERR_IO, + "TDB: IO Error" + +ec EXT2_ET_TDB_ERR_LOCK, + "TDB: Locking error" + +ec EXT2_ET_TDB_ERR_OOM, + "TDB: Out of memory" + +ec EXT2_ET_TDB_ERR_EXISTS, + "TDB: Record exists" + +ec EXT2_ET_TDB_ERR_NOLOCK, + "TDB: Lock exists on other keys" + +ec EXT2_ET_TDB_ERR_EINVAL, + "TDB: Invalid parameter" + +ec EXT2_ET_TDB_ERR_NOEXIST, + "TDB: Record does not exist" + +ec EXT2_ET_TDB_ERR_RDONLY, + "TDB: Write not permitted" + +ec EXT2_ET_DBLIST_EMPTY, + "Ext2fs directory block list is empty" + +ec EXT2_ET_RO_BLOCK_ITERATE, + "Attempt to modify a block mapping via a read-only block iterator" + +ec EXT2_ET_MAGIC_EXTENT_PATH, + "Wrong magic number for ext4 extent saved path" + +ec EXT2_ET_MAGIC_GENERIC_BITMAP64, + "Wrong magic number for 64-bit generic bitmap" + +ec EXT2_ET_MAGIC_BLOCK_BITMAP64, + "Wrong magic number for 64-bit block bitmap" + +ec EXT2_ET_MAGIC_INODE_BITMAP64, + "Wrong magic number for 64-bit inode bitmap" + +ec EXT2_ET_MAGIC_RESERVED_13, + "Wrong magic number --- RESERVED_13" + +ec EXT2_ET_MAGIC_RESERVED_14, + "Wrong magic number --- RESERVED_14" + +ec EXT2_ET_MAGIC_RESERVED_15, + "Wrong magic number --- RESERVED_15" + +ec EXT2_ET_MAGIC_RESERVED_16, + "Wrong magic number --- RESERVED_16" + +ec EXT2_ET_MAGIC_RESERVED_17, + "Wrong magic number --- RESERVED_17" + +ec EXT2_ET_MAGIC_RESERVED_18, + "Wrong magic number --- RESERVED_18" + +ec EXT2_ET_MAGIC_RESERVED_19, + "Wrong magic number --- RESERVED_19" + +ec EXT2_ET_EXTENT_HEADER_BAD, + "Corrupt extent header" + +ec EXT2_ET_EXTENT_INDEX_BAD, + "Corrupt extent index" + +ec EXT2_ET_EXTENT_LEAF_BAD, + "Corrupt extent" + +ec EXT2_ET_EXTENT_NO_SPACE, + "No free space in extent map" + +ec EXT2_ET_INODE_NOT_EXTENT, + "Inode does not use extents" + +ec EXT2_ET_EXTENT_NO_NEXT, + "No 'next' extent" + +ec EXT2_ET_EXTENT_NO_PREV, + "No 'previous' extent" + +ec EXT2_ET_EXTENT_NO_UP, + "No 'up' extent" + +ec EXT2_ET_EXTENT_NO_DOWN, + "No 'down' extent" + +ec EXT2_ET_NO_CURRENT_NODE, + "No current node" + +ec EXT2_ET_OP_NOT_SUPPORTED, + "Ext2fs operation not supported" + +ec EXT2_ET_CANT_INSERT_EXTENT, + "No room to insert extent in node" + +ec EXT2_ET_CANT_SPLIT_EXTENT, + "Splitting would result in empty node" + +ec EXT2_ET_EXTENT_NOT_FOUND, + "Extent not found" + +ec EXT2_ET_EXTENT_NOT_SUPPORTED, + "Operation not supported for inodes containing extents" + +ec EXT2_ET_EXTENT_INVALID_LENGTH, + "Extent length is invalid" + +ec EXT2_ET_IO_CHANNEL_NO_SUPPORT_64, + "I/O Channel does not support 64-bit block numbers" + +ec EXT2_ET_NO_MTAB_FILE, + "Can't check if filesystem is mounted due to missing mtab file" + +ec EXT2_ET_CANT_USE_LEGACY_BITMAPS, + "Filesystem too large to use legacy bitmaps" + +ec EXT2_ET_MMP_MAGIC_INVALID, + "MMP: invalid magic number" + +ec EXT2_ET_MMP_FAILED, + "MMP: device currently active" + +ec EXT2_ET_MMP_FSCK_ON, + "MMP: e2fsck being run" + +ec EXT2_ET_MMP_BAD_BLOCK, + "MMP: block number beyond filesystem range" + +ec EXT2_ET_MMP_UNKNOWN_SEQ, + "MMP: undergoing an unknown operation" + +ec EXT2_ET_MMP_CHANGE_ABORT, + "MMP: filesystem still in use" + +ec EXT2_ET_MMP_OPEN_DIRECT, + "MMP: open with O_DIRECT failed" + +ec EXT2_ET_BAD_DESC_SIZE, + "Block group descriptor size incorrect" + +ec EXT2_ET_INODE_CSUM_INVALID, + "Inode checksum does not match inode" + +ec EXT2_ET_INODE_BITMAP_CSUM_INVALID, + "Inode bitmap checksum does not match bitmap" + +ec EXT2_ET_EXTENT_CSUM_INVALID, + "Extent block checksum does not match extent block" + +ec EXT2_ET_DIR_NO_SPACE_FOR_CSUM, + "Directory block does not have space for checksum" + +ec EXT2_ET_DIR_CSUM_INVALID, + "Directory block checksum does not match directory block" + +ec EXT2_ET_EXT_ATTR_CSUM_INVALID, + "Extended attribute block checksum does not match block" + +ec EXT2_ET_SB_CSUM_INVALID, + "Superblock checksum does not match superblock" + +ec EXT2_ET_UNKNOWN_CSUM, + "Unknown checksum algorithm" + +ec EXT2_ET_MMP_CSUM_INVALID, + "MMP block checksum does not match" + +ec EXT2_ET_FILE_EXISTS, + "Ext2 file already exists" + +ec EXT2_ET_BLOCK_BITMAP_CSUM_INVALID, + "Block bitmap checksum does not match bitmap" + +ec EXT2_ET_INLINE_DATA_CANT_ITERATE, + "Cannot iterate data blocks of an inode containing inline data" + +ec EXT2_ET_EA_BAD_NAME_LEN, + "Extended attribute has an invalid name length" + +ec EXT2_ET_EA_BAD_VALUE_SIZE, + "Extended attribute has an invalid value length" + +ec EXT2_ET_BAD_EA_HASH, + "Extended attribute has an incorrect hash" + +ec EXT2_ET_BAD_EA_HEADER, + "Extended attribute block has a bad header" + +ec EXT2_ET_EA_KEY_NOT_FOUND, + "Extended attribute key not found" + +ec EXT2_ET_EA_NO_SPACE, + "Insufficient space to store extended attribute data" + +ec EXT2_ET_MISSING_EA_FEATURE, + "Filesystem is missing ext_attr or inline_data feature" + +ec EXT2_ET_NO_INLINE_DATA, + "Inode doesn't have inline data" + +ec EXT2_ET_INLINE_DATA_NO_BLOCK, + "No block for an inode with inline data" + +ec EXT2_ET_INLINE_DATA_NO_SPACE, + "No free space in inline data" + +ec EXT2_ET_MAGIC_EA_HANDLE, + "Wrong magic number for extended attribute structure" + +ec EXT2_ET_INODE_IS_GARBAGE, + "Inode seems to contain garbage" + +ec EXT2_ET_EA_BAD_VALUE_OFFSET, + "Extended attribute has an invalid value offset" + +ec EXT2_ET_JOURNAL_FLAGS_WRONG, + "Journal flags inconsistent" + +ec EXT2_ET_UNDO_FILE_CORRUPT, + "Undo file corrupt" + +ec EXT2_ET_UNDO_FILE_WRONG, + "Wrong undo file for this filesystem" + +ec EXT2_ET_FILESYSTEM_CORRUPTED, + "File system is corrupted" + +ec EXT2_ET_BAD_CRC, + "Bad CRC detected in file system" + +ec EXT2_ET_CORRUPT_JOURNAL_SB, + "The journal superblock is corrupt" + +ec EXT2_ET_INODE_CORRUPTED, + "Inode is corrupted" + +ec EXT2_ET_EA_INODE_CORRUPTED, + "Inode containing extended attribute value is corrupted" + +ec EXT2_ET_NO_GDESC, + "Group descriptors not loaded" + +ec EXT2_FILSYS_CORRUPTED, + "The internal ext2_filsys data structure appears to be corrupted" + +ec EXT2_ET_EXTENT_CYCLE, + "Found cyclic loop in extent tree" + +ec EXT2_ET_EXTERNAL_JOURNAL_NOSUPP, + "Operation not supported on an external journal" + + end diff --git a/lib/ext2fs/ext2_ext_attr.h b/lib/ext2fs/ext2_ext_attr.h new file mode 100644 index 0000000..c6068c4 --- /dev/null +++ b/lib/ext2fs/ext2_ext_attr.h @@ -0,0 +1,84 @@ +/* + File: linux/ext2_ext_attr.h + + On-disk format of extended attributes for the ext2 filesystem. + + (C) 2000 Andreas Gruenbacher, <a.gruenbacher@computer.org> +*/ + +#ifndef _EXT2_EXT_ATTR_H +#define _EXT2_EXT_ATTR_H +/* Magic value in attribute blocks */ +#define EXT2_EXT_ATTR_MAGIC_v1 0xEA010000 +#define EXT2_EXT_ATTR_MAGIC 0xEA020000 + +/* Maximum number of references to one attribute block */ +#define EXT2_EXT_ATTR_REFCOUNT_MAX 1024 + +struct ext2_ext_attr_header { + __u32 h_magic; /* magic number for identification */ + __u32 h_refcount; /* reference count */ + __u32 h_blocks; /* number of disk blocks used */ + __u32 h_hash; /* hash value of all attributes */ + __u32 h_checksum; /* crc32c(uuid+id+xattrs) */ + /* id = inum if refcount = 1, else blknum */ + __u32 h_reserved[3]; /* zero right now */ +}; + +struct ext2_ext_attr_entry { + __u8 e_name_len; /* length of name */ + __u8 e_name_index; /* attribute name index */ + __u16 e_value_offs; /* offset in disk block of value */ + __u32 e_value_inum; /* inode in which the value is stored */ + __u32 e_value_size; /* size of attribute value */ + __u32 e_hash; /* hash value of name and value */ +#if 0 + char e_name[0]; /* attribute name */ +#endif +}; + +#define EXT2_EXT_ATTR_PAD_BITS 2 +#define EXT2_EXT_ATTR_PAD ((unsigned) 1<<EXT2_EXT_ATTR_PAD_BITS) +#define EXT2_EXT_ATTR_ROUND (EXT2_EXT_ATTR_PAD-1) +#define EXT2_EXT_ATTR_LEN(name_len) \ + (((name_len) + EXT2_EXT_ATTR_ROUND + \ + sizeof(struct ext2_ext_attr_entry)) & ~EXT2_EXT_ATTR_ROUND) +#define EXT2_EXT_ATTR_NEXT(entry) \ + ( (struct ext2_ext_attr_entry *)( \ + (char *)(entry) + EXT2_EXT_ATTR_LEN((entry)->e_name_len)) ) +#define EXT2_EXT_ATTR_SIZE(size) \ + (((size) + EXT2_EXT_ATTR_ROUND) & ~EXT2_EXT_ATTR_ROUND) +#define EXT2_EXT_IS_LAST_ENTRY(entry) (*((__u32 *)(entry)) == 0UL) +#define EXT2_EXT_ATTR_NAME(entry) \ + (((char *) (entry)) + sizeof(struct ext2_ext_attr_entry)) +#define EXT2_XATTR_LEN(name_len) \ + (((name_len) + EXT2_EXT_ATTR_ROUND + \ + sizeof(struct ext2_xattr_entry)) & ~EXT2_EXT_ATTR_ROUND) +#define EXT2_XATTR_SIZE(size) \ + (((size) + EXT2_EXT_ATTR_ROUND) & ~EXT2_EXT_ATTR_ROUND) + +/* + * XATTR_SIZE_MAX is currently 64k, but for the purposes of checking + * for file system consistency errors, we use a somewhat bigger value. + * This allows XATTR_SIZE_MAX to grow in the future, but by using this + * instead of INT_MAX for certain consistency checks, we don't need to + * worry about arithmetic overflows. (Actually XATTR_SIZE_MAX is + * defined in include/uapi/linux/limits.h, so changing it is going + * not going to be trivial....) + */ +#define EXT2_XATTR_SIZE_MAX (1 << 24) + +#ifdef __KERNEL__ +# ifdef CONFIG_EXT2_FS_EXT_ATTR +extern int ext2_get_ext_attr(struct inode *, const char *, char *, size_t, int); +extern int ext2_set_ext_attr(struct inode *, const char *, char *, size_t, int); +extern void ext2_ext_attr_free_inode(struct inode *inode); +extern void ext2_ext_attr_put_super(struct super_block *sb); +extern int ext2_ext_attr_init(void); +extern void ext2_ext_attr_done(void); +# else +# define ext2_get_ext_attr NULL +# define ext2_set_ext_attr NULL +# endif +#endif /* __KERNEL__ */ +#endif /* _EXT2_EXT_ATTR_H */ diff --git a/lib/ext2fs/ext2_fs.h b/lib/ext2fs/ext2_fs.h new file mode 100644 index 0000000..0fc9c09 --- /dev/null +++ b/lib/ext2fs/ext2_fs.h @@ -0,0 +1,1201 @@ +/* + * linux/include/linux/ext2_fs.h + * + * Copyright (C) 1992, 1993, 1994, 1995 + * Remy Card (card@masi.ibp.fr) + * Laboratoire MASI - Institut Blaise Pascal + * Universite Pierre et Marie Curie (Paris VI) + * + * from + * + * linux/include/linux/minix_fs.h + * + * Copyright (C) 1991, 1992 Linus Torvalds + */ + +#ifndef _LINUX_EXT2_FS_H +#define _LINUX_EXT2_FS_H + +#include <ext2fs/ext2_types.h> /* Changed from linux/types.h */ + +#ifndef __GNUC_PREREQ +#if defined(__GNUC__) && defined(__GNUC_MINOR__) +#define __GNUC_PREREQ(maj, min) \ + ((__GNUC__ << 16) + __GNUC_MINOR__ >= ((maj) << 16) + (min)) +#else +#define __GNUC_PREREQ(maj, min) 0 +#endif +#endif + +#ifndef __nonstring +#ifdef __has_attribute +#if __has_attribute(__nonstring__) +#define __nonstring __attribute__((__nonstring__)) +#else +#define __nonstring +#endif /* __has_attribute(__nonstring__) */ +#else +# define __nonstring +#endif /* __has_attribute */ +#endif /* __nonstring */ + +/* + * The second extended filesystem constants/structures + */ + +/* + * Define EXT2FS_DEBUG to produce debug messages + */ +#undef EXT2FS_DEBUG + +/* + * Define EXT2_PREALLOCATE to preallocate data blocks for expanding files + */ +#define EXT2_PREALLOCATE +#define EXT2_DEFAULT_PREALLOC_BLOCKS 8 + +/* + * The second extended file system version + */ +#define EXT2FS_DATE "95/08/09" +#define EXT2FS_VERSION "0.5b" + +/* + * Special inode numbers + */ +#define EXT2_BAD_INO 1 /* Bad blocks inode */ +#define EXT2_ROOT_INO 2 /* Root inode */ +#define EXT4_USR_QUOTA_INO 3 /* User quota inode */ +#define EXT4_GRP_QUOTA_INO 4 /* Group quota inode */ +#define EXT2_BOOT_LOADER_INO 5 /* Boot loader inode */ +#define EXT2_UNDEL_DIR_INO 6 /* Undelete directory inode */ +#define EXT2_RESIZE_INO 7 /* Reserved group descriptors inode */ +#define EXT2_JOURNAL_INO 8 /* Journal inode */ +#define EXT2_EXCLUDE_INO 9 /* The "exclude" inode, for snapshots */ +#define EXT4_REPLICA_INO 10 /* Used by non-upstream feature */ + +/* First non-reserved inode for old ext2 filesystems */ +#define EXT2_GOOD_OLD_FIRST_INO 11 + +/* + * The second extended file system magic number + */ +#define EXT2_SUPER_MAGIC 0xEF53 + +#ifdef __KERNEL__ +#define EXT2_SB(sb) (&((sb)->u.ext2_sb)) +#else +/* Assume that user mode programs are passing in an ext2fs superblock, not + * a kernel struct super_block. This will allow us to call the feature-test + * macros from user land. */ +#define EXT2_SB(sb) (sb) +#endif + +/* + * Maximal count of links to a file + */ +#define EXT2_LINK_MAX 65000 + +/* + * Macro-instructions used to manage several block sizes + */ +#define EXT2_MIN_BLOCK_LOG_SIZE 10 /* 1024 */ +#define EXT2_MAX_BLOCK_LOG_SIZE 16 /* 65536 */ +#define EXT2_MIN_BLOCK_SIZE (1 << EXT2_MIN_BLOCK_LOG_SIZE) +#define EXT2_MAX_BLOCK_SIZE (1 << EXT2_MAX_BLOCK_LOG_SIZE) +#ifdef __KERNEL__ +#define EXT2_BLOCK_SIZE(s) ((s)->s_blocksize) +#define EXT2_BLOCK_SIZE_BITS(s) ((s)->s_blocksize_bits) +#define EXT2_ADDR_PER_BLOCK_BITS(s) (EXT2_SB(s)->addr_per_block_bits) +#define EXT2_INODE_SIZE(s) (EXT2_SB(s)->s_inode_size) +#define EXT2_FIRST_INO(s) (EXT2_SB(s)->s_first_ino) +#else +#define EXT2_BLOCK_SIZE(s) (EXT2_MIN_BLOCK_SIZE << (s)->s_log_block_size) +#define EXT2_BLOCK_SIZE_BITS(s) ((s)->s_log_block_size + 10) +#define EXT2_INODE_SIZE(s) (((s)->s_rev_level == EXT2_GOOD_OLD_REV) ? \ + EXT2_GOOD_OLD_INODE_SIZE : (s)->s_inode_size) +#define EXT2_FIRST_INO(s) (((s)->s_rev_level == EXT2_GOOD_OLD_REV) ? \ + EXT2_GOOD_OLD_FIRST_INO : (s)->s_first_ino) +#endif +#define EXT2_ADDR_PER_BLOCK(s) (EXT2_BLOCK_SIZE(s) / sizeof(__u32)) + +/* + * Macro-instructions used to manage allocation clusters + */ +#define EXT2_MIN_CLUSTER_LOG_SIZE EXT2_MIN_BLOCK_LOG_SIZE +#define EXT2_MAX_CLUSTER_LOG_SIZE 29 /* 512MB */ +#define EXT2_MIN_CLUSTER_SIZE EXT2_MIN_BLOCK_SIZE +#define EXT2_MAX_CLUSTER_SIZE (1 << EXT2_MAX_CLUSTER_LOG_SIZE) +#define EXT2_CLUSTER_SIZE(s) (EXT2_MIN_BLOCK_SIZE << \ + (s)->s_log_cluster_size) +#define EXT2_CLUSTER_SIZE_BITS(s) ((s)->s_log_cluster_size + 10) + +/* + * Macro-instructions used to manage fragments + * + * Note: for backwards compatibility only, for the dump program. + * Ext2/3/4 will never support fragments.... + */ +#define EXT2_MIN_FRAG_SIZE EXT2_MIN_BLOCK_SIZE +#define EXT2_MAX_FRAG_SIZE EXT2_MAX_BLOCK_SIZE +#define EXT2_MIN_FRAG_LOG_SIZE EXT2_MIN_BLOCK_LOG_SIZE +#define EXT2_FRAG_SIZE(s) EXT2_BLOCK_SIZE(s) +#define EXT2_FRAGS_PER_BLOCK(s) 1 + +/* + * ACL structures + */ +struct ext2_acl_header /* Header of Access Control Lists */ +{ + __u32 aclh_size; + __u32 aclh_file_count; + __u32 aclh_acle_count; + __u32 aclh_first_acle; +}; + +struct ext2_acl_entry /* Access Control List Entry */ +{ + __u32 acle_size; + __u16 acle_perms; /* Access permissions */ + __u16 acle_type; /* Type of entry */ + __u16 acle_tag; /* User or group identity */ + __u16 acle_pad1; + __u32 acle_next; /* Pointer on next entry for the */ + /* same inode or on next free entry */ +}; + +/* + * Structure of a blocks group descriptor + */ +struct ext2_group_desc +{ + __u32 bg_block_bitmap; /* Blocks bitmap block */ + __u32 bg_inode_bitmap; /* Inodes bitmap block */ + __u32 bg_inode_table; /* Inodes table block */ + __u16 bg_free_blocks_count; /* Free blocks count */ + __u16 bg_free_inodes_count; /* Free inodes count */ + __u16 bg_used_dirs_count; /* Directories count */ + __u16 bg_flags; + __u32 bg_exclude_bitmap_lo; /* Exclude bitmap for snapshots */ + __u16 bg_block_bitmap_csum_lo;/* crc32c(s_uuid+grp_num+bitmap) LSB */ + __u16 bg_inode_bitmap_csum_lo;/* crc32c(s_uuid+grp_num+bitmap) LSB */ + __u16 bg_itable_unused; /* Unused inodes count */ + __u16 bg_checksum; /* crc16(s_uuid+group_num+group_desc)*/ +}; + +/* + * Structure of a blocks group descriptor + */ +struct ext4_group_desc +{ + __u32 bg_block_bitmap; /* Blocks bitmap block */ + __u32 bg_inode_bitmap; /* Inodes bitmap block */ + __u32 bg_inode_table; /* Inodes table block */ + __u16 bg_free_blocks_count; /* Free blocks count */ + __u16 bg_free_inodes_count; /* Free inodes count */ + __u16 bg_used_dirs_count; /* Directories count */ + __u16 bg_flags; /* EXT4_BG_flags (INODE_UNINIT, etc) */ + __u32 bg_exclude_bitmap_lo; /* Exclude bitmap for snapshots */ + __u16 bg_block_bitmap_csum_lo;/* crc32c(s_uuid+grp_num+bitmap) LSB */ + __u16 bg_inode_bitmap_csum_lo;/* crc32c(s_uuid+grp_num+bitmap) LSB */ + __u16 bg_itable_unused; /* Unused inodes count */ + __u16 bg_checksum; /* crc16(sb_uuid+group+desc) */ + __u32 bg_block_bitmap_hi; /* Blocks bitmap block MSB */ + __u32 bg_inode_bitmap_hi; /* Inodes bitmap block MSB */ + __u32 bg_inode_table_hi; /* Inodes table block MSB */ + __u16 bg_free_blocks_count_hi;/* Free blocks count MSB */ + __u16 bg_free_inodes_count_hi;/* Free inodes count MSB */ + __u16 bg_used_dirs_count_hi; /* Directories count MSB */ + __u16 bg_itable_unused_hi; /* Unused inodes count MSB */ + __u32 bg_exclude_bitmap_hi; /* Exclude bitmap block MSB */ + __u16 bg_block_bitmap_csum_hi;/* crc32c(s_uuid+grp_num+bitmap) MSB */ + __u16 bg_inode_bitmap_csum_hi;/* crc32c(s_uuid+grp_num+bitmap) MSB */ + __u32 bg_reserved; +}; + +#define EXT4_BG_INODE_BITMAP_CSUM_HI_END \ + (offsetof(struct ext4_group_desc, bg_inode_bitmap_csum_hi) + \ + sizeof(__u16)) +#define EXT4_BG_BLOCK_BITMAP_CSUM_HI_LOCATION \ + (offsetof(struct ext4_group_desc, bg_block_bitmap_csum_hi) + \ + sizeof(__u16)) + +#define EXT2_BG_INODE_UNINIT 0x0001 /* Inode table/bitmap not initialized */ +#define EXT2_BG_BLOCK_UNINIT 0x0002 /* Block bitmap not initialized */ +#define EXT2_BG_INODE_ZEROED 0x0004 /* On-disk itable initialized to zero */ + +/* + * Data structures used by the directory indexing feature + * + * Note: all of the multibyte integer fields are little endian. + */ + +/* + * Note: dx_root_info is laid out so that if it should somehow get + * overlaid by a dirent the two low bits of the hash version will be + * zero. Therefore, the hash version mod 4 should never be 0. + * Sincerely, the paranoia department. + */ +struct ext2_dx_root_info { + __u32 reserved_zero; + __u8 hash_version; /* 0 now, 1 at release */ + __u8 info_length; /* 8 */ + __u8 indirect_levels; + __u8 unused_flags; +}; + +#define EXT2_HASH_LEGACY 0 +#define EXT2_HASH_HALF_MD4 1 +#define EXT2_HASH_TEA 2 +#define EXT2_HASH_LEGACY_UNSIGNED 3 /* reserved for userspace lib */ +#define EXT2_HASH_HALF_MD4_UNSIGNED 4 /* reserved for userspace lib */ +#define EXT2_HASH_TEA_UNSIGNED 5 /* reserved for userspace lib */ +#define EXT2_HASH_SIPHASH 6 + +#define EXT2_HASH_FLAG_INCOMPAT 0x1 + +#define EXT4_DX_BLOCK_MASK 0x0fffffff + +struct ext2_dx_entry { + __le32 hash; + __le32 block; +}; + +struct ext2_dx_countlimit { + __le16 limit; + __le16 count; +}; + +/* + * This goes at the end of each htree block. + */ +struct ext2_dx_tail { + __le32 dt_reserved; + __le32 dt_checksum; /* crc32c(uuid+inum+dxblock) */ +}; + +/* + * Macro-instructions used to manage group descriptors + */ +#define EXT2_MIN_DESC_SIZE 32 +#define EXT2_MIN_DESC_SIZE_64BIT 64 +#define EXT2_MAX_DESC_SIZE EXT2_MIN_BLOCK_SIZE +#define EXT2_DESC_SIZE(s) \ + (ext2fs_has_feature_64bit(s) ? (s)->s_desc_size : EXT2_MIN_DESC_SIZE) + +#define EXT2_BLOCKS_PER_GROUP(s) (EXT2_SB(s)->s_blocks_per_group) +#define EXT2_INODES_PER_GROUP(s) (EXT2_SB(s)->s_inodes_per_group) +#define EXT2_CLUSTERS_PER_GROUP(s) (EXT2_SB(s)->s_clusters_per_group) +#define EXT2_INODES_PER_BLOCK(s) (EXT2_BLOCK_SIZE(s)/EXT2_INODE_SIZE(s)) +/* limits imposed by 16-bit value gd_free_{blocks,inode}_count */ +#define EXT2_MAX_BLOCKS_PER_GROUP(s) ((((unsigned) 1 << 16) - 8) * \ + (EXT2_CLUSTER_SIZE(s) / \ + EXT2_BLOCK_SIZE(s))) +#define EXT2_MAX_CLUSTERS_PER_GROUP(s) (((unsigned) 1 << 16) - 8) +#define EXT2_MAX_INODES_PER_GROUP(s) (((unsigned) 1 << 16) - \ + EXT2_INODES_PER_BLOCK(s)) +#ifdef __KERNEL__ +#define EXT2_DESC_PER_BLOCK(s) (EXT2_SB(s)->s_desc_per_block) +#define EXT2_DESC_PER_BLOCK_BITS(s) (EXT2_SB(s)->s_desc_per_block_bits) +#else +#define EXT2_DESC_PER_BLOCK(s) (EXT2_BLOCK_SIZE(s) / EXT2_DESC_SIZE(s)) +#endif + +#define EXT2_GROUPS_TO_BLOCKS(s, g) ((blk64_t) EXT2_BLOCKS_PER_GROUP(s) * \ + (g)) +#define EXT2_GROUPS_TO_CLUSTERS(s, g) ((blk64_t) EXT2_CLUSTERS_PER_GROUP(s) * \ + (g)) + +/* + * Constants relative to the data blocks + */ +#define EXT2_NDIR_BLOCKS 12 +#define EXT2_IND_BLOCK EXT2_NDIR_BLOCKS +#define EXT2_DIND_BLOCK (EXT2_IND_BLOCK + 1) +#define EXT2_TIND_BLOCK (EXT2_DIND_BLOCK + 1) +#define EXT2_N_BLOCKS (EXT2_TIND_BLOCK + 1) + +/* + * Inode flags + */ +#define EXT2_SECRM_FL 0x00000001 /* Secure deletion */ +#define EXT2_UNRM_FL 0x00000002 /* Undelete */ +#define EXT2_COMPR_FL 0x00000004 /* Compress file */ +#define EXT2_SYNC_FL 0x00000008 /* Synchronous updates */ +#define EXT2_IMMUTABLE_FL 0x00000010 /* Immutable file */ +#define EXT2_APPEND_FL 0x00000020 /* writes to file may only append */ +#define EXT2_NODUMP_FL 0x00000040 /* do not dump file */ +#define EXT2_NOATIME_FL 0x00000080 /* do not update atime */ +/* Reserved for compression usage... */ +#define EXT2_DIRTY_FL 0x00000100 +#define EXT2_COMPRBLK_FL 0x00000200 /* One or more compressed clusters */ +#define EXT2_NOCOMPR_FL 0x00000400 /* Access raw compressed data */ + /* nb: was previously EXT2_ECOMPR_FL */ +#define EXT4_ENCRYPT_FL 0x00000800 /* encrypted inode */ +/* End compression flags --- maybe not all used */ +#define EXT2_BTREE_FL 0x00001000 /* btree format dir */ +#define EXT2_INDEX_FL 0x00001000 /* hash-indexed directory */ +#define EXT2_IMAGIC_FL 0x00002000 +#define EXT3_JOURNAL_DATA_FL 0x00004000 /* file data should be journaled */ +#define EXT2_NOTAIL_FL 0x00008000 /* file tail should not be merged */ +#define EXT2_DIRSYNC_FL 0x00010000 /* Synchronous directory modifications */ +#define EXT2_TOPDIR_FL 0x00020000 /* Top of directory hierarchies*/ +#define EXT4_HUGE_FILE_FL 0x00040000 /* Set to each huge file */ +#define EXT4_EXTENTS_FL 0x00080000 /* Inode uses extents */ +#define EXT4_VERITY_FL 0x00100000 /* Verity protected inode */ +#define EXT4_EA_INODE_FL 0x00200000 /* Inode used for large EA */ +/* EXT4_EOFBLOCKS_FL 0x00400000 was here */ +#define FS_NOCOW_FL 0x00800000 /* Do not cow file */ +#define EXT4_SNAPFILE_FL 0x01000000 /* Inode is a snapshot */ +#define FS_DAX_FL 0x02000000 /* Inode is DAX */ +#define EXT4_SNAPFILE_DELETED_FL 0x04000000 /* Snapshot is being deleted */ +#define EXT4_SNAPFILE_SHRUNK_FL 0x08000000 /* Snapshot shrink has completed */ +#define EXT4_INLINE_DATA_FL 0x10000000 /* Inode has inline data */ +#define EXT4_PROJINHERIT_FL 0x20000000 /* Create with parents projid */ +#define EXT4_CASEFOLD_FL 0x40000000 /* Casefolded file */ +#define EXT2_RESERVED_FL 0x80000000 /* reserved for ext2 lib */ + +#define EXT2_FL_USER_VISIBLE 0x604BDFFF /* User visible flags */ +#define EXT2_FL_USER_MODIFIABLE 0x604B80FF /* User modifiable flags */ + +/* + * ioctl commands + */ + +/* Used for online resize */ +struct ext2_new_group_input { + __u32 group; /* Group number for this data */ + __u32 block_bitmap; /* Absolute block number of block bitmap */ + __u32 inode_bitmap; /* Absolute block number of inode bitmap */ + __u32 inode_table; /* Absolute block number of inode table start */ + __u32 blocks_count; /* Total number of blocks in this group */ + __u16 reserved_blocks; /* Number of reserved blocks in this group */ + __u16 unused; /* Number of reserved GDT blocks in group */ +}; + +struct ext4_new_group_input { + __u32 group; /* Group number for this data */ + __u64 block_bitmap; /* Absolute block number of block bitmap */ + __u64 inode_bitmap; /* Absolute block number of inode bitmap */ + __u64 inode_table; /* Absolute block number of inode table start */ + __u32 blocks_count; /* Total number of blocks in this group */ + __u16 reserved_blocks; /* Number of reserved blocks in this group */ + __u16 unused; +}; + +#ifdef __GNU__ /* Needed for the Hurd */ +#define _IOT_ext2_new_group_input _IOT (_IOTS(__u32), 5, _IOTS(__u16), 2, 0, 0) +#endif + +#define EXT2_IOC_GETFLAGS _IOR('f', 1, long) +#define EXT2_IOC_SETFLAGS _IOW('f', 2, long) +#define EXT2_IOC_GETVERSION _IOR('v', 1, long) +#define EXT2_IOC_SETVERSION _IOW('v', 2, long) +#define EXT2_IOC_GETVERSION_NEW _IOR('f', 3, long) +#define EXT2_IOC_SETVERSION_NEW _IOW('f', 4, long) +#define EXT2_IOC_GROUP_EXTEND _IOW('f', 7, unsigned long) +#define EXT2_IOC_GROUP_ADD _IOW('f', 8,struct ext2_new_group_input) +#define EXT4_IOC_GROUP_ADD _IOW('f', 8,struct ext4_new_group_input) +#define EXT4_IOC_RESIZE_FS _IOW('f', 16, __u64) + +/* + * Structure of an inode on the disk + */ +struct ext2_inode { +/*00*/ __u16 i_mode; /* File mode */ + __u16 i_uid; /* Low 16 bits of Owner Uid */ + __u32 i_size; /* Size in bytes */ + __u32 i_atime; /* Access time */ + __u32 i_ctime; /* Inode change time */ +/*10*/ __u32 i_mtime; /* Modification time */ + __u32 i_dtime; /* Deletion Time */ + __u16 i_gid; /* Low 16 bits of Group Id */ + __u16 i_links_count; /* Links count */ + __u32 i_blocks; /* Blocks count */ +/*20*/ __u32 i_flags; /* File flags */ + union { + struct { + __u32 l_i_version; /* was l_i_reserved1 */ + } linux1; + struct { + __u32 h_i_translator; + } hurd1; + } osd1; /* OS dependent 1 */ +/*28*/ __u32 i_block[EXT2_N_BLOCKS];/* Pointers to blocks */ +/*64*/ __u32 i_generation; /* File version (for NFS) */ + __u32 i_file_acl; /* File ACL */ + __u32 i_size_high; +/*70*/ __u32 i_faddr; /* Fragment address */ + union { + struct { + __u16 l_i_blocks_hi; + __u16 l_i_file_acl_high; + __u16 l_i_uid_high; /* these 2 fields */ + __u16 l_i_gid_high; /* were reserved2[0] */ + __u16 l_i_checksum_lo; /* crc32c(uuid+inum+inode) */ + __u16 l_i_reserved; + } linux2; + struct { + __u8 h_i_frag; /* Fragment number */ + __u8 h_i_fsize; /* Fragment size */ + __u16 h_i_mode_high; + __u16 h_i_uid_high; + __u16 h_i_gid_high; + __u32 h_i_author; + } hurd2; + } osd2; /* OS dependent 2 */ +}; + +/* + * Permanent part of an large inode on the disk + */ +struct ext2_inode_large { +/*00*/ __u16 i_mode; /* File mode */ + __u16 i_uid; /* Low 16 bits of Owner Uid */ + __u32 i_size; /* Size in bytes */ + __u32 i_atime; /* Access time */ + __u32 i_ctime; /* Inode Change time */ +/*10*/ __u32 i_mtime; /* Modification time */ + __u32 i_dtime; /* Deletion Time */ + __u16 i_gid; /* Low 16 bits of Group Id */ + __u16 i_links_count; /* Links count */ + __u32 i_blocks; /* Blocks count */ +/*20*/ __u32 i_flags; /* File flags */ + union { + struct { + __u32 l_i_version; /* was l_i_reserved1 */ + } linux1; + struct { + __u32 h_i_translator; + } hurd1; + } osd1; /* OS dependent 1 */ +/*28*/ __u32 i_block[EXT2_N_BLOCKS];/* Pointers to blocks */ +/*64*/ __u32 i_generation; /* File version (for NFS) */ + __u32 i_file_acl; /* File ACL */ + __u32 i_size_high; +/*70*/ __u32 i_faddr; /* Fragment address */ + union { + struct { + __u16 l_i_blocks_hi; + __u16 l_i_file_acl_high; + __u16 l_i_uid_high; /* these 2 fields */ + __u16 l_i_gid_high; /* were reserved2[0] */ + __u16 l_i_checksum_lo; /* crc32c(uuid+inum+inode) */ + __u16 l_i_reserved; + } linux2; + struct { + __u8 h_i_frag; /* Fragment number */ + __u8 h_i_fsize; /* Fragment size */ + __u16 h_i_mode_high; + __u16 h_i_uid_high; + __u16 h_i_gid_high; + __u32 h_i_author; + } hurd2; + } osd2; /* OS dependent 2 */ +/*80*/ __u16 i_extra_isize; + __u16 i_checksum_hi; /* crc32c(uuid+inum+inode) */ + __u32 i_ctime_extra; /* extra Change time (nsec << 2 | epoch) */ + __u32 i_mtime_extra; /* extra Modification time (nsec << 2 | epoch) */ + __u32 i_atime_extra; /* extra Access time (nsec << 2 | epoch) */ +/*90*/ __u32 i_crtime; /* File creation time */ + __u32 i_crtime_extra; /* extra File creation time (nsec << 2 | epoch)*/ + __u32 i_version_hi; /* high 32 bits for 64-bit version */ +/*9c*/ __u32 i_projid; /* Project ID */ +}; + +#define EXT4_INODE_CSUM_HI_EXTRA_END \ + (offsetof(struct ext2_inode_large, i_checksum_hi) + sizeof(__u16) - \ + EXT2_GOOD_OLD_INODE_SIZE) + +#define EXT4_EPOCH_BITS 2 +#define EXT4_EPOCH_MASK ((1 << EXT4_EPOCH_BITS) - 1) + +#define i_checksum_lo osd2.linux2.l_i_checksum_lo + +#define inode_includes(size, field) \ + (size >= (sizeof(((struct ext2_inode_large *)0)->field) + \ + offsetof(struct ext2_inode_large, field))) + +#if defined(__KERNEL__) || defined(__linux__) +#define i_reserved1 osd1.linux1.l_i_reserved1 +#define i_frag osd2.linux2.l_i_frag +#define i_fsize osd2.linux2.l_i_fsize +#define i_uid_low i_uid +#define i_gid_low i_gid +#define i_uid_high osd2.linux2.l_i_uid_high +#define i_gid_high osd2.linux2.l_i_gid_high +#else +#if defined(__GNU__) + +#define i_translator osd1.hurd1.h_i_translator +#define i_frag osd2.hurd2.h_i_frag; +#define i_fsize osd2.hurd2.h_i_fsize; +#define i_uid_high osd2.hurd2.h_i_uid_high +#define i_gid_high osd2.hurd2.h_i_gid_high +#define i_author osd2.hurd2.h_i_author + +#endif /* __GNU__ */ +#endif /* defined(__KERNEL__) || defined(__linux__) */ + +#define inode_uid(inode) ((inode).i_uid | (unsigned)(inode).osd2.linux2.l_i_uid_high << 16) +#define inode_gid(inode) ((inode).i_gid | (unsigned)(inode).osd2.linux2.l_i_gid_high << 16) +#define inode_projid(inode) ((inode).i_projid) +#define ext2fs_set_i_uid_high(inode,x) ((inode).osd2.linux2.l_i_uid_high = (x)) +#define ext2fs_set_i_gid_high(inode,x) ((inode).osd2.linux2.l_i_gid_high = (x)) + +static inline +struct ext2_inode *EXT2_INODE(struct ext2_inode_large *large_inode) +{ + return (struct ext2_inode *) large_inode; +} + +/* + * File system states + */ +#define EXT2_VALID_FS 0x0001 /* Unmounted cleanly */ +#define EXT2_ERROR_FS 0x0002 /* Errors detected */ +#define EXT3_ORPHAN_FS 0x0004 /* Orphans being recovered */ +#define EXT4_FC_REPLAY 0x0020 /* Ext4 fast commit replay ongoing */ + +/* + * Misc. filesystem flags + */ +#define EXT2_FLAGS_SIGNED_HASH 0x0001 /* Signed dirhash in use */ +#define EXT2_FLAGS_UNSIGNED_HASH 0x0002 /* Unsigned dirhash in use */ +#define EXT2_FLAGS_TEST_FILESYS 0x0004 /* OK for use on development code */ +#define EXT2_FLAGS_IS_SNAPSHOT 0x0010 /* This is a snapshot image */ +#define EXT2_FLAGS_FIX_SNAPSHOT 0x0020 /* Snapshot inodes corrupted */ +#define EXT2_FLAGS_FIX_EXCLUDE 0x0040 /* Exclude bitmaps corrupted */ + +/* + * Mount flags + */ +#define EXT2_MOUNT_CHECK 0x0001 /* Do mount-time checks */ +#define EXT2_MOUNT_GRPID 0x0004 /* Create files with directory's group */ +#define EXT2_MOUNT_DEBUG 0x0008 /* Some debugging messages */ +#define EXT2_MOUNT_ERRORS_CONT 0x0010 /* Continue on errors */ +#define EXT2_MOUNT_ERRORS_RO 0x0020 /* Remount fs ro on errors */ +#define EXT2_MOUNT_ERRORS_PANIC 0x0040 /* Panic on errors */ +#define EXT2_MOUNT_MINIX_DF 0x0080 /* Mimics the Minix statfs */ +#define EXT2_MOUNT_NO_UID32 0x0200 /* Disable 32-bit UIDs */ + +#define clear_opt(o, opt) o &= ~EXT2_MOUNT_##opt +#define set_opt(o, opt) o |= EXT2_MOUNT_##opt +#define test_opt(sb, opt) (EXT2_SB(sb)->s_mount_opt & \ + EXT2_MOUNT_##opt) +/* + * Maximal mount counts between two filesystem checks + */ +#define EXT2_DFL_MAX_MNT_COUNT 20 /* Allow 20 mounts */ +#define EXT2_DFL_CHECKINTERVAL 0 /* Don't use interval check */ + +/* + * Behaviour when detecting errors + */ +#define EXT2_ERRORS_CONTINUE 1 /* Continue execution */ +#define EXT2_ERRORS_RO 2 /* Remount fs read-only */ +#define EXT2_ERRORS_PANIC 3 /* Panic */ +#define EXT2_ERRORS_DEFAULT EXT2_ERRORS_CONTINUE + +#if (__GNUC__ >= 4) +#define ext4_offsetof(TYPE,MEMBER) __builtin_offsetof(TYPE,MEMBER) +#else +#define ext4_offsetof(TYPE, MEMBER) ((size_t) &((TYPE *)0)->MEMBER) +#endif + +/* Metadata checksum algorithms */ +#define EXT2_CRC32C_CHKSUM 1 + +/* Encryption algorithms, key size and key reference len */ +#define EXT4_ENCRYPTION_MODE_INVALID 0 +#define EXT4_ENCRYPTION_MODE_AES_256_XTS 1 +#define EXT4_ENCRYPTION_MODE_AES_256_GCM 2 +#define EXT4_ENCRYPTION_MODE_AES_256_CBC 3 +#define EXT4_ENCRYPTION_MODE_AES_256_CTS 4 + +#define EXT4_AES_256_XTS_KEY_SIZE 64 +#define EXT4_AES_256_GCM_KEY_SIZE 32 +#define EXT4_AES_256_CBC_KEY_SIZE 32 +#define EXT4_AES_256_CTS_KEY_SIZE 32 +#define EXT4_MAX_KEY_SIZE 64 + +#define EXT4_KEY_DESCRIPTOR_SIZE 8 +#define EXT4_CRYPTO_BLOCK_SIZE 16 + +/* Password derivation constants */ +#define EXT4_MAX_PASSPHRASE_SIZE 1024 +#define EXT4_MAX_SALT_SIZE 256 +#define EXT4_PBKDF2_ITERATIONS 0xFFFF + +#define EXT2_LABEL_LEN 16 + +/* + * Policy provided via an ioctl on the topmost directory. This + * structure is also in the kernel. + */ +struct ext4_encryption_policy { + char version; + char contents_encryption_mode; + char filenames_encryption_mode; + char flags; + char master_key_descriptor[EXT4_KEY_DESCRIPTOR_SIZE]; +} __attribute__((__packed__)); + +struct ext4_encryption_key { + __u32 mode; + char raw[EXT4_MAX_KEY_SIZE]; + __u32 size; +} __attribute__((__packed__)); + +/* + * Structure of the super block + */ +struct ext2_super_block { +/*000*/ __u32 s_inodes_count; /* Inodes count */ + __u32 s_blocks_count; /* Blocks count */ + __u32 s_r_blocks_count; /* Reserved blocks count */ + __u32 s_free_blocks_count; /* Free blocks count */ +/*010*/ __u32 s_free_inodes_count; /* Free inodes count */ + __u32 s_first_data_block; /* First Data Block */ + __u32 s_log_block_size; /* Block size */ + __u32 s_log_cluster_size; /* Allocation cluster size */ +/*020*/ __u32 s_blocks_per_group; /* # Blocks per group */ + __u32 s_clusters_per_group; /* # Fragments per group */ + __u32 s_inodes_per_group; /* # Inodes per group */ + __u32 s_mtime; /* Mount time */ +/*030*/ __u32 s_wtime; /* Write time */ + __u16 s_mnt_count; /* Mount count */ + __s16 s_max_mnt_count; /* Maximal mount count */ + __u16 s_magic; /* Magic signature */ + __u16 s_state; /* File system state */ + __u16 s_errors; /* Behaviour when detecting errors */ + __u16 s_minor_rev_level; /* minor revision level */ +/*040*/ __u32 s_lastcheck; /* time of last check */ + __u32 s_checkinterval; /* max. time between checks */ + __u32 s_creator_os; /* OS */ + __u32 s_rev_level; /* Revision level */ +/*050*/ __u16 s_def_resuid; /* Default uid for reserved blocks */ + __u16 s_def_resgid; /* Default gid for reserved blocks */ + /* + * These fields are for EXT2_DYNAMIC_REV superblocks only. + * + * Note: the difference between the compatible feature set and + * the incompatible feature set is that if there is a bit set + * in the incompatible feature set that the kernel doesn't + * know about, it should refuse to mount the filesystem. + * + * e2fsck's requirements are more strict; if it doesn't know + * about a feature in either the compatible or incompatible + * feature set, it must abort and not try to meddle with + * things it doesn't understand... + */ + __u32 s_first_ino; /* First non-reserved inode */ + __u16 s_inode_size; /* size of inode structure */ + __u16 s_block_group_nr; /* block group # of this superblock */ + __u32 s_feature_compat; /* compatible feature set */ +/*060*/ __u32 s_feature_incompat; /* incompatible feature set */ + __u32 s_feature_ro_compat; /* readonly-compatible feature set */ +/*068*/ __u8 s_uuid[16] __nonstring; /* 128-bit uuid for volume */ +/*078*/ __u8 s_volume_name[EXT2_LABEL_LEN] __nonstring; /* volume name, no NUL? */ +/*088*/ __u8 s_last_mounted[64] __nonstring; /* directory last mounted on, no NUL? */ +/*0c8*/ __u32 s_algorithm_usage_bitmap; /* For compression */ + /* + * Performance hints. Directory preallocation should only + * happen if the EXT2_FEATURE_COMPAT_DIR_PREALLOC flag is on. + */ + __u8 s_prealloc_blocks; /* Nr of blocks to try to preallocate*/ + __u8 s_prealloc_dir_blocks; /* Nr to preallocate for dirs */ + __u16 s_reserved_gdt_blocks; /* Per group table for online growth */ + /* + * Journaling support valid if EXT2_FEATURE_COMPAT_HAS_JOURNAL set. + */ +/*0d0*/ __u8 s_journal_uuid[16] __nonstring; /* uuid of journal superblock */ +/*0e0*/ __u32 s_journal_inum; /* inode number of journal file */ + __u32 s_journal_dev; /* device number of journal file */ + __u32 s_last_orphan; /* start of list of inodes to delete */ +/*0ec*/ __u32 s_hash_seed[4]; /* HTREE hash seed */ +/*0fc*/ __u8 s_def_hash_version; /* Default hash version to use */ + __u8 s_jnl_backup_type; /* Default type of journal backup */ + __u16 s_desc_size; /* Group desc. size: INCOMPAT_64BIT */ +/*100*/ __u32 s_default_mount_opts; /* default EXT2_MOUNT_* flags used */ + __u32 s_first_meta_bg; /* First metablock group */ + __u32 s_mkfs_time; /* When the filesystem was created */ +/*10c*/ __u32 s_jnl_blocks[17]; /* Backup of the journal inode */ +/*150*/ __u32 s_blocks_count_hi; /* Blocks count high 32bits */ + __u32 s_r_blocks_count_hi; /* Reserved blocks count high 32 bits*/ + __u32 s_free_blocks_hi; /* Free blocks count */ + __u16 s_min_extra_isize; /* All inodes have at least # bytes */ + __u16 s_want_extra_isize; /* New inodes should reserve # bytes */ +/*160*/ __u32 s_flags; /* Miscellaneous flags */ + __u16 s_raid_stride; /* RAID stride in blocks */ + __u16 s_mmp_update_interval; /* # seconds to wait in MMP checking */ + __u64 s_mmp_block; /* Block for multi-mount protection */ +/*170*/ __u32 s_raid_stripe_width; /* blocks on all data disks (N*stride)*/ + __u8 s_log_groups_per_flex; /* FLEX_BG group size */ + __u8 s_checksum_type; /* metadata checksum algorithm */ + __u8 s_encryption_level; /* versioning level for encryption */ + __u8 s_reserved_pad; /* Padding to next 32bits */ + __u64 s_kbytes_written; /* nr of lifetime kilobytes written */ +/*180*/ __u32 s_snapshot_inum; /* Inode number of active snapshot */ + __u32 s_snapshot_id; /* sequential ID of active snapshot */ + __u64 s_snapshot_r_blocks_count; /* active snapshot reserved blocks */ +/*190*/ __u32 s_snapshot_list; /* inode number of disk snapshot list */ +#define EXT4_S_ERR_START ext4_offsetof(struct ext2_super_block, s_error_count) + __u32 s_error_count; /* number of fs errors */ + __u32 s_first_error_time; /* first time an error happened */ + __u32 s_first_error_ino; /* inode involved in first error */ +/*1a0*/ __u64 s_first_error_block; /* block involved in first error */ + __u8 s_first_error_func[32] __nonstring; /* function where error hit, no NUL? */ +/*1c8*/ __u32 s_first_error_line; /* line number where error happened */ + __u32 s_last_error_time; /* most recent time of an error */ +/*1d0*/ __u32 s_last_error_ino; /* inode involved in last error */ + __u32 s_last_error_line; /* line number where error happened */ + __u64 s_last_error_block; /* block involved of last error */ +/*1e0*/ __u8 s_last_error_func[32] __nonstring; /* function where error hit, no NUL? */ +#define EXT4_S_ERR_END ext4_offsetof(struct ext2_super_block, s_mount_opts) +/*200*/ __u8 s_mount_opts[64] __nonstring; /* default mount options, no NUL? */ +/*240*/ __u32 s_usr_quota_inum; /* inode number of user quota file */ + __u32 s_grp_quota_inum; /* inode number of group quota file */ + __u32 s_overhead_clusters; /* overhead blocks/clusters in fs */ +/*24c*/ __u32 s_backup_bgs[2]; /* If sparse_super2 enabled */ +/*254*/ __u8 s_encrypt_algos[4]; /* Encryption algorithms in use */ +/*258*/ __u8 s_encrypt_pw_salt[16]; /* Salt used for string2key algorithm */ +/*268*/ __le32 s_lpf_ino; /* Location of the lost+found inode */ + __le32 s_prj_quota_inum; /* inode for tracking project quota */ +/*270*/ __le32 s_checksum_seed; /* crc32c(orig_uuid) if csum_seed set */ +/*274*/ __u8 s_wtime_hi; + __u8 s_mtime_hi; + __u8 s_mkfs_time_hi; + __u8 s_lastcheck_hi; + __u8 s_first_error_time_hi; + __u8 s_last_error_time_hi; + __u8 s_first_error_errcode; + __u8 s_last_error_errcode; +/*27c*/ __le16 s_encoding; /* Filename charset encoding */ + __le16 s_encoding_flags; /* Filename charset encoding flags */ + __le32 s_orphan_file_inum; /* Inode for tracking orphan inodes */ + __le32 s_reserved[94]; /* Padding to the end of the block */ +/*3fc*/ __u32 s_checksum; /* crc32c(superblock) */ +}; + +#define EXT4_S_ERR_LEN (EXT4_S_ERR_END - EXT4_S_ERR_START) +#define EXT2_LEN_STR(buf) (int)sizeof(buf), (char *)buf + +/* + * Codes for operating systems + */ +#define EXT2_OS_LINUX 0 +#define EXT2_OS_HURD 1 +#define EXT2_OBSO_OS_MASIX 2 +#define EXT2_OS_FREEBSD 3 +#define EXT2_OS_LITES 4 + +/* + * Revision levels + */ +#define EXT2_GOOD_OLD_REV 0 /* The good old (original) format */ +#define EXT2_DYNAMIC_REV 1 /* V2 format w/ dynamic inode sizes */ + +#define EXT2_CURRENT_REV EXT2_GOOD_OLD_REV +#define EXT2_MAX_SUPP_REV EXT2_DYNAMIC_REV + +#define EXT2_GOOD_OLD_INODE_SIZE 128 + +/* + * Journal inode backup types + */ +#define EXT3_JNL_BACKUP_BLOCKS 1 + +/* + * Feature set definitions + */ + +#define EXT2_HAS_COMPAT_FEATURE(sb,mask) \ + ( EXT2_SB(sb)->s_feature_compat & (mask) ) +#define EXT2_HAS_RO_COMPAT_FEATURE(sb,mask) \ + ( EXT2_SB(sb)->s_feature_ro_compat & (mask) ) +#define EXT2_HAS_INCOMPAT_FEATURE(sb,mask) \ + ( EXT2_SB(sb)->s_feature_incompat & (mask) ) + +#define EXT2_FEATURE_COMPAT_DIR_PREALLOC 0x0001 +#define EXT2_FEATURE_COMPAT_IMAGIC_INODES 0x0002 +#define EXT3_FEATURE_COMPAT_HAS_JOURNAL 0x0004 +#define EXT2_FEATURE_COMPAT_EXT_ATTR 0x0008 +#define EXT2_FEATURE_COMPAT_RESIZE_INODE 0x0010 +#define EXT2_FEATURE_COMPAT_DIR_INDEX 0x0020 +#define EXT2_FEATURE_COMPAT_LAZY_BG 0x0040 +/* #define EXT2_FEATURE_COMPAT_EXCLUDE_INODE 0x0080 not used, legacy */ +#define EXT2_FEATURE_COMPAT_EXCLUDE_BITMAP 0x0100 +#define EXT4_FEATURE_COMPAT_SPARSE_SUPER2 0x0200 +#define EXT4_FEATURE_COMPAT_FAST_COMMIT 0x0400 +#define EXT4_FEATURE_COMPAT_STABLE_INODES 0x0800 +#define EXT4_FEATURE_COMPAT_ORPHAN_FILE 0x1000 + +#define EXT2_FEATURE_RO_COMPAT_SPARSE_SUPER 0x0001 +#define EXT2_FEATURE_RO_COMPAT_LARGE_FILE 0x0002 +/* #define EXT2_FEATURE_RO_COMPAT_BTREE_DIR 0x0004 not used */ +#define EXT4_FEATURE_RO_COMPAT_HUGE_FILE 0x0008 +#define EXT4_FEATURE_RO_COMPAT_GDT_CSUM 0x0010 +#define EXT4_FEATURE_RO_COMPAT_DIR_NLINK 0x0020 +#define EXT4_FEATURE_RO_COMPAT_EXTRA_ISIZE 0x0040 +#define EXT4_FEATURE_RO_COMPAT_HAS_SNAPSHOT 0x0080 +#define EXT4_FEATURE_RO_COMPAT_QUOTA 0x0100 +#define EXT4_FEATURE_RO_COMPAT_BIGALLOC 0x0200 +/* + * METADATA_CSUM implies GDT_CSUM. When METADATA_CSUM is set, group + * descriptor checksums use the same algorithm as all other data + * structures' checksums. + */ +#define EXT4_FEATURE_RO_COMPAT_METADATA_CSUM 0x0400 +#define EXT4_FEATURE_RO_COMPAT_REPLICA 0x0800 +#define EXT4_FEATURE_RO_COMPAT_READONLY 0x1000 +#define EXT4_FEATURE_RO_COMPAT_PROJECT 0x2000 /* Project quota */ +#define EXT4_FEATURE_RO_COMPAT_SHARED_BLOCKS 0x4000 +#define EXT4_FEATURE_RO_COMPAT_VERITY 0x8000 +#define EXT4_FEATURE_RO_COMPAT_ORPHAN_PRESENT 0x10000 + +#define EXT2_FEATURE_INCOMPAT_COMPRESSION 0x0001 +#define EXT2_FEATURE_INCOMPAT_FILETYPE 0x0002 +#define EXT3_FEATURE_INCOMPAT_RECOVER 0x0004 /* Needs recovery */ +#define EXT3_FEATURE_INCOMPAT_JOURNAL_DEV 0x0008 /* Journal device */ +#define EXT2_FEATURE_INCOMPAT_META_BG 0x0010 +#define EXT3_FEATURE_INCOMPAT_EXTENTS 0x0040 +#define EXT4_FEATURE_INCOMPAT_64BIT 0x0080 +#define EXT4_FEATURE_INCOMPAT_MMP 0x0100 +#define EXT4_FEATURE_INCOMPAT_FLEX_BG 0x0200 +#define EXT4_FEATURE_INCOMPAT_EA_INODE 0x0400 +#define EXT4_FEATURE_INCOMPAT_DIRDATA 0x1000 +#define EXT4_FEATURE_INCOMPAT_CSUM_SEED 0x2000 +#define EXT4_FEATURE_INCOMPAT_LARGEDIR 0x4000 /* >2GB or 3-lvl htree */ +#define EXT4_FEATURE_INCOMPAT_INLINE_DATA 0x8000 /* data in inode */ +#define EXT4_FEATURE_INCOMPAT_ENCRYPT 0x10000 +#define EXT4_FEATURE_INCOMPAT_CASEFOLD 0x20000 + +#define EXT4_FEATURE_COMPAT_FUNCS(name, ver, flagname) \ +static inline int ext2fs_has_feature_##name(struct ext2_super_block *sb) \ +{ \ + return ((EXT2_SB(sb)->s_feature_compat & \ + EXT##ver##_FEATURE_COMPAT_##flagname) != 0); \ +} \ +static inline void ext2fs_set_feature_##name(struct ext2_super_block *sb) \ +{ \ + EXT2_SB(sb)->s_feature_compat |= \ + EXT##ver##_FEATURE_COMPAT_##flagname; \ +} \ +static inline void ext2fs_clear_feature_##name(struct ext2_super_block *sb) \ +{ \ + EXT2_SB(sb)->s_feature_compat &= \ + ~EXT##ver##_FEATURE_COMPAT_##flagname; \ +} + +#define EXT4_FEATURE_RO_COMPAT_FUNCS(name, ver, flagname) \ +static inline int ext2fs_has_feature_##name(struct ext2_super_block *sb) \ +{ \ + return ((EXT2_SB(sb)->s_feature_ro_compat & \ + EXT##ver##_FEATURE_RO_COMPAT_##flagname) != 0); \ +} \ +static inline void ext2fs_set_feature_##name(struct ext2_super_block *sb) \ +{ \ + EXT2_SB(sb)->s_feature_ro_compat |= \ + EXT##ver##_FEATURE_RO_COMPAT_##flagname; \ +} \ +static inline void ext2fs_clear_feature_##name(struct ext2_super_block *sb) \ +{ \ + EXT2_SB(sb)->s_feature_ro_compat &= \ + ~EXT##ver##_FEATURE_RO_COMPAT_##flagname; \ +} + +#define EXT4_FEATURE_INCOMPAT_FUNCS(name, ver, flagname) \ +static inline int ext2fs_has_feature_##name(struct ext2_super_block *sb) \ +{ \ + return ((EXT2_SB(sb)->s_feature_incompat & \ + EXT##ver##_FEATURE_INCOMPAT_##flagname) != 0); \ +} \ +static inline void ext2fs_set_feature_##name(struct ext2_super_block *sb) \ +{ \ + EXT2_SB(sb)->s_feature_incompat |= \ + EXT##ver##_FEATURE_INCOMPAT_##flagname; \ +} \ +static inline void ext2fs_clear_feature_##name(struct ext2_super_block *sb) \ +{ \ + EXT2_SB(sb)->s_feature_incompat &= \ + ~EXT##ver##_FEATURE_INCOMPAT_##flagname; \ +} + +EXT4_FEATURE_COMPAT_FUNCS(dir_prealloc, 2, DIR_PREALLOC) +EXT4_FEATURE_COMPAT_FUNCS(imagic_inodes, 2, IMAGIC_INODES) +EXT4_FEATURE_COMPAT_FUNCS(journal, 3, HAS_JOURNAL) +EXT4_FEATURE_COMPAT_FUNCS(xattr, 2, EXT_ATTR) +EXT4_FEATURE_COMPAT_FUNCS(resize_inode, 2, RESIZE_INODE) +EXT4_FEATURE_COMPAT_FUNCS(dir_index, 2, DIR_INDEX) +EXT4_FEATURE_COMPAT_FUNCS(lazy_bg, 2, LAZY_BG) +EXT4_FEATURE_COMPAT_FUNCS(exclude_bitmap, 2, EXCLUDE_BITMAP) +EXT4_FEATURE_COMPAT_FUNCS(sparse_super2, 4, SPARSE_SUPER2) +EXT4_FEATURE_COMPAT_FUNCS(fast_commit, 4, FAST_COMMIT) +EXT4_FEATURE_COMPAT_FUNCS(stable_inodes, 4, STABLE_INODES) +EXT4_FEATURE_COMPAT_FUNCS(orphan_file, 4, ORPHAN_FILE) + +EXT4_FEATURE_RO_COMPAT_FUNCS(sparse_super, 2, SPARSE_SUPER) +EXT4_FEATURE_RO_COMPAT_FUNCS(large_file, 2, LARGE_FILE) +EXT4_FEATURE_RO_COMPAT_FUNCS(huge_file, 4, HUGE_FILE) +EXT4_FEATURE_RO_COMPAT_FUNCS(gdt_csum, 4, GDT_CSUM) +EXT4_FEATURE_RO_COMPAT_FUNCS(dir_nlink, 4, DIR_NLINK) +EXT4_FEATURE_RO_COMPAT_FUNCS(extra_isize, 4, EXTRA_ISIZE) +EXT4_FEATURE_RO_COMPAT_FUNCS(has_snapshot, 4, HAS_SNAPSHOT) +EXT4_FEATURE_RO_COMPAT_FUNCS(quota, 4, QUOTA) +EXT4_FEATURE_RO_COMPAT_FUNCS(bigalloc, 4, BIGALLOC) +EXT4_FEATURE_RO_COMPAT_FUNCS(metadata_csum, 4, METADATA_CSUM) +EXT4_FEATURE_RO_COMPAT_FUNCS(replica, 4, REPLICA) +EXT4_FEATURE_RO_COMPAT_FUNCS(readonly, 4, READONLY) +EXT4_FEATURE_RO_COMPAT_FUNCS(project, 4, PROJECT) +EXT4_FEATURE_RO_COMPAT_FUNCS(shared_blocks, 4, SHARED_BLOCKS) +EXT4_FEATURE_RO_COMPAT_FUNCS(verity, 4, VERITY) +EXT4_FEATURE_RO_COMPAT_FUNCS(orphan_present, 4, ORPHAN_PRESENT) + +EXT4_FEATURE_INCOMPAT_FUNCS(compression, 2, COMPRESSION) +EXT4_FEATURE_INCOMPAT_FUNCS(filetype, 2, FILETYPE) +EXT4_FEATURE_INCOMPAT_FUNCS(journal_needs_recovery, 3, RECOVER) +EXT4_FEATURE_INCOMPAT_FUNCS(journal_dev, 3, JOURNAL_DEV) +EXT4_FEATURE_INCOMPAT_FUNCS(meta_bg, 2, META_BG) +EXT4_FEATURE_INCOMPAT_FUNCS(extents, 3, EXTENTS) +EXT4_FEATURE_INCOMPAT_FUNCS(64bit, 4, 64BIT) +EXT4_FEATURE_INCOMPAT_FUNCS(mmp, 4, MMP) +EXT4_FEATURE_INCOMPAT_FUNCS(flex_bg, 4, FLEX_BG) +EXT4_FEATURE_INCOMPAT_FUNCS(ea_inode, 4, EA_INODE) +EXT4_FEATURE_INCOMPAT_FUNCS(dirdata, 4, DIRDATA) +EXT4_FEATURE_INCOMPAT_FUNCS(csum_seed, 4, CSUM_SEED) +EXT4_FEATURE_INCOMPAT_FUNCS(largedir, 4, LARGEDIR) +EXT4_FEATURE_INCOMPAT_FUNCS(inline_data, 4, INLINE_DATA) +EXT4_FEATURE_INCOMPAT_FUNCS(encrypt, 4, ENCRYPT) +EXT4_FEATURE_INCOMPAT_FUNCS(casefold, 4, CASEFOLD) + +#define EXT2_FEATURE_COMPAT_SUPP 0 +#define EXT2_FEATURE_INCOMPAT_SUPP (EXT2_FEATURE_INCOMPAT_FILETYPE| \ + EXT4_FEATURE_INCOMPAT_MMP| \ + EXT4_FEATURE_INCOMPAT_LARGEDIR| \ + EXT4_FEATURE_INCOMPAT_EA_INODE) +#define EXT2_FEATURE_RO_COMPAT_SUPP (EXT2_FEATURE_RO_COMPAT_SPARSE_SUPER| \ + EXT2_FEATURE_RO_COMPAT_LARGE_FILE| \ + EXT4_FEATURE_RO_COMPAT_DIR_NLINK| \ + EXT2_FEATURE_RO_COMPAT_BTREE_DIR| \ + EXT4_FEATURE_RO_COMPAT_VERITY) + +/* + * Default values for user and/or group using reserved blocks + */ +#define EXT2_DEF_RESUID 0 +#define EXT2_DEF_RESGID 0 + +/* + * Default mount options + */ +#define EXT2_DEFM_DEBUG 0x0001 +#define EXT2_DEFM_BSDGROUPS 0x0002 +#define EXT2_DEFM_XATTR_USER 0x0004 +#define EXT2_DEFM_ACL 0x0008 +#define EXT2_DEFM_UID16 0x0010 +#define EXT3_DEFM_JMODE 0x0060 +#define EXT3_DEFM_JMODE_DATA 0x0020 +#define EXT3_DEFM_JMODE_ORDERED 0x0040 +#define EXT3_DEFM_JMODE_WBACK 0x0060 +#define EXT4_DEFM_NOBARRIER 0x0100 +#define EXT4_DEFM_BLOCK_VALIDITY 0x0200 +#define EXT4_DEFM_DISCARD 0x0400 +#define EXT4_DEFM_NODELALLOC 0x0800 + +static inline int ext4_hash_in_dirent(const struct ext2_inode *inode) +{ + return (inode->i_flags & EXT4_ENCRYPT_FL) && + (inode->i_flags & EXT4_CASEFOLD_FL); +} + +/* + * Structure of a directory entry + */ +#define EXT2_NAME_LEN 255 + +struct ext2_dir_entry { + __u32 inode; /* Inode number */ + __u16 rec_len; /* Directory entry length */ + __u16 name_len; /* Name length */ + char name[EXT2_NAME_LEN]; /* File name */ +}; + +/* + * The new version of the directory entry. Since EXT2 structures are + * stored in intel byte order, and the name_len field could never be + * bigger than 255 chars, it's safe to reclaim the extra byte for the + * file_type field. + * + * This structure is deprecated due to endian issues. Please use struct + * ext2_dir_entry and accessor functions + * ext2fs_dirent_name_len + * ext2fs_dirent_set_name_len + * ext2fs_dirent_file_type + * ext2fs_dirent_set_file_type + * to get and set name_len and file_type fields. + */ +struct ext2_dir_entry_2 { + __u32 inode; /* Inode number */ + __u16 rec_len; /* Directory entry length */ + __u8 name_len; /* Name length */ + __u8 file_type; + char name[EXT2_NAME_LEN]; /* File name */ +}; + +/* + * Hashes for ext4_dir_entry for casefolded and ecrypted directories. + * This is located at the first 4 bit aligned location after the name. + */ + +struct ext2_dir_entry_hash { + __le32 hash; + __le32 minor_hash; +}; + +#define EXT2_DIRENT_HASHES(entry) \ + ((struct ext2_dir_entry_hash *) &entry->name[\ + (ext2fs_dirent_name_len(entry) + \ + EXT2_DIR_ROUND) & ~EXT2_DIR_ROUND]) +#define EXT2_DIRENT_HASH(entry) \ + ext2fs_le32_to_cpu(EXT2_DIRENT_HASHES(entry)->hash) +#define EXT2_DIRENT_MINOR_HASH(entry) \ + ext2fs_le32_to_cpu(EXT2_DIRENT_HASHES(entry)->minor_hash) + +/* + * This is a bogus directory entry at the end of each leaf block that + * records checksums. + */ +struct ext2_dir_entry_tail { + __u32 det_reserved_zero1; /* Pretend to be unused */ + __u16 det_rec_len; /* 12 */ + __u16 det_reserved_name_len; /* 0xDE00, fake namelen/filetype */ + __u32 det_checksum; /* crc32c(uuid+inode+dirent) */ +}; + +/* + * Ext2 directory file types. Only the low 3 bits are used. The + * other bits are reserved for now. + */ +#define EXT2_FT_UNKNOWN 0 +#define EXT2_FT_REG_FILE 1 +#define EXT2_FT_DIR 2 +#define EXT2_FT_CHRDEV 3 +#define EXT2_FT_BLKDEV 4 +#define EXT2_FT_FIFO 5 +#define EXT2_FT_SOCK 6 +#define EXT2_FT_SYMLINK 7 + +#define EXT2_FT_MAX 8 + +/* + * Annoyingly, e2fsprogs always swab16s ext2_dir_entry.name_len, so we + * have to build ext2_dir_entry_tail with that assumption too. This + * constant helps to build the dir_entry_tail to look like it has an + * "invalid" file type. + */ +#define EXT2_DIR_NAME_LEN_CSUM 0xDE00 + +/* + * EXT2_DIR_PAD defines the directory entries boundaries + * + * NOTE: It must be a multiple of 4 + */ +#define EXT2_DIR_ENTRY_HEADER_LEN 8 +#define EXT2_DIR_ENTRY_HASH_LEN 8 +#define EXT2_DIR_PAD 4 +#define EXT2_DIR_ROUND (EXT2_DIR_PAD - 1) +#define EXT2_DIR_REC_LEN(name_len) ext2fs_dir_rec_len(name_len, 0) + +static inline unsigned int ext2fs_dir_rec_len(__u8 name_len, + int extended) +{ + int rec_len = (name_len + EXT2_DIR_ENTRY_HEADER_LEN + EXT2_DIR_ROUND); + + rec_len &= ~EXT2_DIR_ROUND; + if (extended) + rec_len += EXT2_DIR_ENTRY_HASH_LEN; + return rec_len; +} + +#define EXT4_ORPHAN_BLOCK_MAGIC 0x0b10ca04 + +/* Structure at the tail of orphan block */ +struct ext4_orphan_block_tail { + __u32 ob_magic; + __u32 ob_checksum; +}; + +/* + * Constants for ext4's extended time encoding + */ +#define EXT4_EPOCH_BITS 2 +#define EXT4_EPOCH_MASK ((1 << EXT4_EPOCH_BITS) - 1) +#define EXT4_NSEC_MASK (~0UL << EXT4_EPOCH_BITS) + +/* + * This structure is used for multiple mount protection. It is written + * into the block number saved in the s_mmp_block field in the superblock. + * Programs that check MMP should assume that if SEQ_FSCK (or any unknown + * code above SEQ_MAX) is present then it is NOT safe to use the filesystem, + * regardless of how old the timestamp is. + * + * The timestamp in the MMP structure will be updated by e2fsck at some + * arbitrary intervals (start of passes, after every few groups of inodes + * in pass1 and pass1b). There is no guarantee that e2fsck is updating + * the MMP block in a timely manner, and the updates it does are purely + * for the convenience of the sysadmin and not for automatic validation. + * + * Note: Only the mmp_seq value is used to determine whether the MMP block + * is being updated. The mmp_time, mmp_nodename, and mmp_bdevname + * fields are only for informational purposes for the administrator, + * due to clock skew between nodes and hostname HA service takeover. + */ +#define EXT4_MMP_MAGIC 0x004D4D50U /* ASCII for MMP */ +#define EXT4_MMP_SEQ_CLEAN 0xFF4D4D50U /* mmp_seq value for clean unmount */ +#define EXT4_MMP_SEQ_FSCK 0xE24D4D50U /* mmp_seq value when being fscked */ +#define EXT4_MMP_SEQ_MAX 0xE24D4D4FU /* maximum valid mmp_seq value */ + +/* Not endian-annotated; it's swapped at read/write time */ +struct mmp_struct { + __u32 mmp_magic; /* Magic number for MMP */ + __u32 mmp_seq; /* Sequence no. updated periodically */ + __u64 mmp_time; /* Time last updated (seconds) */ + __u8 mmp_nodename[64] __nonstring; /* Node updating MMP block, no NUL? */ + __u8 mmp_bdevname[32] __nonstring; /* Bdev updating MMP block, no NUL? */ + __u16 mmp_check_interval; /* Changed mmp_check_interval */ + __u16 mmp_pad1; + __u32 mmp_pad2[226]; + __u32 mmp_checksum; /* crc32c(uuid+mmp_block) */ +}; + +/* + * Default interval for MMP update in seconds. + */ +#define EXT4_MMP_UPDATE_INTERVAL 5 + +/* + * Maximum interval for MMP update in seconds. + */ +#define EXT4_MMP_MAX_UPDATE_INTERVAL 300 + +/* + * Minimum interval for MMP checking in seconds. + */ +#define EXT4_MMP_MIN_CHECK_INTERVAL 5 + +/* + * Minimum size of inline data. + */ +#define EXT4_MIN_INLINE_DATA_SIZE ((sizeof(__u32) * EXT2_N_BLOCKS)) + +/* + * Size of a parent inode in inline data directory. + */ +#define EXT4_INLINE_DATA_DOTDOT_SIZE (4) + +#define EXT4_ENC_UTF8_12_1 1 + +#define EXT4_ENC_STRICT_MODE_FL (1 << 0) /* Reject invalid sequences */ + +#endif /* _LINUX_EXT2_FS_H */ diff --git a/lib/ext2fs/ext2_io.h b/lib/ext2fs/ext2_io.h new file mode 100644 index 0000000..679184e --- /dev/null +++ b/lib/ext2fs/ext2_io.h @@ -0,0 +1,179 @@ +/* + * io.h --- the I/O manager abstraction + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef _EXT2FS_EXT2_IO_H +#define _EXT2FS_EXT2_IO_H + +#include <ext2fs/ext2_types.h> + +/* + * ext2_loff_t is defined here since unix_io.c needs it. + */ +#if defined(__GNUC__) || defined(HAS_LONG_LONG) +typedef long long ext2_loff_t; +#else +typedef long ext2_loff_t; +#endif + +/* llseek.c */ +ext2_loff_t ext2fs_llseek (int, ext2_loff_t, int); + +typedef struct struct_io_manager *io_manager; +typedef struct struct_io_channel *io_channel; +typedef struct struct_io_stats *io_stats; + +#define CHANNEL_FLAGS_WRITETHROUGH 0x01 +#define CHANNEL_FLAGS_DISCARD_ZEROES 0x02 +#define CHANNEL_FLAGS_BLOCK_DEVICE 0x04 +#define CHANNEL_FLAGS_THREADS 0x08 + +#define io_channel_discard_zeroes_data(i) (i->flags & CHANNEL_FLAGS_DISCARD_ZEROES) + +struct struct_io_channel { + errcode_t magic; + io_manager manager; + char *name; + int block_size; + errcode_t (*read_error)(io_channel channel, + unsigned long block, + int count, + void *data, + size_t size, + int actual_bytes_read, + errcode_t error); + errcode_t (*write_error)(io_channel channel, + unsigned long block, + int count, + const void *data, + size_t size, + int actual_bytes_written, + errcode_t error); + int refcount; + int flags; + long reserved[14]; + void *private_data; + void *app_data; + int align; +}; + +struct struct_io_stats { + int num_fields; + int reserved; + unsigned long long bytes_read; + unsigned long long bytes_written; +}; + +struct struct_io_manager { + errcode_t magic; + const char *name; + errcode_t (*open)(const char *name, int flags, io_channel *channel); + errcode_t (*close)(io_channel channel); + errcode_t (*set_blksize)(io_channel channel, int blksize); + errcode_t (*read_blk)(io_channel channel, unsigned long block, + int count, void *data); + errcode_t (*write_blk)(io_channel channel, unsigned long block, + int count, const void *data); + errcode_t (*flush)(io_channel channel); + errcode_t (*write_byte)(io_channel channel, unsigned long offset, + int count, const void *data); + errcode_t (*set_option)(io_channel channel, const char *option, + const char *arg); + errcode_t (*get_stats)(io_channel channel, io_stats *io_stats); + errcode_t (*read_blk64)(io_channel channel, unsigned long long block, + int count, void *data); + errcode_t (*write_blk64)(io_channel channel, unsigned long long block, + int count, const void *data); + errcode_t (*discard)(io_channel channel, unsigned long long block, + unsigned long long count); + errcode_t (*cache_readahead)(io_channel channel, + unsigned long long block, + unsigned long long count); + errcode_t (*zeroout)(io_channel channel, unsigned long long block, + unsigned long long count); + long reserved[14]; +}; + +#define IO_FLAG_RW 0x0001 +#define IO_FLAG_EXCLUSIVE 0x0002 +#define IO_FLAG_DIRECT_IO 0x0004 +#define IO_FLAG_FORCE_BOUNCE 0x0008 +#define IO_FLAG_THREADS 0x0010 +#define IO_FLAG_NOCACHE 0x0020 + +/* + * Convenience functions.... + */ +#define io_channel_close(c) ((c)->manager->close((c))) +#define io_channel_set_blksize(c,s) ((c)->manager->set_blksize((c),s)) +#define io_channel_read_blk(c,b,n,d) ((c)->manager->read_blk((c),b,n,d)) +#define io_channel_write_blk(c,b,n,d) ((c)->manager->write_blk((c),b,n,d)) +#define io_channel_flush(c) ((c)->manager->flush((c))) +#define io_channel_bumpcount(c) ((c)->refcount++) + +/* io_manager.c */ +extern errcode_t io_channel_set_options(io_channel channel, + const char *options); +extern errcode_t io_channel_write_byte(io_channel channel, + unsigned long offset, + int count, const void *data); +extern errcode_t io_channel_read_blk64(io_channel channel, + unsigned long long block, + int count, void *data); +extern errcode_t io_channel_write_blk64(io_channel channel, + unsigned long long block, + int count, const void *data); +extern errcode_t io_channel_discard(io_channel channel, + unsigned long long block, + unsigned long long count); +extern errcode_t io_channel_zeroout(io_channel channel, + unsigned long long block, + unsigned long long count); +extern errcode_t io_channel_alloc_buf(io_channel channel, + int count, void *ptr); +extern errcode_t io_channel_cache_readahead(io_channel io, + unsigned long long block, + unsigned long long count); + +#ifdef _WIN32 +/* windows_io.c */ +extern io_manager windows_io_manager; +#define default_io_manager windows_io_manager +#else +/* unix_io.c */ +extern io_manager unix_io_manager; +extern io_manager unixfd_io_manager; +#define default_io_manager unix_io_manager +#endif + +/* sparse_io.c */ +extern io_manager sparse_io_manager; +extern io_manager sparsefd_io_manager; + +/* undo_io.c */ +extern io_manager undo_io_manager; +extern errcode_t set_undo_io_backing_manager(io_manager manager); +extern errcode_t set_undo_io_backup_file(char *file_name); + +/* test_io.c */ +extern io_manager test_io_manager, test_io_backing_manager; +extern void (*test_io_cb_read_blk) + (unsigned long block, int count, errcode_t err); +extern void (*test_io_cb_write_blk) + (unsigned long block, int count, errcode_t err); +extern void (*test_io_cb_read_blk64) + (unsigned long long block, int count, errcode_t err); +extern void (*test_io_cb_write_blk64) + (unsigned long long block, int count, errcode_t err); +extern void (*test_io_cb_set_blksize) + (int blksize, errcode_t err); + +#endif /* _EXT2FS_EXT2_IO_H */ + diff --git a/lib/ext2fs/ext2_types.h.in b/lib/ext2fs/ext2_types.h.in new file mode 100644 index 0000000..98cc65b --- /dev/null +++ b/lib/ext2fs/ext2_types.h.in @@ -0,0 +1,196 @@ +/* + * If linux/types.h is already been included, assume it has defined + * everything we need. (cross fingers) Other header files may have + * also defined the types that we need. + */ +#if (!defined(_LINUX_TYPES_H) && !defined(_BLKID_TYPES_H) && \ + !defined(_EXT2_TYPES_H)) +#define _EXT2_TYPES_H + +@ASM_TYPES_HEADER@ + +#ifndef HAVE___U8 +#define HAVE___U8 +#ifdef __U8_TYPEDEF +typedef __U8_TYPEDEF __u8; +#else +typedef unsigned char __u8; +#endif +#endif /* HAVE___U8 */ + +#ifndef HAVE___S8 +#define HAVE___S8 +#ifdef __S8_TYPEDEF +typedef __S8_TYPEDEF __s8; +#else +typedef signed char __s8; +#endif +#endif /* HAVE___S8 */ + +#ifndef HAVE___U16 +#define HAVE___U16 +#ifdef __U16_TYPEDEF +typedef __U16_TYPEDEF __u16; +#else +#if (@SIZEOF_INT@ == 2) +typedef unsigned int __u16; +#else +#if (@SIZEOF_SHORT@ == 2) +typedef unsigned short __u16; +#else +#undef HAVE___U16 + ?==error: undefined 16 bit type +#endif /* SIZEOF_SHORT == 2 */ +#endif /* SIZEOF_INT == 2 */ +#endif /* __U16_TYPEDEF */ +#endif /* HAVE___U16 */ + +#ifndef HAVE___S16 +#define HAVE___S16 +#ifdef __S16_TYPEDEF +typedef __S16_TYPEDEF __s16; +#else +#if (@SIZEOF_INT@ == 2) +typedef int __s16; +#else +#if (@SIZEOF_SHORT@ == 2) +typedef short __s16; +#else +#undef HAVE___S16 + ?==error: undefined 16 bit type +#endif /* SIZEOF_SHORT == 2 */ +#endif /* SIZEOF_INT == 2 */ +#endif /* __S16_TYPEDEF */ +#endif /* HAVE___S16 */ + +#ifndef HAVE___U32 +#define HAVE___U32 +#ifdef __U32_TYPEDEF +typedef __U32_TYPEDEF __u32; +#else +#if (@SIZEOF_INT@ == 4) +typedef unsigned int __u32; +#else +#if (@SIZEOF_LONG@ == 4) +typedef unsigned long __u32; +#else +#if (@SIZEOF_SHORT@ == 4) +typedef unsigned short __u32; +#else +#undef HAVE___U32 + ?== error: undefined 32 bit type +#endif /* SIZEOF_SHORT == 4 */ +#endif /* SIZEOF_LONG == 4 */ +#endif /* SIZEOF_INT == 4 */ +#endif /* __U32_TYPEDEF */ +#endif /* HAVE___U32 */ + +#ifndef HAVE___S32 +#define HAVE___S32 +#ifdef __S32_TYPEDEF +typedef __S32_TYPEDEF __s32; +#else +#if (@SIZEOF_INT@ == 4) +typedef int __s32; +#else +#if (@SIZEOF_LONG@ == 4) +typedef long __s32; +#else +#if (@SIZEOF_SHORT@ == 4) +typedef short __s32; +#else +#undef HAVE___S32 + ?== error: undefined 32 bit type +#endif /* SIZEOF_SHORT == 4 */ +#endif /* SIZEOF_LONG == 4 */ +#endif /* SIZEOF_INT == 4 */ +#endif /* __S32_TYPEDEF */ +#endif /* HAVE___S32 */ + +#ifndef HAVE___U64 +#define HAVE___U64 +#ifdef __U64_TYPEDEF +typedef __U64_TYPEDEF __u64; +#else +#if (@SIZEOF_INT@ == 8) +typedef unsigned int __u64; +#else +#if (@SIZEOF_LONG_LONG@ == 8) +typedef unsigned long long __u64; +#else +#if (@SIZEOF_LONG@ == 8) +typedef unsigned long __u64; +#else +#undef HAVE___U64 + ?== error: undefined 64 bit type +#endif /* SIZEOF_LONG_LONG == 8 */ +#endif /* SIZEOF_LONG == 8 */ +#endif /* SIZEOF_INT == 8 */ +#endif /* __U64_TYPEDEF */ +#endif /* HAVE___U64 */ + +#ifndef HAVE___S64 +#define HAVE___S64 +#ifdef __S64_TYPEDEF +typedef __S64_TYPEDEF __s64; +#else +#if (@SIZEOF_INT@ == 8) +typedef int __s64; +#else +#if (@SIZEOF_LONG_LONG@ == 8) +#if defined(__GNUC__) +typedef __signed__ long long __s64; +#else +typedef signed long long __s64; +#endif /* __GNUC__ */ +#else +#if (@SIZEOF_LONG@ == 8) +typedef long __s64; +#else +#undef HAVE___S64 + ?== error: undefined 64 bit type +#endif /* SIZEOF_LONG_LONG == 8 */ +#endif /* SIZEOF_LONG == 8 */ +#endif /* SIZEOF_INT == 8 */ +#endif /* __S64_TYPEDEF */ +#endif /* HAVE___S64 */ + +#undef __S8_TYPEDEF +#undef __U8_TYPEDEF +#undef __S16_TYPEDEF +#undef __U16_TYPEDEF +#undef __S32_TYPEDEF +#undef __U32_TYPEDEF +#undef __S64_TYPEDEF +#undef __U64_TYPEDEF + +#endif /* _*_TYPES_H */ + +#include <stdint.h> + +/* endian checking stuff */ +#ifndef EXT2_ENDIAN_H_ +#define EXT2_ENDIAN_H_ + +#ifdef __CHECKER__ +# ifndef __bitwise +# define __bitwise __attribute__((bitwise)) +# endif +#define __force __attribute__((force)) +#else +# ifndef __bitwise +# define __bitwise +# endif +#define __force +#endif + +typedef __u16 __bitwise __le16; +typedef __u32 __bitwise __le32; +typedef __u64 __bitwise __le64; +typedef __u16 __bitwise __be16; +typedef __u32 __bitwise __be32; +typedef __u64 __bitwise __be64; + +#endif /* EXT2_ENDIAN_H_ */ + +@PUBLIC_CONFIG_HEADER@ diff --git a/lib/ext2fs/ext2fs.h b/lib/ext2fs/ext2fs.h new file mode 100644 index 0000000..72c60d2 --- /dev/null +++ b/lib/ext2fs/ext2fs.h @@ -0,0 +1,2224 @@ +/* + * ext2fs.h --- ext2fs + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef _EXT2FS_EXT2FS_H +#define _EXT2FS_EXT2FS_H + +#ifdef __GNUC__ +#define EXT2FS_ATTR(x) __attribute__(x) +#else +#define EXT2FS_ATTR(x) +#endif + +#ifndef __nonstring +#ifdef __has_attribute +#if __has_attribute(__nonstring__) +#define __nonstring __attribute__((__nonstring__)) +#else +#define __nonstring +#endif /* __has_attribute(__nonstring__) */ +#else +# define __nonstring +#endif /* __has_attribute */ +#endif /* __nonstring */ + +#ifdef CONFIG_TDB +#define EXT2FS_NO_TDB_UNUSED +#else +#define EXT2FS_NO_TDB_UNUSED EXT2FS_ATTR((unused)) +#endif + +#ifdef __cplusplus +extern "C" { +#endif + +/* + * Non-GNU C compilers won't necessarily understand inline + */ +#if (!defined(__GNUC__) && !defined(__WATCOMC__)) +#define NO_INLINE_FUNCS +#endif + +/* + * Where the master copy of the superblock is located, and how big + * superblocks are supposed to be. We define SUPERBLOCK_SIZE because + * the size of the superblock structure is not necessarily trustworthy + * (some versions have the padding set up so that the superblock is + * 1032 bytes long). + */ +#define SUPERBLOCK_OFFSET 1024 +#define SUPERBLOCK_SIZE 1024 + +#define UUID_STR_SIZE 37 + +/* + * The last ext2fs revision level that this version of the library is + * able to support. + */ +#define EXT2_LIB_CURRENT_REV EXT2_DYNAMIC_REV + +#ifdef HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <time.h> +#include <errno.h> + +#if EXT2_FLAT_INCLUDES +#include "e2_types.h" +#include "ext2_fs.h" +#include "ext3_extents.h" +#else +#include <ext2fs/ext2_types.h> +#include <ext2fs/ext2_fs.h> +#include <ext2fs/ext3_extents.h> +#endif /* EXT2_FLAT_INCLUDES */ + +typedef __u32 __bitwise ext2_ino_t; +typedef __u32 __bitwise blk_t; +typedef __u64 __bitwise blk64_t; +typedef __u32 __bitwise dgrp_t; +typedef __s32 __bitwise ext2_off_t; +typedef __s64 __bitwise ext2_off64_t; +typedef __s64 __bitwise e2_blkcnt_t; +typedef __u32 __bitwise ext2_dirhash_t; + +#if EXT2_FLAT_INCLUDES +#include "com_err.h" +#include "ext2_io.h" +#include "ext2_err.h" +#include "ext2_ext_attr.h" +#else +#include <et/com_err.h> +#include <ext2fs/ext2_io.h> +#include <ext2fs/ext2_err.h> +#include <ext2fs/ext2_ext_attr.h> +#endif + +#include "hashmap.h" + +/* + * Portability help for Microsoft Visual C++ + */ +#ifdef _MSC_VER +#define EXT2_QSORT_TYPE int __cdecl +#else +#define EXT2_QSORT_TYPE int +#endif + +typedef struct struct_ext2_filsys *ext2_filsys; + +#define EXT2FS_MARK_ERROR 0 +#define EXT2FS_UNMARK_ERROR 1 +#define EXT2FS_TEST_ERROR 2 + +struct ext2fs_struct_generic_bitmap_base { + errcode_t magic; + ext2_filsys fs; +}; + +typedef struct ext2fs_struct_generic_bitmap_base *ext2fs_generic_bitmap; +typedef struct ext2fs_struct_generic_bitmap_base *ext2fs_inode_bitmap; +typedef struct ext2fs_struct_generic_bitmap_base *ext2fs_block_bitmap; + +#define EXT2_FIRST_INODE(s) EXT2_FIRST_INO(s) + + +/* + * Badblocks list definitions + */ + +typedef struct ext2_struct_u32_list *ext2_badblocks_list; +typedef struct ext2_struct_u32_iterate *ext2_badblocks_iterate; + +typedef struct ext2_struct_u32_list *ext2_u32_list; +typedef struct ext2_struct_u32_iterate *ext2_u32_iterate; + +/* old */ +typedef struct ext2_struct_u32_list *badblocks_list; +typedef struct ext2_struct_u32_iterate *badblocks_iterate; + +#define BADBLOCKS_FLAG_DIRTY 1 + +/* + * ext2_dblist structure and abstractions (see dblist.c) + */ +struct ext2_db_entry2 { + ext2_ino_t ino; + blk64_t blk; + e2_blkcnt_t blockcnt; +}; + +/* Ye Olde 32-bit version */ +struct ext2_db_entry { + ext2_ino_t ino; + blk_t blk; + int blockcnt; +}; + +typedef struct ext2_struct_dblist *ext2_dblist; + +#define DBLIST_ABORT 1 + +/* + * ext2_fileio definitions + */ + +#define EXT2_FILE_WRITE 0x0001 +#define EXT2_FILE_CREATE 0x0002 + +#define EXT2_FILE_MASK 0x00FF + +#define EXT2_FILE_BUF_DIRTY 0x4000 +#define EXT2_FILE_BUF_VALID 0x2000 + +typedef struct ext2_file *ext2_file_t; + +#define EXT2_SEEK_SET 0 +#define EXT2_SEEK_CUR 1 +#define EXT2_SEEK_END 2 + +/* + * Flags for the ext2_filsys structure and for ext2fs_open() + */ +#define EXT2_FLAG_RW 0x01 +#define EXT2_FLAG_CHANGED 0x02 +#define EXT2_FLAG_DIRTY 0x04 +#define EXT2_FLAG_VALID 0x08 +#define EXT2_FLAG_IB_DIRTY 0x10 +#define EXT2_FLAG_BB_DIRTY 0x20 +#define EXT2_FLAG_SWAP_BYTES 0x40 +#define EXT2_FLAG_SWAP_BYTES_READ 0x80 +#define EXT2_FLAG_SWAP_BYTES_WRITE 0x100 +#define EXT2_FLAG_MASTER_SB_ONLY 0x200 +#define EXT2_FLAG_FORCE 0x400 +#define EXT2_FLAG_SUPER_ONLY 0x800 +#define EXT2_FLAG_JOURNAL_DEV_OK 0x1000 +#define EXT2_FLAG_IMAGE_FILE 0x2000 +#define EXT2_FLAG_EXCLUSIVE 0x4000 +#define EXT2_FLAG_SOFTSUPP_FEATURES 0x8000 +#define EXT2_FLAG_NOFREE_ON_ERROR 0x10000 +#define EXT2_FLAG_64BITS 0x20000 +#define EXT2_FLAG_PRINT_PROGRESS 0x40000 +#define EXT2_FLAG_DIRECT_IO 0x80000 +#define EXT2_FLAG_SKIP_MMP 0x100000 +#define EXT2_FLAG_IGNORE_CSUM_ERRORS 0x200000 +#define EXT2_FLAG_SHARE_DUP 0x400000 +#define EXT2_FLAG_IGNORE_SB_ERRORS 0x800000 +#define EXT2_FLAG_BBITMAP_TAIL_PROBLEM 0x1000000 +#define EXT2_FLAG_IBITMAP_TAIL_PROBLEM 0x2000000 +#define EXT2_FLAG_THREADS 0x4000000 +#define EXT2_FLAG_IGNORE_SWAP_DIRENT 0x8000000 + +/* + * Special flag in the ext2 inode i_flag field that means that this is + * a new inode. (So that ext2_write_inode() can clear extra fields.) + */ +#define EXT2_NEW_INODE_FL 0x80000000 + +/* + * Flags for mkjournal + */ +#define EXT2_MKJOURNAL_V1_SUPER 0x0000001 /* create V1 superblock (deprecated) */ +#define EXT2_MKJOURNAL_LAZYINIT 0x0000002 /* don't zero journal inode before use*/ +#define EXT2_MKJOURNAL_NO_MNT_CHECK 0x0000004 /* don't check mount status */ + +/* + * Normal journal area size to fast commit area size ratio. This is used to + * set default size of fast commit area. + */ +#define EXT2_JOURNAL_TO_FC_BLKS_RATIO 64 + +struct blk_alloc_ctx; +struct opaque_ext2_group_desc; + +struct struct_ext2_filsys { + errcode_t magic; + io_channel io; + int flags; + char * device_name; + struct ext2_super_block * super; + unsigned int blocksize; + int fragsize; + dgrp_t group_desc_count; + unsigned long desc_blocks; + struct opaque_ext2_group_desc * group_desc; + unsigned int inode_blocks_per_group; + ext2fs_inode_bitmap inode_map; + ext2fs_block_bitmap block_map; + /* XXX FIXME-64: not 64-bit safe, but not used? */ + errcode_t (*get_blocks)(ext2_filsys fs, ext2_ino_t ino, blk_t *blocks); + errcode_t (*check_directory)(ext2_filsys fs, ext2_ino_t ino); + errcode_t (*write_bitmaps)(ext2_filsys fs); + errcode_t (*read_inode)(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode); + errcode_t (*write_inode)(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode); + ext2_badblocks_list badblocks; + ext2_dblist dblist; + __u32 stride; /* for mke2fs */ + struct ext2_super_block * orig_super; + struct ext2_image_hdr * image_header; + __u32 umask; + time_t now; + int cluster_ratio_bits; + __u16 default_bitmap_type; + __u16 pad; + /* + * Reserved for future expansion + */ + __u32 reserved[5]; + + /* + * Reserved for the use of the calling application. + */ + void * priv_data; + + /* + * Inode cache + */ + struct ext2_inode_cache *icache; + io_channel image_io; + + /* + * More callback functions + */ + errcode_t (*get_alloc_block)(ext2_filsys fs, blk64_t goal, + blk64_t *ret); + errcode_t (*get_alloc_block2)(ext2_filsys fs, blk64_t goal, + blk64_t *ret, struct blk_alloc_ctx *ctx); + void (*block_alloc_stats)(ext2_filsys fs, blk64_t blk, int inuse); + + /* + * Buffers for Multiple mount protection(MMP) block. + */ + void *mmp_buf; + void *mmp_cmp; + int mmp_fd; + + /* + * Time at which e2fsck last updated the MMP block. + */ + long mmp_last_written; + + /* progress operation functions */ + struct ext2fs_progress_ops *progress_ops; + + /* Precomputed FS UUID checksum for seeding other checksums */ + __u32 csum_seed; + + io_channel journal_io; + char *journal_name; + + /* New block range allocation hooks */ + errcode_t (*new_range)(ext2_filsys fs, int flags, blk64_t goal, + blk64_t len, blk64_t *pblk, blk64_t *plen); + void (*block_alloc_stats_range)(ext2_filsys fs, blk64_t blk, blk_t num, + int inuse); + + /* hashmap for SHA of data blocks */ + struct ext2fs_hashmap* block_sha_map; + + const struct ext2fs_nls_table *encoding; +}; + +#if EXT2_FLAT_INCLUDES +#include "e2_bitops.h" +#else +#include <ext2fs/bitops.h> +#endif + +/* + * 64-bit bitmap backend types + */ +#define EXT2FS_BMAP64_BITARRAY 1 +#define EXT2FS_BMAP64_RBTREE 2 +#define EXT2FS_BMAP64_AUTODIR 3 + +/* + * Return flags for the block iterator functions + */ +#define BLOCK_CHANGED 1 +#define BLOCK_ABORT 2 +#define BLOCK_ERROR 4 +#define BLOCK_INLINE_DATA_CHANGED 8 + +/* + * Block iterate flags + * + * BLOCK_FLAG_APPEND, or BLOCK_FLAG_HOLE, indicates that the iterator + * function should be called on blocks where the block number is zero. + * This is used by ext2fs_expand_dir() to be able to add a new block + * to an inode. It can also be used for programs that want to be able + * to deal with files that contain "holes". + * + * BLOCK_FLAG_DEPTH_TRAVERSE indicates that the iterator function for + * the indirect, doubly indirect, etc. blocks should be called after + * all of the blocks contained in the indirect blocks are processed. + * This is useful if you are going to be deallocating blocks from an + * inode. + * + * BLOCK_FLAG_DATA_ONLY indicates that the iterator function should be + * called for data blocks only. + * + * BLOCK_FLAG_READ_ONLY is a promise by the caller that it will not + * modify returned block number. + * + * BLOCK_FLAG_NO_LARGE is for internal use only. It informs + * ext2fs_block_iterate2 that large files won't be accepted. + */ +#define BLOCK_FLAG_APPEND 1 +#define BLOCK_FLAG_HOLE 1 +#define BLOCK_FLAG_DEPTH_TRAVERSE 2 +#define BLOCK_FLAG_DATA_ONLY 4 +#define BLOCK_FLAG_READ_ONLY 8 + +#define BLOCK_FLAG_NO_LARGE 0x1000 + +/* + * Magic "block count" return values for the block iterator function. + */ +#define BLOCK_COUNT_IND (-1) +#define BLOCK_COUNT_DIND (-2) +#define BLOCK_COUNT_TIND (-3) +#define BLOCK_COUNT_TRANSLATOR (-4) + +#define BLOCK_ALLOC_UNKNOWN 0 +#define BLOCK_ALLOC_DATA 1 +#define BLOCK_ALLOC_METADATA 2 + +struct blk_alloc_ctx { + ext2_ino_t ino; + struct ext2_inode *inode; + blk64_t lblk; + int flags; +}; + +#if 0 +/* + * Flags for ext2fs_move_blocks + */ +#define EXT2_BMOVE_GET_DBLIST 0x0001 +#define EXT2_BMOVE_DEBUG 0x0002 +#endif + +/* + * Generic (non-filesystem layout specific) extents structure + */ + +#define EXT2_EXTENT_FLAGS_LEAF 0x0001 +#define EXT2_EXTENT_FLAGS_UNINIT 0x0002 +#define EXT2_EXTENT_FLAGS_SECOND_VISIT 0x0004 + +struct ext2fs_extent { + blk64_t e_pblk; /* first physical block */ + blk64_t e_lblk; /* first logical block extent covers */ + __u32 e_len; /* number of blocks covered by extent */ + __u32 e_flags; /* extent flags */ +}; + +typedef struct ext2_extent_handle *ext2_extent_handle_t; +typedef struct ext2_extent_path *ext2_extent_path_t; + +/* + * Flags used by ext2fs_extent_get() + */ +#define EXT2_EXTENT_CURRENT 0x0000 +#define EXT2_EXTENT_MOVE_MASK 0x000F +#define EXT2_EXTENT_ROOT 0x0001 +#define EXT2_EXTENT_LAST_LEAF 0x0002 +#define EXT2_EXTENT_FIRST_SIB 0x0003 +#define EXT2_EXTENT_LAST_SIB 0x0004 +#define EXT2_EXTENT_NEXT_SIB 0x0005 +#define EXT2_EXTENT_PREV_SIB 0x0006 +#define EXT2_EXTENT_NEXT_LEAF 0x0007 +#define EXT2_EXTENT_PREV_LEAF 0x0008 +#define EXT2_EXTENT_NEXT 0x0009 +#define EXT2_EXTENT_PREV 0x000A +#define EXT2_EXTENT_UP 0x000B +#define EXT2_EXTENT_DOWN 0x000C +#define EXT2_EXTENT_DOWN_AND_LAST 0x000D + +/* + * Flags used by ext2fs_extent_insert() + */ +#define EXT2_EXTENT_INSERT_AFTER 0x0001 /* insert after handle loc'n */ +#define EXT2_EXTENT_INSERT_NOSPLIT 0x0002 /* insert may not cause split */ + +/* + * Flags used by ext2fs_extent_delete() + */ +#define EXT2_EXTENT_DELETE_KEEP_EMPTY 0x001 /* keep node if last extent gone */ + +/* + * Flags used by ext2fs_extent_set_bmap() + */ +#define EXT2_EXTENT_SET_BMAP_UNINIT 0x0001 + +/* + * Data structure returned by ext2fs_extent_get_info() + */ +struct ext2_extent_info { + int curr_entry; + int curr_level; + int num_entries; + int max_entries; + int max_depth; + int bytes_avail; + blk64_t max_lblk; + blk64_t max_pblk; + __u32 max_len; + __u32 max_uninit_len; +}; + +/* + * Flags for directory block reading and writing functions + */ +#define EXT2_DIRBLOCK_V2_STRUCT 0x0001 + +/* + * Return flags for the directory iterator functions + */ +#define DIRENT_CHANGED 1 +#define DIRENT_ABORT 2 +#define DIRENT_ERROR 3 + +/* + * Directory iterator flags + */ + +#define DIRENT_FLAG_INCLUDE_EMPTY 1 +#define DIRENT_FLAG_INCLUDE_REMOVED 2 +#define DIRENT_FLAG_INCLUDE_CSUM 4 +#define DIRENT_FLAG_INCLUDE_INLINE_DATA 8 + +#define DIRENT_DOT_FILE 1 +#define DIRENT_DOT_DOT_FILE 2 +#define DIRENT_OTHER_FILE 3 +#define DIRENT_DELETED_FILE 4 +#define DIRENT_CHECKSUM 5 + +/* + * Inode scan definitions + */ +typedef struct ext2_struct_inode_scan *ext2_inode_scan; + +/* + * ext2fs_scan flags + */ +#define EXT2_SF_CHK_BADBLOCKS 0x0001 +#define EXT2_SF_BAD_INODE_BLK 0x0002 +#define EXT2_SF_BAD_EXTRA_BYTES 0x0004 +#define EXT2_SF_SKIP_MISSING_ITABLE 0x0008 +#define EXT2_SF_DO_LAZY 0x0010 +#define EXT2_SF_WARN_GARBAGE_INODES 0x0020 + +/* + * ext2fs_check_if_mounted flags + */ +#define EXT2_MF_MOUNTED 1 +#define EXT2_MF_ISROOT 2 +#define EXT2_MF_READONLY 4 +#define EXT2_MF_SWAP 8 +#define EXT2_MF_BUSY 16 +#define EXT2_MF_EXTFS 32 + +/* + * Ext2/linux mode flags. We define them here so that we don't need + * to depend on the OS's sys/stat.h, since we may be compiling on a + * non-Linux system. + */ +#define LINUX_S_IFMT 00170000 +#define LINUX_S_IFSOCK 0140000 +#define LINUX_S_IFLNK 0120000 +#define LINUX_S_IFREG 0100000 +#define LINUX_S_IFBLK 0060000 +#define LINUX_S_IFDIR 0040000 +#define LINUX_S_IFCHR 0020000 +#define LINUX_S_IFIFO 0010000 +#define LINUX_S_ISUID 0004000 +#define LINUX_S_ISGID 0002000 +#define LINUX_S_ISVTX 0001000 + +#define LINUX_S_IRWXU 00700 +#define LINUX_S_IRUSR 00400 +#define LINUX_S_IWUSR 00200 +#define LINUX_S_IXUSR 00100 + +#define LINUX_S_IRWXG 00070 +#define LINUX_S_IRGRP 00040 +#define LINUX_S_IWGRP 00020 +#define LINUX_S_IXGRP 00010 + +#define LINUX_S_IRWXO 00007 +#define LINUX_S_IROTH 00004 +#define LINUX_S_IWOTH 00002 +#define LINUX_S_IXOTH 00001 + +#define LINUX_S_ISLNK(m) (((m) & LINUX_S_IFMT) == LINUX_S_IFLNK) +#define LINUX_S_ISREG(m) (((m) & LINUX_S_IFMT) == LINUX_S_IFREG) +#define LINUX_S_ISDIR(m) (((m) & LINUX_S_IFMT) == LINUX_S_IFDIR) +#define LINUX_S_ISCHR(m) (((m) & LINUX_S_IFMT) == LINUX_S_IFCHR) +#define LINUX_S_ISBLK(m) (((m) & LINUX_S_IFMT) == LINUX_S_IFBLK) +#define LINUX_S_ISFIFO(m) (((m) & LINUX_S_IFMT) == LINUX_S_IFIFO) +#define LINUX_S_ISSOCK(m) (((m) & LINUX_S_IFMT) == LINUX_S_IFSOCK) + +/* + * ext2 size of an inode + */ +#define EXT2_I_SIZE(i) ((i)->i_size | ((__u64) (i)->i_size_high << 32)) + +/* + * ext2_icount_t abstraction + */ +#define EXT2_ICOUNT_OPT_INCREMENT 0x01 +#define EXT2_ICOUNT_OPT_FULLMAP 0x02 + +typedef struct ext2_icount *ext2_icount_t; + +/* + * Flags for ext2fs_bmap + */ +#define BMAP_ALLOC 0x0001 +#define BMAP_SET 0x0002 +#define BMAP_UNINIT 0x0004 +#define BMAP_ZERO 0x0008 + +/* + * Returned flags from ext2fs_bmap + */ +#define BMAP_RET_UNINIT 0x0001 + +/* + * Flags for ext2fs_read_inode2 + */ +#define READ_INODE_NOCSUM 0x0001 + +/* + * Flags for ext2fs_write_inode2 + */ +#define WRITE_INODE_NOCSUM 0x0001 + +/* + * Flags for imager.c functions + */ +#define IMAGER_FLAG_INODEMAP 1 +#define IMAGER_FLAG_SPARSEWRITE 2 + +/* + * For checking structure magic numbers... + */ + +#define EXT2_CHECK_MAGIC(struct, code) \ + if ((struct)->magic != (code)) return (code) + +/* + * Features supported by this version of the library + */ +#define EXT2_LIB_FEATURE_COMPAT_SUPP (EXT2_FEATURE_COMPAT_DIR_PREALLOC|\ + EXT2_FEATURE_COMPAT_IMAGIC_INODES|\ + EXT3_FEATURE_COMPAT_HAS_JOURNAL|\ + EXT2_FEATURE_COMPAT_RESIZE_INODE|\ + EXT2_FEATURE_COMPAT_DIR_INDEX|\ + EXT2_FEATURE_COMPAT_EXT_ATTR|\ + EXT4_FEATURE_COMPAT_SPARSE_SUPER2|\ + EXT4_FEATURE_COMPAT_FAST_COMMIT|\ + EXT4_FEATURE_COMPAT_STABLE_INODES|\ + EXT4_FEATURE_COMPAT_ORPHAN_FILE) + +#ifdef CONFIG_MMP +#define EXT4_LIB_INCOMPAT_MMP EXT4_FEATURE_INCOMPAT_MMP +#else +#define EXT4_LIB_INCOMPAT_MMP (0) +#endif + +#define EXT2_LIB_FEATURE_INCOMPAT_SUPP (EXT2_FEATURE_INCOMPAT_FILETYPE|\ + EXT3_FEATURE_INCOMPAT_JOURNAL_DEV|\ + EXT2_FEATURE_INCOMPAT_META_BG|\ + EXT3_FEATURE_INCOMPAT_RECOVER|\ + EXT3_FEATURE_INCOMPAT_EXTENTS|\ + EXT4_FEATURE_INCOMPAT_FLEX_BG|\ + EXT4_FEATURE_INCOMPAT_EA_INODE|\ + EXT4_LIB_INCOMPAT_MMP|\ + EXT4_FEATURE_INCOMPAT_64BIT|\ + EXT4_FEATURE_INCOMPAT_INLINE_DATA|\ + EXT4_FEATURE_INCOMPAT_ENCRYPT|\ + EXT4_FEATURE_INCOMPAT_CASEFOLD|\ + EXT4_FEATURE_INCOMPAT_CSUM_SEED|\ + EXT4_FEATURE_INCOMPAT_LARGEDIR) + +#define EXT2_LIB_FEATURE_RO_COMPAT_SUPP (EXT2_FEATURE_RO_COMPAT_SPARSE_SUPER|\ + EXT4_FEATURE_RO_COMPAT_HUGE_FILE|\ + EXT2_FEATURE_RO_COMPAT_LARGE_FILE|\ + EXT4_FEATURE_RO_COMPAT_DIR_NLINK|\ + EXT4_FEATURE_RO_COMPAT_EXTRA_ISIZE|\ + EXT4_FEATURE_RO_COMPAT_GDT_CSUM|\ + EXT4_FEATURE_RO_COMPAT_BIGALLOC|\ + EXT4_FEATURE_RO_COMPAT_QUOTA|\ + EXT4_FEATURE_RO_COMPAT_METADATA_CSUM|\ + EXT4_FEATURE_RO_COMPAT_READONLY |\ + EXT4_FEATURE_RO_COMPAT_PROJECT |\ + EXT4_FEATURE_RO_COMPAT_SHARED_BLOCKS |\ + EXT4_FEATURE_RO_COMPAT_VERITY |\ + EXT4_FEATURE_RO_COMPAT_ORPHAN_PRESENT) + +/* + * These features are only allowed if EXT2_FLAG_SOFTSUPP_FEATURES is passed + * to ext2fs_openfs() + */ +#define EXT2_LIB_SOFTSUPP_INCOMPAT (0) +#define EXT2_LIB_SOFTSUPP_RO_COMPAT (EXT4_FEATURE_RO_COMPAT_REPLICA) + + +/* Translate a block number to a cluster number */ +#define EXT2FS_CLUSTER_RATIO(fs) (1 << (fs)->cluster_ratio_bits) +#define EXT2FS_CLUSTER_MASK(fs) (EXT2FS_CLUSTER_RATIO(fs) - 1) +#define EXT2FS_B2C(fs, blk) ((blk) >> (fs)->cluster_ratio_bits) +/* Translate a cluster number to a block number */ +#define EXT2FS_C2B(fs, cluster) ((cluster) << (fs)->cluster_ratio_bits) +/* Translate # of blks to # of clusters */ +#define EXT2FS_NUM_B2C(fs, blks) (((blks) + EXT2FS_CLUSTER_MASK(fs)) >> \ + (fs)->cluster_ratio_bits) + +#if defined(HAVE_FSTAT64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED) +typedef struct stat64 ext2fs_struct_stat; +#else +typedef struct stat ext2fs_struct_stat; +#endif + +/* + * For ext2fs_close2() and ext2fs_flush2(), this flag allows you to + * avoid the fsync call. + */ +#define EXT2_FLAG_FLUSH_NO_SYNC 1 + +/* + * Modify and iterate extended attributes + */ +struct ext2_xattr_handle; +#define XATTR_ABORT 1 +#define XATTR_CHANGED 2 + +/* + * flags for ext2fs_rw_bitmaps() + */ +#define EXT2FS_BITMAPS_WRITE 0x0001 +#define EXT2FS_BITMAPS_BLOCK 0x0002 +#define EXT2FS_BITMAPS_INODE 0x0004 +#define EXT2FS_BITMAPS_VALID_FLAGS 0x0007 + +/* + * function prototypes + */ +static inline int ext2fs_has_group_desc_csum(ext2_filsys fs) +{ + return ext2fs_has_feature_metadata_csum(fs->super) || + ext2fs_has_feature_gdt_csum(fs->super); +} + +/* The LARGE_FILE feature should be set if we have stored files 2GB+ in size */ +static inline int ext2fs_needs_large_file_feature(unsigned long long file_size) +{ + return file_size >= 0x80000000ULL; +} + +/* alloc.c */ +extern void ext2fs_clear_block_uninit(ext2_filsys fs, dgrp_t group); +extern errcode_t ext2fs_new_inode(ext2_filsys fs, ext2_ino_t dir, int mode, + ext2fs_inode_bitmap map, ext2_ino_t *ret); +extern errcode_t ext2fs_new_block(ext2_filsys fs, blk_t goal, + ext2fs_block_bitmap map, blk_t *ret); +extern errcode_t ext2fs_new_block2(ext2_filsys fs, blk64_t goal, + ext2fs_block_bitmap map, blk64_t *ret); +extern errcode_t ext2fs_new_block3(ext2_filsys fs, blk64_t goal, + ext2fs_block_bitmap map, blk64_t *ret, + struct blk_alloc_ctx *ctx); +extern errcode_t ext2fs_get_free_blocks(ext2_filsys fs, blk_t start, + blk_t finish, int num, + ext2fs_block_bitmap map, + blk_t *ret); +extern errcode_t ext2fs_get_free_blocks2(ext2_filsys fs, blk64_t start, + blk64_t finish, int num, + ext2fs_block_bitmap map, + blk64_t *ret); +extern errcode_t ext2fs_alloc_block(ext2_filsys fs, blk_t goal, + char *block_buf, blk_t *ret); +extern errcode_t ext2fs_alloc_block2(ext2_filsys fs, blk64_t goal, + char *block_buf, blk64_t *ret); +extern errcode_t ext2fs_alloc_block3(ext2_filsys fs, blk64_t goal, + char *block_buf, blk64_t *ret, + struct blk_alloc_ctx *ctx); + +extern void ext2fs_set_alloc_block_callback(ext2_filsys fs, + errcode_t (*func)(ext2_filsys fs, + blk64_t goal, + blk64_t *ret), + errcode_t (**old)(ext2_filsys fs, + blk64_t goal, + blk64_t *ret)); +blk64_t ext2fs_find_inode_goal(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, blk64_t lblk); +extern void ext2fs_set_new_range_callback(ext2_filsys fs, + errcode_t (*func)(ext2_filsys fs, int flags, blk64_t goal, + blk64_t len, blk64_t *pblk, blk64_t *plen), + errcode_t (**old)(ext2_filsys fs, int flags, blk64_t goal, + blk64_t len, blk64_t *pblk, blk64_t *plen)); +extern void ext2fs_set_block_alloc_stats_range_callback(ext2_filsys fs, + void (*func)(ext2_filsys fs, blk64_t blk, + blk_t num, int inuse), + void (**old)(ext2_filsys fs, blk64_t blk, + blk_t num, int inuse)); +#define EXT2_NEWRANGE_FIXED_GOAL (0x1) +#define EXT2_NEWRANGE_MIN_LENGTH (0x2) +#define EXT2_NEWRANGE_ALL_FLAGS (0x3) +errcode_t ext2fs_new_range(ext2_filsys fs, int flags, blk64_t goal, + blk64_t len, ext2fs_block_bitmap map, blk64_t *pblk, + blk64_t *plen); +#define EXT2_ALLOCRANGE_FIXED_GOAL (0x1) +#define EXT2_ALLOCRANGE_ZERO_BLOCKS (0x2) +#define EXT2_ALLOCRANGE_ALL_FLAGS (0x3) +errcode_t ext2fs_alloc_range(ext2_filsys fs, int flags, blk64_t goal, + blk_t len, blk64_t *ret); + +/* alloc_sb.c */ +extern int ext2fs_reserve_super_and_bgd(ext2_filsys fs, + dgrp_t group, + ext2fs_block_bitmap bmap); +extern void ext2fs_set_block_alloc_stats_callback(ext2_filsys fs, + void (*func)(ext2_filsys fs, + blk64_t blk, + int inuse), + void (**old)(ext2_filsys fs, + blk64_t blk, + int inuse)); + +/* alloc_stats.c */ +void ext2fs_inode_alloc_stats(ext2_filsys fs, ext2_ino_t ino, int inuse); +void ext2fs_inode_alloc_stats2(ext2_filsys fs, ext2_ino_t ino, + int inuse, int isdir); +void ext2fs_block_alloc_stats(ext2_filsys fs, blk_t blk, int inuse); +void ext2fs_block_alloc_stats2(ext2_filsys fs, blk64_t blk, int inuse); +void ext2fs_block_alloc_stats_range(ext2_filsys fs, blk64_t blk, + blk_t num, int inuse); + +/* alloc_tables.c */ +extern errcode_t ext2fs_allocate_tables(ext2_filsys fs); +extern errcode_t ext2fs_allocate_group_table(ext2_filsys fs, dgrp_t group, + ext2fs_block_bitmap bmap); + +/* badblocks.c */ +extern errcode_t ext2fs_u32_list_create(ext2_u32_list *ret, int size); +extern errcode_t ext2fs_u32_list_add(ext2_u32_list bb, __u32 blk); +extern int ext2fs_u32_list_find(ext2_u32_list bb, __u32 blk); +extern int ext2fs_u32_list_test(ext2_u32_list bb, blk_t blk); +extern errcode_t ext2fs_u32_list_iterate_begin(ext2_u32_list bb, + ext2_u32_iterate *ret); +extern int ext2fs_u32_list_iterate(ext2_u32_iterate iter, blk_t *blk); +extern void ext2fs_u32_list_iterate_end(ext2_u32_iterate iter); +extern errcode_t ext2fs_u32_copy(ext2_u32_list src, ext2_u32_list *dest); +extern int ext2fs_u32_list_equal(ext2_u32_list bb1, ext2_u32_list bb2); + +extern errcode_t ext2fs_badblocks_list_create(ext2_badblocks_list *ret, + int size); +extern errcode_t ext2fs_badblocks_list_add(ext2_badblocks_list bb, + blk_t blk); +extern int ext2fs_badblocks_list_test(ext2_badblocks_list bb, + blk_t blk); +extern int ext2fs_u32_list_del(ext2_u32_list bb, __u32 blk); +extern void ext2fs_badblocks_list_del(ext2_u32_list bb, __u32 blk); +extern errcode_t + ext2fs_badblocks_list_iterate_begin(ext2_badblocks_list bb, + ext2_badblocks_iterate *ret); +extern int ext2fs_badblocks_list_iterate(ext2_badblocks_iterate iter, + blk_t *blk); +extern void ext2fs_badblocks_list_iterate_end(ext2_badblocks_iterate iter); +extern errcode_t ext2fs_badblocks_copy(ext2_badblocks_list src, + ext2_badblocks_list *dest); +extern int ext2fs_badblocks_equal(ext2_badblocks_list bb1, + ext2_badblocks_list bb2); +extern int ext2fs_u32_list_count(ext2_u32_list bb); + +/* bb_compat */ +extern errcode_t badblocks_list_create(badblocks_list *ret, int size); +extern errcode_t badblocks_list_add(badblocks_list bb, blk_t blk); +extern int badblocks_list_test(badblocks_list bb, blk_t blk); +extern errcode_t badblocks_list_iterate_begin(badblocks_list bb, + badblocks_iterate *ret); +extern int badblocks_list_iterate(badblocks_iterate iter, blk_t *blk); +extern void badblocks_list_iterate_end(badblocks_iterate iter); +extern void badblocks_list_free(badblocks_list bb); + +/* bb_inode.c */ +extern errcode_t ext2fs_update_bb_inode(ext2_filsys fs, + ext2_badblocks_list bb_list); + +/* bitmaps.c */ +extern void ext2fs_free_block_bitmap(ext2fs_block_bitmap bitmap); +extern void ext2fs_free_inode_bitmap(ext2fs_inode_bitmap bitmap); +extern errcode_t ext2fs_copy_bitmap(ext2fs_generic_bitmap src, + ext2fs_generic_bitmap *dest); +extern errcode_t ext2fs_allocate_block_bitmap(ext2_filsys fs, + const char *descr, + ext2fs_block_bitmap *ret); +extern errcode_t ext2fs_allocate_subcluster_bitmap(ext2_filsys fs, + const char *descr, + ext2fs_block_bitmap *ret); +extern int ext2fs_get_bitmap_granularity(ext2fs_block_bitmap bitmap); +extern errcode_t ext2fs_allocate_inode_bitmap(ext2_filsys fs, + const char *descr, + ext2fs_inode_bitmap *ret); +extern errcode_t ext2fs_fudge_inode_bitmap_end(ext2fs_inode_bitmap bitmap, + ext2_ino_t end, ext2_ino_t *oend); +extern errcode_t ext2fs_fudge_block_bitmap_end(ext2fs_block_bitmap bitmap, + blk_t end, blk_t *oend); +extern errcode_t ext2fs_fudge_block_bitmap_end2(ext2fs_block_bitmap bitmap, + blk64_t end, blk64_t *oend); +extern void ext2fs_clear_inode_bitmap(ext2fs_inode_bitmap bitmap); +extern void ext2fs_clear_block_bitmap(ext2fs_block_bitmap bitmap); +extern errcode_t ext2fs_resize_inode_bitmap(__u32 new_end, __u32 new_real_end, + ext2fs_inode_bitmap bmap); +extern errcode_t ext2fs_resize_inode_bitmap2(__u64 new_end, + __u64 new_real_end, + ext2fs_inode_bitmap bmap); +extern errcode_t ext2fs_resize_block_bitmap(__u32 new_end, __u32 new_real_end, + ext2fs_block_bitmap bmap); +extern errcode_t ext2fs_resize_block_bitmap2(__u64 new_end, + __u64 new_real_end, + ext2fs_block_bitmap bmap); +extern errcode_t ext2fs_compare_block_bitmap(ext2fs_block_bitmap bm1, + ext2fs_block_bitmap bm2); +extern errcode_t ext2fs_compare_inode_bitmap(ext2fs_inode_bitmap bm1, + ext2fs_inode_bitmap bm2); +extern errcode_t ext2fs_set_inode_bitmap_range(ext2fs_inode_bitmap bmap, + ext2_ino_t start, unsigned int num, + void *in); +extern errcode_t ext2fs_set_inode_bitmap_range2(ext2fs_inode_bitmap bmap, + __u64 start, size_t num, + void *in); +extern errcode_t ext2fs_get_inode_bitmap_range(ext2fs_inode_bitmap bmap, + ext2_ino_t start, unsigned int num, + void *out); +extern errcode_t ext2fs_get_inode_bitmap_range2(ext2fs_inode_bitmap bmap, + __u64 start, size_t num, + void *out); +extern errcode_t ext2fs_set_block_bitmap_range(ext2fs_block_bitmap bmap, + blk_t start, unsigned int num, + void *in); +extern errcode_t ext2fs_set_block_bitmap_range2(ext2fs_block_bitmap bmap, + blk64_t start, size_t num, + void *in); +extern errcode_t ext2fs_get_block_bitmap_range(ext2fs_block_bitmap bmap, + blk_t start, unsigned int num, + void *out); +extern errcode_t ext2fs_get_block_bitmap_range2(ext2fs_block_bitmap bmap, + blk64_t start, size_t num, + void *out); + +/* blknum.c */ +extern __u32 ext2fs_inode_bitmap_checksum(ext2_filsys fs, dgrp_t group); +extern __u32 ext2fs_block_bitmap_checksum(ext2_filsys fs, dgrp_t group); +extern dgrp_t ext2fs_group_of_blk2(ext2_filsys fs, blk64_t); +extern blk64_t ext2fs_group_first_block2(ext2_filsys fs, dgrp_t group); +extern blk64_t ext2fs_group_last_block2(ext2_filsys fs, dgrp_t group); +extern int ext2fs_group_blocks_count(ext2_filsys fs, dgrp_t group); +extern blk64_t ext2fs_inode_data_blocks2(ext2_filsys fs, + struct ext2_inode *inode); +extern blk64_t ext2fs_inode_i_blocks(ext2_filsys fs, + struct ext2_inode *inode); +extern blk64_t ext2fs_get_stat_i_blocks(ext2_filsys fs, + struct ext2_inode *inode); +extern blk64_t ext2fs_blocks_count(struct ext2_super_block *super); +extern void ext2fs_blocks_count_set(struct ext2_super_block *super, + blk64_t blk); +extern void ext2fs_blocks_count_add(struct ext2_super_block *super, + blk64_t blk); +extern blk64_t ext2fs_r_blocks_count(struct ext2_super_block *super); +extern void ext2fs_r_blocks_count_set(struct ext2_super_block *super, + blk64_t blk); +extern void ext2fs_r_blocks_count_add(struct ext2_super_block *super, + blk64_t blk); +extern blk64_t ext2fs_free_blocks_count(struct ext2_super_block *super); +extern void ext2fs_free_blocks_count_set(struct ext2_super_block *super, + blk64_t blk); +extern void ext2fs_free_blocks_count_add(struct ext2_super_block *super, + blk64_t blk); +/* Block group descriptor accessor functions */ +extern struct ext2_group_desc *ext2fs_group_desc(ext2_filsys fs, + struct opaque_ext2_group_desc *gdp, + dgrp_t group); +extern blk64_t ext2fs_block_bitmap_csum(ext2_filsys fs, dgrp_t group); +extern blk64_t ext2fs_block_bitmap_loc(ext2_filsys fs, dgrp_t group); +extern void ext2fs_block_bitmap_loc_set(ext2_filsys fs, dgrp_t group, + blk64_t blk); +extern __u32 ext2fs_inode_bitmap_csum(ext2_filsys fs, dgrp_t group); +extern blk64_t ext2fs_inode_bitmap_loc(ext2_filsys fs, dgrp_t group); +extern void ext2fs_inode_bitmap_loc_set(ext2_filsys fs, dgrp_t group, + blk64_t blk); +extern blk64_t ext2fs_inode_table_loc(ext2_filsys fs, dgrp_t group); +extern void ext2fs_inode_table_loc_set(ext2_filsys fs, dgrp_t group, + blk64_t blk); +extern __u32 ext2fs_bg_free_blocks_count(ext2_filsys fs, dgrp_t group); +extern void ext2fs_bg_free_blocks_count_set(ext2_filsys fs, dgrp_t group, + __u32 n); +extern __u32 ext2fs_bg_free_inodes_count(ext2_filsys fs, dgrp_t group); +extern void ext2fs_bg_free_inodes_count_set(ext2_filsys fs, dgrp_t group, + __u32 n); +extern __u32 ext2fs_bg_used_dirs_count(ext2_filsys fs, dgrp_t group); +extern void ext2fs_bg_used_dirs_count_set(ext2_filsys fs, dgrp_t group, + __u32 n); +extern __u32 ext2fs_bg_itable_unused(ext2_filsys fs, dgrp_t group); +extern void ext2fs_bg_itable_unused_set(ext2_filsys fs, dgrp_t group, + __u32 n); +extern __u16 ext2fs_bg_flags(ext2_filsys fs, dgrp_t group); +extern void ext2fs_bg_flags_zap(ext2_filsys fs, dgrp_t group); +extern int ext2fs_bg_flags_test(ext2_filsys fs, dgrp_t group, __u16 bg_flag); +extern void ext2fs_bg_flags_set(ext2_filsys fs, dgrp_t group, __u16 bg_flags); +extern void ext2fs_bg_flags_clear(ext2_filsys fs, dgrp_t group, __u16 bg_flags); +extern __u16 ext2fs_bg_checksum(ext2_filsys fs, dgrp_t group); +extern void ext2fs_bg_checksum_set(ext2_filsys fs, dgrp_t group, __u16 checksum); +extern blk64_t ext2fs_file_acl_block(ext2_filsys fs, + const struct ext2_inode *inode); +extern void ext2fs_file_acl_block_set(ext2_filsys fs, + struct ext2_inode *inode, blk64_t blk); +extern errcode_t ext2fs_inode_size_set(ext2_filsys fs, struct ext2_inode *inode, + ext2_off64_t size); + +/* block.c */ +extern errcode_t ext2fs_block_iterate(ext2_filsys fs, + ext2_ino_t ino, + int flags, + char *block_buf, + int (*func)(ext2_filsys fs, + blk_t *blocknr, + int blockcnt, + void *priv_data), + void *priv_data); +errcode_t ext2fs_block_iterate2(ext2_filsys fs, + ext2_ino_t ino, + int flags, + char *block_buf, + int (*func)(ext2_filsys fs, + blk_t *blocknr, + e2_blkcnt_t blockcnt, + blk_t ref_blk, + int ref_offset, + void *priv_data), + void *priv_data); +errcode_t ext2fs_block_iterate3(ext2_filsys fs, + ext2_ino_t ino, + int flags, + char *block_buf, + int (*func)(ext2_filsys fs, + blk64_t *blocknr, + e2_blkcnt_t blockcnt, + blk64_t ref_blk, + int ref_offset, + void *priv_data), + void *priv_data); + +/* bmap.c */ +extern errcode_t ext2fs_bmap(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + char *block_buf, int bmap_flags, + blk_t block, blk_t *phys_blk); +extern errcode_t ext2fs_bmap2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + char *block_buf, int bmap_flags, blk64_t block, + int *ret_flags, blk64_t *phys_blk); +errcode_t ext2fs_map_cluster_block(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, blk64_t lblk, + blk64_t *pblk); + +#if 0 +/* bmove.c */ +extern errcode_t ext2fs_move_blocks(ext2_filsys fs, + ext2fs_block_bitmap reserve, + ext2fs_block_bitmap alloc_map, + int flags); +#endif + +/* check_desc.c */ +extern errcode_t ext2fs_check_desc(ext2_filsys fs); + +/* closefs.c */ +extern errcode_t ext2fs_close(ext2_filsys fs); +extern errcode_t ext2fs_close2(ext2_filsys fs, int flags); +extern errcode_t ext2fs_close_free(ext2_filsys *fs); +extern errcode_t ext2fs_flush(ext2_filsys fs); +extern errcode_t ext2fs_flush2(ext2_filsys fs, int flags); +extern int ext2fs_bg_has_super(ext2_filsys fs, dgrp_t group_block); +extern errcode_t ext2fs_super_and_bgd_loc2(ext2_filsys fs, + dgrp_t group, + blk64_t *ret_super_blk, + blk64_t *ret_old_desc_blk, + blk64_t *ret_new_desc_blk, + blk_t *ret_used_blks); +extern int ext2fs_super_and_bgd_loc(ext2_filsys fs, + dgrp_t group, + blk_t *ret_super_blk, + blk_t *ret_old_desc_blk, + blk_t *ret_new_desc_blk, + int *ret_meta_bg); +extern void ext2fs_update_dynamic_rev(ext2_filsys fs); + +/* crc32c.c */ +extern __u32 ext2fs_crc32_be(__u32 crc, unsigned char const *p, size_t len); +extern __u32 ext2fs_crc32c_le(__u32 crc, unsigned char const *p, size_t len); + +/* csum.c */ +extern void ext2fs_init_csum_seed(ext2_filsys fs); +extern errcode_t ext2fs_mmp_csum_set(ext2_filsys fs, struct mmp_struct *mmp); +extern int ext2fs_mmp_csum_verify(ext2_filsys, struct mmp_struct *mmp); +extern int ext2fs_verify_csum_type(ext2_filsys fs, struct ext2_super_block *sb); +extern errcode_t ext2fs_superblock_csum_set(ext2_filsys fs, + struct ext2_super_block *sb); +extern int ext2fs_superblock_csum_verify(ext2_filsys fs, + struct ext2_super_block *sb); +extern errcode_t ext2fs_ext_attr_block_csum_set(ext2_filsys fs, + ext2_ino_t inum, blk64_t block, + struct ext2_ext_attr_header *hdr); +extern int ext2fs_ext_attr_block_csum_verify(ext2_filsys fs, ext2_ino_t inum, + blk64_t block, + struct ext2_ext_attr_header *hdr); +#define EXT2_DIRENT_TAIL(block, blocksize) \ + ((struct ext2_dir_entry_tail *)(((char *)(block)) + \ + (blocksize) - sizeof(struct ext2_dir_entry_tail))) + +extern void ext2fs_initialize_dirent_tail(ext2_filsys fs, + struct ext2_dir_entry_tail *t); +extern int ext2fs_dirent_has_tail(ext2_filsys fs, + struct ext2_dir_entry *dirent); +extern int ext2fs_dirent_csum_verify(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent); +extern int ext2fs_dir_block_csum_verify(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent); +extern errcode_t ext2fs_dir_block_csum_set(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent); +extern errcode_t ext2fs_get_dx_countlimit(ext2_filsys fs, + struct ext2_dir_entry *dirent, + struct ext2_dx_countlimit **cc, + int *offset); +extern errcode_t ext2fs_dx_csum(ext2_filsys fs, ext2_ino_t inum, + struct ext2_dir_entry *dirent, + __u32 *crc, struct ext2_dx_tail **ret_t); +extern errcode_t ext2fs_extent_block_csum_set(ext2_filsys fs, + ext2_ino_t inum, + struct ext3_extent_header *eh); +extern int ext2fs_extent_block_csum_verify(ext2_filsys fs, + ext2_ino_t inum, + struct ext3_extent_header *eh); +extern errcode_t ext2fs_block_bitmap_csum_set(ext2_filsys fs, dgrp_t group, + char *bitmap, int size); +extern int ext2fs_block_bitmap_csum_verify(ext2_filsys fs, dgrp_t group, + char *bitmap, int size); +extern errcode_t ext2fs_inode_bitmap_csum_set(ext2_filsys fs, dgrp_t group, + char *bitmap, int size); +extern int ext2fs_inode_bitmap_csum_verify(ext2_filsys fs, dgrp_t group, + char *bitmap, int size); +extern errcode_t ext2fs_inode_csum_set(ext2_filsys fs, ext2_ino_t inum, + struct ext2_inode_large *inode); +extern int ext2fs_inode_csum_verify(ext2_filsys fs, ext2_ino_t inum, + struct ext2_inode_large *inode); +extern void ext2fs_group_desc_csum_set(ext2_filsys fs, dgrp_t group); +extern int ext2fs_group_desc_csum_verify(ext2_filsys fs, dgrp_t group); +extern errcode_t ext2fs_set_gdt_csum(ext2_filsys fs); +extern __u16 ext2fs_group_desc_csum(ext2_filsys fs, dgrp_t group); + +/* dblist.c */ +extern errcode_t ext2fs_init_dblist(ext2_filsys fs, ext2_dblist *ret_dblist); +extern errcode_t ext2fs_add_dir_block(ext2_dblist dblist, ext2_ino_t ino, + blk_t blk, int blockcnt); +extern errcode_t ext2fs_add_dir_block2(ext2_dblist dblist, ext2_ino_t ino, + blk64_t blk, e2_blkcnt_t blockcnt); +extern void ext2fs_dblist_sort(ext2_dblist dblist, + EXT2_QSORT_TYPE (*sortfunc)(const void *, + const void *)); +extern void ext2fs_dblist_sort2(ext2_dblist dblist, + EXT2_QSORT_TYPE (*sortfunc)(const void *, + const void *)); +extern errcode_t ext2fs_dblist_iterate(ext2_dblist dblist, + int (*func)(ext2_filsys fs, struct ext2_db_entry *db_info, + void *priv_data), + void *priv_data); +extern errcode_t ext2fs_dblist_iterate2(ext2_dblist dblist, + int (*func)(ext2_filsys fs, struct ext2_db_entry2 *db_info, + void *priv_data), + void *priv_data); +extern errcode_t ext2fs_dblist_iterate3(ext2_dblist dblist, + int (*func)(ext2_filsys fs, struct ext2_db_entry2 *db_info, + void *priv_data), + unsigned long long start, + unsigned long long count, + void *priv_data); +extern errcode_t ext2fs_set_dir_block(ext2_dblist dblist, ext2_ino_t ino, + blk_t blk, int blockcnt); +extern errcode_t ext2fs_set_dir_block2(ext2_dblist dblist, ext2_ino_t ino, + blk64_t blk, e2_blkcnt_t blockcnt); +extern errcode_t ext2fs_copy_dblist(ext2_dblist src, + ext2_dblist *dest); +extern int ext2fs_dblist_count(ext2_dblist dblist); +extern blk64_t ext2fs_dblist_count2(ext2_dblist dblist); +extern errcode_t ext2fs_dblist_get_last(ext2_dblist dblist, + struct ext2_db_entry **entry); +extern errcode_t ext2fs_dblist_get_last2(ext2_dblist dblist, + struct ext2_db_entry2 **entry); +extern errcode_t ext2fs_dblist_drop_last(ext2_dblist dblist); + +/* dblist_dir.c */ +extern errcode_t + ext2fs_dblist_dir_iterate(ext2_dblist dblist, + int flags, + char *block_buf, + int (*func)(ext2_ino_t dir, + int entry, + struct ext2_dir_entry *dirent, + int offset, + int blocksize, + char *buf, + void *priv_data), + void *priv_data); + +#if 0 +/* digest_encode.c */ +#define EXT2FS_DIGEST_SIZE EXT2FS_SHA256_LENGTH +extern int ext2fs_digest_encode(const char *src, int len, char *dst); +extern int ext2fs_digest_decode(const char *src, int len, char *dst); +#endif + +/* dirblock.c */ +extern errcode_t ext2fs_read_dir_block(ext2_filsys fs, blk_t block, + void *buf); +extern errcode_t ext2fs_read_dir_block2(ext2_filsys fs, blk_t block, + void *buf, int flags); +extern errcode_t ext2fs_read_dir_block3(ext2_filsys fs, blk64_t block, + void *buf, int flags); +extern errcode_t ext2fs_read_dir_block4(ext2_filsys fs, blk64_t block, + void *buf, int flags, ext2_ino_t ino); +extern errcode_t ext2fs_write_dir_block(ext2_filsys fs, blk_t block, + void *buf); +extern errcode_t ext2fs_write_dir_block2(ext2_filsys fs, blk_t block, + void *buf, int flags); +extern errcode_t ext2fs_write_dir_block3(ext2_filsys fs, blk64_t block, + void *buf, int flags); +extern errcode_t ext2fs_write_dir_block4(ext2_filsys fs, blk64_t block, + void *buf, int flags, ext2_ino_t ino); + +/* dirhash.c */ +extern errcode_t ext2fs_dirhash(int version, const char *name, int len, + const __u32 *seed, + ext2_dirhash_t *ret_hash, + ext2_dirhash_t *ret_minor_hash); + +extern errcode_t ext2fs_dirhash2(int version, const char *name, int len, + const struct ext2fs_nls_table *charset, + int hash_flags, + const __u32 *seed, + ext2_dirhash_t *ret_hash, + ext2_dirhash_t *ret_minor_hash); + +/* dir_iterate.c */ +extern errcode_t ext2fs_get_rec_len(ext2_filsys fs, + struct ext2_dir_entry *dirent, + unsigned int *rec_len); +extern errcode_t ext2fs_set_rec_len(ext2_filsys fs, + unsigned int len, + struct ext2_dir_entry *dirent); +extern errcode_t ext2fs_dir_iterate(ext2_filsys fs, + ext2_ino_t dir, + int flags, + char *block_buf, + int (*func)(struct ext2_dir_entry *dirent, + int offset, + int blocksize, + char *buf, + void *priv_data), + void *priv_data); +extern errcode_t ext2fs_dir_iterate2(ext2_filsys fs, + ext2_ino_t dir, + int flags, + char *block_buf, + int (*func)(ext2_ino_t dir, + int entry, + struct ext2_dir_entry *dirent, + int offset, + int blocksize, + char *buf, + void *priv_data), + void *priv_data); + +/* dupfs.c */ +extern errcode_t ext2fs_dup_handle(ext2_filsys src, ext2_filsys *dest); + +/* expanddir.c */ +extern errcode_t ext2fs_expand_dir(ext2_filsys fs, ext2_ino_t dir); + +/* ext_attr.c */ +extern __u32 ext2fs_ext_attr_hash_entry(struct ext2_ext_attr_entry *entry, + void *data); +extern __u32 ext2fs_ext_attr_hash_entry_signed(struct ext2_ext_attr_entry *entry, + void *data); +extern errcode_t ext2fs_ext_attr_hash_entry2(ext2_filsys fs, + struct ext2_ext_attr_entry *entry, + void *data, __u32 *hash); +extern errcode_t ext2fs_ext_attr_hash_entry3(ext2_filsys fs, + struct ext2_ext_attr_entry *entry, + void *data, __u32 *hash, + __u32 *signed_hash); +extern errcode_t ext2fs_read_ext_attr(ext2_filsys fs, blk_t block, void *buf); +extern errcode_t ext2fs_read_ext_attr2(ext2_filsys fs, blk64_t block, + void *buf); +extern errcode_t ext2fs_read_ext_attr3(ext2_filsys fs, blk64_t block, + void *buf, ext2_ino_t inum); +extern errcode_t ext2fs_write_ext_attr(ext2_filsys fs, blk_t block, + void *buf); +extern errcode_t ext2fs_write_ext_attr2(ext2_filsys fs, blk64_t block, + void *buf); +extern errcode_t ext2fs_write_ext_attr3(ext2_filsys fs, blk64_t block, + void *buf, ext2_ino_t inum); +extern errcode_t ext2fs_adjust_ea_refcount(ext2_filsys fs, blk_t blk, + char *block_buf, + int adjust, __u32 *newcount); +extern errcode_t ext2fs_adjust_ea_refcount2(ext2_filsys fs, blk64_t blk, + char *block_buf, + int adjust, __u32 *newcount); +extern errcode_t ext2fs_adjust_ea_refcount3(ext2_filsys fs, blk64_t blk, + char *block_buf, + int adjust, __u32 *newcount, + ext2_ino_t inum); +errcode_t ext2fs_xattrs_write(struct ext2_xattr_handle *handle); +errcode_t ext2fs_xattrs_read(struct ext2_xattr_handle *handle); +errcode_t ext2fs_xattrs_read_inode(struct ext2_xattr_handle *handle, + struct ext2_inode_large *inode); +errcode_t ext2fs_xattrs_iterate(struct ext2_xattr_handle *h, + int (*func)(char *name, char *value, + size_t value_len, void *data), + void *data); +errcode_t ext2fs_xattr_get(struct ext2_xattr_handle *h, const char *key, + void **value, size_t *value_len); +errcode_t ext2fs_xattr_set(struct ext2_xattr_handle *handle, + const char *key, + const void *value, + size_t value_len); +errcode_t ext2fs_xattr_remove(struct ext2_xattr_handle *handle, + const char *key); +errcode_t ext2fs_xattrs_open(ext2_filsys fs, ext2_ino_t ino, + struct ext2_xattr_handle **handle); +errcode_t ext2fs_xattrs_close(struct ext2_xattr_handle **handle); +errcode_t ext2fs_free_ext_attr(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode_large *inode); +errcode_t ext2fs_xattrs_count(struct ext2_xattr_handle *handle, size_t *count); +errcode_t ext2fs_xattr_inode_max_size(ext2_filsys fs, ext2_ino_t ino, + size_t *size); +#define XATTR_HANDLE_FLAG_RAW 0x0001 +errcode_t ext2fs_xattrs_flags(struct ext2_xattr_handle *handle, + unsigned int *new_flags, unsigned int *old_flags); +extern void ext2fs_ext_attr_block_rehash(struct ext2_ext_attr_header *header, + struct ext2_ext_attr_entry *end); +extern __u32 ext2fs_get_ea_inode_hash(struct ext2_inode *inode); +extern void ext2fs_set_ea_inode_hash(struct ext2_inode *inode, __u32 hash); +extern __u64 ext2fs_get_ea_inode_ref(struct ext2_inode *inode); +extern void ext2fs_set_ea_inode_ref(struct ext2_inode *inode, __u64 ref_count); + +/* extent.c */ +extern errcode_t ext2fs_extent_header_verify(void *ptr, int size); +extern errcode_t ext2fs_extent_open(ext2_filsys fs, ext2_ino_t ino, + ext2_extent_handle_t *handle); +extern errcode_t ext2fs_extent_open2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + ext2_extent_handle_t *ret_handle); +extern void ext2fs_extent_free(ext2_extent_handle_t handle); +extern errcode_t ext2fs_extent_get(ext2_extent_handle_t handle, + int flags, struct ext2fs_extent *extent); +extern errcode_t ext2fs_extent_node_split(ext2_extent_handle_t handle); +extern errcode_t ext2fs_extent_replace(ext2_extent_handle_t handle, int flags, + struct ext2fs_extent *extent); +extern errcode_t ext2fs_extent_insert(ext2_extent_handle_t handle, int flags, + struct ext2fs_extent *extent); +extern errcode_t ext2fs_extent_set_bmap(ext2_extent_handle_t handle, + blk64_t logical, blk64_t physical, + int flags); +extern errcode_t ext2fs_extent_delete(ext2_extent_handle_t handle, int flags); +extern errcode_t ext2fs_extent_get_info(ext2_extent_handle_t handle, + struct ext2_extent_info *info); +extern errcode_t ext2fs_extent_goto(ext2_extent_handle_t handle, + blk64_t blk); +extern errcode_t ext2fs_extent_goto2(ext2_extent_handle_t handle, + int leaf_level, blk64_t blk); +extern errcode_t ext2fs_extent_fix_parents(ext2_extent_handle_t handle); +extern size_t ext2fs_max_extent_depth(ext2_extent_handle_t handle); +extern errcode_t ext2fs_fix_extents_checksums(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode); +extern errcode_t ext2fs_count_blocks(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, blk64_t *ret_count); +extern errcode_t ext2fs_decode_extent(struct ext2fs_extent *to, void *from, + int len); + +/* fallocate.c */ +#define EXT2_FALLOCATE_ZERO_BLOCKS (0x1) +#define EXT2_FALLOCATE_FORCE_INIT (0x2) +#define EXT2_FALLOCATE_FORCE_UNINIT (0x4) +#define EXT2_FALLOCATE_INIT_BEYOND_EOF (0x8) +#define EXT2_FALLOCATE_ALL_FLAGS (0xF) +errcode_t ext2fs_fallocate(ext2_filsys fs, int flags, ext2_ino_t ino, + struct ext2_inode *inode, blk64_t goal, + blk64_t start, blk64_t len); + +/* fileio.c */ +extern errcode_t ext2fs_file_open2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + int flags, ext2_file_t *ret); +extern errcode_t ext2fs_file_open(ext2_filsys fs, ext2_ino_t ino, + int flags, ext2_file_t *ret); +extern ext2_filsys ext2fs_file_get_fs(ext2_file_t file); +struct ext2_inode *ext2fs_file_get_inode(ext2_file_t file); +extern ext2_ino_t ext2fs_file_get_inode_num(ext2_file_t file); +extern errcode_t ext2fs_file_close(ext2_file_t file); +extern errcode_t ext2fs_file_flush(ext2_file_t file); +extern errcode_t ext2fs_file_read(ext2_file_t file, void *buf, + unsigned int wanted, unsigned int *got); +extern errcode_t ext2fs_file_write(ext2_file_t file, const void *buf, + unsigned int nbytes, unsigned int *written); +extern errcode_t ext2fs_file_llseek(ext2_file_t file, __u64 offset, + int whence, __u64 *ret_pos); +extern errcode_t ext2fs_file_lseek(ext2_file_t file, ext2_off_t offset, + int whence, ext2_off_t *ret_pos); +errcode_t ext2fs_file_get_lsize(ext2_file_t file, __u64 *ret_size); +extern ext2_off_t ext2fs_file_get_size(ext2_file_t file); +extern errcode_t ext2fs_file_set_size(ext2_file_t file, ext2_off_t size); +extern errcode_t ext2fs_file_set_size2(ext2_file_t file, ext2_off64_t size); + +/* finddev.c */ +extern char *ext2fs_find_block_device(dev_t device); + +/* flushb.c */ +extern errcode_t ext2fs_sync_device(int fd, int flushb); + +/* freefs.c */ +extern void ext2fs_free(ext2_filsys fs); +extern void ext2fs_free_dblist(ext2_dblist dblist); +extern void ext2fs_badblocks_list_free(ext2_badblocks_list bb); +extern void ext2fs_u32_list_free(ext2_u32_list bb); + +/* gen_bitmap.c */ +extern void ext2fs_free_generic_bitmap(ext2fs_inode_bitmap bitmap); +extern errcode_t ext2fs_make_generic_bitmap(errcode_t magic, ext2_filsys fs, + __u32 start, __u32 end, + __u32 real_end, + const char *descr, char *init_map, + ext2fs_generic_bitmap *ret); +extern errcode_t ext2fs_allocate_generic_bitmap(__u32 start, + __u32 end, + __u32 real_end, + const char *descr, + ext2fs_generic_bitmap *ret); +extern errcode_t ext2fs_copy_generic_bitmap(ext2fs_generic_bitmap src, + ext2fs_generic_bitmap *dest); +extern void ext2fs_clear_generic_bitmap(ext2fs_generic_bitmap bitmap); +extern errcode_t ext2fs_fudge_generic_bitmap_end(ext2fs_inode_bitmap bitmap, + errcode_t magic, + errcode_t neq, + ext2_ino_t end, + ext2_ino_t *oend); +extern void ext2fs_set_generic_bitmap_padding(ext2fs_generic_bitmap map); +extern errcode_t ext2fs_resize_generic_bitmap(errcode_t magic, + __u32 new_end, + __u32 new_real_end, + ext2fs_generic_bitmap bmap); +extern errcode_t ext2fs_compare_generic_bitmap(errcode_t magic, errcode_t neq, + ext2fs_generic_bitmap bm1, + ext2fs_generic_bitmap bm2); +extern errcode_t ext2fs_get_generic_bitmap_range(ext2fs_generic_bitmap bmap, + errcode_t magic, + __u32 start, __u32 num, + void *out); +extern errcode_t ext2fs_set_generic_bitmap_range(ext2fs_generic_bitmap bmap, + errcode_t magic, + __u32 start, __u32 num, + void *in); +extern errcode_t ext2fs_find_first_zero_generic_bitmap(ext2fs_generic_bitmap bitmap, + __u32 start, __u32 end, + __u32 *out); +extern errcode_t ext2fs_find_first_set_generic_bitmap(ext2fs_generic_bitmap bitmap, + __u32 start, __u32 end, + __u32 *out); + +/* gen_bitmap64.c */ +void ext2fs_free_generic_bmap(ext2fs_generic_bitmap bmap); +errcode_t ext2fs_alloc_generic_bmap(ext2_filsys fs, errcode_t magic, + int type, __u64 start, __u64 end, + __u64 real_end, + const char *descr, + ext2fs_generic_bitmap *ret); +errcode_t ext2fs_copy_generic_bmap(ext2fs_generic_bitmap src, + ext2fs_generic_bitmap *dest); +void ext2fs_clear_generic_bmap(ext2fs_generic_bitmap bitmap); +errcode_t ext2fs_fudge_generic_bmap_end(ext2fs_generic_bitmap bitmap, + errcode_t neq, + __u64 end, __u64 *oend); +void ext2fs_set_generic_bmap_padding(ext2fs_generic_bitmap bmap); +errcode_t ext2fs_resize_generic_bmap(ext2fs_generic_bitmap bmap, + __u64 new_end, + __u64 new_real_end); +errcode_t ext2fs_compare_generic_bmap(errcode_t neq, + ext2fs_generic_bitmap bm1, + ext2fs_generic_bitmap bm2); +errcode_t ext2fs_get_generic_bmap_range(ext2fs_generic_bitmap bmap, + __u64 start, unsigned int num, + void *out); +errcode_t ext2fs_set_generic_bmap_range(ext2fs_generic_bitmap bmap, + __u64 start, unsigned int num, + void *in); +errcode_t ext2fs_convert_subcluster_bitmap(ext2_filsys fs, + ext2fs_block_bitmap *bitmap); +errcode_t ext2fs_count_used_clusters(ext2_filsys fs, blk64_t start, + blk64_t end, blk64_t *out); + +/* get_num_dirs.c */ +extern errcode_t ext2fs_get_num_dirs(ext2_filsys fs, ext2_ino_t *ret_num_dirs); + +/* getsize.c */ +extern errcode_t ext2fs_get_device_size(const char *file, int blocksize, + blk_t *retblocks); +extern errcode_t ext2fs_get_device_size2(const char *file, int blocksize, + blk64_t *retblocks); + +/* getsectsize.c */ +extern int ext2fs_get_dio_alignment(int fd); +errcode_t ext2fs_get_device_sectsize(const char *file, int *sectsize); +errcode_t ext2fs_get_device_phys_sectsize(const char *file, int *sectsize); + +/* i_block.c */ +errcode_t ext2fs_iblk_add_blocks(ext2_filsys fs, struct ext2_inode *inode, + blk64_t num_blocks); +errcode_t ext2fs_iblk_sub_blocks(ext2_filsys fs, struct ext2_inode *inode, + blk64_t num_blocks); +errcode_t ext2fs_iblk_set(ext2_filsys fs, struct ext2_inode *inode, blk64_t b); + +/* imager.c */ +extern errcode_t ext2fs_image_inode_write(ext2_filsys fs, int fd, int flags); +extern errcode_t ext2fs_image_inode_read(ext2_filsys fs, int fd, int flags); +extern errcode_t ext2fs_image_super_write(ext2_filsys fs, int fd, int flags); +extern errcode_t ext2fs_image_super_read(ext2_filsys fs, int fd, int flags); +extern errcode_t ext2fs_image_bitmap_write(ext2_filsys fs, int fd, int flags); +extern errcode_t ext2fs_image_bitmap_read(ext2_filsys fs, int fd, int flags); + +/* ind_block.c */ +errcode_t ext2fs_read_ind_block(ext2_filsys fs, blk_t blk, void *buf); +errcode_t ext2fs_write_ind_block(ext2_filsys fs, blk_t blk, void *buf); + +/* initialize.c */ +extern errcode_t ext2fs_initialize(const char *name, int flags, + struct ext2_super_block *param, + io_manager manager, ext2_filsys *ret_fs); +extern errcode_t ext2fs_calculate_summary_stats(ext2_filsys fs, int super_only); + +/* icount.c */ +extern void ext2fs_free_icount(ext2_icount_t icount); +extern errcode_t ext2fs_create_icount_tdb(ext2_filsys fs, char *tdb_dir, + int flags, ext2_icount_t *ret); +extern errcode_t ext2fs_create_icount2(ext2_filsys fs, int flags, + unsigned int size, + ext2_icount_t hint, ext2_icount_t *ret); +extern errcode_t ext2fs_create_icount(ext2_filsys fs, int flags, + unsigned int size, + ext2_icount_t *ret); +extern errcode_t ext2fs_icount_fetch(ext2_icount_t icount, ext2_ino_t ino, + __u16 *ret); +extern errcode_t ext2fs_icount_increment(ext2_icount_t icount, ext2_ino_t ino, + __u16 *ret); +extern errcode_t ext2fs_icount_decrement(ext2_icount_t icount, ext2_ino_t ino, + __u16 *ret); +extern errcode_t ext2fs_icount_store(ext2_icount_t icount, ext2_ino_t ino, + __u16 count); +extern ext2_ino_t ext2fs_get_icount_size(ext2_icount_t icount); +errcode_t ext2fs_icount_validate(ext2_icount_t icount, FILE *); + +/* inline.c */ + +extern errcode_t ext2fs_get_memalign(unsigned long size, + unsigned long align, void *ptr); + +/* inline_data.c */ +extern errcode_t ext2fs_inline_data_init(ext2_filsys fs, ext2_ino_t ino); +extern errcode_t ext2fs_inline_data_size(ext2_filsys fs, ext2_ino_t ino, + size_t *size); +extern errcode_t ext2fs_inline_data_get(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + void *buf, size_t *size); +extern errcode_t ext2fs_inline_data_set(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + void *buf, size_t size); + +/* inode.c */ +extern errcode_t ext2fs_create_inode_cache(ext2_filsys fs, + unsigned int cache_size); +extern void ext2fs_free_inode_cache(struct ext2_inode_cache *icache); +extern errcode_t ext2fs_flush_icache(ext2_filsys fs); +extern errcode_t ext2fs_get_next_inode_full(ext2_inode_scan scan, + ext2_ino_t *ino, + struct ext2_inode *inode, + int bufsize); +#define EXT2_INODE_SCAN_DEFAULT_BUFFER_BLOCKS 8 +extern errcode_t ext2fs_open_inode_scan(ext2_filsys fs, int buffer_blocks, + ext2_inode_scan *ret_scan); +extern void ext2fs_close_inode_scan(ext2_inode_scan scan); +extern errcode_t ext2fs_get_next_inode(ext2_inode_scan scan, ext2_ino_t *ino, + struct ext2_inode *inode); +extern errcode_t ext2fs_inode_scan_goto_blockgroup(ext2_inode_scan scan, + int group); +extern void ext2fs_set_inode_callback + (ext2_inode_scan scan, + errcode_t (*done_group)(ext2_filsys fs, + ext2_inode_scan scan, + dgrp_t group, + void * priv_data), + void *done_group_data); +extern int ext2fs_inode_scan_flags(ext2_inode_scan scan, int set_flags, + int clear_flags); +extern errcode_t ext2fs_read_inode_full(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode, + int bufsize); +extern errcode_t ext2fs_read_inode(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode); +extern errcode_t ext2fs_read_inode2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode, + int bufsize, int flags); +extern errcode_t ext2fs_write_inode_full(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode, + int bufsize); +extern errcode_t ext2fs_write_inode(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode); +extern errcode_t ext2fs_write_inode2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode, + int bufsize, int flags); +extern errcode_t ext2fs_write_new_inode(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode); +extern errcode_t ext2fs_get_blocks(ext2_filsys fs, ext2_ino_t ino, blk_t *blocks); +extern errcode_t ext2fs_check_directory(ext2_filsys fs, ext2_ino_t ino); + +/* inode_io.c */ +extern io_manager inode_io_manager; +extern errcode_t ext2fs_inode_io_intern(ext2_filsys fs, ext2_ino_t ino, + char **name); +extern errcode_t ext2fs_inode_io_intern2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + char **name); + +/* ismounted.c */ +extern errcode_t ext2fs_check_if_mounted(const char *file, int *mount_flags); +extern errcode_t ext2fs_check_mount_point(const char *device, int *mount_flags, + char *mtpt, int mtlen); + +/* punch.c */ +/* + * NOTE: This function removes from an inode the blocks "start", "end", and + * every block in between. + */ +extern errcode_t ext2fs_punch(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + char *block_buf, blk64_t start, + blk64_t end); + +/* namei.c */ +extern errcode_t ext2fs_lookup(ext2_filsys fs, ext2_ino_t dir, const char *name, + int namelen, char *buf, ext2_ino_t *inode); +extern errcode_t ext2fs_namei(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd, + const char *name, ext2_ino_t *inode); +errcode_t ext2fs_namei_follow(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd, + const char *name, ext2_ino_t *inode); +extern errcode_t ext2fs_follow_link(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd, + ext2_ino_t inode, ext2_ino_t *res_inode); + +/* native.c */ +int ext2fs_native_flag(void); + +/* newdir.c */ +extern errcode_t ext2fs_new_dir_block(ext2_filsys fs, ext2_ino_t dir_ino, + ext2_ino_t parent_ino, char **block); +extern errcode_t ext2fs_new_dir_inline_data(ext2_filsys fs, ext2_ino_t dir_ino, + ext2_ino_t parent_ino, __u32 *iblock); + +/* nls_utf8.c */ +extern const struct ext2fs_nls_table *ext2fs_load_nls_table(int encoding); +extern int ext2fs_check_encoded_name(const struct ext2fs_nls_table *table, + char *s, size_t len, char **pos); +extern int ext2fs_casefold_cmp(const struct ext2fs_nls_table *table, + const unsigned char *str1, size_t len1, + const unsigned char *str2, size_t len2); + +/* mkdir.c */ +extern errcode_t ext2fs_mkdir(ext2_filsys fs, ext2_ino_t parent, ext2_ino_t inum, + const char *name); + +/* mkjournal.c */ +struct ext2fs_journal_params { + blk_t num_journal_blocks; + blk_t num_fc_blocks; +}; +extern errcode_t ext2fs_get_journal_params( + struct ext2fs_journal_params *params, ext2_filsys fs); +extern errcode_t ext2fs_zero_blocks(ext2_filsys fs, blk_t blk, int num, + blk_t *ret_blk, int *ret_count); +extern errcode_t ext2fs_zero_blocks2(ext2_filsys fs, blk64_t blk, int num, + blk64_t *ret_blk, int *ret_count); +extern errcode_t ext2fs_create_journal_superblock(ext2_filsys fs, + __u32 num_blocks, int flags, + char **ret_jsb); +extern errcode_t ext2fs_create_journal_superblock2(ext2_filsys fs, + struct ext2fs_journal_params *params, + int flags, char **ret_jsb); +extern errcode_t ext2fs_add_journal_device(ext2_filsys fs, + ext2_filsys journal_dev); +extern errcode_t ext2fs_add_journal_inode(ext2_filsys fs, blk_t num_blocks, + int flags); +extern errcode_t ext2fs_add_journal_inode2(ext2_filsys fs, blk_t num_blocks, + blk64_t goal, int flags); +extern errcode_t ext2fs_add_journal_inode3(ext2_filsys fs, + struct ext2fs_journal_params *params, + blk64_t goal, int flags); +extern int ext2fs_default_journal_size(__u64 num_blocks); +extern int ext2fs_journal_sb_start(int blocksize); + +/* openfs.c */ +extern errcode_t ext2fs_open(const char *name, int flags, int superblock, + unsigned int block_size, io_manager manager, + ext2_filsys *ret_fs); +extern errcode_t ext2fs_open2(const char *name, const char *io_options, + int flags, int superblock, + unsigned int block_size, io_manager manager, + ext2_filsys *ret_fs); +/* + * The dgrp_t argument to these two functions is not actually a group number + * but a block number offset within a group table! Convert with the formula + * (group_number / groups_per_block). + */ +extern blk64_t ext2fs_descriptor_block_loc2(ext2_filsys fs, + blk64_t group_block, dgrp_t i); +extern blk_t ext2fs_descriptor_block_loc(ext2_filsys fs, blk_t group_block, + dgrp_t i); +errcode_t ext2fs_get_data_io(ext2_filsys fs, io_channel *old_io); +errcode_t ext2fs_set_data_io(ext2_filsys fs, io_channel new_io); +errcode_t ext2fs_rewrite_to_io(ext2_filsys fs, io_channel new_io); + +/* orphan.c */ +extern errcode_t ext2fs_create_orphan_file(ext2_filsys fs, blk_t num_blocks); +extern errcode_t ext2fs_truncate_orphan_file(ext2_filsys fs); +extern e2_blkcnt_t ext2fs_default_orphan_file_blocks(ext2_filsys fs); +extern __u32 ext2fs_do_orphan_file_block_csum(ext2_filsys fs, ext2_ino_t ino, + __u32 gen, blk64_t blk, + char *buf); +extern errcode_t ext2fs_orphan_file_block_csum_set(ext2_filsys fs, + ext2_ino_t ino, blk64_t blk, + char *buf); +extern int ext2fs_orphan_file_block_csum_verify(ext2_filsys fs, ext2_ino_t ino, + blk64_t blk, char *buf); + +/* get_pathname.c */ +extern errcode_t ext2fs_get_pathname(ext2_filsys fs, ext2_ino_t dir, ext2_ino_t ino, + char **name); + +/* link.c */ +#define EXT2FS_UNLINK_FORCE 0x1 /* Forcefully unlink even if + * the inode number doesn't + * match the dirent + */ +errcode_t ext2fs_link(ext2_filsys fs, ext2_ino_t dir, const char *name, + ext2_ino_t ino, int flags); +errcode_t ext2fs_unlink(ext2_filsys fs, ext2_ino_t dir, const char *name, + ext2_ino_t ino, int flags); + +/* symlink.c */ +errcode_t ext2fs_symlink(ext2_filsys fs, ext2_ino_t parent, ext2_ino_t ino, + const char *name, const char *target); +int ext2fs_is_fast_symlink(struct ext2_inode *inode); + +/* mmp.c */ +errcode_t ext2fs_mmp_read(ext2_filsys fs, blk64_t mmp_blk, void *buf); +errcode_t ext2fs_mmp_write(ext2_filsys fs, blk64_t mmp_blk, void *buf); +errcode_t ext2fs_mmp_clear(ext2_filsys fs); +errcode_t ext2fs_mmp_init(ext2_filsys fs); +errcode_t ext2fs_mmp_start(ext2_filsys fs); +errcode_t ext2fs_mmp_update(ext2_filsys fs); +errcode_t ext2fs_mmp_update2(ext2_filsys fs, int immediately); +errcode_t ext2fs_mmp_stop(ext2_filsys fs); +unsigned ext2fs_mmp_new_seq(void); + +/* read_bb.c */ +extern errcode_t ext2fs_read_bb_inode(ext2_filsys fs, + ext2_badblocks_list *bb_list); + +/* read_bb_file.c */ +extern errcode_t ext2fs_read_bb_FILE2(ext2_filsys fs, FILE *f, + ext2_badblocks_list *bb_list, + void *priv_data, + void (*invalid)(ext2_filsys fs, + blk_t blk, + char *badstr, + void *priv_data)); +extern errcode_t ext2fs_read_bb_FILE(ext2_filsys fs, FILE *f, + ext2_badblocks_list *bb_list, + void (*invalid)(ext2_filsys fs, + blk_t blk)); + +/* res_gdt.c */ +extern errcode_t ext2fs_create_resize_inode(ext2_filsys fs); + +/* rw_bitmaps.c */ +extern errcode_t ext2fs_rw_bitmaps(ext2_filsys fs, int flags, int num_threads); +extern errcode_t ext2fs_read_bitmaps(ext2_filsys fs); +extern errcode_t ext2fs_read_inode_bitmap (ext2_filsys fs); +extern errcode_t ext2fs_read_block_bitmap(ext2_filsys fs); +extern errcode_t ext2fs_write_bitmaps(ext2_filsys fs); +extern errcode_t ext2fs_write_inode_bitmap(ext2_filsys fs); +extern errcode_t ext2fs_write_block_bitmap (ext2_filsys fs); + +/*sha256.c */ +#define EXT2FS_SHA256_LENGTH 32 +#if 0 +extern void ext2fs_sha256(const unsigned char *in, unsigned long in_size, + unsigned char out[EXT2FS_SHA256_LENGTH]); +#endif + +/* sha512.c */ +#define EXT2FS_SHA512_LENGTH 64 +extern void ext2fs_sha512(const unsigned char *in, unsigned long in_size, + unsigned char out[EXT2FS_SHA512_LENGTH]); + +/* swapfs.c */ +extern errcode_t ext2fs_dirent_swab_in2(ext2_filsys fs, char *buf, size_t size, + int flags); +extern errcode_t ext2fs_dirent_swab_in(ext2_filsys fs, char *buf, int flags); +extern errcode_t ext2fs_dirent_swab_out2(ext2_filsys fs, char *buf, size_t size, + int flags); +extern errcode_t ext2fs_dirent_swab_out(ext2_filsys fs, char *buf, int flags); +extern void ext2fs_swap_ext_attr(char *to, char *from, int bufsize, + int has_header); +extern void ext2fs_swap_ext_attr_header(struct ext2_ext_attr_header *to_header, + struct ext2_ext_attr_header *from_hdr); +extern void ext2fs_swap_ext_attr_entry(struct ext2_ext_attr_entry *to_entry, + struct ext2_ext_attr_entry *from_entry); +extern void ext2fs_swap_super(struct ext2_super_block * super); +extern void ext2fs_swap_group_desc(struct ext2_group_desc *gdp); +extern void ext2fs_swap_group_desc2(ext2_filsys, struct ext2_group_desc *gdp); +extern void ext2fs_swap_inode_full(ext2_filsys fs, struct ext2_inode_large *t, + struct ext2_inode_large *f, int hostorder, + int bufsize); +extern void ext2fs_swap_inode(ext2_filsys fs,struct ext2_inode *t, + struct ext2_inode *f, int hostorder); +extern void ext2fs_swap_mmp(struct mmp_struct *mmp); + +/* unix_io.c */ +extern int ext2fs_open_file(const char *pathname, int flags, mode_t mode); +extern int ext2fs_stat(const char *path, ext2fs_struct_stat *buf); +extern int ext2fs_fstat(int fd, ext2fs_struct_stat *buf); + +/* valid_blk.c */ +extern int ext2fs_inode_has_valid_blocks(struct ext2_inode *inode); +extern int ext2fs_inode_has_valid_blocks2(ext2_filsys fs, + struct ext2_inode *inode); + +/* version.c */ +extern int ext2fs_parse_version_string(const char *ver_string); +extern int ext2fs_get_library_version(const char **ver_string, + const char **date_string); + +/* write_bb_file.c */ +extern errcode_t ext2fs_write_bb_FILE(ext2_badblocks_list bb_list, + unsigned int flags, + FILE *f); + + +/* inline functions */ +#ifdef NO_INLINE_FUNCS +extern errcode_t ext2fs_get_mem(unsigned long size, void *ptr); +extern errcode_t ext2fs_get_memzero(unsigned long size, void *ptr); +extern errcode_t ext2fs_get_array(unsigned long count, + unsigned long size, void *ptr); +extern errcode_t ext2fs_get_arrayzero(unsigned long count, + unsigned long size, void *ptr); +extern errcode_t ext2fs_free_mem(void *ptr); +extern errcode_t ext2fs_resize_mem(unsigned long old_size, + unsigned long size, void *ptr); +extern errcode_t ext2fs_resize_array(unsigned long old_count, unsigned long count, + unsigned long size, void *ptr); +extern void ext2fs_mark_super_dirty(ext2_filsys fs); +extern void ext2fs_mark_changed(ext2_filsys fs); +extern int ext2fs_test_changed(ext2_filsys fs); +extern void ext2fs_mark_valid(ext2_filsys fs); +extern void ext2fs_unmark_valid(ext2_filsys fs); +extern int ext2fs_test_valid(ext2_filsys fs); +extern void ext2fs_mark_ib_dirty(ext2_filsys fs); +extern void ext2fs_mark_bb_dirty(ext2_filsys fs); +extern int ext2fs_test_ib_dirty(ext2_filsys fs); +extern int ext2fs_test_bb_dirty(ext2_filsys fs); +extern dgrp_t ext2fs_group_of_blk(ext2_filsys fs, blk_t blk); +extern dgrp_t ext2fs_group_of_ino(ext2_filsys fs, ext2_ino_t ino); +extern blk_t ext2fs_group_first_block(ext2_filsys fs, dgrp_t group); +extern blk_t ext2fs_group_last_block(ext2_filsys fs, dgrp_t group); +extern blk_t ext2fs_inode_data_blocks(ext2_filsys fs, + struct ext2_inode *inode); +extern int ext2fs_htree_intnode_maxrecs(ext2_filsys fs, int blocks); +extern unsigned int ext2fs_div_ceil(unsigned int a, unsigned int b); +extern __u64 ext2fs_div64_ceil(__u64 a, __u64 b); +extern int ext2fs_dirent_name_len(const struct ext2_dir_entry *entry); +extern void ext2fs_dirent_set_name_len(struct ext2_dir_entry *entry, int len); +extern int ext2fs_dirent_file_type(const struct ext2_dir_entry *entry); +extern void ext2fs_dirent_set_file_type(struct ext2_dir_entry *entry, int type); +extern struct ext2_inode *ext2fs_inode(struct ext2_inode_large * large_inode); +extern const struct ext2_inode *ext2fs_const_inode(const struct ext2_inode_large * large_inode); +extern int ext2fs_inodes_per_orphan_block(ext2_filsys fs); +extern struct ext4_orphan_block_tail *ext2fs_orphan_block_tail(ext2_filsys fs, + char *buf); +#endif + +/* + * The actual inlined functions definitions themselves... + * + * If NO_INLINE_FUNCS is defined, then we won't try to do inline + * functions at all! + */ +#if (defined(INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS)) +#ifdef INCLUDE_INLINE_FUNCS +#define _INLINE_ extern +#else +#if (__STDC_VERSION__ >= 199901L) +#define _INLINE_ inline +#else +#ifdef __GNUC__ +#define _INLINE_ extern __inline__ +#else /* For Watcom C */ +#define _INLINE_ extern inline +#endif /* __GNUC__ */ +#endif /* __STDC_VERSION__ >= 199901L */ +#endif + +#ifndef EXT2_CUSTOM_MEMORY_ROUTINES +#include <string.h> +/* + * Allocate memory. The 'ptr' arg must point to a pointer. + */ +_INLINE_ errcode_t ext2fs_get_mem(unsigned long size, void *ptr) +{ + void *pp; + + pp = malloc(size); + if (!pp) + return EXT2_ET_NO_MEMORY; + memcpy(ptr, &pp, sizeof (pp)); + return 0; +} + +_INLINE_ errcode_t ext2fs_get_memzero(unsigned long size, void *ptr) +{ + void *pp; + + pp = malloc(size); + if (!pp) + return EXT2_ET_NO_MEMORY; + memset(pp, 0, size); + memcpy(ptr, &pp, sizeof(pp)); + return 0; +} + +_INLINE_ errcode_t ext2fs_get_array(unsigned long count, unsigned long size, + void *ptr) +{ + if (count && (~0UL)/count < size) + return EXT2_ET_NO_MEMORY; + return ext2fs_get_mem(count*size, ptr); +} + +_INLINE_ errcode_t ext2fs_get_arrayzero(unsigned long count, + unsigned long size, void *ptr) +{ + if (count && (~0UL)/count < size) + return EXT2_ET_NO_MEMORY; + + return ext2fs_get_memzero((size_t)count * size, ptr); +} + +/* + * Free memory. The 'ptr' arg must point to a pointer. + */ +_INLINE_ errcode_t ext2fs_free_mem(void *ptr) +{ + void *p; + + memcpy(&p, ptr, sizeof(p)); + free(p); + p = 0; + memcpy(ptr, &p, sizeof(p)); + return 0; +} + +/* + * Resize memory. The 'ptr' arg must point to a pointer. + */ +_INLINE_ errcode_t ext2fs_resize_mem(unsigned long EXT2FS_ATTR((unused)) old_size, + unsigned long size, void *ptr) +{ + void *p; + + /* Use "memcpy" for pointer assignments here to avoid problems + * with C99 strict type aliasing rules. */ + memcpy(&p, ptr, sizeof(p)); + p = realloc(p, size); + if (!p) + return EXT2_ET_NO_MEMORY; + memcpy(ptr, &p, sizeof(p)); + return 0; +} + +/* + * Resize array. The 'ptr' arg must point to a pointer. + */ +_INLINE_ errcode_t ext2fs_resize_array(unsigned long size, + unsigned long old_count, + unsigned long count, void *ptr) +{ + unsigned long old_size; + errcode_t retval; + + if (count && (~0UL)/count < size) + return EXT2_ET_NO_MEMORY; + + size *= count; + old_size = size * old_count; + retval = ext2fs_resize_mem(old_size, size, ptr); + if (retval) + return retval; + + if (size > old_size) { + void *p; + + memcpy(&p, ptr, sizeof(p)); + memset((char *)p + old_size, 0, size - old_size); + memcpy(ptr, &p, sizeof(p)); + } + + return 0; +} +#endif /* Custom memory routines */ + +/* + * Mark a filesystem superblock as dirty + */ +_INLINE_ void ext2fs_mark_super_dirty(ext2_filsys fs) +{ + fs->flags |= EXT2_FLAG_DIRTY | EXT2_FLAG_CHANGED; +} + +/* + * Mark a filesystem as changed + */ +_INLINE_ void ext2fs_mark_changed(ext2_filsys fs) +{ + fs->flags |= EXT2_FLAG_CHANGED; +} + +/* + * Check to see if a filesystem has changed + */ +_INLINE_ int ext2fs_test_changed(ext2_filsys fs) +{ + return (fs->flags & EXT2_FLAG_CHANGED); +} + +/* + * Mark a filesystem as valid + */ +_INLINE_ void ext2fs_mark_valid(ext2_filsys fs) +{ + fs->flags |= EXT2_FLAG_VALID; +} + +/* + * Mark a filesystem as NOT valid + */ +_INLINE_ void ext2fs_unmark_valid(ext2_filsys fs) +{ + fs->flags &= ~EXT2_FLAG_VALID; +} + +/* + * Check to see if a filesystem is valid + */ +_INLINE_ int ext2fs_test_valid(ext2_filsys fs) +{ + return (fs->flags & EXT2_FLAG_VALID); +} + +/* + * Mark the inode bitmap as dirty + */ +_INLINE_ void ext2fs_mark_ib_dirty(ext2_filsys fs) +{ + fs->flags |= EXT2_FLAG_IB_DIRTY | EXT2_FLAG_CHANGED; +} + +/* + * Mark the block bitmap as dirty + */ +_INLINE_ void ext2fs_mark_bb_dirty(ext2_filsys fs) +{ + fs->flags |= EXT2_FLAG_BB_DIRTY | EXT2_FLAG_CHANGED; +} + +/* + * Check to see if a filesystem's inode bitmap is dirty + */ +_INLINE_ int ext2fs_test_ib_dirty(ext2_filsys fs) +{ + return (fs->flags & EXT2_FLAG_IB_DIRTY); +} + +/* + * Check to see if a filesystem's block bitmap is dirty + */ +_INLINE_ int ext2fs_test_bb_dirty(ext2_filsys fs) +{ + return (fs->flags & EXT2_FLAG_BB_DIRTY); +} + +/* + * Return the group # of a block + */ +_INLINE_ dgrp_t ext2fs_group_of_blk(ext2_filsys fs, blk_t blk) +{ + return ext2fs_group_of_blk2(fs, blk); +} +/* + * Return the group # of an inode number + */ +_INLINE_ dgrp_t ext2fs_group_of_ino(ext2_filsys fs, ext2_ino_t ino) +{ + return (ino - 1) / fs->super->s_inodes_per_group; +} + +/* + * Return the first block (inclusive) in a group + */ +_INLINE_ blk_t ext2fs_group_first_block(ext2_filsys fs, dgrp_t group) +{ + return (blk_t) ext2fs_group_first_block2(fs, group); +} + +/* + * Return the last block (inclusive) in a group + */ +_INLINE_ blk_t ext2fs_group_last_block(ext2_filsys fs, dgrp_t group) +{ + return (blk_t) ext2fs_group_last_block2(fs, group); +} + +_INLINE_ blk_t ext2fs_inode_data_blocks(ext2_filsys fs, + struct ext2_inode *inode) +{ + return (blk_t) ext2fs_inode_data_blocks2(fs, inode); +} + +_INLINE_ int ext2fs_htree_intnode_maxrecs(ext2_filsys fs, int blocks) +{ + int csum_size = 0; + + if ((EXT2_SB(fs->super)->s_feature_ro_compat & + EXT4_FEATURE_RO_COMPAT_METADATA_CSUM) != 0) + csum_size = sizeof(struct ext2_dx_tail); + return blocks * ((fs->blocksize - (8 + csum_size)) / + sizeof(struct ext2_dx_entry)); +} + +/* + * This is an efficient, overflow safe way of calculating ceil((1.0 * a) / b) + */ +_INLINE_ unsigned int ext2fs_div_ceil(unsigned int a, unsigned int b) +{ + if (!a) + return 0; + return ((a - 1) / b) + 1; +} + +_INLINE_ __u64 ext2fs_div64_ceil(__u64 a, __u64 b) +{ + if (!a) + return 0; + return ((a - 1) / b) + 1; +} + +_INLINE_ int ext2fs_dirent_name_len(const struct ext2_dir_entry *entry) +{ + return entry->name_len & 0xff; +} + +_INLINE_ void ext2fs_dirent_set_name_len(struct ext2_dir_entry *entry, int len) +{ + entry->name_len = (entry->name_len & 0xff00) | (len & 0xff); +} + +_INLINE_ int ext2fs_dirent_file_type(const struct ext2_dir_entry *entry) +{ + return entry->name_len >> 8; +} + +_INLINE_ void ext2fs_dirent_set_file_type(struct ext2_dir_entry *entry, int type) +{ + entry->name_len = (entry->name_len & 0xff) | (type << 8); +} + +_INLINE_ struct ext2_inode *ext2fs_inode(struct ext2_inode_large * large_inode) +{ + /* It is always safe to convert large inode to a small inode */ + return (struct ext2_inode *) large_inode; +} + +_INLINE_ const struct ext2_inode * +ext2fs_const_inode(const struct ext2_inode_large * large_inode) +{ + /* It is always safe to convert large inode to a small inode */ + return (const struct ext2_inode *) large_inode; +} + +_INLINE_ int ext2fs_inodes_per_orphan_block(ext2_filsys fs) +{ + return (fs->blocksize - sizeof(struct ext4_orphan_block_tail)) / + sizeof(__u32); +} + +_INLINE_ struct ext4_orphan_block_tail * +ext2fs_orphan_block_tail(ext2_filsys fs, char *buf) +{ + return (struct ext4_orphan_block_tail *)(buf + fs->blocksize - + sizeof(struct ext4_orphan_block_tail)); +} + +#undef _INLINE_ +#endif + +/* htree levels for ext4 */ +#define EXT4_HTREE_LEVEL_COMPAT 2 +#define EXT4_HTREE_LEVEL 3 + +static inline unsigned int ext2_dir_htree_level(ext2_filsys fs) +{ + if (ext2fs_has_feature_largedir(fs->super)) + return EXT4_HTREE_LEVEL; + + return EXT4_HTREE_LEVEL_COMPAT; +} + +#ifdef __cplusplus +} +#endif + +#endif /* _EXT2FS_EXT2FS_H */ diff --git a/lib/ext2fs/ext2fs.pc.in b/lib/ext2fs/ext2fs.pc.in new file mode 100644 index 0000000..efac85e --- /dev/null +++ b/lib/ext2fs/ext2fs.pc.in @@ -0,0 +1,11 @@ +prefix=@prefix@ +exec_prefix=@exec_prefix@ +libdir=@libdir@ +includedir=@includedir@ + +Name: ext2fs +Description: Ext2fs library +Version: @E2FSPROGS_VERSION@ +Requires.private: com_err +Cflags: -I${includedir}/ext2fs -I${includedir} +Libs: -L${libdir} -lext2fs diff --git a/lib/ext2fs/ext2fsP.h b/lib/ext2fs/ext2fsP.h new file mode 100644 index 0000000..0687384 --- /dev/null +++ b/lib/ext2fs/ext2fsP.h @@ -0,0 +1,210 @@ +/* + * ext2fsP.h --- private header file for ext2 library + * + * Copyright (C) 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif + +#include "ext2fs.h" + +#define EXT2FS_MAX_NESTED_LINKS 8 + +static inline int ext2fsP_is_disk_device(mode_t mode) +{ +#if defined(__FreeBSD__) || defined(__FreeBSD_kernel__) + return S_ISBLK(mode) || S_ISCHR(mode); +#else + return S_ISBLK(mode); +#endif +} + +/* + * Badblocks list + */ +struct ext2_struct_u32_list { + int magic; + int num; + int size; + __u32 *list; + int badblocks_flags; +}; + +struct ext2_struct_u32_iterate { + int magic; + ext2_u32_list bb; + int ptr; +}; + + +/* + * Directory block iterator definition + */ +struct ext2_struct_dblist { + int magic; + ext2_filsys fs; + unsigned long long size; + unsigned long long count; + int sorted; + struct ext2_db_entry2 * list; +}; + +/* + * For directory iterators + */ +struct dir_context { + ext2_ino_t dir; + int flags; + char *buf; + unsigned int buflen; + int (*func)(ext2_ino_t dir, + int entry, + struct ext2_dir_entry *dirent, + int offset, + int blocksize, + char *buf, + void *priv_data); + void *priv_data; + errcode_t errcode; +}; + +/* + * Inode cache structure + */ +struct ext2_inode_cache { + void * buffer; + blk64_t buffer_blk; + int cache_last; + unsigned int cache_size; + int refcount; + struct ext2_inode_cache_ent *cache; +}; + +struct ext2_inode_cache_ent { + ext2_ino_t ino; + struct ext2_inode *inode; +}; + +/* + * NLS definitions + */ +struct ext2fs_nls_table { + int version; + const struct ext2fs_nls_ops *ops; +}; + +struct ext2fs_nls_ops { + int (*casefold)(const struct ext2fs_nls_table *charset, + const unsigned char *str, size_t len, + unsigned char *dest, size_t dlen); + int (*validate)(const struct ext2fs_nls_table *table, + char *s, size_t len, char **pos); + int (*casefold_cmp)(const struct ext2fs_nls_table *table, + const unsigned char *str1, size_t len1, + const unsigned char *str2, size_t len2); +}; + +/* Function prototypes */ + +extern int ext2fs_process_dir_block(ext2_filsys fs, + blk64_t *blocknr, + e2_blkcnt_t blockcnt, + blk64_t ref_block, + int ref_offset, + void *priv_data); + +extern errcode_t ext2fs_inline_data_ea_remove(ext2_filsys fs, ext2_ino_t ino); +extern errcode_t ext2fs_inline_data_expand(ext2_filsys fs, ext2_ino_t ino); +extern int ext2fs_inline_data_dir_iterate(ext2_filsys fs, + ext2_ino_t ino, + void *priv_data); + +/* Generic numeric progress meter */ + +struct ext2fs_numeric_progress_struct { + __u64 max; + int log_max; + int skip_progress; +}; + +/* + * progress callback functions + */ +struct ext2fs_progress_ops { + void (*init)(ext2_filsys fs, + struct ext2fs_numeric_progress_struct * progress, + const char *label, __u64 max); + void (*update)(ext2_filsys fs, + struct ext2fs_numeric_progress_struct * progress, + __u64 val); + void (*close)(ext2_filsys fs, + struct ext2fs_numeric_progress_struct * progress, + const char *message); +}; + +extern struct ext2fs_progress_ops ext2fs_numeric_progress_ops; + +extern void ext2fs_numeric_progress_init(ext2_filsys fs, + struct ext2fs_numeric_progress_struct * progress, + const char *label, __u64 max); +extern void ext2fs_numeric_progress_update(ext2_filsys fs, + struct ext2fs_numeric_progress_struct * progress, + __u64 val); +extern void ext2fs_numeric_progress_close(ext2_filsys fs, + struct ext2fs_numeric_progress_struct * progress, + const char *message); + +/* + * 64-bit bitmap support + */ + +extern errcode_t ext2fs_alloc_generic_bmap(ext2_filsys fs, errcode_t magic, + int type, __u64 start, __u64 end, + __u64 real_end, + const char * description, + ext2fs_generic_bitmap *bmap); + +extern void ext2fs_free_generic_bmap(ext2fs_generic_bitmap bmap); + +extern errcode_t ext2fs_copy_generic_bmap(ext2fs_generic_bitmap src, + ext2fs_generic_bitmap *dest); + +extern errcode_t ext2fs_resize_generic_bmap(ext2fs_generic_bitmap bmap, + __u64 new_end, + __u64 new_real_end); +extern errcode_t ext2fs_fudge_generic_bmap_end(ext2fs_generic_bitmap bitmap, + errcode_t neq, + __u64 end, __u64 *oend); +extern int ext2fs_mark_generic_bmap(ext2fs_generic_bitmap bitmap, + __u64 arg); +extern int ext2fs_unmark_generic_bmap(ext2fs_generic_bitmap bitmap, + __u64 arg); +extern int ext2fs_test_generic_bmap(ext2fs_generic_bitmap bitmap, + __u64 arg); +extern errcode_t ext2fs_set_generic_bmap_range(ext2fs_generic_bitmap bitmap, + __u64 start, unsigned int num, + void *in); +extern errcode_t ext2fs_get_generic_bmap_range(ext2fs_generic_bitmap bitmap, + __u64 start, unsigned int num, + void *out); +extern void ext2fs_warn_bitmap32(ext2fs_generic_bitmap bitmap,const char *func); + +extern int ext2fs_mem_is_zero(const char *mem, size_t len); + +extern int ext2fs_file_block_offset_too_big(ext2_filsys fs, + struct ext2_inode *inode, + blk64_t offset); + +/* atexit support */ +typedef void (*ext2_exit_fn)(void *); +errcode_t ext2fs_add_exit_fn(ext2_exit_fn fn, void *data); +errcode_t ext2fs_remove_exit_fn(ext2_exit_fn fn, void *data); + +#define EXT2FS_BUILD_BUG_ON(cond) ((void)sizeof(char[1 - 2*!!(cond)])) diff --git a/lib/ext2fs/ext3_extents.h b/lib/ext2fs/ext3_extents.h new file mode 100644 index 0000000..309fbc8 --- /dev/null +++ b/lib/ext2fs/ext3_extents.h @@ -0,0 +1,127 @@ +/* + * Copyright (c) 2003,2004 Cluster File Systems, Inc, info@clusterfs.com + * Written by Alex Tomas <alex@clusterfs.com> + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef _LINUX_EXT3_EXTENTS +#define _LINUX_EXT3_EXTENTS + +/* + * ext3_inode has i_block array (total 60 bytes) + * first 4 bytes are used to store: + * - tree depth (0 mean there is no tree yet. all extents in the inode) + * - number of alive extents in the inode + */ + +/* + * This is extent tail on-disk structure. + * All other extent structures are 12 bytes long. It turns out that + * block_size % 12 >= 4 for at least all powers of 2 greater than 512, which + * covers all valid ext4 block sizes. Therefore, this tail structure can be + * crammed into the end of the block without having to rebalance the tree. + */ +struct ext3_extent_tail { + __le32 et_checksum; /* crc32c(uuid+inum+extent_block) */ +}; + +/* + * this is extent on-disk structure + * it's used at the bottom of the tree + */ +struct ext3_extent { + __le32 ee_block; /* first logical block extent covers */ + __le16 ee_len; /* number of blocks covered by extent */ + __le16 ee_start_hi; /* high 16 bits of physical block */ + __le32 ee_start; /* low 32 bigs of physical block */ +}; + +/* + * this is index on-disk structure + * it's used at all the levels, but the bottom + */ +struct ext3_extent_idx { + __le32 ei_block; /* index covers logical blocks from 'block' */ + __le32 ei_leaf; /* pointer to the physical block of the next * + * level. leaf or next index could bet here */ + __le16 ei_leaf_hi; /* high 16 bits of physical block */ + __le16 ei_unused; +}; + +/* + * each block (leaves and indexes), even inode-stored has header + */ +struct ext3_extent_header { + __le16 eh_magic; /* probably will support different formats */ + __le16 eh_entries; /* number of valid entries */ + __le16 eh_max; /* capacity of store in entries */ + __le16 eh_depth; /* has tree real underlying blocks? */ + __le32 eh_generation; /* generation of the tree */ +}; + +#define EXT3_EXT_MAGIC 0xf30a + +/* + * array of ext3_ext_path contains path to some extent + * creation/lookup routines use it for traversal/splitting/etc + * truncate uses it to simulate recursive walking + */ +struct ext3_ext_path { + __u32 p_block; + __u16 p_depth; + struct ext3_extent *p_ext; + struct ext3_extent_idx *p_idx; + struct ext3_extent_header *p_hdr; + struct buffer_head *p_bh; +}; + +/* + * EXT_INIT_MAX_LEN is the maximum number of blocks we can have in an + * initialized extent. This is 2^15 and not (2^16 - 1), since we use the + * MSB of ee_len field in the extent datastructure to signify if this + * particular extent is an initialized extent or an uninitialized (i.e. + * preallocated). + * EXT_UNINIT_MAX_LEN is the maximum number of blocks we can have in an + * uninitialized extent. + * If ee_len is <= 0x8000, it is an initialized extent. Otherwise, it is an + * uninitialized one. In other words, if MSB of ee_len is set, it is an + * uninitialized extent with only one special scenario when ee_len = 0x8000. + * In this case we can not have an uninitialized extent of zero length and + * thus we make it as a special case of initialized extent with 0x8000 length. + * This way we get better extent-to-group alignment for initialized extents. + * Hence, the maximum number of blocks we can have in an *initialized* + * extent is 2^15 (32768) and in an *uninitialized* extent is 2^15-1 (32767). + */ +#define EXT_INIT_MAX_LEN (1UL << 15) +#define EXT_UNINIT_MAX_LEN (EXT_INIT_MAX_LEN - 1) +#define EXT_MAX_EXTENT_LBLK (((__u64) 1 << 32) - 1) +#define EXT_MAX_EXTENT_PBLK (((__u64) 1 << 48) - 1) + +#define EXT_FIRST_EXTENT(__hdr__) \ + ((struct ext3_extent *) (((char *) (__hdr__)) + \ + sizeof(struct ext3_extent_header))) +#define EXT_FIRST_INDEX(__hdr__) \ + ((struct ext3_extent_idx *) (((char *) (__hdr__)) + \ + sizeof(struct ext3_extent_header))) +#define EXT_HAS_FREE_INDEX(__path__) \ + (ext2fs_le16_to_cpu((__path__)->p_hdr->eh_entries) < \ + ext2fs_le16_to_cpu((__path__)->p_hdr->eh_max)) +#define EXT_LAST_EXTENT(__hdr__) \ + (EXT_FIRST_EXTENT((__hdr__)) + \ + ext2fs_le16_to_cpu((__hdr__)->eh_entries) - 1) +#define EXT_LAST_INDEX(__hdr__) \ + (EXT_FIRST_INDEX((__hdr__)) + \ + ext2fs_le16_to_cpu((__hdr__)->eh_entries) - 1) +#define EXT_MAX_EXTENT(__hdr__) \ + (EXT_FIRST_EXTENT((__hdr__)) + \ + ext2fs_le16_to_cpu((__hdr__)->eh_max) - 1) +#define EXT_MAX_INDEX(__hdr__) \ + (EXT_FIRST_INDEX((__hdr__)) + \ + ext2fs_le16_to_cpu((__hdr__)->eh_max) - 1) + +#endif /* _LINUX_EXT3_EXTENTS */ + diff --git a/lib/ext2fs/ext4_acl.h b/lib/ext2fs/ext4_acl.h new file mode 100644 index 0000000..8d4d974 --- /dev/null +++ b/lib/ext2fs/ext4_acl.h @@ -0,0 +1,62 @@ +/* + * Ext4's on-disk acl format. From linux/fs/ext4/acl.h + */ + +#define EXT4_ACL_VERSION 0x0001 + +/* 23.2.5 acl_tag_t values */ + +#define ACL_UNDEFINED_TAG (0x00) +#define ACL_USER_OBJ (0x01) +#define ACL_USER (0x02) +#define ACL_GROUP_OBJ (0x04) +#define ACL_GROUP (0x08) +#define ACL_MASK (0x10) +#define ACL_OTHER (0x20) + +/* 23.3.6 acl_type_t values */ + +#define ACL_TYPE_ACCESS (0x8000) +#define ACL_TYPE_DEFAULT (0x4000) + +/* 23.2.7 ACL qualifier constants */ + +#define ACL_UNDEFINED_ID ((id_t)-1) + +typedef struct { + __le16 e_tag; + __le16 e_perm; + __le32 e_id; + } ext4_acl_entry; + +typedef struct { + __le16 e_tag; + __le16 e_perm; +} ext4_acl_entry_short; + +typedef struct { + __le32 a_version; +} ext4_acl_header; + + +/* Supported ACL a_version fields */ + #define POSIX_ACL_XATTR_VERSION 0x0002 + +typedef struct { + __le16 e_tag; + __le16 e_perm; + __le32 e_id; +} posix_acl_xattr_entry; + +typedef struct { + __le32 a_version; +#if __GNUC_PREREQ (4, 8) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wpedantic" +#endif + posix_acl_xattr_entry a_entries[0]; +#if __GNUC_PREREQ (4, 8) +#pragma GCC diagnostic pop +#endif +} posix_acl_xattr_header; + diff --git a/lib/ext2fs/ext_attr.c b/lib/ext2fs/ext_attr.c new file mode 100644 index 0000000..3494046 --- /dev/null +++ b/lib/ext2fs/ext_attr.c @@ -0,0 +1,1784 @@ +/* + * ext_attr.c --- extended attribute blocks + * + * Copyright (C) 2001 Andreas Gruenbacher, <a.gruenbacher@computer.org> + * + * Copyright (C) 2002 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <string.h> +#include <time.h> + +#include "ext2_fs.h" +#include "ext2_ext_attr.h" +#include "ext4_acl.h" + +#include "ext2fs.h" + +static errcode_t read_ea_inode_hash(ext2_filsys fs, ext2_ino_t ino, __u32 *hash) +{ + struct ext2_inode inode; + errcode_t retval; + + retval = ext2fs_read_inode(fs, ino, &inode); + if (retval) + return retval; + *hash = ext2fs_get_ea_inode_hash(&inode); + return 0; +} + +#define NAME_HASH_SHIFT 5 +#define VALUE_HASH_SHIFT 16 + +/* + * ext2_xattr_hash_entry() + * + * Compute the hash of an extended attribute. + */ +__u32 ext2fs_ext_attr_hash_entry(struct ext2_ext_attr_entry *entry, void *data) +{ + __u32 hash = 0; + unsigned char *name = (((unsigned char *) entry) + + sizeof(struct ext2_ext_attr_entry)); + int n; + + for (n = 0; n < entry->e_name_len; n++) { + hash = (hash << NAME_HASH_SHIFT) ^ + (hash >> (8*sizeof(hash) - NAME_HASH_SHIFT)) ^ + *name++; + } + + /* The hash needs to be calculated on the data in little-endian. */ + if (entry->e_value_inum == 0 && entry->e_value_size != 0) { + __u32 *value = (__u32 *)data; + for (n = (entry->e_value_size + EXT2_EXT_ATTR_ROUND) >> + EXT2_EXT_ATTR_PAD_BITS; n; n--) { + hash = (hash << VALUE_HASH_SHIFT) ^ + (hash >> (8*sizeof(hash) - VALUE_HASH_SHIFT)) ^ + ext2fs_le32_to_cpu(*value++); + } + } + + return hash; +} + +__u32 ext2fs_ext_attr_hash_entry_signed(struct ext2_ext_attr_entry *entry, + void *data) +{ + __u32 hash = 0; + signed char *name = (((signed char *) entry) + + sizeof(struct ext2_ext_attr_entry)); + int n; + + for (n = 0; n < entry->e_name_len; n++) { + hash = (hash << NAME_HASH_SHIFT) ^ + (hash >> (8*sizeof(hash) - NAME_HASH_SHIFT)) ^ + *name++; + } + + /* The hash needs to be calculated on the data in little-endian. */ + if (entry->e_value_inum == 0 && entry->e_value_size != 0) { + __u32 *value = (__u32 *)data; + for (n = (entry->e_value_size + EXT2_EXT_ATTR_ROUND) >> + EXT2_EXT_ATTR_PAD_BITS; n; n--) { + hash = (hash << VALUE_HASH_SHIFT) ^ + (hash >> (8*sizeof(hash) - VALUE_HASH_SHIFT)) ^ + ext2fs_le32_to_cpu(*value++); + } + } + + return hash; +} + + +/* + * ext2fs_ext_attr_hash_entry3() + * + * Compute the hash of an extended attribute. This version of the + * function supports hashing entries that reference external inodes + * (ea_inode feature) as well as calculating the old legacy signed + * hash variant. + */ +errcode_t ext2fs_ext_attr_hash_entry3(ext2_filsys fs, + struct ext2_ext_attr_entry *entry, + void *data, __u32 *hash, + __u32 *signed_hash) +{ + *hash = ext2fs_ext_attr_hash_entry(entry, data); + if (signed_hash) + *signed_hash = ext2fs_ext_attr_hash_entry_signed(entry, data); + + if (entry->e_value_inum) { + __u32 ea_inode_hash; + errcode_t retval; + + retval = read_ea_inode_hash(fs, entry->e_value_inum, + &ea_inode_hash); + if (retval) + return retval; + + *hash = (*hash << VALUE_HASH_SHIFT) ^ + (*hash >> (8*sizeof(*hash) - VALUE_HASH_SHIFT)) ^ + ea_inode_hash; + if (signed_hash) + *signed_hash = (*signed_hash << VALUE_HASH_SHIFT) ^ + (*signed_hash >> (8*sizeof(*hash) - + VALUE_HASH_SHIFT)) ^ + ea_inode_hash; + } + return 0; +} + +/* + * ext2fs_ext_attr_hash_entry2() + * + * Compute the hash of an extended attribute. + * This version of the function supports hashing entries that reference + * external inodes (ea_inode feature). + */ +errcode_t ext2fs_ext_attr_hash_entry2(ext2_filsys fs, + struct ext2_ext_attr_entry *entry, + void *data, __u32 *hash) +{ + return ext2fs_ext_attr_hash_entry3(fs, entry, data, hash, NULL); +} + +#undef NAME_HASH_SHIFT +#undef VALUE_HASH_SHIFT + +#define BLOCK_HASH_SHIFT 16 + +/* Mirrors ext4_xattr_rehash() implementation in kernel. */ +void ext2fs_ext_attr_block_rehash(struct ext2_ext_attr_header *header, + struct ext2_ext_attr_entry *end) +{ + struct ext2_ext_attr_entry *here; + __u32 hash = 0; + + here = (struct ext2_ext_attr_entry *)(header+1); + while (here < end && !EXT2_EXT_IS_LAST_ENTRY(here)) { + if (!here->e_hash) { + /* Block is not shared if an entry's hash value == 0 */ + hash = 0; + break; + } + hash = (hash << BLOCK_HASH_SHIFT) ^ + (hash >> (8*sizeof(hash) - BLOCK_HASH_SHIFT)) ^ + here->e_hash; + here = EXT2_EXT_ATTR_NEXT(here); + } + header->h_hash = hash; +} + +#undef BLOCK_HASH_SHIFT + +__u32 ext2fs_get_ea_inode_hash(struct ext2_inode *inode) +{ + return inode->i_atime; +} + +void ext2fs_set_ea_inode_hash(struct ext2_inode *inode, __u32 hash) +{ + inode->i_atime = hash; +} + +__u64 ext2fs_get_ea_inode_ref(struct ext2_inode *inode) +{ + return ((__u64)inode->i_ctime << 32) | inode->osd1.linux1.l_i_version; +} + +void ext2fs_set_ea_inode_ref(struct ext2_inode *inode, __u64 ref_count) +{ + inode->i_ctime = (__u32)(ref_count >> 32); + inode->osd1.linux1.l_i_version = (__u32)ref_count; +} + +static errcode_t check_ext_attr_header(struct ext2_ext_attr_header *header) +{ + if ((header->h_magic != EXT2_EXT_ATTR_MAGIC_v1 && + header->h_magic != EXT2_EXT_ATTR_MAGIC) || + header->h_blocks != 1) + return EXT2_ET_BAD_EA_HEADER; + + return 0; +} + +errcode_t ext2fs_read_ext_attr3(ext2_filsys fs, blk64_t block, void *buf, + ext2_ino_t inum) +{ + int csum_failed = 0; + errcode_t retval; + + retval = io_channel_read_blk64(fs->io, block, 1, buf); + if (retval) + return retval; + + if (!(fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) && + !ext2fs_ext_attr_block_csum_verify(fs, inum, block, buf)) + csum_failed = 1; + +#ifdef WORDS_BIGENDIAN + ext2fs_swap_ext_attr(buf, buf, fs->blocksize, 1); +#endif + + retval = check_ext_attr_header(buf); + if (retval == 0 && csum_failed) + retval = EXT2_ET_EXT_ATTR_CSUM_INVALID; + + return retval; +} + +errcode_t ext2fs_read_ext_attr2(ext2_filsys fs, blk64_t block, void *buf) +{ + return ext2fs_read_ext_attr3(fs, block, buf, 0); +} + +errcode_t ext2fs_read_ext_attr(ext2_filsys fs, blk_t block, void *buf) +{ + return ext2fs_read_ext_attr2(fs, block, buf); +} + +errcode_t ext2fs_write_ext_attr3(ext2_filsys fs, blk64_t block, void *inbuf, + ext2_ino_t inum) +{ + errcode_t retval; + char *write_buf; + +#ifdef WORDS_BIGENDIAN + retval = ext2fs_get_mem(fs->blocksize, &write_buf); + if (retval) + return retval; + ext2fs_swap_ext_attr(write_buf, inbuf, fs->blocksize, 1); +#else + write_buf = (char *) inbuf; +#endif + + retval = ext2fs_ext_attr_block_csum_set(fs, inum, block, + (struct ext2_ext_attr_header *)write_buf); + if (retval) + return retval; + + retval = io_channel_write_blk64(fs->io, block, 1, write_buf); +#ifdef WORDS_BIGENDIAN + ext2fs_free_mem(&write_buf); +#endif + if (!retval) + ext2fs_mark_changed(fs); + return retval; +} + +errcode_t ext2fs_write_ext_attr2(ext2_filsys fs, blk64_t block, void *inbuf) +{ + return ext2fs_write_ext_attr3(fs, block, inbuf, 0); +} + +errcode_t ext2fs_write_ext_attr(ext2_filsys fs, blk_t block, void *inbuf) +{ + return ext2fs_write_ext_attr2(fs, block, inbuf); +} + +/* + * This function adjusts the reference count of the EA block. + */ +errcode_t ext2fs_adjust_ea_refcount3(ext2_filsys fs, blk64_t blk, + char *block_buf, int adjust, + __u32 *newcount, ext2_ino_t inum) +{ + errcode_t retval; + struct ext2_ext_attr_header *header; + char *buf = 0; + + if ((blk >= ext2fs_blocks_count(fs->super)) || + (blk < fs->super->s_first_data_block)) + return EXT2_ET_BAD_EA_BLOCK_NUM; + + if (!block_buf) { + retval = ext2fs_get_mem(fs->blocksize, &buf); + if (retval) + return retval; + block_buf = buf; + } + + retval = ext2fs_read_ext_attr3(fs, blk, block_buf, inum); + if (retval) + goto errout; + + header = (struct ext2_ext_attr_header *) block_buf; + header->h_refcount += adjust; + if (newcount) + *newcount = header->h_refcount; + + retval = ext2fs_write_ext_attr3(fs, blk, block_buf, inum); + if (retval) + goto errout; + +errout: + if (buf) + ext2fs_free_mem(&buf); + return retval; +} + +errcode_t ext2fs_adjust_ea_refcount2(ext2_filsys fs, blk64_t blk, + char *block_buf, int adjust, + __u32 *newcount) +{ + return ext2fs_adjust_ea_refcount3(fs, blk, block_buf, adjust, + newcount, 0); +} + +errcode_t ext2fs_adjust_ea_refcount(ext2_filsys fs, blk_t blk, + char *block_buf, int adjust, + __u32 *newcount) +{ + return ext2fs_adjust_ea_refcount2(fs, blk, block_buf, adjust, + newcount); +} + +/* Manipulate the contents of extended attribute regions */ +struct ext2_xattr { + int name_index; + char *name; + char *short_name; + void *value; + unsigned int value_len; + ext2_ino_t ea_ino; +}; + +struct ext2_xattr_handle { + errcode_t magic; + ext2_filsys fs; + struct ext2_xattr *attrs; + int capacity; + int count; + int ibody_count; + ext2_ino_t ino; + unsigned int flags; +}; + +static errcode_t ext2fs_xattrs_expand(struct ext2_xattr_handle *h, + unsigned int expandby) +{ + struct ext2_xattr *new_attrs; + errcode_t err; + + err = ext2fs_get_arrayzero(h->capacity + expandby, + sizeof(struct ext2_xattr), &new_attrs); + if (err) + return err; + + memcpy(new_attrs, h->attrs, h->capacity * sizeof(struct ext2_xattr)); + ext2fs_free_mem(&h->attrs); + h->capacity += expandby; + h->attrs = new_attrs; + + return 0; +} + +struct ea_name_index { + int index; + const char *name; +}; + +/* Keep these names sorted in order of decreasing specificity. */ +static struct ea_name_index ea_names[] = { + {10, "gnu."}, + {3, "system.posix_acl_default"}, + {2, "system.posix_acl_access"}, + {8, "system.richacl"}, + {6, "security."}, + {4, "trusted."}, + {7, "system."}, + {1, "user."}, + {0, NULL}, +}; + +static const char *find_ea_prefix(int index) +{ + struct ea_name_index *e; + + for (e = ea_names; e->name; e++) + if (e->index == index) + return e->name; + + return NULL; +} + +static int find_ea_index(const char *fullname, const char **name, int *index) +{ + struct ea_name_index *e; + + for (e = ea_names; e->name; e++) { + if (strncmp(fullname, e->name, strlen(e->name)) == 0) { + *name = fullname + strlen(e->name); + *index = e->index; + return 1; + } + } + return 0; +} + +errcode_t ext2fs_free_ext_attr(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode_large *inode) +{ + struct ext2_ext_attr_header *header; + void *block_buf = NULL; + blk64_t blk; + errcode_t err; + struct ext2_inode_large i; + + /* Read inode? */ + if (inode == NULL) { + err = ext2fs_read_inode_full(fs, ino, (struct ext2_inode *)&i, + sizeof(struct ext2_inode_large)); + if (err) + return err; + inode = &i; + } + + /* Do we already have an EA block? */ + blk = ext2fs_file_acl_block(fs, (struct ext2_inode *)inode); + if (blk == 0) + return 0; + + /* Find block, zero it, write back */ + if ((blk < fs->super->s_first_data_block) || + (blk >= ext2fs_blocks_count(fs->super))) { + err = EXT2_ET_BAD_EA_BLOCK_NUM; + goto out; + } + + err = ext2fs_get_mem(fs->blocksize, &block_buf); + if (err) + goto out; + + err = ext2fs_read_ext_attr3(fs, blk, block_buf, ino); + if (err) + goto out2; + + /* We only know how to deal with v2 EA blocks */ + header = (struct ext2_ext_attr_header *) block_buf; + if (header->h_magic != EXT2_EXT_ATTR_MAGIC) { + err = EXT2_ET_BAD_EA_HEADER; + goto out2; + } + + header->h_refcount--; + err = ext2fs_write_ext_attr3(fs, blk, block_buf, ino); + if (err) + goto out2; + + /* Erase link to block */ + ext2fs_file_acl_block_set(fs, (struct ext2_inode *)inode, 0); + if (header->h_refcount == 0) + ext2fs_block_alloc_stats2(fs, blk, -1); + err = ext2fs_iblk_sub_blocks(fs, (struct ext2_inode *)inode, 1); + if (err) + goto out2; + + /* Write inode? */ + if (inode == &i) { + err = ext2fs_write_inode_full(fs, ino, (struct ext2_inode *)&i, + sizeof(struct ext2_inode_large)); + if (err) + goto out2; + } + +out2: + ext2fs_free_mem(&block_buf); +out: + return err; +} + +static errcode_t prep_ea_block_for_write(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode_large *inode) +{ + struct ext2_ext_attr_header *header; + void *block_buf = NULL; + blk64_t blk, goal; + errcode_t err; + + /* Do we already have an EA block? */ + blk = ext2fs_file_acl_block(fs, (struct ext2_inode *)inode); + if (blk != 0) { + if ((blk < fs->super->s_first_data_block) || + (blk >= ext2fs_blocks_count(fs->super))) { + err = EXT2_ET_BAD_EA_BLOCK_NUM; + goto out; + } + + err = ext2fs_get_mem(fs->blocksize, &block_buf); + if (err) + goto out; + + err = ext2fs_read_ext_attr3(fs, blk, block_buf, ino); + if (err) + goto out2; + + /* We only know how to deal with v2 EA blocks */ + header = (struct ext2_ext_attr_header *) block_buf; + if (header->h_magic != EXT2_EXT_ATTR_MAGIC) { + err = EXT2_ET_BAD_EA_HEADER; + goto out2; + } + + /* Single-user block. We're done here. */ + if (header->h_refcount == 1) + goto out2; + + /* We need to CoW the block. */ + header->h_refcount--; + err = ext2fs_write_ext_attr3(fs, blk, block_buf, ino); + if (err) + goto out2; + } else { + /* No block, we must increment i_blocks */ + err = ext2fs_iblk_add_blocks(fs, (struct ext2_inode *)inode, + 1); + if (err) + goto out; + } + + /* Allocate a block */ + goal = ext2fs_find_inode_goal(fs, ino, (struct ext2_inode *)inode, 0); + err = ext2fs_alloc_block2(fs, goal, NULL, &blk); + if (err) + goto out2; + ext2fs_file_acl_block_set(fs, (struct ext2_inode *)inode, blk); +out2: + if (block_buf) + ext2fs_free_mem(&block_buf); +out: + return err; +} + + +static inline int +posix_acl_xattr_count(size_t size) +{ + if (size < sizeof(posix_acl_xattr_header)) + return -1; + size -= sizeof(posix_acl_xattr_header); + if (size % sizeof(posix_acl_xattr_entry)) + return -1; + return size / sizeof(posix_acl_xattr_entry); +} + +/* + * The lgetxattr function returns data formatted in the POSIX extended + * attribute format. The on-disk format uses a more compact encoding. + * See the ext4_acl_to_disk in fs/ext4/acl.c. + */ +static errcode_t convert_posix_acl_to_disk_buffer(const void *value, size_t size, + void *out_buf, size_t *size_out) +{ + const posix_acl_xattr_header *header = + (const posix_acl_xattr_header*) value; + const posix_acl_xattr_entry *end, *entry = + (const posix_acl_xattr_entry *)(header+1); + ext4_acl_header *ext_acl; + size_t s; + char *e; + + int count; + + if (!value) + return EINVAL; + if (size < sizeof(posix_acl_xattr_header)) + return ENOMEM; + if (header->a_version != ext2fs_cpu_to_le32(POSIX_ACL_XATTR_VERSION)) + return EINVAL; + + count = posix_acl_xattr_count(size); + ext_acl = out_buf; + ext_acl->a_version = ext2fs_cpu_to_le32(EXT4_ACL_VERSION); + + if (count <= 0) + return EINVAL; + + e = (char *) out_buf + sizeof(ext4_acl_header); + s = sizeof(ext4_acl_header); + for (end = entry + count; entry != end;entry++) { + ext4_acl_entry *disk_entry = (ext4_acl_entry*) e; + disk_entry->e_tag = entry->e_tag; + disk_entry->e_perm = entry->e_perm; + + switch(ext2fs_le16_to_cpu(entry->e_tag)) { + case ACL_USER_OBJ: + case ACL_GROUP_OBJ: + case ACL_MASK: + case ACL_OTHER: + e += sizeof(ext4_acl_entry_short); + s += sizeof(ext4_acl_entry_short); + break; + case ACL_USER: + case ACL_GROUP: + disk_entry->e_id = entry->e_id; + e += sizeof(ext4_acl_entry); + s += sizeof(ext4_acl_entry); + break; + default: + return EINVAL; + } + } + *size_out = s; + return 0; +} + +static errcode_t convert_disk_buffer_to_posix_acl(const void *value, size_t size, + void **out_buf, size_t *size_out) +{ + posix_acl_xattr_header *header; + posix_acl_xattr_entry *entry; + const ext4_acl_header *ext_acl = (const ext4_acl_header *) value; + errcode_t err; + const char *cp; + char *out; + + if ((!value) || + (size < sizeof(ext4_acl_header)) || + (ext_acl->a_version != ext2fs_cpu_to_le32(EXT4_ACL_VERSION))) + return EINVAL; + + err = ext2fs_get_mem(size * 2, &out); + if (err) + return err; + + header = (posix_acl_xattr_header *) out; + header->a_version = ext2fs_cpu_to_le32(POSIX_ACL_XATTR_VERSION); + entry = (posix_acl_xattr_entry *) (out + sizeof(posix_acl_xattr_header)); + + cp = (const char *) value + sizeof(ext4_acl_header); + size -= sizeof(ext4_acl_header); + + while (size > 0) { + const ext4_acl_entry *disk_entry = (const ext4_acl_entry *) cp; + + entry->e_tag = disk_entry->e_tag; + entry->e_perm = disk_entry->e_perm; + + switch(ext2fs_le16_to_cpu(entry->e_tag)) { + case ACL_USER_OBJ: + case ACL_GROUP_OBJ: + case ACL_MASK: + case ACL_OTHER: + entry->e_id = 0; + cp += sizeof(ext4_acl_entry_short); + size -= sizeof(ext4_acl_entry_short); + break; + case ACL_USER: + case ACL_GROUP: + entry->e_id = disk_entry->e_id; + cp += sizeof(ext4_acl_entry); + size -= sizeof(ext4_acl_entry); + break; + default: + ext2fs_free_mem(&out); + return EINVAL; + } + entry++; + } + *out_buf = out; + *size_out = ((char *) entry - out); + return 0; +} + +static errcode_t +write_xattrs_to_buffer(ext2_filsys fs, struct ext2_xattr *attrs, int count, + void *entries_start, unsigned int storage_size, + unsigned int value_offset_correction, int write_hash) +{ + struct ext2_xattr *x; + struct ext2_ext_attr_entry *e = entries_start; + char *end = (char *) entries_start + storage_size; + unsigned int value_size; + errcode_t err; + + memset(entries_start, 0, storage_size); + for (x = attrs; x < attrs + count; x++) { + value_size = ((x->value_len + EXT2_EXT_ATTR_PAD - 1) / + EXT2_EXT_ATTR_PAD) * EXT2_EXT_ATTR_PAD; + + /* Fill out e appropriately */ + e->e_name_len = strlen(x->short_name); + e->e_name_index = x->name_index; + + e->e_value_size = x->value_len; + e->e_value_inum = x->ea_ino; + + /* Store name */ + memcpy((char *)e + sizeof(*e), x->short_name, e->e_name_len); + if (x->ea_ino) { + e->e_value_offs = 0; + } else { + end -= value_size; + e->e_value_offs = end - (char *) entries_start + + value_offset_correction; + memcpy(end, x->value, e->e_value_size); + } + + if (write_hash || x->ea_ino) { + err = ext2fs_ext_attr_hash_entry2(fs, e, + x->ea_ino ? 0 : end, + &e->e_hash); + if (err) + return err; + } else + e->e_hash = 0; + + e = EXT2_EXT_ATTR_NEXT(e); + *(__u32 *)e = 0; + } + return 0; +} + +errcode_t ext2fs_xattrs_write(struct ext2_xattr_handle *handle) +{ + ext2_filsys fs = handle->fs; + const unsigned int inode_size = EXT2_INODE_SIZE(fs->super); + struct ext2_inode_large *inode; + char *start, *block_buf = NULL; + struct ext2_ext_attr_header *header; + __u32 ea_inode_magic; + blk64_t blk; + unsigned int storage_size; + unsigned int i; + errcode_t err; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE); + i = inode_size; + if (i < sizeof(*inode)) + i = sizeof(*inode); + err = ext2fs_get_memzero(i, &inode); + if (err) + return err; + + err = ext2fs_read_inode_full(fs, handle->ino, EXT2_INODE(inode), + inode_size); + if (err) + goto out; + + /* If extra_isize isn't set, we need to set it now */ + if (inode->i_extra_isize == 0 && + inode_size > EXT2_GOOD_OLD_INODE_SIZE) { + char *p = (char *)inode; + size_t extra = fs->super->s_want_extra_isize; + + if (extra == 0) + extra = sizeof(__u32); + memset(p + EXT2_GOOD_OLD_INODE_SIZE, 0, extra); + inode->i_extra_isize = extra; + } + if (inode->i_extra_isize & 3) { + err = EXT2_ET_INODE_CORRUPTED; + goto out; + } + + /* Does the inode have space for EA? */ + if (inode->i_extra_isize < sizeof(inode->i_extra_isize) || + inode_size <= EXT2_GOOD_OLD_INODE_SIZE + inode->i_extra_isize + + sizeof(__u32)) + goto write_ea_block; + + /* Write the inode EA */ + ea_inode_magic = EXT2_EXT_ATTR_MAGIC; + memcpy(((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE + + inode->i_extra_isize, &ea_inode_magic, sizeof(__u32)); + storage_size = inode_size - EXT2_GOOD_OLD_INODE_SIZE - + inode->i_extra_isize - sizeof(__u32); + start = ((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE + + inode->i_extra_isize + sizeof(__u32); + + err = write_xattrs_to_buffer(fs, handle->attrs, handle->ibody_count, + start, storage_size, 0, 0); + if (err) + goto out; +write_ea_block: + /* Are we done? */ + if (handle->ibody_count == handle->count && + !ext2fs_file_acl_block(fs, EXT2_INODE(inode))) + goto skip_ea_block; + + /* Write the EA block */ + err = ext2fs_get_memzero(fs->blocksize, &block_buf); + if (err) + goto out; + + storage_size = fs->blocksize - sizeof(struct ext2_ext_attr_header); + start = block_buf + sizeof(struct ext2_ext_attr_header); + + err = write_xattrs_to_buffer(fs, handle->attrs + handle->ibody_count, + handle->count - handle->ibody_count, start, + storage_size, start - block_buf, 1); + if (err) + goto out2; + + /* Write a header on the EA block */ + header = (struct ext2_ext_attr_header *) block_buf; + header->h_magic = EXT2_EXT_ATTR_MAGIC; + header->h_refcount = 1; + header->h_blocks = 1; + + /* Get a new block for writing */ + err = prep_ea_block_for_write(fs, handle->ino, inode); + if (err) + goto out2; + + /* Finally, write the new EA block */ + blk = ext2fs_file_acl_block(fs, EXT2_INODE(inode)); + err = ext2fs_write_ext_attr3(fs, blk, block_buf, handle->ino); + if (err) + goto out2; + +skip_ea_block: + blk = ext2fs_file_acl_block(fs, (struct ext2_inode *)inode); + if (!block_buf && blk) { + /* xattrs shrunk, free the block */ + err = ext2fs_free_ext_attr(fs, handle->ino, inode); + if (err) + goto out; + } + + /* Write the inode */ + err = ext2fs_write_inode_full(fs, handle->ino, EXT2_INODE(inode), + inode_size); + if (err) + goto out2; + +out2: + ext2fs_free_mem(&block_buf); +out: + ext2fs_free_mem(&inode); + return err; +} + +static errcode_t read_xattrs_from_buffer(struct ext2_xattr_handle *handle, + struct ext2_inode_large *inode, + struct ext2_ext_attr_entry *entries, + unsigned int storage_size, + char *value_start) +{ + struct ext2_xattr *x; + struct ext2_ext_attr_entry *entry, *end; + const char *prefix; + unsigned int remain, prefix_len; + errcode_t err; + unsigned int values_size = storage_size + + ((char *)entries - value_start); + + /* find the end */ + end = entries; + remain = storage_size; + while (remain >= sizeof(struct ext2_ext_attr_entry) && + !EXT2_EXT_IS_LAST_ENTRY(end)) { + + /* header eats this space */ + remain -= sizeof(struct ext2_ext_attr_entry); + + /* is attribute name valid? */ + if (EXT2_EXT_ATTR_SIZE(end->e_name_len) > remain) + return EXT2_ET_EA_BAD_NAME_LEN; + + /* attribute len eats this space */ + remain -= EXT2_EXT_ATTR_SIZE(end->e_name_len); + end = EXT2_EXT_ATTR_NEXT(end); + } + + entry = entries; + remain = storage_size; + while (remain >= sizeof(struct ext2_ext_attr_entry) && + !EXT2_EXT_IS_LAST_ENTRY(entry)) { + + /* Allocate space for more attrs? */ + if (handle->count == handle->capacity) { + err = ext2fs_xattrs_expand(handle, 4); + if (err) + return err; + } + + x = handle->attrs + handle->count; + + /* header eats this space */ + remain -= sizeof(struct ext2_ext_attr_entry); + + /* attribute len eats this space */ + remain -= EXT2_EXT_ATTR_SIZE(entry->e_name_len); + + /* Extract name */ + prefix = find_ea_prefix(entry->e_name_index); + prefix_len = (prefix ? strlen(prefix) : 0); + err = ext2fs_get_memzero(entry->e_name_len + prefix_len + 1, + &x->name); + if (err) + return err; + if (prefix) + memcpy(x->name, prefix, prefix_len); + if (entry->e_name_len) + memcpy(x->name + prefix_len, + (char *)entry + sizeof(*entry), + entry->e_name_len); + x->short_name = x->name + prefix_len; + x->name_index = entry->e_name_index; + + /* Check & copy value */ + if (!ext2fs_has_feature_ea_inode(handle->fs->super) && + entry->e_value_inum != 0) + return EXT2_ET_BAD_EA_BLOCK_NUM; + + if (entry->e_value_inum == 0) { + if (entry->e_value_size > remain) + return EXT2_ET_EA_BAD_VALUE_SIZE; + + if (entry->e_value_offs + entry->e_value_size > values_size) + return EXT2_ET_EA_BAD_VALUE_OFFSET; + + if (entry->e_value_size > 0 && + value_start + entry->e_value_offs < + (char *)end + sizeof(__u32)) + return EXT2_ET_EA_BAD_VALUE_OFFSET; + + remain -= entry->e_value_size; + + err = ext2fs_get_mem(entry->e_value_size, &x->value); + if (err) + return err; + memcpy(x->value, value_start + entry->e_value_offs, + entry->e_value_size); + } else { + struct ext2_inode *ea_inode; + ext2_file_t ea_file; + + if (entry->e_value_offs != 0) + return EXT2_ET_EA_BAD_VALUE_OFFSET; + + if (entry->e_value_size > (64 * 1024)) + return EXT2_ET_EA_BAD_VALUE_SIZE; + + err = ext2fs_get_mem(entry->e_value_size, &x->value); + if (err) + return err; + + err = ext2fs_file_open(handle->fs, entry->e_value_inum, + 0, &ea_file); + if (err) + return err; + + ea_inode = ext2fs_file_get_inode(ea_file); + if ((ea_inode->i_flags & EXT4_INLINE_DATA_FL) || + !(ea_inode->i_flags & EXT4_EA_INODE_FL) || + ea_inode->i_links_count == 0) + err = EXT2_ET_EA_INODE_CORRUPTED; + else if ((__u64) ext2fs_file_get_size(ea_file) != + entry->e_value_size) + err = EXT2_ET_EA_BAD_VALUE_SIZE; + else + err = ext2fs_file_read(ea_file, x->value, + entry->e_value_size, 0); + ext2fs_file_close(ea_file); + if (err) + return err; + } + + x->ea_ino = entry->e_value_inum; + x->value_len = entry->e_value_size; + + /* e_hash may be 0 in older inode's ea */ + if (entry->e_hash != 0) { + __u32 hash, signed_hash; + + void *data = (entry->e_value_inum != 0) ? + 0 : value_start + entry->e_value_offs; + + err = ext2fs_ext_attr_hash_entry3(handle->fs, entry, + data, &hash, + &signed_hash); + if (err) + return err; + if ((entry->e_hash != hash) && + (entry->e_hash != signed_hash)) { + struct ext2_inode child; + + /* Check whether this is an old Lustre-style + * ea_inode reference. + */ + err = ext2fs_read_inode(handle->fs, + entry->e_value_inum, + &child); + if (err) + return err; + if (child.i_mtime != handle->ino || + child.i_generation != inode->i_generation) + return EXT2_ET_BAD_EA_HASH; + } + } + + handle->count++; + entry = EXT2_EXT_ATTR_NEXT(entry); + } + + return 0; +} + +static void xattrs_free_keys(struct ext2_xattr_handle *h) +{ + struct ext2_xattr *a = h->attrs; + int i; + + for (i = 0; i < h->capacity; i++) { + if (a[i].name) + ext2fs_free_mem(&a[i].name); + if (a[i].value) + ext2fs_free_mem(&a[i].value); + } + h->count = 0; + h->ibody_count = 0; +} + +/* fetch xattrs from an already-loaded inode */ +errcode_t ext2fs_xattrs_read_inode(struct ext2_xattr_handle *handle, + struct ext2_inode_large *inode) +{ + struct ext2_ext_attr_header *header; + __u32 ea_inode_magic; + unsigned int storage_size; + char *start, *block_buf = NULL; + blk64_t blk; + errcode_t err = 0; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE); + + xattrs_free_keys(handle); + + /* Does the inode have space for EA? */ + if (inode->i_extra_isize < sizeof(inode->i_extra_isize) || + EXT2_INODE_SIZE(handle->fs->super) <= EXT2_GOOD_OLD_INODE_SIZE + + inode->i_extra_isize + + sizeof(__u32)) + goto read_ea_block; + if (inode->i_extra_isize & 3) { + err = EXT2_ET_INODE_CORRUPTED; + goto out; + } + + /* Look for EA in the inode */ + memcpy(&ea_inode_magic, ((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE + + inode->i_extra_isize, sizeof(__u32)); + if (ea_inode_magic == EXT2_EXT_ATTR_MAGIC) { + storage_size = EXT2_INODE_SIZE(handle->fs->super) - + EXT2_GOOD_OLD_INODE_SIZE - inode->i_extra_isize - + sizeof(__u32); + start = ((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE + + inode->i_extra_isize + sizeof(__u32); + + err = read_xattrs_from_buffer(handle, inode, + (struct ext2_ext_attr_entry *) start, + storage_size, start); + if (err) + goto out; + + handle->ibody_count = handle->count; + } + +read_ea_block: + /* Look for EA in a separate EA block */ + blk = ext2fs_file_acl_block(handle->fs, EXT2_INODE(inode)); + if (blk != 0) { + if ((blk < handle->fs->super->s_first_data_block) || + (blk >= ext2fs_blocks_count(handle->fs->super))) { + err = EXT2_ET_BAD_EA_BLOCK_NUM; + goto out; + } + + err = ext2fs_get_mem(handle->fs->blocksize, &block_buf); + if (err) + goto out; + + err = ext2fs_read_ext_attr3(handle->fs, blk, block_buf, + handle->ino); + if (err) + goto out3; + + /* We only know how to deal with v2 EA blocks */ + header = (struct ext2_ext_attr_header *) block_buf; + if (header->h_magic != EXT2_EXT_ATTR_MAGIC) { + err = EXT2_ET_BAD_EA_HEADER; + goto out3; + } + + /* Read EAs */ + storage_size = handle->fs->blocksize - + sizeof(struct ext2_ext_attr_header); + start = block_buf + sizeof(struct ext2_ext_attr_header); + err = read_xattrs_from_buffer(handle, inode, + (struct ext2_ext_attr_entry *) start, + storage_size, block_buf); + } + +out3: + if (block_buf) + ext2fs_free_mem(&block_buf); +out: + return err; +} + +errcode_t ext2fs_xattrs_read(struct ext2_xattr_handle *handle) +{ + struct ext2_inode_large *inode; + size_t inode_size = EXT2_INODE_SIZE(handle->fs->super); + errcode_t err; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE); + + if (inode_size < sizeof(*inode)) + inode_size = sizeof(*inode); + err = ext2fs_get_memzero(inode_size, &inode); + if (err) + return err; + + err = ext2fs_read_inode_full(handle->fs, handle->ino, EXT2_INODE(inode), + EXT2_INODE_SIZE(handle->fs->super)); + if (err) + goto out; + + err = ext2fs_xattrs_read_inode(handle, inode); + +out: + ext2fs_free_mem(&inode); + + return err; +} + +errcode_t ext2fs_xattrs_iterate(struct ext2_xattr_handle *h, + int (*func)(char *name, char *value, + size_t value_len, void *data), + void *data) +{ + struct ext2_xattr *x; + int dirty = 0; + int ret; + + EXT2_CHECK_MAGIC(h, EXT2_ET_MAGIC_EA_HANDLE); + for (x = h->attrs; x < h->attrs + h->count; x++) { + ret = func(x->name, x->value, x->value_len, data); + if (ret & XATTR_CHANGED) + dirty = 1; + if (ret & XATTR_ABORT) + break; + } + + if (dirty) + return ext2fs_xattrs_write(h); + return 0; +} + +errcode_t ext2fs_xattr_get(struct ext2_xattr_handle *h, const char *key, + void **value, size_t *value_len) +{ + struct ext2_xattr *x; + char *val; + errcode_t err; + + EXT2_CHECK_MAGIC(h, EXT2_ET_MAGIC_EA_HANDLE); + for (x = h->attrs; x < h->attrs + h->count; x++) { + if (strcmp(x->name, key)) + continue; + + if (!(h->flags & XATTR_HANDLE_FLAG_RAW) && + ((strcmp(key, "system.posix_acl_default") == 0) || + (strcmp(key, "system.posix_acl_access") == 0))) { + err = convert_disk_buffer_to_posix_acl(x->value, x->value_len, + value, value_len); + return err; + } else { + err = ext2fs_get_mem(x->value_len, &val); + if (err) + return err; + memcpy(val, x->value, x->value_len); + *value = val; + *value_len = x->value_len; + return 0; + } + } + + return EXT2_ET_EA_KEY_NOT_FOUND; +} + +errcode_t ext2fs_xattr_inode_max_size(ext2_filsys fs, ext2_ino_t ino, + size_t *size) +{ + struct ext2_ext_attr_entry *entry; + struct ext2_inode_large *inode; + __u32 ea_inode_magic; + unsigned int minoff; + char *start; + size_t i; + errcode_t err; + + i = EXT2_INODE_SIZE(fs->super); + if (i < sizeof(*inode)) + i = sizeof(*inode); + err = ext2fs_get_memzero(i, &inode); + if (err) + return err; + + err = ext2fs_read_inode_full(fs, ino, (struct ext2_inode *)inode, + EXT2_INODE_SIZE(fs->super)); + if (err) + goto out; + + /* Does the inode have size for EA? */ + if (EXT2_INODE_SIZE(fs->super) <= EXT2_GOOD_OLD_INODE_SIZE + + inode->i_extra_isize + + sizeof(__u32)) { + err = EXT2_ET_INLINE_DATA_NO_SPACE; + goto out; + } + + minoff = EXT2_INODE_SIZE(fs->super) - sizeof(*inode) - sizeof(__u32); + memcpy(&ea_inode_magic, ((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE + + inode->i_extra_isize, sizeof(__u32)); + if (ea_inode_magic == EXT2_EXT_ATTR_MAGIC) { + /* has xattrs. calculate the size */ + start= ((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE + + inode->i_extra_isize + sizeof(__u32); + entry = (struct ext2_ext_attr_entry *) start; + while (!EXT2_EXT_IS_LAST_ENTRY(entry)) { + if (!entry->e_value_inum && entry->e_value_size) { + unsigned int offs = entry->e_value_offs; + if (offs < minoff) + minoff = offs; + } + entry = EXT2_EXT_ATTR_NEXT(entry); + } + *size = minoff - ((char *)entry - (char *)start) - sizeof(__u32); + } else { + /* no xattr. return a maximum size */ + *size = EXT2_EXT_ATTR_SIZE(minoff - + EXT2_EXT_ATTR_LEN(strlen("data")) - + EXT2_EXT_ATTR_ROUND - sizeof(__u32)); + } + +out: + ext2fs_free_mem(&inode); + return err; +} + +static errcode_t xattr_create_ea_inode(ext2_filsys fs, const void *value, + size_t value_len, ext2_ino_t *ea_ino) +{ + struct ext2_inode inode; + ext2_ino_t ino; + ext2_file_t file; + __u32 hash; + errcode_t ret; + + ret = ext2fs_new_inode(fs, 0, 0, 0, &ino); + if (ret) + return ret; + + memset(&inode, 0, sizeof(inode)); + inode.i_flags |= EXT4_EA_INODE_FL; + if (ext2fs_has_feature_extents(fs->super)) + inode.i_flags |= EXT4_EXTENTS_FL; + inode.i_size = 0; + inode.i_mode = LINUX_S_IFREG | 0600; + inode.i_links_count = 1; + ret = ext2fs_write_new_inode(fs, ino, &inode); + if (ret) + return ret; + /* + * ref_count and hash utilize inode's i_*time fields. + * ext2fs_write_new_inode() call above initializes these fields with + * current time. That's why ref count and hash updates are done + * separately below. + */ + ext2fs_set_ea_inode_ref(&inode, 1); + hash = ext2fs_crc32c_le(fs->csum_seed, value, value_len); + ext2fs_set_ea_inode_hash(&inode, hash); + + ret = ext2fs_write_inode(fs, ino, &inode); + if (ret) + return ret; + + ret = ext2fs_file_open(fs, ino, EXT2_FILE_WRITE, &file); + if (ret) + return ret; + ret = ext2fs_file_write(file, value, value_len, NULL); + ext2fs_file_close(file); + if (ret) + return ret; + + ext2fs_inode_alloc_stats2(fs, ino, 1 /* inuse */, 0 /* isdir */); + + *ea_ino = ino; + return 0; +} + +static errcode_t xattr_inode_dec_ref(ext2_filsys fs, ext2_ino_t ino) +{ + struct ext2_inode_large inode; + __u64 ref_count; + errcode_t ret; + + ret = ext2fs_read_inode_full(fs, ino, (struct ext2_inode *)&inode, + sizeof(inode)); + if (ret) + goto out; + + ref_count = ext2fs_get_ea_inode_ref(EXT2_INODE(&inode)); + ref_count--; + ext2fs_set_ea_inode_ref(EXT2_INODE(&inode), ref_count); + + if (ref_count) + goto write_out; + + inode.i_links_count = 0; + inode.i_dtime = fs->now ? fs->now : time(0); + + ret = ext2fs_free_ext_attr(fs, ino, &inode); + if (ret) + goto write_out; + + if (ext2fs_inode_has_valid_blocks2(fs, (struct ext2_inode *)&inode)) { + ret = ext2fs_punch(fs, ino, (struct ext2_inode *)&inode, NULL, + 0, ~0ULL); + if (ret) + goto out; + } + + ext2fs_inode_alloc_stats2(fs, ino, -1 /* inuse */, 0 /* is_dir */); + +write_out: + ret = ext2fs_write_inode_full(fs, ino, (struct ext2_inode *)&inode, + sizeof(inode)); +out: + return ret; +} + +static errcode_t xattr_update_entry(ext2_filsys fs, struct ext2_xattr *x, + const char *name, const char *short_name, + int index, const void *value, + size_t value_len, int in_inode) +{ + ext2_ino_t ea_ino = 0; + void *new_value = NULL; + char *new_name = NULL; + int name_len; + errcode_t ret; + + if (!x->name) { + name_len = strlen(name); + ret = ext2fs_get_mem(name_len + 1, &new_name); + if (ret) + goto fail; + memcpy(new_name, name, name_len + 1); + } + + ret = ext2fs_get_mem(value_len, &new_value); + if (ret) + goto fail; + memcpy(new_value, value, value_len); + + if (in_inode) { + ret = xattr_create_ea_inode(fs, value, value_len, &ea_ino); + if (ret) + goto fail; + } + + if (x->ea_ino) { + ret = xattr_inode_dec_ref(fs, x->ea_ino); + if (ret) + goto fail; + } + + if (!x->name) { + x->name = new_name; + x->short_name = new_name + (short_name - name); + } + x->name_index = index; + + if (x->value) + ext2fs_free_mem(&x->value); + x->value = new_value; + x->value_len = value_len; + x->ea_ino = ea_ino; + return 0; +fail: + if (new_name) + ext2fs_free_mem(&new_name); + if (new_value) + ext2fs_free_mem(&new_value); + if (ea_ino) + xattr_inode_dec_ref(fs, ea_ino); + return ret; +} + +static int xattr_find_position(struct ext2_xattr *attrs, int count, + const char *shortname, int name_idx) +{ + struct ext2_xattr *x; + int i; + int shortname_len, x_shortname_len; + + shortname_len = strlen(shortname); + + for (i = 0, x = attrs; i < count; i++, x++) { + if (name_idx < x->name_index) + break; + if (name_idx > x->name_index) + continue; + + x_shortname_len = strlen(x->short_name); + if (shortname_len < x_shortname_len) + break; + if (shortname_len > x_shortname_len) + continue; + + if (memcmp(shortname, x->short_name, shortname_len) <= 0) + break; + } + return i; +} + +static errcode_t xattr_array_update(struct ext2_xattr_handle *h, + const char *name, + const void *value, size_t value_len, + int ibody_free, int block_free, + int old_idx, int in_inode) +{ + struct ext2_xattr tmp; + int add_to_ibody; + int needed; + int name_len, name_idx = 0; + const char *shortname = name; + int new_idx; + int ret; + + find_ea_index(name, &shortname, &name_idx); + name_len = strlen(shortname); + + needed = EXT2_EXT_ATTR_LEN(name_len); + if (!in_inode) + needed += EXT2_EXT_ATTR_SIZE(value_len); + + if (old_idx >= 0 && old_idx < h->ibody_count) { + ibody_free += EXT2_EXT_ATTR_LEN(name_len); + if (!h->attrs[old_idx].ea_ino) + ibody_free += EXT2_EXT_ATTR_SIZE( + h->attrs[old_idx].value_len); + } + + if (needed <= ibody_free) { + if (old_idx < 0) { + new_idx = h->ibody_count; + add_to_ibody = 1; + goto add_new; + } + + /* Update the existing entry. */ + ret = xattr_update_entry(h->fs, &h->attrs[old_idx], name, + shortname, name_idx, value, + value_len, in_inode); + if (ret) + return ret; + if (h->ibody_count <= old_idx) { + /* Move entry from block to the end of ibody. */ + tmp = h->attrs[old_idx]; + memmove(h->attrs + h->ibody_count + 1, + h->attrs + h->ibody_count, + (old_idx - h->ibody_count) * sizeof(*h->attrs)); + h->attrs[h->ibody_count] = tmp; + h->ibody_count++; + } + return 0; + } + + if (h->ibody_count <= old_idx) { + block_free += EXT2_EXT_ATTR_LEN(name_len); + if (!h->attrs[old_idx].ea_ino) + block_free += + EXT2_EXT_ATTR_SIZE(h->attrs[old_idx].value_len); + } + + if (needed > block_free) + return EXT2_ET_EA_NO_SPACE; + + if (old_idx >= 0) { + /* Update the existing entry. */ + ret = xattr_update_entry(h->fs, &h->attrs[old_idx], name, + shortname, name_idx, value, + value_len, in_inode); + if (ret) + return ret; + if (old_idx < h->ibody_count) { + /* + * Move entry from ibody to the block. Note that + * entries in the block are sorted. + */ + new_idx = xattr_find_position(h->attrs + h->ibody_count, + h->count - h->ibody_count, + shortname, name_idx); + new_idx += h->ibody_count - 1; + tmp = h->attrs[old_idx]; + memmove(h->attrs + old_idx, h->attrs + old_idx + 1, + (new_idx - old_idx) * sizeof(*h->attrs)); + h->attrs[new_idx] = tmp; + h->ibody_count--; + } + return 0; + } + + new_idx = xattr_find_position(h->attrs + h->ibody_count, + h->count - h->ibody_count, + shortname, name_idx); + new_idx += h->ibody_count; + add_to_ibody = 0; + +add_new: + if (h->count == h->capacity) { + ret = ext2fs_xattrs_expand(h, 4); + if (ret) + return ret; + } + + ret = xattr_update_entry(h->fs, &h->attrs[h->count], name, shortname, + name_idx, value, value_len, in_inode); + if (ret) + return ret; + + tmp = h->attrs[h->count]; + memmove(h->attrs + new_idx + 1, h->attrs + new_idx, + (h->count - new_idx)*sizeof(*h->attrs)); + h->attrs[new_idx] = tmp; + if (add_to_ibody) + h->ibody_count++; + h->count++; + return 0; +} + +static int space_used(struct ext2_xattr *attrs, int count) +{ + int total = 0; + struct ext2_xattr *x; + int i, len; + + for (i = 0, x = attrs; i < count; i++, x++) { + len = strlen(x->short_name); + total += EXT2_EXT_ATTR_LEN(len); + if (!x->ea_ino) + total += EXT2_EXT_ATTR_SIZE(x->value_len); + } + return total; +} + +/* + * The minimum size of EA value when you start storing it in an external inode + * size of block - size of header - size of 1 entry - 4 null bytes + */ +#define EXT4_XATTR_MIN_LARGE_EA_SIZE(b) \ + ((b) - EXT2_EXT_ATTR_LEN(3) - sizeof(struct ext2_ext_attr_header) - 4) + +errcode_t ext2fs_xattr_set(struct ext2_xattr_handle *h, + const char *name, + const void *value, + size_t value_len) +{ + ext2_filsys fs = h->fs; + const int inode_size = EXT2_INODE_SIZE(fs->super); + struct ext2_inode_large *inode = NULL; + struct ext2_xattr *x; + char *new_value; + int ibody_free, block_free; + int in_inode = 0; + int old_idx = -1; + int extra_isize; + errcode_t ret; + + EXT2_CHECK_MAGIC(h, EXT2_ET_MAGIC_EA_HANDLE); + + ret = ext2fs_get_mem(value_len, &new_value); + if (ret) + return ret; + if (!(h->flags & XATTR_HANDLE_FLAG_RAW) && + ((strcmp(name, "system.posix_acl_default") == 0) || + (strcmp(name, "system.posix_acl_access") == 0))) { + ret = convert_posix_acl_to_disk_buffer(value, value_len, + new_value, &value_len); + if (ret) + goto out; + } else if (value_len) + memcpy(new_value, value, value_len); + + /* Imitate kernel behavior by skipping update if value is the same. */ + for (x = h->attrs; x < h->attrs + h->count; x++) { + if (!strcmp(x->name, name)) { + if (!x->ea_ino && x->value_len == value_len && + (!value_len || + !memcmp(x->value, new_value, value_len))) { + ret = 0; + goto out; + } + old_idx = x - h->attrs; + break; + } + } + + ret = ext2fs_get_memzero(inode_size, &inode); + if (ret) + goto out; + ret = ext2fs_read_inode_full(fs, h->ino, + (struct ext2_inode *)inode, + inode_size); + if (ret) + goto out; + if (inode_size > EXT2_GOOD_OLD_INODE_SIZE) { + extra_isize = inode->i_extra_isize; + if (extra_isize == 0) { + extra_isize = fs->super->s_want_extra_isize; + if (extra_isize == 0) + extra_isize = sizeof(__u32); + } + ibody_free = inode_size - EXT2_GOOD_OLD_INODE_SIZE; + ibody_free -= extra_isize; + /* Extended attribute magic and final null entry. */ + ibody_free -= sizeof(__u32) * 2; + ibody_free -= space_used(h->attrs, h->ibody_count); + } else + ibody_free = 0; + + /* Inline data can only go to ibody. */ + if (strcmp(name, "system.data") == 0) { + if (h->ibody_count <= old_idx) { + ret = EXT2_ET_FILESYSTEM_CORRUPTED; + goto out; + } + ret = xattr_array_update(h, name, new_value, value_len, + ibody_free, + 0 /* block_free */, old_idx, + 0 /* in_inode */); + if (ret) + goto out; + goto write_out; + } + + block_free = fs->blocksize; + block_free -= sizeof(struct ext2_ext_attr_header); + /* Final null entry. */ + block_free -= sizeof(__u32); + block_free -= space_used(h->attrs + h->ibody_count, + h->count - h->ibody_count); + + if (ext2fs_has_feature_ea_inode(fs->super) && + value_len > EXT4_XATTR_MIN_LARGE_EA_SIZE(fs->blocksize)) + in_inode = 1; + + ret = xattr_array_update(h, name, new_value, value_len, ibody_free, + block_free, old_idx, in_inode); + if (ret == EXT2_ET_EA_NO_SPACE && !in_inode && + ext2fs_has_feature_ea_inode(fs->super)) + ret = xattr_array_update(h, name, new_value, value_len, + ibody_free, block_free, old_idx, 1 /* in_inode */); + if (ret) + goto out; + +write_out: + ret = ext2fs_xattrs_write(h); +out: + if (inode) + ext2fs_free_mem(&inode); + ext2fs_free_mem(&new_value); + return ret; +} + +errcode_t ext2fs_xattr_remove(struct ext2_xattr_handle *handle, + const char *key) +{ + struct ext2_xattr *x; + struct ext2_xattr *end = handle->attrs + handle->count; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE); + for (x = handle->attrs; x < end; x++) { + if (strcmp(x->name, key) == 0) { + ext2fs_free_mem(&x->name); + ext2fs_free_mem(&x->value); + if (x->ea_ino) + xattr_inode_dec_ref(handle->fs, x->ea_ino); + memmove(x, x + 1, (end - x - 1)*sizeof(*x)); + memset(end - 1, 0, sizeof(*end)); + if (x < handle->attrs + handle->ibody_count) + handle->ibody_count--; + handle->count--; + return ext2fs_xattrs_write(handle); + } + } + + /* no key found, success! */ + return 0; +} + +errcode_t ext2fs_xattrs_open(ext2_filsys fs, ext2_ino_t ino, + struct ext2_xattr_handle **handle) +{ + struct ext2_xattr_handle *h; + errcode_t err; + + if (!ext2fs_has_feature_xattr(fs->super) && + !ext2fs_has_feature_inline_data(fs->super)) + return EXT2_ET_MISSING_EA_FEATURE; + + err = ext2fs_get_memzero(sizeof(*h), &h); + if (err) + return err; + + h->magic = EXT2_ET_MAGIC_EA_HANDLE; + h->capacity = 4; + err = ext2fs_get_arrayzero(h->capacity, sizeof(struct ext2_xattr), + &h->attrs); + if (err) { + ext2fs_free_mem(&h); + return err; + } + h->count = 0; + h->ino = ino; + h->fs = fs; + *handle = h; + return 0; +} + +errcode_t ext2fs_xattrs_close(struct ext2_xattr_handle **handle) +{ + struct ext2_xattr_handle *h = *handle; + + EXT2_CHECK_MAGIC(h, EXT2_ET_MAGIC_EA_HANDLE); + xattrs_free_keys(h); + ext2fs_free_mem(&h->attrs); + ext2fs_free_mem(handle); + return 0; +} + +errcode_t ext2fs_xattrs_count(struct ext2_xattr_handle *handle, size_t *count) +{ + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE); + *count = handle->count; + return 0; +} + +errcode_t ext2fs_xattrs_flags(struct ext2_xattr_handle *handle, + unsigned int *new_flags, unsigned int *old_flags) +{ + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE); + if (old_flags) + *old_flags = handle->flags; + if (new_flags) + handle->flags = *new_flags; + return 0; +} diff --git a/lib/ext2fs/extent.c b/lib/ext2fs/extent.c new file mode 100644 index 0000000..82e75cc --- /dev/null +++ b/lib/ext2fs/extent.c @@ -0,0 +1,1877 @@ +/* + * extent.c --- routines to implement extents support + * + * Copyright (C) 2007 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" +#include "e2image.h" + +#undef DEBUG + +/* + * Definitions to be dropped in lib/ext2fs/ext2fs.h + */ + +/* + * Private definitions + */ + +struct extent_path { + char *buf; + int entries; + int max_entries; + int left; + int visit_num; + int flags; + blk64_t end_blk; + blk64_t blk; + void *curr; +}; + + +struct ext2_extent_handle { + errcode_t magic; + ext2_filsys fs; + ext2_ino_t ino; + struct ext2_inode *inode; + struct ext2_inode inodebuf; + int type; + int level; + int max_depth; + int max_paths; + struct extent_path *path; +}; + +struct ext2_extent_path { + errcode_t magic; + int leaf_height; + blk64_t lblk; +}; + +/* + * Useful Debugging stuff + */ + +#ifdef DEBUG +static void dbg_show_header(struct ext3_extent_header *eh) +{ + printf("header: magic=%x entries=%u max=%u depth=%u generation=%u\n", + ext2fs_le16_to_cpu(eh->eh_magic), + ext2fs_le16_to_cpu(eh->eh_entries), + ext2fs_le16_to_cpu(eh->eh_max), + ext2fs_le16_to_cpu(eh->eh_depth), + ext2fs_le32_to_cpu(eh->eh_generation)); +} + +static void dbg_show_index(struct ext3_extent_idx *ix) +{ + printf("index: block=%u leaf=%u leaf_hi=%u unused=%u\n", + ext2fs_le32_to_cpu(ix->ei_block), + ext2fs_le32_to_cpu(ix->ei_leaf), + ext2fs_le16_to_cpu(ix->ei_leaf_hi), + ext2fs_le16_to_cpu(ix->ei_unused)); +} + +static void dbg_show_extent(struct ext3_extent *ex) +{ + printf("extent: block=%u-%u len=%u start=%u start_hi=%u\n", + ext2fs_le32_to_cpu(ex->ee_block), + ext2fs_le32_to_cpu(ex->ee_block) + + ext2fs_le16_to_cpu(ex->ee_len) - 1, + ext2fs_le16_to_cpu(ex->ee_len), + ext2fs_le32_to_cpu(ex->ee_start), + ext2fs_le16_to_cpu(ex->ee_start_hi)); +} + +static void dbg_print_extent(char *desc, struct ext2fs_extent *extent) +{ + if (desc) + printf("%s: ", desc); + printf("extent: lblk %llu--%llu, len %u, pblk %llu, flags: ", + extent->e_lblk, extent->e_lblk + extent->e_len - 1, + extent->e_len, extent->e_pblk); + if (extent->e_flags & EXT2_EXTENT_FLAGS_LEAF) + fputs("LEAF ", stdout); + if (extent->e_flags & EXT2_EXTENT_FLAGS_UNINIT) + fputs("UNINIT ", stdout); + if (extent->e_flags & EXT2_EXTENT_FLAGS_SECOND_VISIT) + fputs("2ND_VISIT ", stdout); + if (!extent->e_flags) + fputs("(none)", stdout); + fputc('\n', stdout); + +} + +static void dump_path(const char *tag, struct ext2_extent_handle *handle, + struct extent_path *path) +{ + struct extent_path *ppp = path; + printf("%s: level=%d\n", tag, handle->level); + + do { + printf("%s: path=%ld buf=%p entries=%d max_entries=%d left=%d " + "visit_num=%d flags=0x%x end_blk=%llu curr=%p(%ld)\n", + tag, (ppp - handle->path), ppp->buf, ppp->entries, + ppp->max_entries, ppp->left, ppp->visit_num, ppp->flags, + ppp->end_blk, ppp->curr, ppp->curr - (void *)ppp->buf); + printf(" "); + dbg_show_header((struct ext3_extent_header *)ppp->buf); + if (ppp->curr) { + printf(" "); + dbg_show_index(ppp->curr); + printf(" "); + dbg_show_extent(ppp->curr); + } + ppp--; + } while (ppp >= handle->path); + fflush(stdout); + + return; +} + +#else +#define dbg_show_header(eh) do { } while (0) +#define dbg_show_index(ix) do { } while (0) +#define dbg_show_extent(ex) do { } while (0) +#define dbg_print_extent(desc, ex) do { } while (0) +#define dump_path(tag, handle, path) do { } while (0) +#endif + +/* + * Verify the extent header as being sane + */ +errcode_t ext2fs_extent_header_verify(void *ptr, int size) +{ + int eh_max, entry_size; + struct ext3_extent_header *eh = ptr; + + dbg_show_header(eh); + if (ext2fs_le16_to_cpu(eh->eh_magic) != EXT3_EXT_MAGIC) + return EXT2_ET_EXTENT_HEADER_BAD; + if (ext2fs_le16_to_cpu(eh->eh_entries) > ext2fs_le16_to_cpu(eh->eh_max)) + return EXT2_ET_EXTENT_HEADER_BAD; + if (eh->eh_depth == 0) + entry_size = sizeof(struct ext3_extent); + else + entry_size = sizeof(struct ext3_extent_idx); + + eh_max = (size - sizeof(*eh)) / entry_size; + /* Allow two extent-sized items at the end of the block, for + * ext4_extent_tail with checksum in the future. */ + if ((ext2fs_le16_to_cpu(eh->eh_max) > eh_max) || + (ext2fs_le16_to_cpu(eh->eh_max) < (eh_max - 2))) + return EXT2_ET_EXTENT_HEADER_BAD; + + return 0; +} + + +/* + * Begin functions to handle an inode's extent information + */ +void ext2fs_extent_free(ext2_extent_handle_t handle) +{ + int i; + + if (!handle) + return; + + if (handle->path) { + for (i = 1; i < handle->max_paths; i++) { + if (handle->path[i].buf) + ext2fs_free_mem(&handle->path[i].buf); + } + ext2fs_free_mem(&handle->path); + } + ext2fs_free_mem(&handle); +} + +errcode_t ext2fs_extent_open(ext2_filsys fs, ext2_ino_t ino, + ext2_extent_handle_t *ret_handle) +{ + return ext2fs_extent_open2(fs, ino, NULL, ret_handle); +} + +errcode_t ext2fs_extent_open2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + ext2_extent_handle_t *ret_handle) +{ + struct ext2_extent_handle *handle; + errcode_t retval; + int i; + struct ext3_extent_header *eh; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!inode) + if ((ino == 0) || (ino > fs->super->s_inodes_count)) + return EXT2_ET_BAD_INODE_NUM; + + retval = ext2fs_get_mem(sizeof(struct ext2_extent_handle), &handle); + if (retval) + return retval; + memset(handle, 0, sizeof(struct ext2_extent_handle)); + + handle->ino = ino; + handle->fs = fs; + + if (inode) { + handle->inode = inode; + } else { + handle->inode = &handle->inodebuf; + retval = ext2fs_read_inode(fs, ino, handle->inode); + if (retval) + goto errout; + } + + eh = (struct ext3_extent_header *) &handle->inode->i_block[0]; + + for (i=0; i < EXT2_N_BLOCKS; i++) + if (handle->inode->i_block[i]) + break; + if (i >= EXT2_N_BLOCKS) { + eh->eh_magic = ext2fs_cpu_to_le16(EXT3_EXT_MAGIC); + eh->eh_depth = 0; + eh->eh_entries = 0; + i = (sizeof(handle->inode->i_block) - sizeof(*eh)) / + sizeof(struct ext3_extent); + eh->eh_max = ext2fs_cpu_to_le16(i); + handle->inode->i_flags |= EXT4_EXTENTS_FL; + } + + if (!(handle->inode->i_flags & EXT4_EXTENTS_FL)) { + retval = EXT2_ET_INODE_NOT_EXTENT; + goto errout; + } + + retval = ext2fs_extent_header_verify(eh, sizeof(handle->inode->i_block)); + if (retval) + goto errout; + + handle->max_depth = ext2fs_le16_to_cpu(eh->eh_depth); + handle->type = ext2fs_le16_to_cpu(eh->eh_magic); + + handle->max_paths = handle->max_depth + 1; + retval = ext2fs_get_memzero(handle->max_paths * + sizeof(struct extent_path), + &handle->path); + handle->path[0].buf = (char *) handle->inode->i_block; + + handle->path[0].left = handle->path[0].entries = + ext2fs_le16_to_cpu(eh->eh_entries); + handle->path[0].max_entries = ext2fs_le16_to_cpu(eh->eh_max); + handle->path[0].curr = 0; + handle->path[0].end_blk = + (EXT2_I_SIZE(handle->inode) + fs->blocksize - 1) >> + EXT2_BLOCK_SIZE_BITS(fs->super); + handle->path[0].blk = 0; + handle->path[0].visit_num = 1; + handle->level = 0; + handle->magic = EXT2_ET_MAGIC_EXTENT_HANDLE; + + *ret_handle = handle; + return 0; + +errout: + ext2fs_extent_free(handle); + return retval; +} + +/* + * This function is responsible for (optionally) moving through the + * extent tree and then returning the current extent + */ +errcode_t ext2fs_extent_get(ext2_extent_handle_t handle, + int flags, struct ext2fs_extent *extent) +{ + struct extent_path *path, *newpath, *tp; + struct ext3_extent_header *eh; + struct ext3_extent_idx *ix = 0; + struct ext3_extent *ex; + errcode_t retval; + blk64_t blk; + blk64_t end_blk; + int orig_op, op, l; + int failed_csum = 0; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE); + + if (!handle->path) + return EXT2_ET_NO_CURRENT_NODE; + + orig_op = op = flags & EXT2_EXTENT_MOVE_MASK; + +retry: + path = handle->path + handle->level; + if ((orig_op == EXT2_EXTENT_NEXT) || + (orig_op == EXT2_EXTENT_NEXT_LEAF)) { + if (handle->level < handle->max_depth) { + /* interior node */ + if (path->visit_num == 0) { + path->visit_num++; + op = EXT2_EXTENT_DOWN; + } else if (path->left > 0) + op = EXT2_EXTENT_NEXT_SIB; + else if (handle->level > 0) + op = EXT2_EXTENT_UP; + else + return EXT2_ET_EXTENT_NO_NEXT; + } else { + /* leaf node */ + if (path->left > 0) + op = EXT2_EXTENT_NEXT_SIB; + else if (handle->level > 0) + op = EXT2_EXTENT_UP; + else + return EXT2_ET_EXTENT_NO_NEXT; + } + if (op != EXT2_EXTENT_NEXT_SIB) { +#ifdef DEBUG_GET_EXTENT + printf("<<<< OP = %s\n", + (op == EXT2_EXTENT_DOWN) ? "down" : + ((op == EXT2_EXTENT_UP) ? "up" : "unknown")); +#endif + } + } + + if ((orig_op == EXT2_EXTENT_PREV) || + (orig_op == EXT2_EXTENT_PREV_LEAF)) { + if (handle->level < handle->max_depth) { + /* interior node */ + if (path->visit_num > 0 ) { + /* path->visit_num = 0; */ + op = EXT2_EXTENT_DOWN_AND_LAST; + } else if (path->left < path->entries-1) + op = EXT2_EXTENT_PREV_SIB; + else if (handle->level > 0) + op = EXT2_EXTENT_UP; + else + return EXT2_ET_EXTENT_NO_PREV; + } else { + /* leaf node */ + if (path->left < path->entries-1) + op = EXT2_EXTENT_PREV_SIB; + else if (handle->level > 0) + op = EXT2_EXTENT_UP; + else + return EXT2_ET_EXTENT_NO_PREV; + } + if (op != EXT2_EXTENT_PREV_SIB) { +#ifdef DEBUG_GET_EXTENT + printf("<<<< OP = %s\n", + (op == EXT2_EXTENT_DOWN_AND_LAST) ? "down/last" : + ((op == EXT2_EXTENT_UP) ? "up" : "unknown")); +#endif + } + } + + if (orig_op == EXT2_EXTENT_LAST_LEAF) { + if ((handle->level < handle->max_depth) && + (path->left == 0)) + op = EXT2_EXTENT_DOWN; + else + op = EXT2_EXTENT_LAST_SIB; +#ifdef DEBUG_GET_EXTENT + printf("<<<< OP = %s\n", + (op == EXT2_EXTENT_DOWN) ? "down" : "last_sib"); +#endif + } + + switch (op) { + case EXT2_EXTENT_CURRENT: + ix = path->curr; + break; + case EXT2_EXTENT_ROOT: + handle->level = 0; + path = handle->path + handle->level; + /* fallthrough */ + case EXT2_EXTENT_FIRST_SIB: + path->left = path->entries; + path->curr = 0; + /* fallthrough */ + case EXT2_EXTENT_NEXT_SIB: + if (path->left <= 0) + return EXT2_ET_EXTENT_NO_NEXT; + if (path->curr) { + ix = path->curr; + ix++; + } else { + eh = (struct ext3_extent_header *) path->buf; + ix = EXT_FIRST_INDEX(eh); + } + path->left--; + path->curr = ix; + path->visit_num = 0; + break; + case EXT2_EXTENT_PREV_SIB: + if (!path->curr || + path->left+1 >= path->entries) + return EXT2_ET_EXTENT_NO_PREV; + ix = path->curr; + ix--; + path->curr = ix; + path->left++; + if (handle->level < handle->max_depth) + path->visit_num = 1; + break; + case EXT2_EXTENT_LAST_SIB: + eh = (struct ext3_extent_header *) path->buf; + path->curr = EXT_LAST_EXTENT(eh); + ix = path->curr; + path->left = 0; + path->visit_num = 0; + break; + case EXT2_EXTENT_UP: + if (handle->level <= 0) + return EXT2_ET_EXTENT_NO_UP; + handle->level--; + path--; + ix = path->curr; + if ((orig_op == EXT2_EXTENT_PREV) || + (orig_op == EXT2_EXTENT_PREV_LEAF)) + path->visit_num = 0; + break; + case EXT2_EXTENT_DOWN: + case EXT2_EXTENT_DOWN_AND_LAST: + if (!path->curr ||(handle->level >= handle->max_depth)) + return EXT2_ET_EXTENT_NO_DOWN; + + ix = path->curr; + newpath = path + 1; + if (!newpath->buf) { + retval = ext2fs_get_mem(handle->fs->blocksize, + &newpath->buf); + if (retval) + return retval; + } + blk = ext2fs_le32_to_cpu(ix->ei_leaf) + + ((__u64) ext2fs_le16_to_cpu(ix->ei_leaf_hi) << 32); + for (l = handle->level, tp = path; l > 0; l--, tp--) { + if (blk == tp->blk) + return EXT2_ET_EXTENT_CYCLE; + } + newpath->blk = blk; + if ((handle->fs->flags & EXT2_FLAG_IMAGE_FILE) && + (handle->fs->io != handle->fs->image_io)) + memset(newpath->buf, 0, handle->fs->blocksize); + else { + retval = io_channel_read_blk64(handle->fs->io, + blk, 1, newpath->buf); + if (retval) + return retval; + } + handle->level++; + + eh = (struct ext3_extent_header *) newpath->buf; + + retval = ext2fs_extent_header_verify(eh, handle->fs->blocksize); + if (retval) { + handle->level--; + return retval; + } + + if (!(handle->fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) && + !ext2fs_extent_block_csum_verify(handle->fs, handle->ino, + eh)) + failed_csum = 1; + + newpath->left = newpath->entries = + ext2fs_le16_to_cpu(eh->eh_entries); + newpath->max_entries = ext2fs_le16_to_cpu(eh->eh_max); + + /* Make sure there is at least one extent present */ + if (newpath->left <= 0) + return EXT2_ET_EXTENT_NO_DOWN; + + if (path->left > 0) { + ix++; + newpath->end_blk = ext2fs_le32_to_cpu(ix->ei_block); + } else + newpath->end_blk = path->end_blk; + + path = newpath; + if (op == EXT2_EXTENT_DOWN) { + ix = EXT_FIRST_INDEX((struct ext3_extent_header *) eh); + path->curr = ix; + path->left = path->entries - 1; + path->visit_num = 0; + } else { + ix = EXT_LAST_INDEX((struct ext3_extent_header *) eh); + path->curr = ix; + path->left = 0; + if (handle->level < handle->max_depth) + path->visit_num = 1; + } +#ifdef DEBUG_GET_EXTENT + printf("Down to level %d/%d, end_blk=%llu\n", + handle->level, handle->max_depth, + path->end_blk); +#endif + break; + default: + return EXT2_ET_OP_NOT_SUPPORTED; + } + + if (!ix) + return EXT2_ET_NO_CURRENT_NODE; + + extent->e_flags = 0; +#ifdef DEBUG_GET_EXTENT + printf("(Left %d)\n", path->left); +#endif + + if (handle->level == handle->max_depth) { + ex = (struct ext3_extent *) ix; + + extent->e_pblk = ext2fs_le32_to_cpu(ex->ee_start) + + ((__u64) ext2fs_le16_to_cpu(ex->ee_start_hi) << 32); + extent->e_lblk = ext2fs_le32_to_cpu(ex->ee_block); + extent->e_len = ext2fs_le16_to_cpu(ex->ee_len); + extent->e_flags |= EXT2_EXTENT_FLAGS_LEAF; + if (extent->e_len > EXT_INIT_MAX_LEN) { + extent->e_len -= EXT_INIT_MAX_LEN; + extent->e_flags |= EXT2_EXTENT_FLAGS_UNINIT; + } + } else { + extent->e_pblk = ext2fs_le32_to_cpu(ix->ei_leaf) + + ((__u64) ext2fs_le16_to_cpu(ix->ei_leaf_hi) << 32); + extent->e_lblk = ext2fs_le32_to_cpu(ix->ei_block); + if (path->left > 0) { + ix++; + end_blk = ext2fs_le32_to_cpu(ix->ei_block); + } else + end_blk = path->end_blk; + + extent->e_len = end_blk - extent->e_lblk; + } + if (path->visit_num) + extent->e_flags |= EXT2_EXTENT_FLAGS_SECOND_VISIT; + + if (((orig_op == EXT2_EXTENT_NEXT_LEAF) || + (orig_op == EXT2_EXTENT_PREV_LEAF)) && + (handle->level != handle->max_depth)) + goto retry; + + if ((orig_op == EXT2_EXTENT_LAST_LEAF) && + ((handle->level != handle->max_depth) || + (path->left != 0))) + goto retry; + + if (failed_csum) + return EXT2_ET_EXTENT_CSUM_INVALID; + + return 0; +} + +static errcode_t update_path(ext2_extent_handle_t handle) +{ + blk64_t blk; + errcode_t retval; + struct ext3_extent_idx *ix; + struct ext3_extent_header *eh; + + if (handle->level == 0) { + retval = ext2fs_write_inode(handle->fs, handle->ino, + handle->inode); + } else { + ix = handle->path[handle->level - 1].curr; + blk = ext2fs_le32_to_cpu(ix->ei_leaf) + + ((__u64) ext2fs_le16_to_cpu(ix->ei_leaf_hi) << 32); + + /* then update the checksum */ + eh = (struct ext3_extent_header *) + handle->path[handle->level].buf; + retval = ext2fs_extent_block_csum_set(handle->fs, handle->ino, + eh); + if (retval) + return retval; + + retval = io_channel_write_blk64(handle->fs->io, + blk, 1, handle->path[handle->level].buf); + } + return retval; +} + +#if 0 +errcode_t ext2fs_extent_save_path(ext2_extent_handle_t handle, + ext2_extent_path_t *ret_path) +{ + ext2_extent_path_t save_path; + struct ext2fs_extent extent; + struct ext2_extent_info info; + errcode_t retval; + + retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent); + if (retval) + return retval; + + retval = ext2fs_extent_get_info(handle, &info); + if (retval) + return retval; + + retval = ext2fs_get_mem(sizeof(struct ext2_extent_path), &save_path); + if (retval) + return retval; + memset(save_path, 0, sizeof(struct ext2_extent_path)); + + save_path->magic = EXT2_ET_MAGIC_EXTENT_PATH; + save_path->leaf_height = info.max_depth - info.curr_level - 1; + save_path->lblk = extent.e_lblk; + + *ret_path = save_path; + return 0; +} + +errcode_t ext2fs_extent_free_path(ext2_extent_path_t path) +{ + EXT2_CHECK_MAGIC(path, EXT2_ET_MAGIC_EXTENT_PATH); + + ext2fs_free_mem(&path); + return 0; +} +#endif + +/* + * Go to the node at leaf_level which contains logical block blk. + * + * leaf_level is height from the leaf node level, i.e. + * leaf_level 0 is at leaf node, leaf_level 1 is 1 above etc. + * + * If "blk" has no mapping (hole) then handle is left at last + * extent before blk. + */ +errcode_t ext2fs_extent_goto2(ext2_extent_handle_t handle, + int leaf_level, blk64_t blk) +{ + struct ext2fs_extent extent; + errcode_t retval; + + retval = ext2fs_extent_get(handle, EXT2_EXTENT_ROOT, &extent); + if (retval) { + if (retval == EXT2_ET_EXTENT_NO_NEXT) + retval = EXT2_ET_EXTENT_NOT_FOUND; + return retval; + } + + if (leaf_level > handle->max_depth) { +#ifdef DEBUG + printf("leaf level %d greater than tree depth %d\n", + leaf_level, handle->max_depth); +#endif + return EXT2_ET_OP_NOT_SUPPORTED; + } + +#ifdef DEBUG + printf("goto extent ino %u, level %d, %llu\n", handle->ino, + leaf_level, blk); +#endif + +#ifdef DEBUG_GOTO_EXTENTS + dbg_print_extent("root", &extent); +#endif + while (1) { + if (handle->max_depth - handle->level == leaf_level) { + /* block is in this &extent */ + if ((blk >= extent.e_lblk) && + (blk < extent.e_lblk + extent.e_len)) + return 0; + if (blk < extent.e_lblk) { + retval = ext2fs_extent_get(handle, + EXT2_EXTENT_PREV_SIB, + &extent); + return EXT2_ET_EXTENT_NOT_FOUND; + } + retval = ext2fs_extent_get(handle, + EXT2_EXTENT_NEXT_SIB, + &extent); + if (retval == EXT2_ET_EXTENT_NO_NEXT) + return EXT2_ET_EXTENT_NOT_FOUND; + if (retval) + return retval; + continue; + } + + retval = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT_SIB, + &extent); + if (retval == EXT2_ET_EXTENT_NO_NEXT) + goto go_down; + if (retval) + return retval; + +#ifdef DEBUG_GOTO_EXTENTS + dbg_print_extent("next", &extent); +#endif + if (blk == extent.e_lblk) + goto go_down; + if (blk > extent.e_lblk) + continue; + + retval = ext2fs_extent_get(handle, EXT2_EXTENT_PREV_SIB, + &extent); + if (retval) + return retval; + +#ifdef DEBUG_GOTO_EXTENTS + dbg_print_extent("prev", &extent); +#endif + + go_down: + retval = ext2fs_extent_get(handle, EXT2_EXTENT_DOWN, + &extent); + if (retval) + return retval; + +#ifdef DEBUG_GOTO_EXTENTS + dbg_print_extent("down", &extent); +#endif + } +} + +errcode_t ext2fs_extent_goto(ext2_extent_handle_t handle, + blk64_t blk) +{ + return ext2fs_extent_goto2(handle, 0, blk); +} + +/* + * Traverse back up to root fixing parents of current node as needed. + * + * If we changed start of first entry in a node, fix parent index start + * and so on. + * + * Safe to call for any position in node; if not at the first entry, + * it will simply return. + * + * Note a subtlety of this function -- if there happen to be two extents + * mapping the same lblk and someone calls fix_parents on the second of the two + * extents, the position of the extent handle after the call will be the second + * extent if nothing happened, or the first extent if something did. A caller + * in this situation must use ext2fs_extent_goto() after calling this function. + * Or simply don't map the same lblk with two extents, ever. + */ +errcode_t ext2fs_extent_fix_parents(ext2_extent_handle_t handle) +{ + int retval = 0; + int orig_height; + blk64_t start; + struct extent_path *path; + struct ext2fs_extent extent; + struct ext2_extent_info info; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE); + + if (!(handle->fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + if (!handle->path) + return EXT2_ET_NO_CURRENT_NODE; + + path = handle->path + handle->level; + if (!path->curr) + return EXT2_ET_NO_CURRENT_NODE; + + retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent); + if (retval) + goto done; + + /* modified node's start block */ + start = extent.e_lblk; + + if ((retval = ext2fs_extent_get_info(handle, &info))) + return retval; + orig_height = info.max_depth - info.curr_level; + + /* traverse up until index not first, or startblk matches, or top */ + while (handle->level > 0 && + (path->left == path->entries - 1)) { + retval = ext2fs_extent_get(handle, EXT2_EXTENT_UP, &extent); + if (retval) + goto done; + if (extent.e_lblk == start) + break; + path = handle->path + handle->level; + extent.e_len += (extent.e_lblk - start); + extent.e_lblk = start; + retval = ext2fs_extent_replace(handle, 0, &extent); + if (retval) + goto done; + update_path(handle); + } + + /* put handle back to where we started */ + retval = ext2fs_extent_goto2(handle, orig_height, start); +done: + return retval; +} + +errcode_t ext2fs_extent_replace(ext2_extent_handle_t handle, + int flags EXT2FS_ATTR((unused)), + struct ext2fs_extent *extent) +{ + struct extent_path *path; + struct ext3_extent_idx *ix; + struct ext3_extent *ex; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE); + + if (!(handle->fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + if (!handle->path) + return EXT2_ET_NO_CURRENT_NODE; + + path = handle->path + handle->level; + if (!path->curr) + return EXT2_ET_NO_CURRENT_NODE; + +#ifdef DEBUG + printf("extent replace: %u ", handle->ino); + dbg_print_extent(0, extent); +#endif + + if (handle->level == handle->max_depth) { + ex = path->curr; + + ex->ee_block = ext2fs_cpu_to_le32(extent->e_lblk); + ex->ee_start = ext2fs_cpu_to_le32(extent->e_pblk & 0xFFFFFFFF); + ex->ee_start_hi = ext2fs_cpu_to_le16(extent->e_pblk >> 32); + if (extent->e_flags & EXT2_EXTENT_FLAGS_UNINIT) { + if (extent->e_len > EXT_UNINIT_MAX_LEN) + return EXT2_ET_EXTENT_INVALID_LENGTH; + ex->ee_len = ext2fs_cpu_to_le16(extent->e_len + + EXT_INIT_MAX_LEN); + } else { + if (extent->e_len > EXT_INIT_MAX_LEN) + return EXT2_ET_EXTENT_INVALID_LENGTH; + ex->ee_len = ext2fs_cpu_to_le16(extent->e_len); + } + } else { + ix = path->curr; + + ix->ei_leaf = ext2fs_cpu_to_le32(extent->e_pblk & 0xFFFFFFFF); + ix->ei_leaf_hi = ext2fs_cpu_to_le16(extent->e_pblk >> 32); + ix->ei_block = ext2fs_cpu_to_le32(extent->e_lblk); + ix->ei_unused = 0; + } + update_path(handle); + return 0; +} + +static int splitting_at_eof(struct ext2_extent_handle *handle, + struct extent_path *path) +{ + struct extent_path *ppp = path; + dump_path(__func__, handle, path); + + if (handle->level == 0) + return 0; + + do { + if (ppp->left) + return 0; + ppp--; + } while (ppp >= handle->path); + + return 1; +} + +/* + * allocate a new block, move half the current node to it, and update parent + * + * handle will be left pointing at original record. + */ +static errcode_t extent_node_split(ext2_extent_handle_t handle, + int expand_allowed) +{ + errcode_t retval = 0; + blk64_t new_node_pblk; + blk64_t new_node_start; + blk64_t orig_lblk; + blk64_t goal_blk = 0; + int orig_height; + char *block_buf = NULL; + struct ext2fs_extent extent; + struct extent_path *path, *newpath = 0; + struct ext3_extent_header *eh, *neweh; + int tocopy; + int new_root = 0; + struct ext2_extent_info info; + int no_balance; + + /* basic sanity */ + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE); + + if (!(handle->fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + if (!handle->path) + return EXT2_ET_NO_CURRENT_NODE; + +#ifdef DEBUG + printf("splitting node at level %d\n", handle->level); +#endif + retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent); + if (retval) + goto done; + + retval = ext2fs_extent_get_info(handle, &info); + if (retval) + goto done; + + /* save the position we were originally splitting... */ + orig_height = info.max_depth - info.curr_level; + orig_lblk = extent.e_lblk; + + /* Try to put the index block before the first extent */ + path = handle->path + handle->level; + eh = (struct ext3_extent_header *) path->buf; + if (handle->level == handle->max_depth) { + struct ext3_extent *ex; + + ex = EXT_FIRST_EXTENT(eh); + goal_blk = ext2fs_le32_to_cpu(ex->ee_start) + + ((__u64) ext2fs_le16_to_cpu(ex->ee_start_hi) << 32); + } else { + struct ext3_extent_idx *ix; + + ix = EXT_FIRST_INDEX(eh); + goal_blk = ext2fs_le32_to_cpu(ix->ei_leaf) + + ((__u64) ext2fs_le16_to_cpu(ix->ei_leaf_hi) << 32); + } + goal_blk -= EXT2FS_CLUSTER_RATIO(handle->fs); + goal_blk &= ~EXT2FS_CLUSTER_MASK(handle->fs); + + /* Is there room in the parent for a new entry? */ + if (handle->level && + (handle->path[handle->level - 1].entries >= + handle->path[handle->level - 1].max_entries)) { + +#ifdef DEBUG + printf("parent level %d full; splitting it too\n", + handle->level - 1); +#endif + /* split the parent */ + retval = ext2fs_extent_get(handle, EXT2_EXTENT_UP, &extent); + if (retval) + goto done; + + retval = extent_node_split(handle, expand_allowed); + if (retval) + goto done; + + /* get handle back to our original split position */ + retval = ext2fs_extent_goto2(handle, orig_height, orig_lblk); + if (retval) + goto done; + } + + /* At this point, parent should have room for this split */ + path = handle->path + handle->level; + if (!path->curr) + return EXT2_ET_NO_CURRENT_NODE; + + /* + * Normally, we try to split a full node in half. This doesn't turn + * out so well if we're tacking extents on the end of the file because + * then we're stuck with a tree of half-full extent blocks. This of + * course doesn't apply to the root level. + */ + no_balance = expand_allowed ? splitting_at_eof(handle, path) : 0; + + /* extent header of the current node we'll split */ + eh = (struct ext3_extent_header *)path->buf; + + /* splitting root level means moving them all out */ + if (handle->level == 0) { + new_root = 1; + tocopy = ext2fs_le16_to_cpu(eh->eh_entries); + retval = ext2fs_get_memzero((handle->max_paths + 1) * + sizeof(struct extent_path), + &newpath); + if (retval) + goto done; + } else { + if (no_balance) + tocopy = 1; + else + tocopy = ext2fs_le16_to_cpu(eh->eh_entries) / 2; + } + +#ifdef DEBUG + printf("will copy out %d of %d entries at level %d\n", + tocopy, ext2fs_le16_to_cpu(eh->eh_entries), + handle->level); +#endif + + if (!tocopy && !no_balance) { +#ifdef DEBUG + printf("Nothing to copy to new block!\n"); +#endif + retval = EXT2_ET_CANT_SPLIT_EXTENT; + goto done; + } + + /* first we need a new block, or can do nothing. */ + block_buf = malloc(handle->fs->blocksize); + if (!block_buf) { + retval = ENOMEM; + goto done; + } + + if (!goal_blk) + goal_blk = ext2fs_find_inode_goal(handle->fs, handle->ino, + handle->inode, 0); + retval = ext2fs_alloc_block2(handle->fs, goal_blk, block_buf, + &new_node_pblk); + if (retval) + goto done; + +#ifdef DEBUG + printf("will copy to new node at block %lu\n", + (unsigned long) new_node_pblk); +#endif + + /* Copy data into new block buffer */ + /* First the header for the new block... */ + neweh = (struct ext3_extent_header *) block_buf; + memcpy(neweh, eh, sizeof(struct ext3_extent_header)); + neweh->eh_entries = ext2fs_cpu_to_le16(tocopy); + neweh->eh_max = ext2fs_cpu_to_le16((handle->fs->blocksize - + sizeof(struct ext3_extent_header)) / + sizeof(struct ext3_extent)); + + /* then the entries for the new block... */ + memcpy(EXT_FIRST_INDEX(neweh), + EXT_FIRST_INDEX(eh) + + (ext2fs_le16_to_cpu(eh->eh_entries) - tocopy), + sizeof(struct ext3_extent_idx) * tocopy); + + new_node_start = ext2fs_le32_to_cpu(EXT_FIRST_INDEX(neweh)->ei_block); + + /* then update the checksum */ + retval = ext2fs_extent_block_csum_set(handle->fs, handle->ino, neweh); + if (retval) + goto done; + + /* ...and write the new node block out to disk. */ + retval = io_channel_write_blk64(handle->fs->io, new_node_pblk, 1, + block_buf); + + if (retval) + goto done; + + /* OK! we've created the new node; now adjust the tree */ + + /* current path now has fewer active entries, we copied some out */ + if (handle->level == 0) { + memcpy(newpath, path, + sizeof(struct extent_path) * handle->max_paths); + handle->path = newpath; + newpath = path; + path = handle->path; + path->entries = 1; + path->left = path->max_entries - 1; + handle->max_depth++; + handle->max_paths++; + eh->eh_depth = ext2fs_cpu_to_le16(handle->max_depth); + } else { + path->entries -= tocopy; + path->left -= tocopy; + } + + eh->eh_entries = ext2fs_cpu_to_le16(path->entries); + /* this writes out the node, incl. the modified header */ + retval = update_path(handle); + if (retval) + goto done; + + /* now go up and insert/replace index for new node we created */ + if (new_root) { + retval = ext2fs_extent_get(handle, EXT2_EXTENT_FIRST_SIB, &extent); + if (retval) + goto done; + + extent.e_lblk = new_node_start; + extent.e_pblk = new_node_pblk; + extent.e_len = handle->path[0].end_blk - extent.e_lblk; + retval = ext2fs_extent_replace(handle, 0, &extent); + if (retval) + goto done; + } else { + __u32 new_node_length; + + retval = ext2fs_extent_get(handle, EXT2_EXTENT_UP, &extent); + /* will insert after this one; it's length is shorter now */ + new_node_length = new_node_start - extent.e_lblk; + extent.e_len -= new_node_length; + retval = ext2fs_extent_replace(handle, 0, &extent); + if (retval) + goto done; + + /* now set up the new extent and insert it */ + extent.e_lblk = new_node_start; + extent.e_pblk = new_node_pblk; + extent.e_len = new_node_length; + retval = ext2fs_extent_insert(handle, EXT2_EXTENT_INSERT_AFTER, &extent); + if (retval) + goto done; + } + + /* get handle back to our original position */ + retval = ext2fs_extent_goto2(handle, orig_height, orig_lblk); + if (retval) + goto done; + + /* new node hooked in, so update inode block count (do this here?) */ + ext2fs_iblk_add_blocks(handle->fs, handle->inode, 1); + retval = ext2fs_write_inode(handle->fs, handle->ino, + handle->inode); + if (retval) + goto done; + +done: + if (newpath) + ext2fs_free_mem(&newpath); + free(block_buf); + + return retval; +} + +errcode_t ext2fs_extent_node_split(ext2_extent_handle_t handle) +{ + return extent_node_split(handle, 0); +} + +errcode_t ext2fs_extent_insert(ext2_extent_handle_t handle, int flags, + struct ext2fs_extent *extent) +{ + struct extent_path *path; + struct ext3_extent_idx *ix; + struct ext3_extent_header *eh; + errcode_t retval; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE); + + if (!(handle->fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + if (!handle->path) + return EXT2_ET_NO_CURRENT_NODE; + +#ifdef DEBUG + printf("extent insert: %u ", handle->ino); + dbg_print_extent(0, extent); +#endif + + path = handle->path + handle->level; + + if (path->entries >= path->max_entries) { + if (flags & EXT2_EXTENT_INSERT_NOSPLIT) { + return EXT2_ET_CANT_INSERT_EXTENT; + } else { +#ifdef DEBUG + printf("node full (level %d) - splitting\n", + handle->level); +#endif + retval = extent_node_split(handle, 1); + if (retval) + return retval; + path = handle->path + handle->level; + } + } + + eh = (struct ext3_extent_header *) path->buf; + if (path->curr) { + ix = path->curr; + if (flags & EXT2_EXTENT_INSERT_AFTER) { + ix++; + path->left--; + } + } else { + ix = EXT_FIRST_INDEX(eh); + path->left = -1; + } + + path->curr = ix; + + if (path->left >= 0) + memmove(ix + 1, ix, + (path->left+1) * sizeof(struct ext3_extent_idx)); + path->left++; + path->entries++; + + eh = (struct ext3_extent_header *) path->buf; + eh->eh_entries = ext2fs_cpu_to_le16(path->entries); + + retval = ext2fs_extent_replace(handle, 0, extent); + if (retval) + goto errout; + + retval = update_path(handle); + if (retval) + goto errout; + + return 0; + +errout: + ext2fs_extent_delete(handle, 0); + return retval; +} + +/* + * Sets the physical block for a logical file block in the extent tree. + * + * May: map unmapped, unmap mapped, or remap mapped blocks. + * + * Mapping an unmapped block adds a single-block extent. + * + * Unmapping first or last block modifies extent in-place + * - But may need to fix parent's starts too in first-block case + * + * Mapping any unmapped block requires adding a (single-block) extent + * and inserting into proper point in tree. + * + * Modifying (unmapping or remapping) a block in the middle + * of an extent requires splitting the extent. + * - Remapping case requires new single-block extent. + * + * Remapping first or last block adds an extent. + * + * We really need extent adding to be smart about merging. + */ + +errcode_t ext2fs_extent_set_bmap(ext2_extent_handle_t handle, + blk64_t logical, blk64_t physical, int flags) +{ + errcode_t ec, retval = 0; + int mapped = 1; /* logical is mapped? */ + int orig_height; + int extent_uninit = 0; + int prev_uninit = 0; + int next_uninit = 0; + int new_uninit = 0; + int max_len = EXT_INIT_MAX_LEN; + int has_prev, has_next; + blk64_t orig_lblk; + struct extent_path *path; + struct ext2fs_extent extent, next_extent, prev_extent; + struct ext2fs_extent newextent; + struct ext2_extent_info info; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE); + +#ifdef DEBUG + printf("set_bmap ino %u log %lld phys %lld flags %d\n", + handle->ino, logical, physical, flags); +#endif + + if (!(handle->fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + if (!handle->path) + return EXT2_ET_NO_CURRENT_NODE; + + path = handle->path + handle->level; + + if (flags & EXT2_EXTENT_SET_BMAP_UNINIT) { + new_uninit = 1; + max_len = EXT_UNINIT_MAX_LEN; + } + + /* if (re)mapping, set up new extent to insert */ + if (physical) { + newextent.e_len = 1; + newextent.e_pblk = physical; + newextent.e_lblk = logical; + newextent.e_flags = EXT2_EXTENT_FLAGS_LEAF; + if (new_uninit) + newextent.e_flags |= EXT2_EXTENT_FLAGS_UNINIT; + } + + /* special case if the extent tree is completely empty */ + if ((handle->max_depth == 0) && (path->entries == 0)) { + retval = ext2fs_extent_insert(handle, 0, &newextent); + return retval; + } + + /* save our original location in the extent tree */ + if ((retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, + &extent))) { + if (retval != EXT2_ET_NO_CURRENT_NODE) + return retval; + memset(&extent, 0, sizeof(extent)); + } + if ((retval = ext2fs_extent_get_info(handle, &info))) + return retval; + orig_height = info.max_depth - info.curr_level; + orig_lblk = extent.e_lblk; + + /* go to the logical spot we want to (re/un)map */ + retval = ext2fs_extent_goto(handle, logical); + if (retval) { + if (retval == EXT2_ET_EXTENT_NOT_FOUND) { + retval = 0; + mapped = 0; + if (!physical) { +#ifdef DEBUG + printf("block %llu already unmapped\n", + logical); +#endif + goto done; + } + } else + goto done; + } + + /* + * This may be the extent *before* the requested logical, + * if it's currently unmapped. + * + * Get the previous and next leaf extents, if they are present. + */ + retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent); + if (retval) + goto done; + if (extent.e_flags & EXT2_EXTENT_FLAGS_UNINIT) + extent_uninit = 1; + retval = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT_LEAF, &next_extent); + if (retval) { + has_next = 0; + if (retval != EXT2_ET_EXTENT_NO_NEXT) + goto done; + } else { + dbg_print_extent("set_bmap: next_extent", + &next_extent); + has_next = 1; + if (next_extent.e_flags & EXT2_EXTENT_FLAGS_UNINIT) + next_uninit = 1; + } + retval = ext2fs_extent_goto(handle, logical); + if (retval && retval != EXT2_ET_EXTENT_NOT_FOUND) + goto done; + retval = ext2fs_extent_get(handle, EXT2_EXTENT_PREV_LEAF, &prev_extent); + if (retval) { + has_prev = 0; + if (retval != EXT2_ET_EXTENT_NO_PREV) + goto done; + } else { + has_prev = 1; + dbg_print_extent("set_bmap: prev_extent", + &prev_extent); + if (prev_extent.e_flags & EXT2_EXTENT_FLAGS_UNINIT) + prev_uninit = 1; + } + retval = ext2fs_extent_goto(handle, logical); + if (retval && retval != EXT2_ET_EXTENT_NOT_FOUND) + goto done; + + /* check if already pointing to the requested physical */ + if (mapped && (new_uninit == extent_uninit) && + (extent.e_pblk + (logical - extent.e_lblk) == physical)) { +#ifdef DEBUG + printf("physical block (at %llu) unchanged\n", logical); +#endif + goto done; + } + + if (!mapped) { +#ifdef DEBUG + printf("mapping unmapped logical block %llu\n", logical); +#endif + if ((logical == extent.e_lblk + extent.e_len) && + (physical == extent.e_pblk + extent.e_len) && + (new_uninit == extent_uninit) && + ((int) extent.e_len < max_len-1)) { + extent.e_len++; + retval = ext2fs_extent_replace(handle, 0, &extent); + } else if ((logical == extent.e_lblk - 1) && + (physical == extent.e_pblk - 1) && + (new_uninit == extent_uninit) && + ((int) extent.e_len < max_len - 1)) { + extent.e_len++; + extent.e_lblk--; + extent.e_pblk--; + retval = ext2fs_extent_replace(handle, 0, &extent); + } else if (has_next && + (logical == next_extent.e_lblk - 1) && + (physical == next_extent.e_pblk - 1) && + (new_uninit == next_uninit) && + ((int) next_extent.e_len < max_len - 1)) { + retval = ext2fs_extent_get(handle, + EXT2_EXTENT_NEXT_LEAF, + &next_extent); + if (retval) + goto done; + next_extent.e_len++; + next_extent.e_lblk--; + next_extent.e_pblk--; + retval = ext2fs_extent_replace(handle, 0, &next_extent); + } else if (logical < extent.e_lblk) + retval = ext2fs_extent_insert(handle, 0, &newextent); + else + retval = ext2fs_extent_insert(handle, + EXT2_EXTENT_INSERT_AFTER, &newextent); + if (retval) + goto done; + retval = ext2fs_extent_fix_parents(handle); + if (retval) + goto done; + } else if ((logical == extent.e_lblk) && (extent.e_len == 1)) { +#ifdef DEBUG + printf("(re/un)mapping only block in extent\n"); +#endif + if (physical) { + retval = ext2fs_extent_replace(handle, 0, &newextent); + } else { + retval = ext2fs_extent_delete(handle, 0); + if (retval) + goto done; + ec = ext2fs_extent_fix_parents(handle); + if (ec != EXT2_ET_NO_CURRENT_NODE) + retval = ec; + } + + if (retval) + goto done; + } else if (logical == extent.e_lblk + extent.e_len - 1) { +#ifdef DEBUG + printf("(re/un)mapping last block in extent\n"); +#endif + if (physical) { + if (has_next && + (logical == (next_extent.e_lblk - 1)) && + (physical == (next_extent.e_pblk - 1)) && + (new_uninit == next_uninit) && + ((int) next_extent.e_len < max_len - 1)) { + retval = ext2fs_extent_get(handle, + EXT2_EXTENT_NEXT_LEAF, &next_extent); + if (retval) + goto done; + next_extent.e_len++; + next_extent.e_lblk--; + next_extent.e_pblk--; + retval = ext2fs_extent_replace(handle, 0, + &next_extent); + if (retval) + goto done; + } else + retval = ext2fs_extent_insert(handle, + EXT2_EXTENT_INSERT_AFTER, &newextent); + if (retval) + goto done; + retval = ext2fs_extent_fix_parents(handle); + if (retval) + goto done; + /* + * Now pointing at inserted extent; move back to prev. + * + * We cannot use EXT2_EXTENT_PREV to go back; note the + * subtlety in the comment for fix_parents(). + */ + retval = ext2fs_extent_goto(handle, logical); + if (retval) + goto done; + retval = ext2fs_extent_get(handle, + EXT2_EXTENT_CURRENT, + &extent); + if (retval) + goto done; + } + extent.e_len--; + retval = ext2fs_extent_replace(handle, 0, &extent); + if (retval) + goto done; + } else if (logical == extent.e_lblk) { +#ifdef DEBUG + printf("(re/un)mapping first block in extent\n"); +#endif + if (physical) { + if (has_prev && + (logical == (prev_extent.e_lblk + + prev_extent.e_len)) && + (physical == (prev_extent.e_pblk + + prev_extent.e_len)) && + (new_uninit == prev_uninit) && + ((int) prev_extent.e_len < max_len-1)) { + retval = ext2fs_extent_get(handle, + EXT2_EXTENT_PREV_LEAF, &prev_extent); + if (retval) + goto done; + prev_extent.e_len++; + retval = ext2fs_extent_replace(handle, 0, + &prev_extent); + } else + retval = ext2fs_extent_insert(handle, + 0, &newextent); + if (retval) + goto done; + retval = ext2fs_extent_fix_parents(handle); + if (retval) + goto done; + retval = ext2fs_extent_get(handle, + EXT2_EXTENT_NEXT_LEAF, + &extent); + if (retval) + goto done; + } + extent.e_pblk++; + extent.e_lblk++; + extent.e_len--; + retval = ext2fs_extent_replace(handle, 0, &extent); + if (retval) + goto done; + retval = ext2fs_extent_fix_parents(handle); + if (retval) + goto done; + } else { + __u32 save_length; + blk64_t save_lblk; + struct ext2fs_extent save_extent; + errcode_t r2; + +#ifdef DEBUG + printf("(re/un)mapping in middle of extent\n"); +#endif + /* need to split this extent; later */ + save_lblk = extent.e_lblk; + save_length = extent.e_len; + save_extent = extent; + + /* shorten pre-split extent */ + extent.e_len = (logical - extent.e_lblk); + retval = ext2fs_extent_replace(handle, 0, &extent); + if (retval) + goto done; + /* insert our new extent, if any */ + if (physical) { + /* insert new extent after current */ + retval = ext2fs_extent_insert(handle, + EXT2_EXTENT_INSERT_AFTER, &newextent); + if (retval) { + r2 = ext2fs_extent_goto(handle, save_lblk); + if (r2 == 0) + (void)ext2fs_extent_replace(handle, 0, + &save_extent); + goto done; + } + } + /* add post-split extent */ + extent.e_pblk += extent.e_len + 1; + extent.e_lblk += extent.e_len + 1; + extent.e_len = save_length - extent.e_len - 1; + retval = ext2fs_extent_insert(handle, + EXT2_EXTENT_INSERT_AFTER, &extent); + if (retval) { + if (physical) { + r2 = ext2fs_extent_goto(handle, + newextent.e_lblk); + if (r2 == 0) + (void)ext2fs_extent_delete(handle, 0); + } + r2 = ext2fs_extent_goto(handle, save_lblk); + if (r2 == 0) + (void)ext2fs_extent_replace(handle, 0, + &save_extent); + goto done; + } + } + +done: + /* get handle back to its position */ + if (orig_height > handle->max_depth) + orig_height = handle->max_depth; /* In case we shortened the tree */ + ext2fs_extent_goto2(handle, orig_height, orig_lblk); + return retval; +} + +errcode_t ext2fs_extent_delete(ext2_extent_handle_t handle, int flags) +{ + struct extent_path *path; + char *cp; + struct ext3_extent_header *eh; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE); + + if (!(handle->fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + if (!handle->path) + return EXT2_ET_NO_CURRENT_NODE; + +#ifdef DEBUG + { + struct ext2fs_extent extent; + + retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, + &extent); + if (retval == 0) { + printf("extent delete %u ", handle->ino); + dbg_print_extent(0, &extent); + } + } +#endif + + path = handle->path + handle->level; + if (!path->curr) + return EXT2_ET_NO_CURRENT_NODE; + + cp = path->curr; + + /* Sanity check before memmove() */ + if (path->left < 0) + return EXT2_ET_EXTENT_LEAF_BAD; + + if (path->left) { + memmove(cp, cp + sizeof(struct ext3_extent_idx), + path->left * sizeof(struct ext3_extent_idx)); + path->left--; + } else { + struct ext3_extent_idx *ix = path->curr; + ix--; + path->curr = ix; + } + if (--path->entries == 0) + path->curr = 0; + + /* if non-root node has no entries left, remove it & parent ptr to it */ + if (path->entries == 0 && handle->level) { + if (!(flags & EXT2_EXTENT_DELETE_KEEP_EMPTY)) { + struct ext2fs_extent extent; + + retval = ext2fs_extent_get(handle, EXT2_EXTENT_UP, + &extent); + if (retval) + return retval; + + retval = ext2fs_extent_delete(handle, flags); + handle->inode->i_blocks -= + (handle->fs->blocksize * + EXT2FS_CLUSTER_RATIO(handle->fs)) / 512; + retval = ext2fs_write_inode(handle->fs, handle->ino, + handle->inode); + ext2fs_block_alloc_stats2(handle->fs, + extent.e_pblk, -1); + } + } else { + eh = (struct ext3_extent_header *) path->buf; + eh->eh_entries = ext2fs_cpu_to_le16(path->entries); + if ((path->entries == 0) && (handle->level == 0)) { + eh->eh_depth = 0; + handle->max_depth = 0; + } + retval = update_path(handle); + } + return retval; +} + +errcode_t ext2fs_extent_get_info(ext2_extent_handle_t handle, + struct ext2_extent_info *info) +{ + struct extent_path *path; + + EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE); + + memset(info, 0, sizeof(struct ext2_extent_info)); + + path = handle->path + handle->level; + if (path) { + if (path->curr) + info->curr_entry = ((char *) path->curr - path->buf) / + sizeof(struct ext3_extent_idx); + else + info->curr_entry = 0; + info->num_entries = path->entries; + info->max_entries = path->max_entries; + info->bytes_avail = (path->max_entries - path->entries) * + sizeof(struct ext3_extent); + } + + info->curr_level = handle->level; + info->max_depth = handle->max_depth; + info->max_lblk = EXT_MAX_EXTENT_LBLK; + info->max_pblk = EXT_MAX_EXTENT_PBLK; + info->max_len = EXT_INIT_MAX_LEN; + info->max_uninit_len = EXT_UNINIT_MAX_LEN; + + return 0; +} + +static int ul_log2(unsigned long arg) +{ + int l = 0; + + arg >>= 1; + while (arg) { + l++; + arg >>= 1; + } + return l; +} + +size_t ext2fs_max_extent_depth(ext2_extent_handle_t handle) +{ + size_t iblock_sz = sizeof(((struct ext2_inode *)NULL)->i_block); + size_t iblock_extents = (iblock_sz - sizeof(struct ext3_extent_header)) / + sizeof(struct ext3_extent); + size_t extents_per_block = (handle->fs->blocksize - + sizeof(struct ext3_extent_header)) / + sizeof(struct ext3_extent); + static unsigned int last_blocksize = 0; + static size_t last_result = 0; + + if (last_blocksize && last_blocksize == handle->fs->blocksize) + return last_result; + + last_result = 1 + ((ul_log2(EXT_MAX_EXTENT_LBLK) - ul_log2(iblock_extents)) / + ul_log2(extents_per_block)); + last_blocksize = handle->fs->blocksize; + return last_result; +} + +errcode_t ext2fs_fix_extents_checksums(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode) +{ + ext2_extent_handle_t handle; + struct ext2fs_extent extent; + errcode_t errcode; + int save_flags = fs->flags; + + if (!ext2fs_has_feature_metadata_csum(fs->super) || + (inode && !(inode->i_flags & EXT4_EXTENTS_FL))) + return 0; + + errcode = ext2fs_extent_open2(fs, ino, inode, &handle); + if (errcode) { + if (errcode == EXT2_ET_INODE_NOT_EXTENT) + errcode = 0; + return errcode; + } + + fs->flags &= ~EXT2_FLAG_IGNORE_CSUM_ERRORS; + errcode = ext2fs_extent_get(handle, EXT2_EXTENT_ROOT, &extent); + if (errcode) + goto out; + + do { + /* Skip to the end of a block of leaf nodes */ + if (extent.e_flags & EXT2_EXTENT_FLAGS_LEAF) { + errcode = ext2fs_extent_get(handle, + EXT2_EXTENT_LAST_SIB, + &extent); + if (errcode) + break; + } + + errcode = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT, &extent); + if (errcode == EXT2_ET_EXTENT_CSUM_INVALID) + errcode = update_path(handle); + } while (errcode == 0); + +out: + /* Ok if we run off the end */ + if (errcode == EXT2_ET_EXTENT_NO_NEXT) + errcode = 0; + ext2fs_extent_free(handle); + fs->flags = save_flags; + return errcode; +} + +errcode_t ext2fs_decode_extent(struct ext2fs_extent *to, void *addr, int len) +{ + struct ext3_extent *from = (struct ext3_extent *)addr; + + if (len != sizeof(struct ext3_extent)) + return EXT2_ET_INVALID_ARGUMENT; + + to->e_pblk = ext2fs_le32_to_cpu(from->ee_start) + + ((__u64) ext2fs_le16_to_cpu(from->ee_start_hi) + << 32); + to->e_lblk = ext2fs_le32_to_cpu(from->ee_block); + to->e_len = ext2fs_le16_to_cpu(from->ee_len); + to->e_flags = EXT2_EXTENT_FLAGS_LEAF; + if (to->e_len > EXT_INIT_MAX_LEN) { + to->e_len -= EXT_INIT_MAX_LEN; + to->e_flags |= EXT2_EXTENT_FLAGS_UNINIT; + } + + return 0; +} + +errcode_t ext2fs_count_blocks(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, blk64_t *ret_count) +{ + ext2_extent_handle_t handle = NULL; + struct ext2fs_extent extent; + errcode_t errcode; + int i; + blk64_t blkcount = 0; + blk64_t *intermediate_nodes; + + errcode = ext2fs_extent_open2(fs, ino, inode, &handle); + if (errcode) + goto out; + + errcode = ext2fs_extent_get(handle, EXT2_EXTENT_ROOT, &extent); + if (errcode) + goto out; + + errcode = ext2fs_get_array(handle->max_depth, sizeof(blk64_t), + &intermediate_nodes); + if (errcode) + goto out; + + blkcount = handle->level; + while (!errcode) { + if (extent.e_flags & EXT2_EXTENT_FLAGS_LEAF) { + blkcount += extent.e_len; + for (i = 0; i < handle->level; i++) { + if (intermediate_nodes[i] != + handle->path[i].end_blk) { + blkcount++; + intermediate_nodes[i] = + handle->path[i].end_blk; + } + } + } + errcode = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT, &extent); + } + ext2fs_free_mem(&intermediate_nodes); +out: + *ret_count = blkcount; + ext2fs_extent_free(handle); + + return 0; +} + +#ifdef DEBUG +/* + * Override debugfs's prompt + */ +const char *debug_prog_name = "tst_extents"; + +#endif + diff --git a/lib/ext2fs/fallocate.c b/lib/ext2fs/fallocate.c new file mode 100644 index 0000000..5cde7d5 --- /dev/null +++ b/lib/ext2fs/fallocate.c @@ -0,0 +1,873 @@ +/* + * fallocate.c -- Allocate large chunks of file. + * + * Copyright (C) 2014 Oracle. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" + +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#define min(a, b) ((a) < (b) ? (a) : (b)) + +#undef DEBUG + +#ifdef DEBUG +# define dbg_printf(f, a...) do {printf(f, ## a); fflush(stdout); } while (0) +#else +# define dbg_printf(f, a...) +#endif + +/* + * Extent-based fallocate code. + * + * Find runs of unmapped logical blocks by starting at start and walking the + * extents until we reach the end of the range we want. + * + * For each run of unmapped blocks, try to find the extents on either side of + * the range. If there's a left extent that can grow by at least a cluster and + * there are lblocks between start and the next lcluster after start, see if + * there's an implied cluster allocation; if so, zero the blocks (if the left + * extent is initialized) and adjust the extent. Ditto for the blocks between + * the end of the last full lcluster and end, if there's a right extent. + * + * Try to attach as much as we can to the left extent, then try to attach as + * much as we can to the right extent. For the remainder, try to allocate the + * whole range; map in whatever we get; and repeat until we're done. + * + * To attach to a left extent, figure out the maximum amount we can add to the + * extent and try to allocate that much, and append if successful. To attach + * to a right extent, figure out the max we can add to the extent, try to + * allocate that much, and prepend if successful. + * + * We need an alloc_range function that tells us how much we can allocate given + * a maximum length and one of a suggested start, a fixed start, or a fixed end + * point. + * + * Every time we modify the extent tree we also need to update the block stats. + * + * At the end, update i_blocks and i_size appropriately. + */ + +static void dbg_print_extent(const char *desc EXT2FS_ATTR((unused)), + const struct ext2fs_extent *extent EXT2FS_ATTR((unused))) +{ +#ifdef DEBUG + if (desc) + printf("%s: ", desc); + printf("extent: lblk %llu--%llu, len %u, pblk %llu, flags: ", + extent->e_lblk, extent->e_lblk + extent->e_len - 1, + extent->e_len, extent->e_pblk); + if (extent->e_flags & EXT2_EXTENT_FLAGS_LEAF) + fputs("LEAF ", stdout); + if (extent->e_flags & EXT2_EXTENT_FLAGS_UNINIT) + fputs("UNINIT ", stdout); + if (extent->e_flags & EXT2_EXTENT_FLAGS_SECOND_VISIT) + fputs("2ND_VISIT ", stdout); + if (!extent->e_flags) + fputs("(none)", stdout); + fputc('\n', stdout); + fflush(stdout); +#endif +} + +static errcode_t claim_range(ext2_filsys fs, struct ext2_inode *inode, + blk64_t blk, blk64_t len) +{ + blk64_t clusters; + + clusters = (len + EXT2FS_CLUSTER_RATIO(fs) - 1) / + EXT2FS_CLUSTER_RATIO(fs); + ext2fs_block_alloc_stats_range(fs, blk, + clusters * EXT2FS_CLUSTER_RATIO(fs), +1); + return ext2fs_iblk_add_blocks(fs, inode, clusters); +} + +static errcode_t ext_falloc_helper(ext2_filsys fs, + int flags, + ext2_ino_t ino, + struct ext2_inode *inode, + ext2_extent_handle_t handle, + struct ext2fs_extent *left_ext, + struct ext2fs_extent *right_ext, + blk64_t range_start, blk64_t range_len, + blk64_t alloc_goal) +{ + struct ext2fs_extent newex, ex; + int op; + blk64_t fillable, pblk, plen, x, y; + blk64_t eof_blk = 0, cluster_fill = 0; + errcode_t err; + blk_t max_extent_len, max_uninit_len, max_init_len; + +#ifdef DEBUG + printf("%s: ", __func__); + if (left_ext) + printf("left_ext=%llu--%llu, ", left_ext->e_lblk, + left_ext->e_lblk + left_ext->e_len - 1); + if (right_ext) + printf("right_ext=%llu--%llu, ", right_ext->e_lblk, + right_ext->e_lblk + right_ext->e_len - 1); + printf("start=%llu len=%llu, goal=%llu\n", range_start, range_len, + alloc_goal); + fflush(stdout); +#endif + /* Can't create initialized extents past EOF? */ + if (!(flags & EXT2_FALLOCATE_INIT_BEYOND_EOF)) + eof_blk = EXT2_I_SIZE(inode) / fs->blocksize; + + /* The allocation goal must be as far into a cluster as range_start. */ + alloc_goal = (alloc_goal & ~EXT2FS_CLUSTER_MASK(fs)) | + (range_start & EXT2FS_CLUSTER_MASK(fs)); + + max_uninit_len = EXT_UNINIT_MAX_LEN & ~EXT2FS_CLUSTER_MASK(fs); + max_init_len = EXT_INIT_MAX_LEN & ~EXT2FS_CLUSTER_MASK(fs); + + /* We must lengthen the left extent to the end of the cluster */ + if (left_ext && EXT2FS_CLUSTER_RATIO(fs) > 1) { + /* How many more blocks can be attached to left_ext? */ + if (left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) + fillable = max_uninit_len - left_ext->e_len; + else + fillable = max_init_len - left_ext->e_len; + + if (fillable > range_len) + fillable = range_len; + if (fillable == 0) + goto expand_right; + + /* + * If range_start isn't on a cluster boundary, try an + * implied cluster allocation for left_ext. + */ + cluster_fill = EXT2FS_CLUSTER_RATIO(fs) - + (range_start & EXT2FS_CLUSTER_MASK(fs)); + cluster_fill &= EXT2FS_CLUSTER_MASK(fs); + if (cluster_fill == 0) + goto expand_right; + + if (cluster_fill > fillable) + cluster_fill = fillable; + + /* Don't expand an initialized left_ext beyond EOF */ + if (!(flags & EXT2_FALLOCATE_INIT_BEYOND_EOF)) { + x = left_ext->e_lblk + left_ext->e_len - 1; + dbg_printf("%s: lend=%llu newlend=%llu eofblk=%llu\n", + __func__, x, x + cluster_fill, eof_blk); + if (eof_blk >= x && eof_blk <= x + cluster_fill) + cluster_fill = eof_blk - x; + if (cluster_fill == 0) + goto expand_right; + } + + err = ext2fs_extent_goto(handle, left_ext->e_lblk); + if (err) + goto expand_right; + left_ext->e_len += cluster_fill; + range_start += cluster_fill; + range_len -= cluster_fill; + alloc_goal += cluster_fill; + + dbg_print_extent("ext_falloc clus left+", left_ext); + err = ext2fs_extent_replace(handle, 0, left_ext); + if (err) + goto out; + err = ext2fs_extent_fix_parents(handle); + if (err) + goto out; + + /* Zero blocks */ + if (!(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) { + err = ext2fs_zero_blocks2(fs, left_ext->e_pblk + + left_ext->e_len - + cluster_fill, cluster_fill, + NULL, NULL); + if (err) + goto out; + } + } + +expand_right: + /* We must lengthen the right extent to the beginning of the cluster */ + if (right_ext && EXT2FS_CLUSTER_RATIO(fs) > 1) { + /* How much can we attach to right_ext? */ + if (right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) + fillable = max_uninit_len - right_ext->e_len; + else + fillable = max_init_len - right_ext->e_len; + + if (fillable > range_len) + fillable = range_len; + if (fillable == 0) + goto try_merge; + + /* + * If range_end isn't on a cluster boundary, try an implied + * cluster allocation for right_ext. + */ + cluster_fill = right_ext->e_lblk & EXT2FS_CLUSTER_MASK(fs); + if (cluster_fill == 0) + goto try_merge; + + err = ext2fs_extent_goto(handle, right_ext->e_lblk); + if (err) + goto out; + + if (cluster_fill > fillable) + cluster_fill = fillable; + right_ext->e_lblk -= cluster_fill; + right_ext->e_pblk -= cluster_fill; + right_ext->e_len += cluster_fill; + range_len -= cluster_fill; + + dbg_print_extent("ext_falloc clus right+", right_ext); + err = ext2fs_extent_replace(handle, 0, right_ext); + if (err) + goto out; + err = ext2fs_extent_fix_parents(handle); + if (err) + goto out; + + /* Zero blocks if necessary */ + if (!(right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) { + err = ext2fs_zero_blocks2(fs, right_ext->e_pblk, + cluster_fill, NULL, NULL); + if (err) + goto out; + } + } + +try_merge: + /* Merge both extents together, perhaps? */ + if (left_ext && right_ext) { + /* Are the two extents mergeable? */ + if ((left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) != + (right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) + goto try_left; + + /* User requires init/uninit but extent is uninit/init. */ + if (((flags & EXT2_FALLOCATE_FORCE_INIT) && + (left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) || + ((flags & EXT2_FALLOCATE_FORCE_UNINIT) && + !(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT))) + goto try_left; + + /* + * Skip initialized extent unless user wants to zero blocks + * or requires init extent. + */ + if (!(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) && + (!(flags & EXT2_FALLOCATE_ZERO_BLOCKS) || + !(flags & EXT2_FALLOCATE_FORCE_INIT))) + goto try_left; + + /* Will it even fit? */ + x = left_ext->e_len + range_len + right_ext->e_len; + if (x > (left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT ? + max_uninit_len : max_init_len)) + goto try_left; + + err = ext2fs_extent_goto(handle, left_ext->e_lblk); + if (err) + goto try_left; + + /* Allocate blocks */ + y = left_ext->e_pblk + left_ext->e_len; + err = ext2fs_new_range(fs, EXT2_NEWRANGE_FIXED_GOAL | + EXT2_NEWRANGE_MIN_LENGTH, y, + right_ext->e_pblk - y + 1, NULL, + &pblk, &plen); + if (err) + goto try_left; + if (pblk + plen != right_ext->e_pblk) + goto try_left; + err = claim_range(fs, inode, pblk, plen); + if (err) + goto out; + + /* Modify extents */ + left_ext->e_len = x; + dbg_print_extent("ext_falloc merge", left_ext); + err = ext2fs_extent_replace(handle, 0, left_ext); + if (err) + goto out; + err = ext2fs_extent_fix_parents(handle); + if (err) + goto out; + err = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT_LEAF, &newex); + if (err) + goto out; + err = ext2fs_extent_delete(handle, 0); + if (err) + goto out; + err = ext2fs_extent_fix_parents(handle); + if (err) + goto out; + *right_ext = *left_ext; + + /* Zero blocks */ + if (!(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) && + (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) { + err = ext2fs_zero_blocks2(fs, range_start, range_len, + NULL, NULL); + if (err) + goto out; + } + + return 0; + } + +try_left: + /* Extend the left extent */ + if (left_ext) { + /* How many more blocks can be attached to left_ext? */ + if (left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) + fillable = max_uninit_len - left_ext->e_len; + else if (flags & EXT2_FALLOCATE_ZERO_BLOCKS) + fillable = max_init_len - left_ext->e_len; + else + fillable = 0; + + /* User requires init/uninit but extent is uninit/init. */ + if (((flags & EXT2_FALLOCATE_FORCE_INIT) && + (left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) || + ((flags & EXT2_FALLOCATE_FORCE_UNINIT) && + !(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT))) + goto try_right; + + if (fillable > range_len) + fillable = range_len; + + /* Don't expand an initialized left_ext beyond EOF */ + x = left_ext->e_lblk + left_ext->e_len - 1; + if (!(flags & EXT2_FALLOCATE_INIT_BEYOND_EOF)) { + dbg_printf("%s: lend=%llu newlend=%llu eofblk=%llu\n", + __func__, x, x + fillable, eof_blk); + if (eof_blk >= x && eof_blk <= x + fillable) + fillable = eof_blk - x; + } + + if (fillable == 0) + goto try_right; + + /* Test if the right edge of the range is already mapped? */ + if (EXT2FS_CLUSTER_RATIO(fs) > 1) { + err = ext2fs_map_cluster_block(fs, ino, inode, + x + fillable, &pblk); + if (err) + goto out; + if (pblk) + fillable -= 1 + ((x + fillable) + & EXT2FS_CLUSTER_MASK(fs)); + if (fillable == 0) + goto try_right; + } + + /* Allocate range of blocks */ + x = left_ext->e_pblk + left_ext->e_len; + err = ext2fs_new_range(fs, EXT2_NEWRANGE_FIXED_GOAL | + EXT2_NEWRANGE_MIN_LENGTH, + x, fillable, NULL, &pblk, &plen); + if (err) + goto try_right; + err = claim_range(fs, inode, pblk, plen); + if (err) + goto out; + + /* Modify left_ext */ + err = ext2fs_extent_goto(handle, left_ext->e_lblk); + if (err) + goto out; + range_start += plen; + range_len -= plen; + left_ext->e_len += plen; + dbg_print_extent("ext_falloc left+", left_ext); + err = ext2fs_extent_replace(handle, 0, left_ext); + if (err) + goto out; + err = ext2fs_extent_fix_parents(handle); + if (err) + goto out; + + /* Zero blocks if necessary */ + if (!(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) && + (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) { + err = ext2fs_zero_blocks2(fs, pblk, plen, NULL, NULL); + if (err) + goto out; + } + } + +try_right: + /* Extend the right extent */ + if (right_ext) { + /* How much can we attach to right_ext? */ + if (right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) + fillable = max_uninit_len - right_ext->e_len; + else if (flags & EXT2_FALLOCATE_ZERO_BLOCKS) + fillable = max_init_len - right_ext->e_len; + else + fillable = 0; + + /* User requires init/uninit but extent is uninit/init. */ + if (((flags & EXT2_FALLOCATE_FORCE_INIT) && + (right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) || + ((flags & EXT2_FALLOCATE_FORCE_UNINIT) && + !(right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT))) + goto try_anywhere; + + if (fillable > range_len) + fillable = range_len; + if (fillable == 0) + goto try_anywhere; + + /* Test if the left edge of the range is already mapped? */ + if (EXT2FS_CLUSTER_RATIO(fs) > 1) { + err = ext2fs_map_cluster_block(fs, ino, inode, + right_ext->e_lblk - fillable, &pblk); + if (err) + goto out; + if (pblk) + fillable -= EXT2FS_CLUSTER_RATIO(fs) - + ((right_ext->e_lblk - fillable) + & EXT2FS_CLUSTER_MASK(fs)); + if (fillable == 0) + goto try_anywhere; + } + + /* + * FIXME: It would be nice if we could handle allocating a + * variable range from a fixed end point instead of just + * skipping to the general allocator if the whole range is + * unavailable. + */ + err = ext2fs_new_range(fs, EXT2_NEWRANGE_FIXED_GOAL | + EXT2_NEWRANGE_MIN_LENGTH, + right_ext->e_pblk - fillable, + fillable, NULL, &pblk, &plen); + if (err) + goto try_anywhere; + err = claim_range(fs, inode, + pblk & ~EXT2FS_CLUSTER_MASK(fs), + plen + (pblk & EXT2FS_CLUSTER_MASK(fs))); + if (err) + goto out; + + /* Modify right_ext */ + err = ext2fs_extent_goto(handle, right_ext->e_lblk); + if (err) + goto out; + range_len -= plen; + right_ext->e_lblk -= plen; + right_ext->e_pblk -= plen; + right_ext->e_len += plen; + dbg_print_extent("ext_falloc right+", right_ext); + err = ext2fs_extent_replace(handle, 0, right_ext); + if (err) + goto out; + err = ext2fs_extent_fix_parents(handle); + if (err) + goto out; + + /* Zero blocks if necessary */ + if (!(right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) && + (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) { + err = ext2fs_zero_blocks2(fs, pblk, + plen + cluster_fill, NULL, NULL); + if (err) + goto out; + } + } + +try_anywhere: + /* Try implied cluster alloc on the left and right ends */ + if (range_len > 0 && (range_start & EXT2FS_CLUSTER_MASK(fs))) { + cluster_fill = EXT2FS_CLUSTER_RATIO(fs) - + (range_start & EXT2FS_CLUSTER_MASK(fs)); + cluster_fill &= EXT2FS_CLUSTER_MASK(fs); + if (cluster_fill > range_len) + cluster_fill = range_len; + newex.e_lblk = range_start; + err = ext2fs_map_cluster_block(fs, ino, inode, newex.e_lblk, + &pblk); + if (err) + goto out; + if (pblk == 0) + goto try_right_implied; + newex.e_pblk = pblk; + newex.e_len = cluster_fill; + newex.e_flags = (flags & EXT2_FALLOCATE_FORCE_INIT ? 0 : + EXT2_EXTENT_FLAGS_UNINIT); + dbg_print_extent("ext_falloc iclus left+", &newex); + ext2fs_extent_goto(handle, newex.e_lblk); + err = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, + &ex); + if (err == EXT2_ET_NO_CURRENT_NODE) + ex.e_lblk = 0; + else if (err) + goto out; + + if (ex.e_lblk > newex.e_lblk) + op = 0; /* insert before */ + else + op = EXT2_EXTENT_INSERT_AFTER; + dbg_printf("%s: inserting %s lblk %llu newex=%llu\n", + __func__, op ? "after" : "before", ex.e_lblk, + newex.e_lblk); + err = ext2fs_extent_insert(handle, op, &newex); + if (err) + goto out; + err = ext2fs_extent_fix_parents(handle); + if (err) + goto out; + + if (!(newex.e_flags & EXT2_EXTENT_FLAGS_UNINIT) && + (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) { + err = ext2fs_zero_blocks2(fs, newex.e_pblk, + newex.e_len, NULL, NULL); + if (err) + goto out; + } + + range_start += cluster_fill; + range_len -= cluster_fill; + } + +try_right_implied: + y = range_start + range_len; + if (range_len > 0 && (y & EXT2FS_CLUSTER_MASK(fs))) { + cluster_fill = y & EXT2FS_CLUSTER_MASK(fs); + if (cluster_fill > range_len) + cluster_fill = range_len; + newex.e_lblk = y & ~EXT2FS_CLUSTER_MASK(fs); + err = ext2fs_map_cluster_block(fs, ino, inode, newex.e_lblk, + &pblk); + if (err) + goto out; + if (pblk == 0) + goto no_implied; + newex.e_pblk = pblk; + newex.e_len = cluster_fill; + newex.e_flags = (flags & EXT2_FALLOCATE_FORCE_INIT ? 0 : + EXT2_EXTENT_FLAGS_UNINIT); + dbg_print_extent("ext_falloc iclus right+", &newex); + ext2fs_extent_goto(handle, newex.e_lblk); + err = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, + &ex); + if (err == EXT2_ET_NO_CURRENT_NODE) + ex.e_lblk = 0; + else if (err) + goto out; + + if (ex.e_lblk > newex.e_lblk) + op = 0; /* insert before */ + else + op = EXT2_EXTENT_INSERT_AFTER; + dbg_printf("%s: inserting %s lblk %llu newex=%llu\n", + __func__, op ? "after" : "before", ex.e_lblk, + newex.e_lblk); + err = ext2fs_extent_insert(handle, op, &newex); + if (err) + goto out; + err = ext2fs_extent_fix_parents(handle); + if (err) + goto out; + + if (!(newex.e_flags & EXT2_EXTENT_FLAGS_UNINIT) && + (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) { + err = ext2fs_zero_blocks2(fs, newex.e_pblk, + newex.e_len, NULL, NULL); + if (err) + goto out; + } + + range_len -= cluster_fill; + } + +no_implied: + if (range_len == 0) + return 0; + + newex.e_lblk = range_start; + if (flags & EXT2_FALLOCATE_FORCE_INIT) { + max_extent_len = max_init_len; + newex.e_flags = 0; + } else { + max_extent_len = max_uninit_len; + newex.e_flags = EXT2_EXTENT_FLAGS_UNINIT; + } + pblk = alloc_goal; + y = range_len; + for (x = 0; x < y;) { + cluster_fill = newex.e_lblk & EXT2FS_CLUSTER_MASK(fs); + fillable = min(range_len + cluster_fill, max_extent_len); + err = ext2fs_new_range(fs, 0, pblk & ~EXT2FS_CLUSTER_MASK(fs), + fillable, + NULL, &pblk, &plen); + if (err) + goto out; + err = claim_range(fs, inode, pblk, plen); + if (err) + goto out; + + /* Create extent */ + newex.e_pblk = pblk + cluster_fill; + newex.e_len = plen - cluster_fill; + dbg_print_extent("ext_falloc create", &newex); + ext2fs_extent_goto(handle, newex.e_lblk); + err = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, + &ex); + if (err == EXT2_ET_NO_CURRENT_NODE) + ex.e_lblk = 0; + else if (err) + goto out; + + if (ex.e_lblk > newex.e_lblk) + op = 0; /* insert before */ + else + op = EXT2_EXTENT_INSERT_AFTER; + dbg_printf("%s: inserting %s lblk %llu newex=%llu\n", + __func__, op ? "after" : "before", ex.e_lblk, + newex.e_lblk); + err = ext2fs_extent_insert(handle, op, &newex); + if (err) + goto out; + err = ext2fs_extent_fix_parents(handle); + if (err) + goto out; + + if (!(newex.e_flags & EXT2_EXTENT_FLAGS_UNINIT) && + (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) { + err = ext2fs_zero_blocks2(fs, pblk, plen, NULL, NULL); + if (err) + goto out; + } + + /* Update variables at end of loop */ + x += plen - cluster_fill; + range_len -= plen - cluster_fill; + newex.e_lblk += plen - cluster_fill; + pblk += plen - cluster_fill; + if (pblk >= ext2fs_blocks_count(fs->super)) + pblk = fs->super->s_first_data_block; + } + +out: + return err; +} + +static errcode_t extent_fallocate(ext2_filsys fs, int flags, ext2_ino_t ino, + struct ext2_inode *inode, blk64_t goal, + blk64_t start, blk64_t len) +{ + ext2_extent_handle_t handle; + struct ext2fs_extent left_extent, right_extent; + struct ext2fs_extent *left_adjacent, *right_adjacent; + errcode_t err; + blk64_t range_start, range_end = 0, end, next; + blk64_t count, goal_distance; + + end = start + len - 1; + err = ext2fs_extent_open2(fs, ino, inode, &handle); + if (err) + return err; + + /* + * Find the extent closest to the start of the alloc range. We don't + * check the return value because _goto() sets the current node to the + * next-lowest extent if 'start' is in a hole; or the next-highest + * extent if there aren't any lower ones; or doesn't set a current node + * if there was a real error reading the extent tree. In that case, + * _get() will error out. + */ +start_again: + ext2fs_extent_goto(handle, start); + err = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &left_extent); + if (err == EXT2_ET_NO_CURRENT_NODE) { + blk64_t max_blocks = ext2fs_blocks_count(fs->super); + + if (goal == ~0ULL) + goal = ext2fs_find_inode_goal(fs, ino, inode, start); + err = ext2fs_find_first_zero_block_bitmap2(fs->block_map, + goal, max_blocks - 1, &goal); + goal += start; + err = ext_falloc_helper(fs, flags, ino, inode, handle, NULL, + NULL, start, len, goal); + goto errout; + } else if (err) + goto errout; + + dbg_print_extent("ext_falloc initial", &left_extent); + next = left_extent.e_lblk + left_extent.e_len; + if (left_extent.e_lblk > start) { + /* The nearest extent we found was beyond start??? */ + goal = left_extent.e_pblk - (left_extent.e_lblk - start); + err = ext_falloc_helper(fs, flags, ino, inode, handle, NULL, + &left_extent, start, + left_extent.e_lblk - start, goal); + if (err) + goto errout; + + goto start_again; + } else if (next >= start) { + range_start = next; + left_adjacent = &left_extent; + } else { + range_start = start; + left_adjacent = NULL; + } + goal = left_extent.e_pblk + (range_start - left_extent.e_lblk); + + do { + err = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT_LEAF, + &right_extent); + dbg_printf("%s: ino=%d get next =%d\n", __func__, ino, + (int)err); + dbg_print_extent("ext_falloc next", &right_extent); + /* Stop if we've seen this extent before */ + if (!err && right_extent.e_lblk <= left_extent.e_lblk) + err = EXT2_ET_EXTENT_NO_NEXT; + + if (err && err != EXT2_ET_EXTENT_NO_NEXT) + goto errout; + if (err == EXT2_ET_EXTENT_NO_NEXT || + right_extent.e_lblk > end + 1) { + range_end = end; + right_adjacent = NULL; + } else { + /* Handle right_extent.e_lblk <= end */ + range_end = right_extent.e_lblk - 1; + right_adjacent = &right_extent; + } + goal_distance = range_start - next; + if (err != EXT2_ET_EXTENT_NO_NEXT && + goal_distance > (range_end - right_extent.e_lblk)) + goal = right_extent.e_pblk - + (right_extent.e_lblk - range_start); + + dbg_printf("%s: ino=%d rstart=%llu rend=%llu\n", __func__, ino, + range_start, range_end); + err = 0; + if (range_start <= range_end) { + count = range_end - range_start + 1; + err = ext_falloc_helper(fs, flags, ino, inode, handle, + left_adjacent, right_adjacent, + range_start, count, goal); + if (err) + goto errout; + } + + if (range_end == end) + break; + + err = ext2fs_extent_goto(handle, right_extent.e_lblk); + if (err) + goto errout; + next = right_extent.e_lblk + right_extent.e_len; + left_extent = right_extent; + left_adjacent = &left_extent; + range_start = next; + goal = left_extent.e_pblk + (range_start - left_extent.e_lblk); + } while (range_end < end); + +errout: + ext2fs_extent_free(handle); + return err; +} + +/* + * Map physical blocks to a range of logical blocks within a file. The range + * of logical blocks are (start, start + len). If there are already extents, + * the mappings will try to extend the mappings; otherwise, it will try to map + * start as if logical block 0 points to goal. If goal is ~0ULL, then the goal + * is calculated based on the inode group. + * + * Flags: + * - EXT2_FALLOCATE_ZERO_BLOCKS: Zero the blocks that are allocated. + * - EXT2_FALLOCATE_FORCE_INIT: Create only initialized extents. + * - EXT2_FALLOCATE_FORCE_UNINIT: Create only uninitialized extents. + * - EXT2_FALLOCATE_INIT_BEYOND_EOF: Create extents beyond EOF. + * + * If neither FORCE_INIT nor FORCE_UNINIT are specified, this function will + * try to expand any extents it finds, zeroing blocks as necessary. + */ +errcode_t ext2fs_fallocate(ext2_filsys fs, int flags, ext2_ino_t ino, + struct ext2_inode *inode, blk64_t goal, + blk64_t start, blk64_t len) +{ + struct ext2_inode inode_buf; + blk64_t blk, x, zero_blk, last = 0; + int zero_len = 0; + errcode_t err; + + if (((flags & EXT2_FALLOCATE_FORCE_INIT) && + (flags & EXT2_FALLOCATE_FORCE_UNINIT)) || + (flags & ~EXT2_FALLOCATE_ALL_FLAGS)) + return EXT2_ET_INVALID_ARGUMENT; + + if (len > ext2fs_blocks_count(fs->super)) + return EXT2_ET_BLOCK_ALLOC_FAIL; + else if (len == 0) + return 0; + + /* Read inode structure if necessary */ + if (!inode) { + err = ext2fs_read_inode(fs, ino, &inode_buf); + if (err) + return err; + inode = &inode_buf; + } + dbg_printf("%s: ino=%d start=%llu len=%llu goal=%llu\n", __func__, ino, + start, len, goal); + + if (inode->i_flags & EXT4_EXTENTS_FL) { + err = extent_fallocate(fs, flags, ino, inode, goal, start, len); + goto out; + } + + /* XXX: Allocate a bunch of blocks the slow way */ + for (blk = start; blk < start + len; blk++) { + err = ext2fs_bmap2(fs, ino, inode, NULL, 0, blk, 0, &x); + if (err) + return err; + if (x) + continue; + + err = ext2fs_bmap2(fs, ino, inode, NULL, BMAP_ALLOC, + blk, 0, &x); + if (err) + goto errout; + if ((zero_len && (x != last+1)) || + (zero_len >= 65536)) { + err = ext2fs_zero_blocks2(fs, zero_blk, zero_len, + NULL, NULL); + zero_len = 0; + if (err) + goto errout; + } + if (zero_len == 0) { + zero_blk = x; + zero_len = 1; + } else { + zero_len++; + } + last = x; + } + +out: + if (inode == &inode_buf) + ext2fs_write_inode(fs, ino, inode); +errout: + if (zero_len) + ext2fs_zero_blocks2(fs, zero_blk, zero_len, NULL, NULL); + return err; +} diff --git a/lib/ext2fs/fast_commit.h b/lib/ext2fs/fast_commit.h new file mode 100644 index 0000000..4ad38f1 --- /dev/null +++ b/lib/ext2fs/fast_commit.h @@ -0,0 +1,190 @@ +/* SPDX-License-Identifier: GPL-2.0 */ + +#ifndef __FAST_COMMIT_H__ +#define __FAST_COMMIT_H__ + +#include "jfs_compat.h" + +/* + * Note this file is present in e2fsprogs/lib/ext2fs/fast_commit.h and + * linux/fs/ext4/fast_commit.h. These file should always be byte identical. + */ + +/* Fast commit tags */ +#define EXT4_FC_TAG_ADD_RANGE 0x0001 +#define EXT4_FC_TAG_DEL_RANGE 0x0002 +#define EXT4_FC_TAG_CREAT 0x0003 +#define EXT4_FC_TAG_LINK 0x0004 +#define EXT4_FC_TAG_UNLINK 0x0005 +#define EXT4_FC_TAG_INODE 0x0006 +#define EXT4_FC_TAG_PAD 0x0007 +#define EXT4_FC_TAG_TAIL 0x0008 +#define EXT4_FC_TAG_HEAD 0x0009 + +#define EXT4_FC_SUPPORTED_FEATURES 0x0 + +/* On disk fast commit tlv value structures */ + +/* Fast commit on disk tag length structure */ +struct ext4_fc_tl { + __le16 fc_tag; + __le16 fc_len; +}; + +/* Value structure for tag EXT4_FC_TAG_HEAD. */ +struct ext4_fc_head { + __le32 fc_features; + __le32 fc_tid; +}; + +/* Value structure for EXT4_FC_TAG_ADD_RANGE. */ +struct ext4_fc_add_range { + __le32 fc_ino; + __u8 fc_ex[12]; +}; + +/* Value structure for tag EXT4_FC_TAG_DEL_RANGE. */ +struct ext4_fc_del_range { + __le32 fc_ino; + __le32 fc_lblk; + __le32 fc_len; +}; + +/* + * This is the value structure for tags EXT4_FC_TAG_CREAT, EXT4_FC_TAG_LINK + * and EXT4_FC_TAG_UNLINK. + */ +struct ext4_fc_dentry_info { + __le32 fc_parent_ino; + __le32 fc_ino; + __u8 fc_dname[0]; +}; + +/* Value structure for EXT4_FC_TAG_INODE and EXT4_FC_TAG_INODE_PARTIAL. */ +struct ext4_fc_inode { + __le32 fc_ino; + __u8 fc_raw_inode[0]; +}; + +/* Value structure for tag EXT4_FC_TAG_TAIL. */ +struct ext4_fc_tail { + __le32 fc_tid; + __le32 fc_crc; +}; + +/* + * Fast commit reason codes + */ +enum { + /* + * Commit status codes: + */ + EXT4_FC_REASON_OK = 0, + EXT4_FC_REASON_INELIGIBLE, + EXT4_FC_REASON_ALREADY_COMMITTED, + EXT4_FC_REASON_FC_START_FAILED, + EXT4_FC_REASON_FC_FAILED, + + /* + * Fast commit ineligiblity reasons: + */ + EXT4_FC_REASON_XATTR = 0, + EXT4_FC_REASON_CROSS_RENAME, + EXT4_FC_REASON_JOURNAL_FLAG_CHANGE, + EXT4_FC_REASON_NOMEM, + EXT4_FC_REASON_SWAP_BOOT, + EXT4_FC_REASON_RESIZE, + EXT4_FC_REASON_RENAME_DIR, + EXT4_FC_REASON_FALLOC_RANGE, + EXT4_FC_REASON_INODE_JOURNAL_DATA, + EXT4_FC_COMMIT_FAILED, + EXT4_FC_REASON_MAX +}; + +#ifdef __KERNEL__ +/* + * In memory list of dentry updates that are performed on the file + * system used by fast commit code. + */ +struct ext4_fc_dentry_update { + int fcd_op; /* Type of update create / unlink / link */ + int fcd_parent; /* Parent inode number */ + int fcd_ino; /* Inode number */ + struct qstr fcd_name; /* Dirent name */ + unsigned char fcd_iname[DNAME_INLINE_LEN]; /* Dirent name string */ + struct list_head fcd_list; +}; + +struct ext4_fc_stats { + unsigned int fc_ineligible_reason_count[EXT4_FC_REASON_MAX]; + unsigned long fc_num_commits; + unsigned long fc_ineligible_commits; + unsigned long fc_numblks; +}; + +#define EXT4_FC_REPLAY_REALLOC_INCREMENT 4 + +/* + * Physical block regions added to different inodes due to fast commit + * recovery. These are set during the SCAN phase. During the replay phase, + * our allocator excludes these from its allocation. This ensures that + * we don't accidentally allocating a block that is going to be used by + * another inode. + */ +struct ext4_fc_alloc_region { + ext4_lblk_t lblk; + ext4_fsblk_t pblk; + int ino, len; +}; + +/* + * Fast commit replay state. + */ +struct ext4_fc_replay_state { + int fc_replay_num_tags; + int fc_replay_expected_off; + int fc_current_pass; + int fc_cur_tag; + int fc_crc; + struct ext4_fc_alloc_region *fc_regions; + int fc_regions_size, fc_regions_used, fc_regions_valid; + int *fc_modified_inodes; + int fc_modified_inodes_used, fc_modified_inodes_size; +}; + +#define region_last(__region) (((__region)->lblk) + ((__region)->len) - 1) +#endif + +static inline const char *tag2str(__u16 tag) +{ + switch (tag) { + case EXT4_FC_TAG_LINK: + return "ADD_ENTRY"; + case EXT4_FC_TAG_UNLINK: + return "DEL_ENTRY"; + case EXT4_FC_TAG_ADD_RANGE: + return "ADD_RANGE"; + case EXT4_FC_TAG_CREAT: + return "CREAT_DENTRY"; + case EXT4_FC_TAG_DEL_RANGE: + return "DEL_RANGE"; + case EXT4_FC_TAG_INODE: + return "INODE"; + case EXT4_FC_TAG_PAD: + return "PAD"; + case EXT4_FC_TAG_TAIL: + return "TAIL"; + case EXT4_FC_TAG_HEAD: + return "HEAD"; + default: + return "ERROR"; + } +} + +/* Get length of a particular tlv */ +static inline int ext4_fc_tag_len(struct ext4_fc_tl *tl) +{ + return le16_to_cpu(tl->fc_len); +} + +#endif /* __FAST_COMMIT_H__ */ diff --git a/lib/ext2fs/fiemap.h b/lib/ext2fs/fiemap.h new file mode 100644 index 0000000..33ab8fb --- /dev/null +++ b/lib/ext2fs/fiemap.h @@ -0,0 +1,93 @@ +/* + * FS_IOC_FIEMAP ioctl infrastructure. + * + * Some portions copyright (C) 2007 Cluster File Systems, Inc + * + * Authors: Mark Fasheh <mfasheh@suse.com> + * Kalpak Shah <kalpak.shah@sun.com> + * Andreas Dilger <adilger@sun.com> + */ + +#ifndef _LINUX_FIEMAP_H +#define _LINUX_FIEMAP_H + +struct fiemap_extent { + __u64 fe_logical; /* logical offset in bytes for the start of + * the extent from the beginning of the file */ + __u64 fe_physical; /* physical offset in bytes for the start + * of the extent from the beginning of the disk */ + __u64 fe_length; /* length in bytes for this extent */ + __u64 fe_reserved64[2]; + __u32 fe_flags; /* FIEMAP_EXTENT_* flags for this extent */ + __u32 fe_reserved[3]; +}; + +struct fiemap { + __u64 fm_start; /* logical offset (inclusive) at + * which to start mapping (in) */ + __u64 fm_length; /* logical length of mapping which + * userspace wants (in) */ + __u32 fm_flags; /* FIEMAP_FLAG_* flags for request (in/out) */ + __u32 fm_mapped_extents;/* number of extents that were mapped (out) */ + __u32 fm_extent_count; /* size of fm_extents array (in) */ + __u32 fm_reserved; +#if __GNUC_PREREQ (4, 8) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wpedantic" +#endif + struct fiemap_extent fm_extents[0]; /* array of mapped extents (out) */ +#if __GNUC_PREREQ (4, 8) +#pragma GCC diagnostic pop +#endif +}; + +#if defined(__linux__) && !defined(FS_IOC_FIEMAP) +#define FS_IOC_FIEMAP _IOWR('f', 11, struct fiemap) +#endif + +#if defined(__linux__) && !defined(FS_IOC_GETSTATE) +#define EXT4_IOC_GETSTATE _IOW('f', 41, __u32) +#endif + +#if defined(__linux__) && !defined(EXT4_IOC_GET_ES_CACHE) +#define EXT4_IOC_GET_ES_CACHE _IOWR('f', 42, struct fiemap) +#endif + +#if defined(__linux__) && !defined(EXT4_STATE_FLAG_EXT_PRECACHED) +#define EXT4_STATE_FLAG_EXT_PRECACHED 0x00000001 +#endif + +#define FIEMAP_MAX_OFFSET (~0ULL) + +#define FIEMAP_FLAG_SYNC 0x00000001 /* sync file data before map */ +#define FIEMAP_FLAG_XATTR 0x00000002 /* map extended attribute tree */ +#define FIEMAP_FLAG_CACHE 0x00000004 /* request caching of the extents */ + +#define FIEMAP_FLAGS_COMPAT (FIEMAP_FLAG_SYNC | FIEMAP_FLAG_XATTR) + +#define FIEMAP_EXTENT_LAST 0x00000001 /* Last extent in file. */ +#define FIEMAP_EXTENT_UNKNOWN 0x00000002 /* Data location unknown. */ +#define FIEMAP_EXTENT_DELALLOC 0x00000004 /* Location still pending. + * Sets EXTENT_UNKNOWN. */ +#define FIEMAP_EXTENT_ENCODED 0x00000008 /* Data can not be read + * while fs is unmounted */ +#define FIEMAP_EXTENT_DATA_ENCRYPTED 0x00000080 /* Data is encrypted by fs. + * Sets EXTENT_NO_BYPASS. */ +#define FIEMAP_EXTENT_NOT_ALIGNED 0x00000100 /* Extent offsets may not be + * block aligned. */ +#define FIEMAP_EXTENT_DATA_INLINE 0x00000200 /* Data mixed with metadata. + * Sets EXTENT_NOT_ALIGNED.*/ +#define FIEMAP_EXTENT_DATA_TAIL 0x00000400 /* Multiple files in block. + * Sets EXTENT_NOT_ALIGNED.*/ +#define FIEMAP_EXTENT_UNWRITTEN 0x00000800 /* Space allocated, but + * no data (i.e. zero). */ +#define FIEMAP_EXTENT_MERGED 0x00001000 /* File does not natively + * support extents. Result + * merged for efficiency. */ +#define FIEMAP_EXTENT_SHARED 0x00002000 /* Space shared with other + * files. */ + +#define EXT4_FIEMAP_EXTENT_HOLE 0x08000000 /* Entry in extent status + cache for a hole*/ + +#endif /* _LINUX_FIEMAP_H */ diff --git a/lib/ext2fs/fileio.c b/lib/ext2fs/fileio.c new file mode 100644 index 0000000..818f7f0 --- /dev/null +++ b/lib/ext2fs/fileio.c @@ -0,0 +1,666 @@ +/* + * fileio.c --- Simple file I/O routines + * + * Copyright (C) 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +struct ext2_file { + errcode_t magic; + ext2_filsys fs; + ext2_ino_t ino; + struct ext2_inode inode; + int flags; + __u64 pos; + blk64_t blockno; + blk64_t physblock; + char *buf; +}; + +struct block_entry { + blk64_t physblock; + unsigned char sha[EXT2FS_SHA512_LENGTH]; +}; +typedef struct block_entry *block_entry_t; + +#define BMAP_BUFFER (file->buf + fs->blocksize) + +errcode_t ext2fs_file_open2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + int flags, ext2_file_t *ret) +{ + ext2_file_t file; + errcode_t retval; + + /* + * Don't let caller create or open a file for writing if the + * filesystem is read-only. + */ + if ((flags & (EXT2_FILE_WRITE | EXT2_FILE_CREATE)) && + !(fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + retval = ext2fs_get_mem(sizeof(struct ext2_file), &file); + if (retval) + return retval; + + memset(file, 0, sizeof(struct ext2_file)); + file->magic = EXT2_ET_MAGIC_EXT2_FILE; + file->fs = fs; + file->ino = ino; + file->flags = flags & EXT2_FILE_MASK; + + if (inode) { + memcpy(&file->inode, inode, sizeof(struct ext2_inode)); + } else { + retval = ext2fs_read_inode(fs, ino, &file->inode); + if (retval) + goto fail; + } + + retval = ext2fs_get_array(3, fs->blocksize, &file->buf); + if (retval) + goto fail; + + *ret = file; + return 0; + +fail: + if (file->buf) + ext2fs_free_mem(&file->buf); + ext2fs_free_mem(&file); + return retval; +} + +errcode_t ext2fs_file_open(ext2_filsys fs, ext2_ino_t ino, + int flags, ext2_file_t *ret) +{ + return ext2fs_file_open2(fs, ino, NULL, flags, ret); +} + +/* + * This function returns the filesystem handle of a file from the structure + */ +ext2_filsys ext2fs_file_get_fs(ext2_file_t file) +{ + if (file->magic != EXT2_ET_MAGIC_EXT2_FILE) + return 0; + return file->fs; +} + +/* + * This function returns the pointer to the inode of a file from the structure + */ +struct ext2_inode *ext2fs_file_get_inode(ext2_file_t file) +{ + if (file->magic != EXT2_ET_MAGIC_EXT2_FILE) + return NULL; + return &file->inode; +} + +/* This function returns the inode number from the structure */ +ext2_ino_t ext2fs_file_get_inode_num(ext2_file_t file) +{ + if (file->magic != EXT2_ET_MAGIC_EXT2_FILE) + return 0; + return file->ino; +} + +/* + * This function flushes the dirty block buffer out to disk if + * necessary. + */ +errcode_t ext2fs_file_flush(ext2_file_t file) +{ + errcode_t retval; + ext2_filsys fs; + int ret_flags; + blk64_t dontcare; + + EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE); + fs = file->fs; + + if (!(file->flags & EXT2_FILE_BUF_VALID) || + !(file->flags & EXT2_FILE_BUF_DIRTY)) + return 0; + + /* Is this an uninit block? */ + if (file->physblock && file->inode.i_flags & EXT4_EXTENTS_FL) { + retval = ext2fs_bmap2(fs, file->ino, &file->inode, BMAP_BUFFER, + 0, file->blockno, &ret_flags, &dontcare); + if (retval) + return retval; + if (ret_flags & BMAP_RET_UNINIT) { + retval = ext2fs_bmap2(fs, file->ino, &file->inode, + BMAP_BUFFER, BMAP_SET, + file->blockno, 0, + &file->physblock); + if (retval) + return retval; + } + } + + /* + * OK, the physical block hasn't been allocated yet. + * Allocate it. + */ + if (!file->physblock) { + retval = ext2fs_bmap2(fs, file->ino, &file->inode, + BMAP_BUFFER, file->ino ? BMAP_ALLOC : 0, + file->blockno, 0, &file->physblock); + if (retval) + return retval; + } + + retval = io_channel_write_blk64(fs->io, file->physblock, 1, file->buf); + if (retval) + return retval; + + file->flags &= ~EXT2_FILE_BUF_DIRTY; + + return retval; +} + +/* + * This function synchronizes the file's block buffer and the current + * file position, possibly invalidating block buffer if necessary + */ +static errcode_t sync_buffer_position(ext2_file_t file) +{ + blk64_t b; + errcode_t retval; + + b = file->pos / file->fs->blocksize; + if (b != file->blockno) { + retval = ext2fs_file_flush(file); + if (retval) + return retval; + file->flags &= ~EXT2_FILE_BUF_VALID; + } + file->blockno = b; + return 0; +} + +/* + * This function loads the file's block buffer with valid data from + * the disk as necessary. + * + * If dontfill is true, then skip initializing the buffer since we're + * going to be replacing its entire contents anyway. If set, then the + * function basically only sets file->physblock and EXT2_FILE_BUF_VALID + */ +#define DONTFILL 1 +static errcode_t load_buffer(ext2_file_t file, int dontfill) +{ + ext2_filsys fs = file->fs; + errcode_t retval; + int ret_flags; + + if (!(file->flags & EXT2_FILE_BUF_VALID)) { + retval = ext2fs_bmap2(fs, file->ino, &file->inode, + BMAP_BUFFER, 0, file->blockno, &ret_flags, + &file->physblock); + if (retval) + return retval; + if (!dontfill) { + if (file->physblock && + !(ret_flags & BMAP_RET_UNINIT)) { + retval = io_channel_read_blk64(fs->io, + file->physblock, + 1, file->buf); + if (retval) + return retval; + } else + memset(file->buf, 0, fs->blocksize); + } + file->flags |= EXT2_FILE_BUF_VALID; + } + return 0; +} + + +errcode_t ext2fs_file_close(ext2_file_t file) +{ + errcode_t retval; + + EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE); + + retval = ext2fs_file_flush(file); + + if (file->buf) + ext2fs_free_mem(&file->buf); + ext2fs_free_mem(&file); + + return retval; +} + + +static errcode_t +ext2fs_file_read_inline_data(ext2_file_t file, void *buf, + unsigned int wanted, unsigned int *got) +{ + ext2_filsys fs; + errcode_t retval; + unsigned int count = 0; + size_t size; + + fs = file->fs; + retval = ext2fs_inline_data_get(fs, file->ino, &file->inode, + file->buf, &size); + if (retval) + return retval; + + if (file->pos >= size) + goto out; + + count = size - file->pos; + if (count > wanted) + count = wanted; + memcpy(buf, file->buf + file->pos, count); + file->pos += count; + buf = (char *) buf + count; + +out: + if (got) + *got = count; + return retval; +} + + +errcode_t ext2fs_file_read(ext2_file_t file, void *buf, + unsigned int wanted, unsigned int *got) +{ + ext2_filsys fs; + errcode_t retval = 0; + unsigned int start, c, count = 0; + __u64 left; + char *ptr = (char *) buf; + + EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE); + fs = file->fs; + + /* If an inode has inline data, things get complicated. */ + if (file->inode.i_flags & EXT4_INLINE_DATA_FL) + return ext2fs_file_read_inline_data(file, buf, wanted, got); + + while ((file->pos < EXT2_I_SIZE(&file->inode)) && (wanted > 0)) { + retval = sync_buffer_position(file); + if (retval) + goto fail; + retval = load_buffer(file, 0); + if (retval) + goto fail; + + start = file->pos % fs->blocksize; + c = fs->blocksize - start; + if (c > wanted) + c = wanted; + left = EXT2_I_SIZE(&file->inode) - file->pos ; + if (c > left) + c = left; + + memcpy(ptr, file->buf+start, c); + file->pos += c; + ptr += c; + count += c; + wanted -= c; + } + +fail: + if (got) + *got = count; + return retval; +} + + +static errcode_t +ext2fs_file_write_inline_data(ext2_file_t file, const void *buf, + unsigned int nbytes, unsigned int *written) +{ + ext2_filsys fs; + errcode_t retval; + unsigned int count = 0; + size_t size; + + fs = file->fs; + retval = ext2fs_inline_data_get(fs, file->ino, &file->inode, + file->buf, &size); + if (retval) + return retval; + + if (file->pos < size) { + count = nbytes - file->pos; + memcpy(file->buf + file->pos, buf, count); + + retval = ext2fs_inline_data_set(fs, file->ino, &file->inode, + file->buf, count); + if (retval == EXT2_ET_INLINE_DATA_NO_SPACE) + goto expand; + if (retval) + return retval; + + file->pos += count; + + /* Update inode size */ + if (count != 0 && EXT2_I_SIZE(&file->inode) < file->pos) { + errcode_t rc; + + rc = ext2fs_file_set_size2(file, file->pos); + if (retval == 0) + retval = rc; + } + + if (written) + *written = count; + return 0; + } + +expand: + retval = ext2fs_inline_data_expand(fs, file->ino); + if (retval) + return retval; + /* + * reload inode and return no space error + * + * XXX: file->inode could be copied from the outside + * in ext2fs_file_open2(). We have no way to modify + * the outside inode. + */ + retval = ext2fs_read_inode(fs, file->ino, &file->inode); + if (retval) + return retval; + return EXT2_ET_INLINE_DATA_NO_SPACE; +} + + +errcode_t ext2fs_file_write(ext2_file_t file, const void *buf, + unsigned int nbytes, unsigned int *written) +{ + ext2_filsys fs; + errcode_t retval = 0; + unsigned int start, c, count = 0; + const char *ptr = (const char *) buf; + block_entry_t new_block = NULL, old_block = NULL; + int bmap_flags = 0; + + EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE); + fs = file->fs; + + if (!(file->flags & EXT2_FILE_WRITE)) + return EXT2_ET_FILE_RO; + + /* If an inode has inline data, things get complicated. */ + if (file->inode.i_flags & EXT4_INLINE_DATA_FL) { + retval = ext2fs_file_write_inline_data(file, buf, nbytes, + written); + if (retval != EXT2_ET_INLINE_DATA_NO_SPACE) + return retval; + /* fall through to read data from the block */ + retval = 0; + } + + while (nbytes > 0) { + retval = sync_buffer_position(file); + if (retval) + goto fail; + + start = file->pos % fs->blocksize; + c = fs->blocksize - start; + if (c > nbytes) + c = nbytes; + + /* + * We only need to do a read-modify-update cycle if + * we're doing a partial write. + */ + retval = load_buffer(file, (c == fs->blocksize)); + if (retval) + goto fail; + + file->flags |= EXT2_FILE_BUF_DIRTY; + memcpy(file->buf+start, ptr, c); + + /* + * OK, the physical block hasn't been allocated yet. + * Allocate it. + */ + if (!file->physblock) { + bmap_flags = (file->ino ? BMAP_ALLOC : 0); + if (fs->flags & EXT2_FLAG_SHARE_DUP) { + new_block = calloc(1, sizeof(*new_block)); + if (!new_block) { + retval = EXT2_ET_NO_MEMORY; + goto fail; + } + ext2fs_sha512((const unsigned char*)file->buf, + fs->blocksize, new_block->sha); + old_block = ext2fs_hashmap_lookup( + fs->block_sha_map, + new_block->sha, + sizeof(new_block->sha)); + } + + if (old_block) { + file->physblock = old_block->physblock; + bmap_flags |= BMAP_SET; + free(new_block); + new_block = NULL; + } + + retval = ext2fs_bmap2(fs, file->ino, &file->inode, + BMAP_BUFFER, + bmap_flags, + file->blockno, 0, + &file->physblock); + if (retval) { + free(new_block); + new_block = NULL; + goto fail; + } + + if (new_block) { + new_block->physblock = file->physblock; + int ret = ext2fs_hashmap_add(fs->block_sha_map, + new_block, new_block->sha, + sizeof(new_block->sha)); + if (ret) { + retval = EXT2_ET_NO_MEMORY; + free(new_block); + goto fail; + } + } + + if (bmap_flags & BMAP_SET) { + ext2fs_iblk_add_blocks(fs, &file->inode, 1); + ext2fs_write_inode(fs, file->ino, &file->inode); + } + } + + file->pos += c; + ptr += c; + count += c; + nbytes -= c; + } + +fail: + /* Update inode size */ + if (count != 0 && EXT2_I_SIZE(&file->inode) < file->pos) { + errcode_t rc; + + rc = ext2fs_file_set_size2(file, file->pos); + if (retval == 0) + retval = rc; + } + + if (written) + *written = count; + return retval; +} + +errcode_t ext2fs_file_llseek(ext2_file_t file, __u64 offset, + int whence, __u64 *ret_pos) +{ + EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE); + + if (whence == EXT2_SEEK_SET) + file->pos = offset; + else if (whence == EXT2_SEEK_CUR) + file->pos += offset; + else if (whence == EXT2_SEEK_END) + file->pos = EXT2_I_SIZE(&file->inode) + offset; + else + return EXT2_ET_INVALID_ARGUMENT; + + if (ret_pos) + *ret_pos = file->pos; + + return 0; +} + +errcode_t ext2fs_file_lseek(ext2_file_t file, ext2_off_t offset, + int whence, ext2_off_t *ret_pos) +{ + __u64 loffset, ret_loffset = 0; + errcode_t retval; + + loffset = offset; + retval = ext2fs_file_llseek(file, loffset, whence, &ret_loffset); + if (ret_pos) + *ret_pos = (ext2_off_t) ret_loffset; + return retval; +} + + +/* + * This function returns the size of the file, according to the inode + */ +errcode_t ext2fs_file_get_lsize(ext2_file_t file, __u64 *ret_size) +{ + if (file->magic != EXT2_ET_MAGIC_EXT2_FILE) + return EXT2_ET_MAGIC_EXT2_FILE; + *ret_size = EXT2_I_SIZE(&file->inode); + return 0; +} + +/* + * This function returns the size of the file, according to the inode + */ +ext2_off_t ext2fs_file_get_size(ext2_file_t file) +{ + __u64 size; + + if (ext2fs_file_get_lsize(file, &size)) + return 0; + if ((size >> 32) != 0) + return 0; + return size; +} + +/* Zero the parts of the last block that are past EOF. */ +static errcode_t ext2fs_file_zero_past_offset(ext2_file_t file, + ext2_off64_t offset) +{ + ext2_filsys fs = file->fs; + char *b = NULL; + ext2_off64_t off = offset % fs->blocksize; + blk64_t blk; + int ret_flags; + errcode_t retval; + + if (off == 0) + return 0; + + retval = sync_buffer_position(file); + if (retval) + return retval; + + /* Is there an initialized block at the end? */ + retval = ext2fs_bmap2(fs, file->ino, NULL, NULL, 0, + offset / fs->blocksize, &ret_flags, &blk); + if (retval) + return retval; + if ((blk == 0) || (ret_flags & BMAP_RET_UNINIT)) + return 0; + + /* Zero to the end of the block */ + retval = ext2fs_get_mem(fs->blocksize, &b); + if (retval) + return retval; + + /* Read/zero/write block */ + retval = io_channel_read_blk64(fs->io, blk, 1, b); + if (retval) + goto out; + + memset(b + off, 0, fs->blocksize - off); + + retval = io_channel_write_blk64(fs->io, blk, 1, b); + if (retval) + goto out; + +out: + ext2fs_free_mem(&b); + return retval; +} + +/* + * This function sets the size of the file, truncating it if necessary + * + */ +errcode_t ext2fs_file_set_size2(ext2_file_t file, ext2_off64_t size) +{ + ext2_off64_t old_size; + errcode_t retval; + blk64_t old_truncate, truncate_block; + + EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE); + + if (size && ext2fs_file_block_offset_too_big(file->fs, &file->inode, + (size - 1) / file->fs->blocksize)) + return EXT2_ET_FILE_TOO_BIG; + truncate_block = ((size + file->fs->blocksize - 1) >> + EXT2_BLOCK_SIZE_BITS(file->fs->super)); + old_size = EXT2_I_SIZE(&file->inode); + old_truncate = ((old_size + file->fs->blocksize - 1) >> + EXT2_BLOCK_SIZE_BITS(file->fs->super)); + + retval = ext2fs_inode_size_set(file->fs, &file->inode, size); + if (retval) + return retval; + + if (file->ino) { + retval = ext2fs_write_inode(file->fs, file->ino, &file->inode); + if (retval) + return retval; + } + + retval = ext2fs_file_zero_past_offset(file, size); + if (retval) + return retval; + + if (truncate_block >= old_truncate) + return 0; + + return ext2fs_punch(file->fs, file->ino, &file->inode, 0, + truncate_block, ~0ULL); +} + +errcode_t ext2fs_file_set_size(ext2_file_t file, ext2_off_t size) +{ + return ext2fs_file_set_size2(file, size); +} diff --git a/lib/ext2fs/finddev.c b/lib/ext2fs/finddev.c new file mode 100644 index 0000000..cd85ef5 --- /dev/null +++ b/lib/ext2fs/finddev.c @@ -0,0 +1,218 @@ +/* + * finddev.c -- this routine attempts to find a particular device in + * /dev + * + * Copyright (C) 2000 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <stdlib.h> +#include <string.h> +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#include <dirent.h> +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#if HAVE_SYS_MKDEV_H +#include <sys/mkdev.h> +#endif +#ifdef HAVE_SYS_SYSMACROS_H +#include <sys/sysmacros.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +struct dir_list { + char *name; + struct dir_list *next; +}; + +/* + * This function adds an entry to the directory list + */ +static void add_to_dirlist(const char *name, struct dir_list **list) +{ + struct dir_list *dp; + + dp = malloc(sizeof(struct dir_list)); + if (!dp) + return; + dp->name = malloc(strlen(name)+1); + if (!dp->name) { + free(dp); + return; + } + strcpy(dp->name, name); + dp->next = *list; + *list = dp; +} + +/* + * This function frees a directory list + */ +static void free_dirlist(struct dir_list **list) +{ + struct dir_list *dp, *next; + + for (dp = *list; dp; dp = next) { + next = dp->next; + free(dp->name); + free(dp); + } + *list = 0; +} + +static int scan_dir(char *dirname, dev_t device, struct dir_list **list, + char **ret_path) +{ + DIR *dir; + struct dirent *dp; + char path[1024], *cp; + int dirlen; + struct stat st; + + dirlen = strlen(dirname); + if ((dir = opendir(dirname)) == NULL) + return errno; + dp = readdir(dir); + while (dp) { + if (dirlen + strlen(dp->d_name) + 2 >= sizeof(path)) + goto skip_to_next; + if (dp->d_name[0] == '.' && + ((dp->d_name[1] == 0) || + ((dp->d_name[1] == '.') && (dp->d_name[2] == 0)))) + goto skip_to_next; + sprintf(path, "%s/%s", dirname, dp->d_name); + if (stat(path, &st) < 0) + goto skip_to_next; + if (S_ISDIR(st.st_mode)) + add_to_dirlist(path, list); + if (ext2fsP_is_disk_device(st.st_mode) && + st.st_rdev == device) { + cp = malloc(strlen(path)+1); + if (!cp) { + closedir(dir); + return ENOMEM; + } + strcpy(cp, path); + *ret_path = cp; + goto success; + } + skip_to_next: + dp = readdir(dir); + } +success: + closedir(dir); + return 0; +} + +/* + * This function finds the pathname to a block device with a given + * device number. It returns a pointer to allocated memory to the + * pathname on success, and NULL on failure. + */ +char *ext2fs_find_block_device(dev_t device) +{ + struct dir_list *list = 0, *new_list = 0; + struct dir_list *current; + char *ret_path = 0; + int level = 0; + + /* + * Add the starting directories to search... + */ + add_to_dirlist("/devices", &list); + add_to_dirlist("/devfs", &list); + add_to_dirlist("/dev", &list); + + while (list) { + current = list; + list = list->next; +#ifdef DEBUG + printf("Scanning directory %s\n", current->name); +#endif + scan_dir(current->name, device, &new_list, &ret_path); + free(current->name); + free(current); + if (ret_path) + break; + /* + * If we're done checking at this level, descend to + * the next level of subdirectories. (breadth-first) + */ + if (list == 0) { + list = new_list; + new_list = 0; + /* Avoid infinite loop */ + if (++level >= EXT2FS_MAX_NESTED_LINKS) + break; + } + } + free_dirlist(&list); + free_dirlist(&new_list); + return ret_path; +} + + +#ifdef DEBUG +int main(int argc, char** argv) +{ + char *devname, *tmp; + int major, minor; + dev_t device; + const char *errmsg = "Couldn't parse %s: %s\n"; + + if ((argc != 2) && (argc != 3)) { + fprintf(stderr, "Usage: %s device_number\n", argv[0]); + fprintf(stderr, "\t: %s major minor\n", argv[0]); + exit(1); + } + if (argc == 2) { + device = strtoul(argv[1], &tmp, 0); + if (*tmp) { + fprintf(stderr, errmsg, "device number", argv[1]); + exit(1); + } + } else { + major = strtoul(argv[1], &tmp, 0); + if (*tmp) { + fprintf(stderr, errmsg, "major number", argv[1]); + exit(1); + } + minor = strtoul(argv[2], &tmp, 0); + if (*tmp) { + fprintf(stderr, errmsg, "minor number", argv[2]); + exit(1); + } + device = makedev(major, minor); + printf("Looking for device 0x%04x (%d:%d)\n", device, + major, minor); + } + devname = ext2fs_find_block_device(device); + if (devname) { + printf("Found device! %s\n", devname); + free(devname); + } else { + printf("Couldn't find device.\n"); + } + return 0; +} + +#endif diff --git a/lib/ext2fs/flushb.c b/lib/ext2fs/flushb.c new file mode 100644 index 0000000..bb7daf4 --- /dev/null +++ b/lib/ext2fs/flushb.c @@ -0,0 +1,88 @@ +/* + * flushb.c --- Hides system-dependent information for both syncing a + * device to disk and to flush any buffers from disk cache. + * + * Copyright (C) 2000 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_SYS_IOCTL_H +#include <sys/ioctl.h> +#endif +#if HAVE_SYS_MOUNT_H +#include <sys/param.h> +#include <sys/mount.h> /* This may define BLKFLSBUF */ +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +/* + * For Linux, define BLKFLSBUF and FDFLUSH if necessary, since + * not all portable header file does so for us. This really should be + * fixed in the glibc header files. (Recent glibcs appear to define + * BLKFLSBUF in sys/mount.h, but FDFLUSH still doesn't seem to be + * defined anywhere portable.) Until then.... + */ +#ifdef __linux__ +#ifndef BLKFLSBUF +#define BLKFLSBUF _IO(0x12,97) /* flush buffer cache */ +#endif +#ifndef FDFLUSH +#define FDFLUSH _IO(2,0x4b) /* flush floppy disk */ +#endif +#endif + +/* + * This function will sync a device/file, and optionally attempt to + * flush the buffer cache. The latter is basically only useful for + * system benchmarks and for torturing systems in burn-in tests. :) + */ +errcode_t ext2fs_sync_device(int fd, int flushb) +{ + /* + * We always sync the device in case we're running on old + * kernels for which we can lose data if we don't. (There + * still is a race condition for those kernels, but this + * reduces it greatly.) + */ +#if defined(HAVE_FSYNC) + if (fsync (fd) == -1) + return errno; +#endif + + if (flushb) { + errcode_t retval = 0; + +#ifdef BLKFLSBUF + if (ioctl (fd, BLKFLSBUF, 0) == 0) + return 0; + retval = errno; +#elif defined(__linux__) +#warning BLKFLSBUF not defined +#endif +#ifdef FDFLUSH + /* In case this is a floppy */ + if (ioctl(fd, FDFLUSH, 0) == 0) + return 0; + if (retval == 0) + retval = errno; +#elif defined(__linux__) +#warning FDFLUSH not defined +#endif + return retval; + } + return 0; +} diff --git a/lib/ext2fs/freefs.c b/lib/ext2fs/freefs.c new file mode 100644 index 0000000..68b8e9a --- /dev/null +++ b/lib/ext2fs/freefs.c @@ -0,0 +1,108 @@ +/* + * freefs.c --- free an ext2 filesystem + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" +#include "hashmap.h" + +void ext2fs_free(ext2_filsys fs) +{ + if (!fs || (fs->magic != EXT2_ET_MAGIC_EXT2FS_FILSYS)) + return; + if (fs->image_io != fs->io) { + if (fs->image_io) + io_channel_close(fs->image_io); + } + if (fs->io) { + io_channel_close(fs->io); + } + if (fs->device_name) + ext2fs_free_mem(&fs->device_name); + if (fs->super) + ext2fs_free_mem(&fs->super); + if (fs->orig_super) + ext2fs_free_mem(&fs->orig_super); + if (fs->group_desc) + ext2fs_free_mem(&fs->group_desc); + if (fs->block_map) + ext2fs_free_block_bitmap(fs->block_map); + if (fs->inode_map) + ext2fs_free_inode_bitmap(fs->inode_map); + if (fs->image_header) + ext2fs_free_mem(&fs->image_header); + + if (fs->badblocks) + ext2fs_badblocks_list_free(fs->badblocks); + fs->badblocks = 0; + + if (fs->dblist) + ext2fs_free_dblist(fs->dblist); + + if (fs->icache) + ext2fs_free_inode_cache(fs->icache); + + if (fs->mmp_buf) + ext2fs_free_mem(&fs->mmp_buf); + if (fs->mmp_cmp) + ext2fs_free_mem(&fs->mmp_cmp); + + if (fs->block_sha_map) + ext2fs_hashmap_free(fs->block_sha_map); + + fs->magic = 0; + + ext2fs_zero_blocks2(NULL, 0, 0, NULL, NULL); + ext2fs_free_mem(&fs); +} + +/* + * This procedure frees a badblocks list. + */ +void ext2fs_u32_list_free(ext2_u32_list bb) +{ + if (bb->magic != EXT2_ET_MAGIC_BADBLOCKS_LIST) + return; + + if (bb->list) + ext2fs_free_mem(&bb->list); + bb->list = 0; + ext2fs_free_mem(&bb); +} + +void ext2fs_badblocks_list_free(ext2_badblocks_list bb) +{ + ext2fs_u32_list_free((ext2_u32_list) bb); +} + + +/* + * Free a directory block list + */ +void ext2fs_free_dblist(ext2_dblist dblist) +{ + if (!dblist || (dblist->magic != EXT2_ET_MAGIC_DBLIST)) + return; + + if (dblist->list) + ext2fs_free_mem(&dblist->list); + dblist->list = 0; + if (dblist->fs && dblist->fs->dblist == dblist) + dblist->fs->dblist = 0; + dblist->magic = 0; + ext2fs_free_mem(&dblist); +} + diff --git a/lib/ext2fs/gen_bitmap.c b/lib/ext2fs/gen_bitmap.c new file mode 100644 index 0000000..1536d4b --- /dev/null +++ b/lib/ext2fs/gen_bitmap.c @@ -0,0 +1,650 @@ +/* + * gen_bitmap.c --- Generic (32-bit) bitmap routines + * + * Copyright (C) 2001 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" + +struct ext2fs_struct_generic_bitmap_32 { + errcode_t magic; + ext2_filsys fs; + __u32 start, end; + __u32 real_end; + char * description; + char * bitmap; + errcode_t base_error_code; + __u32 reserved[7]; +}; + +typedef struct ext2fs_struct_generic_bitmap_32 *ext2fs_generic_bitmap_32; + +#define EXT2FS_IS_32_BITMAP(bmap) \ + (((bmap)->magic == EXT2_ET_MAGIC_GENERIC_BITMAP) || \ + ((bmap)->magic == EXT2_ET_MAGIC_BLOCK_BITMAP) || \ + ((bmap)->magic == EXT2_ET_MAGIC_INODE_BITMAP)) + +#define EXT2FS_IS_64_BITMAP(bmap) \ + (((bmap)->magic == EXT2_ET_MAGIC_GENERIC_BITMAP64) || \ + ((bmap)->magic == EXT2_ET_MAGIC_BLOCK_BITMAP64) || \ + ((bmap)->magic == EXT2_ET_MAGIC_INODE_BITMAP64)) + +/* + * Used by previously inlined function, so we have to export this and + * not change the function signature + */ +void ext2fs_warn_bitmap2(ext2fs_generic_bitmap gen_bitmap, + int code, unsigned long arg) +{ + ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap; + +#ifndef OMIT_COM_ERR + if (bitmap->description) + com_err(0, bitmap->base_error_code+code, + "#%lu for %s", arg, bitmap->description); + else + com_err(0, bitmap->base_error_code + code, "#%lu", arg); +#endif +} + +static errcode_t check_magic(ext2fs_generic_bitmap bitmap) +{ + if (!bitmap || !((bitmap->magic == EXT2_ET_MAGIC_GENERIC_BITMAP) || + (bitmap->magic == EXT2_ET_MAGIC_INODE_BITMAP) || + (bitmap->magic == EXT2_ET_MAGIC_BLOCK_BITMAP))) + return EXT2_ET_MAGIC_GENERIC_BITMAP; + return 0; +} + +errcode_t ext2fs_make_generic_bitmap(errcode_t magic, ext2_filsys fs, + __u32 start, __u32 end, __u32 real_end, + const char *descr, char *init_map, + ext2fs_generic_bitmap *ret) +{ + ext2fs_generic_bitmap_32 bitmap; + errcode_t retval; + size_t size; + + retval = ext2fs_get_mem(sizeof(struct ext2fs_struct_generic_bitmap_32), + &bitmap); + if (retval) + return retval; + + bitmap->magic = magic; + bitmap->fs = fs; + bitmap->start = start; + bitmap->end = end; + bitmap->real_end = real_end; + switch (magic) { + case EXT2_ET_MAGIC_INODE_BITMAP: + bitmap->base_error_code = EXT2_ET_BAD_INODE_MARK; + break; + case EXT2_ET_MAGIC_BLOCK_BITMAP: + bitmap->base_error_code = EXT2_ET_BAD_BLOCK_MARK; + break; + default: + bitmap->base_error_code = EXT2_ET_BAD_GENERIC_MARK; + } + if (descr) { + retval = ext2fs_get_mem(strlen(descr)+1, &bitmap->description); + if (retval) { + ext2fs_free_mem(&bitmap); + return retval; + } + strcpy(bitmap->description, descr); + } else + bitmap->description = 0; + + size = (size_t) (((bitmap->real_end - bitmap->start) / 8) + 1); + /* Round up to allow for the BT x86 instruction */ + size = (size + 7) & ~3; + retval = ext2fs_get_mem(size, &bitmap->bitmap); + if (retval) { + ext2fs_free_mem(&bitmap->description); + ext2fs_free_mem(&bitmap); + return retval; + } + + if (init_map) + memcpy(bitmap->bitmap, init_map, size); + else + memset(bitmap->bitmap, 0, size); + *ret = (ext2fs_generic_bitmap) bitmap; + return 0; +} + +errcode_t ext2fs_allocate_generic_bitmap(__u32 start, + __u32 end, + __u32 real_end, + const char *descr, + ext2fs_generic_bitmap *ret) +{ + return ext2fs_make_generic_bitmap(EXT2_ET_MAGIC_GENERIC_BITMAP, 0, + start, end, real_end, descr, 0, ret); +} + +errcode_t ext2fs_copy_generic_bitmap(ext2fs_generic_bitmap gen_src, + ext2fs_generic_bitmap *dest) +{ + ext2fs_generic_bitmap_32 src = (ext2fs_generic_bitmap_32) gen_src; + + return (ext2fs_make_generic_bitmap(src->magic, src->fs, + src->start, src->end, + src->real_end, + src->description, src->bitmap, + dest)); +} + +void ext2fs_free_generic_bitmap(ext2fs_inode_bitmap gen_bitmap) +{ + ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap; + + if (check_magic(gen_bitmap)) + return; + + bitmap->magic = 0; + if (bitmap->description) { + ext2fs_free_mem(&bitmap->description); + bitmap->description = 0; + } + if (bitmap->bitmap) { + ext2fs_free_mem(&bitmap->bitmap); + bitmap->bitmap = 0; + } + ext2fs_free_mem(&bitmap); +} + +int ext2fs_test_generic_bitmap(ext2fs_generic_bitmap bitmap, + blk_t bitno) +{ + ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap; + + if (!EXT2FS_IS_32_BITMAP(bitmap)) { + if (EXT2FS_IS_64_BITMAP(bitmap)) { + ext2fs_warn_bitmap32(bitmap, __func__); + return ext2fs_test_generic_bmap(bitmap, bitno); + } +#ifndef OMIT_COM_ERR + com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP, + "test_bitmap(%lu)", (unsigned long) bitno); +#endif + return 0; + } + + if ((bitno < bitmap32->start) || (bitno > bitmap32->end)) { + ext2fs_warn_bitmap2(bitmap, EXT2FS_TEST_ERROR, bitno); + return 0; + } + return ext2fs_test_bit(bitno - bitmap32->start, bitmap32->bitmap); +} + +int ext2fs_mark_generic_bitmap(ext2fs_generic_bitmap bitmap, + __u32 bitno) +{ + ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap; + + if (!EXT2FS_IS_32_BITMAP(bitmap)) { + if (EXT2FS_IS_64_BITMAP(bitmap)) { + ext2fs_warn_bitmap32(bitmap, __func__); + return ext2fs_mark_generic_bmap(bitmap, bitno); + } +#ifndef OMIT_COM_ERR + com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP, + "mark_bitmap(%lu)", (unsigned long) bitno); +#endif + return 0; + } + + if ((bitno < bitmap32->start) || (bitno > bitmap32->end)) { + ext2fs_warn_bitmap2(bitmap, EXT2FS_MARK_ERROR, bitno); + return 0; + } + return ext2fs_set_bit(bitno - bitmap32->start, bitmap32->bitmap); +} + +int ext2fs_unmark_generic_bitmap(ext2fs_generic_bitmap bitmap, + blk_t bitno) +{ + ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap; + + if (!EXT2FS_IS_32_BITMAP(bitmap)) { + if (EXT2FS_IS_64_BITMAP(bitmap)) { + ext2fs_warn_bitmap32(bitmap, __func__); + return ext2fs_unmark_generic_bmap(bitmap, bitno); + } +#ifndef OMIT_COM_ERR + com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP, + "mark_bitmap(%lu)", (unsigned long) bitno); +#endif + return 0; + } + + if ((bitno < bitmap32->start) || (bitno > bitmap32->end)) { + ext2fs_warn_bitmap2(bitmap, EXT2FS_UNMARK_ERROR, bitno); + return 0; + } + return ext2fs_clear_bit(bitno - bitmap32->start, bitmap32->bitmap); +} + +__u32 ext2fs_get_generic_bitmap_start(ext2fs_generic_bitmap bitmap) +{ + ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap; + + if (!EXT2FS_IS_32_BITMAP(bitmap)) { + if (EXT2FS_IS_64_BITMAP(bitmap)) { + ext2fs_warn_bitmap32(bitmap, __func__); + return ext2fs_get_generic_bmap_start(bitmap); + } +#ifndef OMIT_COM_ERR + com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP, + "get_bitmap_start"); +#endif + return 0; + } + + return bitmap32->start; +} + +__u32 ext2fs_get_generic_bitmap_end(ext2fs_generic_bitmap bitmap) +{ + ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap; + + if (!EXT2FS_IS_32_BITMAP(bitmap)) { + if (EXT2FS_IS_64_BITMAP(bitmap)) { + ext2fs_warn_bitmap32(bitmap, __func__); + return ext2fs_get_generic_bmap_end(bitmap); + } +#ifndef OMIT_COM_ERR + com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP, + "get_bitmap_end"); +#endif + return 0; + } + return bitmap32->end; +} + +void ext2fs_clear_generic_bitmap(ext2fs_generic_bitmap bitmap) +{ + ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap; + + if (!EXT2FS_IS_32_BITMAP(bitmap)) { + if (EXT2FS_IS_64_BITMAP(bitmap)) { + ext2fs_warn_bitmap32(bitmap, __func__); + ext2fs_clear_generic_bmap(bitmap); + return; + } +#ifndef OMIT_COM_ERR + com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP, + "clear_generic_bitmap"); +#endif + return; + } + + memset(bitmap32->bitmap, 0, + (size_t) (((bitmap32->real_end - bitmap32->start) / 8) + 1)); +} + +errcode_t ext2fs_fudge_generic_bitmap_end(ext2fs_inode_bitmap gen_bitmap, + errcode_t magic, errcode_t neq, + ext2_ino_t end, ext2_ino_t *oend) +{ + ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap; + + EXT2_CHECK_MAGIC(bitmap, magic); + + if (end > bitmap->real_end) + return neq; + if (oend) + *oend = bitmap->end; + bitmap->end = end; + return 0; +} + +errcode_t ext2fs_resize_generic_bitmap(errcode_t magic, + __u32 new_end, __u32 new_real_end, + ext2fs_generic_bitmap gen_bmap) +{ + ext2fs_generic_bitmap_32 bmap = (ext2fs_generic_bitmap_32) gen_bmap; + errcode_t retval; + size_t size, new_size; + __u32 bitno; + + if (!bmap || (bmap->magic != magic)) + return magic; + + /* + * If we're expanding the bitmap, make sure all of the new + * parts of the bitmap are zero. + */ + if (new_end > bmap->end) { + bitno = bmap->real_end; + if (bitno > new_end) + bitno = new_end; + for (; bitno > bmap->end; bitno--) + ext2fs_clear_bit(bitno - bmap->start, bmap->bitmap); + } + if (new_real_end == bmap->real_end) { + bmap->end = new_end; + return 0; + } + + size = ((bmap->real_end - bmap->start) / 8) + 1; + new_size = ((new_real_end - bmap->start) / 8) + 1; + + if (size != new_size) { + retval = ext2fs_resize_mem(size, new_size, &bmap->bitmap); + if (retval) + return retval; + } + if (new_size > size) + memset(bmap->bitmap + size, 0, new_size - size); + + bmap->end = new_end; + bmap->real_end = new_real_end; + return 0; +} + +errcode_t ext2fs_compare_generic_bitmap(errcode_t magic, errcode_t neq, + ext2fs_generic_bitmap gen_bm1, + ext2fs_generic_bitmap gen_bm2) +{ + ext2fs_generic_bitmap_32 bm1 = (ext2fs_generic_bitmap_32) gen_bm1; + ext2fs_generic_bitmap_32 bm2 = (ext2fs_generic_bitmap_32) gen_bm2; + blk_t i; + + if (!bm1 || bm1->magic != magic) + return magic; + if (!bm2 || bm2->magic != magic) + return magic; + + if ((bm1->start != bm2->start) || + (bm1->end != bm2->end) || + (memcmp(bm1->bitmap, bm2->bitmap, + (size_t) (bm1->end - bm1->start)/8))) + return neq; + + for (i = bm1->end - ((bm1->end - bm1->start) % 8); i <= bm1->end; i++) + if (ext2fs_fast_test_block_bitmap(gen_bm1, i) != + ext2fs_fast_test_block_bitmap(gen_bm2, i)) + return neq; + + return 0; +} + +void ext2fs_set_generic_bitmap_padding(ext2fs_generic_bitmap gen_map) +{ + ext2fs_generic_bitmap_32 map = (ext2fs_generic_bitmap_32) gen_map; + __u32 i, j; + + /* Protect loop from wrap-around if map->real_end is maxed */ + for (i=map->end+1, j = i - map->start; + i <= map->real_end && i > map->end; + i++, j++) + ext2fs_set_bit(j, map->bitmap); +} + +errcode_t ext2fs_get_generic_bitmap_range(ext2fs_generic_bitmap gen_bmap, + errcode_t magic, + __u32 start, __u32 num, + void *out) +{ + ext2fs_generic_bitmap_32 bmap = (ext2fs_generic_bitmap_32) gen_bmap; + + if (!bmap || (bmap->magic != magic)) + return magic; + + if ((start < bmap->start) || (start+num-1 > bmap->real_end)) + return EXT2_ET_INVALID_ARGUMENT; + + memcpy(out, bmap->bitmap + ((start - bmap->start) >> 3), (num+7) >> 3); + return 0; +} + +errcode_t ext2fs_set_generic_bitmap_range(ext2fs_generic_bitmap gen_bmap, + errcode_t magic, + __u32 start, __u32 num, + void *in) +{ + ext2fs_generic_bitmap_32 bmap = (ext2fs_generic_bitmap_32) gen_bmap; + + if (!bmap || (bmap->magic != magic)) + return magic; + + if ((start < bmap->start) || (start+num-1 > bmap->real_end)) + return EXT2_ET_INVALID_ARGUMENT; + + memcpy(bmap->bitmap + ((start - bmap->start) >> 3), in, (num+7) >> 3); + return 0; +} + +/* + * Compare @mem to zero buffer by 256 bytes. + * Return 1 if @mem is zeroed memory, otherwise return 0. + */ +int ext2fs_mem_is_zero(const char *mem, size_t len) +{ + static const char zero_buf[256]; + + while (len >= sizeof(zero_buf)) { + if (memcmp(mem, zero_buf, sizeof(zero_buf))) + return 0; + len -= sizeof(zero_buf); + mem += sizeof(zero_buf); + } + /* Deal with leftover bytes. */ + if (len) + return !memcmp(mem, zero_buf, len); + return 1; +} + +/* + * Return true if all of the bits in a specified range are clear + */ +static int ext2fs_test_clear_generic_bitmap_range(ext2fs_generic_bitmap gen_bitmap, + unsigned int start, + unsigned int len) +{ + ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap; + size_t start_byte, len_byte = len >> 3; + unsigned int start_bit, len_bit = len % 8; + int first_bit = 0; + int last_bit = 0; + int mark_count = 0; + int mark_bit = 0; + int i; + const char *ADDR = bitmap->bitmap; + + start -= bitmap->start; + start_byte = start >> 3; + start_bit = start % 8; + + if (start_bit != 0) { + /* + * The compared start block number or start inode number + * is not the first bit in a byte. + */ + mark_count = 8 - start_bit; + if (len < 8 - start_bit) { + mark_count = (int)len; + mark_bit = len + start_bit - 1; + } else + mark_bit = 7; + + for (i = mark_count; i > 0; i--, mark_bit--) + first_bit |= 1 << mark_bit; + + /* + * Compare blocks or inodes in the first byte. + * If there is any marked bit, this function returns 0. + */ + if (first_bit & ADDR[start_byte]) + return 0; + else if (len <= 8 - start_bit) + return 1; + + start_byte++; + len_bit = (len - mark_count) % 8; + len_byte = (len - mark_count) >> 3; + } + + /* + * The compared start block number or start inode number is + * the first bit in a byte. + */ + if (len_bit != 0) { + /* + * The compared end block number or end inode number is + * not the last bit in a byte. + */ + for (mark_bit = len_bit - 1; mark_bit >= 0; mark_bit--) + last_bit |= 1 << mark_bit; + + /* + * Compare blocks or inodes in the last byte. + * If there is any marked bit, this function returns 0. + */ + if (last_bit & ADDR[start_byte + len_byte]) + return 0; + else if (len_byte == 0) + return 1; + } + + /* Check whether all bytes are 0 */ + return ext2fs_mem_is_zero(ADDR + start_byte, len_byte); +} + +errcode_t ext2fs_find_first_zero_generic_bitmap(ext2fs_generic_bitmap gen_bitmap, + __u32 start, __u32 end, + __u32 *out) +{ + ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap; + blk_t b; + + if (start < bitmap->start || end > bitmap->end || start > end) { + ext2fs_warn_bitmap2(gen_bitmap, EXT2FS_TEST_ERROR, start); + return EINVAL; + } + + while (start <= end) { + b = ext2fs_test_bit(start - bitmap->start, bitmap->bitmap); + if (!b) { + *out = start; + return 0; + } + start++; + } + + return ENOENT; +} + +errcode_t ext2fs_find_first_set_generic_bitmap(ext2fs_generic_bitmap gen_bitmap, + __u32 start, __u32 end, + __u32 *out) +{ + ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap; + blk_t b; + + if (start < bitmap->start || end > bitmap->end || start > end) { + ext2fs_warn_bitmap2(gen_bitmap, EXT2FS_TEST_ERROR, start); + return EINVAL; + } + + while (start <= end) { + b = ext2fs_test_bit(start - bitmap->start, bitmap->bitmap); + if (b) { + *out = start; + return 0; + } + start++; + } + + return ENOENT; +} + +int ext2fs_test_block_bitmap_range(ext2fs_block_bitmap gen_bitmap, + blk_t block, int num) +{ + ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap; + + EXT2_CHECK_MAGIC(bitmap, EXT2_ET_MAGIC_BLOCK_BITMAP); + if ((block < bitmap->start) || (block > bitmap->real_end) || + (block+num-1 > bitmap->real_end)) { + ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_TEST, + block, bitmap->description); + return 0; + } + return ext2fs_test_clear_generic_bitmap_range((ext2fs_generic_bitmap) + bitmap, block, num); +} + +int ext2fs_test_inode_bitmap_range(ext2fs_inode_bitmap gen_bitmap, + ext2_ino_t inode, int num) +{ + ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap; + + EXT2_CHECK_MAGIC(bitmap, EXT2_ET_MAGIC_INODE_BITMAP); + if ((inode < bitmap->start) || (inode > bitmap->real_end) || + (inode+num-1 > bitmap->real_end)) { + ext2fs_warn_bitmap(EXT2_ET_BAD_INODE_TEST, + inode, bitmap->description); + return 0; + } + return ext2fs_test_clear_generic_bitmap_range((ext2fs_generic_bitmap) + bitmap, inode, num); +} + +void ext2fs_mark_block_bitmap_range(ext2fs_block_bitmap gen_bitmap, + blk_t block, int num) +{ + ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap; + int i; + + if ((block < bitmap->start) || (block > bitmap->end) || + (block+num-1 > bitmap->end)) { + ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_MARK, block, + bitmap->description); + return; + } + for (i=0; i < num; i++) + ext2fs_fast_set_bit(block + i - bitmap->start, bitmap->bitmap); +} + +void ext2fs_unmark_block_bitmap_range(ext2fs_block_bitmap gen_bitmap, + blk_t block, int num) +{ + ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap; + int i; + + if ((block < bitmap->start) || (block > bitmap->end) || + (block+num-1 > bitmap->end)) { + ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_UNMARK, block, + bitmap->description); + return; + } + for (i=0; i < num; i++) + ext2fs_fast_clear_bit(block + i - bitmap->start, + bitmap->bitmap); +} + diff --git a/lib/ext2fs/gen_bitmap64.c b/lib/ext2fs/gen_bitmap64.c new file mode 100644 index 0000000..4289e81 --- /dev/null +++ b/lib/ext2fs/gen_bitmap64.c @@ -0,0 +1,981 @@ +/* + * gen_bitmap64.c --- routines to read, write, and manipulate the new qinode and + * block bitmaps. + * + * Copyright (C) 2007, 2008 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Public + * License. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#include <errno.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#ifdef HAVE_SYS_TIME_H +#include <sys/time.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" +#include "bmap64.h" + +/* + * Design of 64-bit bitmaps + * + * In order maintain ABI compatibility with programs that don't + * understand about 64-bit blocks/inodes, + * ext2fs_allocate_inode_bitmap() and ext2fs_allocate_block_bitmap() + * will create old-style bitmaps unless the application passes the + * flag EXT2_FLAG_64BITS to ext2fs_open(). If this flag is + * passed, then we know the application has been recompiled, so we can + * use the new-style bitmaps. If it is not passed, we have to return + * an error if trying to open a filesystem which needs 64-bit bitmaps. + * + * The new bitmaps use a new set of structure magic numbers, so that + * both the old-style and new-style interfaces can identify which + * version of the data structure was used. Both the old-style and + * new-style interfaces will support either type of bitmap, although + * of course 64-bit operation will only be possible when both the + * new-style interface and the new-style bitmap are used. + * + * For example, the new bitmap interfaces will check the structure + * magic numbers and so will be able to detect old-stype bitmap. If + * they see an old-style bitmap, they will pass it to the gen_bitmap.c + * functions for handling. The same will be true for the old + * interfaces as well. + * + * The new-style interfaces will have several different back-end + * implementations, so we can support different encodings that are + * appropriate for different applications. In general the default + * should be whatever makes sense, and what the application/library + * will use. However, e2fsck may need specialized implementations for + * its own uses. For example, when doing parent directory pointer + * loop detections in pass 3, the bitmap will *always* be sparse, so + * e2fsck can request an encoding which is optimized for that. + */ + +static void warn_bitmap(ext2fs_generic_bitmap_64 bitmap, + int code, __u64 arg) +{ +#ifndef OMIT_COM_ERR + if (bitmap->description) + com_err(0, bitmap->base_error_code+code, + "#%llu for %s", (unsigned long long) arg, + bitmap->description); + else + com_err(0, bitmap->base_error_code + code, "#%llu", + (unsigned long long) arg); +#endif +} + +#ifdef ENABLE_BMAP_STATS_OPS +#define INC_STAT(map, name) map->stats.name +#else +#define INC_STAT(map, name) ;; +#endif + + +errcode_t ext2fs_alloc_generic_bmap(ext2_filsys fs, errcode_t magic, + int type, __u64 start, __u64 end, + __u64 real_end, + const char *descr, + ext2fs_generic_bitmap *ret) +{ + ext2fs_generic_bitmap_64 bitmap; + struct ext2_bitmap_ops *ops; + ext2_ino_t num_dirs; + errcode_t retval; + + if (!type) + type = EXT2FS_BMAP64_BITARRAY; + + switch (type) { + case EXT2FS_BMAP64_BITARRAY: + ops = &ext2fs_blkmap64_bitarray; + break; + case EXT2FS_BMAP64_RBTREE: + ops = &ext2fs_blkmap64_rbtree; + break; + case EXT2FS_BMAP64_AUTODIR: + retval = ext2fs_get_num_dirs(fs, &num_dirs); + if (retval || num_dirs > (fs->super->s_inodes_count / 320)) + ops = &ext2fs_blkmap64_bitarray; + else + ops = &ext2fs_blkmap64_rbtree; + break; + default: + return EINVAL; + } + + retval = ext2fs_get_memzero(sizeof(struct ext2fs_struct_generic_bitmap_64), + &bitmap); + if (retval) + return retval; + +#ifdef ENABLE_BMAP_STATS + if (gettimeofday(&bitmap->stats.created, + (struct timezone *) NULL) == -1) { + perror("gettimeofday"); + ext2fs_free_mem(&bitmap); + return 1; + } + bitmap->stats.type = type; +#endif + + /* XXX factor out, repeated in copy_bmap */ + bitmap->magic = magic; + bitmap->fs = fs; + bitmap->start = start; + bitmap->end = end; + bitmap->real_end = real_end; + bitmap->bitmap_ops = ops; + bitmap->cluster_bits = 0; + switch (magic) { + case EXT2_ET_MAGIC_INODE_BITMAP64: + bitmap->base_error_code = EXT2_ET_BAD_INODE_MARK; + break; + case EXT2_ET_MAGIC_BLOCK_BITMAP64: + bitmap->base_error_code = EXT2_ET_BAD_BLOCK_MARK; + bitmap->cluster_bits = fs->cluster_ratio_bits; + break; + default: + bitmap->base_error_code = EXT2_ET_BAD_GENERIC_MARK; + } + if (descr) { + retval = ext2fs_get_mem(strlen(descr)+1, &bitmap->description); + if (retval) { + ext2fs_free_mem(&bitmap); + return retval; + } + strcpy(bitmap->description, descr); + } else + bitmap->description = 0; + + retval = bitmap->bitmap_ops->new_bmap(fs, bitmap); + if (retval) { + ext2fs_free_mem(&bitmap->description); + ext2fs_free_mem(&bitmap); + return retval; + } + + *ret = (ext2fs_generic_bitmap) bitmap; + return 0; +} + +#ifdef ENABLE_BMAP_STATS +static void ext2fs_print_bmap_statistics(ext2fs_generic_bitmap_64 bitmap) +{ + struct ext2_bmap_statistics *stats = &bitmap->stats; +#ifdef ENABLE_BMAP_STATS_OPS + float mark_seq_perc = 0.0, test_seq_perc = 0.0; + float mark_back_perc = 0.0, test_back_perc = 0.0; + struct timeval now; + double inuse; + + if (stats->test_count) { + test_seq_perc = ((float)stats->test_seq / + stats->test_count) * 100; + test_back_perc = ((float)stats->test_back / + stats->test_count) * 100; + } + + if (stats->mark_count) { + mark_seq_perc = ((float)stats->mark_seq / + stats->mark_count) * 100; + mark_back_perc = ((float)stats->mark_back / + stats->mark_count) * 100; + } + + if (gettimeofday(&now, (struct timezone *) NULL) == -1) { + perror("gettimeofday"); + return; + } + + inuse = (double) now.tv_sec + \ + (((double) now.tv_usec) * 0.000001); + inuse -= (double) stats->created.tv_sec + \ + (((double) stats->created.tv_usec) * 0.000001); +#endif /* ENABLE_BMAP_STATS_OPS */ + + fprintf(stderr, "\n[+] %s bitmap (type %d)\n", bitmap->description, + stats->type); + fprintf(stderr, "=================================================\n"); +#ifdef ENABLE_BMAP_STATS_OPS + fprintf(stderr, "%16llu bits long\n", + bitmap->real_end - bitmap->start); + fprintf(stderr, "%16lu copy_bmap\n%16lu resize_bmap\n", + stats->copy_count, stats->resize_count); + fprintf(stderr, "%16lu mark bmap\n%16lu unmark_bmap\n", + stats->mark_count, stats->unmark_count); + fprintf(stderr, "%16lu test_bmap\n%16lu mark_bmap_extent\n", + stats->test_count, stats->mark_ext_count); + fprintf(stderr, "%16lu unmark_bmap_extent\n" + "%16lu test_clear_bmap_extent\n", + stats->unmark_ext_count, stats->test_ext_count); + fprintf(stderr, "%16lu set_bmap_range\n%16lu set_bmap_range\n", + stats->set_range_count, stats->get_range_count); + fprintf(stderr, "%16lu clear_bmap\n%16lu contiguous bit test (%.2f%%)\n", + stats->clear_count, stats->test_seq, test_seq_perc); + fprintf(stderr, "%16lu contiguous bit mark (%.2f%%)\n" + "%16llu bits tested backwards (%.2f%%)\n", + stats->mark_seq, mark_seq_perc, + stats->test_back, test_back_perc); + fprintf(stderr, "%16llu bits marked backwards (%.2f%%)\n" + "%16.2f seconds in use\n", + stats->mark_back, mark_back_perc, inuse); +#endif /* ENABLE_BMAP_STATS_OPS */ +} +#endif + +void ext2fs_free_generic_bmap(ext2fs_generic_bitmap gen_bmap) +{ + ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap; + + if (!bmap) + return; + + if (EXT2FS_IS_32_BITMAP(bmap)) { + ext2fs_free_generic_bitmap(gen_bmap); + return; + } + + if (!EXT2FS_IS_64_BITMAP(bmap)) + return; + +#ifdef ENABLE_BMAP_STATS + if (getenv("E2FSPROGS_BITMAP_STATS")) { + ext2fs_print_bmap_statistics(bmap); + bmap->bitmap_ops->print_stats(bmap); + } +#endif + + bmap->bitmap_ops->free_bmap(bmap); + + if (bmap->description) { + ext2fs_free_mem(&bmap->description); + bmap->description = 0; + } + bmap->magic = 0; + ext2fs_free_mem(&bmap); +} + +errcode_t ext2fs_copy_generic_bmap(ext2fs_generic_bitmap gen_src, + ext2fs_generic_bitmap *dest) +{ + ext2fs_generic_bitmap_64 src = (ext2fs_generic_bitmap_64) gen_src; + char *descr, *new_descr; + ext2fs_generic_bitmap_64 new_bmap; + errcode_t retval; + + if (!src) + return EINVAL; + + if (EXT2FS_IS_32_BITMAP(src)) + return ext2fs_copy_generic_bitmap(gen_src, dest); + + if (!EXT2FS_IS_64_BITMAP(src)) + return EINVAL; + + /* Allocate a new bitmap struct */ + retval = ext2fs_get_memzero(sizeof(struct ext2fs_struct_generic_bitmap_64), + &new_bmap); + if (retval) + return retval; + + +#ifdef ENABLE_BMAP_STATS_OPS + src->stats.copy_count++; +#endif +#ifdef ENABLE_BMAP_STATS + if (gettimeofday(&new_bmap->stats.created, + (struct timezone *) NULL) == -1) { + perror("gettimeofday"); + ext2fs_free_mem(&new_bmap); + return 1; + } + new_bmap->stats.type = src->stats.type; +#endif + + /* Copy all the high-level parts over */ + new_bmap->magic = src->magic; + new_bmap->fs = src->fs; + new_bmap->start = src->start; + new_bmap->end = src->end; + new_bmap->real_end = src->real_end; + new_bmap->bitmap_ops = src->bitmap_ops; + new_bmap->base_error_code = src->base_error_code; + new_bmap->cluster_bits = src->cluster_bits; + + descr = src->description; + if (descr) { + retval = ext2fs_get_mem(strlen(descr)+10, &new_descr); + if (retval) { + ext2fs_free_mem(&new_bmap); + return retval; + } + strcpy(new_descr, "copy of "); + strcat(new_descr, descr); + new_bmap->description = new_descr; + } + + retval = src->bitmap_ops->copy_bmap(src, new_bmap); + if (retval) { + ext2fs_free_mem(&new_bmap->description); + ext2fs_free_mem(&new_bmap); + return retval; + } + + *dest = (ext2fs_generic_bitmap) new_bmap; + + return 0; +} + +errcode_t ext2fs_resize_generic_bmap(ext2fs_generic_bitmap gen_bmap, + __u64 new_end, + __u64 new_real_end) +{ + ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap; + + if (!bmap) + return EINVAL; + + if (EXT2FS_IS_32_BITMAP(bmap)) + return ext2fs_resize_generic_bitmap(gen_bmap->magic, new_end, + new_real_end, gen_bmap); + + if (!EXT2FS_IS_64_BITMAP(bmap)) + return EINVAL; + + INC_STAT(bmap, resize_count); + + return bmap->bitmap_ops->resize_bmap(bmap, new_end, new_real_end); +} + +errcode_t ext2fs_fudge_generic_bmap_end(ext2fs_generic_bitmap gen_bitmap, + errcode_t neq, + __u64 end, __u64 *oend) +{ + ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap; + + if (!bitmap) + return EINVAL; + + if (EXT2FS_IS_32_BITMAP(bitmap)) { + ext2_ino_t tmp_oend; + int retval; + + retval = ext2fs_fudge_generic_bitmap_end(gen_bitmap, + bitmap->magic, + neq, end, &tmp_oend); + if (oend) + *oend = tmp_oend; + return retval; + } + + if (!EXT2FS_IS_64_BITMAP(bitmap)) + return EINVAL; + + if (end > bitmap->real_end) + return neq; + if (oend) + *oend = bitmap->end; + bitmap->end = end; + return 0; +} + +__u64 ext2fs_get_generic_bmap_start(ext2fs_generic_bitmap gen_bitmap) +{ + ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap; + + if (!bitmap) + return EINVAL; + + if (EXT2FS_IS_32_BITMAP(bitmap)) + return ext2fs_get_generic_bitmap_start(gen_bitmap); + + if (!EXT2FS_IS_64_BITMAP(bitmap)) + return EINVAL; + + return bitmap->start; +} + +__u64 ext2fs_get_generic_bmap_end(ext2fs_generic_bitmap gen_bitmap) +{ + ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap; + + if (!bitmap) + return EINVAL; + + if (EXT2FS_IS_32_BITMAP(bitmap)) + return ext2fs_get_generic_bitmap_end(gen_bitmap); + + if (!EXT2FS_IS_64_BITMAP(bitmap)) + return EINVAL; + + return bitmap->end; +} + +void ext2fs_clear_generic_bmap(ext2fs_generic_bitmap gen_bitmap) +{ + ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap; + + if (EXT2FS_IS_32_BITMAP(bitmap)) + ext2fs_clear_generic_bitmap(gen_bitmap); + else + bitmap->bitmap_ops->clear_bmap(bitmap); +} + +int ext2fs_mark_generic_bmap(ext2fs_generic_bitmap gen_bitmap, + __u64 arg) +{ + ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap; + + if (!bitmap) + return 0; + + if (EXT2FS_IS_32_BITMAP(bitmap)) { + if (arg & ~0xffffffffULL) { + ext2fs_warn_bitmap2(gen_bitmap, + EXT2FS_MARK_ERROR, 0xffffffff); + return 0; + } + return ext2fs_mark_generic_bitmap(gen_bitmap, arg); + } + + if (!EXT2FS_IS_64_BITMAP(bitmap)) + return 0; + + arg >>= bitmap->cluster_bits; + +#ifdef ENABLE_BMAP_STATS_OPS + if (arg == bitmap->stats.last_marked + 1) + bitmap->stats.mark_seq++; + if (arg < bitmap->stats.last_marked) + bitmap->stats.mark_back++; + bitmap->stats.last_marked = arg; + bitmap->stats.mark_count++; +#endif + + if ((arg < bitmap->start) || (arg > bitmap->end)) { + warn_bitmap(bitmap, EXT2FS_MARK_ERROR, arg); + return 0; + } + + return bitmap->bitmap_ops->mark_bmap(bitmap, arg); +} + +int ext2fs_unmark_generic_bmap(ext2fs_generic_bitmap gen_bitmap, + __u64 arg) +{ + ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap; + + if (!bitmap) + return 0; + + if (EXT2FS_IS_32_BITMAP(bitmap)) { + if (arg & ~0xffffffffULL) { + ext2fs_warn_bitmap2(gen_bitmap, EXT2FS_UNMARK_ERROR, + 0xffffffff); + return 0; + } + return ext2fs_unmark_generic_bitmap(gen_bitmap, arg); + } + + if (!EXT2FS_IS_64_BITMAP(bitmap)) + return 0; + + arg >>= bitmap->cluster_bits; + + INC_STAT(bitmap, unmark_count); + + if ((arg < bitmap->start) || (arg > bitmap->end)) { + warn_bitmap(bitmap, EXT2FS_UNMARK_ERROR, arg); + return 0; + } + + return bitmap->bitmap_ops->unmark_bmap(bitmap, arg); +} + +int ext2fs_test_generic_bmap(ext2fs_generic_bitmap gen_bitmap, + __u64 arg) +{ + ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap; + if (!bitmap) + return 0; + + if (EXT2FS_IS_32_BITMAP(bitmap)) { + if (arg & ~0xffffffffULL) { + ext2fs_warn_bitmap2(gen_bitmap, EXT2FS_TEST_ERROR, + 0xffffffff); + return 0; + } + return ext2fs_test_generic_bitmap(gen_bitmap, arg); + } + + if (!EXT2FS_IS_64_BITMAP(bitmap)) + return 0; + + arg >>= bitmap->cluster_bits; + +#ifdef ENABLE_BMAP_STATS_OPS + bitmap->stats.test_count++; + if (arg == bitmap->stats.last_tested + 1) + bitmap->stats.test_seq++; + if (arg < bitmap->stats.last_tested) + bitmap->stats.test_back++; + bitmap->stats.last_tested = arg; +#endif + + if ((arg < bitmap->start) || (arg > bitmap->end)) { + warn_bitmap(bitmap, EXT2FS_TEST_ERROR, arg); + return 0; + } + + return bitmap->bitmap_ops->test_bmap(bitmap, arg); +} + +errcode_t ext2fs_set_generic_bmap_range(ext2fs_generic_bitmap gen_bmap, + __u64 start, unsigned int num, + void *in) +{ + ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap; + + if (!bmap) + return EINVAL; + + if (EXT2FS_IS_32_BITMAP(bmap)) { + if ((start+num-1) & ~0xffffffffULL) { + ext2fs_warn_bitmap2(gen_bmap, EXT2FS_UNMARK_ERROR, + 0xffffffff); + return EINVAL; + } + return ext2fs_set_generic_bitmap_range(gen_bmap, bmap->magic, + start, num, in); + } + + if (!EXT2FS_IS_64_BITMAP(bmap)) + return EINVAL; + + INC_STAT(bmap, set_range_count); + + return bmap->bitmap_ops->set_bmap_range(bmap, start, num, in); +} + +errcode_t ext2fs_get_generic_bmap_range(ext2fs_generic_bitmap gen_bmap, + __u64 start, unsigned int num, + void *out) +{ + ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap; + + if (!bmap) + return EINVAL; + + if (EXT2FS_IS_32_BITMAP(bmap)) { + if ((start+num-1) & ~0xffffffffULL) { + ext2fs_warn_bitmap2(gen_bmap, + EXT2FS_UNMARK_ERROR, 0xffffffff); + return EINVAL; + } + return ext2fs_get_generic_bitmap_range(gen_bmap, bmap->magic, + start, num, out); + } + + if (!EXT2FS_IS_64_BITMAP(bmap)) + return EINVAL; + + INC_STAT(bmap, get_range_count); + + return bmap->bitmap_ops->get_bmap_range(bmap, start, num, out); +} + +errcode_t ext2fs_compare_generic_bmap(errcode_t neq, + ext2fs_generic_bitmap gen_bm1, + ext2fs_generic_bitmap gen_bm2) +{ + ext2fs_generic_bitmap_64 bm1 = (ext2fs_generic_bitmap_64) gen_bm1; + ext2fs_generic_bitmap_64 bm2 = (ext2fs_generic_bitmap_64) gen_bm2; + blk64_t i; + + if (!bm1 || !bm2) + return EINVAL; + if (bm1->magic != bm2->magic) + return EINVAL; + + /* Now we know both bitmaps have the same magic */ + if (EXT2FS_IS_32_BITMAP(bm1)) + return ext2fs_compare_generic_bitmap(bm1->magic, neq, + gen_bm1, gen_bm2); + + if (!EXT2FS_IS_64_BITMAP(bm1)) + return EINVAL; + + if ((bm1->start != bm2->start) || + (bm1->end != bm2->end)) + return neq; + + for (i = bm1->start; i < bm1->end; i++) { + int ret1, ret2; + ret1 = !!ext2fs_test_generic_bmap(gen_bm1, i); + ret2 = !!ext2fs_test_generic_bmap(gen_bm2, i); + if (ret1 != ret2) { + return neq; + } + } + + return 0; +} + +void ext2fs_set_generic_bmap_padding(ext2fs_generic_bitmap gen_bmap) +{ + ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap; + __u64 start, num; + + if (EXT2FS_IS_32_BITMAP(bmap)) { + ext2fs_set_generic_bitmap_padding(gen_bmap); + return; + } + + start = bmap->end + 1; + num = bmap->real_end - bmap->end; + bmap->bitmap_ops->mark_bmap_extent(bmap, start, num); + /* XXX ought to warn on error */ +} + +int ext2fs_test_block_bitmap_range2(ext2fs_block_bitmap gen_bmap, + blk64_t block, unsigned int num) +{ + ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap; + __u64 end = block + num; + + if (!bmap) + return EINVAL; + + if (num == 1) + return !ext2fs_test_generic_bmap((ext2fs_generic_bitmap) + bmap, block); + + if (EXT2FS_IS_32_BITMAP(bmap)) { + if ((block & ~0xffffffffULL) || + ((block+num-1) & ~0xffffffffULL)) { + ext2fs_warn_bitmap2((ext2fs_generic_bitmap) bmap, + EXT2FS_UNMARK_ERROR, 0xffffffff); + return EINVAL; + } + return ext2fs_test_block_bitmap_range( + (ext2fs_generic_bitmap) bmap, block, num); + } + + if (!EXT2FS_IS_64_BITMAP(bmap)) + return EINVAL; + + INC_STAT(bmap, test_ext_count); + + /* convert to clusters if necessary */ + block >>= bmap->cluster_bits; + end += (1ULL << bmap->cluster_bits) - 1; + end >>= bmap->cluster_bits; + num = end - block; + + if ((block < bmap->start) || (block > bmap->end) || + (block+num-1 > bmap->end)) { + ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_TEST, block, + bmap->description); + return EINVAL; + } + + return bmap->bitmap_ops->test_clear_bmap_extent(bmap, block, num); +} + +void ext2fs_mark_block_bitmap_range2(ext2fs_block_bitmap gen_bmap, + blk64_t block, unsigned int num) +{ + ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap; + __u64 end = block + num; + + if (!bmap) + return; + + if (EXT2FS_IS_32_BITMAP(bmap)) { + if ((block & ~0xffffffffULL) || + ((block+num-1) & ~0xffffffffULL)) { + ext2fs_warn_bitmap2((ext2fs_generic_bitmap) bmap, + EXT2FS_UNMARK_ERROR, 0xffffffff); + return; + } + ext2fs_mark_block_bitmap_range((ext2fs_generic_bitmap) bmap, + block, num); + } + + if (!EXT2FS_IS_64_BITMAP(bmap)) + return; + + INC_STAT(bmap, mark_ext_count); + + /* convert to clusters if necessary */ + block >>= bmap->cluster_bits; + end += (1ULL << bmap->cluster_bits) - 1; + end >>= bmap->cluster_bits; + num = end - block; + + if ((block < bmap->start) || (block > bmap->end) || + (block+num-1 > bmap->end)) { + ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_MARK, block, + bmap->description); + return; + } + + bmap->bitmap_ops->mark_bmap_extent(bmap, block, num); +} + +void ext2fs_unmark_block_bitmap_range2(ext2fs_block_bitmap gen_bmap, + blk64_t block, unsigned int num) +{ + ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap; + __u64 end = block + num; + + if (!bmap) + return; + + if (EXT2FS_IS_32_BITMAP(bmap)) { + if ((block & ~0xffffffffULL) || + ((block+num-1) & ~0xffffffffULL)) { + ext2fs_warn_bitmap2((ext2fs_generic_bitmap) bmap, + EXT2FS_UNMARK_ERROR, 0xffffffff); + return; + } + ext2fs_unmark_block_bitmap_range((ext2fs_generic_bitmap) bmap, + block, num); + } + + if (!EXT2FS_IS_64_BITMAP(bmap)) + return; + + INC_STAT(bmap, unmark_ext_count); + + /* convert to clusters if necessary */ + block >>= bmap->cluster_bits; + end += (1ULL << bmap->cluster_bits) - 1; + end >>= bmap->cluster_bits; + num = end - block; + + if ((block < bmap->start) || (block > bmap->end) || + (block+num-1 > bmap->end)) { + ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_UNMARK, block, + bmap->description); + return; + } + + bmap->bitmap_ops->unmark_bmap_extent(bmap, block, num); +} + +void ext2fs_warn_bitmap32(ext2fs_generic_bitmap gen_bitmap, const char *func) +{ + ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap; + +#ifndef OMIT_COM_ERR + if (bitmap && bitmap->description) + com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP, + "called %s with 64-bit bitmap for %s", func, + bitmap->description); + else + com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP, + "called %s with 64-bit bitmap", func); +#endif +} + +errcode_t ext2fs_convert_subcluster_bitmap(ext2_filsys fs, + ext2fs_block_bitmap *bitmap) +{ + ext2fs_generic_bitmap_64 bmap, cmap; + ext2fs_block_bitmap gen_bmap = *bitmap, gen_cmap; + errcode_t retval; + blk64_t i, next, b_end, c_end; + + bmap = (ext2fs_generic_bitmap_64) gen_bmap; + if (fs->cluster_ratio_bits == ext2fs_get_bitmap_granularity(gen_bmap)) + return 0; /* Nothing to do */ + + retval = ext2fs_allocate_block_bitmap(fs, "converted cluster bitmap", + &gen_cmap); + if (retval) + return retval; + + cmap = (ext2fs_generic_bitmap_64) gen_cmap; + i = bmap->start; + b_end = bmap->end; + bmap->end = bmap->real_end; + c_end = cmap->end; + cmap->end = cmap->real_end; + while (i < bmap->real_end) { + retval = ext2fs_find_first_set_block_bitmap2(gen_bmap, + i, bmap->real_end, &next); + if (retval) + break; + ext2fs_mark_block_bitmap2(gen_cmap, next); + i = EXT2FS_C2B(fs, EXT2FS_B2C(fs, next) + 1); + } + bmap->end = b_end; + cmap->end = c_end; + ext2fs_free_block_bitmap(gen_bmap); + *bitmap = (ext2fs_block_bitmap) cmap; + return 0; +} + +errcode_t ext2fs_find_first_zero_generic_bmap(ext2fs_generic_bitmap bitmap, + __u64 start, __u64 end, __u64 *out) +{ + ext2fs_generic_bitmap_64 bmap64 = (ext2fs_generic_bitmap_64) bitmap; + __u64 cstart, cend, cout; + errcode_t retval; + + if (!bitmap) + return EINVAL; + + if (EXT2FS_IS_32_BITMAP(bitmap)) { + blk_t blk = 0; + + if (((start) & ~0xffffffffULL) || + ((end) & ~0xffffffffULL)) { + ext2fs_warn_bitmap2(bitmap, EXT2FS_TEST_ERROR, start); + return EINVAL; + } + + retval = ext2fs_find_first_zero_generic_bitmap(bitmap, start, + end, &blk); + if (retval == 0) + *out = blk; + return retval; + } + + if (!EXT2FS_IS_64_BITMAP(bitmap)) + return EINVAL; + + cstart = start >> bmap64->cluster_bits; + cend = end >> bmap64->cluster_bits; + + if (cstart < bmap64->start || cend > bmap64->end || start > end) { + warn_bitmap(bmap64, EXT2FS_TEST_ERROR, start); + return EINVAL; + } + + if (bmap64->bitmap_ops->find_first_zero) { + retval = bmap64->bitmap_ops->find_first_zero(bmap64, cstart, + cend, &cout); + if (retval) + return retval; + found: + cout <<= bmap64->cluster_bits; + *out = (cout >= start) ? cout : start; + return 0; + } + + for (cout = cstart; cout <= cend; cout++) + if (!bmap64->bitmap_ops->test_bmap(bmap64, cout)) + goto found; + + return ENOENT; +} + +errcode_t ext2fs_find_first_set_generic_bmap(ext2fs_generic_bitmap bitmap, + __u64 start, __u64 end, __u64 *out) +{ + ext2fs_generic_bitmap_64 bmap64 = (ext2fs_generic_bitmap_64) bitmap; + __u64 cstart, cend, cout; + errcode_t retval; + + if (!bitmap) + return EINVAL; + + if (EXT2FS_IS_32_BITMAP(bitmap)) { + blk_t blk = 0; + + if (((start) & ~0xffffffffULL) || + ((end) & ~0xffffffffULL)) { + ext2fs_warn_bitmap2(bitmap, EXT2FS_TEST_ERROR, start); + return EINVAL; + } + + retval = ext2fs_find_first_set_generic_bitmap(bitmap, start, + end, &blk); + if (retval == 0) + *out = blk; + return retval; + } + + if (!EXT2FS_IS_64_BITMAP(bitmap)) + return EINVAL; + + cstart = start >> bmap64->cluster_bits; + cend = end >> bmap64->cluster_bits; + + if (cstart < bmap64->start || cend > bmap64->end || start > end) { + warn_bitmap(bmap64, EXT2FS_TEST_ERROR, start); + return EINVAL; + } + + if (bmap64->bitmap_ops->find_first_set) { + retval = bmap64->bitmap_ops->find_first_set(bmap64, cstart, + cend, &cout); + if (retval) + return retval; + found: + cout <<= bmap64->cluster_bits; + *out = (cout >= start) ? cout : start; + return 0; + } + + for (cout = cstart; cout <= cend; cout++) + if (bmap64->bitmap_ops->test_bmap(bmap64, cout)) + goto found; + + return ENOENT; +} + +errcode_t ext2fs_count_used_clusters(ext2_filsys fs, blk64_t start, + blk64_t end, blk64_t *out) +{ + blk64_t next; + blk64_t tot_set = 0; + errcode_t retval = 0; + + while (start < end) { + retval = ext2fs_find_first_set_block_bitmap2(fs->block_map, + start, end, &next); + if (retval) { + if (retval == ENOENT) + retval = 0; + break; + } + start = next; + + retval = ext2fs_find_first_zero_block_bitmap2(fs->block_map, + start, end, &next); + if (retval == 0) { + tot_set += next - start; + start = next + 1; + } else if (retval == ENOENT) { + retval = 0; + tot_set += end - start + 1; + break; + } else + break; + } + + if (!retval) + *out = EXT2FS_NUM_B2C(fs, tot_set); + return retval; +} diff --git a/lib/ext2fs/gen_crc32ctable.c b/lib/ext2fs/gen_crc32ctable.c new file mode 100644 index 0000000..a0742ee --- /dev/null +++ b/lib/ext2fs/gen_crc32ctable.c @@ -0,0 +1,117 @@ +#include <stdio.h> +#include "crc32c_defs.h" +#include <inttypes.h> + +#define ENTRIES_PER_LINE 4 + +#if CRC_LE_BITS > 8 +# define LE_TABLE_ROWS (CRC_LE_BITS/8) +# define LE_TABLE_SIZE 256 +#else +# define LE_TABLE_ROWS 1 +# define LE_TABLE_SIZE (1 << CRC_LE_BITS) +#endif + +#if CRC_BE_BITS > 8 +# define BE_TABLE_ROWS (CRC_BE_BITS/8) +# define BE_TABLE_SIZE 256 +#else +# define BE_TABLE_ROWS 1 +# define BE_TABLE_SIZE (1 << CRC_BE_BITS) +#endif + +static uint32_t crc32table_be[BE_TABLE_ROWS][256]; +static uint32_t crc32ctable_le[LE_TABLE_ROWS][256]; + +/** + * crc32init_le() - allocate and initialize LE table data + * + * crc is the crc of the byte i; other entries are filled in based on the + * fact that crctable[i^j] = crctable[i] ^ crctable[j]. + * + */ +static void crc32cinit_le(void) +{ + unsigned i, j; + uint32_t crc = 1; + + crc32ctable_le[0][0] = 0; + + for (i = LE_TABLE_SIZE >> 1; i; i >>= 1) { + crc = (crc >> 1) ^ ((crc & 1) ? CRC32C_POLY_LE : 0); + for (j = 0; j < LE_TABLE_SIZE; j += 2 * i) + crc32ctable_le[0][i + j] = crc ^ crc32ctable_le[0][j]; + } + for (i = 0; i < LE_TABLE_SIZE; i++) { + crc = crc32ctable_le[0][i]; + for (j = 1; j < LE_TABLE_ROWS; j++) { + crc = crc32ctable_le[0][crc & 0xff] ^ (crc >> 8); + crc32ctable_le[j][i] = crc; + } + } +} + +/** + * crc32init_be() - allocate and initialize BE table data + */ +static void crc32init_be(void) +{ + unsigned i, j; + uint32_t crc = 0x80000000; + + crc32table_be[0][0] = 0; + + for (i = 1; i < BE_TABLE_SIZE; i <<= 1) { + crc = (crc << 1) ^ ((crc & 0x80000000) ? CRCPOLY_BE : 0); + for (j = 0; j < i; j++) + crc32table_be[0][i + j] = crc ^ crc32table_be[0][j]; + } + for (i = 0; i < BE_TABLE_SIZE; i++) { + crc = crc32table_be[0][i]; + for (j = 1; j < BE_TABLE_ROWS; j++) { + crc = crc32table_be[0][(crc >> 24) & 0xff] ^ (crc << 8); + crc32table_be[j][i] = crc; + } + } +} + +static void output_table(uint32_t (*table)[256], int rows, int len, char *trans) +{ + int i, j; + + for (j = 0 ; j < rows; j++) { + printf("{"); + for (i = 0; i < len - 1; i++) { + if (i % ENTRIES_PER_LINE == 0) + printf("\n"); + printf("%s(0x%8.8xL), ", trans, table[j][i]); + } + printf("%s(0x%8.8xL)},\n", trans, table[j][len - 1]); + } +} + +int main(int argc, char **argv) +{ + printf("/* this file is generated - do not edit */\n\n"); + + if (CRC_BE_BITS > 1) { + crc32init_be(); + printf("static const uint32_t " + "crc32table_be[%d][%d] = {", + BE_TABLE_ROWS, BE_TABLE_SIZE); + output_table(crc32table_be, LE_TABLE_ROWS, + BE_TABLE_SIZE, "tobe"); + printf("};\n"); + } + if (CRC_LE_BITS > 1) { + crc32cinit_le(); + printf("static const uint32_t " + "crc32ctable_le[%d][%d] = {", + LE_TABLE_ROWS, LE_TABLE_SIZE); + output_table(crc32ctable_le, LE_TABLE_ROWS, + LE_TABLE_SIZE, "tole"); + printf("};\n"); + } + + return 0; +} diff --git a/lib/ext2fs/get_num_dirs.c b/lib/ext2fs/get_num_dirs.c new file mode 100644 index 0000000..f5644f8 --- /dev/null +++ b/lib/ext2fs/get_num_dirs.c @@ -0,0 +1,50 @@ +/* + * get_num_dirs.c -- calculate number of directories + * + * Copyright 1997 by Theodore Ts'o + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <string.h> +#include <time.h> + +#include "ext2_fs.h" +#include "ext2fsP.h" + +/* + * Returns the number of directories in the filesystem as reported by + * the group descriptors. Of course, the group descriptors could be + * wrong! + */ +errcode_t ext2fs_get_num_dirs(ext2_filsys fs, ext2_ino_t *ret_num_dirs) +{ + dgrp_t i; + ext2_ino_t num_dirs, max_dirs; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + num_dirs = 0; + max_dirs = fs->super->s_inodes_per_group; + for (i = 0; i < fs->group_desc_count; i++) { + if (ext2fs_bg_used_dirs_count(fs, i) > max_dirs) + num_dirs += max_dirs / 8; + else + num_dirs += ext2fs_bg_used_dirs_count(fs, i); + } + if (num_dirs > fs->super->s_inodes_count) + num_dirs = fs->super->s_inodes_count; + + *ret_num_dirs = num_dirs; + + return 0; +} + diff --git a/lib/ext2fs/get_pathname.c b/lib/ext2fs/get_pathname.c new file mode 100644 index 0000000..8cfaf6e --- /dev/null +++ b/lib/ext2fs/get_pathname.c @@ -0,0 +1,171 @@ +/* + * get_pathname.c --- do directory/inode -> name translation + * + * Copyright (C) 1993, 1994, 1995 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +/* + * + * ext2fs_get_pathname(fs, dir, ino, name) + * + * This function translates takes two inode numbers into a + * string, placing the result in <name>. <dir> is the containing + * directory inode, and <ino> is the inode number itself. If + * <ino> is zero, then ext2fs_get_pathname will return pathname + * of the the directory <dir>. + * + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +struct get_pathname_struct { + ext2_ino_t search_ino; + ext2_ino_t parent; + char *name; + errcode_t errcode; +}; + +#ifdef __TURBOC__ + #pragma argsused +#endif +static int get_pathname_proc(struct ext2_dir_entry *dirent, + int offset EXT2FS_ATTR((unused)), + int blocksize EXT2FS_ATTR((unused)), + char *buf EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct get_pathname_struct *gp; + errcode_t retval; + int name_len = ext2fs_dirent_name_len(dirent); + + gp = (struct get_pathname_struct *) priv_data; + + if ((name_len == 2) && !strncmp(dirent->name, "..", 2)) + gp->parent = dirent->inode; + if (dirent->inode == gp->search_ino) { + retval = ext2fs_get_mem(name_len + 1, &gp->name); + if (retval) { + gp->errcode = retval; + return DIRENT_ABORT; + } + strncpy(gp->name, dirent->name, name_len); + gp->name[name_len] = '\0'; + return DIRENT_ABORT; + } + return 0; +} + +static errcode_t ext2fs_get_pathname_int(ext2_filsys fs, ext2_ino_t dir, + ext2_ino_t ino, int maxdepth, + char *buf, char **name) +{ + struct get_pathname_struct gp; + char *parent_name = 0, *ret; + errcode_t retval; + + if (dir == ino) { + retval = ext2fs_get_mem(2, name); + if (retval) + return retval; + strcpy(*name, (dir == EXT2_ROOT_INO) ? "/" : "."); + return 0; + } + + if (!dir || (maxdepth < 0)) { + retval = ext2fs_get_mem(4, name); + if (retval) + return retval; + strcpy(*name, "..."); + return 0; + } + + gp.search_ino = ino; + gp.parent = 0; + gp.name = 0; + gp.errcode = 0; + + retval = ext2fs_dir_iterate(fs, dir, 0, buf, get_pathname_proc, &gp); + if (retval == EXT2_ET_NO_DIRECTORY) { + char tmp[32]; + + if (ino) + snprintf(tmp, sizeof(tmp), "<%u>/<%u>", dir, ino); + else + snprintf(tmp, sizeof(tmp), "<%u>", dir); + retval = ext2fs_get_mem(strlen(tmp)+1, name); + if (retval) + goto cleanup; + strcpy(*name, tmp); + return 0; + } else if (retval) + goto cleanup; + if (gp.errcode) { + retval = gp.errcode; + goto cleanup; + } + + retval = ext2fs_get_pathname_int(fs, gp.parent, dir, maxdepth-1, + buf, &parent_name); + if (retval) + goto cleanup; + if (!ino) { + *name = parent_name; + return 0; + } + + if (gp.name) + retval = ext2fs_get_mem(strlen(parent_name)+strlen(gp.name)+2, + &ret); + else + retval = ext2fs_get_mem(strlen(parent_name)+5, &ret); + if (retval) + goto cleanup; + + ret[0] = 0; + if (parent_name[1]) + strcat(ret, parent_name); + strcat(ret, "/"); + if (gp.name) + strcat(ret, gp.name); + else + strcat(ret, "???"); + *name = ret; + retval = 0; + +cleanup: + ext2fs_free_mem(&parent_name); + ext2fs_free_mem(&gp.name); + return retval; +} + +errcode_t ext2fs_get_pathname(ext2_filsys fs, ext2_ino_t dir, ext2_ino_t ino, + char **name) +{ + char *buf; + errcode_t retval; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + retval = ext2fs_get_mem(fs->blocksize, &buf); + if (retval) + return retval; + if (dir == ino) + ino = 0; + retval = ext2fs_get_pathname_int(fs, dir, ino, 32, buf, name); + ext2fs_free_mem(&buf); + return retval; + +} diff --git a/lib/ext2fs/getsectsize.c b/lib/ext2fs/getsectsize.c new file mode 100644 index 0000000..bd978c5 --- /dev/null +++ b/lib/ext2fs/getsectsize.c @@ -0,0 +1,151 @@ +/* + * getsectsize.c --- get the sector size of a device. + * + * Copyright (C) 1995, 1995 Theodore Ts'o. + * Copyright (C) 2003 VMware, Inc. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef _LARGEFILE_SOURCE +#define _LARGEFILE_SOURCE +#endif +#ifndef _LARGEFILE64_SOURCE +#define _LARGEFILE64_SOURCE +#endif + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <fcntl.h> +#ifdef HAVE_SYS_DISK_H +#include <sys/disk.h> +#endif +#ifdef HAVE_LINUX_FD_H +#include <sys/ioctl.h> +#include <linux/fd.h> +#endif + +#if defined(__linux__) && defined(_IO) +#if !defined(BLKSSZGET) +#define BLKSSZGET _IO(0x12,104)/* get block device sector size */ +#endif +#if !defined(BLKPBSZGET) +#define BLKPBSZGET _IO(0x12,123)/* get block physical sector size */ +#endif +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +/* + * Returns the logical sector size of a device + */ +errcode_t ext2fs_get_device_sectsize(const char *file, int *sectsize) +{ +#ifdef _WIN32 + *sectsize = 512; // just guessing + return 0; +#else // not _WIN32 + + int fd; + + fd = ext2fs_open_file(file, O_RDONLY, 0); + if (fd < 0) + return errno; + +#ifdef BLKSSZGET + if (ioctl(fd, BLKSSZGET, sectsize) >= 0) { + close(fd); + return 0; + } +#endif +#ifdef DIOCGSECTORSIZE + if (ioctl(fd, DIOCGSECTORSIZE, sectsize) >= 0) { + close(fd); + return 0; + } +#endif + *sectsize = 0; + close(fd); + return 0; + +#endif // ifdef _WIN32 +} + +/* + * Return desired alignment for direct I/O + */ +int ext2fs_get_dio_alignment(int fd) +{ + int align = 0; + +#ifdef BLKSSZGET + if (ioctl(fd, BLKSSZGET, &align) < 0) + align = 0; +#endif +#ifdef DIOCGSECTORSIZE + if (align <= 0 && + ioctl(fd, DIOCGSECTORSIZE, &align) < 0) + align = 0; +#endif + +#ifdef _SC_PAGESIZE + if (align <= 0) + align = sysconf(_SC_PAGESIZE); +#endif +#ifdef HAVE_GETPAGESIZE + if (align <= 0) + align = getpagesize(); +#endif + if (align <= 0) + align = 4096; + + return align; +} + +/* + * Returns the physical sector size of a device + */ +errcode_t ext2fs_get_device_phys_sectsize(const char *file, int *sectsize) +{ +#ifdef _WIN32 + + return ext2fs_get_device_sectsize(file, sectsize); + +#else // not _WIN32 + + int fd; + + fd = ext2fs_open_file(file, O_RDONLY, 0); + if (fd < 0) + return errno; + +#ifdef BLKPBSZGET + if (ioctl(fd, BLKPBSZGET, sectsize) >= 0) { + close(fd); + return 0; + } +#endif +#ifdef DIOCGSECTORSIZE + /* This isn't really the physical sector size, but FreeBSD + * doesn't seem to have this concept. */ + if (ioctl(fd, DIOCGSECTORSIZE, sectsize) >= 0) { + close(fd); + return 0; + } +#endif + *sectsize = 0; + close(fd); + return 0; + +#endif // ifdef _WIN32 +} diff --git a/lib/ext2fs/getsize.c b/lib/ext2fs/getsize.c new file mode 100644 index 0000000..bcf3020 --- /dev/null +++ b/lib/ext2fs/getsize.c @@ -0,0 +1,324 @@ +/* + * getsize.c --- get the size of a partition. + * + * Copyright (C) 1995, 1995 Theodore Ts'o. + * Copyright (C) 2003 VMware, Inc. + * + * Windows version of ext2fs_get_device_size by Chris Li, VMware. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef _LARGEFILE_SOURCE +#define _LARGEFILE_SOURCE +#endif +#ifndef _LARGEFILE64_SOURCE +#define _LARGEFILE64_SOURCE +#endif + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <fcntl.h> +#ifdef HAVE_SYS_IOCTL_H +#include <sys/ioctl.h> +#endif +#ifdef HAVE_LINUX_FD_H +#include <linux/fd.h> +#endif +#ifdef HAVE_SYS_DISKLABEL_H +#include <sys/disklabel.h> +#endif +#ifdef HAVE_SYS_DISK_H +#include <sys/disk.h> +#endif +#ifdef __linux__ +#include <sys/utsname.h> +#endif +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#include <ctype.h> + +#if defined(__linux__) && defined(_IO) && !defined(BLKGETSIZE) +#define BLKGETSIZE _IO(0x12,96) /* return device size */ +#endif + +#if defined(__linux__) && defined(_IOR) && !defined(BLKGETSIZE64) +#define BLKGETSIZE64 _IOR(0x12,114,size_t) /* return device size in bytes (u64 *arg) */ +#endif + +#ifdef APPLE_DARWIN +#define BLKGETSIZE DKIOCGETBLOCKCOUNT32 +#endif /* APPLE_DARWIN */ + +#include "ext2_fs.h" +#include "ext2fs.h" + +#if defined(__CYGWIN__) || defined (WIN32) +#include "windows.h" +#include "winioctl.h" + +#if (_WIN32_WINNT >= 0x0500) +#define HAVE_GET_FILE_SIZE_EX 1 +#endif + +HANDLE windows_get_handle(io_channel channel); + +errcode_t ext2fs_get_device_size2(const char *file, int blocksize, + blk64_t *retblocks) +{ + HANDLE dev; + PARTITION_INFORMATION pi; + DISK_GEOMETRY gi; + DWORD retbytes; +#ifdef HAVE_GET_FILE_SIZE_EX + LARGE_INTEGER filesize; +#else + DWORD filesize; +#endif /* HAVE_GET_FILE_SIZE_EX */ + + io_channel data_io = 0; + int retval; + + retval = windows_io_manager->open(file, 0, &data_io); + if (retval) + return retval; + + dev = windows_get_handle(data_io); + if (dev == INVALID_HANDLE_VALUE) + return EBADF; + + if (DeviceIoControl(dev, IOCTL_DISK_GET_PARTITION_INFO, + &pi, sizeof(PARTITION_INFORMATION), + &pi, sizeof(PARTITION_INFORMATION), + &retbytes, NULL)) { + + *retblocks = pi.PartitionLength.QuadPart / blocksize; + + } else if (DeviceIoControl(dev, IOCTL_DISK_GET_DRIVE_GEOMETRY, + &gi, sizeof(DISK_GEOMETRY), + &gi, sizeof(DISK_GEOMETRY), + &retbytes, NULL)) { + + *retblocks = gi.BytesPerSector * + gi.SectorsPerTrack * + gi.TracksPerCylinder * + gi.Cylinders.QuadPart / blocksize; + +#ifdef HAVE_GET_FILE_SIZE_EX + } else if (GetFileSizeEx(dev, &filesize)) { + *retblocks = filesize.QuadPart / blocksize; + } +#else + } else { + filesize = GetFileSize(dev, NULL); + if (INVALID_FILE_SIZE != filesize) { + *retblocks = filesize / blocksize; + } + } +#endif /* HAVE_GET_FILE_SIZE_EX */ + + windows_io_manager->close(data_io); + + return 0; +} + +#else + +static int valid_offset (int fd, ext2_loff_t offset) +{ + char ch; + + if (ext2fs_llseek (fd, offset, 0) < 0) + return 0; + if (read (fd, &ch, 1) < 1) + return 0; + return 1; +} + +/* + * Returns the number of blocks in a partition + */ +errcode_t ext2fs_get_device_size2(const char *file, int blocksize, + blk64_t *retblocks) +{ + int fd, rc = 0; + unsigned long long size64; + ext2_loff_t high, low; + + fd = ext2fs_open_file(file, O_RDONLY, 0); + if (fd < 0) + return errno; + +#if defined DKIOCGETBLOCKCOUNT && defined DKIOCGETBLOCKSIZE /* For Apple Darwin */ + unsigned int size; + + if (ioctl(fd, DKIOCGETBLOCKCOUNT, &size64) >= 0 && + ioctl(fd, DKIOCGETBLOCKSIZE, &size) >= 0) { + *retblocks = size64 * size / blocksize; + goto out; + } +#endif + +#ifdef BLKGETSIZE64 + { + int valid_blkgetsize64 = 1; +#ifdef __linux__ + struct utsname ut; + + if ((uname(&ut) == 0) && + ((ut.release[0] == '2') && (ut.release[1] == '.') && + (ut.release[2] < '6') && (ut.release[3] == '.'))) + valid_blkgetsize64 = 0; +#endif + if (valid_blkgetsize64 && + ioctl(fd, BLKGETSIZE64, &size64) >= 0) { + *retblocks = size64 / blocksize; + goto out; + } + } +#endif /* BLKGETSIZE64 */ + +#ifdef BLKGETSIZE + { + unsigned long size; + + if (ioctl(fd, BLKGETSIZE, &size) >= 0) { + *retblocks = size / (blocksize / 512); + goto out; + } + } +#endif + +#ifdef FDGETPRM + { + struct floppy_struct this_floppy; + + if (ioctl(fd, FDGETPRM, &this_floppy) >= 0) { + *retblocks = this_floppy.size / (blocksize / 512); + goto out; + } + } +#endif + +#ifdef HAVE_SYS_DISKLABEL_H + { + int part; + struct disklabel lab; + struct partition *pp; + char ch; + +#if defined(DIOCGMEDIASIZE) + { + off_t ms; + u_int bs; + if (ioctl(fd, DIOCGMEDIASIZE, &ms) >= 0) { + *retblocks = ms / blocksize; + goto out; + } + } +#elif defined(DIOCGDINFO) + /* old disklabel interface */ + part = strlen(file) - 1; + if (part >= 0) { + ch = file[part]; + if (isdigit(ch)) + part = 0; + else if (ch >= 'a' && ch <= 'h') + part = ch - 'a'; + else + part = -1; + } + if (part >= 0 && (ioctl(fd, DIOCGDINFO, (char *)&lab) >= 0)) { + pp = &lab.d_partitions[part]; + if (pp->p_size) { + *retblocks = pp->p_size / (blocksize / 512); + goto out; + } + } +#endif /* defined(DIOCG*) */ + } +#endif /* HAVE_SYS_DISKLABEL_H */ + + { + ext2fs_struct_stat st; + + if (ext2fs_fstat(fd, &st) == 0) + if (S_ISREG(st.st_mode)) { + *retblocks = st.st_size / blocksize; + goto out; + } + } + + /* + * OK, we couldn't figure it out by using a specialized ioctl, + * which is generally the best way. So do binary search to + * find the size of the partition. + */ + low = 0; + for (high = 1024; valid_offset(fd, high); high *= 2) + low = high; + while (low < high - 1) { + const ext2_loff_t mid = (low + high) / 2; + + if (valid_offset (fd, mid)) + low = mid; + else + high = mid; + } + valid_offset(fd, 0); + size64 = low + 1; + *retblocks = size64 / blocksize; +out: + close(fd); + return rc; +} + +#endif /* WIN32 */ + +errcode_t ext2fs_get_device_size(const char *file, int blocksize, + blk_t *retblocks) +{ + errcode_t retval; + blk64_t blocks; + + retval = ext2fs_get_device_size2(file, blocksize, &blocks); + if (retval) + return retval; + if (blocks >= (1ULL << 32)) + return EFBIG; + *retblocks = (blk_t) blocks; + return 0; +} + +#ifdef DEBUG +int main(int argc, char **argv) +{ + blk64_t blocks; + int retval; + + if (argc < 2) { + fprintf(stderr, "Usage: %s device\n", argv[0]); + exit(1); + } + + retval = ext2fs_get_device_size2(argv[1], 1024, &blocks); + if (retval) { + com_err(argv[0], retval, + "while calling ext2fs_get_device_size"); + exit(1); + } + printf("Device %s has %llu 1k blocks.\n", argv[1], + (unsigned long long) locks); + exit(0); +} +#endif diff --git a/lib/ext2fs/hashmap.c b/lib/ext2fs/hashmap.c new file mode 100644 index 0000000..697b2bc --- /dev/null +++ b/lib/ext2fs/hashmap.c @@ -0,0 +1,109 @@ +#include "hashmap.h" +#include <string.h> + +struct ext2fs_hashmap { + uint32_t size; + uint32_t(*hash)(const void *key, size_t len); + void(*free)(void*); + struct ext2fs_hashmap_entry *first; + struct ext2fs_hashmap_entry *last; +#if __GNUC_PREREQ (4, 8) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wpedantic" +#endif + struct ext2fs_hashmap_entry *entries[0]; +#if __GNUC_PREREQ (4, 8) +#pragma GCC diagnostic pop +#endif +}; + +uint32_t ext2fs_djb2_hash(const void *str, size_t size) +{ + int c; + const char *s = str; + uint32_t hash = 5381; + + while (size-- > 0) { + c = *s++; + hash = ((hash << 5) + hash) + c; + } + return hash; +} + +struct ext2fs_hashmap *ext2fs_hashmap_create( + uint32_t(*hash_fct)(const void*, size_t), + void(*free_fct)(void*), size_t size) +{ + struct ext2fs_hashmap *h = calloc(sizeof(struct ext2fs_hashmap) + + sizeof(struct ext2fs_hashmap_entry) * size, 1); + if (!h) + return NULL; + + h->size = size; + h->free = free_fct; + h->hash = hash_fct; + h->first = h->last = NULL; + return h; +} + +int ext2fs_hashmap_add(struct ext2fs_hashmap *h, + void *data, const void *key, size_t key_len) +{ + uint32_t hash = h->hash(key, key_len) % h->size; + struct ext2fs_hashmap_entry *e = malloc(sizeof(*e)); + + if (!e) + return -1; + + e->data = data; + e->key = key; + e->key_len = key_len; + e->next = h->entries[hash]; + h->entries[hash] = e; + + e->list_prev = NULL; + e->list_next = h->first; + if (h->first) + h->first->list_prev = e; + h->first = e; + if (!h->last) + h->last = e; + + return 0; +} + +void *ext2fs_hashmap_lookup(struct ext2fs_hashmap *h, const void *key, + size_t key_len) +{ + struct ext2fs_hashmap_entry *iter; + uint32_t hash = h->hash(key, key_len) % h->size; + + for (iter = h->entries[hash]; iter; iter = iter->next) + if (iter->key_len == key_len && !memcmp(iter->key, key, key_len)) + return iter->data; + return NULL; +} + +void *ext2fs_hashmap_iter_in_order(struct ext2fs_hashmap *h, + struct ext2fs_hashmap_entry **it) +{ + *it = *it ? (*it)->list_next : h->first; + return *it ? (*it)->data : NULL; +} + +void ext2fs_hashmap_free(struct ext2fs_hashmap *h) +{ + size_t i; + + for (i = 0; i < h->size; ++i) { + struct ext2fs_hashmap_entry *it = h->entries[i]; + while (it) { + struct ext2fs_hashmap_entry *tmp = it->next; + if (h->free) + h->free(it->data); + free(it); + it = tmp; + } + } + free(h); +} diff --git a/lib/ext2fs/hashmap.h b/lib/ext2fs/hashmap.h new file mode 100644 index 0000000..0c09d2b --- /dev/null +++ b/lib/ext2fs/hashmap.h @@ -0,0 +1,42 @@ +#ifndef HASHMAP_H +# define HASHMAP_H + +# include <stdlib.h> +# include <stdint.h> + +#ifndef __GNUC_PREREQ +#if defined(__GNUC__) && defined(__GNUC_MINOR__) +#define __GNUC_PREREQ(maj, min) \ + ((__GNUC__ << 16) + __GNUC_MINOR__ >= ((maj) << 16) + (min)) +#else +#define __GNUC_PREREQ(maj, min) 0 +#endif +#endif + +struct ext2fs_hashmap; + +struct ext2fs_hashmap_entry { + void *data; + const void *key; + size_t key_len; + struct ext2fs_hashmap_entry *next; + struct ext2fs_hashmap_entry *list_next; + struct ext2fs_hashmap_entry *list_prev; +}; + +struct ext2fs_hashmap *ext2fs_hashmap_create( + uint32_t(*hash_fct)(const void*, size_t), + void(*free_fct)(void*), size_t size); +int ext2fs_hashmap_add(struct ext2fs_hashmap *h, + void *data, const void *key,size_t key_len); +void *ext2fs_hashmap_lookup(struct ext2fs_hashmap *h, const void *key, + size_t key_len); +void *ext2fs_hashmap_iter_in_order(struct ext2fs_hashmap *h, + struct ext2fs_hashmap_entry **it); +void ext2fs_hashmap_del(struct ext2fs_hashmap *h, + struct ext2fs_hashmap_entry *e); +void ext2fs_hashmap_free(struct ext2fs_hashmap *h); + +uint32_t ext2fs_djb2_hash(const void *str, size_t size); + +#endif /* !HASHMAP_H */ diff --git a/lib/ext2fs/i_block.c b/lib/ext2fs/i_block.c new file mode 100644 index 0000000..2eecf02 --- /dev/null +++ b/lib/ext2fs/i_block.c @@ -0,0 +1,90 @@ +/* + * i_block.c --- Manage the i_block field for i_blocks + * + * Copyright (C) 2008 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <time.h> +#include <string.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#include <errno.h> + +#include "ext2_fs.h" +#include "ext2fs.h" + +errcode_t ext2fs_iblk_add_blocks(ext2_filsys fs, struct ext2_inode *inode, + blk64_t num_blocks) +{ + unsigned long long b = inode->i_blocks; + + if (ext2fs_has_feature_huge_file(fs->super)) + b += ((long long) inode->osd2.linux2.l_i_blocks_hi) << 32; + + if (!ext2fs_has_feature_huge_file(fs->super) || + !(inode->i_flags & EXT4_HUGE_FILE_FL)) + num_blocks *= fs->blocksize / 512; + num_blocks *= EXT2FS_CLUSTER_RATIO(fs); + + b += num_blocks; + + if (ext2fs_has_feature_huge_file(fs->super)) + inode->osd2.linux2.l_i_blocks_hi = b >> 32; + else if (b > 0xFFFFFFFF) + return EOVERFLOW; + inode->i_blocks = b & 0xFFFFFFFF; + return 0; +} + +errcode_t ext2fs_iblk_sub_blocks(ext2_filsys fs, struct ext2_inode *inode, + blk64_t num_blocks) +{ + unsigned long long b = inode->i_blocks; + + if (ext2fs_has_feature_huge_file(fs->super)) + b += ((long long) inode->osd2.linux2.l_i_blocks_hi) << 32; + + if (!ext2fs_has_feature_huge_file(fs->super) || + !(inode->i_flags & EXT4_HUGE_FILE_FL)) + num_blocks *= fs->blocksize / 512; + num_blocks *= EXT2FS_CLUSTER_RATIO(fs); + + if (num_blocks > b) + return EOVERFLOW; + + b -= num_blocks; + + if (ext2fs_has_feature_huge_file(fs->super)) + inode->osd2.linux2.l_i_blocks_hi = b >> 32; + inode->i_blocks = b & 0xFFFFFFFF; + return 0; +} + +errcode_t ext2fs_iblk_set(ext2_filsys fs, struct ext2_inode *inode, blk64_t b) +{ + if (!ext2fs_has_feature_huge_file(fs->super) || + !(inode->i_flags & EXT4_HUGE_FILE_FL)) + b *= fs->blocksize / 512; + b *= EXT2FS_CLUSTER_RATIO(fs); + + inode->i_blocks = b & 0xFFFFFFFF; + if (ext2fs_has_feature_huge_file(fs->super)) + inode->osd2.linux2.l_i_blocks_hi = b >> 32; + else if (b >> 32) + return EOVERFLOW; + return 0; +} diff --git a/lib/ext2fs/icount.c b/lib/ext2fs/icount.c new file mode 100644 index 0000000..888a90b --- /dev/null +++ b/lib/ext2fs/icount.c @@ -0,0 +1,921 @@ +/* + * icount.c --- an efficient inode count abstraction + * + * Copyright (C) 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <string.h> +#include <stdio.h> +#include <sys/stat.h> +#include <fcntl.h> +#include <errno.h> + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "tdb.h" + +/* + * The data storage strategy used by icount relies on the observation + * that most inode counts are either zero (for non-allocated inodes), + * one (for most files), and only a few that are two or more + * (directories and files that are linked to more than one directory). + * + * Also, e2fsck tends to load the icount data sequentially. + * + * So, we use an inode bitmap to indicate which inodes have a count of + * one, and then use a sorted list to store the counts for inodes + * which are greater than one. + * + * We also use an optional bitmap to indicate which inodes are already + * in the sorted list, to speed up the use of this abstraction by + * e2fsck's pass 2. Pass 2 increments inode counts as it finds them, + * so this extra bitmap avoids searching the sorted list to see if a + * particular inode is on the sorted list already. + */ + +struct ext2_icount_el { + ext2_ino_t ino; + __u32 count; +}; + +struct ext2_icount { + errcode_t magic; + ext2fs_inode_bitmap single; + ext2fs_inode_bitmap multiple; + ext2_ino_t count; + ext2_ino_t size; + ext2_ino_t num_inodes; + ext2_ino_t cursor; + struct ext2_icount_el *list; + struct ext2_icount_el *last_lookup; +#ifdef CONFIG_TDB + char *tdb_fn; + TDB_CONTEXT *tdb; +#endif + __u16 *fullmap; +}; + +/* + * We now use a 32-bit counter field because it doesn't cost us + * anything extra for the in-memory data structure, due to alignment + * padding. But there's no point changing the interface if most of + * the time we only care if the number is bigger than 65,000 or not. + * So use the following translation function to return a 16-bit count. + */ +#define icount_16_xlate(x) (((x) > 65500) ? 65500 : (x)) + +void ext2fs_free_icount(ext2_icount_t icount) +{ + if (!icount) + return; + + icount->magic = 0; + if (icount->list) + ext2fs_free_mem(&icount->list); + if (icount->single) + ext2fs_free_inode_bitmap(icount->single); + if (icount->multiple) + ext2fs_free_inode_bitmap(icount->multiple); +#ifdef CONFIG_TDB + if (icount->tdb) + tdb_close(icount->tdb); + if (icount->tdb_fn) { + (void) unlink(icount->tdb_fn); + free(icount->tdb_fn); + } +#endif + + if (icount->fullmap) + ext2fs_free_mem(&icount->fullmap); + + ext2fs_free_mem(&icount); +} + +static errcode_t alloc_icount(ext2_filsys fs, int flags, ext2_icount_t *ret) +{ + ext2_icount_t icount; + errcode_t retval; + + *ret = 0; + + retval = ext2fs_get_mem(sizeof(struct ext2_icount), &icount); + if (retval) + return retval; + memset(icount, 0, sizeof(struct ext2_icount)); + icount->magic = EXT2_ET_MAGIC_ICOUNT; + icount->num_inodes = fs->super->s_inodes_count; + + if ((flags & EXT2_ICOUNT_OPT_FULLMAP) && + (flags & EXT2_ICOUNT_OPT_INCREMENT)) { + unsigned sz = sizeof(*icount->fullmap) * icount->num_inodes; + + retval = ext2fs_get_mem(sz, &icount->fullmap); + /* If we can't allocate, fall back */ + if (!retval) { + memset(icount->fullmap, 0, sz); + *ret = icount; + return 0; + } + } + + retval = ext2fs_allocate_inode_bitmap(fs, "icount", &icount->single); + if (retval) + goto errout; + + if (flags & EXT2_ICOUNT_OPT_INCREMENT) { + retval = ext2fs_allocate_inode_bitmap(fs, "icount_inc", + &icount->multiple); + if (retval) + goto errout; + } else + icount->multiple = 0; + + *ret = icount; + return 0; + +errout: + ext2fs_free_icount(icount); + return(retval); +} + +#ifdef CONFIG_TDB +struct uuid { + __u32 time_low; + __u16 time_mid; + __u16 time_hi_and_version; + __u16 clock_seq; + __u8 node[6]; +}; + +static void unpack_uuid(void *in, struct uuid *uu) +{ + __u8 *ptr = in; + __u32 tmp; + + tmp = *ptr++; + tmp = (tmp << 8) | *ptr++; + tmp = (tmp << 8) | *ptr++; + tmp = (tmp << 8) | *ptr++; + uu->time_low = tmp; + + tmp = *ptr++; + tmp = (tmp << 8) | *ptr++; + uu->time_mid = tmp; + + tmp = *ptr++; + tmp = (tmp << 8) | *ptr++; + uu->time_hi_and_version = tmp; + + tmp = *ptr++; + tmp = (tmp << 8) | *ptr++; + uu->clock_seq = tmp; + + memcpy(uu->node, ptr, 6); +} + +static void uuid_unparse(void *uu, char *out) +{ + struct uuid uuid; + + unpack_uuid(uu, &uuid); + sprintf(out, + "%08x-%04x-%04x-%02x%02x-%02x%02x%02x%02x%02x%02x", + uuid.time_low, uuid.time_mid, uuid.time_hi_and_version, + uuid.clock_seq >> 8, uuid.clock_seq & 0xFF, + uuid.node[0], uuid.node[1], uuid.node[2], + uuid.node[3], uuid.node[4], uuid.node[5]); +} +#endif + +errcode_t ext2fs_create_icount_tdb(ext2_filsys fs EXT2FS_NO_TDB_UNUSED, + char *tdb_dir EXT2FS_NO_TDB_UNUSED, + int flags EXT2FS_NO_TDB_UNUSED, + ext2_icount_t *ret EXT2FS_NO_TDB_UNUSED) +{ +#ifdef CONFIG_TDB + ext2_icount_t icount; + errcode_t retval; + char *fn, uuid[40]; + ext2_ino_t num_inodes; + mode_t save_umask; + int fd; + + retval = alloc_icount(fs, flags, &icount); + if (retval) + return retval; + + retval = ext2fs_get_mem(strlen(tdb_dir) + 64, &fn); + if (retval) + goto errout; + uuid_unparse(fs->super->s_uuid, uuid); + sprintf(fn, "%s/%s-icount-XXXXXX", tdb_dir, uuid); + save_umask = umask(077); + fd = mkstemp(fn); + if (fd < 0) { + retval = errno; + ext2fs_free_mem(&fn); + goto errout; + } + icount->tdb_fn = fn; + umask(save_umask); + /* + * This is an overestimate of the size that we will need; the + * ideal value is the number of used inodes with a count + * greater than 1. OTOH the times when we really need this is + * with the backup programs that use lots of hard links, in + * which case the number of inodes in use approaches the ideal + * value. + */ + num_inodes = fs->super->s_inodes_count - fs->super->s_free_inodes_count; + + icount->tdb = tdb_open(fn, num_inodes, TDB_NOLOCK | TDB_NOSYNC, + O_RDWR | O_CREAT | O_TRUNC, 0600); + close(fd); + if (icount->tdb == NULL) { + retval = errno; + goto errout; + } + *ret = icount; + return 0; +errout: + ext2fs_free_icount(icount); + return(retval); +#else + return EXT2_ET_UNIMPLEMENTED; +#endif +} + +errcode_t ext2fs_create_icount2(ext2_filsys fs, int flags, unsigned int size, + ext2_icount_t hint, ext2_icount_t *ret) +{ + ext2_icount_t icount; + errcode_t retval; + size_t bytes; + ext2_ino_t i; + + if (hint) { + EXT2_CHECK_MAGIC(hint, EXT2_ET_MAGIC_ICOUNT); + if (hint->size > size) + size = (size_t) hint->size; + } + + retval = alloc_icount(fs, flags, &icount); + if (retval) + return retval; + + if (icount->fullmap) + goto successout; + + if (size) { + icount->size = size; + } else { + /* + * Figure out how many special case inode counts we will + * have. We know we will need one for each directory; + * we also need to reserve some extra room for file links + */ + retval = ext2fs_get_num_dirs(fs, &icount->size); + if (retval) + goto errout; + icount->size += fs->super->s_inodes_count / 50; + } + + bytes = (size_t) (icount->size * sizeof(struct ext2_icount_el)); +#if 0 + printf("Icount allocated %u entries, %d bytes.\n", + icount->size, bytes); +#endif + retval = ext2fs_get_array(icount->size, sizeof(struct ext2_icount_el), + &icount->list); + if (retval) + goto errout; + memset(icount->list, 0, bytes); + + icount->count = 0; + icount->cursor = 0; + + /* + * Populate the sorted list with those entries which were + * found in the hint icount (since those are ones which will + * likely need to be in the sorted list this time around). + */ + if (hint) { + for (i=0; i < hint->count; i++) + icount->list[i].ino = hint->list[i].ino; + icount->count = hint->count; + } + +successout: + *ret = icount; + return 0; + +errout: + ext2fs_free_icount(icount); + return(retval); +} + +errcode_t ext2fs_create_icount(ext2_filsys fs, int flags, + unsigned int size, + ext2_icount_t *ret) +{ + return ext2fs_create_icount2(fs, flags, size, 0, ret); +} + +/* + * insert_icount_el() --- Insert a new entry into the sorted list at a + * specified position. + */ +static struct ext2_icount_el *insert_icount_el(ext2_icount_t icount, + ext2_ino_t ino, int pos) +{ + struct ext2_icount_el *el; + errcode_t retval; + ext2_ino_t new_size = 0; + int num; + + if (icount->last_lookup && icount->last_lookup->ino == ino) + return icount->last_lookup; + + if (icount->count >= icount->size) { + if (icount->count) { + new_size = icount->list[(unsigned)icount->count-1].ino; + new_size = (ext2_ino_t) (icount->count * + ((float) icount->num_inodes / new_size)); + } + if (new_size < (icount->size + 100)) + new_size = icount->size + 100; +#if 0 + printf("Reallocating icount %u entries...\n", new_size); +#endif + retval = ext2fs_resize_mem((size_t) icount->size * + sizeof(struct ext2_icount_el), + (size_t) new_size * + sizeof(struct ext2_icount_el), + &icount->list); + if (retval) + return 0; + icount->size = new_size; + } + num = (int) icount->count - pos; + if (num < 0) + return 0; /* should never happen */ + if (num) { + memmove(&icount->list[pos+1], &icount->list[pos], + sizeof(struct ext2_icount_el) * num); + } + icount->count++; + el = &icount->list[pos]; + el->count = 0; + el->ino = ino; + icount->last_lookup = el; + return el; +} + +/* + * get_icount_el() --- given an inode number, try to find icount + * information in the sorted list. If the create flag is set, + * and we can't find an entry, create one in the sorted list. + */ +static struct ext2_icount_el *get_icount_el(ext2_icount_t icount, + ext2_ino_t ino, int create) +{ + int low, high, mid; + + if (!icount || !icount->list) + return 0; + + if (create && ((icount->count == 0) || + (ino > icount->list[(unsigned)icount->count-1].ino))) { + return insert_icount_el(icount, ino, (unsigned) icount->count); + } + if (icount->count == 0) + return 0; + + if (icount->cursor >= icount->count) + icount->cursor = 0; + if (ino == icount->list[icount->cursor].ino) + return &icount->list[icount->cursor++]; +#if 0 + printf("Non-cursor get_icount_el: %u\n", ino); +#endif + low = 0; + high = (int) icount->count-1; + while (low <= high) { + mid = ((unsigned)low + (unsigned)high) >> 1; + if (ino == icount->list[mid].ino) { + icount->cursor = mid+1; + return &icount->list[mid]; + } + if (ino < icount->list[mid].ino) + high = mid-1; + else + low = mid+1; + } + /* + * If we need to create a new entry, it should be right at + * low (where high will be left at low-1). + */ + if (create) + return insert_icount_el(icount, ino, low); + return 0; +} + +static errcode_t set_inode_count(ext2_icount_t icount, ext2_ino_t ino, + __u32 count) +{ + struct ext2_icount_el *el; +#ifdef CONFIG_TDB + TDB_DATA key, data; + + if (icount->tdb) { + key.dptr = (unsigned char *) &ino; + key.dsize = sizeof(ext2_ino_t); + data.dptr = (unsigned char *) &count; + data.dsize = sizeof(__u32); + if (count) { + if (tdb_store(icount->tdb, key, data, TDB_REPLACE)) + return tdb_error(icount->tdb) + + EXT2_ET_TDB_SUCCESS; + } else { + if (tdb_delete(icount->tdb, key)) + return tdb_error(icount->tdb) + + EXT2_ET_TDB_SUCCESS; + } + return 0; + } +#endif + if (icount->fullmap) { + icount->fullmap[ino] = icount_16_xlate(count); + return 0; + } + + el = get_icount_el(icount, ino, 1); + if (!el) + return EXT2_ET_NO_MEMORY; + + el->count = count; + return 0; +} + +static errcode_t get_inode_count(ext2_icount_t icount, ext2_ino_t ino, + __u32 *count) +{ + struct ext2_icount_el *el; +#ifdef CONFIG_TDB + TDB_DATA key, data; + + if (icount->tdb) { + key.dptr = (unsigned char *) &ino; + key.dsize = sizeof(ext2_ino_t); + + data = tdb_fetch(icount->tdb, key); + if (data.dptr == NULL) { + *count = 0; + return tdb_error(icount->tdb) + EXT2_ET_TDB_SUCCESS; + } + + *count = *((__u32 *) data.dptr); + free(data.dptr); + return 0; + } +#endif + if (icount->fullmap) { + *count = icount->fullmap[ino]; + return 0; + } + + el = get_icount_el(icount, ino, 0); + if (!el) { + *count = 0; + return ENOENT; + } + + *count = el->count; + return 0; +} + +errcode_t ext2fs_icount_validate(ext2_icount_t icount, FILE *out) +{ + errcode_t ret = 0; + unsigned int i; + const char *bad = "bad icount"; + + EXT2_CHECK_MAGIC(icount, EXT2_ET_MAGIC_ICOUNT); + + if (icount->count > icount->size) { + fprintf(out, "%s: count > size\n", bad); + return EXT2_ET_INVALID_ARGUMENT; + } + for (i=1; i < icount->count; i++) { + if (icount->list[i-1].ino >= icount->list[i].ino) { + fprintf(out, "%s: list[%d].ino=%u, list[%d].ino=%u\n", + bad, i-1, icount->list[i-1].ino, + i, icount->list[i].ino); + ret = EXT2_ET_INVALID_ARGUMENT; + } + } + return ret; +} + +errcode_t ext2fs_icount_fetch(ext2_icount_t icount, ext2_ino_t ino, __u16 *ret) +{ + __u32 val; + EXT2_CHECK_MAGIC(icount, EXT2_ET_MAGIC_ICOUNT); + + if (!ino || (ino > icount->num_inodes)) + return EXT2_ET_INVALID_ARGUMENT; + + if (!icount->fullmap) { + if (ext2fs_test_inode_bitmap2(icount->single, ino)) { + *ret = 1; + return 0; + } + if (icount->multiple && + !ext2fs_test_inode_bitmap2(icount->multiple, ino)) { + *ret = 0; + return 0; + } + } + get_inode_count(icount, ino, &val); + *ret = icount_16_xlate(val); + return 0; +} + +errcode_t ext2fs_icount_increment(ext2_icount_t icount, ext2_ino_t ino, + __u16 *ret) +{ + __u32 curr_value; + + EXT2_CHECK_MAGIC(icount, EXT2_ET_MAGIC_ICOUNT); + + if (!ino || (ino > icount->num_inodes)) + return EXT2_ET_INVALID_ARGUMENT; + + if (icount->fullmap) { + curr_value = icount_16_xlate(icount->fullmap[ino] + 1); + icount->fullmap[ino] = curr_value; + } else if (ext2fs_test_inode_bitmap2(icount->single, ino)) { + /* + * If the existing count is 1, then we know there is + * no entry in the list. + */ + if (set_inode_count(icount, ino, 2)) + return EXT2_ET_NO_MEMORY; + curr_value = 2; + ext2fs_unmark_inode_bitmap2(icount->single, ino); + } else if (icount->multiple) { + /* + * The count is either zero or greater than 1; if the + * inode is set in icount->multiple, then there should + * be an entry in the list, so we need to fix it. + */ + if (ext2fs_test_inode_bitmap2(icount->multiple, ino)) { + get_inode_count(icount, ino, &curr_value); + curr_value++; + if (set_inode_count(icount, ino, curr_value)) + return EXT2_ET_NO_MEMORY; + } else { + /* + * The count was zero; mark the single bitmap + * and return. + */ + ext2fs_mark_inode_bitmap2(icount->single, ino); + if (ret) + *ret = 1; + return 0; + } + } else { + /* + * The count is either zero or greater than 1; try to + * find an entry in the list to determine which. + */ + get_inode_count(icount, ino, &curr_value); + curr_value++; + if (set_inode_count(icount, ino, curr_value)) + return EXT2_ET_NO_MEMORY; + } + if (icount->multiple) + ext2fs_mark_inode_bitmap2(icount->multiple, ino); + if (ret) + *ret = icount_16_xlate(curr_value); + return 0; +} + +errcode_t ext2fs_icount_decrement(ext2_icount_t icount, ext2_ino_t ino, + __u16 *ret) +{ + __u32 curr_value; + + if (!ino || (ino > icount->num_inodes)) + return EXT2_ET_INVALID_ARGUMENT; + + EXT2_CHECK_MAGIC(icount, EXT2_ET_MAGIC_ICOUNT); + + if (icount->fullmap) { + if (!icount->fullmap[ino]) + return EXT2_ET_INVALID_ARGUMENT; + + curr_value = --icount->fullmap[ino]; + if (ret) + *ret = icount_16_xlate(curr_value); + return 0; + } + + if (ext2fs_test_inode_bitmap2(icount->single, ino)) { + ext2fs_unmark_inode_bitmap2(icount->single, ino); + if (icount->multiple) + ext2fs_unmark_inode_bitmap2(icount->multiple, ino); + else { + set_inode_count(icount, ino, 0); + } + if (ret) + *ret = 0; + return 0; + } + + if (icount->multiple && + !ext2fs_test_inode_bitmap2(icount->multiple, ino)) + return EXT2_ET_INVALID_ARGUMENT; + + get_inode_count(icount, ino, &curr_value); + if (!curr_value) + return EXT2_ET_INVALID_ARGUMENT; + curr_value--; + if (set_inode_count(icount, ino, curr_value)) + return EXT2_ET_NO_MEMORY; + + if (curr_value == 1) + ext2fs_mark_inode_bitmap2(icount->single, ino); + if ((curr_value == 0) && icount->multiple) + ext2fs_unmark_inode_bitmap2(icount->multiple, ino); + + if (ret) + *ret = icount_16_xlate(curr_value); + return 0; +} + +errcode_t ext2fs_icount_store(ext2_icount_t icount, ext2_ino_t ino, + __u16 count) +{ + if (!ino || (ino > icount->num_inodes)) + return EXT2_ET_INVALID_ARGUMENT; + + EXT2_CHECK_MAGIC(icount, EXT2_ET_MAGIC_ICOUNT); + + if (icount->fullmap) + return set_inode_count(icount, ino, count); + + if (count == 1) { + ext2fs_mark_inode_bitmap2(icount->single, ino); + if (icount->multiple) + ext2fs_unmark_inode_bitmap2(icount->multiple, ino); + return 0; + } + if (count == 0) { + ext2fs_unmark_inode_bitmap2(icount->single, ino); + if (icount->multiple) { + /* + * If the icount->multiple bitmap is enabled, + * we can just clear both bitmaps and we're done + */ + ext2fs_unmark_inode_bitmap2(icount->multiple, ino); + } else + set_inode_count(icount, ino, 0); + return 0; + } + + if (set_inode_count(icount, ino, count)) + return EXT2_ET_NO_MEMORY; + ext2fs_unmark_inode_bitmap2(icount->single, ino); + if (icount->multiple) + ext2fs_mark_inode_bitmap2(icount->multiple, ino); + return 0; +} + +ext2_ino_t ext2fs_get_icount_size(ext2_icount_t icount) +{ + if (!icount || icount->magic != EXT2_ET_MAGIC_ICOUNT) + return 0; + + return icount->size; +} + +#ifdef DEBUG + +ext2_filsys test_fs; +ext2_icount_t icount; + +#define EXIT 0x00 +#define FETCH 0x01 +#define STORE 0x02 +#define INCREMENT 0x03 +#define DECREMENT 0x04 + +struct test_program { + int cmd; + ext2_ino_t ino; + __u16 arg; + __u16 expected; +}; + +struct test_program prog[] = { + { STORE, 42, 42, 42 }, + { STORE, 1, 1, 1 }, + { STORE, 2, 2, 2 }, + { STORE, 3, 3, 3 }, + { STORE, 10, 1, 1 }, + { STORE, 42, 0, 0 }, + { INCREMENT, 5, 0, 1 }, + { INCREMENT, 5, 0, 2 }, + { INCREMENT, 5, 0, 3 }, + { INCREMENT, 5, 0, 4 }, + { DECREMENT, 5, 0, 3 }, + { DECREMENT, 5, 0, 2 }, + { DECREMENT, 5, 0, 1 }, + { DECREMENT, 5, 0, 0 }, + { FETCH, 10, 0, 1 }, + { FETCH, 1, 0, 1 }, + { FETCH, 2, 0, 2 }, + { FETCH, 3, 0, 3 }, + { INCREMENT, 1, 0, 2 }, + { DECREMENT, 2, 0, 1 }, + { DECREMENT, 2, 0, 0 }, + { FETCH, 12, 0, 0 }, + { EXIT, 0, 0, 0 } +}; + +struct test_program extended[] = { + { STORE, 1, 1, 1 }, + { STORE, 2, 2, 2 }, + { STORE, 3, 3, 3 }, + { STORE, 4, 4, 4 }, + { STORE, 5, 5, 5 }, + { STORE, 6, 1, 1 }, + { STORE, 7, 2, 2 }, + { STORE, 8, 3, 3 }, + { STORE, 9, 4, 4 }, + { STORE, 10, 5, 5 }, + { STORE, 11, 1, 1 }, + { STORE, 12, 2, 2 }, + { STORE, 13, 3, 3 }, + { STORE, 14, 4, 4 }, + { STORE, 15, 5, 5 }, + { STORE, 16, 1, 1 }, + { STORE, 17, 2, 2 }, + { STORE, 18, 3, 3 }, + { STORE, 19, 4, 4 }, + { STORE, 20, 5, 5 }, + { STORE, 21, 1, 1 }, + { STORE, 22, 2, 2 }, + { STORE, 23, 3, 3 }, + { STORE, 24, 4, 4 }, + { STORE, 25, 5, 5 }, + { STORE, 26, 1, 1 }, + { STORE, 27, 2, 2 }, + { STORE, 28, 3, 3 }, + { STORE, 29, 4, 4 }, + { STORE, 30, 5, 5 }, + { EXIT, 0, 0, 0 } +}; + +/* + * Setup the variables for doing the inode scan test. + */ +static void setup(void) +{ + errcode_t retval; + struct ext2_super_block param; + + initialize_ext2_error_table(); + + memset(¶m, 0, sizeof(param)); + ext2fs_blocks_count_set(¶m, 12000); + + retval = ext2fs_initialize("test fs", EXT2_FLAG_64BITS, ¶m, + test_io_manager, &test_fs); + if (retval) { + com_err("setup", retval, + "while initializing filesystem"); + exit(1); + } + retval = ext2fs_allocate_tables(test_fs); + if (retval) { + com_err("setup", retval, + "while allocating tables for test filesystem"); + exit(1); + } +} + +int run_test(int flags, int size, char *dir, struct test_program *prog) +{ + errcode_t retval; + ext2_icount_t icount; + struct test_program *pc; + __u16 result; + int problem = 0; + + if (dir) { +#ifdef CONFIG_TDB + retval = ext2fs_create_icount_tdb(test_fs, dir, + flags, &icount); + if (retval) { + com_err("run_test", retval, + "while creating icount using tdb"); + exit(1); + } +#else + printf("Skipped\n"); + return 0; +#endif + } else { + retval = ext2fs_create_icount2(test_fs, flags, size, 0, + &icount); + if (retval) { + com_err("run_test", retval, "while creating icount"); + exit(1); + } + } + for (pc = prog; pc->cmd != EXIT; pc++) { + switch (pc->cmd) { + case FETCH: + printf("icount_fetch(%u) = ", pc->ino); + break; + case STORE: + retval = ext2fs_icount_store(icount, pc->ino, pc->arg); + if (retval) { + com_err("run_test", retval, + "while calling icount_store"); + exit(1); + } + printf("icount_store(%u, %u) = ", pc->ino, pc->arg); + break; + case INCREMENT: + retval = ext2fs_icount_increment(icount, pc->ino, 0); + if (retval) { + com_err("run_test", retval, + "while calling icount_increment"); + exit(1); + } + printf("icount_increment(%u) = ", pc->ino); + break; + case DECREMENT: + retval = ext2fs_icount_decrement(icount, pc->ino, 0); + if (retval) { + com_err("run_test", retval, + "while calling icount_decrement"); + exit(1); + } + printf("icount_decrement(%u) = ", pc->ino); + break; + } + retval = ext2fs_icount_fetch(icount, pc->ino, &result); + if (retval) { + com_err("run_test", retval, + "while calling icount_fetch"); + exit(1); + } + printf("%u (%s)\n", result, (result == pc->expected) ? + "OK" : "NOT OK"); + if (result != pc->expected) + problem++; + } + printf("icount size is %u\n", ext2fs_get_icount_size(icount)); + retval = ext2fs_icount_validate(icount, stdout); + if (retval) { + com_err("run_test", retval, "while calling icount_validate"); + exit(1); + } + ext2fs_free_icount(icount); + return problem; +} + + +int main(int argc, char **argv) +{ + int failed = 0; + + setup(); + printf("Standard icount run:\n"); + failed += run_test(0, 0, 0, prog); + printf("\nMultiple bitmap test:\n"); + failed += run_test(EXT2_ICOUNT_OPT_INCREMENT, 0, 0, prog); + printf("\nResizing icount:\n"); + failed += run_test(0, 3, 0, extended); + printf("\nStandard icount run with tdb:\n"); + failed += run_test(0, 0, ".", prog); + printf("\nMultiple bitmap test with tdb:\n"); + failed += run_test(EXT2_ICOUNT_OPT_INCREMENT, 0, ".", prog); + if (failed) + printf("FAILED!\n"); + return failed; +} +#endif diff --git a/lib/ext2fs/imager.c b/lib/ext2fs/imager.c new file mode 100644 index 0000000..23290a6 --- /dev/null +++ b/lib/ext2fs/imager.c @@ -0,0 +1,470 @@ +/* + * image.c --- writes out the critical parts of the filesystem as a + * flat file. + * + * Copyright (C) 2000 Theodore Ts'o. + * + * Note: this uses the POSIX IO interfaces, unlike most of the other + * functions in this library. So sue me. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +#ifndef HAVE_TYPE_SSIZE_T +typedef int ssize_t; +#endif + +/* + * This function returns 1 if the specified block is all zeros + */ +static int check_zero_block(char *buf, int blocksize) +{ + char *cp = buf; + int left = blocksize; + + while (left > 0) { + if (*cp++) + return 0; + left--; + } + return 1; +} + +/* + * Write the inode table out as a single block. + */ +#define BUF_BLOCKS 32 + +errcode_t ext2fs_image_inode_write(ext2_filsys fs, int fd, int flags) +{ + dgrp_t group; + ssize_t left, c, d; + char *buf, *cp; + blk64_t blk; + ssize_t actual; + errcode_t retval; + ext2_loff_t r; + + buf = malloc(fs->blocksize * BUF_BLOCKS); + if (!buf) + return ENOMEM; + + for (group = 0; group < fs->group_desc_count; group++) { + blk = ext2fs_inode_table_loc(fs, group); + if (!blk) { + retval = EXT2_ET_MISSING_INODE_TABLE; + goto errout; + } + left = fs->inode_blocks_per_group; + if ((blk < fs->super->s_first_data_block) || + (blk + left - 1 >= ext2fs_blocks_count(fs->super))) { + retval = EXT2_ET_GDESC_BAD_INODE_TABLE; + goto errout; + } + while (left) { + c = BUF_BLOCKS; + if (c > left) + c = left; + retval = io_channel_read_blk64(fs->io, blk, c, buf); + if (retval) + goto errout; + cp = buf; + while (c) { + if (!(flags & IMAGER_FLAG_SPARSEWRITE)) { + d = c; + goto skip_sparse; + } + /* Skip zero blocks */ + if (check_zero_block(cp, fs->blocksize)) { + c--; + blk++; + left--; + cp += fs->blocksize; + r = ext2fs_llseek(fd, fs->blocksize, + SEEK_CUR); + if (r < 0) { + retval = errno; + goto errout; + } + continue; + } + /* Find non-zero blocks */ + for (d = 1; d < c; d++) { + if (check_zero_block(cp + + d * fs->blocksize, + fs->blocksize)) + break; + } + skip_sparse: + actual = write(fd, cp, d * fs->blocksize); + if (actual == -1) { + retval = errno; + goto errout; + } + if (actual != d * fs->blocksize) { + retval = EXT2_ET_SHORT_WRITE; + goto errout; + } + blk += d; + left -= d; + cp += d * fs->blocksize; + c -= d; + } + } + } + retval = 0; + +errout: + free(buf); + return retval; +} + +/* + * Read in the inode table and stuff it into place + */ +errcode_t ext2fs_image_inode_read(ext2_filsys fs, int fd, + int flags EXT2FS_ATTR((unused))) +{ + dgrp_t group; + ssize_t c, left; + char *buf; + blk64_t blk; + ssize_t actual; + errcode_t retval; + + buf = malloc(fs->blocksize * BUF_BLOCKS); + if (!buf) + return ENOMEM; + + for (group = 0; group < fs->group_desc_count; group++) { + blk = ext2fs_inode_table_loc(fs, group); + if (!blk) { + retval = EXT2_ET_MISSING_INODE_TABLE; + goto errout; + } + left = fs->inode_blocks_per_group; + while (left) { + c = BUF_BLOCKS; + if (c > left) + c = left; + actual = read(fd, buf, fs->blocksize * c); + if (actual == -1) { + retval = errno; + goto errout; + } + if (actual != fs->blocksize * c) { + retval = EXT2_ET_SHORT_READ; + goto errout; + } + retval = io_channel_write_blk64(fs->io, blk, c, buf); + if (retval) + goto errout; + + blk += c; + left -= c; + } + } + retval = ext2fs_flush_icache(fs); + +errout: + free(buf); + return retval; +} + +/* + * Write out superblock and group descriptors + */ +errcode_t ext2fs_image_super_write(ext2_filsys fs, int fd, + int flags EXT2FS_ATTR((unused))) +{ + char *buf, *cp; + ssize_t actual; + errcode_t retval; +#ifdef WORDS_BIGENDIAN + unsigned int groups_per_block; + struct ext2_group_desc *gdp; + int j; +#endif + + if (fs->group_desc == NULL) + return EXT2_ET_NO_GDESC; + + buf = malloc(fs->blocksize); + if (!buf) + return ENOMEM; + + /* + * Write out the superblock + */ + memset(buf, 0, fs->blocksize); +#ifdef WORDS_BIGENDIAN + /* + * We're writing out superblock so let's convert + * it to little endian and then back if needed + */ + ext2fs_swap_super(fs->super); + memcpy(buf, fs->super, SUPERBLOCK_SIZE); + ext2fs_swap_super(fs->super); +#else + memcpy(buf, fs->super, SUPERBLOCK_SIZE); +#endif + actual = write(fd, buf, fs->blocksize); + if (actual == -1) { + retval = errno; + goto errout; + } + if (actual != (ssize_t) fs->blocksize) { + retval = EXT2_ET_SHORT_WRITE; + goto errout; + } + + /* + * Now write out the block group descriptors + */ + + cp = (char *) fs->group_desc; + +#ifdef WORDS_BIGENDIAN + /* + * Convert group descriptors to little endian and back + * if needed + */ + groups_per_block = EXT2_DESC_PER_BLOCK(fs->super); + for (j=0; j < groups_per_block*fs->desc_blocks; j++) { + gdp = ext2fs_group_desc(fs, fs->group_desc, j); + if (gdp) + ext2fs_swap_group_desc2(fs, gdp); + } +#endif + + actual = write(fd, cp, (ssize_t)fs->blocksize * fs->desc_blocks); + + +#ifdef WORDS_BIGENDIAN + groups_per_block = EXT2_DESC_PER_BLOCK(fs->super); + for (j=0; j < groups_per_block*fs->desc_blocks; j++) { + gdp = ext2fs_group_desc(fs, fs->group_desc, j); + if (gdp) + ext2fs_swap_group_desc2(fs, gdp); + } +#endif + + if (actual == -1) { + retval = errno; + goto errout; + } + if (actual != (ssize_t)(fs->blocksize * fs->desc_blocks)) { + retval = EXT2_ET_SHORT_WRITE; + goto errout; + } + + retval = 0; + +errout: + free(buf); + return retval; +} + +/* + * Read the superblock and group descriptors and overwrite them. + */ +errcode_t ext2fs_image_super_read(ext2_filsys fs, int fd, + int flags EXT2FS_ATTR((unused))) +{ + char *buf; + ssize_t actual, size; + errcode_t retval; + + size = (ssize_t)fs->blocksize * (fs->group_desc_count + 1); + buf = malloc(size); + if (!buf) + return ENOMEM; + + /* + * Read it all in. + */ + actual = read(fd, buf, size); + if (actual == -1) { + retval = errno; + goto errout; + } + if (actual != size) { + retval = EXT2_ET_SHORT_READ; + goto errout; + } + + /* + * Now copy in the superblock and group descriptors + */ + memcpy(fs->super, buf, SUPERBLOCK_SIZE); + + memcpy(fs->group_desc, buf + fs->blocksize, + (ssize_t)fs->blocksize * fs->group_desc_count); + + retval = 0; + +errout: + free(buf); + return retval; +} + +/* + * Write the block/inode bitmaps. + */ +errcode_t ext2fs_image_bitmap_write(ext2_filsys fs, int fd, int flags) +{ + ext2fs_generic_bitmap bmap; + errcode_t retval; + ssize_t actual; + size_t c; + __u64 itr, cnt, size, total_size; + char buf[1024]; + + if (flags & IMAGER_FLAG_INODEMAP) { + if (!fs->inode_map) { + retval = ext2fs_read_inode_bitmap(fs); + if (retval) + return retval; + } + bmap = fs->inode_map; + itr = 1; + cnt = (__u64)EXT2_INODES_PER_GROUP(fs->super) * + fs->group_desc_count; + size = (EXT2_INODES_PER_GROUP(fs->super) / 8); + } else { + if (!fs->block_map) { + retval = ext2fs_read_block_bitmap(fs); + if (retval) + return retval; + } + bmap = fs->block_map; + itr = fs->super->s_first_data_block; + cnt = EXT2_GROUPS_TO_CLUSTERS(fs->super, fs->group_desc_count); + size = EXT2_CLUSTERS_PER_GROUP(fs->super) / 8; + } + total_size = size * fs->group_desc_count; + + while (cnt > 0) { + size = sizeof(buf); + if (size > (cnt >> 3)) + size = (cnt >> 3); + if (size == 0) + break; + + retval = ext2fs_get_generic_bmap_range(bmap, itr, + size << 3, buf); + if (retval) + return retval; + + actual = write(fd, buf, size); + if (actual == -1) + return errno; + if (actual != (int) size) + return EXT2_ET_SHORT_READ; + + itr += size << 3; + cnt -= size << 3; + } + + size = total_size % fs->blocksize; + memset(buf, 0, sizeof(buf)); + if (size) { + size = fs->blocksize - size; + while (size) { + c = size; + if (c > (int) sizeof(buf)) + c = sizeof(buf); + actual = write(fd, buf, c); + if (actual < 0) + return errno; + if ((size_t) actual != c) + return EXT2_ET_SHORT_WRITE; + size -= c; + } + } + return 0; +} + + +/* + * Read the block/inode bitmaps. + */ +errcode_t ext2fs_image_bitmap_read(ext2_filsys fs, int fd, int flags) +{ + ext2fs_generic_bitmap bmap; + errcode_t retval; + __u64 itr, cnt; + char buf[1024]; + unsigned int size; + ssize_t actual; + + if (flags & IMAGER_FLAG_INODEMAP) { + if (!fs->inode_map) { + retval = ext2fs_read_inode_bitmap(fs); + if (retval) + return retval; + } + bmap = fs->inode_map; + itr = 1; + cnt = (__u64)EXT2_INODES_PER_GROUP(fs->super) * + fs->group_desc_count; + size = (EXT2_INODES_PER_GROUP(fs->super) / 8); + } else { + if (!fs->block_map) { + retval = ext2fs_read_block_bitmap(fs); + if (retval) + return retval; + } + bmap = fs->block_map; + itr = fs->super->s_first_data_block; + cnt = EXT2_GROUPS_TO_BLOCKS(fs->super, fs->group_desc_count); + size = EXT2_BLOCKS_PER_GROUP(fs->super) / 8; + } + + while (cnt > 0) { + size = sizeof(buf); + if (size > (cnt >> 3)) + size = (cnt >> 3); + if (size == 0) + break; + + actual = read(fd, buf, size); + if (actual == -1) + return errno; + if (actual != (int) size) + return EXT2_ET_SHORT_READ; + + retval = ext2fs_set_generic_bmap_range(bmap, itr, + size << 3, buf); + if (retval) + return retval; + + itr += size << 3; + cnt -= size << 3; + } + return 0; +} diff --git a/lib/ext2fs/ind_block.c b/lib/ext2fs/ind_block.c new file mode 100644 index 0000000..aa82ae6 --- /dev/null +++ b/lib/ext2fs/ind_block.c @@ -0,0 +1,67 @@ +/* + * ind_block.c --- indirect block I/O routines + * + * Copyright (C) 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, + * 2001, 2002, 2003, 2004, 2005 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +errcode_t ext2fs_read_ind_block(ext2_filsys fs, blk_t blk, void *buf) +{ + errcode_t retval; +#ifdef WORDS_BIGENDIAN + blk_t *block_nr; + int i; + int limit = fs->blocksize >> 2; +#endif + + if ((fs->flags & EXT2_FLAG_IMAGE_FILE) && + (fs->io != fs->image_io)) + memset(buf, 0, fs->blocksize); + else { + retval = io_channel_read_blk(fs->io, blk, 1, buf); + if (retval) + return retval; + } +#ifdef WORDS_BIGENDIAN + block_nr = (blk_t *) buf; + for (i = 0; i < limit; i++, block_nr++) + *block_nr = ext2fs_swab32(*block_nr); +#endif + return 0; +} + +errcode_t ext2fs_write_ind_block(ext2_filsys fs, blk_t blk, void *buf) +{ +#ifdef WORDS_BIGENDIAN + blk_t *block_nr; + int i; + int limit = fs->blocksize >> 2; +#endif + + if (fs->flags & EXT2_FLAG_IMAGE_FILE) + return 0; + +#ifdef WORDS_BIGENDIAN + block_nr = (blk_t *) buf; + for (i = 0; i < limit; i++, block_nr++) + *block_nr = ext2fs_swab32(*block_nr); +#endif + return io_channel_write_blk(fs->io, blk, 1, buf); +} + + diff --git a/lib/ext2fs/initialize.c b/lib/ext2fs/initialize.c new file mode 100644 index 0000000..edd692b --- /dev/null +++ b/lib/ext2fs/initialize.c @@ -0,0 +1,671 @@ +/* + * initialize.c --- initialize a filesystem handle given superblock + * parameters. Used by mke2fs when initializing a filesystem. + * + * Copyright (C) 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +#ifndef O_BINARY +#define O_BINARY 0 +#endif + +#if defined(__linux__) && defined(EXT2_OS_LINUX) +#define CREATOR_OS EXT2_OS_LINUX +#else +#if defined(__GNU__) && defined(EXT2_OS_HURD) +#define CREATOR_OS EXT2_OS_HURD +#else +#if defined(__FreeBSD__) && defined(EXT2_OS_FREEBSD) +#define CREATOR_OS EXT2_OS_FREEBSD +#else +#if defined(LITES) && defined(EXT2_OS_LITES) +#define CREATOR_OS EXT2_OS_LITES +#else +#define CREATOR_OS EXT2_OS_LINUX /* by default */ +#endif /* defined(LITES) && defined(EXT2_OS_LITES) */ +#endif /* defined(__FreeBSD__) && defined(EXT2_OS_FREEBSD) */ +#endif /* defined(__GNU__) && defined(EXT2_OS_HURD) */ +#endif /* defined(__linux__) && defined(EXT2_OS_LINUX) */ + +/* + * Calculate the number of GDT blocks to reserve for online filesystem growth. + * The absolute maximum number of GDT blocks we can reserve is determined by + * the number of block pointers that can fit into a single block. + */ +static unsigned int calc_reserved_gdt_blocks(ext2_filsys fs) +{ + struct ext2_super_block *sb = fs->super; + unsigned long bpg = sb->s_blocks_per_group; + unsigned int gdpb = EXT2_DESC_PER_BLOCK(sb); + unsigned long max_blocks = 0xffffffff; + unsigned long rsv_groups; + unsigned int rsv_gdb; + + /* We set it at 1024x the current filesystem size, or + * the upper block count limit (2^32), whichever is lower. + */ + if (ext2fs_blocks_count(sb) < max_blocks / 1024) + max_blocks = ext2fs_blocks_count(sb) * 1024; + /* + * ext2fs_div64_ceil() is unnecessary because max_blocks is + * max _GDT_ blocks, which is limited to 32 bits. + */ + rsv_groups = ext2fs_div_ceil(max_blocks - sb->s_first_data_block, bpg); + rsv_gdb = ext2fs_div_ceil(rsv_groups, gdpb) - fs->desc_blocks; + if (rsv_gdb > EXT2_ADDR_PER_BLOCK(sb)) + rsv_gdb = EXT2_ADDR_PER_BLOCK(sb); +#ifdef RES_GDT_DEBUG + printf("max_blocks %lu, rsv_groups = %lu, rsv_gdb = %u\n", + max_blocks, rsv_groups, rsv_gdb); +#endif + + return rsv_gdb; +} + +errcode_t ext2fs_initialize(const char *name, int flags, + struct ext2_super_block *param, + io_manager manager, ext2_filsys *ret_fs) +{ + ext2_filsys fs; + errcode_t retval; + struct ext2_super_block *super; + unsigned int rem; + unsigned int overhead = 0; + unsigned int ipg; + dgrp_t i; + blk64_t free_blocks; + blk_t numblocks; + int rsv_gdt; + int csum_flag; + int bigalloc_flag; + int io_flags; + int has_bg; + unsigned reserved_inos; + char *buf = 0; + char c; + double reserved_ratio; + char *time_env; + + if (!param || !ext2fs_blocks_count(param)) + return EXT2_ET_INVALID_ARGUMENT; + + retval = ext2fs_get_mem(sizeof(struct struct_ext2_filsys), &fs); + if (retval) + return retval; + + memset(fs, 0, sizeof(struct struct_ext2_filsys)); + fs->magic = EXT2_ET_MAGIC_EXT2FS_FILSYS; + fs->flags = flags | EXT2_FLAG_RW; + fs->umask = 022; + fs->default_bitmap_type = EXT2FS_BMAP64_RBTREE; +#ifdef WORDS_BIGENDIAN + fs->flags |= EXT2_FLAG_SWAP_BYTES; +#endif + + time_env = getenv("E2FSPROGS_FAKE_TIME"); + if (time_env) + fs->now = strtoul(time_env, NULL, 0); + + io_flags = IO_FLAG_RW; + if (flags & EXT2_FLAG_EXCLUSIVE) + io_flags |= IO_FLAG_EXCLUSIVE; + if (flags & EXT2_FLAG_DIRECT_IO) + io_flags |= IO_FLAG_DIRECT_IO; + io_flags |= O_BINARY; + retval = manager->open(name, io_flags, &fs->io); + if (retval) + goto cleanup; + fs->image_io = fs->io; + fs->io->app_data = fs; + retval = ext2fs_get_mem(strlen(name)+1, &fs->device_name); + if (retval) + goto cleanup; + + strcpy(fs->device_name, name); + retval = ext2fs_get_mem(SUPERBLOCK_SIZE, &super); + if (retval) + goto cleanup; + fs->super = super; + + memset(super, 0, SUPERBLOCK_SIZE); + +#define set_field(field, default) (super->field = param->field ? \ + param->field : (default)) +#define assign_field(field) (super->field = param->field) + + super->s_magic = EXT2_SUPER_MAGIC; + super->s_state = EXT2_VALID_FS; + + bigalloc_flag = ext2fs_has_feature_bigalloc(param); + + assign_field(s_log_block_size); + + if (bigalloc_flag) { + set_field(s_log_cluster_size, super->s_log_block_size+4); + if (super->s_log_block_size > super->s_log_cluster_size) { + retval = EXT2_ET_INVALID_ARGUMENT; + goto cleanup; + } + } else + super->s_log_cluster_size = super->s_log_block_size; + + set_field(s_first_data_block, super->s_log_cluster_size ? 0 : 1); + set_field(s_max_mnt_count, 0); + set_field(s_errors, EXT2_ERRORS_DEFAULT); + set_field(s_feature_compat, 0); + set_field(s_feature_incompat, 0); + set_field(s_feature_ro_compat, 0); + set_field(s_default_mount_opts, 0); + set_field(s_first_meta_bg, 0); + set_field(s_raid_stride, 0); /* default stride size: 0 */ + set_field(s_raid_stripe_width, 0); /* default stripe width: 0 */ + set_field(s_log_groups_per_flex, 0); + set_field(s_flags, 0); + assign_field(s_backup_bgs[0]); + assign_field(s_backup_bgs[1]); + + assign_field(s_encoding); + assign_field(s_encoding_flags); + + if (ext2fs_has_feature_casefold(param)) + fs->encoding = ext2fs_load_nls_table(param->s_encoding); + + if (super->s_feature_incompat & ~EXT2_LIB_FEATURE_INCOMPAT_SUPP) { + retval = EXT2_ET_UNSUPP_FEATURE; + goto cleanup; + } + if (super->s_feature_ro_compat & ~EXT2_LIB_FEATURE_RO_COMPAT_SUPP) { + retval = EXT2_ET_RO_UNSUPP_FEATURE; + goto cleanup; + } + + set_field(s_rev_level, EXT2_GOOD_OLD_REV); + if (super->s_rev_level >= EXT2_DYNAMIC_REV) { + set_field(s_first_ino, EXT2_GOOD_OLD_FIRST_INO); + set_field(s_inode_size, EXT2_GOOD_OLD_INODE_SIZE); + if (super->s_inode_size >= sizeof(struct ext2_inode_large)) { + int extra_isize = sizeof(struct ext2_inode_large) - + EXT2_GOOD_OLD_INODE_SIZE; + set_field(s_min_extra_isize, extra_isize); + set_field(s_want_extra_isize, extra_isize); + } + } else { + super->s_first_ino = EXT2_GOOD_OLD_FIRST_INO; + super->s_inode_size = EXT2_GOOD_OLD_INODE_SIZE; + } + + set_field(s_checkinterval, 0); + super->s_mkfs_time = super->s_lastcheck = fs->now ? fs->now : time(NULL); + + super->s_creator_os = CREATOR_OS; + + fs->fragsize = fs->blocksize = EXT2_BLOCK_SIZE(super); + fs->cluster_ratio_bits = super->s_log_cluster_size - + super->s_log_block_size; + + if (bigalloc_flag) { + unsigned long long bpg; + + if (param->s_blocks_per_group && + param->s_clusters_per_group && + ((param->s_clusters_per_group * EXT2FS_CLUSTER_RATIO(fs)) != + param->s_blocks_per_group)) { + retval = EXT2_ET_INVALID_ARGUMENT; + goto cleanup; + } + if (param->s_clusters_per_group) + assign_field(s_clusters_per_group); + else if (param->s_blocks_per_group) + super->s_clusters_per_group = + param->s_blocks_per_group / + EXT2FS_CLUSTER_RATIO(fs); + else if (super->s_log_cluster_size + 15 < 32) + super->s_clusters_per_group = fs->blocksize * 8; + else + super->s_clusters_per_group = (fs->blocksize - 1) * 8; + if (super->s_clusters_per_group > EXT2_MAX_CLUSTERS_PER_GROUP(super)) + super->s_clusters_per_group = EXT2_MAX_CLUSTERS_PER_GROUP(super); + bpg = EXT2FS_C2B(fs, + (unsigned long long) super->s_clusters_per_group); + if (bpg >= (((unsigned long long) 1) << 32)) { + retval = EXT2_ET_INVALID_ARGUMENT; + goto cleanup; + } + super->s_blocks_per_group = bpg; + } else { + set_field(s_blocks_per_group, fs->blocksize * 8); + if (super->s_blocks_per_group > EXT2_MAX_BLOCKS_PER_GROUP(super)) + super->s_blocks_per_group = EXT2_MAX_BLOCKS_PER_GROUP(super); + super->s_clusters_per_group = super->s_blocks_per_group; + } + + ext2fs_blocks_count_set(super, ext2fs_blocks_count(param) & + ~((blk64_t) EXT2FS_CLUSTER_MASK(fs))); + ext2fs_r_blocks_count_set(super, ext2fs_r_blocks_count(param)); + if (ext2fs_r_blocks_count(super) >= ext2fs_blocks_count(param)) { + retval = EXT2_ET_INVALID_ARGUMENT; + goto cleanup; + } + + set_field(s_mmp_update_interval, 0); + + /* + * If we're creating an external journal device, we don't need + * to bother with the rest. + */ + if (ext2fs_has_feature_journal_dev(super)) { + fs->group_desc_count = 0; + ext2fs_mark_super_dirty(fs); + *ret_fs = fs; + return 0; + } + +retry: + fs->group_desc_count = (dgrp_t) ext2fs_div64_ceil( + ext2fs_blocks_count(super) - super->s_first_data_block, + EXT2_BLOCKS_PER_GROUP(super)); + if (fs->group_desc_count == 0) { + retval = EXT2_ET_TOOSMALL; + goto cleanup; + } + + set_field(s_desc_size, + ext2fs_has_feature_64bit(super) ? + EXT2_MIN_DESC_SIZE_64BIT : 0); + + fs->desc_blocks = ext2fs_div_ceil(fs->group_desc_count, + EXT2_DESC_PER_BLOCK(super)); + + i = fs->blocksize >= 4096 ? 1 : 4096 / fs->blocksize; + + if (ext2fs_has_feature_64bit(super) && + (ext2fs_blocks_count(super) / i) >= (1ULL << 32)) + set_field(s_inodes_count, ~0U); + else + set_field(s_inodes_count, ext2fs_blocks_count(super) / i); + + /* + * Make sure we have at least EXT2_FIRST_INO + 1 inodes, so + * that we have enough inodes for the filesystem(!) + */ + if (super->s_inodes_count < EXT2_FIRST_INODE(super)+1) + super->s_inodes_count = EXT2_FIRST_INODE(super)+1; + + /* + * There should be at least as many inodes as the user + * requested. Figure out how many inodes per group that + * should be. But make sure that we don't allocate more than + * one bitmap's worth of inodes each group. + */ + ipg = ext2fs_div_ceil(super->s_inodes_count, fs->group_desc_count); + if (ipg > fs->blocksize * 8) { + if (!bigalloc_flag && super->s_blocks_per_group >= 256) { + /* Try again with slightly different parameters */ + super->s_blocks_per_group -= 8; + ext2fs_blocks_count_set(super, + ext2fs_blocks_count(param)); + super->s_clusters_per_group = super->s_blocks_per_group; + goto retry; + } else { + retval = EXT2_ET_TOO_MANY_INODES; + goto cleanup; + } + } + + if (ipg > (unsigned) EXT2_MAX_INODES_PER_GROUP(super)) + ipg = EXT2_MAX_INODES_PER_GROUP(super); + +ipg_retry: + super->s_inodes_per_group = ipg; + + /* + * Make sure the number of inodes per group completely fills + * the inode table blocks in the descriptor. If not, add some + * additional inodes/group. Waste not, want not... + */ + fs->inode_blocks_per_group = (((super->s_inodes_per_group * + EXT2_INODE_SIZE(super)) + + EXT2_BLOCK_SIZE(super) - 1) / + EXT2_BLOCK_SIZE(super)); + super->s_inodes_per_group = ((fs->inode_blocks_per_group * + EXT2_BLOCK_SIZE(super)) / + EXT2_INODE_SIZE(super)); + /* + * Finally, make sure the number of inodes per group is a + * multiple of 8. This is needed to simplify the bitmap + * splicing code. + */ + if (super->s_inodes_per_group < 8) + super->s_inodes_per_group = 8; + super->s_inodes_per_group &= ~7; + fs->inode_blocks_per_group = (((super->s_inodes_per_group * + EXT2_INODE_SIZE(super)) + + EXT2_BLOCK_SIZE(super) - 1) / + EXT2_BLOCK_SIZE(super)); + + /* + * adjust inode count to reflect the adjusted inodes_per_group + */ + if ((__u64)super->s_inodes_per_group * fs->group_desc_count > ~0U) { + ipg--; + goto ipg_retry; + } + super->s_inodes_count = super->s_inodes_per_group * + fs->group_desc_count; + super->s_free_inodes_count = super->s_inodes_count; + + /* + * check the number of reserved group descriptor table blocks + */ + if (ext2fs_has_feature_resize_inode(super)) + rsv_gdt = calc_reserved_gdt_blocks(fs); + else + rsv_gdt = 0; + set_field(s_reserved_gdt_blocks, rsv_gdt); + if (super->s_reserved_gdt_blocks > EXT2_ADDR_PER_BLOCK(super)) { + retval = EXT2_ET_RES_GDT_BLOCKS; + goto cleanup; + } + /* Enable meta_bg if we'd lose more than 3/4 of a BG to GDT blocks. */ + if (super->s_reserved_gdt_blocks + fs->desc_blocks > + super->s_blocks_per_group * 3 / 4) { + ext2fs_set_feature_meta_bg(fs->super); + ext2fs_clear_feature_resize_inode(fs->super); + set_field(s_reserved_gdt_blocks, 0); + } + + /* + * Calculate the maximum number of bookkeeping blocks per + * group. It includes the superblock, the block group + * descriptors, the block bitmap, the inode bitmap, the inode + * table, and the reserved gdt blocks. + */ + overhead = (int) (3 + fs->inode_blocks_per_group + + super->s_reserved_gdt_blocks); + + if (ext2fs_has_feature_meta_bg(fs->super)) + overhead++; + else + overhead += fs->desc_blocks; + + /* This can only happen if the user requested too many inodes */ + if (overhead > super->s_blocks_per_group) { + retval = EXT2_ET_TOO_MANY_INODES; + goto cleanup; + } + + /* + * See if the last group is big enough to support the + * necessary data structures. If not, we need to get rid of + * it. We need to recalculate the overhead for the last block + * group, since it might or might not have a superblock + * backup. + */ + overhead = (int) (2 + fs->inode_blocks_per_group); + has_bg = 0; + if (ext2fs_has_feature_sparse_super2(super)) { + /* + * We have to do this manually since + * super->s_backup_bgs hasn't been set up yet. + */ + if (fs->group_desc_count == 2) + has_bg = param->s_backup_bgs[0] != 0; + else + has_bg = param->s_backup_bgs[1] != 0; + } else + has_bg = ext2fs_bg_has_super(fs, fs->group_desc_count - 1); + if (has_bg) + overhead += 1 + fs->desc_blocks + super->s_reserved_gdt_blocks; + rem = ((ext2fs_blocks_count(super) - super->s_first_data_block) % + super->s_blocks_per_group); + if ((fs->group_desc_count == 1) && rem && (rem < overhead)) { + retval = EXT2_ET_TOOSMALL; + goto cleanup; + } + if (rem && (rem < overhead+50)) { + ext2fs_blocks_count_set(super, ext2fs_blocks_count(super) - + rem); + /* + * If blocks count is changed, we need to recalculate + * reserved blocks count not to exceed 50%. + */ + reserved_ratio = 100.0 * ext2fs_r_blocks_count(param) / + ext2fs_blocks_count(param); + ext2fs_r_blocks_count_set(super, reserved_ratio * + ext2fs_blocks_count(super) / 100.0); + + goto retry; + } + + /* + * At this point we know how big the filesystem will be. So + * we can do any and all allocations that depend on the block + * count. + */ + + /* Set up the locations of the backup superblocks */ + if (ext2fs_has_feature_sparse_super2(super)) { + if (super->s_backup_bgs[0] >= fs->group_desc_count) + super->s_backup_bgs[0] = fs->group_desc_count - 1; + if (super->s_backup_bgs[1] >= fs->group_desc_count) + super->s_backup_bgs[1] = fs->group_desc_count - 1; + if (super->s_backup_bgs[0] == super->s_backup_bgs[1]) + super->s_backup_bgs[1] = 0; + if (super->s_backup_bgs[0] > super->s_backup_bgs[1]) { + __u32 t = super->s_backup_bgs[0]; + super->s_backup_bgs[0] = super->s_backup_bgs[1]; + super->s_backup_bgs[1] = t; + } + } + + retval = ext2fs_get_mem(strlen(fs->device_name) + 80, &buf); + if (retval) + goto cleanup; + + strcpy(buf, "block bitmap for "); + strcat(buf, fs->device_name); + retval = ext2fs_allocate_subcluster_bitmap(fs, buf, &fs->block_map); + if (retval) + goto cleanup; + + strcpy(buf, "inode bitmap for "); + strcat(buf, fs->device_name); + retval = ext2fs_allocate_inode_bitmap(fs, buf, &fs->inode_map); + if (retval) + goto cleanup; + + ext2fs_free_mem(&buf); + + retval = ext2fs_get_array(fs->desc_blocks, fs->blocksize, + &fs->group_desc); + if (retval) + goto cleanup; + + memset(fs->group_desc, 0, (size_t) fs->desc_blocks * fs->blocksize); + + /* + * Reserve the superblock and group descriptors for each + * group, and fill in the correct group statistics for group. + * Note that although the block bitmap, inode bitmap, and + * inode table have not been allocated (and in fact won't be + * by this routine), they are accounted for nevertheless. + * + * If FLEX_BG meta-data grouping is used, only account for the + * superblock and group descriptors (the inode tables and + * bitmaps will be accounted for when allocated). + */ + free_blocks = 0; + csum_flag = ext2fs_has_group_desc_csum(fs); + reserved_inos = super->s_first_ino; + for (i = 0; i < fs->group_desc_count; i++) { + /* + * Don't set the BLOCK_UNINIT group for the last group + * because the block bitmap needs to be padded. + */ + if (csum_flag) { + if (i != fs->group_desc_count - 1) + ext2fs_bg_flags_set(fs, i, + EXT2_BG_BLOCK_UNINIT); + ext2fs_bg_flags_set(fs, i, EXT2_BG_INODE_UNINIT); + numblocks = super->s_inodes_per_group; + if (reserved_inos) { + if (numblocks > reserved_inos) { + numblocks -= reserved_inos; + reserved_inos = 0; + } else { + reserved_inos -= numblocks; + numblocks = 0; + } + } + ext2fs_bg_itable_unused_set(fs, i, numblocks); + } + numblocks = ext2fs_reserve_super_and_bgd(fs, i, fs->block_map); + if (fs->super->s_log_groups_per_flex) + numblocks += 2 + fs->inode_blocks_per_group; + + free_blocks += numblocks; + ext2fs_bg_free_blocks_count_set(fs, i, numblocks); + ext2fs_bg_free_inodes_count_set(fs, i, fs->super->s_inodes_per_group); + ext2fs_bg_used_dirs_count_set(fs, i, 0); + ext2fs_group_desc_csum_set(fs, i); + } + free_blocks &= ~EXT2FS_CLUSTER_MASK(fs); + ext2fs_free_blocks_count_set(super, free_blocks); + + c = (char) 255; + if (((int) c) == -1) { + super->s_flags |= EXT2_FLAGS_SIGNED_HASH; + } else { + super->s_flags |= EXT2_FLAGS_UNSIGNED_HASH; + } + + ext2fs_mark_super_dirty(fs); + ext2fs_mark_bb_dirty(fs); + ext2fs_mark_ib_dirty(fs); + + io_channel_set_blksize(fs->io, fs->blocksize); + + *ret_fs = fs; + return 0; +cleanup: + free(buf); + ext2fs_free(fs); + return retval; +} + +errcode_t ext2fs_calculate_summary_stats(ext2_filsys fs, int super_only) +{ + blk64_t blk; + ext2_ino_t ino; + unsigned int group = 0; + unsigned int count = 0; + int total_free = 0; + int group_free = 0; + int last_allocated = 0; + int uninit; + + /* + * First calculate the block statistics + */ + uninit = 1; + for (blk = fs->super->s_first_data_block; + blk < ext2fs_blocks_count(fs->super); blk++) { + if (!ext2fs_fast_test_block_bitmap2(fs->block_map, blk)) { + group_free++; + total_free++; + } else { + uninit = 0; + } + count++; + if ((count == fs->super->s_blocks_per_group) || + (blk == ext2fs_blocks_count(fs->super)-1)) { + ext2fs_bg_free_blocks_count_set(fs, group, + group_free); + if (!super_only) { + if (uninit && blk != + ext2fs_blocks_count(fs->super) - 1) + ext2fs_bg_flags_set(fs, group, + EXT2_BG_BLOCK_UNINIT); + else + ext2fs_bg_flags_clear(fs, group, + EXT2_BG_BLOCK_UNINIT); + } + count = 0; + group_free = 0; + uninit = 1; + group++; + } + } + total_free = EXT2FS_C2B(fs, total_free); + ext2fs_free_blocks_count_set(fs->super, total_free); + + /* + * Next, calculate the inode statistics + */ + group_free = 0; + total_free = 0; + last_allocated = 0; + count = 0; + group = 0; + + /* Protect loop from wrap-around if s_inodes_count maxed */ + for (ino = 1; ino <= fs->super->s_inodes_count && ino > 0; ino++) { + if (!ext2fs_test_inode_bitmap2(fs->inode_map, ino)) { + group_free++; + total_free++; + } else { + last_allocated = ino; + } + count++; + if ((count == fs->super->s_inodes_per_group) || + (ino == fs->super->s_inodes_count)) { + if (!super_only) { + if (last_allocated) { + ext2fs_bg_flags_clear(fs, group, + EXT2_BG_INODE_UNINIT); + ext2fs_bg_itable_unused_set(fs, group, + fs->super->s_inodes_per_group - + (last_allocated % + fs->super->s_inodes_per_group)); + } else { + ext2fs_bg_flags_set(fs, group, + EXT2_BG_INODE_UNINIT); + ext2fs_bg_itable_unused_set(fs, group, + 0); + } + ext2fs_bg_free_inodes_count_set(fs, group, + group_free); + } + group++; + count = 0; + group_free = 0; + last_allocated = 0; + } + } + fs->super->s_free_inodes_count = total_free; + ext2fs_mark_super_dirty(fs); + return 0; +} diff --git a/lib/ext2fs/inline.c b/lib/ext2fs/inline.c new file mode 100644 index 0000000..ae2ae6e --- /dev/null +++ b/lib/ext2fs/inline.c @@ -0,0 +1,118 @@ +/* + * inline.c --- Includes the inlined functions defined in the header + * files as standalone functions, in case the application program + * is compiled with inlining turned off. + * + * Copyright (C) 1993, 1994 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef _XOPEN_SOURCE +#define _XOPEN_SOURCE 600 /* for posix_memalign() */ +#endif + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#if HAVE_MALLOC_H +#include <malloc.h> +#endif + +#include "ext2_fs.h" +#define INCLUDE_INLINE_FUNCS +#include "ext2fs.h" + +/* + * We used to define this as an inline, but since we are now using + * autoconf-defined #ifdef's, we need to export this as a + * library-provided function exclusively. + */ +errcode_t ext2fs_get_memalign(unsigned long size, + unsigned long align, void *ptr) +{ + errcode_t retval = 0; + void **p = ptr; + + if (align < 8) + align = 8; +#ifdef HAVE_POSIX_MEMALIGN + retval = posix_memalign(p, align, size); + if (retval == ENOMEM) + return EXT2_ET_NO_MEMORY; +#else /* !HAVE_POSIX_MEMALIGN */ +#ifdef HAVE_MEMALIGN + *p = memalign(align, size); + if (*p == NULL) { + if (errno) + return errno; + else + return EXT2_ET_NO_MEMORY; + } +#else /* !HAVE_MEMALIGN */ +#ifdef HAVE_VALLOC + if (align > sizeof(long long)) + *p = valloc(size); + else +#endif + *p = malloc(size); + if ((uintptr_t) *p & (align - 1)) { + free(*p); + *p = 0; + } + if (*p == 0) + return EXT2_ET_NO_MEMORY; +#endif /* HAVE_MEMALIGN */ +#endif /* HAVE_POSIX_MEMALIGN */ + return retval; +} + +#ifdef DEBUG +static int isaligned(void *ptr, unsigned long align) +{ + return (((unsigned long) ptr & (align - 1)) == 0); +} + +static errcode_t test_memalign(unsigned long align) +{ + void *ptr = 0; + errcode_t retval; + + retval = ext2fs_get_memalign(32, align, &ptr); + if (!retval && !isaligned(ptr, align)) + retval = EINVAL; + free(ptr); + printf("tst_memalign(%lu) is %s\n", align, + retval ? error_message(retval) : "OK"); + return retval; +} + +int main(int argc, char **argv) +{ + int err = 0; + + if (test_memalign(4)) + err++; + if (test_memalign(32)) + err++; + if (test_memalign(1024)) + err++; + if (test_memalign(4096)) + err++; + return err; +} +#endif diff --git a/lib/ext2fs/inline_data.c b/lib/ext2fs/inline_data.c new file mode 100644 index 0000000..bd52e37 --- /dev/null +++ b/lib/ext2fs/inline_data.c @@ -0,0 +1,842 @@ +/* + * inline_data.c --- data in inode + * + * Copyright (C) 2012 Zheng Liu <wenqing.lz@taobao.com> + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <time.h> +#include <limits.h> /* for PATH_MAX */ + +#include "ext2_fs.h" +#include "ext2_ext_attr.h" + +#include "ext2fs.h" +#include "ext2fsP.h" + +struct ext2_inline_data { + ext2_filsys fs; + ext2_ino_t ino; + size_t ea_size; /* the size of inline data in ea area */ + void *ea_data; +}; + +static errcode_t ext2fs_inline_data_ea_set(struct ext2_inline_data *data) +{ + struct ext2_xattr_handle *handle; + errcode_t retval; + + retval = ext2fs_xattrs_open(data->fs, data->ino, &handle); + if (retval) + return retval; + + retval = ext2fs_xattrs_read(handle); + if (retval) + goto err; + + retval = ext2fs_xattr_set(handle, "system.data", + data->ea_data, data->ea_size); +err: + (void) ext2fs_xattrs_close(&handle); + return retval; +} + +static errcode_t ext2fs_inline_data_ea_get(struct ext2_inline_data *data) +{ + struct ext2_xattr_handle *handle; + errcode_t retval; + + data->ea_size = 0; + data->ea_data = 0; + + retval = ext2fs_xattrs_open(data->fs, data->ino, &handle); + if (retval) + return retval; + + retval = ext2fs_xattrs_read(handle); + if (retval) + goto err; + + retval = ext2fs_xattr_get(handle, "system.data", + (void **)&data->ea_data, &data->ea_size); + if (retval == EXT2_ET_EA_KEY_NOT_FOUND) { + data->ea_size = 0; + data->ea_data = NULL; + retval = 0; + } else if (retval) + goto err; + +err: + (void) ext2fs_xattrs_close(&handle); + return retval; +} + +errcode_t ext2fs_inline_data_init(ext2_filsys fs, ext2_ino_t ino) +{ + struct ext2_inline_data data; + char empty[1] = { '\0' }; + + data.fs = fs; + data.ino = ino; + data.ea_size = 0; + data.ea_data = empty; + return ext2fs_inline_data_ea_set(&data); +} + +errcode_t ext2fs_inline_data_size(ext2_filsys fs, ext2_ino_t ino, size_t *size) +{ + struct ext2_inode inode; + struct ext2_inline_data data; + errcode_t retval; + + retval = ext2fs_read_inode(fs, ino, &inode); + if (retval) + return retval; + + if (!(inode.i_flags & EXT4_INLINE_DATA_FL)) + return EXT2_ET_NO_INLINE_DATA; + + data.fs = fs; + data.ino = ino; + retval = ext2fs_inline_data_ea_get(&data); + if (retval) + return retval; + + *size = EXT4_MIN_INLINE_DATA_SIZE + data.ea_size; + return ext2fs_free_mem(&data.ea_data); +} + +int ext2fs_inline_data_dir_iterate(ext2_filsys fs, ext2_ino_t ino, + void *priv_data) +{ + struct dir_context *ctx; + struct ext2_inode inode; + struct ext2_dir_entry dirent; + struct ext2_inline_data data; + int ret = BLOCK_ABORT; + e2_blkcnt_t blockcnt = 0; + char *old_buf; + unsigned int old_buflen; + int old_flags; + + ctx = (struct dir_context *)priv_data; + old_buf = ctx->buf; + old_buflen = ctx->buflen; + old_flags = ctx->flags; + ctx->flags |= DIRENT_FLAG_INCLUDE_INLINE_DATA; + + ctx->errcode = ext2fs_read_inode(fs, ino, &inode); + if (ctx->errcode) + goto out; + + if (!(inode.i_flags & EXT4_INLINE_DATA_FL)) { + ctx->errcode = EXT2_ET_NO_INLINE_DATA; + goto out; + } + + if (!LINUX_S_ISDIR(inode.i_mode)) { + ctx->errcode = EXT2_ET_NO_DIRECTORY; + goto out; + } + ret = 0; + + /* we first check '.' and '..' dir */ + dirent.inode = ino; + dirent.name_len = 1; + ext2fs_set_rec_len(fs, EXT2_DIR_REC_LEN(2), &dirent); + dirent.name[0] = '.'; + dirent.name[1] = '\0'; + ctx->buf = (char *)&dirent; + ext2fs_get_rec_len(fs, &dirent, &ctx->buflen); + ret |= ext2fs_process_dir_block(fs, 0, blockcnt++, 0, 0, priv_data); + if (ret & BLOCK_ABORT) + goto out; + + dirent.inode = ext2fs_le32_to_cpu(inode.i_block[0]); + dirent.name_len = 2; + ext2fs_set_rec_len(fs, EXT2_DIR_REC_LEN(3), &dirent); + dirent.name[0] = '.'; + dirent.name[1] = '.'; + dirent.name[2] = '\0'; + ctx->buf = (char *)&dirent; + ext2fs_get_rec_len(fs, &dirent, &ctx->buflen); + ret |= ext2fs_process_dir_block(fs, 0, blockcnt++, 0, 0, priv_data); + if (ret & BLOCK_INLINE_DATA_CHANGED) { + errcode_t err; + + inode.i_block[0] = ext2fs_cpu_to_le32(dirent.inode); + err = ext2fs_write_inode(fs, ino, &inode); + if (err) + goto out; + ret &= ~BLOCK_INLINE_DATA_CHANGED; + } + if (ret & BLOCK_ABORT) + goto out; + + ctx->buf = (char *)inode.i_block + EXT4_INLINE_DATA_DOTDOT_SIZE; + ctx->buflen = EXT4_MIN_INLINE_DATA_SIZE - EXT4_INLINE_DATA_DOTDOT_SIZE; +#ifdef WORDS_BIGENDIAN + ctx->errcode = ext2fs_dirent_swab_in2(fs, ctx->buf, ctx->buflen, 0); + if (ctx->errcode) { + ret |= BLOCK_ABORT; + goto out; + } +#endif + ret |= ext2fs_process_dir_block(fs, 0, blockcnt++, 0, 0, priv_data); + if (ret & BLOCK_INLINE_DATA_CHANGED) { +#ifdef WORDS_BIGENDIAN + ctx->errcode = ext2fs_dirent_swab_out2(fs, ctx->buf, + ctx->buflen, 0); + if (ctx->errcode) { + ret |= BLOCK_ABORT; + goto out; + } +#endif + ctx->errcode = ext2fs_write_inode(fs, ino, &inode); + if (ctx->errcode) + ret |= BLOCK_ABORT; + ret &= ~BLOCK_INLINE_DATA_CHANGED; + } + if (ret & BLOCK_ABORT) + goto out; + + data.fs = fs; + data.ino = ino; + ctx->errcode = ext2fs_inline_data_ea_get(&data); + if (ctx->errcode) { + ret |= BLOCK_ABORT; + goto out; + } + if (data.ea_size <= 0) + goto out1; + + ctx->buf = data.ea_data; + ctx->buflen = data.ea_size; +#ifdef WORDS_BIGENDIAN + ctx->errcode = ext2fs_dirent_swab_in2(fs, ctx->buf, ctx->buflen, 0); + if (ctx->errcode) { + ret |= BLOCK_ABORT; + goto out1; + } +#endif + + ret |= ext2fs_process_dir_block(fs, 0, blockcnt++, 0, 0, priv_data); + if (ret & BLOCK_INLINE_DATA_CHANGED) { +#ifdef WORDS_BIGENDIAN + ctx->errcode = ext2fs_dirent_swab_out2(fs, ctx->buf, + ctx->buflen, 0); + if (ctx->errcode) { + ret |= BLOCK_ABORT; + goto out1; + } +#endif + ctx->errcode = ext2fs_inline_data_ea_set(&data); + if (ctx->errcode) + ret |= BLOCK_ABORT; + } + +out1: + ext2fs_free_mem(&data.ea_data); +out: + ctx->buf = old_buf; + ctx->buflen = old_buflen; + ctx->flags = old_flags; + ret &= ~(BLOCK_ABORT | BLOCK_INLINE_DATA_CHANGED); + return ret; +} + +errcode_t ext2fs_inline_data_ea_remove(ext2_filsys fs, ext2_ino_t ino) +{ + struct ext2_xattr_handle *handle; + errcode_t retval; + + retval = ext2fs_xattrs_open(fs, ino, &handle); + if (retval) + return retval; + + retval = ext2fs_xattrs_read(handle); + if (retval) + goto err; + + retval = ext2fs_xattr_remove(handle, "system.data"); +err: + (void) ext2fs_xattrs_close(&handle); + return retval; +} + +static errcode_t ext2fs_inline_data_convert_dir(ext2_filsys fs, ext2_ino_t ino, + char *bbuf, char *ibuf, int size) +{ + struct ext2_dir_entry *dir, *dir2; + struct ext2_dir_entry_tail *t; + errcode_t retval; + int offset; + unsigned int rec_len; + int csum_size = 0; + int filetype = 0; + + if (ext2fs_has_feature_metadata_csum(fs->super)) + csum_size = sizeof(struct ext2_dir_entry_tail); + + /* Create '.' and '..' */ + if (ext2fs_has_feature_filetype(fs->super)) + filetype = EXT2_FT_DIR; + + /* + * Set up entry for '.' + */ + dir = (struct ext2_dir_entry *) bbuf; + dir->inode = ino; + ext2fs_dirent_set_name_len(dir, 1); + ext2fs_dirent_set_file_type(dir, filetype); + dir->name[0] = '.'; + rec_len = (fs->blocksize - csum_size) - EXT2_DIR_REC_LEN(1); + dir->rec_len = EXT2_DIR_REC_LEN(1); + + /* + * Set up entry for '..' + */ + dir = (struct ext2_dir_entry *) (bbuf + dir->rec_len); + dir->rec_len = EXT2_DIR_REC_LEN(2); + dir->inode = ext2fs_le32_to_cpu(((__u32 *)ibuf)[0]); + ext2fs_dirent_set_name_len(dir, 2); + ext2fs_dirent_set_file_type(dir, filetype); + dir->name[0] = '.'; + dir->name[1] = '.'; + + /* + * Adjust the last rec_len + */ + offset = EXT2_DIR_REC_LEN(1) + EXT2_DIR_REC_LEN(2); + dir = (struct ext2_dir_entry *) (bbuf + offset); + memcpy(bbuf + offset, ibuf + EXT4_INLINE_DATA_DOTDOT_SIZE, + size - EXT4_INLINE_DATA_DOTDOT_SIZE); + size += EXT2_DIR_REC_LEN(1) + EXT2_DIR_REC_LEN(2) - + EXT4_INLINE_DATA_DOTDOT_SIZE; + + do { + dir2 = dir; + retval = ext2fs_get_rec_len(fs, dir, &rec_len); + if (retval) + goto err; + offset += rec_len; + dir = (struct ext2_dir_entry *) (bbuf + offset); + } while (offset < size); + rec_len += fs->blocksize - csum_size - offset; + retval = ext2fs_set_rec_len(fs, rec_len, dir2); + if (retval) + goto err; + + if (csum_size) { + t = EXT2_DIRENT_TAIL(bbuf, fs->blocksize); + ext2fs_initialize_dirent_tail(fs, t); + } + +err: + return retval; +} + +static errcode_t +ext2fs_inline_data_dir_expand(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, char *buf, size_t size) +{ + errcode_t retval; + blk64_t blk; + char *blk_buf; + + retval = ext2fs_get_memzero(fs->blocksize, &blk_buf); + if (retval) + return retval; + +#ifdef WORDS_BIGENDIAN + retval = ext2fs_dirent_swab_in2(fs, buf + EXT4_INLINE_DATA_DOTDOT_SIZE, + size, 0); + if (retval) + goto errout; +#endif + + /* Adjust the rec_len */ + retval = ext2fs_inline_data_convert_dir(fs, ino, blk_buf, buf, size); + if (retval) + goto errout; + /* Allocate a new block */ + retval = ext2fs_new_block2(fs, 0, 0, &blk); + if (retval) + goto errout; + retval = ext2fs_write_dir_block4(fs, blk, blk_buf, 0, ino); + if (retval) + goto errout; + + /* Update inode */ + if (ext2fs_has_feature_extents(fs->super)) + inode->i_flags |= EXT4_EXTENTS_FL; + inode->i_flags &= ~EXT4_INLINE_DATA_FL; + retval = ext2fs_iblk_add_blocks(fs, inode, 1); + if (retval) + goto errout; + inode->i_size = fs->blocksize; + retval = ext2fs_bmap2(fs, ino, inode, 0, BMAP_SET, 0, 0, &blk); + if (retval) + goto errout; + retval = ext2fs_write_inode(fs, ino, inode); + if (retval) + goto errout; + ext2fs_block_alloc_stats(fs, blk, +1); + +errout: + ext2fs_free_mem(&blk_buf); + return retval; +} + +static errcode_t +ext2fs_inline_data_file_expand(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, char *buf, size_t size) +{ + ext2_file_t e2_file; + errcode_t retval; + + /* Update inode */ + memset(inode->i_block, 0, sizeof(inode->i_block)); + if (ext2fs_has_feature_extents(fs->super)) { + ext2_extent_handle_t handle; + + inode->i_flags &= ~EXT4_EXTENTS_FL; + retval = ext2fs_extent_open2(fs, ino, inode, &handle); + if (retval) + return retval; + ext2fs_extent_free(handle); + } + inode->i_flags &= ~EXT4_INLINE_DATA_FL; + inode->i_size = 0; + retval = ext2fs_write_inode(fs, ino, inode); + if (retval) + return retval; + + /* Write out the block buffer */ + retval = ext2fs_file_open(fs, ino, EXT2_FILE_WRITE, &e2_file); + if (retval) + return retval; + retval = ext2fs_file_write(e2_file, buf, size, 0); + ext2fs_file_close(e2_file); + return retval; +} + +errcode_t ext2fs_inline_data_expand(ext2_filsys fs, ext2_ino_t ino) +{ + struct ext2_inode inode; + struct ext2_inline_data data; + errcode_t retval; + size_t inline_size; + char *inline_buf = 0; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + retval = ext2fs_read_inode(fs, ino, &inode); + if (retval) + return retval; + + if (!(inode.i_flags & EXT4_INLINE_DATA_FL)) + return EXT2_ET_NO_INLINE_DATA; + + data.fs = fs; + data.ino = ino; + retval = ext2fs_inline_data_ea_get(&data); + if (retval) + return retval; + inline_size = data.ea_size + EXT4_MIN_INLINE_DATA_SIZE; + retval = ext2fs_get_mem(inline_size, &inline_buf); + if (retval) + goto errout; + + memcpy(inline_buf, (void *)inode.i_block, EXT4_MIN_INLINE_DATA_SIZE); + if (data.ea_size > 0) { + memcpy(inline_buf + EXT4_MIN_INLINE_DATA_SIZE, + data.ea_data, data.ea_size); + } + + memset((void *)inode.i_block, 0, EXT4_MIN_INLINE_DATA_SIZE); + /* + * NOTE: We must do this write -> ea_remove -> read cycle here because + * removing the inline data EA can free the EA block, which is a change + * that our stack copy of the inode will never see. If that happens, + * we can end up with the EA block and lblk 0 pointing to the same + * pblk, which is bad news. + */ + retval = ext2fs_write_inode(fs, ino, &inode); + if (retval) + goto errout; + retval = ext2fs_inline_data_ea_remove(fs, ino); + if (retval) + goto errout; + retval = ext2fs_read_inode(fs, ino, &inode); + if (retval) + goto errout; + + if (LINUX_S_ISDIR(inode.i_mode)) { + retval = ext2fs_inline_data_dir_expand(fs, ino, &inode, + inline_buf, inline_size); + } else { + retval = ext2fs_inline_data_file_expand(fs, ino, &inode, + inline_buf, inline_size); + } + +errout: + if (inline_buf) + ext2fs_free_mem(&inline_buf); + ext2fs_free_mem(&data.ea_data); + return retval; +} + +/* + * When caller uses this function to retrieve the inline data, it must + * allocate a buffer which has the size of inline data. The size of + * inline data can be know by ext2fs_inline_data_get_size(). + */ +errcode_t ext2fs_inline_data_get(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + void *buf, size_t *size) +{ + struct ext2_inode inode_buf; + struct ext2_inline_data data; + errcode_t retval; + + if (!inode) { + retval = ext2fs_read_inode(fs, ino, &inode_buf); + if (retval) + return retval; + inode = &inode_buf; + } + + data.fs = fs; + data.ino = ino; + retval = ext2fs_inline_data_ea_get(&data); + if (retval) + return retval; + + memcpy(buf, (void *)inode->i_block, EXT4_MIN_INLINE_DATA_SIZE); + if (data.ea_size > 0) + memcpy((char *) buf + EXT4_MIN_INLINE_DATA_SIZE, + data.ea_data, data.ea_size); + + if (size) + *size = EXT4_MIN_INLINE_DATA_SIZE + data.ea_size; + ext2fs_free_mem(&data.ea_data); + return 0; +} + +errcode_t ext2fs_inline_data_set(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + void *buf, size_t size) +{ + struct ext2_inode inode_buf; + struct ext2_inline_data data = { + .fs = fs, + .ino = ino, + }; + errcode_t retval; + size_t free_ea_size, existing_size, free_inode_size; + + if (!inode) { + retval = ext2fs_read_inode(fs, ino, &inode_buf); + if (retval) + return retval; + inode = &inode_buf; + } + + if (size <= EXT4_MIN_INLINE_DATA_SIZE) { + memcpy((void *)inode->i_block, buf, size); + } else { + retval = ext2fs_xattr_inode_max_size(fs, ino, &free_ea_size); + if (retval) + return retval; + + retval = ext2fs_inline_data_size(fs, ino, &existing_size); + if (retval) + return retval; + + if (existing_size < EXT4_MIN_INLINE_DATA_SIZE) { + free_inode_size = EXT4_MIN_INLINE_DATA_SIZE - + existing_size; + } else { + free_inode_size = 0; + } + + if (size != existing_size && + size > existing_size + free_ea_size + free_inode_size) + return EXT2_ET_INLINE_DATA_NO_SPACE; + + memcpy((void *)inode->i_block, buf, EXT4_MIN_INLINE_DATA_SIZE); + if (size > EXT4_MIN_INLINE_DATA_SIZE) + data.ea_size = size - EXT4_MIN_INLINE_DATA_SIZE; + data.ea_data = (char *) buf + EXT4_MIN_INLINE_DATA_SIZE; + } + retval = ext2fs_write_inode(fs, ino, inode); + if (retval) + return retval; + return ext2fs_inline_data_ea_set(&data); +} + +#ifdef DEBUG +#include "e2p/e2p.h" + +/* + * The length of buffer is set to 64 because in inode's i_block member it only + * can save 60 bytes. Thus this value can let the data being saved in extra + * space. + */ +#define BUFF_SIZE (64) + +static errcode_t file_test(ext2_filsys fs) +{ + struct ext2_inode inode; + ext2_ino_t newfile; + errcode_t retval; + size_t size; + char *buf = 0, *cmpbuf = 0; + + /* create a new file */ + retval = ext2fs_new_inode(fs, 2, 010755, 0, &newfile); + if (retval) { + com_err("file_test", retval, "while allocating a new inode"); + return 1; + } + + memset(&inode, 0, sizeof(inode)); + inode.i_flags |= EXT4_INLINE_DATA_FL; + inode.i_size = EXT4_MIN_INLINE_DATA_SIZE; + inode.i_mode = LINUX_S_IFREG; + retval = ext2fs_write_new_inode(fs, newfile, &inode); + if (retval) { + com_err("file_test", retval, "while writing a new inode"); + return 1; + } + + retval = ext2fs_inline_data_init(fs, newfile); + if (retval) { + com_err("file_test", retval, "while init 'system.data'"); + return 1; + } + + retval = ext2fs_inline_data_size(fs, newfile, &size); + if (retval) { + com_err("file_test", retval, "while getting size"); + return 1; + } + + if (size != EXT4_MIN_INLINE_DATA_SIZE) { + fprintf(stderr, + "tst_inline_data: size of inline data is wrong\n"); + return 1; + } + + ext2fs_get_mem(BUFF_SIZE, &buf); + memset(buf, 'a', BUFF_SIZE); + retval = ext2fs_inline_data_set(fs, newfile, 0, buf, BUFF_SIZE); + if (retval) { + com_err("file_test", retval, + "while setting inline data %s", buf); + goto err; + } + + ext2fs_get_mem(BUFF_SIZE, &cmpbuf); + retval = ext2fs_inline_data_get(fs, newfile, 0, cmpbuf, &size); + if (retval) { + com_err("file_test", retval, "while getting inline data"); + goto err; + } + + if (size != BUFF_SIZE) { + fprintf(stderr, + "tst_inline_data: size %zu != buflen %u\n", + size, BUFF_SIZE); + retval = 1; + goto err; + } + + if (memcmp(buf, cmpbuf, BUFF_SIZE)) { + fprintf(stderr, "tst_inline_data: buf != cmpbuf\n"); + retval = 1; + goto err; + } + + retval = ext2fs_punch(fs, newfile, 0, 0, 0, ~0ULL); + if (retval) { + com_err("file_test", retval, "while truncating inode"); + goto err; + } + + /* reload inode and check isize */ + ext2fs_read_inode(fs, newfile, &inode); + if (inode.i_size != 0) { + fprintf(stderr, "tst_inline_data: i_size should be 0\n"); + retval = 1; + } + +err: + if (cmpbuf) + ext2fs_free_mem(&cmpbuf); + if (buf) + ext2fs_free_mem(&buf); + return retval; +} + +static errcode_t dir_test(ext2_filsys fs) +{ + const char *dot_name = "."; + const char *stub_name = "stub"; + const char *parent_name = "test"; + ext2_ino_t parent, dir, tmp; + errcode_t retval; + char dirname[32]; + int i; + + retval = ext2fs_mkdir(fs, 11, 11, stub_name); + if (retval) { + com_err("dir_test", retval, "while creating %s dir", stub_name); + return retval; + } + + retval = ext2fs_mkdir(fs, 11, 0, parent_name); + if (retval) { + com_err("dir_test", retval, + "while creating %s dir", parent_name); + return retval; + } + + retval = ext2fs_lookup(fs, 11, parent_name, strlen(parent_name), + 0, &parent); + if (retval) { + com_err("dir_test", retval, + "while looking up %s dir", parent_name); + return retval; + } + + retval = ext2fs_lookup(fs, parent, dot_name, strlen(dot_name), + 0, &tmp); + if (retval) { + com_err("dir_test", retval, + "while looking up %s dir", parent_name); + return retval; + } + + if (parent != tmp) { + fprintf(stderr, "tst_inline_data: parent (%u) != tmp (%u)\n", + parent, tmp); + return 1; + } + + for (i = 0, dir = 13; i < 4; i++, dir++) { + tmp = 0; + snprintf(dirname, sizeof(dirname), "%d", i); + retval = ext2fs_mkdir(fs, parent, 0, dirname); + if (retval) { + com_err("dir_test", retval, + "while creating %s dir", dirname); + return retval; + } + + retval = ext2fs_lookup(fs, parent, dirname, strlen(dirname), + 0, &tmp); + if (retval) { + com_err("dir_test", retval, + "while looking up %s dir", parent_name); + return retval; + } + + if (dir != tmp) { + fprintf(stderr, + "tst_inline_data: dir (%u) != tmp (%u)\n", + dir, tmp); + return 1; + } + } + + snprintf(dirname, sizeof(dirname), "%d", i); + retval = ext2fs_mkdir(fs, parent, 0, dirname); + if (retval && retval != EXT2_ET_DIR_NO_SPACE) { + com_err("dir_test", retval, "while creating %s dir", dirname); + return retval; + } + + retval = ext2fs_expand_dir(fs, parent); + if (retval) { + com_err("dir_test", retval, "while expanding %s dir", parent_name); + return retval; + } + + return 0; +} + +int main(int argc, char *argv[]) +{ + ext2_filsys fs; + struct ext2_super_block param; + errcode_t retval; + + /* setup */ + initialize_ext2_error_table(); + + memset(¶m, 0, sizeof(param)); + ext2fs_blocks_count_set(¶m, 32768); + param.s_inodes_count = 100; + + param.s_feature_incompat |= EXT4_FEATURE_INCOMPAT_INLINE_DATA; + param.s_rev_level = EXT2_DYNAMIC_REV; + param.s_inode_size = 256; + + retval = ext2fs_initialize("test fs", EXT2_FLAG_64BITS, ¶m, + test_io_manager, &fs); + if (retval) { + com_err("setup", retval, + "while initializing filesystem"); + exit(1); + } + + retval = ext2fs_allocate_tables(fs); + if (retval) { + com_err("setup", retval, + "while allocating tables for test filesystem"); + exit(1); + } + + /* initialize inode cache */ + if (!fs->icache) { + ext2_ino_t first_ino = EXT2_FIRST_INO(fs->super); + int i; + + /* we just want to init inode cache. So ignore error */ + ext2fs_create_inode_cache(fs, 16); + if (!fs->icache) { + fprintf(stderr, + "tst_inline_data: init inode cache failed\n"); + exit(1); + } + + /* setup inode cache */ + for (i = 0; i < fs->icache->cache_size; i++) + fs->icache->cache[i].ino = first_ino++; + } + + /* test */ + if (file_test(fs)) { + fprintf(stderr, "tst_inline_data(FILE): FAILED\n"); + return 1; + } + printf("tst_inline_data(FILE): OK\n"); + + if (dir_test(fs)) { + fprintf(stderr, "tst_inline_data(DIR): FAILED\n"); + return 1; + } + printf("tst_inline_data(DIR): OK\n"); + ext2fs_free(fs); + + return 0; +} +#endif diff --git a/lib/ext2fs/inode.c b/lib/ext2fs/inode.c new file mode 100644 index 0000000..957d5aa --- /dev/null +++ b/lib/ext2fs/inode.c @@ -0,0 +1,1122 @@ +/* + * inode.c --- utility routines to read and write inodes + * + * Copyright (C) 1993, 1994, 1995, 1996, 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" +#include "e2image.h" + +#define IBLOCK_STATUS_CSUMS_OK 1 +#define IBLOCK_STATUS_INSANE 2 +#define SCAN_BLOCK_STATUS(scan) ((scan)->temp_buffer + (scan)->inode_size) + +struct ext2_struct_inode_scan { + errcode_t magic; + ext2_filsys fs; + ext2_ino_t current_inode; + blk64_t current_block; + dgrp_t current_group; + ext2_ino_t inodes_left; + blk_t blocks_left; + dgrp_t groups_left; + blk_t inode_buffer_blocks; + char * inode_buffer; + int inode_size; + char * ptr; + int bytes_left; + char *temp_buffer; + errcode_t (*done_group)(ext2_filsys fs, + ext2_inode_scan scan, + dgrp_t group, + void * priv_data); + void * done_group_data; + int bad_block_ptr; + int scan_flags; + int reserved[6]; +}; + +/* + * This routine flushes the icache, if it exists. + */ +errcode_t ext2fs_flush_icache(ext2_filsys fs) +{ + unsigned i; + + if (!fs->icache) + return 0; + + for (i=0; i < fs->icache->cache_size; i++) + fs->icache->cache[i].ino = 0; + + fs->icache->buffer_blk = 0; + return 0; +} + +/* + * Free the inode cache structure + */ +void ext2fs_free_inode_cache(struct ext2_inode_cache *icache) +{ + unsigned i; + + if (--icache->refcount) + return; + if (icache->buffer) + ext2fs_free_mem(&icache->buffer); + for (i = 0; i < icache->cache_size; i++) + ext2fs_free_mem(&icache->cache[i].inode); + if (icache->cache) + ext2fs_free_mem(&icache->cache); + icache->buffer_blk = 0; + ext2fs_free_mem(&icache); +} + +errcode_t ext2fs_create_inode_cache(ext2_filsys fs, unsigned int cache_size) +{ + unsigned i; + errcode_t retval; + + if (fs->icache) + return 0; + retval = ext2fs_get_mem(sizeof(struct ext2_inode_cache), &fs->icache); + if (retval) + return retval; + + memset(fs->icache, 0, sizeof(struct ext2_inode_cache)); + retval = ext2fs_get_mem(fs->blocksize, &fs->icache->buffer); + if (retval) + goto errout; + + fs->icache->buffer_blk = 0; + fs->icache->cache_last = -1; + fs->icache->cache_size = cache_size; + fs->icache->refcount = 1; + retval = ext2fs_get_array(fs->icache->cache_size, + sizeof(struct ext2_inode_cache_ent), + &fs->icache->cache); + if (retval) + goto errout; + + for (i = 0; i < fs->icache->cache_size; i++) { + retval = ext2fs_get_mem(EXT2_INODE_SIZE(fs->super), + &fs->icache->cache[i].inode); + if (retval) + goto errout; + } + + ext2fs_flush_icache(fs); + return 0; +errout: + ext2fs_free_inode_cache(fs->icache); + fs->icache = 0; + return retval; +} + +errcode_t ext2fs_open_inode_scan(ext2_filsys fs, int buffer_blocks, + ext2_inode_scan *ret_scan) +{ + ext2_inode_scan scan; + errcode_t retval; + errcode_t (*save_get_blocks)(ext2_filsys f, ext2_ino_t ino, blk_t *blocks); + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (ext2fs_has_feature_journal_dev(fs->super)) + return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP; + + if (fs->blocksize < 1024) + return EXT2_FILSYS_CORRUPTED; /* Should never happen */ + + /* + * If fs->badblocks isn't set, then set it --- since the inode + * scanning functions require it. + */ + if (fs->badblocks == 0) { + /* + * Temporarily save fs->get_blocks and set it to zero, + * for compatibility with old e2fsck's. + */ + save_get_blocks = fs->get_blocks; + fs->get_blocks = 0; + retval = ext2fs_read_bb_inode(fs, &fs->badblocks); + if (retval && fs->badblocks) { + ext2fs_badblocks_list_free(fs->badblocks); + fs->badblocks = 0; + } + fs->get_blocks = save_get_blocks; + } + + retval = ext2fs_get_mem(sizeof(struct ext2_struct_inode_scan), &scan); + if (retval) + return retval; + memset(scan, 0, sizeof(struct ext2_struct_inode_scan)); + + scan->magic = EXT2_ET_MAGIC_INODE_SCAN; + scan->fs = fs; + scan->inode_size = EXT2_INODE_SIZE(fs->super); + scan->bytes_left = 0; + scan->current_group = 0; + scan->groups_left = fs->group_desc_count - 1; + scan->inode_buffer_blocks = buffer_blocks ? buffer_blocks : + EXT2_INODE_SCAN_DEFAULT_BUFFER_BLOCKS; + scan->current_block = ext2fs_inode_table_loc(scan->fs, + scan->current_group); + if (scan->current_block && + ((scan->current_block < fs->super->s_first_data_block) || + (scan->current_block + fs->inode_blocks_per_group - 1 >= + ext2fs_blocks_count(fs->super)))) { + ext2fs_free_mem(&scan); + return EXT2_ET_GDESC_BAD_INODE_TABLE; + } + + scan->inodes_left = EXT2_INODES_PER_GROUP(scan->fs->super); + scan->blocks_left = scan->fs->inode_blocks_per_group; + if (ext2fs_has_group_desc_csum(fs)) { + __u32 unused = ext2fs_bg_itable_unused(fs, scan->current_group); + if (scan->inodes_left > unused) + scan->inodes_left -= unused; + else + scan->inodes_left = 0; + scan->blocks_left = + (scan->inodes_left + + (fs->blocksize / scan->inode_size - 1)) * + scan->inode_size / fs->blocksize; + } + retval = io_channel_alloc_buf(fs->io, scan->inode_buffer_blocks, + &scan->inode_buffer); + scan->done_group = 0; + scan->done_group_data = 0; + scan->bad_block_ptr = 0; + if (retval) { + ext2fs_free_mem(&scan); + return retval; + } + retval = ext2fs_get_mem(scan->inode_size + scan->inode_buffer_blocks, + &scan->temp_buffer); + if (retval) { + ext2fs_free_mem(&scan->inode_buffer); + ext2fs_free_mem(&scan); + return retval; + } + memset(SCAN_BLOCK_STATUS(scan), 0, scan->inode_buffer_blocks); + if (scan->fs->badblocks && scan->fs->badblocks->num) + scan->scan_flags |= EXT2_SF_CHK_BADBLOCKS; + if (ext2fs_has_group_desc_csum(fs)) + scan->scan_flags |= EXT2_SF_DO_LAZY; + *ret_scan = scan; + return 0; +} + +void ext2fs_close_inode_scan(ext2_inode_scan scan) +{ + if (!scan || (scan->magic != EXT2_ET_MAGIC_INODE_SCAN)) + return; + + ext2fs_free_mem(&scan->inode_buffer); + scan->inode_buffer = NULL; + ext2fs_free_mem(&scan->temp_buffer); + scan->temp_buffer = NULL; + ext2fs_free_mem(&scan); + return; +} + +void ext2fs_set_inode_callback(ext2_inode_scan scan, + errcode_t (*done_group)(ext2_filsys fs, + ext2_inode_scan scan, + dgrp_t group, + void * priv_data), + void *done_group_data) +{ + if (!scan || (scan->magic != EXT2_ET_MAGIC_INODE_SCAN)) + return; + + scan->done_group = done_group; + scan->done_group_data = done_group_data; +} + +int ext2fs_inode_scan_flags(ext2_inode_scan scan, int set_flags, + int clear_flags) +{ + int old_flags; + + if (!scan || (scan->magic != EXT2_ET_MAGIC_INODE_SCAN)) + return 0; + + old_flags = scan->scan_flags; + scan->scan_flags &= ~clear_flags; + scan->scan_flags |= set_flags; + return old_flags; +} + +/* + * This function is called by ext2fs_get_next_inode when it needs to + * get ready to read in a new blockgroup. + */ +static errcode_t get_next_blockgroup(ext2_inode_scan scan) +{ + ext2_filsys fs = scan->fs; + + scan->current_group++; + scan->groups_left--; + + scan->current_block = ext2fs_inode_table_loc(scan->fs, + scan->current_group); + scan->current_inode = scan->current_group * + EXT2_INODES_PER_GROUP(fs->super); + + scan->bytes_left = 0; + scan->inodes_left = EXT2_INODES_PER_GROUP(fs->super); + scan->blocks_left = fs->inode_blocks_per_group; + if (ext2fs_has_group_desc_csum(fs)) { + __u32 unused = ext2fs_bg_itable_unused(fs, scan->current_group); + if (scan->inodes_left > unused) + scan->inodes_left -= unused; + else + scan->inodes_left = 0; + scan->blocks_left = + (scan->inodes_left + + (fs->blocksize / scan->inode_size - 1)) * + scan->inode_size / fs->blocksize; + } + if (scan->current_block && + ((scan->current_block < fs->super->s_first_data_block) || + (scan->current_block + fs->inode_blocks_per_group - 1 >= + ext2fs_blocks_count(fs->super)))) + return EXT2_ET_GDESC_BAD_INODE_TABLE; + return 0; +} + +errcode_t ext2fs_inode_scan_goto_blockgroup(ext2_inode_scan scan, + int group) +{ + scan->current_group = group - 1; + scan->groups_left = scan->fs->group_desc_count - group; + scan->bad_block_ptr = 0; + return get_next_blockgroup(scan); +} + +/* + * This function is called by get_next_blocks() to check for bad + * blocks in the inode table. + * + * This function assumes that badblocks_list->list is sorted in + * increasing order. + */ +static errcode_t check_for_inode_bad_blocks(ext2_inode_scan scan, + blk64_t *num_blocks) +{ + blk64_t blk = scan->current_block; + badblocks_list bb = scan->fs->badblocks; + + /* + * If the inode table is missing, then obviously there are no + * bad blocks. :-) + */ + if (blk == 0) + return 0; + + /* Make sure bad_block_ptr is still valid */ + if (scan->bad_block_ptr >= bb->num) { + scan->scan_flags &= ~EXT2_SF_CHK_BADBLOCKS; + return 0; + } + + /* + * If the current block is greater than the bad block listed + * in the bad block list, then advance the pointer until this + * is no longer the case. If we run out of bad blocks, then + * we don't need to do any more checking! + */ + while (blk > bb->list[scan->bad_block_ptr]) { + if (++scan->bad_block_ptr >= bb->num) { + scan->scan_flags &= ~EXT2_SF_CHK_BADBLOCKS; + return 0; + } + } + + /* + * If the current block is equal to the bad block listed in + * the bad block list, then handle that one block specially. + * (We could try to handle runs of bad blocks, but that + * only increases CPU efficiency by a small amount, at the + * expense of a huge expense of code complexity, and for an + * uncommon case at that.) + */ + if (blk == bb->list[scan->bad_block_ptr]) { + scan->scan_flags |= EXT2_SF_BAD_INODE_BLK; + *num_blocks = 1; + if (++scan->bad_block_ptr >= bb->num) + scan->scan_flags &= ~EXT2_SF_CHK_BADBLOCKS; + return 0; + } + + /* + * If there is a bad block in the range that we're about to + * read in, adjust the number of blocks to read so that we we + * don't read in the bad block. (Then the next block to read + * will be the bad block, which is handled in the above case.) + */ + if ((blk + *num_blocks) > bb->list[scan->bad_block_ptr]) + *num_blocks = (int) (bb->list[scan->bad_block_ptr] - blk); + + return 0; +} + +static int block_map_looks_insane(ext2_filsys fs, + struct ext2_inode_large *inode) +{ + unsigned int i, bad; + + /* We're only interested in block mapped files, dirs, and symlinks */ + if ((inode->i_flags & EXT4_INLINE_DATA_FL) || + (inode->i_flags & EXT4_EXTENTS_FL)) + return 0; + if (!LINUX_S_ISREG(inode->i_mode) && + !LINUX_S_ISLNK(inode->i_mode) && + !LINUX_S_ISDIR(inode->i_mode)) + return 0; + if (LINUX_S_ISLNK(inode->i_mode) && + EXT2_I_SIZE(inode) <= sizeof(inode->i_block)) + return 0; + + /* Unused inodes probably aren't insane */ + if (inode->i_links_count == 0) + return 0; + + /* See if more than half the block maps are insane */ + for (i = 0, bad = 0; i < EXT2_N_BLOCKS; i++) + if (inode->i_block[i] != 0 && + (inode->i_block[i] < fs->super->s_first_data_block || + inode->i_block[i] >= ext2fs_blocks_count(fs->super))) + bad++; + return bad > EXT2_N_BLOCKS / 2; +} + +static int extent_head_looks_insane(struct ext2_inode_large *inode) +{ + if (!(inode->i_flags & EXT4_EXTENTS_FL) || + ext2fs_extent_header_verify(inode->i_block, + sizeof(inode->i_block)) == 0) + return 0; + return 1; +} + +/* + * Check all the inodes that we just read into the buffer. Record what we + * find here -- currently, we can observe that all checksums are ok; more + * than half the inodes are insane; or no conclusions at all. + */ +static void check_inode_block_sanity(ext2_inode_scan scan, blk64_t num_blocks) +{ + ext2_ino_t ino, inodes_to_scan; + unsigned int badness, checksum_failures; + unsigned int inodes_in_buf, inodes_per_block; + char *p; + struct ext2_inode_large *inode; + char *block_status; + unsigned int blk, bad_csum; + + if (!(scan->scan_flags & EXT2_SF_WARN_GARBAGE_INODES)) + return; + + inodes_to_scan = scan->inodes_left; + inodes_in_buf = num_blocks * scan->fs->blocksize / scan->inode_size; + if (inodes_to_scan > inodes_in_buf) + inodes_to_scan = inodes_in_buf; + + p = (char *) scan->inode_buffer; + ino = scan->current_inode + 1; + checksum_failures = badness = 0; + block_status = SCAN_BLOCK_STATUS(scan); + memset(block_status, 0, scan->inode_buffer_blocks); + inodes_per_block = EXT2_INODES_PER_BLOCK(scan->fs->super); + + if (inodes_per_block < 2) + return; + +#ifdef WORDS_BIGENDIAN + if (ext2fs_get_mem(EXT2_INODE_SIZE(scan->fs->super), &inode)) + return; +#endif + + while (inodes_to_scan > 0) { + blk = (p - (char *)scan->inode_buffer) / scan->fs->blocksize; + bad_csum = ext2fs_inode_csum_verify(scan->fs, ino, + (struct ext2_inode_large *) p) == 0; + +#ifdef WORDS_BIGENDIAN + ext2fs_swap_inode_full(scan->fs, + (struct ext2_inode_large *) inode, + (struct ext2_inode_large *) p, + 0, EXT2_INODE_SIZE(scan->fs->super)); +#else + inode = (struct ext2_inode_large *) p; +#endif + + /* Is this inode insane? */ + if (bad_csum) { + checksum_failures++; + badness++; + } else if (extent_head_looks_insane(inode) || + block_map_looks_insane(scan->fs, inode)) + badness++; + + /* If more than half are insane, declare the whole block bad */ + if (badness > inodes_per_block / 2) { + unsigned int ino_adj; + + block_status[blk] |= IBLOCK_STATUS_INSANE; + ino_adj = inodes_per_block - + ((ino - 1) % inodes_per_block); + if (ino_adj > inodes_to_scan) + ino_adj = inodes_to_scan; + inodes_to_scan -= ino_adj; + p += scan->inode_size * ino_adj; + ino += ino_adj; + checksum_failures = badness = 0; + continue; + } + + if ((ino % inodes_per_block) == 0) { + if (checksum_failures == 0) + block_status[blk] |= IBLOCK_STATUS_CSUMS_OK; + checksum_failures = badness = 0; + } + inodes_to_scan--; + p += scan->inode_size; + ino++; + }; + +#ifdef WORDS_BIGENDIAN + ext2fs_free_mem(&inode); +#endif +} + +/* + * This function is called by ext2fs_get_next_inode when it needs to + * read in more blocks from the current blockgroup's inode table. + */ +static errcode_t get_next_blocks(ext2_inode_scan scan) +{ + blk64_t num_blocks; + errcode_t retval; + + /* + * Figure out how many blocks to read; we read at most + * inode_buffer_blocks, and perhaps less if there aren't that + * many blocks left to read. + */ + num_blocks = scan->inode_buffer_blocks; + if (num_blocks > scan->blocks_left) + num_blocks = scan->blocks_left; + + /* + * If the past block "read" was a bad block, then mark the + * left-over extra bytes as also being bad. + */ + if (scan->scan_flags & EXT2_SF_BAD_INODE_BLK) { + if (scan->bytes_left) + scan->scan_flags |= EXT2_SF_BAD_EXTRA_BYTES; + scan->scan_flags &= ~EXT2_SF_BAD_INODE_BLK; + } + + /* + * Do inode bad block processing, if necessary. + */ + if (scan->scan_flags & EXT2_SF_CHK_BADBLOCKS) { + retval = check_for_inode_bad_blocks(scan, &num_blocks); + if (retval) + return retval; + } + + if ((scan->scan_flags & EXT2_SF_BAD_INODE_BLK) || + (scan->current_block == 0)) { + memset(scan->inode_buffer, 0, + (size_t) num_blocks * scan->fs->blocksize); + } else { + retval = io_channel_read_blk64(scan->fs->io, + scan->current_block, + (int) num_blocks, + scan->inode_buffer); + if (retval) + return EXT2_ET_NEXT_INODE_READ; + } + check_inode_block_sanity(scan, num_blocks); + + scan->ptr = scan->inode_buffer; + scan->bytes_left = num_blocks * scan->fs->blocksize; + + scan->blocks_left -= num_blocks; + if (scan->current_block) + scan->current_block += num_blocks; + + return 0; +} + +#if 0 +/* + * Returns 1 if the entire inode_buffer has a non-zero size and + * contains all zeros. (Not just deleted inodes, since that means + * that part of the inode table was used at one point; we want all + * zeros, which means that the inode table is pristine.) + */ +static inline int is_empty_scan(ext2_inode_scan scan) +{ + int i; + + if (scan->bytes_left == 0) + return 0; + + for (i=0; i < scan->bytes_left; i++) + if (scan->ptr[i]) + return 0; + return 1; +} +#endif + +errcode_t ext2fs_get_next_inode_full(ext2_inode_scan scan, ext2_ino_t *ino, + struct ext2_inode *inode, int bufsize) +{ + errcode_t retval; + int extra_bytes = 0; + int length; + struct ext2_inode_large *iptr = (struct ext2_inode_large *)inode; + char *iblock_status; + unsigned int iblk; + + EXT2_CHECK_MAGIC(scan, EXT2_ET_MAGIC_INODE_SCAN); + length = EXT2_INODE_SIZE(scan->fs->super); + iblock_status = SCAN_BLOCK_STATUS(scan); + + /* + * Do we need to start reading a new block group? + */ + if (scan->inodes_left <= 0) { + force_new_group: + if (scan->done_group) { + retval = (scan->done_group) + (scan->fs, scan, scan->current_group, + scan->done_group_data); + if (retval) + return retval; + } + if (scan->groups_left <= 0) { + *ino = 0; + return 0; + } + retval = get_next_blockgroup(scan); + if (retval) + return retval; + } + /* + * These checks are done outside the above if statement so + * they can be done for block group #0. + */ + if ((scan->scan_flags & EXT2_SF_DO_LAZY) && + (ext2fs_bg_flags_test(scan->fs, scan->current_group, EXT2_BG_INODE_UNINIT) + )) + goto force_new_group; + if (scan->inodes_left == 0) + goto force_new_group; + if (scan->current_block == 0) { + if (scan->scan_flags & EXT2_SF_SKIP_MISSING_ITABLE) { + goto force_new_group; + } else + return EXT2_ET_MISSING_INODE_TABLE; + } + + + /* + * Have we run out of space in the inode buffer? If so, we + * need to read in more blocks. + */ + if (scan->bytes_left < scan->inode_size) { + if (scan->bytes_left) + memcpy(scan->temp_buffer, scan->ptr, scan->bytes_left); + extra_bytes = scan->bytes_left; + + retval = get_next_blocks(scan); + if (retval) + return retval; +#if 0 + /* + * XXX test Need check for used inode somehow. + * (Note: this is hard.) + */ + if (is_empty_scan(scan)) + goto force_new_group; +#endif + } + + if (bufsize < length) { + retval = ext2fs_get_mem(length, &iptr); + if (retval) + return retval; + } + + retval = 0; + iblk = scan->current_inode % EXT2_INODES_PER_GROUP(scan->fs->super) / + EXT2_INODES_PER_BLOCK(scan->fs->super) % + scan->inode_buffer_blocks; + if (extra_bytes) { + memcpy(scan->temp_buffer+extra_bytes, scan->ptr, + scan->inode_size - extra_bytes); + scan->ptr += scan->inode_size - extra_bytes; + scan->bytes_left -= scan->inode_size - extra_bytes; + + /* Verify the inode checksum. */ + if (!(iblock_status[iblk] & IBLOCK_STATUS_CSUMS_OK) && + !(scan->fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) && + !ext2fs_inode_csum_verify(scan->fs, scan->current_inode + 1, + (struct ext2_inode_large *)scan->temp_buffer)) + retval = EXT2_ET_INODE_CSUM_INVALID; + +#ifdef WORDS_BIGENDIAN + memset(iptr, 0, length); + ext2fs_swap_inode_full(scan->fs, + (struct ext2_inode_large *) iptr, + (struct ext2_inode_large *) scan->temp_buffer, + 0, length); +#else + memcpy(iptr, scan->temp_buffer, length); +#endif + if (scan->scan_flags & EXT2_SF_BAD_EXTRA_BYTES) + retval = EXT2_ET_BAD_BLOCK_IN_INODE_TABLE; + scan->scan_flags &= ~EXT2_SF_BAD_EXTRA_BYTES; + } else { + /* Verify the inode checksum. */ + if (!(iblock_status[iblk] & IBLOCK_STATUS_CSUMS_OK) && + !(scan->fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) && + !ext2fs_inode_csum_verify(scan->fs, scan->current_inode + 1, + (struct ext2_inode_large *)scan->ptr)) + retval = EXT2_ET_INODE_CSUM_INVALID; + +#ifdef WORDS_BIGENDIAN + memset(iptr, 0, length); + ext2fs_swap_inode_full(scan->fs, + (struct ext2_inode_large *) iptr, + (struct ext2_inode_large *) scan->ptr, + 0, length); +#else + memcpy(iptr, scan->ptr, length); +#endif + scan->ptr += scan->inode_size; + scan->bytes_left -= scan->inode_size; + if (scan->scan_flags & EXT2_SF_BAD_INODE_BLK) + retval = EXT2_ET_BAD_BLOCK_IN_INODE_TABLE; + } + if ((iblock_status[iblk] & IBLOCK_STATUS_INSANE) && + (retval == 0 || retval == EXT2_ET_INODE_CSUM_INVALID)) + retval = EXT2_ET_INODE_IS_GARBAGE; + + scan->inodes_left--; + scan->current_inode++; + *ino = scan->current_inode; + if (iptr != (struct ext2_inode_large *)inode) { + memcpy(inode, iptr, bufsize); + ext2fs_free_mem(&iptr); + } + return retval; +} + +errcode_t ext2fs_get_next_inode(ext2_inode_scan scan, ext2_ino_t *ino, + struct ext2_inode *inode) +{ + return ext2fs_get_next_inode_full(scan, ino, inode, + sizeof(struct ext2_inode)); +} + +/* + * Functions to read and write a single inode. + */ +errcode_t ext2fs_read_inode2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode, int bufsize, + int flags) +{ + blk64_t block_nr; + dgrp_t group; + unsigned long block, offset; + char *ptr; + errcode_t retval; + unsigned i; + int clen, inodes_per_block; + io_channel io; + int length = EXT2_INODE_SIZE(fs->super); + struct ext2_inode_large *iptr; + int cache_slot, fail_csum; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (ext2fs_has_feature_journal_dev(fs->super)) + return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP; + + if (fs->blocksize < 1024) + return EXT2_FILSYS_CORRUPTED; /* Should never happen */ + + /* Check to see if user has an override function */ + if (fs->read_inode && + ((bufsize == sizeof(struct ext2_inode)) || + (EXT2_INODE_SIZE(fs->super) == sizeof(struct ext2_inode)))) { + retval = (fs->read_inode)(fs, ino, inode); + if (retval != EXT2_ET_CALLBACK_NOTHANDLED) + return retval; + } + if ((ino == 0) || (ino > fs->super->s_inodes_count)) + return EXT2_ET_BAD_INODE_NUM; + /* Create inode cache if not present */ + if (!fs->icache) { + retval = ext2fs_create_inode_cache(fs, 4); + if (retval) + return retval; + } + /* Check to see if it's in the inode cache */ + for (i = 0; i < fs->icache->cache_size; i++) { + if (fs->icache->cache[i].ino == ino) { + memcpy(inode, fs->icache->cache[i].inode, + (bufsize > length) ? length : bufsize); + return 0; + } + } + if (fs->flags & EXT2_FLAG_IMAGE_FILE) { + inodes_per_block = fs->blocksize / EXT2_INODE_SIZE(fs->super); + block_nr = ext2fs_le32_to_cpu(fs->image_header->offset_inode) / fs->blocksize; + block_nr += (ino - 1) / inodes_per_block; + offset = ((ino - 1) % inodes_per_block) * + EXT2_INODE_SIZE(fs->super); + io = fs->image_io; + } else { + group = (ino - 1) / EXT2_INODES_PER_GROUP(fs->super); + if (group > fs->group_desc_count) + return EXT2_ET_BAD_INODE_NUM; + offset = ((ino - 1) % EXT2_INODES_PER_GROUP(fs->super)) * + EXT2_INODE_SIZE(fs->super); + block = offset >> EXT2_BLOCK_SIZE_BITS(fs->super); + block_nr = ext2fs_inode_table_loc(fs, group); + if (!block_nr) + return EXT2_ET_MISSING_INODE_TABLE; + if ((block_nr < fs->super->s_first_data_block) || + (block_nr + fs->inode_blocks_per_group - 1 >= + ext2fs_blocks_count(fs->super))) + return EXT2_ET_GDESC_BAD_INODE_TABLE; + block_nr += block; + io = fs->io; + } + offset &= (EXT2_BLOCK_SIZE(fs->super) - 1); + + cache_slot = (fs->icache->cache_last + 1) % fs->icache->cache_size; + iptr = (struct ext2_inode_large *)fs->icache->cache[cache_slot].inode; + + ptr = (char *) iptr; + while (length) { + clen = length; + if ((offset + length) > fs->blocksize) + clen = fs->blocksize - offset; + + if (block_nr != fs->icache->buffer_blk) { + retval = io_channel_read_blk64(io, block_nr, 1, + fs->icache->buffer); + if (retval) + return retval; + fs->icache->buffer_blk = block_nr; + } + + memcpy(ptr, ((char *) fs->icache->buffer) + (unsigned) offset, + clen); + + offset = 0; + length -= clen; + ptr += clen; + block_nr++; + } + length = EXT2_INODE_SIZE(fs->super); + + /* Verify the inode checksum. */ + fail_csum = !ext2fs_inode_csum_verify(fs, ino, iptr); + +#ifdef WORDS_BIGENDIAN + ext2fs_swap_inode_full(fs, (struct ext2_inode_large *) iptr, + (struct ext2_inode_large *) iptr, + 0, length); +#endif + + /* Update the inode cache bookkeeping */ + if (!fail_csum) { + fs->icache->cache_last = cache_slot; + fs->icache->cache[cache_slot].ino = ino; + } + memcpy(inode, iptr, (bufsize > length) ? length : bufsize); + + if (!(fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) && + !(flags & READ_INODE_NOCSUM) && fail_csum) + return EXT2_ET_INODE_CSUM_INVALID; + + return 0; +} + +errcode_t ext2fs_read_inode_full(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode, int bufsize) +{ + return ext2fs_read_inode2(fs, ino, inode, bufsize, 0); +} + +errcode_t ext2fs_read_inode(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode) +{ + return ext2fs_read_inode2(fs, ino, inode, + sizeof(struct ext2_inode), 0); +} + +errcode_t ext2fs_write_inode2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode, int bufsize, + int flags) +{ + blk64_t block_nr; + dgrp_t group; + unsigned long block, offset; + errcode_t retval = 0; + struct ext2_inode_large *w_inode; + char *ptr; + unsigned i; + int clen; + int length = EXT2_INODE_SIZE(fs->super); + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (ext2fs_has_feature_journal_dev(fs->super)) + return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP; + + /* Check to see if user provided an override function */ + if (fs->write_inode) { + retval = (fs->write_inode)(fs, ino, inode); + if (retval != EXT2_ET_CALLBACK_NOTHANDLED) + return retval; + } + + if ((ino == 0) || (ino > fs->super->s_inodes_count)) + return EXT2_ET_BAD_INODE_NUM; + + /* Prepare our shadow buffer for read/modify/byteswap/write */ + retval = ext2fs_get_mem(length, &w_inode); + if (retval) + return retval; + + if (bufsize < length) { + retval = ext2fs_read_inode2(fs, ino, + (struct ext2_inode *)w_inode, + length, READ_INODE_NOCSUM); + if (retval) + goto errout; + } + + /* Check to see if the inode cache needs to be updated */ + if (fs->icache) { + for (i=0; i < fs->icache->cache_size; i++) { + if (fs->icache->cache[i].ino == ino) { + memcpy(fs->icache->cache[i].inode, inode, + (bufsize > length) ? length : bufsize); + break; + } + } + } else { + retval = ext2fs_create_inode_cache(fs, 4); + if (retval) + goto errout; + } + memcpy(w_inode, inode, (bufsize > length) ? length : bufsize); + + if (!(fs->flags & EXT2_FLAG_RW)) { + retval = EXT2_ET_RO_FILSYS; + goto errout; + } + +#ifdef WORDS_BIGENDIAN + ext2fs_swap_inode_full(fs, w_inode, w_inode, 1, length); +#endif + + if ((flags & WRITE_INODE_NOCSUM) == 0) { + retval = ext2fs_inode_csum_set(fs, ino, w_inode); + if (retval) + goto errout; + } + + group = (ino - 1) / EXT2_INODES_PER_GROUP(fs->super); + offset = ((ino - 1) % EXT2_INODES_PER_GROUP(fs->super)) * + EXT2_INODE_SIZE(fs->super); + block = offset >> EXT2_BLOCK_SIZE_BITS(fs->super); + block_nr = ext2fs_inode_table_loc(fs, (unsigned) group); + if (!block_nr) { + retval = EXT2_ET_MISSING_INODE_TABLE; + goto errout; + } + if ((block_nr < fs->super->s_first_data_block) || + (block_nr + fs->inode_blocks_per_group - 1 >= + ext2fs_blocks_count(fs->super))) { + retval = EXT2_ET_GDESC_BAD_INODE_TABLE; + goto errout; + } + block_nr += block; + + offset &= (EXT2_BLOCK_SIZE(fs->super) - 1); + + ptr = (char *) w_inode; + + while (length) { + clen = length; + if ((offset + length) > fs->blocksize) + clen = fs->blocksize - offset; + + if (fs->icache->buffer_blk != block_nr) { + retval = io_channel_read_blk64(fs->io, block_nr, 1, + fs->icache->buffer); + if (retval) + goto errout; + fs->icache->buffer_blk = block_nr; + } + + + memcpy((char *) fs->icache->buffer + (unsigned) offset, + ptr, clen); + + retval = io_channel_write_blk64(fs->io, block_nr, 1, + fs->icache->buffer); + if (retval) + goto errout; + + offset = 0; + ptr += clen; + length -= clen; + block_nr++; + } + + fs->flags |= EXT2_FLAG_CHANGED; +errout: + ext2fs_free_mem(&w_inode); + return retval; +} + +errcode_t ext2fs_write_inode_full(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode * inode, int bufsize) +{ + return ext2fs_write_inode2(fs, ino, inode, bufsize, 0); +} + +errcode_t ext2fs_write_inode(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode) +{ + return ext2fs_write_inode2(fs, ino, inode, + sizeof(struct ext2_inode), 0); +} + +/* + * This function should be called when writing a new inode. It makes + * sure that extra part of large inodes is initialized properly. + */ +errcode_t ext2fs_write_new_inode(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode) +{ + struct ext2_inode *buf; + int size = EXT2_INODE_SIZE(fs->super); + struct ext2_inode_large *large_inode; + errcode_t retval; + __u32 t = fs->now ? fs->now : time(NULL); + + if (!inode->i_ctime) + inode->i_ctime = t; + if (!inode->i_mtime) + inode->i_mtime = t; + if (!inode->i_atime) + inode->i_atime = t; + + if (size == sizeof(struct ext2_inode)) + return ext2fs_write_inode_full(fs, ino, inode, + sizeof(struct ext2_inode)); + + buf = malloc(size); + if (!buf) + return ENOMEM; + + memset(buf, 0, size); + *buf = *inode; + + large_inode = (struct ext2_inode_large *) buf; + large_inode->i_extra_isize = sizeof(struct ext2_inode_large) - + EXT2_GOOD_OLD_INODE_SIZE; + if (!large_inode->i_crtime) + large_inode->i_crtime = t; + + retval = ext2fs_write_inode_full(fs, ino, buf, size); + free(buf); + return retval; +} + + +errcode_t ext2fs_get_blocks(ext2_filsys fs, ext2_ino_t ino, blk_t *blocks) +{ + struct ext2_inode inode; + int i; + errcode_t retval; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (ino > fs->super->s_inodes_count) + return EXT2_ET_BAD_INODE_NUM; + + if (fs->get_blocks) { + if (!(*fs->get_blocks)(fs, ino, blocks)) + return 0; + } + retval = ext2fs_read_inode(fs, ino, &inode); + if (retval) + return retval; + for (i=0; i < EXT2_N_BLOCKS; i++) + blocks[i] = inode.i_block[i]; + return 0; +} + +errcode_t ext2fs_check_directory(ext2_filsys fs, ext2_ino_t ino) +{ + struct ext2_inode inode; + errcode_t retval; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (ino > fs->super->s_inodes_count) + return EXT2_ET_BAD_INODE_NUM; + + if (fs->check_directory) { + retval = (fs->check_directory)(fs, ino); + if (retval != EXT2_ET_CALLBACK_NOTHANDLED) + return retval; + } + retval = ext2fs_read_inode(fs, ino, &inode); + if (retval) + return retval; + if (!LINUX_S_ISDIR(inode.i_mode)) + return EXT2_ET_NO_DIRECTORY; + return 0; +} + diff --git a/lib/ext2fs/inode_io.c b/lib/ext2fs/inode_io.c new file mode 100644 index 0000000..d7474a6 --- /dev/null +++ b/lib/ext2fs/inode_io.c @@ -0,0 +1,290 @@ +/* + * inode_io.c --- This is allows an inode in an ext2 filesystem image + * to be accessed via the I/O manager interface. + * + * Copyright (C) 2002 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <time.h> + +#include "ext2_fs.h" +#include "ext2fs.h" + +/* + * For checking structure magic numbers... + */ + +#define EXT2_CHECK_MAGIC(struct, code) \ + if ((struct)->magic != (code)) return (code) + +struct inode_private_data { + int magic; + char name[32]; + ext2_file_t file; + ext2_filsys fs; + ext2_ino_t ino; + struct ext2_inode inode; + int flags; + struct inode_private_data *next; +}; + +#define CHANNEL_HAS_INODE 0x8000 + +static struct inode_private_data *top_intern; +static int ino_unique = 0; + +static errcode_t inode_open(const char *name, int flags, io_channel *channel); +static errcode_t inode_close(io_channel channel); +static errcode_t inode_set_blksize(io_channel channel, int blksize); +static errcode_t inode_read_blk(io_channel channel, unsigned long block, + int count, void *data); +static errcode_t inode_write_blk(io_channel channel, unsigned long block, + int count, const void *data); +static errcode_t inode_flush(io_channel channel); +static errcode_t inode_write_byte(io_channel channel, unsigned long offset, + int size, const void *data); +static errcode_t inode_read_blk64(io_channel channel, + unsigned long long block, int count, void *data); +static errcode_t inode_write_blk64(io_channel channel, + unsigned long long block, int count, const void *data); + +static struct struct_io_manager struct_inode_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "Inode I/O Manager", + .open = inode_open, + .close = inode_close, + .set_blksize = inode_set_blksize, + .read_blk = inode_read_blk, + .write_blk = inode_write_blk, + .flush = inode_flush, + .write_byte = inode_write_byte, + .read_blk64 = inode_read_blk64, + .write_blk64 = inode_write_blk64 +}; + +io_manager inode_io_manager = &struct_inode_manager; + +errcode_t ext2fs_inode_io_intern2(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + char **name) +{ + struct inode_private_data *data; + errcode_t retval; + + if ((retval = ext2fs_get_mem(sizeof(struct inode_private_data), + &data))) + return retval; + data->magic = EXT2_ET_MAGIC_INODE_IO_CHANNEL; + sprintf(data->name, "%u:%d", ino, ino_unique++); + data->file = 0; + data->fs = fs; + data->ino = ino; + data->flags = 0; + if (inode) { + memcpy(&data->inode, inode, sizeof(struct ext2_inode)); + data->flags |= CHANNEL_HAS_INODE; + } + data->next = top_intern; + top_intern = data; + *name = data->name; + return 0; +} + +errcode_t ext2fs_inode_io_intern(ext2_filsys fs, ext2_ino_t ino, + char **name) +{ + return ext2fs_inode_io_intern2(fs, ino, NULL, name); +} + + +static errcode_t inode_open(const char *name, int flags, io_channel *channel) +{ + io_channel io = NULL; + struct inode_private_data *prev, *data = NULL; + errcode_t retval; + int open_flags; + + if (name == 0) + return EXT2_ET_BAD_DEVICE_NAME; + + for (data = top_intern, prev = NULL; data; + prev = data, data = data->next) + if (strcmp(name, data->name) == 0) + break; + if (!data) + return ENOENT; + if (prev) + prev->next = data->next; + else + top_intern = data->next; + + retval = ext2fs_get_mem(sizeof(struct struct_io_channel), &io); + if (retval) + goto cleanup; + memset(io, 0, sizeof(struct struct_io_channel)); + + io->magic = EXT2_ET_MAGIC_IO_CHANNEL; + io->manager = inode_io_manager; + retval = ext2fs_get_mem(strlen(name)+1, &io->name); + if (retval) + goto cleanup; + + strcpy(io->name, name); + io->private_data = data; + io->block_size = 1024; + io->read_error = 0; + io->write_error = 0; + io->refcount = 1; + + open_flags = (flags & IO_FLAG_RW) ? EXT2_FILE_WRITE : 0; + retval = ext2fs_file_open2(data->fs, data->ino, + (data->flags & CHANNEL_HAS_INODE) ? + &data->inode : 0, open_flags, + &data->file); + if (retval) + goto cleanup; + + *channel = io; + return 0; + +cleanup: + if (io && io->name) + ext2fs_free_mem(&io->name); + if (data) + ext2fs_free_mem(&data); + if (io) + ext2fs_free_mem(&io); + return retval; +} + +static errcode_t inode_close(io_channel channel) +{ + struct inode_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct inode_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL); + + if (--channel->refcount > 0) + return 0; + + retval = ext2fs_file_close(data->file); + + ext2fs_free_mem(&channel->private_data); + if (channel->name) + ext2fs_free_mem(&channel->name); + ext2fs_free_mem(&channel); + return retval; +} + +static errcode_t inode_set_blksize(io_channel channel, int blksize) +{ + struct inode_private_data *data; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct inode_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL); + + channel->block_size = blksize; + return 0; +} + + +static errcode_t inode_read_blk64(io_channel channel, + unsigned long long block, int count, void *buf) +{ + struct inode_private_data *data; + errcode_t retval; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct inode_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL); + + if ((retval = ext2fs_file_llseek(data->file, + (ext2_off64_t)(block * channel->block_size), + EXT2_SEEK_SET, 0))) + return retval; + + count = (count < 0) ? -count : (count * channel->block_size); + + return ext2fs_file_read(data->file, buf, count, 0); +} + +static errcode_t inode_read_blk(io_channel channel, unsigned long block, + int count, void *buf) +{ + return inode_read_blk64(channel, block, count, buf); +} + +static errcode_t inode_write_blk64(io_channel channel, + unsigned long long block, int count, const void *buf) +{ + struct inode_private_data *data; + errcode_t retval; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct inode_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL); + + if ((retval = ext2fs_file_llseek(data->file, + (ext2_off64_t) (block * channel->block_size), + EXT2_SEEK_SET, 0))) + return retval; + + count = (count < 0) ? -count : (count * channel->block_size); + + return ext2fs_file_write(data->file, buf, count, 0); +} + +static errcode_t inode_write_blk(io_channel channel, unsigned long block, + int count, const void *buf) +{ + return inode_write_blk64(channel, block, count, buf); +} + +static errcode_t inode_write_byte(io_channel channel, unsigned long offset, + int size, const void *buf) +{ + struct inode_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct inode_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL); + + if ((retval = ext2fs_file_lseek(data->file, offset, + EXT2_SEEK_SET, 0))) + return retval; + + return ext2fs_file_write(data->file, buf, size, 0); +} + +/* + * Flush data buffers to disk. + */ +static errcode_t inode_flush(io_channel channel) +{ + struct inode_private_data *data; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct inode_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL); + + return ext2fs_file_flush(data->file); +} + diff --git a/lib/ext2fs/io_manager.c b/lib/ext2fs/io_manager.c new file mode 100644 index 0000000..dca6af0 --- /dev/null +++ b/lib/ext2fs/io_manager.c @@ -0,0 +1,152 @@ +/* + * io_manager.c --- the I/O manager abstraction + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +errcode_t io_channel_set_options(io_channel channel, const char *opts) +{ + errcode_t retval = 0; + char *next, *ptr, *options, *arg; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + + if (!opts) + return 0; + + if (!channel->manager->set_option) + return EXT2_ET_INVALID_ARGUMENT; + + options = malloc(strlen(opts)+1); + if (!options) + return EXT2_ET_NO_MEMORY; + strcpy(options, opts); + ptr = options; + + while (ptr && *ptr) { + next = strchr(ptr, '&'); + if (next) + *next++ = 0; + + arg = strchr(ptr, '='); + if (arg) + *arg++ = 0; + + retval = (channel->manager->set_option)(channel, ptr, arg); + if (retval) + break; + ptr = next; + } + free(options); + return retval; +} + +errcode_t io_channel_write_byte(io_channel channel, unsigned long offset, + int count, const void *data) +{ + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + + if (channel->manager->write_byte) + return channel->manager->write_byte(channel, offset, + count, data); + + return EXT2_ET_UNIMPLEMENTED; +} + +errcode_t io_channel_read_blk64(io_channel channel, unsigned long long block, + int count, void *data) +{ + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + + if (channel->manager->read_blk64) + return (channel->manager->read_blk64)(channel, block, + count, data); + + if ((block >> 32) != 0) + return EXT2_ET_IO_CHANNEL_NO_SUPPORT_64; + + return (channel->manager->read_blk)(channel, (unsigned long) block, + count, data); +} + +errcode_t io_channel_write_blk64(io_channel channel, unsigned long long block, + int count, const void *data) +{ + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + + if (channel->manager->write_blk64) + return (channel->manager->write_blk64)(channel, block, + count, data); + + if ((block >> 32) != 0) + return EXT2_ET_IO_CHANNEL_NO_SUPPORT_64; + + return (channel->manager->write_blk)(channel, (unsigned long) block, + count, data); +} + +errcode_t io_channel_discard(io_channel channel, unsigned long long block, + unsigned long long count) +{ + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + + if (channel->manager->discard) + return (channel->manager->discard)(channel, block, count); + + return EXT2_ET_UNIMPLEMENTED; +} + +errcode_t io_channel_zeroout(io_channel channel, unsigned long long block, + unsigned long long count) +{ + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + + if (channel->manager->zeroout) + return (channel->manager->zeroout)(channel, block, count); + + return EXT2_ET_UNIMPLEMENTED; +} + +errcode_t io_channel_alloc_buf(io_channel io, int count, void *ptr) +{ + size_t size; + + if (count == 0) + size = io->block_size; + else if (count > 0) + size = io->block_size * count; + else + size = -count; + + if (io->align > 0) { + if ((unsigned) io->align > size) + size = io->align; + return ext2fs_get_memalign(size, io->align, ptr); + } else + return ext2fs_get_mem(size, ptr); +} + +errcode_t io_channel_cache_readahead(io_channel io, unsigned long long block, + unsigned long long count) +{ + if (!io->manager->cache_readahead) + return EXT2_ET_OP_NOT_SUPPORTED; + + return io->manager->cache_readahead(io, block, count); +} diff --git a/lib/ext2fs/irel.h b/lib/ext2fs/irel.h new file mode 100644 index 0000000..23741ba --- /dev/null +++ b/lib/ext2fs/irel.h @@ -0,0 +1,114 @@ +/* + * irel.h + * + * Copyright (C) 1996, 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +struct ext2_inode_reference { + blk64_t block; + __u16 offset; +}; + +struct ext2_inode_relocate_entry { + ext2_ino_t new; + ext2_ino_t orig; + __u16 flags; + __u16 max_refs; +}; + +typedef struct ext2_inode_relocation_table *ext2_irel; + +struct ext2_inode_relocation_table { + __u32 magic; + char *name; + ext2_ino_t current; + void *priv_data; + + /* + * Add an inode relocation entry. + */ + errcode_t (*put)(ext2_irel irel, ext2_ino_t old, + struct ext2_inode_relocate_entry *ent); + /* + * Get an inode relocation entry. + */ + errcode_t (*get)(ext2_irel irel, ext2_ino_t old, + struct ext2_inode_relocate_entry *ent); + + /* + * Get an inode relocation entry by its original inode number + */ + errcode_t (*get_by_orig)(ext2_irel irel, ext2_ino_t orig, ext2_ino_t *old, + struct ext2_inode_relocate_entry *ent); + + /* + * Initialize for iterating over the inode relocation entries. + */ + errcode_t (*start_iter)(ext2_irel irel); + + /* + * The iterator function for the inode relocation entries. + * Returns an inode number of 0 when out of entries. + */ + errcode_t (*next)(ext2_irel irel, ext2_ino_t *old, + struct ext2_inode_relocate_entry *ent); + + /* + * Add an inode reference (i.e., note the fact that a + * particular block/offset contains a reference to an inode) + */ + errcode_t (*add_ref)(ext2_irel irel, ext2_ino_t ino, + struct ext2_inode_reference *ref); + + /* + * Initialize for iterating over the inode references for a + * particular inode. + */ + errcode_t (*start_iter_ref)(ext2_irel irel, ext2_ino_t ino); + + /* + * The iterator function for the inode references for an + * inode. The references for only one inode can be iterator + * over at a time, as the iterator state is stored in ext2_irel. + */ + errcode_t (*next_ref)(ext2_irel irel, + struct ext2_inode_reference *ref); + + /* + * Move the inode relocation table from one inode number to + * another. Note that the inode references also must move. + */ + errcode_t (*move)(ext2_irel irel, ext2_ino_t old, ext2_ino_t new); + + /* + * Remove an inode relocation entry, along with all of the + * inode references. + */ + errcode_t (*delete)(ext2_irel irel, ext2_ino_t old); + + /* + * Free the inode relocation table. + */ + errcode_t (*free)(ext2_irel irel); +}; + +errcode_t ext2fs_irel_memarray_create(char *name, ext2_ino_t max_inode, + ext2_irel *irel); + +#define ext2fs_irel_put(irel, old, ent) ((irel)->put((irel), old, ent)) +#define ext2fs_irel_get(irel, old, ent) ((irel)->get((irel), old, ent)) +#define ext2fs_irel_get_by_orig(irel, orig, old, ent) \ + ((irel)->get_by_orig((irel), orig, old, ent)) +#define ext2fs_irel_start_iter(irel) ((irel)->start_iter((irel))) +#define ext2fs_irel_next(irel, old, ent) ((irel)->next((irel), old, ent)) +#define ext2fs_irel_add_ref(irel, ino, ref) ((irel)->add_ref((irel), ino, ref)) +#define ext2fs_irel_start_iter_ref(irel, ino) ((irel)->start_iter_ref((irel), ino)) +#define ext2fs_irel_next_ref(irel, ref) ((irel)->next_ref((irel), ref)) +#define ext2fs_irel_move(irel, old, new) ((irel)->move((irel), old, new)) +#define ext2fs_irel_delete(irel, old) ((irel)->delete((irel), old)) +#define ext2fs_irel_free(irel) ((irel)->free((irel))) diff --git a/lib/ext2fs/irel_ma.c b/lib/ext2fs/irel_ma.c new file mode 100644 index 0000000..c64b7e7 --- /dev/null +++ b/lib/ext2fs/irel_ma.c @@ -0,0 +1,377 @@ +/* + * irel_ma.c + * + * Copyright (C) 1996, 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <fcntl.h> +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "irel.h" + +static errcode_t ima_put(ext2_irel irel, ext2_ino_t old, + struct ext2_inode_relocate_entry *ent); +static errcode_t ima_get(ext2_irel irel, ext2_ino_t old, + struct ext2_inode_relocate_entry *ent); +static errcode_t ima_get_by_orig(ext2_irel irel, ext2_ino_t orig, ext2_ino_t *old, + struct ext2_inode_relocate_entry *ent); +static errcode_t ima_start_iter(ext2_irel irel); +static errcode_t ima_next(ext2_irel irel, ext2_ino_t *old, + struct ext2_inode_relocate_entry *ent); +static errcode_t ima_add_ref(ext2_irel irel, ext2_ino_t ino, + struct ext2_inode_reference *ref); +static errcode_t ima_start_iter_ref(ext2_irel irel, ext2_ino_t ino); +static errcode_t ima_next_ref(ext2_irel irel, struct ext2_inode_reference *ref); +static errcode_t ima_move(ext2_irel irel, ext2_ino_t old, ext2_ino_t new); +static errcode_t ima_delete(ext2_irel irel, ext2_ino_t old); +static errcode_t ima_free(ext2_irel irel); + +/* + * This data structure stores the array of inode references; there is + * a structure for each inode. + */ +struct inode_reference_entry { + __u16 num; + struct ext2_inode_reference *refs; +}; + +struct irel_ma { + __u32 magic; + ext2_ino_t max_inode; + ext2_ino_t ref_current; + int ref_iter; + ext2_ino_t *orig_map; + struct ext2_inode_relocate_entry *entries; + struct inode_reference_entry *ref_entries; +}; + +errcode_t ext2fs_irel_memarray_create(char *name, ext2_ino_t max_inode, + ext2_irel *new_irel) +{ + ext2_irel irel = 0; + errcode_t retval; + struct irel_ma *ma = 0; + size_t size; + + *new_irel = 0; + + /* + * Allocate memory structures + */ + retval = ext2fs_get_mem(sizeof(struct ext2_inode_relocation_table), + &irel); + if (retval) + goto errout; + memset(irel, 0, sizeof(struct ext2_inode_relocation_table)); + + retval = ext2fs_get_mem(strlen(name)+1, &irel->name); + if (retval) + goto errout; + strcpy(irel->name, name); + + retval = ext2fs_get_mem(sizeof(struct irel_ma), &ma); + if (retval) + goto errout; + memset(ma, 0, sizeof(struct irel_ma)); + irel->priv_data = ma; + + size = (size_t) (sizeof(ext2_ino_t) * (max_inode+1)); + retval = ext2fs_get_array(max_inode+1, sizeof(ext2_ino_t), + &ma->orig_map); + if (retval) + goto errout; + memset(ma->orig_map, 0, size); + + size = (size_t) (sizeof(struct ext2_inode_relocate_entry) * + (max_inode+1)); + retval = ext2fs_get_array((max_inode+1, + sizeof(struct ext2_inode_relocate_entry), &ma->entries); + if (retval) + goto errout; + memset(ma->entries, 0, size); + + size = (size_t) (sizeof(struct inode_reference_entry) * + (max_inode+1)); + retval = ext2fs_get_mem(max_inode+1, + sizeof(struct inode_reference_entry), &ma->ref_entries); + if (retval) + goto errout; + memset(ma->ref_entries, 0, size); + ma->max_inode = max_inode; + + /* + * Fill in the irel data structure + */ + irel->put = ima_put; + irel->get = ima_get; + irel->get_by_orig = ima_get_by_orig; + irel->start_iter = ima_start_iter; + irel->next = ima_next; + irel->add_ref = ima_add_ref; + irel->start_iter_ref = ima_start_iter_ref; + irel->next_ref = ima_next_ref; + irel->move = ima_move; + irel->delete = ima_delete; + irel->free = ima_free; + + *new_irel = irel; + return 0; + +errout: + ima_free(irel); + return retval; +} + +static errcode_t ima_put(ext2_irel irel, ext2_ino_t old, + struct ext2_inode_relocate_entry *ent) +{ + struct inode_reference_entry *ref_ent; + struct irel_ma *ma; + errcode_t retval; + size_t size, old_size; + + ma = irel->priv_data; + if (old > ma->max_inode) + return EXT2_ET_INVALID_ARGUMENT; + + /* + * Force the orig field to the correct value; the application + * program shouldn't be messing with this field. + */ + if (ma->entries[(unsigned) old].new == 0) + ent->orig = old; + else + ent->orig = ma->entries[(unsigned) old].orig; + + /* + * If max_refs has changed, reallocate the refs array + */ + ref_ent = ma->ref_entries + (unsigned) old; + if (ref_ent->refs && ent->max_refs != + ma->entries[(unsigned) old].max_refs) { + size = (sizeof(struct ext2_inode_reference) * ent->max_refs); + old_size = (sizeof(struct ext2_inode_reference) * + ma->entries[(unsigned) old].max_refs); + retval = ext2fs_resize_mem(old_size, size, &ref_ent->refs); + if (retval) + return retval; + } + + ma->entries[(unsigned) old] = *ent; + ma->orig_map[(unsigned) ent->orig] = old; + return 0; +} + +static errcode_t ima_get(ext2_irel irel, ext2_ino_t old, + struct ext2_inode_relocate_entry *ent) +{ + struct irel_ma *ma; + + ma = irel->priv_data; + if (old > ma->max_inode) + return EXT2_ET_INVALID_ARGUMENT; + if (ma->entries[(unsigned) old].new == 0) + return ENOENT; + *ent = ma->entries[(unsigned) old]; + return 0; +} + +static errcode_t ima_get_by_orig(ext2_irel irel, ext2_ino_t orig, ext2_ino_t *old, + struct ext2_inode_relocate_entry *ent) +{ + struct irel_ma *ma; + ext2_ino_t ino; + + ma = irel->priv_data; + if (orig > ma->max_inode) + return EXT2_ET_INVALID_ARGUMENT; + ino = ma->orig_map[(unsigned) orig]; + if (ino == 0) + return ENOENT; + *old = ino; + *ent = ma->entries[(unsigned) ino]; + return 0; +} + +static errcode_t ima_start_iter(ext2_irel irel) +{ + irel->current = 0; + return 0; +} + +static errcode_t ima_next(ext2_irel irel, ext2_ino_t *old, + struct ext2_inode_relocate_entry *ent) +{ + struct irel_ma *ma; + + ma = irel->priv_data; + while (++irel->current < ma->max_inode) { + if (ma->entries[(unsigned) irel->current].new == 0) + continue; + *old = irel->current; + *ent = ma->entries[(unsigned) irel->current]; + return 0; + } + *old = 0; + return 0; +} + +static errcode_t ima_add_ref(ext2_irel irel, ext2_ino_t ino, + struct ext2_inode_reference *ref) +{ + struct irel_ma *ma; + size_t size; + struct inode_reference_entry *ref_ent; + struct ext2_inode_relocate_entry *ent; + errcode_t retval; + + ma = irel->priv_data; + if (ino > ma->max_inode) + return EXT2_ET_INVALID_ARGUMENT; + + ref_ent = ma->ref_entries + (unsigned) ino; + ent = ma->entries + (unsigned) ino; + + /* + * If the inode reference array doesn't exist, create it. + */ + if (ref_ent->refs == 0) { + size = (size_t) ((sizeof(struct ext2_inode_reference) * + ent->max_refs)); + retval = ext2fs_get_array(ent->max_refs, + sizeof(struct ext2_inode_reference), &ref_ent->refs); + if (retval) + return retval; + memset(ref_ent->refs, 0, size); + ref_ent->num = 0; + } + + if (ref_ent->num >= ent->max_refs) + return EXT2_ET_TOO_MANY_REFS; + + ref_ent->refs[(unsigned) ref_ent->num++] = *ref; + return 0; +} + +static errcode_t ima_start_iter_ref(ext2_irel irel, ext2_ino_t ino) +{ + struct irel_ma *ma; + + ma = irel->priv_data; + if (ino > ma->max_inode) + return EXT2_ET_INVALID_ARGUMENT; + if (ma->entries[(unsigned) ino].new == 0) + return ENOENT; + ma->ref_current = ino; + ma->ref_iter = 0; + return 0; +} + +static errcode_t ima_next_ref(ext2_irel irel, + struct ext2_inode_reference *ref) +{ + struct irel_ma *ma; + struct inode_reference_entry *ref_ent; + + ma = irel->priv_data; + + ref_ent = ma->ref_entries + ma->ref_current; + + if ((ref_ent->refs == NULL) || + (ma->ref_iter >= ref_ent->num)) { + ref->block = 0; + ref->offset = 0; + return 0; + } + *ref = ref_ent->refs[ma->ref_iter++]; + return 0; +} + + +static errcode_t ima_move(ext2_irel irel, ext2_ino_t old, ext2_ino_t new) +{ + struct irel_ma *ma; + + ma = irel->priv_data; + if ((old > ma->max_inode) || (new > ma->max_inode)) + return EXT2_ET_INVALID_ARGUMENT; + if (ma->entries[(unsigned) old].new == 0) + return ENOENT; + + ma->entries[(unsigned) new] = ma->entries[(unsigned) old]; + if (ma->ref_entries[(unsigned) new].refs) + ext2fs_free_mem(&ma->ref_entries[(unsigned) new].refs); + ma->ref_entries[(unsigned) new] = ma->ref_entries[(unsigned) old]; + + ma->entries[(unsigned) old].new = 0; + ma->ref_entries[(unsigned) old].num = 0; + ma->ref_entries[(unsigned) old].refs = 0; + + ma->orig_map[ma->entries[new].orig] = new; + return 0; +} + +static errcode_t ima_delete(ext2_irel irel, ext2_ino_t old) +{ + struct irel_ma *ma; + + ma = irel->priv_data; + if (old > ma->max_inode) + return EXT2_ET_INVALID_ARGUMENT; + if (ma->entries[(unsigned) old].new == 0) + return ENOENT; + + ma->entries[old].new = 0; + if (ma->ref_entries[(unsigned) old].refs) + ext2fs_free_mem(&ma->ref_entries[(unsigned) old].refs); + ma->orig_map[ma->entries[(unsigned) old].orig] = 0; + + ma->ref_entries[(unsigned) old].num = 0; + ma->ref_entries[(unsigned) old].refs = 0; + return 0; +} + +static errcode_t ima_free(ext2_irel irel) +{ + struct irel_ma *ma; + ext2_ino_t ino; + + if (!irel) + return 0; + + ma = irel->priv_data; + + if (ma) { + if (ma->orig_map) + ext2fs_free_mem(&ma->orig_map); + if (ma->entries) + ext2fs_free_mem(&ma->entries); + if (ma->ref_entries) { + for (ino = 0; ino <= ma->max_inode; ino++) { + if (ma->ref_entries[(unsigned) ino].refs) + ext2fs_free_mem(&ma->ref_entries[(unsigned) ino].refs); + } + ext2fs_free_mem(&ma->ref_entries); + } + ext2fs_free_mem(&ma); + } + if (irel->name) + ext2fs_free_mem(&irel->name); + ext2fs_free_mem(&irel); + return 0; +} diff --git a/lib/ext2fs/ismounted.c b/lib/ext2fs/ismounted.c new file mode 100644 index 0000000..a7db1a5 --- /dev/null +++ b/lib/ext2fs/ismounted.c @@ -0,0 +1,478 @@ +/* + * ismounted.c --- Check to see if the filesystem was mounted + * + * Copyright (C) 1995,1996,1997,1998,1999,2000 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +/* define BSD_SOURCE to make sure we get the major() macro */ +#ifndef _BSD_SOURCE +#define _BSD_SOURCE +#endif +#ifndef _DEFAULT_SOURCE +#define _DEFAULT_SOURCE /* since glibc 2.20 _SVID_SOURCE is deprecated */ +#endif + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <fcntl.h> +#ifdef HAVE_LINUX_FD_H +#include <linux/fd.h> +#endif +#ifdef HAVE_LINUX_LOOP_H +#include <linux/loop.h> +#include <sys/ioctl.h> +#ifdef HAVE_LINUX_MAJOR_H +#include <linux/major.h> +#endif /* HAVE_LINUX_MAJOR_H */ +#endif /* HAVE_LINUX_LOOP_H */ +#ifdef HAVE_MNTENT_H +#include <mntent.h> +#endif +#ifdef HAVE_GETMNTINFO +#include <paths.h> +#include <sys/param.h> +#include <sys/mount.h> +#endif /* HAVE_GETMNTINFO */ +#include <string.h> +#include <sys/stat.h> +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#ifdef HAVE_SYS_SYSMACROS_H +#include <sys/sysmacros.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +#ifdef HAVE_SETMNTENT +/* + * Check to see if a regular file is mounted. + * If /etc/mtab/ is a symlink of /proc/mounts, you will need the following check + * because the name in /proc/mounts is a loopback device not a regular file. + */ +static int check_loop_mounted(const char *mnt_fsname, dev_t mnt_rdev, + dev_t file_dev, ino_t file_ino) +{ +#if defined(HAVE_LINUX_LOOP_H) && defined(HAVE_LINUX_MAJOR_H) + struct loop_info64 loopinfo = {0, }; + int loop_fd, ret; + + if (major(mnt_rdev) == LOOP_MAJOR) { + loop_fd = open(mnt_fsname, O_RDONLY); + if (loop_fd < 0) + return -1; + + ret = ioctl(loop_fd, LOOP_GET_STATUS64, &loopinfo); + close(loop_fd); + if (ret < 0) + return -1; + + if (file_dev == loopinfo.lo_device && + file_ino == loopinfo.lo_inode) + return 1; + } +#endif /* defined(HAVE_LINUX_LOOP_H) && defined(HAVE_LINUX_MAJOR_H) */ + return 0; +} + +/* + * Helper function which checks a file in /etc/mtab format to see if a + * filesystem is mounted. Returns an error if the file doesn't exist + * or can't be opened. + */ +static errcode_t check_mntent_file(const char *mtab_file, const char *file, + int *mount_flags, char *mtpt, int mtlen) +{ + struct mntent *mnt; + struct stat st_buf, dir_st_buf; + errcode_t retval = 0; + dev_t file_dev=0, file_rdev=0; + ino_t file_ino=0; + FILE *f; + int fd; + + *mount_flags = 0; + + if ((f = setmntent (mtab_file, "r")) == NULL) { + if (errno == ENOENT) { + if (getenv("EXT2FS_NO_MTAB_OK")) + return 0; + else + return EXT2_ET_NO_MTAB_FILE; + } + return errno; + } + if (stat(file, &st_buf) == 0) { + if (ext2fsP_is_disk_device(st_buf.st_mode)) { +#ifndef __GNU__ /* The GNU hurd is broken with respect to stat devices */ + file_rdev = st_buf.st_rdev; +#endif /* __GNU__ */ + } else { + file_dev = st_buf.st_dev; + file_ino = st_buf.st_ino; + } + } + while ((mnt = getmntent (f)) != NULL) { + if (mnt->mnt_fsname[0] != '/') + continue; + if (strcmp(file, mnt->mnt_fsname) == 0) { + if (stat(mnt->mnt_dir, &st_buf) != 0) + continue; + if (file_rdev && (file_rdev != st_buf.st_dev)) { +#ifdef DEBUG + printf("Bogus entry in %s! " + "(%s is not mounted on %s)\n", + mtab_file, file, mnt->mnt_dir); +#endif /* DEBUG */ + continue; + } + break; + } + if (stat(mnt->mnt_fsname, &st_buf) == 0) { + if (ext2fsP_is_disk_device(st_buf.st_mode)) { +#ifndef __GNU__ + if (file_rdev && + (file_rdev == st_buf.st_rdev)) { + if (stat(mnt->mnt_dir, + &dir_st_buf) != 0) + continue; + if (file_rdev == dir_st_buf.st_dev) + break; + } + if (check_loop_mounted(mnt->mnt_fsname, + st_buf.st_rdev, file_dev, + file_ino) == 1) + break; +#endif /* __GNU__ */ + } else { + if (file_dev && ((file_dev == st_buf.st_dev) && + (file_ino == st_buf.st_ino))) + break; + } + } + } + + if (mnt == 0) { +#ifndef __GNU__ /* The GNU hurd is broken with respect to stat devices */ + /* + * Do an extra check to see if this is the root device. We + * can't trust /etc/mtab, and /proc/mounts will only list + * /dev/root for the root filesystem. Argh. Instead we + * check if the given device has the same major/minor number + * as the device that the root directory is on. + */ + if (file_rdev && stat("/", &st_buf) == 0) { + if (st_buf.st_dev == file_rdev) { + *mount_flags = EXT2_MF_MOUNTED; + if (mtpt) + strncpy(mtpt, "/", mtlen); + goto is_root; + } + } +#endif /* __GNU__ */ + goto errout; + } + *mount_flags = EXT2_MF_MOUNTED; + +#ifdef MNTOPT_RO + /* Check to see if the ro option is set */ + if (hasmntopt(mnt, MNTOPT_RO)) + *mount_flags |= EXT2_MF_READONLY; +#endif + + if (mtpt) + strncpy(mtpt, mnt->mnt_dir, mtlen); + /* + * Check to see if we're referring to the root filesystem. + * If so, do a manual check to see if we can open /etc/mtab + * read/write, since if the root is mounted read/only, the + * contents of /etc/mtab may not be accurate. + */ + if (!strcmp(mnt->mnt_dir, "/")) { +is_root: +#define TEST_FILE "/.ismount-test-file" + *mount_flags |= EXT2_MF_ISROOT; + fd = open(TEST_FILE, O_RDWR|O_CREAT, 0600); + if (fd < 0) { + if (errno == EROFS) + *mount_flags |= EXT2_MF_READONLY; + } else + close(fd); + (void) unlink(TEST_FILE); + } + + if (mnt && mnt->mnt_type && + (!strcmp(mnt->mnt_type, "ext4") || + !strcmp(mnt->mnt_type, "ext3") || + !strcmp(mnt->mnt_type, "ext2"))) + *mount_flags |= EXT2_MF_EXTFS; + retval = 0; +errout: + endmntent (f); + return retval; +} + +static errcode_t check_mntent(const char *file, int *mount_flags, + char *mtpt, int mtlen) +{ + errcode_t retval; + +#ifdef DEBUG + retval = check_mntent_file("/tmp/mtab", file, mount_flags, + mtpt, mtlen); + if (retval == 0) + return 0; +#endif /* DEBUG */ +#ifdef __linux__ + retval = check_mntent_file("/proc/mounts", file, mount_flags, + mtpt, mtlen); + if (retval == 0) + return 0; +#endif /* __linux__ */ +#if defined(MOUNTED) || defined(_PATH_MOUNTED) +#ifndef MOUNTED +#define MOUNTED _PATH_MOUNTED +#endif /* MOUNTED */ + retval = check_mntent_file(MOUNTED, file, mount_flags, mtpt, mtlen); + return retval; +#else + *mount_flags = 0; + return 0; +#endif /* defined(MOUNTED) || defined(_PATH_MOUNTED) */ +} + +#else +#if defined(HAVE_GETMNTINFO) + +static errcode_t check_getmntinfo(const char *file, int *mount_flags, + char *mtpt, int mtlen) +{ + struct statfs *mp; + int len, n; + const char *s1; + char *s2; + + n = getmntinfo(&mp, MNT_NOWAIT); + if (n == 0) + return errno; + + len = sizeof(_PATH_DEV) - 1; + s1 = file; + if (strncmp(_PATH_DEV, s1, len) == 0) + s1 += len; + + *mount_flags = 0; + while (--n >= 0) { + s2 = mp->f_mntfromname; + if (strncmp(_PATH_DEV, s2, len) == 0) { + s2 += len - 1; + *s2 = 'r'; + } + if (strcmp(s1, s2) == 0 || strcmp(s1, &s2[1]) == 0) { + *mount_flags = EXT2_MF_MOUNTED; + break; + } + ++mp; + } + if (mtpt) + strncpy(mtpt, mp->f_mntonname, mtlen); + return 0; +} +#endif /* HAVE_GETMNTINFO */ +#endif /* HAVE_SETMNTENT */ + +/* + * Check to see if we're dealing with the swap device. + */ +static int is_swap_device(const char *file) +{ + FILE *f; + char buf[1024], *cp; + dev_t file_dev; + struct stat st_buf; + int ret = 0; + + file_dev = 0; +#ifndef __GNU__ /* The GNU hurd is broken with respect to stat devices */ + if ((stat(file, &st_buf) == 0) && + ext2fsP_is_disk_device(st_buf.st_mode)) + file_dev = st_buf.st_rdev; +#endif /* __GNU__ */ + + if (!(f = fopen("/proc/swaps", "r"))) + return 0; + /* Skip the first line */ + if (!fgets(buf, sizeof(buf), f)) + goto leave; + if (*buf && strncmp(buf, "Filename\t", 9)) + /* Linux <=2.6.19 contained a bug in the /proc/swaps + * code where the header would not be displayed + */ + goto valid_first_line; + + while (fgets(buf, sizeof(buf), f)) { +valid_first_line: + if ((cp = strchr(buf, ' ')) != NULL) + *cp = 0; + if ((cp = strchr(buf, '\t')) != NULL) + *cp = 0; + if (strcmp(buf, file) == 0) { + ret++; + break; + } +#ifndef __GNU__ + if (file_dev && (stat(buf, &st_buf) == 0) && + ext2fsP_is_disk_device(st_buf.st_mode) && + file_dev == st_buf.st_rdev) { + ret++; + break; + } +#endif /* __GNU__ */ + } + +leave: + fclose(f); + return ret; +} + + +/* + * ext2fs_check_mount_point() fills determines if the device is + * mounted or otherwise busy, and fills in mount_flags with one or + * more of the following flags: EXT2_MF_MOUNTED, EXT2_MF_ISROOT, + * EXT2_MF_READONLY, EXT2_MF_SWAP, and EXT2_MF_BUSY. If mtpt is + * non-NULL, the directory where the device is mounted is copied to + * where mtpt is pointing, up to mtlen characters. + */ +#ifdef __TURBOC__ + #pragma argsused +#endif +errcode_t ext2fs_check_mount_point(const char *device, int *mount_flags, + char *mtpt, int mtlen) +{ + errcode_t retval = 0; + int busy = 0; + + if (getenv("EXT2FS_PRETEND_RO_MOUNT")) { + *mount_flags = EXT2_MF_MOUNTED | EXT2_MF_READONLY; + if (getenv("EXT2FS_PRETEND_ROOTFS")) + *mount_flags = EXT2_MF_ISROOT; + return 0; + } + if (getenv("EXT2FS_PRETEND_RW_MOUNT")) { + *mount_flags = EXT2_MF_MOUNTED; + if (getenv("EXT2FS_PRETEND_ROOTFS")) + *mount_flags = EXT2_MF_ISROOT; + return 0; + } + +#ifdef __linux__ /* This only works on Linux 2.6+ systems */ + { + struct stat st_buf; + + if (stat(device, &st_buf) == 0 && + ext2fsP_is_disk_device(st_buf.st_mode)) { + int fd = open(device, O_RDONLY | O_EXCL); + + if (fd >= 0) { + /* + * The device is not busy so it's + * definitelly not mounted. No need to + * to perform any more checks. + */ + close(fd); + *mount_flags = 0; + return 0; + } else if (errno == EBUSY) { + busy = 1; + } + } + } +#endif + + if (is_swap_device(device)) { + *mount_flags = EXT2_MF_MOUNTED | EXT2_MF_SWAP; + if (mtpt) + strncpy(mtpt, "<swap>", mtlen); + } else { +#ifdef HAVE_SETMNTENT + retval = check_mntent(device, mount_flags, mtpt, mtlen); +#else +#ifdef HAVE_GETMNTINFO + retval = check_getmntinfo(device, mount_flags, mtpt, mtlen); +#else +#if defined(__GNUC__) && !defined(_WIN32) + #warning "Can't use getmntent or getmntinfo to check for mounted filesystems!" +#endif + *mount_flags = 0; +#endif /* HAVE_GETMNTINFO */ +#endif /* HAVE_SETMNTENT */ + } + if (retval) + return retval; + + if (busy) + *mount_flags |= EXT2_MF_BUSY; + + return 0; +} + +/* + * ext2fs_check_if_mounted() sets the mount_flags EXT2_MF_MOUNTED, + * EXT2_MF_READONLY, and EXT2_MF_ROOT + * + */ +errcode_t ext2fs_check_if_mounted(const char *file, int *mount_flags) +{ + return ext2fs_check_mount_point(file, mount_flags, NULL, 0); +} + +#ifdef DEBUG +int main(int argc, char **argv) +{ + int retval, mount_flags; + char mntpt[80]; + + if (argc < 2) { + fprintf(stderr, "Usage: %s device\n", argv[0]); + exit(1); + } + + add_error_table(&et_ext2_error_table); + mntpt[0] = 0; + retval = ext2fs_check_mount_point(argv[1], &mount_flags, + mntpt, sizeof(mntpt)); + if (retval) { + com_err(argv[0], retval, + "while calling ext2fs_check_if_mounted"); + exit(1); + } + printf("Device %s reports flags %02x\n", argv[1], mount_flags); + if (mount_flags & EXT2_MF_BUSY) + printf("\t%s is apparently in use.\n", argv[1]); + if (mount_flags & EXT2_MF_MOUNTED) + printf("\t%s is mounted.\n", argv[1]); + if (mount_flags & EXT2_MF_SWAP) + printf("\t%s is a swap device.\n", argv[1]); + if (mount_flags & EXT2_MF_READONLY) + printf("\t%s is read-only.\n", argv[1]); + if (mount_flags & EXT2_MF_ISROOT) + printf("\t%s is the root filesystem.\n", argv[1]); + if (mntpt[0]) + printf("\t%s is mounted on %s.\n", argv[1], mntpt); + exit(0); +} +#endif /* DEBUG */ diff --git a/lib/ext2fs/jfs_compat.h b/lib/ext2fs/jfs_compat.h new file mode 100644 index 0000000..0e96b56 --- /dev/null +++ b/lib/ext2fs/jfs_compat.h @@ -0,0 +1,113 @@ + +#ifndef _JFS_COMPAT_H +#define _JFS_COMPAT_H + +#include "kernel-list.h" +#include <errno.h> +#ifdef HAVE_NETINET_IN_H +#include <netinet/in.h> +#endif +#include <arpa/inet.h> +#include <stdbool.h> + +#define printk printf +#define KERN_ERR "" +#define KERN_DEBUG "" + +#define REQ_OP_READ 0 +#define REQ_OP_WRITE 1 + +#define cpu_to_le16(x) ext2fs_cpu_to_le16(x) +#define cpu_to_be16(x) ext2fs_cpu_to_be16(x) +#define cpu_to_le32(x) ext2fs_cpu_to_le32(x) +#define cpu_to_be32(x) ext2fs_cpu_to_be32(x) +#define cpu_to_le64(x) ext2fs_cpu_to_le64(x) +#define cpu_to_be64(x) ext2fs_cpu_to_be64(x) + +#define le16_to_cpu(x) ext2fs_le16_to_cpu(x) +#define be16_to_cpu(x) ext2fs_be16_to_cpu(x) +#define le32_to_cpu(x) ext2fs_le32_to_cpu(x) +#define be32_to_cpu(x) ext2fs_be32_to_cpu(x) +#define le64_to_cpu(x) ext2fs_le64_to_cpu(x) +#define be64_to_cpu(x) ext2fs_be64_to_cpu(x) + +typedef unsigned int tid_t; +typedef struct journal_s journal_t; +typedef struct kdev_s *kdev_t; + +struct buffer_head; +struct inode; + +typedef unsigned int gfp_t; +#define GFP_KERNEL 0 +#define GFP_NOFS 0 +#define __GFP_NOFAIL 0 +#define JBD2_TAG_SIZE32 JBD_TAG_SIZE32 +#define JBD2_BARRIER 0 +typedef __u64 u64; +#define put_bh(x) brelse(x) + +#define crc32_be(x, y, z) ext2fs_crc32_be((x), (y), (z)) +#define spin_lock_init(x) +#define spin_lock(x) +#define spin_unlock(x) +#define SLAB_HWCACHE_ALIGN 0 +#define SLAB_TEMPORARY 0 +#define KMEM_CACHE(__struct, __flags) kmem_cache_create(#__struct,\ + sizeof(struct __struct), __alignof__(struct __struct),\ + (__flags), NULL) + +#define blkdev_issue_flush(kdev) sync_blockdev(kdev) +#define is_power_of_2(x) ((x) != 0 && (((x) & ((x) - 1)) == 0)) +#define pr_emerg(fmt) +#define pr_err(...) + +enum passtype {PASS_SCAN, PASS_REVOKE, PASS_REPLAY}; + +#define JBD2_FC_REPLAY_STOP 0 +#define JBD2_FC_REPLAY_CONTINUE 1 + +struct journal_s +{ + unsigned long j_flags; + int j_errno; + struct buffer_head * j_sb_buffer; + struct journal_superblock_s *j_superblock; + int j_format_version; + unsigned long j_head; + unsigned long j_tail; + unsigned long j_fc_first; + unsigned long j_fc_off; + unsigned long j_fc_last; + unsigned long j_free; + unsigned long j_first, j_last; + kdev_t j_dev; + kdev_t j_fs_dev; + int j_blocksize; + unsigned int j_blk_offset; + unsigned int j_total_len; + struct inode * j_inode; + tid_t j_tail_sequence; + tid_t j_transaction_sequence; + __u8 j_uuid[16]; + struct jbd2_revoke_table_s *j_revoke; + struct jbd2_revoke_table_s *j_revoke_table[2]; + tid_t j_failed_commit; + __u32 j_csum_seed; + int (*j_fc_replay_callback)(struct journal_s *journal, + struct buffer_head *bh, + enum passtype pass, int off, + tid_t expected_tid); + +}; + +#define is_journal_abort(x) 0 + +#define BUFFER_TRACE(bh, info) do {} while (0) + +/* Need this so we can compile with configure --enable-gcc-wall */ +#ifdef NO_INLINE_FUNCS +#define inline +#endif + +#endif /* _JFS_COMPAT_H */ diff --git a/lib/ext2fs/kernel-jbd.h b/lib/ext2fs/kernel-jbd.h new file mode 100644 index 0000000..e569500 --- /dev/null +++ b/lib/ext2fs/kernel-jbd.h @@ -0,0 +1,456 @@ +/* + * linux/include/linux/jbd.h + * + * Written by Stephen C. Tweedie <sct@redhat.com> + * + * Copyright 1998-2000 Red Hat, Inc --- All Rights Reserved + * + * This file is part of the Linux kernel and is made available under + * the terms of the GNU General Public License, version 2, or at your + * option, any later version, incorporated herein by reference. + * + * Definitions for transaction data structures for the buffer cache + * filesystem journaling support. + */ + +#ifndef _LINUX_JBD_H +#define _LINUX_JBD_H + +#include "jfs_compat.h" +#define JFS_DEBUG +#define jfs_debug jbd_debug + +#ifndef __GNUC__ +#define __FUNCTION__ "" +#endif + +#define journal_oom_retry 0 + +#ifdef CONFIG_JBD_DEBUG +/* + * Define JBD_EXPENSIVE_CHECKING to enable more expensive internal + * consistency checks. By default we don't do this unless + * CONFIG_JBD_DEBUG is on. + */ +#define JBD_EXPENSIVE_CHECKING +extern int journal_enable_debug; +#else +#define journal_enable_debug (-1) +#endif /* !CONFIG_JBD_DEBUG */ + +#ifdef __STDC__ +#define jbd_debug(n, f, a...) \ + do { \ + if ((n) <= journal_enable_debug) { \ + printk (KERN_DEBUG "(%s, %d): %s: ", \ + __FILE__, __LINE__, __FUNCTION__); \ + printk (f, ## a); \ + } \ + } while (0) +#else +#define jbd_debug(x) /* AIX doesn't do STDC */ +#endif /* !__STDC__ */ + +extern void * __jbd_kmalloc (char *where, size_t size, int flags, int retry); +#define jbd_kmalloc(size, flags) \ + __jbd_kmalloc(__FUNCTION__, (size), (flags), journal_oom_retry) +#define jbd_rep_kmalloc(size, flags) \ + __jbd_kmalloc(__FUNCTION__, (size), (flags), 1) + +#define JBD2_MIN_JOURNAL_BLOCKS 1024 +#define JBD2_DEFAULT_FAST_COMMIT_BLOCKS 256 + +/* + * Internal structures used by the logging mechanism: + */ + +#define JBD2_MAGIC_NUMBER 0xc03b3998U /* The first 4 bytes of /dev/random! */ + +/* + * On-disk structures + */ + +/* + * Descriptor block types: + */ + +#define JBD2_DESCRIPTOR_BLOCK 1 +#define JBD2_COMMIT_BLOCK 2 +#define JBD2_SUPERBLOCK_V1 3 +#define JBD2_SUPERBLOCK_V2 4 +#define JBD2_REVOKE_BLOCK 5 +#define JBD2_FC_BLOCK 6 + +/* + * Standard header for all descriptor blocks: + */ +typedef struct journal_header_s +{ + __be32 h_magic; + __be32 h_blocktype; + __be32 h_sequence; +} journal_header_t; + +/* + * Checksum types. + */ +#define JBD2_CRC32_CHKSUM 1 +#define JBD2_MD5_CHKSUM 2 +#define JBD2_SHA1_CHKSUM 3 +#define JBD2_CRC32C_CHKSUM 4 + +#define JBD2_CRC32_CHKSUM_SIZE 4 + +#define JBD2_CHECKSUM_BYTES (32 / sizeof(__u32)) +/* + * Commit block header for storing transactional checksums: + * + * NOTE: If FEATURE_COMPAT_CHECKSUM (checksum v1) is set, the h_chksum* + * fields are used to store a checksum of the descriptor and data blocks. + * + * If FEATURE_INCOMPAT_CSUM_V2 (checksum v2) is set, then the h_chksum + * field is used to store crc32c(uuid+commit_block). Each journal metadata + * block gets its own checksum, and data block checksums are stored in + * journal_block_tag (in the descriptor). The other h_chksum* fields are + * not used. + * + * If FEATURE_INCOMPAT_CSUM_V3 is set, the descriptor block uses + * journal_block_tag3_t to store a full 32-bit checksum. Everything else + * is the same as v2. + * + * Checksum v1, v2, and v3 are mutually exclusive features. + */ +struct commit_header { + __be32 h_magic; + __be32 h_blocktype; + __be32 h_sequence; + unsigned char h_chksum_type; + unsigned char h_chksum_size; + unsigned char h_padding[2]; + __be32 h_chksum[JBD2_CHECKSUM_BYTES]; + __be64 h_commit_sec; + __be32 h_commit_nsec; +}; + +/* + * The block tag: used to describe a single buffer in the journal + */ +typedef struct journal_block_tag3_s +{ + __be32 t_blocknr; /* The on-disk block number */ + __be32 t_flags; /* See below */ + __be32 t_blocknr_high; /* most-significant high 32bits. */ + __be32 t_checksum; /* crc32c(uuid+seq+block) */ +} journal_block_tag3_t; + +typedef struct journal_block_tag_s +{ + __be32 t_blocknr; /* The on-disk block number */ + __be16 t_checksum; /* truncated crc32c(uuid+seq+block) */ + __be16 t_flags; /* See below */ + __be32 t_blocknr_high; /* most-significant high 32bits. */ +} journal_block_tag_t; + +/* Tail of descriptor or revoke block, for checksumming */ +struct jbd2_journal_block_tail { + __be32 t_checksum; +}; + +/* + * The revoke descriptor: used on disk to describe a series of blocks to + * be revoked from the log + */ +typedef struct journal_revoke_header_s +{ + journal_header_t r_header; + __be32 r_count; /* Count of bytes used in the block */ +} jbd2_journal_revoke_header_t; + +/* Definitions for the journal tag flags word: */ +#define JBD2_FLAG_ESCAPE 1 /* on-disk block is escaped */ +#define JBD2_FLAG_SAME_UUID 2 /* block has same uuid as previous */ +#define JBD2_FLAG_DELETED 4 /* block deleted by this transaction */ +#define JBD2_FLAG_LAST_TAG 8 /* last tag in this descriptor block */ + + +#define UUID_SIZE 16 +#define JBD2_USERS_MAX 48 +#define JBD2_USERS_SIZE (UUID_SIZE * JBD2_USERS_MAX) +/* + * The journal superblock. All fields are in big-endian byte order. + */ +typedef struct journal_superblock_s +{ +/* 0x0000 */ + journal_header_t s_header; + +/* 0x000C */ + /* Static information describing the journal */ + __be32 s_blocksize; /* journal device blocksize */ + __be32 s_maxlen; /* total blocks in journal file */ + __be32 s_first; /* first block of log information */ + +/* 0x0018 */ + /* Dynamic information describing the current state of the log */ + __be32 s_sequence; /* first commit ID expected in log */ + __be32 s_start; /* blocknr of start of log */ + +/* 0x0020 */ + /* Error value, as set by journal_abort(). */ + __s32 s_errno; + +/* 0x0024 */ + /* Remaining fields are only valid in a version-2 superblock */ + __be32 s_feature_compat; /* compatible feature set */ + __be32 s_feature_incompat; /* incompatible feature set */ + __be32 s_feature_ro_compat; /* readonly-compatible feature set */ +/* 0x0030 */ + __u8 s_uuid[16]; /* 128-bit uuid for journal */ + +/* 0x0040 */ + __be32 s_nr_users; /* Nr of filesystems sharing log */ + + __be32 s_dynsuper; /* Blocknr of dynamic superblock copy*/ + +/* 0x0048 */ + __be32 s_max_transaction; /* Limit of journal blocks per trans.*/ + __be32 s_max_trans_data; /* Limit of data blocks per trans. */ + +/* 0x0050 */ + __u8 s_checksum_type; /* checksum type */ + __u8 s_padding2[3]; +/* 0x0054 */ + __be32 s_num_fc_blks; /* Number of fast commit blocks */ +/* 0x0058 */ + __be32 s_padding[41]; + __be32 s_checksum; /* crc32c(superblock) */ + +/* 0x0100 */ + __u8 s_users[JBD2_USERS_SIZE]; /* ids of all fs'es sharing the log */ + +/* 0x0400 */ +} journal_superblock_t; + +#define JBD2_HAS_COMPAT_FEATURE(j,mask) \ + ((j)->j_format_version >= 2 && \ + ((j)->j_superblock->s_feature_compat & ext2fs_cpu_to_be32((mask)))) +#define JBD2_HAS_RO_COMPAT_FEATURE(j,mask) \ + ((j)->j_format_version >= 2 && \ + ((j)->j_superblock->s_feature_ro_compat & ext2fs_cpu_to_be32((mask)))) +#define JBD2_HAS_INCOMPAT_FEATURE(j,mask) \ + ((j)->j_format_version >= 2 && \ + ((j)->j_superblock->s_feature_incompat & ext2fs_cpu_to_be32((mask)))) + +#define JBD2_FEATURE_COMPAT_CHECKSUM 0x00000001 + +#define JBD2_FEATURE_INCOMPAT_REVOKE 0x00000001 +#define JBD2_FEATURE_INCOMPAT_64BIT 0x00000002 +#define JBD2_FEATURE_INCOMPAT_ASYNC_COMMIT 0x00000004 +#define JBD2_FEATURE_INCOMPAT_CSUM_V2 0x00000008 +#define JBD2_FEATURE_INCOMPAT_CSUM_V3 0x00000010 +#define JBD2_FEATURE_INCOMPAT_FAST_COMMIT 0x00000020 + +/* Features known to this kernel version: */ +#define JBD2_KNOWN_COMPAT_FEATURES 0 +#define JBD2_KNOWN_ROCOMPAT_FEATURES 0 +#define JBD2_KNOWN_INCOMPAT_FEATURES (JBD2_FEATURE_INCOMPAT_REVOKE|\ + JBD2_FEATURE_INCOMPAT_ASYNC_COMMIT| \ + JBD2_FEATURE_INCOMPAT_64BIT|\ + JBD2_FEATURE_INCOMPAT_CSUM_V2| \ + JBD2_FEATURE_INCOMPAT_CSUM_V3 | \ + JBD2_FEATURE_INCOMPAT_FAST_COMMIT) + +#ifdef NO_INLINE_FUNCS +extern size_t journal_tag_bytes(journal_t *journal); +extern int jbd2_journal_has_csum_v2or3(journal_t *journal); +extern int jbd2_journal_get_num_fc_blks(journal_superblock_t *jsb); +extern int tid_gt(tid_t x, tid_t y) EXT2FS_ATTR((unused)); +extern int tid_geq(tid_t x, tid_t y) EXT2FS_ATTR((unused)); +#endif + +#if (defined(E2FSCK_INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS)) +#ifdef E2FSCK_INCLUDE_INLINE_FUNCS +#if (__STDC_VERSION__ >= 199901L) +#define _INLINE_ extern inline +#else +#define _INLINE_ inline +#endif +#else /* !E2FSCK_INCLUDE_INLINE FUNCS */ +#if (__STDC_VERSION__ >= 199901L) +#define _INLINE_ inline +#else /* not C99 */ +#ifdef __GNUC__ +#define _INLINE_ extern __inline__ +#else /* For Watcom C */ +#define _INLINE_ extern inline +#endif /* __GNUC__ */ +#endif /* __STDC_VERSION__ >= 199901L */ +#endif /* INCLUDE_INLINE_FUNCS */ + +/* journal feature predicate functions */ +#define JBD2_FEATURE_COMPAT_FUNCS(name, flagname) \ +_INLINE_ int jbd2_has_feature_##name(journal_t *j); \ +_INLINE_ int jbd2_has_feature_##name(journal_t *j) \ +{ \ + return ((j)->j_format_version >= 2 && \ + ((j)->j_superblock->s_feature_compat & \ + ext2fs_cpu_to_be32(JBD2_FEATURE_COMPAT_##flagname)) != 0); \ +} \ +_INLINE_ void jbd2_set_feature_##name(journal_t *j); \ +_INLINE_ void jbd2_set_feature_##name(journal_t *j) \ +{ \ + (j)->j_superblock->s_feature_compat |= \ + ext2fs_cpu_to_be32(JBD2_FEATURE_COMPAT_##flagname); \ +} \ +_INLINE_ void jbd2_clear_feature_##name(journal_t *j); \ +_INLINE_ void jbd2_clear_feature_##name(journal_t *j) \ +{ \ + (j)->j_superblock->s_feature_compat &= \ + ~ext2fs_cpu_to_be32(JBD2_FEATURE_COMPAT_##flagname); \ +} + +#define JBD2_FEATURE_RO_COMPAT_FUNCS(name, flagname) \ +_INLINE_ int jbd2_has_feature_##name(journal_t *j); \ +_INLINE_ int jbd2_has_feature_##name(journal_t *j) \ +{ \ + return ((j)->j_format_version >= 2 && \ + ((j)->j_superblock->s_feature_ro_compat & \ + ext2fs_cpu_to_be32(JBD2_FEATURE_RO_COMPAT_##flagname)) != 0); \ +} \ +_INLINE_ void jbd2_set_feature_##name(journal_t *j); \ +_INLINE_ void jbd2_set_feature_##name(journal_t *j) \ +{ \ + (j)->j_superblock->s_feature_ro_compat |= \ + ext2fs_cpu_to_be32(JBD2_FEATURE_RO_COMPAT_##flagname); \ +} \ +_INLINE_ void jbd2_clear_feature_##name(journal_t *j); \ +_INLINE_ void jbd2_clear_feature_##name(journal_t *j) \ +{ \ + (j)->j_superblock->s_feature_ro_compat &= \ + ~ext2fs_cpu_to_be32(JBD2_FEATURE_RO_COMPAT_##flagname); \ +} + +#define JBD2_FEATURE_INCOMPAT_FUNCS(name, flagname) \ +_INLINE_ int jbd2_has_feature_##name(journal_t *j); \ +_INLINE_ int jbd2_has_feature_##name(journal_t *j) \ +{ \ + return ((j)->j_format_version >= 2 && \ + ((j)->j_superblock->s_feature_incompat & \ + ext2fs_cpu_to_be32(JBD2_FEATURE_INCOMPAT_##flagname)) != 0); \ +} \ +_INLINE_ void jbd2_set_feature_##name(journal_t *j); \ +_INLINE_ void jbd2_set_feature_##name(journal_t *j) \ +{ \ + (j)->j_superblock->s_feature_incompat |= \ + ext2fs_cpu_to_be32(JBD2_FEATURE_INCOMPAT_##flagname); \ +} \ +_INLINE_ void jbd2_clear_feature_##name(journal_t *j); \ +_INLINE_ void jbd2_clear_feature_##name(journal_t *j) \ +{ \ + (j)->j_superblock->s_feature_incompat &= \ + ~ext2fs_cpu_to_be32(JBD2_FEATURE_INCOMPAT_##flagname); \ +} + +#else +#define JBD2_FEATURE_COMPAT_FUNCS(name, flagname) \ +extern int jbd2_has_feature_##name(journal_t *j); \ +extern void jbd2_set_feature_##name(journal_t *j); \ +extern void jbd2_clear_feature_##name(journal_t *j); + +#define JBD2_FEATURE_RO_COMPAT_FUNCS(name, flagname) \ +extern int jbd2_has_feature_##name(journal_t *j); \ +extern void jbd2_set_feature_##name(journal_t *j); \ +extern void jbd2_clear_feature_##name(journal_t *j); + +#define JBD2_FEATURE_INCOMPAT_FUNCS(name, flagname) \ +extern int jbd2_has_feature_##name(journal_t *j); \ +extern void jbd2_set_feature_##name(journal_t *j); \ +extern void jbd2_clear_feature_##name(journal_t *j); + +#endif /* (defined(E2FSCK_INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS)) */ + +JBD2_FEATURE_COMPAT_FUNCS(checksum, CHECKSUM) + +JBD2_FEATURE_INCOMPAT_FUNCS(revoke, REVOKE) +JBD2_FEATURE_INCOMPAT_FUNCS(64bit, 64BIT) +JBD2_FEATURE_INCOMPAT_FUNCS(async_commit, ASYNC_COMMIT) +JBD2_FEATURE_INCOMPAT_FUNCS(csum2, CSUM_V2) +JBD2_FEATURE_INCOMPAT_FUNCS(csum3, CSUM_V3) +JBD2_FEATURE_INCOMPAT_FUNCS(fast_commit, FAST_COMMIT) + +#if (defined(E2FSCK_INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS)) +/* + * helper functions to deal with 32 or 64bit block numbers. + */ +_INLINE_ size_t journal_tag_bytes(journal_t *journal) +{ + size_t sz; + + if (jbd2_has_feature_csum3(journal)) + return sizeof(journal_block_tag3_t); + + sz = sizeof(journal_block_tag_t); + + if (jbd2_has_feature_csum2(journal)) + sz += sizeof(__u16); + + if (jbd2_has_feature_64bit(journal)) + return sz; + + return sz - sizeof(__u32); +} + +_INLINE_ int jbd2_journal_has_csum_v2or3(journal_t *journal) +{ + if (jbd2_has_feature_csum2(journal) || jbd2_has_feature_csum3(journal)) + return 1; + + return 0; +} + +_INLINE_ int jbd2_journal_get_num_fc_blks(journal_superblock_t *jsb) +{ + int num_fc_blocks = be32_to_cpu(jsb->s_num_fc_blks); + + return num_fc_blocks ? num_fc_blocks : JBD2_DEFAULT_FAST_COMMIT_BLOCKS; +} + +/* Comparison functions for transaction IDs: perform comparisons using + * modulo arithmetic so that they work over sequence number wraps. */ + +_INLINE_ int tid_gt(tid_t x, tid_t y) +{ + int difference = (x - y); + return (difference > 0); +} + +_INLINE_ int tid_geq(tid_t x, tid_t y) +{ + int difference = (x - y); + return (difference >= 0); +} +#endif /* (defined(E2FSCK_INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS)) */ + +#undef _INLINE_ + +extern int journal_blocks_per_page(struct inode *inode); + +/* + * Definitions which augment the buffer_head layer + */ + +/* journaling buffer types */ +#define BJ_None 0 /* Not journaled */ +#define BJ_SyncData 1 /* Normal data: flush before commit */ +#define BJ_AsyncData 2 /* writepage data: wait on it before commit */ +#define BJ_Metadata 3 /* Normal journaled metadata */ +#define BJ_Forget 4 /* Buffer superseded by this transaction */ +#define BJ_IO 5 /* Buffer is for temporary IO use */ +#define BJ_Shadow 6 /* Buffer contents being shadowed to the log */ +#define BJ_LogCtl 7 /* Buffer contains log descriptors */ +#define BJ_Reserved 8 /* Buffer is reserved for access by journal */ +#define BJ_Types 9 + +extern int jbd_blocks_per_page(struct inode *inode); + +#endif /* _LINUX_JBD_H */ diff --git a/lib/ext2fs/kernel-list.h b/lib/ext2fs/kernel-list.h new file mode 100644 index 0000000..dd7b8e0 --- /dev/null +++ b/lib/ext2fs/kernel-list.h @@ -0,0 +1,111 @@ +#ifndef _LINUX_LIST_H +#define _LINUX_LIST_H + +#include "compiler.h" + +/* + * Simple doubly linked list implementation. + * + * Some of the internal functions ("__xxx") are useful when + * manipulating whole lists rather than single entries, as + * sometimes we already know the next/prev entries and we can + * generate better code by using them directly rather than + * using the generic single-entry routines. + */ + +struct list_head { + struct list_head *next, *prev; +}; + +#define LIST_HEAD_INIT(name) { &(name), &(name) } + +#define INIT_LIST_HEAD(ptr) do { \ + (ptr)->next = (ptr); (ptr)->prev = (ptr); \ +} while (0) + +#if (!defined(__GNUC__) && !defined(__WATCOMC__)) +#define __inline__ +#endif + +/* + * Insert a new entry between two known consecutive entries. + * + * This is only for internal list manipulation where we know + * the prev/next entries already! + */ +static __inline__ void __list_add(struct list_head * new, + struct list_head * prev, + struct list_head * next) +{ + next->prev = new; + new->next = next; + new->prev = prev; + prev->next = new; +} + +/* + * Insert a new entry after the specified head.. + */ +static __inline__ void list_add(struct list_head *new, struct list_head *head) +{ + __list_add(new, head, head->next); +} + +/* + * Insert a new entry at the tail + */ +static __inline__ void list_add_tail(struct list_head *new, struct list_head *head) +{ + __list_add(new, head->prev, head); +} + +/* + * Delete a list entry by making the prev/next entries + * point to each other. + * + * This is only for internal list manipulation where we know + * the prev/next entries already! + */ +static __inline__ void __list_del(struct list_head * prev, + struct list_head * next) +{ + next->prev = prev; + prev->next = next; +} + +static __inline__ void list_del(struct list_head *entry) +{ + __list_del(entry->prev, entry->next); +} + +static __inline__ int list_empty(struct list_head *head) +{ + return head->next == head; +} + +/* + * Splice in "list" into "head" + */ +static __inline__ void list_splice(struct list_head *list, struct list_head *head) +{ + struct list_head *first = list->next; + + if (first != list) { + struct list_head *last = list->prev; + struct list_head *at = head->next; + + first->prev = head; + head->next = first; + + last->next = at; + at->prev = last; + } +} + +#define list_entry(ptr, type, member) \ + container_of(ptr, type, member) + +#define list_for_each(pos, head) \ + for (pos = (head)->next; pos != (head); pos = pos->next) + +#endif diff --git a/lib/ext2fs/link.c b/lib/ext2fs/link.c new file mode 100644 index 0000000..d69b1e3 --- /dev/null +++ b/lib/ext2fs/link.c @@ -0,0 +1,646 @@ +/* + * link.c --- create links in a ext2fs directory + * + * Copyright (C) 1993, 1994 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +#define EXT2_DX_ROOT_OFF 24 + +struct dx_frame { + void *buf; + blk64_t pblock; + struct ext2_dx_countlimit *head; + struct ext2_dx_entry *entries; + struct ext2_dx_entry *at; +}; + +struct dx_lookup_info { + const char *name; + int namelen; + int hash_alg; + __u32 hash; + unsigned levels; + struct dx_frame frames[EXT4_HTREE_LEVEL]; +}; + +static errcode_t alloc_dx_frame(ext2_filsys fs, struct dx_frame *frame) +{ + return ext2fs_get_mem(fs->blocksize, &frame->buf); +} + +static void dx_release(struct dx_lookup_info *info) +{ + unsigned level; + + for (level = 0; level < info->levels; level++) { + if (info->frames[level].buf == NULL) + break; + ext2fs_free_mem(&(info->frames[level].buf)); + } + info->levels = 0; +} + +static void dx_search_entry(struct dx_frame *frame, int count, __u32 hash) +{ + struct ext2_dx_entry *p, *q, *m; + + p = frame->entries + 1; + q = frame->entries + count - 1; + while (p <= q) { + m = p + (q - p) / 2; + if (ext2fs_le32_to_cpu(m->hash) > hash) + q = m - 1; + else + p = m + 1; + } + frame->at = p - 1; +} + +static errcode_t load_logical_dir_block(ext2_filsys fs, ext2_ino_t dir, + struct ext2_inode *diri, blk64_t block, + blk64_t *pblk, void *buf) +{ + errcode_t errcode; + int ret_flags; + + errcode = ext2fs_bmap2(fs, dir, diri, NULL, 0, block, &ret_flags, + pblk); + if (errcode) + return errcode; + if (ret_flags & BMAP_RET_UNINIT) + return EXT2_ET_DIR_CORRUPTED; + return ext2fs_read_dir_block4(fs, *pblk, buf, 0, dir); +} + +static errcode_t dx_lookup(ext2_filsys fs, ext2_ino_t dir, + struct ext2_inode *diri, struct dx_lookup_info *info) +{ + struct ext2_dx_root_info *root; + errcode_t errcode; + int level = 0; + int count, limit; + int hash_alg; + int hash_flags = diri->i_flags & EXT4_CASEFOLD_FL; + __u32 minor_hash; + struct dx_frame *frame; + + errcode = alloc_dx_frame(fs, &(info->frames[0])); + if (errcode) + return errcode; + info->levels = 1; + + errcode = load_logical_dir_block(fs, dir, diri, 0, + &(info->frames[0].pblock), + info->frames[0].buf); + if (errcode) + goto out_err; + root = (struct ext2_dx_root_info *) ((char *)info->frames[0].buf + + EXT2_DX_ROOT_OFF); + hash_alg = root->hash_version; + if (hash_alg != EXT2_HASH_TEA && hash_alg != EXT2_HASH_HALF_MD4 && + hash_alg != EXT2_HASH_LEGACY) { + errcode = EXT2_ET_DIRHASH_UNSUPP; + goto out_err; + } + if (hash_alg <= EXT2_HASH_TEA && + fs->super->s_flags & EXT2_FLAGS_UNSIGNED_HASH) + hash_alg += 3; + if (root->indirect_levels >= ext2_dir_htree_level(fs)) { + errcode = EXT2_ET_DIR_CORRUPTED; + goto out_err; + } + info->hash_alg = hash_alg; + + errcode = ext2fs_dirhash2(hash_alg, info->name, info->namelen, + fs->encoding, hash_flags, + fs->super->s_hash_seed, &info->hash, + &minor_hash); + if (errcode) + goto out_err; + + for (level = 0; level <= root->indirect_levels; level++) { + frame = &(info->frames[level]); + if (level > 0) { + errcode = alloc_dx_frame(fs, frame); + if (errcode) + goto out_err; + info->levels++; + + errcode = load_logical_dir_block(fs, dir, diri, + ext2fs_le32_to_cpu(info->frames[level-1].at->block) & 0x0fffffff, + &(frame->pblock), frame->buf); + if (errcode) + goto out_err; + } + errcode = ext2fs_get_dx_countlimit(fs, frame->buf, + &(frame->head), NULL); + if (errcode) + goto out_err; + count = ext2fs_le16_to_cpu(frame->head->count); + limit = ext2fs_le16_to_cpu(frame->head->limit); + frame->entries = (struct ext2_dx_entry *)(frame->head); + if (!count || count > limit) { + errcode = EXT2_ET_DIR_CORRUPTED; + goto out_err; + } + + dx_search_entry(frame, count, info->hash); + } + return 0; +out_err: + dx_release(info); + return errcode; +} + +struct link_struct { + ext2_filsys fs; + const char *name; + int namelen; + ext2_ino_t inode; + int flags; + int done; + unsigned int blocksize; + errcode_t err; + struct ext2_super_block *sb; +}; + +static int link_proc(ext2_ino_t dir EXT2FS_ATTR((unused)), + int entru EXT2FS_ATTR((unused)), + struct ext2_dir_entry *dirent, + int offset, + int blocksize, + char *buf, + void *priv_data) +{ + struct link_struct *ls = (struct link_struct *) priv_data; + struct ext2_dir_entry *next; + unsigned int rec_len, min_rec_len, curr_rec_len; + int ret = 0; + int csum_size = 0; + + if (ls->done) + return DIRENT_ABORT; + + rec_len = EXT2_DIR_REC_LEN(ls->namelen); + + ls->err = ext2fs_get_rec_len(ls->fs, dirent, &curr_rec_len); + if (ls->err) + return DIRENT_ABORT; + + if (ext2fs_has_feature_metadata_csum(ls->fs->super)) + csum_size = sizeof(struct ext2_dir_entry_tail); + /* + * See if the following directory entry (if any) is unused; + * if so, absorb it into this one. + */ + next = (struct ext2_dir_entry *) (buf + offset + curr_rec_len); + if ((offset + (int) curr_rec_len < blocksize - (8 + csum_size)) && + (next->inode == 0) && + (offset + (int) curr_rec_len + (int) next->rec_len <= blocksize)) { + curr_rec_len += next->rec_len; + ls->err = ext2fs_set_rec_len(ls->fs, curr_rec_len, dirent); + if (ls->err) + return DIRENT_ABORT; + ret = DIRENT_CHANGED; + } + + /* + * If the directory entry is used, see if we can split the + * directory entry to make room for the new name. If so, + * truncate it and return. + */ + if (dirent->inode) { + min_rec_len = EXT2_DIR_REC_LEN(ext2fs_dirent_name_len(dirent)); + if (curr_rec_len < (min_rec_len + rec_len)) + return ret; + rec_len = curr_rec_len - min_rec_len; + ls->err = ext2fs_set_rec_len(ls->fs, min_rec_len, dirent); + if (ls->err) + return DIRENT_ABORT; + next = (struct ext2_dir_entry *) (buf + offset + + dirent->rec_len); + next->inode = 0; + ext2fs_dirent_set_name_len(next, 0); + ext2fs_dirent_set_file_type(next, 0); + ls->err = ext2fs_set_rec_len(ls->fs, rec_len, next); + if (ls->err) + return DIRENT_ABORT; + return DIRENT_CHANGED; + } + + /* + * If we get this far, then the directory entry is not used. + * See if we can fit the request entry in. If so, do it. + */ + if (curr_rec_len < rec_len) + return ret; + dirent->inode = ls->inode; + ext2fs_dirent_set_name_len(dirent, ls->namelen); + strncpy(dirent->name, ls->name, ls->namelen); + if (ext2fs_has_feature_filetype(ls->sb)) + ext2fs_dirent_set_file_type(dirent, ls->flags & 0x7); + + ls->done++; + return DIRENT_ABORT|DIRENT_CHANGED; +} + +static errcode_t add_dirent_to_buf(ext2_filsys fs, e2_blkcnt_t blockcnt, + char *buf, ext2_ino_t dir, + struct ext2_inode *diri, const char *name, + ext2_ino_t ino, int flags, blk64_t *pblkp) +{ + struct dir_context ctx; + struct link_struct ls; + errcode_t retval; + + retval = load_logical_dir_block(fs, dir, diri, blockcnt, pblkp, buf); + if (retval) + return retval; + ctx.errcode = 0; + ctx.func = link_proc; + ctx.dir = dir; + ctx.flags = DIRENT_FLAG_INCLUDE_EMPTY; + ctx.buf = buf; + ctx.priv_data = &ls; + + ls.fs = fs; + ls.name = name; + ls.namelen = strlen(name); + ls.inode = ino; + ls.flags = flags; + ls.done = 0; + ls.sb = fs->super; + ls.blocksize = fs->blocksize; + ls.err = 0; + + ext2fs_process_dir_block(fs, pblkp, blockcnt, 0, 0, &ctx); + if (ctx.errcode) + return ctx.errcode; + if (ls.err) + return ls.err; + if (!ls.done) + return EXT2_ET_DIR_NO_SPACE; + return 0; +} + +struct dx_hash_map { + __u32 hash; + int size; + int off; +}; + +static EXT2_QSORT_TYPE dx_hash_map_cmp(const void *ap, const void *bp) +{ + const struct dx_hash_map *a = ap, *b = bp; + + if (a->hash < b->hash) + return -1; + if (a->hash > b->hash) + return 1; + return 0; +} + +static errcode_t dx_move_dirents(ext2_filsys fs, struct dx_hash_map *map, + int count, void *from, void *to) +{ + struct ext2_dir_entry *de; + int i; + int rec_len = 0; + errcode_t retval; + int csum_size = 0; + void *base = to; + + if (ext2fs_has_feature_metadata_csum(fs->super)) + csum_size = sizeof(struct ext2_dir_entry_tail); + + for (i = 0; i < count; i++) { + de = (struct ext2_dir_entry *) ((char *)from + map[i].off); + rec_len = EXT2_DIR_REC_LEN(ext2fs_dirent_name_len(de)); + memcpy(to, de, rec_len); + retval = ext2fs_set_rec_len(fs, rec_len, to); + if (retval) + return retval; + to = (char *)to + rec_len; + } + /* + * Update rec_len of the last dir entry to stretch to the end of block + */ + to = (char *)to - rec_len; + rec_len = fs->blocksize - ((char *)to - (char *)base) - csum_size; + retval = ext2fs_set_rec_len(fs, rec_len, to); + if (retval) + return retval; + if (csum_size) + ext2fs_initialize_dirent_tail(fs, + EXT2_DIRENT_TAIL(base, fs->blocksize)); + return 0; +} + +static errcode_t dx_insert_entry(ext2_filsys fs, ext2_ino_t dir, + struct dx_lookup_info *info, int level, + __u32 hash, blk64_t lblk) +{ + int pcount; + struct ext2_dx_entry *top, *new; + + pcount = ext2fs_le16_to_cpu(info->frames[level].head->count); + top = info->frames[level].entries + pcount; + new = info->frames[level].at + 1; + memmove(new + 1, new, (char *)top - (char *)new); + new->hash = ext2fs_cpu_to_le32(hash); + new->block = ext2fs_cpu_to_le32(lblk); + info->frames[level].head->count = ext2fs_cpu_to_le16(pcount + 1); + return ext2fs_write_dir_block4(fs, info->frames[level].pblock, + info->frames[level].buf, 0, dir); +} + +static errcode_t dx_split_leaf(ext2_filsys fs, ext2_ino_t dir, + struct ext2_inode *diri, + struct dx_lookup_info *info, void *buf, + blk64_t leaf_pblk, blk64_t new_lblk, + blk64_t new_pblk) +{ + int hash_flags = diri->i_flags & EXT4_CASEFOLD_FL; + struct ext2_dir_entry *de; + void *buf2; + errcode_t retval = 0; + unsigned int rec_len; + unsigned int offset, move_size; + int i, count = 0; + struct dx_hash_map *map; + int continued; + __u32 minor_hash; + + retval = ext2fs_get_mem(fs->blocksize, &buf2); + if (retval) + return retval; + retval = ext2fs_get_array(fs->blocksize / 12, + sizeof(struct dx_hash_map), &map); + if (retval) { + ext2fs_free_mem(&buf2); + return retval; + } + for (offset = 0; offset < fs->blocksize; offset += rec_len) { + de = (struct ext2_dir_entry *) ((char *)buf + offset); + retval = ext2fs_get_rec_len(fs, de, &rec_len); + if (retval) + goto out; + if (ext2fs_dirent_name_len(de) > 0 && de->inode) { + map[count].off = offset; + map[count].size = rec_len; + retval = ext2fs_dirhash2(info->hash_alg, de->name, + ext2fs_dirent_name_len(de), + fs->encoding, hash_flags, + fs->super->s_hash_seed, + &(map[count].hash), + &minor_hash); + if (retval) + goto out; + count++; + } + } + qsort(map, count, sizeof(struct dx_hash_map), dx_hash_map_cmp); + move_size = 0; + /* Find place to split block */ + for (i = count - 1; i >= 0; i--) { + if (move_size + map[i].size / 2 > fs->blocksize / 2) + break; + move_size += map[i].size; + } + /* Let i be the first entry to move */ + i++; + /* Move selected directory entries to new block */ + retval = dx_move_dirents(fs, map + i, count - i, buf, buf2); + if (retval) + goto out; + retval = ext2fs_write_dir_block4(fs, new_pblk, buf2, 0, dir); + if (retval) + goto out; + /* Repack remaining entries in the old block */ + retval = dx_move_dirents(fs, map, i, buf, buf2); + if (retval) + goto out; + retval = ext2fs_write_dir_block4(fs, leaf_pblk, buf2, 0, dir); + if (retval) + goto out; + /* Update parent node */ + continued = map[i].hash == map[i-1].hash; + retval = dx_insert_entry(fs, dir, info, info->levels - 1, + map[i].hash + continued, new_lblk); +out: + ext2fs_free_mem(&buf2); + ext2fs_free_mem(&map); + return retval; +} + +static errcode_t dx_grow_tree(ext2_filsys fs, ext2_ino_t dir, + struct ext2_inode *diri, + struct dx_lookup_info *info, void *buf, + blk64_t leaf_pblk) +{ + int i; + errcode_t retval; + ext2_off64_t size = EXT2_I_SIZE(diri); + blk64_t lblk, pblk; + struct ext2_dir_entry *de; + struct ext2_dx_countlimit *head; + int csum_size = 0; + int count; + + if (ext2fs_has_feature_metadata_csum(fs->super)) + csum_size = sizeof(struct ext2_dx_tail); + + /* Find level which can accommodate new child */ + for (i = info->levels - 1; i >= 0; i--) + if (ext2fs_le16_to_cpu(info->frames[i].head->count) < + ext2fs_le16_to_cpu(info->frames[i].head->limit)) + break; + /* Need to grow tree depth? */ + if (i < 0 && info->levels >= ext2_dir_htree_level(fs)) + return EXT2_ET_DIR_NO_SPACE; + lblk = size / fs->blocksize; + size += fs->blocksize; + retval = ext2fs_inode_size_set(fs, diri, size); + if (retval) + return retval; + retval = ext2fs_fallocate(fs, + EXT2_FALLOCATE_FORCE_INIT | EXT2_FALLOCATE_ZERO_BLOCKS, + dir, diri, 0, lblk, 1); + if (retval) + return retval; + retval = ext2fs_write_inode(fs, dir, diri); + if (retval) + return retval; + retval = ext2fs_bmap2(fs, dir, diri, NULL, 0, lblk, NULL, &pblk); + if (retval) + return retval; + /* Only leaf addition needed? */ + if (i == (int)info->levels - 1) + return dx_split_leaf(fs, dir, diri, info, buf, leaf_pblk, + lblk, pblk); + + de = buf; + de->inode = 0; + ext2fs_dirent_set_name_len(de, 0); + ext2fs_dirent_set_file_type(de, 0); + retval = ext2fs_set_rec_len(fs, fs->blocksize, de); + if (retval) + return retval; + head = (struct ext2_dx_countlimit *) ((char *)buf + 8); + count = ext2fs_le16_to_cpu(info->frames[i+1].head->count); + /* Growing tree depth? */ + if (i < 0) { + struct ext2_dx_root_info *root; + + memcpy(head, info->frames[0].entries, + count * sizeof(struct ext2_dx_entry)); + head->limit = ext2fs_cpu_to_le16( + (fs->blocksize - (8 + csum_size)) / + sizeof(struct ext2_dx_entry)); + /* head->count gets set by memcpy above to correct value */ + + /* Now update tree root */ + info->frames[0].head->count = ext2fs_cpu_to_le16(1); + info->frames[0].entries[0].block = ext2fs_cpu_to_le32(lblk); + root = (struct ext2_dx_root_info *) + ((char *)info->frames[0].buf + EXT2_DX_ROOT_OFF); + root->indirect_levels++; + } else { + /* Splitting internal node in two */ + int count1 = count / 2; + int count2 = count - count1; + __u32 split_hash = ext2fs_le32_to_cpu(info->frames[i+1].entries[count1].hash); + + memcpy(head, info->frames[i+1].entries + count1, + count2 * sizeof(struct ext2_dx_entry)); + head->count = ext2fs_cpu_to_le16(count2); + head->limit = ext2fs_cpu_to_le16( + (fs->blocksize - (8 + csum_size)) / + sizeof(struct ext2_dx_entry)); + info->frames[i+1].head->count = ext2fs_cpu_to_le16(count1); + + /* Update parent node */ + retval = dx_insert_entry(fs, dir, info, i, split_hash, lblk); + if (retval) + return retval; + + } + /* Writeout split block / updated root */ + retval = ext2fs_write_dir_block4(fs, info->frames[i+1].pblock, + info->frames[i+1].buf, 0, dir); + if (retval) + return retval; + /* Writeout new tree block */ + retval = ext2fs_write_dir_block4(fs, pblk, buf, 0, dir); + if (retval) + return retval; + return 0; +} + +static errcode_t dx_link(ext2_filsys fs, ext2_ino_t dir, + struct ext2_inode *diri, const char *name, + ext2_ino_t ino, int flags) +{ + struct dx_lookup_info dx_info; + errcode_t retval; + void *blockbuf; + unsigned restart = 0; + blk64_t leaf_pblk; + + retval = ext2fs_get_mem(fs->blocksize, &blockbuf); + if (retval) + return retval; + + dx_info.name = name; + dx_info.namelen = strlen(name); +again: + retval = dx_lookup(fs, dir, diri, &dx_info); + if (retval) + goto free_buf; + + retval = add_dirent_to_buf(fs, + ext2fs_le32_to_cpu(dx_info.frames[dx_info.levels-1].at->block) & 0x0fffffff, + blockbuf, dir, diri, name, ino, flags, &leaf_pblk); + /* + * Success or error other than ENOSPC...? We are done. We may need upto + * two tries to add entry. One to split htree node and another to add + * new leaf block. + */ + if (restart >= dx_info.levels || retval != EXT2_ET_DIR_NO_SPACE) + goto free_frames; + retval = dx_grow_tree(fs, dir, diri, &dx_info, blockbuf, leaf_pblk); + if (retval) + goto free_frames; + /* Restart everything now that the tree is larger */ + restart++; + dx_release(&dx_info); + goto again; +free_frames: + dx_release(&dx_info); +free_buf: + ext2fs_free_mem(&blockbuf); + return retval; +} + +/* + * Note: the low 3 bits of the flags field are used as the directory + * entry filetype. + */ +#ifdef __TURBOC__ + #pragma argsused +#endif +errcode_t ext2fs_link(ext2_filsys fs, ext2_ino_t dir, const char *name, + ext2_ino_t ino, int flags) +{ + errcode_t retval; + struct link_struct ls; + struct ext2_inode inode; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!(fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + if ((retval = ext2fs_read_inode(fs, dir, &inode)) != 0) + return retval; + + if (inode.i_flags & EXT2_INDEX_FL) + return dx_link(fs, dir, &inode, name, ino, flags); + + ls.fs = fs; + ls.name = name; + ls.namelen = name ? strlen(name) : 0; + ls.inode = ino; + ls.flags = flags; + ls.done = 0; + ls.sb = fs->super; + ls.blocksize = fs->blocksize; + ls.err = 0; + + retval = ext2fs_dir_iterate2(fs, dir, DIRENT_FLAG_INCLUDE_EMPTY, + NULL, link_proc, &ls); + if (retval) + return retval; + if (ls.err) + return ls.err; + + if (!ls.done) + return EXT2_ET_DIR_NO_SPACE; + return 0; +} diff --git a/lib/ext2fs/llseek.c b/lib/ext2fs/llseek.c new file mode 100644 index 0000000..45f21d0 --- /dev/null +++ b/lib/ext2fs/llseek.c @@ -0,0 +1,145 @@ +/* + * llseek.c -- stub calling the llseek system call + * + * Copyright (C) 1994, 1995, 1996, 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef _LARGEFILE_SOURCE +#define _LARGEFILE_SOURCE +#endif +#ifndef _LARGEFILE64_SOURCE +#define _LARGEFILE64_SOURCE +#endif + +#include "config.h" +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#ifdef __MSDOS__ +#include <io.h> +#endif +#include "et/com_err.h" +#include "ext2fs/ext2_io.h" + +#ifdef __linux__ + +#if defined(HAVE_LSEEK64) && defined(HAVE_LSEEK64_PROTOTYPE) + +#define my_llseek lseek64 + +#else +#if defined(HAVE_LLSEEK) +#include <sys/syscall.h> + +#ifndef HAVE_LLSEEK_PROTOTYPE +extern long long llseek (int fd, long long offset, int origin); +#endif + +#define my_llseek llseek + +#else /* ! HAVE_LLSEEK */ + +#if SIZEOF_LONG == SIZEOF_LONG_LONG || _FILE_OFFSET_BITS+0 == 64 + +#define my_llseek lseek + +#else /* SIZEOF_LONG != SIZEOF_LONG_LONG */ + +#include <linux/unistd.h> + +#ifndef __NR__llseek +#define __NR__llseek 140 +#endif + +#ifndef __i386__ +static int _llseek (unsigned int, unsigned long, + unsigned long, ext2_loff_t *, unsigned int); + +static _syscall5(int,_llseek,unsigned int,fd,unsigned long,offset_high, + unsigned long, offset_low,ext2_loff_t *,result, + unsigned int, origin); +#endif + +static ext2_loff_t my_llseek (int fd, ext2_loff_t offset, int origin) +{ + ext2_loff_t result; + int retval; + +#ifndef __i386__ + retval = _llseek(fd, ((unsigned long long) offset) >> 32, +#else + retval = syscall(__NR__llseek, fd, (unsigned long long) (offset >> 32), +#endif + ((unsigned long long) offset) & 0xffffffff, + &result, origin); + return (retval == -1 ? (ext2_loff_t) retval : result); +} + +#endif /* SIZE_LONG == SIZEOF_LONG_LONG */ + +#endif /* HAVE_LLSEEK */ +#endif /* defined(HAVE_LSEEK64) && defined(HAVE_LSEEK64_PROTOTYPE) */ + +ext2_loff_t ext2fs_llseek (int fd, ext2_loff_t offset, int origin) +{ +#if SIZEOF_OFF_T >= SIZEOF_LONG_LONG + return my_llseek (fd, offset, origin); +#else + ext2_loff_t result; + static int do_compat = 0; + + if (do_compat) + goto fallback; + + result = my_llseek (fd, offset, origin); + if (result == -1 && errno == ENOSYS) { + /* + * Just in case this code runs on top of an old kernel + * which does not support the llseek system call + */ + do_compat++; + fallback: + if (offset < ((ext2_loff_t) 1 << ((sizeof(off_t)*8) -1))) + return lseek(fd, (off_t) offset, origin); + errno = EINVAL; + return -1; + } + return result; +#endif +} + +#else /* !linux */ + +#ifndef EINVAL +#define EINVAL EXT2_ET_INVALID_ARGUMENT +#endif + +ext2_loff_t ext2fs_llseek (int fd, ext2_loff_t offset, int origin) +{ +#if defined(HAVE_LSEEK64) && defined(HAVE_LSEEK64_PROTOTYPE) + return lseek64 (fd, offset, origin); +#else + if ((sizeof(off_t) < sizeof(ext2_loff_t)) && + (offset >= ((ext2_loff_t) 1 << ((sizeof(off_t)*8) -1)))) { + errno = EINVAL; + return -1; + } + return lseek (fd, (off_t) offset, origin); +#endif +} + +#endif /* linux */ + + diff --git a/lib/ext2fs/lookup.c b/lib/ext2fs/lookup.c new file mode 100644 index 0000000..c1d802c --- /dev/null +++ b/lib/ext2fs/lookup.c @@ -0,0 +1,70 @@ +/* + * lookup.c --- ext2fs directory lookup operations + * + * Copyright (C) 1993, 1994, 1994, 1995 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +struct lookup_struct { + const char *name; + int len; + ext2_ino_t *inode; + int found; +}; + +#ifdef __TURBOC__ + #pragma argsused +#endif +static int lookup_proc(struct ext2_dir_entry *dirent, + int offset EXT2FS_ATTR((unused)), + int blocksize EXT2FS_ATTR((unused)), + char *buf EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct lookup_struct *ls = (struct lookup_struct *) priv_data; + + if (ls->len != ext2fs_dirent_name_len(dirent)) + return 0; + if (strncmp(ls->name, dirent->name, ext2fs_dirent_name_len(dirent))) + return 0; + *ls->inode = dirent->inode; + ls->found++; + return DIRENT_ABORT; +} + + +errcode_t ext2fs_lookup(ext2_filsys fs, ext2_ino_t dir, const char *name, + int namelen, char *buf, ext2_ino_t *inode) +{ + errcode_t retval; + struct lookup_struct ls; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + ls.name = name; + ls.len = namelen; + ls.inode = inode; + ls.found = 0; + + retval = ext2fs_dir_iterate(fs, dir, 0, buf, lookup_proc, &ls); + if (retval) + return retval; + + return (ls.found) ? 0 : EXT2_ET_FILE_NOT_FOUND; +} + + diff --git a/lib/ext2fs/mkdir.c b/lib/ext2fs/mkdir.c new file mode 100644 index 0000000..437c8ff --- /dev/null +++ b/lib/ext2fs/mkdir.c @@ -0,0 +1,200 @@ +/* + * mkdir.c --- make a directory in the filesystem + * + * Copyright (C) 1994, 1995 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +#ifndef EXT2_FT_DIR +#define EXT2_FT_DIR 2 +#endif + +errcode_t ext2fs_mkdir(ext2_filsys fs, ext2_ino_t parent, ext2_ino_t inum, + const char *name) +{ + ext2_extent_handle_t handle; + errcode_t retval; + struct ext2_inode parent_inode, inode; + ext2_ino_t ino = inum; + ext2_ino_t scratch_ino; + blk64_t blk; + char *block = 0; + int inline_data = 0; + int drop_refcount = 0; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + /* + * Create a new dir with inline data iff this feature is enabled + * and ino >= EXT2_FIRST_INO. + */ + if ((!ino || ino >= EXT2_FIRST_INO(fs->super)) && + ext2fs_has_feature_inline_data(fs->super)) + inline_data = 1; + + /* + * Allocate an inode, if necessary + */ + if (!ino) { + retval = ext2fs_new_inode(fs, parent, LINUX_S_IFDIR | 0755, + 0, &ino); + if (retval) + goto cleanup; + } + + /* + * Allocate a data block for the directory + */ + memset(&inode, 0, sizeof(struct ext2_inode)); + if (!inline_data) { + retval = ext2fs_new_block2(fs, ext2fs_find_inode_goal(fs, ino, + &inode, + 0), + NULL, &blk); + if (retval) + goto cleanup; + } + + /* + * Create a scratch template for the directory + */ + if (inline_data) + retval = ext2fs_new_dir_inline_data(fs, ino, parent, + inode.i_block); + else + retval = ext2fs_new_dir_block(fs, ino, parent, &block); + if (retval) + goto cleanup; + + /* + * Get the parent's inode, if necessary + */ + if (parent != ino) { + retval = ext2fs_read_inode(fs, parent, &parent_inode); + if (retval) + goto cleanup; + } else + memset(&parent_inode, 0, sizeof(parent_inode)); + + /* + * Create the inode structure.... + */ + inode.i_mode = LINUX_S_IFDIR | (0777 & ~fs->umask); + inode.i_uid = inode.i_gid = 0; + if (inline_data) { + inode.i_flags |= EXT4_INLINE_DATA_FL; + inode.i_size = EXT4_MIN_INLINE_DATA_SIZE; + } else { + if (ext2fs_has_feature_extents(fs->super)) + inode.i_flags |= EXT4_EXTENTS_FL; + else + inode.i_block[0] = blk; + inode.i_size = fs->blocksize; + ext2fs_iblk_set(fs, &inode, 1); + } + inode.i_links_count = 2; + + /* + * Write out the inode and inode data block. The inode generation + * number is assigned by write_new_inode, which means that the call + * to write_dir_block must come after that. + */ + retval = ext2fs_write_new_inode(fs, ino, &inode); + if (retval) + goto cleanup; + if (inline_data) { + /* init "system.data" for new dir */ + retval = ext2fs_inline_data_init(fs, ino); + } else { + retval = ext2fs_write_dir_block4(fs, blk, block, 0, ino); + if (retval) + goto cleanup; + + if (ext2fs_has_feature_extents(fs->super)) { + retval = ext2fs_extent_open2(fs, ino, &inode, &handle); + if (retval) + goto cleanup; + retval = ext2fs_extent_set_bmap(handle, 0, blk, 0); + ext2fs_extent_free(handle); + if (retval) + goto cleanup; + } + } + + /* + * Update accounting.... + */ + if (!inline_data) + ext2fs_block_alloc_stats2(fs, blk, +1); + ext2fs_inode_alloc_stats2(fs, ino, +1, 1); + drop_refcount = 1; + + /* + * Link the directory into the filesystem hierarchy + */ + if (name) { + retval = ext2fs_lookup(fs, parent, name, strlen(name), 0, + &scratch_ino); + if (!retval) { + retval = EXT2_ET_DIR_EXISTS; + name = 0; + goto cleanup; + } + if (retval != EXT2_ET_FILE_NOT_FOUND) + goto cleanup; + retval = ext2fs_link(fs, parent, name, ino, EXT2_FT_DIR); + if (retval) + goto cleanup; + } + + /* + * Update parent inode's counts + */ + if (parent != ino) { + /* reload parent inode due to inline data */ + retval = ext2fs_read_inode(fs, parent, &parent_inode); + if (retval) + goto cleanup; + parent_inode.i_links_count++; + retval = ext2fs_write_inode(fs, parent, &parent_inode); + if (retval) + goto cleanup; + } + drop_refcount = 0; + +cleanup: + if (block) + ext2fs_free_mem(&block); + if (drop_refcount) { + if (!inline_data) + ext2fs_block_alloc_stats2(fs, blk, -1); + ext2fs_inode_alloc_stats2(fs, ino, -1, 1); + } + return retval; + +} + + diff --git a/lib/ext2fs/mkjournal.c b/lib/ext2fs/mkjournal.c new file mode 100644 index 0000000..54772dd --- /dev/null +++ b/lib/ext2fs/mkjournal.c @@ -0,0 +1,654 @@ +/* + * mkjournal.c --- make a journal for a filesystem + * + * Copyright (C) 2000 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#include <assert.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#if HAVE_SYS_IOCTL_H +#include <sys/ioctl.h> +#endif +#if HAVE_NETINET_IN_H +#include <netinet/in.h> +#endif + +#include "ext2_fs.h" +#include "e2p/e2p.h" +#include "ext2fs.h" + +#include "kernel-jbd.h" + +/* + * This function automatically sets up the journal superblock and + * returns it as an allocated block. + */ +errcode_t ext2fs_create_journal_superblock2(ext2_filsys fs, + struct ext2fs_journal_params *jparams, + int flags, char **ret_jsb) +{ + errcode_t retval; + journal_superblock_t *jsb; + + if (jparams->num_journal_blocks < JBD2_MIN_JOURNAL_BLOCKS) + return EXT2_ET_JOURNAL_TOO_SMALL; + + if ((retval = ext2fs_get_mem(fs->blocksize, &jsb))) + return retval; + + memset (jsb, 0, fs->blocksize); + + jsb->s_header.h_magic = htonl(JBD2_MAGIC_NUMBER); + if (flags & EXT2_MKJOURNAL_V1_SUPER) + jsb->s_header.h_blocktype = htonl(JBD2_SUPERBLOCK_V1); + else + jsb->s_header.h_blocktype = htonl(JBD2_SUPERBLOCK_V2); + jsb->s_blocksize = htonl(fs->blocksize); + jsb->s_maxlen = htonl(jparams->num_journal_blocks + jparams->num_fc_blocks); + jsb->s_nr_users = htonl(1); + jsb->s_first = htonl(1); + jsb->s_sequence = htonl(1); + jsb->s_num_fc_blks = htonl(jparams->num_fc_blocks); + memcpy(jsb->s_uuid, fs->super->s_uuid, sizeof(fs->super->s_uuid)); + /* + * If we're creating an external journal device, we need to + * adjust these fields. + */ + if (ext2fs_has_feature_journal_dev(fs->super)) { + jsb->s_nr_users = 0; + jsb->s_first = htonl(ext2fs_journal_sb_start(fs->blocksize) + 1); + } + + *ret_jsb = (char *) jsb; + return 0; +} + +errcode_t ext2fs_create_journal_superblock(ext2_filsys fs, __u32 num_blocks, + int flags, char **ret_sb) +{ + struct ext2fs_journal_params jparams; + + jparams.num_journal_blocks = num_blocks; + jparams.num_fc_blocks = 0; + + return ext2fs_create_journal_superblock2(fs, &jparams, flags, ret_sb); +} + +/* + * This function writes a journal using POSIX routines. It is used + * for creating external journals and creating journals on live + * filesystems. + */ +static errcode_t write_journal_file(ext2_filsys fs, char *filename, + struct ext2fs_journal_params *jparams, + int flags) +{ + errcode_t retval; + char *buf = 0; + int fd, ret_size; + blk_t i; + + if ((retval = ext2fs_create_journal_superblock2(fs, jparams, flags, + &buf))) + return retval; + + /* Open the device or journal file */ + if ((fd = open(filename, O_WRONLY)) < 0) { + retval = errno; + goto errfree; + } + + /* Write the superblock out */ + retval = EXT2_ET_SHORT_WRITE; + ret_size = write(fd, buf, fs->blocksize); + if (ret_size < 0) { + retval = errno; + goto errout; + } + if (ret_size != (int) fs->blocksize) + goto errout; + memset(buf, 0, fs->blocksize); + + if (flags & EXT2_MKJOURNAL_LAZYINIT) + goto success; + + for (i = 1; i < jparams->num_journal_blocks + jparams->num_fc_blocks; i++) { + ret_size = write(fd, buf, fs->blocksize); + if (ret_size < 0) { + retval = errno; + goto errout; + } + if (ret_size != (int) fs->blocksize) + goto errout; + } + +success: + retval = 0; +errout: + close(fd); +errfree: + ext2fs_free_mem(&buf); + return retval; +} + +/* + * Convenience function which zeros out _num_ blocks starting at + * _blk_. In case of an error, the details of the error is returned + * via _ret_blk_ and _ret_count_ if they are non-NULL pointers. + * Returns 0 on success, and an error code on an error. + * + * As a special case, if the first argument is NULL, then it will + * attempt to free the static zeroizing buffer. (This is to keep + * programs that check for memory leaks happy.) + */ +#define MAX_STRIDE_LENGTH (4194304 / (int) fs->blocksize) +errcode_t ext2fs_zero_blocks2(ext2_filsys fs, blk64_t blk, int num, + blk64_t *ret_blk, int *ret_count) +{ + int j, count; + static void *buf; + static int stride_length; + errcode_t retval; + + /* If fs is null, clean up the static buffer and return */ + if (!fs) { + if (buf) { + free(buf); + buf = 0; + stride_length = 0; + } + return 0; + } + + /* Deal with zeroing less than 1 block */ + if (num <= 0) + return 0; + + /* Try a zero out command, if supported */ + retval = io_channel_zeroout(fs->io, blk, num); + if (retval == 0) + return 0; + + /* Allocate the zeroizing buffer if necessary */ + if (num > stride_length && stride_length < MAX_STRIDE_LENGTH) { + void *p; + int new_stride = num; + + if (new_stride > MAX_STRIDE_LENGTH) + new_stride = MAX_STRIDE_LENGTH; + p = realloc(buf, fs->blocksize * new_stride); + if (!p) + return EXT2_ET_NO_MEMORY; + buf = p; + stride_length = new_stride; + memset(buf, 0, fs->blocksize * stride_length); + } + /* OK, do the write loop */ + j=0; + while (j < num) { + if (blk % stride_length) { + count = stride_length - (blk % stride_length); + if (count > (num - j)) + count = num - j; + } else { + count = num - j; + if (count > stride_length) + count = stride_length; + } + retval = io_channel_write_blk64(fs->io, blk, count, buf); + if (retval) { + if (ret_count) + *ret_count = count; + if (ret_blk) + *ret_blk = blk; + return retval; + } + j += count; blk += count; + } + return 0; +} + +errcode_t ext2fs_zero_blocks(ext2_filsys fs, blk_t blk, int num, + blk_t *ret_blk, int *ret_count) +{ + blk64_t ret_blk2; + errcode_t retval; + + retval = ext2fs_zero_blocks2(fs, blk, num, &ret_blk2, ret_count); + if (retval) + *ret_blk = (blk_t) ret_blk2; + return retval; +} + +/* + * Calculate the initial goal block to be roughly at the middle of the + * filesystem. Pick a group that has the largest number of free + * blocks. + */ +static blk64_t get_midpoint_journal_block(ext2_filsys fs) +{ + dgrp_t group, start, end, i, log_flex; + + group = ext2fs_group_of_blk2(fs, (ext2fs_blocks_count(fs->super) - + fs->super->s_first_data_block) / 2); + log_flex = 1U << fs->super->s_log_groups_per_flex; + if (fs->super->s_log_groups_per_flex && (group > log_flex)) { + group = group & ~(log_flex - 1); + while ((group < fs->group_desc_count) && + ext2fs_bg_free_blocks_count(fs, group) == 0) + group++; + if (group == fs->group_desc_count) + group = 0; + start = group; + } else + start = (group > 0) ? group-1 : group; + end = ((group+1) < fs->group_desc_count) ? group+1 : group; + group = start; + for (i = start + 1; i <= end; i++) + if (ext2fs_bg_free_blocks_count(fs, i) > + ext2fs_bg_free_blocks_count(fs, group)) + group = i; + return ext2fs_group_first_block2(fs, group); +} + +/* + * This function creates a journal using direct I/O routines. + */ +static errcode_t write_journal_inode(ext2_filsys fs, ext2_ino_t journal_ino, + struct ext2fs_journal_params *jparams, + blk64_t goal, int flags) +{ + char *buf; + errcode_t retval; + struct ext2_inode inode; + unsigned long long inode_size; + int falloc_flags = EXT2_FALLOCATE_FORCE_INIT; + blk64_t zblk; + + if ((retval = ext2fs_create_journal_superblock2(fs, jparams, flags, + &buf))) + return retval; + + if ((retval = ext2fs_read_bitmaps(fs))) + goto out2; + + if ((retval = ext2fs_read_inode(fs, journal_ino, &inode))) + goto out2; + + if (inode.i_blocks > 0) { + retval = EEXIST; + goto out2; + } + + if (goal == ~0ULL) + goal = get_midpoint_journal_block(fs); + + if (ext2fs_has_feature_extents(fs->super)) + inode.i_flags |= EXT4_EXTENTS_FL; + + if (!(flags & EXT2_MKJOURNAL_LAZYINIT)) + falloc_flags |= EXT2_FALLOCATE_ZERO_BLOCKS; + + inode_size = (unsigned long long)fs->blocksize * + (jparams->num_journal_blocks + jparams->num_fc_blocks); + inode.i_mtime = inode.i_ctime = fs->now ? fs->now : time(0); + inode.i_links_count = 1; + inode.i_mode = LINUX_S_IFREG | 0600; + retval = ext2fs_inode_size_set(fs, &inode, inode_size); + if (retval) + goto out2; + + retval = ext2fs_fallocate(fs, falloc_flags, journal_ino, + &inode, goal, 0, + jparams->num_journal_blocks + jparams->num_fc_blocks); + if (retval) + goto out2; + + if ((retval = ext2fs_write_new_inode(fs, journal_ino, &inode))) + goto out2; + + retval = ext2fs_bmap2(fs, journal_ino, &inode, NULL, 0, 0, NULL, &zblk); + if (retval) + goto out2; + + retval = io_channel_write_blk64(fs->io, zblk, 1, buf); + if (retval) + goto out2; + + memcpy(fs->super->s_jnl_blocks, inode.i_block, EXT2_N_BLOCKS*4); + fs->super->s_jnl_blocks[15] = inode.i_size_high; + fs->super->s_jnl_blocks[16] = inode.i_size; + fs->super->s_jnl_backup_type = EXT3_JNL_BACKUP_BLOCKS; + ext2fs_mark_super_dirty(fs); + +out2: + ext2fs_free_mem(&buf); + return retval; +} + +/* + * Find a reasonable journal file size (in blocks) given the number of blocks + * in the filesystem. For very small filesystems, it is not reasonable to + * have a journal that fills more than half of the filesystem. + * + * n.b. comments assume 4k blocks + */ +int ext2fs_default_journal_size(__u64 num_blocks) +{ + if (num_blocks < 2048) + return -1; + if (num_blocks < 32768) /* 128 MB */ + return (1024); /* 4 MB */ + if (num_blocks < 256*1024) /* 1 GB */ + return (4096); /* 16 MB */ + if (num_blocks < 512*1024) /* 2 GB */ + return (8192); /* 32 MB */ + if (num_blocks < 4096*1024) /* 16 GB */ + return (16384); /* 64 MB */ + if (num_blocks < 8192*1024) /* 32 GB */ + return (32768); /* 128 MB */ + if (num_blocks < 16384*1024) /* 64 GB */ + return (65536); /* 256 MB */ + if (num_blocks < 32768*1024) /* 128 GB */ + return (131072); /* 512 MB */ + return 262144; /* 1 GB */ +} + +errcode_t ext2fs_get_journal_params(struct ext2fs_journal_params *params, + ext2_filsys fs) +{ + blk_t total_blks; + int ret; + + memset(params, 0, sizeof(*params)); + if (ext2fs_has_feature_journal_dev(fs->super)) { + total_blks = ext2fs_blocks_count(fs->super); + if (total_blks < JBD2_MIN_JOURNAL_BLOCKS) + return EXT2_ET_JOURNAL_TOO_SMALL; + + if (!ext2fs_has_feature_fast_commit(fs->super)) { + params->num_journal_blocks = total_blks; + params->num_fc_blocks = 0; + return 0; + } + params->num_journal_blocks = ext2fs_blocks_count(fs->super) * + EXT2_JOURNAL_TO_FC_BLKS_RATIO / + (EXT2_JOURNAL_TO_FC_BLKS_RATIO + 1); + if (JBD2_MIN_JOURNAL_BLOCKS > params->num_journal_blocks) + params->num_journal_blocks = JBD2_MIN_JOURNAL_BLOCKS; + params->num_fc_blocks = total_blks - params->num_journal_blocks; + return 0; + } + + ret = ext2fs_default_journal_size(ext2fs_blocks_count(fs->super)); + if (ret < 0) + return EXT2_ET_JOURNAL_TOO_SMALL; + + params->num_journal_blocks = ret; + if (ext2fs_has_feature_fast_commit(fs->super)) + params->num_fc_blocks = params->num_journal_blocks / + EXT2_JOURNAL_TO_FC_BLKS_RATIO; + return 0; +} + +int ext2fs_journal_sb_start(int blocksize) +{ + if (blocksize == EXT2_MIN_BLOCK_SIZE) + return 2; + return 1; +} + +/* + * This function adds a journal device to a filesystem + */ +errcode_t ext2fs_add_journal_device(ext2_filsys fs, ext2_filsys journal_dev) +{ + struct stat st; + errcode_t retval; + char buf[SUPERBLOCK_SIZE]; + journal_superblock_t *jsb; + int start; + __u32 i, nr_users; + + /* Make sure the device exists and is a block device */ + if (stat(journal_dev->device_name, &st) < 0) + return errno; + + if (!S_ISBLK(st.st_mode)) + return EXT2_ET_JOURNAL_NOT_BLOCK; /* Must be a block device */ + + /* Get the journal superblock */ + start = ext2fs_journal_sb_start(journal_dev->blocksize); + if ((retval = io_channel_read_blk64(journal_dev->io, start, + -SUPERBLOCK_SIZE, + buf))) + return retval; + + jsb = (journal_superblock_t *) buf; + if ((jsb->s_header.h_magic != (unsigned) ntohl(JBD2_MAGIC_NUMBER)) || + (jsb->s_header.h_blocktype != (unsigned) ntohl(JBD2_SUPERBLOCK_V2))) + return EXT2_ET_NO_JOURNAL_SB; + + if (ntohl(jsb->s_blocksize) != (unsigned long) fs->blocksize) + return EXT2_ET_UNEXPECTED_BLOCK_SIZE; + + /* Check and see if this filesystem has already been added */ + nr_users = ntohl(jsb->s_nr_users); + if (nr_users > JBD2_USERS_MAX) + return EXT2_ET_CORRUPT_JOURNAL_SB; + for (i=0; i < nr_users; i++) { + if (memcmp(fs->super->s_uuid, + &jsb->s_users[i*16], 16) == 0) + break; + } + if (i >= nr_users) { + memcpy(&jsb->s_users[nr_users*16], + fs->super->s_uuid, 16); + jsb->s_nr_users = htonl(nr_users+1); + } + + /* Writeback the journal superblock */ + if ((retval = io_channel_write_blk64(journal_dev->io, start, + -SUPERBLOCK_SIZE, buf))) + return retval; + + fs->super->s_journal_inum = 0; + fs->super->s_journal_dev = st.st_rdev; + memcpy(fs->super->s_journal_uuid, jsb->s_uuid, + sizeof(fs->super->s_journal_uuid)); + memset(fs->super->s_jnl_blocks, 0, sizeof(fs->super->s_jnl_blocks)); + ext2fs_set_feature_journal(fs->super); + ext2fs_mark_super_dirty(fs); + return 0; +} + +/* + * This function adds a journal inode to a filesystem, using either + * POSIX routines if the filesystem is mounted, or using direct I/O + * functions if it is not. + */ +errcode_t ext2fs_add_journal_inode3(ext2_filsys fs, struct ext2fs_journal_params *jparams, + blk64_t goal, int flags) +{ + errcode_t retval; + ext2_ino_t journal_ino; + struct stat st; + char jfile[1024]; + int mount_flags; + int fd = -1; + + if (flags & EXT2_MKJOURNAL_NO_MNT_CHECK) + mount_flags = 0; + else if ((retval = ext2fs_check_mount_point(fs->device_name, + &mount_flags, + jfile, sizeof(jfile)-10))) + return retval; + + if (mount_flags & EXT2_MF_MOUNTED) { +#if HAVE_EXT2_IOCTLS + int f = 0; +#endif + strcat(jfile, "/.journal"); + + /* + * If .../.journal already exists, make sure any + * immutable or append-only flags are cleared. + */ +#if defined(HAVE_CHFLAGS) && defined(UF_NODUMP) + (void) chflags (jfile, 0); +#else +#if HAVE_EXT2_IOCTLS + fd = open(jfile, O_RDONLY); + if (fd >= 0) { + retval = ioctl(fd, EXT2_IOC_SETFLAGS, &f); + close(fd); + if (retval) + return errno; + } +#endif +#endif + + /* Create the journal file */ + if ((fd = open(jfile, O_CREAT|O_WRONLY, 0600)) < 0) + return errno; + + /* Note that we can't do lazy journal initialization for mounted + * filesystems, since the zero writing is also allocating the + * journal blocks. We could use fallocate, but not all kernels + * support that, and creating a journal on a mounted ext2 + * filesystems is extremely rare these days... Ignore it. */ + flags &= ~EXT2_MKJOURNAL_LAZYINIT; + + if ((retval = write_journal_file(fs, jfile, jparams, flags))) + goto errout; + + /* Get inode number of the journal file */ + if (fstat(fd, &st) < 0) { + retval = errno; + goto errout; + } + +#if defined(HAVE_CHFLAGS) && defined(UF_NODUMP) + retval = fchflags (fd, UF_NODUMP|UF_IMMUTABLE); +#else +#if HAVE_EXT2_IOCTLS + if (ioctl(fd, EXT2_IOC_GETFLAGS, &f) < 0) { + retval = errno; + goto errout; + } + f |= EXT2_NODUMP_FL | EXT2_IMMUTABLE_FL; + retval = ioctl(fd, EXT2_IOC_SETFLAGS, &f); +#endif +#endif + if (retval) { + retval = errno; + goto errout; + } + + if (close(fd) < 0) { + retval = errno; + fd = -1; + goto errout; + } + journal_ino = st.st_ino; + memset(fs->super->s_jnl_blocks, 0, + sizeof(fs->super->s_jnl_blocks)); + } else { + if ((mount_flags & EXT2_MF_BUSY) && + !(fs->flags & EXT2_FLAG_EXCLUSIVE)) { + retval = EBUSY; + goto errout; + } + journal_ino = EXT2_JOURNAL_INO; + if ((retval = write_journal_inode(fs, journal_ino, + jparams, goal, flags))) + return retval; + } + + fs->super->s_journal_inum = journal_ino; + fs->super->s_journal_dev = 0; + memset(fs->super->s_journal_uuid, 0, + sizeof(fs->super->s_journal_uuid)); + ext2fs_set_feature_journal(fs->super); + + ext2fs_mark_super_dirty(fs); + return 0; +errout: + if (fd >= 0) + close(fd); + return retval; +} + +errcode_t ext2fs_add_journal_inode2(ext2_filsys fs, blk_t num_blocks, + blk64_t goal, int flags) +{ + struct ext2fs_journal_params jparams; + + jparams.num_journal_blocks = num_blocks; + jparams.num_fc_blocks = 0; + + return ext2fs_add_journal_inode3(fs, &jparams, goal, flags); +} + +errcode_t ext2fs_add_journal_inode(ext2_filsys fs, blk_t num_blocks, int flags) +{ + return ext2fs_add_journal_inode2(fs, num_blocks, ~0ULL, flags); +} + + +#ifdef DEBUG +main(int argc, char **argv) +{ + errcode_t retval; + char *device_name; + ext2_filsys fs; + + if (argc < 2) { + fprintf(stderr, "Usage: %s filesystem\n", argv[0]); + exit(1); + } + device_name = argv[1]; + + retval = ext2fs_open (device_name, EXT2_FLAG_RW, 0, 0, + unix_io_manager, &fs); + if (retval) { + com_err(argv[0], retval, "while opening %s", device_name); + exit(1); + } + + retval = ext2fs_add_journal_inode(fs, JBD2_MIN_JOURNAL_BLOCKS, 0); + if (retval) { + com_err(argv[0], retval, "while adding journal to %s", + device_name); + exit(1); + } + retval = ext2fs_flush(fs); + if (retval) { + printf("Warning, had trouble writing out superblocks.\n"); + } + ext2fs_close_free(&fs); + exit(0); + +} +#endif diff --git a/lib/ext2fs/mmp.c b/lib/ext2fs/mmp.c new file mode 100644 index 0000000..eb94170 --- /dev/null +++ b/lib/ext2fs/mmp.c @@ -0,0 +1,488 @@ +/* + * Helper functions for multiple mount protection (MMP). + * + * Copyright (C) 2011 Whamcloud, Inc. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef _GNU_SOURCE +#define _GNU_SOURCE +#endif +#ifndef _DEFAULT_SOURCE +#define _DEFAULT_SOURCE /* since glibc 2.20 _SVID_SOURCE is deprecated */ +#endif + +#include "config.h" + +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <sys/time.h> + +#include <sys/types.h> +#include <sys/stat.h> +#include <fcntl.h> + +#include "ext2fs/ext2_fs.h" +#include "ext2fs/ext2fs.h" + +#ifndef O_DIRECT +#define O_DIRECT 0 +#endif + +#if __GNUC_PREREQ (4, 6) +#pragma GCC diagnostic push +#ifndef CONFIG_MMP +#pragma GCC diagnostic ignored "-Wunused-parameter" +#endif +#endif + +errcode_t ext2fs_mmp_read(ext2_filsys fs, blk64_t mmp_blk, void *buf) +{ +#ifdef CONFIG_MMP + struct mmp_struct *mmp_cmp; + errcode_t retval = 0; + + if ((mmp_blk <= fs->super->s_first_data_block) || + (mmp_blk >= ext2fs_blocks_count(fs->super))) + return EXT2_ET_MMP_BAD_BLOCK; + + /* ext2fs_open() reserves fd0,1,2 to avoid stdio collision, so checking + * mmp_fd <= 0 is OK to validate that the fd is valid. This opens its + * own fd to read the MMP block to ensure that it is using O_DIRECT, + * regardless of how the io_manager is doing reads, to avoid caching of + * the MMP block by the io_manager or the VM. It needs to be fresh. */ + if (fs->mmp_fd <= 0) { + struct stat st; + int flags = O_RDONLY | O_DIRECT; + + /* + * There is no reason for using O_DIRECT if we're working with + * regular file. Disabling it also avoids problems with + * alignment when the device of the host file system has sector + * size larger than blocksize of the fs we're working with. + */ + if (stat(fs->device_name, &st) == 0 && + S_ISREG(st.st_mode)) + flags &= ~O_DIRECT; + + fs->mmp_fd = open(fs->device_name, flags); + if (fs->mmp_fd < 0) { + retval = EXT2_ET_MMP_OPEN_DIRECT; + goto out; + } + } + + if (fs->mmp_cmp == NULL) { + int align = ext2fs_get_dio_alignment(fs->mmp_fd); + + retval = ext2fs_get_memalign(fs->blocksize, align, + &fs->mmp_cmp); + if (retval) + return retval; + } + + if ((blk64_t) ext2fs_llseek(fs->mmp_fd, mmp_blk * fs->blocksize, + SEEK_SET) != + mmp_blk * fs->blocksize) { + retval = EXT2_ET_LLSEEK_FAILED; + goto out; + } + + if (read(fs->mmp_fd, fs->mmp_cmp, fs->blocksize) != fs->blocksize) { + retval = EXT2_ET_SHORT_READ; + goto out; + } + + mmp_cmp = fs->mmp_cmp; + + if (!(fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) && + !ext2fs_mmp_csum_verify(fs, mmp_cmp)) + retval = EXT2_ET_MMP_CSUM_INVALID; + +#ifdef WORDS_BIGENDIAN + ext2fs_swap_mmp(mmp_cmp); +#endif + + if (buf != NULL && buf != fs->mmp_cmp) + memcpy(buf, fs->mmp_cmp, fs->blocksize); + + if (mmp_cmp->mmp_magic != EXT4_MMP_MAGIC) { + retval = EXT2_ET_MMP_MAGIC_INVALID; + goto out; + } + +out: + return retval; +#else + return EXT2_ET_OP_NOT_SUPPORTED; +#endif +} + +errcode_t ext2fs_mmp_write(ext2_filsys fs, blk64_t mmp_blk, void *buf) +{ +#ifdef CONFIG_MMP + struct mmp_struct *mmp_s = buf; + struct timeval tv; + errcode_t retval = 0; + + gettimeofday(&tv, 0); + mmp_s->mmp_time = tv.tv_sec; + fs->mmp_last_written = tv.tv_sec; + + if (fs->super->s_mmp_block < fs->super->s_first_data_block || + fs->super->s_mmp_block > ext2fs_blocks_count(fs->super)) + return EXT2_ET_MMP_BAD_BLOCK; + +#ifdef WORDS_BIGENDIAN + ext2fs_swap_mmp(mmp_s); +#endif + + retval = ext2fs_mmp_csum_set(fs, mmp_s); + if (retval) + return retval; + + /* I was tempted to make this use O_DIRECT and the mmp_fd, but + * this caused no end of grief, while leaving it as-is works. */ + retval = io_channel_write_blk64(fs->io, mmp_blk, -(int)sizeof(struct mmp_struct), buf); + +#ifdef WORDS_BIGENDIAN + ext2fs_swap_mmp(mmp_s); +#endif + + /* Make sure the block gets to disk quickly */ + io_channel_flush(fs->io); + return retval; +#else + return EXT2_ET_OP_NOT_SUPPORTED; +#endif +} + +#ifdef HAVE_SRANDOM +#define srand(x) srandom(x) +#define rand() random() +#endif + +unsigned ext2fs_mmp_new_seq(void) +{ +#ifdef CONFIG_MMP + unsigned new_seq; + struct timeval tv; + unsigned long pid = getpid(); + + gettimeofday(&tv, 0); + pid = (pid >> 16) | ((pid & 0xFFFF) << 16); + srand(pid ^ getuid() ^ tv.tv_sec ^ tv.tv_usec); + + gettimeofday(&tv, 0); + /* Crank the random number generator a few times */ + for (new_seq = (tv.tv_sec ^ tv.tv_usec) & 0x1F; new_seq > 0; new_seq--) + rand(); + + do { + new_seq = rand(); + } while (new_seq > EXT4_MMP_SEQ_MAX); + + return new_seq; +#else + return EXT2_ET_OP_NOT_SUPPORTED; +#endif +} + +#ifdef CONFIG_MMP +static errcode_t ext2fs_mmp_reset(ext2_filsys fs) +{ + struct mmp_struct *mmp_s = NULL; + errcode_t retval = 0; + + if (fs->mmp_buf == NULL) { + retval = ext2fs_get_mem(fs->blocksize, &fs->mmp_buf); + if (retval) + goto out; + } + + memset(fs->mmp_buf, 0, fs->blocksize); + mmp_s = fs->mmp_buf; + + mmp_s->mmp_magic = EXT4_MMP_MAGIC; + mmp_s->mmp_seq = EXT4_MMP_SEQ_CLEAN; + mmp_s->mmp_time = 0; +#ifdef HAVE_GETHOSTNAME + gethostname((char *) mmp_s->mmp_nodename, sizeof(mmp_s->mmp_nodename)); +#else + mmp_s->mmp_nodename[0] = '\0'; +#endif + strncpy((char *) mmp_s->mmp_bdevname, fs->device_name, + sizeof(mmp_s->mmp_bdevname)); + + mmp_s->mmp_check_interval = fs->super->s_mmp_update_interval; + if (mmp_s->mmp_check_interval < EXT4_MMP_MIN_CHECK_INTERVAL) + mmp_s->mmp_check_interval = EXT4_MMP_MIN_CHECK_INTERVAL; + + retval = ext2fs_mmp_write(fs, fs->super->s_mmp_block, fs->mmp_buf); +out: + return retval; +} +#endif + +errcode_t ext2fs_mmp_update(ext2_filsys fs) +{ + return ext2fs_mmp_update2(fs, 0); +} + +errcode_t ext2fs_mmp_clear(ext2_filsys fs) +{ +#ifdef CONFIG_MMP + errcode_t retval = 0; + + if (!(fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + retval = ext2fs_mmp_reset(fs); + + return retval; +#else + return EXT2_ET_OP_NOT_SUPPORTED; +#endif +} + +errcode_t ext2fs_mmp_init(ext2_filsys fs) +{ +#ifdef CONFIG_MMP + struct ext2_super_block *sb = fs->super; + blk64_t mmp_block; + errcode_t retval; + + if (sb->s_mmp_update_interval == 0) + sb->s_mmp_update_interval = EXT4_MMP_UPDATE_INTERVAL; + /* This is probably excessively large, but who knows? */ + else if (sb->s_mmp_update_interval > EXT4_MMP_MAX_UPDATE_INTERVAL) + return EXT2_ET_INVALID_ARGUMENT; + + if (fs->mmp_buf == NULL) { + retval = ext2fs_get_mem(fs->blocksize, &fs->mmp_buf); + if (retval) + goto out; + } + + retval = ext2fs_alloc_block2(fs, 0, fs->mmp_buf, &mmp_block); + if (retval) + goto out; + + sb->s_mmp_block = mmp_block; + + retval = ext2fs_mmp_reset(fs); + if (retval) + goto out; + +out: + return retval; +#else + return EXT2_ET_OP_NOT_SUPPORTED; +#endif +} + +#ifndef min +#define min(x, y) ((x) < (y) ? (x) : (y)) +#endif + +/* + * Make sure that the fs is not mounted or being fsck'ed while opening the fs. + */ +errcode_t ext2fs_mmp_start(ext2_filsys fs) +{ +#ifdef CONFIG_MMP + struct mmp_struct *mmp_s; + unsigned seq; + unsigned int mmp_check_interval; + errcode_t retval = 0; + + if (fs->mmp_buf == NULL) { + retval = ext2fs_get_mem(fs->blocksize, &fs->mmp_buf); + if (retval) + goto mmp_error; + } + + retval = ext2fs_mmp_read(fs, fs->super->s_mmp_block, fs->mmp_buf); + if (retval) + goto mmp_error; + + mmp_s = fs->mmp_buf; + + mmp_check_interval = fs->super->s_mmp_update_interval; + if (mmp_check_interval < EXT4_MMP_MIN_CHECK_INTERVAL) + mmp_check_interval = EXT4_MMP_MIN_CHECK_INTERVAL; + + seq = mmp_s->mmp_seq; + if (seq == EXT4_MMP_SEQ_CLEAN) + goto clean_seq; + if (seq == EXT4_MMP_SEQ_FSCK) { + retval = EXT2_ET_MMP_FSCK_ON; + goto mmp_error; + } + + if (seq > EXT4_MMP_SEQ_FSCK) { + retval = EXT2_ET_MMP_UNKNOWN_SEQ; + goto mmp_error; + } + + /* + * If check_interval in MMP block is larger, use that instead of + * check_interval from the superblock. + */ + if (mmp_s->mmp_check_interval > mmp_check_interval) + mmp_check_interval = mmp_s->mmp_check_interval; + + sleep(min(mmp_check_interval * 2 + 1, mmp_check_interval + 60)); + + retval = ext2fs_mmp_read(fs, fs->super->s_mmp_block, fs->mmp_buf); + if (retval) + goto mmp_error; + + if (seq != mmp_s->mmp_seq) { + retval = EXT2_ET_MMP_FAILED; + goto mmp_error; + } + +clean_seq: + if (!(fs->flags & EXT2_FLAG_RW)) + goto mmp_error; + + mmp_s->mmp_seq = seq = ext2fs_mmp_new_seq(); +#ifdef HAVE_GETHOSTNAME + gethostname((char *) mmp_s->mmp_nodename, sizeof(mmp_s->mmp_nodename)); +#else + strcpy((char *) mmp_s->mmp_nodename, "unknown host"); +#endif + strncpy((char *) mmp_s->mmp_bdevname, fs->device_name, + sizeof(mmp_s->mmp_bdevname)); + + retval = ext2fs_mmp_write(fs, fs->super->s_mmp_block, fs->mmp_buf); + if (retval) + goto mmp_error; + + sleep(min(2 * mmp_check_interval + 1, mmp_check_interval + 60)); + + retval = ext2fs_mmp_read(fs, fs->super->s_mmp_block, fs->mmp_buf); + if (retval) + goto mmp_error; + + if (seq != mmp_s->mmp_seq) { + retval = EXT2_ET_MMP_FAILED; + goto mmp_error; + } + + mmp_s->mmp_seq = EXT4_MMP_SEQ_FSCK; + retval = ext2fs_mmp_write(fs, fs->super->s_mmp_block, fs->mmp_buf); + if (retval) + goto mmp_error; + + return 0; + +mmp_error: + return retval; +#else + return EXT2_ET_OP_NOT_SUPPORTED; +#endif +} + +/* + * Clear the MMP usage in the filesystem. If this function returns an + * error EXT2_ET_MMP_CHANGE_ABORT it means the filesystem was modified + * by some other process while in use, and changes should be dropped, or + * risk filesystem corruption. + */ +errcode_t ext2fs_mmp_stop(ext2_filsys fs) +{ +#ifdef CONFIG_MMP + struct mmp_struct *mmp, *mmp_cmp; + errcode_t retval = 0; + + if (!ext2fs_has_feature_mmp(fs->super) || + !(fs->flags & EXT2_FLAG_RW) || (fs->flags & EXT2_FLAG_SKIP_MMP) || + (fs->mmp_buf == NULL) || (fs->mmp_cmp == NULL)) + goto mmp_error; + + retval = ext2fs_mmp_read(fs, fs->super->s_mmp_block, NULL); + if (retval) + goto mmp_error; + + /* Check if the MMP block is not changed. */ + mmp = fs->mmp_buf; + mmp_cmp = fs->mmp_cmp; + if (memcmp(mmp, mmp_cmp, sizeof(*mmp_cmp))) { + retval = EXT2_ET_MMP_CHANGE_ABORT; + goto mmp_error; + } + + mmp_cmp->mmp_seq = EXT4_MMP_SEQ_CLEAN; + retval = ext2fs_mmp_write(fs, fs->super->s_mmp_block, fs->mmp_cmp); + +mmp_error: + if (fs->mmp_fd > 0) { + close(fs->mmp_fd); + fs->mmp_fd = -1; + } + + return retval; +#else + if (!ext2fs_has_feature_mmp(fs->super) || + !(fs->flags & EXT2_FLAG_RW) || (fs->flags & EXT2_FLAG_SKIP_MMP)) + return 0; + + return EXT2_ET_OP_NOT_SUPPORTED; +#endif +} + +#define EXT2_MIN_MMP_UPDATE_INTERVAL 60 + +/* + * Update the on-disk mmp buffer, after checking that it hasn't been changed. + */ +errcode_t ext2fs_mmp_update2(ext2_filsys fs, int immediately) +{ +#ifdef CONFIG_MMP + struct mmp_struct *mmp, *mmp_cmp; + struct timeval tv; + errcode_t retval = 0; + + if (!ext2fs_has_feature_mmp(fs->super) || + !(fs->flags & EXT2_FLAG_RW) || (fs->flags & EXT2_FLAG_SKIP_MMP)) + return 0; + + gettimeofday(&tv, 0); + if (!immediately && + tv.tv_sec - fs->mmp_last_written < EXT2_MIN_MMP_UPDATE_INTERVAL) + return 0; + + retval = ext2fs_mmp_read(fs, fs->super->s_mmp_block, NULL); + if (retval) + goto mmp_error; + + mmp = fs->mmp_buf; + mmp_cmp = fs->mmp_cmp; + + if (memcmp(mmp, mmp_cmp, sizeof(*mmp_cmp))) + return EXT2_ET_MMP_CHANGE_ABORT; + + mmp->mmp_time = tv.tv_sec; + mmp->mmp_seq = EXT4_MMP_SEQ_FSCK; + retval = ext2fs_mmp_write(fs, fs->super->s_mmp_block, fs->mmp_buf); + +mmp_error: + return retval; +#else + if (!ext2fs_has_feature_mmp(fs->super) || + !(fs->flags & EXT2_FLAG_RW) || (fs->flags & EXT2_FLAG_SKIP_MMP)) + return 0; + + return EXT2_ET_OP_NOT_SUPPORTED; +#endif +} +#if __GNUC_PREREQ (4, 6) +#pragma GCC diagnostic pop +#endif diff --git a/lib/ext2fs/namei.c b/lib/ext2fs/namei.c new file mode 100644 index 0000000..1064ab5 --- /dev/null +++ b/lib/ext2fs/namei.c @@ -0,0 +1,227 @@ +/* + * namei.c --- ext2fs directory lookup operations + * + * Copyright (C) 1993, 1994, 1994, 1995 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +/* #define NAMEI_DEBUG */ + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +static errcode_t open_namei(ext2_filsys fs, ext2_ino_t root, ext2_ino_t base, + const char *pathname, size_t pathlen, int follow, + int link_count, char *buf, ext2_ino_t *res_inode); + +static errcode_t follow_link(ext2_filsys fs, ext2_ino_t root, ext2_ino_t dir, + ext2_ino_t inode, int link_count, + char *buf, ext2_ino_t *res_inode) +{ + char *pathname; + char *buffer = 0; + errcode_t retval; + struct ext2_inode ei; + blk64_t blk; + +#ifdef NAMEI_DEBUG + printf("follow_link: root=%lu, dir=%lu, inode=%lu, lc=%d\n", + root, dir, inode, link_count); + +#endif + retval = ext2fs_read_inode (fs, inode, &ei); + if (retval) return retval; + if (!LINUX_S_ISLNK (ei.i_mode)) { + *res_inode = inode; + return 0; + } + if (link_count++ >= EXT2FS_MAX_NESTED_LINKS) + return EXT2_ET_SYMLINK_LOOP; + + if (ext2fs_is_fast_symlink(&ei)) + pathname = (char *)&(ei.i_block[0]); + else if (ei.i_flags & EXT4_INLINE_DATA_FL) { + retval = ext2fs_get_memzero(ei.i_size, &buffer); + if (retval) + return retval; + + retval = ext2fs_inline_data_get(fs, inode, + &ei, buffer, NULL); + if (retval) { + ext2fs_free_mem(&buffer); + return retval; + } + pathname = buffer; + } else { + retval = ext2fs_bmap2(fs, inode, &ei, NULL, 0, 0, NULL, &blk); + if (retval) + return retval; + + retval = ext2fs_get_mem(fs->blocksize, &buffer); + if (retval) + return retval; + + retval = io_channel_read_blk64(fs->io, blk, 1, buffer); + if (retval) { + ext2fs_free_mem(&buffer); + return retval; + } + pathname = buffer; + } + + retval = open_namei(fs, root, dir, pathname, ei.i_size, 1, + link_count, buf, res_inode); + if (buffer) + ext2fs_free_mem(&buffer); + return retval; +} + +/* + * This routine interprets a pathname in the context of the current + * directory and the root directory, and returns the inode of the + * containing directory, and a pointer to the filename of the file + * (pointing into the pathname) and the length of the filename. + */ +static errcode_t dir_namei(ext2_filsys fs, ext2_ino_t root, ext2_ino_t dir, + const char *pathname, int pathlen, + int link_count, char *buf, + const char **name, int *namelen, + ext2_ino_t *res_inode) +{ + char c; + const char *thisname; + int len; + ext2_ino_t inode; + errcode_t retval; + + if ((c = *pathname) == '/') { + dir = root; + pathname++; + pathlen--; + } + while (1) { + thisname = pathname; + for (len=0; --pathlen >= 0;len++) { + c = *(pathname++); + if (c == '/') + break; + } + if (pathlen < 0) + break; + retval = ext2fs_lookup (fs, dir, thisname, len, buf, &inode); + if (retval) return retval; + retval = follow_link (fs, root, dir, inode, + link_count, buf, &dir); + if (retval) return retval; + } + *name = thisname; + *namelen = len; + *res_inode = dir; + return 0; +} + +static errcode_t open_namei(ext2_filsys fs, ext2_ino_t root, ext2_ino_t base, + const char *pathname, size_t pathlen, int follow, + int link_count, char *buf, ext2_ino_t *res_inode) +{ + const char *base_name; + int namelen; + ext2_ino_t dir, inode; + errcode_t retval; + +#ifdef NAMEI_DEBUG + printf("open_namei: root=%lu, dir=%lu, path=%.*s, lc=%d\n", + root, base, pathlen, pathname, link_count); +#endif + retval = dir_namei(fs, root, base, pathname, pathlen, + link_count, buf, &base_name, &namelen, &dir); + if (retval) return retval; + if (!namelen) { /* special case: '/usr/' etc */ + *res_inode=dir; + return 0; + } + retval = ext2fs_lookup (fs, dir, base_name, namelen, buf, &inode); + if (retval) + return retval; + if (follow) { + retval = follow_link(fs, root, dir, inode, link_count, + buf, &inode); + if (retval) + return retval; + } +#ifdef NAMEI_DEBUG + printf("open_namei: (link_count=%d) returns %lu\n", + link_count, inode); +#endif + *res_inode = inode; + return 0; +} + +errcode_t ext2fs_namei(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd, + const char *name, ext2_ino_t *inode) +{ + char *buf; + errcode_t retval; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + retval = ext2fs_get_mem(fs->blocksize, &buf); + if (retval) + return retval; + + retval = open_namei(fs, root, cwd, name, strlen(name), 0, 0, + buf, inode); + + ext2fs_free_mem(&buf); + return retval; +} + +errcode_t ext2fs_namei_follow(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd, + const char *name, ext2_ino_t *inode) +{ + char *buf; + errcode_t retval; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + retval = ext2fs_get_mem(fs->blocksize, &buf); + if (retval) + return retval; + + retval = open_namei(fs, root, cwd, name, strlen(name), 1, 0, + buf, inode); + + ext2fs_free_mem(&buf); + return retval; +} + +errcode_t ext2fs_follow_link(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd, + ext2_ino_t inode, ext2_ino_t *res_inode) +{ + char *buf; + errcode_t retval; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + retval = ext2fs_get_mem(fs->blocksize, &buf); + if (retval) + return retval; + + retval = follow_link(fs, root, cwd, inode, 0, buf, res_inode); + + ext2fs_free_mem(&buf); + return retval; +} + diff --git a/lib/ext2fs/native.c b/lib/ext2fs/native.c new file mode 100644 index 0000000..ba3e0c8 --- /dev/null +++ b/lib/ext2fs/native.c @@ -0,0 +1,28 @@ +/* + * native.c --- returns the ext2_flag for a native byte order + * + * Copyright (C) 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> + +#include "ext2_fs.h" +#include "ext2fs.h" + +int ext2fs_native_flag(void) +{ +#ifdef WORDS_BIGENDIAN + return EXT2_FLAG_SWAP_BYTES; +#else + return 0; +#endif +} + + + diff --git a/lib/ext2fs/newdir.c b/lib/ext2fs/newdir.c new file mode 100644 index 0000000..7f47285 --- /dev/null +++ b/lib/ext2fs/newdir.c @@ -0,0 +1,126 @@ +/* + * newdir.c --- create a new directory block + * + * Copyright (C) 1994, 1995 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +#ifndef EXT2_FT_DIR +#define EXT2_FT_DIR 2 +#endif + +/* + * Create new directory block + */ +errcode_t ext2fs_new_dir_block(ext2_filsys fs, ext2_ino_t dir_ino, + ext2_ino_t parent_ino, char **block) +{ + struct ext2_dir_entry *dir = NULL; + errcode_t retval; + char *buf; + int rec_len; + int filetype = 0; + struct ext2_dir_entry_tail *t; + int csum_size = 0; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + retval = ext2fs_get_mem(fs->blocksize, &buf); + if (retval) + return retval; + memset(buf, 0, fs->blocksize); + dir = (struct ext2_dir_entry *) buf; + + if (ext2fs_has_feature_metadata_csum(fs->super)) + csum_size = sizeof(struct ext2_dir_entry_tail); + + retval = ext2fs_set_rec_len(fs, fs->blocksize - csum_size, dir); + if (retval) { + ext2fs_free_mem(&buf); + return retval; + } + + if (dir_ino) { + if (ext2fs_has_feature_filetype(fs->super)) + filetype = EXT2_FT_DIR; + /* + * Set up entry for '.' + */ + dir->inode = dir_ino; + ext2fs_dirent_set_name_len(dir, 1); + ext2fs_dirent_set_file_type(dir, filetype); + dir->name[0] = '.'; + rec_len = (fs->blocksize - csum_size) - EXT2_DIR_REC_LEN(1); + dir->rec_len = EXT2_DIR_REC_LEN(1); + + /* + * Set up entry for '..' + */ + dir = (struct ext2_dir_entry *) (buf + dir->rec_len); + retval = ext2fs_set_rec_len(fs, rec_len, dir); + if (retval) { + ext2fs_free_mem(&buf); + return retval; + } + dir->inode = parent_ino; + ext2fs_dirent_set_name_len(dir, 2); + ext2fs_dirent_set_file_type(dir, filetype); + dir->name[0] = '.'; + dir->name[1] = '.'; + + } + + if (csum_size) { + t = EXT2_DIRENT_TAIL(buf, fs->blocksize); + ext2fs_initialize_dirent_tail(fs, t); + } + *block = buf; + return 0; +} + +/* + * Create new directory on inline data + */ +errcode_t ext2fs_new_dir_inline_data(ext2_filsys fs, + ext2_ino_t dir_ino EXT2FS_ATTR((unused)), + ext2_ino_t parent_ino, __u32 *iblock) +{ + struct ext2_dir_entry *dir = NULL; + errcode_t retval; + int rec_len; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + iblock[0] = ext2fs_cpu_to_le32(parent_ino); + + dir = (struct ext2_dir_entry *)((char *)iblock + + EXT4_INLINE_DATA_DOTDOT_SIZE); + dir->inode = 0; + rec_len = EXT4_MIN_INLINE_DATA_SIZE - EXT4_INLINE_DATA_DOTDOT_SIZE; + retval = ext2fs_set_rec_len(fs, rec_len, dir); + if (retval) + goto errout; + +#ifdef WORDS_BIGENDIAN + retval = ext2fs_dirent_swab_out2(fs, (char *)dir, rec_len, 0); + if (retval) + goto errout; +#endif + +errout: + return retval; +} diff --git a/lib/ext2fs/nls_utf8.c b/lib/ext2fs/nls_utf8.c new file mode 100644 index 0000000..b07e66e --- /dev/null +++ b/lib/ext2fs/nls_utf8.c @@ -0,0 +1,1000 @@ +/* + * Copyright (c) 2014 SGI. + * Copyright (c) 2018 Collabora Ltd. + * All rights reserved. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation. + * + * This program is distributed in the hope that it would be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + */ + +/* + * This code is adapted from the Linux Kernel. We have a + * userspace version here such that the hashes will match that + * implementation. + */ + +#include "config.h" +#include <stdint.h> +#include <unistd.h> +#include <string.h> +#include <limits.h> +#include <errno.h> + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +/* Encoding a unicode version number as a single unsigned int. */ +#define UNICODE_MAJ_SHIFT (16) +#define UNICODE_MIN_SHIFT (8) + +#define UNICODE_AGE(MAJ, MIN, REV) \ + (((unsigned int)(MAJ) << UNICODE_MAJ_SHIFT) | \ + ((unsigned int)(MIN) << UNICODE_MIN_SHIFT) | \ + ((unsigned int)(REV))) + +/* Needed in struct utf8cursor below. */ +#define UTF8HANGULLEAF (12) + +/* + * Cursor structure used by the normalizer. + */ +struct utf8cursor { + const struct utf8data *data; + const char *s; + const char *p; + const char *ss; + const char *sp; + unsigned int len; + unsigned int slen; + short int ccc; + short int nccc; + unsigned char hangul[UTF8HANGULLEAF]; +}; + +/* + * Initialize a utf8cursor to normalize a string. + * Returns 0 on success. + * Returns -1 on failure. + */ +// extern int utf8cursor(struct utf8cursor *u8c, const struct utf8data *data, +// const char *s); +// extern int utf8ncursor(struct utf8cursor *u8c, const struct utf8data *data, +// const char *s, size_t len); + +/* + * Get the next byte in the normalization. + * Returns a value > 0 && < 256 on success. + * Returns 0 when the end of the normalization is reached. + * Returns -1 if the string being normalized is not valid UTF-8. + */ +// extern int utf8byte(struct utf8cursor *u8c); + + +struct utf8data { + unsigned int maxage; + unsigned int offset; +}; + +#define __INCLUDED_FROM_UTF8NORM_C__ +#include "utf8data.h" +#undef __INCLUDED_FROM_UTF8NORM_C__ + +#define ARRAY_SIZE(array) \ + (sizeof(array) / sizeof(array[0])) + +#if 0 +/* Highest unicode version supported by the data tables. */ +static int utf8version_is_supported(uint8_t maj, uint8_t min, uint8_t rev) +{ + int i = ARRAY_SIZE(utf8agetab) - 1; + unsigned int sb_utf8version = UNICODE_AGE(maj, min, rev); + + while (i >= 0 && utf8agetab[i] != 0) { + if (sb_utf8version == utf8agetab[i]) + return 1; + i--; + } + return 0; +} +#endif + +#if 0 +static int utf8version_latest(void) +{ + return utf8vers; +} +#endif + +/* + * UTF-8 valid ranges. + * + * The UTF-8 encoding spreads the bits of a 32bit word over several + * bytes. This table gives the ranges that can be held and how they'd + * be represented. + * + * 0x00000000 0x0000007F: 0xxxxxxx + * 0x00000000 0x000007FF: 110xxxxx 10xxxxxx + * 0x00000000 0x0000FFFF: 1110xxxx 10xxxxxx 10xxxxxx + * 0x00000000 0x001FFFFF: 11110xxx 10xxxxxx 10xxxxxx 10xxxxxx + * 0x00000000 0x03FFFFFF: 111110xx 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx + * 0x00000000 0x7FFFFFFF: 1111110x 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx + * + * There is an additional requirement on UTF-8, in that only the + * shortest representation of a 32bit value is to be used. A decoder + * must not decode sequences that do not satisfy this requirement. + * Thus the allowed ranges have a lower bound. + * + * 0x00000000 0x0000007F: 0xxxxxxx + * 0x00000080 0x000007FF: 110xxxxx 10xxxxxx + * 0x00000800 0x0000FFFF: 1110xxxx 10xxxxxx 10xxxxxx + * 0x00010000 0x001FFFFF: 11110xxx 10xxxxxx 10xxxxxx 10xxxxxx + * 0x00200000 0x03FFFFFF: 111110xx 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx + * 0x04000000 0x7FFFFFFF: 1111110x 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx + * + * Actual unicode characters are limited to the range 0x0 - 0x10FFFF, + * 17 planes of 65536 values. This limits the sequences actually seen + * even more, to just the following. + * + * 0 - 0x7F: 0 - 0x7F + * 0x80 - 0x7FF: 0xC2 0x80 - 0xDF 0xBF + * 0x800 - 0xFFFF: 0xE0 0xA0 0x80 - 0xEF 0xBF 0xBF + * 0x10000 - 0x10FFFF: 0xF0 0x90 0x80 0x80 - 0xF4 0x8F 0xBF 0xBF + * + * Within those ranges the surrogates 0xD800 - 0xDFFF are not allowed. + * + * Note that the longest sequence seen with valid usage is 4 bytes, + * the same a single UTF-32 character. This makes the UTF-8 + * representation of Unicode strictly smaller than UTF-32. + * + * The shortest sequence requirement was introduced by: + * Corrigendum #1: UTF-8 Shortest Form + * It can be found here: + * http://www.unicode.org/versions/corrigendum1.html + * + */ + +/* + * Return the number of bytes used by the current UTF-8 sequence. + * Assumes the input points to the first byte of a valid UTF-8 + * sequence. + */ +static inline int utf8clen(const char *s) +{ + unsigned char c = *s; + + return 1 + (c >= 0xC0) + (c >= 0xE0) + (c >= 0xF0); +} + +/* + * Decode a 3-byte UTF-8 sequence. + */ +static unsigned int +utf8decode3(const char *str) +{ + unsigned int uc; + + uc = *str++ & 0x0F; + uc <<= 6; + uc |= *str++ & 0x3F; + uc <<= 6; + uc |= *str++ & 0x3F; + + return uc; +} + +/* + * Encode a 3-byte UTF-8 sequence. + */ +static int +utf8encode3(char *str, unsigned int val) +{ + str[2] = (val & 0x3F) | 0x80; + val >>= 6; + str[1] = (val & 0x3F) | 0x80; + val >>= 6; + str[0] = val | 0xE0; + + return 3; +} + +/* + * utf8trie_t + * + * A compact binary tree, used to decode UTF-8 characters. + * + * Internal nodes are one byte for the node itself, and up to three + * bytes for an offset into the tree. The first byte contains the + * following information: + * NEXTBYTE - flag - advance to next byte if set + * BITNUM - 3 bit field - the bit number to tested + * OFFLEN - 2 bit field - number of bytes in the offset + * if offlen == 0 (non-branching node) + * RIGHTPATH - 1 bit field - set if the following node is for the + * right-hand path (tested bit is set) + * TRIENODE - 1 bit field - set if the following node is an internal + * node, otherwise it is a leaf node + * if offlen != 0 (branching node) + * LEFTNODE - 1 bit field - set if the left-hand node is internal + * RIGHTNODE - 1 bit field - set if the right-hand node is internal + * + * Due to the way utf8 works, there cannot be branching nodes with + * NEXTBYTE set, and moreover those nodes always have a righthand + * descendant. + */ +typedef const unsigned char utf8trie_t; +#define BITNUM 0x07 +#define NEXTBYTE 0x08 +#define OFFLEN 0x30 +#define OFFLEN_SHIFT 4 +#define RIGHTPATH 0x40 +#define TRIENODE 0x80 +#define RIGHTNODE 0x40 +#define LEFTNODE 0x80 + +/* + * utf8leaf_t + * + * The leaves of the trie are embedded in the trie, and so the same + * underlying datatype: unsigned char. + * + * leaf[0]: The unicode version, stored as a generation number that is + * an index into utf8agetab[]. With this we can filter code + * points based on the unicode version in which they were + * defined. The CCC of a non-defined code point is 0. + * leaf[1]: Canonical Combining Class. During normalization, we need + * to do a stable sort into ascending order of all characters + * with a non-zero CCC that occur between two characters with + * a CCC of 0, or at the begin or end of a string. + * The unicode standard guarantees that all CCC values are + * between 0 and 254 inclusive, which leaves 255 available as + * a special value. + * Code points with CCC 0 are known as stoppers. + * leaf[2]: Decomposition. If leaf[1] == 255, then leaf[2] is the + * start of a NUL-terminated string that is the decomposition + * of the character. + * The CCC of a decomposable character is the same as the CCC + * of the first character of its decomposition. + * Some characters decompose as the empty string: these are + * characters with the Default_Ignorable_Code_Point property. + * These do affect normalization, as they all have CCC 0. + * + * The decompositions in the trie have been fully expanded, with the + * exception of Hangul syllables, which are decomposed algorithmically. + * + * Casefolding, if applicable, is also done using decompositions. + * + * The trie is constructed in such a way that leaves exist for all + * UTF-8 sequences that match the criteria from the "UTF-8 valid + * ranges" comment above, and only for those sequences. Therefore a + * lookup in the trie can be used to validate the UTF-8 input. + */ +typedef const unsigned char utf8leaf_t; + +#define LEAF_GEN(LEAF) ((LEAF)[0]) +#define LEAF_CCC(LEAF) ((LEAF)[1]) +#define LEAF_STR(LEAF) ((const char *)((LEAF) + 2)) + +#define MINCCC (0) +#define MAXCCC (254) +#define STOPPER (0) +#define DECOMPOSE (255) + +/* Marker for hangul syllable decomposition. */ +#define HANGUL ((char)(255)) +/* Size of the synthesized leaf used for Hangul syllable decomposition. */ +#define UTF8HANGULLEAF (12) + +/* + * Hangul decomposition (algorithm from Section 3.12 of Unicode 6.3.0) + * + * AC00;<Hangul Syllable, First>;Lo;0;L;;;;;N;;;;; + * D7A3;<Hangul Syllable, Last>;Lo;0;L;;;;;N;;;;; + * + * SBase = 0xAC00 + * LBase = 0x1100 + * VBase = 0x1161 + * TBase = 0x11A7 + * LCount = 19 + * VCount = 21 + * TCount = 28 + * NCount = 588 (VCount * TCount) + * SCount = 11172 (LCount * NCount) + * + * Decomposition: + * SIndex = s - SBase + * + * LV (Canonical/Full) + * LIndex = SIndex / NCount + * VIndex = (Sindex % NCount) / TCount + * LPart = LBase + LIndex + * VPart = VBase + VIndex + * + * LVT (Canonical) + * LVIndex = (SIndex / TCount) * TCount + * TIndex = (Sindex % TCount) + * LVPart = SBase + LVIndex + * TPart = TBase + TIndex + * + * LVT (Full) + * LIndex = SIndex / NCount + * VIndex = (Sindex % NCount) / TCount + * TIndex = (Sindex % TCount) + * LPart = LBase + LIndex + * VPart = VBase + VIndex + * if (TIndex == 0) { + * d = <LPart, VPart> + * } else { + * TPart = TBase + TIndex + * d = <LPart, TPart, VPart> + * } + */ + +/* Constants */ +#define SB (0xAC00) +#define LB (0x1100) +#define VB (0x1161) +#define TB (0x11A7) +#define LC (19) +#define VC (21) +#define TC (28) +#define NC (VC * TC) +#define SC (LC * NC) + +/* Algorithmic decomposition of hangul syllable. */ +static utf8leaf_t * +utf8hangul(const char *str, unsigned char *hangul) +{ + unsigned int si; + unsigned int li; + unsigned int vi; + unsigned int ti; + unsigned char *h; + + /* Calculate the SI, LI, VI, and TI values. */ + si = utf8decode3(str) - SB; + li = si / NC; + vi = (si % NC) / TC; + ti = si % TC; + + /* Fill in base of leaf. */ + h = hangul; + LEAF_GEN(h) = 2; + LEAF_CCC(h) = DECOMPOSE; + h += 2; + + /* Add LPart, a 3-byte UTF-8 sequence. */ + h += utf8encode3((char *)h, li + LB); + + /* Add VPart, a 3-byte UTF-8 sequence. */ + h += utf8encode3((char *)h, vi + VB); + + /* Add TPart if required, also a 3-byte UTF-8 sequence. */ + if (ti) + h += utf8encode3((char *)h, ti + TB); + + /* Terminate string. */ + h[0] = '\0'; + + return hangul; +} + +/* + * Use trie to scan s, touching at most len bytes. + * Returns the leaf if one exists, NULL otherwise. + * + * A non-NULL return guarantees that the UTF-8 sequence starting at s + * is well-formed and corresponds to a known unicode code point. The + * shorthand for this will be "is valid UTF-8 unicode". + */ +static utf8leaf_t *utf8nlookup(const struct utf8data *data, + unsigned char *hangul, const char *s, size_t len) +{ + utf8trie_t *trie; + int offlen; + int offset; + int mask; + int node; + + if (!data) + return NULL; + if (len == 0) + return NULL; + + trie = utf8data + data->offset; + node = 1; + while (node) { + offlen = (*trie & OFFLEN) >> OFFLEN_SHIFT; + if (*trie & NEXTBYTE) { + if (--len == 0) + return NULL; + s++; + } + mask = 1 << (*trie & BITNUM); + if (*s & mask) { + /* Right leg */ + if (offlen) { + /* Right node at offset of trie */ + node = (*trie & RIGHTNODE); + offset = trie[offlen]; + while (--offlen) { + offset <<= 8; + offset |= trie[offlen]; + } + trie += offset; + } else if (*trie & RIGHTPATH) { + /* Right node after this node */ + node = (*trie & TRIENODE); + trie++; + } else { + /* No right node. */ + return NULL; + } + } else { + /* Left leg */ + if (offlen) { + /* Left node after this node. */ + node = (*trie & LEFTNODE); + trie += offlen + 1; + } else if (*trie & RIGHTPATH) { + /* No left node. */ + return NULL; + } else { + /* Left node after this node */ + node = (*trie & TRIENODE); + trie++; + } + } + } + /* + * Hangul decomposition is done algorithmically. These are the + * codepoints >= 0xAC00 and <= 0xD7A3. Their UTF-8 encoding is + * always 3 bytes long, so s has been advanced twice, and the + * start of the sequence is at s-2. + */ + if (LEAF_CCC(trie) == DECOMPOSE && LEAF_STR(trie)[0] == HANGUL) + trie = utf8hangul(s - 2, hangul); + return trie; +} + +/* + * Use trie to scan s. + * Returns the leaf if one exists, NULL otherwise. + * + * Forwards to utf8nlookup(). + */ +static utf8leaf_t *utf8lookup(const struct utf8data *data, + unsigned char *hangul, const char *s) +{ + return utf8nlookup(data, hangul, s, (size_t)-1); +} + +#if 0 +/* + * Maximum age of any character in s. + * Return -1 if s is not valid UTF-8 unicode. + * Return 0 if only non-assigned code points are used. + */ +static int utf8agemax(const struct utf8data *data, const char *s) +{ + utf8leaf_t *leaf; + int age = 0; + int leaf_age; + unsigned char hangul[UTF8HANGULLEAF]; + + if (!data) + return -1; + + while (*s) { + leaf = utf8lookup(data, hangul, s); + if (!leaf) + return -1; + + leaf_age = utf8agetab[LEAF_GEN(leaf)]; + if (leaf_age <= data->maxage && leaf_age > age) + age = leaf_age; + s += utf8clen(s); + } + return age; +} +#endif + +#if 0 +/* + * Minimum age of any character in s. + * Return -1 if s is not valid UTF-8 unicode. + * Return 0 if non-assigned code points are used. + */ +static int utf8agemin(const struct utf8data *data, const char *s) +{ + utf8leaf_t *leaf; + int age; + int leaf_age; + unsigned char hangul[UTF8HANGULLEAF]; + + if (!data) + return -1; + age = data->maxage; + while (*s) { + leaf = utf8lookup(data, hangul, s); + if (!leaf) + return -1; + leaf_age = utf8agetab[LEAF_GEN(leaf)]; + if (leaf_age <= data->maxage && leaf_age < age) + age = leaf_age; + s += utf8clen(s); + } + return age; +} +#endif + +#if 0 +/* + * Maximum age of any character in s, touch at most len bytes. + * Return -1 if s is not valid UTF-8 unicode. + */ +static int utf8nagemax(const struct utf8data *data, const char *s, size_t len) +{ + utf8leaf_t *leaf; + int age = 0; + int leaf_age; + unsigned char hangul[UTF8HANGULLEAF]; + + if (!data) + return -1; + + while (len && *s) { + leaf = utf8nlookup(data, hangul, s, len); + if (!leaf) + return -1; + leaf_age = utf8agetab[LEAF_GEN(leaf)]; + if (leaf_age <= data->maxage && leaf_age > age) + age = leaf_age; + len -= utf8clen(s); + s += utf8clen(s); + } + return age; +} +#endif + +#if 0 +/* + * Maximum age of any character in s, touch at most len bytes. + * Return -1 if s is not valid UTF-8 unicode. + */ +static int utf8nagemin(const struct utf8data *data, const char *s, size_t len) +{ + utf8leaf_t *leaf; + int leaf_age; + int age; + unsigned char hangul[UTF8HANGULLEAF]; + + if (!data) + return -1; + age = data->maxage; + while (len && *s) { + leaf = utf8nlookup(data, hangul, s, len); + if (!leaf) + return -1; + leaf_age = utf8agetab[LEAF_GEN(leaf)]; + if (leaf_age <= data->maxage && leaf_age < age) + age = leaf_age; + len -= utf8clen(s); + s += utf8clen(s); + } + return age; +} +#endif + +#if 0 +/* + * Length of the normalization of s. + * Return -1 if s is not valid UTF-8 unicode. + * + * A string of Default_Ignorable_Code_Point has length 0. + */ +static ssize_t utf8len(const struct utf8data *data, const char *s) +{ + utf8leaf_t *leaf; + size_t ret = 0; + unsigned char hangul[UTF8HANGULLEAF]; + + if (!data) + return -1; + while (*s) { + leaf = utf8lookup(data, hangul, s); + if (!leaf) + return -1; + if (utf8agetab[LEAF_GEN(leaf)] > data->maxage) + ret += utf8clen(s); + else if (LEAF_CCC(leaf) == DECOMPOSE) + ret += strlen(LEAF_STR(leaf)); + else + ret += utf8clen(s); + s += utf8clen(s); + } + return ret; +} +#endif + +#if 0 +/* + * Length of the normalization of s, touch at most len bytes. + * Return -1 if s is not valid UTF-8 unicode. + */ +static ssize_t utf8nlen(const struct utf8data *data, const char *s, size_t len) +{ + utf8leaf_t *leaf; + size_t ret = 0; + unsigned char hangul[UTF8HANGULLEAF]; + + if (!data) + return -1; + while (len && *s) { + leaf = utf8nlookup(data, hangul, s, len); + if (!leaf) + return -1; + if (utf8agetab[LEAF_GEN(leaf)] > data->maxage) + ret += utf8clen(s); + else if (LEAF_CCC(leaf) == DECOMPOSE) + ret += strlen(LEAF_STR(leaf)); + else + ret += utf8clen(s); + len -= utf8clen(s); + s += utf8clen(s); + } + return ret; +} +#endif + +/* + * Set up an utf8cursor for use by utf8byte(). + * + * u8c : pointer to cursor. + * data : const struct utf8data to use for normalization. + * s : string. + * len : length of s. + * + * Returns -1 on error, 0 on success. + */ +static int utf8ncursor(struct utf8cursor *u8c, const struct utf8data *data, + const char *s, size_t len) +{ + if (!data) + return -1; + if (!s) + return -1; + u8c->data = data; + u8c->s = s; + u8c->p = NULL; + u8c->ss = NULL; + u8c->sp = NULL; + u8c->len = len; + u8c->slen = 0; + u8c->ccc = STOPPER; + u8c->nccc = STOPPER; + /* Check we didn't clobber the maximum length. */ + if (u8c->len != len) + return -1; + /* The first byte of s may not be an utf8 continuation. */ + if (len > 0 && (*s & 0xC0) == 0x80) + return -1; + return 0; +} + +#if 0 +/* + * Set up an utf8cursor for use by utf8byte(). + * + * u8c : pointer to cursor. + * data : const struct utf8data to use for normalization. + * s : NUL-terminated string. + * + * Returns -1 on error, 0 on success. + */ +static int utf8cursor(struct utf8cursor *u8c, const struct utf8data *data, + const char *s) +{ + return utf8ncursor(u8c, data, s, (unsigned int)-1); +} +#endif + +/* + * Get one byte from the normalized form of the string described by u8c. + * + * Returns the byte cast to an unsigned char on success, and -1 on failure. + * + * The cursor keeps track of the location in the string in u8c->s. + * When a character is decomposed, the current location is stored in + * u8c->p, and u8c->s is set to the start of the decomposition. Note + * that bytes from a decomposition do not count against u8c->len. + * + * Characters are emitted if they match the current CCC in u8c->ccc. + * Hitting end-of-string while u8c->ccc == STOPPER means we're done, + * and the function returns 0 in that case. + * + * Sorting by CCC is done by repeatedly scanning the string. The + * values of u8c->s and u8c->p are stored in u8c->ss and u8c->sp at + * the start of the scan. The first pass finds the lowest CCC to be + * emitted and stores it in u8c->nccc, the second pass emits the + * characters with this CCC and finds the next lowest CCC. This limits + * the number of passes to 1 + the number of different CCCs in the + * sequence being scanned. + * + * Therefore: + * u8c->p != NULL -> a decomposition is being scanned. + * u8c->ss != NULL -> this is a repeating scan. + * u8c->ccc == -1 -> this is the first scan of a repeating scan. + */ +static int utf8byte(struct utf8cursor *u8c) +{ + utf8leaf_t *leaf; + int ccc; + + for (;;) { + /* Check for the end of a decomposed character. */ + if (u8c->p && *u8c->s == '\0') { + u8c->s = u8c->p; + u8c->p = NULL; + } + + /* Check for end-of-string. */ + if (!u8c->p && (u8c->len == 0 || *u8c->s == '\0')) { + /* There is no next byte. */ + if (u8c->ccc == STOPPER) + return 0; + /* End-of-string during a scan counts as a stopper. */ + ccc = STOPPER; + goto ccc_mismatch; + } else if ((*u8c->s & 0xC0) == 0x80) { + /* This is a continuation of the current character. */ + if (!u8c->p) + u8c->len--; + return (unsigned char)*u8c->s++; + } + + /* Look up the data for the current character. */ + if (u8c->p) { + leaf = utf8lookup(u8c->data, u8c->hangul, u8c->s); + } else { + leaf = utf8nlookup(u8c->data, u8c->hangul, + u8c->s, u8c->len); + } + + /* No leaf found implies that the input is a binary blob. */ + if (!leaf) + return -1; + + ccc = LEAF_CCC(leaf); + /* Characters that are too new have CCC 0. */ + if (utf8agetab[LEAF_GEN(leaf)] > u8c->data->maxage) { + ccc = STOPPER; + } else if (ccc == DECOMPOSE) { + u8c->len -= utf8clen(u8c->s); + u8c->p = u8c->s + utf8clen(u8c->s); + u8c->s = LEAF_STR(leaf); + /* Empty decomposition implies CCC 0. */ + if (*u8c->s == '\0') { + if (u8c->ccc == STOPPER) + continue; + ccc = STOPPER; + goto ccc_mismatch; + } + + leaf = utf8lookup(u8c->data, u8c->hangul, u8c->s); + if (!leaf) + return -1; + ccc = LEAF_CCC(leaf); + } + + /* + * If this is not a stopper, then see if it updates + * the next canonical class to be emitted. + */ + if (ccc != STOPPER && u8c->ccc < ccc && ccc < u8c->nccc) + u8c->nccc = ccc; + + /* + * Return the current byte if this is the current + * combining class. + */ + if (ccc == u8c->ccc) { + if (!u8c->p) + u8c->len--; + return (unsigned char)*u8c->s++; + } + + /* Current combining class mismatch. */ +ccc_mismatch: + if (u8c->nccc == STOPPER) { + /* + * Scan forward for the first canonical class + * to be emitted. Save the position from + * which to restart. + */ + u8c->ccc = MINCCC - 1; + u8c->nccc = ccc; + u8c->sp = u8c->p; + u8c->ss = u8c->s; + u8c->slen = u8c->len; + if (!u8c->p) + u8c->len -= utf8clen(u8c->s); + u8c->s += utf8clen(u8c->s); + } else if (ccc != STOPPER) { + /* Not a stopper, and not the ccc we're emitting. */ + if (!u8c->p) + u8c->len -= utf8clen(u8c->s); + u8c->s += utf8clen(u8c->s); + } else if (u8c->nccc != MAXCCC + 1) { + /* At a stopper, restart for next ccc. */ + u8c->ccc = u8c->nccc; + u8c->nccc = MAXCCC + 1; + u8c->s = u8c->ss; + u8c->p = u8c->sp; + u8c->len = u8c->slen; + } else { + /* All done, proceed from here. */ + u8c->ccc = STOPPER; + u8c->nccc = STOPPER; + u8c->sp = NULL; + u8c->ss = NULL; + u8c->slen = 0; + } + } +} + +#if 0 +/* + * Look for the correct const struct utf8data for a unicode version. + * Returns NULL if the version requested is too new. + * + * Two normalization forms are supported: nfdi and nfdicf. + * + * nfdi: + * - Apply unicode normalization form NFD. + * - Remove any Default_Ignorable_Code_Point. + * + * nfdicf: + * - Apply unicode normalization form NFD. + * - Remove any Default_Ignorable_Code_Point. + * - Apply a full casefold (C + F). + */ +static const struct utf8data *utf8nfdi(unsigned int maxage) +{ + int i = ARRAY_SIZE(utf8nfdidata) - 1; + + while (maxage < utf8nfdidata[i].maxage) + i--; + if (maxage > utf8nfdidata[i].maxage) + return NULL; + return &utf8nfdidata[i]; +} +#endif + +static const struct utf8data *utf8nfdicf(unsigned int maxage) +{ + int i = ARRAY_SIZE(utf8nfdicfdata) - 1; + + while (maxage < utf8nfdicfdata[i].maxage) + i--; + if (maxage > utf8nfdicfdata[i].maxage) + return NULL; + return &utf8nfdicfdata[i]; +} + +static int utf8_casefold(const struct ext2fs_nls_table *table, + const unsigned char *str, size_t len, + unsigned char *dest, size_t dlen) +{ + const struct utf8data *data = utf8nfdicf(table->version); + struct utf8cursor cur; + size_t nlen = 0; + + if (utf8ncursor(&cur, data, (const char *) str, len) < 0) + goto invalid_seq; + + for (nlen = 0; nlen < dlen; nlen++) { + int c = utf8byte(&cur); + + dest[nlen] = c; + if (!c) + return nlen; + if (c == -1) + break; + } + + return -ENAMETOOLONG; + +invalid_seq: + if (dlen < len) + return -ENAMETOOLONG; + + /* Signal invalid sequence */ + return -EINVAL; +} + +static int utf8_validate(const struct ext2fs_nls_table *table, + char *s, size_t len, char **pos) +{ + const struct utf8data *data = utf8nfdicf(table->version); + utf8leaf_t *leaf; + unsigned char hangul[UTF8HANGULLEAF]; + + if (!data) + return -1; + while (len && *s) { + leaf = utf8nlookup(data, hangul, s, len); + if (!leaf) { + *pos = s; + return 1; + } + len -= utf8clen(s); + s += utf8clen(s); + } + return 0; +} + +static int utf8_casefold_cmp(const struct ext2fs_nls_table *table, + const unsigned char *str1, size_t len1, + const unsigned char *str2, size_t len2) +{ + const struct utf8data *data = utf8nfdicf(table->version); + int c1, c2; + struct utf8cursor cur1, cur2; + + if (utf8ncursor(&cur1, data, (const char *) str1, len1) < 0) + return -1; + if (utf8ncursor(&cur2, data, (const char *) str2, len2) < 0) + return -1; + + do { + c1 = utf8byte(&cur1); + c2 = utf8byte(&cur2); + + if (c1 < 0 || c2 < 0) + return -1; + if (c1 != c2) + return c1 - c2; + } while (c1); + + return 0; +} + +static const struct ext2fs_nls_ops utf8_ops = { + .casefold = utf8_casefold, + .validate = utf8_validate, + .casefold_cmp = utf8_casefold_cmp, +}; + +static const struct ext2fs_nls_table nls_utf8 = { + .ops = &utf8_ops, + .version = UNICODE_AGE(12, 1, 0), +}; + +const struct ext2fs_nls_table *ext2fs_load_nls_table(int encoding) +{ + if (encoding == EXT4_ENC_UTF8_12_1) + return &nls_utf8; + + return NULL; +} + +int ext2fs_check_encoded_name(const struct ext2fs_nls_table *table, + char *name, size_t len, char **pos) +{ + return table->ops->validate(table, name, len, pos); +} + +int ext2fs_casefold_cmp(const struct ext2fs_nls_table *table, + const unsigned char *str1, size_t len1, + const unsigned char *str2, size_t len2) +{ + return table->ops->casefold_cmp(table, str1, len1, str2, len2); +} diff --git a/lib/ext2fs/nt_io.c b/lib/ext2fs/nt_io.c new file mode 100644 index 0000000..234f6b1 --- /dev/null +++ b/lib/ext2fs/nt_io.c @@ -0,0 +1,1494 @@ +/* + * nt_io.c --- This is the Nt I/O interface to the I/O manager. + * + * Implements a one-block write-through cache. + * + * Copyright (C) 1993, 1994, 1995 Theodore Ts'o. + * Copyright (C) 1998 Andrey Shedel (andreys@ns.cr.cyco.com) + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifdef HAVE_CONFIG_H +#include "config.h" +#endif + + +// +// I need some warnings to disable... +// + + +#pragma warning(disable:4514) // unreferenced inline function has been removed +#pragma warning(push,4) + +#pragma warning(disable:4201) // nonstandard extension used : nameless struct/union) +#pragma warning(disable:4214) // nonstandard extension used : bit field types other than int +#pragma warning(disable:4115) // named type definition in parentheses + +#include <ntddk.h> +#include <ntdddisk.h> +#include <ntstatus.h> + +#pragma warning(pop) + + +// +// Some native APIs. +// + +NTSYSAPI +ULONG +NTAPI +RtlNtStatusToDosError( + IN NTSTATUS Status + ); + +NTSYSAPI +NTSTATUS +NTAPI +NtClose( + IN HANDLE Handle + ); + + +NTSYSAPI +NTSTATUS +NTAPI +NtOpenFile( + OUT PHANDLE FileHandle, + IN ACCESS_MASK DesiredAccess, + IN POBJECT_ATTRIBUTES ObjectAttributes, + OUT PIO_STATUS_BLOCK IoStatusBlock, + IN ULONG ShareAccess, + IN ULONG OpenOptions + ); + +NTSYSAPI +NTSTATUS +NTAPI +NtFlushBuffersFile( + IN HANDLE FileHandle, + OUT PIO_STATUS_BLOCK IoStatusBlock + ); + + +NTSYSAPI +NTSTATUS +NTAPI +NtReadFile( + IN HANDLE FileHandle, + IN HANDLE Event OPTIONAL, + IN PIO_APC_ROUTINE ApcRoutine OPTIONAL, + IN PVOID ApcContext OPTIONAL, + OUT PIO_STATUS_BLOCK IoStatusBlock, + OUT PVOID Buffer, + IN ULONG Length, + IN PLARGE_INTEGER ByteOffset OPTIONAL, + IN PULONG Key OPTIONAL + ); + +NTSYSAPI +NTSTATUS +NTAPI +NtWriteFile( + IN HANDLE FileHandle, + IN HANDLE Event OPTIONAL, + IN PIO_APC_ROUTINE ApcRoutine OPTIONAL, + IN PVOID ApcContext OPTIONAL, + OUT PIO_STATUS_BLOCK IoStatusBlock, + IN PVOID Buffer, + IN ULONG Length, + IN PLARGE_INTEGER ByteOffset OPTIONAL, + IN PULONG Key OPTIONAL + ); + +NTSYSAPI +NTSTATUS +NTAPI +NtDeviceIoControlFile( + IN HANDLE FileHandle, + IN HANDLE Event OPTIONAL, + IN PIO_APC_ROUTINE ApcRoutine OPTIONAL, + IN PVOID ApcContext OPTIONAL, + OUT PIO_STATUS_BLOCK IoStatusBlock, + IN ULONG IoControlCode, + IN PVOID InputBuffer OPTIONAL, + IN ULONG InputBufferLength, + OUT PVOID OutputBuffer OPTIONAL, + IN ULONG OutputBufferLength + ); + +NTSYSAPI +NTSTATUS +NTAPI +NtFsControlFile( + IN HANDLE FileHandle, + IN HANDLE Event OPTIONAL, + IN PIO_APC_ROUTINE ApcRoutine OPTIONAL, + IN PVOID ApcContext OPTIONAL, + OUT PIO_STATUS_BLOCK IoStatusBlock, + IN ULONG IoControlCode, + IN PVOID InputBuffer OPTIONAL, + IN ULONG InputBufferLength, + OUT PVOID OutputBuffer OPTIONAL, + IN ULONG OutputBufferLength + ); + + +NTSYSAPI +NTSTATUS +NTAPI +NtDelayExecution( + IN BOOLEAN Alertable, + IN PLARGE_INTEGER Interval + ); + + +#define FSCTL_LOCK_VOLUME CTL_CODE(FILE_DEVICE_FILE_SYSTEM, 6, METHOD_BUFFERED, FILE_ANY_ACCESS) +#define FSCTL_UNLOCK_VOLUME CTL_CODE(FILE_DEVICE_FILE_SYSTEM, 7, METHOD_BUFFERED, FILE_ANY_ACCESS) +#define FSCTL_DISMOUNT_VOLUME CTL_CODE(FILE_DEVICE_FILE_SYSTEM, 8, METHOD_BUFFERED, FILE_ANY_ACCESS) +#define FSCTL_IS_VOLUME_MOUNTED CTL_CODE(FILE_DEVICE_FILE_SYSTEM,10, METHOD_BUFFERED, FILE_ANY_ACCESS) + + +// +// useful macros +// + +#define BooleanFlagOn(Flags,SingleFlag) ((BOOLEAN)((((Flags) & (SingleFlag)) != 0))) + + +// +// Include Win32 error codes. +// + +#include <winerror.h> + +// +// standard stuff +// + +#include <assert.h> +#include <stdio.h> +#include <string.h> +#include <stdlib.h> +#include <malloc.h> + +#include <linux/types.h> +#include "ext2_fs.h" +#include <errno.h> + +#include "et/com_err.h" +#include "ext2fs/ext2fs.h" +#include "ext2fs/ext2_err.h" + + + + +// +// For checking structure magic numbers... +// + + +#define EXT2_CHECK_MAGIC(struct, code) \ + if ((struct)->magic != (code)) return (code) + +#define EXT2_ET_MAGIC_NT_IO_CHANNEL 0x10ed + + +// +// Private data block +// + +typedef struct _NT_PRIVATE_DATA { + int magic; + HANDLE Handle; + int Flags; + PCHAR Buffer; + __u32 BufferBlockNumber; + ULONG BufferSize; + BOOLEAN OpenedReadonly; + BOOLEAN Written; +}NT_PRIVATE_DATA, *PNT_PRIVATE_DATA; + + + +// +// Standard interface prototypes +// + +static errcode_t nt_open(const char *name, int flags, io_channel *channel); +static errcode_t nt_close(io_channel channel); +static errcode_t nt_set_blksize(io_channel channel, int blksize); +static errcode_t nt_read_blk(io_channel channel, unsigned long block, + int count, void *data); +static errcode_t nt_write_blk(io_channel channel, unsigned long block, + int count, const void *data); +static errcode_t nt_flush(io_channel channel); + +static struct struct_io_manager struct_nt_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "NT I/O Manager", + .open = nt_open, + .close = nt_close, + .set_blksize = nt_set_blksize, + .read_blk = nt_read_blk, + .write_blk = nt_write_blk, + .flush = nt_flush +}; + +// +// function to get API +// + +io_manager nt_io_manager() +{ + return &struct_nt_manager; +} + + + + + +// +// This is a code to convert Win32 errors to unix errno +// + +typedef struct { + ULONG WinError; + int errnocode; +}ERROR_ENTRY; + +static ERROR_ENTRY ErrorTable[] = { + { ERROR_INVALID_FUNCTION, EINVAL }, + { ERROR_FILE_NOT_FOUND, ENOENT }, + { ERROR_PATH_NOT_FOUND, ENOENT }, + { ERROR_TOO_MANY_OPEN_FILES, EMFILE }, + { ERROR_ACCESS_DENIED, EACCES }, + { ERROR_INVALID_HANDLE, EBADF }, + { ERROR_ARENA_TRASHED, ENOMEM }, + { ERROR_NOT_ENOUGH_MEMORY, ENOMEM }, + { ERROR_INVALID_BLOCK, ENOMEM }, + { ERROR_BAD_ENVIRONMENT, E2BIG }, + { ERROR_BAD_FORMAT, ENOEXEC }, + { ERROR_INVALID_ACCESS, EINVAL }, + { ERROR_INVALID_DATA, EINVAL }, + { ERROR_INVALID_DRIVE, ENOENT }, + { ERROR_CURRENT_DIRECTORY, EACCES }, + { ERROR_NOT_SAME_DEVICE, EXDEV }, + { ERROR_NO_MORE_FILES, ENOENT }, + { ERROR_LOCK_VIOLATION, EACCES }, + { ERROR_BAD_NETPATH, ENOENT }, + { ERROR_NETWORK_ACCESS_DENIED, EACCES }, + { ERROR_BAD_NET_NAME, ENOENT }, + { ERROR_FILE_EXISTS, EEXIST }, + { ERROR_CANNOT_MAKE, EACCES }, + { ERROR_FAIL_I24, EACCES }, + { ERROR_INVALID_PARAMETER, EINVAL }, + { ERROR_NO_PROC_SLOTS, EAGAIN }, + { ERROR_DRIVE_LOCKED, EACCES }, + { ERROR_BROKEN_PIPE, EPIPE }, + { ERROR_DISK_FULL, ENOSPC }, + { ERROR_INVALID_TARGET_HANDLE, EBADF }, + { ERROR_INVALID_HANDLE, EINVAL }, + { ERROR_WAIT_NO_CHILDREN, ECHILD }, + { ERROR_CHILD_NOT_COMPLETE, ECHILD }, + { ERROR_DIRECT_ACCESS_HANDLE, EBADF }, + { ERROR_NEGATIVE_SEEK, EINVAL }, + { ERROR_SEEK_ON_DEVICE, EACCES }, + { ERROR_DIR_NOT_EMPTY, ENOTEMPTY }, + { ERROR_NOT_LOCKED, EACCES }, + { ERROR_BAD_PATHNAME, ENOENT }, + { ERROR_MAX_THRDS_REACHED, EAGAIN }, + { ERROR_LOCK_FAILED, EACCES }, + { ERROR_ALREADY_EXISTS, EEXIST }, + { ERROR_FILENAME_EXCED_RANGE, ENOENT }, + { ERROR_NESTING_NOT_ALLOWED, EAGAIN }, + { ERROR_NOT_ENOUGH_QUOTA, ENOMEM } +}; + + + + +static +unsigned +_MapDosError ( + IN ULONG WinError + ) +{ + int i; + + // + // Lookup + // + + for (i = 0; i < (sizeof(ErrorTable)/sizeof(ErrorTable[0])); ++i) + { + if (WinError == ErrorTable[i].WinError) + { + return ErrorTable[i].errnocode; + } + } + + // + // not in table. Check ranges + // + + if ((WinError >= ERROR_WRITE_PROTECT) && + (WinError <= ERROR_SHARING_BUFFER_EXCEEDED)) + { + return EACCES; + } + else if ((WinError >= ERROR_INVALID_STARTING_CODESEG) && + (WinError <= ERROR_INFLOOP_IN_RELOC_CHAIN)) + { + return ENOEXEC; + } + else + { + return EINVAL; + } +} + + + + + + + +// +// Function to map NT status to dos error. +// + +static +__inline +unsigned +_MapNtStatus( + IN NTSTATUS Status + ) +{ + return _MapDosError(RtlNtStatusToDosError(Status)); +} + + + + + +// +// Helper functions to make things easier +// + +static +NTSTATUS +_OpenNtName( + IN PCSTR Name, + IN BOOLEAN Readonly, + OUT PHANDLE Handle, + OUT PBOOLEAN OpenedReadonly OPTIONAL + ) +{ + UNICODE_STRING UnicodeString; + ANSI_STRING AnsiString; + WCHAR Buffer[512]; + NTSTATUS Status; + OBJECT_ATTRIBUTES ObjectAttributes; + IO_STATUS_BLOCK IoStatusBlock; + + // + // Make Unicode name from input string + // + + UnicodeString.Buffer = &Buffer[0]; + UnicodeString.Length = 0; + UnicodeString.MaximumLength = sizeof(Buffer); // in bytes!!! + + RtlInitAnsiString(&AnsiString, Name); + + Status = RtlAnsiStringToUnicodeString(&UnicodeString, &AnsiString, FALSE); + + if(!NT_SUCCESS(Status)) + { + return Status; // Unmappable character? + } + + // + // Initialize object + // + + InitializeObjectAttributes(&ObjectAttributes, + &UnicodeString, + OBJ_CASE_INSENSITIVE, + NULL, + NULL ); + + // + // Try to open it in initial mode + // + + if(ARGUMENT_PRESENT(OpenedReadonly)) + { + *OpenedReadonly = Readonly; + } + + + Status = NtOpenFile(Handle, + SYNCHRONIZE | FILE_READ_DATA | (Readonly ? 0 : FILE_WRITE_DATA), + &ObjectAttributes, + &IoStatusBlock, + FILE_SHARE_WRITE | FILE_SHARE_READ, + FILE_SYNCHRONOUS_IO_NONALERT); + + if(!NT_SUCCESS(Status)) + { + // + // Maybe was just mounted? wait 0.5 sec and retry. + // + + LARGE_INTEGER Interval; + Interval.QuadPart = -5000000; // 0.5 sec. from now + + NtDelayExecution(FALSE, &Interval); + + Status = NtOpenFile(Handle, + SYNCHRONIZE | FILE_READ_DATA | (Readonly ? 0 : FILE_WRITE_DATA), + &ObjectAttributes, + &IoStatusBlock, + FILE_SHARE_WRITE | FILE_SHARE_READ, + FILE_SYNCHRONOUS_IO_NONALERT); + + // + // Try to satisfy mode + // + + if((STATUS_ACCESS_DENIED == Status) && !Readonly) + { + if(ARGUMENT_PRESENT(OpenedReadonly)) + { + *OpenedReadonly = TRUE; + } + + Status = NtOpenFile(Handle, + SYNCHRONIZE | FILE_READ_DATA, + &ObjectAttributes, + &IoStatusBlock, + FILE_SHARE_WRITE | FILE_SHARE_READ, + FILE_SYNCHRONOUS_IO_NONALERT); + } + } + + + + // + // done + // + + return Status; +} + + +static +NTSTATUS +_OpenDriveLetter( + IN CHAR Letter, + IN BOOLEAN ReadOnly, + OUT PHANDLE Handle, + OUT PBOOLEAN OpenedReadonly OPTIONAL + ) +{ + CHAR Buffer[100]; + + sprintf(Buffer, "\\DosDevices\\%c:", Letter); + + return _OpenNtName(Buffer, ReadOnly, Handle, OpenedReadonly); +} + + +// +// Flush device +// + +static +__inline +NTSTATUS +_FlushDrive( + IN HANDLE Handle + ) +{ + IO_STATUS_BLOCK IoStatusBlock; + return NtFlushBuffersFile(Handle, &IoStatusBlock); +} + + +// +// lock drive +// + +static +__inline +NTSTATUS +_LockDrive( + IN HANDLE Handle + ) +{ + IO_STATUS_BLOCK IoStatusBlock; + return NtFsControlFile(Handle, 0, 0, 0, &IoStatusBlock, FSCTL_LOCK_VOLUME, 0, 0, 0, 0); +} + + +// +// unlock drive +// + +static +__inline +NTSTATUS +_UnlockDrive( + IN HANDLE Handle + ) +{ + IO_STATUS_BLOCK IoStatusBlock; + return NtFsControlFile(Handle, 0, 0, 0, &IoStatusBlock, FSCTL_UNLOCK_VOLUME, 0, 0, 0, 0); +} + +static +__inline +NTSTATUS +_DismountDrive( + IN HANDLE Handle + ) +{ + IO_STATUS_BLOCK IoStatusBlock; + return NtFsControlFile(Handle, 0, 0, 0, &IoStatusBlock, FSCTL_DISMOUNT_VOLUME, 0, 0, 0, 0); +} + + +// +// is mounted +// + +static +__inline +BOOLEAN +_IsMounted( + IN HANDLE Handle + ) +{ + IO_STATUS_BLOCK IoStatusBlock; + NTSTATUS Status; + Status = NtFsControlFile(Handle, 0, 0, 0, &IoStatusBlock, FSCTL_IS_VOLUME_MOUNTED, 0, 0, 0, 0); + return (BOOLEAN)(STATUS_SUCCESS == Status); +} + + +static +__inline +NTSTATUS +_CloseDisk( + IN HANDLE Handle + ) +{ + return NtClose(Handle); +} + + + + +// +// Make NT name from any recognized name +// + +static +PCSTR +_NormalizeDeviceName( + IN PCSTR Device, + IN PSTR NormalizedDeviceNameBuffer + ) +{ + int PartitionNumber = -1; + UCHAR DiskNumber; + PSTR p; + + + // + // Do not try to parse NT name + // + + if('\\' == *Device) + return Device; + + + + // + // Strip leading '/dev/' if any + // + + if(('/' == *(Device)) && + ('d' == *(Device + 1)) && + ('e' == *(Device + 2)) && + ('v' == *(Device + 3)) && + ('/' == *(Device + 4))) + { + Device += 5; + } + + if('\0' == *Device) + { + return NULL; + } + + + // + // forms: hda[n], fd[n] + // + + if('d' != *(Device + 1)) + { + return NULL; + } + + if('h' == *Device) + { + if((*(Device + 2) < 'a') || (*(Device + 2) > ('a' + 9)) || + ((*(Device + 3) != '\0') && + ((*(Device + 4) != '\0') || + ((*(Device + 3) < '0') || (*(Device + 3) > '9')) + ) + ) + ) + { + return NULL; + } + + DiskNumber = (UCHAR)(*(Device + 2) - 'a'); + + if(*(Device + 3) != '\0') + { + PartitionNumber = (*(Device + 3) - '0'); + } + + } + else if('f' == *Device) + { + // + // 3-d letter should be a digit. + // + + if((*(Device + 3) != '\0') || + (*(Device + 2) < '0') || (*(Device + 2) > '9')) + { + return NULL; + } + + DiskNumber = (UCHAR)(*(Device + 2) - '0'); + + } + else + { + // + // invalid prefix + // + + return NULL; + } + + + + // + // Prefix + // + + strcpy(NormalizedDeviceNameBuffer, "\\Device\\"); + + // + // Media name + // + + switch(*Device) + { + + case 'f': + strcat(NormalizedDeviceNameBuffer, "Floppy0"); + break; + + case 'h': + strcat(NormalizedDeviceNameBuffer, "Harddisk0"); + break; + } + + + p = NormalizedDeviceNameBuffer + strlen(NormalizedDeviceNameBuffer) - 1; + *p = (CHAR)(*p + DiskNumber); + + + // + // Partition nr. + // + + if(PartitionNumber >= 0) + { + strcat(NormalizedDeviceNameBuffer, "\\Partition0"); + + p = NormalizedDeviceNameBuffer + strlen(NormalizedDeviceNameBuffer) - 1; + *p = (CHAR)(*p + PartitionNumber); + } + + + return NormalizedDeviceNameBuffer; +} + + + + +static +VOID +_GetDeviceSize( + IN HANDLE h, + OUT unsigned __int64 *FsSize + ) +{ + PARTITION_INFORMATION pi; + DISK_GEOMETRY gi; + NTSTATUS Status; + IO_STATUS_BLOCK IoStatusBlock; + + // + // Zero it + // + + *FsSize = 0; + + // + // Call driver + // + + RtlZeroMemory(&pi, sizeof(PARTITION_INFORMATION)); + + Status = NtDeviceIoControlFile( + h, NULL, NULL, NULL, &IoStatusBlock, IOCTL_DISK_GET_PARTITION_INFO, + &pi, sizeof(PARTITION_INFORMATION), + &pi, sizeof(PARTITION_INFORMATION)); + + + if(NT_SUCCESS(Status)) + { + *FsSize = pi.PartitionLength.QuadPart; + } + else if(STATUS_INVALID_DEVICE_REQUEST == Status) + { + // + // No partitions: get device info. + // + + RtlZeroMemory(&gi, sizeof(DISK_GEOMETRY)); + + Status = NtDeviceIoControlFile( + h, NULL, NULL, NULL, &IoStatusBlock, IOCTL_DISK_GET_DRIVE_GEOMETRY, + &gi, sizeof(DISK_GEOMETRY), + &gi, sizeof(DISK_GEOMETRY)); + + + if(NT_SUCCESS(Status)) + { + *FsSize = + gi.BytesPerSector * + gi.SectorsPerTrack * + gi.TracksPerCylinder * + gi.Cylinders.QuadPart; + } + + } +} + + + +// +// Open device by name. +// + +static +BOOLEAN +_Ext2OpenDevice( + IN PCSTR Name, + IN BOOLEAN ReadOnly, + OUT PHANDLE Handle, + OUT PBOOLEAN OpenedReadonly OPTIONAL, + OUT unsigned *Errno OPTIONAL + ) +{ + CHAR NormalizedDeviceName[512]; + NTSTATUS Status; + + if(NULL == Name) + { + // + // Set not found + // + + if(ARGUMENT_PRESENT(Errno)) + *Errno = ENOENT; + + return FALSE; + } + + + if((((*Name) | 0x20) >= 'a') && (((*Name) | 0x20) <= 'z') && + (':' == *(Name + 1)) && ('\0' == *(Name + 2))) + { + Status = _OpenDriveLetter(*Name, ReadOnly, Handle, OpenedReadonly); + } + else + { + // + // Make name + // + + Name = _NormalizeDeviceName(Name, NormalizedDeviceName); + + if(NULL == Name) + { + // + // Set not found + // + + if(ARGUMENT_PRESENT(Errno)) + *Errno = ENOENT; + + return FALSE; + } + + // + // Try to open it + // + + Status = _OpenNtName(Name, ReadOnly, Handle, OpenedReadonly); + } + + + if(!NT_SUCCESS(Status)) + { + if(ARGUMENT_PRESENT(Errno)) + *Errno = _MapNtStatus(Status); + + return FALSE; + } + + return TRUE; +} + + +// +// Raw block io. Sets dos errno +// + +static +BOOLEAN +_BlockIo( + IN HANDLE Handle, + IN LARGE_INTEGER Offset, + IN ULONG Bytes, + IN OUT PCHAR Buffer, + IN BOOLEAN Read, + OUT unsigned* Errno + ) +{ + IO_STATUS_BLOCK IoStatusBlock; + NTSTATUS Status; + + // + // Should be aligned + // + + ASSERT(0 == (Bytes % 512)); + ASSERT(0 == (Offset.LowPart % 512)); + + + // + // perform io + // + + if(Read) + { + Status = NtReadFile(Handle, NULL, NULL, NULL, + &IoStatusBlock, Buffer, Bytes, &Offset, NULL); + } + else + { + Status = NtWriteFile(Handle, NULL, NULL, NULL, + &IoStatusBlock, Buffer, Bytes, &Offset, NULL); + } + + + // + // translate error + // + + if(NT_SUCCESS(Status)) + { + *Errno = 0; + return TRUE; + } + + *Errno = _MapNtStatus(Status); + + return FALSE; +} + + + +__inline +BOOLEAN +_RawWrite( + IN HANDLE Handle, + IN LARGE_INTEGER Offset, + IN ULONG Bytes, + OUT const CHAR* Buffer, + OUT unsigned* Errno + ) +{ + return _BlockIo(Handle, Offset, Bytes, (PCHAR)Buffer, FALSE, Errno); +} + +__inline +BOOLEAN +_RawRead( + IN HANDLE Handle, + IN LARGE_INTEGER Offset, + IN ULONG Bytes, + IN PCHAR Buffer, + OUT unsigned* Errno + ) +{ + return _BlockIo(Handle, Offset, Bytes, Buffer, TRUE, Errno); +} + + + +__inline +BOOLEAN +_SetPartType( + IN HANDLE Handle, + IN UCHAR Type + ) +{ + IO_STATUS_BLOCK IoStatusBlock; + return STATUS_SUCCESS == NtDeviceIoControlFile( + Handle, NULL, NULL, NULL, &IoStatusBlock, IOCTL_DISK_SET_PARTITION_INFO, + &Type, sizeof(Type), + NULL, 0); +} + + + +//--------------------- interface part + +// +// Interface functions. +// Is_mounted is set to 1 if the device is mounted, 0 otherwise +// + +errcode_t +ext2fs_check_if_mounted(const char *file, int *mount_flags) +{ + HANDLE h; + BOOLEAN Readonly; + + *mount_flags = 0; + + if(!_Ext2OpenDevice(file, TRUE, &h, &Readonly, NULL)) + { + return 0; + } + + + __try{ + *mount_flags &= _IsMounted(h) ? EXT2_MF_MOUNTED : 0; + } + __finally{ + _CloseDisk(h); + } + + return 0; +} + + + +// +// Returns the number of blocks in a partition +// + +static __int64 FsSize = 0; +static char knowndevice[1024] = ""; + + +errcode_t +ext2fs_get_device_size(const char *file, int blocksize, + blk_t *retblocks) +{ + HANDLE h; + BOOLEAN Readonly; + + if((0 == FsSize) || (0 != strcmp(knowndevice, file))) + { + + if(!_Ext2OpenDevice(file, TRUE, &h, &Readonly, NULL)) + { + return 0; + } + + + __try{ + + // + // Get size + // + + _GetDeviceSize(h, &FsSize); + strcpy(knowndevice, file); + } + __finally{ + _CloseDisk(h); + } + + } + + *retblocks = (blk_t)(unsigned __int64)(FsSize / blocksize); + UNREFERENCED_PARAMETER(file); + return 0; +} + + + + + + +// +// Table elements +// + + +static +errcode_t +nt_open(const char *name, int flags, io_channel *channel) +{ + io_channel io = NULL; + PNT_PRIVATE_DATA NtData = NULL; + errcode_t Errno = 0; + + // + // Check name + // + + if (NULL == name) + { + return EXT2_ET_BAD_DEVICE_NAME; + } + + __try{ + + // + // Allocate channel handle + // + + io = (io_channel) malloc(sizeof(struct struct_io_channel)); + + if (NULL == io) + { + Errno = ENOMEM; + __leave; + } + + RtlZeroMemory(io, sizeof(struct struct_io_channel)); + io->magic = EXT2_ET_MAGIC_IO_CHANNEL; + + NtData = (PNT_PRIVATE_DATA)malloc(sizeof(NT_PRIVATE_DATA)); + + if (NULL == NtData) + { + Errno = ENOMEM; + __leave; + } + + + io->manager = nt_io_manager(); + io->name = malloc(strlen(name) + 1); + if (NULL == io->name) + { + Errno = ENOMEM; + __leave; + } + + strcpy(io->name, name); + io->private_data = NtData; + io->block_size = 1024; + io->read_error = 0; + io->write_error = 0; + io->refcount = 1; + + // + // Initialize data + // + + RtlZeroMemory(NtData, sizeof(NT_PRIVATE_DATA)); + + NtData->magic = EXT2_ET_MAGIC_NT_IO_CHANNEL; + NtData->BufferBlockNumber = 0xffffffff; + NtData->BufferSize = 1024; + NtData->Buffer = malloc(NtData->BufferSize); + + if (NULL == NtData->Buffer) + { + Errno = ENOMEM; + __leave; + } + + // + // Open it + // + + if(!_Ext2OpenDevice(name, (BOOLEAN)!BooleanFlagOn(flags, EXT2_FLAG_RW), &NtData->Handle, &NtData->OpenedReadonly, &Errno)) + { + __leave; + } + + + // + // get size + // + + _GetDeviceSize(NtData->Handle, &FsSize); + strcpy(knowndevice, name); + + + // + // Lock/dismount + // + + if(!NT_SUCCESS(_LockDrive(NtData->Handle)) /*|| !NT_SUCCESS(_DismountDrive(NtData->Handle))*/) + { + NtData->OpenedReadonly = TRUE; + } + + // + // Done + // + + *channel = io; + + + } + __finally{ + + if(0 != Errno) + { + // + // Cleanup + // + + if (NULL != io) + { + free(io->name); + free(io); + } + + if (NULL != NtData) + { + if(NULL != NtData->Handle) + { + _UnlockDrive(NtData->Handle); + _CloseDisk(NtData->Handle); + } + + free(NtData->Buffer); + free(NtData); + } + } + } + + return Errno; +} + + +// +// Close api +// + +static +errcode_t +nt_close(io_channel channel) +{ + PNT_PRIVATE_DATA NtData = NULL; + + if(NULL == channel) + { + return 0; + } + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + NtData = (PNT_PRIVATE_DATA) channel->private_data; + EXT2_CHECK_MAGIC(NtData, EXT2_ET_MAGIC_NT_IO_CHANNEL); + + if (--channel->refcount > 0) + { + return 0; + } + + free(channel->name); + free(channel); + + if (NULL != NtData) + { + if(NULL != NtData->Handle) + { + _DismountDrive(NtData->Handle); + _UnlockDrive(NtData->Handle); + _CloseDisk(NtData->Handle); + } + + free(NtData->Buffer); + free(NtData); + } + + return 0; +} + + + +// +// set block size +// + +static +errcode_t +nt_set_blksize(io_channel channel, int blksize) +{ + PNT_PRIVATE_DATA NtData = NULL; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + NtData = (PNT_PRIVATE_DATA) channel->private_data; + EXT2_CHECK_MAGIC(NtData, EXT2_ET_MAGIC_NT_IO_CHANNEL); + + if (channel->block_size != blksize) + { + channel->block_size = blksize; + + free(NtData->Buffer); + NtData->BufferBlockNumber = 0xffffffff; + NtData->BufferSize = channel->block_size; + ASSERT(0 == (NtData->BufferSize % 512)); + + NtData->Buffer = malloc(NtData->BufferSize); + + if (NULL == NtData->Buffer) + { + return ENOMEM; + } + + } + + return 0; +} + + +// +// read block +// + +static +errcode_t +nt_read_blk(io_channel channel, unsigned long block, + int count, void *buf) +{ + PVOID BufferToRead; + ULONG SizeToRead; + ULONG Size; + LARGE_INTEGER Offset; + PNT_PRIVATE_DATA NtData = NULL; + unsigned Errno = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + NtData = (PNT_PRIVATE_DATA) channel->private_data; + EXT2_CHECK_MAGIC(NtData, EXT2_ET_MAGIC_NT_IO_CHANNEL); + + // + // If it's in the cache, use it! + // + + if ((1 == count) && + (block == NtData->BufferBlockNumber) && + (NtData->BufferBlockNumber != 0xffffffff)) + { + memcpy(buf, NtData->Buffer, channel->block_size); + return 0; + } + + Size = (count < 0) ? (ULONG)(-count) : (ULONG)(count * channel->block_size); + + Offset.QuadPart = block * channel->block_size; + + // + // If not fit to the block + // + + if(Size <= NtData->BufferSize) + { + // + // Update the cache + // + + NtData->BufferBlockNumber = block; + BufferToRead = NtData->Buffer; + SizeToRead = NtData->BufferSize; + } + else + { + SizeToRead = Size; + BufferToRead = buf; + ASSERT(0 == (SizeToRead % channel->block_size)); + } + + if(!_RawRead(NtData->Handle, Offset, SizeToRead, BufferToRead, &Errno)) + { + + if (channel->read_error) + { + return (channel->read_error)(channel, block, count, buf, + Size, 0, Errno); + } + else + { + return Errno; + } + } + + + if(BufferToRead != buf) + { + ASSERT(Size <= SizeToRead); + memcpy(buf, BufferToRead, Size); + } + + return 0; +} + + +// +// write block +// + +static +errcode_t +nt_write_blk(io_channel channel, unsigned long block, + int count, const void *buf) +{ + ULONG SizeToWrite; + LARGE_INTEGER Offset; + PNT_PRIVATE_DATA NtData = NULL; + unsigned Errno = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + NtData = (PNT_PRIVATE_DATA) channel->private_data; + EXT2_CHECK_MAGIC(NtData, EXT2_ET_MAGIC_NT_IO_CHANNEL); + + if(NtData->OpenedReadonly) + { + return EACCES; + } + + if (count == 1) + { + SizeToWrite = channel->block_size; + } + else + { + NtData->BufferBlockNumber = 0xffffffff; + + if (count < 0) + { + SizeToWrite = (ULONG)(-count); + } + else + { + SizeToWrite = (ULONG)(count * channel->block_size); + } + } + + + ASSERT(0 == (SizeToWrite % 512)); + Offset.QuadPart = block * channel->block_size; + + if(!_RawWrite(NtData->Handle, Offset, SizeToWrite, buf, &Errno)) + { + if (channel->write_error) + { + return (channel->write_error)(channel, block, count, buf, + SizeToWrite, 0, Errno); + } + else + { + return Errno; + } + } + + + // + // Stash a copy. + // + + if(SizeToWrite >= NtData->BufferSize) + { + NtData->BufferBlockNumber = block; + memcpy(NtData->Buffer, buf, NtData->BufferSize); + } + + NtData->Written = TRUE; + + return 0; + +} + + + +// +// Flush data buffers to disk. Since we are currently using a +// write-through cache, this is a no-op. +// + +static +errcode_t +nt_flush(io_channel channel) +{ + PNT_PRIVATE_DATA NtData = NULL; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + NtData = (PNT_PRIVATE_DATA) channel->private_data; + EXT2_CHECK_MAGIC(NtData, EXT2_ET_MAGIC_NT_IO_CHANNEL); + + if(NtData->OpenedReadonly) + { + return 0; // EACCESS; + } + + + // + // Flush file buffers. + // + + _FlushDrive(NtData->Handle); + + + // + // Test and correct partition type. + // + + if(NtData->Written) + { + _SetPartType(NtData->Handle, 0x83); + } + + return 0; +} + + diff --git a/lib/ext2fs/openfs.c b/lib/ext2fs/openfs.c new file mode 100644 index 0000000..fd56a9a --- /dev/null +++ b/lib/ext2fs/openfs.c @@ -0,0 +1,590 @@ +/* + * openfs.c --- open an ext2 filesystem + * + * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#ifdef HAVE_ERRNO_H +#include <errno.h> +#endif + +#include "ext2_fs.h" + +#include "ext2fs.h" +#include "e2image.h" + +blk64_t ext2fs_descriptor_block_loc2(ext2_filsys fs, blk64_t group_block, + dgrp_t i) +{ + int bg; + int has_super = 0, group_zero_adjust = 0; + blk64_t ret_blk; + + /* + * On a bigalloc FS with 1K blocks, block 0 is reserved for non-ext4 + * stuff, so adjust for that if we're being asked for group 0. + */ + if (i == 0 && fs->blocksize == 1024 && EXT2FS_CLUSTER_RATIO(fs) > 1) + group_zero_adjust = 1; + + if (!ext2fs_has_feature_meta_bg(fs->super) || + (i < fs->super->s_first_meta_bg)) + return group_block + i + 1 + group_zero_adjust; + + bg = EXT2_DESC_PER_BLOCK(fs->super) * i; + if (ext2fs_bg_has_super(fs, bg)) + has_super = 1; + ret_blk = ext2fs_group_first_block2(fs, bg); + /* + * If group_block is not the normal value, we're trying to use + * the backup group descriptors and superblock --- so use the + * alternate location of the second block group in the + * metablock group. Ideally we should be testing each bg + * descriptor block individually for correctness, but we don't + * have the infrastructure in place to do that. + */ + if (group_block != fs->super->s_first_data_block && + ((ret_blk + has_super + fs->super->s_blocks_per_group) < + ext2fs_blocks_count(fs->super))) { + ret_blk += fs->super->s_blocks_per_group; + + /* + * If we're going to jump forward a block group, make sure + * that we adjust has_super to account for the next group's + * backup superblock (or lack thereof). + */ + if (ext2fs_bg_has_super(fs, bg + 1)) + has_super = 1; + else + has_super = 0; + } + return ret_blk + has_super + group_zero_adjust; +} + +blk_t ext2fs_descriptor_block_loc(ext2_filsys fs, blk_t group_block, dgrp_t i) +{ + return ext2fs_descriptor_block_loc2(fs, group_block, i); +} + +errcode_t ext2fs_open(const char *name, int flags, int superblock, + unsigned int block_size, io_manager manager, + ext2_filsys *ret_fs) +{ + return ext2fs_open2(name, 0, flags, superblock, block_size, + manager, ret_fs); +} + +static void block_sha_map_free_entry(void *data) +{ + free(data); + return; +} + +/* + * Note: if superblock is non-zero, block-size must also be non-zero. + * Superblock and block_size can be zero to use the default size. + * + * Valid flags for ext2fs_open() + * + * EXT2_FLAG_RW - Open the filesystem for read/write. + * EXT2_FLAG_FORCE - Open the filesystem even if some of the + * features aren't supported. + * EXT2_FLAG_JOURNAL_DEV_OK - Open an ext3 journal device + * EXT2_FLAG_SKIP_MMP - Open without multi-mount protection check. + * EXT2_FLAG_64BITS - Allow 64-bit bitfields (needed for large + * filesystems) + */ +errcode_t ext2fs_open2(const char *name, const char *io_options, + int flags, int superblock, + unsigned int block_size, io_manager manager, + ext2_filsys *ret_fs) +{ + ext2_filsys fs; + errcode_t retval; + unsigned long i, first_meta_bg; + __u32 features; + unsigned int blocks_per_group, io_flags; + blk64_t group_block, blk; + char *dest, *cp; + int group_zero_adjust = 0; + unsigned int inode_size; + __u64 groups_cnt; +#ifdef WORDS_BIGENDIAN + unsigned int groups_per_block; + struct ext2_group_desc *gdp; + int j; +#endif + char *time_env; + int csum_retries = 0; + + EXT2_CHECK_MAGIC(manager, EXT2_ET_MAGIC_IO_MANAGER); + + retval = ext2fs_get_mem(sizeof(struct struct_ext2_filsys), &fs); + if (retval) + return retval; + + memset(fs, 0, sizeof(struct struct_ext2_filsys)); + fs->magic = EXT2_ET_MAGIC_EXT2FS_FILSYS; + fs->flags = flags; + /* don't overwrite sb backups unless flag is explicitly cleared */ + fs->flags |= EXT2_FLAG_MASTER_SB_ONLY; + fs->umask = 022; + + time_env = getenv("E2FSPROGS_FAKE_TIME"); + if (time_env) + fs->now = strtoul(time_env, NULL, 0); + + retval = ext2fs_get_mem(strlen(name)+1, &fs->device_name); + if (retval) + goto cleanup; + strcpy(fs->device_name, name); + cp = strchr(fs->device_name, '?'); + if (!io_options && cp) { + *cp++ = 0; + io_options = cp; + } + + io_flags = 0; + if (flags & EXT2_FLAG_RW) + io_flags |= IO_FLAG_RW; + if (flags & EXT2_FLAG_EXCLUSIVE) + io_flags |= IO_FLAG_EXCLUSIVE; + if (flags & EXT2_FLAG_DIRECT_IO) + io_flags |= IO_FLAG_DIRECT_IO; + if (flags & EXT2_FLAG_THREADS) + io_flags |= IO_FLAG_THREADS; + retval = manager->open(fs->device_name, io_flags, &fs->io); + if (retval) + goto cleanup; + if (io_options && + (retval = io_channel_set_options(fs->io, io_options))) + goto cleanup; + fs->image_io = fs->io; + fs->io->app_data = fs; + retval = io_channel_alloc_buf(fs->io, -SUPERBLOCK_SIZE, &fs->super); + if (retval) + goto cleanup; + if (flags & EXT2_FLAG_IMAGE_FILE) { + retval = ext2fs_get_mem(sizeof(struct ext2_image_hdr), + &fs->image_header); + if (retval) + goto cleanup; + retval = io_channel_read_blk(fs->io, 0, + -(int)sizeof(struct ext2_image_hdr), + fs->image_header); + if (retval) + goto cleanup; + if (ext2fs_le32_to_cpu(fs->image_header->magic_number) != EXT2_ET_MAGIC_E2IMAGE) + return EXT2_ET_MAGIC_E2IMAGE; + superblock = 1; + block_size = ext2fs_le32_to_cpu(fs->image_header->fs_blocksize); + } + + /* + * If the user specifies a specific block # for the + * superblock, then he/she must also specify the block size! + * Otherwise, read the master superblock located at offset + * SUPERBLOCK_OFFSET from the start of the partition. + * + * Note: we only save a backup copy of the superblock if we + * are reading the superblock from the primary superblock location. + */ + if (superblock) { + if (!block_size) { + retval = EXT2_ET_INVALID_ARGUMENT; + goto cleanup; + } + io_channel_set_blksize(fs->io, block_size); + group_block = superblock; + fs->orig_super = 0; + } else { + io_channel_set_blksize(fs->io, SUPERBLOCK_OFFSET); + superblock = 1; + group_block = 0; + retval = ext2fs_get_mem(SUPERBLOCK_SIZE, &fs->orig_super); + if (retval) + goto cleanup; + } +retry: + retval = io_channel_read_blk(fs->io, superblock, -SUPERBLOCK_SIZE, + fs->super); + if (retval) + goto cleanup; + if (fs->orig_super) + memcpy(fs->orig_super, fs->super, SUPERBLOCK_SIZE); + + if (!(fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS)) { + retval = 0; + if (!ext2fs_verify_csum_type(fs, fs->super)) + retval = EXT2_ET_UNKNOWN_CSUM; + if (!ext2fs_superblock_csum_verify(fs, fs->super)) { + if (csum_retries++ < 3) + goto retry; + retval = EXT2_ET_SB_CSUM_INVALID; + } + } + +#ifdef WORDS_BIGENDIAN + fs->flags |= EXT2_FLAG_SWAP_BYTES; + ext2fs_swap_super(fs->super); +#else + if (fs->flags & EXT2_FLAG_SWAP_BYTES) { + retval = EXT2_ET_UNIMPLEMENTED; + goto cleanup; + } +#endif + + if (fs->super->s_magic != EXT2_SUPER_MAGIC) + retval = EXT2_ET_BAD_MAGIC; + if (retval) + goto cleanup; + + if (fs->super->s_rev_level > EXT2_LIB_CURRENT_REV) { + retval = EXT2_ET_REV_TOO_HIGH; + goto cleanup; + } + + /* + * Check for feature set incompatibility + */ + if (!(flags & EXT2_FLAG_FORCE)) { + features = fs->super->s_feature_incompat; +#ifdef EXT2_LIB_SOFTSUPP_INCOMPAT + if (flags & EXT2_FLAG_SOFTSUPP_FEATURES) + features &= ~EXT2_LIB_SOFTSUPP_INCOMPAT; +#endif + if (features & ~EXT2_LIB_FEATURE_INCOMPAT_SUPP) { + retval = EXT2_ET_UNSUPP_FEATURE; + goto cleanup; + } + + features = fs->super->s_feature_ro_compat; +#ifdef EXT2_LIB_SOFTSUPP_RO_COMPAT + if (flags & EXT2_FLAG_SOFTSUPP_FEATURES) + features &= ~EXT2_LIB_SOFTSUPP_RO_COMPAT; +#endif + if ((flags & EXT2_FLAG_RW) && + (features & ~EXT2_LIB_FEATURE_RO_COMPAT_SUPP)) { + retval = EXT2_ET_RO_UNSUPP_FEATURE; + goto cleanup; + } + + if (!(flags & EXT2_FLAG_JOURNAL_DEV_OK) && + ext2fs_has_feature_journal_dev(fs->super)) { + retval = EXT2_ET_UNSUPP_FEATURE; + goto cleanup; + } + } + + if ((fs->super->s_log_block_size > + (unsigned) (EXT2_MAX_BLOCK_LOG_SIZE - EXT2_MIN_BLOCK_LOG_SIZE)) || + (fs->super->s_log_cluster_size > + (unsigned) (EXT2_MAX_CLUSTER_LOG_SIZE - EXT2_MIN_CLUSTER_LOG_SIZE)) || + (fs->super->s_log_block_size > fs->super->s_log_cluster_size) || + (fs->super->s_log_groups_per_flex > 31)) { + retval = EXT2_ET_CORRUPT_SUPERBLOCK; + goto cleanup; + } + + /* + * bigalloc requires cluster-aware bitfield operations, which at the + * moment means we need EXT2_FLAG_64BITS. + */ + if (ext2fs_has_feature_bigalloc(fs->super) && + !(flags & EXT2_FLAG_64BITS)) { + retval = EXT2_ET_CANT_USE_LEGACY_BITMAPS; + goto cleanup; + } + + if (!ext2fs_has_feature_bigalloc(fs->super) && + (fs->super->s_log_block_size != fs->super->s_log_cluster_size)) { + retval = EXT2_ET_CORRUPT_SUPERBLOCK; + goto cleanup; + } + fs->fragsize = fs->blocksize = EXT2_BLOCK_SIZE(fs->super); + inode_size = EXT2_INODE_SIZE(fs->super); + if ((inode_size < EXT2_GOOD_OLD_INODE_SIZE) || + (inode_size > fs->blocksize) || + (inode_size & (inode_size - 1))) { + retval = EXT2_ET_CORRUPT_SUPERBLOCK; + goto cleanup; + } + + /* Enforce the block group descriptor size */ + if (!(flags & EXT2_FLAG_IGNORE_SB_ERRORS) && + ext2fs_has_feature_64bit(fs->super)) { + unsigned desc_size = fs->super->s_desc_size; + + if ((desc_size < EXT2_MIN_DESC_SIZE_64BIT) || + (desc_size > EXT2_MAX_DESC_SIZE) || + (desc_size & (desc_size - 1)) != 0) { + retval = EXT2_ET_BAD_DESC_SIZE; + goto cleanup; + } + } + + fs->cluster_ratio_bits = fs->super->s_log_cluster_size - + fs->super->s_log_block_size; + if (EXT2_BLOCKS_PER_GROUP(fs->super) != + EXT2_CLUSTERS_PER_GROUP(fs->super) << fs->cluster_ratio_bits) { + retval = EXT2_ET_CORRUPT_SUPERBLOCK; + goto cleanup; + } + fs->inode_blocks_per_group = ((EXT2_INODES_PER_GROUP(fs->super) * + EXT2_INODE_SIZE(fs->super) + + EXT2_BLOCK_SIZE(fs->super) - 1) / + EXT2_BLOCK_SIZE(fs->super)); + if (block_size) { + if (block_size != fs->blocksize) { + retval = EXT2_ET_UNEXPECTED_BLOCK_SIZE; + goto cleanup; + } + } + /* + * Set the blocksize to the filesystem's blocksize. + */ + io_channel_set_blksize(fs->io, fs->blocksize); + + /* + * If this is an external journal device, don't try to read + * the group descriptors, because they're not there. + */ + if (ext2fs_has_feature_journal_dev(fs->super)) { + fs->group_desc_count = 0; + *ret_fs = fs; + return 0; + } + + if (EXT2_INODES_PER_GROUP(fs->super) == 0) { + retval = EXT2_ET_CORRUPT_SUPERBLOCK; + goto cleanup; + } + /* Precompute the FS UUID to seed other checksums */ + ext2fs_init_csum_seed(fs); + + /* + * Read group descriptors + */ + blocks_per_group = EXT2_BLOCKS_PER_GROUP(fs->super); + if (blocks_per_group < 8 || + blocks_per_group > EXT2_MAX_BLOCKS_PER_GROUP(fs->super) || + fs->inode_blocks_per_group > EXT2_MAX_INODES_PER_GROUP(fs->super) || + EXT2_DESC_PER_BLOCK(fs->super) == 0 || + fs->super->s_first_data_block >= ext2fs_blocks_count(fs->super)) { + retval = EXT2_ET_CORRUPT_SUPERBLOCK; + goto cleanup; + } + groups_cnt = ext2fs_div64_ceil(ext2fs_blocks_count(fs->super) - + fs->super->s_first_data_block, + blocks_per_group); + if (groups_cnt >> 32) { + retval = EXT2_ET_CORRUPT_SUPERBLOCK; + goto cleanup; + } + fs->group_desc_count = groups_cnt; + if (!(flags & EXT2_FLAG_IGNORE_SB_ERRORS) && + (__u64)fs->group_desc_count * EXT2_INODES_PER_GROUP(fs->super) != + fs->super->s_inodes_count) { + retval = EXT2_ET_CORRUPT_SUPERBLOCK; + goto cleanup; + } + fs->desc_blocks = ext2fs_div_ceil(fs->group_desc_count, + EXT2_DESC_PER_BLOCK(fs->super)); + if (ext2fs_has_feature_meta_bg(fs->super) && + (fs->super->s_first_meta_bg > fs->desc_blocks) && + !(flags & EXT2_FLAG_IGNORE_SB_ERRORS)) { + retval = EXT2_ET_CORRUPT_SUPERBLOCK; + goto cleanup; + } + if (flags & EXT2_FLAG_SUPER_ONLY) + goto skip_read_bg; + retval = ext2fs_get_array(fs->desc_blocks, fs->blocksize, + &fs->group_desc); + if (retval) + goto cleanup; + if (!group_block) + group_block = fs->super->s_first_data_block; + /* + * On a FS with a 1K blocksize, block 0 is reserved for bootloaders + * so we must increment block numbers to any group 0 items. + * + * However, we cannot touch group_block directly because in the meta_bg + * case, the ext2fs_descriptor_block_loc2() function will interpret + * group_block != s_first_data_block to mean that we want to access the + * backup group descriptors. This is not what we want if the caller + * set superblock == 0 (i.e. auto-detect the superblock), which is + * what's going on here. + */ + if (group_block == 0 && fs->blocksize == 1024) + group_zero_adjust = 1; + dest = (char *) fs->group_desc; +#ifdef WORDS_BIGENDIAN + groups_per_block = EXT2_DESC_PER_BLOCK(fs->super); +#endif + if (ext2fs_has_feature_meta_bg(fs->super) && + !(flags & EXT2_FLAG_IMAGE_FILE)) { + first_meta_bg = fs->super->s_first_meta_bg; + if (first_meta_bg > fs->desc_blocks) + first_meta_bg = fs->desc_blocks; + } else + first_meta_bg = fs->desc_blocks; + if (first_meta_bg) { + retval = io_channel_read_blk(fs->io, group_block + + group_zero_adjust + 1, + first_meta_bg, dest); + if (retval) + goto cleanup; +#ifdef WORDS_BIGENDIAN + gdp = (struct ext2_group_desc *) dest; + for (j=0; j < groups_per_block*first_meta_bg; j++) { + gdp = ext2fs_group_desc(fs, fs->group_desc, j); + if (gdp) + ext2fs_swap_group_desc2(fs, gdp); + } +#endif + dest += fs->blocksize*first_meta_bg; + } + + for (i = first_meta_bg ; i < fs->desc_blocks; i++) { + blk = ext2fs_descriptor_block_loc2(fs, group_block, i); + io_channel_cache_readahead(fs->io, blk, 1); + } + + for (i=first_meta_bg ; i < fs->desc_blocks; i++) { + blk = ext2fs_descriptor_block_loc2(fs, group_block, i); + retval = io_channel_read_blk64(fs->io, blk, 1, dest); + if (retval) + goto cleanup; +#ifdef WORDS_BIGENDIAN + for (j=0; j < groups_per_block; j++) { + gdp = ext2fs_group_desc(fs, fs->group_desc, + i * groups_per_block + j); + if (gdp) + ext2fs_swap_group_desc2(fs, gdp); + } +#endif + dest += fs->blocksize; + } + + fs->stride = fs->super->s_raid_stride; + + /* + * If recovery is from backup superblock, Clear _UNININT flags & + * reset bg_itable_unused to zero + */ + if (superblock > 1 && ext2fs_has_group_desc_csum(fs)) { + dgrp_t group; + + for (group = 0; group < fs->group_desc_count; group++) { + ext2fs_bg_flags_clear(fs, group, EXT2_BG_BLOCK_UNINIT); + ext2fs_bg_flags_clear(fs, group, EXT2_BG_INODE_UNINIT); + ext2fs_bg_itable_unused_set(fs, group, 0); + /* The checksum will be reset later, but fix it here + * anyway to avoid printing a lot of spurious errors. */ + ext2fs_group_desc_csum_set(fs, group); + } + if (fs->flags & EXT2_FLAG_RW) + ext2fs_mark_super_dirty(fs); + } +skip_read_bg: + if (ext2fs_has_feature_mmp(fs->super) && + !(flags & EXT2_FLAG_SKIP_MMP) && + (flags & (EXT2_FLAG_RW | EXT2_FLAG_EXCLUSIVE))) { + retval = ext2fs_mmp_start(fs); + if (retval) { + fs->flags |= EXT2_FLAG_SKIP_MMP; /* just do cleanup */ + ext2fs_mmp_stop(fs); + goto cleanup; + } + } + + if (fs->flags & EXT2_FLAG_SHARE_DUP) { + fs->block_sha_map = ext2fs_hashmap_create(ext2fs_djb2_hash, + block_sha_map_free_entry, 4096); + if (!fs->block_sha_map) { + retval = EXT2_ET_NO_MEMORY; + goto cleanup; + } + ext2fs_set_feature_shared_blocks(fs->super); + } + + if (ext2fs_has_feature_casefold(fs->super)) + fs->encoding = ext2fs_load_nls_table(fs->super->s_encoding); + + fs->flags &= ~EXT2_FLAG_NOFREE_ON_ERROR; + *ret_fs = fs; + + return 0; +cleanup: + if (!(flags & EXT2_FLAG_NOFREE_ON_ERROR)) { + ext2fs_free(fs); + fs = NULL; + } + *ret_fs = fs; + return retval; +} + +/* + * Set/get the filesystem data I/O channel. + * + * These functions are only valid if EXT2_FLAG_IMAGE_FILE is true. + */ +errcode_t ext2fs_get_data_io(ext2_filsys fs, io_channel *old_io) +{ + if ((fs->flags & EXT2_FLAG_IMAGE_FILE) == 0) + return EXT2_ET_NOT_IMAGE_FILE; + if (old_io) { + *old_io = (fs->image_io == fs->io) ? 0 : fs->io; + } + return 0; +} + +errcode_t ext2fs_set_data_io(ext2_filsys fs, io_channel new_io) +{ + if ((fs->flags & EXT2_FLAG_IMAGE_FILE) == 0) + return EXT2_ET_NOT_IMAGE_FILE; + fs->io = new_io ? new_io : fs->image_io; + return 0; +} + +errcode_t ext2fs_rewrite_to_io(ext2_filsys fs, io_channel new_io) +{ + errcode_t err; + + if ((fs->flags & EXT2_FLAG_IMAGE_FILE) == 0) + return EXT2_ET_NOT_IMAGE_FILE; + err = io_channel_set_blksize(new_io, fs->blocksize); + if (err) + return err; + if ((new_io == fs->image_io) || (new_io == fs->io)) + return 0; + if ((fs->image_io != fs->io) && + fs->image_io) + io_channel_close(fs->image_io); + if (fs->io) + io_channel_close(fs->io); + fs->io = fs->image_io = new_io; + fs->flags |= EXT2_FLAG_DIRTY | EXT2_FLAG_RW | + EXT2_FLAG_BB_DIRTY | EXT2_FLAG_IB_DIRTY; + fs->flags &= ~EXT2_FLAG_IMAGE_FILE; + return 0; +} diff --git a/lib/ext2fs/orphan.c b/lib/ext2fs/orphan.c new file mode 100644 index 0000000..e25f20c --- /dev/null +++ b/lib/ext2fs/orphan.c @@ -0,0 +1,273 @@ +/* + * orphan.c --- utility function to handle orphan file + * + * Copyright (C) 2015 Jan Kara. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <string.h> + +#include "ext2_fs.h" +#include "ext2fsP.h" + +errcode_t ext2fs_truncate_orphan_file(ext2_filsys fs) +{ + struct ext2_inode inode; + errcode_t err; + ext2_ino_t ino = fs->super->s_orphan_file_inum; + + err = ext2fs_read_inode(fs, ino, &inode); + if (err) + return err; + + err = ext2fs_punch(fs, ino, &inode, NULL, 0, ~0ULL); + if (err) + return err; + + fs->flags &= ~EXT2_FLAG_SUPER_ONLY; + memset(&inode, 0, sizeof(struct ext2_inode)); + err = ext2fs_write_inode(fs, ino, &inode); + + ext2fs_clear_feature_orphan_file(fs->super); + ext2fs_clear_feature_orphan_present(fs->super); + ext2fs_mark_super_dirty(fs); + /* Need to update group descriptors as well */ + fs->flags &= ~EXT2_FLAG_SUPER_ONLY; + + return err; +} + +__u32 ext2fs_do_orphan_file_block_csum(ext2_filsys fs, ext2_ino_t ino, + __u32 gen, blk64_t blk, char *buf) +{ + int inodes_per_ob = ext2fs_inodes_per_orphan_block(fs); + __u32 crc; + + ino = ext2fs_cpu_to_le32(ino); + gen = ext2fs_cpu_to_le32(gen); + blk = ext2fs_cpu_to_le64(blk); + crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&ino, + sizeof(ino)); + crc = ext2fs_crc32c_le(crc, (unsigned char *)&gen, sizeof(gen)); + crc = ext2fs_crc32c_le(crc, (unsigned char *)&blk, sizeof(blk)); + crc = ext2fs_crc32c_le(crc, (unsigned char *)buf, + inodes_per_ob * sizeof(__u32)); + + return ext2fs_cpu_to_le32(crc); +} + +struct mkorphan_info { + char *buf; + char *zerobuf; + blk_t num_blocks; + blk_t alloc_blocks; + blk64_t last_blk; + errcode_t err; + ext2_ino_t ino; + __u32 generation; +}; + +static int mkorphan_proc(ext2_filsys fs, + blk64_t *blocknr, + e2_blkcnt_t blockcnt, + blk64_t ref_block EXT2FS_ATTR((unused)), + int ref_offset EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct mkorphan_info *oi = (struct mkorphan_info *)priv_data; + blk64_t new_blk; + errcode_t err; + + /* Can we just continue in currently allocated cluster? */ + if (blockcnt && + EXT2FS_B2C(fs, oi->last_blk) == EXT2FS_B2C(fs, oi->last_blk + 1)) { + new_blk = oi->last_blk + 1; + } else { + err = ext2fs_new_block2(fs, oi->last_blk, 0, &new_blk); + if (err) { + oi->err = err; + return BLOCK_ABORT; + } + ext2fs_block_alloc_stats2(fs, new_blk, +1); + oi->alloc_blocks++; + } + if (blockcnt >= 0) { + if (ext2fs_has_feature_metadata_csum(fs->super)) { + struct ext4_orphan_block_tail *tail; + + tail = ext2fs_orphan_block_tail(fs, oi->buf); + tail->ob_checksum = ext2fs_do_orphan_file_block_csum(fs, + oi->ino, oi->generation, new_blk, oi->buf); + } + err = io_channel_write_blk64(fs->io, new_blk, 1, oi->buf); + } else /* zerobuf is used to initialize new indirect blocks... */ + err = io_channel_write_blk64(fs->io, new_blk, 1, oi->zerobuf); + if (err) { + oi->err = err; + return BLOCK_ABORT; + } + oi->last_blk = new_blk; + *blocknr = new_blk; + if (blockcnt >= 0 && --oi->num_blocks == 0) + return BLOCK_CHANGED | BLOCK_ABORT; + return BLOCK_CHANGED; +} + +errcode_t ext2fs_create_orphan_file(ext2_filsys fs, blk_t num_blocks) +{ + struct ext2_inode inode; + ext2_ino_t ino = fs->super->s_orphan_file_inum; + errcode_t err; + char *buf = NULL, *zerobuf = NULL; + struct mkorphan_info oi; + struct ext4_orphan_block_tail *ob_tail; + + if (!ino) { + err = ext2fs_new_inode(fs, EXT2_ROOT_INO, LINUX_S_IFREG | 0600, + 0, &ino); + if (err) + return err; + ext2fs_inode_alloc_stats2(fs, ino, +1, 0); + ext2fs_mark_ib_dirty(fs); + } + + err = ext2fs_read_inode(fs, ino, &inode); + if (err) + return err; + if (EXT2_I_SIZE(&inode)) { + err = ext2fs_truncate_orphan_file(fs); + if (err) + return err; + } + + memset(&inode, 0, sizeof(struct ext2_inode)); + if (ext2fs_has_feature_extents(fs->super)) { + inode.i_flags |= EXT4_EXTENTS_FL; + err = ext2fs_write_inode(fs, ino, &inode); + if (err) + return err; + } + + err = ext2fs_get_mem(fs->blocksize, &buf); + if (err) + return err; + err = ext2fs_get_mem(fs->blocksize, &zerobuf); + if (err) + goto out; + memset(buf, 0, fs->blocksize); + memset(zerobuf, 0, fs->blocksize); + ob_tail = ext2fs_orphan_block_tail(fs, buf); + ob_tail->ob_magic = ext2fs_cpu_to_le32(EXT4_ORPHAN_BLOCK_MAGIC); + oi.num_blocks = num_blocks; + oi.alloc_blocks = 0; + oi.last_blk = 0; + oi.generation = inode.i_generation; + oi.ino = ino; + oi.buf = buf; + oi.zerobuf = zerobuf; + oi.err = 0; + err = ext2fs_block_iterate3(fs, ino, BLOCK_FLAG_APPEND, + 0, mkorphan_proc, &oi); + if (err) + goto out; + if (oi.err) { + err = oi.err; + goto out; + } + + /* Reread inode after blocks were allocated */ + err = ext2fs_read_inode(fs, ino, &inode); + if (err) + goto out; + ext2fs_iblk_set(fs, &inode, 0); + inode.i_atime = inode.i_mtime = + inode.i_ctime = fs->now ? fs->now : time(0); + inode.i_links_count = 1; + inode.i_mode = LINUX_S_IFREG | 0600; + ext2fs_iblk_add_blocks(fs, &inode, oi.alloc_blocks); + err = ext2fs_inode_size_set(fs, &inode, + (unsigned long long)fs->blocksize * num_blocks); + if (err) + goto out; + err = ext2fs_write_new_inode(fs, ino, &inode); + if (err) + goto out; + + fs->super->s_orphan_file_inum = ino; + ext2fs_set_feature_orphan_file(fs->super); + ext2fs_mark_super_dirty(fs); + /* Need to update group descriptors as well */ + fs->flags &= ~EXT2_FLAG_SUPER_ONLY; +out: + if (buf) + ext2fs_free_mem(&buf); + if (zerobuf) + ext2fs_free_mem(&zerobuf); + return err; +} + +/* + * Find reasonable size for orphan file. We choose orphan file size to be + * between 32 and 512 filesystem blocks and not more than 1/4096 of the + * filesystem unless it is really small. + */ +e2_blkcnt_t ext2fs_default_orphan_file_blocks(ext2_filsys fs) +{ + __u64 num_blocks = ext2fs_blocks_count(fs->super); + e2_blkcnt_t blks = 512; + + if (num_blocks < 128 * 1024) + blks = 32; + else if (num_blocks < 2 * 1024 * 1024) + blks = num_blocks / 4096; + return (blks + EXT2FS_CLUSTER_MASK(fs)) & ~EXT2FS_CLUSTER_MASK(fs); +} + +static errcode_t ext2fs_orphan_file_block_csum(ext2_filsys fs, ext2_ino_t ino, + blk64_t blk, char *buf, + __u32 *crcp) +{ + struct ext2_inode inode; + errcode_t retval; + + retval = ext2fs_read_inode(fs, ino, &inode); + if (retval) + return retval; + *crcp = ext2fs_do_orphan_file_block_csum(fs, ino, inode.i_generation, + blk, buf); + return 0; +} + +errcode_t ext2fs_orphan_file_block_csum_set(ext2_filsys fs, ext2_ino_t ino, + blk64_t blk, char *buf) +{ + struct ext4_orphan_block_tail *tail; + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 0; + + tail = ext2fs_orphan_block_tail(fs, buf); + return ext2fs_orphan_file_block_csum(fs, ino, blk, buf, + &tail->ob_checksum); +} + +int ext2fs_orphan_file_block_csum_verify(ext2_filsys fs, ext2_ino_t ino, + blk64_t blk, char *buf) +{ + struct ext4_orphan_block_tail *tail; + __u32 crc; + errcode_t retval; + + if (!ext2fs_has_feature_metadata_csum(fs->super)) + return 1; + retval = ext2fs_orphan_file_block_csum(fs, ino, blk, buf, &crc); + if (retval) + return 0; + tail = ext2fs_orphan_block_tail(fs, buf); + return ext2fs_le32_to_cpu(tail->ob_checksum) == crc; +} diff --git a/lib/ext2fs/progress.c b/lib/ext2fs/progress.c new file mode 100644 index 0000000..fe4292f --- /dev/null +++ b/lib/ext2fs/progress.c @@ -0,0 +1,103 @@ +/* + * progress.c - Numeric progress meter + * + * Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, + * 2003, 2004, 2005 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Public + * License. + * %End-Header% + */ + +#include "config.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +#include <time.h> + +static char spaces[80], backspaces[80]; +static time_t last_update; + +struct ext2fs_progress_ops ext2fs_numeric_progress_ops = { + .init = ext2fs_numeric_progress_init, + .update = ext2fs_numeric_progress_update, + .close = ext2fs_numeric_progress_close, +}; + +static int int_log10(unsigned int arg) +{ + int l; + + for (l=0; arg ; l++) + arg = arg / 10; + return l; +} + +void ext2fs_numeric_progress_init(ext2_filsys fs, + struct ext2fs_numeric_progress_struct * progress, + const char *label, __u64 max) +{ + /* + * The PRINT_PROGRESS flag turns on or off ALL + * progress-related messages, whereas the SKIP_PROGRESS + * environment variable prints the start and end messages but + * not the numeric countdown in the middle. + */ + if (!(fs->flags & EXT2_FLAG_PRINT_PROGRESS)) + return; + + memset(spaces, ' ', sizeof(spaces)-1); + spaces[sizeof(spaces)-1] = 0; + memset(backspaces, '\b', sizeof(backspaces)-1); + backspaces[sizeof(backspaces)-1] = 0; + + memset(progress, 0, sizeof(*progress)); + if (getenv("E2FSPROGS_SKIP_PROGRESS")) + progress->skip_progress++; + + + /* + * Figure out how many digits we need + */ + progress->max = max; + progress->log_max = int_log10(max); + + if (label) { + fputs(label, stdout); + fflush(stdout); + } + last_update = 0; +} + +void ext2fs_numeric_progress_update(ext2_filsys fs, + struct ext2fs_numeric_progress_struct * progress, + __u64 val) +{ + time_t now; + + if (!(fs->flags & EXT2_FLAG_PRINT_PROGRESS)) + return; + if (progress->skip_progress) + return; + now = time(0); + if (now == last_update) + return; + last_update = now; + + printf("%*llu/%*llu", progress->log_max, (unsigned long long) val, + progress->log_max, (unsigned long long) progress->max); + fprintf(stdout, "%.*s", (2*progress->log_max)+1, backspaces); +} + +void ext2fs_numeric_progress_close(ext2_filsys fs, + struct ext2fs_numeric_progress_struct * progress, + const char *message) +{ + if (!(fs->flags & EXT2_FLAG_PRINT_PROGRESS)) + return; + fprintf(stdout, "%.*s", (2*progress->log_max)+1, spaces); + fprintf(stdout, "%.*s", (2*progress->log_max)+1, backspaces); + if (message) + fputs(message, stdout); +} diff --git a/lib/ext2fs/punch.c b/lib/ext2fs/punch.c new file mode 100644 index 0000000..e2543e1 --- /dev/null +++ b/lib/ext2fs/punch.c @@ -0,0 +1,513 @@ +/* + * punch.c --- deallocate blocks allocated to an inode + * + * Copyright (C) 2010 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <errno.h> + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +#undef PUNCH_DEBUG + +/* + * This function returns 1 if the specified block is all zeros + */ +static int check_zero_block(char *buf, int blocksize) +{ + char *cp = buf; + int left = blocksize; + + while (left > 0) { + if (*cp++) + return 0; + left--; + } + return 1; +} + +/* + * This clever recursive function handles i_blocks[] as well as + * indirect, double indirect, and triple indirect blocks. It iterates + * over the entries in the i_blocks array or indirect blocks, and for + * each one, will recursively handle any indirect blocks and then + * frees and deallocates the blocks. + */ +static errcode_t ind_punch(ext2_filsys fs, struct ext2_inode *inode, + char *block_buf, blk_t *p, int level, + blk64_t start, blk64_t count, int max) +{ + errcode_t retval; + blk_t b; + int i; + blk64_t offset, incr; + int freed = 0; + +#ifdef PUNCH_DEBUG + printf("Entering ind_punch, level %d, start %llu, count %llu, " + "max %d\n", level, start, count, max); +#endif + incr = 1ULL << ((EXT2_BLOCK_SIZE_BITS(fs->super) - 2) * level); + for (i = 0, offset = 0; i < max; i++, p++, offset += incr) { + if (offset >= start + count) + break; + if (*p == 0 || (offset+incr) <= start) + continue; + b = *p; + if (level > 0) { + blk_t start2; +#ifdef PUNCH_DEBUG + printf("Reading indirect block %u\n", b); +#endif + retval = ext2fs_read_ind_block(fs, b, block_buf); + if (retval) + return retval; + start2 = (start > offset) ? start - offset : 0; + retval = ind_punch(fs, inode, block_buf + fs->blocksize, + (blk_t *) block_buf, level - 1, + start2, count - offset, + fs->blocksize >> 2); + if (retval) + return retval; + retval = ext2fs_write_ind_block(fs, b, block_buf); + if (retval) + return retval; + if (!check_zero_block(block_buf, fs->blocksize)) + continue; + } +#ifdef PUNCH_DEBUG + printf("Freeing block %u (offset %llu)\n", b, offset); +#endif + ext2fs_block_alloc_stats(fs, b, -1); + *p = 0; + freed++; + } +#ifdef PUNCH_DEBUG + printf("Freed %d blocks\n", freed); +#endif + return ext2fs_iblk_sub_blocks(fs, inode, freed); +} + +#define BLK_T_MAX ((blk_t)~0ULL) +static errcode_t ext2fs_punch_ind(ext2_filsys fs, struct ext2_inode *inode, + char *block_buf, blk64_t start, blk64_t end) +{ + errcode_t retval; + char *buf = 0; + int level; + int num = EXT2_NDIR_BLOCKS; + blk_t *bp = inode->i_block; + blk_t addr_per_block; + blk64_t max = EXT2_NDIR_BLOCKS; + blk_t count; + + /* Check start/end don't overflow the 2^32-1 indirect block limit */ + if (start > BLK_T_MAX) + return 0; + if (end >= BLK_T_MAX || end - start + 1 >= BLK_T_MAX) + count = BLK_T_MAX - start; + else + count = end - start + 1; + + if (!block_buf) { + retval = ext2fs_get_array(3, fs->blocksize, &buf); + if (retval) + return retval; + block_buf = buf; + } + + addr_per_block = (blk_t)fs->blocksize >> 2; + + for (level = 0; level < 4; level++, max *= (blk64_t)addr_per_block) { +#ifdef PUNCH_DEBUG + printf("Main loop level %d, start %llu count %u " + "max %llu num %d\n", level, start, count, max, num); +#endif + if (start < max) { + retval = ind_punch(fs, inode, block_buf, bp, level, + start, count, num); + if (retval) + goto errout; + if (count > max) + count -= max - start; + else + break; + start = 0; + } else + start -= max; + bp += num; + if (level == 0) { + num = 1; + max = 1; + } + } + retval = 0; +errout: + if (buf) + ext2fs_free_mem(&buf); + return retval; +} +#undef BLK_T_MAX + +#ifdef PUNCH_DEBUG + +#define dbg_printf(f, a...) printf(f, ## a) + +static void dbg_print_extent(char *desc, struct ext2fs_extent *extent) +{ + if (desc) + printf("%s: ", desc); + printf("extent: lblk %llu--%llu, len %u, pblk %llu, flags: ", + extent->e_lblk, extent->e_lblk + extent->e_len - 1, + extent->e_len, extent->e_pblk); + if (extent->e_flags & EXT2_EXTENT_FLAGS_LEAF) + fputs("LEAF ", stdout); + if (extent->e_flags & EXT2_EXTENT_FLAGS_UNINIT) + fputs("UNINIT ", stdout); + if (extent->e_flags & EXT2_EXTENT_FLAGS_SECOND_VISIT) + fputs("2ND_VISIT ", stdout); + if (!extent->e_flags) + fputs("(none)", stdout); + fputc('\n', stdout); + +} +#else +#define dbg_print_extent(desc, ex) do { } while (0) +#define dbg_printf(f, a...) do { } while (0) +#endif + +/* Free a range of blocks, respecting cluster boundaries */ +static errcode_t punch_extent_blocks(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + blk64_t lfree_start, blk64_t free_start, + __u32 free_count, int *freed) +{ + blk64_t pblk; + int freed_now = 0; + __u32 cluster_freed; + errcode_t retval = 0; + + if (free_start < fs->super->s_first_data_block || + (free_start + free_count) >= ext2fs_blocks_count(fs->super)) + return EXT2_ET_BAD_BLOCK_NUM; + + /* No bigalloc? Just free each block. */ + if (EXT2FS_CLUSTER_RATIO(fs) == 1) { + *freed += free_count; + while (free_count-- > 0) + ext2fs_block_alloc_stats2(fs, free_start++, -1); + return retval; + } + + /* + * Try to free up to the next cluster boundary. We assume that all + * blocks in a logical cluster map to blocks from the same physical + * cluster, and that the offsets within the [pl]clusters match. + */ + if (free_start & EXT2FS_CLUSTER_MASK(fs)) { + retval = ext2fs_map_cluster_block(fs, ino, inode, + lfree_start, &pblk); + if (retval) + goto errout; + if (!pblk) { + ext2fs_block_alloc_stats2(fs, free_start, -1); + freed_now++; + } + cluster_freed = EXT2FS_CLUSTER_RATIO(fs) - + (free_start & EXT2FS_CLUSTER_MASK(fs)); + if (cluster_freed > free_count) + cluster_freed = free_count; + free_count -= cluster_freed; + free_start += cluster_freed; + lfree_start += cluster_freed; + } + + /* Free whole clusters from the middle of the range. */ + while (free_count > 0 && free_count >= (unsigned) EXT2FS_CLUSTER_RATIO(fs)) { + ext2fs_block_alloc_stats2(fs, free_start, -1); + freed_now++; + cluster_freed = EXT2FS_CLUSTER_RATIO(fs); + free_count -= cluster_freed; + free_start += cluster_freed; + lfree_start += cluster_freed; + } + + /* Try to free the last cluster. */ + if (free_count > 0) { + retval = ext2fs_map_cluster_block(fs, ino, inode, + lfree_start, &pblk); + if (retval) + goto errout; + if (!pblk) { + ext2fs_block_alloc_stats2(fs, free_start, -1); + freed_now++; + } + } + +errout: + *freed += freed_now; + return retval; +} + +static errcode_t ext2fs_punch_extent(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + blk64_t start, blk64_t end) +{ + ext2_extent_handle_t handle = 0; + struct ext2fs_extent extent; + errcode_t retval; + blk64_t free_start, next, lfree_start; + __u32 free_count, newlen; + int freed = 0; + int op; + + retval = ext2fs_extent_open2(fs, ino, inode, &handle); + if (retval) + return retval; + /* + * Find the extent closest to the start of the punch range. We don't + * check the return value because _goto() sets the current node to the + * next-lowest extent if 'start' is in a hole, and doesn't set a + * current node if there was a real error reading the extent tree. + * In that case, _get() will error out. + * + * Note: If _get() returns 'no current node', that simply means that + * there aren't any blocks mapped past this point in the file, so we're + * done. + */ + ext2fs_extent_goto(handle, start); + retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent); + if (retval == EXT2_ET_NO_CURRENT_NODE) { + retval = 0; + goto errout; + } else if (retval) + goto errout; + while (1) { + op = EXT2_EXTENT_NEXT_LEAF; + dbg_print_extent("main loop", &extent); + next = extent.e_lblk + extent.e_len; + dbg_printf("start %llu, end %llu, next %llu\n", + (unsigned long long) start, + (unsigned long long) end, + (unsigned long long) next); + if (start <= extent.e_lblk) { + /* + * Have we iterated past the end of the punch region? + * If so, we can stop. + */ + if (end < extent.e_lblk) + break; + dbg_printf("Case #%d\n", 1); + /* Start of deleted region before extent; + adjust beginning of extent */ + free_start = extent.e_pblk; + lfree_start = extent.e_lblk; + if (next > end) + free_count = end - extent.e_lblk + 1; + else + free_count = extent.e_len; + extent.e_len -= free_count; + extent.e_lblk += free_count; + extent.e_pblk += free_count; + } else if (end >= next-1) { + /* + * Is the punch region beyond this extent? This can + * happen if start is already inside a hole. Try to + * advance to the next extent if this is the case. + */ + if (start >= next) + goto next_extent; + /* End of deleted region after extent; + adjust end of extent */ + dbg_printf("Case #%d\n", 2); + newlen = start - extent.e_lblk; + free_start = extent.e_pblk + newlen; + lfree_start = extent.e_lblk + newlen; + free_count = extent.e_len - newlen; + extent.e_len = newlen; + } else { + struct ext2fs_extent newex; + + dbg_printf("Case #%d\n", 3); + /* The hard case; we need to split the extent */ + newex.e_pblk = extent.e_pblk + + (end + 1 - extent.e_lblk); + newex.e_lblk = end + 1; + newex.e_len = next - end - 1; + newex.e_flags = extent.e_flags; + + extent.e_len = start - extent.e_lblk; + free_start = extent.e_pblk + extent.e_len; + lfree_start = extent.e_lblk + extent.e_len; + free_count = end - start + 1; + + dbg_print_extent("inserting", &newex); + retval = ext2fs_extent_insert(handle, + EXT2_EXTENT_INSERT_AFTER, &newex); + if (retval) + goto errout; + retval = ext2fs_extent_fix_parents(handle); + if (retval) + goto errout; + /* + * Now pointing at inserted extent; so go back. + * + * We cannot use EXT2_EXTENT_PREV to go back; note the + * subtlety in the comment for fix_parents(). + */ + retval = ext2fs_extent_goto(handle, extent.e_lblk); + if (retval) + goto errout; + } + if (extent.e_len) { + dbg_print_extent("replacing", &extent); + retval = ext2fs_extent_replace(handle, 0, &extent); + if (retval) + goto errout; + retval = ext2fs_extent_fix_parents(handle); + } else { + struct ext2fs_extent newex; + blk64_t old_lblk, next_lblk; + dbg_printf("deleting current extent%s\n", ""); + + /* + * Save the location of the next leaf, then slip + * back to the current extent. + */ + retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, + &newex); + if (retval) + goto errout; + old_lblk = newex.e_lblk; + + retval = ext2fs_extent_get(handle, + EXT2_EXTENT_NEXT_LEAF, + &newex); + if (retval == EXT2_ET_EXTENT_NO_NEXT) + next_lblk = old_lblk; + else if (retval) + goto errout; + else + next_lblk = newex.e_lblk; + + retval = ext2fs_extent_goto(handle, old_lblk); + if (retval) + goto errout; + + /* Now delete the extent. */ + retval = ext2fs_extent_delete(handle, 0); + if (retval) + goto errout; + + retval = ext2fs_extent_fix_parents(handle); + if (retval && retval != EXT2_ET_NO_CURRENT_NODE) + goto errout; + retval = 0; + + /* + * Jump forward to the next extent. If there are + * errors, the ext2fs_extent_get down below will + * capture them for us. + */ + (void)ext2fs_extent_goto(handle, next_lblk); + op = EXT2_EXTENT_CURRENT; + } + if (retval) + goto errout; + dbg_printf("Free start %llu, free count = %u\n", + free_start, free_count); + retval = punch_extent_blocks(fs, ino, inode, lfree_start, + free_start, free_count, &freed); + if (retval) + goto errout; + next_extent: + retval = ext2fs_extent_get(handle, op, + &extent); + if (retval == EXT2_ET_EXTENT_NO_NEXT || + retval == EXT2_ET_NO_CURRENT_NODE) + break; + if (retval) + goto errout; + } + dbg_printf("Freed %d blocks\n", freed); + retval = ext2fs_iblk_sub_blocks(fs, inode, freed); +errout: + ext2fs_extent_free(handle); + return retval; +} + +static errcode_t ext2fs_punch_inline_data(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + blk64_t start, + blk64_t end EXT2FS_ATTR((unused))) +{ + errcode_t retval; + + /* + * In libext2fs ext2fs_punch is based on block unit. So that + * means that if start > 0 we don't need to do nothing. Due + * to this we will remove all inline data in ext2fs_punch() + * now. + */ + if (start > 0) + return 0; + + memset((char *)inode->i_block, 0, EXT4_MIN_INLINE_DATA_SIZE); + inode->i_size = 0; + retval = ext2fs_write_inode(fs, ino, inode); + if (retval) + return retval; + + return ext2fs_inline_data_ea_remove(fs, ino); +} + +/* + * Deallocate all logical _blocks_ starting at start to end, inclusive. + * If end is ~0ULL, then this is effectively truncate. + */ +errcode_t ext2fs_punch(ext2_filsys fs, ext2_ino_t ino, + struct ext2_inode *inode, + char *block_buf, blk64_t start, + blk64_t end) +{ + errcode_t retval; + struct ext2_inode inode_buf; + + if (start > end) + return EINVAL; + + /* Read inode structure if necessary */ + if (!inode) { + retval = ext2fs_read_inode(fs, ino, &inode_buf); + if (retval) + return retval; + inode = &inode_buf; + } + if (inode->i_flags & EXT4_INLINE_DATA_FL) + return ext2fs_punch_inline_data(fs, ino, inode, start, end); + else if (inode->i_flags & EXT4_EXTENTS_FL) + retval = ext2fs_punch_extent(fs, ino, inode, start, end); + else + retval = ext2fs_punch_ind(fs, inode, block_buf, start, end); + if (retval) + return retval; + +#ifdef PUNCH_DEBUG + printf("%u: write inode size now %lu blocks %u\n", + ino, EXT2_I_SIZE(inode), inode->i_blocks); +#endif + return ext2fs_write_inode(fs, ino, inode); +} diff --git a/lib/ext2fs/qcow2.c b/lib/ext2fs/qcow2.c new file mode 100644 index 0000000..2082417 --- /dev/null +++ b/lib/ext2fs/qcow2.c @@ -0,0 +1,272 @@ +/* + * qcow2.c --- Functions to generate qcow2 formatted disk images. This + * format is used originally by QEMU for virtual machines, and stores the + * filesystem data on disk in a packed format to avoid creating sparse + * image files that need lots of seeking to read and write. + * + * The qcow2 format supports zlib compression, but that is not yet + * implemented. + * + * It is possible to directly mount a qcow2 image using qemu-nbd: + * + * [root]# modprobe nbd max_part=63 + * [root]# qemu-nbd -c /dev/nbd0 image.img + * [root]# mount /dev/nbd0p1 /mnt/qemu + * + * Format details at http://people.gnome.org/~markmc/qcow-image-format.html + * + * Copyright (C) 2010 Red Hat, Inc., Lukas Czerner <lczerner@redhat.com> + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Public + * License. + * %End-Header% + */ + +#ifndef _LARGEFILE_SOURCE +#define _LARGEFILE_SOURCE +#endif +#ifndef _LARGEFILE64_SOURCE +#define _LARGEFILE64_SOURCE +#endif + +#include "config.h" +#include <fcntl.h> +#include <grp.h> +#include <pwd.h> +#include <stdio.h> +#ifdef HAVE_STDLIB_H +#include <stdlib.h> +#endif +#include <string.h> +#include <time.h> +#include <unistd.h> +#include <fcntl.h> +#include <errno.h> +#include <sys/stat.h> +#include <sys/types.h> +#include <assert.h> + +#include "ext2fs/ext2fs.h" +#include "qcow2.h" + +/* Functions for converting qcow2 image into raw image */ + +struct ext2_qcow2_hdr *qcow2_read_header(int fd) +{ + void *buffer = NULL; + struct ext2_qcow2_hdr *hdr = NULL; + size_t size; + errcode_t ret; + + ret = ext2fs_get_mem(sizeof(struct ext2_qcow2_hdr), &buffer); + if (ret) + return NULL; + memset(buffer, 0, sizeof(struct ext2_qcow2_hdr)); + + if (ext2fs_llseek(fd, 0, SEEK_SET < 0)) { + ext2fs_free_mem(&buffer); + return NULL; + } + + size = read(fd, buffer, sizeof(struct ext2_qcow2_hdr)); + if (size != sizeof(struct ext2_qcow2_hdr)) { + ext2fs_free_mem(&buffer); + return NULL; + } + + hdr = (struct ext2_qcow2_hdr *)(buffer); + + if ((ext2fs_be32_to_cpu(hdr->magic) != QCOW_MAGIC) || + (ext2fs_be32_to_cpu(hdr->version) != 2)) { + ext2fs_free_mem(&hdr); + return NULL; + } + + return hdr; +} + +static int qcow2_read_l1_table(struct ext2_qcow2_image *img) +{ + int fd = img->fd; + size_t size, l1_size = img->l1_size * sizeof(blk64_t); + blk64_t *table; + errcode_t ret; + + ret = ext2fs_get_memzero(l1_size, &table); + if (ret) + return ret; + + if (ext2fs_llseek(fd, img->l1_offset, SEEK_SET) < 0) { + ext2fs_free_mem(&table); + return errno; + } + + size = read(fd, table, l1_size); + if (size != l1_size) { + ext2fs_free_mem(&table); + return errno; + } + + img->l1_table = table; + + return 0; +} + +static int qcow2_read_l2_table(struct ext2_qcow2_image *img, + __u64 offset, blk64_t **l2_table) +{ + int fd = img->fd; + size_t size; + + assert(*l2_table); + + if (ext2fs_llseek(fd, offset, SEEK_SET) < 0) + return errno; + + size = read(fd, *l2_table, img->cluster_size); + if (size != img->cluster_size) + return errno; + + return 0; +} + +static int qcow2_copy_data(int fdin, int fdout, __u64 off_in, + __u64 off_out, void *buf, size_t count) +{ + size_t size; + + assert(buf); + + if (ext2fs_llseek(fdout, off_out, SEEK_SET) < 0) + return errno; + + if (ext2fs_llseek(fdin, off_in, SEEK_SET) < 0) + return errno; + + size = read(fdin, buf, count); + if (size != count) + return errno; + + size = write(fdout, buf, count); + if (size != count) + return errno; + + return 0; +} + + +int qcow2_write_raw_image(int qcow2_fd, int raw_fd, + struct ext2_qcow2_hdr *hdr) +{ + struct ext2_qcow2_image img; + errcode_t ret = 0; + unsigned int l1_index, l2_index; + __u64 offset; + blk64_t *l1_table, *l2_table = NULL; + void *copy_buf = NULL; + size_t size; + unsigned int max_l1_size; + + if (hdr->crypt_method) + return -QCOW_ENCRYPTED; + + img.fd = qcow2_fd; + img.hdr = hdr; + img.l2_cache = NULL; + img.l1_table = NULL; + img.cluster_bits = ext2fs_be32_to_cpu(hdr->cluster_bits); + if (img.cluster_bits < 9 || img.cluster_bits > 31) + return -QCOW_CORRUPTED; + img.cluster_size = 1 << img.cluster_bits; + img.l1_size = ext2fs_be32_to_cpu(hdr->l1_size); + img.l1_offset = ext2fs_be64_to_cpu(hdr->l1_table_offset); + img.l2_size = 1 << (img.cluster_bits - 3); + img.image_size = ext2fs_be64_to_cpu(hdr->size); + + if (img.l1_offset & (img.cluster_size - 1)) + return -QCOW_CORRUPTED; + + max_l1_size = (img.image_size >> ((2 * img.cluster_bits) - 3)) + + img.cluster_size; + if (img.l1_size > max_l1_size) + return -QCOW_CORRUPTED; + + ret = ext2fs_get_memzero(img.cluster_size, &l2_table); + if (ret) + goto out; + + ret = ext2fs_get_memzero(1 << img.cluster_bits, ©_buf); + if (ret) + goto out; + + if (ext2fs_llseek(raw_fd, 0, SEEK_SET) < 0) { + ret = errno; + goto out; + } + + ret = qcow2_read_l1_table(&img); + if (ret) + goto out; + + l1_table = img.l1_table; + /* Walk through l1 table */ + for (l1_index = 0; l1_index < img.l1_size; l1_index++) { + __u64 off_out; + + offset = ext2fs_be64_to_cpu(l1_table[l1_index]) & + ~QCOW_OFLAG_COPIED; + + if ((offset > img.image_size) || + (offset <= 0)) + continue; + + if (offset & QCOW_OFLAG_COMPRESSED) { + ret = -QCOW_COMPRESSED; + goto out; + } + + ret = qcow2_read_l2_table(&img, offset, &l2_table); + if (ret) + break; + + /* Walk through l2 table and copy data blocks into raw image */ + for (l2_index = 0; l2_index < img.l2_size; l2_index++) { + offset = ext2fs_be64_to_cpu(l2_table[l2_index]) & + ~QCOW_OFLAG_COPIED; + + if (offset == 0) + continue; + + off_out = ((__u64)l1_index * img.l2_size) + + l2_index; + off_out <<= img.cluster_bits; + ret = qcow2_copy_data(qcow2_fd, raw_fd, offset, + off_out, copy_buf, img.cluster_size); + if (ret) + goto out; + } + } + + /* Resize the output image to the filesystem size */ + if (ext2fs_llseek(raw_fd, img.image_size - 1, SEEK_SET) < 0) { + ret = errno; + goto out; + } + + ((char *)copy_buf)[0] = 0; + size = write(raw_fd, copy_buf, 1); + if (size != 1) { + ret = errno; + goto out; + } + +out: + if (copy_buf) + ext2fs_free_mem(©_buf); + if (img.l1_table) + ext2fs_free_mem(&img.l1_table); + if (l2_table) + ext2fs_free_mem(&l2_table); + return ret; +} diff --git a/lib/ext2fs/qcow2.h b/lib/ext2fs/qcow2.h new file mode 100644 index 0000000..b649c9c --- /dev/null +++ b/lib/ext2fs/qcow2.h @@ -0,0 +1,114 @@ +/* + * qcow2.h --- structures and function prototypes for qcow2.c to generate + * qcow2 formatted disk images. This format is used originally by QEMU + * for virtual machines, and stores the filesystem data on disk in a + * packed format to avoid creating sparse image files that need lots of + * seeking to read and write. + * + * The qcow2 format supports zlib compression, but that is not yet + * implemented. + * + * It is possible to directly mount a qcow2 image using qemu-nbd: + * + * [root]# modprobe nbd max_part=63 + * [root]# qemu-nbd -c /dev/nbd0 image.img + * [root]# mount /dev/nbd0p1 /mnt/qemu + * + * Format details at http://people.gnome.org/~markmc/qcow-image-format.html + * + * Copyright (C) 2010 Red Hat, Inc., Lukas Czerner <lczerner@redhat.com> + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Public + * License. + * %End-Header% + */ + +/* Number of l2 tables in memory before writeback */ +#define L2_CACHE_PREALLOC 512 + + +#define QCOW_MAGIC (('Q' << 24) | ('F' << 16) | ('I' << 8) | 0xfb) +#define QCOW_VERSION 2 +#define QCOW_OFLAG_COPIED (1ULL << 63) +#define QCOW_OFLAG_COMPRESSED (1ULL << 62) + +#define QCOW_COMPRESSED 1 +#define QCOW_ENCRYPTED 2 +#define QCOW_CORRUPTED 3 + +struct ext2_qcow2_hdr { + __u32 magic; + __u32 version; + + __u64 backing_file_offset; + __u32 backing_file_size; + + __u32 cluster_bits; + __u64 size; + __u32 crypt_method; + + __u32 l1_size; + __u64 l1_table_offset; + + __u64 refcount_table_offset; + __u32 refcount_table_clusters; + + __u32 nb_snapshots; + __u64 snapshots_offset; +}; + +typedef struct ext2_qcow2_l2_table L2_CACHE_HEAD; + +struct ext2_qcow2_l2_table { + __u32 l1_index; + __u64 offset; + __u64 *data; + L2_CACHE_HEAD *next; +}; + +struct ext2_qcow2_l2_cache { + L2_CACHE_HEAD *used_head; + L2_CACHE_HEAD *used_tail; + L2_CACHE_HEAD *free_head; + __u32 free; + __u32 count; + __u64 next_offset; +}; + +struct ext2_qcow2_refcount { + __u64 *refcount_table; + __u64 refcount_table_offset; + __u64 refcount_block_offset; + + __u32 refcount_table_clusters; + __u32 refcount_table_index; + __u32 refcount_block_index; + + __u16 *refcount_block; +}; + +struct ext2_qcow2_image { + int fd; + struct ext2_qcow2_hdr *hdr; + struct ext2_qcow2_l2_cache *l2_cache; + struct ext2_qcow2_refcount refcount; + __u32 cluster_size; + __u32 cluster_bits; + __u32 l1_size; + __u32 l2_size; + + __u64 *l1_table; + __u64 l2_offset; + __u64 l1_offset; + __u64 image_size; +}; + +/* Function prototypes */ + +/* qcow2.c */ + +/* Functions for converting qcow2 image into raw image */ +struct ext2_qcow2_hdr *qcow2_read_header(int); +int qcow2_write_raw_image(int, int, struct ext2_qcow2_hdr *); + diff --git a/lib/ext2fs/rbtree.c b/lib/ext2fs/rbtree.c new file mode 100644 index 0000000..74426fa --- /dev/null +++ b/lib/ext2fs/rbtree.c @@ -0,0 +1,383 @@ +/* + Red Black Trees + (C) 1999 Andrea Arcangeli <andrea@suse.de> + (C) 2002 David Woodhouse <dwmw2@infradead.org> + + This program is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 2 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + + linux/lib/rbtree.c +*/ + +#include "rbtree.h" + +static void __rb_rotate_left(struct rb_node *node, struct rb_root *root) +{ + struct rb_node *right = node->rb_right; + struct rb_node *parent = ext2fs_rb_parent(node); + + if ((node->rb_right = right->rb_left)) + ext2fs_rb_set_parent(right->rb_left, node); + right->rb_left = node; + + ext2fs_rb_set_parent(right, parent); + + if (parent) + { + if (node == parent->rb_left) + parent->rb_left = right; + else + parent->rb_right = right; + } + else + root->rb_node = right; + ext2fs_rb_set_parent(node, right); +} + +static void __rb_rotate_right(struct rb_node *node, struct rb_root *root) +{ + struct rb_node *left = node->rb_left; + struct rb_node *parent = ext2fs_rb_parent(node); + + if ((node->rb_left = left->rb_right)) + ext2fs_rb_set_parent(left->rb_right, node); + left->rb_right = node; + + ext2fs_rb_set_parent(left, parent); + + if (parent) + { + if (node == parent->rb_right) + parent->rb_right = left; + else + parent->rb_left = left; + } + else + root->rb_node = left; + ext2fs_rb_set_parent(node, left); +} + +void ext2fs_rb_insert_color(struct rb_node *node, struct rb_root *root) +{ + struct rb_node *parent, *gparent; + + while ((parent = ext2fs_rb_parent(node)) && ext2fs_rb_is_red(parent)) + { + gparent = ext2fs_rb_parent(parent); + + if (parent == gparent->rb_left) + { + { + register struct rb_node *uncle = gparent->rb_right; + if (uncle && ext2fs_rb_is_red(uncle)) + { + ext2fs_rb_set_black(uncle); + ext2fs_rb_set_black(parent); + ext2fs_rb_set_red(gparent); + node = gparent; + continue; + } + } + + if (parent->rb_right == node) + { + register struct rb_node *tmp; + __rb_rotate_left(parent, root); + tmp = parent; + parent = node; + node = tmp; + } + + ext2fs_rb_set_black(parent); + ext2fs_rb_set_red(gparent); + __rb_rotate_right(gparent, root); + } else { + { + register struct rb_node *uncle = gparent->rb_left; + if (uncle && ext2fs_rb_is_red(uncle)) + { + ext2fs_rb_set_black(uncle); + ext2fs_rb_set_black(parent); + ext2fs_rb_set_red(gparent); + node = gparent; + continue; + } + } + + if (parent->rb_left == node) + { + register struct rb_node *tmp; + __rb_rotate_right(parent, root); + tmp = parent; + parent = node; + node = tmp; + } + + ext2fs_rb_set_black(parent); + ext2fs_rb_set_red(gparent); + __rb_rotate_left(gparent, root); + } + } + + ext2fs_rb_set_black(root->rb_node); +} + +static void __rb_erase_color(struct rb_node *node, struct rb_node *parent, + struct rb_root *root) +{ + struct rb_node *other; + + while ((!node || ext2fs_rb_is_black(node)) && node != root->rb_node) + { + if (parent->rb_left == node) + { + other = parent->rb_right; + if (ext2fs_rb_is_red(other)) + { + ext2fs_rb_set_black(other); + ext2fs_rb_set_red(parent); + __rb_rotate_left(parent, root); + other = parent->rb_right; + } + if ((!other->rb_left || ext2fs_rb_is_black(other->rb_left)) && + (!other->rb_right || ext2fs_rb_is_black(other->rb_right))) + { + ext2fs_rb_set_red(other); + node = parent; + parent = ext2fs_rb_parent(node); + } + else + { + if (!other->rb_right || ext2fs_rb_is_black(other->rb_right)) + { + ext2fs_rb_set_black(other->rb_left); + ext2fs_rb_set_red(other); + __rb_rotate_right(other, root); + other = parent->rb_right; + } + ext2fs_rb_set_color(other, ext2fs_rb_color(parent)); + ext2fs_rb_set_black(parent); + ext2fs_rb_set_black(other->rb_right); + __rb_rotate_left(parent, root); + node = root->rb_node; + break; + } + } + else + { + other = parent->rb_left; + if (ext2fs_rb_is_red(other)) + { + ext2fs_rb_set_black(other); + ext2fs_rb_set_red(parent); + __rb_rotate_right(parent, root); + other = parent->rb_left; + } + if ((!other->rb_left || ext2fs_rb_is_black(other->rb_left)) && + (!other->rb_right || ext2fs_rb_is_black(other->rb_right))) + { + ext2fs_rb_set_red(other); + node = parent; + parent = ext2fs_rb_parent(node); + } + else + { + if (!other->rb_left || ext2fs_rb_is_black(other->rb_left)) + { + ext2fs_rb_set_black(other->rb_right); + ext2fs_rb_set_red(other); + __rb_rotate_left(other, root); + other = parent->rb_left; + } + ext2fs_rb_set_color(other, ext2fs_rb_color(parent)); + ext2fs_rb_set_black(parent); + ext2fs_rb_set_black(other->rb_left); + __rb_rotate_right(parent, root); + node = root->rb_node; + break; + } + } + } + if (node) + ext2fs_rb_set_black(node); +} + +void ext2fs_rb_erase(struct rb_node *node, struct rb_root *root) +{ + struct rb_node *child, *parent; + int color; + + if (!node->rb_left) + child = node->rb_right; + else if (!node->rb_right) + child = node->rb_left; + else + { + struct rb_node *old = node, *left; + + node = node->rb_right; + while ((left = node->rb_left) != NULL) + node = left; + + if (ext2fs_rb_parent(old)) { + if (ext2fs_rb_parent(old)->rb_left == old) + ext2fs_rb_parent(old)->rb_left = node; + else + ext2fs_rb_parent(old)->rb_right = node; + } else + root->rb_node = node; + + child = node->rb_right; + parent = ext2fs_rb_parent(node); + color = ext2fs_rb_color(node); + + if (parent == old) { + parent = node; + } else { + if (child) + ext2fs_rb_set_parent(child, parent); + parent->rb_left = child; + + node->rb_right = old->rb_right; + ext2fs_rb_set_parent(old->rb_right, node); + } + + node->rb_parent_color = old->rb_parent_color; + node->rb_left = old->rb_left; + ext2fs_rb_set_parent(old->rb_left, node); + + goto color; + } + + parent = ext2fs_rb_parent(node); + color = ext2fs_rb_color(node); + + if (child) + ext2fs_rb_set_parent(child, parent); + if (parent) + { + if (parent->rb_left == node) + parent->rb_left = child; + else + parent->rb_right = child; + } + else + root->rb_node = child; + + color: + if (color == RB_BLACK) + __rb_erase_color(child, parent, root); +} + +/* + * This function returns the first node (in sort order) of the tree. + */ +struct rb_node *ext2fs_rb_first(const struct rb_root *root) +{ + struct rb_node *n; + + n = root->rb_node; + if (!n) + return NULL; + while (n->rb_left) + n = n->rb_left; + return n; +} + +struct rb_node *ext2fs_rb_last(const struct rb_root *root) +{ + struct rb_node *n; + + n = root->rb_node; + if (!n) + return NULL; + while (n->rb_right) + n = n->rb_right; + return n; +} + +struct rb_node *ext2fs_rb_next(struct rb_node *node) +{ + struct rb_node *parent; + + if (ext2fs_rb_parent(node) == node) + return NULL; + + /* If we have a right-hand child, go down and then left as far + as we can. */ + if (node->rb_right) { + node = node->rb_right; + while (node->rb_left) + node=node->rb_left; + return (struct rb_node *)node; + } + + /* No right-hand children. Everything down and left is + smaller than us, so any 'next' node must be in the general + direction of our parent. Go up the tree; any time the + ancestor is a right-hand child of its parent, keep going + up. First time it's a left-hand child of its parent, said + parent is our 'next' node. */ + while ((parent = ext2fs_rb_parent(node)) && node == parent->rb_right) + node = parent; + + return parent; +} + +struct rb_node *ext2fs_rb_prev(struct rb_node *node) +{ + struct rb_node *parent; + + if (ext2fs_rb_parent(node) == node) + return NULL; + + /* If we have a left-hand child, go down and then right as far + as we can. */ + if (node->rb_left) { + node = node->rb_left; + while (node->rb_right) + node=node->rb_right; + return (struct rb_node *)node; + } + + /* No left-hand children. Go up till we find an ancestor which + is a right-hand child of its parent */ + while ((parent = ext2fs_rb_parent(node)) && node == parent->rb_left) + node = parent; + + return parent; +} + +void ext2fs_rb_replace_node(struct rb_node *victim, struct rb_node *new, + struct rb_root *root) +{ + struct rb_node *parent = ext2fs_rb_parent(victim); + + /* Set the surrounding nodes to point to the replacement */ + if (parent) { + if (victim == parent->rb_left) + parent->rb_left = new; + else + parent->rb_right = new; + } else { + root->rb_node = new; + } + if (victim->rb_left) + ext2fs_rb_set_parent(victim->rb_left, new); + if (victim->rb_right) + ext2fs_rb_set_parent(victim->rb_right, new); + + /* Copy the pointers/colour from the victim to the replacement */ + *new = *victim; +} diff --git a/lib/ext2fs/rbtree.h b/lib/ext2fs/rbtree.h new file mode 100644 index 0000000..790f5c1 --- /dev/null +++ b/lib/ext2fs/rbtree.h @@ -0,0 +1,183 @@ +/* + Red Black Trees + (C) 1999 Andrea Arcangeli <andrea@suse.de> + + This program is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 2 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + + linux/include/linux/rbtree.h + + To use rbtrees you'll have to implement your own insert and search cores. + This will avoid us to use callbacks and to drop dramatically performances. + I know it's not the cleaner way, but in C (not in C++) to get + performances and genericity... + + Some example of insert and search follows here. The search is a plain + normal search over an ordered tree. The insert instead must be implemented + in two steps: First, the code must insert the element in order as a red leaf + in the tree, and then the support library function rb_insert_color() must + be called. Such function will do the not trivial work to rebalance the + rbtree, if necessary. + +----------------------------------------------------------------------- +static inline struct page * rb_search_page_cache(struct inode * inode, + unsigned long offset) +{ + struct rb_node * n = inode->i_rb_page_cache.rb_node; + struct page * page; + + while (n) + { + page = rb_entry(n, struct page, rb_page_cache); + + if (offset < page->offset) + n = n->rb_left; + else if (offset > page->offset) + n = n->rb_right; + else + return page; + } + return NULL; +} + +static inline struct page * __rb_insert_page_cache(struct inode * inode, + unsigned long offset, + struct rb_node * node) +{ + struct rb_node ** p = &inode->i_rb_page_cache.rb_node; + struct rb_node * parent = NULL; + struct page * page; + + while (*p) + { + parent = *p; + page = rb_entry(parent, struct page, rb_page_cache); + + if (offset < page->offset) + p = &(*p)->rb_left; + else if (offset > page->offset) + p = &(*p)->rb_right; + else + return page; + } + + rb_link_node(node, parent, p); + + return NULL; +} + +static inline struct page * rb_insert_page_cache(struct inode * inode, + unsigned long offset, + struct rb_node * node) +{ + struct page * ret; + if ((ret = __rb_insert_page_cache(inode, offset, node))) + goto out; + rb_insert_color(node, &inode->i_rb_page_cache); + out: + return ret; +} +----------------------------------------------------------------------- +*/ + +#ifndef _LINUX_RBTREE_H +#define _LINUX_RBTREE_H + +#include <stdlib.h> +#include <stdint.h> +#include "compiler.h" + +#if __GNUC_PREREQ (4, 6) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wunused-function" +#endif + +struct rb_node +{ + uintptr_t rb_parent_color; +#define RB_RED 0 +#define RB_BLACK 1 + struct rb_node *rb_right; + struct rb_node *rb_left; +} __attribute__((aligned(sizeof(long)))); + /* The alignment might seem pointless, but allegedly CRIS needs it */ + +struct rb_root +{ + struct rb_node *rb_node; +}; + + +#define ext2fs_rb_parent(r) ((struct rb_node *)((r)->rb_parent_color & ~3)) +#define ext2fs_rb_color(r) ((r)->rb_parent_color & 1) +#define ext2fs_rb_is_red(r) (!ext2fs_rb_color(r)) +#define ext2fs_rb_is_black(r) ext2fs_rb_color(r) +#define ext2fs_rb_set_red(r) do { (r)->rb_parent_color &= ~1; } while (0) +#define ext2fs_rb_set_black(r) do { (r)->rb_parent_color |= 1; } while (0) + +static inline void ext2fs_rb_set_parent(struct rb_node *rb, struct rb_node *p) +{ + rb->rb_parent_color = (rb->rb_parent_color & 3) | (uintptr_t)p; +} +static inline void ext2fs_rb_set_color(struct rb_node *rb, int color) +{ + rb->rb_parent_color = (rb->rb_parent_color & ~1) | color; +} + +#define RB_ROOT (struct rb_root) { NULL, } +#define ext2fs_rb_entry(ptr, type, member) container_of(ptr, type, member) + +static inline int ext2fs_rb_empty_root(struct rb_root *root) +{ + return root->rb_node == NULL; +} + +static inline int ext2fs_rb_empty_node(struct rb_node *node) +{ + return ext2fs_rb_parent(node) == node; +} + +static inline void ext2fs_rb_clear_node(struct rb_node *node) +{ + ext2fs_rb_set_parent(node, node); +} + +extern void ext2fs_rb_insert_color(struct rb_node *, struct rb_root *); +extern void ext2fs_rb_erase(struct rb_node *, struct rb_root *); + +/* Find logical next and previous nodes in a tree */ +extern struct rb_node *ext2fs_rb_next(struct rb_node *); +extern struct rb_node *ext2fs_rb_prev(struct rb_node *); +extern struct rb_node *ext2fs_rb_first(const struct rb_root *); +extern struct rb_node *ext2fs_rb_last(const struct rb_root *); + +/* Fast replacement of a single node without remove/rebalance/add/rebalance */ +extern void ext2fs_rb_replace_node(struct rb_node *victim, struct rb_node *new, + struct rb_root *root); + +static inline void ext2fs_rb_link_node(struct rb_node * node, + struct rb_node * parent, + struct rb_node ** rb_link) +{ + node->rb_parent_color = (uintptr_t)parent; + node->rb_left = node->rb_right = NULL; + + *rb_link = node; +} + +#if __GNUC_PREREQ (4, 6) +#pragma GCC diagnostic pop +#endif + +#endif /* _LINUX_RBTREE_H */ diff --git a/lib/ext2fs/read_bb.c b/lib/ext2fs/read_bb.c new file mode 100644 index 0000000..e58b7cb --- /dev/null +++ b/lib/ext2fs/read_bb.c @@ -0,0 +1,102 @@ +/* + * read_bb --- read the bad blocks inode + * + * Copyright (C) 1994 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +struct read_bb_record { + ext2_badblocks_list bb_list; + errcode_t err; +}; + +/* + * Helper function for ext2fs_read_bb_inode() + */ +#ifdef __TURBOC__ + #pragma argsused +#endif +static int mark_bad_block(ext2_filsys fs, blk_t *block_nr, + e2_blkcnt_t blockcnt EXT2FS_ATTR((unused)), + blk_t ref_block EXT2FS_ATTR((unused)), + int ref_offset EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct read_bb_record *rb = (struct read_bb_record *) priv_data; + + if (blockcnt < 0) + return 0; + + if ((*block_nr < fs->super->s_first_data_block) || + (*block_nr >= ext2fs_blocks_count(fs->super))) + return 0; /* Ignore illegal blocks */ + + rb->err = ext2fs_badblocks_list_add(rb->bb_list, *block_nr); + if (rb->err) + return BLOCK_ABORT; + return 0; +} + +/* + * Reads the current bad blocks from the bad blocks inode. + */ +errcode_t ext2fs_read_bb_inode(ext2_filsys fs, ext2_badblocks_list *bb_list) +{ + errcode_t retval; + struct read_bb_record rb; + struct ext2_inode inode; + blk_t numblocks; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!*bb_list) { + retval = ext2fs_read_inode(fs, EXT2_BAD_INO, &inode); + if (retval) + return retval; + numblocks = inode.i_blocks; + if (!(ext2fs_has_feature_huge_file(fs->super) && + (inode.i_flags & EXT4_HUGE_FILE_FL))) + numblocks = numblocks / (fs->blocksize / 512); + numblocks += 20; + if (numblocks < 50) + numblocks = 50; + if (numblocks > 50000) + numblocks = 500; + retval = ext2fs_badblocks_list_create(bb_list, numblocks); + if (retval) + return retval; + } + + rb.bb_list = *bb_list; + rb.err = 0; + retval = ext2fs_block_iterate2(fs, EXT2_BAD_INO, BLOCK_FLAG_READ_ONLY, + 0, mark_bad_block, &rb); + if (retval) + return retval; + + return rb.err; +} + + diff --git a/lib/ext2fs/read_bb_file.c b/lib/ext2fs/read_bb_file.c new file mode 100644 index 0000000..a6d3beb --- /dev/null +++ b/lib/ext2fs/read_bb_file.c @@ -0,0 +1,109 @@ +/* + * read_bb_file.c --- read a list of bad blocks from a FILE * + * + * Copyright (C) 1994, 1995, 2000 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +/* + * Reads a list of bad blocks from a FILE * + */ +errcode_t ext2fs_read_bb_FILE2(ext2_filsys fs, FILE *f, + ext2_badblocks_list *bb_list, + void *priv_data, + void (*invalid)(ext2_filsys fs, + blk_t blk, + char *badstr, + void *priv_data)) +{ + errcode_t retval; + unsigned long long blockno; + int count; + char buf[128]; + + if (fs) + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!*bb_list) { + retval = ext2fs_badblocks_list_create(bb_list, 10); + if (retval) + return retval; + } + + while (!feof (f)) { + if (fgets(buf, sizeof(buf), f) == NULL) + break; + count = sscanf(buf, "%llu", &blockno); + if (count <= 0) + continue; + /* Badblocks isn't going to be updated for 64bit */ + if (blockno >> 32) + return EOVERFLOW; + if (fs && + ((blockno < fs->super->s_first_data_block) || + (blockno >= ext2fs_blocks_count(fs->super)))) { + if (invalid) + (invalid)(fs, (blk64_t) blockno, buf, priv_data); + continue; + } + retval = ext2fs_badblocks_list_add(*bb_list, (blk64_t) blockno); + if (retval) + return retval; + } + return 0; +} + +struct compat_struct { + void (*invalid)(ext2_filsys, blk_t); +}; + +static void call_compat_invalid(ext2_filsys fs, blk_t blk, + char *badstr EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct compat_struct *st; + + st = (struct compat_struct *) priv_data; + if (st->invalid) + (st->invalid)(fs, blk); +} + + +/* + * Reads a list of bad blocks from a FILE * + */ +errcode_t ext2fs_read_bb_FILE(ext2_filsys fs, FILE *f, + ext2_badblocks_list *bb_list, + void (*invalid)(ext2_filsys fs, blk_t blk)) +{ + struct compat_struct st; + + st.invalid = invalid; + + return ext2fs_read_bb_FILE2(fs, f, bb_list, &st, + call_compat_invalid); +} + + diff --git a/lib/ext2fs/res_gdt.c b/lib/ext2fs/res_gdt.c new file mode 100644 index 0000000..fa8d8d6 --- /dev/null +++ b/lib/ext2fs/res_gdt.c @@ -0,0 +1,239 @@ +/* + * res_gdt.c --- reserve blocks for growing the group descriptor table + * during online resizing. + * + * Copyright (C) 2002 Andreas Dilger + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#include <time.h> +#include "ext2_fs.h" +#include "ext2fs.h" + +/* + * Iterate through the groups which hold BACKUP superblock/GDT copies in an + * ext3 filesystem. The counters should be initialized to 1, 5, and 7 before + * calling this for the first time. In a sparse filesystem it will be the + * sequence of powers of 3, 5, and 7: 1, 3, 5, 7, 9, 25, 27, 49, 81, ... + * For a non-sparse filesystem it will be every group: 1, 2, 3, 4, ... + */ +static unsigned int list_backups(ext2_filsys fs, unsigned int *three, + unsigned int *five, unsigned int *seven) +{ + unsigned int *min = three; + int mult = 3; + unsigned int ret; + + if (ext2fs_has_feature_sparse_super2(fs->super)) { + if (*min == 1) { + *min += 1; + if (fs->super->s_backup_bgs[0]) + return fs->super->s_backup_bgs[0]; + } + if (*min == 2) { + *min += 1; + if (fs->super->s_backup_bgs[1]) + return fs->super->s_backup_bgs[1]; + } + return fs->group_desc_count; + } + if (!ext2fs_has_feature_sparse_super(fs->super)) { + ret = *min; + *min += 1; + return ret; + } + + if (*five < *min) { + min = five; + mult = 5; + } + if (*seven < *min) { + min = seven; + mult = 7; + } + + ret = *min; + *min *= mult; + + return ret; +} + +/* + * This code assumes that the reserved blocks have already been marked in-use + * during ext2fs_initialize(), so that they are not allocated for other + * uses before we can add them to the resize inode (which has to come + * after the creation of the inode table). + */ +errcode_t ext2fs_create_resize_inode(ext2_filsys fs) +{ + errcode_t retval, retval2; + struct ext2_super_block *sb; + struct ext2_inode inode; + __u32 *dindir_buf, *gdt_buf; + unsigned long long apb, inode_size; + /* FIXME-64 - can't deal with extents */ + blk_t dindir_blk, rsv_off, gdt_off, gdt_blk; + int dindir_dirty = 0, inode_dirty = 0, sb_blk = 0; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + sb = fs->super; + + retval = ext2fs_get_array(2, fs->blocksize, &dindir_buf); + if (retval) + return retval; + gdt_buf = (__u32 *)((char *)dindir_buf + fs->blocksize); + + retval = ext2fs_read_inode(fs, EXT2_RESIZE_INO, &inode); + if (retval) + goto out_free; + + /* + * File systems with a blocksize of 1024 and bigalloc have + * sb->s_first_data_block of 0; yet the superblock is still at + * block #1. We compensate for it here. + */ + sb_blk = sb->s_first_data_block; + if (fs->blocksize == 1024 && sb_blk == 0) + sb_blk = 1; + + /* Maximum possible file size (we only use double indirect blocks) */ + apb = EXT2_ADDR_PER_BLOCK(sb); + if ((dindir_blk = inode.i_block[EXT2_DIND_BLOCK])) { +#ifdef RES_GDT_DEBUG + printf("reading GDT dindir %u\n", dindir_blk); +#endif + retval = ext2fs_read_ind_block(fs, dindir_blk, dindir_buf); + if (retval) + goto out_inode; + } else { + blk_t goal = sb_blk + fs->desc_blocks + + sb->s_reserved_gdt_blocks + 2 + + fs->inode_blocks_per_group; + + retval = ext2fs_alloc_block(fs, goal, 0, &dindir_blk); + if (retval) + goto out_free; + inode.i_mode = LINUX_S_IFREG | 0600; + inode.i_links_count = 1; + inode.i_block[EXT2_DIND_BLOCK] = dindir_blk; + ext2fs_iblk_set(fs, &inode, 1); + memset(dindir_buf, 0, fs->blocksize); +#ifdef RES_GDT_DEBUG + printf("allocated GDT dindir %u\n", dindir_blk); +#endif + dindir_dirty = inode_dirty = 1; + inode_size = apb*apb + apb + EXT2_NDIR_BLOCKS; + inode_size *= fs->blocksize; + retval = ext2fs_inode_size_set(fs, &inode, inode_size); + if (retval) + goto out_free; + inode.i_ctime = fs->now ? fs->now : time(0); + } + + for (rsv_off = 0, gdt_off = fs->desc_blocks, + gdt_blk = sb_blk + 1 + fs->desc_blocks; + rsv_off < sb->s_reserved_gdt_blocks; + rsv_off++, gdt_off++, gdt_blk++) { + unsigned int three = 1, five = 5, seven = 7; + unsigned int grp, last = 0; + int gdt_dirty = 0; + + gdt_off %= apb; + if (!dindir_buf[gdt_off]) { + /* FIXME XXX XXX + blk_t new_blk; + + retval = ext2fs_new_block(fs, gdt_blk, 0, &new_blk); + if (retval) + goto out_free; + if (new_blk != gdt_blk) { + // XXX free block + retval = -1; // XXX + } + */ + gdt_dirty = dindir_dirty = inode_dirty = 1; + memset(gdt_buf, 0, fs->blocksize); + dindir_buf[gdt_off] = gdt_blk; + ext2fs_iblk_add_blocks(fs, &inode, 1); +#ifdef RES_GDT_DEBUG + printf("added primary GDT block %u at %u[%u]\n", + gdt_blk, dindir_blk, gdt_off); +#endif + } else if (dindir_buf[gdt_off] == gdt_blk) { +#ifdef RES_GDT_DEBUG + printf("reading primary GDT block %u\n", gdt_blk); +#endif + retval = ext2fs_read_ind_block(fs, gdt_blk, gdt_buf); + if (retval) + goto out_dindir; + } else { +#ifdef RES_GDT_DEBUG + printf("bad primary GDT %u != %u at %u[%u]\n", + dindir_buf[gdt_off], gdt_blk,dindir_blk,gdt_off); +#endif + retval = EXT2_ET_RESIZE_INODE_CORRUPT; + goto out_dindir; + } + + while ((grp = list_backups(fs, &three, &five, &seven)) < + fs->group_desc_count) { + blk_t expect = gdt_blk + grp * sb->s_blocks_per_group; + + if (!gdt_buf[last]) { +#ifdef RES_GDT_DEBUG + printf("added backup GDT %u grp %u@%u[%u]\n", + expect, grp, gdt_blk, last); +#endif + gdt_buf[last] = expect; + ext2fs_iblk_add_blocks(fs, &inode, 1); + gdt_dirty = inode_dirty = 1; + } else if (gdt_buf[last] != expect) { +#ifdef RES_GDT_DEBUG + printf("bad backup GDT %u != %u at %u[%u]\n", + gdt_buf[last], expect, gdt_blk, last); +#endif + retval = EXT2_ET_RESIZE_INODE_CORRUPT; + goto out_dindir; + } + last++; + } + if (gdt_dirty) { +#ifdef RES_GDT_DEBUG + printf("writing primary GDT block %u\n", gdt_blk); +#endif + retval = ext2fs_write_ind_block(fs, gdt_blk, gdt_buf); + if (retval) + goto out_dindir; + } + } + +out_dindir: + if (dindir_dirty) { + retval2 = ext2fs_write_ind_block(fs, dindir_blk, dindir_buf); + if (!retval) + retval = retval2; + } +out_inode: +#ifdef RES_GDT_DEBUG + printf("inode.i_blocks = %u, i_size = %lu\n", inode.i_blocks, + EXT2_I_SIZE(&inode)); +#endif + if (inode_dirty) { + inode.i_atime = inode.i_mtime = fs->now ? fs->now : time(0); + retval2 = ext2fs_write_new_inode(fs, EXT2_RESIZE_INO, &inode); + if (!retval) + retval = retval2; + } +out_free: + ext2fs_free_mem(&dindir_buf); + return retval; +} + diff --git a/lib/ext2fs/rw_bitmaps.c b/lib/ext2fs/rw_bitmaps.c new file mode 100644 index 0000000..1fe65f7 --- /dev/null +++ b/lib/ext2fs/rw_bitmaps.c @@ -0,0 +1,682 @@ +/* + * rw_bitmaps.c --- routines to read and write the inode and block bitmaps. + * + * Copyright (C) 1993, 1994, 1994, 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#ifdef HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#ifdef HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#ifdef HAVE_PTHREAD_H +#include <pthread.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "e2image.h" + +#ifdef HAVE_PTHREAD +typedef pthread_mutex_t mutex_t; + +static void unix_pthread_mutex_lock(mutex_t *mutex) +{ + if (mutex) + pthread_mutex_lock(mutex); +} +static void unix_pthread_mutex_unlock(mutex_t *mutex) +{ + if (mutex) + pthread_mutex_unlock(mutex); +} +#else +typedef int mutex_t; +#define unix_pthread_mutex_lock(mutex_t) do {} while (0) +#define unix_pthread_mutex_unlock(mutex_t) do {} while (0) +#endif + +static errcode_t write_bitmaps(ext2_filsys fs, int do_inode, int do_block) +{ + dgrp_t i; + unsigned int j; + int block_nbytes, inode_nbytes; + unsigned int nbits; + errcode_t retval; + char *block_buf = NULL, *inode_buf = NULL; + int csum_flag; + blk64_t blk; + blk64_t blk_itr = EXT2FS_B2C(fs, fs->super->s_first_data_block); + ext2_ino_t ino_itr = 1; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!(fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + csum_flag = ext2fs_has_group_desc_csum(fs); + + inode_nbytes = block_nbytes = 0; + if (do_block) { + block_nbytes = EXT2_CLUSTERS_PER_GROUP(fs->super) / 8; + retval = io_channel_alloc_buf(fs->io, 0, &block_buf); + if (retval) + goto errout; + memset(block_buf, 0xff, fs->blocksize); + } + if (do_inode) { + inode_nbytes = (size_t) + ((EXT2_INODES_PER_GROUP(fs->super)+7) / 8); + retval = io_channel_alloc_buf(fs->io, 0, &inode_buf); + if (retval) + goto errout; + memset(inode_buf, 0xff, fs->blocksize); + } + + for (i = 0; i < fs->group_desc_count; i++) { + if (!do_block) + goto skip_block_bitmap; + + if (csum_flag && ext2fs_bg_flags_test(fs, i, EXT2_BG_BLOCK_UNINIT) + ) + goto skip_this_block_bitmap; + + retval = ext2fs_get_block_bitmap_range2(fs->block_map, + blk_itr, block_nbytes << 3, block_buf); + if (retval) + goto errout; + + if (i == fs->group_desc_count - 1) { + /* Force bitmap padding for the last group */ + nbits = EXT2FS_NUM_B2C(fs, + ((ext2fs_blocks_count(fs->super) + - (__u64) fs->super->s_first_data_block) + % (__u64) EXT2_BLOCKS_PER_GROUP(fs->super))); + if (nbits) + for (j = nbits; j < fs->blocksize * 8; j++) + ext2fs_set_bit(j, block_buf); + } + + retval = ext2fs_block_bitmap_csum_set(fs, i, block_buf, + block_nbytes); + if (retval) + return retval; + ext2fs_group_desc_csum_set(fs, i); + fs->flags |= EXT2_FLAG_DIRTY; + + blk = ext2fs_block_bitmap_loc(fs, i); + if (blk && blk < ext2fs_blocks_count(fs->super)) { + retval = io_channel_write_blk64(fs->io, blk, 1, + block_buf); + if (retval) { + retval = EXT2_ET_BLOCK_BITMAP_WRITE; + goto errout; + } + } + skip_this_block_bitmap: + blk_itr += block_nbytes << 3; + skip_block_bitmap: + + if (!do_inode) + continue; + + if (csum_flag && ext2fs_bg_flags_test(fs, i, EXT2_BG_INODE_UNINIT) + ) + goto skip_this_inode_bitmap; + + retval = ext2fs_get_inode_bitmap_range2(fs->inode_map, + ino_itr, inode_nbytes << 3, inode_buf); + if (retval) + goto errout; + + retval = ext2fs_inode_bitmap_csum_set(fs, i, inode_buf, + inode_nbytes); + if (retval) + goto errout; + ext2fs_group_desc_csum_set(fs, i); + fs->flags |= EXT2_FLAG_DIRTY; + + blk = ext2fs_inode_bitmap_loc(fs, i); + if (blk && blk < ext2fs_blocks_count(fs->super)) { + retval = io_channel_write_blk64(fs->io, blk, 1, + inode_buf); + if (retval) { + retval = EXT2_ET_INODE_BITMAP_WRITE; + goto errout; + } + } + skip_this_inode_bitmap: + ino_itr += inode_nbytes << 3; + + } + if (do_block) { + fs->flags &= ~EXT2_FLAG_BB_DIRTY; + ext2fs_free_mem(&block_buf); + } + if (do_inode) { + fs->flags &= ~EXT2_FLAG_IB_DIRTY; + ext2fs_free_mem(&inode_buf); + } + return 0; +errout: + if (inode_buf) + ext2fs_free_mem(&inode_buf); + if (block_buf) + ext2fs_free_mem(&block_buf); + return retval; +} + +static errcode_t mark_uninit_bg_group_blocks(ext2_filsys fs) +{ + dgrp_t i; + blk64_t blk; + ext2fs_block_bitmap bmap = fs->block_map; + + for (i = 0; i < fs->group_desc_count; i++) { + if (!ext2fs_bg_flags_test(fs, i, EXT2_BG_BLOCK_UNINIT)) + continue; + + ext2fs_reserve_super_and_bgd(fs, i, bmap); + + /* + * Mark the blocks used for the inode table + */ + blk = ext2fs_inode_table_loc(fs, i); + if (blk) + ext2fs_mark_block_bitmap_range2(bmap, blk, + fs->inode_blocks_per_group); + + /* + * Mark block used for the block bitmap + */ + blk = ext2fs_block_bitmap_loc(fs, i); + if (blk && blk < ext2fs_blocks_count(fs->super)) + ext2fs_mark_block_bitmap2(bmap, blk); + + /* + * Mark block used for the inode bitmap + */ + blk = ext2fs_inode_bitmap_loc(fs, i); + if (blk && blk < ext2fs_blocks_count(fs->super)) + ext2fs_mark_block_bitmap2(bmap, blk); + } + return 0; +} + +static int bitmap_tail_verify(unsigned char *bitmap, int first, int last) +{ + int i; + + for (i = first; i <= last; i++) + if (bitmap[i] != 0xff) + return 0; + return 1; +} + +static errcode_t read_bitmaps_range_prepare(ext2_filsys fs, int flags) +{ + errcode_t retval; + int block_nbytes = EXT2_CLUSTERS_PER_GROUP(fs->super) / 8; + int inode_nbytes = EXT2_INODES_PER_GROUP(fs->super) / 8; + char *buf; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if ((block_nbytes > (int) fs->blocksize) || + (inode_nbytes > (int) fs->blocksize)) + return EXT2_ET_CORRUPT_SUPERBLOCK; + + fs->write_bitmaps = ext2fs_write_bitmaps; + + retval = ext2fs_get_mem(strlen(fs->device_name) + 80, &buf); + if (retval) + return retval; + + if (flags & EXT2FS_BITMAPS_BLOCK) { + if (fs->block_map) + ext2fs_free_block_bitmap(fs->block_map); + strcpy(buf, "block bitmap for "); + strcat(buf, fs->device_name); + retval = ext2fs_allocate_block_bitmap(fs, buf, &fs->block_map); + if (retval) + goto cleanup; + } + + if (flags & EXT2FS_BITMAPS_INODE) { + if (fs->inode_map) + ext2fs_free_inode_bitmap(fs->inode_map); + strcpy(buf, "inode bitmap for "); + strcat(buf, fs->device_name); + retval = ext2fs_allocate_inode_bitmap(fs, buf, &fs->inode_map); + if (retval) + goto cleanup; + } + ext2fs_free_mem(&buf); + return retval; + +cleanup: + if (flags & EXT2FS_BITMAPS_BLOCK) { + ext2fs_free_block_bitmap(fs->block_map); + fs->block_map = 0; + } + if (flags & EXT2FS_BITMAPS_INODE) { + ext2fs_free_inode_bitmap(fs->inode_map); + fs->inode_map = 0; + } + ext2fs_free_mem(&buf); + return retval; +} + +static errcode_t read_bitmaps_range_start(ext2_filsys fs, int flags, + dgrp_t start, dgrp_t end, + mutex_t *mutex, + int *tail_flags) +{ + dgrp_t i; + char *block_bitmap = 0, *inode_bitmap = 0; + errcode_t retval = 0; + int block_nbytes = EXT2_CLUSTERS_PER_GROUP(fs->super) / 8; + int inode_nbytes = EXT2_INODES_PER_GROUP(fs->super) / 8; + int csum_flag; + unsigned int cnt; + blk64_t blk; + blk64_t blk_itr = EXT2FS_B2C(fs, fs->super->s_first_data_block); + blk64_t blk_cnt; + ext2_ino_t ino_itr = 1; + ext2_ino_t ino_cnt; + + csum_flag = ext2fs_has_group_desc_csum(fs); + + if (flags & EXT2FS_BITMAPS_BLOCK) { + retval = io_channel_alloc_buf(fs->io, 0, &block_bitmap); + if (retval) + goto cleanup; + } else { + block_nbytes = 0; + } + + if (flags & EXT2FS_BITMAPS_INODE) { + retval = io_channel_alloc_buf(fs->io, 0, &inode_bitmap); + if (retval) + goto cleanup; + } else { + inode_nbytes = 0; + } + + /* io should be null */ + if (fs->flags & EXT2_FLAG_IMAGE_FILE) { + blk = (ext2fs_le32_to_cpu(fs->image_header->offset_inodemap) / fs->blocksize); + ino_cnt = fs->super->s_inodes_count; + while (inode_bitmap && ino_cnt > 0) { + retval = io_channel_read_blk64(fs->image_io, blk++, + 1, inode_bitmap); + if (retval) + goto cleanup; + cnt = fs->blocksize << 3; + if (cnt > ino_cnt) + cnt = ino_cnt; + retval = ext2fs_set_inode_bitmap_range2(fs->inode_map, + ino_itr, cnt, inode_bitmap); + if (retval) + goto cleanup; + ino_itr += cnt; + ino_cnt -= cnt; + } + blk = (ext2fs_le32_to_cpu(fs->image_header->offset_blockmap) / + fs->blocksize); + blk_cnt = EXT2_GROUPS_TO_CLUSTERS(fs->super, + fs->group_desc_count); + while (block_bitmap && blk_cnt > 0) { + retval = io_channel_read_blk64(fs->image_io, blk++, + 1, block_bitmap); + if (retval) + goto cleanup; + cnt = fs->blocksize << 3; + if (cnt > blk_cnt) + cnt = blk_cnt; + retval = ext2fs_set_block_bitmap_range2(fs->block_map, + blk_itr, cnt, block_bitmap); + if (retval) + goto cleanup; + blk_itr += cnt; + blk_cnt -= cnt; + } + goto cleanup; + } + + blk_itr += ((blk64_t)start * (block_nbytes << 3)); + ino_itr += ((blk64_t)start * (inode_nbytes << 3)); + for (i = start; i <= end; i++) { + if (block_bitmap) { + blk = ext2fs_block_bitmap_loc(fs, i); + if ((csum_flag && + ext2fs_bg_flags_test(fs, i, EXT2_BG_BLOCK_UNINIT) && + ext2fs_group_desc_csum_verify(fs, i)) || + (blk >= ext2fs_blocks_count(fs->super))) + blk = 0; + if (blk) { + retval = io_channel_read_blk64(fs->io, blk, + 1, block_bitmap); + if (retval) { + retval = EXT2_ET_BLOCK_BITMAP_READ; + goto cleanup; + } + /* verify block bitmap checksum */ + if (!(fs->flags & + EXT2_FLAG_IGNORE_CSUM_ERRORS) && + !ext2fs_block_bitmap_csum_verify(fs, i, + block_bitmap, block_nbytes)) { + retval = + EXT2_ET_BLOCK_BITMAP_CSUM_INVALID; + goto cleanup; + } + if (!bitmap_tail_verify((unsigned char *) block_bitmap, + block_nbytes, fs->blocksize - 1)) + *tail_flags |= EXT2_FLAG_BBITMAP_TAIL_PROBLEM; + } else + memset(block_bitmap, 0, block_nbytes); + cnt = block_nbytes << 3; + unix_pthread_mutex_lock(mutex); + retval = ext2fs_set_block_bitmap_range2(fs->block_map, + blk_itr, cnt, block_bitmap); + unix_pthread_mutex_unlock(mutex); + if (retval) + goto cleanup; + blk_itr += block_nbytes << 3; + } + if (inode_bitmap) { + blk = ext2fs_inode_bitmap_loc(fs, i); + if ((csum_flag && + ext2fs_bg_flags_test(fs, i, EXT2_BG_INODE_UNINIT) && + ext2fs_group_desc_csum_verify(fs, i)) || + (blk >= ext2fs_blocks_count(fs->super))) + blk = 0; + if (blk) { + retval = io_channel_read_blk64(fs->io, blk, + 1, inode_bitmap); + if (retval) { + retval = EXT2_ET_INODE_BITMAP_READ; + goto cleanup; + } + + /* verify inode bitmap checksum */ + if (!(fs->flags & + EXT2_FLAG_IGNORE_CSUM_ERRORS) && + !ext2fs_inode_bitmap_csum_verify(fs, i, + inode_bitmap, inode_nbytes)) { + retval = + EXT2_ET_INODE_BITMAP_CSUM_INVALID; + goto cleanup; + } + if (!bitmap_tail_verify((unsigned char *) inode_bitmap, + inode_nbytes, fs->blocksize - 1)) + *tail_flags |= EXT2_FLAG_IBITMAP_TAIL_PROBLEM; + } else + memset(inode_bitmap, 0, inode_nbytes); + cnt = inode_nbytes << 3; + unix_pthread_mutex_lock(mutex); + retval = ext2fs_set_inode_bitmap_range2(fs->inode_map, + ino_itr, cnt, inode_bitmap); + unix_pthread_mutex_unlock(mutex); + if (retval) + goto cleanup; + ino_itr += inode_nbytes << 3; + } + } + +cleanup: + if (inode_bitmap) + ext2fs_free_mem(&inode_bitmap); + if (block_bitmap) + ext2fs_free_mem(&block_bitmap); + return retval; +} + +static errcode_t read_bitmaps_range_end(ext2_filsys fs, int flags, + int tail_flags) +{ + errcode_t retval; + + /* Mark group blocks for any BLOCK_UNINIT groups */ + if (flags & EXT2FS_BITMAPS_BLOCK) { + retval = mark_uninit_bg_group_blocks(fs); + if (retval) + return retval; + fs->flags &= ~EXT2_FLAG_BBITMAP_TAIL_PROBLEM; + } + if (flags & EXT2FS_BITMAPS_INODE) + fs->flags &= ~EXT2_FLAG_IBITMAP_TAIL_PROBLEM; + fs->flags |= tail_flags; + + return 0; +} + +static void read_bitmaps_cleanup_on_error(ext2_filsys fs, int flags) +{ + if (flags & EXT2FS_BITMAPS_BLOCK) { + ext2fs_free_block_bitmap(fs->block_map); + fs->block_map = 0; + } + if (flags & EXT2FS_BITMAPS_INODE) { + ext2fs_free_inode_bitmap(fs->inode_map); + fs->inode_map = 0; + } +} + +static errcode_t read_bitmaps_range(ext2_filsys fs, int flags, + dgrp_t start, dgrp_t end) +{ + errcode_t retval; + int tail_flags = 0; + + retval = read_bitmaps_range_prepare(fs, flags); + if (retval) + return retval; + + retval = read_bitmaps_range_start(fs, flags, start, end, + NULL, &tail_flags); + if (retval == 0) + retval = read_bitmaps_range_end(fs, flags, tail_flags); + if (retval) + read_bitmaps_cleanup_on_error(fs, flags); + return retval; +} + +#ifdef HAVE_PTHREAD +struct read_bitmaps_thread_info { + ext2_filsys rbt_fs; + int rbt_flags; + dgrp_t rbt_grp_start; + dgrp_t rbt_grp_end; + errcode_t rbt_retval; + pthread_mutex_t *rbt_mutex; + int rbt_tail_flags; +}; + +static void *read_bitmaps_thread(void *data) +{ + struct read_bitmaps_thread_info *rbt = data; + + rbt->rbt_retval = read_bitmaps_range_start(rbt->rbt_fs, rbt->rbt_flags, + rbt->rbt_grp_start, rbt->rbt_grp_end, + rbt->rbt_mutex, &rbt->rbt_tail_flags); + return NULL; +} +#endif + +errcode_t ext2fs_rw_bitmaps(ext2_filsys fs, int flags, int num_threads) +{ +#ifdef HAVE_PTHREAD + pthread_attr_t attr; + pthread_t *thread_ids = NULL; + struct read_bitmaps_thread_info *thread_infos = NULL; + pthread_mutex_t rbt_mutex = PTHREAD_MUTEX_INITIALIZER; + errcode_t retval; + errcode_t rc; + unsigned flexbg_size = 1U << fs->super->s_log_groups_per_flex; + dgrp_t average_group; + int i, tail_flags = 0; +#endif + + if (flags & ~EXT2FS_BITMAPS_VALID_FLAGS) + return EXT2_ET_INVALID_ARGUMENT; + + if (ext2fs_has_feature_journal_dev(fs->super)) + return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP; + + if (flags & EXT2FS_BITMAPS_WRITE) + return write_bitmaps(fs, flags & EXT2FS_BITMAPS_INODE, + flags & EXT2FS_BITMAPS_BLOCK); + +#ifdef HAVE_PTHREAD + if (((fs->io->flags & CHANNEL_FLAGS_THREADS) == 0) || + (num_threads == 1) || (fs->flags & EXT2_FLAG_IMAGE_FILE)) + goto fallback; + +#if defined(HAVE_SYSCONF) && defined(_SC_NPROCESSORS_CONF) + if (num_threads < 0) + num_threads = sysconf(_SC_NPROCESSORS_CONF); +#endif + /* + * Guess for now; eventually we should probably define + * ext2fs_get_num_cpus() and teach it how to get this info on + * MacOS, FreeBSD, etc. + * ref: https://stackoverflow.com/questions/150355 + */ + if (num_threads < 0) + num_threads = 4; + + if ((unsigned) num_threads > fs->group_desc_count) + num_threads = fs->group_desc_count; + average_group = fs->group_desc_count / num_threads; + if (ext2fs_has_feature_flex_bg(fs->super)) { + average_group = (average_group / flexbg_size) * flexbg_size; + } + if ((num_threads <= 1) || (average_group == 0)) + goto fallback; + + io_channel_set_options(fs->io, "cache=off"); + retval = pthread_attr_init(&attr); + if (retval) + return retval; + + thread_ids = calloc(sizeof(pthread_t), num_threads); + if (!thread_ids) + return ENOMEM; + + thread_infos = calloc(sizeof(struct read_bitmaps_thread_info), + num_threads); + if (!thread_infos) + goto out; + + retval = read_bitmaps_range_prepare(fs, flags); + if (retval) + goto out; + +// fprintf(stdout, "Multiple threads triggered to read bitmaps\n"); + for (i = 0; i < num_threads; i++) { + thread_infos[i].rbt_fs = fs; + thread_infos[i].rbt_flags = flags; + thread_infos[i].rbt_mutex = &rbt_mutex; + thread_infos[i].rbt_tail_flags = 0; + if (i == 0) + thread_infos[i].rbt_grp_start = 0; + else + thread_infos[i].rbt_grp_start = average_group * i + 1; + + if (i == num_threads - 1) + thread_infos[i].rbt_grp_end = fs->group_desc_count - 1; + else + thread_infos[i].rbt_grp_end = average_group * (i + 1); + retval = pthread_create(&thread_ids[i], &attr, + &read_bitmaps_thread, &thread_infos[i]); + if (retval) + break; + } + for (i = 0; i < num_threads; i++) { + if (!thread_ids[i]) + break; + rc = pthread_join(thread_ids[i], NULL); + if (rc && !retval) + retval = rc; + rc = thread_infos[i].rbt_retval; + if (rc && !retval) + retval = rc; + tail_flags |= thread_infos[i].rbt_tail_flags; + } +out: + rc = pthread_attr_destroy(&attr); + if (rc && !retval) + retval = rc; + free(thread_infos); + free(thread_ids); + + if (retval == 0) + retval = read_bitmaps_range_end(fs, flags, tail_flags); + if (retval) + read_bitmaps_cleanup_on_error(fs, flags); + /* XXX should save and restore cache setting */ + io_channel_set_options(fs->io, "cache=on"); + return retval; +fallback: +#endif /* HAVE_PTHREAD */ + return read_bitmaps_range(fs, flags, 0, fs->group_desc_count - 1); +} + +errcode_t ext2fs_read_inode_bitmap(ext2_filsys fs) +{ + return ext2fs_rw_bitmaps(fs, EXT2FS_BITMAPS_INODE, -1); +} + +errcode_t ext2fs_read_block_bitmap(ext2_filsys fs) +{ + return ext2fs_rw_bitmaps(fs, EXT2FS_BITMAPS_BLOCK, -1); +} + +errcode_t ext2fs_write_inode_bitmap(ext2_filsys fs) +{ + return write_bitmaps(fs, 1, 0); +} + +errcode_t ext2fs_write_block_bitmap (ext2_filsys fs) +{ + return write_bitmaps(fs, 0, 1); +} + +errcode_t ext2fs_read_bitmaps(ext2_filsys fs) +{ + int flags = 0; + + if (!fs->inode_map) + flags |= EXT2FS_BITMAPS_INODE; + if (!fs->block_map) + flags |= EXT2FS_BITMAPS_BLOCK; + if (flags == 0) + return 0; + return ext2fs_rw_bitmaps(fs, flags, -1); +} + +errcode_t ext2fs_write_bitmaps(ext2_filsys fs) +{ + int do_inode = fs->inode_map && ext2fs_test_ib_dirty(fs); + int do_block = fs->block_map && ext2fs_test_bb_dirty(fs); + + if (!do_inode && !do_block) + return 0; + + return write_bitmaps(fs, do_inode, do_block); +} diff --git a/lib/ext2fs/sha256.c b/lib/ext2fs/sha256.c new file mode 100644 index 0000000..b1506e2 --- /dev/null +++ b/lib/ext2fs/sha256.c @@ -0,0 +1,254 @@ +/* + * sha256.c --- The sh256 algorithm + * + * Copyright (C) 2004 Sam Hocevar <sam@hocevar.net> + * (copied from libtomcrypt and then relicensed under GPLv2) + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + + +#include "config.h" +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#include "ext2fs.h" + +static const __u32 K[64] = { + 0x428a2f98UL, 0x71374491UL, 0xb5c0fbcfUL, 0xe9b5dba5UL, 0x3956c25bUL, + 0x59f111f1UL, 0x923f82a4UL, 0xab1c5ed5UL, 0xd807aa98UL, 0x12835b01UL, + 0x243185beUL, 0x550c7dc3UL, 0x72be5d74UL, 0x80deb1feUL, 0x9bdc06a7UL, + 0xc19bf174UL, 0xe49b69c1UL, 0xefbe4786UL, 0x0fc19dc6UL, 0x240ca1ccUL, + 0x2de92c6fUL, 0x4a7484aaUL, 0x5cb0a9dcUL, 0x76f988daUL, 0x983e5152UL, + 0xa831c66dUL, 0xb00327c8UL, 0xbf597fc7UL, 0xc6e00bf3UL, 0xd5a79147UL, + 0x06ca6351UL, 0x14292967UL, 0x27b70a85UL, 0x2e1b2138UL, 0x4d2c6dfcUL, + 0x53380d13UL, 0x650a7354UL, 0x766a0abbUL, 0x81c2c92eUL, 0x92722c85UL, + 0xa2bfe8a1UL, 0xa81a664bUL, 0xc24b8b70UL, 0xc76c51a3UL, 0xd192e819UL, + 0xd6990624UL, 0xf40e3585UL, 0x106aa070UL, 0x19a4c116UL, 0x1e376c08UL, + 0x2748774cUL, 0x34b0bcb5UL, 0x391c0cb3UL, 0x4ed8aa4aUL, 0x5b9cca4fUL, + 0x682e6ff3UL, 0x748f82eeUL, 0x78a5636fUL, 0x84c87814UL, 0x8cc70208UL, + 0x90befffaUL, 0xa4506cebUL, 0xbef9a3f7UL, 0xc67178f2UL +}; + +/* Various logical functions */ +#define Ch(x,y,z) (z ^ (x & (y ^ z))) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define S(x, n) RORc((x),(n)) +#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) +#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) +#define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) +#define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) +#define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) +#define RORc(x, y) ( ((((__u32)(x)&0xFFFFFFFFUL)>>(__u32)((y)&31)) | ((__u32)(x)<<(__u32)(32-((y)&31)))) & 0xFFFFFFFFUL) + +#define RND(a,b,c,d,e,f,g,h,i) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + +#define STORE64H(x, y) \ + do { \ + (y)[0] = (unsigned char)(((x)>>56)&255);\ + (y)[1] = (unsigned char)(((x)>>48)&255);\ + (y)[2] = (unsigned char)(((x)>>40)&255);\ + (y)[3] = (unsigned char)(((x)>>32)&255);\ + (y)[4] = (unsigned char)(((x)>>24)&255);\ + (y)[5] = (unsigned char)(((x)>>16)&255);\ + (y)[6] = (unsigned char)(((x)>>8)&255);\ + (y)[7] = (unsigned char)((x)&255); } while(0) + +#define STORE32H(x, y) \ + do { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255); \ + (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } while(0) + +#define LOAD32H(x, y) \ + do { x = ((__u32)((y)[0] & 255)<<24) | \ + ((__u32)((y)[1] & 255)<<16) | \ + ((__u32)((y)[2] & 255)<<8) | \ + ((__u32)((y)[3] & 255)); } while(0) + +struct sha256_state { + __u64 length; + __u32 state[8], curlen; + unsigned char buf[64]; +}; + +/* This is a highly simplified version from libtomcrypt */ +struct hash_state { + struct sha256_state sha256; +}; + +static void sha256_compress(struct hash_state * md, const unsigned char *buf) +{ + __u32 S[8], W[64], t0, t1; + __u32 t; + int i; + + /* copy state into S */ + for (i = 0; i < 8; i++) { + S[i] = md->sha256.state[i]; + } + + /* copy the state into 512-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD32H(W[i], buf + (4*i)); + } + + /* fill W[16..63] */ + for (i = 16; i < 64; i++) { + W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; + } + + /* Compress */ + for (i = 0; i < 64; ++i) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); + t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; + S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; + } + + /* feedback */ + for (i = 0; i < 8; i++) { + md->sha256.state[i] = md->sha256.state[i] + S[i]; + } +} + +static void sha256_init(struct hash_state * md) +{ + md->sha256.curlen = 0; + md->sha256.length = 0; + md->sha256.state[0] = 0x6A09E667UL; + md->sha256.state[1] = 0xBB67AE85UL; + md->sha256.state[2] = 0x3C6EF372UL; + md->sha256.state[3] = 0xA54FF53AUL; + md->sha256.state[4] = 0x510E527FUL; + md->sha256.state[5] = 0x9B05688CUL; + md->sha256.state[6] = 0x1F83D9ABUL; + md->sha256.state[7] = 0x5BE0CD19UL; +} + +#define MIN(x, y) ( ((x)<(y))?(x):(y) ) +#define SHA256_BLOCKSIZE 64 +static void sha256_process(struct hash_state * md, const unsigned char *in, unsigned long inlen) +{ + unsigned long n; + + while (inlen > 0) { + if (md->sha256.curlen == 0 && inlen >= SHA256_BLOCKSIZE) { + sha256_compress(md, in); + md->sha256.length += SHA256_BLOCKSIZE * 8; + in += SHA256_BLOCKSIZE; + inlen -= SHA256_BLOCKSIZE; + } else { + n = MIN(inlen, (SHA256_BLOCKSIZE - md->sha256.curlen)); + memcpy(md->sha256.buf + md->sha256.curlen, in, (size_t)n); + md->sha256.curlen += n; + in += n; + inlen -= n; + if (md->sha256.curlen == SHA256_BLOCKSIZE) { + sha256_compress(md, md->sha256.buf); + md->sha256.length += 8*SHA256_BLOCKSIZE; + md->sha256.curlen = 0; + } + } + } +} + + +static void sha256_done(struct hash_state * md, unsigned char *out) +{ + int i; + + /* increase the length of the message */ + md->sha256.length += md->sha256.curlen * 8; + + /* append the '1' bit */ + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha256.curlen > 56) { + while (md->sha256.curlen < 64) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + sha256_compress(md, md->sha256.buf); + md->sha256.curlen = 0; + } + + /* pad up to 56 bytes of zeroes */ + while (md->sha256.curlen < 56) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha256.length, md->sha256.buf+56); + sha256_compress(md, md->sha256.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE32H(md->sha256.state[i], out+(4*i)); + } +} + +void ext2fs_sha256(const unsigned char *in, unsigned long in_size, + unsigned char out[EXT2FS_SHA256_LENGTH]) +{ + struct hash_state md; + + sha256_init(&md); + sha256_process(&md, in, in_size); + sha256_done(&md, out); +} + +#ifdef UNITTEST +static const struct { + char *msg; + unsigned char hash[32]; +} tests[] = { + { "", + { 0xe3, 0xb0, 0xc4, 0x42, 0x98, 0xfc, 0x1c, 0x14, + 0x9a, 0xfb, 0xf4, 0xc8, 0x99, 0x6f, 0xb9, 0x24, + 0x27, 0xae, 0x41, 0xe4, 0x64, 0x9b, 0x93, 0x4c, + 0xa4, 0x95, 0x99, 0x1b, 0x78, 0x52, 0xb8, 0x55 } + }, + { "abc", + { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea, + 0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23, + 0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c, + 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, + 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39, + 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, + 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 } + }, +}; + +int main(int argc, char **argv) +{ + int i; + int errors = 0; + unsigned char tmp[32]; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + unsigned char *msg = (unsigned char *) tests[i].msg; + int len = strlen(tests[i].msg); + + ext2fs_sha256(msg, len, tmp); + printf("SHA256 test message %d: ", i); + if (memcmp(tmp, tests[i].hash, 32) != 0) { + printf("FAILED\n"); + errors++; + } else + printf("OK\n"); + } + return errors; +} + +#endif /* UNITTEST */ diff --git a/lib/ext2fs/sha512.c b/lib/ext2fs/sha512.c new file mode 100644 index 0000000..f246afb --- /dev/null +++ b/lib/ext2fs/sha512.c @@ -0,0 +1,302 @@ +/* + * sha512.c --- The sha512 algorithm + * + * Copyright (C) 2004 Sam Hocevar <sam@hocevar.net> + * (copied from libtomcrypt and then relicensed under GPLv2) + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + + +#include "config.h" +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#include "ext2fs.h" + +/* the K array */ +#define CONST64(n) n +static const __u64 K[80] = { + CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd), + CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc), + CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019), + CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118), + CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe), + CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2), + CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1), + CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694), + CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3), + CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65), + CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483), + CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5), + CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210), + CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4), + CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725), + CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70), + CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926), + CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df), + CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8), + CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b), + CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001), + CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30), + CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910), + CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8), + CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53), + CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8), + CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb), + CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3), + CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60), + CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec), + CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9), + CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b), + CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207), + CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178), + CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6), + CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b), + CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493), + CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c), + CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a), + CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817) +}; +#define Ch(x,y,z) (z ^ (x & (y ^ z))) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define S(x, n) ROR64c(x, n) +#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((__u64)n)) +#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) +#define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) +#define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) +#define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) +#define RND(a,b,c,d,e,f,g,h,i)\ + t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i];\ + t1 = Sigma0(a) + Maj(a, b, c);\ + d += t0;\ + h = t0 + t1; +#define STORE64H(x, y) \ + do { \ + (y)[0] = (unsigned char)(((x)>>56)&255);\ + (y)[1] = (unsigned char)(((x)>>48)&255);\ + (y)[2] = (unsigned char)(((x)>>40)&255);\ + (y)[3] = (unsigned char)(((x)>>32)&255);\ + (y)[4] = (unsigned char)(((x)>>24)&255);\ + (y)[5] = (unsigned char)(((x)>>16)&255);\ + (y)[6] = (unsigned char)(((x)>>8)&255);\ + (y)[7] = (unsigned char)((x)&255); } while(0) + +#define LOAD64H(x, y)\ + do {x = \ + (((__u64)((y)[0] & 255)) << 56) |\ + (((__u64)((y)[1] & 255)) << 48) |\ + (((__u64)((y)[2] & 255)) << 40) |\ + (((__u64)((y)[3] & 255)) << 32) |\ + (((__u64)((y)[4] & 255)) << 24) |\ + (((__u64)((y)[5] & 255)) << 16) |\ + (((__u64)((y)[6] & 255)) << 8) |\ + (((__u64)((y)[7] & 255)));\ + } while(0) + +#define ROR64c(x, y) \ + ( ((((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((__u64)(y)&CONST64(63))) | \ + ((x)<<((__u64)(64-((y)&CONST64(63)))))) & CONST64(0xFFFFFFFFFFFFFFFF)) + +struct sha512_state { + __u64 length, state[8]; + unsigned long curlen; + unsigned char buf[128]; +}; + +/* This is a highly simplified version from libtomcrypt */ +struct hash_state { + struct sha512_state sha512; +}; + +static void sha512_compress(struct hash_state * md, const unsigned char *buf) +{ + __u64 S[8], W[80], t0, t1; + int i; + + /* copy state into S */ + for (i = 0; i < 8; i++) { + S[i] = md->sha512.state[i]; + } + + /* copy the state into 1024-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD64H(W[i], buf + (8*i)); + } + + /* fill W[16..79] */ + for (i = 16; i < 80; i++) { + W[i] = Gamma1(W[i - 2]) + W[i - 7] + + Gamma0(W[i - 15]) + W[i - 16]; + } + + for (i = 0; i < 80; i += 8) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); + } + + /* feedback */ + for (i = 0; i < 8; i++) { + md->sha512.state[i] = md->sha512.state[i] + S[i]; + } +} + +static void sha512_init(struct hash_state * md) +{ + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0x6a09e667f3bcc908); + md->sha512.state[1] = CONST64(0xbb67ae8584caa73b); + md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b); + md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1); + md->sha512.state[4] = CONST64(0x510e527fade682d1); + md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f); + md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b); + md->sha512.state[7] = CONST64(0x5be0cd19137e2179); +} + +static void sha512_done(struct hash_state * md, unsigned char *out) +{ + int i; + + /* increase the length of the message */ + md->sha512.length += md->sha512.curlen * CONST64(8); + + /* append the '1' bit */ + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 112 bytes we append zeros then + * compress. Then we can fall back to padding zeros and length encoding + * like normal. */ + if (md->sha512.curlen > 112) { + while (md->sha512.curlen < 128) { + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; + } + sha512_compress(md, md->sha512.buf); + md->sha512.curlen = 0; + } + + /* pad up to 120 bytes of zeroes note: that from 112 to 120 is the 64 MSB + * of the length. We assume that you won't hash > 2^64 bits of data. */ + while (md->sha512.curlen < 120) { + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha512.length, md->sha512.buf + 120); + sha512_compress(md, md->sha512.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE64H(md->sha512.state[i], out+(8 * i)); + } +} + +#define MIN(x, y) ( ((x)<(y))?(x):(y) ) +#define SHA512_BLOCKSIZE 128 +static void sha512_process(struct hash_state * md, + const unsigned char *in, + unsigned long inlen) +{ + unsigned long n; + + while (inlen > 0) { + if (md->sha512.curlen == 0 && inlen >= SHA512_BLOCKSIZE) { + sha512_compress(md, in); + md->sha512.length += SHA512_BLOCKSIZE * 8; + in += SHA512_BLOCKSIZE; + inlen -= SHA512_BLOCKSIZE; + } else { + n = MIN(inlen, (SHA512_BLOCKSIZE - md->sha512.curlen)); + memcpy(md->sha512.buf + md->sha512.curlen, + in, (size_t)n); + md->sha512.curlen += n; + in += n; + inlen -= n; + if (md->sha512.curlen == SHA512_BLOCKSIZE) { + sha512_compress(md, md->sha512.buf); + md->sha512.length += SHA512_BLOCKSIZE * 8; + md->sha512.curlen = 0; + } + } + } +} + +void ext2fs_sha512(const unsigned char *in, unsigned long in_size, + unsigned char out[EXT2FS_SHA512_LENGTH]) +{ + struct hash_state md; + + sha512_init(&md); + sha512_process(&md, in, in_size); + sha512_done(&md, out); +} + +#ifdef UNITTEST +static const struct { + char *msg; + unsigned char hash[64]; +} tests[] = { + { "", + { 0xcf, 0x83, 0xe1, 0x35, 0x7e, 0xef, 0xb8, 0xbd, + 0xf1, 0x54, 0x28, 0x50, 0xd6, 0x6d, 0x80, 0x07, + 0xd6, 0x20, 0xe4, 0x05, 0x0b, 0x57, 0x15, 0xdc, + 0x83, 0xf4, 0xa9, 0x21, 0xd3, 0x6c, 0xe9, 0xce, + 0x47, 0xd0, 0xd1, 0x3c, 0x5d, 0x85, 0xf2, 0xb0, + 0xff, 0x83, 0x18, 0xd2, 0x87, 0x7e, 0xec, 0x2f, + 0x63, 0xb9, 0x31, 0xbd, 0x47, 0x41, 0x7a, 0x81, + 0xa5, 0x38, 0x32, 0x7a, 0xf9, 0x27, 0xda, 0x3e } + }, + { "abc", + { 0xdd, 0xaf, 0x35, 0xa1, 0x93, 0x61, 0x7a, 0xba, + 0xcc, 0x41, 0x73, 0x49, 0xae, 0x20, 0x41, 0x31, + 0x12, 0xe6, 0xfa, 0x4e, 0x89, 0xa9, 0x7e, 0xa2, + 0x0a, 0x9e, 0xee, 0xe6, 0x4b, 0x55, 0xd3, 0x9a, + 0x21, 0x92, 0x99, 0x2a, 0x27, 0x4f, 0xc1, 0xa8, + 0x36, 0xba, 0x3c, 0x23, 0xa3, 0xfe, 0xeb, 0xbd, + 0x45, 0x4d, 0x44, 0x23, 0x64, 0x3c, 0xe8, 0x0e, + 0x2a, 0x9a, 0xc9, 0x4f, 0xa5, 0x4c, 0xa4, 0x9f } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x8e, 0x95, 0x9b, 0x75, 0xda, 0xe3, 0x13, 0xda, + 0x8c, 0xf4, 0xf7, 0x28, 0x14, 0xfc, 0x14, 0x3f, + 0x8f, 0x77, 0x79, 0xc6, 0xeb, 0x9f, 0x7f, 0xa1, + 0x72, 0x99, 0xae, 0xad, 0xb6, 0x88, 0x90, 0x18, + 0x50, 0x1d, 0x28, 0x9e, 0x49, 0x00, 0xf7, 0xe4, + 0x33, 0x1b, 0x99, 0xde, 0xc4, 0xb5, 0x43, 0x3a, + 0xc7, 0xd3, 0x29, 0xee, 0xb6, 0xdd, 0x26, 0x54, + 0x5e, 0x96, 0xe5, 0x5b, 0x87, 0x4b, 0xe9, 0x09 } + }, +}; + +int main(int argc, char **argv) +{ + int i; + int errors = 0; + unsigned char tmp[64]; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + unsigned char *msg = (unsigned char *) tests[i].msg; + int len = strlen(tests[i].msg); + + ext2fs_sha512(msg, len, tmp); + printf("SHA512 test message %d: ", i); + if (memcmp(tmp, tests[i].hash, 64) != 0) { + printf("FAILED\n"); + errors++; + } else + printf("OK\n"); + } + return errors; +} + +#endif /* UNITTEST */ diff --git a/lib/ext2fs/sparse_io.c b/lib/ext2fs/sparse_io.c new file mode 100644 index 0000000..f287e76 --- /dev/null +++ b/lib/ext2fs/sparse_io.c @@ -0,0 +1,554 @@ +#include "config.h" +#include <sys/types.h> +#include <sys/stat.h> +#include <fcntl.h> +#include <unistd.h> +#include <stdint.h> +#include "ext2_fs.h" +#include "ext2fs.h" + +#ifndef O_BINARY +#define O_BINARY 0 +#endif + +#if !defined(ENABLE_LIBSPARSE) +static errcode_t sparse_open(const char *name EXT2FS_ATTR((unused)), + int flags EXT2FS_ATTR((unused)), + io_channel *channel EXT2FS_ATTR((unused))) +{ + return EXT2_ET_UNIMPLEMENTED; +} +static errcode_t sparse_close(io_channel channel EXT2FS_ATTR((unused))) +{ + return EXT2_ET_UNIMPLEMENTED; +} +static struct struct_io_manager struct_sparse_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "Android sparse I/O Manager", + .open = sparse_open, + .close = sparse_close, +}; +static struct struct_io_manager struct_sparsefd_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "Android sparse fd I/O Manager", + .open = sparse_open, + .close = sparse_close, +}; +#else +#include <sparse/sparse.h> + +struct sparse_map { + int fd; + char **blocks; + int block_size; + uint64_t blocks_count; + char *file; + struct sparse_file *sparse_file; + io_channel channel; +}; + +struct sparse_io_params { + int fd; + char *file; + uint64_t blocks_count; + unsigned int block_size; +}; + +static errcode_t sparse_write_blk(io_channel channel, unsigned long block, + int count, const void *buf); + +static void free_sparse_blocks(struct sparse_map *sm) +{ + uint64_t i; + + for (i = 0; i < sm->blocks_count; ++i) + free(sm->blocks[i]); + free(sm->blocks); + sm->blocks = NULL; +} + +static int sparse_import_segment(void *priv, const void *data, size_t len, + unsigned int block, unsigned int nr_blocks) +{ + struct sparse_map *sm = priv; + + /* Ignore chunk headers, only write the data */ + if (!nr_blocks || len % sm->block_size) + return 0; + + return sparse_write_blk(sm->channel, block, nr_blocks, data); +} + +static errcode_t io_manager_import_sparse(struct sparse_io_params *params, + struct sparse_map *sm, io_channel io) +{ + int fd; + errcode_t retval; + struct sparse_file *sparse_file; + + if (params->fd < 0) { + fd = open(params->file, O_RDONLY); + if (fd < 0) { + retval = -1; + goto err_open; + } + } else + fd = params->fd; + sparse_file = sparse_file_import(fd, false, false); + if (!sparse_file) { + retval = -1; + goto err_sparse; + } + + sm->block_size = sparse_file_block_size(sparse_file); + sm->blocks_count = (sparse_file_len(sparse_file, 0, 0) - 1) + / sm->block_size + 1; + sm->blocks = calloc(sm->blocks_count, sizeof(char*)); + if (!sm->blocks) { + retval = -1; + goto err_alloc; + } + io->block_size = sm->block_size; + + retval = sparse_file_foreach_chunk(sparse_file, true, false, + sparse_import_segment, sm); + + if (retval) + free_sparse_blocks(sm); +err_alloc: + sparse_file_destroy(sparse_file); +err_sparse: + close(fd); +err_open: + return retval; +} + +static errcode_t io_manager_configure(struct sparse_io_params *params, + int flags, io_channel io) +{ + errcode_t retval; + uint64_t img_size; + struct sparse_map *sm = calloc(1, sizeof(*sm)); + if (!sm) + return EXT2_ET_NO_MEMORY; + + sm->file = params->file; + sm->channel = io; + io->private_data = sm; + retval = io_manager_import_sparse(params, sm, io); + if (retval) { + if (!params->block_size || !params->blocks_count) { + retval = EINVAL; + goto err_params; + } + sm->block_size = params->block_size; + sm->blocks_count = params->blocks_count; + sm->blocks = calloc(params->blocks_count, sizeof(void*)); + if (!sm->blocks) { + retval = EXT2_ET_NO_MEMORY; + goto err_alloc; + } + } + io->block_size = sm->block_size; + img_size = (uint64_t)sm->block_size * sm->blocks_count; + + if (flags & IO_FLAG_RW) { + sm->sparse_file = sparse_file_new(sm->block_size, img_size); + if (!sm->sparse_file) { + retval = EXT2_ET_NO_MEMORY; + goto err_alloc; + } + if (params->fd < 0) { + sm->fd = open(params->file, O_CREAT | O_RDWR | O_TRUNC | O_BINARY, + 0644); + if (sm->fd < 0) { + retval = errno; + goto err_open; + } + } else + sm->fd = params->fd; + } else { + sm->fd = -1; + sm->sparse_file = NULL; + } + return 0; + +err_open: + sparse_file_destroy(sm->sparse_file); +err_alloc: + free_sparse_blocks(sm); +err_params: + free(sm); + return retval; +} + +static errcode_t sparse_open_channel(struct sparse_io_params *sparse_params, + int flags, io_channel *channel) +{ + errcode_t retval; + io_channel io; + + io = calloc(1, sizeof(struct struct_io_channel)); + io->magic = EXT2_ET_MAGIC_IO_CHANNEL; + io->block_size = 0; + io->refcount = 1; + + retval = io_manager_configure(sparse_params, flags, io); + if (retval) { + free(io); + return retval; + } + + *channel = io; + return 0; +} + +static errcode_t read_sparse_argv(const char *name, bool is_fd, + struct sparse_io_params *sparse_params) +{ + int ret; + sparse_params->fd = -1; + sparse_params->block_size = 0; + sparse_params->blocks_count = 0; + + sparse_params->file = malloc(strlen(name) + 1); + if (!sparse_params->file) { + fprintf(stderr, "failed to alloc %zu\n", strlen(name) + 1); + return EXT2_ET_NO_MEMORY; + } + + if (is_fd) { + ret = sscanf(name, "(%d):%llu:%u", &sparse_params->fd, + (unsigned long long *)&sparse_params->blocks_count, + &sparse_params->block_size); + } else { + ret = sscanf(name, "(%[^)])%*[:]%llu%*[:]%u", sparse_params->file, + (unsigned long long *)&sparse_params->blocks_count, + &sparse_params->block_size); + } + + if (ret < 1) { + free(sparse_params->file); + return EINVAL; + } + return 0; +} + +static errcode_t sparse_open(const char *name, int flags, io_channel *channel) +{ + errcode_t retval; + struct sparse_io_params sparse_params; + + retval = read_sparse_argv(name, false, &sparse_params); + if (retval) + return EXT2_ET_BAD_DEVICE_NAME; + + retval = sparse_open_channel(&sparse_params, flags, channel); + if (retval) + return retval; + (*channel)->manager = sparse_io_manager; + + return retval; +} + +static errcode_t sparsefd_open(const char *name, int flags, io_channel *channel) +{ + errcode_t retval; + struct sparse_io_params sparse_params; + + retval = read_sparse_argv(name, true, &sparse_params); + if (retval) + return EXT2_ET_BAD_DEVICE_NAME; + + retval = sparse_open_channel(&sparse_params, flags, channel); + if (retval) + return retval; + (*channel)->manager = sparsefd_io_manager; + + return retval; +} + +static errcode_t sparse_merge_blocks(struct sparse_map *sm, uint64_t start, + uint64_t num) +{ + char *buf; + uint64_t i; + unsigned int block_size = sm->block_size; + errcode_t retval = 0; + + buf = calloc(num, block_size); + if (!buf) { + fprintf(stderr, "failed to alloc %llu\n", + (unsigned long long)num * block_size); + return EXT2_ET_NO_MEMORY; + } + + for (i = 0; i < num; i++) { + memcpy(buf + i * block_size, sm->blocks[start + i] , block_size); + free(sm->blocks[start + i]); + sm->blocks[start + i] = NULL; + } + + /* free_sparse_blocks will release this buf. */ + sm->blocks[start] = buf; + + retval = sparse_file_add_data(sm->sparse_file, sm->blocks[start], + block_size * num, start); + + return retval; +} + +static errcode_t sparse_close_channel(io_channel channel) +{ + uint64_t i; + errcode_t retval = 0; + struct sparse_map *sm = channel->private_data; + + if (sm->sparse_file) { + int64_t chunk_start = (sm->blocks[0] == NULL) ? -1 : 0; + for (i = 0; i < sm->blocks_count; ++i) { + if (!sm->blocks[i] && chunk_start != -1) { + retval = sparse_merge_blocks(sm, chunk_start, i - chunk_start); + chunk_start = -1; + } else if (sm->blocks[i] && chunk_start == -1) { + chunk_start = i; + } + if (retval) + goto ret; + } + if (chunk_start != -1) { + retval = sparse_merge_blocks(sm, chunk_start, + sm->blocks_count - chunk_start); + if (retval) + goto ret; + } + retval = sparse_file_write(sm->sparse_file, sm->fd, + /*gzip*/0, /*sparse*/1, /*crc*/0); + } + +ret: + if (sm->sparse_file) + sparse_file_destroy(sm->sparse_file); + free_sparse_blocks(sm); + free(sm->file); + free(sm); + free(channel); + return retval; +} + +static errcode_t sparse_close(io_channel channel) +{ + errcode_t retval; + struct sparse_map *sm = channel->private_data; + int fd = sm->fd; + + retval = sparse_close_channel(channel); + if (fd >= 0) + close(fd); + + return retval; +} + +static errcode_t sparse_set_blksize(io_channel channel, int blksize) +{ + channel->block_size = blksize; + return 0; +} + +static blk64_t block_to_sparse_block(blk64_t block, blk64_t *offset, + io_channel channel, struct sparse_map *sm) +{ + int ratio; + blk64_t ret = block; + + ratio = sm->block_size / channel->block_size; + ret /= ratio; + *offset = (block % ratio) * channel->block_size; + + return ret; +} + +static errcode_t check_block_size(io_channel channel, struct sparse_map *sm) +{ + if (sm->block_size >= channel->block_size) + return 0; + return EXT2_ET_UNEXPECTED_BLOCK_SIZE; +} + +static errcode_t sparse_read_blk64(io_channel channel, blk64_t block, + int count, void *buf) +{ + int i; + char *out = buf; + blk64_t offset = 0, cur_block; + struct sparse_map *sm = channel->private_data; + + if (check_block_size(channel, sm)) + return EXT2_ET_UNEXPECTED_BLOCK_SIZE; + + if (count < 0) { //partial read + count = -count; + cur_block = block_to_sparse_block(block, &offset, channel, sm); + if (sm->blocks[cur_block]) + memcpy(out, (sm->blocks[cur_block]) + offset, count); + else + memset(out, 0, count); + } else { + for (i = 0; i < count; ++i) { + cur_block = block_to_sparse_block(block + i, &offset, + channel, sm); + if (sm->blocks[cur_block]) + memcpy(out + (i * channel->block_size), + sm->blocks[cur_block] + offset, + channel->block_size); + else if (sm->blocks) + memset(out + (i * channel->block_size), 0, + channel->block_size); + } + } + return 0; +} + +static errcode_t sparse_read_blk(io_channel channel, unsigned long block, + int count, void *buf) +{ + return sparse_read_blk64(channel, block, count, buf); +} + +static errcode_t sparse_write_blk64(io_channel channel, blk64_t block, + int count, const void *buf) +{ + int i; + blk64_t offset = 0, cur_block; + const char *in = buf; + struct sparse_map *sm = channel->private_data; + + if (check_block_size(channel, sm)) + return EXT2_ET_UNEXPECTED_BLOCK_SIZE; + + if (count < 0) { //partial write + count = -count; + cur_block = block_to_sparse_block(block, &offset, channel, + sm); + if (!sm->blocks[cur_block]) { + sm->blocks[cur_block] = calloc(1, sm->block_size); + if (!sm->blocks[cur_block]) + return EXT2_ET_NO_MEMORY; + } + memcpy(sm->blocks[cur_block] + offset, in, count); + } else { + for (i = 0; i < count; ++i) { + if (block + i >= sm->blocks_count) + return 0; + cur_block = block_to_sparse_block(block + i, &offset, + channel, sm); + if (!sm->blocks[cur_block]) { + sm->blocks[cur_block] = + calloc(1, sm->block_size); + if (!sm->blocks[cur_block]) + return EXT2_ET_NO_MEMORY; + } + memcpy(sm->blocks[cur_block] + offset, + in + (i * channel->block_size), + channel->block_size); + } + } + return 0; +} + +static errcode_t sparse_write_blk(io_channel channel, unsigned long block, + int count, const void *buf) +{ + return sparse_write_blk64(channel, block, count, buf); +} + +static errcode_t sparse_discard(io_channel channel __attribute__((unused)), + blk64_t blk, unsigned long long count) +{ + blk64_t cur_block, offset; + struct sparse_map *sm = channel->private_data; + + if (check_block_size(channel, sm)) + return EXT2_ET_UNEXPECTED_BLOCK_SIZE; + + for (unsigned long long i = 0; i < count; ++i) { + if (blk + i >= sm->blocks_count) + return 0; + cur_block = block_to_sparse_block(blk + i, &offset, channel, + sm); + if (!sm->blocks[cur_block]) + continue; + free(sm->blocks[cur_block]); + sm->blocks[cur_block] = NULL; + } + return 0; +} + +static errcode_t sparse_zeroout(io_channel channel, blk64_t blk, + unsigned long long count) +{ + return sparse_discard(channel, blk, count); +} + +static errcode_t sparse_flush(io_channel channel __attribute__((unused))) +{ + return 0; +} + +static errcode_t sparse_set_option(io_channel channel __attribute__((unused)), + const char *option __attribute__((unused)), + const char *arg __attribute__((unused))) +{ + return 0; +} + +static errcode_t sparse_cache_readahead( + io_channel channel __attribute__((unused)), + blk64_t blk __attribute__((unused)), + unsigned long long count __attribute__((unused))) +{ + return 0; +} + +static struct struct_io_manager struct_sparse_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "Android sparse I/O Manager", + .open = sparse_open, + .close = sparse_close, + .set_blksize = sparse_set_blksize, + .read_blk = sparse_read_blk, + .write_blk = sparse_write_blk, + .flush = sparse_flush, + .write_byte = NULL, + .set_option = sparse_set_option, + .get_stats = NULL, + .read_blk64 = sparse_read_blk64, + .write_blk64 = sparse_write_blk64, + .discard = sparse_discard, + .cache_readahead = sparse_cache_readahead, + .zeroout = sparse_zeroout, +}; + +static struct struct_io_manager struct_sparsefd_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "Android sparse fd I/O Manager", + .open = sparsefd_open, + .close = sparse_close, + .set_blksize = sparse_set_blksize, + .read_blk = sparse_read_blk, + .write_blk = sparse_write_blk, + .flush = sparse_flush, + .write_byte = NULL, + .set_option = sparse_set_option, + .get_stats = NULL, + .read_blk64 = sparse_read_blk64, + .write_blk64 = sparse_write_blk64, + .discard = sparse_discard, + .cache_readahead = sparse_cache_readahead, + .zeroout = sparse_zeroout, +}; + +#endif + +io_manager sparse_io_manager = &struct_sparse_manager; +io_manager sparsefd_io_manager = &struct_sparsefd_manager; diff --git a/lib/ext2fs/swapfs.c b/lib/ext2fs/swapfs.c new file mode 100644 index 0000000..fe764b9 --- /dev/null +++ b/lib/ext2fs/swapfs.c @@ -0,0 +1,491 @@ +/* + * swapfs.c --- swap ext2 filesystem data structures + * + * Copyright (C) 1995, 1996, 2002 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <string.h> +#include <time.h> + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" +#include <ext2fs/ext2_ext_attr.h> + +void ext2fs_swap_super(struct ext2_super_block * sb) +{ + int i; + + sb->s_inodes_count = ext2fs_swab32(sb->s_inodes_count); + sb->s_blocks_count = ext2fs_swab32(sb->s_blocks_count); + sb->s_r_blocks_count = ext2fs_swab32(sb->s_r_blocks_count); + sb->s_free_blocks_count = ext2fs_swab32(sb->s_free_blocks_count); + sb->s_free_inodes_count = ext2fs_swab32(sb->s_free_inodes_count); + sb->s_first_data_block = ext2fs_swab32(sb->s_first_data_block); + sb->s_log_block_size = ext2fs_swab32(sb->s_log_block_size); + sb->s_log_cluster_size = ext2fs_swab32(sb->s_log_cluster_size); + sb->s_blocks_per_group = ext2fs_swab32(sb->s_blocks_per_group); + sb->s_clusters_per_group = ext2fs_swab32(sb->s_clusters_per_group); + sb->s_inodes_per_group = ext2fs_swab32(sb->s_inodes_per_group); + sb->s_mtime = ext2fs_swab32(sb->s_mtime); + sb->s_wtime = ext2fs_swab32(sb->s_wtime); + sb->s_mnt_count = ext2fs_swab16(sb->s_mnt_count); + sb->s_max_mnt_count = ext2fs_swab16(sb->s_max_mnt_count); + sb->s_magic = ext2fs_swab16(sb->s_magic); + sb->s_state = ext2fs_swab16(sb->s_state); + sb->s_errors = ext2fs_swab16(sb->s_errors); + sb->s_minor_rev_level = ext2fs_swab16(sb->s_minor_rev_level); + sb->s_lastcheck = ext2fs_swab32(sb->s_lastcheck); + sb->s_checkinterval = ext2fs_swab32(sb->s_checkinterval); + sb->s_creator_os = ext2fs_swab32(sb->s_creator_os); + sb->s_rev_level = ext2fs_swab32(sb->s_rev_level); + sb->s_def_resuid = ext2fs_swab16(sb->s_def_resuid); + sb->s_def_resgid = ext2fs_swab16(sb->s_def_resgid); + sb->s_first_ino = ext2fs_swab32(sb->s_first_ino); + sb->s_inode_size = ext2fs_swab16(sb->s_inode_size); + sb->s_block_group_nr = ext2fs_swab16(sb->s_block_group_nr); + sb->s_feature_compat = ext2fs_swab32(sb->s_feature_compat); + sb->s_feature_incompat = ext2fs_swab32(sb->s_feature_incompat); + sb->s_feature_ro_compat = ext2fs_swab32(sb->s_feature_ro_compat); + /* sb->s_uuid is __u8 and does not need swabbing */ + /* sb->s_volume_name is char and does not need swabbing */ + /* sb->s_last_mounted is char and does not need swabbing */ + sb->s_algorithm_usage_bitmap = ext2fs_swab32(sb->s_algorithm_usage_bitmap); + /* sb->s_prealloc_blocks is __u8 and does not need swabbing */ + /* sb->s_prealloc_dir_blocks is __u8 and does not need swabbing */ + sb->s_reserved_gdt_blocks = ext2fs_swab16(sb->s_reserved_gdt_blocks); + /* sb->s_journal_uuid is __u8 and does not need swabbing */ + sb->s_journal_inum = ext2fs_swab32(sb->s_journal_inum); + sb->s_journal_dev = ext2fs_swab32(sb->s_journal_dev); + sb->s_last_orphan = ext2fs_swab32(sb->s_last_orphan); + for (i = 0; i < 4; i++) + sb->s_hash_seed[i] = ext2fs_swab32(sb->s_hash_seed[i]); + /* sb->s_def_hash_version is __u8 and does not need swabbing */ + /* sb->s_jnl_backup_type is __u8 and does not need swabbing */ + sb->s_desc_size = ext2fs_swab16(sb->s_desc_size); + sb->s_default_mount_opts = ext2fs_swab32(sb->s_default_mount_opts); + sb->s_first_meta_bg = ext2fs_swab32(sb->s_first_meta_bg); + sb->s_mkfs_time = ext2fs_swab32(sb->s_mkfs_time); + /* if journal backup is for a valid extent-based journal... */ + if (ext2fs_extent_header_verify(sb->s_jnl_blocks, + sizeof(sb->s_jnl_blocks)) == 0) { + /* ... swap only the journal i_size and i_size_high, + * and the extent data is not swapped on read */ + i = 15; + } else { + /* direct/indirect journal: swap it all */ + i = 0; + } + for (; i < 17; i++) + sb->s_jnl_blocks[i] = ext2fs_swab32(sb->s_jnl_blocks[i]); + sb->s_blocks_count_hi = ext2fs_swab32(sb->s_blocks_count_hi); + sb->s_r_blocks_count_hi = ext2fs_swab32(sb->s_r_blocks_count_hi); + sb->s_free_blocks_hi = ext2fs_swab32(sb->s_free_blocks_hi); + sb->s_min_extra_isize = ext2fs_swab16(sb->s_min_extra_isize); + sb->s_want_extra_isize = ext2fs_swab16(sb->s_want_extra_isize); + sb->s_flags = ext2fs_swab32(sb->s_flags); + sb->s_raid_stride = ext2fs_swab16(sb->s_raid_stride); + sb->s_mmp_update_interval = ext2fs_swab16(sb->s_mmp_update_interval); + sb->s_mmp_block = ext2fs_swab64(sb->s_mmp_block); + sb->s_raid_stripe_width = ext2fs_swab32(sb->s_raid_stripe_width); + /* sb->s_log_groups_per_flex is __u8 and does not need swabbing */ + /* sb->s_checksum_type is __u8 and does not need swabbing */ + /* sb->s_encryption_level is __u8 and does not need swabbing */ + /* sb->s_reserved_pad is __u8 and does not need swabbing */ + sb->s_kbytes_written = ext2fs_swab64(sb->s_kbytes_written); + sb->s_snapshot_inum = ext2fs_swab32(sb->s_snapshot_inum); + sb->s_snapshot_id = ext2fs_swab32(sb->s_snapshot_id); + sb->s_snapshot_r_blocks_count = + ext2fs_swab64(sb->s_snapshot_r_blocks_count); + sb->s_snapshot_list = ext2fs_swab32(sb->s_snapshot_list); + sb->s_error_count = ext2fs_swab32(sb->s_error_count); + sb->s_first_error_time = ext2fs_swab32(sb->s_first_error_time); + sb->s_first_error_ino = ext2fs_swab32(sb->s_first_error_ino); + sb->s_first_error_block = ext2fs_swab64(sb->s_first_error_block); + /* sb->s_first_error_func is __u8 and does not need swabbing */ + sb->s_last_error_time = ext2fs_swab32(sb->s_last_error_time); + sb->s_last_error_ino = ext2fs_swab32(sb->s_last_error_ino); + sb->s_last_error_block = ext2fs_swab64(sb->s_last_error_block); + /* sb->s_last_error_func is __u8 and does not need swabbing */ + /* sb->s_mount_opts is __u8 and does not need swabbing */ + sb->s_usr_quota_inum = ext2fs_swab32(sb->s_usr_quota_inum); + sb->s_grp_quota_inum = ext2fs_swab32(sb->s_grp_quota_inum); + sb->s_overhead_clusters = ext2fs_swab32(sb->s_overhead_clusters); + sb->s_backup_bgs[0] = ext2fs_swab32(sb->s_backup_bgs[0]); + sb->s_backup_bgs[1] = ext2fs_swab32(sb->s_backup_bgs[1]); + /* sb->s_encrypt_algos is __u8 and does not need swabbing */ + /* sb->s_encrypt_pw_salt is __u8 and does not need swabbing */ + sb->s_lpf_ino = ext2fs_swab32(sb->s_lpf_ino); + sb->s_prj_quota_inum = ext2fs_swab32(sb->s_prj_quota_inum); + sb->s_checksum_seed = ext2fs_swab32(sb->s_checksum_seed); + /* s_*_time_hi are __u8 and does not need swabbing */ + sb->s_encoding = ext2fs_swab16(sb->s_encoding); + sb->s_encoding_flags = ext2fs_swab16(sb->s_encoding_flags); + sb->s_orphan_file_inum = ext2fs_swab32(sb->s_orphan_file_inum); + /* catch when new fields are used from s_reserved */ + EXT2FS_BUILD_BUG_ON(sizeof(sb->s_reserved) != 94 * sizeof(__le32)); + sb->s_checksum = ext2fs_swab32(sb->s_checksum); +} + +void ext2fs_swap_group_desc2(ext2_filsys fs, struct ext2_group_desc *gdp) +{ + struct ext4_group_desc *gdp4 = (struct ext4_group_desc *)gdp; + + /* Do the 32-bit parts first */ + gdp->bg_block_bitmap = ext2fs_swab32(gdp->bg_block_bitmap); + gdp->bg_inode_bitmap = ext2fs_swab32(gdp->bg_inode_bitmap); + gdp->bg_inode_table = ext2fs_swab32(gdp->bg_inode_table); + gdp->bg_free_blocks_count = ext2fs_swab16(gdp->bg_free_blocks_count); + gdp->bg_free_inodes_count = ext2fs_swab16(gdp->bg_free_inodes_count); + gdp->bg_used_dirs_count = ext2fs_swab16(gdp->bg_used_dirs_count); + gdp->bg_flags = ext2fs_swab16(gdp->bg_flags); + gdp->bg_exclude_bitmap_lo = ext2fs_swab32(gdp->bg_exclude_bitmap_lo); + gdp->bg_block_bitmap_csum_lo = + ext2fs_swab16(gdp->bg_block_bitmap_csum_lo); + gdp->bg_inode_bitmap_csum_lo = + ext2fs_swab16(gdp->bg_inode_bitmap_csum_lo); + gdp->bg_itable_unused = ext2fs_swab16(gdp->bg_itable_unused); + gdp->bg_checksum = ext2fs_swab16(gdp->bg_checksum); + /* If we're 32-bit, we're done */ + if (fs == NULL || EXT2_DESC_SIZE(fs->super) < EXT2_MIN_DESC_SIZE_64BIT) + return; + + /* Swap the 64-bit parts */ + gdp4->bg_block_bitmap_hi = ext2fs_swab32(gdp4->bg_block_bitmap_hi); + gdp4->bg_inode_bitmap_hi = ext2fs_swab32(gdp4->bg_inode_bitmap_hi); + gdp4->bg_inode_table_hi = ext2fs_swab32(gdp4->bg_inode_table_hi); + gdp4->bg_free_blocks_count_hi = + ext2fs_swab16(gdp4->bg_free_blocks_count_hi); + gdp4->bg_free_inodes_count_hi = + ext2fs_swab16(gdp4->bg_free_inodes_count_hi); + gdp4->bg_used_dirs_count_hi = + ext2fs_swab16(gdp4->bg_used_dirs_count_hi); + gdp4->bg_itable_unused_hi = ext2fs_swab16(gdp4->bg_itable_unused_hi); + gdp4->bg_exclude_bitmap_hi = ext2fs_swab16(gdp4->bg_exclude_bitmap_hi); + gdp4->bg_block_bitmap_csum_hi = + ext2fs_swab16(gdp4->bg_block_bitmap_csum_hi); + gdp4->bg_inode_bitmap_csum_hi = + ext2fs_swab16(gdp4->bg_inode_bitmap_csum_hi); + EXT2FS_BUILD_BUG_ON(sizeof(gdp4->bg_reserved) != sizeof(__u32)); +} + +void ext2fs_swap_group_desc(struct ext2_group_desc *gdp) +{ + ext2fs_swap_group_desc2(0, gdp); +} + + +void ext2fs_swap_ext_attr_header(struct ext2_ext_attr_header *to_header, + struct ext2_ext_attr_header *from_header) +{ + int n; + + to_header->h_magic = ext2fs_swab32(from_header->h_magic); + to_header->h_blocks = ext2fs_swab32(from_header->h_blocks); + to_header->h_refcount = ext2fs_swab32(from_header->h_refcount); + to_header->h_hash = ext2fs_swab32(from_header->h_hash); + to_header->h_checksum = ext2fs_swab32(from_header->h_checksum); + for (n = 0; n < 3; n++) + to_header->h_reserved[n] = + ext2fs_swab32(from_header->h_reserved[n]); +} + +void ext2fs_swap_ext_attr_entry(struct ext2_ext_attr_entry *to_entry, + struct ext2_ext_attr_entry *from_entry) +{ + to_entry->e_value_offs = ext2fs_swab16(from_entry->e_value_offs); + to_entry->e_value_inum = ext2fs_swab32(from_entry->e_value_inum); + to_entry->e_value_size = ext2fs_swab32(from_entry->e_value_size); + to_entry->e_hash = ext2fs_swab32(from_entry->e_hash); +} + +void ext2fs_swap_ext_attr(char *to, char *from, int bufsize, int has_header) +{ + struct ext2_ext_attr_header *from_header = + (struct ext2_ext_attr_header *)from; + struct ext2_ext_attr_header *to_header = + (struct ext2_ext_attr_header *)to; + struct ext2_ext_attr_entry *from_entry, *to_entry; + char *from_end = (char *)from_header + bufsize; + + if (to_header != from_header) + memcpy(to_header, from_header, bufsize); + + if (has_header) { + ext2fs_swap_ext_attr_header(to_header, from_header); + + from_entry = (struct ext2_ext_attr_entry *)(from_header+1); + to_entry = (struct ext2_ext_attr_entry *)(to_header+1); + } else { + from_entry = (struct ext2_ext_attr_entry *)from_header; + to_entry = (struct ext2_ext_attr_entry *)to_header; + } + + while ((char *)from_entry < from_end && + (char *)EXT2_EXT_ATTR_NEXT(from_entry) <= from_end && + *(__u32 *)from_entry) { + ext2fs_swap_ext_attr_entry(to_entry, from_entry); + from_entry = EXT2_EXT_ATTR_NEXT(from_entry); + to_entry = EXT2_EXT_ATTR_NEXT(to_entry); + } +} + +void ext2fs_swap_inode_full(ext2_filsys fs, struct ext2_inode_large *t, + struct ext2_inode_large *f, int hostorder, + int bufsize) +{ + unsigned i, extra_isize, attr_magic; + int has_extents = 0, has_inline_data = 0, islnk = 0, fast_symlink = 0; + unsigned int inode_size; + __u32 *eaf, *eat; + + /* + * Note that t and f may point to the same address. That's why + * if (hostorder) condition is executed before swab calls and + * if (!hostorder) afterwards. + */ + if (hostorder) { + islnk = LINUX_S_ISLNK(f->i_mode); + fast_symlink = ext2fs_is_fast_symlink(EXT2_INODE(f)); + has_extents = (f->i_flags & EXT4_EXTENTS_FL) != 0; + has_inline_data = (f->i_flags & EXT4_INLINE_DATA_FL) != 0; + } + + t->i_mode = ext2fs_swab16(f->i_mode); + t->i_uid = ext2fs_swab16(f->i_uid); + t->i_size = ext2fs_swab32(f->i_size); + t->i_atime = ext2fs_swab32(f->i_atime); + t->i_ctime = ext2fs_swab32(f->i_ctime); + t->i_mtime = ext2fs_swab32(f->i_mtime); + t->i_dtime = ext2fs_swab32(f->i_dtime); + t->i_gid = ext2fs_swab16(f->i_gid); + t->i_links_count = ext2fs_swab16(f->i_links_count); + t->i_file_acl = ext2fs_swab32(f->i_file_acl); + t->i_blocks = ext2fs_swab32(f->i_blocks); + t->i_flags = ext2fs_swab32(f->i_flags); + t->i_size_high = ext2fs_swab32(f->i_size_high); + + if (!hostorder) { + islnk = LINUX_S_ISLNK(t->i_mode); + fast_symlink = ext2fs_is_fast_symlink(EXT2_INODE(t)); + has_extents = (t->i_flags & EXT4_EXTENTS_FL) != 0; + has_inline_data = (t->i_flags & EXT4_INLINE_DATA_FL) != 0; + } + + /* + * Extent data and inline data are swapped on access, not here + */ + if (!has_extents && !has_inline_data && (!islnk || !fast_symlink)) { + for (i = 0; i < EXT2_N_BLOCKS; i++) + t->i_block[i] = ext2fs_swab32(f->i_block[i]); + } else if (t != f) { + for (i = 0; i < EXT2_N_BLOCKS; i++) + t->i_block[i] = f->i_block[i]; + } + t->i_generation = ext2fs_swab32(f->i_generation); + t->i_faddr = ext2fs_swab32(f->i_faddr); + + switch (fs->super->s_creator_os) { + case EXT2_OS_LINUX: + t->osd1.linux1.l_i_version = + ext2fs_swab32(f->osd1.linux1.l_i_version); + t->osd2.linux2.l_i_blocks_hi = + ext2fs_swab16(f->osd2.linux2.l_i_blocks_hi); + t->osd2.linux2.l_i_file_acl_high = + ext2fs_swab16(f->osd2.linux2.l_i_file_acl_high); + t->osd2.linux2.l_i_uid_high = + ext2fs_swab16 (f->osd2.linux2.l_i_uid_high); + t->osd2.linux2.l_i_gid_high = + ext2fs_swab16 (f->osd2.linux2.l_i_gid_high); + t->osd2.linux2.l_i_checksum_lo = + ext2fs_swab16(f->osd2.linux2.l_i_checksum_lo); + break; + case EXT2_OS_HURD: + t->osd1.hurd1.h_i_translator = + ext2fs_swab32 (f->osd1.hurd1.h_i_translator); + t->osd2.hurd2.h_i_frag = f->osd2.hurd2.h_i_frag; + t->osd2.hurd2.h_i_fsize = f->osd2.hurd2.h_i_fsize; + t->osd2.hurd2.h_i_mode_high = + ext2fs_swab16 (f->osd2.hurd2.h_i_mode_high); + t->osd2.hurd2.h_i_uid_high = + ext2fs_swab16 (f->osd2.hurd2.h_i_uid_high); + t->osd2.hurd2.h_i_gid_high = + ext2fs_swab16 (f->osd2.hurd2.h_i_gid_high); + t->osd2.hurd2.h_i_author = + ext2fs_swab32 (f->osd2.hurd2.h_i_author); + break; + default: + break; + } + + if (bufsize < (int) (sizeof(struct ext2_inode) + sizeof(__u16))) + return; /* no i_extra_isize field */ + + if (hostorder) + extra_isize = f->i_extra_isize; + t->i_extra_isize = ext2fs_swab16(f->i_extra_isize); + if (!hostorder) + extra_isize = t->i_extra_isize; + if (extra_isize > EXT2_INODE_SIZE(fs->super) - + sizeof(struct ext2_inode)) { + /* this is error case: i_extra_size is too large */ + return; + } + if (extra_isize & 3) + return; /* Illegal inode extra_isize */ + + inode_size = EXT2_GOOD_OLD_INODE_SIZE + extra_isize; + if (inode_includes(inode_size, i_checksum_hi)) + t->i_checksum_hi = ext2fs_swab16(f->i_checksum_hi); + if (inode_includes(inode_size, i_ctime_extra)) + t->i_ctime_extra = ext2fs_swab32(f->i_ctime_extra); + if (inode_includes(inode_size, i_mtime_extra)) + t->i_mtime_extra = ext2fs_swab32(f->i_mtime_extra); + if (inode_includes(inode_size, i_atime_extra)) + t->i_atime_extra = ext2fs_swab32(f->i_atime_extra); + if (inode_includes(inode_size, i_crtime)) + t->i_crtime = ext2fs_swab32(f->i_crtime); + if (inode_includes(inode_size, i_crtime_extra)) + t->i_crtime_extra = ext2fs_swab32(f->i_crtime_extra); + if (inode_includes(inode_size, i_version_hi)) + t->i_version_hi = ext2fs_swab32(f->i_version_hi); + if (inode_includes(inode_size, i_projid)) + t->i_projid = ext2fs_swab32(f->i_projid); + /* catch new static fields added after i_projid */ + EXT2FS_BUILD_BUG_ON(sizeof(struct ext2_inode_large) != 160); + + i = sizeof(struct ext2_inode) + extra_isize + sizeof(__u32); + if (bufsize < (int) i) + return; /* no space for EA magic */ + + eaf = (__u32 *) (((char *) f) + sizeof(struct ext2_inode) + + extra_isize); + + attr_magic = *eaf; + if (!hostorder) + attr_magic = ext2fs_swab32(attr_magic); + + if (attr_magic != EXT2_EXT_ATTR_MAGIC) + return; /* it seems no magic here */ + + eat = (__u32 *) (((char *) t) + sizeof(struct ext2_inode) + + extra_isize); + *eat = ext2fs_swab32(*eaf); + + /* convert EA(s) */ + ext2fs_swap_ext_attr((char *) (eat + 1), (char *) (eaf + 1), + bufsize - sizeof(struct ext2_inode) - + extra_isize - sizeof(__u32), 0); + +} + +void ext2fs_swap_inode(ext2_filsys fs, struct ext2_inode *t, + struct ext2_inode *f, int hostorder) +{ + ext2fs_swap_inode_full(fs, (struct ext2_inode_large *) t, + (struct ext2_inode_large *) f, hostorder, + sizeof(struct ext2_inode)); +} + +void ext2fs_swap_mmp(struct mmp_struct *mmp) +{ + mmp->mmp_magic = ext2fs_swab32(mmp->mmp_magic); + mmp->mmp_seq = ext2fs_swab32(mmp->mmp_seq); + mmp->mmp_time = ext2fs_swab64(mmp->mmp_time); + mmp->mmp_check_interval = ext2fs_swab16(mmp->mmp_check_interval); + mmp->mmp_checksum = ext2fs_swab32(mmp->mmp_checksum); +} + +errcode_t ext2fs_dirent_swab_in(ext2_filsys fs, char *buf, int flags) +{ + return ext2fs_dirent_swab_in2(fs, buf, fs->blocksize, flags); +} + +errcode_t ext2fs_dirent_swab_in2(ext2_filsys fs, char *buf, + size_t size, int flags) +{ + errcode_t retval; + char *p, *end; + struct ext2_dir_entry *dirent; + unsigned int name_len, rec_len, left; + + p = (char *) buf; + end = (char *) buf + size; + left = size; + while (p < end-8) { + dirent = (struct ext2_dir_entry *) p; + dirent->inode = ext2fs_swab32(dirent->inode); + dirent->rec_len = ext2fs_swab16(dirent->rec_len); + dirent->name_len = ext2fs_swab16(dirent->name_len); + name_len = dirent->name_len; + if (flags & EXT2_DIRBLOCK_V2_STRUCT) + dirent->name_len = ext2fs_swab16(dirent->name_len); + retval = ext2fs_get_rec_len(fs, dirent, &rec_len); + if (retval) + return retval; + if ((rec_len < 8) || (rec_len % 4)) { + rec_len = 8; + if (!(fs->flags & EXT2_FLAG_IGNORE_SWAP_DIRENT)) + return EXT2_ET_DIR_CORRUPTED; + } else if (((name_len & 0xFF) + 8) > rec_len) + if (!(fs->flags & EXT2_FLAG_IGNORE_SWAP_DIRENT)) + return EXT2_ET_DIR_CORRUPTED; + if (rec_len > left) + if (!(fs->flags & EXT2_FLAG_IGNORE_SWAP_DIRENT)) + return EXT2_ET_DIR_CORRUPTED; + left -= rec_len; + p += rec_len; + } + + return 0; +} + +errcode_t ext2fs_dirent_swab_out(ext2_filsys fs, char *buf, int flags) +{ + return ext2fs_dirent_swab_out2(fs, buf, fs->blocksize, flags); +} + +errcode_t ext2fs_dirent_swab_out2(ext2_filsys fs, char *buf, + size_t size, int flags) +{ + errcode_t retval; + char *p, *end; + unsigned int rec_len; + struct ext2_dir_entry *dirent; + + p = buf; + end = buf + size; + while (p < end) { + dirent = (struct ext2_dir_entry *) p; + retval = ext2fs_get_rec_len(fs, dirent, &rec_len); + if (retval) + return retval; + if ((rec_len < 8) || + (rec_len % 4)) { + ext2fs_free_mem(&buf); + return EXT2_ET_DIR_CORRUPTED; + } + p += rec_len; + dirent->inode = ext2fs_swab32(dirent->inode); + dirent->rec_len = ext2fs_swab16(dirent->rec_len); + dirent->name_len = ext2fs_swab16(dirent->name_len); + if (rec_len > size) + return EXT2_ET_DIR_CORRUPTED; + size -= rec_len; + + if (flags & EXT2_DIRBLOCK_V2_STRUCT) + dirent->name_len = ext2fs_swab16(dirent->name_len); + } + + return 0; +} diff --git a/lib/ext2fs/symlink.c b/lib/ext2fs/symlink.c new file mode 100644 index 0000000..a66fb7e --- /dev/null +++ b/lib/ext2fs/symlink.c @@ -0,0 +1,212 @@ +/* + * symlink.c --- make a symlink in the filesystem, based on mkdir.c + * + * Copyright (c) 2012, Intel Corporation. + * All Rights Reserved. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +#ifndef HAVE_STRNLEN +/* + * Incredibly, libc5 doesn't appear to have strnlen. So we have to + * provide our own. + */ +static int my_strnlen(const char * s, int count) +{ + const char *cp = s; + + while (count-- && *cp) + cp++; + return cp - s; +} +#define strnlen(str, x) my_strnlen((str),(x)) +#endif + +errcode_t ext2fs_symlink(ext2_filsys fs, ext2_ino_t parent, ext2_ino_t ino, + const char *name, const char *target) +{ + errcode_t retval; + struct ext2_inode inode; + ext2_ino_t scratch_ino; + blk64_t blk; + int fastlink, inlinelink; + unsigned int target_len; + char *block_buf = 0; + int drop_refcount = 0; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + /* + * The Linux kernel doesn't allow for links longer than a block + * (counting the NUL terminator) + */ + target_len = strnlen(target, fs->blocksize + 1); + if (target_len >= fs->blocksize) { + retval = EXT2_ET_INVALID_ARGUMENT; + goto cleanup; + } + + /* + * Allocate a data block for slow links + */ + retval = ext2fs_get_mem(fs->blocksize, &block_buf); + if (retval) + goto cleanup; + memset(block_buf, 0, fs->blocksize); + strncpy(block_buf, target, fs->blocksize); + + memset(&inode, 0, sizeof(struct ext2_inode)); + fastlink = (target_len < sizeof(inode.i_block)); + if (!fastlink) { + retval = ext2fs_new_block2(fs, ext2fs_find_inode_goal(fs, ino, + &inode, + 0), + NULL, &blk); + if (retval) + goto cleanup; + } + + /* + * Allocate an inode, if necessary + */ + if (!ino) { + retval = ext2fs_new_inode(fs, parent, LINUX_S_IFLNK | 0755, + 0, &ino); + if (retval) + goto cleanup; + } + + /* + * Create the inode structure.... + */ + inode.i_mode = LINUX_S_IFLNK | 0777; + inode.i_uid = inode.i_gid = 0; + inode.i_links_count = 1; + ext2fs_inode_size_set(fs, &inode, target_len); + /* The time fields are set by ext2fs_write_new_inode() */ + + inlinelink = !fastlink && ext2fs_has_feature_inline_data(fs->super); + if (fastlink) { + /* Fast symlinks, target stored in inode */ + strcpy((char *)&inode.i_block, target); + } else if (inlinelink) { + /* Try inserting an inline data symlink */ + inode.i_flags |= EXT4_INLINE_DATA_FL; + retval = ext2fs_write_new_inode(fs, ino, &inode); + if (retval) + goto cleanup; + retval = ext2fs_inline_data_set(fs, ino, &inode, block_buf, + target_len); + if (retval) { + inode.i_flags &= ~EXT4_INLINE_DATA_FL; + inlinelink = 0; + goto need_block; + } + retval = ext2fs_read_inode(fs, ino, &inode); + if (retval) + goto cleanup; + } else { +need_block: + /* Slow symlinks, target stored in the first block */ + ext2fs_iblk_set(fs, &inode, 1); + if (ext2fs_has_feature_extents(fs->super)) { + /* + * The extent bmap is setup after the inode and block + * have been written out below. + */ + inode.i_flags |= EXT4_EXTENTS_FL; + } + } + + /* + * Write out the inode and inode data block. The inode generation + * number is assigned by write_new_inode, which means that the + * operations using ino must come after it. + */ + if (inlinelink) + retval = ext2fs_write_inode(fs, ino, &inode); + else + retval = ext2fs_write_new_inode(fs, ino, &inode); + if (retval) + goto cleanup; + + if (!fastlink && !inlinelink) { + retval = ext2fs_bmap2(fs, ino, &inode, NULL, BMAP_SET, 0, NULL, + &blk); + if (retval) + goto cleanup; + + retval = io_channel_write_blk64(fs->io, blk, 1, block_buf); + if (retval) + goto cleanup; + } + + /* + * Update accounting.... + */ + if (!fastlink && !inlinelink) + ext2fs_block_alloc_stats2(fs, blk, +1); + ext2fs_inode_alloc_stats2(fs, ino, +1, 0); + drop_refcount = 1; + + /* + * Link the symlink into the filesystem hierarchy + */ + if (name) { + retval = ext2fs_lookup(fs, parent, name, strlen(name), 0, + &scratch_ino); + if (!retval) { + retval = EXT2_ET_FILE_EXISTS; + goto cleanup; + } + if (retval != EXT2_ET_FILE_NOT_FOUND) + goto cleanup; + retval = ext2fs_link(fs, parent, name, ino, EXT2_FT_SYMLINK); + if (retval) + goto cleanup; + } + drop_refcount = 0; + +cleanup: + if (block_buf) + ext2fs_free_mem(&block_buf); + if (drop_refcount) { + if (!fastlink && !inlinelink) + ext2fs_block_alloc_stats2(fs, blk, -1); + ext2fs_inode_alloc_stats2(fs, ino, -1, 0); + } + return retval; +} + +/* + * Test whether an inode is a fast symlink. + * + * A fast symlink has its symlink data stored in inode->i_block. + */ +int ext2fs_is_fast_symlink(struct ext2_inode *inode) +{ + return LINUX_S_ISLNK(inode->i_mode) && EXT2_I_SIZE(inode) && + EXT2_I_SIZE(inode) < sizeof(inode->i_block); +} diff --git a/lib/ext2fs/tdb.c b/lib/ext2fs/tdb.c new file mode 100644 index 0000000..b07b291 --- /dev/null +++ b/lib/ext2fs/tdb.c @@ -0,0 +1,4174 @@ +/* +URL: svn://svnanon.samba.org/samba/branches/SAMBA_4_0/source/lib/tdb/common +Rev: 23590 +Last Changed Date: 2007-06-22 13:36:10 -0400 (Fri, 22 Jun 2007) +*/ + /* + trivial database library - standalone version + + Copyright (C) Andrew Tridgell 1999-2005 + Copyright (C) Jeremy Allison 2000-2006 + Copyright (C) Paul `Rusty' Russell 2000 + + ** NOTE! The following LGPL license applies to the tdb + ** library. This does NOT imply that all of Samba is released + ** under the LGPL + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation; either + version 2 of the License, or (at your option) any later version. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifdef CONFIG_STAND_ALONE +#define HAVE_MMAP +#define HAVE_STRDUP +#define HAVE_SYS_MMAN_H +#define HAVE_UTIME_H +#define HAVE_UTIME +#endif +#ifndef __FreeBSD__ +#define _XOPEN_SOURCE 600 +#endif + +#include "config.h" +#include <unistd.h> +#include <stdio.h> +#include <stdlib.h> +#include <stdarg.h> +#include <stddef.h> +#include <errno.h> +#include <string.h> +#ifdef HAVE_SYS_SELECT_H +#include <sys/select.h> +#endif +#include <sys/time.h> +#include <sys/types.h> +#include <time.h> +#ifdef HAVE_UTIME_H +#include <utime.h> +#endif +#include <sys/stat.h> +#include <sys/file.h> +#include <fcntl.h> + +#ifdef HAVE_SYS_MMAN_H +#include <sys/mman.h> +#endif + +#ifdef __GNUC__ +#define EXT2FS_ATTR(x) __attribute__(x) +#else +#define EXT2FS_ATTR(x) +#endif + +#ifndef MAP_FILE +#define MAP_FILE 0 +#endif + +#ifndef MAP_FAILED +#define MAP_FAILED ((void *)-1) +#endif + +#ifndef HAVE_STRDUP +#define strdup rep_strdup +static char *rep_strdup(const char *s) +{ + char *ret; + int length; + + if (!s) + return NULL; + length = strlen(s); + ret = malloc(length + 1); + if (ret) { + strncpy(ret, s, length); + ret[length] = '\0'; + } + return ret; +} +#endif + +#ifndef PRINTF_ATTRIBUTE +#if (__GNUC__ >= 3) && (__GNUC_MINOR__ >= 1 ) +/** Use gcc attribute to check printf fns. a1 is the 1-based index of + * the parameter containing the format, and a2 the index of the first + * argument. Note that some gcc 2.x versions don't handle this + * properly **/ +#define PRINTF_ATTRIBUTE(a1, a2) __attribute__ ((format (__printf__, a1, a2))) +#else +#define PRINTF_ATTRIBUTE(a1, a2) +#endif +#endif + +typedef int bool; + +#include "tdb.h" + +static TDB_DATA tdb_null; + +#ifndef u32 +#define u32 unsigned +#endif + +typedef u32 tdb_len_t; +typedef u32 tdb_off_t; + +#ifndef offsetof +#define offsetof(t,f) ((unsigned int)&((t *)0)->f) +#endif + +#define TDB_MAGIC_FOOD "TDB file\n" +#define TDB_VERSION (0x26011967 + 6) +#define TDB_MAGIC (0x26011999U) +#define TDB_FREE_MAGIC (~TDB_MAGIC) +#define TDB_DEAD_MAGIC (0xFEE1DEAD) +#define TDB_RECOVERY_MAGIC (0xf53bc0e7U) +#define TDB_ALIGNMENT 4 +#define MIN_REC_SIZE (2*sizeof(struct list_struct) + TDB_ALIGNMENT) +#define DEFAULT_HASH_SIZE 131 +#define FREELIST_TOP (sizeof(struct tdb_header)) +#define TDB_ALIGN(x,a) (((x) + (a)-1) & ~((a)-1)) +#define TDB_BYTEREV(x) (((((x)&0xff)<<24)|((x)&0xFF00)<<8)|(((x)>>8)&0xFF00)|((x)>>24)) +#define TDB_DEAD(r) ((r)->magic == TDB_DEAD_MAGIC) +#define TDB_BAD_MAGIC(r) ((r)->magic != TDB_MAGIC && !TDB_DEAD(r)) +#define TDB_HASH_TOP(hash) (FREELIST_TOP + (BUCKET(hash)+1)*sizeof(tdb_off_t)) +#define TDB_HASHTABLE_SIZE(tdb) ((tdb->header.hash_size+1)*sizeof(tdb_off_t)) +#define TDB_DATA_START(hash_size) TDB_HASH_TOP(hash_size-1) +#define TDB_RECOVERY_HEAD offsetof(struct tdb_header, recovery_start) +#define TDB_SEQNUM_OFS offsetof(struct tdb_header, sequence_number) +#define TDB_PAD_BYTE 0x42 +#define TDB_PAD_U32 0x42424242 + +/* NB assumes there is a local variable called "tdb" that is the + * current context, also takes doubly-parenthesized print-style + * argument. */ +#define TDB_LOG(x) tdb->log.log_fn x + +/* lock offsets */ +#define GLOBAL_LOCK 0 +#define ACTIVE_LOCK 4 +#define TRANSACTION_LOCK 8 + +/* free memory if the pointer is valid and zero the pointer */ +#ifndef SAFE_FREE +#define SAFE_FREE(x) do { if ((x) != NULL) {free(x); (x)=NULL;} } while(0) +#endif + +#define BUCKET(hash) ((hash) % tdb->header.hash_size) + +#define DOCONV() (tdb->flags & TDB_CONVERT) +#define CONVERT(x) (DOCONV() ? tdb_convert(&x, sizeof(x)) : &x) + + +/* the body of the database is made of one list_struct for the free space + plus a separate data list for each hash value */ +struct list_struct { + tdb_off_t next; /* offset of the next record in the list */ + tdb_len_t rec_len; /* total byte length of record */ + tdb_len_t key_len; /* byte length of key */ + tdb_len_t data_len; /* byte length of data */ + u32 full_hash; /* the full 32 bit hash of the key */ + u32 magic; /* try to catch errors */ + /* the following union is implied: + union { + char record[rec_len]; + struct { + char key[key_len]; + char data[data_len]; + } + u32 totalsize; (tailer) + } + */ +}; + + +/* this is stored at the front of every database */ +struct tdb_header { + char magic_food[32]; /* for /etc/magic */ + u32 version; /* version of the code */ + u32 hash_size; /* number of hash entries */ + tdb_off_t rwlocks; /* obsolete - kept to detect old formats */ + tdb_off_t recovery_start; /* offset of transaction recovery region */ + tdb_off_t sequence_number; /* used when TDB_SEQNUM is set */ + tdb_off_t reserved[29]; +}; + +struct tdb_lock_type { + int list; + u32 count; + u32 ltype; +}; + +struct tdb_traverse_lock { + struct tdb_traverse_lock *next; + u32 off; + u32 hash; + int lock_rw; +}; + + +struct tdb_methods { + int (*tdb_read)(struct tdb_context *, tdb_off_t , void *, tdb_len_t , int ); + int (*tdb_write)(struct tdb_context *, tdb_off_t, const void *, tdb_len_t); + void (*next_hash_chain)(struct tdb_context *, u32 *); + int (*tdb_oob)(struct tdb_context *, tdb_off_t , int ); + int (*tdb_expand_file)(struct tdb_context *, tdb_off_t , tdb_off_t ); + int (*tdb_brlock)(struct tdb_context *, tdb_off_t , int, int, int, size_t); +}; + +struct tdb_context { + char *name; /* the name of the database */ + void *map_ptr; /* where it is currently mapped */ + int fd; /* open file descriptor for the database */ + tdb_len_t map_size; /* how much space has been mapped */ + int read_only; /* opened read-only */ + int traverse_read; /* read-only traversal */ + struct tdb_lock_type global_lock; + int num_lockrecs; + struct tdb_lock_type *lockrecs; /* only real locks, all with count>0 */ + enum TDB_ERROR ecode; /* error code for last tdb error */ + struct tdb_header header; /* a cached copy of the header */ + u32 flags; /* the flags passed to tdb_open */ + struct tdb_traverse_lock travlocks; /* current traversal locks */ + struct tdb_context *next; /* all tdbs to avoid multiple opens */ + dev_t device; /* uniquely identifies this tdb */ + ino_t inode; /* uniquely identifies this tdb */ + struct tdb_logging_context log; + unsigned int (*hash_fn)(TDB_DATA *key); + int open_flags; /* flags used in the open - needed by reopen */ + unsigned int num_locks; /* number of chain locks held */ + const struct tdb_methods *methods; + struct tdb_transaction *transaction; + int page_size; + int max_dead_records; + bool have_transaction_lock; + tdb_len_t real_map_size; /* how much space has been mapped */ +}; + + +/* + internal prototypes +*/ +static int tdb_munmap(struct tdb_context *tdb); +static void tdb_mmap(struct tdb_context *tdb); +static int tdb_lock(struct tdb_context *tdb, int list, int ltype); +int tdb_lock_nonblock(struct tdb_context *tdb, int list, int ltype); +static int tdb_unlock(struct tdb_context *tdb, int list, int ltype); +static int tdb_brlock(struct tdb_context *tdb, tdb_off_t offset, int rw_type, int lck_type, int probe, size_t len); +static int tdb_transaction_lock(struct tdb_context *tdb, int ltype); +static int tdb_transaction_unlock(struct tdb_context *tdb); +static int tdb_brlock_upgrade(struct tdb_context *tdb, tdb_off_t offset, size_t len); +static int tdb_write_lock_record(struct tdb_context *tdb, tdb_off_t off); +static int tdb_write_unlock_record(struct tdb_context *tdb, tdb_off_t off); +static int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); +static int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); +static void *tdb_convert(void *buf, u32 size); +static int tdb_free(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec); +static tdb_off_t tdb_allocate(struct tdb_context *tdb, tdb_len_t length, struct list_struct *rec); +static int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); +static int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); +static int tdb_lock_record(struct tdb_context *tdb, tdb_off_t off); +static int tdb_unlock_record(struct tdb_context *tdb, tdb_off_t off); +static int tdb_rec_read(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec); +static int tdb_rec_write(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec); +static int tdb_do_delete(struct tdb_context *tdb, tdb_off_t rec_ptr, struct list_struct *rec); +static unsigned char *tdb_alloc_read(struct tdb_context *tdb, tdb_off_t offset, tdb_len_t len); +static int tdb_parse_data(struct tdb_context *tdb, TDB_DATA key, + tdb_off_t offset, tdb_len_t len, + int (*parser)(TDB_DATA key, TDB_DATA data, + void *private_data), + void *private_data); +static tdb_off_t tdb_find_lock_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash, int locktype, + struct list_struct *rec); +static void tdb_io_init(struct tdb_context *tdb); +static int tdb_expand(struct tdb_context *tdb, tdb_off_t size); +static int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off, + struct list_struct *rec); + + +/* file: error.c */ + +enum TDB_ERROR tdb_error(struct tdb_context *tdb) +{ + return tdb->ecode; +} + +static struct tdb_errname { + enum TDB_ERROR ecode; const char *estring; +} emap[] = { {TDB_SUCCESS, "Success"}, + {TDB_ERR_CORRUPT, "Corrupt database"}, + {TDB_ERR_IO, "IO Error"}, + {TDB_ERR_LOCK, "Locking error"}, + {TDB_ERR_OOM, "Out of memory"}, + {TDB_ERR_EXISTS, "Record exists"}, + {TDB_ERR_NOLOCK, "Lock exists on other keys"}, + {TDB_ERR_EINVAL, "Invalid parameter"}, + {TDB_ERR_NOEXIST, "Record does not exist"}, + {TDB_ERR_RDONLY, "write not permitted"} }; + +/* Error string for the last tdb error */ +const char *tdb_errorstr(struct tdb_context *tdb) +{ + u32 i; + for (i = 0; i < sizeof(emap) / sizeof(struct tdb_errname); i++) + if (tdb->ecode == emap[i].ecode) + return emap[i].estring; + return "Invalid error code"; +} + +/* file: lock.c */ + +#define TDB_MARK_LOCK 0x80000000 + +/* a byte range locking function - return 0 on success + this functions locks/unlocks 1 byte at the specified offset. + + On error, errno is also set so that errors are passed back properly + through tdb_open(). + + note that a len of zero means lock to end of file +*/ +int tdb_brlock(struct tdb_context *tdb, tdb_off_t offset, + int rw_type, int lck_type, int probe, size_t len) +{ + struct flock fl; + int ret; + + if (tdb->flags & TDB_NOLOCK) { + return 0; + } + + if ((rw_type == F_WRLCK) && (tdb->read_only || tdb->traverse_read)) { + tdb->ecode = TDB_ERR_RDONLY; + return -1; + } + + fl.l_type = rw_type; + fl.l_whence = SEEK_SET; + fl.l_start = offset; + fl.l_len = len; + fl.l_pid = 0; + + do { + ret = fcntl(tdb->fd,lck_type,&fl); + } while (ret == -1 && errno == EINTR); + + if (ret == -1) { + /* Generic lock error. errno set by fcntl. + * EAGAIN is an expected return from non-blocking + * locks. */ + if (!probe && lck_type != F_SETLK) { + /* Ensure error code is set for log fun to examine. */ + tdb->ecode = TDB_ERR_LOCK; + TDB_LOG((tdb, TDB_DEBUG_TRACE,"tdb_brlock failed (fd=%d) at offset %d rw_type=%d lck_type=%d len=%d\n", + tdb->fd, offset, rw_type, lck_type, (int)len)); + } + return TDB_ERRCODE(TDB_ERR_LOCK, -1); + } + return 0; +} + + +/* + upgrade a read lock to a write lock. This needs to be handled in a + special way as some OSes (such as solaris) have too conservative + deadlock detection and claim a deadlock when progress can be + made. For those OSes we may loop for a while. +*/ +int tdb_brlock_upgrade(struct tdb_context *tdb, tdb_off_t offset, size_t len) +{ + int count = 1000; + while (count--) { + struct timeval tv; + if (tdb_brlock(tdb, offset, F_WRLCK, F_SETLKW, 1, len) == 0) { + return 0; + } + if (errno != EDEADLK) { + break; + } + /* sleep for as short a time as we can - more portable than usleep() */ + tv.tv_sec = 0; + tv.tv_usec = 1; + select(0, NULL, NULL, NULL, &tv); + } + TDB_LOG((tdb, TDB_DEBUG_TRACE,"tdb_brlock_upgrade failed at offset %d\n", offset)); + return -1; +} + + +/* lock a list in the database. list -1 is the alloc list */ +static int _tdb_lock(struct tdb_context *tdb, int list, int ltype, int op) +{ + struct tdb_lock_type *new_lck; + int i; + bool mark_lock = ((ltype & TDB_MARK_LOCK) == TDB_MARK_LOCK); + + ltype &= ~TDB_MARK_LOCK; + + /* a global lock allows us to avoid per chain locks */ + if (tdb->global_lock.count && + ((u32)ltype == tdb->global_lock.ltype || ltype == F_RDLCK)) { + return 0; + } + + if (tdb->global_lock.count) { + return TDB_ERRCODE(TDB_ERR_LOCK, -1); + } + + if (list < -1 || list >= (int)tdb->header.hash_size) { + TDB_LOG((tdb, TDB_DEBUG_ERROR,"tdb_lock: invalid list %d for ltype=%d\n", + list, ltype)); + return -1; + } + if (tdb->flags & TDB_NOLOCK) + return 0; + + for (i=0; i<tdb->num_lockrecs; i++) { + if (tdb->lockrecs[i].list == list) { + if (tdb->lockrecs[i].count == 0) { + /* + * Can't happen, see tdb_unlock(). It should + * be an assert. + */ + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_lock: " + "lck->count == 0 for list %d", list)); + } + /* + * Just increment the in-memory struct, posix locks + * don't stack. + */ + tdb->lockrecs[i].count++; + return 0; + } + } + + new_lck = (struct tdb_lock_type *)realloc( + tdb->lockrecs, + sizeof(*tdb->lockrecs) * (tdb->num_lockrecs+1)); + if (new_lck == NULL) { + errno = ENOMEM; + return -1; + } + tdb->lockrecs = new_lck; + + /* Since fcntl locks don't nest, we do a lock for the first one, + and simply bump the count for future ones */ + if (!mark_lock && + tdb->methods->tdb_brlock(tdb,FREELIST_TOP+4*list, ltype, op, + 0, 1)) { + return -1; + } + + tdb->num_locks++; + + tdb->lockrecs[tdb->num_lockrecs].list = list; + tdb->lockrecs[tdb->num_lockrecs].count = 1; + tdb->lockrecs[tdb->num_lockrecs].ltype = ltype; + tdb->num_lockrecs += 1; + + return 0; +} + +/* lock a list in the database. list -1 is the alloc list */ +int tdb_lock(struct tdb_context *tdb, int list, int ltype) +{ + int ret; + ret = _tdb_lock(tdb, list, ltype, F_SETLKW); + if (ret) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_lock failed on list %d " + "ltype=%d (%s)\n", list, ltype, strerror(errno))); + } + return ret; +} + +/* lock a list in the database. list -1 is the alloc list. non-blocking lock */ +int tdb_lock_nonblock(struct tdb_context *tdb, int list, int ltype) +{ + return _tdb_lock(tdb, list, ltype, F_SETLK); +} + + +/* unlock the database: returns void because it's too late for errors. */ + /* changed to return int it may be interesting to know there + has been an error --simo */ +int tdb_unlock(struct tdb_context *tdb, int list, int ltype) +{ + int ret = -1; + int i; + struct tdb_lock_type *lck = NULL; + bool mark_lock = ((ltype & TDB_MARK_LOCK) == TDB_MARK_LOCK); + + ltype &= ~TDB_MARK_LOCK; + + /* a global lock allows us to avoid per chain locks */ + if (tdb->global_lock.count && + ((u32)ltype == tdb->global_lock.ltype || ltype == F_RDLCK)) { + return 0; + } + + if (tdb->global_lock.count) { + return TDB_ERRCODE(TDB_ERR_LOCK, -1); + } + + if (tdb->flags & TDB_NOLOCK) + return 0; + + /* Sanity checks */ + if (list < -1 || list >= (int)tdb->header.hash_size) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_unlock: list %d invalid (%d)\n", list, tdb->header.hash_size)); + return ret; + } + + for (i=0; i<tdb->num_lockrecs; i++) { + if (tdb->lockrecs[i].list == list) { + lck = &tdb->lockrecs[i]; + break; + } + } + + if ((lck == NULL) || (lck->count == 0)) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_unlock: count is 0\n")); + return -1; + } + + if (lck->count > 1) { + lck->count--; + return 0; + } + + /* + * This lock has count==1 left, so we need to unlock it in the + * kernel. We don't bother with decrementing the in-memory array + * element, we're about to overwrite it with the last array element + * anyway. + */ + + if (mark_lock) { + ret = 0; + } else { + ret = tdb->methods->tdb_brlock(tdb, FREELIST_TOP+4*list, F_UNLCK, + F_SETLKW, 0, 1); + } + tdb->num_locks--; + + /* + * Shrink the array by overwriting the element just unlocked with the + * last array element. + */ + + if (tdb->num_lockrecs > 1) { + *lck = tdb->lockrecs[tdb->num_lockrecs-1]; + } + tdb->num_lockrecs -= 1; + + /* + * We don't bother with realloc when the array shrinks, but if we have + * a completely idle tdb we should get rid of the locked array. + */ + + if (tdb->num_lockrecs == 0) { + SAFE_FREE(tdb->lockrecs); + } + + if (ret) + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_unlock: An error occurred unlocking!\n")); + return ret; +} + +/* + get the transaction lock + */ +int tdb_transaction_lock(struct tdb_context *tdb, int ltype) +{ + if (tdb->have_transaction_lock || tdb->global_lock.count) { + return 0; + } + if (tdb->methods->tdb_brlock(tdb, TRANSACTION_LOCK, ltype, + F_SETLKW, 0, 1) == -1) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_lock: failed to get transaction lock\n")); + tdb->ecode = TDB_ERR_LOCK; + return -1; + } + tdb->have_transaction_lock = 1; + return 0; +} + +/* + release the transaction lock + */ +int tdb_transaction_unlock(struct tdb_context *tdb) +{ + int ret; + if (!tdb->have_transaction_lock) { + return 0; + } + ret = tdb->methods->tdb_brlock(tdb, TRANSACTION_LOCK, F_UNLCK, F_SETLKW, 0, 1); + if (ret == 0) { + tdb->have_transaction_lock = 0; + } + return ret; +} + + + + +/* lock/unlock entire database */ +static int _tdb_lockall(struct tdb_context *tdb, int ltype, int op) +{ + bool mark_lock = ((ltype & TDB_MARK_LOCK) == TDB_MARK_LOCK); + + ltype &= ~TDB_MARK_LOCK; + + /* There are no locks on read-only dbs */ + if (tdb->read_only || tdb->traverse_read) + return TDB_ERRCODE(TDB_ERR_LOCK, -1); + + if (tdb->global_lock.count && tdb->global_lock.ltype == (u32)ltype) { + tdb->global_lock.count++; + return 0; + } + + if (tdb->global_lock.count) { + /* a global lock of a different type exists */ + return TDB_ERRCODE(TDB_ERR_LOCK, -1); + } + + if (tdb->num_locks != 0) { + /* can't combine global and chain locks */ + return TDB_ERRCODE(TDB_ERR_LOCK, -1); + } + + if (!mark_lock && + tdb->methods->tdb_brlock(tdb, FREELIST_TOP, ltype, op, + 0, 4*tdb->header.hash_size)) { + if (op == F_SETLKW) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_lockall failed (%s)\n", strerror(errno))); + } + return -1; + } + + tdb->global_lock.count = 1; + tdb->global_lock.ltype = ltype; + + return 0; +} + + + +/* unlock entire db */ +static int _tdb_unlockall(struct tdb_context *tdb, int ltype) +{ + bool mark_lock = ((ltype & TDB_MARK_LOCK) == TDB_MARK_LOCK); + + ltype &= ~TDB_MARK_LOCK; + + /* There are no locks on read-only dbs */ + if (tdb->read_only || tdb->traverse_read) { + return TDB_ERRCODE(TDB_ERR_LOCK, -1); + } + + if (tdb->global_lock.ltype != (u32)ltype || + tdb->global_lock.count == 0) { + return TDB_ERRCODE(TDB_ERR_LOCK, -1); + } + + if (tdb->global_lock.count > 1) { + tdb->global_lock.count--; + return 0; + } + + if (!mark_lock && + tdb->methods->tdb_brlock(tdb, FREELIST_TOP, F_UNLCK, F_SETLKW, + 0, 4*tdb->header.hash_size)) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_unlockall failed (%s)\n", strerror(errno))); + return -1; + } + + tdb->global_lock.count = 0; + tdb->global_lock.ltype = 0; + + return 0; +} + +/* lock entire database with write lock */ +int tdb_lockall(struct tdb_context *tdb) +{ + return _tdb_lockall(tdb, F_WRLCK, F_SETLKW); +} + +/* lock entire database with write lock - mark only */ +int tdb_lockall_mark(struct tdb_context *tdb) +{ + return _tdb_lockall(tdb, F_WRLCK | TDB_MARK_LOCK, F_SETLKW); +} + +/* unlock entire database with write lock - unmark only */ +int tdb_lockall_unmark(struct tdb_context *tdb) +{ + return _tdb_unlockall(tdb, F_WRLCK | TDB_MARK_LOCK); +} + +/* lock entire database with write lock - nonblocking variant */ +int tdb_lockall_nonblock(struct tdb_context *tdb) +{ + return _tdb_lockall(tdb, F_WRLCK, F_SETLK); +} + +/* unlock entire database with write lock */ +int tdb_unlockall(struct tdb_context *tdb) +{ + return _tdb_unlockall(tdb, F_WRLCK); +} + +/* lock entire database with read lock */ +int tdb_lockall_read(struct tdb_context *tdb) +{ + return _tdb_lockall(tdb, F_RDLCK, F_SETLKW); +} + +/* lock entire database with read lock - nonblock variant */ +int tdb_lockall_read_nonblock(struct tdb_context *tdb) +{ + return _tdb_lockall(tdb, F_RDLCK, F_SETLK); +} + +/* unlock entire database with read lock */ +int tdb_unlockall_read(struct tdb_context *tdb) +{ + return _tdb_unlockall(tdb, F_RDLCK); +} + +/* lock/unlock one hash chain. This is meant to be used to reduce + contention - it cannot guarantee how many records will be locked */ +int tdb_chainlock(struct tdb_context *tdb, TDB_DATA key) +{ + return tdb_lock(tdb, BUCKET(tdb->hash_fn(&key)), F_WRLCK); +} + +/* lock/unlock one hash chain, non-blocking. This is meant to be used + to reduce contention - it cannot guarantee how many records will be + locked */ +int tdb_chainlock_nonblock(struct tdb_context *tdb, TDB_DATA key) +{ + return tdb_lock_nonblock(tdb, BUCKET(tdb->hash_fn(&key)), F_WRLCK); +} + +/* mark a chain as locked without actually locking it. Warning! use with great caution! */ +int tdb_chainlock_mark(struct tdb_context *tdb, TDB_DATA key) +{ + return tdb_lock(tdb, BUCKET(tdb->hash_fn(&key)), F_WRLCK | TDB_MARK_LOCK); +} + +/* unmark a chain as locked without actually locking it. Warning! use with great caution! */ +int tdb_chainlock_unmark(struct tdb_context *tdb, TDB_DATA key) +{ + return tdb_unlock(tdb, BUCKET(tdb->hash_fn(&key)), F_WRLCK | TDB_MARK_LOCK); +} + +int tdb_chainunlock(struct tdb_context *tdb, TDB_DATA key) +{ + return tdb_unlock(tdb, BUCKET(tdb->hash_fn(&key)), F_WRLCK); +} + +int tdb_chainlock_read(struct tdb_context *tdb, TDB_DATA key) +{ + return tdb_lock(tdb, BUCKET(tdb->hash_fn(&key)), F_RDLCK); +} + +int tdb_chainunlock_read(struct tdb_context *tdb, TDB_DATA key) +{ + return tdb_unlock(tdb, BUCKET(tdb->hash_fn(&key)), F_RDLCK); +} + + + +/* record lock stops delete underneath */ +int tdb_lock_record(struct tdb_context *tdb, tdb_off_t off) +{ + return off ? tdb->methods->tdb_brlock(tdb, off, F_RDLCK, F_SETLKW, 0, 1) : 0; +} + +/* + Write locks override our own fcntl readlocks, so check it here. + Note this is meant to be F_SETLK, *not* F_SETLKW, as it's not + an error to fail to get the lock here. +*/ +int tdb_write_lock_record(struct tdb_context *tdb, tdb_off_t off) +{ + struct tdb_traverse_lock *i; + for (i = &tdb->travlocks; i; i = i->next) + if (i->off == off) + return -1; + return tdb->methods->tdb_brlock(tdb, off, F_WRLCK, F_SETLK, 1, 1); +} + +/* + Note this is meant to be F_SETLK, *not* F_SETLKW, as it's not + an error to fail to get the lock here. +*/ +int tdb_write_unlock_record(struct tdb_context *tdb, tdb_off_t off) +{ + return tdb->methods->tdb_brlock(tdb, off, F_UNLCK, F_SETLK, 0, 1); +} + +/* fcntl locks don't stack: avoid unlocking someone else's */ +int tdb_unlock_record(struct tdb_context *tdb, tdb_off_t off) +{ + struct tdb_traverse_lock *i; + u32 count = 0; + + if (off == 0) + return 0; + for (i = &tdb->travlocks; i; i = i->next) + if (i->off == off) + count++; + return (count == 1 ? tdb->methods->tdb_brlock(tdb, off, F_UNLCK, F_SETLKW, 0, 1) : 0); +} + +/* file: io.c */ + +/* check for an out of bounds access - if it is out of bounds then + see if the database has been expanded by someone else and expand + if necessary + note that "len" is the minimum length needed for the db +*/ +static int tdb_oob(struct tdb_context *tdb, tdb_off_t len, int probe) +{ + struct stat st; + if (len <= tdb->map_size) + return 0; + if (tdb->flags & TDB_INTERNAL) { + if (!probe) { + /* Ensure ecode is set for log fn. */ + tdb->ecode = TDB_ERR_IO; + TDB_LOG((tdb, TDB_DEBUG_FATAL,"tdb_oob len %d beyond internal malloc size %d\n", + (int)len, (int)tdb->map_size)); + } + return TDB_ERRCODE(TDB_ERR_IO, -1); + } + + if (fstat(tdb->fd, &st) == -1) { + return TDB_ERRCODE(TDB_ERR_IO, -1); + } + + if (st.st_size < (off_t)len) { + if (!probe) { + /* Ensure ecode is set for log fn. */ + tdb->ecode = TDB_ERR_IO; + TDB_LOG((tdb, TDB_DEBUG_FATAL,"tdb_oob len %d beyond eof at %d\n", + (int)len, (int)st.st_size)); + } + return TDB_ERRCODE(TDB_ERR_IO, -1); + } + + /* Unmap, update size, remap */ + if (tdb_munmap(tdb) == -1) + return TDB_ERRCODE(TDB_ERR_IO, -1); + tdb->map_size = st.st_size; + tdb_mmap(tdb); + return 0; +} + +/* write a lump of data at a specified offset */ +static int tdb_write(struct tdb_context *tdb, tdb_off_t off, + const void *buf, tdb_len_t len) +{ + if (len == 0) { + return 0; + } + + if (tdb->read_only || tdb->traverse_read) { + tdb->ecode = TDB_ERR_RDONLY; + return -1; + } + + if (tdb->methods->tdb_oob(tdb, off + len, 0) != 0) + return -1; + + if (tdb->map_ptr) { + memcpy(off + (char *)tdb->map_ptr, buf, len); + } else if (pwrite(tdb->fd, buf, len, off) != (ssize_t)len) { + /* Ensure ecode is set for log fn. */ + tdb->ecode = TDB_ERR_IO; + TDB_LOG((tdb, TDB_DEBUG_FATAL,"tdb_write failed at %d len=%d (%s)\n", + off, len, strerror(errno))); + return TDB_ERRCODE(TDB_ERR_IO, -1); + } + return 0; +} + +/* Endian conversion: we only ever deal with 4 byte quantities */ +void *tdb_convert(void *buf, u32 size) +{ + u32 i, *p = (u32 *)buf; + for (i = 0; i < size / 4; i++) + p[i] = TDB_BYTEREV(p[i]); + return buf; +} + + +/* read a lump of data at a specified offset, maybe convert */ +static int tdb_read(struct tdb_context *tdb, tdb_off_t off, void *buf, + tdb_len_t len, int cv) +{ + if (tdb->methods->tdb_oob(tdb, off + len, 0) != 0) { + return -1; + } + + if (tdb->map_ptr) { + memcpy(buf, off + (char *)tdb->map_ptr, len); + } else { + ssize_t ret = pread(tdb->fd, buf, len, off); + if (ret != (ssize_t)len) { + /* Ensure ecode is set for log fn. */ + tdb->ecode = TDB_ERR_IO; + TDB_LOG((tdb, TDB_DEBUG_FATAL,"tdb_read failed at %d " + "len=%d ret=%d (%s) map_size=%d\n", + (int)off, (int)len, (int)ret, strerror(errno), + (int)tdb->map_size)); + return TDB_ERRCODE(TDB_ERR_IO, -1); + } + } + if (cv) { + tdb_convert(buf, len); + } + return 0; +} + + + +/* + do an unlocked scan of the hash table heads to find the next non-zero head. The value + will then be confirmed with the lock held +*/ +static void tdb_next_hash_chain(struct tdb_context *tdb, u32 *chain) +{ + u32 h = *chain; + if (tdb->map_ptr) { + for (;h < tdb->header.hash_size;h++) { + if (0 != *(u32 *)(TDB_HASH_TOP(h) + (unsigned char *)tdb->map_ptr)) { + break; + } + } + } else { + u32 off=0; + for (;h < tdb->header.hash_size;h++) { + if (tdb_ofs_read(tdb, TDB_HASH_TOP(h), &off) != 0 || off != 0) { + break; + } + } + } + (*chain) = h; +} + + +int tdb_munmap(struct tdb_context *tdb) +{ + if (tdb->flags & TDB_INTERNAL) + return 0; + +#ifdef HAVE_MMAP + if (tdb->map_ptr) { + int ret = munmap(tdb->map_ptr, tdb->real_map_size); + if (ret != 0) + return ret; + tdb->real_map_size = 0; + } +#endif + tdb->map_ptr = NULL; + return 0; +} + +void tdb_mmap(struct tdb_context *tdb) +{ + if (tdb->flags & TDB_INTERNAL) + return; + +#ifdef HAVE_MMAP + if (!(tdb->flags & TDB_NOMMAP)) { + tdb->map_ptr = mmap(NULL, tdb->map_size, + PROT_READ|(tdb->read_only? 0:PROT_WRITE), + MAP_SHARED|MAP_FILE, tdb->fd, 0); + + /* + * NB. When mmap fails it returns MAP_FAILED *NOT* NULL !!!! + */ + + if (tdb->map_ptr == MAP_FAILED) { + tdb->real_map_size = 0; + tdb->map_ptr = NULL; + TDB_LOG((tdb, TDB_DEBUG_WARNING, "tdb_mmap failed for size %d (%s)\n", + tdb->map_size, strerror(errno))); + } + tdb->real_map_size = tdb->map_size; + } else { + tdb->map_ptr = NULL; + } +#else + tdb->map_ptr = NULL; +#endif +} + +/* expand a file. we prefer to use ftruncate, as that is what posix + says to use for mmap expansion */ +static int tdb_expand_file(struct tdb_context *tdb, tdb_off_t size, tdb_off_t addition) +{ + char buf[1024]; + + if (tdb->read_only || tdb->traverse_read) { + tdb->ecode = TDB_ERR_RDONLY; + return -1; + } + + if (ftruncate(tdb->fd, size+addition) == -1) { + char b = 0; + if (pwrite(tdb->fd, &b, 1, (size+addition) - 1) != 1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "expand_file to %d failed (%s)\n", + size+addition, strerror(errno))); + return -1; + } + } + + /* now fill the file with something. This ensures that the + file isn't sparse, which would be very bad if we ran out of + disk. This must be done with write, not via mmap */ + memset(buf, TDB_PAD_BYTE, sizeof(buf)); + while (addition) { + int n = addition>sizeof(buf)?sizeof(buf):addition; + int ret = pwrite(tdb->fd, buf, n, size); + if (ret != n) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "expand_file write of %d failed (%s)\n", + n, strerror(errno))); + return -1; + } + addition -= n; + size += n; + } + return 0; +} + + +/* expand the database at least size bytes by expanding the underlying + file and doing the mmap again if necessary */ +int tdb_expand(struct tdb_context *tdb, tdb_off_t size) +{ + struct list_struct rec; + tdb_off_t offset; + + if (tdb_lock(tdb, -1, F_WRLCK) == -1) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "lock failed in tdb_expand\n")); + return -1; + } + + /* must know about any previous expansions by another process */ + tdb->methods->tdb_oob(tdb, tdb->map_size + 1, 1); + + /* always make room for at least 10 more records, and round + the database up to a multiple of the page size */ + size = TDB_ALIGN(tdb->map_size + size*10, tdb->page_size) - tdb->map_size; + + if (!(tdb->flags & TDB_INTERNAL)) + tdb_munmap(tdb); + + /* + * We must ensure the file is unmapped before doing this + * to ensure consistency with systems like OpenBSD where + * writes and mmaps are not consistent. + */ + + /* expand the file itself */ + if (!(tdb->flags & TDB_INTERNAL)) { + if (tdb->methods->tdb_expand_file(tdb, tdb->map_size, size) != 0) + goto fail; + } + + tdb->map_size += size; + + if (tdb->flags & TDB_INTERNAL) { + char *new_map_ptr = (char *)realloc(tdb->map_ptr, + tdb->map_size); + if (!new_map_ptr) { + tdb->map_size -= size; + goto fail; + } + tdb->map_ptr = new_map_ptr; + } else { + /* + * We must ensure the file is remapped before adding the space + * to ensure consistency with systems like OpenBSD where + * writes and mmaps are not consistent. + */ + + /* We're ok if the mmap fails as we'll fallback to read/write */ + tdb_mmap(tdb); + } + + /* form a new freelist record */ + memset(&rec,'\0',sizeof(rec)); + rec.rec_len = size - sizeof(rec); + + /* link it into the free list */ + offset = tdb->map_size - size; + if (tdb_free(tdb, offset, &rec) == -1) + goto fail; + + tdb_unlock(tdb, -1, F_WRLCK); + return 0; + fail: + tdb_unlock(tdb, -1, F_WRLCK); + return -1; +} + +/* read/write a tdb_off_t */ +int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d) +{ + return tdb->methods->tdb_read(tdb, offset, (char*)d, sizeof(*d), DOCONV()); +} + +int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d) +{ + tdb_off_t off = *d; + return tdb->methods->tdb_write(tdb, offset, CONVERT(off), sizeof(*d)); +} + + +/* read a lump of data, allocating the space for it */ +unsigned char *tdb_alloc_read(struct tdb_context *tdb, tdb_off_t offset, tdb_len_t len) +{ + unsigned char *buf; + + /* some systems don't like zero length malloc */ + if (len == 0) { + len = 1; + } + + if (!(buf = (unsigned char *)malloc(len))) { + /* Ensure ecode is set for log fn. */ + tdb->ecode = TDB_ERR_OOM; + TDB_LOG((tdb, TDB_DEBUG_ERROR,"tdb_alloc_read malloc failed len=%d (%s)\n", + len, strerror(errno))); + return TDB_ERRCODE(TDB_ERR_OOM, buf); + } + if (tdb->methods->tdb_read(tdb, offset, buf, len, 0) == -1) { + SAFE_FREE(buf); + return NULL; + } + return buf; +} + +/* Give a piece of tdb data to a parser */ + +int tdb_parse_data(struct tdb_context *tdb, TDB_DATA key, + tdb_off_t offset, tdb_len_t len, + int (*parser)(TDB_DATA key, TDB_DATA data, + void *private_data), + void *private_data) +{ + TDB_DATA data; + int result; + + data.dsize = len; + + if ((tdb->transaction == NULL) && (tdb->map_ptr != NULL)) { + /* + * Optimize by avoiding the malloc/memcpy/free, point the + * parser directly at the mmap area. + */ + if (tdb->methods->tdb_oob(tdb, offset+len, 0) != 0) { + return -1; + } + data.dptr = offset + (unsigned char *)tdb->map_ptr; + return parser(key, data, private_data); + } + + if (!(data.dptr = tdb_alloc_read(tdb, offset, len))) { + return -1; + } + + result = parser(key, data, private_data); + free(data.dptr); + return result; +} + +/* read/write a record */ +int tdb_rec_read(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec) +{ + if (tdb->methods->tdb_read(tdb, offset, rec, sizeof(*rec),DOCONV()) == -1) + return -1; + if (TDB_BAD_MAGIC(rec)) { + /* Ensure ecode is set for log fn. */ + tdb->ecode = TDB_ERR_CORRUPT; + TDB_LOG((tdb, TDB_DEBUG_FATAL,"tdb_rec_read bad magic 0x%x at offset=%d\n", rec->magic, offset)); + return TDB_ERRCODE(TDB_ERR_CORRUPT, -1); + } + return tdb->methods->tdb_oob(tdb, rec->next+sizeof(*rec), 0); +} + +int tdb_rec_write(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec) +{ + struct list_struct r = *rec; + return tdb->methods->tdb_write(tdb, offset, CONVERT(r), sizeof(r)); +} + +static const struct tdb_methods io_methods = { + tdb_read, + tdb_write, + tdb_next_hash_chain, + tdb_oob, + tdb_expand_file, + tdb_brlock +}; + +/* + initialise the default methods table +*/ +void tdb_io_init(struct tdb_context *tdb) +{ + tdb->methods = &io_methods; +} + +/* file: transaction.c */ + +/* + transaction design: + + - only allow a single transaction at a time per database. This makes + using the transaction API simpler, as otherwise the caller would + have to cope with temporary failures in transactions that conflict + with other current transactions + + - keep the transaction recovery information in the same file as the + database, using a special 'transaction recovery' record pointed at + by the header. This removes the need for extra journal files as + used by some other databases + + - dynamically allocated the transaction recover record, re-using it + for subsequent transactions. If a larger record is needed then + tdb_free() the old record to place it on the normal tdb freelist + before allocating the new record + + - during transactions, keep a linked list of writes all that have + been performed by intercepting all tdb_write() calls. The hooked + transaction versions of tdb_read() and tdb_write() check this + linked list and try to use the elements of the list in preference + to the real database. + + - don't allow any locks to be held when a transaction starts, + otherwise we can end up with deadlock (plus lack of lock nesting + in posix locks would mean the lock is lost) + + - if the caller gains a lock during the transaction but doesn't + release it then fail the commit + + - allow for nested calls to tdb_transaction_start(), re-using the + existing transaction record. If the inner transaction is cancelled + then a subsequent commit will fail + + - keep a mirrored copy of the tdb hash chain heads to allow for the + fast hash heads scan on traverse, updating the mirrored copy in + the transaction version of tdb_write + + - allow callers to mix transaction and non-transaction use of tdb, + although once a transaction is started then an exclusive lock is + gained until the transaction is committed or cancelled + + - the commit strategy involves first saving away all modified data + into a linearised buffer in the transaction recovery area, then + marking the transaction recovery area with a magic value to + indicate a valid recovery record. In total 4 fsync/msync calls are + needed per commit to prevent race conditions. It might be possible + to reduce this to 3 or even 2 with some more work. + + - check for a valid recovery record on open of the tdb, while the + global lock is held. Automatically recover from the transaction + recovery area if needed, then continue with the open as + usual. This allows for smooth crash recovery with no administrator + intervention. + + - if TDB_NOSYNC is passed to flags in tdb_open then transactions are + still available, but no transaction recovery area is used and no + fsync/msync calls are made. + +*/ + +struct tdb_transaction_el { + struct tdb_transaction_el *next, *prev; + tdb_off_t offset; + tdb_len_t length; + unsigned char *data; +}; + +/* + hold the context of any current transaction +*/ +struct tdb_transaction { + /* we keep a mirrored copy of the tdb hash heads here so + tdb_next_hash_chain() can operate efficiently */ + u32 *hash_heads; + + /* the original io methods - used to do IOs to the real db */ + const struct tdb_methods *io_methods; + + /* the list of transaction elements. We use a doubly linked + list with a last pointer to allow us to keep the list + ordered, with first element at the front of the list. It + needs to be doubly linked as the read/write traversals need + to be backwards, while the commit needs to be forwards */ + struct tdb_transaction_el *elements, *elements_last; + + /* non-zero when an internal transaction error has + occurred. All write operations will then fail until the + transaction is ended */ + int transaction_error; + + /* when inside a transaction we need to keep track of any + nested tdb_transaction_start() calls, as these are allowed, + but don't create a new transaction */ + int nesting; + + /* old file size before transaction */ + tdb_len_t old_map_size; +}; + + +/* + read while in a transaction. We need to check first if the data is in our list + of transaction elements, then if not do a real read +*/ +static int transaction_read(struct tdb_context *tdb, tdb_off_t off, void *buf, + tdb_len_t len, int cv) +{ + struct tdb_transaction_el *el; + + /* we need to walk the list backwards to get the most recent data */ + for (el=tdb->transaction->elements_last;el;el=el->prev) { + tdb_len_t partial; + + if (off+len <= el->offset) { + continue; + } + if (off >= el->offset + el->length) { + continue; + } + + /* an overlapping read - needs to be split into up to + 2 reads and a memcpy */ + if (off < el->offset) { + partial = el->offset - off; + if (transaction_read(tdb, off, buf, partial, cv) != 0) { + goto fail; + } + len -= partial; + off += partial; + buf = (void *)(partial + (char *)buf); + } + if (off + len <= el->offset + el->length) { + partial = len; + } else { + partial = el->offset + el->length - off; + } + memcpy(buf, el->data + (off - el->offset), partial); + if (cv) { + tdb_convert(buf, len); + } + len -= partial; + off += partial; + buf = (void *)(partial + (char *)buf); + + if (len != 0 && transaction_read(tdb, off, buf, len, cv) != 0) { + goto fail; + } + + return 0; + } + + /* its not in the transaction elements - do a real read */ + return tdb->transaction->io_methods->tdb_read(tdb, off, buf, len, cv); + +fail: + TDB_LOG((tdb, TDB_DEBUG_FATAL, "transaction_read: failed at off=%d len=%d\n", off, len)); + tdb->ecode = TDB_ERR_IO; + tdb->transaction->transaction_error = 1; + return -1; +} + + +/* + write while in a transaction +*/ +static int transaction_write(struct tdb_context *tdb, tdb_off_t off, + const void *buf, tdb_len_t len) +{ + struct tdb_transaction_el *el, *best_el=NULL; + + if (len == 0) { + return 0; + } + + /* if the write is to a hash head, then update the transaction + hash heads */ + if (len == sizeof(tdb_off_t) && off >= FREELIST_TOP && + off < FREELIST_TOP+TDB_HASHTABLE_SIZE(tdb)) { + u32 chain = (off-FREELIST_TOP) / sizeof(tdb_off_t); + memcpy(&tdb->transaction->hash_heads[chain], buf, len); + } + + /* first see if we can replace an existing entry */ + for (el=tdb->transaction->elements_last;el;el=el->prev) { + tdb_len_t partial; + + if (best_el == NULL && off == el->offset+el->length) { + best_el = el; + } + + if (off+len <= el->offset) { + continue; + } + if (off >= el->offset + el->length) { + continue; + } + + /* an overlapping write - needs to be split into up to + 2 writes and a memcpy */ + if (off < el->offset) { + partial = el->offset - off; + if (transaction_write(tdb, off, buf, partial) != 0) { + goto fail; + } + len -= partial; + off += partial; + buf = (const void *)(partial + (const char *)buf); + } + if (off + len <= el->offset + el->length) { + partial = len; + } else { + partial = el->offset + el->length - off; + } + memcpy(el->data + (off - el->offset), buf, partial); + len -= partial; + off += partial; + buf = (const void *)(partial + (const char *)buf); + + if (len != 0 && transaction_write(tdb, off, buf, len) != 0) { + goto fail; + } + + return 0; + } + + /* see if we can append the new entry to an existing entry */ + if (best_el && best_el->offset + best_el->length == off && + (off+len < tdb->transaction->old_map_size || + off > tdb->transaction->old_map_size)) { + unsigned char *data = best_el->data; + el = best_el; + el->data = (unsigned char *)realloc(el->data, + el->length + len); + if (el->data == NULL) { + tdb->ecode = TDB_ERR_OOM; + tdb->transaction->transaction_error = 1; + el->data = data; + return -1; + } + if (buf) { + memcpy(el->data + el->length, buf, len); + } else { + memset(el->data + el->length, TDB_PAD_BYTE, len); + } + el->length += len; + return 0; + } + + /* add a new entry at the end of the list */ + el = (struct tdb_transaction_el *)malloc(sizeof(*el)); + if (el == NULL) { + tdb->ecode = TDB_ERR_OOM; + tdb->transaction->transaction_error = 1; + return -1; + } + el->next = NULL; + el->prev = tdb->transaction->elements_last; + el->offset = off; + el->length = len; + el->data = (unsigned char *)malloc(len); + if (el->data == NULL) { + free(el); + tdb->ecode = TDB_ERR_OOM; + tdb->transaction->transaction_error = 1; + return -1; + } + if (buf) { + memcpy(el->data, buf, len); + } else { + memset(el->data, TDB_PAD_BYTE, len); + } + if (el->prev) { + el->prev->next = el; + } else { + tdb->transaction->elements = el; + } + tdb->transaction->elements_last = el; + return 0; + +fail: + TDB_LOG((tdb, TDB_DEBUG_FATAL, "transaction_write: failed at off=%d len=%d\n", off, len)); + tdb->ecode = TDB_ERR_IO; + tdb->transaction->transaction_error = 1; + return -1; +} + +/* + accelerated hash chain head search, using the cached hash heads +*/ +static void transaction_next_hash_chain(struct tdb_context *tdb, u32 *chain) +{ + u32 h = *chain; + for (;h < tdb->header.hash_size;h++) { + /* the +1 takes account of the freelist */ + if (0 != tdb->transaction->hash_heads[h+1]) { + break; + } + } + (*chain) = h; +} + +/* + out of bounds check during a transaction +*/ +static int transaction_oob(struct tdb_context *tdb, tdb_off_t len, + int probe EXT2FS_ATTR((unused))) +{ + if (len <= tdb->map_size) { + return 0; + } + return TDB_ERRCODE(TDB_ERR_IO, -1); +} + +/* + transaction version of tdb_expand(). +*/ +static int transaction_expand_file(struct tdb_context *tdb, tdb_off_t size, + tdb_off_t addition) +{ + /* add a write to the transaction elements, so subsequent + reads see the zero data */ + if (transaction_write(tdb, size, NULL, addition) != 0) { + return -1; + } + + return 0; +} + +/* + brlock during a transaction - ignore them +*/ +static int transaction_brlock(struct tdb_context *tdb EXT2FS_ATTR((unused)), + tdb_off_t offset EXT2FS_ATTR((unused)), + int rw_type EXT2FS_ATTR((unused)), + int lck_type EXT2FS_ATTR((unused)), + int probe EXT2FS_ATTR((unused)), + size_t len EXT2FS_ATTR((unused))) +{ + return 0; +} + +static const struct tdb_methods transaction_methods = { + transaction_read, + transaction_write, + transaction_next_hash_chain, + transaction_oob, + transaction_expand_file, + transaction_brlock +}; + + +/* + start a tdb transaction. No token is returned, as only a single + transaction is allowed to be pending per tdb_context +*/ +int tdb_transaction_start(struct tdb_context *tdb) +{ + /* some sanity checks */ + if (tdb->read_only || (tdb->flags & TDB_INTERNAL) || tdb->traverse_read) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_start: cannot start a transaction on a read-only or internal db\n")); + tdb->ecode = TDB_ERR_EINVAL; + return -1; + } + + /* cope with nested tdb_transaction_start() calls */ + if (tdb->transaction != NULL) { + tdb->transaction->nesting++; + TDB_LOG((tdb, TDB_DEBUG_TRACE, "tdb_transaction_start: nesting %d\n", + tdb->transaction->nesting)); + return 0; + } + + if (tdb->num_locks != 0 || tdb->global_lock.count) { + /* the caller must not have any locks when starting a + transaction as otherwise we'll be screwed by lack + of nested locks in posix */ + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_start: cannot start a transaction with locks held\n")); + tdb->ecode = TDB_ERR_LOCK; + return -1; + } + + if (tdb->travlocks.next != NULL) { + /* you cannot use transactions inside a traverse (although you can use + traverse inside a transaction) as otherwise you can end up with + deadlock */ + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_start: cannot start a transaction within a traverse\n")); + tdb->ecode = TDB_ERR_LOCK; + return -1; + } + + tdb->transaction = (struct tdb_transaction *) + calloc(sizeof(struct tdb_transaction), 1); + if (tdb->transaction == NULL) { + tdb->ecode = TDB_ERR_OOM; + return -1; + } + + /* get the transaction write lock. This is a blocking lock. As + discussed with Volker, there are a number of ways we could + make this async, which we will probably do in the future */ + if (tdb_transaction_lock(tdb, F_WRLCK) == -1) { + SAFE_FREE(tdb->transaction); + return -1; + } + + /* get a read lock from the freelist to the end of file. This + is upgraded to a write lock during the commit */ + if (tdb_brlock(tdb, FREELIST_TOP, F_RDLCK, F_SETLKW, 0, 0) == -1) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_start: failed to get hash locks\n")); + tdb->ecode = TDB_ERR_LOCK; + goto fail; + } + + /* setup a copy of the hash table heads so the hash scan in + traverse can be fast */ + tdb->transaction->hash_heads = (u32 *) + calloc(tdb->header.hash_size+1, sizeof(u32)); + if (tdb->transaction->hash_heads == NULL) { + tdb->ecode = TDB_ERR_OOM; + goto fail; + } + if (tdb->methods->tdb_read(tdb, FREELIST_TOP, tdb->transaction->hash_heads, + TDB_HASHTABLE_SIZE(tdb), 0) != 0) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_start: failed to read hash heads\n")); + tdb->ecode = TDB_ERR_IO; + goto fail; + } + + /* make sure we know about any file expansions already done by + anyone else */ + tdb->methods->tdb_oob(tdb, tdb->map_size + 1, 1); + tdb->transaction->old_map_size = tdb->map_size; + + /* finally hook the io methods, replacing them with + transaction specific methods */ + tdb->transaction->io_methods = tdb->methods; + tdb->methods = &transaction_methods; + + /* by calling this transaction write here, we ensure that we don't grow the + transaction linked list due to hash table updates */ + if (transaction_write(tdb, FREELIST_TOP, tdb->transaction->hash_heads, + TDB_HASHTABLE_SIZE(tdb)) != 0) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_start: failed to prime hash table\n")); + tdb->ecode = TDB_ERR_IO; + tdb->methods = tdb->transaction->io_methods; + goto fail; + } + + return 0; + +fail: + tdb_brlock(tdb, FREELIST_TOP, F_UNLCK, F_SETLKW, 0, 0); + tdb_transaction_unlock(tdb); + SAFE_FREE(tdb->transaction->hash_heads); + SAFE_FREE(tdb->transaction); + return -1; +} + + +/* + cancel the current transaction +*/ +int tdb_transaction_cancel(struct tdb_context *tdb) +{ + if (tdb->transaction == NULL) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_cancel: no transaction\n")); + return -1; + } + + if (tdb->transaction->nesting != 0) { + tdb->transaction->transaction_error = 1; + tdb->transaction->nesting--; + return 0; + } + + tdb->map_size = tdb->transaction->old_map_size; + + /* free all the transaction elements */ + while (tdb->transaction->elements) { + struct tdb_transaction_el *el = tdb->transaction->elements; + tdb->transaction->elements = el->next; + free(el->data); + free(el); + } + + /* remove any global lock created during the transaction */ + if (tdb->global_lock.count != 0) { + tdb_brlock(tdb, FREELIST_TOP, F_UNLCK, F_SETLKW, 0, 4*tdb->header.hash_size); + tdb->global_lock.count = 0; + } + + /* remove any locks created during the transaction */ + if (tdb->num_locks != 0) { + int i; + for (i=0;i<tdb->num_lockrecs;i++) { + tdb_brlock(tdb,FREELIST_TOP+4*tdb->lockrecs[i].list, + F_UNLCK,F_SETLKW, 0, 1); + } + tdb->num_locks = 0; + tdb->num_lockrecs = 0; + SAFE_FREE(tdb->lockrecs); + } + + /* restore the normal io methods */ + tdb->methods = tdb->transaction->io_methods; + + tdb_brlock(tdb, FREELIST_TOP, F_UNLCK, F_SETLKW, 0, 0); + tdb_transaction_unlock(tdb); + SAFE_FREE(tdb->transaction->hash_heads); + SAFE_FREE(tdb->transaction); + + return 0; +} + +/* + sync to disk +*/ +static int transaction_sync(struct tdb_context *tdb, tdb_off_t offset, tdb_len_t length) +{ + if (fsync(tdb->fd) != 0) { + tdb->ecode = TDB_ERR_IO; + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction: fsync failed\n")); + return -1; + } +#if defined(HAVE_MSYNC) && defined(MS_SYNC) + if (tdb->map_ptr) { + tdb_off_t moffset = offset & ~(tdb->page_size-1); + if (msync(moffset + (char *)tdb->map_ptr, + length + (offset - moffset), MS_SYNC) != 0) { + tdb->ecode = TDB_ERR_IO; + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction: msync failed - %s\n", + strerror(errno))); + return -1; + } + } +#endif + return 0; +} + + +/* + work out how much space the linearised recovery data will consume +*/ +static tdb_len_t tdb_recovery_size(struct tdb_context *tdb) +{ + struct tdb_transaction_el *el; + tdb_len_t recovery_size = 0; + + recovery_size = sizeof(u32); + for (el=tdb->transaction->elements;el;el=el->next) { + if (el->offset >= tdb->transaction->old_map_size) { + continue; + } + recovery_size += 2*sizeof(tdb_off_t) + el->length; + } + + return recovery_size; +} + +/* + allocate the recovery area, or use an existing recovery area if it is + large enough +*/ +static int tdb_recovery_allocate(struct tdb_context *tdb, + tdb_len_t *recovery_size, + tdb_off_t *recovery_offset, + tdb_len_t *recovery_max_size) +{ + struct list_struct rec; + const struct tdb_methods *methods = tdb->transaction->io_methods; + tdb_off_t recovery_head; + + if (tdb_ofs_read(tdb, TDB_RECOVERY_HEAD, &recovery_head) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_recovery_allocate: failed to read recovery head\n")); + return -1; + } + + rec.rec_len = 0; + + if (recovery_head != 0 && + methods->tdb_read(tdb, recovery_head, &rec, sizeof(rec), DOCONV()) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_recovery_allocate: failed to read recovery record\n")); + return -1; + } + + *recovery_size = tdb_recovery_size(tdb); + + if (recovery_head != 0 && *recovery_size <= rec.rec_len) { + /* it fits in the existing area */ + *recovery_max_size = rec.rec_len; + *recovery_offset = recovery_head; + return 0; + } + + /* we need to free up the old recovery area, then allocate a + new one at the end of the file. Note that we cannot use + tdb_allocate() to allocate the new one as that might return + us an area that is being currently used (as of the start of + the transaction) */ + if (recovery_head != 0) { + if (tdb_free(tdb, recovery_head, &rec) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_recovery_allocate: failed to free previous recovery area\n")); + return -1; + } + } + + /* the tdb_free() call might have increased the recovery size */ + *recovery_size = tdb_recovery_size(tdb); + + /* round up to a multiple of page size */ + *recovery_max_size = TDB_ALIGN(sizeof(rec) + *recovery_size, tdb->page_size) - sizeof(rec); + *recovery_offset = tdb->map_size; + recovery_head = *recovery_offset; + + if (methods->tdb_expand_file(tdb, tdb->transaction->old_map_size, + (tdb->map_size - tdb->transaction->old_map_size) + + sizeof(rec) + *recovery_max_size) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_recovery_allocate: failed to create recovery area\n")); + return -1; + } + + /* remap the file (if using mmap) */ + methods->tdb_oob(tdb, tdb->map_size + 1, 1); + + /* we have to reset the old map size so that we don't try to expand the file + again in the transaction commit, which would destroy the recovery area */ + tdb->transaction->old_map_size = tdb->map_size; + + /* write the recovery header offset and sync - we can sync without a race here + as the magic ptr in the recovery record has not been set */ + CONVERT(recovery_head); + if (methods->tdb_write(tdb, TDB_RECOVERY_HEAD, + &recovery_head, sizeof(tdb_off_t)) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_recovery_allocate: failed to write recovery head\n")); + return -1; + } + + return 0; +} + + +/* + setup the recovery data that will be used on a crash during commit +*/ +static int transaction_setup_recovery(struct tdb_context *tdb, + tdb_off_t *magic_offset) +{ + struct tdb_transaction_el *el; + tdb_len_t recovery_size; + unsigned char *data, *p; + const struct tdb_methods *methods = tdb->transaction->io_methods; + struct list_struct *rec; + tdb_off_t recovery_offset, recovery_max_size; + tdb_off_t old_map_size = tdb->transaction->old_map_size; + u32 magic, tailer; + + /* + check that the recovery area has enough space + */ + if (tdb_recovery_allocate(tdb, &recovery_size, + &recovery_offset, &recovery_max_size) == -1) { + return -1; + } + + data = (unsigned char *)malloc(recovery_size + sizeof(*rec)); + if (data == NULL) { + tdb->ecode = TDB_ERR_OOM; + return -1; + } + + rec = (struct list_struct *)data; + memset(rec, 0, sizeof(*rec)); + + rec->magic = 0; + rec->data_len = recovery_size; + rec->rec_len = recovery_max_size; + rec->key_len = old_map_size; + CONVERT(rec); + + /* build the recovery data into a single blob to allow us to do a single + large write, which should be more efficient */ + p = data + sizeof(*rec); + for (el=tdb->transaction->elements;el;el=el->next) { + if (el->offset >= old_map_size) { + continue; + } + if (el->offset + el->length > tdb->transaction->old_map_size) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_setup_recovery: transaction data over new region boundary\n")); + free(data); + tdb->ecode = TDB_ERR_CORRUPT; + return -1; + } + memcpy(p, &el->offset, 4); + memcpy(p+4, &el->length, 4); + if (DOCONV()) { + tdb_convert(p, 8); + } + /* the recovery area contains the old data, not the + new data, so we have to call the original tdb_read + method to get it */ + if (methods->tdb_read(tdb, el->offset, p + 8, el->length, 0) != 0) { + free(data); + tdb->ecode = TDB_ERR_IO; + return -1; + } + p += 8 + el->length; + } + + /* and the tailer */ + tailer = sizeof(*rec) + recovery_max_size; + memcpy(p, &tailer, 4); + CONVERT(p); + + /* write the recovery data to the recovery area */ + if (methods->tdb_write(tdb, recovery_offset, data, sizeof(*rec) + recovery_size) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_setup_recovery: failed to write recovery data\n")); + free(data); + tdb->ecode = TDB_ERR_IO; + return -1; + } + + /* as we don't have ordered writes, we have to sync the recovery + data before we update the magic to indicate that the recovery + data is present */ + if (transaction_sync(tdb, recovery_offset, sizeof(*rec) + recovery_size) == -1) { + free(data); + return -1; + } + + free(data); + + magic = TDB_RECOVERY_MAGIC; + CONVERT(magic); + + *magic_offset = recovery_offset + offsetof(struct list_struct, magic); + + if (methods->tdb_write(tdb, *magic_offset, &magic, sizeof(magic)) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_setup_recovery: failed to write recovery magic\n")); + tdb->ecode = TDB_ERR_IO; + return -1; + } + + /* ensure the recovery magic marker is on disk */ + if (transaction_sync(tdb, *magic_offset, sizeof(magic)) == -1) { + return -1; + } + + return 0; +} + +/* + commit the current transaction +*/ +int tdb_transaction_commit(struct tdb_context *tdb) +{ + const struct tdb_methods *methods; + tdb_off_t magic_offset = 0; + u32 zero = 0; + + if (tdb->transaction == NULL) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_commit: no transaction\n")); + return -1; + } + + if (tdb->transaction->transaction_error) { + tdb->ecode = TDB_ERR_IO; + tdb_transaction_cancel(tdb); + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_commit: transaction error pending\n")); + return -1; + } + + if (tdb->transaction->nesting != 0) { + tdb->transaction->nesting--; + return 0; + } + + /* check for a null transaction */ + if (tdb->transaction->elements == NULL) { + tdb_transaction_cancel(tdb); + return 0; + } + + methods = tdb->transaction->io_methods; + + /* if there are any locks pending then the caller has not + nested their locks properly, so fail the transaction */ + if (tdb->num_locks || tdb->global_lock.count) { + tdb->ecode = TDB_ERR_LOCK; + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_commit: locks pending on commit\n")); + tdb_transaction_cancel(tdb); + return -1; + } + + /* upgrade the main transaction lock region to a write lock */ + if (tdb_brlock_upgrade(tdb, FREELIST_TOP, 0) == -1) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_start: failed to upgrade hash locks\n")); + tdb->ecode = TDB_ERR_LOCK; + tdb_transaction_cancel(tdb); + return -1; + } + + /* get the global lock - this prevents new users attaching to the database + during the commit */ + if (tdb_brlock(tdb, GLOBAL_LOCK, F_WRLCK, F_SETLKW, 0, 1) == -1) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_commit: failed to get global lock\n")); + tdb->ecode = TDB_ERR_LOCK; + tdb_transaction_cancel(tdb); + return -1; + } + + if (!(tdb->flags & TDB_NOSYNC)) { + /* write the recovery data to the end of the file */ + if (transaction_setup_recovery(tdb, &magic_offset) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_commit: failed to setup recovery data\n")); + tdb_brlock(tdb, GLOBAL_LOCK, F_UNLCK, F_SETLKW, 0, 1); + tdb_transaction_cancel(tdb); + return -1; + } + } + + /* expand the file to the new size if needed */ + if (tdb->map_size != tdb->transaction->old_map_size) { + if (methods->tdb_expand_file(tdb, tdb->transaction->old_map_size, + tdb->map_size - + tdb->transaction->old_map_size) == -1) { + tdb->ecode = TDB_ERR_IO; + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_commit: expansion failed\n")); + tdb_brlock(tdb, GLOBAL_LOCK, F_UNLCK, F_SETLKW, 0, 1); + tdb_transaction_cancel(tdb); + return -1; + } + tdb->map_size = tdb->transaction->old_map_size; + methods->tdb_oob(tdb, tdb->map_size + 1, 1); + } + + /* perform all the writes */ + while (tdb->transaction->elements) { + struct tdb_transaction_el *el = tdb->transaction->elements; + + if (methods->tdb_write(tdb, el->offset, el->data, el->length) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_commit: write failed during commit\n")); + + /* we've overwritten part of the data and + possibly expanded the file, so we need to + run the crash recovery code */ + tdb->methods = methods; + tdb_transaction_recover(tdb); + + tdb_transaction_cancel(tdb); + tdb_brlock(tdb, GLOBAL_LOCK, F_UNLCK, F_SETLKW, 0, 1); + + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_commit: write failed\n")); + return -1; + } + tdb->transaction->elements = el->next; + free(el->data); + free(el); + } + + if (!(tdb->flags & TDB_NOSYNC)) { + /* ensure the new data is on disk */ + if (transaction_sync(tdb, 0, tdb->map_size) == -1) { + return -1; + } + + /* remove the recovery marker */ + if (methods->tdb_write(tdb, magic_offset, &zero, 4) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_commit: failed to remove recovery magic\n")); + return -1; + } + + /* ensure the recovery marker has been removed on disk */ + if (transaction_sync(tdb, magic_offset, 4) == -1) { + return -1; + } + } + + tdb_brlock(tdb, GLOBAL_LOCK, F_UNLCK, F_SETLKW, 0, 1); + + /* + TODO: maybe write to some dummy hdr field, or write to magic + offset without mmap, before the last sync, instead of the + utime() call + */ + + /* on some systems (like Linux 2.6.x) changes via mmap/msync + don't change the mtime of the file, this means the file may + not be backed up (as tdb rounding to block sizes means that + file size changes are quite rare too). The following forces + mtime changes when a transaction completes */ +#ifdef HAVE_UTIME + utime(tdb->name, NULL); +#endif + + /* use a transaction cancel to free memory and remove the + transaction locks */ + tdb_transaction_cancel(tdb); + return 0; +} + + +/* + recover from an aborted transaction. Must be called with exclusive + database write access already established (including the global + lock to prevent new processes attaching) +*/ +int tdb_transaction_recover(struct tdb_context *tdb) +{ + tdb_off_t recovery_head, recovery_eof; + unsigned char *data, *p; + u32 zero = 0; + struct list_struct rec; + + /* find the recovery area */ + if (tdb_ofs_read(tdb, TDB_RECOVERY_HEAD, &recovery_head) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to read recovery head\n")); + tdb->ecode = TDB_ERR_IO; + return -1; + } + + if (recovery_head == 0) { + /* we have never allocated a recovery record */ + return 0; + } + + /* read the recovery record */ + if (tdb->methods->tdb_read(tdb, recovery_head, &rec, + sizeof(rec), DOCONV()) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to read recovery record\n")); + tdb->ecode = TDB_ERR_IO; + return -1; + } + + if (rec.magic != TDB_RECOVERY_MAGIC) { + /* there is no valid recovery data */ + return 0; + } + + if (tdb->read_only) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: attempt to recover read only database\n")); + tdb->ecode = TDB_ERR_CORRUPT; + return -1; + } + + recovery_eof = rec.key_len; + + data = (unsigned char *)malloc(rec.data_len); + if (data == NULL) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to allocate recovery data\n")); + tdb->ecode = TDB_ERR_OOM; + return -1; + } + + /* read the full recovery data */ + if (tdb->methods->tdb_read(tdb, recovery_head + sizeof(rec), data, + rec.data_len, 0) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to read recovery data\n")); + tdb->ecode = TDB_ERR_IO; + free(data); + return -1; + } + + /* recover the file data */ + p = data; + while (p+8 < data + rec.data_len) { + u32 ofs, len; + if (DOCONV()) { + tdb_convert(p, 8); + } + memcpy(&ofs, p, 4); + memcpy(&len, p+4, 4); + + if (tdb->methods->tdb_write(tdb, ofs, p+8, len) == -1) { + free(data); + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to recover %d bytes at offset %d\n", len, ofs)); + tdb->ecode = TDB_ERR_IO; + return -1; + } + p += 8 + len; + } + + free(data); + + if (transaction_sync(tdb, 0, tdb->map_size) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to sync recovery\n")); + tdb->ecode = TDB_ERR_IO; + return -1; + } + + /* if the recovery area is after the recovered eof then remove it */ + if (recovery_eof <= recovery_head) { + if (tdb_ofs_write(tdb, TDB_RECOVERY_HEAD, &zero) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to remove recovery head\n")); + tdb->ecode = TDB_ERR_IO; + return -1; + } + } + + /* remove the recovery magic */ + if (tdb_ofs_write(tdb, recovery_head + offsetof(struct list_struct, magic), + &zero) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to remove recovery magic\n")); + tdb->ecode = TDB_ERR_IO; + return -1; + } + + /* reduce the file size to the old size */ + tdb_munmap(tdb); + if (ftruncate(tdb->fd, recovery_eof) != 0) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to reduce to recovery size\n")); + tdb->ecode = TDB_ERR_IO; + return -1; + } + tdb->map_size = recovery_eof; + tdb_mmap(tdb); + + if (transaction_sync(tdb, 0, recovery_eof) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to sync2 recovery\n")); + tdb->ecode = TDB_ERR_IO; + return -1; + } + + TDB_LOG((tdb, TDB_DEBUG_TRACE, "tdb_transaction_recover: recovered %d byte database\n", + recovery_eof)); + + /* all done */ + return 0; +} + +/* file: freelist.c */ + +/* read a freelist record and check for simple errors */ +static int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off, struct list_struct *rec) +{ + if (tdb->methods->tdb_read(tdb, off, rec, sizeof(*rec),DOCONV()) == -1) + return -1; + + if (rec->magic == TDB_MAGIC) { + /* this happens when a app is showdown while deleting a record - we should + not completely fail when this happens */ + TDB_LOG((tdb, TDB_DEBUG_WARNING, "tdb_rec_free_read non-free magic 0x%x at offset=%d - fixing\n", + rec->magic, off)); + rec->magic = TDB_FREE_MAGIC; + if (tdb->methods->tdb_write(tdb, off, rec, sizeof(*rec)) == -1) + return -1; + } + + if (rec->magic != TDB_FREE_MAGIC) { + /* Ensure ecode is set for log fn. */ + tdb->ecode = TDB_ERR_CORRUPT; + TDB_LOG((tdb, TDB_DEBUG_WARNING, "tdb_rec_free_read bad magic 0x%x at offset=%d\n", + rec->magic, off)); + return TDB_ERRCODE(TDB_ERR_CORRUPT, -1); + } + if (tdb->methods->tdb_oob(tdb, rec->next+sizeof(*rec), 0) != 0) + return -1; + return 0; +} + + + +/* Remove an element from the freelist. Must have alloc lock. */ +static int remove_from_freelist(struct tdb_context *tdb, tdb_off_t off, tdb_off_t next) +{ + tdb_off_t last_ptr, i; + + /* read in the freelist top */ + last_ptr = FREELIST_TOP; + while (tdb_ofs_read(tdb, last_ptr, &i) != -1 && i != 0) { + if (i == off) { + /* We've found it! */ + return tdb_ofs_write(tdb, last_ptr, &next); + } + /* Follow chain (next offset is at start of record) */ + last_ptr = i; + } + TDB_LOG((tdb, TDB_DEBUG_FATAL,"remove_from_freelist: not on list at off=%d\n", off)); + return TDB_ERRCODE(TDB_ERR_CORRUPT, -1); +} + + +/* update a record tailer (must hold allocation lock) */ +static int update_tailer(struct tdb_context *tdb, tdb_off_t offset, + const struct list_struct *rec) +{ + tdb_off_t totalsize; + + /* Offset of tailer from record header */ + totalsize = sizeof(*rec) + rec->rec_len; + return tdb_ofs_write(tdb, offset + totalsize - sizeof(tdb_off_t), + &totalsize); +} + +/* Add an element into the freelist. Merge adjacent records if + necessary. */ +int tdb_free(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec) +{ + tdb_off_t right, left; + + /* Allocation and tailer lock */ + if (tdb_lock(tdb, -1, F_WRLCK) != 0) + return -1; + + /* set an initial tailer, so if we fail we don't leave a bogus record */ + if (update_tailer(tdb, offset, rec) != 0) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: update_tailer failed!\n")); + goto fail; + } + + /* Look right first (I'm an Australian, dammit) */ + right = offset + sizeof(*rec) + rec->rec_len; + if (right + sizeof(*rec) <= tdb->map_size) { + struct list_struct r; + + if (tdb->methods->tdb_read(tdb, right, &r, sizeof(r), DOCONV()) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: right read failed at %u\n", right)); + goto left; + } + + /* If it's free, expand to include it. */ + if (r.magic == TDB_FREE_MAGIC) { + if (remove_from_freelist(tdb, right, r.next) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: right free failed at %u\n", right)); + goto left; + } + rec->rec_len += sizeof(r) + r.rec_len; + } + } + +left: + /* Look left */ + left = offset - sizeof(tdb_off_t); + if (left > TDB_DATA_START(tdb->header.hash_size)) { + struct list_struct l; + tdb_off_t leftsize; + + /* Read in tailer and jump back to header */ + if (tdb_ofs_read(tdb, left, &leftsize) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: left offset read failed at %u\n", left)); + goto update; + } + + /* it could be uninitialised data */ + if (leftsize == 0 || leftsize == TDB_PAD_U32) { + goto update; + } + + left = offset - leftsize; + + /* Now read in record */ + if (tdb->methods->tdb_read(tdb, left, &l, sizeof(l), DOCONV()) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: left read failed at %u (%u)\n", left, leftsize)); + goto update; + } + + /* If it's free, expand to include it. */ + if (l.magic == TDB_FREE_MAGIC) { + if (remove_from_freelist(tdb, left, l.next) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: left free failed at %u\n", left)); + goto update; + } else { + offset = left; + rec->rec_len += leftsize; + } + } + } + +update: + if (update_tailer(tdb, offset, rec) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: update_tailer failed at %u\n", offset)); + goto fail; + } + + /* Now, prepend to free list */ + rec->magic = TDB_FREE_MAGIC; + + if (tdb_ofs_read(tdb, FREELIST_TOP, &rec->next) == -1 || + tdb_rec_write(tdb, offset, rec) == -1 || + tdb_ofs_write(tdb, FREELIST_TOP, &offset) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free record write failed at offset=%d\n", offset)); + goto fail; + } + + /* And we're done. */ + tdb_unlock(tdb, -1, F_WRLCK); + return 0; + + fail: + tdb_unlock(tdb, -1, F_WRLCK); + return -1; +} + + +/* + the core of tdb_allocate - called when we have decided which + free list entry to use + */ +static tdb_off_t tdb_allocate_ofs(struct tdb_context *tdb, tdb_len_t length, tdb_off_t rec_ptr, + struct list_struct *rec, tdb_off_t last_ptr) +{ + struct list_struct newrec; + tdb_off_t newrec_ptr; + + memset(&newrec, '\0', sizeof(newrec)); + + /* found it - now possibly split it up */ + if (rec->rec_len > length + MIN_REC_SIZE) { + /* Length of left piece */ + length = TDB_ALIGN(length, TDB_ALIGNMENT); + + /* Right piece to go on free list */ + newrec.rec_len = rec->rec_len - (sizeof(*rec) + length); + newrec_ptr = rec_ptr + sizeof(*rec) + length; + + /* And left record is shortened */ + rec->rec_len = length; + } else { + newrec_ptr = 0; + } + + /* Remove allocated record from the free list */ + if (tdb_ofs_write(tdb, last_ptr, &rec->next) == -1) { + return 0; + } + + /* Update header: do this before we drop alloc + lock, otherwise tdb_free() might try to + merge with us, thinking we're free. + (Thanks Jeremy Allison). */ + rec->magic = TDB_MAGIC; + if (tdb_rec_write(tdb, rec_ptr, rec) == -1) { + return 0; + } + + /* Did we create new block? */ + if (newrec_ptr) { + /* Update allocated record tailer (we + shortened it). */ + if (update_tailer(tdb, rec_ptr, rec) == -1) { + return 0; + } + + /* Free new record */ + if (tdb_free(tdb, newrec_ptr, &newrec) == -1) { + return 0; + } + } + + /* all done - return the new record offset */ + return rec_ptr; +} + +/* allocate some space from the free list. The offset returned points + to a unconnected list_struct within the database with room for at + least length bytes of total data + + 0 is returned if the space could not be allocated + */ +tdb_off_t tdb_allocate(struct tdb_context *tdb, tdb_len_t length, struct list_struct *rec) +{ + tdb_off_t rec_ptr, last_ptr, newrec_ptr; + struct { + tdb_off_t rec_ptr, last_ptr; + tdb_len_t rec_len; + } bestfit; + + if (tdb_lock(tdb, -1, F_WRLCK) == -1) + return 0; + + /* Extra bytes required for tailer */ + length += sizeof(tdb_off_t); + + again: + last_ptr = FREELIST_TOP; + + /* read in the freelist top */ + if (tdb_ofs_read(tdb, FREELIST_TOP, &rec_ptr) == -1) + goto fail; + + bestfit.rec_ptr = 0; + bestfit.last_ptr = 0; + bestfit.rec_len = 0; + + /* + this is a best fit allocation strategy. Originally we used + a first fit strategy, but it suffered from massive fragmentation + issues when faced with a slowly increasing record size. + */ + while (rec_ptr) { + if (tdb_rec_free_read(tdb, rec_ptr, rec) == -1) { + goto fail; + } + + if (rec->rec_len >= length) { + if (bestfit.rec_ptr == 0 || + rec->rec_len < bestfit.rec_len) { + bestfit.rec_len = rec->rec_len; + bestfit.rec_ptr = rec_ptr; + bestfit.last_ptr = last_ptr; + /* consider a fit to be good enough if + we aren't wasting more than half + the space */ + if (bestfit.rec_len < 2*length) { + break; + } + } + } + + /* move to the next record */ + last_ptr = rec_ptr; + rec_ptr = rec->next; + } + + if (bestfit.rec_ptr != 0) { + if (tdb_rec_free_read(tdb, bestfit.rec_ptr, rec) == -1) { + goto fail; + } + + newrec_ptr = tdb_allocate_ofs(tdb, length, bestfit.rec_ptr, rec, bestfit.last_ptr); + tdb_unlock(tdb, -1, F_WRLCK); + return newrec_ptr; + } + + /* we didn't find enough space. See if we can expand the + database and if we can then try again */ + if (tdb_expand(tdb, length + sizeof(*rec)) == 0) + goto again; + fail: + tdb_unlock(tdb, -1, F_WRLCK); + return 0; +} + +/* file: freelistcheck.c */ + +/* Check the freelist is good and contains no loops. + Very memory intensive - only do this as a consistency + checker. Heh heh - uses an in memory tdb as the storage + for the "seen" record list. For some reason this strikes + me as extremely clever as I don't have to write another tree + data structure implementation :-). + */ + +static int seen_insert(struct tdb_context *mem_tdb, tdb_off_t rec_ptr) +{ + TDB_DATA key, data; + + memset(&data, '\0', sizeof(data)); + key.dptr = (unsigned char *)&rec_ptr; + key.dsize = sizeof(rec_ptr); + return tdb_store(mem_tdb, key, data, TDB_INSERT); +} + +int tdb_validate_freelist(struct tdb_context *tdb, int *pnum_entries) +{ + struct tdb_context *mem_tdb = NULL; + struct list_struct rec; + tdb_off_t rec_ptr, last_ptr; + int ret = -1; + + *pnum_entries = 0; + + mem_tdb = tdb_open("flval", tdb->header.hash_size, + TDB_INTERNAL, O_RDWR, 0600); + if (!mem_tdb) { + return -1; + } + + if (tdb_lock(tdb, -1, F_WRLCK) == -1) { + tdb_close(mem_tdb); + return 0; + } + + last_ptr = FREELIST_TOP; + + /* Store the FREELIST_TOP record. */ + if (seen_insert(mem_tdb, last_ptr) == -1) { + ret = TDB_ERRCODE(TDB_ERR_CORRUPT, -1); + goto fail; + } + + /* read in the freelist top */ + if (tdb_ofs_read(tdb, FREELIST_TOP, &rec_ptr) == -1) { + goto fail; + } + + while (rec_ptr) { + + /* If we can't store this record (we've seen it + before) then the free list has a loop and must + be corrupt. */ + + if (seen_insert(mem_tdb, rec_ptr)) { + ret = TDB_ERRCODE(TDB_ERR_CORRUPT, -1); + goto fail; + } + + if (tdb_rec_free_read(tdb, rec_ptr, &rec) == -1) { + goto fail; + } + + /* move to the next record */ + last_ptr = rec_ptr; + rec_ptr = rec.next; + *pnum_entries += 1; + } + + ret = 0; + + fail: + + tdb_close(mem_tdb); + tdb_unlock(tdb, -1, F_WRLCK); + return ret; +} + +/* file: traverse.c */ + +/* Uses traverse lock: 0 = finish, -1 = error, other = record offset */ +static int tdb_next_lock(struct tdb_context *tdb, struct tdb_traverse_lock *tlock, + struct list_struct *rec) +{ + int want_next = (tlock->off != 0); + + /* Lock each chain from the start one. */ + for (; tlock->hash < tdb->header.hash_size; tlock->hash++) { + if (!tlock->off && tlock->hash != 0) { + /* this is an optimisation for the common case where + the hash chain is empty, which is particularly + common for the use of tdb with ldb, where large + hashes are used. In that case we spend most of our + time in tdb_brlock(), locking empty hash chains. + + To avoid this, we do an unlocked pre-check to see + if the hash chain is empty before starting to look + inside it. If it is empty then we can avoid that + hash chain. If it isn't empty then we can't believe + the value we get back, as we read it without a + lock, so instead we get the lock and re-fetch the + value below. + + Notice that not doing this optimisation on the + first hash chain is critical. We must guarantee + that we have done at least one fcntl lock at the + start of a search to guarantee that memory is + coherent on SMP systems. If records are added by + others during the search then that's OK, and we + could possibly miss those with this trick, but we + could miss them anyway without this trick, so the + semantics don't change. + + With a non-indexed ldb search this trick gains us a + factor of around 80 in speed on a linux 2.6.x + system (testing using ldbtest). + */ + tdb->methods->next_hash_chain(tdb, &tlock->hash); + if (tlock->hash == tdb->header.hash_size) { + continue; + } + } + + if (tdb_lock(tdb, tlock->hash, tlock->lock_rw) == -1) + return -1; + + /* No previous record? Start at top of chain. */ + if (!tlock->off) { + if (tdb_ofs_read(tdb, TDB_HASH_TOP(tlock->hash), + &tlock->off) == -1) + goto fail; + } else { + /* Otherwise unlock the previous record. */ + if (tdb_unlock_record(tdb, tlock->off) != 0) + goto fail; + } + + if (want_next) { + /* We have offset of old record: grab next */ + if (tdb_rec_read(tdb, tlock->off, rec) == -1) + goto fail; + tlock->off = rec->next; + } + + /* Iterate through chain */ + while( tlock->off) { + tdb_off_t current; + if (tdb_rec_read(tdb, tlock->off, rec) == -1) + goto fail; + + /* Detect infinite loops. From "Shlomi Yaakobovich" <Shlomi@exanet.com>. */ + if (tlock->off == rec->next) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_next_lock: loop detected.\n")); + goto fail; + } + + if (!TDB_DEAD(rec)) { + /* Woohoo: we found one! */ + if (tdb_lock_record(tdb, tlock->off) != 0) + goto fail; + return tlock->off; + } + + /* Try to clean dead ones from old traverses */ + current = tlock->off; + tlock->off = rec->next; + if (!(tdb->read_only || tdb->traverse_read) && + tdb_do_delete(tdb, current, rec) != 0) + goto fail; + } + tdb_unlock(tdb, tlock->hash, tlock->lock_rw); + want_next = 0; + } + /* We finished iteration without finding anything */ + return TDB_ERRCODE(TDB_SUCCESS, 0); + + fail: + tlock->off = 0; + if (tdb_unlock(tdb, tlock->hash, tlock->lock_rw) != 0) + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_next_lock: On error unlock failed!\n")); + return -1; +} + +/* traverse the entire database - calling fn(tdb, key, data) on each element. + return -1 on error or the record count traversed + if fn is NULL then it is not called + a non-zero return value from fn() indicates that the traversal should stop + */ +static int tdb_traverse_internal(struct tdb_context *tdb, + tdb_traverse_func fn, void *private_data, + struct tdb_traverse_lock *tl) +{ + TDB_DATA key, dbuf; + struct list_struct rec; + int ret, count = 0; + + /* This was in the initialization, above, but the IRIX compiler + * did not like it. crh + */ + tl->next = tdb->travlocks.next; + + /* fcntl locks don't stack: beware traverse inside traverse */ + tdb->travlocks.next = tl; + + /* tdb_next_lock places locks on the record returned, and its chain */ + while ((ret = tdb_next_lock(tdb, tl, &rec)) > 0) { + count++; + /* now read the full record */ + key.dptr = tdb_alloc_read(tdb, tl->off + sizeof(rec), + rec.key_len + rec.data_len); + if (!key.dptr) { + ret = -1; + if (tdb_unlock(tdb, tl->hash, tl->lock_rw) != 0) + goto out; + if (tdb_unlock_record(tdb, tl->off) != 0) + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_traverse: key.dptr == NULL and unlock_record failed!\n")); + goto out; + } + key.dsize = rec.key_len; + dbuf.dptr = key.dptr + rec.key_len; + dbuf.dsize = rec.data_len; + + /* Drop chain lock, call out */ + if (tdb_unlock(tdb, tl->hash, tl->lock_rw) != 0) { + ret = -1; + SAFE_FREE(key.dptr); + goto out; + } + if (fn && fn(tdb, key, dbuf, private_data)) { + /* They want us to terminate traversal */ + ret = count; + if (tdb_unlock_record(tdb, tl->off) != 0) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_traverse: unlock_record failed!\n"));; + ret = -1; + } + SAFE_FREE(key.dptr); + goto out; + } + SAFE_FREE(key.dptr); + } +out: + tdb->travlocks.next = tl->next; + if (ret < 0) + return -1; + else + return count; +} + + +/* + a write style traverse - temporarily marks the db read only +*/ +int tdb_traverse_read(struct tdb_context *tdb, + tdb_traverse_func fn, void *private_data) +{ + struct tdb_traverse_lock tl = { NULL, 0, 0, F_RDLCK }; + int ret; + + /* we need to get a read lock on the transaction lock here to + cope with the lock ordering semantics of solaris10 */ + if (tdb_transaction_lock(tdb, F_RDLCK)) { + return -1; + } + + tdb->traverse_read++; + ret = tdb_traverse_internal(tdb, fn, private_data, &tl); + tdb->traverse_read--; + + tdb_transaction_unlock(tdb); + + return ret; +} + +/* + a write style traverse - needs to get the transaction lock to + prevent deadlocks +*/ +int tdb_traverse(struct tdb_context *tdb, + tdb_traverse_func fn, void *private_data) +{ + struct tdb_traverse_lock tl = { NULL, 0, 0, F_WRLCK }; + int ret; + + if (tdb->read_only || tdb->traverse_read) { + return tdb_traverse_read(tdb, fn, private_data); + } + + if (tdb_transaction_lock(tdb, F_WRLCK)) { + return -1; + } + + ret = tdb_traverse_internal(tdb, fn, private_data, &tl); + + tdb_transaction_unlock(tdb); + + return ret; +} + + +/* find the first entry in the database and return its key */ +TDB_DATA tdb_firstkey(struct tdb_context *tdb) +{ + TDB_DATA key; + struct list_struct rec; + + /* release any old lock */ + if (tdb_unlock_record(tdb, tdb->travlocks.off) != 0) + return tdb_null; + tdb->travlocks.off = tdb->travlocks.hash = 0; + tdb->travlocks.lock_rw = F_RDLCK; + + /* Grab first record: locks chain and returned record. */ + if (tdb_next_lock(tdb, &tdb->travlocks, &rec) <= 0) + return tdb_null; + /* now read the key */ + key.dsize = rec.key_len; + key.dptr =tdb_alloc_read(tdb,tdb->travlocks.off+sizeof(rec),key.dsize); + + /* Unlock the hash chain of the record we just read. */ + if (tdb_unlock(tdb, tdb->travlocks.hash, tdb->travlocks.lock_rw) != 0) + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_firstkey: error occurred while tdb_unlocking!\n")); + return key; +} + +/* find the next entry in the database, returning its key */ +TDB_DATA tdb_nextkey(struct tdb_context *tdb, TDB_DATA oldkey) +{ + u32 oldhash; + TDB_DATA key = tdb_null; + struct list_struct rec; + unsigned char *k = NULL; + + /* Is locked key the old key? If so, traverse will be reliable. */ + if (tdb->travlocks.off) { + if (tdb_lock(tdb,tdb->travlocks.hash,tdb->travlocks.lock_rw)) + return tdb_null; + if (tdb_rec_read(tdb, tdb->travlocks.off, &rec) == -1 + || !(k = tdb_alloc_read(tdb,tdb->travlocks.off+sizeof(rec), + rec.key_len)) + || memcmp(k, oldkey.dptr, oldkey.dsize) != 0) { + /* No, it wasn't: unlock it and start from scratch */ + if (tdb_unlock_record(tdb, tdb->travlocks.off) != 0) { + SAFE_FREE(k); + return tdb_null; + } + if (tdb_unlock(tdb, tdb->travlocks.hash, tdb->travlocks.lock_rw) != 0) { + SAFE_FREE(k); + return tdb_null; + } + tdb->travlocks.off = 0; + } + + SAFE_FREE(k); + } + + if (!tdb->travlocks.off) { + /* No previous element: do normal find, and lock record */ + tdb->travlocks.off = tdb_find_lock_hash(tdb, oldkey, tdb->hash_fn(&oldkey), tdb->travlocks.lock_rw, &rec); + if (!tdb->travlocks.off) + return tdb_null; + tdb->travlocks.hash = BUCKET(rec.full_hash); + if (tdb_lock_record(tdb, tdb->travlocks.off) != 0) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_nextkey: lock_record failed (%s)!\n", strerror(errno))); + return tdb_null; + } + } + oldhash = tdb->travlocks.hash; + + /* Grab next record: locks chain and returned record, + unlocks old record */ + if (tdb_next_lock(tdb, &tdb->travlocks, &rec) > 0) { + key.dsize = rec.key_len; + key.dptr = tdb_alloc_read(tdb, tdb->travlocks.off+sizeof(rec), + key.dsize); + /* Unlock the chain of this new record */ + if (tdb_unlock(tdb, tdb->travlocks.hash, tdb->travlocks.lock_rw) != 0) + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_nextkey: WARNING tdb_unlock failed!\n")); + } + /* Unlock the chain of old record */ + if (tdb_unlock(tdb, BUCKET(oldhash), tdb->travlocks.lock_rw) != 0) + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_nextkey: WARNING tdb_unlock failed!\n")); + return key; +} + +/* file: dump.c */ + +static tdb_off_t tdb_dump_record(struct tdb_context *tdb, int hash, + tdb_off_t offset) +{ + struct list_struct rec; + tdb_off_t tailer_ofs, tailer; + + if (tdb->methods->tdb_read(tdb, offset, (char *)&rec, + sizeof(rec), DOCONV()) == -1) { + printf("ERROR: failed to read record at %u\n", offset); + return 0; + } + + printf(" rec: hash=%d offset=0x%08x next=0x%08x rec_len=%d " + "key_len=%d data_len=%d full_hash=0x%x magic=0x%x\n", + hash, offset, rec.next, rec.rec_len, rec.key_len, rec.data_len, + rec.full_hash, rec.magic); + + tailer_ofs = offset + sizeof(rec) + rec.rec_len - sizeof(tdb_off_t); + + if (tdb_ofs_read(tdb, tailer_ofs, &tailer) == -1) { + printf("ERROR: failed to read tailer at %u\n", tailer_ofs); + return rec.next; + } + + if (tailer != rec.rec_len + sizeof(rec)) { + printf("ERROR: tailer does not match record! tailer=%u totalsize=%u\n", + (unsigned int)tailer, (unsigned int)(rec.rec_len + sizeof(rec))); + } + return rec.next; +} + +static int tdb_dump_chain(struct tdb_context *tdb, int i) +{ + tdb_off_t rec_ptr, top; + + top = TDB_HASH_TOP(i); + + if (tdb_lock(tdb, i, F_WRLCK) != 0) + return -1; + + if (tdb_ofs_read(tdb, top, &rec_ptr) == -1) + return tdb_unlock(tdb, i, F_WRLCK); + + if (rec_ptr) + printf("hash=%d\n", i); + + while (rec_ptr) { + rec_ptr = tdb_dump_record(tdb, i, rec_ptr); + } + + return tdb_unlock(tdb, i, F_WRLCK); +} + +void tdb_dump_all(struct tdb_context *tdb) +{ + int i; + for (i = 0; i < (int)tdb->header.hash_size; i++) { + tdb_dump_chain(tdb, i); + } + printf("freelist:\n"); + tdb_dump_chain(tdb, -1); +} + +int tdb_printfreelist(struct tdb_context *tdb) +{ + int ret; + long total_free = 0; + tdb_off_t offset, rec_ptr; + struct list_struct rec; + + if ((ret = tdb_lock(tdb, -1, F_WRLCK)) != 0) + return ret; + + offset = FREELIST_TOP; + + /* read in the freelist top */ + if (tdb_ofs_read(tdb, offset, &rec_ptr) == -1) { + tdb_unlock(tdb, -1, F_WRLCK); + return 0; + } + + printf("freelist top=[0x%08x]\n", rec_ptr ); + while (rec_ptr) { + if (tdb->methods->tdb_read(tdb, rec_ptr, (char *)&rec, + sizeof(rec), DOCONV()) == -1) { + tdb_unlock(tdb, -1, F_WRLCK); + return -1; + } + + if (rec.magic != TDB_FREE_MAGIC) { + printf("bad magic 0x%08x in free list\n", rec.magic); + tdb_unlock(tdb, -1, F_WRLCK); + return -1; + } + + printf("entry offset=[0x%08x], rec.rec_len = [0x%08x (%d)] (end = 0x%08x)\n", + rec_ptr, rec.rec_len, rec.rec_len, rec_ptr + rec.rec_len); + total_free += rec.rec_len; + + /* move to the next record */ + rec_ptr = rec.next; + } + printf("total rec_len = [0x%08x (%d)]\n", (int)total_free, + (int)total_free); + + return tdb_unlock(tdb, -1, F_WRLCK); +} + +/* file: tdb.c */ + +/* + non-blocking increment of the tdb sequence number if the tdb has been opened using + the TDB_SEQNUM flag +*/ +void tdb_increment_seqnum_nonblock(struct tdb_context *tdb) +{ + tdb_off_t seqnum=0; + + if (!(tdb->flags & TDB_SEQNUM)) { + return; + } + + /* we ignore errors from this, as we have no sane way of + dealing with them. + */ + if (tdb_ofs_read(tdb, TDB_SEQNUM_OFS, &seqnum) == -1) + return; + seqnum++; + (void) tdb_ofs_write(tdb, TDB_SEQNUM_OFS, &seqnum); +} + +/* + increment the tdb sequence number if the tdb has been opened using + the TDB_SEQNUM flag +*/ +static void tdb_increment_seqnum(struct tdb_context *tdb) +{ + if (!(tdb->flags & TDB_SEQNUM)) { + return; + } + + if (tdb_brlock(tdb, TDB_SEQNUM_OFS, F_WRLCK, F_SETLKW, 1, 1) != 0) { + return; + } + + tdb_increment_seqnum_nonblock(tdb); + + tdb_brlock(tdb, TDB_SEQNUM_OFS, F_UNLCK, F_SETLKW, 1, 1); +} + +static int tdb_key_compare(TDB_DATA key, TDB_DATA data, + void *private_data EXT2FS_ATTR((unused))) +{ + return memcmp(data.dptr, key.dptr, data.dsize); +} + +/* Returns 0 on fail. On success, return offset of record, and fills + in rec */ +static tdb_off_t tdb_find(struct tdb_context *tdb, TDB_DATA key, u32 hash, + struct list_struct *r) +{ + tdb_off_t rec_ptr; + + /* read in the hash top */ + if (tdb_ofs_read(tdb, TDB_HASH_TOP(hash), &rec_ptr) == -1) + return 0; + + /* keep looking until we find the right record */ + while (rec_ptr) { + if (tdb_rec_read(tdb, rec_ptr, r) == -1) + return 0; + + if (!TDB_DEAD(r) && hash==r->full_hash + && key.dsize==r->key_len + && tdb_parse_data(tdb, key, rec_ptr + sizeof(*r), + r->key_len, tdb_key_compare, + NULL) == 0) { + return rec_ptr; + } + rec_ptr = r->next; + } + return TDB_ERRCODE(TDB_ERR_NOEXIST, 0); +} + +/* As tdb_find, but if you succeed, keep the lock */ +tdb_off_t tdb_find_lock_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash, int locktype, + struct list_struct *rec) +{ + u32 rec_ptr; + + if (tdb_lock(tdb, BUCKET(hash), locktype) == -1) + return 0; + if (!(rec_ptr = tdb_find(tdb, key, hash, rec))) + tdb_unlock(tdb, BUCKET(hash), locktype); + return rec_ptr; +} + + +/* update an entry in place - this only works if the new data size + is <= the old data size and the key exists. + on failure return -1. +*/ +static int tdb_update_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash, TDB_DATA dbuf) +{ + struct list_struct rec; + tdb_off_t rec_ptr; + + /* find entry */ + if (!(rec_ptr = tdb_find(tdb, key, hash, &rec))) + return -1; + + /* must be long enough key, data and tailer */ + if (rec.rec_len < key.dsize + dbuf.dsize + sizeof(tdb_off_t)) { + tdb->ecode = TDB_SUCCESS; /* Not really an error */ + return -1; + } + + if (tdb->methods->tdb_write(tdb, rec_ptr + sizeof(rec) + rec.key_len, + dbuf.dptr, dbuf.dsize) == -1) + return -1; + + if (dbuf.dsize != rec.data_len) { + /* update size */ + rec.data_len = dbuf.dsize; + return tdb_rec_write(tdb, rec_ptr, &rec); + } + + return 0; +} + +/* find an entry in the database given a key */ +/* If an entry doesn't exist tdb_err will be set to + * TDB_ERR_NOEXIST. If a key has no data attached + * then the TDB_DATA will have zero length but + * a non-zero pointer + */ +TDB_DATA tdb_fetch(struct tdb_context *tdb, TDB_DATA key) +{ + tdb_off_t rec_ptr; + struct list_struct rec; + TDB_DATA ret; + u32 hash; + + /* find which hash bucket it is in */ + hash = tdb->hash_fn(&key); + if (!(rec_ptr = tdb_find_lock_hash(tdb,key,hash,F_RDLCK,&rec))) + return tdb_null; + + ret.dptr = tdb_alloc_read(tdb, rec_ptr + sizeof(rec) + rec.key_len, + rec.data_len); + ret.dsize = rec.data_len; + tdb_unlock(tdb, BUCKET(rec.full_hash), F_RDLCK); + return ret; +} + +/* + * Find an entry in the database and hand the record's data to a parsing + * function. The parsing function is executed under the chain read lock, so it + * should be fast and should not block on other syscalls. + * + * DONT CALL OTHER TDB CALLS FROM THE PARSER, THIS MIGHT LEAD TO SEGFAULTS. + * + * For mmapped tdb's that do not have a transaction open it points the parsing + * function directly at the mmap area, it avoids the malloc/memcpy in this + * case. If a transaction is open or no mmap is available, it has to do + * malloc/read/parse/free. + * + * This is interesting for all readers of potentially large data structures in + * the tdb records, ldb indexes being one example. + */ + +int tdb_parse_record(struct tdb_context *tdb, TDB_DATA key, + int (*parser)(TDB_DATA key, TDB_DATA data, + void *private_data), + void *private_data) +{ + tdb_off_t rec_ptr; + struct list_struct rec; + int ret; + u32 hash; + + /* find which hash bucket it is in */ + hash = tdb->hash_fn(&key); + + if (!(rec_ptr = tdb_find_lock_hash(tdb,key,hash,F_RDLCK,&rec))) { + return TDB_ERRCODE(TDB_ERR_NOEXIST, 0); + } + + ret = tdb_parse_data(tdb, key, rec_ptr + sizeof(rec) + rec.key_len, + rec.data_len, parser, private_data); + + tdb_unlock(tdb, BUCKET(rec.full_hash), F_RDLCK); + + return ret; +} + +/* check if an entry in the database exists + + note that 1 is returned if the key is found and 0 is returned if not found + this doesn't match the conventions in the rest of this module, but is + compatible with gdbm +*/ +static int tdb_exists_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash) +{ + struct list_struct rec; + + if (tdb_find_lock_hash(tdb, key, hash, F_RDLCK, &rec) == 0) + return 0; + tdb_unlock(tdb, BUCKET(rec.full_hash), F_RDLCK); + return 1; +} + +int tdb_exists(struct tdb_context *tdb, TDB_DATA key) +{ + u32 hash = tdb->hash_fn(&key); + return tdb_exists_hash(tdb, key, hash); +} + +/* actually delete an entry in the database given the offset */ +int tdb_do_delete(struct tdb_context *tdb, tdb_off_t rec_ptr, struct list_struct*rec) +{ + tdb_off_t last_ptr, i; + struct list_struct lastrec; + + if (tdb->read_only || tdb->traverse_read) return -1; + + if (tdb_write_lock_record(tdb, rec_ptr) == -1) { + /* Someone traversing here: mark it as dead */ + rec->magic = TDB_DEAD_MAGIC; + return tdb_rec_write(tdb, rec_ptr, rec); + } + if (tdb_write_unlock_record(tdb, rec_ptr) != 0) + return -1; + + /* find previous record in hash chain */ + if (tdb_ofs_read(tdb, TDB_HASH_TOP(rec->full_hash), &i) == -1) + return -1; + for (last_ptr = 0; i != rec_ptr; last_ptr = i, i = lastrec.next) + if (tdb_rec_read(tdb, i, &lastrec) == -1) + return -1; + + /* unlink it: next ptr is at start of record. */ + if (last_ptr == 0) + last_ptr = TDB_HASH_TOP(rec->full_hash); + if (tdb_ofs_write(tdb, last_ptr, &rec->next) == -1) + return -1; + + /* recover the space */ + if (tdb_free(tdb, rec_ptr, rec) == -1) + return -1; + return 0; +} + +static int tdb_count_dead(struct tdb_context *tdb, u32 hash) +{ + int res = 0; + tdb_off_t rec_ptr; + struct list_struct rec; + + /* read in the hash top */ + if (tdb_ofs_read(tdb, TDB_HASH_TOP(hash), &rec_ptr) == -1) + return 0; + + while (rec_ptr) { + if (tdb_rec_read(tdb, rec_ptr, &rec) == -1) + return 0; + + if (rec.magic == TDB_DEAD_MAGIC) { + res += 1; + } + rec_ptr = rec.next; + } + return res; +} + +/* + * Purge all DEAD records from a hash chain + */ +static int tdb_purge_dead(struct tdb_context *tdb, u32 hash) +{ + int res = -1; + struct list_struct rec; + tdb_off_t rec_ptr; + + if (tdb_lock(tdb, -1, F_WRLCK) == -1) { + return -1; + } + + /* read in the hash top */ + if (tdb_ofs_read(tdb, TDB_HASH_TOP(hash), &rec_ptr) == -1) + goto fail; + + while (rec_ptr) { + tdb_off_t next; + + if (tdb_rec_read(tdb, rec_ptr, &rec) == -1) { + goto fail; + } + + next = rec.next; + + if (rec.magic == TDB_DEAD_MAGIC + && tdb_do_delete(tdb, rec_ptr, &rec) == -1) { + goto fail; + } + rec_ptr = next; + } + res = 0; + fail: + tdb_unlock(tdb, -1, F_WRLCK); + return res; +} + +/* delete an entry in the database given a key */ +static int tdb_delete_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash) +{ + tdb_off_t rec_ptr; + struct list_struct rec; + int ret; + + if (tdb->max_dead_records != 0) { + + /* + * Allow for some dead records per hash chain, mainly for + * tdb's with a very high create/delete rate like locking.tdb. + */ + + if (tdb_lock(tdb, BUCKET(hash), F_WRLCK) == -1) + return -1; + + if (tdb_count_dead(tdb, hash) >= tdb->max_dead_records) { + /* + * Don't let the per-chain freelist grow too large, + * delete all existing dead records + */ + tdb_purge_dead(tdb, hash); + } + + if (!(rec_ptr = tdb_find(tdb, key, hash, &rec))) { + tdb_unlock(tdb, BUCKET(hash), F_WRLCK); + return -1; + } + + /* + * Just mark the record as dead. + */ + rec.magic = TDB_DEAD_MAGIC; + ret = tdb_rec_write(tdb, rec_ptr, &rec); + } + else { + if (!(rec_ptr = tdb_find_lock_hash(tdb, key, hash, F_WRLCK, + &rec))) + return -1; + + ret = tdb_do_delete(tdb, rec_ptr, &rec); + } + + if (ret == 0) { + tdb_increment_seqnum(tdb); + } + + if (tdb_unlock(tdb, BUCKET(rec.full_hash), F_WRLCK) != 0) + TDB_LOG((tdb, TDB_DEBUG_WARNING, "tdb_delete: WARNING tdb_unlock failed!\n")); + return ret; +} + +int tdb_delete(struct tdb_context *tdb, TDB_DATA key) +{ + u32 hash = tdb->hash_fn(&key); + return tdb_delete_hash(tdb, key, hash); +} + +/* + * See if we have a dead record around with enough space + */ +static tdb_off_t tdb_find_dead(struct tdb_context *tdb, u32 hash, + struct list_struct *r, tdb_len_t length) +{ + tdb_off_t rec_ptr; + + /* read in the hash top */ + if (tdb_ofs_read(tdb, TDB_HASH_TOP(hash), &rec_ptr) == -1) + return 0; + + /* keep looking until we find the right record */ + while (rec_ptr) { + if (tdb_rec_read(tdb, rec_ptr, r) == -1) + return 0; + + if (TDB_DEAD(r) && r->rec_len >= length) { + /* + * First fit for simple coding, TODO: change to best + * fit + */ + return rec_ptr; + } + rec_ptr = r->next; + } + return 0; +} + +/* store an element in the database, replacing any existing element + with the same key + + return 0 on success, -1 on failure +*/ +int tdb_store(struct tdb_context *tdb, TDB_DATA key, TDB_DATA dbuf, int flag) +{ + struct list_struct rec; + u32 hash; + tdb_off_t rec_ptr; + char *p = NULL; + int ret = -1; + + if (tdb->read_only || tdb->traverse_read) { + tdb->ecode = TDB_ERR_RDONLY; + return -1; + } + + /* find which hash bucket it is in */ + hash = tdb->hash_fn(&key); + if (tdb_lock(tdb, BUCKET(hash), F_WRLCK) == -1) + return -1; + + /* check for it existing, on insert. */ + if (flag == TDB_INSERT) { + if (tdb_exists_hash(tdb, key, hash)) { + tdb->ecode = TDB_ERR_EXISTS; + goto fail; + } + } else { + /* first try in-place update, on modify or replace. */ + if (tdb_update_hash(tdb, key, hash, dbuf) == 0) { + goto done; + } + if (tdb->ecode == TDB_ERR_NOEXIST && + flag == TDB_MODIFY) { + /* if the record doesn't exist and we are in TDB_MODIFY mode then + we should fail the store */ + goto fail; + } + } + /* reset the error code potentially set by the tdb_update() */ + tdb->ecode = TDB_SUCCESS; + + /* delete any existing record - if it doesn't exist we don't + care. Doing this first reduces fragmentation, and avoids + coalescing with `allocated' block before it's updated. */ + if (flag != TDB_INSERT) + tdb_delete_hash(tdb, key, hash); + + /* Copy key+value *before* allocating free space in case malloc + fails and we are left with a dead spot in the tdb. */ + + if (!(p = (char *)malloc(key.dsize + dbuf.dsize))) { + tdb->ecode = TDB_ERR_OOM; + goto fail; + } + + memcpy(p, key.dptr, key.dsize); + if (dbuf.dsize) + memcpy(p+key.dsize, dbuf.dptr, dbuf.dsize); + + if (tdb->max_dead_records != 0) { + /* + * Allow for some dead records per hash chain, look if we can + * find one that can hold the new record. We need enough space + * for key, data and tailer. If we find one, we don't have to + * consult the central freelist. + */ + rec_ptr = tdb_find_dead( + tdb, hash, &rec, + key.dsize + dbuf.dsize + sizeof(tdb_off_t)); + + if (rec_ptr != 0) { + rec.key_len = key.dsize; + rec.data_len = dbuf.dsize; + rec.full_hash = hash; + rec.magic = TDB_MAGIC; + if (tdb_rec_write(tdb, rec_ptr, &rec) == -1 + || tdb->methods->tdb_write( + tdb, rec_ptr + sizeof(rec), + p, key.dsize + dbuf.dsize) == -1) { + goto fail; + } + goto done; + } + } + + /* + * We have to allocate some space from the freelist, so this means we + * have to lock it. Use the chance to purge all the DEAD records from + * the hash chain under the freelist lock. + */ + + if (tdb_lock(tdb, -1, F_WRLCK) == -1) { + goto fail; + } + + if ((tdb->max_dead_records != 0) + && (tdb_purge_dead(tdb, hash) == -1)) { + tdb_unlock(tdb, -1, F_WRLCK); + goto fail; + } + + /* we have to allocate some space */ + rec_ptr = tdb_allocate(tdb, key.dsize + dbuf.dsize, &rec); + + tdb_unlock(tdb, -1, F_WRLCK); + + if (rec_ptr == 0) { + goto fail; + } + + /* Read hash top into next ptr */ + if (tdb_ofs_read(tdb, TDB_HASH_TOP(hash), &rec.next) == -1) + goto fail; + + rec.key_len = key.dsize; + rec.data_len = dbuf.dsize; + rec.full_hash = hash; + rec.magic = TDB_MAGIC; + + /* write out and point the top of the hash chain at it */ + if (tdb_rec_write(tdb, rec_ptr, &rec) == -1 + || tdb->methods->tdb_write(tdb, rec_ptr+sizeof(rec), p, key.dsize+dbuf.dsize)==-1 + || tdb_ofs_write(tdb, TDB_HASH_TOP(hash), &rec_ptr) == -1) { + /* Need to tdb_unallocate() here */ + goto fail; + } + + done: + ret = 0; + fail: + if (ret == 0) { + tdb_increment_seqnum(tdb); + } + + SAFE_FREE(p); + tdb_unlock(tdb, BUCKET(hash), F_WRLCK); + return ret; +} + + +/* Append to an entry. Create if not exist. */ +int tdb_append(struct tdb_context *tdb, TDB_DATA key, TDB_DATA new_dbuf) +{ + u32 hash; + TDB_DATA dbuf; + int ret = -1; + + /* find which hash bucket it is in */ + hash = tdb->hash_fn(&key); + if (tdb_lock(tdb, BUCKET(hash), F_WRLCK) == -1) + return -1; + + dbuf = tdb_fetch(tdb, key); + + if (dbuf.dptr == NULL) { + dbuf.dptr = (unsigned char *)malloc(new_dbuf.dsize); + } else { + unsigned char *new_dptr = (unsigned char *)realloc(dbuf.dptr, + dbuf.dsize + new_dbuf.dsize); + if (new_dptr == NULL) { + free(dbuf.dptr); + } + dbuf.dptr = new_dptr; + } + + if (dbuf.dptr == NULL) { + tdb->ecode = TDB_ERR_OOM; + goto failed; + } + + memcpy(dbuf.dptr + dbuf.dsize, new_dbuf.dptr, new_dbuf.dsize); + dbuf.dsize += new_dbuf.dsize; + + ret = tdb_store(tdb, key, dbuf, 0); + +failed: + tdb_unlock(tdb, BUCKET(hash), F_WRLCK); + SAFE_FREE(dbuf.dptr); + return ret; +} + + +/* + return the name of the current tdb file + useful for external logging functions +*/ +const char *tdb_name(struct tdb_context *tdb) +{ + return tdb->name; +} + +/* + return the underlying file descriptor being used by tdb, or -1 + useful for external routines that want to check the device/inode + of the fd +*/ +int tdb_fd(struct tdb_context *tdb) +{ + return tdb->fd; +} + +/* + return the current logging function + useful for external tdb routines that wish to log tdb errors +*/ +tdb_log_func tdb_log_fn(struct tdb_context *tdb) +{ + return tdb->log.log_fn; +} + + +/* + get the tdb sequence number. Only makes sense if the writers opened + with TDB_SEQNUM set. Note that this sequence number will wrap quite + quickly, so it should only be used for a 'has something changed' + test, not for code that relies on the count of the number of changes + made. If you want a counter then use a tdb record. + + The aim of this sequence number is to allow for a very lightweight + test of a possible tdb change. +*/ +int tdb_get_seqnum(struct tdb_context *tdb) +{ + tdb_off_t seqnum=0; + + if (tdb_ofs_read(tdb, TDB_SEQNUM_OFS, &seqnum) == -1) + return 0; + return seqnum; +} + +int tdb_hash_size(struct tdb_context *tdb) +{ + return tdb->header.hash_size; +} + +size_t tdb_map_size(struct tdb_context *tdb) +{ + return tdb->map_size; +} + +int tdb_get_flags(struct tdb_context *tdb) +{ + return tdb->flags; +} + + +/* + enable sequence number handling on an open tdb +*/ +void tdb_enable_seqnum(struct tdb_context *tdb) +{ + tdb->flags |= TDB_SEQNUM; +} + +/* file: open.c */ + +/* all contexts, to ensure no double-opens (fcntl locks don't nest!) */ +static struct tdb_context *tdbs = NULL; + + +/* This is from a hash algorithm suggested by Rogier Wolff */ +static unsigned int default_tdb_hash(TDB_DATA *key) +{ + u32 value; /* Used to compute the hash value. */ + u32 i; /* Used to cycle through random values. */ + + /* Set the initial value from the key size. */ + for (value = 0, i=0; i < key->dsize; i++) + value = value * 256 + key->dptr[i] + (value >> 24) * 241; + + return value; +} + + +/* initialise a new database with a specified hash size */ +static int tdb_new_database(struct tdb_context *tdb, int hash_size) +{ + struct tdb_header *newdb; + int size, ret = -1; + + /* We make it up in memory, then write it out if not internal */ + size = sizeof(struct tdb_header) + (hash_size+1)*sizeof(tdb_off_t); + if (!(newdb = (struct tdb_header *)calloc(size, 1))) + return TDB_ERRCODE(TDB_ERR_OOM, -1); + + /* Fill in the header */ + newdb->version = TDB_VERSION; + newdb->hash_size = hash_size; + if (tdb->flags & TDB_INTERNAL) { + tdb->map_size = size; + tdb->map_ptr = (char *)newdb; + memcpy(&tdb->header, newdb, sizeof(tdb->header)); + /* Convert the `ondisk' version if asked. */ + CONVERT(*newdb); + return 0; + } + if (lseek(tdb->fd, 0, SEEK_SET) == -1) + goto fail; + + if (ftruncate(tdb->fd, 0) == -1) + goto fail; + + /* This creates an endian-converted header, as if read from disk */ + CONVERT(*newdb); + memcpy(&tdb->header, newdb, sizeof(tdb->header)); + /* Don't endian-convert the magic food! */ + memcpy(newdb->magic_food, TDB_MAGIC_FOOD, strlen(TDB_MAGIC_FOOD)+1); + if (write(tdb->fd, newdb, size) != size) { + ret = -1; + } else { + ret = 0; + } + + fail: + SAFE_FREE(newdb); + return ret; +} + + + +static int tdb_already_open(dev_t device, + ino_t ino) +{ + struct tdb_context *i; + + for (i = tdbs; i; i = i->next) { + if (i->device == device && i->inode == ino) { + return 1; + } + } + + return 0; +} + +/* open the database, creating it if necessary + + The open_flags and mode are passed straight to the open call on the + database file. A flags value of O_WRONLY is invalid. The hash size + is advisory, use zero for a default value. + + Return is NULL on error, in which case errno is also set. Don't + try to call tdb_error or tdb_errname, just do strerror(errno). + + @param name may be NULL for internal databases. */ +struct tdb_context *tdb_open(const char *name, int hash_size, int tdb_flags, + int open_flags, mode_t mode) +{ + return tdb_open_ex(name, hash_size, tdb_flags, open_flags, mode, NULL, NULL); +} + +/* a default logging function */ +static void null_log_fn(struct tdb_context *tdb, enum tdb_debug_level level, const char *fmt, ...) PRINTF_ATTRIBUTE(3, 4); +static void null_log_fn(struct tdb_context *tdb EXT2FS_ATTR((unused)), + enum tdb_debug_level level EXT2FS_ATTR((unused)), + const char *fmt EXT2FS_ATTR((unused)), ...) +{ +} + + +struct tdb_context *tdb_open_ex(const char *name, int hash_size, int tdb_flags, + int open_flags, mode_t mode, + const struct tdb_logging_context *log_ctx, + tdb_hash_func hash_fn) +{ + struct tdb_context *tdb; + struct stat st; + int rev = 0, locked = 0; + unsigned char *vp; + u32 vertest; + + if (!(tdb = (struct tdb_context *)calloc(1, sizeof *tdb))) { + /* Can't log this */ + errno = ENOMEM; + goto fail; + } + tdb_io_init(tdb); + tdb->fd = -1; + tdb->name = NULL; + tdb->map_ptr = NULL; + tdb->flags = tdb_flags; + tdb->open_flags = open_flags; + if (log_ctx) { + tdb->log = *log_ctx; + } else { + tdb->log.log_fn = null_log_fn; + tdb->log.log_private = NULL; + } + tdb->hash_fn = hash_fn ? hash_fn : default_tdb_hash; + + /* cache the page size */ + tdb->page_size = sysconf(_SC_PAGESIZE); + if (tdb->page_size <= 0) { + tdb->page_size = 0x2000; + } + + if ((open_flags & O_ACCMODE) == O_WRONLY) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: can't open tdb %s write-only\n", + name)); + errno = EINVAL; + goto fail; + } + + if (hash_size == 0) + hash_size = DEFAULT_HASH_SIZE; + if ((open_flags & O_ACCMODE) == O_RDONLY) { + tdb->read_only = 1; + /* read only databases don't do locking or clear if first */ + tdb->flags |= TDB_NOLOCK; + tdb->flags &= ~TDB_CLEAR_IF_FIRST; + } + + /* internal databases don't mmap or lock, and start off cleared */ + if (tdb->flags & TDB_INTERNAL) { + tdb->flags |= (TDB_NOLOCK | TDB_NOMMAP); + tdb->flags &= ~TDB_CLEAR_IF_FIRST; + if (tdb_new_database(tdb, hash_size) != 0) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: tdb_new_database failed!")); + goto fail; + } + goto internal; + } + + if ((tdb->fd = open(name, open_flags, mode)) == -1) { + TDB_LOG((tdb, TDB_DEBUG_WARNING, "tdb_open_ex: could not open file %s: %s\n", + name, strerror(errno))); + goto fail; /* errno set by open(2) */ + } + + /* ensure there is only one process initialising at once */ + if (tdb->methods->tdb_brlock(tdb, GLOBAL_LOCK, F_WRLCK, F_SETLKW, 0, 1) == -1) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: failed to get global lock on %s: %s\n", + name, strerror(errno))); + goto fail; /* errno set by tdb_brlock */ + } + + /* we need to zero database if we are the only one with it open */ + if ((tdb_flags & TDB_CLEAR_IF_FIRST) && + (locked = (tdb->methods->tdb_brlock(tdb, ACTIVE_LOCK, F_WRLCK, F_SETLK, 0, 1) == 0))) { + open_flags |= O_CREAT; + if (ftruncate(tdb->fd, 0) == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_open_ex: " + "failed to truncate %s: %s\n", + name, strerror(errno))); + goto fail; /* errno set by ftruncate */ + } + } + + if (read(tdb->fd, &tdb->header, sizeof(tdb->header)) != sizeof(tdb->header) + || memcmp(tdb->header.magic_food, TDB_MAGIC_FOOD, + sizeof(TDB_MAGIC_FOOD)) != 0 + || (tdb->header.version != TDB_VERSION + && !(rev = (tdb->header.version==TDB_BYTEREV(TDB_VERSION))))) { + /* its not a valid database - possibly initialise it */ + if (!(open_flags & O_CREAT) || tdb_new_database(tdb, hash_size) == -1) { + errno = EIO; /* ie bad format or something */ + goto fail; + } + rev = (tdb->flags & TDB_CONVERT); + } + vp = (unsigned char *)&tdb->header.version; + vertest = (((u32)vp[0]) << 24) | (((u32)vp[1]) << 16) | + (((u32)vp[2]) << 8) | (u32)vp[3]; + tdb->flags |= (vertest==TDB_VERSION) ? TDB_BIGENDIAN : 0; + if (!rev) + tdb->flags &= ~TDB_CONVERT; + else { + tdb->flags |= TDB_CONVERT; + tdb_convert(&tdb->header, sizeof(tdb->header)); + } + if (fstat(tdb->fd, &st) == -1) + goto fail; + + if (tdb->header.rwlocks != 0) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: spinlocks no longer supported\n")); + goto fail; + } + + /* Is it already in the open list? If so, fail. */ + if (tdb_already_open(st.st_dev, st.st_ino)) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: " + "%s (%d,%d) is already open in this process\n", + name, (int)st.st_dev, (int)st.st_ino)); + errno = EBUSY; + goto fail; + } + + if (!(tdb->name = (char *)strdup(name))) { + errno = ENOMEM; + goto fail; + } + + tdb->map_size = st.st_size; + tdb->device = st.st_dev; + tdb->inode = st.st_ino; + tdb->max_dead_records = 0; + tdb_mmap(tdb); + if (locked) { + if (tdb->methods->tdb_brlock(tdb, ACTIVE_LOCK, F_UNLCK, F_SETLK, 0, 1) == -1) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: " + "failed to take ACTIVE_LOCK on %s: %s\n", + name, strerror(errno))); + goto fail; + } + + } + + /* We always need to do this if the CLEAR_IF_FIRST flag is set, even if + we didn't get the initial exclusive lock as we need to let all other + users know we're using it. */ + + if (tdb_flags & TDB_CLEAR_IF_FIRST) { + /* leave this lock in place to indicate it's in use */ + if (tdb->methods->tdb_brlock(tdb, ACTIVE_LOCK, F_RDLCK, F_SETLKW, 0, 1) == -1) + goto fail; + } + + /* if needed, run recovery */ + if (tdb_transaction_recover(tdb) == -1) { + goto fail; + } + + internal: + /* Internal (memory-only) databases skip all the code above to + * do with disk files, and resume here by releasing their + * global lock and hooking into the active list. */ + if (tdb->methods->tdb_brlock(tdb, GLOBAL_LOCK, F_UNLCK, F_SETLKW, 0, 1) == -1) + goto fail; + tdb->next = tdbs; + tdbs = tdb; + return tdb; + + fail: + { int save_errno = errno; + + if (!tdb) + return NULL; + + if (tdb->map_ptr) { + if (tdb->flags & TDB_INTERNAL) + SAFE_FREE(tdb->map_ptr); + else + tdb_munmap(tdb); + } + SAFE_FREE(tdb->name); + if (tdb->fd != -1) + if (close(tdb->fd) != 0) + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: failed to close tdb->fd on error!\n")); + SAFE_FREE(tdb); + errno = save_errno; + return NULL; + } +} + +/* + * Set the maximum number of dead records per hash chain + */ + +void tdb_set_max_dead(struct tdb_context *tdb, int max_dead) +{ + tdb->max_dead_records = max_dead; +} + +/** + * Close a database. + * + * @returns -1 for error; 0 for success. + **/ +int tdb_close(struct tdb_context *tdb) +{ + struct tdb_context **i; + int ret = 0; + + if (tdb->transaction) { + tdb_transaction_cancel(tdb); + } + + if (tdb->map_ptr) { + if (tdb->flags & TDB_INTERNAL) + SAFE_FREE(tdb->map_ptr); + else + tdb_munmap(tdb); + } + SAFE_FREE(tdb->name); + if (tdb->fd != -1) + ret = close(tdb->fd); + SAFE_FREE(tdb->lockrecs); + + /* Remove from contexts list */ + for (i = &tdbs; *i; i = &(*i)->next) { + if (*i == tdb) { + *i = tdb->next; + break; + } + } + + memset(tdb, 0, sizeof(*tdb)); + SAFE_FREE(tdb); + + return ret; +} + +/* register a logging function */ +void tdb_set_logging_function(struct tdb_context *tdb, + const struct tdb_logging_context *log_ctx) +{ + tdb->log = *log_ctx; +} + +void *tdb_get_logging_private(struct tdb_context *tdb) +{ + return tdb->log.log_private; +} + +/* reopen a tdb - this can be used after a fork to ensure that we have an independent + seek pointer from our parent and to re-establish locks */ +int tdb_reopen(struct tdb_context *tdb) +{ + struct stat st; + + if (tdb->flags & TDB_INTERNAL) { + return 0; /* Nothing to do. */ + } + + if (tdb->num_locks != 0 || tdb->global_lock.count) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_reopen: reopen not allowed with locks held\n")); + goto fail; + } + + if (tdb->transaction != 0) { + TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_reopen: reopen not allowed inside a transaction\n")); + goto fail; + } + + if (tdb_munmap(tdb) != 0) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: munmap failed (%s)\n", strerror(errno))); + goto fail; + } + if (close(tdb->fd) != 0) + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: WARNING closing tdb->fd failed!\n")); + tdb->fd = open(tdb->name, tdb->open_flags & ~(O_CREAT|O_TRUNC), 0); + if (tdb->fd == -1) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: open failed (%s)\n", strerror(errno))); + goto fail; + } + if ((tdb->flags & TDB_CLEAR_IF_FIRST) && + (tdb->methods->tdb_brlock(tdb, ACTIVE_LOCK, F_RDLCK, F_SETLKW, 0, 1) == -1)) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: failed to obtain active lock\n")); + goto fail; + } + if (fstat(tdb->fd, &st) != 0) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: fstat failed (%s)\n", strerror(errno))); + goto fail; + } + if (st.st_ino != tdb->inode || st.st_dev != tdb->device) { + TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: file dev/inode has changed!\n")); + goto fail; + } + tdb_mmap(tdb); + + return 0; + +fail: + tdb_close(tdb); + return -1; +} + +/* reopen all tdb's */ +int tdb_reopen_all(int parent_longlived) +{ + struct tdb_context *tdb; + + for (tdb=tdbs; tdb; tdb = tdb->next) { + /* + * If the parent is longlived (ie. a + * parent daemon architecture), we know + * it will keep it's active lock on a + * tdb opened with CLEAR_IF_FIRST. Thus + * for child processes we don't have to + * add an active lock. This is essential + * to improve performance on systems that + * keep POSIX locks as a non-scalable data + * structure in the kernel. + */ + if (parent_longlived) { + /* Ensure no clear-if-first. */ + tdb->flags &= ~TDB_CLEAR_IF_FIRST; + } + + if (tdb_reopen(tdb) != 0) + return -1; + } + + return 0; +} + +/** + * Flush a database file from the page cache. + **/ +int tdb_flush(struct tdb_context *tdb) +{ + if (tdb->fd != -1) + return fsync(tdb->fd); + return 0; +} diff --git a/lib/ext2fs/tdb.h b/lib/ext2fs/tdb.h new file mode 100644 index 0000000..de7aa33 --- /dev/null +++ b/lib/ext2fs/tdb.h @@ -0,0 +1,215 @@ +#ifndef __TDB_H__ +#define __TDB_H__ + +/* + Unix SMB/CIFS implementation. + + trivial database library + + Copyright (C) Andrew Tridgell 1999-2004 + + ** NOTE! The following LGPL license applies to the tdb + ** library. This does NOT imply that all of Samba is released + ** under the LGPL + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation; either + version 2 of the License, or (at your option) any later version. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifdef __cplusplus +extern "C" { +#endif + + +/* flags to tdb_store() */ +#define TDB_REPLACE 1 +#define TDB_INSERT 2 +#define TDB_MODIFY 3 + +/* flags for tdb_open() */ +#define TDB_DEFAULT 0 /* just a readability place holder */ +#define TDB_CLEAR_IF_FIRST 1 +#define TDB_INTERNAL 2 /* don't store on disk */ +#define TDB_NOLOCK 4 /* don't do any locking */ +#define TDB_NOMMAP 8 /* don't use mmap */ +#define TDB_CONVERT 16 /* convert endian (internal use) */ +#define TDB_BIGENDIAN 32 /* header is big-endian (internal use) */ +#define TDB_NOSYNC 64 /* don't use synchronous transactions */ +#define TDB_SEQNUM 128 /* maintain a sequence number */ + +#define TDB_ERRCODE(code, ret) ((tdb->ecode = (code)), ret) + +/* error codes */ +enum TDB_ERROR {TDB_SUCCESS=0, TDB_ERR_CORRUPT, TDB_ERR_IO, TDB_ERR_LOCK, + TDB_ERR_OOM, TDB_ERR_EXISTS, TDB_ERR_NOLOCK, TDB_ERR_LOCK_TIMEOUT, + TDB_ERR_NOEXIST, TDB_ERR_EINVAL, TDB_ERR_RDONLY}; + +/* debugging uses one of the following levels */ +enum tdb_debug_level {TDB_DEBUG_FATAL = 0, TDB_DEBUG_ERROR, + TDB_DEBUG_WARNING, TDB_DEBUG_TRACE}; + +typedef struct TDB_DATA { + unsigned char *dptr; + size_t dsize; +} TDB_DATA; + +#ifndef PRINTF_ATTRIBUTE +#if (__GNUC__ >= 3) +/** Use gcc attribute to check printf fns. a1 is the 1-based index of + * the parameter containing the format, and a2 the index of the first + * argument. Note that some gcc 2.x versions don't handle this + * properly **/ +#define PRINTF_ATTRIBUTE(a1, a2) __attribute__ ((format (__printf__, a1, a2))) +#else +#define PRINTF_ATTRIBUTE(a1, a2) +#endif +#endif + +/* ext2fs tdb renames */ +#define tdb_open ext2fs_tdb_open +#define tdb_open_ex ext2fs_tdb_open_ex +#define tdb_set_max_dead ext2fs_tdb_set_max_dead +#define tdb_reopen ext2fs_tdb_reopen +#define tdb_reopen_all ext2fs_tdb_reopen_all +#define tdb_set_logging_function ext2fs_tdb_set_logging_function +#define tdb_error ext2fs_tdb_error +#define tdb_errorstr ext2fs_tdb_errorstr +#define tdb_fetch ext2fs_tdb_fetch +#define tdb_parse_record ext2fs_tdb_parse_record +#define tdb_delete ext2fs_tdb_delete +#define tdb_store ext2fs_tdb_store +#define tdb_append ext2fs_tdb_append +#define tdb_close ext2fs_tdb_close +#define tdb_firstkey ext2fs_tdb_firstkey +#define tdb_nextkey ext2fs_tdb_nextkey +#define tdb_traverse ext2fs_tdb_traverse +#define tdb_traverse_read ext2fs_tdb_traverse_read +#define tdb_exists ext2fs_tdb_exists +#define tdb_lockall ext2fs_tdb_lockall +#define tdb_unlockall ext2fs_tdb_unlockall +#define tdb_lockall_read ext2fs_tdb_lockall_read +#define tdb_unlockall_read ext2fs_tdb_unlockall_read +#define tdb_name ext2fs_tdb_name +#define tdb_fd ext2fs_tdb_fd +#define tdb_log_fn ext2fs_tdb_log_fn +#define tdb_get_logging_private ext2fs_tdb_get_logging_private +#define tdb_transaction_start ext2fs_tdb_transaction_start +#define tdb_transaction_commit ext2fs_tdb_transaction_commit +#define tdb_transaction_cancel ext2fs_tdb_transaction_cancel +#define tdb_transaction_recover ext2fs_tdb_transaction_recover +#define tdb_get_seqnum ext2fs_tdb_get_seqnum +#define tdb_hash_size ext2fs_tdb_hash_size +#define tdb_map_size ext2fs_tdb_map_size +#define tdb_get_flags ext2fs_tdb_get_flags +#define tdb_chainlock ext2fs_tdb_chainlock +#define tdb_chainunlock ext2fs_tdb_chainunlock +#define tdb_chainlock_read ext2fs_tdb_chainlock_read +#define tdb_chainunlock_read ext2fs_tdb_chainunlock_read +#define tdb_dump_all ext2fs_tdb_dump_all +#define tdb_printfreelist ext2fs_tdb_printfreelist +#define tdb_validate_freelist ext2fs_tdb_validate_freelist +#define tdb_chainlock_mark ext2fs_tdb_chainlock_mark +#define tdb_chainlock_nonblock ext2fs_tdb_chainlock_nonblock +#define tdb_chainlock_unmark ext2fs_tdb_chainlock_unmark +#define tdb_enable_seqnum ext2fs_tdb_enable_seqnum +#define tdb_increment_seqnum_nonblock ext2fs_tdb_increment_seqnum_nonblock +#define tdb_lock_nonblock ext2fs_tdb_lock_nonblock +#define tdb_lockall_mark ext2fs_tdb_lockall_mark +#define tdb_lockall_nonblock ext2fs_tdb_lockall_nonblock +#define tdb_lockall_read_nonblock ext2fs_tdb_lockall_read_nonblock +#define tdb_lockall_unmark ext2fs_tdb_lockall_unmark +#define tdb_flush ext2fs_tdb_flush + +/* this is the context structure that is returned from a db open */ +typedef struct tdb_context TDB_CONTEXT; + +typedef int (*tdb_traverse_func)(struct tdb_context *, TDB_DATA, TDB_DATA, void *); +typedef void (*tdb_log_func)(struct tdb_context *, enum tdb_debug_level, const char *, ...) PRINTF_ATTRIBUTE(3, 4); +typedef unsigned int (*tdb_hash_func)(TDB_DATA *key); + +struct tdb_logging_context { + tdb_log_func log_fn; + void *log_private; +}; + +struct tdb_context *tdb_open(const char *name, int hash_size, int tdb_flags, + int open_flags, mode_t mode); +struct tdb_context *tdb_open_ex(const char *name, int hash_size, int tdb_flags, + int open_flags, mode_t mode, + const struct tdb_logging_context *log_ctx, + tdb_hash_func hash_fn); +void tdb_set_max_dead(struct tdb_context *tdb, int max_dead); + +int tdb_reopen(struct tdb_context *tdb); +int tdb_reopen_all(int parent_longlived); +void tdb_set_logging_function(struct tdb_context *tdb, const struct tdb_logging_context *log_ctx); +enum TDB_ERROR tdb_error(struct tdb_context *tdb); +const char *tdb_errorstr(struct tdb_context *tdb); +TDB_DATA tdb_fetch(struct tdb_context *tdb, TDB_DATA key); +int tdb_parse_record(struct tdb_context *tdb, TDB_DATA key, + int (*parser)(TDB_DATA key, TDB_DATA data, + void *private_data), + void *private_data); +int tdb_delete(struct tdb_context *tdb, TDB_DATA key); +int tdb_store(struct tdb_context *tdb, TDB_DATA key, TDB_DATA dbuf, int flag); +int tdb_append(struct tdb_context *tdb, TDB_DATA key, TDB_DATA new_dbuf); +int tdb_close(struct tdb_context *tdb); +TDB_DATA tdb_firstkey(struct tdb_context *tdb); +TDB_DATA tdb_nextkey(struct tdb_context *tdb, TDB_DATA key); +int tdb_traverse(struct tdb_context *tdb, tdb_traverse_func fn, void *); +int tdb_traverse_read(struct tdb_context *tdb, tdb_traverse_func fn, void *); +int tdb_exists(struct tdb_context *tdb, TDB_DATA key); +int tdb_lockall(struct tdb_context *tdb); +int tdb_lockall_nonblock(struct tdb_context *tdb); +int tdb_unlockall(struct tdb_context *tdb); +int tdb_lockall_read(struct tdb_context *tdb); +int tdb_lockall_read_nonblock(struct tdb_context *tdb); +int tdb_unlockall_read(struct tdb_context *tdb); +int tdb_lockall_mark(struct tdb_context *tdb); +int tdb_lockall_unmark(struct tdb_context *tdb); +const char *tdb_name(struct tdb_context *tdb); +int tdb_fd(struct tdb_context *tdb); +tdb_log_func tdb_log_fn(struct tdb_context *tdb); +void *tdb_get_logging_private(struct tdb_context *tdb); +int tdb_transaction_start(struct tdb_context *tdb); +int tdb_transaction_commit(struct tdb_context *tdb); +int tdb_transaction_cancel(struct tdb_context *tdb); +int tdb_transaction_recover(struct tdb_context *tdb); +int tdb_get_seqnum(struct tdb_context *tdb); +int tdb_hash_size(struct tdb_context *tdb); +size_t tdb_map_size(struct tdb_context *tdb); +int tdb_get_flags(struct tdb_context *tdb); +void tdb_enable_seqnum(struct tdb_context *tdb); +void tdb_increment_seqnum_nonblock(struct tdb_context *tdb); +int tdb_flush(struct tdb_context *tdb); + +/* Low level locking functions: use with care */ +int tdb_chainlock(struct tdb_context *tdb, TDB_DATA key); +int tdb_chainlock_nonblock(struct tdb_context *tdb, TDB_DATA key); +int tdb_chainunlock(struct tdb_context *tdb, TDB_DATA key); +int tdb_chainlock_read(struct tdb_context *tdb, TDB_DATA key); +int tdb_chainunlock_read(struct tdb_context *tdb, TDB_DATA key); +int tdb_chainlock_mark(struct tdb_context *tdb, TDB_DATA key); +int tdb_chainlock_unmark(struct tdb_context *tdb, TDB_DATA key); + +/* Debug functions. Not used in production. */ +void tdb_dump_all(struct tdb_context *tdb); +int tdb_printfreelist(struct tdb_context *tdb); +int tdb_validate_freelist(struct tdb_context *tdb, int *pnum_entries); + +#ifdef __cplusplus +} +#endif + +#endif /* tdb.h */ diff --git a/lib/ext2fs/tdb/build-tdb b/lib/ext2fs/tdb/build-tdb new file mode 100755 index 0000000..1cc18f7 --- /dev/null +++ b/lib/ext2fs/tdb/build-tdb @@ -0,0 +1,34 @@ +#!/bin/sh +# +# This file creates a stand-alone TDB based on a set of sources from +# Samba + +#BASE_DIR=/usr/projects/samba/samba-4.0.0tp4/source/lib/tdb +BASE_DIR=/usr/projects/samba/tdb + +rm -rf .pc + +FILES="error.c lock.c io.c transaction.c freelist.c \ + freelistcheck.c traverse.c dump.c tdb.c open.c" + +(cd $BASE_DIR/common; svn info ) > .svninfo +echo "/*" > tdb.c +grep ^URL .svninfo >> tdb.c +grep "^Last Changed Rev" .svninfo | sed -e 's/Last Changed //' >> tdb.c +grep "^Last Changed Date" .svninfo >> tdb.c +echo "*/" >> tdb.c + +cat $BASE_DIR/common/tdb_private.h >> tdb.c +for i in $FILES; do + if [ `tail -n 1 tdb.c | wc -c` -gt 1 ]; then + printf "\n" >> tdb.c + fi + echo "/* file: $i */" >> tdb.c + sed -e '1,/#include "tdb_private.h"/d' < $BASE_DIR/common/$i >> tdb.c +done + +cp $BASE_DIR/include/tdb.h . +cp $BASE_DIR/tools/tdbtool.c . + +quilt push -a + diff --git a/lib/ext2fs/tdb/patches/copyright b/lib/ext2fs/tdb/patches/copyright new file mode 100644 index 0000000..d9d1d84 --- /dev/null +++ b/lib/ext2fs/tdb/patches/copyright @@ -0,0 +1,20 @@ +Index: tdbsa/tdb.c +=================================================================== +--- tdbsa.orig/tdb.c ++++ tdbsa/tdb.c +@@ -4,11 +4,11 @@ Rev: 23371 + Last Changed Date: 2007-06-06 20:14:06 -0400 (Wed, 06 Jun 2007) + */ + /* +- Unix SMB/CIFS implementation. ++ trivial database library - standalone version + +- trivial database library - private includes +- +- Copyright (C) Andrew Tridgell 2005 ++ Copyright (C) Andrew Tridgell 1999-2005 ++ Copyright (C) Jeremy Allison 2000-2006 ++ Copyright (C) Paul `Rusty' Russell 2000 + + ** NOTE! The following LGPL license applies to the tdb + ** library. This does NOT imply that all of Samba is released diff --git a/lib/ext2fs/tdb/patches/ext2tdb-rename b/lib/ext2fs/tdb/patches/ext2tdb-rename new file mode 100644 index 0000000..15bf085 --- /dev/null +++ b/lib/ext2fs/tdb/patches/ext2tdb-rename @@ -0,0 +1,65 @@ +Index: tdb/tdb.h +=================================================================== +--- tdb.orig/tdb.h ++++ tdb/tdb.h +@@ -76,6 +76,60 @@ typedef struct TDB_DATA { + #endif + #endif + ++/* ext2fs tdb renames */ ++#define tdb_open ext2fs_tdb_open ++#define tdb_open_ex ext2fs_tdb_open_ex ++#define tdb_set_max_dead ext2fs_tdb_set_max_dead ++#define tdb_reopen ext2fs_tdb_reopen ++#define tdb_reopen_all ext2fs_tdb_reopen_all ++#define tdb_set_logging_function ext2fs_tdb_set_logging_function ++#define tdb_error ext2fs_tdb_error ++#define tdb_errorstr ext2fs_tdb_errorstr ++#define tdb_fetch ext2fs_tdb_fetch ++#define tdb_parse_record ext2fs_tdb_parse_record ++#define tdb_delete ext2fs_tdb_delete ++#define tdb_store ext2fs_tdb_store ++#define tdb_append ext2fs_tdb_append ++#define tdb_close ext2fs_tdb_close ++#define tdb_firstkey ext2fs_tdb_firstkey ++#define tdb_nextkey ext2fs_tdb_nextkey ++#define tdb_traverse ext2fs_tdb_traverse ++#define tdb_traverse_read ext2fs_tdb_traverse_read ++#define tdb_exists ext2fs_tdb_exists ++#define tdb_lockall ext2fs_tdb_lockall ++#define tdb_unlockall ext2fs_tdb_unlockall ++#define tdb_lockall_read ext2fs_tdb_lockall_read ++#define tdb_unlockall_read ext2fs_tdb_unlockall_read ++#define tdb_name ext2fs_tdb_name ++#define tdb_fd ext2fs_tdb_fd ++#define tdb_log_fn ext2fs_tdb_log_fn ++#define tdb_get_logging_private ext2fs_tdb_get_logging_private ++#define tdb_transaction_start ext2fs_tdb_transaction_start ++#define tdb_transaction_commit ext2fs_tdb_transaction_commit ++#define tdb_transaction_cancel ext2fs_tdb_transaction_cancel ++#define tdb_transaction_recover ext2fs_tdb_transaction_recover ++#define tdb_get_seqnum ext2fs_tdb_get_seqnum ++#define tdb_hash_size ext2fs_tdb_hash_size ++#define tdb_map_size ext2fs_tdb_map_size ++#define tdb_get_flags ext2fs_tdb_get_flags ++#define tdb_chainlock ext2fs_tdb_chainlock ++#define tdb_chainunlock ext2fs_tdb_chainunlock ++#define tdb_chainlock_read ext2fs_tdb_chainlock_read ++#define tdb_chainunlock_read ext2fs_tdb_chainunlock_read ++#define tdb_dump_all ext2fs_tdb_dump_all ++#define tdb_printfreelist ext2fs_tdb_printfreelist ++#define tdb_validate_freelist ext2fs_tdb_validate_freelist ++#define tdb_chainlock_mark ext2fs_tdb_chainlock_mark ++#define tdb_chainlock_nonblock ext2fs_tdb_chainlock_nonblock ++#define tdb_chainlock_unmark ext2fs_tdb_chainlock_unmark ++#define tdb_enable_seqnum ext2fs_tdb_enable_seqnum ++#define tdb_increment_seqnum_nonblock ext2fs_tdb_increment_seqnum_nonblock ++#define tdb_lock_nonblock ext2fs_tdb_lock_nonblock ++#define tdb_lockall_mark ext2fs_tdb_lockall_mark ++#define tdb_lockall_nonblock ext2fs_tdb_lockall_nonblock ++#define tdb_lockall_read_nonblock ext2fs_tdb_lockall_read_nonblock ++#define tdb_lockall_unmark ext2fs_tdb_lockall_unmark ++ + /* this is the context structure that is returned from a db open */ + typedef struct tdb_context TDB_CONTEXT; + diff --git a/lib/ext2fs/tdb/patches/replace-includes b/lib/ext2fs/tdb/patches/replace-includes new file mode 100644 index 0000000..f4181c1 --- /dev/null +++ b/lib/ext2fs/tdb/patches/replace-includes @@ -0,0 +1,92 @@ +Index: tdb/tdb.c +=================================================================== +--- tdb.orig/tdb.c ++++ tdb/tdb.c +@@ -29,11 +29,82 @@ Last Changed Date: 2007-06-22 13:36:10 - + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + */ + +-#include "replace.h" +-#include "system/filesys.h" +-#include "system/time.h" +-#include "system/shmem.h" +-#include "system/select.h" ++#ifdef CONFIG_STAND_ALONE ++#define HAVE_MMAP ++#define HAVE_STRDUP ++#define HAVE_SYS_MMAN_H ++#define HAVE_UTIME_H ++#define HAVE_UTIME ++#endif ++#define _XOPEN_SOURCE 500 ++ ++#include <unistd.h> ++#include <stdio.h> ++#include <stdlib.h> ++#include <stdarg.h> ++#include <stddef.h> ++#include <errno.h> ++#include <string.h> ++#ifdef HAVE_SYS_SELECT_H ++#include <sys/select.h> ++#endif ++#include <sys/time.h> ++#include <sys/types.h> ++#include <time.h> ++#ifdef HAVE_UTIME_H ++#include <utime.h> ++#endif ++#include <sys/stat.h> ++#include <sys/file.h> ++#include <fcntl.h> ++ ++#ifdef HAVE_SYS_MMAN_H ++#include <sys/mman.h> ++#endif ++ ++#ifndef MAP_FILE ++#define MAP_FILE 0 ++#endif ++ ++#ifndef MAP_FAILED ++#define MAP_FAILED ((void *)-1) ++#endif ++ ++#ifndef HAVE_STRDUP ++#define strdup rep_strdup ++static char *rep_strdup(const char *s) ++{ ++ char *ret; ++ int length; ++ if (!s) ++ return NULL; ++ ++ if (!length) ++ length = strlen(s); ++ ++ ret = malloc(length + 1); ++ if (ret) { ++ strncpy(ret, s, length); ++ ret[length] = '\0'; ++ } ++ return ret; ++} ++#endif ++ ++#ifndef PRINTF_ATTRIBUTE ++#if (__GNUC__ >= 3) && (__GNUC_MINOR__ >= 1 ) ++/** Use gcc attribute to check printf fns. a1 is the 1-based index of ++ * the parameter containing the format, and a2 the index of the first ++ * argument. Note that some gcc 2.x versions don't handle this ++ * properly **/ ++#define PRINTF_ATTRIBUTE(a1, a2) __attribute__ ((format (__printf__, a1, a2))) ++#else ++#define PRINTF_ATTRIBUTE(a1, a2) ++#endif ++#endif ++ ++typedef int bool; ++ + #include "tdb.h" + + #ifndef u32 diff --git a/lib/ext2fs/tdb/patches/series b/lib/ext2fs/tdb/patches/series new file mode 100644 index 0000000..722b921 --- /dev/null +++ b/lib/ext2fs/tdb/patches/series @@ -0,0 +1,6 @@ +copyright +replace-includes +static-prototypes +static-functions +tdbtool-includes +ext2tdb-rename diff --git a/lib/ext2fs/tdb/patches/static-functions b/lib/ext2fs/tdb/patches/static-functions new file mode 100644 index 0000000..ab0fbef --- /dev/null +++ b/lib/ext2fs/tdb/patches/static-functions @@ -0,0 +1,13 @@ +Index: tdbsa/tdb.c +=================================================================== +--- tdbsa.orig/tdb.c ++++ tdbsa/tdb.c +@@ -2254,7 +2254,7 @@ int tdb_transaction_recover(struct tdb_c + /* file: freelist.c */ + + /* read a freelist record and check for simple errors */ +-int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off, struct list_struct *rec) ++static int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off, struct list_struct *rec) + { + if (tdb->methods->tdb_read(tdb, off, rec, sizeof(*rec),DOCONV()) == -1) + return -1; diff --git a/lib/ext2fs/tdb/patches/static-prototypes b/lib/ext2fs/tdb/patches/static-prototypes new file mode 100644 index 0000000..cf8af61 --- /dev/null +++ b/lib/ext2fs/tdb/patches/static-prototypes @@ -0,0 +1,72 @@ +Index: tdbsa/tdb.c +=================================================================== +--- tdbsa.orig/tdb.c ++++ tdbsa/tdb.c +@@ -251,39 +251,39 @@ struct tdb_context { + /* + internal prototypes + */ +-int tdb_munmap(struct tdb_context *tdb); +-void tdb_mmap(struct tdb_context *tdb); +-int tdb_lock(struct tdb_context *tdb, int list, int ltype); +-int tdb_unlock(struct tdb_context *tdb, int list, int ltype); +-int tdb_brlock(struct tdb_context *tdb, tdb_off_t offset, int rw_type, int lck_type, int probe, size_t len); +-int tdb_transaction_lock(struct tdb_context *tdb, int ltype); +-int tdb_transaction_unlock(struct tdb_context *tdb); +-int tdb_brlock_upgrade(struct tdb_context *tdb, tdb_off_t offset, size_t len); +-int tdb_write_lock_record(struct tdb_context *tdb, tdb_off_t off); +-int tdb_write_unlock_record(struct tdb_context *tdb, tdb_off_t off); +-int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); +-int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); +-void *tdb_convert(void *buf, u32 size); +-int tdb_free(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec); +-tdb_off_t tdb_allocate(struct tdb_context *tdb, tdb_len_t length, struct list_struct *rec); +-int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); +-int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); +-int tdb_lock_record(struct tdb_context *tdb, tdb_off_t off); +-int tdb_unlock_record(struct tdb_context *tdb, tdb_off_t off); +-int tdb_rec_read(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec); +-int tdb_rec_write(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec); +-int tdb_do_delete(struct tdb_context *tdb, tdb_off_t rec_ptr, struct list_struct *rec); +-unsigned char *tdb_alloc_read(struct tdb_context *tdb, tdb_off_t offset, tdb_len_t len); +-int tdb_parse_data(struct tdb_context *tdb, TDB_DATA key, ++static int tdb_munmap(struct tdb_context *tdb); ++static void tdb_mmap(struct tdb_context *tdb); ++static int tdb_lock(struct tdb_context *tdb, int list, int ltype); ++static int tdb_unlock(struct tdb_context *tdb, int list, int ltype); ++static int tdb_brlock(struct tdb_context *tdb, tdb_off_t offset, int rw_type, int lck_type, int probe, size_t len); ++static int tdb_transaction_lock(struct tdb_context *tdb, int ltype); ++static int tdb_transaction_unlock(struct tdb_context *tdb); ++static int tdb_brlock_upgrade(struct tdb_context *tdb, tdb_off_t offset, size_t len); ++static int tdb_write_lock_record(struct tdb_context *tdb, tdb_off_t off); ++static int tdb_write_unlock_record(struct tdb_context *tdb, tdb_off_t off); ++static int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); ++static int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); ++static void *tdb_convert(void *buf, u32 size); ++static int tdb_free(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec); ++static tdb_off_t tdb_allocate(struct tdb_context *tdb, tdb_len_t length, struct list_struct *rec); ++static int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); ++static int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d); ++static int tdb_lock_record(struct tdb_context *tdb, tdb_off_t off); ++static int tdb_unlock_record(struct tdb_context *tdb, tdb_off_t off); ++static int tdb_rec_read(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec); ++static int tdb_rec_write(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec); ++static int tdb_do_delete(struct tdb_context *tdb, tdb_off_t rec_ptr, struct list_struct *rec); ++static unsigned char *tdb_alloc_read(struct tdb_context *tdb, tdb_off_t offset, tdb_len_t len); ++static int tdb_parse_data(struct tdb_context *tdb, TDB_DATA key, + tdb_off_t offset, tdb_len_t len, + int (*parser)(TDB_DATA key, TDB_DATA data, + void *private_data), + void *private_data); +-tdb_off_t tdb_find_lock_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash, int locktype, ++static tdb_off_t tdb_find_lock_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash, int locktype, + struct list_struct *rec); +-void tdb_io_init(struct tdb_context *tdb); +-int tdb_expand(struct tdb_context *tdb, tdb_off_t size); +-int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off, ++static void tdb_io_init(struct tdb_context *tdb); ++static int tdb_expand(struct tdb_context *tdb, tdb_off_t size); ++static int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off, + struct list_struct *rec); + + diff --git a/lib/ext2fs/tdb/patches/tdbtool-includes b/lib/ext2fs/tdb/patches/tdbtool-includes new file mode 100644 index 0000000..c076c79 --- /dev/null +++ b/lib/ext2fs/tdb/patches/tdbtool-includes @@ -0,0 +1,30 @@ +Index: tdbsa/tdbtool.c +=================================================================== +--- tdbsa.orig/tdbtool.c ++++ tdbsa/tdbtool.c +@@ -21,10 +21,21 @@ + Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. + */ + +-#include "replace.h" +-#include "system/locale.h" +-#include "system/time.h" +-#include "system/filesys.h" ++#include <errno.h> ++#include <stdlib.h> ++#include <stdio.h> ++#include <fcntl.h> ++#include <unistd.h> ++#include <string.h> ++#include <fcntl.h> ++#include <time.h> ++#include <sys/mman.h> ++#include <sys/stat.h> ++#include <sys/time.h> ++#include <ctype.h> ++#include <signal.h> ++#include <stdarg.h> ++ + #include "tdb.h" + + static int do_command(void); diff --git a/lib/ext2fs/tdbtool.c b/lib/ext2fs/tdbtool.c new file mode 100644 index 0000000..eeac0c8 --- /dev/null +++ b/lib/ext2fs/tdbtool.c @@ -0,0 +1,621 @@ +/* + Unix SMB/CIFS implementation. + Samba database functions + Copyright (C) Andrew Tridgell 1999-2000 + Copyright (C) Paul `Rusty' Russell 2000 + Copyright (C) Jeremy Allison 2000 + Copyright (C) Andrew Esh 2001 + + This program is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation; either version 2 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program; if not, write to the Free Software + Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. +*/ + +#include "config.h" +#include <errno.h> +#include <stdlib.h> +#include <stdio.h> +#include <fcntl.h> +#include <unistd.h> +#include <string.h> +#include <fcntl.h> +#include <time.h> +#include <sys/mman.h> +#include <sys/stat.h> +#include <sys/time.h> +#include <ctype.h> +#include <signal.h> +#include <stdarg.h> + +#include "tdb.h" + +static int do_command(void); +const char *cmdname; +char *arg1, *arg2; +size_t arg1len, arg2len; +int bIterate = 0; +char *line; +TDB_DATA iterate_kbuf; +char cmdline[1024]; + +enum commands { + CMD_CREATE_TDB, + CMD_OPEN_TDB, + CMD_ERASE, + CMD_DUMP, + CMD_INSERT, + CMD_MOVE, + CMD_STORE, + CMD_SHOW, + CMD_KEYS, + CMD_HEXKEYS, + CMD_DELETE, + CMD_LIST_HASH_FREE, + CMD_LIST_FREE, + CMD_INFO, + CMD_FIRST, + CMD_NEXT, + CMD_SYSTEM, + CMD_QUIT, + CMD_HELP +}; + +typedef struct { + const char *name; + enum commands cmd; +} COMMAND_TABLE; + +COMMAND_TABLE cmd_table[] = { + {"create", CMD_CREATE_TDB}, + {"open", CMD_OPEN_TDB}, + {"erase", CMD_ERASE}, + {"dump", CMD_DUMP}, + {"insert", CMD_INSERT}, + {"move", CMD_MOVE}, + {"store", CMD_STORE}, + {"show", CMD_SHOW}, + {"keys", CMD_KEYS}, + {"hexkeys", CMD_HEXKEYS}, + {"delete", CMD_DELETE}, + {"list", CMD_LIST_HASH_FREE}, + {"free", CMD_LIST_FREE}, + {"info", CMD_INFO}, + {"first", CMD_FIRST}, + {"1", CMD_FIRST}, + {"next", CMD_NEXT}, + {"n", CMD_NEXT}, + {"quit", CMD_QUIT}, + {"q", CMD_QUIT}, + {"!", CMD_SYSTEM}, + {NULL, CMD_HELP} +}; + +/* a tdb tool for manipulating a tdb database */ + +static TDB_CONTEXT *tdb; + +static int print_rec(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state); +static int print_key(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state); +static int print_hexkey(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state); + +static void print_asc(const char *buf,int len) +{ + int i; + + /* We're probably printing ASCII strings so don't try to display + the trailing NULL character. */ + + if (buf[len - 1] == 0) + len--; + + for (i=0;i<len;i++) + printf("%c",isprint(buf[i])?buf[i]:'.'); +} + +static void print_data(const char *buf,int len) +{ + int i=0; + if (len<=0) return; + printf("[%03X] ",i); + for (i=0;i<len;) { + printf("%02X ",(int)buf[i]); + i++; + if (i%8 == 0) printf(" "); + if (i%16 == 0) { + print_asc(&buf[i-16],8); printf(" "); + print_asc(&buf[i-8],8); printf("\n"); + if (i<len) printf("[%03X] ",i); + } + } + if (i%16) { + int n; + + n = 16 - (i%16); + printf(" "); + if (n>8) printf(" "); + while (n--) printf(" "); + + n = i%16; + if (n > 8) n = 8; + print_asc(&buf[i-(i%16)],n); printf(" "); + n = (i%16) - n; + if (n>0) print_asc(&buf[i-n],n); + printf("\n"); + } +} + +static void help(void) +{ + printf("\n" +"tdbtool: \n" +" create dbname : create a database\n" +" open dbname : open an existing database\n" +" erase : erase the database\n" +" dump : dump the database as strings\n" +" keys : dump the database keys as strings\n" +" hexkeys : dump the database keys as hex values\n" +" info : print summary info about the database\n" +" insert key data : insert a record\n" +" move key file : move a record to a destination tdb\n" +" store key data : store a record (replace)\n" +" show key : show a record by key\n" +" delete key : delete a record by key\n" +" list : print the database hash table and freelist\n" +" free : print the database freelist\n" +" ! command : execute system command\n" +" 1 | first : print the first record\n" +" n | next : print the next record\n" +" q | quit : terminate\n" +" \\n : repeat 'next' command\n" +"\n"); +} + +static void terror(const char *why) +{ + printf("%s\n", why); +} + +static void create_tdb(const char *tdbname) +{ + if (tdb) tdb_close(tdb); + tdb = tdb_open(tdbname, 0, TDB_CLEAR_IF_FIRST, + O_RDWR | O_CREAT | O_TRUNC, 0600); + if (!tdb) { + printf("Could not create %s: %s\n", tdbname, strerror(errno)); + } +} + +static void open_tdb(const char *tdbname) +{ + if (tdb) tdb_close(tdb); + tdb = tdb_open(tdbname, 0, 0, O_RDWR, 0600); + if (!tdb) { + printf("Could not open %s: %s\n", tdbname, strerror(errno)); + } +} + +static void insert_tdb(char *keyname, size_t keylen, char* data, size_t datalen) +{ + TDB_DATA key, dbuf; + + if ((keyname == NULL) || (keylen == 0)) { + terror("need key"); + return; + } + + key.dptr = (unsigned char *)keyname; + key.dsize = keylen; + dbuf.dptr = (unsigned char *)data; + dbuf.dsize = datalen; + + if (tdb_store(tdb, key, dbuf, TDB_INSERT) == -1) { + terror("insert failed"); + } +} + +static void store_tdb(char *keyname, size_t keylen, char* data, size_t datalen) +{ + TDB_DATA key, dbuf; + + if ((keyname == NULL) || (keylen == 0)) { + terror("need key"); + return; + } + + if ((data == NULL) || (datalen == 0)) { + terror("need data"); + return; + } + + key.dptr = (unsigned char *)keyname; + key.dsize = keylen; + dbuf.dptr = (unsigned char *)data; + dbuf.dsize = datalen; + + printf("Storing key:\n"); + print_rec(tdb, key, dbuf, NULL); + + if (tdb_store(tdb, key, dbuf, TDB_REPLACE) == -1) { + terror("store failed"); + } +} + +static void show_tdb(char *keyname, size_t keylen) +{ + TDB_DATA key, dbuf; + + if ((keyname == NULL) || (keylen == 0)) { + terror("need key"); + return; + } + + key.dptr = (unsigned char *)keyname; + key.dsize = keylen; + + dbuf = tdb_fetch(tdb, key); + if (!dbuf.dptr) { + terror("fetch failed"); + return; + } + + print_rec(tdb, key, dbuf, NULL); + + free( dbuf.dptr ); + + return; +} + +static void delete_tdb(char *keyname, size_t keylen) +{ + TDB_DATA key; + + if ((keyname == NULL) || (keylen == 0)) { + terror("need key"); + return; + } + + key.dptr = (unsigned char *)keyname; + key.dsize = keylen; + + if (tdb_delete(tdb, key) != 0) { + terror("delete failed"); + } +} + +static void move_rec(char *keyname, size_t keylen, char* tdbname) +{ + TDB_DATA key, dbuf; + TDB_CONTEXT *dst_tdb; + + if ((keyname == NULL) || (keylen == 0)) { + terror("need key"); + return; + } + + if ( !tdbname ) { + terror("need destination tdb name"); + return; + } + + key.dptr = (unsigned char *)keyname; + key.dsize = keylen; + + dbuf = tdb_fetch(tdb, key); + if (!dbuf.dptr) { + terror("fetch failed"); + return; + } + + print_rec(tdb, key, dbuf, NULL); + + dst_tdb = tdb_open(tdbname, 0, 0, O_RDWR, 0600); + if ( !dst_tdb ) { + terror("unable to open destination tdb"); + return; + } + + if ( tdb_store( dst_tdb, key, dbuf, TDB_REPLACE ) == -1 ) { + terror("failed to move record"); + } + else + printf("record moved\n"); + + tdb_close( dst_tdb ); + + return; +} + +static int print_rec(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state) +{ + printf("\nkey %d bytes\n", (int)key.dsize); + print_asc((const char *)key.dptr, key.dsize); + printf("\ndata %d bytes\n", (int)dbuf.dsize); + print_data((const char *)dbuf.dptr, dbuf.dsize); + return 0; +} + +static int print_key(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state) +{ + printf("key %d bytes: ", (int)key.dsize); + print_asc((const char *)key.dptr, key.dsize); + printf("\n"); + return 0; +} + +static int print_hexkey(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state) +{ + printf("key %d bytes\n", (int)key.dsize); + print_data((const char *)key.dptr, key.dsize); + printf("\n"); + return 0; +} + +static int total_bytes; + +static int traverse_fn(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state) +{ + total_bytes += dbuf.dsize; + return 0; +} + +static void info_tdb(void) +{ + int count; + total_bytes = 0; + if ((count = tdb_traverse(tdb, traverse_fn, NULL)) == -1) + printf("Error = %s\n", tdb_errorstr(tdb)); + else + printf("%d records totalling %d bytes\n", count, total_bytes); +} + +static char *tdb_getline(const char *prompt) +{ + static char thisline[1024]; + char *p; + fputs(prompt, stdout); + thisline[0] = 0; + p = fgets(thisline, sizeof(thisline)-1, stdin); + if (p) p = strchr(p, '\n'); + if (p) *p = 0; + return p?thisline:NULL; +} + +static int do_delete_fn(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, + void *state) +{ + return tdb_delete(the_tdb, key); +} + +static void first_record(TDB_CONTEXT *the_tdb, TDB_DATA *pkey) +{ + TDB_DATA dbuf; + *pkey = tdb_firstkey(the_tdb); + + dbuf = tdb_fetch(the_tdb, *pkey); + if (!dbuf.dptr) terror("fetch failed"); + else { + print_rec(the_tdb, *pkey, dbuf, NULL); + } +} + +static void next_record(TDB_CONTEXT *the_tdb, TDB_DATA *pkey) +{ + TDB_DATA dbuf; + *pkey = tdb_nextkey(the_tdb, *pkey); + + dbuf = tdb_fetch(the_tdb, *pkey); + if (!dbuf.dptr) + terror("fetch failed"); + else + print_rec(the_tdb, *pkey, dbuf, NULL); +} + +static int do_command(void) +{ + COMMAND_TABLE *ctp = cmd_table; + enum commands mycmd = CMD_HELP; + int cmd_len; + + if (cmdname && strlen(cmdname) == 0) { + mycmd = CMD_NEXT; + } else { + while (ctp->name) { + cmd_len = strlen(ctp->name); + if (strncmp(ctp->name,cmdname,cmd_len) == 0) { + mycmd = ctp->cmd; + break; + } + ctp++; + } + } + + switch (mycmd) { + case CMD_CREATE_TDB: + bIterate = 0; + create_tdb(arg1); + return 0; + case CMD_OPEN_TDB: + bIterate = 0; + open_tdb(arg1); + return 0; + case CMD_SYSTEM: + /* Shell command */ + system(arg1); + return 0; + case CMD_QUIT: + return 1; + default: + /* all the rest require a open database */ + if (!tdb) { + bIterate = 0; + terror("database not open"); + help(); + return 0; + } + switch (mycmd) { + case CMD_ERASE: + bIterate = 0; + tdb_traverse(tdb, do_delete_fn, NULL); + return 0; + case CMD_DUMP: + bIterate = 0; + tdb_traverse(tdb, print_rec, NULL); + return 0; + case CMD_INSERT: + bIterate = 0; + insert_tdb(arg1, arg1len,arg2,arg2len); + return 0; + case CMD_MOVE: + bIterate = 0; + move_rec(arg1,arg1len,arg2); + return 0; + case CMD_STORE: + bIterate = 0; + store_tdb(arg1,arg1len,arg2,arg2len); + return 0; + case CMD_SHOW: + bIterate = 0; + show_tdb(arg1, arg1len); + return 0; + case CMD_KEYS: + tdb_traverse(tdb, print_key, NULL); + return 0; + case CMD_HEXKEYS: + tdb_traverse(tdb, print_hexkey, NULL); + return 0; + case CMD_DELETE: + bIterate = 0; + delete_tdb(arg1,arg1len); + return 0; + case CMD_LIST_HASH_FREE: + tdb_dump_all(tdb); + return 0; + case CMD_LIST_FREE: + tdb_printfreelist(tdb); + return 0; + case CMD_INFO: + info_tdb(); + return 0; + case CMD_FIRST: + bIterate = 1; + first_record(tdb, &iterate_kbuf); + return 0; + case CMD_NEXT: + if (bIterate) + next_record(tdb, &iterate_kbuf); + return 0; + case CMD_HELP: + help(); + return 0; + case CMD_CREATE_TDB: + case CMD_OPEN_TDB: + case CMD_SYSTEM: + case CMD_QUIT: + /* + * unhandled commands. cases included here to avoid compiler + * warnings. + */ + return 0; + } + } + + return 0; +} + +static char *convert_string(char *instring, size_t *sizep) +{ + size_t length = 0; + char *outp, *inp; + char temp[3]; + + + outp = inp = instring; + + while (*inp) { + if (*inp == '\\') { + inp++; + if (*inp && strchr("0123456789abcdefABCDEF",(int)*inp)) { + temp[0] = *inp++; + temp[1] = '\0'; + if (*inp && strchr("0123456789abcdefABCDEF",(int)*inp)) { + temp[1] = *inp++; + temp[2] = '\0'; + } + *outp++ = (char)strtol((const char *)temp,NULL,16); + } else { + *outp++ = *inp++; + } + } else { + *outp++ = *inp++; + } + length++; + } + *sizep = length; + return instring; +} + +int main(int argc, char *argv[]) +{ + cmdname = ""; + arg1 = NULL; + arg1len = 0; + arg2 = NULL; + arg2len = 0; + + if (argv[1]) { + cmdname = "open"; + arg1 = argv[1]; + do_command(); + cmdname = ""; + arg1 = NULL; + } + + switch (argc) { + case 1: + case 2: + /* Interactive mode */ + while ((cmdname = tdb_getline("tdb> "))) { + arg2 = arg1 = NULL; + if ((arg1 = strchr((const char *)cmdname,' ')) != NULL) { + arg1++; + arg2 = arg1; + while (*arg2) { + if (*arg2 == ' ') { + *arg2++ = '\0'; + break; + } + if ((*arg2++ == '\\') && (*arg2 == ' ')) { + arg2++; + } + } + } + if (arg1) arg1 = convert_string(arg1,&arg1len); + if (arg2) arg2 = convert_string(arg2,&arg2len); + if (do_command()) break; + } + break; + case 5: + arg2 = convert_string(argv[4],&arg2len); + case 4: + arg1 = convert_string(argv[3],&arg1len); + case 3: + cmdname = argv[2]; + default: + do_command(); + break; + } + + if (tdb) tdb_close(tdb); + + return 0; +} diff --git a/lib/ext2fs/test_io.c b/lib/ext2fs/test_io.c new file mode 100644 index 0000000..6843edb --- /dev/null +++ b/lib/ext2fs/test_io.c @@ -0,0 +1,557 @@ +/* + * test_io.c --- This is the Test I/O interface. + * + * Copyright (C) 1996 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#ifdef HAVE_SYS_PRCTL_H +#include <sys/prctl.h> +#else +#define PR_GET_DUMPABLE 3 +#endif +#if (!defined(HAVE_PRCTL) && defined(linux)) +#include <sys/syscall.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +/* + * For checking structure magic numbers... + */ + +#define EXT2_CHECK_MAGIC(struct, code) \ + if ((struct)->magic != (code)) return (code) + +struct test_private_data { + int magic; + io_channel real; + int flags; + FILE *outfile; + unsigned long block; + int read_abort_count, write_abort_count; + void (*read_blk)(unsigned long block, int count, errcode_t err); + void (*write_blk)(unsigned long block, int count, errcode_t err); + void (*set_blksize)(int blksize, errcode_t err); + void (*write_byte)(unsigned long block, int count, errcode_t err); + void (*read_blk64)(unsigned long long block, int count, errcode_t err); + void (*write_blk64)(unsigned long long block, int count, errcode_t err); +}; + +/* + * These global variable can be set by the test program as + * necessary *before* calling test_open + */ +io_manager test_io_backing_manager = 0; +void (*test_io_cb_read_blk) + (unsigned long block, int count, errcode_t err) = 0; +void (*test_io_cb_write_blk) + (unsigned long block, int count, errcode_t err) = 0; +void (*test_io_cb_read_blk64) + (unsigned long long block, int count, errcode_t err) = 0; +void (*test_io_cb_write_blk64) + (unsigned long long block, int count, errcode_t err) = 0; +void (*test_io_cb_set_blksize) + (int blksize, errcode_t err) = 0; +void (*test_io_cb_write_byte) + (unsigned long block, int count, errcode_t err) = 0; + +/* + * Test flags + */ +#define TEST_FLAG_READ 0x01 +#define TEST_FLAG_WRITE 0x02 +#define TEST_FLAG_SET_BLKSIZE 0x04 +#define TEST_FLAG_FLUSH 0x08 +#define TEST_FLAG_DUMP 0x10 +#define TEST_FLAG_SET_OPTION 0x20 +#define TEST_FLAG_DISCARD 0x40 +#define TEST_FLAG_READAHEAD 0x80 +#define TEST_FLAG_ZEROOUT 0x100 + +static void test_dump_block(io_channel channel, + struct test_private_data *data, + unsigned long block, const void *buf) +{ + const unsigned char *cp; + FILE *f = data->outfile; + int i; + unsigned long cksum = 0; + + for (i=0, cp = buf; i < channel->block_size; i++, cp++) { + cksum += *cp; + } + fprintf(f, "Contents of block %lu, checksum %08lu: \n", block, cksum); + for (i=0, cp = buf; i < channel->block_size; i++, cp++) { + if ((i % 16) == 0) + fprintf(f, "%04x: ", i); + fprintf(f, "%02x%c", *cp, ((i % 16) == 15) ? '\n' : ' '); + } +} + +/* + * Flush data buffers to disk. + */ +static errcode_t test_flush(io_channel channel) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *)channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real) + retval = io_channel_flush(data->real); + + if (data->flags & TEST_FLAG_FLUSH) + fprintf(data->outfile, "Test_io: flush() returned %s\n", + retval ? error_message(retval) : "OK"); + + return retval; +} + +static void test_abort(io_channel channel, unsigned long block) +{ + struct test_private_data *data; + FILE *f; + + data = (struct test_private_data *) channel->private_data; + f = data->outfile; + test_flush(channel); + + fprintf(f, "Aborting due to I/O to block %lu\n", block); + fflush(f); + abort(); +} + +static char *safe_getenv(const char *arg) +{ +#if !defined(_WIN32) + if ((getuid() != geteuid()) || (getgid() != getegid())) + return NULL; +#endif +#if HAVE_PRCTL + if (prctl(PR_GET_DUMPABLE, 0, 0, 0, 0) == 0) + return NULL; +#else +#if (defined(linux) && defined(SYS_prctl)) + if (syscall(SYS_prctl, PR_GET_DUMPABLE, 0, 0, 0, 0) == 0) + return NULL; +#endif +#endif + +#if defined(HAVE_SECURE_GETENV) + return secure_getenv(arg); +#elif defined(HAVE___SECURE_GETENV) + return __secure_getenv(arg); +#else + return getenv(arg); +#endif +} + +static errcode_t test_open(const char *name, int flags, io_channel *channel) +{ + io_channel io = NULL; + struct test_private_data *data = NULL; + errcode_t retval; + char *value; + + if (name == 0) + return EXT2_ET_BAD_DEVICE_NAME; + retval = ext2fs_get_mem(sizeof(struct struct_io_channel), &io); + if (retval) + goto cleanup; + memset(io, 0, sizeof(struct struct_io_channel)); + io->magic = EXT2_ET_MAGIC_IO_CHANNEL; + retval = ext2fs_get_mem(sizeof(struct test_private_data), &data); + if (retval) + goto cleanup; + io->manager = test_io_manager; + retval = ext2fs_get_mem(strlen(name)+1, &io->name); + if (retval) + goto cleanup; + + strcpy(io->name, name); + io->private_data = data; + io->block_size = 1024; + io->read_error = 0; + io->write_error = 0; + io->refcount = 1; + io->flags = 0; + + memset(data, 0, sizeof(struct test_private_data)); + data->magic = EXT2_ET_MAGIC_TEST_IO_CHANNEL; + if (test_io_backing_manager) { + retval = test_io_backing_manager->open(name, flags, + &data->real); + if (retval) + goto cleanup; + } else { + data->real = 0; + } + data->read_blk = test_io_cb_read_blk; + data->write_blk = test_io_cb_write_blk; + data->set_blksize = test_io_cb_set_blksize; + data->write_byte = test_io_cb_write_byte; + data->read_blk64 = test_io_cb_read_blk64; + data->write_blk64 = test_io_cb_write_blk64; + + data->outfile = NULL; + if ((value = safe_getenv("TEST_IO_LOGFILE")) != NULL) + data->outfile = fopen(value, "w"); + if (!data->outfile) + data->outfile = stderr; + + data->flags = 0; + if ((value = safe_getenv("TEST_IO_FLAGS")) != NULL) + data->flags = strtoul(value, NULL, 0); + + data->block = 0; + if ((value = safe_getenv("TEST_IO_BLOCK")) != NULL) + data->block = strtoul(value, NULL, 0); + + data->read_abort_count = 0; + if ((value = safe_getenv("TEST_IO_READ_ABORT")) != NULL) + data->read_abort_count = strtoul(value, NULL, 0); + + data->write_abort_count = 0; + if ((value = safe_getenv("TEST_IO_WRITE_ABORT")) != NULL) + data->write_abort_count = strtoul(value, NULL, 0); + + if (data->real) { + io->align = data->real->align; + if (data->real->flags & CHANNEL_FLAGS_THREADS) + io->flags |= CHANNEL_FLAGS_THREADS; + } + + *channel = io; + return 0; + +cleanup: + if (io && io->name) + ext2fs_free_mem(&io->name); + if (io) + ext2fs_free_mem(&io); + if (data) + ext2fs_free_mem(&data); + return retval; +} + +static errcode_t test_close(io_channel channel) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (--channel->refcount > 0) + return 0; + + if (data->real) + retval = io_channel_close(data->real); + + if (data->outfile && data->outfile != stderr) + fclose(data->outfile); + + ext2fs_free_mem(&channel->private_data); + if (channel->name) + ext2fs_free_mem(&channel->name); + ext2fs_free_mem(&channel); + return retval; +} + +static errcode_t test_set_blksize(io_channel channel, int blksize) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real) { + retval = io_channel_set_blksize(data->real, blksize); + channel->align = data->real->align; + } + if (data->set_blksize) + data->set_blksize(blksize, retval); + if (data->flags & TEST_FLAG_SET_BLKSIZE) + fprintf(data->outfile, + "Test_io: set_blksize(%d) returned %s\n", + blksize, retval ? error_message(retval) : "OK"); + channel->block_size = blksize; + return retval; +} + + +static errcode_t test_read_blk(io_channel channel, unsigned long block, + int count, void *buf) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real) + retval = io_channel_read_blk(data->real, block, count, buf); + if (data->read_blk) + data->read_blk(block, count, retval); + if (data->flags & TEST_FLAG_READ) + fprintf(data->outfile, + "Test_io: read_blk(%lu, %d) returned %s\n", + block, count, retval ? error_message(retval) : "OK"); + if (data->block && data->block == block) { + if (data->flags & TEST_FLAG_DUMP) + test_dump_block(channel, data, block, buf); + if (--data->read_abort_count == 0) + test_abort(channel, block); + } + return retval; +} + +static errcode_t test_write_blk(io_channel channel, unsigned long block, + int count, const void *buf) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real) + retval = io_channel_write_blk(data->real, block, count, buf); + if (data->write_blk) + data->write_blk(block, count, retval); + if (data->flags & TEST_FLAG_WRITE) + fprintf(data->outfile, + "Test_io: write_blk(%lu, %d) returned %s\n", + block, count, retval ? error_message(retval) : "OK"); + if (data->block && data->block == block) { + if (data->flags & TEST_FLAG_DUMP) + test_dump_block(channel, data, block, buf); + if (--data->write_abort_count == 0) + test_abort(channel, block); + } + return retval; +} + +static errcode_t test_read_blk64(io_channel channel, unsigned long long block, + int count, void *buf) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real) + retval = io_channel_read_blk64(data->real, block, count, buf); + if (data->read_blk64) + data->read_blk64(block, count, retval); + if (data->flags & TEST_FLAG_READ) + fprintf(data->outfile, + "Test_io: read_blk64(%llu, %d) returned %s\n", + block, count, retval ? error_message(retval) : "OK"); + if (data->block && data->block == block) { + if (data->flags & TEST_FLAG_DUMP) + test_dump_block(channel, data, block, buf); + if (--data->read_abort_count == 0) + test_abort(channel, block); + } + return retval; +} + +static errcode_t test_write_blk64(io_channel channel, unsigned long long block, + int count, const void *buf) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real) + retval = io_channel_write_blk64(data->real, block, count, buf); + if (data->write_blk64) + data->write_blk64(block, count, retval); + if (data->flags & TEST_FLAG_WRITE) + fprintf(data->outfile, + "Test_io: write_blk64(%llu, %d) returned %s\n", + block, count, retval ? error_message(retval) : "OK"); + if (data->block && data->block == block) { + if (data->flags & TEST_FLAG_DUMP) + test_dump_block(channel, data, block, buf); + if (--data->write_abort_count == 0) + test_abort(channel, block); + } + return retval; +} + +static errcode_t test_write_byte(io_channel channel, unsigned long offset, + int count, const void *buf) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real && data->real->manager->write_byte) + retval = io_channel_write_byte(data->real, offset, count, buf); + if (data->write_byte) + data->write_byte(offset, count, retval); + if (data->flags & TEST_FLAG_WRITE) + fprintf(data->outfile, + "Test_io: write_byte(%lu, %d) returned %s\n", + offset, count, retval ? error_message(retval) : "OK"); + return retval; +} + +static errcode_t test_set_option(io_channel channel, const char *option, + const char *arg) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + + if (data->flags & TEST_FLAG_SET_OPTION) + fprintf(data->outfile, "Test_io: set_option(%s, %s) ", + option, arg); + if (data->real && data->real->manager->set_option) { + retval = (data->real->manager->set_option)(data->real, + option, arg); + if (data->flags & TEST_FLAG_SET_OPTION) + fprintf(data->outfile, "returned %s\n", + retval ? error_message(retval) : "OK"); + } else { + if (data->flags & TEST_FLAG_SET_OPTION) + fprintf(data->outfile, "not implemented\n"); + } + return retval; +} + +static errcode_t test_get_stats(io_channel channel, io_stats *stats) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real && data->real->manager->get_stats) { + retval = (data->real->manager->get_stats)(data->real, stats); + } + return retval; +} + +static errcode_t test_discard(io_channel channel, unsigned long long block, + unsigned long long count) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real) + retval = io_channel_discard(data->real, block, count); + if (data->flags & TEST_FLAG_DISCARD) + fprintf(data->outfile, + "Test_io: discard(%llu, %llu) returned %s\n", + block, count, retval ? error_message(retval) : "OK"); + return retval; +} + +static errcode_t test_cache_readahead(io_channel channel, + unsigned long long block, + unsigned long long count) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real) + retval = io_channel_cache_readahead(data->real, block, count); + if (data->flags & TEST_FLAG_READAHEAD) + fprintf(data->outfile, + "Test_io: readahead(%llu, %llu) returned %s\n", + block, count, retval ? error_message(retval) : "OK"); + return retval; +} + +static errcode_t test_zeroout(io_channel channel, unsigned long long block, + unsigned long long count) +{ + struct test_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct test_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL); + + if (data->real) + retval = io_channel_zeroout(data->real, block, count); + if (data->flags & TEST_FLAG_ZEROOUT) + fprintf(data->outfile, + "Test_io: zeroout(%llu, %llu) returned %s\n", + block, count, retval ? error_message(retval) : "OK"); + return retval; +} + +static struct struct_io_manager struct_test_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "Test I/O Manager", + .open = test_open, + .close = test_close, + .set_blksize = test_set_blksize, + .read_blk = test_read_blk, + .write_blk = test_write_blk, + .flush = test_flush, + .write_byte = test_write_byte, + .set_option = test_set_option, + .get_stats = test_get_stats, + .read_blk64 = test_read_blk64, + .write_blk64 = test_write_blk64, + .discard = test_discard, + .cache_readahead = test_cache_readahead, + .zeroout = test_zeroout, +}; + +io_manager test_io_manager = &struct_test_manager; diff --git a/lib/ext2fs/tst_badblocks.c b/lib/ext2fs/tst_badblocks.c new file mode 100644 index 0000000..b6e766a --- /dev/null +++ b/lib/ext2fs/tst_badblocks.c @@ -0,0 +1,369 @@ +/* + * This testing program makes sure the badblocks implementation works. + * + * Copyright (C) 1996 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#include <sys/stat.h> +#include <sys/types.h> +#if HAVE_ERRNO_H +#include <errno.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +#define ADD_BLK 0x0001 +#define DEL_BLK 0x0002 + +blk_t test1[] = { 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 0 }; +blk_t test2[] = { 11, 10, 9, 8, 7, 6, 5, 4, 3, 3, 2, 1, 0 }; +blk_t test3[] = { 3, 1, 4, 5, 9, 2, 7, 10, 5, 6, 10, 8, 0 }; +blk_t test4[] = { 20, 50, 12, 17, 13, 2, 66, 23, 56, 0 }; +blk_t test4a[] = { + 20, 1, + 50, 1, + 3, 0, + 17, 1, + 18, 0, + 16, 0, + 11, 0, + 12, 1, + 13, 1, + 14, 0, + 80, 0, + 45, 0, + 66, 1, + 0 }; +blk_t test5[] = { 31, 20, 17, 51, 23, 1, 56, 57, 0 }; +blk_t test5a[] = { + 50, ADD_BLK, + 51, DEL_BLK, + 57, DEL_BLK, + 66, ADD_BLK, + 31, DEL_BLK, + 12, ADD_BLK, + 2, ADD_BLK, + 13, ADD_BLK, + 1, DEL_BLK, + 0 + }; + + +static int test_fail = 0; +static int test_expected_fail = 0; + +static errcode_t create_test_list(blk_t *vec, badblocks_list *ret) +{ + errcode_t retval; + badblocks_list bb; + int i; + + retval = ext2fs_badblocks_list_create(&bb, 5); + if (retval) { + com_err("create_test_list", retval, "while creating list"); + return retval; + } + for (i=0; vec[i]; i++) { + retval = ext2fs_badblocks_list_add(bb, vec[i]); + if (retval) { + com_err("create_test_list", retval, + "while adding test vector %d", i); + ext2fs_badblocks_list_free(bb); + return retval; + } + } + *ret = bb; + return 0; +} + +static void print_list(badblocks_list bb, int verify) +{ + errcode_t retval; + badblocks_iterate iter; + blk_t blk; + int i, ok; + + retval = ext2fs_badblocks_list_iterate_begin(bb, &iter); + if (retval) { + com_err("print_list", retval, "while setting up iterator"); + return; + } + ok = i = 1; + while (ext2fs_badblocks_list_iterate(iter, &blk)) { + printf("%u ", blk); + if (i++ != blk) + ok = 0; + } + ext2fs_badblocks_list_iterate_end(iter); + if (verify) { + if (ok) + printf("--- OK"); + else { + printf("--- NOT OK"); + test_fail++; + } + } +} + +static void validate_test_seq(badblocks_list bb, blk_t *vec) +{ + int i, match, ok; + + for (i = 0; vec[i]; i += 2) { + match = ext2fs_badblocks_list_test(bb, vec[i]); + if (match == vec[i+1]) + ok = 1; + else { + ok = 0; + test_fail++; + } + printf("\tblock %u is %s --- %s\n", vec[i], + match ? "present" : "absent", + ok ? "OK" : "NOT OK"); + } +} + +static void do_test_seq(badblocks_list bb, blk_t *vec) +{ + int i, match; + + for (i = 0; vec[i]; i += 2) { + switch (vec[i+1]) { + case ADD_BLK: + ext2fs_badblocks_list_add(bb, vec[i]); + match = ext2fs_badblocks_list_test(bb, vec[i]); + printf("Adding block %u --- now %s\n", vec[i], + match ? "present" : "absent"); + if (!match) { + printf("FAILURE!\n"); + test_fail++; + } + break; + case DEL_BLK: + ext2fs_badblocks_list_del(bb, vec[i]); + match = ext2fs_badblocks_list_test(bb, vec[i]); + printf("Removing block %u --- now %s\n", vec[i], + ext2fs_badblocks_list_test(bb, vec[i]) ? + "present" : "absent"); + if (match) { + printf("FAILURE!\n"); + test_fail++; + } + break; + } + } +} + + +int file_test(badblocks_list bb) +{ + badblocks_list new_bb = 0; + errcode_t retval; + FILE *f; + + f = tmpfile(); + if (!f) { + fprintf(stderr, "Error opening temp file: %s\n", + error_message(errno)); + return 1; + } + retval = ext2fs_write_bb_FILE(bb, 0, f); + if (retval) { + com_err("file_test", retval, "while writing bad blocks"); + return 1; + } + + rewind(f); + retval = ext2fs_read_bb_FILE2(0, f, &new_bb, 0, 0); + if (retval) { + com_err("file_test", retval, "while reading bad blocks"); + return 1; + } + fclose(f); + + if (ext2fs_badblocks_equal(bb, new_bb)) { + printf("Block bitmap matched after reading and writing.\n"); + } else { + printf("Block bitmap NOT matched.\n"); + test_fail++; + } + ext2fs_badblocks_list_free(new_bb); + return 0; +} + +static void invalid_proc(ext2_filsys fs, blk_t blk) +{ + if (blk == 34500) { + printf("Expected invalid block\n"); + test_expected_fail++; + } else { + printf("Invalid block #: %u\n", blk); + test_fail++; + } +} + +void file_test_invalid(badblocks_list bb) +{ + badblocks_list new_bb = 0; + errcode_t retval; + ext2_filsys fs; + FILE *f; + + fs = malloc(sizeof(struct struct_ext2_filsys)); + memset(fs, 0, sizeof(struct struct_ext2_filsys)); + fs->magic = EXT2_ET_MAGIC_EXT2FS_FILSYS; + fs->super = malloc(SUPERBLOCK_SIZE); + memset(fs->super, 0, SUPERBLOCK_SIZE); + fs->super->s_first_data_block = 1; + ext2fs_blocks_count_set(fs->super, 100); + + f = tmpfile(); + if (!f) { + fprintf(stderr, "Error opening temp file: %s\n", + error_message(errno)); + test_fail++; + goto out; + } + retval = ext2fs_write_bb_FILE(bb, 0, f); + if (retval) { + com_err("file_test", retval, "while writing bad blocks"); + test_fail++; + goto out; + } + fprintf(f, "34500\n"); + + rewind(f); + test_expected_fail = 0; + retval = ext2fs_read_bb_FILE(fs, f, &new_bb, invalid_proc); + if (retval) { + com_err("file_test", retval, "while reading bad blocks"); + test_fail++; + goto out; + } + fclose(f); + if (!test_expected_fail) { + printf("Expected test failure didn't happen!\n"); + test_fail++; + } + + + if (ext2fs_badblocks_equal(bb, new_bb)) { + printf("Block bitmap matched after reading and writing.\n"); + } else { + printf("Block bitmap NOT matched.\n"); + test_fail++; + } + ext2fs_badblocks_list_free(new_bb); +out: + free(fs->super); + free(fs); +} + +int main(int argc, char **argv) +{ + badblocks_list bb1, bb2, bb3, bb4, bb5; + int equal; + errcode_t retval; + + add_error_table(&et_ext2_error_table); + + bb1 = bb2 = bb3 = bb4 = bb5 = 0; + + printf("test1: "); + retval = create_test_list(test1, &bb1); + if (retval == 0) + print_list(bb1, 1); + printf("\n"); + + printf("test2: "); + retval = create_test_list(test2, &bb2); + if (retval == 0) + print_list(bb2, 1); + printf("\n"); + + printf("test3: "); + retval = create_test_list(test3, &bb3); + if (retval == 0) + print_list(bb3, 1); + printf("\n"); + + printf("test4: "); + retval = create_test_list(test4, &bb4); + if (retval == 0) { + print_list(bb4, 0); + printf("\n"); + validate_test_seq(bb4, test4a); + } + printf("\n"); + + printf("test5: "); + retval = create_test_list(test5, &bb5); + if (retval == 0) { + print_list(bb5, 0); + printf("\n"); + do_test_seq(bb5, test5a); + printf("After test5 sequence: "); + print_list(bb5, 0); + printf("\n"); + } + printf("\n"); + + if (bb1 && bb2 && bb3 && bb4 && bb5) { + printf("Comparison tests:\n"); + equal = ext2fs_badblocks_equal(bb1, bb2); + printf("bb1 and bb2 are %sequal.\n", equal ? "" : "NOT "); + if (equal) + test_fail++; + + equal = ext2fs_badblocks_equal(bb1, bb3); + printf("bb1 and bb3 are %sequal.\n", equal ? "" : "NOT "); + if (!equal) + test_fail++; + + equal = ext2fs_badblocks_equal(bb1, bb4); + printf("bb1 and bb4 are %sequal.\n", equal ? "" : "NOT "); + if (equal) + test_fail++; + + equal = ext2fs_badblocks_equal(bb4, bb5); + printf("bb4 and bb5 are %sequal.\n", equal ? "" : "NOT "); + if (!equal) + test_fail++; + printf("\n"); + } + + file_test(bb4); + + file_test_invalid(bb4); + + if (test_fail == 0) + printf("ext2fs library badblocks tests checks out OK!\n"); + + if (bb1) + ext2fs_badblocks_list_free(bb1); + if (bb2) + ext2fs_badblocks_list_free(bb2); + if (bb3) + ext2fs_badblocks_list_free(bb3); + if (bb4) + ext2fs_badblocks_list_free(bb4); + if (bb5) + ext2fs_badblocks_list_free(bb5); + + return test_fail; + +} diff --git a/lib/ext2fs/tst_bitmaps.c b/lib/ext2fs/tst_bitmaps.c new file mode 100644 index 0000000..cb3c70d --- /dev/null +++ b/lib/ext2fs/tst_bitmaps.c @@ -0,0 +1,732 @@ +/* + * tst_bitmaps.c + * + * Copyright (C) 2011 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <unistd.h> +#include <stdlib.h> +#include <stdio.h> +#ifdef HAVE_GETOPT_H +#include <getopt.h> +#endif +#include <string.h> +#include <fcntl.h> +#include <time.h> +#include <sys/stat.h> +#include <sys/types.h> +#include "ss/ss.h" + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +extern ss_request_table tst_bitmaps_cmds; + +static char subsystem_name[] = "tst_bitmaps"; +static char version[] = "1.0"; + +ext2_filsys test_fs; +int exit_status = 0; + +static int source_file(const char *cmd_file, int sci_idx) +{ + FILE *f; + char buf[256]; + char *cp; + int retval; + int noecho; + + if (strcmp(cmd_file, "-") == 0) + f = stdin; + else { + f = fopen(cmd_file, "r"); + if (!f) { + perror(cmd_file); + exit(1); + } + } + fflush(stdout); + fflush(stderr); + setbuf(stdout, NULL); + setbuf(stderr, NULL); + while (!feof(f)) { + if (fgets(buf, sizeof(buf), f) == NULL) + break; + if (buf[0] == '#') + continue; + noecho = 0; + if (buf[0] == '-') { + noecho = 1; + buf[0] = ' '; + } + cp = strchr(buf, '\n'); + if (cp) + *cp = 0; + cp = strchr(buf, '\r'); + if (cp) + *cp = 0; + if (!noecho) + printf("%s: %s\n", subsystem_name, buf); + retval = ss_execute_line(sci_idx, buf); + if (retval) { + ss_perror(sci_idx, retval, buf); + exit_status++; + } + } + return exit_status; +} + + +/* + * This function resets the libc getopt() function, which keeps + * internal state. Bad design! Stupid libc API designers! No + * biscuit! + * + * BSD-derived getopt() functions require that optind be reset to 1 in + * order to reset getopt() state. This used to be generally accepted + * way of resetting getopt(). However, glibc's getopt() + * has additional getopt() state beyond optind, and requires that + * optind be set zero to reset its state. So the unfortunate state of + * affairs is that BSD-derived versions of getopt() misbehave if + * optind is set to 0 in order to reset getopt(), and glibc's getopt() + * will core dump if optind is set 1 in order to reset getopt(). + * + * More modern versions of BSD require that optreset be set to 1 in + * order to reset getopt(). Sigh. Standards, anyone? + * + * We hide the hair here. + */ +void reset_getopt(void) +{ +#if defined(__GLIBC__) || defined(__linux__) + optind = 0; +#else + optind = 1; +#endif +#ifdef HAVE_OPTRESET + optreset = 1; /* Makes BSD getopt happy */ +#endif +} + +/* + * This function will convert a string to an unsigned long, printing + * an error message if it fails, and returning success or failure in err. + */ +unsigned long parse_ulong(const char *str, const char *cmd, + const char *descr, int *err) +{ + char *tmp; + unsigned long ret; + + ret = strtoul(str, &tmp, 0); + if (*tmp == 0) { + if (err) + *err = 0; + return ret; + } + com_err(cmd, 0, "Bad %s - %s", descr, str); + if (err) + *err = 1; + else + exit(1); + return 0; +} + + +int check_fs_open(char *name) +{ + if (!test_fs) { + com_err(name, 0, "Filesystem not open"); + return 1; + } + return 0; +} + +static void setup_filesystem(const char *name, + unsigned int blocks, unsigned int inodes, + unsigned int type, int flags) +{ + struct ext2_super_block param; + errcode_t retval; + + memset(¶m, 0, sizeof(param)); + ext2fs_blocks_count_set(¶m, blocks); + param.s_inodes_count = inodes; + + retval = ext2fs_initialize("test fs", flags, ¶m, + test_io_manager, &test_fs); + + if (retval) { + com_err(name, retval, "while initializing filesystem"); + return; + } + test_fs->default_bitmap_type = type; + ext2fs_free_block_bitmap(test_fs->block_map); + test_fs->block_map = 0; + ext2fs_free_inode_bitmap(test_fs->inode_map); + test_fs->inode_map = 0; + retval = ext2fs_allocate_block_bitmap(test_fs, "block bitmap", + &test_fs->block_map); + if (retval) { + com_err(name, retval, "while allocating block bitmap"); + goto errout; + } + retval = ext2fs_allocate_inode_bitmap(test_fs, "inode bitmap", + &test_fs->inode_map); + if (retval) { + com_err(name, retval, "while allocating inode bitmap"); + goto errout; + } + return; + +errout: + ext2fs_close_free(&test_fs); +} + +void setup_cmd(int argc, char **argv, int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + int c, err; + unsigned int blocks = 128; + unsigned int inodes = 0; + unsigned int type = EXT2FS_BMAP64_BITARRAY; + int flags = EXT2_FLAG_64BITS; + + if (test_fs) + ext2fs_close_free(&test_fs); + + reset_getopt(); + while ((c = getopt(argc, argv, "b:i:lt:")) != EOF) { + switch (c) { + case 'b': + blocks = parse_ulong(optarg, argv[0], + "number of blocks", &err); + if (err) + return; + break; + case 'i': + inodes = parse_ulong(optarg, argv[0], + "number of blocks", &err); + if (err) + return; + break; + case 'l': /* Legacy bitmaps */ + flags = 0; + break; + case 't': + type = parse_ulong(optarg, argv[0], + "bitmap backend type", &err); + if (err) + return; + break; + default: + fprintf(stderr, "%s: usage: setup [-b blocks] " + "[-i inodes] [-t type]\n", argv[0]); + return; + } + } + setup_filesystem(argv[0], blocks, inodes, type, flags); +} + +void close_cmd(int argc, char **argv, int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + if (check_fs_open(argv[0])) + return; + + ext2fs_close_free(&test_fs); +} + + +void dump_bitmap(ext2fs_generic_bitmap bmap, unsigned int start, unsigned num) +{ + unsigned char *buf; + errcode_t retval; + int i, len = (num - start + 7) / 8; + + buf = malloc(len); + if (!buf) { + com_err("dump_bitmap", 0, "couldn't allocate buffer"); + return; + } + memset(buf, 0, len); + retval = ext2fs_get_generic_bmap_range(bmap, (__u64) start, num, buf); + if (retval) { + com_err("dump_bitmap", retval, + "while calling ext2fs_generic_bmap_range"); + free(buf); + return; + } + for (i=0; i < len; i++) + printf("%02x", buf[i]); + printf("\n"); + printf("bits set: %u\n", ext2fs_bitcount(buf, len)); + free(buf); +} + +void dump_inode_bitmap_cmd(int argc, char **argv, + int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + if (check_fs_open(argv[0])) + return; + + printf("inode bitmap: "); + dump_bitmap(test_fs->inode_map, 1, test_fs->super->s_inodes_count); +} + +void dump_block_bitmap_cmd(int argc, char **argv, + int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + if (check_fs_open(argv[0])) + return; + + printf("block bitmap: "); + dump_bitmap(test_fs->block_map, test_fs->super->s_first_data_block, + test_fs->super->s_blocks_count); +} + +void do_setb(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + unsigned int block, num; + int err; + int test_result, op_result; + + if (check_fs_open(argv[0])) + return; + + if (argc != 2 && argc != 3) { + com_err(argv[0], 0, "Usage: setb <block> [num]"); + return; + } + + block = parse_ulong(argv[1], argv[0], "block", &err); + if (err) + return; + + if (argc == 3) { + num = parse_ulong(argv[2], argv[0], "num", &err); + if (err) + return; + + ext2fs_mark_block_bitmap_range2(test_fs->block_map, + block, num); + printf("Marking blocks %u to %u\n", block, block + num - 1); + return; + } + + test_result = ext2fs_test_block_bitmap2(test_fs->block_map, block); + op_result = ext2fs_mark_block_bitmap2(test_fs->block_map, block); + printf("Setting block %u, was %s before\n", block, op_result ? + "set" : "clear"); + if (!test_result != !op_result) + com_err(argv[0], 0, "*ERROR* test_result different! (%d, %d)", + test_result, op_result); +} + +void do_clearb(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + unsigned int block, num; + int err; + int test_result, op_result; + + if (check_fs_open(argv[0])) + return; + + if (argc != 2 && argc != 3) { + com_err(argv[0], 0, "Usage: clearb <block> [num]"); + return; + } + + block = parse_ulong(argv[1], argv[0], "block", &err); + if (err) + return; + + if (argc == 3) { + num = parse_ulong(argv[2], argv[0], "num", &err); + if (err) + return; + + ext2fs_unmark_block_bitmap_range2(test_fs->block_map, + block, num); + printf("Clearing blocks %u to %u\n", block, block + num - 1); + return; + } + + test_result = ext2fs_test_block_bitmap2(test_fs->block_map, block); + op_result = ext2fs_unmark_block_bitmap2(test_fs->block_map, block); + printf("Clearing block %u, was %s before\n", block, op_result ? + "set" : "clear"); + if (!test_result != !op_result) + com_err(argv[0], 0, "*ERROR* test_result different! (%d, %d)", + test_result, op_result); +} + +void do_testb(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + unsigned int block, num; + int err; + int test_result; + + if (check_fs_open(argv[0])) + return; + + if (argc != 2 && argc != 3) { + com_err(argv[0], 0, "Usage: testb <block> [num]"); + return; + } + + block = parse_ulong(argv[1], argv[0], "block", &err); + if (err) + return; + + if (argc == 3) { + num = parse_ulong(argv[2], argv[0], "num", &err); + if (err) + return; + + test_result = + ext2fs_test_block_bitmap_range2(test_fs->block_map, + block, num); + printf("Blocks %u to %u are %sall clear.\n", + block, block + num - 1, test_result ? "" : "NOT "); + return; + } + + test_result = ext2fs_test_block_bitmap2(test_fs->block_map, block); + printf("Block %u is %s\n", block, test_result ? "set" : "clear"); +} + +void do_ffzb(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + unsigned int start, end; + int err; + errcode_t retval; + blk64_t out; + + if (check_fs_open(argv[0])) + return; + + if (argc != 3 && argc != 3) { + com_err(argv[0], 0, "Usage: ffzb <start> <end>"); + return; + } + + start = parse_ulong(argv[1], argv[0], "start", &err); + if (err) + return; + + end = parse_ulong(argv[2], argv[0], "end", &err); + if (err) + return; + + retval = ext2fs_find_first_zero_block_bitmap2(test_fs->block_map, + start, end, &out); + if (retval) { + printf("ext2fs_find_first_zero_block_bitmap2() returned %s\n", + error_message(retval)); + return; + } + printf("First unmarked block is %llu\n", (unsigned long long) out); +} + +void do_ffsb(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + unsigned int start, end; + int err; + errcode_t retval; + blk64_t out; + + if (check_fs_open(argv[0])) + return; + + if (argc != 3 && argc != 3) { + com_err(argv[0], 0, "Usage: ffsb <start> <end>"); + return; + } + + start = parse_ulong(argv[1], argv[0], "start", &err); + if (err) + return; + + end = parse_ulong(argv[2], argv[0], "end", &err); + if (err) + return; + + retval = ext2fs_find_first_set_block_bitmap2(test_fs->block_map, + start, end, &out); + if (retval) { + printf("ext2fs_find_first_set_block_bitmap2() returned %s\n", + error_message(retval)); + return; + } + printf("First marked block is %llu\n", (unsigned long long) out); +} + + +void do_zerob(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + if (check_fs_open(argv[0])) + return; + + printf("Clearing block bitmap.\n"); + ext2fs_clear_block_bitmap(test_fs->block_map); +} + +void do_seti(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + unsigned int inode; + int err; + int test_result, op_result; + + if (check_fs_open(argv[0])) + return; + + if (argc != 2) { + com_err(argv[0], 0, "Usage: seti <inode>"); + return; + } + + inode = parse_ulong(argv[1], argv[0], "inode", &err); + if (err) + return; + + test_result = ext2fs_test_inode_bitmap2(test_fs->inode_map, inode); + op_result = ext2fs_mark_inode_bitmap2(test_fs->inode_map, inode); + printf("Setting inode %u, was %s before\n", inode, op_result ? + "set" : "clear"); + if (!test_result != !op_result) { + com_err(argv[0], 0, "*ERROR* test_result different! (%d, %d)", + test_result, op_result); + exit_status++; + } +} + +void do_cleari(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + unsigned int inode; + int err; + int test_result, op_result; + + if (check_fs_open(argv[0])) + return; + + if (argc != 2) { + com_err(argv[0], 0, "Usage: clearb <inode>"); + return; + } + + inode = parse_ulong(argv[1], argv[0], "inode", &err); + if (err) + return; + + test_result = ext2fs_test_inode_bitmap2(test_fs->inode_map, inode); + op_result = ext2fs_unmark_inode_bitmap2(test_fs->inode_map, inode); + printf("Clearing inode %u, was %s before\n", inode, op_result ? + "set" : "clear"); + if (!test_result != !op_result) { + com_err(argv[0], 0, "*ERROR* test_result different! (%d, %d)", + test_result, op_result); + exit_status++; + } +} + +void do_testi(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + unsigned int inode; + int err; + int test_result; + + if (check_fs_open(argv[0])) + return; + + if (argc != 2) { + com_err(argv[0], 0, "Usage: testb <inode>"); + return; + } + + inode = parse_ulong(argv[1], argv[0], "inode", &err); + if (err) + return; + + test_result = ext2fs_test_inode_bitmap2(test_fs->inode_map, inode); + printf("Inode %u is %s\n", inode, test_result ? "set" : "clear"); +} + +void do_ffzi(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + unsigned int start, end; + int err; + errcode_t retval; + ext2_ino_t out; + + if (check_fs_open(argv[0])) + return; + + if (argc != 3 && argc != 3) { + com_err(argv[0], 0, "Usage: ffzi <start> <end>"); + return; + } + + start = parse_ulong(argv[1], argv[0], "start", &err); + if (err) + return; + + end = parse_ulong(argv[2], argv[0], "end", &err); + if (err) + return; + + retval = ext2fs_find_first_zero_inode_bitmap2(test_fs->inode_map, + start, end, &out); + if (retval) { + printf("ext2fs_find_first_zero_inode_bitmap2() returned %s\n", + error_message(retval)); + return; + } + printf("First unmarked inode is %u\n", out); +} + +void do_ffsi(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + unsigned int start, end; + int err; + errcode_t retval; + ext2_ino_t out; + + if (check_fs_open(argv[0])) + return; + + if (argc != 3 && argc != 3) { + com_err(argv[0], 0, "Usage: ffsi <start> <end>"); + return; + } + + start = parse_ulong(argv[1], argv[0], "start", &err); + if (err) + return; + + end = parse_ulong(argv[2], argv[0], "end", &err); + if (err) + return; + + retval = ext2fs_find_first_set_inode_bitmap2(test_fs->inode_map, + start, end, &out); + if (retval) { + printf("ext2fs_find_first_set_inode_bitmap2() returned %s\n", + error_message(retval)); + return; + } + printf("First marked inode is %u\n", out); +} + +void do_zeroi(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + if (check_fs_open(argv[0])) + return; + + printf("Clearing inode bitmap.\n"); + ext2fs_clear_inode_bitmap(test_fs->inode_map); +} + +int main(int argc, char **argv) +{ + unsigned int blocks = 128; + unsigned int inodes = 0; + unsigned int type = EXT2FS_BMAP64_BITARRAY; + int c, err, code; + char *request = (char *)NULL; + char *cmd_file = 0; + int sci_idx; + int flags = EXT2_FLAG_64BITS; + + add_error_table(&et_ss_error_table); + add_error_table(&et_ext2_error_table); + while ((c = getopt (argc, argv, "b:i:lt:R:f:")) != EOF) { + switch (c) { + case 'b': + blocks = parse_ulong(optarg, argv[0], + "number of blocks", &err); + if (err) + exit(1); + break; + case 'i': + inodes = parse_ulong(optarg, argv[0], + "number of blocks", &err); + if (err) + exit(1); + break; + case 'l': /* Legacy bitmaps */ + flags = 0; + break; + case 't': + type = parse_ulong(optarg, argv[0], + "bitmap backend type", &err); + if (err) + exit(1); + break; + case 'R': + request = optarg; + break; + case 'f': + cmd_file = optarg; + break; + default: + com_err(argv[0], 0, "Usage: %s [-R request] " + "[-f cmd_file]", subsystem_name); + exit(1); + } + } + + sci_idx = ss_create_invocation(subsystem_name, version, + (char *)NULL, &tst_bitmaps_cmds, &code); + if (code) { + ss_perror(sci_idx, code, "creating invocation"); + exit(1); + } + + (void) ss_add_request_table (sci_idx, &ss_std_requests, 1, &code); + if (code) { + ss_perror(sci_idx, code, "adding standard requests"); + exit (1); + } + + printf("%s %s. Type '?' for a list of commands.\n\n", + subsystem_name, version); + + setup_filesystem(argv[0], blocks, inodes, type, flags); + + if (request) { + code = ss_execute_line(sci_idx, request); + if (code) { + ss_perror(sci_idx, code, request); + exit_status++; + } + } else if (cmd_file) { + exit_status = source_file(cmd_file, sci_idx); + } else { + ss_listen(sci_idx); + } + + exit(exit_status); +} + diff --git a/lib/ext2fs/tst_bitmaps_cmd.ct b/lib/ext2fs/tst_bitmaps_cmd.ct new file mode 100644 index 0000000..13b7fa7 --- /dev/null +++ b/lib/ext2fs/tst_bitmaps_cmd.ct @@ -0,0 +1,51 @@ +command_table tst_bitmaps_cmds; + +request setup_cmd, "Setup file system", + setup; + +request close_cmd, "Close file system", + close; + +request dump_inode_bitmap_cmd, "Dump the inode bitmap", + dump_inode_bitmap, dump_ib; + +request dump_block_bitmap_cmd, "Dump the block bitmap", + dump_block_bitmap, dump_bb; + +request do_setb, "Set block", + set_block, setb; + +request do_clearb, "Clear block", + clear_block, clearb; + +request do_testb, "Test block", + test_block, testb; + +request do_ffzb, "Find first zero block", + find_first_zero_block, ffzb; + +request do_ffsb, "Find first set block", + find_first_set_block, ffsb; + +request do_zerob, "Clear block bitmap", + clear_block_bitmap, zerob; + +request do_seti, "Set inode", + set_inode, seti; + +request do_cleari, "Clear inode", + clear_inode, cleari; + +request do_testi, "Test inode", + test_inode, testi; + +request do_ffzi, "Find first zero inode", + find_first_zero_inode, ffzi; + +request do_ffsi, "Find first set inode", + find_first_set_inode, ffsi; + +request do_zeroi, "Clear inode bitmap", + clear_inode_bitmap, zeroi; + +end; diff --git a/lib/ext2fs/tst_bitmaps_cmds b/lib/ext2fs/tst_bitmaps_cmds new file mode 100644 index 0000000..dc116b1 --- /dev/null +++ b/lib/ext2fs/tst_bitmaps_cmds @@ -0,0 +1,150 @@ +setb 12 0 +setb 12 +setb 12 +clearb 12 +clearb 12 +setb 12 +setb 14 +setb 16 +testb 13 +testb 15 +testb 12 +testb 14 +setb 13 +setb 15 +testb 12 +testb 11 +testb 15 +testb 16 +dump_bb +ffzb 11 16 +ffzb 12 16 +ffzb 12 20 +ffsb 0 127 +ffsb 1 128 +ffsb 1 127 +ffsb 1 10 +ffsb 1 11 +ffsb 12 12 +ffsb 13 12 +ffsb 12 15 +clearb 13 +ffzb 12 20 +ffsb 13 18 +setb 13 +clearb 12 7 +testb 12 7 +setb 15 +testb 12 7 +clearb 15 +testb 12 7 +setb 12 0 +setb 12 7 +dump_bb +seti 2 +seti 5 +seti 4 +seti 3 +seti 4 +seti 5 +testi 6 +testi 1 +dump_ib +ffzi 1 6 +ffzi 2 5 +ffzi 2 6 +ffsi 0 31 +ffsi 1 33 +ffsi 1 32 +ffsi 2 32 +ffsi 6 32 +cleari 4 +ffzi 2 6 +ffsi 4 32 +ffsi 5 32 +zeroi +testi 5 +seti 5 +seti 5 +cleari 5 +cleari 5 +testi 17 +testi 6 +testi 4 +clearb 7 12 +dump_bb +setb 1 +dump_bb +setb 2 +dump_bb +setb 3 +dump_bb +setb 4 +dump_bb +setb 5 +dump_bb +setb 6 +dump_bb +setb 7 +dump_bb +setb 8 +dump_bb +setb 10 +setb 12 +setb 14 +setb 17 +setb 19 +setb 24 +setb 26 +setb 27 +setb 30 +setb 31 +setb 32 +setb 35 +setb 39 +setb 40 +setb 44 +setb 46 +setb 47 +setb 49 +setb 51 +setb 52 +clearb 2 +clearb 3 +clearb 7 +dump_bb +ffsb 14 127 +ffsb 15 127 +ffsb 36 127 +ffsb 32 127 +ffsb 52 127 +ffsb 53 127 +ffsb 46 127 +ffsb 45 127 +ffsb 41 127 +ffsb 20 127 +ffsb 1 127 +ffsb 2 127 +ffsb 3 127 +ffsb 4 127 +ffsb 5 127 +ffsb 6 127 +ffsb 7 127 +ffsb 8 127 +ffzb 1 127 +ffzb 2 127 +ffzb 3 127 +ffzb 4 127 +ffzb 5 127 +ffzb 6 127 +ffzb 7 127 +ffzb 8 127 +ffzb 45 127 +ffzb 46 127 +ffzb 47 127 +ffzb 48 127 +ffzb 49 127 +ffzb 50 127 +ffzb 51 127 +quit + diff --git a/lib/ext2fs/tst_bitmaps_exp b/lib/ext2fs/tst_bitmaps_exp new file mode 100644 index 0000000..9cfea13 --- /dev/null +++ b/lib/ext2fs/tst_bitmaps_exp @@ -0,0 +1,313 @@ +tst_bitmaps 1.0. Type '?' for a list of commands. + +tst_bitmaps: setb 12 0 +Marking blocks 12 to 11 +tst_bitmaps: setb 12 +Setting block 12, was clear before +tst_bitmaps: setb 12 +Setting block 12, was set before +tst_bitmaps: clearb 12 +Clearing block 12, was set before +tst_bitmaps: clearb 12 +Clearing block 12, was clear before +tst_bitmaps: setb 12 +Setting block 12, was clear before +tst_bitmaps: setb 14 +Setting block 14, was clear before +tst_bitmaps: setb 16 +Setting block 16, was clear before +tst_bitmaps: testb 13 +Block 13 is clear +tst_bitmaps: testb 15 +Block 15 is clear +tst_bitmaps: testb 12 +Block 12 is set +tst_bitmaps: testb 14 +Block 14 is set +tst_bitmaps: setb 13 +Setting block 13, was clear before +tst_bitmaps: setb 15 +Setting block 15, was clear before +tst_bitmaps: testb 12 +Block 12 is set +tst_bitmaps: testb 11 +Block 11 is clear +tst_bitmaps: testb 15 +Block 15 is set +tst_bitmaps: testb 16 +Block 16 is set +tst_bitmaps: dump_bb +block bitmap: 00f80000000000000000000000000000 +bits set: 5 +tst_bitmaps: ffzb 11 16 +First unmarked block is 11 +tst_bitmaps: ffzb 12 16 +ext2fs_find_first_zero_block_bitmap2() returned No such file or directory +tst_bitmaps: ffzb 12 20 +First unmarked block is 17 +tst_bitmaps: ffsb 0 127 +ext2fs_find_first_set_block_bitmap2() returned Invalid argument +tst_bitmaps: ffsb 1 128 +ext2fs_find_first_set_block_bitmap2() returned Invalid argument +tst_bitmaps: ffsb 1 127 +First marked block is 12 +tst_bitmaps: ffsb 1 10 +ext2fs_find_first_set_block_bitmap2() returned No such file or directory +tst_bitmaps: ffsb 1 11 +ext2fs_find_first_set_block_bitmap2() returned No such file or directory +tst_bitmaps: ffsb 12 12 +First marked block is 12 +tst_bitmaps: ffsb 13 12 +ext2fs_find_first_set_block_bitmap2() returned Invalid argument +tst_bitmaps: ffsb 12 15 +First marked block is 12 +tst_bitmaps: clearb 13 +Clearing block 13, was set before +tst_bitmaps: ffzb 12 20 +First unmarked block is 13 +tst_bitmaps: ffsb 13 18 +First marked block is 14 +tst_bitmaps: setb 13 +Setting block 13, was clear before +tst_bitmaps: clearb 12 7 +Clearing blocks 12 to 18 +tst_bitmaps: testb 12 7 +Blocks 12 to 18 are all clear. +tst_bitmaps: setb 15 +Setting block 15, was clear before +tst_bitmaps: testb 12 7 +Blocks 12 to 18 are NOT all clear. +tst_bitmaps: clearb 15 +Clearing block 15, was set before +tst_bitmaps: testb 12 7 +Blocks 12 to 18 are all clear. +tst_bitmaps: setb 12 0 +Marking blocks 12 to 11 +tst_bitmaps: setb 12 7 +Marking blocks 12 to 18 +tst_bitmaps: dump_bb +block bitmap: 00f80300000000000000000000000000 +bits set: 7 +tst_bitmaps: seti 2 +Setting inode 2, was clear before +tst_bitmaps: seti 5 +Setting inode 5, was clear before +tst_bitmaps: seti 4 +Setting inode 4, was clear before +tst_bitmaps: seti 3 +Setting inode 3, was clear before +tst_bitmaps: seti 4 +Setting inode 4, was set before +tst_bitmaps: seti 5 +Setting inode 5, was set before +tst_bitmaps: testi 6 +Inode 6 is clear +tst_bitmaps: testi 1 +Inode 1 is clear +tst_bitmaps: dump_ib +inode bitmap: 1e000000 +bits set: 4 +tst_bitmaps: ffzi 1 6 +First unmarked inode is 1 +tst_bitmaps: ffzi 2 5 +ext2fs_find_first_zero_inode_bitmap2() returned No such file or directory +tst_bitmaps: ffzi 2 6 +First unmarked inode is 6 +tst_bitmaps: ffsi 0 31 +ext2fs_find_first_set_inode_bitmap2() returned Invalid argument +tst_bitmaps: ffsi 1 33 +ext2fs_find_first_set_inode_bitmap2() returned Invalid argument +tst_bitmaps: ffsi 1 32 +First marked inode is 2 +tst_bitmaps: ffsi 2 32 +First marked inode is 2 +tst_bitmaps: ffsi 6 32 +ext2fs_find_first_set_inode_bitmap2() returned No such file or directory +tst_bitmaps: cleari 4 +Clearing inode 4, was set before +tst_bitmaps: ffzi 2 6 +First unmarked inode is 4 +tst_bitmaps: ffsi 4 32 +First marked inode is 5 +tst_bitmaps: ffsi 5 32 +First marked inode is 5 +tst_bitmaps: zeroi +Clearing inode bitmap. +tst_bitmaps: testi 5 +Inode 5 is clear +tst_bitmaps: seti 5 +Setting inode 5, was clear before +tst_bitmaps: seti 5 +Setting inode 5, was set before +tst_bitmaps: cleari 5 +Clearing inode 5, was set before +tst_bitmaps: cleari 5 +Clearing inode 5, was clear before +tst_bitmaps: testi 17 +Inode 17 is clear +tst_bitmaps: testi 6 +Inode 6 is clear +tst_bitmaps: testi 4 +Inode 4 is clear +tst_bitmaps: clearb 7 12 +Clearing blocks 7 to 18 +tst_bitmaps: dump_bb +block bitmap: 00000000000000000000000000000000 +bits set: 0 +tst_bitmaps: setb 1 +Setting block 1, was clear before +tst_bitmaps: dump_bb +block bitmap: 01000000000000000000000000000000 +bits set: 1 +tst_bitmaps: setb 2 +Setting block 2, was clear before +tst_bitmaps: dump_bb +block bitmap: 03000000000000000000000000000000 +bits set: 2 +tst_bitmaps: setb 3 +Setting block 3, was clear before +tst_bitmaps: dump_bb +block bitmap: 07000000000000000000000000000000 +bits set: 3 +tst_bitmaps: setb 4 +Setting block 4, was clear before +tst_bitmaps: dump_bb +block bitmap: 0f000000000000000000000000000000 +bits set: 4 +tst_bitmaps: setb 5 +Setting block 5, was clear before +tst_bitmaps: dump_bb +block bitmap: 1f000000000000000000000000000000 +bits set: 5 +tst_bitmaps: setb 6 +Setting block 6, was clear before +tst_bitmaps: dump_bb +block bitmap: 3f000000000000000000000000000000 +bits set: 6 +tst_bitmaps: setb 7 +Setting block 7, was clear before +tst_bitmaps: dump_bb +block bitmap: 7f000000000000000000000000000000 +bits set: 7 +tst_bitmaps: setb 8 +Setting block 8, was clear before +tst_bitmaps: dump_bb +block bitmap: ff000000000000000000000000000000 +bits set: 8 +tst_bitmaps: setb 10 +Setting block 10, was clear before +tst_bitmaps: setb 12 +Setting block 12, was clear before +tst_bitmaps: setb 14 +Setting block 14, was clear before +tst_bitmaps: setb 17 +Setting block 17, was clear before +tst_bitmaps: setb 19 +Setting block 19, was clear before +tst_bitmaps: setb 24 +Setting block 24, was clear before +tst_bitmaps: setb 26 +Setting block 26, was clear before +tst_bitmaps: setb 27 +Setting block 27, was clear before +tst_bitmaps: setb 30 +Setting block 30, was clear before +tst_bitmaps: setb 31 +Setting block 31, was clear before +tst_bitmaps: setb 32 +Setting block 32, was clear before +tst_bitmaps: setb 35 +Setting block 35, was clear before +tst_bitmaps: setb 39 +Setting block 39, was clear before +tst_bitmaps: setb 40 +Setting block 40, was clear before +tst_bitmaps: setb 44 +Setting block 44, was clear before +tst_bitmaps: setb 46 +Setting block 46, was clear before +tst_bitmaps: setb 47 +Setting block 47, was clear before +tst_bitmaps: setb 49 +Setting block 49, was clear before +tst_bitmaps: setb 51 +Setting block 51, was clear before +tst_bitmaps: setb 52 +Setting block 52, was clear before +tst_bitmaps: clearb 2 +Clearing block 2, was set before +tst_bitmaps: clearb 3 +Clearing block 3, was set before +tst_bitmaps: clearb 7 +Clearing block 7, was set before +tst_bitmaps: dump_bb +block bitmap: b92a85e6c4680d000000000000000000 +bits set: 25 +tst_bitmaps: ffsb 14 127 +First marked block is 14 +tst_bitmaps: ffsb 15 127 +First marked block is 17 +tst_bitmaps: ffsb 36 127 +First marked block is 39 +tst_bitmaps: ffsb 32 127 +First marked block is 32 +tst_bitmaps: ffsb 52 127 +First marked block is 52 +tst_bitmaps: ffsb 53 127 +ext2fs_find_first_set_block_bitmap2() returned No such file or directory +tst_bitmaps: ffsb 46 127 +First marked block is 46 +tst_bitmaps: ffsb 45 127 +First marked block is 46 +tst_bitmaps: ffsb 41 127 +First marked block is 44 +tst_bitmaps: ffsb 20 127 +First marked block is 24 +tst_bitmaps: ffsb 1 127 +First marked block is 1 +tst_bitmaps: ffsb 2 127 +First marked block is 4 +tst_bitmaps: ffsb 3 127 +First marked block is 4 +tst_bitmaps: ffsb 4 127 +First marked block is 4 +tst_bitmaps: ffsb 5 127 +First marked block is 5 +tst_bitmaps: ffsb 6 127 +First marked block is 6 +tst_bitmaps: ffsb 7 127 +First marked block is 8 +tst_bitmaps: ffsb 8 127 +First marked block is 8 +tst_bitmaps: ffzb 1 127 +First unmarked block is 2 +tst_bitmaps: ffzb 2 127 +First unmarked block is 2 +tst_bitmaps: ffzb 3 127 +First unmarked block is 3 +tst_bitmaps: ffzb 4 127 +First unmarked block is 7 +tst_bitmaps: ffzb 5 127 +First unmarked block is 7 +tst_bitmaps: ffzb 6 127 +First unmarked block is 7 +tst_bitmaps: ffzb 7 127 +First unmarked block is 7 +tst_bitmaps: ffzb 8 127 +First unmarked block is 9 +tst_bitmaps: ffzb 45 127 +First unmarked block is 45 +tst_bitmaps: ffzb 46 127 +First unmarked block is 48 +tst_bitmaps: ffzb 47 127 +First unmarked block is 48 +tst_bitmaps: ffzb 48 127 +First unmarked block is 48 +tst_bitmaps: ffzb 49 127 +First unmarked block is 50 +tst_bitmaps: ffzb 50 127 +First unmarked block is 50 +tst_bitmaps: ffzb 51 127 +First unmarked block is 53 +tst_bitmaps: quit +tst_bitmaps: diff --git a/lib/ext2fs/tst_bitops.c b/lib/ext2fs/tst_bitops.c new file mode 100644 index 0000000..adef12d --- /dev/null +++ b/lib/ext2fs/tst_bitops.c @@ -0,0 +1,288 @@ +/* + * This testing program makes sure the bitops functions work + * + * Copyright (C) 2001 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#include <sys/stat.h> +#include <sys/types.h> +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <sys/time.h> +#include <sys/resource.h> + +#include "ext2_fs.h" +#include "ext2fs.h" + +unsigned char bitarray[] = { + 0x80, 0xF0, 0x40, 0x40, 0x0, 0x0, 0x0, 0x0, 0x10, 0x20, 0x00, 0x00 + }; + +int bits_list[] = { + 7, 12, 13, 14,15, 22, 30, 68, 77, -1, +}; + +#define BIG_TEST_BIT (((unsigned) 1 << 31) + 42) + + +int main(int argc, char **argv) +{ + int i, j, size; + unsigned char testarray[12]; + unsigned char *bigarray; + + size = sizeof(bitarray)*8; +#if 0 + i = ext2fs_find_first_bit_set(bitarray, size); + while (i < size) { + printf("Bit set: %d\n", i); + i = ext2fs_find_next_bit_set(bitarray, size, i+1); + } +#endif + + /* Test test_bit */ + for (i=0,j=0; i < size; i++) { + if (ext2fs_test_bit(i, bitarray)) { + if (bits_list[j] == i) { + j++; + } else { + printf("Bit %d set, not expected\n", i); + exit(1); + } + } else { + if (bits_list[j] == i) { + printf("Expected bit %d to be clear.\n", i); + exit(1); + } + } + } + printf("ext2fs_test_bit appears to be correct\n"); + + /* Test ext2fs_set_bit */ + memset(testarray, 0, sizeof(testarray)); + for (i=0; bits_list[i] > 0; i++) { + ext2fs_set_bit(bits_list[i], testarray); + } + if (memcmp(testarray, bitarray, sizeof(testarray)) == 0) { + printf("ext2fs_set_bit test succeeded.\n"); + } else { + printf("ext2fs_set_bit test failed.\n"); + for (i=0; i < sizeof(testarray); i++) { + printf("%02x ", testarray[i]); + } + printf("\n"); + exit(1); + } + for (i=0; bits_list[i] > 0; i++) { + ext2fs_clear_bit(bits_list[i], testarray); + } + for (i=0; i < sizeof(testarray); i++) { + if (testarray[i]) { + printf("ext2fs_clear_bit failed, " + "testarray[%d] is %d\n", i, testarray[i]); + exit(1); + } + } + printf("ext2fs_clear_bit test succeed.\n"); + + + /* Do bigarray test */ + bigarray = malloc(1 << 29); + if (!bigarray) { + fprintf(stderr, "Failed to allocate scratch memory!\n"); + exit(0); + } + + bigarray[BIG_TEST_BIT >> 3] = 0; + + ext2fs_set_bit(BIG_TEST_BIT, bigarray); + printf("big bit number (%u) test: %d, expected %d\n", BIG_TEST_BIT, + bigarray[BIG_TEST_BIT >> 3], (1 << (BIG_TEST_BIT & 7))); + if (bigarray[BIG_TEST_BIT >> 3] != (1 << (BIG_TEST_BIT & 7))) + exit(1); + + ext2fs_clear_bit(BIG_TEST_BIT, bigarray); + + printf("big bit number (%u) test: %d, expected 0\n", BIG_TEST_BIT, + bigarray[BIG_TEST_BIT >> 3]); + if (bigarray[BIG_TEST_BIT >> 3] != 0) + exit(1); + + printf("ext2fs_set_bit big_test successful\n"); + + + /* Now test ext2fs_fast_set_bit */ + memset(testarray, 0, sizeof(testarray)); + for (i=0; bits_list[i] > 0; i++) { + ext2fs_fast_set_bit(bits_list[i], testarray); + } + if (memcmp(testarray, bitarray, sizeof(testarray)) == 0) { + printf("ext2fs_fast_set_bit test succeeded.\n"); + } else { + printf("ext2fs_fast_set_bit test failed.\n"); + for (i=0; i < sizeof(testarray); i++) { + printf("%02x ", testarray[i]); + } + printf("\n"); + exit(1); + } + for (i=0; bits_list[i] > 0; i++) { + ext2fs_clear_bit(bits_list[i], testarray); + } + for (i=0; i < sizeof(testarray); i++) { + if (testarray[i]) { + printf("ext2fs_clear_bit failed, " + "testarray[%d] is %d\n", i, testarray[i]); + exit(1); + } + } + printf("ext2fs_clear_bit test succeed.\n"); + + + bigarray[BIG_TEST_BIT >> 3] = 0; + + ext2fs_fast_set_bit(BIG_TEST_BIT, bigarray); + printf("big bit number (%u) test: %d, expected %d\n", BIG_TEST_BIT, + bigarray[BIG_TEST_BIT >> 3], (1 << (BIG_TEST_BIT & 7))); + if (bigarray[BIG_TEST_BIT >> 3] != (1 << (BIG_TEST_BIT & 7))) + exit(1); + + ext2fs_fast_clear_bit(BIG_TEST_BIT, bigarray); + + printf("big bit number (%u) test: %d, expected 0\n", BIG_TEST_BIT, + bigarray[BIG_TEST_BIT >> 3]); + if (bigarray[BIG_TEST_BIT >> 3] != 0) + exit(1); + + printf("ext2fs_fast_set_bit big_test successful\n"); + + /* Repeat foregoing tests for 64-bit bitops */ + + /* Test test_bit */ + for (i=0,j=0; i < size; i++) { + if (ext2fs_test_bit64(i, bitarray)) { + if (bits_list[j] == i) { + j++; + } else { + printf("64-bit: Bit %d set, not expected\n", + i); + exit(1); + } + } else { + if (bits_list[j] == i) { + printf("64-bit: " + "Expected bit %d to be clear.\n", i); + exit(1); + } + } + } + printf("64-bit: ext2fs_test_bit appears to be correct\n"); + + /* Test ext2fs_set_bit */ + memset(testarray, 0, sizeof(testarray)); + for (i=0; bits_list[i] > 0; i++) { + ext2fs_set_bit64(bits_list[i], testarray); + } + if (memcmp(testarray, bitarray, sizeof(testarray)) == 0) { + printf("64-bit: ext2fs_set_bit test succeeded.\n"); + } else { + printf("64-bit: ext2fs_set_bit test failed.\n"); + for (i=0; i < sizeof(testarray); i++) { + printf("%02x ", testarray[i]); + } + printf("\n"); + exit(1); + } + for (i=0; bits_list[i] > 0; i++) { + ext2fs_clear_bit64(bits_list[i], testarray); + } + for (i=0; i < sizeof(testarray); i++) { + if (testarray[i]) { + printf("64-bit: ext2fs_clear_bit failed, " + "testarray[%d] is %d\n", i, testarray[i]); + exit(1); + } + } + printf("64-bit: ext2fs_clear_bit test succeed.\n"); + + /* Do bigarray test */ + bigarray[BIG_TEST_BIT >> 3] = 0; + + ext2fs_set_bit64(BIG_TEST_BIT, bigarray); + printf("64-bit: big bit number (%u) test: %d, expected %d\n", + BIG_TEST_BIT, bigarray[BIG_TEST_BIT >> 3], + (1 << (BIG_TEST_BIT & 7))); + if (bigarray[BIG_TEST_BIT >> 3] != (1 << (BIG_TEST_BIT & 7))) + exit(1); + + ext2fs_clear_bit64(BIG_TEST_BIT, bigarray); + + printf("64-bit: big bit number (%u) test: %d, expected 0\n", + BIG_TEST_BIT, + bigarray[BIG_TEST_BIT >> 3]); + if (bigarray[BIG_TEST_BIT >> 3] != 0) + exit(1); + + printf("64-bit: ext2fs_set_bit big_test successful\n"); + + /* Now test ext2fs_fast_set_bit */ + memset(testarray, 0, sizeof(testarray)); + for (i=0; bits_list[i] > 0; i++) { + ext2fs_fast_set_bit64(bits_list[i], testarray); + } + if (memcmp(testarray, bitarray, sizeof(testarray)) == 0) { + printf("64-bit: ext2fs_fast_set_bit test succeeded.\n"); + } else { + printf("64-bit: ext2fs_fast_set_bit test failed.\n"); + for (i=0; i < sizeof(testarray); i++) { + printf("%02x ", testarray[i]); + } + printf("\n"); + exit(1); + } + for (i=0; bits_list[i] > 0; i++) { + ext2fs_clear_bit64(bits_list[i], testarray); + } + for (i=0; i < sizeof(testarray); i++) { + if (testarray[i]) { + printf("64-bit: ext2fs_clear_bit failed, " + "testarray[%d] is %d\n", i, testarray[i]); + exit(1); + } + } + printf("64-bit: ext2fs_clear_bit test succeed.\n"); + + bigarray[BIG_TEST_BIT >> 3] = 0; + + ext2fs_fast_set_bit64(BIG_TEST_BIT, bigarray); + printf("64-bit: big bit number (%u) test: %d, expected %d\n", + BIG_TEST_BIT, bigarray[BIG_TEST_BIT >> 3], + (1 << (BIG_TEST_BIT & 7))); + if (bigarray[BIG_TEST_BIT >> 3] != (1 << (BIG_TEST_BIT & 7))) + exit(1); + + ext2fs_fast_clear_bit64(BIG_TEST_BIT, bigarray); + + printf("64-bit: big bit number (%u) test: %d, expected 0\n", + BIG_TEST_BIT, bigarray[BIG_TEST_BIT >> 3]); + if (bigarray[BIG_TEST_BIT >> 3] != 0) + exit(1); + + printf("64-bit: ext2fs_fast_set_bit big_test successful\n"); + free(bigarray); + exit(0); +} diff --git a/lib/ext2fs/tst_byteswap.c b/lib/ext2fs/tst_byteswap.c new file mode 100644 index 0000000..c500cae --- /dev/null +++ b/lib/ext2fs/tst_byteswap.c @@ -0,0 +1,93 @@ +/* + * This testing program makes sure the byteswap functions work + * + * Copyright (C) 2000 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#include <sys/stat.h> +#include <sys/types.h> +#if HAVE_ERRNO_H +#include <errno.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +__u16 test1[] = { + 0x0001, 0x0100, + 0x1234, 0x3412, + 0xff00, 0x00ff, + 0x4000, 0x0040, + 0xfeff, 0xfffe, + 0x0000, 0x0000 + }; + +__u32 test2[] = { + 0x00000001, 0x01000000, + 0x80000000, 0x00000080, + 0x12345678, 0x78563412, + 0xffff0000, 0x0000ffff, + 0x00ff0000, 0x0000ff00, + 0xff000000, 0x000000ff, + 0x00000000, 0x00000000 + }; + +int main(int argc, char **argv) +{ + int i; + int errors = 0; + + printf("Testing ext2fs_swab16\n"); + i=0; + do { + printf("swab16(0x%04x) = 0x%04x\n", test1[i], + ext2fs_swab16(test1[i])); + if (ext2fs_swab16(test1[i]) != test1[i+1]) { + printf("Error!!! %04x != %04x\n", + ext2fs_swab16(test1[i]), test1[i+1]); + errors++; + } + if (ext2fs_swab16(test1[i+1]) != test1[i]) { + printf("Error!!! %04x != %04x\n", + ext2fs_swab16(test1[i+1]), test1[i]); + errors++; + } + i += 2; + } while (test1[i] != 0); + + printf("Testing ext2fs_swab32\n"); + i = 0; + do { + printf("swab32(0x%08x) = 0x%08x\n", test2[i], + ext2fs_swab32(test2[i])); + if (ext2fs_swab32(test2[i]) != test2[i+1]) { + printf("Error!!! %04x != %04x\n", + ext2fs_swab32(test2[i]), test2[i+1]); + errors++; + } + if (ext2fs_swab32(test2[i+1]) != test2[i]) { + printf("Error!!! %04x != %04x\n", + ext2fs_swab32(test2[i+1]), test2[i]); + errors++; + } + i += 2; + } while (test2[i] != 0); + + if (!errors) + printf("No errors found in the byteswap implementation!\n"); + + return errors; +} diff --git a/lib/ext2fs/tst_cmds.ct b/lib/ext2fs/tst_cmds.ct new file mode 100644 index 0000000..45a8594 --- /dev/null +++ b/lib/ext2fs/tst_cmds.ct @@ -0,0 +1,6 @@ +command_table libext2fs_cmds; + +request do_block_iterate, "block_iterate", + block_iterate; + +end; diff --git a/lib/ext2fs/tst_fs_struct.c b/lib/ext2fs/tst_fs_struct.c new file mode 100644 index 0000000..6f44df1 --- /dev/null +++ b/lib/ext2fs/tst_fs_struct.c @@ -0,0 +1,81 @@ +/* + * This testing program checks the offset of the ext2_filsys structure + * + * Copyright (C) 2007 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include <stdio.h> +#include <unistd.h> +#include <stdlib.h> + +#include "ext2fs.h" + +struct struct_ext2_filsys fs; + +#ifndef offsetof +#define offsetof(type, member) __builtin_offsetof (type, member) +#endif +#define check_field(x) cur_offset = do_field(#x, sizeof(fs.x), \ + offsetof(struct struct_ext2_filsys, x), \ + cur_offset) + +static int do_field(const char *field, size_t size, int offset, int cur_offset) +{ + if (offset != cur_offset) { + printf("\t(padding %d bytes?)\n", offset - cur_offset); + } + printf("%8d %-30s %3u\n", offset, field, (unsigned) size); + return offset + size; +} + +int main(int argc, char **argv) +{ +#if (__GNUC__ >= 4) + int cur_offset = 0; + + printf("%8s %-30s %3s\n", "offset", "field", "size"); + check_field(magic); + check_field(io); + check_field(flags); + check_field(device_name); + check_field(super); + check_field(blocksize); + check_field(fragsize); + check_field(group_desc_count); + check_field(desc_blocks); + check_field(group_desc); + check_field(inode_blocks_per_group); + check_field(inode_map); + check_field(block_map); + check_field(get_blocks); + check_field(check_directory); + check_field(write_bitmaps); + check_field(read_inode); + check_field(write_inode); + check_field(badblocks); + check_field(dblist); + check_field(stride); + check_field(orig_super); + check_field(image_header); + check_field(umask); + check_field(now); + check_field(cluster_ratio_bits); + check_field(reserved); + check_field(priv_data); + check_field(icache); + check_field(image_io); + check_field(get_alloc_block); + check_field(block_alloc_stats); + check_field(mmp_buf); + check_field(mmp_cmp); + check_field(mmp_fd); + check_field(mmp_last_written); + printf("Ending offset is %d\n\n", cur_offset); +#endif + exit(0); +} diff --git a/lib/ext2fs/tst_getsectsize.c b/lib/ext2fs/tst_getsectsize.c new file mode 100644 index 0000000..d616965 --- /dev/null +++ b/lib/ext2fs/tst_getsectsize.c @@ -0,0 +1,63 @@ +/* + * tst_getsize.c --- this function tests the getsize function + * + * Copyright (C) 1997 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#include <sys/stat.h> +#include <sys/types.h> +#if HAVE_ERRNO_H +#include <errno.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +int main(int argc, char **argv) +{ + int lsectsize, psectsize; + int retval; + int fd; + + if (argc < 2) { + fprintf(stderr, "Usage: %s device\n", argv[0]); + exit(1); + } + + retval = ext2fs_get_device_sectsize(argv[1], &lsectsize); + if (retval) { + com_err(argv[0], retval, + "while calling ext2fs_get_device_sectsize"); + exit(1); + } + retval = ext2fs_get_device_phys_sectsize(argv[1], &psectsize); + if (retval) { + com_err(argv[0], retval, + "while calling ext2fs_get_device_phys_sectsize"); + exit(1); + } + printf("Device %s has logical/physical sector size of %d/%d.\n", + argv[1], lsectsize, psectsize); + fd = open(argv[1], O_RDONLY); + if (fd < 0) { + perror("open"); + exit(1); + } + printf("The device's DIO alignment is %d\n", + ext2fs_get_dio_alignment(fd)); + close(fd); + exit(0); +} diff --git a/lib/ext2fs/tst_getsize.c b/lib/ext2fs/tst_getsize.c new file mode 100644 index 0000000..ba869dc --- /dev/null +++ b/lib/ext2fs/tst_getsize.c @@ -0,0 +1,47 @@ +/* + * tst_getsize.c --- this function tests the getsize function + * + * Copyright (C) 1997 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#include <sys/stat.h> +#include <sys/types.h> +#if HAVE_ERRNO_H +#include <errno.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +int main(int argc, const char *argv[]) +{ + errcode_t retval; + blk64_t blocks; + + if (argc < 2) { + fprintf(stderr, "%s device\n", argv[0]); + exit(1); + } + add_error_table(&et_ext2_error_table); + retval = ext2fs_get_device_size2(argv[1], 1024, &blocks); + if (retval) { + com_err(argv[0], retval, "while getting device size"); + exit(1); + } + printf("%s is device has %llu blocks.\n", argv[1], + (unsigned long long) blocks); + return 0; +} diff --git a/lib/ext2fs/tst_inode_size.c b/lib/ext2fs/tst_inode_size.c new file mode 100644 index 0000000..cc5d165 --- /dev/null +++ b/lib/ext2fs/tst_inode_size.c @@ -0,0 +1,89 @@ +/* + * This testing program makes sure the ext2_inode structure is 1024 bytes long + * + * Copyright (C) 2007 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <unistd.h> +#include <stdlib.h> + +#include "ext2_fs.h" + +struct ext2_inode_large inode; + +#ifndef offsetof +#define offsetof(type, member) __builtin_offsetof(type, member) +#endif + +#define check_field(x, s) cur_offset = do_field(#x, s, sizeof(inode.x), \ + offsetof(struct ext2_inode_large, x), \ + cur_offset) + +static int do_field(const char *field, unsigned size, unsigned cur_size, + unsigned offset, unsigned cur_offset) +{ + if (size != cur_size) { + printf("error: %s size %u should be %u\n", + field, cur_size, size); + exit(1); + } + if (offset != cur_offset) { + printf("error: %s offset %u should be %u\n", + field, cur_offset, offset); + exit(1); + } + printf("%8d %-30s %3u\n", offset, field, (unsigned) size); + return offset + size; +} + +int main(int argc, char **argv) +{ +#if (__GNUC__ >= 4) + int cur_offset = 0; + + printf("%8s %-30s %3s\n", "offset", "field", "size"); + check_field(i_mode, 2); + check_field(i_uid, 2); + check_field(i_size, 4); + check_field(i_atime, 4); + check_field(i_ctime, 4); + check_field(i_mtime, 4); + check_field(i_dtime, 4); + check_field(i_gid, 2); + check_field(i_links_count, 2); + check_field(i_blocks, 4); + check_field(i_flags, 4); + check_field(osd1.linux1.l_i_version, 4); + check_field(i_block, 15 * 4); + check_field(i_generation, 4); + check_field(i_file_acl, 4); + check_field(i_size_high, 4); + check_field(i_faddr, 4); + check_field(osd2.linux2.l_i_blocks_hi, 2); + check_field(osd2.linux2.l_i_file_acl_high, 2); + check_field(osd2.linux2.l_i_uid_high, 2); + check_field(osd2.linux2.l_i_gid_high, 2); + check_field(osd2.linux2.l_i_checksum_lo, 2); + check_field(osd2.linux2.l_i_reserved, 2); + do_field("Small inode end", 0, 0, cur_offset, 128); + check_field(i_extra_isize, 2); + check_field(i_checksum_hi, 2); + check_field(i_ctime_extra, 4); + check_field(i_mtime_extra, 4); + check_field(i_atime_extra, 4); + check_field(i_crtime, 4); + check_field(i_crtime_extra, 4); + check_field(i_version_hi, 4); + check_field(i_projid, 4); + /* This size will change as new fields are added */ + do_field("Large inode end", 0, 0, cur_offset, sizeof(inode)); +#endif + return 0; +} diff --git a/lib/ext2fs/tst_iscan.c b/lib/ext2fs/tst_iscan.c new file mode 100644 index 0000000..76aaa9a --- /dev/null +++ b/lib/ext2fs/tst_iscan.c @@ -0,0 +1,227 @@ +/* + * tst_inode.c --- this function tests the inode scan function + * + * Copyright (C) 1996 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <fcntl.h> +#include <time.h> +#include <sys/stat.h> +#include <sys/types.h> +#if HAVE_ERRNO_H +#include <errno.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +blk64_t test_vec[] = { 8, 12, 24, 34, 43, 44, 100, 0 }; + +ext2_filsys test_fs; +ext2fs_block_bitmap bad_block_map, touched_map; +ext2fs_inode_bitmap bad_inode_map; +badblocks_list test_badblocks; + +int first_no_comma = 1; +int failed = 0; + +static void iscan_test_read_blk64(unsigned long long block, int count, errcode_t err) +{ + int i; + + if (first_no_comma) + first_no_comma = 0; + else + printf(", "); + + if (count > 1) + printf("%llu-%llu", block, block+count-1); + else + printf("%llu", block); + + for (i=0; i < count; i++, block++) { + if (ext2fs_test_block_bitmap2(touched_map, block)) { + printf("\nDuplicate block?!? --- %llu\n", block); + failed++; + first_no_comma = 1; + } + ext2fs_mark_block_bitmap2(touched_map, block); + } +} + +static void iscan_test_read_blk(unsigned long block, int count, errcode_t err) +{ + iscan_test_read_blk64(block, count, err); +} + +/* + * Setup the variables for doing the inode scan test. + */ +static void setup(void) +{ + errcode_t retval; + int i; + struct ext2_super_block param; + + initialize_ext2_error_table(); + + memset(¶m, 0, sizeof(param)); + ext2fs_blocks_count_set(¶m, 12000); + + + test_io_cb_read_blk = iscan_test_read_blk; + test_io_cb_read_blk64 = iscan_test_read_blk64; + + retval = ext2fs_initialize("test fs", EXT2_FLAG_64BITS, ¶m, + test_io_manager, &test_fs); + if (retval) { + com_err("setup", retval, + "While initializing filesystem"); + exit(1); + } + retval = ext2fs_allocate_tables(test_fs); + if (retval) { + com_err("setup", retval, + "While allocating tables for test filesystem"); + exit(1); + } + retval = ext2fs_allocate_block_bitmap(test_fs, "bad block map", + &bad_block_map); + if (retval) { + com_err("setup", retval, + "While allocating bad_block bitmap"); + exit(1); + } + retval = ext2fs_allocate_block_bitmap(test_fs, "touched map", + &touched_map); + if (retval) { + com_err("setup", retval, + "While allocating touched block bitmap"); + exit(1); + } + retval = ext2fs_allocate_inode_bitmap(test_fs, "bad inode map", + &bad_inode_map); + if (retval) { + com_err("setup", retval, + "While allocating bad inode bitmap"); + exit(1); + } + + retval = ext2fs_badblocks_list_create(&test_badblocks, 5); + if (retval) { + com_err("setup", retval, "while creating badblocks list"); + exit(1); + } + for (i=0; test_vec[i]; i++) { + retval = ext2fs_badblocks_list_add(test_badblocks, test_vec[i]); + if (retval) { + com_err("setup", retval, + "while adding test vector %d", i); + exit(1); + } + ext2fs_mark_block_bitmap2(bad_block_map, test_vec[i]); + } + test_fs->badblocks = test_badblocks; +} + +/* + * Iterate using inode_scan + */ +static void iterate(void) +{ + struct ext2_inode inode; + ext2_inode_scan scan; + errcode_t retval; + ext2_ino_t ino; + + retval = ext2fs_open_inode_scan(test_fs, 8, &scan); + if (retval) { + com_err("iterate", retval, "While opening inode scan"); + exit(1); + } + printf("Reading blocks: "); + retval = ext2fs_get_next_inode(scan, &ino, &inode); + if (retval) { + com_err("iterate", retval, "while reading first inode"); + exit(1); + } + while (ino) { + retval = ext2fs_get_next_inode(scan, &ino, &inode); + if (retval == EXT2_ET_BAD_BLOCK_IN_INODE_TABLE) { + ext2fs_mark_inode_bitmap2(bad_inode_map, ino); + continue; + } + if (retval) { + com_err("iterate", retval, + "while getting next inode"); + exit(1); + } + } + printf("\n"); + ext2fs_close_inode_scan(scan); +} + +/* + * Verify the touched map + */ +static void check_map(void) +{ + int i, j, first=1; + blk64_t blk; + + for (i=0; test_vec[i]; i++) { + if (ext2fs_test_block_bitmap2(touched_map, test_vec[i])) { + printf("Bad block was touched --- %llu\n", + (unsigned long long) test_vec[i]); + failed++; + first_no_comma = 1; + } + ext2fs_mark_block_bitmap2(touched_map, test_vec[i]); + } + for (i = 0; i < test_fs->group_desc_count; i++) { + for (j=0, blk = ext2fs_inode_table_loc(test_fs, i); + j < test_fs->inode_blocks_per_group; + j++, blk++) { + if (!ext2fs_test_block_bitmap2(touched_map, blk) && + !ext2fs_test_block_bitmap2(bad_block_map, blk)) { + printf("Missing block --- %llu\n", + (unsigned long long) blk); + failed++; + } + } + } + printf("Bad inodes: "); + for (i=1; i <= test_fs->super->s_inodes_count; i++) { + if (ext2fs_test_inode_bitmap2(bad_inode_map, i)) { + if (first) + first = 0; + else + printf(", "); + printf("%u", i); + } + } + printf("\n"); +} + + +int main(int argc, char **argv) +{ + setup(); + iterate(); + check_map(); + if (!failed) + printf("Inode scan tested OK!\n"); + return failed; +} + diff --git a/lib/ext2fs/tst_libext2fs.c b/lib/ext2fs/tst_libext2fs.c new file mode 100644 index 0000000..4c86464 --- /dev/null +++ b/lib/ext2fs/tst_libext2fs.c @@ -0,0 +1,72 @@ +/* + * tst_libext2fs.c + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif + +#include "ext2_fs.h" +#include "ext2fsP.h" + +#include "ss/ss.h" +#include "debugfs.h" + +/* + * Hook in new commands into debugfs + * Override debugfs's prompt + */ +const char *debug_prog_name = "tst_libext2fs"; +extern ss_request_table libext2fs_cmds; +ss_request_table *extra_cmds = &libext2fs_cmds; + +static int print_blocks_proc(ext2_filsys fs EXT2FS_ATTR((unused)), + blk64_t *blocknr, e2_blkcnt_t blockcnt, + blk64_t ref_block, int ref_offset, + void *private EXT2FS_ATTR((unused))) +{ + printf("%6lld %8llu (%d %llu)\n", (long long) blockcnt, + (unsigned long long) *blocknr, ref_offset, + (unsigned long long) ref_block); + return 0; +} + + +void do_block_iterate(int argc, char **argv, int sci_idx EXT2FS_ATTR((unused)), + void *infop EXT2FS_ATTR((unused))) +{ + const char *usage = "block_iterate <file> <flags"; + ext2_ino_t ino; + int err = 0; + int flags = 0; + + if (common_args_process(argc, argv, 2, 3, argv[0], usage, 0)) + return; + + ino = string_to_inode(argv[1]); + if (!ino) + return; + + if (argc > 2) { + flags = parse_ulong(argv[2], argv[0], "flags", &err); + if (err) + return; + } + flags |= BLOCK_FLAG_READ_ONLY; + + ext2fs_block_iterate3(current_fs, ino, flags, NULL, + print_blocks_proc, NULL); + putc('\n', stdout); +} diff --git a/lib/ext2fs/tst_super_size.c b/lib/ext2fs/tst_super_size.c new file mode 100644 index 0000000..ad452de --- /dev/null +++ b/lib/ext2fs/tst_super_size.c @@ -0,0 +1,161 @@ +/* + * This testing program makes sure superblock size is 1024 bytes long + * + * Copyright (C) 2007 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <unistd.h> +#include <stdlib.h> + +#include "ext2_fs.h" + +#define sb_struct ext2_super_block +#define sb_struct_name "ext2_super_block" + +struct sb_struct sb; + +#ifndef offsetof +#define offsetof(type, member) __builtin_offsetof (type, member) +#endif + +#define check_field(x, s) cur_offset = do_field(#x, s, sizeof(sb.x), \ + offsetof(struct sb_struct, x), \ + cur_offset) + +static int do_field(const char *field, unsigned size, unsigned cur_size, + unsigned offset, unsigned cur_offset) +{ + if (size != cur_size) { + printf("error: %s size %u should be %u\n", + field, cur_size, size); + exit(1); + } + if (offset != cur_offset) { + printf("error: %s offset %u should be %u\n", + field, cur_offset, offset); + exit(1); + } + printf("%8d %-30s %3u\n", offset, field, size); + return offset + size; +} + +int main(int argc, char **argv) +{ +#if (__GNUC__ >= 4) + int cur_offset = 0; + + printf("%8s %-30s %3s\n", "offset", "field", "size"); + check_field(s_inodes_count, 4); + check_field(s_blocks_count, 4); + check_field(s_r_blocks_count, 4); + check_field(s_free_blocks_count, 4); + check_field(s_free_inodes_count, 4); + check_field(s_first_data_block, 4); + check_field(s_log_block_size, 4); + check_field(s_log_cluster_size, 4); + check_field(s_blocks_per_group, 4); + check_field(s_clusters_per_group, 4); + check_field(s_inodes_per_group, 4); + check_field(s_mtime, 4); + check_field(s_wtime, 4); + check_field(s_mnt_count, 2); + check_field(s_max_mnt_count, 2); + check_field(s_magic, 2); + check_field(s_state, 2); + check_field(s_errors, 2); + check_field(s_minor_rev_level, 2); + check_field(s_lastcheck, 4); + check_field(s_checkinterval, 4); + check_field(s_creator_os, 4); + check_field(s_rev_level, 4); + check_field(s_def_resuid, 2); + check_field(s_def_resgid, 2); + check_field(s_first_ino, 4); + check_field(s_inode_size, 2); + check_field(s_block_group_nr, 2); + check_field(s_feature_compat, 4); + check_field(s_feature_incompat, 4); + check_field(s_feature_ro_compat, 4); + check_field(s_uuid, 16); + check_field(s_volume_name, 16); + check_field(s_last_mounted, 64); + check_field(s_algorithm_usage_bitmap, 4); + check_field(s_prealloc_blocks, 1); + check_field(s_prealloc_dir_blocks, 1); + check_field(s_reserved_gdt_blocks, 2); + check_field(s_journal_uuid, 16); + check_field(s_journal_inum, 4); + check_field(s_journal_dev, 4); + check_field(s_last_orphan, 4); + check_field(s_hash_seed, 4 * 4); + check_field(s_def_hash_version, 1); + check_field(s_jnl_backup_type, 1); + check_field(s_desc_size, 2); + check_field(s_default_mount_opts, 4); + check_field(s_first_meta_bg, 4); + check_field(s_mkfs_time, 4); + check_field(s_jnl_blocks, 17 * 4); + check_field(s_blocks_count_hi, 4); + check_field(s_r_blocks_count_hi, 4); + check_field(s_free_blocks_hi, 4); + check_field(s_min_extra_isize, 2); + check_field(s_want_extra_isize, 2); + check_field(s_flags, 4); + check_field(s_raid_stride, 2); + check_field(s_mmp_update_interval, 2); + check_field(s_mmp_block, 8); + check_field(s_raid_stripe_width, 4); + check_field(s_log_groups_per_flex, 1); + check_field(s_checksum_type, 1); + check_field(s_encryption_level, 1); + check_field(s_reserved_pad, 1); + check_field(s_kbytes_written, 8); + check_field(s_snapshot_inum, 4); + check_field(s_snapshot_id, 4); + check_field(s_snapshot_r_blocks_count, 8); + check_field(s_snapshot_list, 4); + check_field(s_error_count, 4); + check_field(s_first_error_time, 4); + check_field(s_first_error_ino, 4); + check_field(s_first_error_block, 8); + check_field(s_first_error_func, 32); + check_field(s_first_error_line, 4); + check_field(s_last_error_time, 4); + check_field(s_last_error_ino, 4); + check_field(s_last_error_line, 4); + check_field(s_last_error_block, 8); + check_field(s_last_error_func, 32); + check_field(s_mount_opts, 64); + check_field(s_usr_quota_inum, 4); + check_field(s_grp_quota_inum, 4); + check_field(s_overhead_clusters, 4); + check_field(s_backup_bgs, 8); + check_field(s_encrypt_algos, 4); + check_field(s_encrypt_pw_salt, 16); + check_field(s_lpf_ino, 4); + check_field(s_prj_quota_inum, 4); + check_field(s_checksum_seed, 4); + check_field(s_wtime_hi, 1); + check_field(s_mtime_hi, 1); + check_field(s_mkfs_time_hi, 1); + check_field(s_lastcheck_hi, 1); + check_field(s_first_error_time_hi, 1); + check_field(s_last_error_time_hi, 1); + check_field(s_first_error_errcode, 1); + check_field(s_last_error_errcode, 1); + check_field(s_encoding, 2); + check_field(s_encoding_flags, 2); + check_field(s_orphan_file_inum, 4); + check_field(s_reserved, 94 * 4); + check_field(s_checksum, 4); + do_field("Superblock end", 0, 0, cur_offset, 1024); +#endif + return 0; +} diff --git a/lib/ext2fs/tst_types.c b/lib/ext2fs/tst_types.c new file mode 100644 index 0000000..3e41128 --- /dev/null +++ b/lib/ext2fs/tst_types.c @@ -0,0 +1,64 @@ +/* + * This testing program makes sure the ext2_types header file + * + * Copyright (C) 2006 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <stdlib.h> +#include <unistd.h> + +#include "ext2fs/ext2_types.h" + +int main(int argc, char **argv) +{ + if (sizeof(__u8) != 1) { + printf("Sizeof(__u8) is %d should be 1\n", + (int)sizeof(__u8)); + exit(1); + } + if (sizeof(__s8) != 1) { + printf("Sizeof(_s8) is %d should be 1\n", + (int)sizeof(__s8)); + exit(1); + } + if (sizeof(__u16) != 2) { + printf("Sizeof(__u16) is %d should be 2\n", + (int)sizeof(__u16)); + exit(1); + } + if (sizeof(__s16) != 2) { + printf("Sizeof(__s16) is %d should be 2\n", + (int)sizeof(__s16)); + exit(1); + } + if (sizeof(__u32) != 4) { + printf("Sizeof(__u32) is %d should be 4\n", + (int)sizeof(__u32)); + exit(1); + } + if (sizeof(__s32) != 4) { + printf("Sizeof(__s32) is %d should be 4\n", + (int)sizeof(__s32)); + exit(1); + } + if (sizeof(__u64) != 8) { + printf("Sizeof(__u64) is %d should be 8\n", + (int)sizeof(__u64)); + exit(1); + } + if (sizeof(__s64) != 8) { + printf("Sizeof(__s64) is %d should be 8\n", + (int)sizeof(__s64)); + exit(1); + } + printf("The ext2_types.h types are correct.\n"); + exit(0); +} + diff --git a/lib/ext2fs/undo_io.c b/lib/ext2fs/undo_io.c new file mode 100644 index 0000000..f4a6d52 --- /dev/null +++ b/lib/ext2fs/undo_io.c @@ -0,0 +1,1108 @@ +/* + * undo_io.c --- This is the undo io manager that copies the old data that + * copies the old data being overwritten into a tdb database + * + * Copyright IBM Corporation, 2007 + * Author Aneesh Kumar K.V <aneesh.kumar@linux.vnet.ibm.com> + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#ifndef _LARGEFILE_SOURCE +#define _LARGEFILE_SOURCE +#endif +#ifndef _LARGEFILE64_SOURCE +#define _LARGEFILE64_SOURCE +#endif + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <fcntl.h> +#include <time.h> +#ifdef __linux__ +#include <sys/utsname.h> +#endif +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#if HAVE_SYS_RESOURCE_H +#include <sys/resource.h> +#endif +#include <limits.h> + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +#ifdef __GNUC__ +#define ATTR(x) __attribute__(x) +#else +#define ATTR(x) +#endif + +#undef DEBUG + +#ifdef DEBUG +# define dbg_printf(f, a...) do {printf(f, ## a); fflush(stdout); } while (0) +#else +# define dbg_printf(f, a...) +#endif + +/* + * For checking structure magic numbers... + */ + +#define EXT2_CHECK_MAGIC(struct, code) \ + if ((struct)->magic != (code)) return (code) +/* + * Undo file format: The file is cut up into undo_header.block_size blocks. + * The first block contains the header. + * The second block contains the superblock. + * There is then a repeating series of blocks as follows: + * A key block, which contains undo_keys to map the following data blocks. + * Data blocks + * (Note that there are pointers to the first key block and the sb, so this + * order isn't strictly necessary.) + */ +#define E2UNDO_MAGIC "E2UNDO02" +#define KEYBLOCK_MAGIC 0xCADECADE + +#define E2UNDO_STATE_FINISHED 0x1 /* undo file is complete */ + +#define E2UNDO_MIN_BLOCK_SIZE 1024 /* undo blocks are no less than 1KB */ +#define E2UNDO_MAX_BLOCK_SIZE 1048576 /* undo blocks are no more than 1MB */ + +struct undo_header { + char magic[8]; /* "E2UNDO02" */ + __le64 num_keys; /* how many keys? */ + __le64 super_offset; /* where in the file is the superblock copy? */ + __le64 key_offset; /* where do the key/data block chunks start? */ + __le32 block_size; /* block size of the undo file */ + __le32 fs_block_size; /* block size of the target device */ + __le32 sb_crc; /* crc32c of the superblock */ + __le32 state; /* e2undo state flags */ + __le32 f_compat; /* compatible features */ + __le32 f_incompat; /* incompatible features (none so far) */ + __le32 f_rocompat; /* ro compatible features (none so far) */ + __le32 pad32; /* padding for fs_offset */ + __le64 fs_offset; /* filesystem offset */ + __u8 padding[436]; /* padding */ + __le32 header_crc; /* crc32c of this header (but not this field) */ +}; + +#define E2UNDO_MAX_EXTENT_BLOCKS 512 /* max extent size, in blocks */ + +struct undo_key { + __le64 fsblk; /* where in the fs does the block go */ + __le32 blk_crc; /* crc32c of the block */ + __le32 size; /* how many bytes in this block? */ +}; + +struct undo_key_block { + __le32 magic; /* KEYBLOCK_MAGIC number */ + __le32 crc; /* block checksum */ + __le64 reserved; /* zero */ + +#if __STDC_VERSION__ >= 199901L + struct undo_key keys[]; /* keys, which come immediately after */ +#else + struct undo_key keys[0]; /* keys, which come immediately after */ +#endif +}; + +struct undo_private_data { + int magic; + + /* the undo file io channel */ + io_channel undo_file; + blk64_t undo_blk_num; /* next free block */ + blk64_t key_blk_num; /* current key block location */ + blk64_t super_blk_num; /* superblock location */ + blk64_t first_key_blk; /* first key block location */ + struct undo_key_block *keyb; + size_t num_keys, keys_in_block; + + /* The backing io channel */ + io_channel real; + + unsigned long long tdb_data_size; + int tdb_written; + + /* to support offset in unix I/O manager */ + ext2_loff_t offset; + + ext2fs_block_bitmap written_block_map; + struct struct_ext2_filsys fake_fs; + char *tdb_file; + struct undo_header hdr; +}; +#define KEYS_PER_BLOCK(d) (((d)->tdb_data_size / sizeof(struct undo_key)) - 1) + +#define E2UNDO_FEATURE_COMPAT_FS_OFFSET 0x1 /* the filesystem offset */ + +static inline void e2undo_set_feature_fs_offset(struct undo_header *header) { + header->f_compat |= ext2fs_le32_to_cpu(E2UNDO_FEATURE_COMPAT_FS_OFFSET); +} + +static inline void e2undo_clear_feature_fs_offset(struct undo_header *header) { + header->f_compat &= ~ext2fs_le32_to_cpu(E2UNDO_FEATURE_COMPAT_FS_OFFSET); +} + +static io_manager undo_io_backing_manager; +static char *tdb_file; +static int actual_size; + +errcode_t set_undo_io_backing_manager(io_manager manager) +{ + /* + * We may want to do some validation later + */ + undo_io_backing_manager = manager; + return 0; +} + +errcode_t set_undo_io_backup_file(char *file_name) +{ + tdb_file = strdup(file_name); + + if (tdb_file == NULL) { + return EXT2_ET_NO_MEMORY; + } + + return 0; +} + +static errcode_t write_undo_indexes(struct undo_private_data *data, int flush) +{ + errcode_t retval; + struct ext2_super_block super; + io_channel channel; + int block_size; + __u32 sb_crc, hdr_crc; + + /* Spit out a key block, if there's any data */ + if (data->keys_in_block) { + data->keyb->magic = ext2fs_cpu_to_le32(KEYBLOCK_MAGIC); + data->keyb->crc = 0; + data->keyb->crc = ext2fs_cpu_to_le32( + ext2fs_crc32c_le(~0, + (unsigned char *)data->keyb, + data->tdb_data_size)); + dbg_printf("Writing keyblock to blk %llu\n", data->key_blk_num); + retval = io_channel_write_blk64(data->undo_file, + data->key_blk_num, + 1, data->keyb); + if (retval) + return retval; + /* Move on to the next key block if it's full. */ + if (data->keys_in_block == KEYS_PER_BLOCK(data)) { + memset(data->keyb, 0, data->tdb_data_size); + data->keys_in_block = 0; + data->key_blk_num = data->undo_blk_num; + data->undo_blk_num++; + } + } + + /* Prepare superblock for write */ + channel = data->real; + block_size = channel->block_size; + + io_channel_set_blksize(channel, SUPERBLOCK_OFFSET); + retval = io_channel_read_blk64(channel, 1, -SUPERBLOCK_SIZE, &super); + if (retval) + goto err_out; + sb_crc = ext2fs_crc32c_le(~0, (unsigned char *)&super, SUPERBLOCK_SIZE); + super.s_magic = ~super.s_magic; + + /* Write the undo header to disk. */ + memcpy(data->hdr.magic, E2UNDO_MAGIC, sizeof(data->hdr.magic)); + data->hdr.num_keys = ext2fs_cpu_to_le64(data->num_keys); + data->hdr.super_offset = ext2fs_cpu_to_le64(data->super_blk_num); + data->hdr.key_offset = ext2fs_cpu_to_le64(data->first_key_blk); + data->hdr.fs_block_size = ext2fs_cpu_to_le32(block_size); + data->hdr.sb_crc = ext2fs_cpu_to_le32(sb_crc); + data->hdr.fs_offset = ext2fs_cpu_to_le64(data->offset); + if (data->offset) + e2undo_set_feature_fs_offset(&data->hdr); + else + e2undo_clear_feature_fs_offset(&data->hdr); + hdr_crc = ext2fs_crc32c_le(~0, (unsigned char *)&data->hdr, + sizeof(data->hdr) - + sizeof(data->hdr.header_crc)); + data->hdr.header_crc = ext2fs_cpu_to_le32(hdr_crc); + retval = io_channel_write_blk64(data->undo_file, 0, + -(int)sizeof(data->hdr), + &data->hdr); + if (retval) + goto err_out; + + /* + * Record the entire superblock (in FS byte order) so that we can't + * apply e2undo files to the wrong FS or out of order. + */ + dbg_printf("Writing superblock to block %llu\n", data->super_blk_num); + retval = io_channel_write_blk64(data->undo_file, data->super_blk_num, + -SUPERBLOCK_SIZE, &super); + if (retval) + goto err_out; + + if (flush) + retval = io_channel_flush(data->undo_file); +err_out: + io_channel_set_blksize(channel, block_size); + return retval; +} + +static errcode_t undo_setup_tdb(struct undo_private_data *data) +{ + int i; + errcode_t retval; + + if (data->tdb_written == 1) + return 0; + + data->tdb_written = 1; + + /* Make a bitmap to track what we've written */ + memset(&data->fake_fs, 0, sizeof(data->fake_fs)); + data->fake_fs.blocksize = data->tdb_data_size; + retval = ext2fs_alloc_generic_bmap(&data->fake_fs, + EXT2_ET_MAGIC_BLOCK_BITMAP64, + EXT2FS_BMAP64_RBTREE, + 0, ~1ULL, ~1ULL, + "undo block map", &data->written_block_map); + if (retval) + return retval; + + /* Allocate key block */ + retval = ext2fs_get_mem(data->tdb_data_size, &data->keyb); + if (retval) + return retval; + data->key_blk_num = data->first_key_blk; + + /* Record block size */ + dbg_printf("Undo block size %llu\n", data->tdb_data_size); + dbg_printf("Keys per block %llu\n", KEYS_PER_BLOCK(data)); + data->hdr.block_size = ext2fs_cpu_to_le32(data->tdb_data_size); + io_channel_set_blksize(data->undo_file, data->tdb_data_size); + + /* Ensure that we have space for header blocks */ + for (i = 0; i <= 2; i++) { + retval = io_channel_read_blk64(data->undo_file, i, 1, + data->keyb); + if (retval) + memset(data->keyb, 0, data->tdb_data_size); + retval = io_channel_write_blk64(data->undo_file, i, 1, + data->keyb); + if (retval) + return retval; + retval = io_channel_flush(data->undo_file); + if (retval) + return retval; + } + memset(data->keyb, 0, data->tdb_data_size); + return 0; +} + +static errcode_t undo_write_tdb(io_channel channel, + unsigned long long block, int count) + +{ + int size, sz; + unsigned long long block_num, backing_blk_num; + errcode_t retval = 0; + ext2_loff_t offset; + struct undo_private_data *data; + unsigned char *read_ptr; + unsigned long long end_block; + unsigned long long data_size; + struct undo_key *key; + __u32 blk_crc; + + data = (struct undo_private_data *) channel->private_data; + + if (data->undo_file == NULL) { + /* + * Transaction database not initialized + */ + return 0; + } + + if (count == 1) + size = channel->block_size; + else { + if (count < 0) + size = -count; + else + size = count * channel->block_size; + } + + retval = undo_setup_tdb(data); + if (retval) + return retval; + /* + * Data is stored in tdb database as blocks of tdb_data_size size + * This helps in efficient lookup further. + * + * We divide the disk to blocks of tdb_data_size. + */ + offset = (block * channel->block_size) + data->offset ; + block_num = offset / data->tdb_data_size; + end_block = (offset + size - 1) / data->tdb_data_size; + + while (block_num <= end_block) { + __u32 keysz; + + /* + * Check if we have the record already + */ + if (ext2fs_test_block_bitmap2(data->written_block_map, + block_num)) { + /* Try the next block */ + block_num++; + continue; + } + ext2fs_mark_block_bitmap2(data->written_block_map, block_num); + + /* + * Read one block using the backing I/O manager + * The backing I/O manager block size may be + * different from the tdb_data_size. + * Also we need to recalculate the block number with respect + * to the backing I/O manager. + */ + offset = block_num * data->tdb_data_size + + (data->offset % data->tdb_data_size); + backing_blk_num = (offset - data->offset) / channel->block_size; + + retval = ext2fs_get_mem(data->tdb_data_size, &read_ptr); + if (retval) { + return retval; + } + + memset(read_ptr, 0, data->tdb_data_size); + actual_size = 0; + if ((data->tdb_data_size % channel->block_size) == 0) + sz = data->tdb_data_size / channel->block_size; + else + sz = -data->tdb_data_size; + retval = io_channel_read_blk64(data->real, backing_blk_num, + sz, read_ptr); + if (retval) { + if (retval != EXT2_ET_SHORT_READ) { + free(read_ptr); + return retval; + } + /* + * short read so update the record size + * accordingly + */ + data_size = actual_size; + } else { + data_size = data->tdb_data_size; + } + if (data_size == 0) { + free(read_ptr); + block_num++; + continue; + } + dbg_printf("Read %llu bytes from FS block %llu (blk=%llu cnt=%llu)\n", + data_size, backing_blk_num, block, data->tdb_data_size); + if ((data_size % data->undo_file->block_size) == 0) + sz = data_size / data->undo_file->block_size; + else + sz = -data_size;; + /* extend this key? */ + if (data->keys_in_block) { + key = data->keyb->keys + data->keys_in_block - 1; + keysz = ext2fs_le32_to_cpu(key->size); + } else { + key = NULL; + keysz = 0; + } + if (key != NULL && + (ext2fs_le64_to_cpu(key->fsblk) * channel->block_size + + channel->block_size - 1 + + keysz) / channel->block_size == backing_blk_num && + E2UNDO_MAX_EXTENT_BLOCKS * data->tdb_data_size > + keysz + data_size) { + blk_crc = ext2fs_le32_to_cpu(key->blk_crc); + blk_crc = ext2fs_crc32c_le(blk_crc, read_ptr, data_size); + key->blk_crc = ext2fs_cpu_to_le32(blk_crc); + key->size = ext2fs_cpu_to_le32(keysz + data_size); + } else { + data->num_keys++; + key = data->keyb->keys + data->keys_in_block; + data->keys_in_block++; + key->fsblk = ext2fs_cpu_to_le64(backing_blk_num); + blk_crc = ext2fs_crc32c_le(~0, read_ptr, data_size); + key->blk_crc = ext2fs_cpu_to_le32(blk_crc); + key->size = ext2fs_cpu_to_le32(data_size); + } + dbg_printf("Writing block %llu to offset %llu size %d key %zu\n", + block_num, + data->undo_blk_num, + sz, data->num_keys - 1); + retval = io_channel_write_blk64(data->undo_file, + data->undo_blk_num, sz, read_ptr); + if (retval) { + free(read_ptr); + return retval; + } + data->undo_blk_num++; + free(read_ptr); + + /* Write out the key block */ + retval = write_undo_indexes(data, 0); + if (retval) + return retval; + + /* Next block */ + block_num++; + } + + return retval; +} + +static errcode_t undo_io_read_error(io_channel channel ATTR((unused)), + unsigned long block ATTR((unused)), + int count ATTR((unused)), + void *data ATTR((unused)), + size_t size ATTR((unused)), + int actual, + errcode_t error ATTR((unused))) +{ + actual_size = actual; + return error; +} + +static void undo_err_handler_init(io_channel channel) +{ + channel->read_error = undo_io_read_error; +} + +static int check_filesystem(struct undo_header *hdr, io_channel undo_file, + unsigned int blocksize, blk64_t super_block, + io_channel channel) +{ + struct ext2_super_block super, *sb; + char *buf; + __u32 sb_crc; + errcode_t retval; + + io_channel_set_blksize(channel, SUPERBLOCK_OFFSET); + retval = io_channel_read_blk64(channel, 1, -SUPERBLOCK_SIZE, &super); + if (retval) + return retval; + + /* + * Compare the FS and the undo file superblock so that we don't + * append to something that doesn't match this FS. + */ + retval = ext2fs_get_mem(blocksize, &buf); + if (retval) + return retval; + retval = io_channel_read_blk64(undo_file, super_block, + -SUPERBLOCK_SIZE, buf); + if (retval) + goto out; + sb = (struct ext2_super_block *)buf; + sb->s_magic = ~sb->s_magic; + if (memcmp(&super, buf, sizeof(super))) { + retval = -1; + goto out; + } + sb_crc = ext2fs_crc32c_le(~0, (unsigned char *)buf, SUPERBLOCK_SIZE); + if (ext2fs_le32_to_cpu(hdr->sb_crc) != sb_crc) { + retval = -1; + goto out; + } + +out: + ext2fs_free_mem(&buf); + return retval; +} + +/* + * Try to re-open the undo file, so that we can resume where we left off. + * That way, the user can pass the same undo file to various programs as + * part of an FS upgrade instead of having to create multiple files and + * then apply them in correct order. + */ +static errcode_t try_reopen_undo_file(int undo_fd, + struct undo_private_data *data) +{ + struct undo_header hdr; + struct undo_key *dkey; + ext2fs_struct_stat statbuf; + unsigned int blocksize, fs_blocksize; + blk64_t super_block, lblk; + size_t num_keys, keys_per_block, i; + __u32 hdr_crc, key_crc; + errcode_t retval; + + /* Zero size already? */ + retval = ext2fs_fstat(undo_fd, &statbuf); + if (retval) + goto bad_file; + if (statbuf.st_size == 0) + goto out; + + /* check the file header */ + retval = io_channel_read_blk64(data->undo_file, 0, -(int)sizeof(hdr), + &hdr); + if (retval) + goto bad_file; + + if (memcmp(hdr.magic, E2UNDO_MAGIC, + sizeof(hdr.magic))) + goto bad_file; + hdr_crc = ext2fs_crc32c_le(~0, (unsigned char *)&hdr, + sizeof(struct undo_header) - + sizeof(__u32)); + if (ext2fs_le32_to_cpu(hdr.header_crc) != hdr_crc) + goto bad_file; + blocksize = ext2fs_le32_to_cpu(hdr.block_size); + fs_blocksize = ext2fs_le32_to_cpu(hdr.fs_block_size); + if (blocksize > E2UNDO_MAX_BLOCK_SIZE || + blocksize < E2UNDO_MIN_BLOCK_SIZE || + !blocksize || !fs_blocksize) + goto bad_file; + super_block = ext2fs_le64_to_cpu(hdr.super_offset); + num_keys = ext2fs_le64_to_cpu(hdr.num_keys); + io_channel_set_blksize(data->undo_file, blocksize); + /* + * Do not compare hdr.f_compat with the available compatible + * features set, because a "missing" compatible feature should + * not cause any problems. + */ + if (hdr.f_incompat || hdr.f_rocompat) + goto bad_file; + + /* Superblock matches this FS? */ + if (check_filesystem(&hdr, data->undo_file, blocksize, super_block, + data->real) != 0) { + retval = EXT2_ET_UNDO_FILE_WRONG; + goto out; + } + + /* Try to set ourselves up */ + data->tdb_data_size = blocksize; + retval = undo_setup_tdb(data); + if (retval) + goto bad_file; + data->num_keys = num_keys; + data->super_blk_num = super_block; + data->first_key_blk = ext2fs_le64_to_cpu(hdr.key_offset); + + /* load the written block map */ + keys_per_block = KEYS_PER_BLOCK(data); + lblk = data->first_key_blk; + dbg_printf("nr_keys=%lu, kpb=%zu, blksz=%u\n", + num_keys, keys_per_block, blocksize); + for (i = 0; i < num_keys; i += keys_per_block) { + size_t j, max_j; + __le32 crc; + + data->key_blk_num = lblk; + retval = io_channel_read_blk64(data->undo_file, + lblk, 1, data->keyb); + if (retval) + goto bad_key_replay; + + /* check keys */ + if (ext2fs_le32_to_cpu(data->keyb->magic) != KEYBLOCK_MAGIC) { + retval = EXT2_ET_UNDO_FILE_CORRUPT; + goto bad_key_replay; + } + crc = data->keyb->crc; + data->keyb->crc = 0; + key_crc = ext2fs_crc32c_le(~0, (unsigned char *)data->keyb, + blocksize); + if (ext2fs_le32_to_cpu(crc) != key_crc) { + retval = EXT2_ET_UNDO_FILE_CORRUPT; + goto bad_key_replay; + } + + /* load keys from key block */ + lblk++; + max_j = data->num_keys - i; + if (max_j > keys_per_block) + max_j = keys_per_block; + for (j = 0, dkey = data->keyb->keys; + j < max_j; + j++, dkey++) { + blk64_t fsblk = ext2fs_le64_to_cpu(dkey->fsblk); + blk64_t undo_blk = fsblk * fs_blocksize / blocksize; + size_t size = ext2fs_le32_to_cpu(dkey->size); + + ext2fs_mark_block_bitmap_range2(data->written_block_map, + undo_blk, + (size + blocksize - 1) / blocksize); + lblk += (size + blocksize - 1) / blocksize; + data->undo_blk_num = lblk; + data->keys_in_block = j + 1; + } + } + dbg_printf("Reopen undo, keyblk=%llu undoblk=%llu nrkeys=%zu kib=%zu\n", + data->key_blk_num, data->undo_blk_num, data->num_keys, + data->keys_in_block); + + data->hdr.state = hdr.state & ~E2UNDO_STATE_FINISHED; + data->hdr.f_compat = hdr.f_compat; + data->hdr.f_incompat = hdr.f_incompat; + data->hdr.f_rocompat = hdr.f_rocompat; + return retval; + +bad_key_replay: + data->key_blk_num = data->undo_blk_num = 0; + data->keys_in_block = 0; + ext2fs_free_mem(&data->keyb); + ext2fs_free_generic_bitmap(data->written_block_map); + data->tdb_written = 0; + goto out; +bad_file: + retval = EXT2_ET_UNDO_FILE_CORRUPT; +out: + return retval; +} + +static void undo_atexit(void *p) +{ + struct undo_private_data *data = p; + errcode_t err; + + err = write_undo_indexes(data, 1); + io_channel_close(data->undo_file); + + com_err(data->tdb_file, err, "while force-closing undo file"); +} + +static errcode_t undo_open(const char *name, int flags, io_channel *channel) +{ + io_channel io = NULL; + struct undo_private_data *data = NULL; + int undo_fd = -1; + errcode_t retval; + + /* We don't support multi-threading, at least for now */ + flags &= ~IO_FLAG_THREADS; + if (name == 0) + return EXT2_ET_BAD_DEVICE_NAME; + retval = ext2fs_get_mem(sizeof(struct struct_io_channel), &io); + if (retval) + goto cleanup; + memset(io, 0, sizeof(struct struct_io_channel)); + io->magic = EXT2_ET_MAGIC_IO_CHANNEL; + retval = ext2fs_get_mem(sizeof(struct undo_private_data), &data); + if (retval) + goto cleanup; + + io->manager = undo_io_manager; + retval = ext2fs_get_mem(strlen(name)+1, &io->name); + if (retval) + goto cleanup; + + strcpy(io->name, name); + io->private_data = data; + io->block_size = 1024; + io->read_error = 0; + io->write_error = 0; + io->refcount = 1; + + memset(data, 0, sizeof(struct undo_private_data)); + data->magic = EXT2_ET_MAGIC_UNIX_IO_CHANNEL; + data->super_blk_num = 1; + data->first_key_blk = 2; + data->undo_blk_num = 3; + + if (undo_io_backing_manager) { + retval = undo_io_backing_manager->open(name, flags, + &data->real); + if (retval) + goto cleanup; + + data->tdb_file = strdup(tdb_file); + if (data->tdb_file == NULL) + goto cleanup; + undo_fd = ext2fs_open_file(data->tdb_file, O_RDWR | O_CREAT, + 0600); + if (undo_fd < 0) + goto cleanup; + + retval = undo_io_backing_manager->open(data->tdb_file, + IO_FLAG_RW, + &data->undo_file); + if (retval) + goto cleanup; + } else { + data->real = NULL; + data->undo_file = NULL; + } + + if (data->real) + io->flags = (io->flags & ~CHANNEL_FLAGS_DISCARD_ZEROES) | + (data->real->flags & CHANNEL_FLAGS_DISCARD_ZEROES); + + /* + * setup err handler for read so that we know + * when the backing manager fails do short read + */ + if (data->real) + undo_err_handler_init(data->real); + + if (data->undo_file) { + retval = try_reopen_undo_file(undo_fd, data); + if (retval) + goto cleanup; + } + retval = ext2fs_add_exit_fn(undo_atexit, data); + if (retval) + goto cleanup; + + *channel = io; + if (undo_fd >= 0) + close(undo_fd); + return retval; + +cleanup: + ext2fs_remove_exit_fn(undo_atexit, data); + if (undo_fd >= 0) + close(undo_fd); + if (data && data->undo_file) + io_channel_close(data->undo_file); + if (data && data->tdb_file) + free(data->tdb_file); + if (data && data->real) + io_channel_close(data->real); + if (data) + ext2fs_free_mem(&data); + if (io && io->name) + ext2fs_free_mem(&io->name); + if (io) + ext2fs_free_mem(&io); + return retval; +} + +static errcode_t undo_close(io_channel channel) +{ + struct undo_private_data *data; + errcode_t err, retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (--channel->refcount > 0) + return 0; + /* Before closing write the file system identity */ + if (!getenv("UNDO_IO_SIMULATE_UNFINISHED")) + data->hdr.state = ext2fs_cpu_to_le32(E2UNDO_STATE_FINISHED); + err = write_undo_indexes(data, 1); + ext2fs_remove_exit_fn(undo_atexit, data); + if (data->real) + retval = io_channel_close(data->real); + if (data->tdb_file) + free(data->tdb_file); + if (data->undo_file) + io_channel_close(data->undo_file); + ext2fs_free_mem(&data->keyb); + if (data->written_block_map) + ext2fs_free_generic_bitmap(data->written_block_map); + ext2fs_free_mem(&channel->private_data); + if (channel->name) + ext2fs_free_mem(&channel->name); + ext2fs_free_mem(&channel); + + if (err) + return err; + return retval; +} + +static errcode_t undo_set_blksize(io_channel channel, int blksize) +{ + struct undo_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (blksize > E2UNDO_MAX_BLOCK_SIZE || blksize < E2UNDO_MIN_BLOCK_SIZE) + return EXT2_ET_INVALID_ARGUMENT; + + if (data->real) + retval = io_channel_set_blksize(data->real, blksize); + /* + * Set the block size used for tdb + */ + if (!data->tdb_data_size || !data->tdb_written) + data->tdb_data_size = blksize; + channel->block_size = blksize; + return retval; +} + +static errcode_t undo_read_blk64(io_channel channel, unsigned long long block, + int count, void *buf) +{ + errcode_t retval = 0; + struct undo_private_data *data; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (data->real) + retval = io_channel_read_blk64(data->real, block, count, buf); + + return retval; +} + +static errcode_t undo_read_blk(io_channel channel, unsigned long block, + int count, void *buf) +{ + return undo_read_blk64(channel, block, count, buf); +} + +static errcode_t undo_write_blk64(io_channel channel, unsigned long long block, + int count, const void *buf) +{ + struct undo_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + /* + * First write the existing content into database + */ + retval = undo_write_tdb(channel, block, count); + if (retval) + return retval; + if (data->real) + retval = io_channel_write_blk64(data->real, block, count, buf); + + return retval; +} + +static errcode_t undo_write_blk(io_channel channel, unsigned long block, + int count, const void *buf) +{ + return undo_write_blk64(channel, block, count, buf); +} + +static errcode_t undo_write_byte(io_channel channel, unsigned long offset, + int size, const void *buf) +{ + struct undo_private_data *data; + errcode_t retval = 0; + ext2_loff_t location; + unsigned long blk_num, count;; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + location = offset + data->offset; + blk_num = location/channel->block_size; + /* + * the size specified may spread across multiple blocks + * also make sure we account for the fact that block start + * offset for tdb is different from the backing I/O manager + * due to possible different block size + */ + count = (size + (location % channel->block_size) + + channel->block_size -1)/channel->block_size; + retval = undo_write_tdb(channel, blk_num, count); + if (retval) + return retval; + if (data->real && data->real->manager->write_byte) + retval = io_channel_write_byte(data->real, offset, size, buf); + + return retval; +} + +static errcode_t undo_discard(io_channel channel, unsigned long long block, + unsigned long long count) +{ + struct undo_private_data *data; + errcode_t retval = 0; + int icount; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (count > INT_MAX) + return EXT2_ET_UNIMPLEMENTED; + icount = count; + + /* + * First write the existing content into database + */ + retval = undo_write_tdb(channel, block, icount); + if (retval) + return retval; + if (data->real) + retval = io_channel_discard(data->real, block, count); + + return retval; +} + +static errcode_t undo_zeroout(io_channel channel, unsigned long long block, + unsigned long long count) +{ + struct undo_private_data *data; + errcode_t retval = 0; + int icount; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (count > INT_MAX) + return EXT2_ET_UNIMPLEMENTED; + icount = count; + + /* + * First write the existing content into database + */ + retval = undo_write_tdb(channel, block, icount); + if (retval) + return retval; + if (data->real) + retval = io_channel_zeroout(data->real, block, count); + + return retval; +} + +static errcode_t undo_cache_readahead(io_channel channel, + unsigned long long block, + unsigned long long count) +{ + struct undo_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (data->real) + retval = io_channel_cache_readahead(data->real, block, count); + + return retval; +} + +/* + * Flush data buffers to disk. + */ +static errcode_t undo_flush(io_channel channel) +{ + errcode_t retval = 0; + struct undo_private_data *data; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (data->real) + retval = io_channel_flush(data->real); + + return retval; +} + +static errcode_t undo_set_option(io_channel channel, const char *option, + const char *arg) +{ + errcode_t retval = 0; + struct undo_private_data *data; + unsigned long tmp; + char *end; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (!strcmp(option, "tdb_data_size")) { + if (!arg) + return EXT2_ET_INVALID_ARGUMENT; + + tmp = strtoul(arg, &end, 0); + if (*end) + return EXT2_ET_INVALID_ARGUMENT; + if (tmp > E2UNDO_MAX_BLOCK_SIZE || tmp < E2UNDO_MIN_BLOCK_SIZE) + return EXT2_ET_INVALID_ARGUMENT; + if (!data->tdb_data_size || !data->tdb_written) { + data->tdb_written = -1; + data->tdb_data_size = tmp; + } + return 0; + } + /* + * Need to support offset option to work with + * Unix I/O manager + */ + if (data->real && data->real->manager->set_option) { + retval = data->real->manager->set_option(data->real, + option, arg); + } + if (!retval && !strcmp(option, "offset")) { + if (!arg) + return EXT2_ET_INVALID_ARGUMENT; + + tmp = strtoul(arg, &end, 0); + if (*end) + return EXT2_ET_INVALID_ARGUMENT; + data->offset = tmp; + } + return retval; +} + +static errcode_t undo_get_stats(io_channel channel, io_stats *stats) +{ + errcode_t retval = 0; + struct undo_private_data *data; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct undo_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (data->real) + retval = (data->real->manager->get_stats)(data->real, stats); + + return retval; +} + +static struct struct_io_manager struct_undo_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "Undo I/O Manager", + .open = undo_open, + .close = undo_close, + .set_blksize = undo_set_blksize, + .read_blk = undo_read_blk, + .write_blk = undo_write_blk, + .flush = undo_flush, + .write_byte = undo_write_byte, + .set_option = undo_set_option, + .get_stats = undo_get_stats, + .read_blk64 = undo_read_blk64, + .write_blk64 = undo_write_blk64, + .discard = undo_discard, + .zeroout = undo_zeroout, + .cache_readahead = undo_cache_readahead, +}; + +io_manager undo_io_manager = &struct_undo_manager; diff --git a/lib/ext2fs/unix_io.c b/lib/ext2fs/unix_io.c new file mode 100644 index 0000000..3171c73 --- /dev/null +++ b/lib/ext2fs/unix_io.c @@ -0,0 +1,1510 @@ +/* + * unix_io.c --- This is the Unix (well, really POSIX) implementation + * of the I/O manager. + * + * Implements a one-block write-through cache. + * + * Includes support for Windows NT support under Cygwin. + * + * Copyright (C) 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, + * 2002 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#if !defined(__FreeBSD__) && !defined(__NetBSD__) && !defined(__OpenBSD__) +#define _XOPEN_SOURCE 600 +#define _DARWIN_C_SOURCE +#define _FILE_OFFSET_BITS 64 +#ifndef _LARGEFILE_SOURCE +#define _LARGEFILE_SOURCE +#endif +#ifndef _LARGEFILE64_SOURCE +#define _LARGEFILE64_SOURCE +#endif +#ifndef _GNU_SOURCE +#define _GNU_SOURCE +#endif +#endif + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <fcntl.h> +#include <time.h> +#ifdef __linux__ +#include <sys/utsname.h> +#endif +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#ifdef HAVE_SYS_IOCTL_H +#include <sys/ioctl.h> +#endif +#ifdef HAVE_SYS_MOUNT_H +#include <sys/mount.h> +#endif +#ifdef HAVE_SYS_PRCTL_H +#include <sys/prctl.h> +#else +#define PR_GET_DUMPABLE 3 +#endif +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#if HAVE_SYS_RESOURCE_H +#include <sys/resource.h> +#endif +#if HAVE_LINUX_FALLOC_H +#include <linux/falloc.h> +#endif +#ifdef HAVE_PTHREAD +#include <pthread.h> +#endif + +#if defined(__linux__) && defined(_IO) && !defined(BLKROGET) +#define BLKROGET _IO(0x12, 94) /* Get read-only status (0 = read_write). */ +#endif + +#undef ALIGN_DEBUG + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +/* + * For checking structure magic numbers... + */ + +#define EXT2_CHECK_MAGIC(struct, code) \ + if ((struct)->magic != (code)) return (code) + +struct unix_cache { + char *buf; + unsigned long long block; + int access_time; + unsigned dirty:1; + unsigned in_use:1; + unsigned write_err:1; +}; + +#define CACHE_SIZE 8 +#define WRITE_DIRECT_SIZE 4 /* Must be smaller than CACHE_SIZE */ +#define READ_DIRECT_SIZE 4 /* Should be smaller than CACHE_SIZE */ + +struct unix_private_data { + int magic; + int dev; + int flags; + int align; + int access_time; + ext2_loff_t offset; + struct unix_cache cache[CACHE_SIZE]; + void *bounce; + struct struct_io_stats io_stats; +#ifdef HAVE_PTHREAD + pthread_mutex_t cache_mutex; + pthread_mutex_t bounce_mutex; + pthread_mutex_t stats_mutex; +#endif +}; + +#define IS_ALIGNED(n, align) ((((uintptr_t) n) & \ + ((uintptr_t) ((align)-1))) == 0) + +typedef enum lock_kind { + CACHE_MTX, BOUNCE_MTX, STATS_MTX +} kind_t; + +#ifdef HAVE_PTHREAD +static inline pthread_mutex_t *get_mutex(struct unix_private_data *data, + kind_t kind) +{ + if (data->flags & IO_FLAG_THREADS) { + switch (kind) { + case CACHE_MTX: + return &data->cache_mutex; + case BOUNCE_MTX: + return &data->bounce_mutex; + case STATS_MTX: + return &data->stats_mutex; + } + } + return NULL; +} +#endif + +static inline void mutex_lock(struct unix_private_data *data, kind_t kind) +{ +#ifdef HAVE_PTHREAD + pthread_mutex_t *mtx = get_mutex(data,kind); + + if (mtx) + pthread_mutex_lock(mtx); +#endif +} + +static inline void mutex_unlock(struct unix_private_data *data, kind_t kind) +{ +#ifdef HAVE_PTHREAD + pthread_mutex_t *mtx = get_mutex(data,kind); + + if (mtx) + pthread_mutex_unlock(mtx); +#endif +} + +static errcode_t unix_get_stats(io_channel channel, io_stats *stats) +{ + errcode_t retval = 0; + + struct unix_private_data *data; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct unix_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (stats) { + mutex_lock(data, STATS_MTX); + *stats = &data->io_stats; + mutex_unlock(data, STATS_MTX); + } + + return retval; +} + +static char *safe_getenv(const char *arg) +{ + if ((getuid() != geteuid()) || (getgid() != getegid())) + return NULL; +#ifdef HAVE_PRCTL + if (prctl(PR_GET_DUMPABLE, 0, 0, 0, 0) == 0) + return NULL; +#else +#if (defined(linux) && defined(SYS_prctl)) + if (syscall(SYS_prctl, PR_GET_DUMPABLE, 0, 0, 0, 0) == 0) + return NULL; +#endif +#endif + +#if defined(HAVE_SECURE_GETENV) + return secure_getenv(arg); +#elif defined(HAVE___SECURE_GETENV) + return __secure_getenv(arg); +#else + return getenv(arg); +#endif +} + +/* + * Here are the raw I/O functions + */ +static errcode_t raw_read_blk(io_channel channel, + struct unix_private_data *data, + unsigned long long block, + int count, void *bufv) +{ + errcode_t retval; + ssize_t size; + ext2_loff_t location; + int actual = 0; + unsigned char *buf = bufv; + ssize_t really_read = 0; + unsigned long long aligned_blk; + int align_size, offset; + + size = (count < 0) ? -count : (ext2_loff_t) count * channel->block_size; + mutex_lock(data, STATS_MTX); + data->io_stats.bytes_read += size; + mutex_unlock(data, STATS_MTX); + location = ((ext2_loff_t) block * channel->block_size) + data->offset; + + if (data->flags & IO_FLAG_FORCE_BOUNCE) + goto bounce_read; + +#ifdef HAVE_PREAD64 + /* Try an aligned pread */ + if ((channel->align == 0) || + (IS_ALIGNED(buf, channel->align) && + IS_ALIGNED(location, channel->align) && + IS_ALIGNED(size, channel->align))) { + actual = pread64(data->dev, buf, size, location); + if (actual == size) + return 0; + actual = 0; + } +#elif HAVE_PREAD + /* Try an aligned pread */ + if ((sizeof(off_t) >= sizeof(ext2_loff_t)) && + ((channel->align == 0) || + (IS_ALIGNED(buf, channel->align) && + IS_ALIGNED(location, channel->align) && + IS_ALIGNED(size, channel->align)))) { + actual = pread(data->dev, buf, size, location); + if (actual == size) + return 0; + actual = 0; + } +#endif /* HAVE_PREAD */ + + if ((channel->align == 0) || + (IS_ALIGNED(buf, channel->align) && + IS_ALIGNED(location, channel->align) && + IS_ALIGNED(size, channel->align))) { + mutex_lock(data, BOUNCE_MTX); + if (ext2fs_llseek(data->dev, location, SEEK_SET) < 0) { + retval = errno ? errno : EXT2_ET_LLSEEK_FAILED; + goto error_unlock; + } + actual = read(data->dev, buf, size); + if (actual != size) { + short_read: + if (actual < 0) { + retval = errno; + actual = 0; + } else + retval = EXT2_ET_SHORT_READ; + goto error_unlock; + } + goto success_unlock; + } + +#ifdef ALIGN_DEBUG + printf("raw_read_blk: O_DIRECT fallback: %p %lu\n", buf, + (unsigned long) size); +#endif + + /* + * The buffer or size which we're trying to read isn't aligned + * to the O_DIRECT rules, so we need to do this the hard way... + */ +bounce_read: + if (channel->align == 0) + channel->align = 1; + if ((channel->block_size > channel->align) && + (channel->block_size % channel->align) == 0) + align_size = channel->block_size; + else + align_size = channel->align; + aligned_blk = location / align_size; + offset = location % align_size; + + mutex_lock(data, BOUNCE_MTX); + if (ext2fs_llseek(data->dev, aligned_blk * align_size, SEEK_SET) < 0) { + retval = errno ? errno : EXT2_ET_LLSEEK_FAILED; + goto error_unlock; + } + while (size > 0) { + actual = read(data->dev, data->bounce, align_size); + if (actual != align_size) { + actual = really_read; + buf -= really_read; + size += really_read; + goto short_read; + } + if ((actual + offset) > align_size) + actual = align_size - offset; + if (actual > size) + actual = size; + memcpy(buf, (char *)data->bounce + offset, actual); + + really_read += actual; + size -= actual; + buf += actual; + offset = 0; + aligned_blk++; + } +success_unlock: + mutex_unlock(data, BOUNCE_MTX); + return 0; + +error_unlock: + mutex_unlock(data, BOUNCE_MTX); + if (actual >= 0 && actual < size) + memset((char *) buf+actual, 0, size-actual); + if (channel->read_error) + retval = (channel->read_error)(channel, block, count, buf, + size, actual, retval); + return retval; +} + +#define RAW_WRITE_NO_HANDLER 1 + +static errcode_t raw_write_blk(io_channel channel, + struct unix_private_data *data, + unsigned long long block, + int count, const void *bufv, + int flags) +{ + ssize_t size; + ext2_loff_t location; + int actual = 0; + errcode_t retval; + const unsigned char *buf = bufv; + unsigned long long aligned_blk; + int align_size, offset; + + if (count == 1) + size = channel->block_size; + else { + if (count < 0) + size = -count; + else + size = (ext2_loff_t) count * channel->block_size; + } + mutex_lock(data, STATS_MTX); + data->io_stats.bytes_written += size; + mutex_unlock(data, STATS_MTX); + + location = ((ext2_loff_t) block * channel->block_size) + data->offset; + + if (data->flags & IO_FLAG_FORCE_BOUNCE) + goto bounce_write; + +#ifdef HAVE_PWRITE64 + /* Try an aligned pwrite */ + if ((channel->align == 0) || + (IS_ALIGNED(buf, channel->align) && + IS_ALIGNED(location, channel->align) && + IS_ALIGNED(size, channel->align))) { + actual = pwrite64(data->dev, buf, size, location); + if (actual == size) + return 0; + } +#elif HAVE_PWRITE + /* Try an aligned pwrite */ + if ((sizeof(off_t) >= sizeof(ext2_loff_t)) && + ((channel->align == 0) || + (IS_ALIGNED(buf, channel->align) && + IS_ALIGNED(location, channel->align) && + IS_ALIGNED(size, channel->align)))) { + actual = pwrite(data->dev, buf, size, location); + if (actual == size) + return 0; + } +#endif /* HAVE_PWRITE */ + + if ((channel->align == 0) || + (IS_ALIGNED(buf, channel->align) && + IS_ALIGNED(location, channel->align) && + IS_ALIGNED(size, channel->align))) { + mutex_lock(data, BOUNCE_MTX); + if (ext2fs_llseek(data->dev, location, SEEK_SET) < 0) { + retval = errno ? errno : EXT2_ET_LLSEEK_FAILED; + goto error_unlock; + } + actual = write(data->dev, buf, size); + mutex_unlock(data, BOUNCE_MTX); + if (actual < 0) { + retval = errno; + goto error_out; + } + if (actual != size) { + short_write: + retval = EXT2_ET_SHORT_WRITE; + goto error_out; + } + return 0; + } + +#ifdef ALIGN_DEBUG + printf("raw_write_blk: O_DIRECT fallback: %p %lu\n", buf, + (unsigned long) size); +#endif + /* + * The buffer or size which we're trying to write isn't aligned + * to the O_DIRECT rules, so we need to do this the hard way... + */ +bounce_write: + if (channel->align == 0) + channel->align = 1; + if ((channel->block_size > channel->align) && + (channel->block_size % channel->align) == 0) + align_size = channel->block_size; + else + align_size = channel->align; + aligned_blk = location / align_size; + offset = location % align_size; + + while (size > 0) { + int actual_w; + + mutex_lock(data, BOUNCE_MTX); + if (size < align_size || offset) { + if (ext2fs_llseek(data->dev, aligned_blk * align_size, + SEEK_SET) < 0) { + retval = errno ? errno : EXT2_ET_LLSEEK_FAILED; + goto error_unlock; + } + actual = read(data->dev, data->bounce, + align_size); + if (actual != align_size) { + if (actual < 0) { + retval = errno; + goto error_unlock; + } + memset((char *) data->bounce + actual, 0, + align_size - actual); + } + } + actual = size; + if ((actual + offset) > align_size) + actual = align_size - offset; + if (actual > size) + actual = size; + memcpy(((char *)data->bounce) + offset, buf, actual); + if (ext2fs_llseek(data->dev, aligned_blk * align_size, SEEK_SET) < 0) { + retval = errno ? errno : EXT2_ET_LLSEEK_FAILED; + goto error_unlock; + } + actual_w = write(data->dev, data->bounce, align_size); + mutex_unlock(data, BOUNCE_MTX); + if (actual_w < 0) { + retval = errno; + goto error_out; + } + if (actual_w != align_size) + goto short_write; + size -= actual; + buf += actual; + location += actual; + aligned_blk++; + offset = 0; + } + return 0; + +error_unlock: + mutex_unlock(data, BOUNCE_MTX); +error_out: + if (((flags & RAW_WRITE_NO_HANDLER) == 0) && channel->write_error) + retval = (channel->write_error)(channel, block, count, buf, + size, actual, retval); + return retval; +} + + +/* + * Here we implement the cache functions + */ + +/* Allocate the cache buffers */ +static errcode_t alloc_cache(io_channel channel, + struct unix_private_data *data) +{ + errcode_t retval; + struct unix_cache *cache; + int i; + + data->access_time = 0; + for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) { + cache->block = 0; + cache->access_time = 0; + cache->dirty = 0; + cache->in_use = 0; + if (cache->buf) + ext2fs_free_mem(&cache->buf); + retval = io_channel_alloc_buf(channel, 0, &cache->buf); + if (retval) + return retval; + } + if (channel->align || data->flags & IO_FLAG_FORCE_BOUNCE) { + if (data->bounce) + ext2fs_free_mem(&data->bounce); + retval = io_channel_alloc_buf(channel, 0, &data->bounce); + } + return retval; +} + +/* Free the cache buffers */ +static void free_cache(struct unix_private_data *data) +{ + struct unix_cache *cache; + int i; + + data->access_time = 0; + for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) { + cache->block = 0; + cache->access_time = 0; + cache->dirty = 0; + cache->in_use = 0; + if (cache->buf) + ext2fs_free_mem(&cache->buf); + } + if (data->bounce) + ext2fs_free_mem(&data->bounce); +} + +#ifndef NO_IO_CACHE +/* + * Try to find a block in the cache. If the block is not found, and + * eldest is a non-zero pointer, then fill in eldest with the cache + * entry to that should be reused. + */ +static struct unix_cache *find_cached_block(struct unix_private_data *data, + unsigned long long block, + struct unix_cache **eldest) +{ + struct unix_cache *cache, *unused_cache, *oldest_cache; + int i; + + unused_cache = oldest_cache = 0; + for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) { + if (!cache->in_use) { + if (!unused_cache) + unused_cache = cache; + continue; + } + if (cache->block == block) { + cache->access_time = ++data->access_time; + return cache; + } + if (!oldest_cache || + (cache->access_time < oldest_cache->access_time)) + oldest_cache = cache; + } + if (eldest) + *eldest = (unused_cache) ? unused_cache : oldest_cache; + return 0; +} + +/* + * Reuse a particular cache entry for another block. + */ +static errcode_t reuse_cache(io_channel channel, + struct unix_private_data *data, struct unix_cache *cache, + unsigned long long block) +{ + if (cache->dirty && cache->in_use) { + errcode_t retval; + + retval = raw_write_blk(channel, data, cache->block, 1, + cache->buf, RAW_WRITE_NO_HANDLER); + if (retval) { + cache->write_err = 1; + return retval; + } + } + + cache->in_use = 1; + cache->dirty = 0; + cache->write_err = 0; + cache->block = block; + cache->access_time = ++data->access_time; + return 0; +} + +#define FLUSH_INVALIDATE 0x01 +#define FLUSH_NOLOCK 0x02 + +/* + * Flush all of the blocks in the cache + */ +static errcode_t flush_cached_blocks(io_channel channel, + struct unix_private_data *data, + int flags) +{ + struct unix_cache *cache; + errcode_t retval, retval2 = 0; + int i; + int errors_found = 0; + + if ((flags & FLUSH_NOLOCK) == 0) + mutex_lock(data, CACHE_MTX); + for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) { + if (!cache->in_use || !cache->dirty) + continue; + retval = raw_write_blk(channel, data, + cache->block, 1, cache->buf, + RAW_WRITE_NO_HANDLER); + if (retval) { + cache->write_err = 1; + errors_found = 1; + retval2 = retval; + } else { + cache->dirty = 0; + cache->write_err = 0; + if (flags & FLUSH_INVALIDATE) + cache->in_use = 0; + } + } + if ((flags & FLUSH_NOLOCK) == 0) + mutex_unlock(data, CACHE_MTX); +retry: + while (errors_found) { + if ((flags & FLUSH_NOLOCK) == 0) + mutex_lock(data, CACHE_MTX); + errors_found = 0; + for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) { + if (!cache->in_use || !cache->write_err) + continue; + errors_found = 1; + if (cache->write_err && channel->write_error) { + char *err_buf = NULL; + unsigned long long err_block = cache->block; + + cache->dirty = 0; + cache->in_use = 0; + cache->write_err = 0; + if (io_channel_alloc_buf(channel, 0, + &err_buf)) + err_buf = NULL; + else + memcpy(err_buf, cache->buf, + channel->block_size); + mutex_unlock(data, CACHE_MTX); + (channel->write_error)(channel, err_block, + 1, err_buf, channel->block_size, -1, + retval2); + if (err_buf) + ext2fs_free_mem(&err_buf); + goto retry; + } else + cache->write_err = 0; + } + if ((flags & FLUSH_NOLOCK) == 0) + mutex_unlock(data, CACHE_MTX); + } + return retval2; +} +#endif /* NO_IO_CACHE */ + +#ifdef __linux__ +#ifndef BLKDISCARDZEROES +#define BLKDISCARDZEROES _IO(0x12,124) +#endif +#endif + +int ext2fs_open_file(const char *pathname, int flags, mode_t mode) +{ + if (mode) +#if defined(HAVE_OPEN64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED) + return open64(pathname, flags, mode); + else + return open64(pathname, flags); +#else + return open(pathname, flags, mode); + else + return open(pathname, flags); +#endif +} + +int ext2fs_stat(const char *path, ext2fs_struct_stat *buf) +{ +#if defined(HAVE_FSTAT64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED) + return stat64(path, buf); +#else + return stat(path, buf); +#endif +} + +int ext2fs_fstat(int fd, ext2fs_struct_stat *buf) +{ +#if defined(HAVE_FSTAT64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED) + return fstat64(fd, buf); +#else + return fstat(fd, buf); +#endif +} + + +static errcode_t unix_open_channel(const char *name, int fd, + int flags, io_channel *channel, + io_manager io_mgr) +{ + io_channel io = NULL; + struct unix_private_data *data = NULL; + errcode_t retval; + ext2fs_struct_stat st; +#ifdef __linux__ + struct utsname ut; +#endif + + if (safe_getenv("UNIX_IO_FORCE_BOUNCE")) + flags |= IO_FLAG_FORCE_BOUNCE; + +#ifdef __linux__ + /* + * We need to make sure any previous errors in the block + * device are thrown away, sigh. + */ + (void) fsync(fd); +#endif + + retval = ext2fs_get_mem(sizeof(struct struct_io_channel), &io); + if (retval) + goto cleanup; + memset(io, 0, sizeof(struct struct_io_channel)); + io->magic = EXT2_ET_MAGIC_IO_CHANNEL; + retval = ext2fs_get_mem(sizeof(struct unix_private_data), &data); + if (retval) + goto cleanup; + + io->manager = io_mgr; + retval = ext2fs_get_mem(strlen(name)+1, &io->name); + if (retval) + goto cleanup; + + strcpy(io->name, name); + io->private_data = data; + io->block_size = 1024; + io->read_error = 0; + io->write_error = 0; + io->refcount = 1; + io->flags = 0; + + memset(data, 0, sizeof(struct unix_private_data)); + data->magic = EXT2_ET_MAGIC_UNIX_IO_CHANNEL; + data->io_stats.num_fields = 2; + data->flags = flags; + data->dev = fd; + +#if defined(O_DIRECT) + if (flags & IO_FLAG_DIRECT_IO) + io->align = ext2fs_get_dio_alignment(data->dev); +#elif defined(F_NOCACHE) + if (flags & IO_FLAG_DIRECT_IO) + io->align = 4096; +#endif + + /* + * If the device is really a block device, then set the + * appropriate flag, otherwise we can set DISCARD_ZEROES flag + * because we are going to use punch hole instead of discard + * and if it succeed, subsequent read from sparse area returns + * zero. + */ + if (ext2fs_fstat(data->dev, &st) == 0) { + if (ext2fsP_is_disk_device(st.st_mode)) + io->flags |= CHANNEL_FLAGS_BLOCK_DEVICE; + else + io->flags |= CHANNEL_FLAGS_DISCARD_ZEROES; + } + +#ifdef BLKDISCARDZEROES + { + int zeroes = 0; + if (ioctl(data->dev, BLKDISCARDZEROES, &zeroes) == 0 && + zeroes) + io->flags |= CHANNEL_FLAGS_DISCARD_ZEROES; + } +#endif + +#if defined(__CYGWIN__) + /* + * Some operating systems require that the buffers be aligned, + * regardless of O_DIRECT + */ + if (!io->align) + io->align = 512; +#endif + +#if defined(__FreeBSD__) || defined(__FreeBSD_kernel__) + if (io->flags & CHANNEL_FLAGS_BLOCK_DEVICE) { + int dio_align = ext2fs_get_dio_alignment(fd); + + if (io->align < dio_align) + io->align = dio_align; + } +#endif + + if ((retval = alloc_cache(io, data))) + goto cleanup; + +#ifdef BLKROGET + if (flags & IO_FLAG_RW) { + int error; + int readonly = 0; + + /* Is the block device actually writable? */ + error = ioctl(data->dev, BLKROGET, &readonly); + if (!error && readonly) { + retval = EPERM; + goto cleanup; + } + } +#endif + +#ifdef __linux__ +#undef RLIM_INFINITY +#if (defined(__alpha__) || ((defined(__sparc__) || defined(__mips__)) && (SIZEOF_LONG == 4))) +#define RLIM_INFINITY ((unsigned long)(~0UL>>1)) +#else +#define RLIM_INFINITY (~0UL) +#endif + /* + * Work around a bug in 2.4.10-2.4.18 kernels where writes to + * block devices are wrongly getting hit by the filesize + * limit. This workaround isn't perfect, since it won't work + * if glibc wasn't built against 2.2 header files. (Sigh.) + * + */ + if ((flags & IO_FLAG_RW) && + (uname(&ut) == 0) && + ((ut.release[0] == '2') && (ut.release[1] == '.') && + (ut.release[2] == '4') && (ut.release[3] == '.') && + (ut.release[4] == '1') && (ut.release[5] >= '0') && + (ut.release[5] < '8')) && + (ext2fs_fstat(data->dev, &st) == 0) && + (ext2fsP_is_disk_device(st.st_mode))) { + struct rlimit rlim; + + rlim.rlim_cur = rlim.rlim_max = (unsigned long) RLIM_INFINITY; + setrlimit(RLIMIT_FSIZE, &rlim); + getrlimit(RLIMIT_FSIZE, &rlim); + if (((unsigned long) rlim.rlim_cur) < + ((unsigned long) rlim.rlim_max)) { + rlim.rlim_cur = rlim.rlim_max; + setrlimit(RLIMIT_FSIZE, &rlim); + } + } +#endif +#ifdef HAVE_PTHREAD + if (flags & IO_FLAG_THREADS) { + io->flags |= CHANNEL_FLAGS_THREADS; + retval = pthread_mutex_init(&data->cache_mutex, NULL); + if (retval) + goto cleanup; + retval = pthread_mutex_init(&data->bounce_mutex, NULL); + if (retval) { + pthread_mutex_destroy(&data->cache_mutex); + goto cleanup; + } + retval = pthread_mutex_init(&data->stats_mutex, NULL); + if (retval) { + pthread_mutex_destroy(&data->cache_mutex); + pthread_mutex_destroy(&data->bounce_mutex); + goto cleanup; + } + } +#endif + *channel = io; + return 0; + +cleanup: + if (data) { + if (data->dev >= 0) + close(data->dev); + free_cache(data); + ext2fs_free_mem(&data); + } + if (io) { + if (io->name) { + ext2fs_free_mem(&io->name); + } + ext2fs_free_mem(&io); + } + return retval; +} + +static errcode_t unixfd_open(const char *str_fd, int flags, + io_channel *channel) +{ + int fd; + int fd_flags; + + fd = atoi(str_fd); +#if defined(HAVE_FCNTL) + fd_flags = fcntl(fd, F_GETFD); + if (fd_flags == -1) + return EBADF; + + flags = 0; + if (fd_flags & O_RDWR) + flags |= IO_FLAG_RW; + if (fd_flags & O_EXCL) + flags |= IO_FLAG_EXCLUSIVE; +#if defined(O_DIRECT) + if (fd_flags & O_DIRECT) + flags |= IO_FLAG_DIRECT_IO; +#endif +#endif /* HAVE_FCNTL */ + + return unix_open_channel(str_fd, fd, flags, channel, unixfd_io_manager); +} + +static errcode_t unix_open(const char *name, int flags, + io_channel *channel) +{ + int fd = -1; + int open_flags; + + if (name == 0) + return EXT2_ET_BAD_DEVICE_NAME; + + open_flags = (flags & IO_FLAG_RW) ? O_RDWR : O_RDONLY; + if (flags & IO_FLAG_EXCLUSIVE) + open_flags |= O_EXCL; +#if defined(O_DIRECT) + if (flags & IO_FLAG_DIRECT_IO) + open_flags |= O_DIRECT; +#endif + fd = ext2fs_open_file(name, open_flags, 0); + if (fd < 0) + return errno; +#if defined(F_NOCACHE) && !defined(IO_DIRECT) + if (flags & IO_FLAG_DIRECT_IO) { + if (fcntl(fd, F_NOCACHE, 1) < 0) + return errno; + } +#endif + return unix_open_channel(name, fd, flags, channel, unix_io_manager); +} + +static errcode_t unix_close(io_channel channel) +{ + struct unix_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct unix_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (--channel->refcount > 0) + return 0; + +#ifndef NO_IO_CACHE + retval = flush_cached_blocks(channel, data, 0); +#endif + + if (close(data->dev) < 0) + retval = errno; + free_cache(data); +#ifdef HAVE_PTHREAD + if (data->flags & IO_FLAG_THREADS) { + pthread_mutex_destroy(&data->cache_mutex); + pthread_mutex_destroy(&data->bounce_mutex); + pthread_mutex_destroy(&data->stats_mutex); + } +#endif + + ext2fs_free_mem(&channel->private_data); + if (channel->name) + ext2fs_free_mem(&channel->name); + ext2fs_free_mem(&channel); + return retval; +} + +static errcode_t unix_set_blksize(io_channel channel, int blksize) +{ + struct unix_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct unix_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (channel->block_size != blksize) { + mutex_lock(data, CACHE_MTX); + mutex_lock(data, BOUNCE_MTX); +#ifndef NO_IO_CACHE + if ((retval = flush_cached_blocks(channel, data, FLUSH_NOLOCK))){ + mutex_unlock(data, BOUNCE_MTX); + mutex_unlock(data, CACHE_MTX); + return retval; + } +#endif + + channel->block_size = blksize; + free_cache(data); + retval = alloc_cache(channel, data); + mutex_unlock(data, BOUNCE_MTX); + mutex_unlock(data, CACHE_MTX); + } + return retval; +} + +static errcode_t unix_read_blk64(io_channel channel, unsigned long long block, + int count, void *buf) +{ + struct unix_private_data *data; + struct unix_cache *cache; + errcode_t retval; + char *cp; + int i, j; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct unix_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + +#ifdef NO_IO_CACHE + return raw_read_blk(channel, data, block, count, buf); +#else + if (data->flags & IO_FLAG_NOCACHE) + return raw_read_blk(channel, data, block, count, buf); + /* + * If we're doing an odd-sized read or a very large read, + * flush out the cache and then do a direct read. + */ + if (count < 0 || count > WRITE_DIRECT_SIZE) { + if ((retval = flush_cached_blocks(channel, data, 0))) + return retval; + return raw_read_blk(channel, data, block, count, buf); + } + + cp = buf; + mutex_lock(data, CACHE_MTX); + while (count > 0) { + /* If it's in the cache, use it! */ + if ((cache = find_cached_block(data, block, NULL))) { +#ifdef DEBUG + printf("Using cached block %lu\n", block); +#endif + memcpy(cp, cache->buf, channel->block_size); + count--; + block++; + cp += channel->block_size; + continue; + } + + /* + * Find the number of uncached blocks so we can do a + * single read request + */ + for (i=1; i < count; i++) + if (find_cached_block(data, block+i, NULL)) + break; +#ifdef DEBUG + printf("Reading %d blocks starting at %lu\n", i, block); +#endif + mutex_unlock(data, CACHE_MTX); + if ((retval = raw_read_blk(channel, data, block, i, cp))) + return retval; + mutex_lock(data, CACHE_MTX); + + /* Save the results in the cache */ + for (j=0; j < i; j++) { + if (!find_cached_block(data, block, &cache)) { + retval = reuse_cache(channel, data, + cache, block); + if (retval) + goto call_write_handler; + memcpy(cache->buf, cp, channel->block_size); + } + count--; + block++; + cp += channel->block_size; + } + } + mutex_unlock(data, CACHE_MTX); + return 0; + +call_write_handler: + if (cache->write_err && channel->write_error) { + char *err_buf = NULL; + unsigned long long err_block = cache->block; + + cache->dirty = 0; + cache->in_use = 0; + cache->write_err = 0; + if (io_channel_alloc_buf(channel, 0, &err_buf)) + err_buf = NULL; + else + memcpy(err_buf, cache->buf, channel->block_size); + mutex_unlock(data, CACHE_MTX); + (channel->write_error)(channel, err_block, 1, err_buf, + channel->block_size, -1, + retval); + if (err_buf) + ext2fs_free_mem(&err_buf); + } else + mutex_unlock(data, CACHE_MTX); + return retval; +#endif /* NO_IO_CACHE */ +} + +static errcode_t unix_read_blk(io_channel channel, unsigned long block, + int count, void *buf) +{ + return unix_read_blk64(channel, block, count, buf); +} + +static errcode_t unix_write_blk64(io_channel channel, unsigned long long block, + int count, const void *buf) +{ + struct unix_private_data *data; + struct unix_cache *cache, *reuse; + errcode_t retval = 0; + const char *cp; + int writethrough; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct unix_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + +#ifdef NO_IO_CACHE + return raw_write_blk(channel, data, block, count, buf, 0); +#else + if (data->flags & IO_FLAG_NOCACHE) + return raw_write_blk(channel, data, block, count, buf, 0); + /* + * If we're doing an odd-sized write or a very large write, + * flush out the cache completely and then do a direct write. + */ + if (count < 0 || count > WRITE_DIRECT_SIZE) { + if ((retval = flush_cached_blocks(channel, data, + FLUSH_INVALIDATE))) + return retval; + return raw_write_blk(channel, data, block, count, buf, 0); + } + + /* + * For a moderate-sized multi-block write, first force a write + * if we're in write-through cache mode, and then fill the + * cache with the blocks. + */ + writethrough = channel->flags & CHANNEL_FLAGS_WRITETHROUGH; + if (writethrough) + retval = raw_write_blk(channel, data, block, count, buf, 0); + + cp = buf; + mutex_lock(data, CACHE_MTX); + while (count > 0) { + cache = find_cached_block(data, block, &reuse); + if (!cache) { + errcode_t err; + + cache = reuse; + err = reuse_cache(channel, data, cache, block); + if (err) + goto call_write_handler; + } + if (cache->buf != cp) + memcpy(cache->buf, cp, channel->block_size); + cache->dirty = !writethrough; + count--; + block++; + cp += channel->block_size; + } + mutex_unlock(data, CACHE_MTX); + return retval; + +call_write_handler: + if (cache->write_err && channel->write_error) { + char *err_buf = NULL; + unsigned long long err_block = cache->block; + + cache->dirty = 0; + cache->in_use = 0; + cache->write_err = 0; + if (io_channel_alloc_buf(channel, 0, &err_buf)) + err_buf = NULL; + else + memcpy(err_buf, cache->buf, channel->block_size); + mutex_unlock(data, CACHE_MTX); + (channel->write_error)(channel, err_block, 1, err_buf, + channel->block_size, -1, + retval); + if (err_buf) + ext2fs_free_mem(&err_buf); + } else + mutex_unlock(data, CACHE_MTX); + return retval; +#endif /* NO_IO_CACHE */ +} + +static errcode_t unix_cache_readahead(io_channel channel, + unsigned long long block, + unsigned long long count) +{ +#ifdef POSIX_FADV_WILLNEED + struct unix_private_data *data; + + data = (struct unix_private_data *)channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + return posix_fadvise(data->dev, + (ext2_loff_t)block * channel->block_size + data->offset, + (ext2_loff_t)count * channel->block_size, + POSIX_FADV_WILLNEED); +#else + return EXT2_ET_OP_NOT_SUPPORTED; +#endif +} + +static errcode_t unix_write_blk(io_channel channel, unsigned long block, + int count, const void *buf) +{ + return unix_write_blk64(channel, block, count, buf); +} + +static errcode_t unix_write_byte(io_channel channel, unsigned long offset, + int size, const void *buf) +{ + struct unix_private_data *data; + errcode_t retval = 0; + ssize_t actual; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct unix_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (channel->align != 0) { +#ifdef ALIGN_DEBUG + printf("unix_write_byte: O_DIRECT fallback\n"); +#endif + return EXT2_ET_UNIMPLEMENTED; + } + +#ifndef NO_IO_CACHE + /* + * Flush out the cache completely + */ + if ((retval = flush_cached_blocks(channel, data, FLUSH_INVALIDATE))) + return retval; +#endif + + if (lseek(data->dev, offset + data->offset, SEEK_SET) < 0) + return errno; + + actual = write(data->dev, buf, size); + if (actual < 0) + return errno; + if (actual != size) + return EXT2_ET_SHORT_WRITE; + + return 0; +} + +/* + * Flush data buffers to disk. + */ +static errcode_t unix_flush(io_channel channel) +{ + struct unix_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct unix_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + +#ifndef NO_IO_CACHE + retval = flush_cached_blocks(channel, data, 0); +#endif +#ifdef HAVE_FSYNC + if (!retval && fsync(data->dev) != 0) + return errno; +#endif + return retval; +} + +static errcode_t unix_set_option(io_channel channel, const char *option, + const char *arg) +{ + struct unix_private_data *data; + unsigned long long tmp; + errcode_t retval; + char *end; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct unix_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (!strcmp(option, "offset")) { + if (!arg) + return EXT2_ET_INVALID_ARGUMENT; + + tmp = strtoull(arg, &end, 0); + if (*end) + return EXT2_ET_INVALID_ARGUMENT; + data->offset = tmp; + if (data->offset < 0) + return EXT2_ET_INVALID_ARGUMENT; + return 0; + } + if (!strcmp(option, "cache")) { + if (!arg) + return EXT2_ET_INVALID_ARGUMENT; + if (!strcmp(arg, "on")) { + data->flags &= ~IO_FLAG_NOCACHE; + return 0; + } + if (!strcmp(arg, "off")) { + retval = flush_cached_blocks(channel, data, 0); + data->flags |= IO_FLAG_NOCACHE; + return retval; + } + return EXT2_ET_INVALID_ARGUMENT; + } + return EXT2_ET_INVALID_ARGUMENT; +} + +#if defined(__linux__) && !defined(BLKDISCARD) +#define BLKDISCARD _IO(0x12,119) +#endif + +static errcode_t unix_discard(io_channel channel, unsigned long long block, + unsigned long long count) +{ + struct unix_private_data *data; + int ret; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct unix_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (channel->flags & CHANNEL_FLAGS_BLOCK_DEVICE) { +#ifdef BLKDISCARD + __u64 range[2]; + + range[0] = (__u64)(block) * channel->block_size + data->offset; + range[1] = (__u64)(count) * channel->block_size; + + ret = ioctl(data->dev, BLKDISCARD, &range); +#else + goto unimplemented; +#endif + } else { +#if defined(HAVE_FALLOCATE) && defined(FALLOC_FL_PUNCH_HOLE) + /* + * If we are not on block device, try to use punch hole + * to reclaim free space. + */ + ret = fallocate(data->dev, + FALLOC_FL_PUNCH_HOLE | FALLOC_FL_KEEP_SIZE, + (off_t)(block) * channel->block_size + data->offset, + (off_t)(count) * channel->block_size); +#else + goto unimplemented; +#endif + } + if (ret < 0) { + if (errno == EOPNOTSUPP) + goto unimplemented; + return errno; + } + return 0; +unimplemented: + return EXT2_ET_UNIMPLEMENTED; +} + +/* + * If we know about ZERO_RANGE, try that before we try PUNCH_HOLE because + * ZERO_RANGE doesn't unmap preallocated blocks. We prefer fallocate because + * it always invalidates page cache, and libext2fs requires that reads after + * ZERO_RANGE return zeroes. + */ +static int __unix_zeroout(int fd, off_t offset, off_t len) +{ + int ret = -1; + +#if defined(HAVE_FALLOCATE) && defined(FALLOC_FL_ZERO_RANGE) + ret = fallocate(fd, FALLOC_FL_ZERO_RANGE, offset, len); + if (ret == 0) + return 0; +#endif +#if defined(HAVE_FALLOCATE) && defined(FALLOC_FL_PUNCH_HOLE) && defined(FALLOC_FL_KEEP_SIZE) + ret = fallocate(fd, FALLOC_FL_PUNCH_HOLE | FALLOC_FL_KEEP_SIZE, + offset, len); + if (ret == 0) + return 0; +#endif + errno = EOPNOTSUPP; + return ret; +} + +/* parameters might not be used if OS doesn't support zeroout */ +#if __GNUC_PREREQ (4, 6) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wunused-parameter" +#endif +static errcode_t unix_zeroout(io_channel channel, unsigned long long block, + unsigned long long count) +{ + struct unix_private_data *data; + int ret; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct unix_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL); + + if (safe_getenv("UNIX_IO_NOZEROOUT")) + goto unimplemented; + + if (!(channel->flags & CHANNEL_FLAGS_BLOCK_DEVICE)) { + /* Regular file, try to use truncate/punch/zero. */ + struct stat statbuf; + + if (count == 0) + return 0; + /* + * If we're trying to zero a range past the end of the file, + * extend the file size, then truncate everything. + */ + ret = fstat(data->dev, &statbuf); + if (ret) + goto err; + if ((unsigned long long) statbuf.st_size < + (block + count) * channel->block_size + data->offset) { + ret = ftruncate(data->dev, + (block + count) * channel->block_size + data->offset); + if (ret) + goto err; + } + } + + ret = __unix_zeroout(data->dev, + (off_t)(block) * channel->block_size + data->offset, + (off_t)(count) * channel->block_size); +err: + if (ret < 0) { + if (errno == EOPNOTSUPP) + goto unimplemented; + return errno; + } + return 0; +unimplemented: + return EXT2_ET_UNIMPLEMENTED; +} +#if __GNUC_PREREQ (4, 6) +#pragma GCC diagnostic pop +#endif + +static struct struct_io_manager struct_unix_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "Unix I/O Manager", + .open = unix_open, + .close = unix_close, + .set_blksize = unix_set_blksize, + .read_blk = unix_read_blk, + .write_blk = unix_write_blk, + .flush = unix_flush, + .write_byte = unix_write_byte, + .set_option = unix_set_option, + .get_stats = unix_get_stats, + .read_blk64 = unix_read_blk64, + .write_blk64 = unix_write_blk64, + .discard = unix_discard, + .cache_readahead = unix_cache_readahead, + .zeroout = unix_zeroout, +}; + +io_manager unix_io_manager = &struct_unix_manager; + +static struct struct_io_manager struct_unixfd_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "Unix fd I/O Manager", + .open = unixfd_open, + .close = unix_close, + .set_blksize = unix_set_blksize, + .read_blk = unix_read_blk, + .write_blk = unix_write_blk, + .flush = unix_flush, + .write_byte = unix_write_byte, + .set_option = unix_set_option, + .get_stats = unix_get_stats, + .read_blk64 = unix_read_blk64, + .write_blk64 = unix_write_blk64, + .discard = unix_discard, + .cache_readahead = unix_cache_readahead, + .zeroout = unix_zeroout, +}; + +io_manager unixfd_io_manager = &struct_unixfd_manager; diff --git a/lib/ext2fs/unlink.c b/lib/ext2fs/unlink.c new file mode 100644 index 0000000..3ec04cf --- /dev/null +++ b/lib/ext2fs/unlink.c @@ -0,0 +1,100 @@ +/* + * unlink.c --- delete links in a ext2fs directory + * + * Copyright (C) 1993, 1994, 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" + +struct link_struct { + const char *name; + int namelen; + ext2_ino_t inode; + int flags; + struct ext2_dir_entry *prev; + int done; +}; + +#ifdef __TURBOC__ + #pragma argsused +#endif +static int unlink_proc(struct ext2_dir_entry *dirent, + int offset, + int blocksize EXT2FS_ATTR((unused)), + char *buf EXT2FS_ATTR((unused)), + void *priv_data) +{ + struct link_struct *ls = (struct link_struct *) priv_data; + struct ext2_dir_entry *prev; + + prev = ls->prev; + ls->prev = dirent; + + if (ls->name) { + if (ext2fs_dirent_name_len(dirent) != ls->namelen) + return 0; + if (strncmp(ls->name, dirent->name, ext2fs_dirent_name_len(dirent))) + return 0; + } + if (!(ls->flags & EXT2FS_UNLINK_FORCE) && ls->inode) { + if (dirent->inode != ls->inode) + return 0; + } else { + if (!dirent->inode) + return 0; + } + + if (offset) + prev->rec_len += dirent->rec_len; + else + dirent->inode = 0; + ls->done++; + return DIRENT_ABORT|DIRENT_CHANGED; +} + +#ifdef __TURBOC__ + #pragma argsused +#endif +errcode_t ext2fs_unlink(ext2_filsys fs, ext2_ino_t dir, + const char *name, ext2_ino_t ino, + int flags) +{ + errcode_t retval; + struct link_struct ls; + + EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS); + + if (!name && !ino) + return EXT2_ET_INVALID_ARGUMENT; + + if (!(fs->flags & EXT2_FLAG_RW)) + return EXT2_ET_RO_FILSYS; + + ls.name = name; + ls.namelen = name ? strlen(name) : 0; + ls.inode = ino; + ls.flags = flags; + ls.done = 0; + ls.prev = 0; + + retval = ext2fs_dir_iterate(fs, dir, DIRENT_FLAG_INCLUDE_EMPTY, + 0, unlink_proc, &ls); + if (retval) + return retval; + + return (ls.done) ? 0 : EXT2_ET_DIR_NO_SPACE; +} + diff --git a/lib/ext2fs/utf8data.h b/lib/ext2fs/utf8data.h new file mode 100644 index 0000000..76e4f0e --- /dev/null +++ b/lib/ext2fs/utf8data.h @@ -0,0 +1,4109 @@ +/* This file is generated code, do not edit. */ +#ifndef __INCLUDED_FROM_UTF8NORM_C__ +#error Only nls_utf8-norm.c should include this file. +#endif + +static const unsigned int utf8vers = 0xc0100; + +static const unsigned int utf8agetab[] = { + 0, + 0x10100, + 0x20000, + 0x20100, + 0x30000, + 0x30100, + 0x30200, + 0x40000, + 0x40100, + 0x50000, + 0x50100, + 0x50200, + 0x60000, + 0x60100, + 0x60200, + 0x60300, + 0x70000, + 0x80000, + 0x90000, + 0xa0000, + 0xb0000, + 0xc0000, + 0xc0100 +}; + +static const struct utf8data utf8nfdicfdata[] = { + { 0, 0 }, + { 0x10100, 0 }, + { 0x20000, 0 }, + { 0x20100, 0 }, + { 0x30000, 0 }, + { 0x30100, 0 }, + { 0x30200, 1792 }, + { 0x40000, 3200 }, + { 0x40100, 3200 }, + { 0x50000, 3200 }, + { 0x50100, 3200 }, + { 0x50200, 3200 }, + { 0x60000, 3200 }, + { 0x60100, 3200 }, + { 0x60200, 3200 }, + { 0x60300, 3200 }, + { 0x70000, 3200 }, + { 0x80000, 3200 }, + { 0x90000, 3200 }, + { 0xa0000, 3200 }, + { 0xb0000, 3200 }, + { 0xc0000, 3200 }, + { 0xc0100, 3200 } +}; + +static const struct utf8data utf8nfdidata[] = { + { 0, 896 }, + { 0x10100, 896 }, + { 0x20000, 896 }, + { 0x20100, 896 }, + { 0x30000, 896 }, + { 0x30100, 896 }, + { 0x30200, 2496 }, + { 0x40000, 20736 }, + { 0x40100, 20736 }, + { 0x50000, 20736 }, + { 0x50100, 20736 }, + { 0x50200, 20736 }, + { 0x60000, 20736 }, + { 0x60100, 20736 }, + { 0x60200, 20736 }, + { 0x60300, 20736 }, + { 0x70000, 20736 }, + { 0x80000, 20736 }, + { 0x90000, 20736 }, + { 0xa0000, 20736 }, + { 0xb0000, 20736 }, + { 0xc0000, 20736 }, + { 0xc0100, 20736 } +}; + +static const unsigned char utf8data[64256] = { + /* nfdicf_30100 */ + 0xd7,0x07,0x66,0x84,0x0c,0x01,0x00,0xc6,0xd5,0x16,0xe4,0x99,0x1a,0xe3,0x63,0x15, + 0xe2,0x4c,0x0e,0xc1,0xe0,0x4e,0x0d,0xcf,0x86,0x65,0x2d,0x0d,0x01,0x00,0xd4,0xb8, + 0xd3,0x27,0xe2,0x89,0xa3,0xe1,0xce,0x35,0xe0,0x2c,0x22,0xcf,0x86,0xc5,0xe4,0x15, + 0x6d,0xe3,0x60,0x68,0xe2,0xf6,0x65,0xe1,0x29,0x65,0xe0,0xee,0x64,0xcf,0x86,0xe5, + 0xb3,0x64,0x64,0x96,0x64,0x0b,0x00,0xd2,0x0e,0xe1,0xb5,0x3c,0xe0,0xba,0xa3,0xcf, + 0x86,0xcf,0x06,0x01,0x00,0xd1,0x0c,0xe0,0x1e,0xa9,0xcf,0x86,0xcf,0x06,0x02,0xff, + 0xff,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x01, + 0x00,0xe4,0xe1,0x45,0xe3,0x3b,0x45,0xd2,0x06,0xcf,0x06,0x01,0x00,0xe1,0x87,0xad, + 0xd0,0x21,0xcf,0x86,0xe5,0x81,0xaa,0xe4,0x00,0xaa,0xe3,0xbf,0xa9,0xe2,0x9e,0xa9, + 0xe1,0x8d,0xa9,0x10,0x08,0x01,0xff,0xe8,0xb1,0x88,0x00,0x01,0xff,0xe6,0x9b,0xb4, + 0x00,0xcf,0x86,0xe5,0x63,0xac,0xd4,0x19,0xe3,0xa2,0xab,0xe2,0x81,0xab,0xe1,0x70, + 0xab,0x10,0x08,0x01,0xff,0xe9,0xb9,0xbf,0x00,0x01,0xff,0xe8,0xab,0x96,0x00,0xe3, + 0x09,0xac,0xe2,0xe8,0xab,0xe1,0xd7,0xab,0x10,0x08,0x01,0xff,0xe7,0xb8,0xb7,0x00, + 0x01,0xff,0xe9,0x9b,0xbb,0x00,0x83,0xe2,0x19,0xfa,0xe1,0xf2,0xf6,0xe0,0x6f,0xf5, + 0xcf,0x86,0xd5,0x31,0xc4,0xe3,0x54,0x4e,0xe2,0xf5,0x4c,0xe1,0xa4,0xcc,0xe0,0x9c, + 0x4b,0xcf,0x86,0xe5,0x8e,0x49,0xe4,0xaf,0x46,0xe3,0x11,0xbd,0xe2,0x68,0xbc,0xe1, + 0x43,0xbc,0xe0,0x1c,0xbc,0xcf,0x86,0xe5,0xe9,0xbb,0x94,0x07,0x63,0xd4,0xbb,0x07, + 0x00,0x07,0x00,0xe4,0xdb,0xf4,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd2,0x0b, + 0xe1,0xea,0xe1,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd1,0x0e,0xe0,0xd9,0xe2,0xcf,0x86, + 0xe5,0x9e,0xe2,0xcf,0x06,0x11,0x00,0xd0,0x0b,0xcf,0x86,0xe5,0xd9,0xe2,0xcf,0x06, + 0x13,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xe4,0x74,0xf4,0xe3,0x5d,0xf3, + 0xd2,0xa0,0xe1,0x13,0xe7,0xd0,0x21,0xcf,0x86,0xe5,0x14,0xe4,0xe4,0x90,0xe3,0xe3, + 0x4e,0xe3,0xe2,0x2d,0xe3,0xe1,0x1b,0xe3,0x10,0x08,0x05,0xff,0xe4,0xb8,0xbd,0x00, + 0x05,0xff,0xe4,0xb8,0xb8,0x00,0xcf,0x86,0xd5,0x1c,0xe4,0x70,0xe5,0xe3,0x2f,0xe5, + 0xe2,0x0e,0xe5,0xe1,0xfd,0xe4,0x10,0x08,0x05,0xff,0xe5,0x92,0xa2,0x00,0x05,0xff, + 0xe5,0x93,0xb6,0x00,0xd4,0x34,0xd3,0x18,0xe2,0xf7,0xe5,0xe1,0xe6,0xe5,0x10,0x09, + 0x05,0xff,0xf0,0xa1,0x9a,0xa8,0x00,0x05,0xff,0xf0,0xa1,0x9b,0xaa,0x00,0xe2,0x17, + 0xe6,0x91,0x11,0x10,0x09,0x05,0xff,0xf0,0xa1,0x8d,0xaa,0x00,0x05,0xff,0xe5,0xac, + 0x88,0x00,0x05,0xff,0xe5,0xac,0xbe,0x00,0xe3,0x5d,0xe6,0xd2,0x14,0xe1,0x2c,0xe6, + 0x10,0x08,0x05,0xff,0xe5,0xaf,0xb3,0x00,0x05,0xff,0xf0,0xa1,0xac,0x98,0x00,0xe1, + 0x38,0xe6,0x10,0x08,0x05,0xff,0xe5,0xbc,0xb3,0x00,0x05,0xff,0xe5,0xb0,0xa2,0x00, + 0xd1,0xd5,0xd0,0x6a,0xcf,0x86,0xe5,0x8d,0xeb,0xd4,0x19,0xe3,0xc6,0xea,0xe2,0xa4, + 0xea,0xe1,0x93,0xea,0x10,0x08,0x05,0xff,0xe6,0xb4,0xbe,0x00,0x05,0xff,0xe6,0xb5, + 0xb7,0x00,0xd3,0x18,0xe2,0x10,0xeb,0xe1,0xff,0xea,0x10,0x09,0x05,0xff,0xf0,0xa3, + 0xbd,0x9e,0x00,0x05,0xff,0xf0,0xa3,0xbe,0x8e,0x00,0xd2,0x13,0xe1,0x28,0xeb,0x10, + 0x08,0x05,0xff,0xe7,0x81,0xbd,0x00,0x05,0xff,0xe7,0x81,0xb7,0x00,0xd1,0x11,0x10, + 0x08,0x05,0xff,0xe7,0x85,0x85,0x00,0x05,0xff,0xf0,0xa4,0x89,0xa3,0x00,0x10,0x08, + 0x05,0xff,0xe7,0x86,0x9c,0x00,0x05,0xff,0xe4,0x8e,0xab,0x00,0xcf,0x86,0xe5,0x2a, + 0xed,0xd4,0x1a,0xe3,0x62,0xec,0xe2,0x48,0xec,0xe1,0x35,0xec,0x10,0x08,0x05,0xff, + 0xe7,0x9b,0xb4,0x00,0x05,0xff,0xf0,0xa5,0x83,0xb3,0x00,0xd3,0x16,0xe2,0xaa,0xec, + 0xe1,0x98,0xec,0x10,0x08,0x05,0xff,0xe7,0xa3,0x8c,0x00,0x05,0xff,0xe4,0x83,0xa3, + 0x00,0xd2,0x13,0xe1,0xc6,0xec,0x10,0x08,0x05,0xff,0xe4,0x84,0xaf,0x00,0x05,0xff, + 0xe7,0xa9,0x80,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0xa5,0xbc,0x00,0x05, + 0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x05, + 0xff,0xe7,0xaa,0xae,0x00,0xe0,0xdc,0xef,0xcf,0x86,0xd5,0x1d,0xe4,0x51,0xee,0xe3, + 0x0d,0xee,0xe2,0xeb,0xed,0xe1,0xda,0xed,0x10,0x09,0x05,0xff,0xf0,0xa3,0x8d,0x9f, + 0x00,0x05,0xff,0xe4,0x8f,0x95,0x00,0xd4,0x19,0xe3,0xf8,0xee,0xe2,0xd4,0xee,0xe1, + 0xc3,0xee,0x10,0x08,0x05,0xff,0xe8,0x8d,0x93,0x00,0x05,0xff,0xe8,0x8f,0x8a,0x00, + 0xd3,0x18,0xe2,0x43,0xef,0xe1,0x32,0xef,0x10,0x09,0x05,0xff,0xf0,0xa6,0xbe,0xb1, + 0x00,0x05,0xff,0xf0,0xa7,0x83,0x92,0x00,0xd2,0x13,0xe1,0x5b,0xef,0x10,0x08,0x05, + 0xff,0xe8,0x9a,0x88,0x00,0x05,0xff,0xe8,0x9c,0x8e,0x00,0xd1,0x10,0x10,0x08,0x05, + 0xff,0xe8,0x9c,0xa8,0x00,0x05,0xff,0xe8,0x9d,0xab,0x00,0x10,0x08,0x05,0xff,0xe8, + 0x9e,0x86,0x00,0x05,0xff,0xe4,0xb5,0x97,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + /* nfdi_30100 */ + 0x57,0x04,0x01,0x00,0xc6,0xd5,0x16,0xe4,0xc2,0x59,0xe3,0xfb,0x54,0xe2,0x74,0x4f, + 0xc1,0xe0,0xa0,0x4d,0xcf,0x86,0x65,0x84,0x4d,0x01,0x00,0xd4,0xb8,0xd3,0x27,0xe2, + 0x0c,0xa0,0xe1,0xdf,0x8d,0xe0,0x39,0x71,0xcf,0x86,0xc5,0xe4,0x98,0x69,0xe3,0xe3, + 0x64,0xe2,0x79,0x62,0xe1,0xac,0x61,0xe0,0x71,0x61,0xcf,0x86,0xe5,0x36,0x61,0x64, + 0x19,0x61,0x0b,0x00,0xd2,0x0e,0xe1,0xc2,0xa0,0xe0,0x3d,0xa0,0xcf,0x86,0xcf,0x06, + 0x01,0x00,0xd1,0x0c,0xe0,0xa1,0xa5,0xcf,0x86,0xcf,0x06,0x02,0xff,0xff,0xd0,0x08, + 0xcf,0x86,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x01,0x00,0xe4,0x9e, + 0xb6,0xe3,0x18,0xae,0xd2,0x06,0xcf,0x06,0x01,0x00,0xe1,0x0a,0xaa,0xd0,0x21,0xcf, + 0x86,0xe5,0x04,0xa7,0xe4,0x83,0xa6,0xe3,0x42,0xa6,0xe2,0x21,0xa6,0xe1,0x10,0xa6, + 0x10,0x08,0x01,0xff,0xe8,0xb1,0x88,0x00,0x01,0xff,0xe6,0x9b,0xb4,0x00,0xcf,0x86, + 0xe5,0xe6,0xa8,0xd4,0x19,0xe3,0x25,0xa8,0xe2,0x04,0xa8,0xe1,0xf3,0xa7,0x10,0x08, + 0x01,0xff,0xe9,0xb9,0xbf,0x00,0x01,0xff,0xe8,0xab,0x96,0x00,0xe3,0x8c,0xa8,0xe2, + 0x6b,0xa8,0xe1,0x5a,0xa8,0x10,0x08,0x01,0xff,0xe7,0xb8,0xb7,0x00,0x01,0xff,0xe9, + 0x9b,0xbb,0x00,0x83,0xe2,0x9c,0xf6,0xe1,0x75,0xf3,0xe0,0xf2,0xf1,0xcf,0x86,0xd5, + 0x31,0xc4,0xe3,0x6d,0xcc,0xe2,0x46,0xca,0xe1,0x27,0xc9,0xe0,0xb7,0xbf,0xcf,0x86, + 0xe5,0xaa,0xbb,0xe4,0xa3,0xba,0xe3,0x94,0xb9,0xe2,0xeb,0xb8,0xe1,0xc6,0xb8,0xe0, + 0x9f,0xb8,0xcf,0x86,0xe5,0x6c,0xb8,0x94,0x07,0x63,0x57,0xb8,0x07,0x00,0x07,0x00, + 0xe4,0x5e,0xf1,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd2,0x0b,0xe1,0x6d,0xde, + 0xcf,0x86,0xcf,0x06,0x05,0x00,0xd1,0x0e,0xe0,0x5c,0xdf,0xcf,0x86,0xe5,0x21,0xdf, + 0xcf,0x06,0x11,0x00,0xd0,0x0b,0xcf,0x86,0xe5,0x5c,0xdf,0xcf,0x06,0x13,0x00,0xcf, + 0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xe4,0xf7,0xf0,0xe3,0xe0,0xef,0xd2,0xa0,0xe1, + 0x96,0xe3,0xd0,0x21,0xcf,0x86,0xe5,0x97,0xe0,0xe4,0x13,0xe0,0xe3,0xd1,0xdf,0xe2, + 0xb0,0xdf,0xe1,0x9e,0xdf,0x10,0x08,0x05,0xff,0xe4,0xb8,0xbd,0x00,0x05,0xff,0xe4, + 0xb8,0xb8,0x00,0xcf,0x86,0xd5,0x1c,0xe4,0xf3,0xe1,0xe3,0xb2,0xe1,0xe2,0x91,0xe1, + 0xe1,0x80,0xe1,0x10,0x08,0x05,0xff,0xe5,0x92,0xa2,0x00,0x05,0xff,0xe5,0x93,0xb6, + 0x00,0xd4,0x34,0xd3,0x18,0xe2,0x7a,0xe2,0xe1,0x69,0xe2,0x10,0x09,0x05,0xff,0xf0, + 0xa1,0x9a,0xa8,0x00,0x05,0xff,0xf0,0xa1,0x9b,0xaa,0x00,0xe2,0x9a,0xe2,0x91,0x11, + 0x10,0x09,0x05,0xff,0xf0,0xa1,0x8d,0xaa,0x00,0x05,0xff,0xe5,0xac,0x88,0x00,0x05, + 0xff,0xe5,0xac,0xbe,0x00,0xe3,0xe0,0xe2,0xd2,0x14,0xe1,0xaf,0xe2,0x10,0x08,0x05, + 0xff,0xe5,0xaf,0xb3,0x00,0x05,0xff,0xf0,0xa1,0xac,0x98,0x00,0xe1,0xbb,0xe2,0x10, + 0x08,0x05,0xff,0xe5,0xbc,0xb3,0x00,0x05,0xff,0xe5,0xb0,0xa2,0x00,0xd1,0xd5,0xd0, + 0x6a,0xcf,0x86,0xe5,0x10,0xe8,0xd4,0x19,0xe3,0x49,0xe7,0xe2,0x27,0xe7,0xe1,0x16, + 0xe7,0x10,0x08,0x05,0xff,0xe6,0xb4,0xbe,0x00,0x05,0xff,0xe6,0xb5,0xb7,0x00,0xd3, + 0x18,0xe2,0x93,0xe7,0xe1,0x82,0xe7,0x10,0x09,0x05,0xff,0xf0,0xa3,0xbd,0x9e,0x00, + 0x05,0xff,0xf0,0xa3,0xbe,0x8e,0x00,0xd2,0x13,0xe1,0xab,0xe7,0x10,0x08,0x05,0xff, + 0xe7,0x81,0xbd,0x00,0x05,0xff,0xe7,0x81,0xb7,0x00,0xd1,0x11,0x10,0x08,0x05,0xff, + 0xe7,0x85,0x85,0x00,0x05,0xff,0xf0,0xa4,0x89,0xa3,0x00,0x10,0x08,0x05,0xff,0xe7, + 0x86,0x9c,0x00,0x05,0xff,0xe4,0x8e,0xab,0x00,0xcf,0x86,0xe5,0xad,0xe9,0xd4,0x1a, + 0xe3,0xe5,0xe8,0xe2,0xcb,0xe8,0xe1,0xb8,0xe8,0x10,0x08,0x05,0xff,0xe7,0x9b,0xb4, + 0x00,0x05,0xff,0xf0,0xa5,0x83,0xb3,0x00,0xd3,0x16,0xe2,0x2d,0xe9,0xe1,0x1b,0xe9, + 0x10,0x08,0x05,0xff,0xe7,0xa3,0x8c,0x00,0x05,0xff,0xe4,0x83,0xa3,0x00,0xd2,0x13, + 0xe1,0x49,0xe9,0x10,0x08,0x05,0xff,0xe4,0x84,0xaf,0x00,0x05,0xff,0xe7,0xa9,0x80, + 0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0xa5,0xbc,0x00,0x05,0xff,0xf0,0xa5, + 0xaa,0xa7,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x05,0xff,0xe7,0xaa, + 0xae,0x00,0xe0,0x5f,0xec,0xcf,0x86,0xd5,0x1d,0xe4,0xd4,0xea,0xe3,0x90,0xea,0xe2, + 0x6e,0xea,0xe1,0x5d,0xea,0x10,0x09,0x05,0xff,0xf0,0xa3,0x8d,0x9f,0x00,0x05,0xff, + 0xe4,0x8f,0x95,0x00,0xd4,0x19,0xe3,0x7b,0xeb,0xe2,0x57,0xeb,0xe1,0x46,0xeb,0x10, + 0x08,0x05,0xff,0xe8,0x8d,0x93,0x00,0x05,0xff,0xe8,0x8f,0x8a,0x00,0xd3,0x18,0xe2, + 0xc6,0xeb,0xe1,0xb5,0xeb,0x10,0x09,0x05,0xff,0xf0,0xa6,0xbe,0xb1,0x00,0x05,0xff, + 0xf0,0xa7,0x83,0x92,0x00,0xd2,0x13,0xe1,0xde,0xeb,0x10,0x08,0x05,0xff,0xe8,0x9a, + 0x88,0x00,0x05,0xff,0xe8,0x9c,0x8e,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x9c, + 0xa8,0x00,0x05,0xff,0xe8,0x9d,0xab,0x00,0x10,0x08,0x05,0xff,0xe8,0x9e,0x86,0x00, + 0x05,0xff,0xe4,0xb5,0x97,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + /* nfdicf_30200 */ + 0xd7,0x07,0x66,0x84,0x05,0x01,0x00,0xc6,0xd5,0x16,0xe4,0x99,0x13,0xe3,0x63,0x0e, + 0xe2,0x4c,0x07,0xc1,0xe0,0x4e,0x06,0xcf,0x86,0x65,0x2d,0x06,0x01,0x00,0xd4,0x2a, + 0xe3,0xd0,0x35,0xe2,0x88,0x9c,0xe1,0xcd,0x2e,0xe0,0x2b,0x1b,0xcf,0x86,0xc5,0xe4, + 0x14,0x66,0xe3,0x5f,0x61,0xe2,0xf5,0x5e,0xe1,0x28,0x5e,0xe0,0xed,0x5d,0xcf,0x86, + 0xe5,0xb2,0x5d,0x64,0x95,0x5d,0x0b,0x00,0x83,0xe2,0xa7,0xf3,0xe1,0x80,0xf0,0xe0, + 0xfd,0xee,0xcf,0x86,0xd5,0x31,0xc4,0xe3,0xe2,0x47,0xe2,0x83,0x46,0xe1,0x32,0xc6, + 0xe0,0x2a,0x45,0xcf,0x86,0xe5,0x1c,0x43,0xe4,0x3d,0x40,0xe3,0x9f,0xb6,0xe2,0xf6, + 0xb5,0xe1,0xd1,0xb5,0xe0,0xaa,0xb5,0xcf,0x86,0xe5,0x77,0xb5,0x94,0x07,0x63,0x62, + 0xb5,0x07,0x00,0x07,0x00,0xe4,0x69,0xee,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00, + 0xd2,0x0b,0xe1,0x78,0xdb,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd1,0x0e,0xe0,0x67,0xdc, + 0xcf,0x86,0xe5,0x2c,0xdc,0xcf,0x06,0x11,0x00,0xd0,0x0b,0xcf,0x86,0xe5,0x67,0xdc, + 0xcf,0x06,0x13,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xe4,0x02,0xee,0xe3, + 0xeb,0xec,0xd2,0xa0,0xe1,0xa1,0xe0,0xd0,0x21,0xcf,0x86,0xe5,0xa2,0xdd,0xe4,0x1e, + 0xdd,0xe3,0xdc,0xdc,0xe2,0xbb,0xdc,0xe1,0xa9,0xdc,0x10,0x08,0x05,0xff,0xe4,0xb8, + 0xbd,0x00,0x05,0xff,0xe4,0xb8,0xb8,0x00,0xcf,0x86,0xd5,0x1c,0xe4,0xfe,0xde,0xe3, + 0xbd,0xde,0xe2,0x9c,0xde,0xe1,0x8b,0xde,0x10,0x08,0x05,0xff,0xe5,0x92,0xa2,0x00, + 0x05,0xff,0xe5,0x93,0xb6,0x00,0xd4,0x34,0xd3,0x18,0xe2,0x85,0xdf,0xe1,0x74,0xdf, + 0x10,0x09,0x05,0xff,0xf0,0xa1,0x9a,0xa8,0x00,0x05,0xff,0xf0,0xa1,0x9b,0xaa,0x00, + 0xe2,0xa5,0xdf,0x91,0x11,0x10,0x09,0x05,0xff,0xf0,0xa1,0x8d,0xaa,0x00,0x05,0xff, + 0xe5,0xac,0x88,0x00,0x05,0xff,0xe5,0xac,0xbe,0x00,0xe3,0xeb,0xdf,0xd2,0x14,0xe1, + 0xba,0xdf,0x10,0x08,0x05,0xff,0xe5,0xaf,0xb3,0x00,0x05,0xff,0xf0,0xa1,0xac,0x98, + 0x00,0xe1,0xc6,0xdf,0x10,0x08,0x05,0xff,0xe5,0xbc,0xb3,0x00,0x05,0xff,0xe5,0xb0, + 0xa2,0x00,0xd1,0xd5,0xd0,0x6a,0xcf,0x86,0xe5,0x1b,0xe5,0xd4,0x19,0xe3,0x54,0xe4, + 0xe2,0x32,0xe4,0xe1,0x21,0xe4,0x10,0x08,0x05,0xff,0xe6,0xb4,0xbe,0x00,0x05,0xff, + 0xe6,0xb5,0xb7,0x00,0xd3,0x18,0xe2,0x9e,0xe4,0xe1,0x8d,0xe4,0x10,0x09,0x05,0xff, + 0xf0,0xa3,0xbd,0x9e,0x00,0x05,0xff,0xf0,0xa3,0xbe,0x8e,0x00,0xd2,0x13,0xe1,0xb6, + 0xe4,0x10,0x08,0x05,0xff,0xe7,0x81,0xbd,0x00,0x05,0xff,0xe7,0x81,0xb7,0x00,0xd1, + 0x11,0x10,0x08,0x05,0xff,0xe7,0x85,0x85,0x00,0x05,0xff,0xf0,0xa4,0x89,0xa3,0x00, + 0x10,0x08,0x05,0xff,0xe7,0x86,0x9c,0x00,0x05,0xff,0xe4,0x8e,0xab,0x00,0xcf,0x86, + 0xe5,0xb8,0xe6,0xd4,0x1a,0xe3,0xf0,0xe5,0xe2,0xd6,0xe5,0xe1,0xc3,0xe5,0x10,0x08, + 0x05,0xff,0xe7,0x9b,0xb4,0x00,0x05,0xff,0xf0,0xa5,0x83,0xb3,0x00,0xd3,0x16,0xe2, + 0x38,0xe6,0xe1,0x26,0xe6,0x10,0x08,0x05,0xff,0xe7,0xa3,0x8c,0x00,0x05,0xff,0xe4, + 0x83,0xa3,0x00,0xd2,0x13,0xe1,0x54,0xe6,0x10,0x08,0x05,0xff,0xe4,0x84,0xaf,0x00, + 0x05,0xff,0xe7,0xa9,0x80,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0xa5,0xbc, + 0x00,0x05,0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0xaa,0xa7, + 0x00,0x05,0xff,0xe7,0xaa,0xae,0x00,0xe0,0x6a,0xe9,0xcf,0x86,0xd5,0x1d,0xe4,0xdf, + 0xe7,0xe3,0x9b,0xe7,0xe2,0x79,0xe7,0xe1,0x68,0xe7,0x10,0x09,0x05,0xff,0xf0,0xa3, + 0x8d,0x9f,0x00,0x05,0xff,0xe4,0x8f,0x95,0x00,0xd4,0x19,0xe3,0x86,0xe8,0xe2,0x62, + 0xe8,0xe1,0x51,0xe8,0x10,0x08,0x05,0xff,0xe8,0x8d,0x93,0x00,0x05,0xff,0xe8,0x8f, + 0x8a,0x00,0xd3,0x18,0xe2,0xd1,0xe8,0xe1,0xc0,0xe8,0x10,0x09,0x05,0xff,0xf0,0xa6, + 0xbe,0xb1,0x00,0x05,0xff,0xf0,0xa7,0x83,0x92,0x00,0xd2,0x13,0xe1,0xe9,0xe8,0x10, + 0x08,0x05,0xff,0xe8,0x9a,0x88,0x00,0x05,0xff,0xe8,0x9c,0x8e,0x00,0xd1,0x10,0x10, + 0x08,0x05,0xff,0xe8,0x9c,0xa8,0x00,0x05,0xff,0xe8,0x9d,0xab,0x00,0x10,0x08,0x05, + 0xff,0xe8,0x9e,0x86,0x00,0x05,0xff,0xe4,0xb5,0x97,0x00,0x00,0x00,0x00,0x00,0x00, + /* nfdi_30200 */ + 0x57,0x04,0x01,0x00,0xc6,0xd5,0x16,0xe4,0x82,0x53,0xe3,0xbb,0x4e,0xe2,0x34,0x49, + 0xc1,0xe0,0x60,0x47,0xcf,0x86,0x65,0x44,0x47,0x01,0x00,0xd4,0x2a,0xe3,0x1c,0x9a, + 0xe2,0xcb,0x99,0xe1,0x9e,0x87,0xe0,0xf8,0x6a,0xcf,0x86,0xc5,0xe4,0x57,0x63,0xe3, + 0xa2,0x5e,0xe2,0x38,0x5c,0xe1,0x6b,0x5b,0xe0,0x30,0x5b,0xcf,0x86,0xe5,0xf5,0x5a, + 0x64,0xd8,0x5a,0x0b,0x00,0x83,0xe2,0xea,0xf0,0xe1,0xc3,0xed,0xe0,0x40,0xec,0xcf, + 0x86,0xd5,0x31,0xc4,0xe3,0xbb,0xc6,0xe2,0x94,0xc4,0xe1,0x75,0xc3,0xe0,0x05,0xba, + 0xcf,0x86,0xe5,0xf8,0xb5,0xe4,0xf1,0xb4,0xe3,0xe2,0xb3,0xe2,0x39,0xb3,0xe1,0x14, + 0xb3,0xe0,0xed,0xb2,0xcf,0x86,0xe5,0xba,0xb2,0x94,0x07,0x63,0xa5,0xb2,0x07,0x00, + 0x07,0x00,0xe4,0xac,0xeb,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd2,0x0b,0xe1, + 0xbb,0xd8,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd1,0x0e,0xe0,0xaa,0xd9,0xcf,0x86,0xe5, + 0x6f,0xd9,0xcf,0x06,0x11,0x00,0xd0,0x0b,0xcf,0x86,0xe5,0xaa,0xd9,0xcf,0x06,0x13, + 0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xe4,0x45,0xeb,0xe3,0x2e,0xea,0xd2, + 0xa0,0xe1,0xe4,0xdd,0xd0,0x21,0xcf,0x86,0xe5,0xe5,0xda,0xe4,0x61,0xda,0xe3,0x1f, + 0xda,0xe2,0xfe,0xd9,0xe1,0xec,0xd9,0x10,0x08,0x05,0xff,0xe4,0xb8,0xbd,0x00,0x05, + 0xff,0xe4,0xb8,0xb8,0x00,0xcf,0x86,0xd5,0x1c,0xe4,0x41,0xdc,0xe3,0x00,0xdc,0xe2, + 0xdf,0xdb,0xe1,0xce,0xdb,0x10,0x08,0x05,0xff,0xe5,0x92,0xa2,0x00,0x05,0xff,0xe5, + 0x93,0xb6,0x00,0xd4,0x34,0xd3,0x18,0xe2,0xc8,0xdc,0xe1,0xb7,0xdc,0x10,0x09,0x05, + 0xff,0xf0,0xa1,0x9a,0xa8,0x00,0x05,0xff,0xf0,0xa1,0x9b,0xaa,0x00,0xe2,0xe8,0xdc, + 0x91,0x11,0x10,0x09,0x05,0xff,0xf0,0xa1,0x8d,0xaa,0x00,0x05,0xff,0xe5,0xac,0x88, + 0x00,0x05,0xff,0xe5,0xac,0xbe,0x00,0xe3,0x2e,0xdd,0xd2,0x14,0xe1,0xfd,0xdc,0x10, + 0x08,0x05,0xff,0xe5,0xaf,0xb3,0x00,0x05,0xff,0xf0,0xa1,0xac,0x98,0x00,0xe1,0x09, + 0xdd,0x10,0x08,0x05,0xff,0xe5,0xbc,0xb3,0x00,0x05,0xff,0xe5,0xb0,0xa2,0x00,0xd1, + 0xd5,0xd0,0x6a,0xcf,0x86,0xe5,0x5e,0xe2,0xd4,0x19,0xe3,0x97,0xe1,0xe2,0x75,0xe1, + 0xe1,0x64,0xe1,0x10,0x08,0x05,0xff,0xe6,0xb4,0xbe,0x00,0x05,0xff,0xe6,0xb5,0xb7, + 0x00,0xd3,0x18,0xe2,0xe1,0xe1,0xe1,0xd0,0xe1,0x10,0x09,0x05,0xff,0xf0,0xa3,0xbd, + 0x9e,0x00,0x05,0xff,0xf0,0xa3,0xbe,0x8e,0x00,0xd2,0x13,0xe1,0xf9,0xe1,0x10,0x08, + 0x05,0xff,0xe7,0x81,0xbd,0x00,0x05,0xff,0xe7,0x81,0xb7,0x00,0xd1,0x11,0x10,0x08, + 0x05,0xff,0xe7,0x85,0x85,0x00,0x05,0xff,0xf0,0xa4,0x89,0xa3,0x00,0x10,0x08,0x05, + 0xff,0xe7,0x86,0x9c,0x00,0x05,0xff,0xe4,0x8e,0xab,0x00,0xcf,0x86,0xe5,0xfb,0xe3, + 0xd4,0x1a,0xe3,0x33,0xe3,0xe2,0x19,0xe3,0xe1,0x06,0xe3,0x10,0x08,0x05,0xff,0xe7, + 0x9b,0xb4,0x00,0x05,0xff,0xf0,0xa5,0x83,0xb3,0x00,0xd3,0x16,0xe2,0x7b,0xe3,0xe1, + 0x69,0xe3,0x10,0x08,0x05,0xff,0xe7,0xa3,0x8c,0x00,0x05,0xff,0xe4,0x83,0xa3,0x00, + 0xd2,0x13,0xe1,0x97,0xe3,0x10,0x08,0x05,0xff,0xe4,0x84,0xaf,0x00,0x05,0xff,0xe7, + 0xa9,0x80,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0xa5,0xbc,0x00,0x05,0xff, + 0xf0,0xa5,0xaa,0xa7,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x05,0xff, + 0xe7,0xaa,0xae,0x00,0xe0,0xad,0xe6,0xcf,0x86,0xd5,0x1d,0xe4,0x22,0xe5,0xe3,0xde, + 0xe4,0xe2,0xbc,0xe4,0xe1,0xab,0xe4,0x10,0x09,0x05,0xff,0xf0,0xa3,0x8d,0x9f,0x00, + 0x05,0xff,0xe4,0x8f,0x95,0x00,0xd4,0x19,0xe3,0xc9,0xe5,0xe2,0xa5,0xe5,0xe1,0x94, + 0xe5,0x10,0x08,0x05,0xff,0xe8,0x8d,0x93,0x00,0x05,0xff,0xe8,0x8f,0x8a,0x00,0xd3, + 0x18,0xe2,0x14,0xe6,0xe1,0x03,0xe6,0x10,0x09,0x05,0xff,0xf0,0xa6,0xbe,0xb1,0x00, + 0x05,0xff,0xf0,0xa7,0x83,0x92,0x00,0xd2,0x13,0xe1,0x2c,0xe6,0x10,0x08,0x05,0xff, + 0xe8,0x9a,0x88,0x00,0x05,0xff,0xe8,0x9c,0x8e,0x00,0xd1,0x10,0x10,0x08,0x05,0xff, + 0xe8,0x9c,0xa8,0x00,0x05,0xff,0xe8,0x9d,0xab,0x00,0x10,0x08,0x05,0xff,0xe8,0x9e, + 0x86,0x00,0x05,0xff,0xe4,0xb5,0x97,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + /* nfdicf_c0100 */ + 0xd7,0xb0,0x56,0x04,0x01,0x00,0x95,0xa8,0xd4,0x5e,0xd3,0x2e,0xd2,0x16,0xd1,0x0a, + 0x10,0x04,0x01,0x00,0x01,0xff,0x61,0x00,0x10,0x06,0x01,0xff,0x62,0x00,0x01,0xff, + 0x63,0x00,0xd1,0x0c,0x10,0x06,0x01,0xff,0x64,0x00,0x01,0xff,0x65,0x00,0x10,0x06, + 0x01,0xff,0x66,0x00,0x01,0xff,0x67,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x06,0x01,0xff, + 0x68,0x00,0x01,0xff,0x69,0x00,0x10,0x06,0x01,0xff,0x6a,0x00,0x01,0xff,0x6b,0x00, + 0xd1,0x0c,0x10,0x06,0x01,0xff,0x6c,0x00,0x01,0xff,0x6d,0x00,0x10,0x06,0x01,0xff, + 0x6e,0x00,0x01,0xff,0x6f,0x00,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x06,0x01,0xff, + 0x70,0x00,0x01,0xff,0x71,0x00,0x10,0x06,0x01,0xff,0x72,0x00,0x01,0xff,0x73,0x00, + 0xd1,0x0c,0x10,0x06,0x01,0xff,0x74,0x00,0x01,0xff,0x75,0x00,0x10,0x06,0x01,0xff, + 0x76,0x00,0x01,0xff,0x77,0x00,0x92,0x16,0xd1,0x0c,0x10,0x06,0x01,0xff,0x78,0x00, + 0x01,0xff,0x79,0x00,0x10,0x06,0x01,0xff,0x7a,0x00,0x01,0x00,0x01,0x00,0x01,0x00, + 0xc6,0xe5,0xf9,0x14,0xe4,0x6f,0x0d,0xe3,0x39,0x08,0xe2,0x22,0x01,0xc1,0xd0,0x24, + 0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x07,0x63,0xd8,0x43,0x01,0x00,0x93,0x13,0x52, + 0x04,0x01,0x00,0x91,0x0b,0x10,0x04,0x01,0x00,0x01,0xff,0xce,0xbc,0x00,0x01,0x00, + 0x01,0x00,0xcf,0x86,0xe5,0xb3,0x44,0xd4,0x7f,0xd3,0x3f,0xd2,0x20,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x61,0xcc,0x80,0x00,0x01,0xff,0x61,0xcc,0x81,0x00,0x10,0x08,0x01, + 0xff,0x61,0xcc,0x82,0x00,0x01,0xff,0x61,0xcc,0x83,0x00,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x61,0xcc,0x88,0x00,0x01,0xff,0x61,0xcc,0x8a,0x00,0x10,0x07,0x01,0xff,0xc3, + 0xa6,0x00,0x01,0xff,0x63,0xcc,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff, + 0x65,0xcc,0x80,0x00,0x01,0xff,0x65,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x65,0xcc, + 0x82,0x00,0x01,0xff,0x65,0xcc,0x88,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc, + 0x80,0x00,0x01,0xff,0x69,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x69,0xcc,0x82,0x00, + 0x01,0xff,0x69,0xcc,0x88,0x00,0xd3,0x3b,0xd2,0x1f,0xd1,0x0f,0x10,0x07,0x01,0xff, + 0xc3,0xb0,0x00,0x01,0xff,0x6e,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x80, + 0x00,0x01,0xff,0x6f,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x82, + 0x00,0x01,0xff,0x6f,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x88,0x00,0x01, + 0x00,0xd2,0x1f,0xd1,0x0f,0x10,0x07,0x01,0xff,0xc3,0xb8,0x00,0x01,0xff,0x75,0xcc, + 0x80,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0x81,0x00,0x01,0xff,0x75,0xcc,0x82,0x00, + 0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc,0x88,0x00,0x01,0xff,0x79,0xcc,0x81,0x00, + 0x10,0x07,0x01,0xff,0xc3,0xbe,0x00,0x01,0xff,0x73,0x73,0x00,0xe1,0xd4,0x03,0xe0, + 0xeb,0x01,0xcf,0x86,0xd5,0xfb,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x01,0xff,0x61,0xcc,0x84,0x00,0x01,0xff,0x61,0xcc,0x84,0x00,0x10,0x08,0x01,0xff, + 0x61,0xcc,0x86,0x00,0x01,0xff,0x61,0xcc,0x86,0x00,0xd1,0x10,0x10,0x08,0x01,0xff, + 0x61,0xcc,0xa8,0x00,0x01,0xff,0x61,0xcc,0xa8,0x00,0x10,0x08,0x01,0xff,0x63,0xcc, + 0x81,0x00,0x01,0xff,0x63,0xcc,0x81,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff, + 0x63,0xcc,0x82,0x00,0x01,0xff,0x63,0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x63,0xcc, + 0x87,0x00,0x01,0xff,0x63,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x63,0xcc, + 0x8c,0x00,0x01,0xff,0x63,0xcc,0x8c,0x00,0x10,0x08,0x01,0xff,0x64,0xcc,0x8c,0x00, + 0x01,0xff,0x64,0xcc,0x8c,0x00,0xd3,0x3b,0xd2,0x1b,0xd1,0x0b,0x10,0x07,0x01,0xff, + 0xc4,0x91,0x00,0x01,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,0x84,0x00,0x01,0xff,0x65, + 0xcc,0x84,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x65,0xcc,0x86,0x00,0x01,0xff,0x65, + 0xcc,0x86,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,0x87,0x00,0x01,0xff,0x65,0xcc,0x87, + 0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x65,0xcc,0xa8,0x00,0x01,0xff,0x65, + 0xcc,0xa8,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,0x8c,0x00,0x01,0xff,0x65,0xcc,0x8c, + 0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x67,0xcc,0x82,0x00,0x01,0xff,0x67,0xcc,0x82, + 0x00,0x10,0x08,0x01,0xff,0x67,0xcc,0x86,0x00,0x01,0xff,0x67,0xcc,0x86,0x00,0xd4, + 0x7b,0xd3,0x3b,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x67,0xcc,0x87,0x00,0x01, + 0xff,0x67,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x67,0xcc,0xa7,0x00,0x01,0xff,0x67, + 0xcc,0xa7,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x68,0xcc,0x82,0x00,0x01,0xff,0x68, + 0xcc,0x82,0x00,0x10,0x07,0x01,0xff,0xc4,0xa7,0x00,0x01,0x00,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x01,0xff,0x69,0xcc,0x83,0x00,0x01,0xff,0x69,0xcc,0x83,0x00,0x10,0x08, + 0x01,0xff,0x69,0xcc,0x84,0x00,0x01,0xff,0x69,0xcc,0x84,0x00,0xd1,0x10,0x10,0x08, + 0x01,0xff,0x69,0xcc,0x86,0x00,0x01,0xff,0x69,0xcc,0x86,0x00,0x10,0x08,0x01,0xff, + 0x69,0xcc,0xa8,0x00,0x01,0xff,0x69,0xcc,0xa8,0x00,0xd3,0x37,0xd2,0x17,0xd1,0x0c, + 0x10,0x08,0x01,0xff,0x69,0xcc,0x87,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xc4,0xb3, + 0x00,0x01,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6a,0xcc,0x82,0x00,0x01,0xff,0x6a, + 0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x6b,0xcc,0xa7,0x00,0x01,0xff,0x6b,0xcc,0xa7, + 0x00,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x6c,0xcc,0x81,0x00,0x10, + 0x08,0x01,0xff,0x6c,0xcc,0x81,0x00,0x01,0xff,0x6c,0xcc,0xa7,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x6c,0xcc,0xa7,0x00,0x01,0xff,0x6c,0xcc,0x8c,0x00,0x10,0x08,0x01, + 0xff,0x6c,0xcc,0x8c,0x00,0x01,0xff,0xc5,0x80,0x00,0xcf,0x86,0xd5,0xed,0xd4,0x72, + 0xd3,0x37,0xd2,0x17,0xd1,0x0b,0x10,0x04,0x01,0x00,0x01,0xff,0xc5,0x82,0x00,0x10, + 0x04,0x01,0x00,0x01,0xff,0x6e,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6e, + 0xcc,0x81,0x00,0x01,0xff,0x6e,0xcc,0xa7,0x00,0x10,0x08,0x01,0xff,0x6e,0xcc,0xa7, + 0x00,0x01,0xff,0x6e,0xcc,0x8c,0x00,0xd2,0x1b,0xd1,0x10,0x10,0x08,0x01,0xff,0x6e, + 0xcc,0x8c,0x00,0x01,0xff,0xca,0xbc,0x6e,0x00,0x10,0x07,0x01,0xff,0xc5,0x8b,0x00, + 0x01,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x84,0x00,0x01,0xff,0x6f,0xcc, + 0x84,0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x86,0x00,0x01,0xff,0x6f,0xcc,0x86,0x00, + 0xd3,0x3b,0xd2,0x1b,0xd1,0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x8b,0x00,0x01,0xff, + 0x6f,0xcc,0x8b,0x00,0x10,0x07,0x01,0xff,0xc5,0x93,0x00,0x01,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x72,0xcc,0x81,0x00,0x01,0xff,0x72,0xcc,0x81,0x00,0x10,0x08,0x01, + 0xff,0x72,0xcc,0xa7,0x00,0x01,0xff,0x72,0xcc,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x72,0xcc,0x8c,0x00,0x01,0xff,0x72,0xcc,0x8c,0x00,0x10,0x08,0x01, + 0xff,0x73,0xcc,0x81,0x00,0x01,0xff,0x73,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x73,0xcc,0x82,0x00,0x01,0xff,0x73,0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x73, + 0xcc,0xa7,0x00,0x01,0xff,0x73,0xcc,0xa7,0x00,0xd4,0x7b,0xd3,0x3b,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x73,0xcc,0x8c,0x00,0x01,0xff,0x73,0xcc,0x8c,0x00,0x10, + 0x08,0x01,0xff,0x74,0xcc,0xa7,0x00,0x01,0xff,0x74,0xcc,0xa7,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x74,0xcc,0x8c,0x00,0x01,0xff,0x74,0xcc,0x8c,0x00,0x10,0x07,0x01, + 0xff,0xc5,0xa7,0x00,0x01,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc, + 0x83,0x00,0x01,0xff,0x75,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0x84,0x00, + 0x01,0xff,0x75,0xcc,0x84,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc,0x86,0x00, + 0x01,0xff,0x75,0xcc,0x86,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0x8a,0x00,0x01,0xff, + 0x75,0xcc,0x8a,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc, + 0x8b,0x00,0x01,0xff,0x75,0xcc,0x8b,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0xa8,0x00, + 0x01,0xff,0x75,0xcc,0xa8,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0x82,0x00, + 0x01,0xff,0x77,0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x79,0xcc,0x82,0x00,0x01,0xff, + 0x79,0xcc,0x82,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x79,0xcc,0x88,0x00, + 0x01,0xff,0x7a,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x7a,0xcc,0x81,0x00,0x01,0xff, + 0x7a,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x7a,0xcc,0x87,0x00,0x01,0xff, + 0x7a,0xcc,0x8c,0x00,0x10,0x08,0x01,0xff,0x7a,0xcc,0x8c,0x00,0x01,0xff,0x73,0x00, + 0xe0,0x65,0x01,0xcf,0x86,0xd5,0xb4,0xd4,0x5a,0xd3,0x2f,0xd2,0x16,0xd1,0x0b,0x10, + 0x04,0x01,0x00,0x01,0xff,0xc9,0x93,0x00,0x10,0x07,0x01,0xff,0xc6,0x83,0x00,0x01, + 0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xc6,0x85,0x00,0x01,0x00,0x10,0x07,0x01,0xff, + 0xc9,0x94,0x00,0x01,0xff,0xc6,0x88,0x00,0xd2,0x19,0xd1,0x0b,0x10,0x04,0x01,0x00, + 0x01,0xff,0xc9,0x96,0x00,0x10,0x07,0x01,0xff,0xc9,0x97,0x00,0x01,0xff,0xc6,0x8c, + 0x00,0x51,0x04,0x01,0x00,0x10,0x07,0x01,0xff,0xc7,0x9d,0x00,0x01,0xff,0xc9,0x99, + 0x00,0xd3,0x32,0xd2,0x19,0xd1,0x0e,0x10,0x07,0x01,0xff,0xc9,0x9b,0x00,0x01,0xff, + 0xc6,0x92,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xc9,0xa0,0x00,0xd1,0x0b,0x10,0x07, + 0x01,0xff,0xc9,0xa3,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xc9,0xa9,0x00,0x01,0xff, + 0xc9,0xa8,0x00,0xd2,0x0f,0x91,0x0b,0x10,0x07,0x01,0xff,0xc6,0x99,0x00,0x01,0x00, + 0x01,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xc9,0xaf,0x00,0x01,0xff,0xc9,0xb2,0x00, + 0x10,0x04,0x01,0x00,0x01,0xff,0xc9,0xb5,0x00,0xd4,0x5d,0xd3,0x34,0xd2,0x1b,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x9b,0x00,0x01,0xff,0x6f,0xcc,0x9b,0x00,0x10, + 0x07,0x01,0xff,0xc6,0xa3,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xc6,0xa5, + 0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xca,0x80,0x00,0x01,0xff,0xc6,0xa8,0x00,0xd2, + 0x0f,0x91,0x0b,0x10,0x04,0x01,0x00,0x01,0xff,0xca,0x83,0x00,0x01,0x00,0xd1,0x0b, + 0x10,0x07,0x01,0xff,0xc6,0xad,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xca,0x88,0x00, + 0x01,0xff,0x75,0xcc,0x9b,0x00,0xd3,0x33,0xd2,0x1d,0xd1,0x0f,0x10,0x08,0x01,0xff, + 0x75,0xcc,0x9b,0x00,0x01,0xff,0xca,0x8a,0x00,0x10,0x07,0x01,0xff,0xca,0x8b,0x00, + 0x01,0xff,0xc6,0xb4,0x00,0xd1,0x0b,0x10,0x04,0x01,0x00,0x01,0xff,0xc6,0xb6,0x00, + 0x10,0x04,0x01,0x00,0x01,0xff,0xca,0x92,0x00,0xd2,0x0f,0x91,0x0b,0x10,0x07,0x01, + 0xff,0xc6,0xb9,0x00,0x01,0x00,0x01,0x00,0x91,0x0b,0x10,0x07,0x01,0xff,0xc6,0xbd, + 0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0xd4,0xd4,0x44,0xd3,0x16,0x52,0x04,0x01, + 0x00,0x51,0x07,0x01,0xff,0xc7,0x86,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xc7,0x89, + 0x00,0xd2,0x12,0x91,0x0b,0x10,0x07,0x01,0xff,0xc7,0x89,0x00,0x01,0x00,0x01,0xff, + 0xc7,0x8c,0x00,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x61,0xcc,0x8c,0x00,0x10, + 0x08,0x01,0xff,0x61,0xcc,0x8c,0x00,0x01,0xff,0x69,0xcc,0x8c,0x00,0xd3,0x46,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,0x8c,0x00,0x01,0xff,0x6f,0xcc,0x8c, + 0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x8c,0x00,0x01,0xff,0x75,0xcc,0x8c,0x00,0xd1, + 0x12,0x10,0x08,0x01,0xff,0x75,0xcc,0x8c,0x00,0x01,0xff,0x75,0xcc,0x88,0xcc,0x84, + 0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88,0xcc,0x84,0x00,0x01,0xff,0x75,0xcc,0x88, + 0xcc,0x81,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88,0xcc,0x81, + 0x00,0x01,0xff,0x75,0xcc,0x88,0xcc,0x8c,0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88, + 0xcc,0x8c,0x00,0x01,0xff,0x75,0xcc,0x88,0xcc,0x80,0x00,0xd1,0x0e,0x10,0x0a,0x01, + 0xff,0x75,0xcc,0x88,0xcc,0x80,0x00,0x01,0x00,0x10,0x0a,0x01,0xff,0x61,0xcc,0x88, + 0xcc,0x84,0x00,0x01,0xff,0x61,0xcc,0x88,0xcc,0x84,0x00,0xd4,0x87,0xd3,0x41,0xd2, + 0x26,0xd1,0x14,0x10,0x0a,0x01,0xff,0x61,0xcc,0x87,0xcc,0x84,0x00,0x01,0xff,0x61, + 0xcc,0x87,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xc3,0xa6,0xcc,0x84,0x00,0x01,0xff, + 0xc3,0xa6,0xcc,0x84,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xc7,0xa5,0x00,0x01,0x00, + 0x10,0x08,0x01,0xff,0x67,0xcc,0x8c,0x00,0x01,0xff,0x67,0xcc,0x8c,0x00,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x01,0xff,0x6b,0xcc,0x8c,0x00,0x01,0xff,0x6b,0xcc,0x8c,0x00, + 0x10,0x08,0x01,0xff,0x6f,0xcc,0xa8,0x00,0x01,0xff,0x6f,0xcc,0xa8,0x00,0xd1,0x14, + 0x10,0x0a,0x01,0xff,0x6f,0xcc,0xa8,0xcc,0x84,0x00,0x01,0xff,0x6f,0xcc,0xa8,0xcc, + 0x84,0x00,0x10,0x09,0x01,0xff,0xca,0x92,0xcc,0x8c,0x00,0x01,0xff,0xca,0x92,0xcc, + 0x8c,0x00,0xd3,0x38,0xd2,0x1a,0xd1,0x0f,0x10,0x08,0x01,0xff,0x6a,0xcc,0x8c,0x00, + 0x01,0xff,0xc7,0xb3,0x00,0x10,0x07,0x01,0xff,0xc7,0xb3,0x00,0x01,0x00,0xd1,0x10, + 0x10,0x08,0x01,0xff,0x67,0xcc,0x81,0x00,0x01,0xff,0x67,0xcc,0x81,0x00,0x10,0x07, + 0x04,0xff,0xc6,0x95,0x00,0x04,0xff,0xc6,0xbf,0x00,0xd2,0x24,0xd1,0x10,0x10,0x08, + 0x04,0xff,0x6e,0xcc,0x80,0x00,0x04,0xff,0x6e,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff, + 0x61,0xcc,0x8a,0xcc,0x81,0x00,0x01,0xff,0x61,0xcc,0x8a,0xcc,0x81,0x00,0xd1,0x12, + 0x10,0x09,0x01,0xff,0xc3,0xa6,0xcc,0x81,0x00,0x01,0xff,0xc3,0xa6,0xcc,0x81,0x00, + 0x10,0x09,0x01,0xff,0xc3,0xb8,0xcc,0x81,0x00,0x01,0xff,0xc3,0xb8,0xcc,0x81,0x00, + 0xe2,0x31,0x02,0xe1,0xc3,0x44,0xe0,0xc8,0x01,0xcf,0x86,0xd5,0xfb,0xd4,0x80,0xd3, + 0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x61,0xcc,0x8f,0x00,0x01,0xff,0x61, + 0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x61,0xcc,0x91,0x00,0x01,0xff,0x61,0xcc,0x91, + 0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x65,0xcc,0x8f,0x00,0x01,0xff,0x65,0xcc,0x8f, + 0x00,0x10,0x08,0x01,0xff,0x65,0xcc,0x91,0x00,0x01,0xff,0x65,0xcc,0x91,0x00,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,0x8f,0x00,0x01,0xff,0x69,0xcc,0x8f, + 0x00,0x10,0x08,0x01,0xff,0x69,0xcc,0x91,0x00,0x01,0xff,0x69,0xcc,0x91,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x8f,0x00,0x01,0xff,0x6f,0xcc,0x8f,0x00,0x10, + 0x08,0x01,0xff,0x6f,0xcc,0x91,0x00,0x01,0xff,0x6f,0xcc,0x91,0x00,0xd3,0x40,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x72,0xcc,0x8f,0x00,0x01,0xff,0x72,0xcc,0x8f, + 0x00,0x10,0x08,0x01,0xff,0x72,0xcc,0x91,0x00,0x01,0xff,0x72,0xcc,0x91,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x75,0xcc,0x8f,0x00,0x01,0xff,0x75,0xcc,0x8f,0x00,0x10, + 0x08,0x01,0xff,0x75,0xcc,0x91,0x00,0x01,0xff,0x75,0xcc,0x91,0x00,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x04,0xff,0x73,0xcc,0xa6,0x00,0x04,0xff,0x73,0xcc,0xa6,0x00,0x10, + 0x08,0x04,0xff,0x74,0xcc,0xa6,0x00,0x04,0xff,0x74,0xcc,0xa6,0x00,0xd1,0x0b,0x10, + 0x07,0x04,0xff,0xc8,0x9d,0x00,0x04,0x00,0x10,0x08,0x04,0xff,0x68,0xcc,0x8c,0x00, + 0x04,0xff,0x68,0xcc,0x8c,0x00,0xd4,0x79,0xd3,0x31,0xd2,0x16,0xd1,0x0b,0x10,0x07, + 0x06,0xff,0xc6,0x9e,0x00,0x07,0x00,0x10,0x07,0x04,0xff,0xc8,0xa3,0x00,0x04,0x00, + 0xd1,0x0b,0x10,0x07,0x04,0xff,0xc8,0xa5,0x00,0x04,0x00,0x10,0x08,0x04,0xff,0x61, + 0xcc,0x87,0x00,0x04,0xff,0x61,0xcc,0x87,0x00,0xd2,0x24,0xd1,0x10,0x10,0x08,0x04, + 0xff,0x65,0xcc,0xa7,0x00,0x04,0xff,0x65,0xcc,0xa7,0x00,0x10,0x0a,0x04,0xff,0x6f, + 0xcc,0x88,0xcc,0x84,0x00,0x04,0xff,0x6f,0xcc,0x88,0xcc,0x84,0x00,0xd1,0x14,0x10, + 0x0a,0x04,0xff,0x6f,0xcc,0x83,0xcc,0x84,0x00,0x04,0xff,0x6f,0xcc,0x83,0xcc,0x84, + 0x00,0x10,0x08,0x04,0xff,0x6f,0xcc,0x87,0x00,0x04,0xff,0x6f,0xcc,0x87,0x00,0xd3, + 0x27,0xe2,0x21,0x43,0xd1,0x14,0x10,0x0a,0x04,0xff,0x6f,0xcc,0x87,0xcc,0x84,0x00, + 0x04,0xff,0x6f,0xcc,0x87,0xcc,0x84,0x00,0x10,0x08,0x04,0xff,0x79,0xcc,0x84,0x00, + 0x04,0xff,0x79,0xcc,0x84,0x00,0xd2,0x13,0x51,0x04,0x08,0x00,0x10,0x08,0x08,0xff, + 0xe2,0xb1,0xa5,0x00,0x08,0xff,0xc8,0xbc,0x00,0xd1,0x0b,0x10,0x04,0x08,0x00,0x08, + 0xff,0xc6,0x9a,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1,0xa6,0x00,0x08,0x00,0xcf,0x86, + 0x95,0x5f,0x94,0x5b,0xd3,0x2f,0xd2,0x16,0xd1,0x0b,0x10,0x04,0x08,0x00,0x08,0xff, + 0xc9,0x82,0x00,0x10,0x04,0x09,0x00,0x09,0xff,0xc6,0x80,0x00,0xd1,0x0e,0x10,0x07, + 0x09,0xff,0xca,0x89,0x00,0x09,0xff,0xca,0x8c,0x00,0x10,0x07,0x09,0xff,0xc9,0x87, + 0x00,0x09,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x09,0xff,0xc9,0x89,0x00,0x09,0x00, + 0x10,0x07,0x09,0xff,0xc9,0x8b,0x00,0x09,0x00,0xd1,0x0b,0x10,0x07,0x09,0xff,0xc9, + 0x8d,0x00,0x09,0x00,0x10,0x07,0x09,0xff,0xc9,0x8f,0x00,0x09,0x00,0x01,0x00,0x01, + 0x00,0xd1,0x8b,0xd0,0x0c,0xcf,0x86,0xe5,0x10,0x43,0x64,0xef,0x42,0x01,0xe6,0xcf, + 0x86,0xd5,0x2a,0xe4,0x99,0x43,0xe3,0x7f,0x43,0xd2,0x11,0xe1,0x5e,0x43,0x10,0x07, + 0x01,0xff,0xcc,0x80,0x00,0x01,0xff,0xcc,0x81,0x00,0xe1,0x65,0x43,0x10,0x09,0x01, + 0xff,0xcc,0x88,0xcc,0x81,0x00,0x01,0xff,0xce,0xb9,0x00,0xd4,0x0f,0x93,0x0b,0x92, + 0x07,0x61,0xab,0x43,0x01,0xea,0x06,0xe6,0x06,0xe6,0xd3,0x2c,0xd2,0x16,0xd1,0x0b, + 0x10,0x07,0x0a,0xff,0xcd,0xb1,0x00,0x0a,0x00,0x10,0x07,0x0a,0xff,0xcd,0xb3,0x00, + 0x0a,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xca,0xb9,0x00,0x01,0x00,0x10,0x07,0x0a, + 0xff,0xcd,0xb7,0x00,0x0a,0x00,0xd2,0x07,0x61,0x97,0x43,0x00,0x00,0x51,0x04,0x09, + 0x00,0x10,0x06,0x01,0xff,0x3b,0x00,0x10,0xff,0xcf,0xb3,0x00,0xe0,0x31,0x01,0xcf, + 0x86,0xd5,0xd3,0xd4,0x5f,0xd3,0x21,0x52,0x04,0x00,0x00,0xd1,0x0d,0x10,0x04,0x01, + 0x00,0x01,0xff,0xc2,0xa8,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x81, + 0x00,0x01,0xff,0xc2,0xb7,0x00,0xd2,0x1f,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb5, + 0xcc,0x81,0x00,0x01,0xff,0xce,0xb7,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,0xb9, + 0xcc,0x81,0x00,0x00,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xce,0xbf,0xcc,0x81,0x00, + 0x00,0x00,0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x81,0x00,0x01,0xff,0xcf,0x89,0xcc, + 0x81,0x00,0xd3,0x3c,0xd2,0x20,0xd1,0x12,0x10,0x0b,0x01,0xff,0xce,0xb9,0xcc,0x88, + 0xcc,0x81,0x00,0x01,0xff,0xce,0xb1,0x00,0x10,0x07,0x01,0xff,0xce,0xb2,0x00,0x01, + 0xff,0xce,0xb3,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xce,0xb4,0x00,0x01,0xff,0xce, + 0xb5,0x00,0x10,0x07,0x01,0xff,0xce,0xb6,0x00,0x01,0xff,0xce,0xb7,0x00,0xd2,0x1c, + 0xd1,0x0e,0x10,0x07,0x01,0xff,0xce,0xb8,0x00,0x01,0xff,0xce,0xb9,0x00,0x10,0x07, + 0x01,0xff,0xce,0xba,0x00,0x01,0xff,0xce,0xbb,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff, + 0xce,0xbc,0x00,0x01,0xff,0xce,0xbd,0x00,0x10,0x07,0x01,0xff,0xce,0xbe,0x00,0x01, + 0xff,0xce,0xbf,0x00,0xe4,0x85,0x43,0xd3,0x35,0xd2,0x19,0xd1,0x0e,0x10,0x07,0x01, + 0xff,0xcf,0x80,0x00,0x01,0xff,0xcf,0x81,0x00,0x10,0x04,0x00,0x00,0x01,0xff,0xcf, + 0x83,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xcf,0x84,0x00,0x01,0xff,0xcf,0x85,0x00, + 0x10,0x07,0x01,0xff,0xcf,0x86,0x00,0x01,0xff,0xcf,0x87,0x00,0xe2,0x2b,0x43,0xd1, + 0x0e,0x10,0x07,0x01,0xff,0xcf,0x88,0x00,0x01,0xff,0xcf,0x89,0x00,0x10,0x09,0x01, + 0xff,0xce,0xb9,0xcc,0x88,0x00,0x01,0xff,0xcf,0x85,0xcc,0x88,0x00,0xcf,0x86,0xd5, + 0x94,0xd4,0x3c,0xd3,0x13,0x92,0x0f,0x51,0x04,0x01,0x00,0x10,0x07,0x01,0xff,0xcf, + 0x83,0x00,0x01,0x00,0x01,0x00,0xd2,0x07,0x61,0x3a,0x43,0x01,0x00,0xd1,0x12,0x10, + 0x09,0x01,0xff,0xce,0xbf,0xcc,0x81,0x00,0x01,0xff,0xcf,0x85,0xcc,0x81,0x00,0x10, + 0x09,0x01,0xff,0xcf,0x89,0xcc,0x81,0x00,0x0a,0xff,0xcf,0x97,0x00,0xd3,0x2c,0xd2, + 0x11,0xe1,0x46,0x43,0x10,0x07,0x01,0xff,0xce,0xb2,0x00,0x01,0xff,0xce,0xb8,0x00, + 0xd1,0x10,0x10,0x09,0x01,0xff,0xcf,0x92,0xcc,0x88,0x00,0x01,0xff,0xcf,0x86,0x00, + 0x10,0x07,0x01,0xff,0xcf,0x80,0x00,0x04,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x06, + 0xff,0xcf,0x99,0x00,0x06,0x00,0x10,0x07,0x01,0xff,0xcf,0x9b,0x00,0x04,0x00,0xd1, + 0x0b,0x10,0x07,0x01,0xff,0xcf,0x9d,0x00,0x04,0x00,0x10,0x07,0x01,0xff,0xcf,0x9f, + 0x00,0x04,0x00,0xd4,0x58,0xd3,0x2c,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xcf, + 0xa1,0x00,0x04,0x00,0x10,0x07,0x01,0xff,0xcf,0xa3,0x00,0x01,0x00,0xd1,0x0b,0x10, + 0x07,0x01,0xff,0xcf,0xa5,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xcf,0xa7,0x00,0x01, + 0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xcf,0xa9,0x00,0x01,0x00,0x10,0x07, + 0x01,0xff,0xcf,0xab,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xcf,0xad,0x00, + 0x01,0x00,0x10,0x07,0x01,0xff,0xcf,0xaf,0x00,0x01,0x00,0xd3,0x2b,0xd2,0x12,0x91, + 0x0e,0x10,0x07,0x01,0xff,0xce,0xba,0x00,0x01,0xff,0xcf,0x81,0x00,0x01,0x00,0xd1, + 0x0e,0x10,0x07,0x05,0xff,0xce,0xb8,0x00,0x05,0xff,0xce,0xb5,0x00,0x10,0x04,0x06, + 0x00,0x07,0xff,0xcf,0xb8,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x04,0x07,0x00,0x07,0xff, + 0xcf,0xb2,0x00,0x10,0x07,0x07,0xff,0xcf,0xbb,0x00,0x07,0x00,0xd1,0x0b,0x10,0x04, + 0x08,0x00,0x08,0xff,0xcd,0xbb,0x00,0x10,0x07,0x08,0xff,0xcd,0xbc,0x00,0x08,0xff, + 0xcd,0xbd,0x00,0xe3,0xed,0x46,0xe2,0x3d,0x05,0xe1,0x27,0x02,0xe0,0x66,0x01,0xcf, + 0x86,0xd5,0xf0,0xd4,0x7e,0xd3,0x40,0xd2,0x22,0xd1,0x12,0x10,0x09,0x04,0xff,0xd0, + 0xb5,0xcc,0x80,0x00,0x01,0xff,0xd0,0xb5,0xcc,0x88,0x00,0x10,0x07,0x01,0xff,0xd1, + 0x92,0x00,0x01,0xff,0xd0,0xb3,0xcc,0x81,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd1, + 0x94,0x00,0x01,0xff,0xd1,0x95,0x00,0x10,0x07,0x01,0xff,0xd1,0x96,0x00,0x01,0xff, + 0xd1,0x96,0xcc,0x88,0x00,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd1,0x98,0x00, + 0x01,0xff,0xd1,0x99,0x00,0x10,0x07,0x01,0xff,0xd1,0x9a,0x00,0x01,0xff,0xd1,0x9b, + 0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,0xba,0xcc,0x81,0x00,0x04,0xff,0xd0,0xb8, + 0xcc,0x80,0x00,0x10,0x09,0x01,0xff,0xd1,0x83,0xcc,0x86,0x00,0x01,0xff,0xd1,0x9f, + 0x00,0xd3,0x38,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd0,0xb0,0x00,0x01,0xff, + 0xd0,0xb1,0x00,0x10,0x07,0x01,0xff,0xd0,0xb2,0x00,0x01,0xff,0xd0,0xb3,0x00,0xd1, + 0x0e,0x10,0x07,0x01,0xff,0xd0,0xb4,0x00,0x01,0xff,0xd0,0xb5,0x00,0x10,0x07,0x01, + 0xff,0xd0,0xb6,0x00,0x01,0xff,0xd0,0xb7,0x00,0xd2,0x1e,0xd1,0x10,0x10,0x07,0x01, + 0xff,0xd0,0xb8,0x00,0x01,0xff,0xd0,0xb8,0xcc,0x86,0x00,0x10,0x07,0x01,0xff,0xd0, + 0xba,0x00,0x01,0xff,0xd0,0xbb,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd0,0xbc,0x00, + 0x01,0xff,0xd0,0xbd,0x00,0x10,0x07,0x01,0xff,0xd0,0xbe,0x00,0x01,0xff,0xd0,0xbf, + 0x00,0xe4,0x25,0x42,0xd3,0x38,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd1,0x80, + 0x00,0x01,0xff,0xd1,0x81,0x00,0x10,0x07,0x01,0xff,0xd1,0x82,0x00,0x01,0xff,0xd1, + 0x83,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd1,0x84,0x00,0x01,0xff,0xd1,0x85,0x00, + 0x10,0x07,0x01,0xff,0xd1,0x86,0x00,0x01,0xff,0xd1,0x87,0x00,0xd2,0x1c,0xd1,0x0e, + 0x10,0x07,0x01,0xff,0xd1,0x88,0x00,0x01,0xff,0xd1,0x89,0x00,0x10,0x07,0x01,0xff, + 0xd1,0x8a,0x00,0x01,0xff,0xd1,0x8b,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd1,0x8c, + 0x00,0x01,0xff,0xd1,0x8d,0x00,0x10,0x07,0x01,0xff,0xd1,0x8e,0x00,0x01,0xff,0xd1, + 0x8f,0x00,0xcf,0x86,0xd5,0x07,0x64,0xcf,0x41,0x01,0x00,0xd4,0x58,0xd3,0x2c,0xd2, + 0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd1,0xa1,0x00,0x01,0x00,0x10,0x07,0x01,0xff, + 0xd1,0xa3,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd1,0xa5,0x00,0x01,0x00, + 0x10,0x07,0x01,0xff,0xd1,0xa7,0x00,0x01,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01, + 0xff,0xd1,0xa9,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd1,0xab,0x00,0x01,0x00,0xd1, + 0x0b,0x10,0x07,0x01,0xff,0xd1,0xad,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd1,0xaf, + 0x00,0x01,0x00,0xd3,0x33,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd1,0xb1,0x00, + 0x01,0x00,0x10,0x07,0x01,0xff,0xd1,0xb3,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01, + 0xff,0xd1,0xb5,0x00,0x01,0x00,0x10,0x09,0x01,0xff,0xd1,0xb5,0xcc,0x8f,0x00,0x01, + 0xff,0xd1,0xb5,0xcc,0x8f,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd1,0xb9, + 0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd1,0xbb,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07, + 0x01,0xff,0xd1,0xbd,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd1,0xbf,0x00,0x01,0x00, + 0xe0,0x41,0x01,0xcf,0x86,0xd5,0x8e,0xd4,0x36,0xd3,0x11,0xe2,0x91,0x41,0xe1,0x88, + 0x41,0x10,0x07,0x01,0xff,0xd2,0x81,0x00,0x01,0x00,0xd2,0x0f,0x51,0x04,0x04,0x00, + 0x10,0x07,0x06,0xff,0xd2,0x8b,0x00,0x06,0x00,0xd1,0x0b,0x10,0x07,0x04,0xff,0xd2, + 0x8d,0x00,0x04,0x00,0x10,0x07,0x04,0xff,0xd2,0x8f,0x00,0x04,0x00,0xd3,0x2c,0xd2, + 0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,0x91,0x00,0x01,0x00,0x10,0x07,0x01,0xff, + 0xd2,0x93,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,0x95,0x00,0x01,0x00, + 0x10,0x07,0x01,0xff,0xd2,0x97,0x00,0x01,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01, + 0xff,0xd2,0x99,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0x9b,0x00,0x01,0x00,0xd1, + 0x0b,0x10,0x07,0x01,0xff,0xd2,0x9d,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0x9f, + 0x00,0x01,0x00,0xd4,0x58,0xd3,0x2c,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2, + 0xa1,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xa3,0x00,0x01,0x00,0xd1,0x0b,0x10, + 0x07,0x01,0xff,0xd2,0xa5,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xa7,0x00,0x01, + 0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,0xa9,0x00,0x01,0x00,0x10,0x07, + 0x01,0xff,0xd2,0xab,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,0xad,0x00, + 0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xaf,0x00,0x01,0x00,0xd3,0x2c,0xd2,0x16,0xd1, + 0x0b,0x10,0x07,0x01,0xff,0xd2,0xb1,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xb3, + 0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,0xb5,0x00,0x01,0x00,0x10,0x07, + 0x01,0xff,0xd2,0xb7,0x00,0x01,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2, + 0xb9,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xbb,0x00,0x01,0x00,0xd1,0x0b,0x10, + 0x07,0x01,0xff,0xd2,0xbd,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xbf,0x00,0x01, + 0x00,0xcf,0x86,0xd5,0xdc,0xd4,0x5a,0xd3,0x36,0xd2,0x20,0xd1,0x10,0x10,0x07,0x01, + 0xff,0xd3,0x8f,0x00,0x01,0xff,0xd0,0xb6,0xcc,0x86,0x00,0x10,0x09,0x01,0xff,0xd0, + 0xb6,0xcc,0x86,0x00,0x01,0xff,0xd3,0x84,0x00,0xd1,0x0b,0x10,0x04,0x01,0x00,0x06, + 0xff,0xd3,0x86,0x00,0x10,0x04,0x06,0x00,0x01,0xff,0xd3,0x88,0x00,0xd2,0x16,0xd1, + 0x0b,0x10,0x04,0x01,0x00,0x06,0xff,0xd3,0x8a,0x00,0x10,0x04,0x06,0x00,0x01,0xff, + 0xd3,0x8c,0x00,0xe1,0x69,0x40,0x10,0x04,0x01,0x00,0x06,0xff,0xd3,0x8e,0x00,0xd3, + 0x41,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,0xb0,0xcc,0x86,0x00,0x01,0xff, + 0xd0,0xb0,0xcc,0x86,0x00,0x10,0x09,0x01,0xff,0xd0,0xb0,0xcc,0x88,0x00,0x01,0xff, + 0xd0,0xb0,0xcc,0x88,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd3,0x95,0x00,0x01,0x00, + 0x10,0x09,0x01,0xff,0xd0,0xb5,0xcc,0x86,0x00,0x01,0xff,0xd0,0xb5,0xcc,0x86,0x00, + 0xd2,0x1d,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd3,0x99,0x00,0x01,0x00,0x10,0x09,0x01, + 0xff,0xd3,0x99,0xcc,0x88,0x00,0x01,0xff,0xd3,0x99,0xcc,0x88,0x00,0xd1,0x12,0x10, + 0x09,0x01,0xff,0xd0,0xb6,0xcc,0x88,0x00,0x01,0xff,0xd0,0xb6,0xcc,0x88,0x00,0x10, + 0x09,0x01,0xff,0xd0,0xb7,0xcc,0x88,0x00,0x01,0xff,0xd0,0xb7,0xcc,0x88,0x00,0xd4, + 0x82,0xd3,0x41,0xd2,0x1d,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd3,0xa1,0x00,0x01,0x00, + 0x10,0x09,0x01,0xff,0xd0,0xb8,0xcc,0x84,0x00,0x01,0xff,0xd0,0xb8,0xcc,0x84,0x00, + 0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,0xb8,0xcc,0x88,0x00,0x01,0xff,0xd0,0xb8,0xcc, + 0x88,0x00,0x10,0x09,0x01,0xff,0xd0,0xbe,0xcc,0x88,0x00,0x01,0xff,0xd0,0xbe,0xcc, + 0x88,0x00,0xd2,0x1d,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd3,0xa9,0x00,0x01,0x00,0x10, + 0x09,0x01,0xff,0xd3,0xa9,0xcc,0x88,0x00,0x01,0xff,0xd3,0xa9,0xcc,0x88,0x00,0xd1, + 0x12,0x10,0x09,0x04,0xff,0xd1,0x8d,0xcc,0x88,0x00,0x04,0xff,0xd1,0x8d,0xcc,0x88, + 0x00,0x10,0x09,0x01,0xff,0xd1,0x83,0xcc,0x84,0x00,0x01,0xff,0xd1,0x83,0xcc,0x84, + 0x00,0xd3,0x41,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd1,0x83,0xcc,0x88,0x00, + 0x01,0xff,0xd1,0x83,0xcc,0x88,0x00,0x10,0x09,0x01,0xff,0xd1,0x83,0xcc,0x8b,0x00, + 0x01,0xff,0xd1,0x83,0xcc,0x8b,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd1,0x87,0xcc, + 0x88,0x00,0x01,0xff,0xd1,0x87,0xcc,0x88,0x00,0x10,0x07,0x08,0xff,0xd3,0xb7,0x00, + 0x08,0x00,0xd2,0x1d,0xd1,0x12,0x10,0x09,0x01,0xff,0xd1,0x8b,0xcc,0x88,0x00,0x01, + 0xff,0xd1,0x8b,0xcc,0x88,0x00,0x10,0x07,0x09,0xff,0xd3,0xbb,0x00,0x09,0x00,0xd1, + 0x0b,0x10,0x07,0x09,0xff,0xd3,0xbd,0x00,0x09,0x00,0x10,0x07,0x09,0xff,0xd3,0xbf, + 0x00,0x09,0x00,0xe1,0x26,0x02,0xe0,0x78,0x01,0xcf,0x86,0xd5,0xb0,0xd4,0x58,0xd3, + 0x2c,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x06,0xff,0xd4,0x81,0x00,0x06,0x00,0x10,0x07, + 0x06,0xff,0xd4,0x83,0x00,0x06,0x00,0xd1,0x0b,0x10,0x07,0x06,0xff,0xd4,0x85,0x00, + 0x06,0x00,0x10,0x07,0x06,0xff,0xd4,0x87,0x00,0x06,0x00,0xd2,0x16,0xd1,0x0b,0x10, + 0x07,0x06,0xff,0xd4,0x89,0x00,0x06,0x00,0x10,0x07,0x06,0xff,0xd4,0x8b,0x00,0x06, + 0x00,0xd1,0x0b,0x10,0x07,0x06,0xff,0xd4,0x8d,0x00,0x06,0x00,0x10,0x07,0x06,0xff, + 0xd4,0x8f,0x00,0x06,0x00,0xd3,0x2c,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x09,0xff,0xd4, + 0x91,0x00,0x09,0x00,0x10,0x07,0x09,0xff,0xd4,0x93,0x00,0x09,0x00,0xd1,0x0b,0x10, + 0x07,0x0a,0xff,0xd4,0x95,0x00,0x0a,0x00,0x10,0x07,0x0a,0xff,0xd4,0x97,0x00,0x0a, + 0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x0a,0xff,0xd4,0x99,0x00,0x0a,0x00,0x10,0x07, + 0x0a,0xff,0xd4,0x9b,0x00,0x0a,0x00,0xd1,0x0b,0x10,0x07,0x0a,0xff,0xd4,0x9d,0x00, + 0x0a,0x00,0x10,0x07,0x0a,0xff,0xd4,0x9f,0x00,0x0a,0x00,0xd4,0x58,0xd3,0x2c,0xd2, + 0x16,0xd1,0x0b,0x10,0x07,0x0a,0xff,0xd4,0xa1,0x00,0x0a,0x00,0x10,0x07,0x0a,0xff, + 0xd4,0xa3,0x00,0x0a,0x00,0xd1,0x0b,0x10,0x07,0x0b,0xff,0xd4,0xa5,0x00,0x0b,0x00, + 0x10,0x07,0x0c,0xff,0xd4,0xa7,0x00,0x0c,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x10, + 0xff,0xd4,0xa9,0x00,0x10,0x00,0x10,0x07,0x10,0xff,0xd4,0xab,0x00,0x10,0x00,0xd1, + 0x0b,0x10,0x07,0x10,0xff,0xd4,0xad,0x00,0x10,0x00,0x10,0x07,0x10,0xff,0xd4,0xaf, + 0x00,0x10,0x00,0xd3,0x35,0xd2,0x19,0xd1,0x0b,0x10,0x04,0x00,0x00,0x01,0xff,0xd5, + 0xa1,0x00,0x10,0x07,0x01,0xff,0xd5,0xa2,0x00,0x01,0xff,0xd5,0xa3,0x00,0xd1,0x0e, + 0x10,0x07,0x01,0xff,0xd5,0xa4,0x00,0x01,0xff,0xd5,0xa5,0x00,0x10,0x07,0x01,0xff, + 0xd5,0xa6,0x00,0x01,0xff,0xd5,0xa7,0x00,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff, + 0xd5,0xa8,0x00,0x01,0xff,0xd5,0xa9,0x00,0x10,0x07,0x01,0xff,0xd5,0xaa,0x00,0x01, + 0xff,0xd5,0xab,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd5,0xac,0x00,0x01,0xff,0xd5, + 0xad,0x00,0x10,0x07,0x01,0xff,0xd5,0xae,0x00,0x01,0xff,0xd5,0xaf,0x00,0xcf,0x86, + 0xe5,0x08,0x3f,0xd4,0x70,0xd3,0x38,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd5, + 0xb0,0x00,0x01,0xff,0xd5,0xb1,0x00,0x10,0x07,0x01,0xff,0xd5,0xb2,0x00,0x01,0xff, + 0xd5,0xb3,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd5,0xb4,0x00,0x01,0xff,0xd5,0xb5, + 0x00,0x10,0x07,0x01,0xff,0xd5,0xb6,0x00,0x01,0xff,0xd5,0xb7,0x00,0xd2,0x1c,0xd1, + 0x0e,0x10,0x07,0x01,0xff,0xd5,0xb8,0x00,0x01,0xff,0xd5,0xb9,0x00,0x10,0x07,0x01, + 0xff,0xd5,0xba,0x00,0x01,0xff,0xd5,0xbb,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd5, + 0xbc,0x00,0x01,0xff,0xd5,0xbd,0x00,0x10,0x07,0x01,0xff,0xd5,0xbe,0x00,0x01,0xff, + 0xd5,0xbf,0x00,0xe3,0x87,0x3e,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd6,0x80, + 0x00,0x01,0xff,0xd6,0x81,0x00,0x10,0x07,0x01,0xff,0xd6,0x82,0x00,0x01,0xff,0xd6, + 0x83,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd6,0x84,0x00,0x01,0xff,0xd6,0x85,0x00, + 0x10,0x07,0x01,0xff,0xd6,0x86,0x00,0x00,0x00,0xe0,0x2f,0x3f,0xcf,0x86,0xe5,0xc0, + 0x3e,0xe4,0x97,0x3e,0xe3,0x76,0x3e,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10, + 0x04,0x01,0x00,0x01,0xff,0xd5,0xa5,0xd6,0x82,0x00,0xe4,0x3e,0x25,0xe3,0xc3,0x1a, + 0xe2,0x7b,0x81,0xe1,0xc0,0x13,0xd0,0x1e,0xcf,0x86,0xc5,0xe4,0x08,0x4b,0xe3,0x53, + 0x46,0xe2,0xe9,0x43,0xe1,0x1c,0x43,0xe0,0xe1,0x42,0xcf,0x86,0xe5,0xa6,0x42,0x64, + 0x89,0x42,0x0b,0x00,0xcf,0x86,0xe5,0xfa,0x01,0xe4,0x03,0x56,0xe3,0x76,0x01,0xe2, + 0x8e,0x53,0xd1,0x0c,0xe0,0xef,0x52,0xcf,0x86,0x65,0x8d,0x52,0x04,0x00,0xe0,0x0d, + 0x01,0xcf,0x86,0xd5,0x0a,0xe4,0x10,0x53,0x63,0xff,0x52,0x0a,0x00,0xd4,0x80,0xd3, + 0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x80,0x00,0x01,0xff,0xe2, + 0xb4,0x81,0x00,0x10,0x08,0x01,0xff,0xe2,0xb4,0x82,0x00,0x01,0xff,0xe2,0xb4,0x83, + 0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x84,0x00,0x01,0xff,0xe2,0xb4,0x85, + 0x00,0x10,0x08,0x01,0xff,0xe2,0xb4,0x86,0x00,0x01,0xff,0xe2,0xb4,0x87,0x00,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x88,0x00,0x01,0xff,0xe2,0xb4,0x89, + 0x00,0x10,0x08,0x01,0xff,0xe2,0xb4,0x8a,0x00,0x01,0xff,0xe2,0xb4,0x8b,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x8c,0x00,0x01,0xff,0xe2,0xb4,0x8d,0x00,0x10, + 0x08,0x01,0xff,0xe2,0xb4,0x8e,0x00,0x01,0xff,0xe2,0xb4,0x8f,0x00,0xd3,0x40,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x90,0x00,0x01,0xff,0xe2,0xb4,0x91, + 0x00,0x10,0x08,0x01,0xff,0xe2,0xb4,0x92,0x00,0x01,0xff,0xe2,0xb4,0x93,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x94,0x00,0x01,0xff,0xe2,0xb4,0x95,0x00,0x10, + 0x08,0x01,0xff,0xe2,0xb4,0x96,0x00,0x01,0xff,0xe2,0xb4,0x97,0x00,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x98,0x00,0x01,0xff,0xe2,0xb4,0x99,0x00,0x10, + 0x08,0x01,0xff,0xe2,0xb4,0x9a,0x00,0x01,0xff,0xe2,0xb4,0x9b,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0xe2,0xb4,0x9c,0x00,0x01,0xff,0xe2,0xb4,0x9d,0x00,0x10,0x08,0x01, + 0xff,0xe2,0xb4,0x9e,0x00,0x01,0xff,0xe2,0xb4,0x9f,0x00,0xcf,0x86,0xe5,0x42,0x52, + 0x94,0x50,0xd3,0x3c,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0xa0,0x00, + 0x01,0xff,0xe2,0xb4,0xa1,0x00,0x10,0x08,0x01,0xff,0xe2,0xb4,0xa2,0x00,0x01,0xff, + 0xe2,0xb4,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0xa4,0x00,0x01,0xff, + 0xe2,0xb4,0xa5,0x00,0x10,0x04,0x00,0x00,0x0d,0xff,0xe2,0xb4,0xa7,0x00,0x52,0x04, + 0x00,0x00,0x91,0x0c,0x10,0x04,0x00,0x00,0x0d,0xff,0xe2,0xb4,0xad,0x00,0x00,0x00, + 0x01,0x00,0xd2,0x1b,0xe1,0xfc,0x52,0xe0,0xad,0x52,0xcf,0x86,0x95,0x0f,0x94,0x0b, + 0x93,0x07,0x62,0x92,0x52,0x04,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0xd1,0x13,0xe0, + 0xd3,0x53,0xcf,0x86,0x95,0x0a,0xe4,0xa8,0x53,0x63,0x97,0x53,0x04,0x00,0x04,0x00, + 0xd0,0x0d,0xcf,0x86,0x95,0x07,0x64,0x22,0x54,0x08,0x00,0x04,0x00,0xcf,0x86,0x55, + 0x04,0x04,0x00,0x54,0x04,0x04,0x00,0xd3,0x07,0x62,0x2f,0x54,0x04,0x00,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8f,0xb0,0x00,0x11,0xff,0xe1,0x8f,0xb1,0x00, + 0x10,0x08,0x11,0xff,0xe1,0x8f,0xb2,0x00,0x11,0xff,0xe1,0x8f,0xb3,0x00,0x91,0x10, + 0x10,0x08,0x11,0xff,0xe1,0x8f,0xb4,0x00,0x11,0xff,0xe1,0x8f,0xb5,0x00,0x00,0x00, + 0xd4,0x1c,0xe3,0xe0,0x56,0xe2,0x17,0x56,0xe1,0xda,0x55,0xe0,0xbb,0x55,0xcf,0x86, + 0x95,0x0a,0xe4,0xa4,0x55,0x63,0x88,0x55,0x04,0x00,0x04,0x00,0xe3,0xd2,0x01,0xe2, + 0x2b,0x5a,0xd1,0x0c,0xe0,0x4c,0x59,0xcf,0x86,0x65,0x25,0x59,0x0a,0x00,0xe0,0x9c, + 0x59,0xcf,0x86,0xd5,0xc5,0xd4,0x45,0xd3,0x31,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x12, + 0xff,0xd0,0xb2,0x00,0x12,0xff,0xd0,0xb4,0x00,0x10,0x07,0x12,0xff,0xd0,0xbe,0x00, + 0x12,0xff,0xd1,0x81,0x00,0x51,0x07,0x12,0xff,0xd1,0x82,0x00,0x10,0x07,0x12,0xff, + 0xd1,0x8a,0x00,0x12,0xff,0xd1,0xa3,0x00,0x92,0x10,0x91,0x0c,0x10,0x08,0x12,0xff, + 0xea,0x99,0x8b,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x14,0xff,0xe1,0x83,0x90,0x00,0x14,0xff,0xe1,0x83,0x91,0x00,0x10,0x08, + 0x14,0xff,0xe1,0x83,0x92,0x00,0x14,0xff,0xe1,0x83,0x93,0x00,0xd1,0x10,0x10,0x08, + 0x14,0xff,0xe1,0x83,0x94,0x00,0x14,0xff,0xe1,0x83,0x95,0x00,0x10,0x08,0x14,0xff, + 0xe1,0x83,0x96,0x00,0x14,0xff,0xe1,0x83,0x97,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x14,0xff,0xe1,0x83,0x98,0x00,0x14,0xff,0xe1,0x83,0x99,0x00,0x10,0x08,0x14,0xff, + 0xe1,0x83,0x9a,0x00,0x14,0xff,0xe1,0x83,0x9b,0x00,0xd1,0x10,0x10,0x08,0x14,0xff, + 0xe1,0x83,0x9c,0x00,0x14,0xff,0xe1,0x83,0x9d,0x00,0x10,0x08,0x14,0xff,0xe1,0x83, + 0x9e,0x00,0x14,0xff,0xe1,0x83,0x9f,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x14,0xff,0xe1,0x83,0xa0,0x00,0x14,0xff,0xe1,0x83,0xa1,0x00,0x10,0x08, + 0x14,0xff,0xe1,0x83,0xa2,0x00,0x14,0xff,0xe1,0x83,0xa3,0x00,0xd1,0x10,0x10,0x08, + 0x14,0xff,0xe1,0x83,0xa4,0x00,0x14,0xff,0xe1,0x83,0xa5,0x00,0x10,0x08,0x14,0xff, + 0xe1,0x83,0xa6,0x00,0x14,0xff,0xe1,0x83,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x14,0xff,0xe1,0x83,0xa8,0x00,0x14,0xff,0xe1,0x83,0xa9,0x00,0x10,0x08,0x14,0xff, + 0xe1,0x83,0xaa,0x00,0x14,0xff,0xe1,0x83,0xab,0x00,0xd1,0x10,0x10,0x08,0x14,0xff, + 0xe1,0x83,0xac,0x00,0x14,0xff,0xe1,0x83,0xad,0x00,0x10,0x08,0x14,0xff,0xe1,0x83, + 0xae,0x00,0x14,0xff,0xe1,0x83,0xaf,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x14,0xff,0xe1,0x83,0xb0,0x00,0x14,0xff,0xe1,0x83,0xb1,0x00,0x10,0x08,0x14,0xff, + 0xe1,0x83,0xb2,0x00,0x14,0xff,0xe1,0x83,0xb3,0x00,0xd1,0x10,0x10,0x08,0x14,0xff, + 0xe1,0x83,0xb4,0x00,0x14,0xff,0xe1,0x83,0xb5,0x00,0x10,0x08,0x14,0xff,0xe1,0x83, + 0xb6,0x00,0x14,0xff,0xe1,0x83,0xb7,0x00,0xd2,0x1c,0xd1,0x10,0x10,0x08,0x14,0xff, + 0xe1,0x83,0xb8,0x00,0x14,0xff,0xe1,0x83,0xb9,0x00,0x10,0x08,0x14,0xff,0xe1,0x83, + 0xba,0x00,0x00,0x00,0xd1,0x0c,0x10,0x04,0x00,0x00,0x14,0xff,0xe1,0x83,0xbd,0x00, + 0x10,0x08,0x14,0xff,0xe1,0x83,0xbe,0x00,0x14,0xff,0xe1,0x83,0xbf,0x00,0xe2,0x9d, + 0x08,0xe1,0x48,0x04,0xe0,0x1c,0x02,0xcf,0x86,0xe5,0x11,0x01,0xd4,0x84,0xd3,0x40, + 0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x61,0xcc,0xa5,0x00,0x01,0xff,0x61,0xcc, + 0xa5,0x00,0x10,0x08,0x01,0xff,0x62,0xcc,0x87,0x00,0x01,0xff,0x62,0xcc,0x87,0x00, + 0xd1,0x10,0x10,0x08,0x01,0xff,0x62,0xcc,0xa3,0x00,0x01,0xff,0x62,0xcc,0xa3,0x00, + 0x10,0x08,0x01,0xff,0x62,0xcc,0xb1,0x00,0x01,0xff,0x62,0xcc,0xb1,0x00,0xd2,0x24, + 0xd1,0x14,0x10,0x0a,0x01,0xff,0x63,0xcc,0xa7,0xcc,0x81,0x00,0x01,0xff,0x63,0xcc, + 0xa7,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x64,0xcc,0x87,0x00,0x01,0xff,0x64,0xcc, + 0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x64,0xcc,0xa3,0x00,0x01,0xff,0x64,0xcc, + 0xa3,0x00,0x10,0x08,0x01,0xff,0x64,0xcc,0xb1,0x00,0x01,0xff,0x64,0xcc,0xb1,0x00, + 0xd3,0x48,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x64,0xcc,0xa7,0x00,0x01,0xff, + 0x64,0xcc,0xa7,0x00,0x10,0x08,0x01,0xff,0x64,0xcc,0xad,0x00,0x01,0xff,0x64,0xcc, + 0xad,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x65,0xcc,0x84,0xcc,0x80,0x00,0x01,0xff, + 0x65,0xcc,0x84,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x65,0xcc,0x84,0xcc,0x81,0x00, + 0x01,0xff,0x65,0xcc,0x84,0xcc,0x81,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff, + 0x65,0xcc,0xad,0x00,0x01,0xff,0x65,0xcc,0xad,0x00,0x10,0x08,0x01,0xff,0x65,0xcc, + 0xb0,0x00,0x01,0xff,0x65,0xcc,0xb0,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x65,0xcc, + 0xa7,0xcc,0x86,0x00,0x01,0xff,0x65,0xcc,0xa7,0xcc,0x86,0x00,0x10,0x08,0x01,0xff, + 0x66,0xcc,0x87,0x00,0x01,0xff,0x66,0xcc,0x87,0x00,0xd4,0x84,0xd3,0x40,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x01,0xff,0x67,0xcc,0x84,0x00,0x01,0xff,0x67,0xcc,0x84,0x00, + 0x10,0x08,0x01,0xff,0x68,0xcc,0x87,0x00,0x01,0xff,0x68,0xcc,0x87,0x00,0xd1,0x10, + 0x10,0x08,0x01,0xff,0x68,0xcc,0xa3,0x00,0x01,0xff,0x68,0xcc,0xa3,0x00,0x10,0x08, + 0x01,0xff,0x68,0xcc,0x88,0x00,0x01,0xff,0x68,0xcc,0x88,0x00,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x01,0xff,0x68,0xcc,0xa7,0x00,0x01,0xff,0x68,0xcc,0xa7,0x00,0x10,0x08, + 0x01,0xff,0x68,0xcc,0xae,0x00,0x01,0xff,0x68,0xcc,0xae,0x00,0xd1,0x10,0x10,0x08, + 0x01,0xff,0x69,0xcc,0xb0,0x00,0x01,0xff,0x69,0xcc,0xb0,0x00,0x10,0x0a,0x01,0xff, + 0x69,0xcc,0x88,0xcc,0x81,0x00,0x01,0xff,0x69,0xcc,0x88,0xcc,0x81,0x00,0xd3,0x40, + 0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x6b,0xcc,0x81,0x00,0x01,0xff,0x6b,0xcc, + 0x81,0x00,0x10,0x08,0x01,0xff,0x6b,0xcc,0xa3,0x00,0x01,0xff,0x6b,0xcc,0xa3,0x00, + 0xd1,0x10,0x10,0x08,0x01,0xff,0x6b,0xcc,0xb1,0x00,0x01,0xff,0x6b,0xcc,0xb1,0x00, + 0x10,0x08,0x01,0xff,0x6c,0xcc,0xa3,0x00,0x01,0xff,0x6c,0xcc,0xa3,0x00,0xd2,0x24, + 0xd1,0x14,0x10,0x0a,0x01,0xff,0x6c,0xcc,0xa3,0xcc,0x84,0x00,0x01,0xff,0x6c,0xcc, + 0xa3,0xcc,0x84,0x00,0x10,0x08,0x01,0xff,0x6c,0xcc,0xb1,0x00,0x01,0xff,0x6c,0xcc, + 0xb1,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6c,0xcc,0xad,0x00,0x01,0xff,0x6c,0xcc, + 0xad,0x00,0x10,0x08,0x01,0xff,0x6d,0xcc,0x81,0x00,0x01,0xff,0x6d,0xcc,0x81,0x00, + 0xcf,0x86,0xe5,0x15,0x01,0xd4,0x88,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x6d,0xcc,0x87,0x00,0x01,0xff,0x6d,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x6d, + 0xcc,0xa3,0x00,0x01,0xff,0x6d,0xcc,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6e, + 0xcc,0x87,0x00,0x01,0xff,0x6e,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x6e,0xcc,0xa3, + 0x00,0x01,0xff,0x6e,0xcc,0xa3,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x6e, + 0xcc,0xb1,0x00,0x01,0xff,0x6e,0xcc,0xb1,0x00,0x10,0x08,0x01,0xff,0x6e,0xcc,0xad, + 0x00,0x01,0xff,0x6e,0xcc,0xad,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x83, + 0xcc,0x81,0x00,0x01,0xff,0x6f,0xcc,0x83,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x6f, + 0xcc,0x83,0xcc,0x88,0x00,0x01,0xff,0x6f,0xcc,0x83,0xcc,0x88,0x00,0xd3,0x48,0xd2, + 0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x84,0xcc,0x80,0x00,0x01,0xff,0x6f, + 0xcc,0x84,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x84,0xcc,0x81,0x00,0x01, + 0xff,0x6f,0xcc,0x84,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x70,0xcc,0x81, + 0x00,0x01,0xff,0x70,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x70,0xcc,0x87,0x00,0x01, + 0xff,0x70,0xcc,0x87,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x72,0xcc,0x87, + 0x00,0x01,0xff,0x72,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x72,0xcc,0xa3,0x00,0x01, + 0xff,0x72,0xcc,0xa3,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x72,0xcc,0xa3,0xcc,0x84, + 0x00,0x01,0xff,0x72,0xcc,0xa3,0xcc,0x84,0x00,0x10,0x08,0x01,0xff,0x72,0xcc,0xb1, + 0x00,0x01,0xff,0x72,0xcc,0xb1,0x00,0xd4,0x8c,0xd3,0x48,0xd2,0x20,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x73,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x87,0x00,0x10,0x08,0x01, + 0xff,0x73,0xcc,0xa3,0x00,0x01,0xff,0x73,0xcc,0xa3,0x00,0xd1,0x14,0x10,0x0a,0x01, + 0xff,0x73,0xcc,0x81,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x81,0xcc,0x87,0x00,0x10, + 0x0a,0x01,0xff,0x73,0xcc,0x8c,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x8c,0xcc,0x87, + 0x00,0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,0x73,0xcc,0xa3,0xcc,0x87,0x00,0x01, + 0xff,0x73,0xcc,0xa3,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x74,0xcc,0x87,0x00,0x01, + 0xff,0x74,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x74,0xcc,0xa3,0x00,0x01, + 0xff,0x74,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x74,0xcc,0xb1,0x00,0x01,0xff,0x74, + 0xcc,0xb1,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x74,0xcc,0xad, + 0x00,0x01,0xff,0x74,0xcc,0xad,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0xa4,0x00,0x01, + 0xff,0x75,0xcc,0xa4,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc,0xb0,0x00,0x01, + 0xff,0x75,0xcc,0xb0,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0xad,0x00,0x01,0xff,0x75, + 0xcc,0xad,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x75,0xcc,0x83,0xcc,0x81, + 0x00,0x01,0xff,0x75,0xcc,0x83,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x84, + 0xcc,0x88,0x00,0x01,0xff,0x75,0xcc,0x84,0xcc,0x88,0x00,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x76,0xcc,0x83,0x00,0x01,0xff,0x76,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x76, + 0xcc,0xa3,0x00,0x01,0xff,0x76,0xcc,0xa3,0x00,0xe0,0x11,0x02,0xcf,0x86,0xd5,0xe2, + 0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0x80,0x00, + 0x01,0xff,0x77,0xcc,0x80,0x00,0x10,0x08,0x01,0xff,0x77,0xcc,0x81,0x00,0x01,0xff, + 0x77,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0x88,0x00,0x01,0xff, + 0x77,0xcc,0x88,0x00,0x10,0x08,0x01,0xff,0x77,0xcc,0x87,0x00,0x01,0xff,0x77,0xcc, + 0x87,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0xa3,0x00,0x01,0xff, + 0x77,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x78,0xcc,0x87,0x00,0x01,0xff,0x78,0xcc, + 0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x78,0xcc,0x88,0x00,0x01,0xff,0x78,0xcc, + 0x88,0x00,0x10,0x08,0x01,0xff,0x79,0xcc,0x87,0x00,0x01,0xff,0x79,0xcc,0x87,0x00, + 0xd3,0x33,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x7a,0xcc,0x82,0x00,0x01,0xff, + 0x7a,0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x7a,0xcc,0xa3,0x00,0x01,0xff,0x7a,0xcc, + 0xa3,0x00,0xe1,0x12,0x59,0x10,0x08,0x01,0xff,0x7a,0xcc,0xb1,0x00,0x01,0xff,0x7a, + 0xcc,0xb1,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0x8a,0x00,0x01, + 0xff,0x79,0xcc,0x8a,0x00,0x10,0x08,0x01,0xff,0x61,0xca,0xbe,0x00,0x02,0xff,0x73, + 0xcc,0x87,0x00,0x51,0x04,0x0a,0x00,0x10,0x07,0x0a,0xff,0x73,0x73,0x00,0x0a,0x00, + 0xd4,0x98,0xd3,0x48,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x61,0xcc,0xa3,0x00, + 0x01,0xff,0x61,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x61,0xcc,0x89,0x00,0x01,0xff, + 0x61,0xcc,0x89,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x61,0xcc,0x82,0xcc,0x81,0x00, + 0x01,0xff,0x61,0xcc,0x82,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x61,0xcc,0x82,0xcc, + 0x80,0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,0x80,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a, + 0x01,0xff,0x61,0xcc,0x82,0xcc,0x89,0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,0x89,0x00, + 0x10,0x0a,0x01,0xff,0x61,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x61,0xcc,0x82,0xcc, + 0x83,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x61,0xcc,0xa3,0xcc,0x82,0x00,0x01,0xff, + 0x61,0xcc,0xa3,0xcc,0x82,0x00,0x10,0x0a,0x01,0xff,0x61,0xcc,0x86,0xcc,0x81,0x00, + 0x01,0xff,0x61,0xcc,0x86,0xcc,0x81,0x00,0xd3,0x50,0xd2,0x28,0xd1,0x14,0x10,0x0a, + 0x01,0xff,0x61,0xcc,0x86,0xcc,0x80,0x00,0x01,0xff,0x61,0xcc,0x86,0xcc,0x80,0x00, + 0x10,0x0a,0x01,0xff,0x61,0xcc,0x86,0xcc,0x89,0x00,0x01,0xff,0x61,0xcc,0x86,0xcc, + 0x89,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x61,0xcc,0x86,0xcc,0x83,0x00,0x01,0xff, + 0x61,0xcc,0x86,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x61,0xcc,0xa3,0xcc,0x86,0x00, + 0x01,0xff,0x61,0xcc,0xa3,0xcc,0x86,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff, + 0x65,0xcc,0xa3,0x00,0x01,0xff,0x65,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x65,0xcc, + 0x89,0x00,0x01,0xff,0x65,0xcc,0x89,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x65,0xcc, + 0x83,0x00,0x01,0xff,0x65,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x65,0xcc,0x82,0xcc, + 0x81,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x81,0x00,0xcf,0x86,0xe5,0x31,0x01,0xd4, + 0x90,0xd3,0x50,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x65,0xcc,0x82,0xcc,0x80, + 0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x65,0xcc,0x82, + 0xcc,0x89,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x89,0x00,0xd1,0x14,0x10,0x0a,0x01, + 0xff,0x65,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x83,0x00,0x10, + 0x0a,0x01,0xff,0x65,0xcc,0xa3,0xcc,0x82,0x00,0x01,0xff,0x65,0xcc,0xa3,0xcc,0x82, + 0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,0x89,0x00,0x01,0xff,0x69, + 0xcc,0x89,0x00,0x10,0x08,0x01,0xff,0x69,0xcc,0xa3,0x00,0x01,0xff,0x69,0xcc,0xa3, + 0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0xa3,0x00,0x01,0xff,0x6f,0xcc,0xa3, + 0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x89,0x00,0xd3, + 0x50,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x81,0x00,0x01, + 0xff,0x6f,0xcc,0x82,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x80, + 0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x80,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f, + 0xcc,0x82,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x89,0x00,0x10,0x0a,0x01, + 0xff,0x6f,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x83,0x00,0xd2, + 0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0xa3,0xcc,0x82,0x00,0x01,0xff,0x6f, + 0xcc,0xa3,0xcc,0x82,0x00,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x81,0x00,0x01, + 0xff,0x6f,0xcc,0x9b,0xcc,0x81,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x9b, + 0xcc,0x80,0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x6f, + 0xcc,0x9b,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x89,0x00,0xd4,0x98,0xd3, + 0x48,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x83,0x00,0x01, + 0xff,0x6f,0xcc,0x9b,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0xa3, + 0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x75, + 0xcc,0xa3,0x00,0x01,0xff,0x75,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0x89, + 0x00,0x01,0xff,0x75,0xcc,0x89,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x75, + 0xcc,0x9b,0xcc,0x81,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x81,0x00,0x10,0x0a,0x01, + 0xff,0x75,0xcc,0x9b,0xcc,0x80,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x80,0x00,0xd1, + 0x14,0x10,0x0a,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x89,0x00,0x01,0xff,0x75,0xcc,0x9b, + 0xcc,0x89,0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x83,0x00,0x01,0xff,0x75, + 0xcc,0x9b,0xcc,0x83,0x00,0xd3,0x44,0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,0x75, + 0xcc,0x9b,0xcc,0xa3,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0xa3,0x00,0x10,0x08,0x01, + 0xff,0x79,0xcc,0x80,0x00,0x01,0xff,0x79,0xcc,0x80,0x00,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x79,0xcc,0xa3,0x00,0x01,0xff,0x79,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x79, + 0xcc,0x89,0x00,0x01,0xff,0x79,0xcc,0x89,0x00,0xd2,0x1c,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x79,0xcc,0x83,0x00,0x01,0xff,0x79,0xcc,0x83,0x00,0x10,0x08,0x0a,0xff,0xe1, + 0xbb,0xbb,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xe1,0xbb,0xbd,0x00,0x0a, + 0x00,0x10,0x08,0x0a,0xff,0xe1,0xbb,0xbf,0x00,0x0a,0x00,0xe1,0xbf,0x02,0xe0,0xa1, + 0x01,0xcf,0x86,0xd5,0xc6,0xd4,0x6c,0xd3,0x18,0xe2,0x0e,0x59,0xe1,0xf7,0x58,0x10, + 0x09,0x01,0xff,0xce,0xb1,0xcc,0x93,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0x00,0xd2, + 0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x93,0x00,0x01,0xff,0xce,0xb1, + 0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff, + 0xce,0xb1,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc, + 0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01, + 0xff,0xce,0xb1,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcd,0x82, + 0x00,0xd3,0x18,0xe2,0x4a,0x59,0xe1,0x33,0x59,0x10,0x09,0x01,0xff,0xce,0xb5,0xcc, + 0x93,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01, + 0xff,0xce,0xb5,0xcc,0x93,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,0x00,0x10,0x0b,0x01, + 0xff,0xce,0xb5,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,0xcc,0x80, + 0x00,0x91,0x16,0x10,0x0b,0x01,0xff,0xce,0xb5,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff, + 0xce,0xb5,0xcc,0x94,0xcc,0x81,0x00,0x00,0x00,0xd4,0x6c,0xd3,0x18,0xe2,0x74,0x59, + 0xe1,0x5d,0x59,0x10,0x09,0x01,0xff,0xce,0xb7,0xcc,0x93,0x00,0x01,0xff,0xce,0xb7, + 0xcc,0x94,0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb7,0xcc,0x93,0x00, + 0x01,0xff,0xce,0xb7,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc, + 0x80,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01, + 0xff,0xce,0xb7,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x81, + 0x00,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xb7, + 0xcc,0x94,0xcd,0x82,0x00,0xd3,0x18,0xe2,0xb0,0x59,0xe1,0x99,0x59,0x10,0x09,0x01, + 0xff,0xce,0xb9,0xcc,0x93,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,0x00,0xd2,0x28,0xd1, + 0x12,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x93,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94, + 0x00,0x10,0x0b,0x01,0xff,0xce,0xb9,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xb9, + 0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb9,0xcc,0x93,0xcc, + 0x81,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,0xce, + 0xb9,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,0xcd,0x82,0x00,0xcf, + 0x86,0xd5,0xac,0xd4,0x5a,0xd3,0x18,0xe2,0xed,0x59,0xe1,0xd6,0x59,0x10,0x09,0x01, + 0xff,0xce,0xbf,0xcc,0x93,0x00,0x01,0xff,0xce,0xbf,0xcc,0x94,0x00,0xd2,0x28,0xd1, + 0x12,0x10,0x09,0x01,0xff,0xce,0xbf,0xcc,0x93,0x00,0x01,0xff,0xce,0xbf,0xcc,0x94, + 0x00,0x10,0x0b,0x01,0xff,0xce,0xbf,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xbf, + 0xcc,0x94,0xcc,0x80,0x00,0x91,0x16,0x10,0x0b,0x01,0xff,0xce,0xbf,0xcc,0x93,0xcc, + 0x81,0x00,0x01,0xff,0xce,0xbf,0xcc,0x94,0xcc,0x81,0x00,0x00,0x00,0xd3,0x18,0xe2, + 0x17,0x5a,0xe1,0x00,0x5a,0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x93,0x00,0x01,0xff, + 0xcf,0x85,0xcc,0x94,0x00,0xd2,0x1c,0xd1,0x0d,0x10,0x04,0x00,0x00,0x01,0xff,0xcf, + 0x85,0xcc,0x94,0x00,0x10,0x04,0x00,0x00,0x01,0xff,0xcf,0x85,0xcc,0x94,0xcc,0x80, + 0x00,0xd1,0x0f,0x10,0x04,0x00,0x00,0x01,0xff,0xcf,0x85,0xcc,0x94,0xcc,0x81,0x00, + 0x10,0x04,0x00,0x00,0x01,0xff,0xcf,0x85,0xcc,0x94,0xcd,0x82,0x00,0xe4,0xd3,0x5a, + 0xd3,0x18,0xe2,0x52,0x5a,0xe1,0x3b,0x5a,0x10,0x09,0x01,0xff,0xcf,0x89,0xcc,0x93, + 0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff, + 0xcf,0x89,0xcc,0x93,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff, + 0xcf,0x89,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc,0x80,0x00, + 0xd1,0x16,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xcf, + 0x89,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcd,0x82, + 0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcd,0x82,0x00,0xe0,0xd9,0x02,0xcf,0x86,0xe5, + 0x91,0x01,0xd4,0xc8,0xd3,0x64,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb1, + 0xcc,0x93,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xce,0xb9,0x00,0x10,0x0d, + 0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xcc, + 0x94,0xcc,0x80,0xce,0xb9,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93, + 0xcc,0x81,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcc,0x81,0xce,0xb9,0x00, + 0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcd,0x82,0xce,0xb9,0x00,0x01,0xff,0xce, + 0xb1,0xcc,0x94,0xcd,0x82,0xce,0xb9,0x00,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff, + 0xce,0xb1,0xcc,0x93,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xce,0xb9,0x00, + 0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xce, + 0xb1,0xcc,0x94,0xcc,0x80,0xce,0xb9,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xce,0xb1, + 0xcc,0x93,0xcc,0x81,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcc,0x81,0xce, + 0xb9,0x00,0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcd,0x82,0xce,0xb9,0x00,0x01, + 0xff,0xce,0xb1,0xcc,0x94,0xcd,0x82,0xce,0xb9,0x00,0xd3,0x64,0xd2,0x30,0xd1,0x16, + 0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xcc, + 0x94,0xce,0xb9,0x00,0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x80,0xce,0xb9, + 0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x80,0xce,0xb9,0x00,0xd1,0x1a,0x10,0x0d, + 0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x81,0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xcc, + 0x94,0xcc,0x81,0xce,0xb9,0x00,0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcd,0x82, + 0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcd,0x82,0xce,0xb9,0x00,0xd2,0x30, + 0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xce,0xb9,0x00,0x01,0xff,0xce, + 0xb7,0xcc,0x94,0xce,0xb9,0x00,0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x80, + 0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x80,0xce,0xb9,0x00,0xd1,0x1a, + 0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x81,0xce,0xb9,0x00,0x01,0xff,0xce, + 0xb7,0xcc,0x94,0xcc,0x81,0xce,0xb9,0x00,0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93, + 0xcd,0x82,0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcd,0x82,0xce,0xb9,0x00, + 0xd4,0xc8,0xd3,0x64,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x93, + 0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xce,0xb9,0x00,0x10,0x0d,0x01,0xff, + 0xcf,0x89,0xcc,0x93,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc, + 0x80,0xce,0xb9,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x81, + 0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc,0x81,0xce,0xb9,0x00,0x10,0x0d, + 0x01,0xff,0xcf,0x89,0xcc,0x93,0xcd,0x82,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc, + 0x94,0xcd,0x82,0xce,0xb9,0x00,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,0xcf,0x89, + 0xcc,0x93,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xce,0xb9,0x00,0x10,0x0d, + 0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc, + 0x94,0xcc,0x80,0xce,0xb9,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xcf,0x89,0xcc,0x93, + 0xcc,0x81,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc,0x81,0xce,0xb9,0x00, + 0x10,0x0d,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcd,0x82,0xce,0xb9,0x00,0x01,0xff,0xcf, + 0x89,0xcc,0x94,0xcd,0x82,0xce,0xb9,0x00,0xd3,0x49,0xd2,0x26,0xd1,0x12,0x10,0x09, + 0x01,0xff,0xce,0xb1,0xcc,0x86,0x00,0x01,0xff,0xce,0xb1,0xcc,0x84,0x00,0x10,0x0b, + 0x01,0xff,0xce,0xb1,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xce,0xb9,0x00, + 0xd1,0x0f,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x81,0xce,0xb9,0x00,0x00,0x00,0x10, + 0x09,0x01,0xff,0xce,0xb1,0xcd,0x82,0x00,0x01,0xff,0xce,0xb1,0xcd,0x82,0xce,0xb9, + 0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x86,0x00,0x01,0xff, + 0xce,0xb1,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x80,0x00,0x01,0xff, + 0xce,0xb1,0xcc,0x81,0x00,0xe1,0xf3,0x5a,0x10,0x09,0x01,0xff,0xce,0xb1,0xce,0xb9, + 0x00,0x01,0x00,0xcf,0x86,0xd5,0xbd,0xd4,0x7e,0xd3,0x44,0xd2,0x21,0xd1,0x0d,0x10, + 0x04,0x01,0x00,0x01,0xff,0xc2,0xa8,0xcd,0x82,0x00,0x10,0x0b,0x01,0xff,0xce,0xb7, + 0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xce,0xb9,0x00,0xd1,0x0f,0x10,0x0b, + 0x01,0xff,0xce,0xb7,0xcc,0x81,0xce,0xb9,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xce, + 0xb7,0xcd,0x82,0x00,0x01,0xff,0xce,0xb7,0xcd,0x82,0xce,0xb9,0x00,0xd2,0x24,0xd1, + 0x12,0x10,0x09,0x01,0xff,0xce,0xb5,0xcc,0x80,0x00,0x01,0xff,0xce,0xb5,0xcc,0x81, + 0x00,0x10,0x09,0x01,0xff,0xce,0xb7,0xcc,0x80,0x00,0x01,0xff,0xce,0xb7,0xcc,0x81, + 0x00,0xe1,0x02,0x5b,0x10,0x09,0x01,0xff,0xce,0xb7,0xce,0xb9,0x00,0x01,0xff,0xe1, + 0xbe,0xbf,0xcc,0x80,0x00,0xd3,0x18,0xe2,0x28,0x5b,0xe1,0x11,0x5b,0x10,0x09,0x01, + 0xff,0xce,0xb9,0xcc,0x86,0x00,0x01,0xff,0xce,0xb9,0xcc,0x84,0x00,0xe2,0x4c,0x5b, + 0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x86,0x00,0x01,0xff,0xce,0xb9,0xcc, + 0x84,0x00,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x80,0x00,0x01,0xff,0xce,0xb9,0xcc, + 0x81,0x00,0xd4,0x51,0xd3,0x18,0xe2,0x6f,0x5b,0xe1,0x58,0x5b,0x10,0x09,0x01,0xff, + 0xcf,0x85,0xcc,0x86,0x00,0x01,0xff,0xcf,0x85,0xcc,0x84,0x00,0xd2,0x24,0xd1,0x12, + 0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x86,0x00,0x01,0xff,0xcf,0x85,0xcc,0x84,0x00, + 0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x80,0x00,0x01,0xff,0xcf,0x85,0xcc,0x81,0x00, + 0xe1,0x8f,0x5b,0x10,0x09,0x01,0xff,0xcf,0x81,0xcc,0x94,0x00,0x01,0xff,0xc2,0xa8, + 0xcc,0x80,0x00,0xd3,0x3b,0xd2,0x18,0x51,0x04,0x00,0x00,0x10,0x0b,0x01,0xff,0xcf, + 0x89,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xce,0xb9,0x00,0xd1,0x0f,0x10, + 0x0b,0x01,0xff,0xcf,0x89,0xcc,0x81,0xce,0xb9,0x00,0x00,0x00,0x10,0x09,0x01,0xff, + 0xcf,0x89,0xcd,0x82,0x00,0x01,0xff,0xcf,0x89,0xcd,0x82,0xce,0xb9,0x00,0xd2,0x24, + 0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xbf,0xcc,0x80,0x00,0x01,0xff,0xce,0xbf,0xcc, + 0x81,0x00,0x10,0x09,0x01,0xff,0xcf,0x89,0xcc,0x80,0x00,0x01,0xff,0xcf,0x89,0xcc, + 0x81,0x00,0xe1,0x99,0x5b,0x10,0x09,0x01,0xff,0xcf,0x89,0xce,0xb9,0x00,0x01,0xff, + 0xc2,0xb4,0x00,0xe0,0x0c,0x68,0xcf,0x86,0xe5,0x23,0x02,0xe4,0x25,0x01,0xe3,0x85, + 0x5e,0xd2,0x2a,0xe1,0x5f,0x5c,0xe0,0xdd,0x5b,0xcf,0x86,0xe5,0xbb,0x5b,0x94,0x1b, + 0xe3,0xa4,0x5b,0x92,0x14,0x91,0x10,0x10,0x08,0x01,0xff,0xe2,0x80,0x82,0x00,0x01, + 0xff,0xe2,0x80,0x83,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd1,0xd6,0xd0,0x46,0xcf, + 0x86,0x55,0x04,0x01,0x00,0xd4,0x29,0xd3,0x13,0x52,0x04,0x01,0x00,0x51,0x04,0x01, + 0x00,0x10,0x07,0x01,0xff,0xcf,0x89,0x00,0x01,0x00,0x92,0x12,0x51,0x04,0x01,0x00, + 0x10,0x06,0x01,0xff,0x6b,0x00,0x01,0xff,0x61,0xcc,0x8a,0x00,0x01,0x00,0xe3,0x25, + 0x5d,0x92,0x10,0x51,0x04,0x01,0x00,0x10,0x08,0x01,0xff,0xe2,0x85,0x8e,0x00,0x01, + 0x00,0x01,0x00,0xcf,0x86,0xd5,0x0a,0xe4,0x42,0x5d,0x63,0x2d,0x5d,0x06,0x00,0x94, + 0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x85,0xb0,0x00,0x01, + 0xff,0xe2,0x85,0xb1,0x00,0x10,0x08,0x01,0xff,0xe2,0x85,0xb2,0x00,0x01,0xff,0xe2, + 0x85,0xb3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x85,0xb4,0x00,0x01,0xff,0xe2, + 0x85,0xb5,0x00,0x10,0x08,0x01,0xff,0xe2,0x85,0xb6,0x00,0x01,0xff,0xe2,0x85,0xb7, + 0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x85,0xb8,0x00,0x01,0xff,0xe2, + 0x85,0xb9,0x00,0x10,0x08,0x01,0xff,0xe2,0x85,0xba,0x00,0x01,0xff,0xe2,0x85,0xbb, + 0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x85,0xbc,0x00,0x01,0xff,0xe2,0x85,0xbd, + 0x00,0x10,0x08,0x01,0xff,0xe2,0x85,0xbe,0x00,0x01,0xff,0xe2,0x85,0xbf,0x00,0x01, + 0x00,0xe0,0x34,0x5d,0xcf,0x86,0xe5,0x13,0x5d,0xe4,0xf2,0x5c,0xe3,0xe1,0x5c,0xe2, + 0xd4,0x5c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x04,0xff,0xe2,0x86,0x84,0x00, + 0xe3,0x23,0x61,0xe2,0xf0,0x60,0xd1,0x0c,0xe0,0x9d,0x60,0xcf,0x86,0x65,0x7e,0x60, + 0x01,0x00,0xd0,0x62,0xcf,0x86,0x55,0x04,0x01,0x00,0x54,0x04,0x01,0x00,0xd3,0x18, + 0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x08,0x01,0xff,0xe2,0x93,0x90,0x00, + 0x01,0xff,0xe2,0x93,0x91,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x93, + 0x92,0x00,0x01,0xff,0xe2,0x93,0x93,0x00,0x10,0x08,0x01,0xff,0xe2,0x93,0x94,0x00, + 0x01,0xff,0xe2,0x93,0x95,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x93,0x96,0x00, + 0x01,0xff,0xe2,0x93,0x97,0x00,0x10,0x08,0x01,0xff,0xe2,0x93,0x98,0x00,0x01,0xff, + 0xe2,0x93,0x99,0x00,0xcf,0x86,0xe5,0x57,0x60,0x94,0x80,0xd3,0x40,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x01,0xff,0xe2,0x93,0x9a,0x00,0x01,0xff,0xe2,0x93,0x9b,0x00,0x10, + 0x08,0x01,0xff,0xe2,0x93,0x9c,0x00,0x01,0xff,0xe2,0x93,0x9d,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0xe2,0x93,0x9e,0x00,0x01,0xff,0xe2,0x93,0x9f,0x00,0x10,0x08,0x01, + 0xff,0xe2,0x93,0xa0,0x00,0x01,0xff,0xe2,0x93,0xa1,0x00,0xd2,0x20,0xd1,0x10,0x10, + 0x08,0x01,0xff,0xe2,0x93,0xa2,0x00,0x01,0xff,0xe2,0x93,0xa3,0x00,0x10,0x08,0x01, + 0xff,0xe2,0x93,0xa4,0x00,0x01,0xff,0xe2,0x93,0xa5,0x00,0xd1,0x10,0x10,0x08,0x01, + 0xff,0xe2,0x93,0xa6,0x00,0x01,0xff,0xe2,0x93,0xa7,0x00,0x10,0x08,0x01,0xff,0xe2, + 0x93,0xa8,0x00,0x01,0xff,0xe2,0x93,0xa9,0x00,0x01,0x00,0xd4,0x0c,0xe3,0x33,0x62, + 0xe2,0x2c,0x62,0xcf,0x06,0x04,0x00,0xe3,0x0c,0x65,0xe2,0xff,0x63,0xe1,0x2e,0x02, + 0xe0,0x84,0x01,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x08,0xff,0xe2,0xb0,0xb0,0x00,0x08,0xff,0xe2,0xb0,0xb1,0x00,0x10,0x08, + 0x08,0xff,0xe2,0xb0,0xb2,0x00,0x08,0xff,0xe2,0xb0,0xb3,0x00,0xd1,0x10,0x10,0x08, + 0x08,0xff,0xe2,0xb0,0xb4,0x00,0x08,0xff,0xe2,0xb0,0xb5,0x00,0x10,0x08,0x08,0xff, + 0xe2,0xb0,0xb6,0x00,0x08,0xff,0xe2,0xb0,0xb7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x08,0xff,0xe2,0xb0,0xb8,0x00,0x08,0xff,0xe2,0xb0,0xb9,0x00,0x10,0x08,0x08,0xff, + 0xe2,0xb0,0xba,0x00,0x08,0xff,0xe2,0xb0,0xbb,0x00,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe2,0xb0,0xbc,0x00,0x08,0xff,0xe2,0xb0,0xbd,0x00,0x10,0x08,0x08,0xff,0xe2,0xb0, + 0xbe,0x00,0x08,0xff,0xe2,0xb0,0xbf,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x08,0xff,0xe2,0xb1,0x80,0x00,0x08,0xff,0xe2,0xb1,0x81,0x00,0x10,0x08,0x08,0xff, + 0xe2,0xb1,0x82,0x00,0x08,0xff,0xe2,0xb1,0x83,0x00,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe2,0xb1,0x84,0x00,0x08,0xff,0xe2,0xb1,0x85,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1, + 0x86,0x00,0x08,0xff,0xe2,0xb1,0x87,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe2,0xb1,0x88,0x00,0x08,0xff,0xe2,0xb1,0x89,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1, + 0x8a,0x00,0x08,0xff,0xe2,0xb1,0x8b,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe2,0xb1, + 0x8c,0x00,0x08,0xff,0xe2,0xb1,0x8d,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1,0x8e,0x00, + 0x08,0xff,0xe2,0xb1,0x8f,0x00,0x94,0x7c,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x08,0xff,0xe2,0xb1,0x90,0x00,0x08,0xff,0xe2,0xb1,0x91,0x00,0x10,0x08,0x08,0xff, + 0xe2,0xb1,0x92,0x00,0x08,0xff,0xe2,0xb1,0x93,0x00,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe2,0xb1,0x94,0x00,0x08,0xff,0xe2,0xb1,0x95,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1, + 0x96,0x00,0x08,0xff,0xe2,0xb1,0x97,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe2,0xb1,0x98,0x00,0x08,0xff,0xe2,0xb1,0x99,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1, + 0x9a,0x00,0x08,0xff,0xe2,0xb1,0x9b,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe2,0xb1, + 0x9c,0x00,0x08,0xff,0xe2,0xb1,0x9d,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1,0x9e,0x00, + 0x00,0x00,0x08,0x00,0xcf,0x86,0xd5,0x07,0x64,0xef,0x61,0x08,0x00,0xd4,0x63,0xd3, + 0x32,0xd2,0x1b,0xd1,0x0c,0x10,0x08,0x09,0xff,0xe2,0xb1,0xa1,0x00,0x09,0x00,0x10, + 0x07,0x09,0xff,0xc9,0xab,0x00,0x09,0xff,0xe1,0xb5,0xbd,0x00,0xd1,0x0b,0x10,0x07, + 0x09,0xff,0xc9,0xbd,0x00,0x09,0x00,0x10,0x04,0x09,0x00,0x09,0xff,0xe2,0xb1,0xa8, + 0x00,0xd2,0x18,0xd1,0x0c,0x10,0x04,0x09,0x00,0x09,0xff,0xe2,0xb1,0xaa,0x00,0x10, + 0x04,0x09,0x00,0x09,0xff,0xe2,0xb1,0xac,0x00,0xd1,0x0b,0x10,0x04,0x09,0x00,0x0a, + 0xff,0xc9,0x91,0x00,0x10,0x07,0x0a,0xff,0xc9,0xb1,0x00,0x0a,0xff,0xc9,0x90,0x00, + 0xd3,0x27,0xd2,0x17,0xd1,0x0b,0x10,0x07,0x0b,0xff,0xc9,0x92,0x00,0x0a,0x00,0x10, + 0x08,0x0a,0xff,0xe2,0xb1,0xb3,0x00,0x0a,0x00,0x91,0x0c,0x10,0x04,0x09,0x00,0x09, + 0xff,0xe2,0xb1,0xb6,0x00,0x09,0x00,0x52,0x04,0x0a,0x00,0x51,0x04,0x0a,0x00,0x10, + 0x07,0x0b,0xff,0xc8,0xbf,0x00,0x0b,0xff,0xc9,0x80,0x00,0xe0,0x83,0x01,0xcf,0x86, + 0xd5,0xc0,0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2, + 0x81,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x83,0x00,0x08,0x00,0xd1,0x0c, + 0x10,0x08,0x08,0xff,0xe2,0xb2,0x85,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2, + 0x87,0x00,0x08,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0x89,0x00, + 0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x8b,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08, + 0x08,0xff,0xe2,0xb2,0x8d,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x8f,0x00, + 0x08,0x00,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0x91,0x00, + 0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x93,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08, + 0x08,0xff,0xe2,0xb2,0x95,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x97,0x00, + 0x08,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0x99,0x00,0x08,0x00, + 0x10,0x08,0x08,0xff,0xe2,0xb2,0x9b,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,0x08,0xff, + 0xe2,0xb2,0x9d,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x9f,0x00,0x08,0x00, + 0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0xa1,0x00, + 0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0xa3,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08, + 0x08,0xff,0xe2,0xb2,0xa5,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0xa7,0x00, + 0x08,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0xa9,0x00,0x08,0x00, + 0x10,0x08,0x08,0xff,0xe2,0xb2,0xab,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,0x08,0xff, + 0xe2,0xb2,0xad,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0xaf,0x00,0x08,0x00, + 0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0xb1,0x00,0x08,0x00, + 0x10,0x08,0x08,0xff,0xe2,0xb2,0xb3,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,0x08,0xff, + 0xe2,0xb2,0xb5,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0xb7,0x00,0x08,0x00, + 0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0xb9,0x00,0x08,0x00,0x10,0x08, + 0x08,0xff,0xe2,0xb2,0xbb,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2, + 0xbd,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0xbf,0x00,0x08,0x00,0xcf,0x86, + 0xd5,0xc0,0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb3, + 0x81,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x83,0x00,0x08,0x00,0xd1,0x0c, + 0x10,0x08,0x08,0xff,0xe2,0xb3,0x85,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3, + 0x87,0x00,0x08,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb3,0x89,0x00, + 0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x8b,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08, + 0x08,0xff,0xe2,0xb3,0x8d,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x8f,0x00, + 0x08,0x00,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb3,0x91,0x00, + 0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x93,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08, + 0x08,0xff,0xe2,0xb3,0x95,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x97,0x00, + 0x08,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb3,0x99,0x00,0x08,0x00, + 0x10,0x08,0x08,0xff,0xe2,0xb3,0x9b,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,0x08,0xff, + 0xe2,0xb3,0x9d,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x9f,0x00,0x08,0x00, + 0xd4,0x3b,0xd3,0x1c,0x92,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb3,0xa1,0x00, + 0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0xa3,0x00,0x08,0x00,0x08,0x00,0xd2,0x10, + 0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x0b,0xff,0xe2,0xb3,0xac,0x00,0xe1,0x3b, + 0x5f,0x10,0x04,0x0b,0x00,0x0b,0xff,0xe2,0xb3,0xae,0x00,0xe3,0x40,0x5f,0x92,0x10, + 0x51,0x04,0x0b,0xe6,0x10,0x08,0x0d,0xff,0xe2,0xb3,0xb3,0x00,0x0d,0x00,0x00,0x00, + 0xe2,0x98,0x08,0xd1,0x0b,0xe0,0x11,0x67,0xcf,0x86,0xcf,0x06,0x01,0x00,0xe0,0x65, + 0x6c,0xcf,0x86,0xe5,0xa7,0x05,0xd4,0x06,0xcf,0x06,0x04,0x00,0xd3,0x0c,0xe2,0xf8, + 0x67,0xe1,0x8f,0x67,0xcf,0x06,0x04,0x00,0xe2,0xdb,0x01,0xe1,0x26,0x01,0xd0,0x09, + 0xcf,0x86,0x65,0xf4,0x67,0x0a,0x00,0xcf,0x86,0xd5,0xc0,0xd4,0x60,0xd3,0x30,0xd2, + 0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x81,0x00,0x0a,0x00,0x10,0x08,0x0a, + 0xff,0xea,0x99,0x83,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x85, + 0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x99,0x87,0x00,0x0a,0x00,0xd2,0x18,0xd1, + 0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x89,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea, + 0x99,0x8b,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x8d,0x00,0x0a, + 0x00,0x10,0x08,0x0a,0xff,0xea,0x99,0x8f,0x00,0x0a,0x00,0xd3,0x30,0xd2,0x18,0xd1, + 0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x91,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea, + 0x99,0x93,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x95,0x00,0x0a, + 0x00,0x10,0x08,0x0a,0xff,0xea,0x99,0x97,0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10, + 0x08,0x0a,0xff,0xea,0x99,0x99,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x99,0x9b, + 0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x9d,0x00,0x0a,0x00,0x10, + 0x08,0x0a,0xff,0xea,0x99,0x9f,0x00,0x0a,0x00,0xe4,0x5d,0x67,0xd3,0x30,0xd2,0x18, + 0xd1,0x0c,0x10,0x08,0x0c,0xff,0xea,0x99,0xa1,0x00,0x0c,0x00,0x10,0x08,0x0a,0xff, + 0xea,0x99,0xa3,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0xa5,0x00, + 0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x99,0xa7,0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c, + 0x10,0x08,0x0a,0xff,0xea,0x99,0xa9,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x99, + 0xab,0x00,0x0a,0x00,0xe1,0x0c,0x67,0x10,0x08,0x0a,0xff,0xea,0x99,0xad,0x00,0x0a, + 0x00,0xe0,0x35,0x67,0xcf,0x86,0x95,0xab,0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c, + 0x10,0x08,0x0a,0xff,0xea,0x9a,0x81,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9a, + 0x83,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9a,0x85,0x00,0x0a,0x00, + 0x10,0x08,0x0a,0xff,0xea,0x9a,0x87,0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08, + 0x0a,0xff,0xea,0x9a,0x89,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9a,0x8b,0x00, + 0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9a,0x8d,0x00,0x0a,0x00,0x10,0x08, + 0x0a,0xff,0xea,0x9a,0x8f,0x00,0x0a,0x00,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08, + 0x0a,0xff,0xea,0x9a,0x91,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9a,0x93,0x00, + 0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9a,0x95,0x00,0x0a,0x00,0x10,0x08, + 0x0a,0xff,0xea,0x9a,0x97,0x00,0x0a,0x00,0xe2,0x92,0x66,0xd1,0x0c,0x10,0x08,0x10, + 0xff,0xea,0x9a,0x99,0x00,0x10,0x00,0x10,0x08,0x10,0xff,0xea,0x9a,0x9b,0x00,0x10, + 0x00,0x0b,0x00,0xe1,0x10,0x02,0xd0,0xb9,0xcf,0x86,0xd5,0x07,0x64,0x9e,0x66,0x08, + 0x00,0xd4,0x58,0xd3,0x28,0xd2,0x10,0x51,0x04,0x09,0x00,0x10,0x08,0x0a,0xff,0xea, + 0x9c,0xa3,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9c,0xa5,0x00,0x0a, + 0x00,0x10,0x08,0x0a,0xff,0xea,0x9c,0xa7,0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10, + 0x08,0x0a,0xff,0xea,0x9c,0xa9,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9c,0xab, + 0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9c,0xad,0x00,0x0a,0x00,0x10, + 0x08,0x0a,0xff,0xea,0x9c,0xaf,0x00,0x0a,0x00,0xd3,0x28,0xd2,0x10,0x51,0x04,0x0a, + 0x00,0x10,0x08,0x0a,0xff,0xea,0x9c,0xb3,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a, + 0xff,0xea,0x9c,0xb5,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9c,0xb7,0x00,0x0a, + 0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9c,0xb9,0x00,0x0a,0x00,0x10, + 0x08,0x0a,0xff,0xea,0x9c,0xbb,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea, + 0x9c,0xbd,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9c,0xbf,0x00,0x0a,0x00,0xcf, + 0x86,0xd5,0xc0,0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea, + 0x9d,0x81,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x83,0x00,0x0a,0x00,0xd1, + 0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0x85,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea, + 0x9d,0x87,0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0x89, + 0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x8b,0x00,0x0a,0x00,0xd1,0x0c,0x10, + 0x08,0x0a,0xff,0xea,0x9d,0x8d,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x8f, + 0x00,0x0a,0x00,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0x91, + 0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x93,0x00,0x0a,0x00,0xd1,0x0c,0x10, + 0x08,0x0a,0xff,0xea,0x9d,0x95,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x97, + 0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0x99,0x00,0x0a, + 0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x9b,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a, + 0xff,0xea,0x9d,0x9d,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x9f,0x00,0x0a, + 0x00,0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0xa1, + 0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0xa3,0x00,0x0a,0x00,0xd1,0x0c,0x10, + 0x08,0x0a,0xff,0xea,0x9d,0xa5,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0xa7, + 0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0xa9,0x00,0x0a, + 0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0xab,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a, + 0xff,0xea,0x9d,0xad,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0xaf,0x00,0x0a, + 0x00,0x53,0x04,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x04,0x0a,0x00,0x0a,0xff,0xea, + 0x9d,0xba,0x00,0x10,0x04,0x0a,0x00,0x0a,0xff,0xea,0x9d,0xbc,0x00,0xd1,0x0c,0x10, + 0x04,0x0a,0x00,0x0a,0xff,0xe1,0xb5,0xb9,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0xbf, + 0x00,0x0a,0x00,0xe0,0x71,0x01,0xcf,0x86,0xd5,0xa6,0xd4,0x4e,0xd3,0x30,0xd2,0x18, + 0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9e,0x81,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff, + 0xea,0x9e,0x83,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9e,0x85,0x00, + 0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9e,0x87,0x00,0x0a,0x00,0xd2,0x10,0x51,0x04, + 0x0a,0x00,0x10,0x04,0x0a,0x00,0x0a,0xff,0xea,0x9e,0x8c,0x00,0xe1,0x9a,0x64,0x10, + 0x04,0x0a,0x00,0x0c,0xff,0xc9,0xa5,0x00,0xd3,0x28,0xd2,0x18,0xd1,0x0c,0x10,0x08, + 0x0c,0xff,0xea,0x9e,0x91,0x00,0x0c,0x00,0x10,0x08,0x0d,0xff,0xea,0x9e,0x93,0x00, + 0x0d,0x00,0x51,0x04,0x10,0x00,0x10,0x08,0x10,0xff,0xea,0x9e,0x97,0x00,0x10,0x00, + 0xd2,0x18,0xd1,0x0c,0x10,0x08,0x10,0xff,0xea,0x9e,0x99,0x00,0x10,0x00,0x10,0x08, + 0x10,0xff,0xea,0x9e,0x9b,0x00,0x10,0x00,0xd1,0x0c,0x10,0x08,0x10,0xff,0xea,0x9e, + 0x9d,0x00,0x10,0x00,0x10,0x08,0x10,0xff,0xea,0x9e,0x9f,0x00,0x10,0x00,0xd4,0x63, + 0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0c,0xff,0xea,0x9e,0xa1,0x00,0x0c,0x00, + 0x10,0x08,0x0c,0xff,0xea,0x9e,0xa3,0x00,0x0c,0x00,0xd1,0x0c,0x10,0x08,0x0c,0xff, + 0xea,0x9e,0xa5,0x00,0x0c,0x00,0x10,0x08,0x0c,0xff,0xea,0x9e,0xa7,0x00,0x0c,0x00, + 0xd2,0x1a,0xd1,0x0c,0x10,0x08,0x0c,0xff,0xea,0x9e,0xa9,0x00,0x0c,0x00,0x10,0x07, + 0x0d,0xff,0xc9,0xa6,0x00,0x10,0xff,0xc9,0x9c,0x00,0xd1,0x0e,0x10,0x07,0x10,0xff, + 0xc9,0xa1,0x00,0x10,0xff,0xc9,0xac,0x00,0x10,0x07,0x12,0xff,0xc9,0xaa,0x00,0x14, + 0x00,0xd3,0x35,0xd2,0x1d,0xd1,0x0e,0x10,0x07,0x10,0xff,0xca,0x9e,0x00,0x10,0xff, + 0xca,0x87,0x00,0x10,0x07,0x11,0xff,0xca,0x9d,0x00,0x11,0xff,0xea,0xad,0x93,0x00, + 0xd1,0x0c,0x10,0x08,0x11,0xff,0xea,0x9e,0xb5,0x00,0x11,0x00,0x10,0x08,0x11,0xff, + 0xea,0x9e,0xb7,0x00,0x11,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x14,0xff,0xea,0x9e, + 0xb9,0x00,0x14,0x00,0x10,0x08,0x15,0xff,0xea,0x9e,0xbb,0x00,0x15,0x00,0xd1,0x0c, + 0x10,0x08,0x15,0xff,0xea,0x9e,0xbd,0x00,0x15,0x00,0x10,0x08,0x15,0xff,0xea,0x9e, + 0xbf,0x00,0x15,0x00,0xcf,0x86,0xe5,0xd4,0x63,0x94,0x2f,0x93,0x2b,0xd2,0x10,0x51, + 0x04,0x00,0x00,0x10,0x08,0x15,0xff,0xea,0x9f,0x83,0x00,0x15,0x00,0xd1,0x0f,0x10, + 0x08,0x15,0xff,0xea,0x9e,0x94,0x00,0x15,0xff,0xca,0x82,0x00,0x10,0x08,0x15,0xff, + 0xe1,0xb6,0x8e,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xe4,0xb4,0x66,0xd3,0x1d,0xe2, + 0x5b,0x64,0xe1,0x0a,0x64,0xe0,0xf7,0x63,0xcf,0x86,0xe5,0xd8,0x63,0x94,0x0b,0x93, + 0x07,0x62,0xc3,0x63,0x08,0x00,0x08,0x00,0x08,0x00,0xd2,0x0f,0xe1,0x5a,0x65,0xe0, + 0x27,0x65,0xcf,0x86,0x65,0x0c,0x65,0x0a,0x00,0xd1,0xab,0xd0,0x1a,0xcf,0x86,0xe5, + 0x17,0x66,0xe4,0xfa,0x65,0xe3,0xe1,0x65,0xe2,0xd4,0x65,0x91,0x08,0x10,0x04,0x00, + 0x00,0x0c,0x00,0x0c,0x00,0xcf,0x86,0x55,0x04,0x10,0x00,0xd4,0x0b,0x93,0x07,0x62, + 0x27,0x66,0x11,0x00,0x00,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x11,0xff, + 0xe1,0x8e,0xa0,0x00,0x11,0xff,0xe1,0x8e,0xa1,0x00,0x10,0x08,0x11,0xff,0xe1,0x8e, + 0xa2,0x00,0x11,0xff,0xe1,0x8e,0xa3,0x00,0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e, + 0xa4,0x00,0x11,0xff,0xe1,0x8e,0xa5,0x00,0x10,0x08,0x11,0xff,0xe1,0x8e,0xa6,0x00, + 0x11,0xff,0xe1,0x8e,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e, + 0xa8,0x00,0x11,0xff,0xe1,0x8e,0xa9,0x00,0x10,0x08,0x11,0xff,0xe1,0x8e,0xaa,0x00, + 0x11,0xff,0xe1,0x8e,0xab,0x00,0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e,0xac,0x00, + 0x11,0xff,0xe1,0x8e,0xad,0x00,0x10,0x08,0x11,0xff,0xe1,0x8e,0xae,0x00,0x11,0xff, + 0xe1,0x8e,0xaf,0x00,0xe0,0xb2,0x65,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40, + 0xd2,0x20,0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e,0xb0,0x00,0x11,0xff,0xe1,0x8e, + 0xb1,0x00,0x10,0x08,0x11,0xff,0xe1,0x8e,0xb2,0x00,0x11,0xff,0xe1,0x8e,0xb3,0x00, + 0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e,0xb4,0x00,0x11,0xff,0xe1,0x8e,0xb5,0x00, + 0x10,0x08,0x11,0xff,0xe1,0x8e,0xb6,0x00,0x11,0xff,0xe1,0x8e,0xb7,0x00,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e,0xb8,0x00,0x11,0xff,0xe1,0x8e,0xb9,0x00, + 0x10,0x08,0x11,0xff,0xe1,0x8e,0xba,0x00,0x11,0xff,0xe1,0x8e,0xbb,0x00,0xd1,0x10, + 0x10,0x08,0x11,0xff,0xe1,0x8e,0xbc,0x00,0x11,0xff,0xe1,0x8e,0xbd,0x00,0x10,0x08, + 0x11,0xff,0xe1,0x8e,0xbe,0x00,0x11,0xff,0xe1,0x8e,0xbf,0x00,0xd3,0x40,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8f,0x80,0x00,0x11,0xff,0xe1,0x8f,0x81,0x00, + 0x10,0x08,0x11,0xff,0xe1,0x8f,0x82,0x00,0x11,0xff,0xe1,0x8f,0x83,0x00,0xd1,0x10, + 0x10,0x08,0x11,0xff,0xe1,0x8f,0x84,0x00,0x11,0xff,0xe1,0x8f,0x85,0x00,0x10,0x08, + 0x11,0xff,0xe1,0x8f,0x86,0x00,0x11,0xff,0xe1,0x8f,0x87,0x00,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x11,0xff,0xe1,0x8f,0x88,0x00,0x11,0xff,0xe1,0x8f,0x89,0x00,0x10,0x08, + 0x11,0xff,0xe1,0x8f,0x8a,0x00,0x11,0xff,0xe1,0x8f,0x8b,0x00,0xd1,0x10,0x10,0x08, + 0x11,0xff,0xe1,0x8f,0x8c,0x00,0x11,0xff,0xe1,0x8f,0x8d,0x00,0x10,0x08,0x11,0xff, + 0xe1,0x8f,0x8e,0x00,0x11,0xff,0xe1,0x8f,0x8f,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8f,0x90,0x00,0x11,0xff,0xe1,0x8f,0x91,0x00, + 0x10,0x08,0x11,0xff,0xe1,0x8f,0x92,0x00,0x11,0xff,0xe1,0x8f,0x93,0x00,0xd1,0x10, + 0x10,0x08,0x11,0xff,0xe1,0x8f,0x94,0x00,0x11,0xff,0xe1,0x8f,0x95,0x00,0x10,0x08, + 0x11,0xff,0xe1,0x8f,0x96,0x00,0x11,0xff,0xe1,0x8f,0x97,0x00,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x11,0xff,0xe1,0x8f,0x98,0x00,0x11,0xff,0xe1,0x8f,0x99,0x00,0x10,0x08, + 0x11,0xff,0xe1,0x8f,0x9a,0x00,0x11,0xff,0xe1,0x8f,0x9b,0x00,0xd1,0x10,0x10,0x08, + 0x11,0xff,0xe1,0x8f,0x9c,0x00,0x11,0xff,0xe1,0x8f,0x9d,0x00,0x10,0x08,0x11,0xff, + 0xe1,0x8f,0x9e,0x00,0x11,0xff,0xe1,0x8f,0x9f,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x11,0xff,0xe1,0x8f,0xa0,0x00,0x11,0xff,0xe1,0x8f,0xa1,0x00,0x10,0x08, + 0x11,0xff,0xe1,0x8f,0xa2,0x00,0x11,0xff,0xe1,0x8f,0xa3,0x00,0xd1,0x10,0x10,0x08, + 0x11,0xff,0xe1,0x8f,0xa4,0x00,0x11,0xff,0xe1,0x8f,0xa5,0x00,0x10,0x08,0x11,0xff, + 0xe1,0x8f,0xa6,0x00,0x11,0xff,0xe1,0x8f,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x11,0xff,0xe1,0x8f,0xa8,0x00,0x11,0xff,0xe1,0x8f,0xa9,0x00,0x10,0x08,0x11,0xff, + 0xe1,0x8f,0xaa,0x00,0x11,0xff,0xe1,0x8f,0xab,0x00,0xd1,0x10,0x10,0x08,0x11,0xff, + 0xe1,0x8f,0xac,0x00,0x11,0xff,0xe1,0x8f,0xad,0x00,0x10,0x08,0x11,0xff,0xe1,0x8f, + 0xae,0x00,0x11,0xff,0xe1,0x8f,0xaf,0x00,0xd1,0x0c,0xe0,0xeb,0x63,0xcf,0x86,0xcf, + 0x06,0x02,0xff,0xff,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x06, + 0xcf,0x06,0x01,0x00,0xd4,0xae,0xd3,0x09,0xe2,0x54,0x64,0xcf,0x06,0x01,0x00,0xd2, + 0x27,0xe1,0x1f,0x70,0xe0,0x26,0x6e,0xcf,0x86,0xe5,0x3f,0x6d,0xe4,0xce,0x6c,0xe3, + 0x99,0x6c,0xe2,0x78,0x6c,0xe1,0x67,0x6c,0x10,0x08,0x01,0xff,0xe5,0x88,0x87,0x00, + 0x01,0xff,0xe5,0xba,0xa6,0x00,0xe1,0x74,0x74,0xe0,0xe8,0x73,0xcf,0x86,0xe5,0x22, + 0x73,0xd4,0x3b,0x93,0x37,0xd2,0x1d,0xd1,0x0e,0x10,0x07,0x01,0xff,0x66,0x66,0x00, + 0x01,0xff,0x66,0x69,0x00,0x10,0x07,0x01,0xff,0x66,0x6c,0x00,0x01,0xff,0x66,0x66, + 0x69,0x00,0xd1,0x0f,0x10,0x08,0x01,0xff,0x66,0x66,0x6c,0x00,0x01,0xff,0x73,0x74, + 0x00,0x10,0x07,0x01,0xff,0x73,0x74,0x00,0x00,0x00,0x00,0x00,0xe3,0xc8,0x72,0xd2, + 0x11,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0xff,0xd5,0xb4,0xd5,0xb6,0x00, + 0xd1,0x12,0x10,0x09,0x01,0xff,0xd5,0xb4,0xd5,0xa5,0x00,0x01,0xff,0xd5,0xb4,0xd5, + 0xab,0x00,0x10,0x09,0x01,0xff,0xd5,0xbe,0xd5,0xb6,0x00,0x01,0xff,0xd5,0xb4,0xd5, + 0xad,0x00,0xd3,0x09,0xe2,0x40,0x74,0xcf,0x06,0x01,0x00,0xd2,0x13,0xe1,0x30,0x75, + 0xe0,0xc1,0x74,0xcf,0x86,0xe5,0x9e,0x74,0x64,0x8d,0x74,0x06,0xff,0x00,0xe1,0x96, + 0x75,0xe0,0x63,0x75,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x7c, + 0xd3,0x3c,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0xef,0xbd,0x81,0x00, + 0x10,0x08,0x01,0xff,0xef,0xbd,0x82,0x00,0x01,0xff,0xef,0xbd,0x83,0x00,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xef,0xbd,0x84,0x00,0x01,0xff,0xef,0xbd,0x85,0x00,0x10,0x08, + 0x01,0xff,0xef,0xbd,0x86,0x00,0x01,0xff,0xef,0xbd,0x87,0x00,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xef,0xbd,0x88,0x00,0x01,0xff,0xef,0xbd,0x89,0x00,0x10,0x08, + 0x01,0xff,0xef,0xbd,0x8a,0x00,0x01,0xff,0xef,0xbd,0x8b,0x00,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xef,0xbd,0x8c,0x00,0x01,0xff,0xef,0xbd,0x8d,0x00,0x10,0x08,0x01,0xff, + 0xef,0xbd,0x8e,0x00,0x01,0xff,0xef,0xbd,0x8f,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xef,0xbd,0x90,0x00,0x01,0xff,0xef,0xbd,0x91,0x00,0x10,0x08, + 0x01,0xff,0xef,0xbd,0x92,0x00,0x01,0xff,0xef,0xbd,0x93,0x00,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xef,0xbd,0x94,0x00,0x01,0xff,0xef,0xbd,0x95,0x00,0x10,0x08,0x01,0xff, + 0xef,0xbd,0x96,0x00,0x01,0xff,0xef,0xbd,0x97,0x00,0x92,0x1c,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xef,0xbd,0x98,0x00,0x01,0xff,0xef,0xbd,0x99,0x00,0x10,0x08,0x01,0xff, + 0xef,0xbd,0x9a,0x00,0x01,0x00,0x01,0x00,0x83,0xe2,0x87,0xb3,0xe1,0x60,0xb0,0xe0, + 0xdd,0xae,0xcf,0x86,0xe5,0x81,0x9b,0xc4,0xe3,0xc1,0x07,0xe2,0x62,0x06,0xe1,0x11, + 0x86,0xe0,0x09,0x05,0xcf,0x86,0xe5,0xfb,0x02,0xd4,0x1c,0xe3,0x7f,0x76,0xe2,0xd6, + 0x75,0xe1,0xb1,0x75,0xe0,0x8a,0x75,0xcf,0x86,0xe5,0x57,0x75,0x94,0x07,0x63,0x42, + 0x75,0x07,0x00,0x07,0x00,0xe3,0x2b,0x78,0xe2,0xf0,0x77,0xe1,0x77,0x01,0xe0,0x88, + 0x77,0xcf,0x86,0xe5,0x21,0x01,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09, + 0x05,0xff,0xf0,0x90,0x90,0xa8,0x00,0x05,0xff,0xf0,0x90,0x90,0xa9,0x00,0x10,0x09, + 0x05,0xff,0xf0,0x90,0x90,0xaa,0x00,0x05,0xff,0xf0,0x90,0x90,0xab,0x00,0xd1,0x12, + 0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xac,0x00,0x05,0xff,0xf0,0x90,0x90,0xad,0x00, + 0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xae,0x00,0x05,0xff,0xf0,0x90,0x90,0xaf,0x00, + 0xd2,0x24,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xb0,0x00,0x05,0xff,0xf0, + 0x90,0x90,0xb1,0x00,0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xb2,0x00,0x05,0xff,0xf0, + 0x90,0x90,0xb3,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xb4,0x00,0x05, + 0xff,0xf0,0x90,0x90,0xb5,0x00,0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xb6,0x00,0x05, + 0xff,0xf0,0x90,0x90,0xb7,0x00,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x05,0xff, + 0xf0,0x90,0x90,0xb8,0x00,0x05,0xff,0xf0,0x90,0x90,0xb9,0x00,0x10,0x09,0x05,0xff, + 0xf0,0x90,0x90,0xba,0x00,0x05,0xff,0xf0,0x90,0x90,0xbb,0x00,0xd1,0x12,0x10,0x09, + 0x05,0xff,0xf0,0x90,0x90,0xbc,0x00,0x05,0xff,0xf0,0x90,0x90,0xbd,0x00,0x10,0x09, + 0x05,0xff,0xf0,0x90,0x90,0xbe,0x00,0x05,0xff,0xf0,0x90,0x90,0xbf,0x00,0xd2,0x24, + 0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0x90,0x91,0x80,0x00,0x05,0xff,0xf0,0x90,0x91, + 0x81,0x00,0x10,0x09,0x05,0xff,0xf0,0x90,0x91,0x82,0x00,0x05,0xff,0xf0,0x90,0x91, + 0x83,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0x90,0x91,0x84,0x00,0x05,0xff,0xf0, + 0x90,0x91,0x85,0x00,0x10,0x09,0x05,0xff,0xf0,0x90,0x91,0x86,0x00,0x05,0xff,0xf0, + 0x90,0x91,0x87,0x00,0x94,0x4c,0x93,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x05,0xff, + 0xf0,0x90,0x91,0x88,0x00,0x05,0xff,0xf0,0x90,0x91,0x89,0x00,0x10,0x09,0x05,0xff, + 0xf0,0x90,0x91,0x8a,0x00,0x05,0xff,0xf0,0x90,0x91,0x8b,0x00,0xd1,0x12,0x10,0x09, + 0x05,0xff,0xf0,0x90,0x91,0x8c,0x00,0x05,0xff,0xf0,0x90,0x91,0x8d,0x00,0x10,0x09, + 0x07,0xff,0xf0,0x90,0x91,0x8e,0x00,0x07,0xff,0xf0,0x90,0x91,0x8f,0x00,0x05,0x00, + 0x05,0x00,0xd0,0xa0,0xcf,0x86,0xd5,0x07,0x64,0x30,0x76,0x07,0x00,0xd4,0x07,0x63, + 0x3d,0x76,0x07,0x00,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x90, + 0x93,0x98,0x00,0x12,0xff,0xf0,0x90,0x93,0x99,0x00,0x10,0x09,0x12,0xff,0xf0,0x90, + 0x93,0x9a,0x00,0x12,0xff,0xf0,0x90,0x93,0x9b,0x00,0xd1,0x12,0x10,0x09,0x12,0xff, + 0xf0,0x90,0x93,0x9c,0x00,0x12,0xff,0xf0,0x90,0x93,0x9d,0x00,0x10,0x09,0x12,0xff, + 0xf0,0x90,0x93,0x9e,0x00,0x12,0xff,0xf0,0x90,0x93,0x9f,0x00,0xd2,0x24,0xd1,0x12, + 0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xa0,0x00,0x12,0xff,0xf0,0x90,0x93,0xa1,0x00, + 0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xa2,0x00,0x12,0xff,0xf0,0x90,0x93,0xa3,0x00, + 0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xa4,0x00,0x12,0xff,0xf0,0x90,0x93, + 0xa5,0x00,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xa6,0x00,0x12,0xff,0xf0,0x90,0x93, + 0xa7,0x00,0xcf,0x86,0xe5,0xc6,0x75,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10, + 0x09,0x12,0xff,0xf0,0x90,0x93,0xa8,0x00,0x12,0xff,0xf0,0x90,0x93,0xa9,0x00,0x10, + 0x09,0x12,0xff,0xf0,0x90,0x93,0xaa,0x00,0x12,0xff,0xf0,0x90,0x93,0xab,0x00,0xd1, + 0x12,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xac,0x00,0x12,0xff,0xf0,0x90,0x93,0xad, + 0x00,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xae,0x00,0x12,0xff,0xf0,0x90,0x93,0xaf, + 0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xb0,0x00,0x12,0xff, + 0xf0,0x90,0x93,0xb1,0x00,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xb2,0x00,0x12,0xff, + 0xf0,0x90,0x93,0xb3,0x00,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xb4,0x00, + 0x12,0xff,0xf0,0x90,0x93,0xb5,0x00,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xb6,0x00, + 0x12,0xff,0xf0,0x90,0x93,0xb7,0x00,0x93,0x28,0x92,0x24,0xd1,0x12,0x10,0x09,0x12, + 0xff,0xf0,0x90,0x93,0xb8,0x00,0x12,0xff,0xf0,0x90,0x93,0xb9,0x00,0x10,0x09,0x12, + 0xff,0xf0,0x90,0x93,0xba,0x00,0x12,0xff,0xf0,0x90,0x93,0xbb,0x00,0x00,0x00,0x12, + 0x00,0xd4,0x1f,0xe3,0xdf,0x76,0xe2,0x6a,0x76,0xe1,0x09,0x76,0xe0,0xea,0x75,0xcf, + 0x86,0xe5,0xb7,0x75,0x94,0x0a,0xe3,0xa2,0x75,0x62,0x99,0x75,0x07,0x00,0x07,0x00, + 0xe3,0xde,0x78,0xe2,0xaf,0x78,0xd1,0x09,0xe0,0x4c,0x78,0xcf,0x06,0x0b,0x00,0xe0, + 0x7f,0x78,0xcf,0x86,0xe5,0x21,0x01,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10, + 0x09,0x11,0xff,0xf0,0x90,0xb3,0x80,0x00,0x11,0xff,0xf0,0x90,0xb3,0x81,0x00,0x10, + 0x09,0x11,0xff,0xf0,0x90,0xb3,0x82,0x00,0x11,0xff,0xf0,0x90,0xb3,0x83,0x00,0xd1, + 0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x84,0x00,0x11,0xff,0xf0,0x90,0xb3,0x85, + 0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x86,0x00,0x11,0xff,0xf0,0x90,0xb3,0x87, + 0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x88,0x00,0x11,0xff, + 0xf0,0x90,0xb3,0x89,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x8a,0x00,0x11,0xff, + 0xf0,0x90,0xb3,0x8b,0x00,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x8c,0x00, + 0x11,0xff,0xf0,0x90,0xb3,0x8d,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x8e,0x00, + 0x11,0xff,0xf0,0x90,0xb3,0x8f,0x00,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x11, + 0xff,0xf0,0x90,0xb3,0x90,0x00,0x11,0xff,0xf0,0x90,0xb3,0x91,0x00,0x10,0x09,0x11, + 0xff,0xf0,0x90,0xb3,0x92,0x00,0x11,0xff,0xf0,0x90,0xb3,0x93,0x00,0xd1,0x12,0x10, + 0x09,0x11,0xff,0xf0,0x90,0xb3,0x94,0x00,0x11,0xff,0xf0,0x90,0xb3,0x95,0x00,0x10, + 0x09,0x11,0xff,0xf0,0x90,0xb3,0x96,0x00,0x11,0xff,0xf0,0x90,0xb3,0x97,0x00,0xd2, + 0x24,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x98,0x00,0x11,0xff,0xf0,0x90, + 0xb3,0x99,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x9a,0x00,0x11,0xff,0xf0,0x90, + 0xb3,0x9b,0x00,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x9c,0x00,0x11,0xff, + 0xf0,0x90,0xb3,0x9d,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x9e,0x00,0x11,0xff, + 0xf0,0x90,0xb3,0x9f,0x00,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x11, + 0xff,0xf0,0x90,0xb3,0xa0,0x00,0x11,0xff,0xf0,0x90,0xb3,0xa1,0x00,0x10,0x09,0x11, + 0xff,0xf0,0x90,0xb3,0xa2,0x00,0x11,0xff,0xf0,0x90,0xb3,0xa3,0x00,0xd1,0x12,0x10, + 0x09,0x11,0xff,0xf0,0x90,0xb3,0xa4,0x00,0x11,0xff,0xf0,0x90,0xb3,0xa5,0x00,0x10, + 0x09,0x11,0xff,0xf0,0x90,0xb3,0xa6,0x00,0x11,0xff,0xf0,0x90,0xb3,0xa7,0x00,0xd2, + 0x24,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0xa8,0x00,0x11,0xff,0xf0,0x90, + 0xb3,0xa9,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0xaa,0x00,0x11,0xff,0xf0,0x90, + 0xb3,0xab,0x00,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0xac,0x00,0x11,0xff, + 0xf0,0x90,0xb3,0xad,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0xae,0x00,0x11,0xff, + 0xf0,0x90,0xb3,0xaf,0x00,0x93,0x23,0x92,0x1f,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0, + 0x90,0xb3,0xb0,0x00,0x11,0xff,0xf0,0x90,0xb3,0xb1,0x00,0x10,0x09,0x11,0xff,0xf0, + 0x90,0xb3,0xb2,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x15,0xe4,0x91, + 0x7b,0xe3,0x9b,0x79,0xe2,0x94,0x78,0xe1,0xe4,0x77,0xe0,0x9d,0x77,0xcf,0x06,0x0c, + 0x00,0xe4,0xeb,0x7e,0xe3,0x44,0x7e,0xe2,0xed,0x7d,0xd1,0x0c,0xe0,0xb2,0x7d,0xcf, + 0x86,0x65,0x93,0x7d,0x14,0x00,0xe0,0xb6,0x7d,0xcf,0x86,0x55,0x04,0x00,0x00,0xd4, + 0x90,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x80,0x00, + 0x10,0xff,0xf0,0x91,0xa3,0x81,0x00,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x82,0x00, + 0x10,0xff,0xf0,0x91,0xa3,0x83,0x00,0xd1,0x12,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3, + 0x84,0x00,0x10,0xff,0xf0,0x91,0xa3,0x85,0x00,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3, + 0x86,0x00,0x10,0xff,0xf0,0x91,0xa3,0x87,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x10, + 0xff,0xf0,0x91,0xa3,0x88,0x00,0x10,0xff,0xf0,0x91,0xa3,0x89,0x00,0x10,0x09,0x10, + 0xff,0xf0,0x91,0xa3,0x8a,0x00,0x10,0xff,0xf0,0x91,0xa3,0x8b,0x00,0xd1,0x12,0x10, + 0x09,0x10,0xff,0xf0,0x91,0xa3,0x8c,0x00,0x10,0xff,0xf0,0x91,0xa3,0x8d,0x00,0x10, + 0x09,0x10,0xff,0xf0,0x91,0xa3,0x8e,0x00,0x10,0xff,0xf0,0x91,0xa3,0x8f,0x00,0xd3, + 0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x90,0x00,0x10,0xff, + 0xf0,0x91,0xa3,0x91,0x00,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x92,0x00,0x10,0xff, + 0xf0,0x91,0xa3,0x93,0x00,0xd1,0x12,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x94,0x00, + 0x10,0xff,0xf0,0x91,0xa3,0x95,0x00,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x96,0x00, + 0x10,0xff,0xf0,0x91,0xa3,0x97,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x10,0xff,0xf0, + 0x91,0xa3,0x98,0x00,0x10,0xff,0xf0,0x91,0xa3,0x99,0x00,0x10,0x09,0x10,0xff,0xf0, + 0x91,0xa3,0x9a,0x00,0x10,0xff,0xf0,0x91,0xa3,0x9b,0x00,0xd1,0x12,0x10,0x09,0x10, + 0xff,0xf0,0x91,0xa3,0x9c,0x00,0x10,0xff,0xf0,0x91,0xa3,0x9d,0x00,0x10,0x09,0x10, + 0xff,0xf0,0x91,0xa3,0x9e,0x00,0x10,0xff,0xf0,0x91,0xa3,0x9f,0x00,0xd1,0x11,0xe0, + 0x12,0x81,0xcf,0x86,0xe5,0x09,0x81,0xe4,0xd2,0x80,0xcf,0x06,0x00,0x00,0xe0,0xdb, + 0x82,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x09,0xe3,0x10,0x81,0xcf,0x06, + 0x0c,0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xe2,0x3b,0x82,0xe1,0x16,0x82,0xd0,0x06, + 0xcf,0x06,0x00,0x00,0xcf,0x86,0xa5,0x21,0x01,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1, + 0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xa0,0x00,0x14,0xff,0xf0,0x96,0xb9,0xa1, + 0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xa2,0x00,0x14,0xff,0xf0,0x96,0xb9,0xa3, + 0x00,0xd1,0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xa4,0x00,0x14,0xff,0xf0,0x96, + 0xb9,0xa5,0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xa6,0x00,0x14,0xff,0xf0,0x96, + 0xb9,0xa7,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xa8,0x00, + 0x14,0xff,0xf0,0x96,0xb9,0xa9,0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xaa,0x00, + 0x14,0xff,0xf0,0x96,0xb9,0xab,0x00,0xd1,0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9, + 0xac,0x00,0x14,0xff,0xf0,0x96,0xb9,0xad,0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9, + 0xae,0x00,0x14,0xff,0xf0,0x96,0xb9,0xaf,0x00,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10, + 0x09,0x14,0xff,0xf0,0x96,0xb9,0xb0,0x00,0x14,0xff,0xf0,0x96,0xb9,0xb1,0x00,0x10, + 0x09,0x14,0xff,0xf0,0x96,0xb9,0xb2,0x00,0x14,0xff,0xf0,0x96,0xb9,0xb3,0x00,0xd1, + 0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xb4,0x00,0x14,0xff,0xf0,0x96,0xb9,0xb5, + 0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xb6,0x00,0x14,0xff,0xf0,0x96,0xb9,0xb7, + 0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xb8,0x00,0x14,0xff, + 0xf0,0x96,0xb9,0xb9,0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xba,0x00,0x14,0xff, + 0xf0,0x96,0xb9,0xbb,0x00,0xd1,0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xbc,0x00, + 0x14,0xff,0xf0,0x96,0xb9,0xbd,0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xbe,0x00, + 0x14,0xff,0xf0,0x96,0xb9,0xbf,0x00,0x14,0x00,0xd2,0x14,0xe1,0x25,0x82,0xe0,0x1c, + 0x82,0xcf,0x86,0xe5,0xdd,0x81,0xe4,0x9a,0x81,0xcf,0x06,0x12,0x00,0xd1,0x0b,0xe0, + 0x51,0x83,0xcf,0x86,0xcf,0x06,0x00,0x00,0xe0,0x95,0x8b,0xcf,0x86,0xd5,0x22,0xe4, + 0xd0,0x88,0xe3,0x93,0x88,0xe2,0x38,0x88,0xe1,0x31,0x88,0xe0,0x2a,0x88,0xcf,0x86, + 0xe5,0xfb,0x87,0xe4,0xe2,0x87,0x93,0x07,0x62,0xd1,0x87,0x12,0xe6,0x12,0xe6,0xe4, + 0x36,0x89,0xe3,0x2f,0x89,0xd2,0x09,0xe1,0xb8,0x88,0xcf,0x06,0x10,0x00,0xe1,0x1f, + 0x89,0xe0,0xec,0x88,0xcf,0x86,0xe5,0x21,0x01,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1, + 0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xa2,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xa3, + 0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xa4,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xa5, + 0x00,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xa6,0x00,0x12,0xff,0xf0,0x9e, + 0xa4,0xa7,0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xa8,0x00,0x12,0xff,0xf0,0x9e, + 0xa4,0xa9,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xaa,0x00, + 0x12,0xff,0xf0,0x9e,0xa4,0xab,0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xac,0x00, + 0x12,0xff,0xf0,0x9e,0xa4,0xad,0x00,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4, + 0xae,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xaf,0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4, + 0xb0,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xb1,0x00,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10, + 0x09,0x12,0xff,0xf0,0x9e,0xa4,0xb2,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xb3,0x00,0x10, + 0x09,0x12,0xff,0xf0,0x9e,0xa4,0xb4,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xb5,0x00,0xd1, + 0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xb6,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xb7, + 0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xb8,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xb9, + 0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xba,0x00,0x12,0xff, + 0xf0,0x9e,0xa4,0xbb,0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xbc,0x00,0x12,0xff, + 0xf0,0x9e,0xa4,0xbd,0x00,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xbe,0x00, + 0x12,0xff,0xf0,0x9e,0xa4,0xbf,0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa5,0x80,0x00, + 0x12,0xff,0xf0,0x9e,0xa5,0x81,0x00,0x94,0x1e,0x93,0x1a,0x92,0x16,0x91,0x12,0x10, + 0x09,0x12,0xff,0xf0,0x9e,0xa5,0x82,0x00,0x12,0xff,0xf0,0x9e,0xa5,0x83,0x00,0x12, + 0x00,0x12,0x00,0x12,0x00,0x12,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + /* nfdi_c0100 */ + 0x57,0x04,0x01,0x00,0xc6,0xe5,0xac,0x13,0xe4,0x41,0x0c,0xe3,0x7a,0x07,0xe2,0xf3, + 0x01,0xc1,0xd0,0x1f,0xcf,0x86,0x55,0x04,0x01,0x00,0x94,0x15,0x53,0x04,0x01,0x00, + 0x52,0x04,0x01,0x00,0x91,0x09,0x10,0x04,0x01,0x00,0x01,0xff,0x00,0x01,0x00,0x01, + 0x00,0xcf,0x86,0xd5,0xe4,0xd4,0x7c,0xd3,0x3c,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x41,0xcc,0x80,0x00,0x01,0xff,0x41,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x41, + 0xcc,0x82,0x00,0x01,0xff,0x41,0xcc,0x83,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x41, + 0xcc,0x88,0x00,0x01,0xff,0x41,0xcc,0x8a,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0x43, + 0xcc,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x45,0xcc,0x80,0x00,0x01, + 0xff,0x45,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x45,0xcc,0x82,0x00,0x01,0xff,0x45, + 0xcc,0x88,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x49,0xcc,0x80,0x00,0x01,0xff,0x49, + 0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x49,0xcc,0x82,0x00,0x01,0xff,0x49,0xcc,0x88, + 0x00,0xd3,0x38,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x4e,0xcc,0x83, + 0x00,0x10,0x08,0x01,0xff,0x4f,0xcc,0x80,0x00,0x01,0xff,0x4f,0xcc,0x81,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x4f,0xcc,0x82,0x00,0x01,0xff,0x4f,0xcc,0x83,0x00,0x10, + 0x08,0x01,0xff,0x4f,0xcc,0x88,0x00,0x01,0x00,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01, + 0x00,0x01,0xff,0x55,0xcc,0x80,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0x81,0x00,0x01, + 0xff,0x55,0xcc,0x82,0x00,0x91,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0x88,0x00,0x01, + 0xff,0x59,0xcc,0x81,0x00,0x01,0x00,0xd4,0x7c,0xd3,0x3c,0xd2,0x20,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x61,0xcc,0x80,0x00,0x01,0xff,0x61,0xcc,0x81,0x00,0x10,0x08,0x01, + 0xff,0x61,0xcc,0x82,0x00,0x01,0xff,0x61,0xcc,0x83,0x00,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x61,0xcc,0x88,0x00,0x01,0xff,0x61,0xcc,0x8a,0x00,0x10,0x04,0x01,0x00,0x01, + 0xff,0x63,0xcc,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x65,0xcc,0x80, + 0x00,0x01,0xff,0x65,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,0x82,0x00,0x01, + 0xff,0x65,0xcc,0x88,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,0x80,0x00,0x01, + 0xff,0x69,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x69,0xcc,0x82,0x00,0x01,0xff,0x69, + 0xcc,0x88,0x00,0xd3,0x38,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x6e, + 0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x80,0x00,0x01,0xff,0x6f,0xcc,0x81, + 0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x82,0x00,0x01,0xff,0x6f,0xcc,0x83, + 0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x88,0x00,0x01,0x00,0xd2,0x1c,0xd1,0x0c,0x10, + 0x04,0x01,0x00,0x01,0xff,0x75,0xcc,0x80,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0x81, + 0x00,0x01,0xff,0x75,0xcc,0x82,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc,0x88, + 0x00,0x01,0xff,0x79,0xcc,0x81,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0x79,0xcc,0x88, + 0x00,0xe1,0x9a,0x03,0xe0,0xd3,0x01,0xcf,0x86,0xd5,0xf4,0xd4,0x80,0xd3,0x40,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x41,0xcc,0x84,0x00,0x01,0xff,0x61,0xcc,0x84, + 0x00,0x10,0x08,0x01,0xff,0x41,0xcc,0x86,0x00,0x01,0xff,0x61,0xcc,0x86,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x41,0xcc,0xa8,0x00,0x01,0xff,0x61,0xcc,0xa8,0x00,0x10, + 0x08,0x01,0xff,0x43,0xcc,0x81,0x00,0x01,0xff,0x63,0xcc,0x81,0x00,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x43,0xcc,0x82,0x00,0x01,0xff,0x63,0xcc,0x82,0x00,0x10, + 0x08,0x01,0xff,0x43,0xcc,0x87,0x00,0x01,0xff,0x63,0xcc,0x87,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x43,0xcc,0x8c,0x00,0x01,0xff,0x63,0xcc,0x8c,0x00,0x10,0x08,0x01, + 0xff,0x44,0xcc,0x8c,0x00,0x01,0xff,0x64,0xcc,0x8c,0x00,0xd3,0x34,0xd2,0x14,0x51, + 0x04,0x01,0x00,0x10,0x08,0x01,0xff,0x45,0xcc,0x84,0x00,0x01,0xff,0x65,0xcc,0x84, + 0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x45,0xcc,0x86,0x00,0x01,0xff,0x65,0xcc,0x86, + 0x00,0x10,0x08,0x01,0xff,0x45,0xcc,0x87,0x00,0x01,0xff,0x65,0xcc,0x87,0x00,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x45,0xcc,0xa8,0x00,0x01,0xff,0x65,0xcc,0xa8, + 0x00,0x10,0x08,0x01,0xff,0x45,0xcc,0x8c,0x00,0x01,0xff,0x65,0xcc,0x8c,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x47,0xcc,0x82,0x00,0x01,0xff,0x67,0xcc,0x82,0x00,0x10, + 0x08,0x01,0xff,0x47,0xcc,0x86,0x00,0x01,0xff,0x67,0xcc,0x86,0x00,0xd4,0x74,0xd3, + 0x34,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x47,0xcc,0x87,0x00,0x01,0xff,0x67, + 0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x47,0xcc,0xa7,0x00,0x01,0xff,0x67,0xcc,0xa7, + 0x00,0x91,0x10,0x10,0x08,0x01,0xff,0x48,0xcc,0x82,0x00,0x01,0xff,0x68,0xcc,0x82, + 0x00,0x01,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x49,0xcc,0x83,0x00,0x01, + 0xff,0x69,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x49,0xcc,0x84,0x00,0x01,0xff,0x69, + 0xcc,0x84,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x49,0xcc,0x86,0x00,0x01,0xff,0x69, + 0xcc,0x86,0x00,0x10,0x08,0x01,0xff,0x49,0xcc,0xa8,0x00,0x01,0xff,0x69,0xcc,0xa8, + 0x00,0xd3,0x30,0xd2,0x10,0x91,0x0c,0x10,0x08,0x01,0xff,0x49,0xcc,0x87,0x00,0x01, + 0x00,0x01,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x4a,0xcc,0x82,0x00,0x01,0xff,0x6a, + 0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x4b,0xcc,0xa7,0x00,0x01,0xff,0x6b,0xcc,0xa7, + 0x00,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x4c,0xcc,0x81,0x00,0x10, + 0x08,0x01,0xff,0x6c,0xcc,0x81,0x00,0x01,0xff,0x4c,0xcc,0xa7,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x6c,0xcc,0xa7,0x00,0x01,0xff,0x4c,0xcc,0x8c,0x00,0x10,0x08,0x01, + 0xff,0x6c,0xcc,0x8c,0x00,0x01,0x00,0xcf,0x86,0xd5,0xd4,0xd4,0x60,0xd3,0x30,0xd2, + 0x10,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0x4e,0xcc,0x81,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x6e,0xcc,0x81,0x00,0x01,0xff,0x4e,0xcc,0xa7,0x00,0x10, + 0x08,0x01,0xff,0x6e,0xcc,0xa7,0x00,0x01,0xff,0x4e,0xcc,0x8c,0x00,0xd2,0x10,0x91, + 0x0c,0x10,0x08,0x01,0xff,0x6e,0xcc,0x8c,0x00,0x01,0x00,0x01,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x4f,0xcc,0x84,0x00,0x01,0xff,0x6f,0xcc,0x84,0x00,0x10,0x08,0x01, + 0xff,0x4f,0xcc,0x86,0x00,0x01,0xff,0x6f,0xcc,0x86,0x00,0xd3,0x34,0xd2,0x14,0x91, + 0x10,0x10,0x08,0x01,0xff,0x4f,0xcc,0x8b,0x00,0x01,0xff,0x6f,0xcc,0x8b,0x00,0x01, + 0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x52,0xcc,0x81,0x00,0x01,0xff,0x72,0xcc,0x81, + 0x00,0x10,0x08,0x01,0xff,0x52,0xcc,0xa7,0x00,0x01,0xff,0x72,0xcc,0xa7,0x00,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x52,0xcc,0x8c,0x00,0x01,0xff,0x72,0xcc,0x8c, + 0x00,0x10,0x08,0x01,0xff,0x53,0xcc,0x81,0x00,0x01,0xff,0x73,0xcc,0x81,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x53,0xcc,0x82,0x00,0x01,0xff,0x73,0xcc,0x82,0x00,0x10, + 0x08,0x01,0xff,0x53,0xcc,0xa7,0x00,0x01,0xff,0x73,0xcc,0xa7,0x00,0xd4,0x74,0xd3, + 0x34,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x53,0xcc,0x8c,0x00,0x01,0xff,0x73, + 0xcc,0x8c,0x00,0x10,0x08,0x01,0xff,0x54,0xcc,0xa7,0x00,0x01,0xff,0x74,0xcc,0xa7, + 0x00,0x91,0x10,0x10,0x08,0x01,0xff,0x54,0xcc,0x8c,0x00,0x01,0xff,0x74,0xcc,0x8c, + 0x00,0x01,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0x83,0x00,0x01, + 0xff,0x75,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0x84,0x00,0x01,0xff,0x75, + 0xcc,0x84,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0x86,0x00,0x01,0xff,0x75, + 0xcc,0x86,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0x8a,0x00,0x01,0xff,0x75,0xcc,0x8a, + 0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0x8b,0x00,0x01, + 0xff,0x75,0xcc,0x8b,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0xa8,0x00,0x01,0xff,0x75, + 0xcc,0xa8,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x57,0xcc,0x82,0x00,0x01,0xff,0x77, + 0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x59,0xcc,0x82,0x00,0x01,0xff,0x79,0xcc,0x82, + 0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x59,0xcc,0x88,0x00,0x01,0xff,0x5a, + 0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x7a,0xcc,0x81,0x00,0x01,0xff,0x5a,0xcc,0x87, + 0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x7a,0xcc,0x87,0x00,0x01,0xff,0x5a,0xcc,0x8c, + 0x00,0x10,0x08,0x01,0xff,0x7a,0xcc,0x8c,0x00,0x01,0x00,0xd0,0x4a,0xcf,0x86,0x55, + 0x04,0x01,0x00,0xd4,0x2c,0xd3,0x18,0x92,0x14,0x91,0x10,0x10,0x08,0x01,0xff,0x4f, + 0xcc,0x9b,0x00,0x01,0xff,0x6f,0xcc,0x9b,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01, + 0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0x55,0xcc,0x9b,0x00,0x93, + 0x14,0x92,0x10,0x91,0x0c,0x10,0x08,0x01,0xff,0x75,0xcc,0x9b,0x00,0x01,0x00,0x01, + 0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0xb4,0xd4,0x24,0x53,0x04,0x01,0x00,0x52, + 0x04,0x01,0x00,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x41,0xcc,0x8c,0x00,0x10, + 0x08,0x01,0xff,0x61,0xcc,0x8c,0x00,0x01,0xff,0x49,0xcc,0x8c,0x00,0xd3,0x46,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,0x8c,0x00,0x01,0xff,0x4f,0xcc,0x8c, + 0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x8c,0x00,0x01,0xff,0x55,0xcc,0x8c,0x00,0xd1, + 0x12,0x10,0x08,0x01,0xff,0x75,0xcc,0x8c,0x00,0x01,0xff,0x55,0xcc,0x88,0xcc,0x84, + 0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88,0xcc,0x84,0x00,0x01,0xff,0x55,0xcc,0x88, + 0xcc,0x81,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88,0xcc,0x81, + 0x00,0x01,0xff,0x55,0xcc,0x88,0xcc,0x8c,0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88, + 0xcc,0x8c,0x00,0x01,0xff,0x55,0xcc,0x88,0xcc,0x80,0x00,0xd1,0x0e,0x10,0x0a,0x01, + 0xff,0x75,0xcc,0x88,0xcc,0x80,0x00,0x01,0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x88, + 0xcc,0x84,0x00,0x01,0xff,0x61,0xcc,0x88,0xcc,0x84,0x00,0xd4,0x80,0xd3,0x3a,0xd2, + 0x26,0xd1,0x14,0x10,0x0a,0x01,0xff,0x41,0xcc,0x87,0xcc,0x84,0x00,0x01,0xff,0x61, + 0xcc,0x87,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xc3,0x86,0xcc,0x84,0x00,0x01,0xff, + 0xc3,0xa6,0xcc,0x84,0x00,0x51,0x04,0x01,0x00,0x10,0x08,0x01,0xff,0x47,0xcc,0x8c, + 0x00,0x01,0xff,0x67,0xcc,0x8c,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x4b, + 0xcc,0x8c,0x00,0x01,0xff,0x6b,0xcc,0x8c,0x00,0x10,0x08,0x01,0xff,0x4f,0xcc,0xa8, + 0x00,0x01,0xff,0x6f,0xcc,0xa8,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,0xa8, + 0xcc,0x84,0x00,0x01,0xff,0x6f,0xcc,0xa8,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xc6, + 0xb7,0xcc,0x8c,0x00,0x01,0xff,0xca,0x92,0xcc,0x8c,0x00,0xd3,0x24,0xd2,0x10,0x91, + 0x0c,0x10,0x08,0x01,0xff,0x6a,0xcc,0x8c,0x00,0x01,0x00,0x01,0x00,0x91,0x10,0x10, + 0x08,0x01,0xff,0x47,0xcc,0x81,0x00,0x01,0xff,0x67,0xcc,0x81,0x00,0x04,0x00,0xd2, + 0x24,0xd1,0x10,0x10,0x08,0x04,0xff,0x4e,0xcc,0x80,0x00,0x04,0xff,0x6e,0xcc,0x80, + 0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x8a,0xcc,0x81,0x00,0x01,0xff,0x61,0xcc,0x8a, + 0xcc,0x81,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xc3,0x86,0xcc,0x81,0x00,0x01,0xff, + 0xc3,0xa6,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xc3,0x98,0xcc,0x81,0x00,0x01,0xff, + 0xc3,0xb8,0xcc,0x81,0x00,0xe2,0x07,0x02,0xe1,0xae,0x01,0xe0,0x93,0x01,0xcf,0x86, + 0xd5,0xf4,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x41,0xcc, + 0x8f,0x00,0x01,0xff,0x61,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x41,0xcc,0x91,0x00, + 0x01,0xff,0x61,0xcc,0x91,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x45,0xcc,0x8f,0x00, + 0x01,0xff,0x65,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x45,0xcc,0x91,0x00,0x01,0xff, + 0x65,0xcc,0x91,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x49,0xcc,0x8f,0x00, + 0x01,0xff,0x69,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x49,0xcc,0x91,0x00,0x01,0xff, + 0x69,0xcc,0x91,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x4f,0xcc,0x8f,0x00,0x01,0xff, + 0x6f,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x4f,0xcc,0x91,0x00,0x01,0xff,0x6f,0xcc, + 0x91,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x52,0xcc,0x8f,0x00, + 0x01,0xff,0x72,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x52,0xcc,0x91,0x00,0x01,0xff, + 0x72,0xcc,0x91,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0x8f,0x00,0x01,0xff, + 0x75,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0x91,0x00,0x01,0xff,0x75,0xcc, + 0x91,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x04,0xff,0x53,0xcc,0xa6,0x00,0x04,0xff, + 0x73,0xcc,0xa6,0x00,0x10,0x08,0x04,0xff,0x54,0xcc,0xa6,0x00,0x04,0xff,0x74,0xcc, + 0xa6,0x00,0x51,0x04,0x04,0x00,0x10,0x08,0x04,0xff,0x48,0xcc,0x8c,0x00,0x04,0xff, + 0x68,0xcc,0x8c,0x00,0xd4,0x68,0xd3,0x20,0xd2,0x0c,0x91,0x08,0x10,0x04,0x06,0x00, + 0x07,0x00,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x08,0x04,0xff,0x41,0xcc,0x87,0x00, + 0x04,0xff,0x61,0xcc,0x87,0x00,0xd2,0x24,0xd1,0x10,0x10,0x08,0x04,0xff,0x45,0xcc, + 0xa7,0x00,0x04,0xff,0x65,0xcc,0xa7,0x00,0x10,0x0a,0x04,0xff,0x4f,0xcc,0x88,0xcc, + 0x84,0x00,0x04,0xff,0x6f,0xcc,0x88,0xcc,0x84,0x00,0xd1,0x14,0x10,0x0a,0x04,0xff, + 0x4f,0xcc,0x83,0xcc,0x84,0x00,0x04,0xff,0x6f,0xcc,0x83,0xcc,0x84,0x00,0x10,0x08, + 0x04,0xff,0x4f,0xcc,0x87,0x00,0x04,0xff,0x6f,0xcc,0x87,0x00,0x93,0x30,0xd2,0x24, + 0xd1,0x14,0x10,0x0a,0x04,0xff,0x4f,0xcc,0x87,0xcc,0x84,0x00,0x04,0xff,0x6f,0xcc, + 0x87,0xcc,0x84,0x00,0x10,0x08,0x04,0xff,0x59,0xcc,0x84,0x00,0x04,0xff,0x79,0xcc, + 0x84,0x00,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00,0x08,0x00,0x08,0x00,0xcf,0x86, + 0x95,0x14,0x94,0x10,0x93,0x0c,0x92,0x08,0x11,0x04,0x08,0x00,0x09,0x00,0x09,0x00, + 0x09,0x00,0x01,0x00,0x01,0x00,0xd0,0x22,0xcf,0x86,0x55,0x04,0x01,0x00,0x94,0x18, + 0x53,0x04,0x01,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x04,0x00,0x04,0x00, + 0x11,0x04,0x04,0x00,0x07,0x00,0x01,0x00,0xcf,0x86,0xd5,0x18,0x54,0x04,0x01,0x00, + 0x53,0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00, + 0x04,0x00,0x94,0x18,0x53,0x04,0x01,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x04,0x00, + 0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x07,0x00,0x07,0x00,0xe1,0x35,0x01,0xd0, + 0x72,0xcf,0x86,0xd5,0x24,0x54,0x04,0x01,0xe6,0xd3,0x10,0x52,0x04,0x01,0xe6,0x91, + 0x08,0x10,0x04,0x01,0xe6,0x01,0xe8,0x01,0xdc,0x92,0x0c,0x51,0x04,0x01,0xdc,0x10, + 0x04,0x01,0xe8,0x01,0xd8,0x01,0xdc,0xd4,0x2c,0xd3,0x1c,0xd2,0x10,0xd1,0x08,0x10, + 0x04,0x01,0xdc,0x01,0xca,0x10,0x04,0x01,0xca,0x01,0xdc,0x51,0x04,0x01,0xdc,0x10, + 0x04,0x01,0xdc,0x01,0xca,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0xca,0x01,0xdc,0x01, + 0xdc,0x01,0xdc,0xd3,0x08,0x12,0x04,0x01,0xdc,0x01,0x01,0xd2,0x0c,0x91,0x08,0x10, + 0x04,0x01,0x01,0x01,0xdc,0x01,0xdc,0x91,0x08,0x10,0x04,0x01,0xdc,0x01,0xe6,0x01, + 0xe6,0xcf,0x86,0xd5,0x7f,0xd4,0x47,0xd3,0x2e,0xd2,0x19,0xd1,0x0e,0x10,0x07,0x01, + 0xff,0xcc,0x80,0x00,0x01,0xff,0xcc,0x81,0x00,0x10,0x04,0x01,0xe6,0x01,0xff,0xcc, + 0x93,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xcc,0x88,0xcc,0x81,0x00,0x01,0xf0,0x10, + 0x04,0x04,0xe6,0x04,0xdc,0xd2,0x08,0x11,0x04,0x04,0xdc,0x04,0xe6,0xd1,0x08,0x10, + 0x04,0x04,0xe6,0x04,0xdc,0x10,0x04,0x04,0xdc,0x06,0xff,0x00,0xd3,0x18,0xd2,0x0c, + 0x51,0x04,0x07,0xe6,0x10,0x04,0x07,0xe6,0x07,0xdc,0x51,0x04,0x07,0xdc,0x10,0x04, + 0x07,0xdc,0x07,0xe6,0xd2,0x10,0xd1,0x08,0x10,0x04,0x08,0xe8,0x08,0xdc,0x10,0x04, + 0x08,0xdc,0x08,0xe6,0xd1,0x08,0x10,0x04,0x08,0xe9,0x07,0xea,0x10,0x04,0x07,0xea, + 0x07,0xe9,0xd4,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x01,0xea,0x10,0x04,0x04,0xe9, + 0x06,0xe6,0x06,0xe6,0x06,0xe6,0xd3,0x13,0x52,0x04,0x0a,0x00,0x91,0x0b,0x10,0x07, + 0x01,0xff,0xca,0xb9,0x00,0x01,0x00,0x0a,0x00,0xd2,0x0c,0x51,0x04,0x00,0x00,0x10, + 0x04,0x01,0x00,0x09,0x00,0x51,0x04,0x09,0x00,0x10,0x06,0x01,0xff,0x3b,0x00,0x10, + 0x00,0xd0,0xe1,0xcf,0x86,0xd5,0x7a,0xd4,0x5f,0xd3,0x21,0x52,0x04,0x00,0x00,0xd1, + 0x0d,0x10,0x04,0x01,0x00,0x01,0xff,0xc2,0xa8,0xcc,0x81,0x00,0x10,0x09,0x01,0xff, + 0xce,0x91,0xcc,0x81,0x00,0x01,0xff,0xc2,0xb7,0x00,0xd2,0x1f,0xd1,0x12,0x10,0x09, + 0x01,0xff,0xce,0x95,0xcc,0x81,0x00,0x01,0xff,0xce,0x97,0xcc,0x81,0x00,0x10,0x09, + 0x01,0xff,0xce,0x99,0xcc,0x81,0x00,0x00,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xce, + 0x9f,0xcc,0x81,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xce,0xa5,0xcc,0x81,0x00,0x01, + 0xff,0xce,0xa9,0xcc,0x81,0x00,0x93,0x17,0x92,0x13,0x91,0x0f,0x10,0x0b,0x01,0xff, + 0xce,0xb9,0xcc,0x88,0xcc,0x81,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4, + 0x4a,0xd3,0x10,0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x01, + 0x00,0xd2,0x16,0x51,0x04,0x01,0x00,0x10,0x09,0x01,0xff,0xce,0x99,0xcc,0x88,0x00, + 0x01,0xff,0xce,0xa5,0xcc,0x88,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc, + 0x81,0x00,0x01,0xff,0xce,0xb5,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,0xb7,0xcc, + 0x81,0x00,0x01,0xff,0xce,0xb9,0xcc,0x81,0x00,0x93,0x17,0x92,0x13,0x91,0x0f,0x10, + 0x0b,0x01,0xff,0xcf,0x85,0xcc,0x88,0xcc,0x81,0x00,0x01,0x00,0x01,0x00,0x01,0x00, + 0x01,0x00,0xcf,0x86,0xd5,0x7b,0xd4,0x39,0x53,0x04,0x01,0x00,0xd2,0x16,0x51,0x04, + 0x01,0x00,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x88,0x00,0x01,0xff,0xcf,0x85,0xcc, + 0x88,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xbf,0xcc,0x81,0x00,0x01,0xff,0xcf, + 0x85,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xcf,0x89,0xcc,0x81,0x00,0x0a,0x00,0xd3, + 0x26,0xd2,0x11,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xcf,0x92,0xcc, + 0x81,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xcf,0x92,0xcc,0x88,0x00,0x01,0x00,0x10, + 0x04,0x01,0x00,0x04,0x00,0xd2,0x0c,0x51,0x04,0x06,0x00,0x10,0x04,0x01,0x00,0x04, + 0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x04,0x00,0x10,0x04,0x01,0x00,0x04,0x00,0xd4, + 0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x04,0x00,0x01,0x00,0x01, + 0x00,0x01,0x00,0xd3,0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x05,0x00,0x10,0x04,0x06, + 0x00,0x07,0x00,0x12,0x04,0x07,0x00,0x08,0x00,0xe3,0x47,0x04,0xe2,0xbe,0x02,0xe1, + 0x07,0x01,0xd0,0x8b,0xcf,0x86,0xd5,0x6c,0xd4,0x53,0xd3,0x30,0xd2,0x1f,0xd1,0x12, + 0x10,0x09,0x04,0xff,0xd0,0x95,0xcc,0x80,0x00,0x01,0xff,0xd0,0x95,0xcc,0x88,0x00, + 0x10,0x04,0x01,0x00,0x01,0xff,0xd0,0x93,0xcc,0x81,0x00,0x51,0x04,0x01,0x00,0x10, + 0x04,0x01,0x00,0x01,0xff,0xd0,0x86,0xcc,0x88,0x00,0x52,0x04,0x01,0x00,0xd1,0x12, + 0x10,0x09,0x01,0xff,0xd0,0x9a,0xcc,0x81,0x00,0x04,0xff,0xd0,0x98,0xcc,0x80,0x00, + 0x10,0x09,0x01,0xff,0xd0,0xa3,0xcc,0x86,0x00,0x01,0x00,0x53,0x04,0x01,0x00,0x92, + 0x11,0x91,0x0d,0x10,0x04,0x01,0x00,0x01,0xff,0xd0,0x98,0xcc,0x86,0x00,0x01,0x00, + 0x01,0x00,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0x92,0x11,0x91,0x0d,0x10,0x04, + 0x01,0x00,0x01,0xff,0xd0,0xb8,0xcc,0x86,0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0xd5, + 0x57,0x54,0x04,0x01,0x00,0xd3,0x30,0xd2,0x1f,0xd1,0x12,0x10,0x09,0x04,0xff,0xd0, + 0xb5,0xcc,0x80,0x00,0x01,0xff,0xd0,0xb5,0xcc,0x88,0x00,0x10,0x04,0x01,0x00,0x01, + 0xff,0xd0,0xb3,0xcc,0x81,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff, + 0xd1,0x96,0xcc,0x88,0x00,0x52,0x04,0x01,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd0, + 0xba,0xcc,0x81,0x00,0x04,0xff,0xd0,0xb8,0xcc,0x80,0x00,0x10,0x09,0x01,0xff,0xd1, + 0x83,0xcc,0x86,0x00,0x01,0x00,0x54,0x04,0x01,0x00,0x93,0x1a,0x52,0x04,0x01,0x00, + 0x51,0x04,0x01,0x00,0x10,0x09,0x01,0xff,0xd1,0xb4,0xcc,0x8f,0x00,0x01,0xff,0xd1, + 0xb5,0xcc,0x8f,0x00,0x01,0x00,0xd0,0x2e,0xcf,0x86,0x95,0x28,0x94,0x24,0xd3,0x18, + 0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xe6,0x51,0x04,0x01,0xe6, + 0x10,0x04,0x01,0xe6,0x0a,0xe6,0x92,0x08,0x11,0x04,0x04,0x00,0x06,0x00,0x04,0x00, + 0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0xbe,0xd4,0x4a,0xd3,0x2a,0xd2,0x1a,0xd1,0x0d, + 0x10,0x04,0x01,0x00,0x01,0xff,0xd0,0x96,0xcc,0x86,0x00,0x10,0x09,0x01,0xff,0xd0, + 0xb6,0xcc,0x86,0x00,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x06,0x00,0x10,0x04, + 0x06,0x00,0x01,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x06,0x00,0x10,0x04, + 0x06,0x00,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x06,0x00,0x10,0x04,0x06,0x00, + 0x09,0x00,0xd3,0x3a,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,0x90,0xcc,0x86, + 0x00,0x01,0xff,0xd0,0xb0,0xcc,0x86,0x00,0x10,0x09,0x01,0xff,0xd0,0x90,0xcc,0x88, + 0x00,0x01,0xff,0xd0,0xb0,0xcc,0x88,0x00,0x51,0x04,0x01,0x00,0x10,0x09,0x01,0xff, + 0xd0,0x95,0xcc,0x86,0x00,0x01,0xff,0xd0,0xb5,0xcc,0x86,0x00,0xd2,0x16,0x51,0x04, + 0x01,0x00,0x10,0x09,0x01,0xff,0xd3,0x98,0xcc,0x88,0x00,0x01,0xff,0xd3,0x99,0xcc, + 0x88,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,0x96,0xcc,0x88,0x00,0x01,0xff,0xd0, + 0xb6,0xcc,0x88,0x00,0x10,0x09,0x01,0xff,0xd0,0x97,0xcc,0x88,0x00,0x01,0xff,0xd0, + 0xb7,0xcc,0x88,0x00,0xd4,0x74,0xd3,0x3a,0xd2,0x16,0x51,0x04,0x01,0x00,0x10,0x09, + 0x01,0xff,0xd0,0x98,0xcc,0x84,0x00,0x01,0xff,0xd0,0xb8,0xcc,0x84,0x00,0xd1,0x12, + 0x10,0x09,0x01,0xff,0xd0,0x98,0xcc,0x88,0x00,0x01,0xff,0xd0,0xb8,0xcc,0x88,0x00, + 0x10,0x09,0x01,0xff,0xd0,0x9e,0xcc,0x88,0x00,0x01,0xff,0xd0,0xbe,0xcc,0x88,0x00, + 0xd2,0x16,0x51,0x04,0x01,0x00,0x10,0x09,0x01,0xff,0xd3,0xa8,0xcc,0x88,0x00,0x01, + 0xff,0xd3,0xa9,0xcc,0x88,0x00,0xd1,0x12,0x10,0x09,0x04,0xff,0xd0,0xad,0xcc,0x88, + 0x00,0x04,0xff,0xd1,0x8d,0xcc,0x88,0x00,0x10,0x09,0x01,0xff,0xd0,0xa3,0xcc,0x84, + 0x00,0x01,0xff,0xd1,0x83,0xcc,0x84,0x00,0xd3,0x3a,0xd2,0x24,0xd1,0x12,0x10,0x09, + 0x01,0xff,0xd0,0xa3,0xcc,0x88,0x00,0x01,0xff,0xd1,0x83,0xcc,0x88,0x00,0x10,0x09, + 0x01,0xff,0xd0,0xa3,0xcc,0x8b,0x00,0x01,0xff,0xd1,0x83,0xcc,0x8b,0x00,0x91,0x12, + 0x10,0x09,0x01,0xff,0xd0,0xa7,0xcc,0x88,0x00,0x01,0xff,0xd1,0x87,0xcc,0x88,0x00, + 0x08,0x00,0x92,0x16,0x91,0x12,0x10,0x09,0x01,0xff,0xd0,0xab,0xcc,0x88,0x00,0x01, + 0xff,0xd1,0x8b,0xcc,0x88,0x00,0x09,0x00,0x09,0x00,0xd1,0x74,0xd0,0x36,0xcf,0x86, + 0xd5,0x10,0x54,0x04,0x06,0x00,0x93,0x08,0x12,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00, + 0xd4,0x10,0x93,0x0c,0x52,0x04,0x0a,0x00,0x11,0x04,0x0b,0x00,0x0c,0x00,0x10,0x00, + 0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00, + 0x01,0x00,0xcf,0x86,0xd5,0x24,0x54,0x04,0x01,0x00,0xd3,0x10,0x52,0x04,0x01,0x00, + 0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x92,0x0c,0x91,0x08,0x10,0x04, + 0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x14,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd0,0xba, + 0xcf,0x86,0xd5,0x4c,0xd4,0x24,0x53,0x04,0x01,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04, + 0x14,0x00,0x01,0x00,0x10,0x04,0x04,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x00,0x00, + 0x10,0x00,0x10,0x04,0x10,0x00,0x0d,0x00,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04, + 0x00,0x00,0x02,0xdc,0x02,0xe6,0x51,0x04,0x02,0xe6,0x10,0x04,0x02,0xdc,0x02,0xe6, + 0x92,0x0c,0x51,0x04,0x02,0xe6,0x10,0x04,0x02,0xde,0x02,0xdc,0x02,0xe6,0xd4,0x2c, + 0xd3,0x10,0x92,0x0c,0x51,0x04,0x02,0xe6,0x10,0x04,0x08,0xdc,0x02,0xdc,0x02,0xdc, + 0xd2,0x0c,0x51,0x04,0x02,0xe6,0x10,0x04,0x02,0xdc,0x02,0xe6,0xd1,0x08,0x10,0x04, + 0x02,0xe6,0x02,0xde,0x10,0x04,0x02,0xe4,0x02,0xe6,0xd3,0x20,0xd2,0x10,0xd1,0x08, + 0x10,0x04,0x01,0x0a,0x01,0x0b,0x10,0x04,0x01,0x0c,0x01,0x0d,0xd1,0x08,0x10,0x04, + 0x01,0x0e,0x01,0x0f,0x10,0x04,0x01,0x10,0x01,0x11,0xd2,0x10,0xd1,0x08,0x10,0x04, + 0x01,0x12,0x01,0x13,0x10,0x04,0x09,0x13,0x01,0x14,0xd1,0x08,0x10,0x04,0x01,0x15, + 0x01,0x16,0x10,0x04,0x01,0x00,0x01,0x17,0xcf,0x86,0xd5,0x28,0x94,0x24,0x93,0x20, + 0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x01,0x18,0x10,0x04,0x01,0x19,0x01,0x00, + 0xd1,0x08,0x10,0x04,0x02,0xe6,0x08,0xdc,0x10,0x04,0x08,0x00,0x08,0x12,0x00,0x00, + 0x01,0x00,0xd4,0x1c,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04, + 0x01,0x00,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x14,0x00,0x93,0x10, + 0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0xe2,0xfb,0x01,0xe1,0x2b,0x01,0xd0,0xa8,0xcf,0x86,0xd5,0x55,0xd4,0x28,0xd3,0x10, + 0x52,0x04,0x07,0x00,0x91,0x08,0x10,0x04,0x0d,0x00,0x10,0x00,0x0a,0x00,0xd2,0x0c, + 0x51,0x04,0x0a,0x00,0x10,0x04,0x0a,0x00,0x08,0x00,0x91,0x08,0x10,0x04,0x01,0x00, + 0x07,0x00,0x07,0x00,0xd3,0x0c,0x52,0x04,0x07,0xe6,0x11,0x04,0x07,0xe6,0x0a,0xe6, + 0xd2,0x10,0xd1,0x08,0x10,0x04,0x0a,0x1e,0x0a,0x1f,0x10,0x04,0x0a,0x20,0x01,0x00, + 0xd1,0x09,0x10,0x05,0x0f,0xff,0x00,0x00,0x00,0x10,0x04,0x08,0x00,0x01,0x00,0xd4, + 0x3d,0x93,0x39,0xd2,0x1a,0xd1,0x08,0x10,0x04,0x0c,0x00,0x01,0x00,0x10,0x09,0x01, + 0xff,0xd8,0xa7,0xd9,0x93,0x00,0x01,0xff,0xd8,0xa7,0xd9,0x94,0x00,0xd1,0x12,0x10, + 0x09,0x01,0xff,0xd9,0x88,0xd9,0x94,0x00,0x01,0xff,0xd8,0xa7,0xd9,0x95,0x00,0x10, + 0x09,0x01,0xff,0xd9,0x8a,0xd9,0x94,0x00,0x01,0x00,0x01,0x00,0x53,0x04,0x01,0x00, + 0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x0a,0x00,0x0a,0x00,0xcf,0x86, + 0xd5,0x5c,0xd4,0x20,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04, + 0x01,0x00,0x01,0x1b,0xd1,0x08,0x10,0x04,0x01,0x1c,0x01,0x1d,0x10,0x04,0x01,0x1e, + 0x01,0x1f,0xd3,0x20,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x20,0x01,0x21,0x10,0x04, + 0x01,0x22,0x04,0xe6,0xd1,0x08,0x10,0x04,0x04,0xe6,0x04,0xdc,0x10,0x04,0x07,0xdc, + 0x07,0xe6,0xd2,0x0c,0x91,0x08,0x10,0x04,0x07,0xe6,0x08,0xe6,0x08,0xe6,0xd1,0x08, + 0x10,0x04,0x08,0xdc,0x08,0xe6,0x10,0x04,0x08,0xe6,0x0c,0xdc,0xd4,0x10,0x53,0x04, + 0x01,0x00,0x52,0x04,0x01,0x00,0x11,0x04,0x01,0x00,0x06,0x00,0x93,0x10,0x92,0x0c, + 0x91,0x08,0x10,0x04,0x01,0x23,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd0,0x22, + 0xcf,0x86,0x55,0x04,0x01,0x00,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x08, + 0x11,0x04,0x04,0x00,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x04,0x00, + 0xcf,0x86,0xd5,0x5b,0xd4,0x2e,0xd3,0x1e,0x92,0x1a,0xd1,0x0d,0x10,0x09,0x01,0xff, + 0xdb,0x95,0xd9,0x94,0x00,0x01,0x00,0x10,0x09,0x01,0xff,0xdb,0x81,0xd9,0x94,0x00, + 0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00, + 0x04,0x00,0xd3,0x19,0xd2,0x11,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff, + 0xdb,0x92,0xd9,0x94,0x00,0x11,0x04,0x01,0x00,0x01,0xe6,0x52,0x04,0x01,0xe6,0xd1, + 0x08,0x10,0x04,0x01,0xe6,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xe6,0xd4,0x38,0xd3, + 0x1c,0xd2,0x0c,0x51,0x04,0x01,0xe6,0x10,0x04,0x01,0xe6,0x01,0xdc,0xd1,0x08,0x10, + 0x04,0x01,0xe6,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xe6,0xd2,0x10,0xd1,0x08,0x10, + 0x04,0x01,0xe6,0x01,0x00,0x10,0x04,0x01,0xdc,0x01,0xe6,0x91,0x08,0x10,0x04,0x01, + 0xe6,0x01,0xdc,0x07,0x00,0x53,0x04,0x01,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x04, + 0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x07,0x00,0xd1,0xc8,0xd0,0x76,0xcf, + 0x86,0xd5,0x28,0xd4,0x14,0x53,0x04,0x04,0x00,0x52,0x04,0x04,0x00,0x51,0x04,0x04, + 0x00,0x10,0x04,0x00,0x00,0x04,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x04, + 0x00,0x04,0x24,0x04,0x00,0x04,0x00,0x04,0x00,0xd4,0x14,0x53,0x04,0x04,0x00,0x52, + 0x04,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x07,0x00,0x07,0x00,0xd3,0x1c,0xd2, + 0x0c,0x91,0x08,0x10,0x04,0x04,0xe6,0x04,0xdc,0x04,0xe6,0xd1,0x08,0x10,0x04,0x04, + 0xdc,0x04,0xe6,0x10,0x04,0x04,0xe6,0x04,0xdc,0xd2,0x0c,0x51,0x04,0x04,0xdc,0x10, + 0x04,0x04,0xe6,0x04,0xdc,0xd1,0x08,0x10,0x04,0x04,0xdc,0x04,0xe6,0x10,0x04,0x04, + 0xdc,0x04,0xe6,0xcf,0x86,0xd5,0x3c,0x94,0x38,0xd3,0x1c,0xd2,0x0c,0x51,0x04,0x04, + 0xe6,0x10,0x04,0x04,0xdc,0x04,0xe6,0xd1,0x08,0x10,0x04,0x04,0xdc,0x04,0xe6,0x10, + 0x04,0x04,0xdc,0x04,0xe6,0xd2,0x10,0xd1,0x08,0x10,0x04,0x04,0xdc,0x04,0xe6,0x10, + 0x04,0x04,0xe6,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x07,0x00,0x07,0x00,0x08, + 0x00,0x94,0x10,0x53,0x04,0x08,0x00,0x52,0x04,0x08,0x00,0x11,0x04,0x08,0x00,0x0a, + 0x00,0x0a,0x00,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x04,0x00,0x54,0x04,0x04,0x00,0x93, + 0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,0x06,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0xcf,0x86,0x55,0x04,0x09,0x00,0xd4,0x14,0x53,0x04,0x09,0x00,0x92,0x0c,0x51, + 0x04,0x09,0x00,0x10,0x04,0x09,0x00,0x09,0xe6,0x09,0xe6,0xd3,0x10,0x92,0x0c,0x51, + 0x04,0x09,0xe6,0x10,0x04,0x09,0xdc,0x09,0xe6,0x09,0x00,0xd2,0x0c,0x51,0x04,0x09, + 0x00,0x10,0x04,0x09,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x14,0xdc,0x14, + 0x00,0xe4,0xf8,0x57,0xe3,0x45,0x3f,0xe2,0xf4,0x3e,0xe1,0xc7,0x2c,0xe0,0x21,0x10, + 0xcf,0x86,0xc5,0xe4,0x80,0x08,0xe3,0xcb,0x03,0xe2,0x61,0x01,0xd1,0x94,0xd0,0x5a, + 0xcf,0x86,0xd5,0x20,0x54,0x04,0x0b,0x00,0xd3,0x0c,0x52,0x04,0x0b,0x00,0x11,0x04, + 0x0b,0x00,0x0b,0xe6,0x92,0x0c,0x51,0x04,0x0b,0xe6,0x10,0x04,0x0b,0x00,0x0b,0xe6, + 0x0b,0xe6,0xd4,0x24,0xd3,0x10,0x52,0x04,0x0b,0xe6,0x91,0x08,0x10,0x04,0x0b,0x00, + 0x0b,0xe6,0x0b,0xe6,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0b,0x00,0x0b,0xe6,0x0b,0xe6, + 0x11,0x04,0x0b,0xe6,0x00,0x00,0x53,0x04,0x0b,0x00,0x52,0x04,0x0b,0x00,0x51,0x04, + 0x0b,0x00,0x10,0x04,0x0b,0x00,0x00,0x00,0xcf,0x86,0xd5,0x20,0x54,0x04,0x0c,0x00, + 0x53,0x04,0x0c,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x0c,0xdc,0x0c,0xdc, + 0x51,0x04,0x00,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,0x94,0x14,0x53,0x04,0x13,0x00, + 0x92,0x0c,0x51,0x04,0x13,0x00,0x10,0x04,0x13,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0xd0,0x4a,0xcf,0x86,0x55,0x04,0x00,0x00,0xd4,0x20,0xd3,0x10,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x0d,0x00,0x10,0x00,0x0d,0x00,0x0d,0x00,0x52,0x04,0x0d,0x00,0x91,0x08, + 0x10,0x04,0x0d,0x00,0x10,0x00,0x10,0x00,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x10,0x00, + 0x10,0x04,0x10,0x00,0x11,0x00,0x91,0x08,0x10,0x04,0x11,0x00,0x00,0x00,0x12,0x00, + 0x52,0x04,0x12,0x00,0x11,0x04,0x12,0x00,0x00,0x00,0xcf,0x86,0xd5,0x18,0x54,0x04, + 0x00,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x14,0xdc, + 0x12,0xe6,0x12,0xe6,0xd4,0x30,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x12,0xe6,0x10,0x04, + 0x12,0x00,0x11,0xdc,0x51,0x04,0x0d,0xe6,0x10,0x04,0x0d,0xdc,0x0d,0xe6,0xd2,0x0c, + 0x91,0x08,0x10,0x04,0x0d,0xe6,0x0d,0xdc,0x0d,0xe6,0x91,0x08,0x10,0x04,0x0d,0xe6, + 0x0d,0xdc,0x0d,0xdc,0xd3,0x1c,0xd2,0x10,0xd1,0x08,0x10,0x04,0x0d,0x1b,0x0d,0x1c, + 0x10,0x04,0x0d,0x1d,0x0d,0xe6,0x51,0x04,0x0d,0xe6,0x10,0x04,0x0d,0xdc,0x0d,0xe6, + 0xd2,0x10,0xd1,0x08,0x10,0x04,0x0d,0xe6,0x0d,0xdc,0x10,0x04,0x0d,0xdc,0x0d,0xe6, + 0x51,0x04,0x0d,0xe6,0x10,0x04,0x0d,0xe6,0x10,0xe6,0xe1,0x3a,0x01,0xd0,0x77,0xcf, + 0x86,0xd5,0x20,0x94,0x1c,0x93,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0b,0x00,0x01, + 0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x07,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01, + 0x00,0xd4,0x1b,0x53,0x04,0x01,0x00,0x92,0x13,0x91,0x0f,0x10,0x04,0x01,0x00,0x01, + 0xff,0xe0,0xa4,0xa8,0xe0,0xa4,0xbc,0x00,0x01,0x00,0x01,0x00,0xd3,0x26,0xd2,0x13, + 0x91,0x0f,0x10,0x04,0x01,0x00,0x01,0xff,0xe0,0xa4,0xb0,0xe0,0xa4,0xbc,0x00,0x01, + 0x00,0x91,0x0f,0x10,0x0b,0x01,0xff,0xe0,0xa4,0xb3,0xe0,0xa4,0xbc,0x00,0x01,0x00, + 0x01,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x0c,0x00,0x91,0x08,0x10,0x04,0x01,0x07, + 0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0x8c,0xd4,0x18,0x53,0x04,0x01,0x00,0x52,0x04, + 0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x01,0x09,0x10,0x04,0x0b,0x00,0x0c,0x00, + 0xd3,0x1c,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x01,0xe6,0x10,0x04,0x01,0xdc, + 0x01,0xe6,0x91,0x08,0x10,0x04,0x01,0xe6,0x0b,0x00,0x0c,0x00,0xd2,0x2c,0xd1,0x16, + 0x10,0x0b,0x01,0xff,0xe0,0xa4,0x95,0xe0,0xa4,0xbc,0x00,0x01,0xff,0xe0,0xa4,0x96, + 0xe0,0xa4,0xbc,0x00,0x10,0x0b,0x01,0xff,0xe0,0xa4,0x97,0xe0,0xa4,0xbc,0x00,0x01, + 0xff,0xe0,0xa4,0x9c,0xe0,0xa4,0xbc,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xe0,0xa4, + 0xa1,0xe0,0xa4,0xbc,0x00,0x01,0xff,0xe0,0xa4,0xa2,0xe0,0xa4,0xbc,0x00,0x10,0x0b, + 0x01,0xff,0xe0,0xa4,0xab,0xe0,0xa4,0xbc,0x00,0x01,0xff,0xe0,0xa4,0xaf,0xe0,0xa4, + 0xbc,0x00,0x54,0x04,0x01,0x00,0xd3,0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x01,0x00, + 0x0a,0x00,0x10,0x04,0x0a,0x00,0x0c,0x00,0x0c,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04, + 0x10,0x00,0x0b,0x00,0x10,0x04,0x0b,0x00,0x09,0x00,0x91,0x08,0x10,0x04,0x09,0x00, + 0x08,0x00,0x09,0x00,0xd0,0x86,0xcf,0x86,0xd5,0x44,0xd4,0x2c,0xd3,0x18,0xd2,0x0c, + 0x91,0x08,0x10,0x04,0x10,0x00,0x01,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00, + 0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00, + 0x10,0x04,0x00,0x00,0x01,0x00,0x93,0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x01,0x00, + 0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04, + 0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00, + 0xd3,0x18,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x01,0x00, + 0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00, + 0x91,0x08,0x10,0x04,0x01,0x07,0x07,0x00,0x01,0x00,0xcf,0x86,0xd5,0x7b,0xd4,0x42, + 0xd3,0x14,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04, + 0x00,0x00,0x01,0x00,0xd2,0x17,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04, + 0x00,0x00,0x01,0xff,0xe0,0xa7,0x87,0xe0,0xa6,0xbe,0x00,0xd1,0x0f,0x10,0x0b,0x01, + 0xff,0xe0,0xa7,0x87,0xe0,0xa7,0x97,0x00,0x01,0x09,0x10,0x04,0x08,0x00,0x00,0x00, + 0xd3,0x10,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00, + 0x52,0x04,0x00,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xe0,0xa6,0xa1,0xe0,0xa6,0xbc, + 0x00,0x01,0xff,0xe0,0xa6,0xa2,0xe0,0xa6,0xbc,0x00,0x10,0x04,0x00,0x00,0x01,0xff, + 0xe0,0xa6,0xaf,0xe0,0xa6,0xbc,0x00,0xd4,0x10,0x93,0x0c,0x52,0x04,0x01,0x00,0x11, + 0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01, + 0x00,0x10,0x04,0x01,0x00,0x0b,0x00,0x51,0x04,0x13,0x00,0x10,0x04,0x14,0xe6,0x00, + 0x00,0xe2,0x48,0x02,0xe1,0x4f,0x01,0xd0,0xa4,0xcf,0x86,0xd5,0x4c,0xd4,0x34,0xd3, + 0x1c,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x07,0x00,0x10,0x04,0x01,0x00,0x07, + 0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01, + 0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01, + 0x00,0x93,0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x00, + 0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,0x00,0x92,0x0c,0x91, + 0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,0x2e,0xd2,0x17,0xd1, + 0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xe0,0xa8,0xb2, + 0xe0,0xa8,0xbc,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x10,0x0b,0x01,0xff, + 0xe0,0xa8,0xb8,0xe0,0xa8,0xbc,0x00,0x00,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x00, + 0x00,0x91,0x08,0x10,0x04,0x01,0x07,0x00,0x00,0x01,0x00,0xcf,0x86,0xd5,0x80,0xd4, + 0x34,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x51, + 0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01, + 0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x01, + 0x09,0x00,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0a,0x00,0x00, + 0x00,0x00,0x00,0xd2,0x25,0xd1,0x0f,0x10,0x04,0x00,0x00,0x01,0xff,0xe0,0xa8,0x96, + 0xe0,0xa8,0xbc,0x00,0x10,0x0b,0x01,0xff,0xe0,0xa8,0x97,0xe0,0xa8,0xbc,0x00,0x01, + 0xff,0xe0,0xa8,0x9c,0xe0,0xa8,0xbc,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00, + 0x10,0x0b,0x01,0xff,0xe0,0xa8,0xab,0xe0,0xa8,0xbc,0x00,0x00,0x00,0xd4,0x10,0x93, + 0x0c,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x93,0x14,0x52, + 0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x0a,0x00,0x10,0x04,0x14,0x00,0x00, + 0x00,0x00,0x00,0xd0,0x82,0xcf,0x86,0xd5,0x40,0xd4,0x2c,0xd3,0x18,0xd2,0x0c,0x91, + 0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01, + 0x00,0x01,0x00,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x07,0x00,0x01,0x00,0x10, + 0x04,0x00,0x00,0x01,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x00, + 0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,0x00,0x92,0x0c,0x91, + 0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,0x18,0xd2,0x0c,0x91, + 0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01, + 0x00,0x01,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x01, + 0x07,0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0x3c,0xd4,0x28,0xd3,0x10,0x52,0x04,0x01, + 0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01, + 0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x01,0x09,0x00, + 0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0x00,0xd4,0x18,0x93,0x14,0xd2,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x07, + 0x00,0x07,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,0x10,0x92,0x0c,0x91, + 0x08,0x10,0x04,0x0d,0x00,0x07,0x00,0x00,0x00,0x00,0x00,0x92,0x0c,0x91,0x08,0x10, + 0x04,0x00,0x00,0x11,0x00,0x13,0x00,0x13,0x00,0xe1,0x24,0x01,0xd0,0x86,0xcf,0x86, + 0xd5,0x44,0xd4,0x2c,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00, + 0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00, + 0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x93,0x14, + 0x92,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00, + 0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04, + 0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04, + 0x01,0x00,0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x07,0x00,0x01,0x00, + 0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x01,0x07,0x01,0x00, + 0x01,0x00,0xcf,0x86,0xd5,0x73,0xd4,0x45,0xd3,0x14,0x52,0x04,0x01,0x00,0xd1,0x08, + 0x10,0x04,0x0a,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0xd2,0x1e,0xd1,0x0f, + 0x10,0x0b,0x01,0xff,0xe0,0xad,0x87,0xe0,0xad,0x96,0x00,0x00,0x00,0x10,0x04,0x00, + 0x00,0x01,0xff,0xe0,0xad,0x87,0xe0,0xac,0xbe,0x00,0x91,0x0f,0x10,0x0b,0x01,0xff, + 0xe0,0xad,0x87,0xe0,0xad,0x97,0x00,0x01,0x09,0x00,0x00,0xd3,0x0c,0x52,0x04,0x00, + 0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x52,0x04,0x00,0x00,0xd1,0x16,0x10,0x0b,0x01, + 0xff,0xe0,0xac,0xa1,0xe0,0xac,0xbc,0x00,0x01,0xff,0xe0,0xac,0xa2,0xe0,0xac,0xbc, + 0x00,0x10,0x04,0x00,0x00,0x01,0x00,0xd4,0x14,0x93,0x10,0xd2,0x08,0x11,0x04,0x01, + 0x00,0x0a,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x93,0x10,0x92,0x0c,0x91, + 0x08,0x10,0x04,0x01,0x00,0x07,0x00,0x0c,0x00,0x0c,0x00,0x00,0x00,0xd0,0xb1,0xcf, + 0x86,0xd5,0x63,0xd4,0x28,0xd3,0x14,0xd2,0x08,0x11,0x04,0x00,0x00,0x01,0x00,0x91, + 0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10, + 0x04,0x01,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0xd3,0x1f,0xd2,0x0c,0x91, + 0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x91,0x0f,0x10,0x0b,0x01,0xff,0xe0, + 0xae,0x92,0xe0,0xaf,0x97,0x00,0x01,0x00,0x00,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04, + 0x00,0x00,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x01,0x00, + 0x00,0x00,0x01,0x00,0xd4,0x2c,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x00,0x00,0x10,0x04, + 0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0xd2,0x0c, + 0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00, + 0xd3,0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x08,0x00,0x01,0x00, + 0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0xcf,0x86, + 0xd5,0x61,0xd4,0x45,0xd3,0x14,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00, + 0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0xd2,0x1e,0xd1,0x08,0x10,0x04,0x01,0x00, + 0x00,0x00,0x10,0x0b,0x01,0xff,0xe0,0xaf,0x86,0xe0,0xae,0xbe,0x00,0x01,0xff,0xe0, + 0xaf,0x87,0xe0,0xae,0xbe,0x00,0x91,0x0f,0x10,0x0b,0x01,0xff,0xe0,0xaf,0x86,0xe0, + 0xaf,0x97,0x00,0x01,0x09,0x00,0x00,0x93,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0a, + 0x00,0x00,0x00,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x00, + 0x00,0xd4,0x14,0x93,0x10,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x08, + 0x00,0x01,0x00,0x01,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01, + 0x00,0x07,0x00,0x07,0x00,0x92,0x0c,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00,0x00, + 0x00,0x00,0x00,0xe3,0x1c,0x04,0xe2,0x1a,0x02,0xd1,0xf3,0xd0,0x76,0xcf,0x86,0xd5, + 0x3c,0xd4,0x28,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,0x01,0x00,0x01, + 0x00,0x91,0x08,0x10,0x04,0x14,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0x91, + 0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10, + 0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01, + 0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd3, + 0x10,0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,0x10,0x00,0x01,0x00,0x01,0x00,0xd2, + 0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x0a,0x00,0x01, + 0x00,0xcf,0x86,0xd5,0x53,0xd4,0x2f,0xd3,0x10,0x52,0x04,0x01,0x00,0x91,0x08,0x10, + 0x04,0x01,0x00,0x00,0x00,0x01,0x00,0xd2,0x13,0x91,0x0f,0x10,0x0b,0x01,0xff,0xe0, + 0xb1,0x86,0xe0,0xb1,0x96,0x00,0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00, + 0x01,0x09,0x00,0x00,0xd3,0x14,0x52,0x04,0x00,0x00,0xd1,0x08,0x10,0x04,0x00,0x00, + 0x01,0x54,0x10,0x04,0x01,0x5b,0x00,0x00,0x92,0x0c,0x51,0x04,0x0a,0x00,0x10,0x04, + 0x11,0x00,0x00,0x00,0x00,0x00,0xd4,0x14,0x93,0x10,0xd2,0x08,0x11,0x04,0x01,0x00, + 0x0a,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x93,0x10,0x52,0x04,0x00,0x00, + 0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x15,0x00,0x0a,0x00,0xd0,0x76,0xcf,0x86, + 0xd5,0x3c,0xd4,0x28,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x12,0x00,0x10,0x00, + 0x01,0x00,0x91,0x08,0x10,0x04,0x14,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00, + 0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x93,0x10,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04, + 0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00, + 0xd3,0x10,0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00, + 0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x07,0x07,0x07,0x00, + 0x01,0x00,0xcf,0x86,0xd5,0x82,0xd4,0x5e,0xd3,0x2a,0xd2,0x13,0x91,0x0f,0x10,0x0b, + 0x01,0xff,0xe0,0xb2,0xbf,0xe0,0xb3,0x95,0x00,0x01,0x00,0x01,0x00,0xd1,0x08,0x10, + 0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xe0,0xb3,0x86,0xe0,0xb3, + 0x95,0x00,0xd2,0x28,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe0,0xb3,0x86,0xe0,0xb3,0x96, + 0x00,0x00,0x00,0x10,0x0b,0x01,0xff,0xe0,0xb3,0x86,0xe0,0xb3,0x82,0x00,0x01,0xff, + 0xe0,0xb3,0x86,0xe0,0xb3,0x82,0xe0,0xb3,0x95,0x00,0x91,0x08,0x10,0x04,0x01,0x00, + 0x01,0x09,0x00,0x00,0xd3,0x14,0x52,0x04,0x00,0x00,0xd1,0x08,0x10,0x04,0x00,0x00, + 0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00, + 0x10,0x04,0x01,0x00,0x00,0x00,0xd4,0x14,0x93,0x10,0xd2,0x08,0x11,0x04,0x01,0x00, + 0x09,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x93,0x14,0x92,0x10,0xd1,0x08, + 0x10,0x04,0x00,0x00,0x09,0x00,0x10,0x04,0x09,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0xe1,0x06,0x01,0xd0,0x6e,0xcf,0x86,0xd5,0x3c,0xd4,0x28,0xd3,0x18,0xd2,0x0c,0x91, + 0x08,0x10,0x04,0x13,0x00,0x10,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01, + 0x00,0x01,0x00,0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01, + 0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01, + 0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x01, + 0x00,0x0c,0x00,0x01,0x00,0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01, + 0x00,0x10,0x04,0x0c,0x00,0x13,0x09,0x91,0x08,0x10,0x04,0x13,0x09,0x0a,0x00,0x01, + 0x00,0xcf,0x86,0xd5,0x65,0xd4,0x45,0xd3,0x10,0x52,0x04,0x01,0x00,0x91,0x08,0x10, + 0x04,0x0a,0x00,0x00,0x00,0x01,0x00,0xd2,0x1e,0xd1,0x08,0x10,0x04,0x01,0x00,0x00, + 0x00,0x10,0x0b,0x01,0xff,0xe0,0xb5,0x86,0xe0,0xb4,0xbe,0x00,0x01,0xff,0xe0,0xb5, + 0x87,0xe0,0xb4,0xbe,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe0,0xb5,0x86,0xe0,0xb5, + 0x97,0x00,0x01,0x09,0x10,0x04,0x0c,0x00,0x12,0x00,0xd3,0x10,0x52,0x04,0x00,0x00, + 0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x01,0x00,0x52,0x04,0x12,0x00,0x51,0x04, + 0x12,0x00,0x10,0x04,0x12,0x00,0x11,0x00,0xd4,0x14,0x93,0x10,0xd2,0x08,0x11,0x04, + 0x01,0x00,0x0a,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,0x0c,0x52,0x04, + 0x0a,0x00,0x11,0x04,0x0a,0x00,0x12,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x12,0x00, + 0x0a,0x00,0x0a,0x00,0x0a,0x00,0xd0,0x5a,0xcf,0x86,0xd5,0x34,0xd4,0x18,0x93,0x14, + 0xd2,0x08,0x11,0x04,0x00,0x00,0x04,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x04,0x00, + 0x04,0x00,0x04,0x00,0xd3,0x10,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04, + 0x04,0x00,0x00,0x00,0x92,0x08,0x11,0x04,0x00,0x00,0x04,0x00,0x04,0x00,0x54,0x04, + 0x04,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x04,0x00,0x10,0x04,0x00,0x00,0x04,0x00, + 0x04,0x00,0x52,0x04,0x04,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x04,0x00,0x00,0x00, + 0xcf,0x86,0xd5,0x77,0xd4,0x28,0xd3,0x10,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00, + 0x10,0x04,0x04,0x00,0x00,0x00,0xd2,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x04,0x09, + 0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x04,0x00,0xd3,0x14,0x52,0x04, + 0x04,0x00,0xd1,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x10,0x04,0x04,0x00,0x00,0x00, + 0xd2,0x13,0x51,0x04,0x04,0x00,0x10,0x0b,0x04,0xff,0xe0,0xb7,0x99,0xe0,0xb7,0x8a, + 0x00,0x04,0x00,0xd1,0x19,0x10,0x0b,0x04,0xff,0xe0,0xb7,0x99,0xe0,0xb7,0x8f,0x00, + 0x04,0xff,0xe0,0xb7,0x99,0xe0,0xb7,0x8f,0xe0,0xb7,0x8a,0x00,0x10,0x0b,0x04,0xff, + 0xe0,0xb7,0x99,0xe0,0xb7,0x9f,0x00,0x04,0x00,0xd4,0x10,0x93,0x0c,0x52,0x04,0x00, + 0x00,0x11,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x93,0x14,0xd2,0x08,0x11,0x04,0x00, + 0x00,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xe2, + 0x31,0x01,0xd1,0x58,0xd0,0x3a,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x92,0x0c, + 0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00, + 0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x67,0x10,0x04, + 0x01,0x09,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0xcf,0x86, + 0x95,0x18,0xd4,0x0c,0x53,0x04,0x01,0x00,0x12,0x04,0x01,0x6b,0x01,0x00,0x53,0x04, + 0x01,0x00,0x12,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0xd0,0x9e,0xcf,0x86,0xd5,0x54, + 0xd4,0x3c,0xd3,0x20,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x10,0x04, + 0x01,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x15,0x00, + 0x01,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x15,0x00,0x10,0x04,0x01,0x00, + 0x00,0x00,0x91,0x08,0x10,0x04,0x15,0x00,0x01,0x00,0x15,0x00,0xd3,0x08,0x12,0x04, + 0x15,0x00,0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x15,0x00,0x01,0x00,0x01,0x00, + 0x01,0x00,0xd4,0x30,0xd3,0x1c,0xd2,0x0c,0x91,0x08,0x10,0x04,0x15,0x00,0x01,0x00, + 0x01,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x10,0x04,0x00,0x00,0x01,0x00, + 0xd2,0x08,0x11,0x04,0x15,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x15,0x00,0x01,0x00, + 0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x76,0x10,0x04,0x15,0x09, + 0x01,0x00,0x11,0x04,0x01,0x00,0x00,0x00,0xcf,0x86,0x95,0x34,0xd4,0x20,0xd3,0x14, + 0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x01,0x00, + 0x00,0x00,0x52,0x04,0x01,0x7a,0x11,0x04,0x01,0x00,0x00,0x00,0x53,0x04,0x01,0x00, + 0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x11,0x04,0x01,0x00,0x0d,0x00,0x00,0x00, + 0xe1,0x2b,0x01,0xd0,0x3e,0xcf,0x86,0xd5,0x14,0x54,0x04,0x02,0x00,0x53,0x04,0x02, + 0x00,0x92,0x08,0x11,0x04,0x02,0xdc,0x02,0x00,0x02,0x00,0x54,0x04,0x02,0x00,0xd3, + 0x14,0x52,0x04,0x02,0x00,0xd1,0x08,0x10,0x04,0x02,0x00,0x02,0xdc,0x10,0x04,0x02, + 0x00,0x02,0xdc,0x92,0x0c,0x91,0x08,0x10,0x04,0x02,0x00,0x02,0xd8,0x02,0x00,0x02, + 0x00,0xcf,0x86,0xd5,0x73,0xd4,0x36,0xd3,0x17,0x92,0x13,0x51,0x04,0x02,0x00,0x10, + 0x04,0x02,0x00,0x02,0xff,0xe0,0xbd,0x82,0xe0,0xbe,0xb7,0x00,0x02,0x00,0xd2,0x0c, + 0x91,0x08,0x10,0x04,0x00,0x00,0x02,0x00,0x02,0x00,0x91,0x0f,0x10,0x04,0x02,0x00, + 0x02,0xff,0xe0,0xbd,0x8c,0xe0,0xbe,0xb7,0x00,0x02,0x00,0xd3,0x26,0xd2,0x13,0x51, + 0x04,0x02,0x00,0x10,0x0b,0x02,0xff,0xe0,0xbd,0x91,0xe0,0xbe,0xb7,0x00,0x02,0x00, + 0x51,0x04,0x02,0x00,0x10,0x04,0x02,0x00,0x02,0xff,0xe0,0xbd,0x96,0xe0,0xbe,0xb7, + 0x00,0x52,0x04,0x02,0x00,0x91,0x0f,0x10,0x0b,0x02,0xff,0xe0,0xbd,0x9b,0xe0,0xbe, + 0xb7,0x00,0x02,0x00,0x02,0x00,0xd4,0x27,0x53,0x04,0x02,0x00,0xd2,0x17,0xd1,0x0f, + 0x10,0x04,0x02,0x00,0x02,0xff,0xe0,0xbd,0x80,0xe0,0xbe,0xb5,0x00,0x10,0x04,0x04, + 0x00,0x0a,0x00,0x91,0x08,0x10,0x04,0x0a,0x00,0x00,0x00,0x00,0x00,0xd3,0x35,0xd2, + 0x17,0xd1,0x08,0x10,0x04,0x00,0x00,0x02,0x81,0x10,0x04,0x02,0x82,0x02,0xff,0xe0, + 0xbd,0xb1,0xe0,0xbd,0xb2,0x00,0xd1,0x0f,0x10,0x04,0x02,0x84,0x02,0xff,0xe0,0xbd, + 0xb1,0xe0,0xbd,0xb4,0x00,0x10,0x0b,0x02,0xff,0xe0,0xbe,0xb2,0xe0,0xbe,0x80,0x00, + 0x02,0x00,0xd2,0x13,0x91,0x0f,0x10,0x0b,0x02,0xff,0xe0,0xbe,0xb3,0xe0,0xbe,0x80, + 0x00,0x02,0x00,0x02,0x82,0x11,0x04,0x02,0x82,0x02,0x00,0xd0,0xd3,0xcf,0x86,0xd5, + 0x65,0xd4,0x27,0xd3,0x1f,0xd2,0x13,0x91,0x0f,0x10,0x04,0x02,0x82,0x02,0xff,0xe0, + 0xbd,0xb1,0xe0,0xbe,0x80,0x00,0x02,0xe6,0x91,0x08,0x10,0x04,0x02,0x09,0x02,0x00, + 0x02,0xe6,0x12,0x04,0x02,0x00,0x0c,0x00,0xd3,0x1f,0xd2,0x13,0x51,0x04,0x02,0x00, + 0x10,0x04,0x02,0x00,0x02,0xff,0xe0,0xbe,0x92,0xe0,0xbe,0xb7,0x00,0x51,0x04,0x02, + 0x00,0x10,0x04,0x04,0x00,0x02,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x02, + 0x00,0x02,0x00,0x91,0x0f,0x10,0x04,0x02,0x00,0x02,0xff,0xe0,0xbe,0x9c,0xe0,0xbe, + 0xb7,0x00,0x02,0x00,0xd4,0x3d,0xd3,0x26,0xd2,0x13,0x51,0x04,0x02,0x00,0x10,0x0b, + 0x02,0xff,0xe0,0xbe,0xa1,0xe0,0xbe,0xb7,0x00,0x02,0x00,0x51,0x04,0x02,0x00,0x10, + 0x04,0x02,0x00,0x02,0xff,0xe0,0xbe,0xa6,0xe0,0xbe,0xb7,0x00,0x52,0x04,0x02,0x00, + 0x91,0x0f,0x10,0x0b,0x02,0xff,0xe0,0xbe,0xab,0xe0,0xbe,0xb7,0x00,0x02,0x00,0x04, + 0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,0x02,0x00,0x02,0x00,0x02, + 0x00,0xd2,0x13,0x91,0x0f,0x10,0x04,0x04,0x00,0x02,0xff,0xe0,0xbe,0x90,0xe0,0xbe, + 0xb5,0x00,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0xcf,0x86, + 0x95,0x4c,0xd4,0x24,0xd3,0x10,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04, + 0x04,0xdc,0x04,0x00,0x52,0x04,0x04,0x00,0xd1,0x08,0x10,0x04,0x04,0x00,0x00,0x00, + 0x10,0x04,0x0a,0x00,0x04,0x00,0xd3,0x14,0xd2,0x08,0x11,0x04,0x08,0x00,0x0a,0x00, + 0x91,0x08,0x10,0x04,0x0a,0x00,0x0b,0x00,0x0b,0x00,0x92,0x10,0xd1,0x08,0x10,0x04, + 0x0b,0x00,0x0c,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86, + 0xe5,0xf7,0x04,0xe4,0x79,0x03,0xe3,0x7b,0x01,0xe2,0x04,0x01,0xd1,0x7f,0xd0,0x65, + 0xcf,0x86,0x55,0x04,0x04,0x00,0xd4,0x33,0xd3,0x1f,0xd2,0x0c,0x51,0x04,0x04,0x00, + 0x10,0x04,0x0a,0x00,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x0b,0x04,0xff,0xe1,0x80, + 0xa5,0xe1,0x80,0xae,0x00,0x04,0x00,0x92,0x10,0xd1,0x08,0x10,0x04,0x0a,0x00,0x04, + 0x00,0x10,0x04,0x04,0x00,0x0a,0x00,0x04,0x00,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x04, + 0x00,0x10,0x04,0x04,0x00,0x0a,0x00,0x51,0x04,0x0a,0x00,0x10,0x04,0x04,0x00,0x04, + 0x07,0x92,0x10,0xd1,0x08,0x10,0x04,0x04,0x00,0x04,0x09,0x10,0x04,0x0a,0x09,0x0a, + 0x00,0x0a,0x00,0xcf,0x86,0x95,0x14,0x54,0x04,0x04,0x00,0x53,0x04,0x04,0x00,0x92, + 0x08,0x11,0x04,0x04,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,0xd0,0x2e,0xcf,0x86,0x95, + 0x28,0xd4,0x14,0x53,0x04,0x0a,0x00,0x52,0x04,0x0a,0x00,0x91,0x08,0x10,0x04,0x0a, + 0x00,0x0a,0xdc,0x0a,0x00,0x53,0x04,0x0a,0x00,0xd2,0x08,0x11,0x04,0x0a,0x00,0x0b, + 0x00,0x11,0x04,0x0b,0x00,0x0a,0x00,0x01,0x00,0xcf,0x86,0xd5,0x24,0x94,0x20,0xd3, + 0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0x52, + 0x04,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x00,0x00,0x01,0x00,0x54, + 0x04,0x01,0x00,0xd3,0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01, + 0x00,0x06,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x06,0x00,0x08,0x00,0x10,0x04,0x08, + 0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x08,0x00,0x0d,0x00,0x0d,0x00,0xd1,0x3e,0xd0, + 0x06,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x1d,0x54,0x04,0x01,0x00,0x53,0x04,0x01, + 0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b, + 0x00,0x01,0xff,0x00,0x94,0x15,0x93,0x11,0x92,0x0d,0x91,0x09,0x10,0x05,0x01,0xff, + 0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd0,0x1e,0xcf,0x86,0x55, + 0x04,0x01,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01, + 0x00,0x0b,0x00,0x0b,0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0x54, + 0x04,0x01,0x00,0x53,0x04,0x01,0x00,0x92,0x08,0x11,0x04,0x01,0x00,0x0b,0x00,0x0b, + 0x00,0xe2,0x21,0x01,0xd1,0x6c,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x94,0x14,0x93,0x10, + 0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0x04,0x00, + 0x04,0x00,0x04,0x00,0xcf,0x86,0x95,0x48,0xd4,0x24,0xd3,0x10,0x52,0x04,0x04,0x00, + 0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04, + 0x04,0x00,0x00,0x00,0x04,0x00,0x11,0x04,0x04,0x00,0x00,0x00,0xd3,0x10,0x52,0x04, + 0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x00,0x00,0xd2,0x0c,0x91,0x08, + 0x10,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0x11,0x04,0x04,0x00,0x00,0x00,0x04,0x00, + 0xd0,0x62,0xcf,0x86,0xd5,0x28,0x94,0x24,0xd3,0x10,0x52,0x04,0x04,0x00,0x51,0x04, + 0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x04,0x00, + 0x00,0x00,0x04,0x00,0x11,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0xd4,0x14,0x53,0x04, + 0x04,0x00,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00, + 0xd3,0x14,0xd2,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0x11,0x04, + 0x04,0x00,0x00,0x00,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00, + 0x00,0x00,0xcf,0x86,0xd5,0x38,0xd4,0x24,0xd3,0x14,0xd2,0x0c,0x91,0x08,0x10,0x04, + 0x04,0x00,0x00,0x00,0x04,0x00,0x11,0x04,0x04,0x00,0x00,0x00,0x52,0x04,0x04,0x00, + 0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0x93,0x10,0x52,0x04,0x04,0x00, + 0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0x94,0x14,0x53,0x04, + 0x04,0x00,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00, + 0x04,0x00,0xd1,0x9c,0xd0,0x3e,0xcf,0x86,0x95,0x38,0xd4,0x14,0x53,0x04,0x04,0x00, + 0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0xd3,0x14, + 0xd2,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0x11,0x04,0x04,0x00, + 0x00,0x00,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00, + 0x04,0x00,0xcf,0x86,0xd5,0x34,0xd4,0x14,0x93,0x10,0x52,0x04,0x04,0x00,0x51,0x04, + 0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0x04,0x00,0x53,0x04,0x04,0x00,0xd2,0x0c, + 0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x00,0x00, + 0x0c,0xe6,0x10,0x04,0x0c,0xe6,0x08,0xe6,0xd4,0x14,0x93,0x10,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x08,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0x53,0x04,0x04,0x00, + 0x52,0x04,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0xd0,0x1a, + 0xcf,0x86,0x95,0x14,0x54,0x04,0x08,0x00,0x53,0x04,0x08,0x00,0x92,0x08,0x11,0x04, + 0x08,0x00,0x00,0x00,0x00,0x00,0x04,0x00,0xcf,0x86,0x55,0x04,0x04,0x00,0x54,0x04, + 0x04,0x00,0xd3,0x10,0x52,0x04,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x11,0x00, + 0x00,0x00,0x52,0x04,0x11,0x00,0x11,0x04,0x11,0x00,0x00,0x00,0xd3,0x30,0xd2,0x2a, + 0xd1,0x24,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x0b,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0x04,0x00, + 0xcf,0x06,0x04,0x00,0xcf,0x06,0x04,0x00,0xcf,0x06,0x04,0x00,0xd2,0x6c,0xd1,0x24, + 0xd0,0x06,0xcf,0x06,0x04,0x00,0xcf,0x86,0x55,0x04,0x04,0x00,0x54,0x04,0x04,0x00, + 0x93,0x10,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x0b,0x00, + 0x0b,0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,0x04,0x00,0x53,0x04,0x04,0x00, + 0x52,0x04,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0x04,0x00, + 0xcf,0x86,0x55,0x04,0x04,0x00,0x54,0x04,0x04,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x04,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x92,0x0c,0x91,0x08,0x10,0x04, + 0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd1,0x80,0xd0,0x46,0xcf,0x86,0xd5,0x28, + 0xd4,0x14,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0x91,0x08,0x10,0x04,0x06,0x00, + 0x00,0x00,0x06,0x00,0x93,0x10,0x52,0x04,0x06,0x00,0x91,0x08,0x10,0x04,0x06,0x09, + 0x00,0x00,0x00,0x00,0x00,0x00,0x54,0x04,0x06,0x00,0x93,0x14,0x52,0x04,0x06,0x00, + 0xd1,0x08,0x10,0x04,0x06,0x09,0x06,0x00,0x10,0x04,0x06,0x00,0x00,0x00,0x00,0x00, + 0xcf,0x86,0xd5,0x10,0x54,0x04,0x06,0x00,0x93,0x08,0x12,0x04,0x06,0x00,0x00,0x00, + 0x00,0x00,0xd4,0x14,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0x91,0x08,0x10,0x04, + 0x06,0x00,0x00,0x00,0x06,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x06,0x00, + 0x00,0x00,0x06,0x00,0x00,0x00,0x00,0x00,0xd0,0x1b,0xcf,0x86,0x55,0x04,0x04,0x00, + 0x54,0x04,0x04,0x00,0x93,0x0d,0x52,0x04,0x04,0x00,0x11,0x05,0x04,0xff,0x00,0x04, + 0x00,0x04,0x00,0xcf,0x86,0xd5,0x24,0x54,0x04,0x04,0x00,0xd3,0x10,0x92,0x0c,0x51, + 0x04,0x04,0x00,0x10,0x04,0x04,0x09,0x04,0x00,0x04,0x00,0x52,0x04,0x04,0x00,0x91, + 0x08,0x10,0x04,0x04,0x00,0x07,0xe6,0x00,0x00,0xd4,0x10,0x53,0x04,0x04,0x00,0x92, + 0x08,0x11,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x07,0x00,0x92,0x08,0x11, + 0x04,0x07,0x00,0x00,0x00,0x00,0x00,0xe4,0xb7,0x03,0xe3,0x58,0x01,0xd2,0x8f,0xd1, + 0x53,0xd0,0x35,0xcf,0x86,0x95,0x2f,0xd4,0x1f,0x53,0x04,0x04,0x00,0xd2,0x0d,0x51, + 0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x04,0xff,0x00,0x51,0x05,0x04,0xff,0x00,0x10, + 0x05,0x04,0xff,0x00,0x00,0x00,0x53,0x04,0x04,0x00,0x92,0x08,0x11,0x04,0x04,0x00, + 0x00,0x00,0x00,0x00,0x04,0x00,0xcf,0x86,0x55,0x04,0x04,0x00,0x54,0x04,0x04,0x00, + 0x53,0x04,0x04,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0xd0,0x22,0xcf,0x86,0x55,0x04,0x04,0x00,0x94,0x18,0x53,0x04,0x04,0x00, + 0x92,0x10,0xd1,0x08,0x10,0x04,0x04,0x00,0x04,0xe4,0x10,0x04,0x0a,0x00,0x00,0x00, + 0x00,0x00,0x0b,0x00,0xcf,0x86,0x55,0x04,0x0b,0x00,0x54,0x04,0x0b,0x00,0x93,0x0c, + 0x52,0x04,0x0b,0x00,0x11,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0xd1,0x80,0xd0,0x42, + 0xcf,0x86,0xd5,0x1c,0x54,0x04,0x07,0x00,0x53,0x04,0x07,0x00,0x52,0x04,0x07,0x00, + 0xd1,0x08,0x10,0x04,0x07,0x00,0x10,0x00,0x10,0x04,0x10,0x00,0x00,0x00,0xd4,0x0c, + 0x53,0x04,0x07,0x00,0x12,0x04,0x07,0x00,0x00,0x00,0x53,0x04,0x07,0x00,0x92,0x10, + 0xd1,0x08,0x10,0x04,0x07,0x00,0x07,0xde,0x10,0x04,0x07,0xe6,0x07,0xdc,0x00,0x00, + 0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x07,0x00, + 0x00,0x00,0x00,0x00,0x07,0x00,0x07,0x00,0x07,0x00,0xd4,0x10,0x53,0x04,0x07,0x00, + 0x52,0x04,0x07,0x00,0x11,0x04,0x07,0x00,0x00,0x00,0x93,0x10,0x52,0x04,0x07,0x00, + 0x91,0x08,0x10,0x04,0x07,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd0,0x1a,0xcf,0x86, + 0x55,0x04,0x08,0x00,0x94,0x10,0x53,0x04,0x08,0x00,0x92,0x08,0x11,0x04,0x08,0x00, + 0x0b,0x00,0x00,0x00,0x08,0x00,0xcf,0x86,0x95,0x28,0xd4,0x10,0x53,0x04,0x08,0x00, + 0x92,0x08,0x11,0x04,0x08,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x08,0x00,0xd2,0x0c, + 0x51,0x04,0x08,0x00,0x10,0x04,0x0b,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x08,0x00, + 0x07,0x00,0xd2,0xe4,0xd1,0x80,0xd0,0x2e,0xcf,0x86,0x95,0x28,0x54,0x04,0x08,0x00, + 0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x08,0xe6, + 0xd2,0x0c,0x91,0x08,0x10,0x04,0x08,0xdc,0x08,0x00,0x08,0x00,0x11,0x04,0x00,0x00, + 0x08,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x18,0x54,0x04,0x0b,0x00,0x53,0x04,0x0b,0x00, + 0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,0x00,0x00,0xd4,0x14, + 0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0b,0x09,0x0b,0x00,0x0b,0x00,0x0b,0x00, + 0x0b,0x00,0xd3,0x10,0x52,0x04,0x0b,0x00,0x91,0x08,0x10,0x04,0x0b,0x00,0x0b,0xe6, + 0x0b,0xe6,0x52,0x04,0x0b,0xe6,0xd1,0x08,0x10,0x04,0x0b,0xe6,0x00,0x00,0x10,0x04, + 0x00,0x00,0x0b,0xdc,0xd0,0x5e,0xcf,0x86,0xd5,0x20,0xd4,0x10,0x53,0x04,0x0b,0x00, + 0x92,0x08,0x11,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x0b,0x00,0x92,0x08, + 0x11,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0xd4,0x10,0x53,0x04,0x0b,0x00,0x52,0x04, + 0x0b,0x00,0x11,0x04,0x0b,0x00,0x00,0x00,0xd3,0x10,0x52,0x04,0x10,0xe6,0x91,0x08, + 0x10,0x04,0x10,0xe6,0x10,0xdc,0x10,0xdc,0xd2,0x0c,0x51,0x04,0x10,0xdc,0x10,0x04, + 0x10,0xdc,0x10,0xe6,0xd1,0x08,0x10,0x04,0x10,0xe6,0x10,0xdc,0x10,0x04,0x10,0x00, + 0x00,0x00,0xcf,0x06,0x00,0x00,0xe1,0x1e,0x01,0xd0,0xaa,0xcf,0x86,0xd5,0x6e,0xd4, + 0x53,0xd3,0x17,0x52,0x04,0x09,0x00,0x51,0x04,0x09,0x00,0x10,0x0b,0x09,0xff,0xe1, + 0xac,0x85,0xe1,0xac,0xb5,0x00,0x09,0x00,0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x09,0xff, + 0xe1,0xac,0x87,0xe1,0xac,0xb5,0x00,0x09,0x00,0x10,0x0b,0x09,0xff,0xe1,0xac,0x89, + 0xe1,0xac,0xb5,0x00,0x09,0x00,0xd1,0x0f,0x10,0x0b,0x09,0xff,0xe1,0xac,0x8b,0xe1, + 0xac,0xb5,0x00,0x09,0x00,0x10,0x0b,0x09,0xff,0xe1,0xac,0x8d,0xe1,0xac,0xb5,0x00, + 0x09,0x00,0x93,0x17,0x92,0x13,0x51,0x04,0x09,0x00,0x10,0x0b,0x09,0xff,0xe1,0xac, + 0x91,0xe1,0xac,0xb5,0x00,0x09,0x00,0x09,0x00,0x09,0x00,0x54,0x04,0x09,0x00,0xd3, + 0x10,0x52,0x04,0x09,0x00,0x91,0x08,0x10,0x04,0x09,0x07,0x09,0x00,0x09,0x00,0xd2, + 0x13,0x51,0x04,0x09,0x00,0x10,0x04,0x09,0x00,0x09,0xff,0xe1,0xac,0xba,0xe1,0xac, + 0xb5,0x00,0x91,0x0f,0x10,0x04,0x09,0x00,0x09,0xff,0xe1,0xac,0xbc,0xe1,0xac,0xb5, + 0x00,0x09,0x00,0xcf,0x86,0xd5,0x3d,0x94,0x39,0xd3,0x31,0xd2,0x25,0xd1,0x16,0x10, + 0x0b,0x09,0xff,0xe1,0xac,0xbe,0xe1,0xac,0xb5,0x00,0x09,0xff,0xe1,0xac,0xbf,0xe1, + 0xac,0xb5,0x00,0x10,0x04,0x09,0x00,0x09,0xff,0xe1,0xad,0x82,0xe1,0xac,0xb5,0x00, + 0x91,0x08,0x10,0x04,0x09,0x09,0x09,0x00,0x09,0x00,0x12,0x04,0x09,0x00,0x00,0x00, + 0x09,0x00,0xd4,0x1c,0x53,0x04,0x09,0x00,0xd2,0x0c,0x51,0x04,0x09,0x00,0x10,0x04, + 0x09,0x00,0x09,0xe6,0x91,0x08,0x10,0x04,0x09,0xdc,0x09,0xe6,0x09,0xe6,0xd3,0x08, + 0x12,0x04,0x09,0xe6,0x09,0x00,0x52,0x04,0x09,0x00,0x91,0x08,0x10,0x04,0x09,0x00, + 0x00,0x00,0x00,0x00,0xd0,0x2e,0xcf,0x86,0x55,0x04,0x0a,0x00,0xd4,0x18,0x53,0x04, + 0x0a,0x00,0xd2,0x0c,0x51,0x04,0x0a,0x00,0x10,0x04,0x0a,0x09,0x0d,0x09,0x11,0x04, + 0x0d,0x00,0x0a,0x00,0x53,0x04,0x0a,0x00,0x92,0x08,0x11,0x04,0x0a,0x00,0x0d,0x00, + 0x0d,0x00,0xcf,0x86,0x55,0x04,0x0c,0x00,0xd4,0x14,0x93,0x10,0x52,0x04,0x0c,0x00, + 0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x07,0x0c,0x00,0x0c,0x00,0xd3,0x0c,0x92,0x08, + 0x11,0x04,0x0c,0x00,0x0c,0x09,0x00,0x00,0x12,0x04,0x00,0x00,0x0c,0x00,0xe3,0xb2, + 0x01,0xe2,0x09,0x01,0xd1,0x4c,0xd0,0x2a,0xcf,0x86,0x55,0x04,0x0a,0x00,0x54,0x04, + 0x0a,0x00,0xd3,0x10,0x52,0x04,0x0a,0x00,0x51,0x04,0x0a,0x00,0x10,0x04,0x0a,0x00, + 0x0a,0x07,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0a,0x00,0x0a,0x00, + 0xcf,0x86,0x95,0x1c,0x94,0x18,0x53,0x04,0x0a,0x00,0xd2,0x08,0x11,0x04,0x0a,0x00, + 0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00, + 0xd0,0x3a,0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x12,0x00,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x14,0x00,0x54,0x04,0x14,0x00, + 0x53,0x04,0x14,0x00,0xd2,0x0c,0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00, + 0x91,0x08,0x10,0x04,0x00,0x00,0x14,0x00,0x14,0x00,0xcf,0x86,0xd5,0x2c,0xd4,0x08, + 0x13,0x04,0x0d,0x00,0x00,0x00,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x0b,0xe6,0x10,0x04, + 0x0b,0xe6,0x0b,0x00,0x91,0x08,0x10,0x04,0x0b,0x01,0x0b,0xdc,0x0b,0xdc,0x92,0x08, + 0x11,0x04,0x0b,0xdc,0x0b,0xe6,0x0b,0xdc,0xd4,0x28,0xd3,0x10,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x0b,0xe6,0x0b,0x00,0x0b,0x01,0x0b,0x01,0xd2,0x0c,0x91,0x08,0x10,0x04, + 0x0b,0x01,0x0b,0x00,0x0b,0x00,0x91,0x08,0x10,0x04,0x0b,0x00,0x0b,0xdc,0x0b,0x00, + 0xd3,0x1c,0xd2,0x0c,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,0x0d,0x00,0xd1,0x08, + 0x10,0x04,0x0d,0xe6,0x0d,0x00,0x10,0x04,0x0d,0x00,0x13,0x00,0x92,0x0c,0x51,0x04, + 0x10,0xe6,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0xd1,0x1c,0xd0,0x06,0xcf,0x06, + 0x07,0x00,0xcf,0x86,0x55,0x04,0x07,0x00,0x94,0x0c,0x53,0x04,0x07,0x00,0x12,0x04, + 0x07,0x00,0x08,0x00,0x08,0x00,0xd0,0x06,0xcf,0x06,0x08,0x00,0xcf,0x86,0xd5,0x40, + 0xd4,0x2c,0xd3,0x10,0x92,0x0c,0x51,0x04,0x08,0xe6,0x10,0x04,0x08,0xdc,0x08,0xe6, + 0x09,0xe6,0xd2,0x0c,0x51,0x04,0x09,0xe6,0x10,0x04,0x09,0xdc,0x0a,0xe6,0xd1,0x08, + 0x10,0x04,0x0a,0xe6,0x0a,0xea,0x10,0x04,0x0a,0xd6,0x0a,0xdc,0x93,0x10,0x92,0x0c, + 0x91,0x08,0x10,0x04,0x0a,0xca,0x0a,0xe6,0x0a,0xe6,0x0a,0xe6,0x0a,0xe6,0xd4,0x14, + 0x93,0x10,0x52,0x04,0x0a,0xe6,0x51,0x04,0x0a,0xe6,0x10,0x04,0x0a,0xe6,0x10,0xe6, + 0x10,0xe6,0xd3,0x10,0x52,0x04,0x10,0xe6,0x51,0x04,0x10,0xe6,0x10,0x04,0x13,0xe8, + 0x13,0xe4,0xd2,0x10,0xd1,0x08,0x10,0x04,0x13,0xe4,0x13,0xdc,0x10,0x04,0x00,0x00, + 0x12,0xe6,0xd1,0x08,0x10,0x04,0x0c,0xe9,0x0b,0xdc,0x10,0x04,0x09,0xe6,0x09,0xdc, + 0xe2,0x80,0x08,0xe1,0x48,0x04,0xe0,0x1c,0x02,0xcf,0x86,0xe5,0x11,0x01,0xd4,0x84, + 0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x41,0xcc,0xa5,0x00,0x01,0xff, + 0x61,0xcc,0xa5,0x00,0x10,0x08,0x01,0xff,0x42,0xcc,0x87,0x00,0x01,0xff,0x62,0xcc, + 0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x42,0xcc,0xa3,0x00,0x01,0xff,0x62,0xcc, + 0xa3,0x00,0x10,0x08,0x01,0xff,0x42,0xcc,0xb1,0x00,0x01,0xff,0x62,0xcc,0xb1,0x00, + 0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,0x43,0xcc,0xa7,0xcc,0x81,0x00,0x01,0xff, + 0x63,0xcc,0xa7,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x44,0xcc,0x87,0x00,0x01,0xff, + 0x64,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x44,0xcc,0xa3,0x00,0x01,0xff, + 0x64,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x44,0xcc,0xb1,0x00,0x01,0xff,0x64,0xcc, + 0xb1,0x00,0xd3,0x48,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x44,0xcc,0xa7,0x00, + 0x01,0xff,0x64,0xcc,0xa7,0x00,0x10,0x08,0x01,0xff,0x44,0xcc,0xad,0x00,0x01,0xff, + 0x64,0xcc,0xad,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x45,0xcc,0x84,0xcc,0x80,0x00, + 0x01,0xff,0x65,0xcc,0x84,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x45,0xcc,0x84,0xcc, + 0x81,0x00,0x01,0xff,0x65,0xcc,0x84,0xcc,0x81,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x01,0xff,0x45,0xcc,0xad,0x00,0x01,0xff,0x65,0xcc,0xad,0x00,0x10,0x08,0x01,0xff, + 0x45,0xcc,0xb0,0x00,0x01,0xff,0x65,0xcc,0xb0,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff, + 0x45,0xcc,0xa7,0xcc,0x86,0x00,0x01,0xff,0x65,0xcc,0xa7,0xcc,0x86,0x00,0x10,0x08, + 0x01,0xff,0x46,0xcc,0x87,0x00,0x01,0xff,0x66,0xcc,0x87,0x00,0xd4,0x84,0xd3,0x40, + 0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x47,0xcc,0x84,0x00,0x01,0xff,0x67,0xcc, + 0x84,0x00,0x10,0x08,0x01,0xff,0x48,0xcc,0x87,0x00,0x01,0xff,0x68,0xcc,0x87,0x00, + 0xd1,0x10,0x10,0x08,0x01,0xff,0x48,0xcc,0xa3,0x00,0x01,0xff,0x68,0xcc,0xa3,0x00, + 0x10,0x08,0x01,0xff,0x48,0xcc,0x88,0x00,0x01,0xff,0x68,0xcc,0x88,0x00,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x01,0xff,0x48,0xcc,0xa7,0x00,0x01,0xff,0x68,0xcc,0xa7,0x00, + 0x10,0x08,0x01,0xff,0x48,0xcc,0xae,0x00,0x01,0xff,0x68,0xcc,0xae,0x00,0xd1,0x10, + 0x10,0x08,0x01,0xff,0x49,0xcc,0xb0,0x00,0x01,0xff,0x69,0xcc,0xb0,0x00,0x10,0x0a, + 0x01,0xff,0x49,0xcc,0x88,0xcc,0x81,0x00,0x01,0xff,0x69,0xcc,0x88,0xcc,0x81,0x00, + 0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x4b,0xcc,0x81,0x00,0x01,0xff, + 0x6b,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x4b,0xcc,0xa3,0x00,0x01,0xff,0x6b,0xcc, + 0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x4b,0xcc,0xb1,0x00,0x01,0xff,0x6b,0xcc, + 0xb1,0x00,0x10,0x08,0x01,0xff,0x4c,0xcc,0xa3,0x00,0x01,0xff,0x6c,0xcc,0xa3,0x00, + 0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4c,0xcc,0xa3,0xcc,0x84,0x00,0x01,0xff, + 0x6c,0xcc,0xa3,0xcc,0x84,0x00,0x10,0x08,0x01,0xff,0x4c,0xcc,0xb1,0x00,0x01,0xff, + 0x6c,0xcc,0xb1,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x4c,0xcc,0xad,0x00,0x01,0xff, + 0x6c,0xcc,0xad,0x00,0x10,0x08,0x01,0xff,0x4d,0xcc,0x81,0x00,0x01,0xff,0x6d,0xcc, + 0x81,0x00,0xcf,0x86,0xe5,0x15,0x01,0xd4,0x88,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x4d,0xcc,0x87,0x00,0x01,0xff,0x6d,0xcc,0x87,0x00,0x10,0x08,0x01, + 0xff,0x4d,0xcc,0xa3,0x00,0x01,0xff,0x6d,0xcc,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x4e,0xcc,0x87,0x00,0x01,0xff,0x6e,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x4e, + 0xcc,0xa3,0x00,0x01,0xff,0x6e,0xcc,0xa3,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x4e,0xcc,0xb1,0x00,0x01,0xff,0x6e,0xcc,0xb1,0x00,0x10,0x08,0x01,0xff,0x4e, + 0xcc,0xad,0x00,0x01,0xff,0x6e,0xcc,0xad,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f, + 0xcc,0x83,0xcc,0x81,0x00,0x01,0xff,0x6f,0xcc,0x83,0xcc,0x81,0x00,0x10,0x0a,0x01, + 0xff,0x4f,0xcc,0x83,0xcc,0x88,0x00,0x01,0xff,0x6f,0xcc,0x83,0xcc,0x88,0x00,0xd3, + 0x48,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x84,0xcc,0x80,0x00,0x01, + 0xff,0x6f,0xcc,0x84,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x84,0xcc,0x81, + 0x00,0x01,0xff,0x6f,0xcc,0x84,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x50, + 0xcc,0x81,0x00,0x01,0xff,0x70,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x50,0xcc,0x87, + 0x00,0x01,0xff,0x70,0xcc,0x87,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x52, + 0xcc,0x87,0x00,0x01,0xff,0x72,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x52,0xcc,0xa3, + 0x00,0x01,0xff,0x72,0xcc,0xa3,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x52,0xcc,0xa3, + 0xcc,0x84,0x00,0x01,0xff,0x72,0xcc,0xa3,0xcc,0x84,0x00,0x10,0x08,0x01,0xff,0x52, + 0xcc,0xb1,0x00,0x01,0xff,0x72,0xcc,0xb1,0x00,0xd4,0x8c,0xd3,0x48,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x01,0xff,0x53,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x87,0x00,0x10, + 0x08,0x01,0xff,0x53,0xcc,0xa3,0x00,0x01,0xff,0x73,0xcc,0xa3,0x00,0xd1,0x14,0x10, + 0x0a,0x01,0xff,0x53,0xcc,0x81,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x81,0xcc,0x87, + 0x00,0x10,0x0a,0x01,0xff,0x53,0xcc,0x8c,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x8c, + 0xcc,0x87,0x00,0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,0x53,0xcc,0xa3,0xcc,0x87, + 0x00,0x01,0xff,0x73,0xcc,0xa3,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x54,0xcc,0x87, + 0x00,0x01,0xff,0x74,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x54,0xcc,0xa3, + 0x00,0x01,0xff,0x74,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x54,0xcc,0xb1,0x00,0x01, + 0xff,0x74,0xcc,0xb1,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x54, + 0xcc,0xad,0x00,0x01,0xff,0x74,0xcc,0xad,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0xa4, + 0x00,0x01,0xff,0x75,0xcc,0xa4,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0xb0, + 0x00,0x01,0xff,0x75,0xcc,0xb0,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0xad,0x00,0x01, + 0xff,0x75,0xcc,0xad,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x55,0xcc,0x83, + 0xcc,0x81,0x00,0x01,0xff,0x75,0xcc,0x83,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x55, + 0xcc,0x84,0xcc,0x88,0x00,0x01,0xff,0x75,0xcc,0x84,0xcc,0x88,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0x56,0xcc,0x83,0x00,0x01,0xff,0x76,0xcc,0x83,0x00,0x10,0x08,0x01, + 0xff,0x56,0xcc,0xa3,0x00,0x01,0xff,0x76,0xcc,0xa3,0x00,0xe0,0x10,0x02,0xcf,0x86, + 0xd5,0xe1,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x57,0xcc, + 0x80,0x00,0x01,0xff,0x77,0xcc,0x80,0x00,0x10,0x08,0x01,0xff,0x57,0xcc,0x81,0x00, + 0x01,0xff,0x77,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x57,0xcc,0x88,0x00, + 0x01,0xff,0x77,0xcc,0x88,0x00,0x10,0x08,0x01,0xff,0x57,0xcc,0x87,0x00,0x01,0xff, + 0x77,0xcc,0x87,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x57,0xcc,0xa3,0x00, + 0x01,0xff,0x77,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x58,0xcc,0x87,0x00,0x01,0xff, + 0x78,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x58,0xcc,0x88,0x00,0x01,0xff, + 0x78,0xcc,0x88,0x00,0x10,0x08,0x01,0xff,0x59,0xcc,0x87,0x00,0x01,0xff,0x79,0xcc, + 0x87,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x5a,0xcc,0x82,0x00, + 0x01,0xff,0x7a,0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x5a,0xcc,0xa3,0x00,0x01,0xff, + 0x7a,0xcc,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x5a,0xcc,0xb1,0x00,0x01,0xff, + 0x7a,0xcc,0xb1,0x00,0x10,0x08,0x01,0xff,0x68,0xcc,0xb1,0x00,0x01,0xff,0x74,0xcc, + 0x88,0x00,0x92,0x1d,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0x8a,0x00,0x01,0xff, + 0x79,0xcc,0x8a,0x00,0x10,0x04,0x01,0x00,0x02,0xff,0xc5,0xbf,0xcc,0x87,0x00,0x0a, + 0x00,0xd4,0x98,0xd3,0x48,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x41,0xcc,0xa3, + 0x00,0x01,0xff,0x61,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x41,0xcc,0x89,0x00,0x01, + 0xff,0x61,0xcc,0x89,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x41,0xcc,0x82,0xcc,0x81, + 0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x82, + 0xcc,0x80,0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,0x80,0x00,0xd2,0x28,0xd1,0x14,0x10, + 0x0a,0x01,0xff,0x41,0xcc,0x82,0xcc,0x89,0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,0x89, + 0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x61,0xcc,0x82, + 0xcc,0x83,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x41,0xcc,0xa3,0xcc,0x82,0x00,0x01, + 0xff,0x61,0xcc,0xa3,0xcc,0x82,0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x86,0xcc,0x81, + 0x00,0x01,0xff,0x61,0xcc,0x86,0xcc,0x81,0x00,0xd3,0x50,0xd2,0x28,0xd1,0x14,0x10, + 0x0a,0x01,0xff,0x41,0xcc,0x86,0xcc,0x80,0x00,0x01,0xff,0x61,0xcc,0x86,0xcc,0x80, + 0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x86,0xcc,0x89,0x00,0x01,0xff,0x61,0xcc,0x86, + 0xcc,0x89,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x41,0xcc,0x86,0xcc,0x83,0x00,0x01, + 0xff,0x61,0xcc,0x86,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0xa3,0xcc,0x86, + 0x00,0x01,0xff,0x61,0xcc,0xa3,0xcc,0x86,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01, + 0xff,0x45,0xcc,0xa3,0x00,0x01,0xff,0x65,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x45, + 0xcc,0x89,0x00,0x01,0xff,0x65,0xcc,0x89,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x45, + 0xcc,0x83,0x00,0x01,0xff,0x65,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x45,0xcc,0x82, + 0xcc,0x81,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x81,0x00,0xcf,0x86,0xe5,0x31,0x01, + 0xd4,0x90,0xd3,0x50,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x45,0xcc,0x82,0xcc, + 0x80,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x45,0xcc, + 0x82,0xcc,0x89,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x89,0x00,0xd1,0x14,0x10,0x0a, + 0x01,0xff,0x45,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x83,0x00, + 0x10,0x0a,0x01,0xff,0x45,0xcc,0xa3,0xcc,0x82,0x00,0x01,0xff,0x65,0xcc,0xa3,0xcc, + 0x82,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x49,0xcc,0x89,0x00,0x01,0xff, + 0x69,0xcc,0x89,0x00,0x10,0x08,0x01,0xff,0x49,0xcc,0xa3,0x00,0x01,0xff,0x69,0xcc, + 0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x4f,0xcc,0xa3,0x00,0x01,0xff,0x6f,0xcc, + 0xa3,0x00,0x10,0x08,0x01,0xff,0x4f,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x89,0x00, + 0xd3,0x50,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x82,0xcc,0x81,0x00, + 0x01,0xff,0x6f,0xcc,0x82,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x82,0xcc, + 0x80,0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x80,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff, + 0x4f,0xcc,0x82,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x89,0x00,0x10,0x0a, + 0x01,0xff,0x4f,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x83,0x00, + 0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,0xa3,0xcc,0x82,0x00,0x01,0xff, + 0x6f,0xcc,0xa3,0xcc,0x82,0x00,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x9b,0xcc,0x81,0x00, + 0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x81,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc, + 0x9b,0xcc,0x80,0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff, + 0x4f,0xcc,0x9b,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x89,0x00,0xd4,0x98, + 0xd3,0x48,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x9b,0xcc,0x83,0x00, + 0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x9b,0xcc, + 0xa3,0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff, + 0x55,0xcc,0xa3,0x00,0x01,0xff,0x75,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x55,0xcc, + 0x89,0x00,0x01,0xff,0x75,0xcc,0x89,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff, + 0x55,0xcc,0x9b,0xcc,0x81,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x81,0x00,0x10,0x0a, + 0x01,0xff,0x55,0xcc,0x9b,0xcc,0x80,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x80,0x00, + 0xd1,0x14,0x10,0x0a,0x01,0xff,0x55,0xcc,0x9b,0xcc,0x89,0x00,0x01,0xff,0x75,0xcc, + 0x9b,0xcc,0x89,0x00,0x10,0x0a,0x01,0xff,0x55,0xcc,0x9b,0xcc,0x83,0x00,0x01,0xff, + 0x75,0xcc,0x9b,0xcc,0x83,0x00,0xd3,0x44,0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff, + 0x55,0xcc,0x9b,0xcc,0xa3,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0xa3,0x00,0x10,0x08, + 0x01,0xff,0x59,0xcc,0x80,0x00,0x01,0xff,0x79,0xcc,0x80,0x00,0xd1,0x10,0x10,0x08, + 0x01,0xff,0x59,0xcc,0xa3,0x00,0x01,0xff,0x79,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff, + 0x59,0xcc,0x89,0x00,0x01,0xff,0x79,0xcc,0x89,0x00,0x92,0x14,0x91,0x10,0x10,0x08, + 0x01,0xff,0x59,0xcc,0x83,0x00,0x01,0xff,0x79,0xcc,0x83,0x00,0x0a,0x00,0x0a,0x00, + 0xe1,0xc0,0x04,0xe0,0x80,0x02,0xcf,0x86,0xe5,0x2d,0x01,0xd4,0xa8,0xd3,0x54,0xd2, + 0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x93,0x00,0x01,0xff,0xce,0xb1, + 0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff, + 0xce,0xb1,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc, + 0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01, + 0xff,0xce,0xb1,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcd,0x82, + 0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0x91,0xcc,0x93,0x00,0x01,0xff, + 0xce,0x91,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0x91,0xcc,0x93,0xcc,0x80,0x00, + 0x01,0xff,0xce,0x91,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce, + 0x91,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0x91,0xcc,0x94,0xcc,0x81,0x00,0x10, + 0x0b,0x01,0xff,0xce,0x91,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0x91,0xcc,0x94, + 0xcd,0x82,0x00,0xd3,0x42,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb5,0xcc, + 0x93,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xb5,0xcc, + 0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,0xcc,0x80,0x00,0x91,0x16,0x10, + 0x0b,0x01,0xff,0xce,0xb5,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94, + 0xcc,0x81,0x00,0x00,0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0x95,0xcc, + 0x93,0x00,0x01,0xff,0xce,0x95,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0x95,0xcc, + 0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0x95,0xcc,0x94,0xcc,0x80,0x00,0x91,0x16,0x10, + 0x0b,0x01,0xff,0xce,0x95,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0x95,0xcc,0x94, + 0xcc,0x81,0x00,0x00,0x00,0xd4,0xa8,0xd3,0x54,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01, + 0xff,0xce,0xb7,0xcc,0x93,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0x00,0x10,0x0b,0x01, + 0xff,0xce,0xb7,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x80, + 0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff, + 0xce,0xb7,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcd, + 0x82,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcd,0x82,0x00,0xd2,0x28,0xd1,0x12,0x10, + 0x09,0x01,0xff,0xce,0x97,0xcc,0x93,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,0x00,0x10, + 0x0b,0x01,0xff,0xce,0x97,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0x97,0xcc,0x94, + 0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0x97,0xcc,0x93,0xcc,0x81,0x00, + 0x01,0xff,0xce,0x97,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,0xce,0x97,0xcc, + 0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,0xcd,0x82,0x00,0xd3,0x54,0xd2, + 0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x93,0x00,0x01,0xff,0xce,0xb9, + 0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xb9,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff, + 0xce,0xb9,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb9,0xcc, + 0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01, + 0xff,0xce,0xb9,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,0xcd,0x82, + 0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0x99,0xcc,0x93,0x00,0x01,0xff, + 0xce,0x99,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0x99,0xcc,0x93,0xcc,0x80,0x00, + 0x01,0xff,0xce,0x99,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce, + 0x99,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0x99,0xcc,0x94,0xcc,0x81,0x00,0x10, + 0x0b,0x01,0xff,0xce,0x99,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0x99,0xcc,0x94, + 0xcd,0x82,0x00,0xcf,0x86,0xe5,0x13,0x01,0xd4,0x84,0xd3,0x42,0xd2,0x28,0xd1,0x12, + 0x10,0x09,0x01,0xff,0xce,0xbf,0xcc,0x93,0x00,0x01,0xff,0xce,0xbf,0xcc,0x94,0x00, + 0x10,0x0b,0x01,0xff,0xce,0xbf,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xbf,0xcc, + 0x94,0xcc,0x80,0x00,0x91,0x16,0x10,0x0b,0x01,0xff,0xce,0xbf,0xcc,0x93,0xcc,0x81, + 0x00,0x01,0xff,0xce,0xbf,0xcc,0x94,0xcc,0x81,0x00,0x00,0x00,0xd2,0x28,0xd1,0x12, + 0x10,0x09,0x01,0xff,0xce,0x9f,0xcc,0x93,0x00,0x01,0xff,0xce,0x9f,0xcc,0x94,0x00, + 0x10,0x0b,0x01,0xff,0xce,0x9f,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0x9f,0xcc, + 0x94,0xcc,0x80,0x00,0x91,0x16,0x10,0x0b,0x01,0xff,0xce,0x9f,0xcc,0x93,0xcc,0x81, + 0x00,0x01,0xff,0xce,0x9f,0xcc,0x94,0xcc,0x81,0x00,0x00,0x00,0xd3,0x54,0xd2,0x28, + 0xd1,0x12,0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x93,0x00,0x01,0xff,0xcf,0x85,0xcc, + 0x94,0x00,0x10,0x0b,0x01,0xff,0xcf,0x85,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xcf, + 0x85,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xcf,0x85,0xcc,0x93, + 0xcc,0x81,0x00,0x01,0xff,0xcf,0x85,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff, + 0xcf,0x85,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xcf,0x85,0xcc,0x94,0xcd,0x82,0x00, + 0xd2,0x1c,0xd1,0x0d,0x10,0x04,0x00,0x00,0x01,0xff,0xce,0xa5,0xcc,0x94,0x00,0x10, + 0x04,0x00,0x00,0x01,0xff,0xce,0xa5,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x0f,0x10,0x04, + 0x00,0x00,0x01,0xff,0xce,0xa5,0xcc,0x94,0xcc,0x81,0x00,0x10,0x04,0x00,0x00,0x01, + 0xff,0xce,0xa5,0xcc,0x94,0xcd,0x82,0x00,0xd4,0xa8,0xd3,0x54,0xd2,0x28,0xd1,0x12, + 0x10,0x09,0x01,0xff,0xcf,0x89,0xcc,0x93,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0x00, + 0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xcf,0x89,0xcc, + 0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x81, + 0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,0xcf,0x89, + 0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcd,0x82,0x00,0xd2,0x28, + 0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xa9,0xcc,0x93,0x00,0x01,0xff,0xce,0xa9,0xcc, + 0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xa9,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce, + 0xa9,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xa9,0xcc,0x93, + 0xcc,0x81,0x00,0x01,0xff,0xce,0xa9,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff, + 0xce,0xa9,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xa9,0xcc,0x94,0xcd,0x82,0x00, + 0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x80,0x00,0x01, + 0xff,0xce,0xb1,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,0xb5,0xcc,0x80,0x00,0x01, + 0xff,0xce,0xb5,0xcc,0x81,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb7,0xcc,0x80, + 0x00,0x01,0xff,0xce,0xb7,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x80, + 0x00,0x01,0xff,0xce,0xb9,0xcc,0x81,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff, + 0xce,0xbf,0xcc,0x80,0x00,0x01,0xff,0xce,0xbf,0xcc,0x81,0x00,0x10,0x09,0x01,0xff, + 0xcf,0x85,0xcc,0x80,0x00,0x01,0xff,0xcf,0x85,0xcc,0x81,0x00,0x91,0x12,0x10,0x09, + 0x01,0xff,0xcf,0x89,0xcc,0x80,0x00,0x01,0xff,0xcf,0x89,0xcc,0x81,0x00,0x00,0x00, + 0xe0,0xe1,0x02,0xcf,0x86,0xe5,0x91,0x01,0xd4,0xc8,0xd3,0x64,0xd2,0x30,0xd1,0x16, + 0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcd,0x85,0x00,0x01,0xff,0xce,0xb1,0xcc, + 0x94,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x80,0xcd,0x85, + 0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcc,0x80,0xcd,0x85,0x00,0xd1,0x1a,0x10,0x0d, + 0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x81,0xcd,0x85,0x00,0x01,0xff,0xce,0xb1,0xcc, + 0x94,0xcc,0x81,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcd,0x82, + 0xcd,0x85,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcd,0x82,0xcd,0x85,0x00,0xd2,0x30, + 0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0x91,0xcc,0x93,0xcd,0x85,0x00,0x01,0xff,0xce, + 0x91,0xcc,0x94,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0x91,0xcc,0x93,0xcc,0x80, + 0xcd,0x85,0x00,0x01,0xff,0xce,0x91,0xcc,0x94,0xcc,0x80,0xcd,0x85,0x00,0xd1,0x1a, + 0x10,0x0d,0x01,0xff,0xce,0x91,0xcc,0x93,0xcc,0x81,0xcd,0x85,0x00,0x01,0xff,0xce, + 0x91,0xcc,0x94,0xcc,0x81,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0x91,0xcc,0x93, + 0xcd,0x82,0xcd,0x85,0x00,0x01,0xff,0xce,0x91,0xcc,0x94,0xcd,0x82,0xcd,0x85,0x00, + 0xd3,0x64,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcd,0x85, + 0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0xb7, + 0xcc,0x93,0xcc,0x80,0xcd,0x85,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x80,0xcd, + 0x85,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x81,0xcd,0x85, + 0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x81,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff, + 0xce,0xb7,0xcc,0x93,0xcd,0x82,0xcd,0x85,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcd, + 0x82,0xcd,0x85,0x00,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0x97,0xcc,0x93, + 0xcd,0x85,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff, + 0xce,0x97,0xcc,0x93,0xcc,0x80,0xcd,0x85,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,0xcc, + 0x80,0xcd,0x85,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xce,0x97,0xcc,0x93,0xcc,0x81, + 0xcd,0x85,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,0xcc,0x81,0xcd,0x85,0x00,0x10,0x0d, + 0x01,0xff,0xce,0x97,0xcc,0x93,0xcd,0x82,0xcd,0x85,0x00,0x01,0xff,0xce,0x97,0xcc, + 0x94,0xcd,0x82,0xcd,0x85,0x00,0xd4,0xc8,0xd3,0x64,0xd2,0x30,0xd1,0x16,0x10,0x0b, + 0x01,0xff,0xcf,0x89,0xcc,0x93,0xcd,0x85,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcd, + 0x85,0x00,0x10,0x0d,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x80,0xcd,0x85,0x00,0x01, + 0xff,0xcf,0x89,0xcc,0x94,0xcc,0x80,0xcd,0x85,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff, + 0xcf,0x89,0xcc,0x93,0xcc,0x81,0xcd,0x85,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc, + 0x81,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcd,0x82,0xcd,0x85, + 0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcd,0x82,0xcd,0x85,0x00,0xd2,0x30,0xd1,0x16, + 0x10,0x0b,0x01,0xff,0xce,0xa9,0xcc,0x93,0xcd,0x85,0x00,0x01,0xff,0xce,0xa9,0xcc, + 0x94,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0xa9,0xcc,0x93,0xcc,0x80,0xcd,0x85, + 0x00,0x01,0xff,0xce,0xa9,0xcc,0x94,0xcc,0x80,0xcd,0x85,0x00,0xd1,0x1a,0x10,0x0d, + 0x01,0xff,0xce,0xa9,0xcc,0x93,0xcc,0x81,0xcd,0x85,0x00,0x01,0xff,0xce,0xa9,0xcc, + 0x94,0xcc,0x81,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0xa9,0xcc,0x93,0xcd,0x82, + 0xcd,0x85,0x00,0x01,0xff,0xce,0xa9,0xcc,0x94,0xcd,0x82,0xcd,0x85,0x00,0xd3,0x49, + 0xd2,0x26,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x86,0x00,0x01,0xff,0xce, + 0xb1,0xcc,0x84,0x00,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x80,0xcd,0x85,0x00,0x01, + 0xff,0xce,0xb1,0xcd,0x85,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x81, + 0xcd,0x85,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xce,0xb1,0xcd,0x82,0x00,0x01,0xff, + 0xce,0xb1,0xcd,0x82,0xcd,0x85,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xce, + 0x91,0xcc,0x86,0x00,0x01,0xff,0xce,0x91,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xce, + 0x91,0xcc,0x80,0x00,0x01,0xff,0xce,0x91,0xcc,0x81,0x00,0xd1,0x0d,0x10,0x09,0x01, + 0xff,0xce,0x91,0xcd,0x85,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xce,0xb9,0x00,0x01, + 0x00,0xcf,0x86,0xe5,0x16,0x01,0xd4,0x8f,0xd3,0x44,0xd2,0x21,0xd1,0x0d,0x10,0x04, + 0x01,0x00,0x01,0xff,0xc2,0xa8,0xcd,0x82,0x00,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc, + 0x80,0xcd,0x85,0x00,0x01,0xff,0xce,0xb7,0xcd,0x85,0x00,0xd1,0x0f,0x10,0x0b,0x01, + 0xff,0xce,0xb7,0xcc,0x81,0xcd,0x85,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xce,0xb7, + 0xcd,0x82,0x00,0x01,0xff,0xce,0xb7,0xcd,0x82,0xcd,0x85,0x00,0xd2,0x24,0xd1,0x12, + 0x10,0x09,0x01,0xff,0xce,0x95,0xcc,0x80,0x00,0x01,0xff,0xce,0x95,0xcc,0x81,0x00, + 0x10,0x09,0x01,0xff,0xce,0x97,0xcc,0x80,0x00,0x01,0xff,0xce,0x97,0xcc,0x81,0x00, + 0xd1,0x13,0x10,0x09,0x01,0xff,0xce,0x97,0xcd,0x85,0x00,0x01,0xff,0xe1,0xbe,0xbf, + 0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0xe1,0xbe,0xbf,0xcc,0x81,0x00,0x01,0xff,0xe1, + 0xbe,0xbf,0xcd,0x82,0x00,0xd3,0x40,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce, + 0xb9,0xcc,0x86,0x00,0x01,0xff,0xce,0xb9,0xcc,0x84,0x00,0x10,0x0b,0x01,0xff,0xce, + 0xb9,0xcc,0x88,0xcc,0x80,0x00,0x01,0xff,0xce,0xb9,0xcc,0x88,0xcc,0x81,0x00,0x51, + 0x04,0x00,0x00,0x10,0x09,0x01,0xff,0xce,0xb9,0xcd,0x82,0x00,0x01,0xff,0xce,0xb9, + 0xcc,0x88,0xcd,0x82,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0x99,0xcc, + 0x86,0x00,0x01,0xff,0xce,0x99,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xce,0x99,0xcc, + 0x80,0x00,0x01,0xff,0xce,0x99,0xcc,0x81,0x00,0xd1,0x0e,0x10,0x04,0x00,0x00,0x01, + 0xff,0xe1,0xbf,0xbe,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0xe1,0xbf,0xbe,0xcc,0x81, + 0x00,0x01,0xff,0xe1,0xbf,0xbe,0xcd,0x82,0x00,0xd4,0x93,0xd3,0x4e,0xd2,0x28,0xd1, + 0x12,0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x86,0x00,0x01,0xff,0xcf,0x85,0xcc,0x84, + 0x00,0x10,0x0b,0x01,0xff,0xcf,0x85,0xcc,0x88,0xcc,0x80,0x00,0x01,0xff,0xcf,0x85, + 0xcc,0x88,0xcc,0x81,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xcf,0x81,0xcc,0x93,0x00, + 0x01,0xff,0xcf,0x81,0xcc,0x94,0x00,0x10,0x09,0x01,0xff,0xcf,0x85,0xcd,0x82,0x00, + 0x01,0xff,0xcf,0x85,0xcc,0x88,0xcd,0x82,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01, + 0xff,0xce,0xa5,0xcc,0x86,0x00,0x01,0xff,0xce,0xa5,0xcc,0x84,0x00,0x10,0x09,0x01, + 0xff,0xce,0xa5,0xcc,0x80,0x00,0x01,0xff,0xce,0xa5,0xcc,0x81,0x00,0xd1,0x12,0x10, + 0x09,0x01,0xff,0xce,0xa1,0xcc,0x94,0x00,0x01,0xff,0xc2,0xa8,0xcc,0x80,0x00,0x10, + 0x09,0x01,0xff,0xc2,0xa8,0xcc,0x81,0x00,0x01,0xff,0x60,0x00,0xd3,0x3b,0xd2,0x18, + 0x51,0x04,0x00,0x00,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x80,0xcd,0x85,0x00,0x01, + 0xff,0xcf,0x89,0xcd,0x85,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x81, + 0xcd,0x85,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xcf,0x89,0xcd,0x82,0x00,0x01,0xff, + 0xcf,0x89,0xcd,0x82,0xcd,0x85,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xce, + 0x9f,0xcc,0x80,0x00,0x01,0xff,0xce,0x9f,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce, + 0xa9,0xcc,0x80,0x00,0x01,0xff,0xce,0xa9,0xcc,0x81,0x00,0xd1,0x10,0x10,0x09,0x01, + 0xff,0xce,0xa9,0xcd,0x85,0x00,0x01,0xff,0xc2,0xb4,0x00,0x10,0x04,0x01,0x00,0x00, + 0x00,0xe0,0x7e,0x0c,0xcf,0x86,0xe5,0xbb,0x08,0xe4,0x14,0x06,0xe3,0xf7,0x02,0xe2, + 0xbd,0x01,0xd1,0xd0,0xd0,0x4f,0xcf,0x86,0xd5,0x2e,0x94,0x2a,0xd3,0x18,0x92,0x14, + 0x91,0x10,0x10,0x08,0x01,0xff,0xe2,0x80,0x82,0x00,0x01,0xff,0xe2,0x80,0x83,0x00, + 0x01,0x00,0x01,0x00,0x92,0x0d,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff, + 0x00,0x01,0xff,0x00,0x01,0x00,0x94,0x1b,0x53,0x04,0x01,0x00,0xd2,0x09,0x11,0x04, + 0x01,0x00,0x01,0xff,0x00,0x51,0x05,0x01,0xff,0x00,0x10,0x05,0x01,0xff,0x00,0x04, + 0x00,0x01,0x00,0xcf,0x86,0xd5,0x48,0xd4,0x1c,0xd3,0x10,0x52,0x04,0x01,0x00,0x51, + 0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x06,0x00,0x52,0x04,0x04,0x00,0x11,0x04,0x04, + 0x00,0x06,0x00,0xd3,0x1c,0xd2,0x0c,0x51,0x04,0x06,0x00,0x10,0x04,0x06,0x00,0x07, + 0x00,0xd1,0x08,0x10,0x04,0x07,0x00,0x08,0x00,0x10,0x04,0x08,0x00,0x06,0x00,0x52, + 0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x06,0x00,0xd4,0x23,0xd3, + 0x14,0x52,0x05,0x06,0xff,0x00,0x91,0x0a,0x10,0x05,0x0a,0xff,0x00,0x00,0xff,0x00, + 0x0f,0xff,0x00,0x92,0x0a,0x11,0x05,0x0f,0xff,0x00,0x01,0xff,0x00,0x01,0xff,0x00, + 0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x06,0x00,0x00,0x00,0x01,0x00, + 0x01,0x00,0xd0,0x7e,0xcf,0x86,0xd5,0x34,0xd4,0x14,0x53,0x04,0x01,0x00,0x52,0x04, + 0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0xd3,0x10,0x52,0x04, + 0x08,0x00,0x91,0x08,0x10,0x04,0x08,0x00,0x0c,0x00,0x0c,0x00,0x52,0x04,0x0c,0x00, + 0x91,0x08,0x10,0x04,0x0c,0x00,0x00,0x00,0x00,0x00,0xd4,0x1c,0x53,0x04,0x01,0x00, + 0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x02,0x00,0x91,0x08,0x10,0x04, + 0x03,0x00,0x04,0x00,0x04,0x00,0xd3,0x10,0xd2,0x08,0x11,0x04,0x06,0x00,0x08,0x00, + 0x11,0x04,0x08,0x00,0x0b,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x0b,0x00,0x0c,0x00, + 0x10,0x04,0x0e,0x00,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x11,0x00,0x13,0x00, + 0xcf,0x86,0xd5,0x28,0x54,0x04,0x00,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,0x01,0xe6, + 0x01,0x01,0x01,0xe6,0xd2,0x0c,0x51,0x04,0x01,0x01,0x10,0x04,0x01,0x01,0x01,0xe6, + 0x91,0x08,0x10,0x04,0x01,0xe6,0x01,0x00,0x01,0x00,0xd4,0x30,0xd3,0x1c,0xd2,0x0c, + 0x91,0x08,0x10,0x04,0x01,0x00,0x01,0xe6,0x04,0x00,0xd1,0x08,0x10,0x04,0x06,0x00, + 0x06,0x01,0x10,0x04,0x06,0x01,0x06,0xe6,0x92,0x10,0xd1,0x08,0x10,0x04,0x06,0xdc, + 0x06,0xe6,0x10,0x04,0x06,0x01,0x08,0x01,0x09,0xdc,0x93,0x10,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x0a,0xe6,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd1,0x81,0xd0,0x4f, + 0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x29,0xd3,0x13,0x52,0x04,0x01,0x00,0x51,0x04, + 0x01,0x00,0x10,0x07,0x01,0xff,0xce,0xa9,0x00,0x01,0x00,0x92,0x12,0x51,0x04,0x01, + 0x00,0x10,0x06,0x01,0xff,0x4b,0x00,0x01,0xff,0x41,0xcc,0x8a,0x00,0x01,0x00,0x53, + 0x04,0x01,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x04,0x00,0x10,0x04,0x04, + 0x00,0x07,0x00,0x91,0x08,0x10,0x04,0x08,0x00,0x06,0x00,0x06,0x00,0xcf,0x86,0x95, + 0x2c,0xd4,0x18,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0xd1,0x08,0x10,0x04,0x08, + 0x00,0x09,0x00,0x10,0x04,0x09,0x00,0x0a,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x0b, + 0x00,0x10,0x04,0x0b,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd0,0x68,0xcf, + 0x86,0xd5,0x48,0xd4,0x28,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01, + 0x00,0x04,0x00,0x91,0x08,0x10,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0x92,0x0c,0x91, + 0x08,0x10,0x04,0x0a,0x00,0x0b,0x00,0x11,0x00,0x00,0x00,0x53,0x04,0x01,0x00,0x92, + 0x18,0x51,0x04,0x01,0x00,0x10,0x0a,0x01,0xff,0xe2,0x86,0x90,0xcc,0xb8,0x00,0x01, + 0xff,0xe2,0x86,0x92,0xcc,0xb8,0x00,0x01,0x00,0x94,0x1a,0x53,0x04,0x01,0x00,0x52, + 0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x0a,0x01,0xff,0xe2,0x86,0x94,0xcc,0xb8, + 0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0x2e,0x94,0x2a,0x53,0x04,0x01,0x00,0x52, + 0x04,0x01,0x00,0xd1,0x0e,0x10,0x04,0x01,0x00,0x01,0xff,0xe2,0x87,0x90,0xcc,0xb8, + 0x00,0x10,0x0a,0x01,0xff,0xe2,0x87,0x94,0xcc,0xb8,0x00,0x01,0xff,0xe2,0x87,0x92, + 0xcc,0xb8,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,0x00,0x92,0x0c,0x51,0x04,0x01, + 0x00,0x10,0x04,0x01,0x00,0x04,0x00,0x04,0x00,0x93,0x08,0x12,0x04,0x04,0x00,0x06, + 0x00,0x06,0x00,0xe2,0x38,0x02,0xe1,0x3f,0x01,0xd0,0x68,0xcf,0x86,0xd5,0x3e,0x94, + 0x3a,0xd3,0x16,0x52,0x04,0x01,0x00,0x91,0x0e,0x10,0x0a,0x01,0xff,0xe2,0x88,0x83, + 0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0xd2,0x12,0x91,0x0e,0x10,0x04,0x01,0x00,0x01, + 0xff,0xe2,0x88,0x88,0xcc,0xb8,0x00,0x01,0x00,0x91,0x0e,0x10,0x0a,0x01,0xff,0xe2, + 0x88,0x8b,0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x94,0x24,0x93,0x20,0x52, + 0x04,0x01,0x00,0xd1,0x0e,0x10,0x0a,0x01,0xff,0xe2,0x88,0xa3,0xcc,0xb8,0x00,0x01, + 0x00,0x10,0x0a,0x01,0xff,0xe2,0x88,0xa5,0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0x01, + 0x00,0xcf,0x86,0xd5,0x48,0x94,0x44,0xd3,0x2e,0xd2,0x12,0x91,0x0e,0x10,0x04,0x01, + 0x00,0x01,0xff,0xe2,0x88,0xbc,0xcc,0xb8,0x00,0x01,0x00,0xd1,0x0e,0x10,0x0a,0x01, + 0xff,0xe2,0x89,0x83,0xcc,0xb8,0x00,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xe2, + 0x89,0x85,0xcc,0xb8,0x00,0x92,0x12,0x91,0x0e,0x10,0x04,0x01,0x00,0x01,0xff,0xe2, + 0x89,0x88,0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x40,0xd3,0x1e,0x92, + 0x1a,0xd1,0x0c,0x10,0x08,0x01,0xff,0x3d,0xcc,0xb8,0x00,0x01,0x00,0x10,0x0a,0x01, + 0xff,0xe2,0x89,0xa1,0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0xd1, + 0x0e,0x10,0x04,0x01,0x00,0x01,0xff,0xe2,0x89,0x8d,0xcc,0xb8,0x00,0x10,0x08,0x01, + 0xff,0x3c,0xcc,0xb8,0x00,0x01,0xff,0x3e,0xcc,0xb8,0x00,0xd3,0x30,0xd2,0x18,0x91, + 0x14,0x10,0x0a,0x01,0xff,0xe2,0x89,0xa4,0xcc,0xb8,0x00,0x01,0xff,0xe2,0x89,0xa5, + 0xcc,0xb8,0x00,0x01,0x00,0x91,0x14,0x10,0x0a,0x01,0xff,0xe2,0x89,0xb2,0xcc,0xb8, + 0x00,0x01,0xff,0xe2,0x89,0xb3,0xcc,0xb8,0x00,0x01,0x00,0x92,0x18,0x91,0x14,0x10, + 0x0a,0x01,0xff,0xe2,0x89,0xb6,0xcc,0xb8,0x00,0x01,0xff,0xe2,0x89,0xb7,0xcc,0xb8, + 0x00,0x01,0x00,0x01,0x00,0xd0,0x86,0xcf,0x86,0xd5,0x50,0x94,0x4c,0xd3,0x30,0xd2, + 0x18,0x91,0x14,0x10,0x0a,0x01,0xff,0xe2,0x89,0xba,0xcc,0xb8,0x00,0x01,0xff,0xe2, + 0x89,0xbb,0xcc,0xb8,0x00,0x01,0x00,0x91,0x14,0x10,0x0a,0x01,0xff,0xe2,0x8a,0x82, + 0xcc,0xb8,0x00,0x01,0xff,0xe2,0x8a,0x83,0xcc,0xb8,0x00,0x01,0x00,0x92,0x18,0x91, + 0x14,0x10,0x0a,0x01,0xff,0xe2,0x8a,0x86,0xcc,0xb8,0x00,0x01,0xff,0xe2,0x8a,0x87, + 0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x94,0x30,0x53,0x04,0x01,0x00,0x52, + 0x04,0x01,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0xe2,0x8a,0xa2,0xcc,0xb8,0x00,0x01, + 0xff,0xe2,0x8a,0xa8,0xcc,0xb8,0x00,0x10,0x0a,0x01,0xff,0xe2,0x8a,0xa9,0xcc,0xb8, + 0x00,0x01,0xff,0xe2,0x8a,0xab,0xcc,0xb8,0x00,0x01,0x00,0xcf,0x86,0x55,0x04,0x01, + 0x00,0xd4,0x5c,0xd3,0x2c,0x92,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0xe2,0x89,0xbc, + 0xcc,0xb8,0x00,0x01,0xff,0xe2,0x89,0xbd,0xcc,0xb8,0x00,0x10,0x0a,0x01,0xff,0xe2, + 0x8a,0x91,0xcc,0xb8,0x00,0x01,0xff,0xe2,0x8a,0x92,0xcc,0xb8,0x00,0x01,0x00,0xd2, + 0x18,0x51,0x04,0x01,0x00,0x10,0x0a,0x01,0xff,0xe2,0x8a,0xb2,0xcc,0xb8,0x00,0x01, + 0xff,0xe2,0x8a,0xb3,0xcc,0xb8,0x00,0x91,0x14,0x10,0x0a,0x01,0xff,0xe2,0x8a,0xb4, + 0xcc,0xb8,0x00,0x01,0xff,0xe2,0x8a,0xb5,0xcc,0xb8,0x00,0x01,0x00,0x93,0x0c,0x92, + 0x08,0x11,0x04,0x01,0x00,0x06,0x00,0x06,0x00,0x06,0x00,0xd1,0x64,0xd0,0x3e,0xcf, + 0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x04, + 0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x94,0x20,0x53,0x04,0x01,0x00,0x92, + 0x18,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x80,0x88,0x00,0x10,0x08,0x01, + 0xff,0xe3,0x80,0x89,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0x55,0x04,0x01, + 0x00,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10, + 0x04,0x01,0x00,0x04,0x00,0x91,0x08,0x10,0x04,0x06,0x00,0x04,0x00,0x04,0x00,0xd0, + 0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,0x04,0x00,0x53,0x04,0x04,0x00,0x92,0x0c,0x51, + 0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x06,0x00,0x06,0x00,0x06,0x00,0xcf,0x86,0xd5, + 0x2c,0xd4,0x14,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0x51,0x04,0x06,0x00,0x10, + 0x04,0x06,0x00,0x07,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x07,0x00,0x08, + 0x00,0x08,0x00,0x08,0x00,0x12,0x04,0x08,0x00,0x09,0x00,0xd4,0x14,0x53,0x04,0x09, + 0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x0b,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0xd3, + 0x08,0x12,0x04,0x0c,0x00,0x10,0x00,0xd2,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,0x10, + 0x00,0x12,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x13,0x00,0xd3,0xa6,0xd2, + 0x74,0xd1,0x40,0xd0,0x22,0xcf,0x86,0x55,0x04,0x01,0x00,0x94,0x18,0x93,0x14,0x52, + 0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x04,0x00,0x10,0x04,0x04,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,0x53,0x04,0x01,0x00,0x92, + 0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x01, + 0x00,0xd0,0x06,0xcf,0x06,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x14,0x53, + 0x04,0x01,0x00,0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x06,0x00,0x06, + 0x00,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0x51,0x04,0x06,0x00,0x10,0x04,0x06, + 0x00,0x07,0x00,0xd1,0x06,0xcf,0x06,0x01,0x00,0xd0,0x1a,0xcf,0x86,0x95,0x14,0x54, + 0x04,0x01,0x00,0x93,0x0c,0x52,0x04,0x01,0x00,0x11,0x04,0x01,0x00,0x06,0x00,0x06, + 0x00,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0x54,0x04,0x01,0x00,0x13,0x04,0x04, + 0x00,0x06,0x00,0xd2,0xdc,0xd1,0x48,0xd0,0x26,0xcf,0x86,0x95,0x20,0x54,0x04,0x01, + 0x00,0xd3,0x0c,0x52,0x04,0x01,0x00,0x11,0x04,0x07,0x00,0x06,0x00,0x92,0x0c,0x91, + 0x08,0x10,0x04,0x08,0x00,0x04,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0x55, + 0x04,0x01,0x00,0x54,0x04,0x01,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,0x04,0x00,0x06, + 0x00,0x06,0x00,0x52,0x04,0x06,0x00,0x11,0x04,0x06,0x00,0x08,0x00,0xd0,0x5e,0xcf, + 0x86,0xd5,0x2c,0xd4,0x10,0x53,0x04,0x06,0x00,0x92,0x08,0x11,0x04,0x06,0x00,0x07, + 0x00,0x07,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,0x07,0x00,0x08,0x00,0x08,0x00,0x52, + 0x04,0x08,0x00,0x91,0x08,0x10,0x04,0x08,0x00,0x0a,0x00,0x0b,0x00,0xd4,0x10,0x93, + 0x0c,0x92,0x08,0x11,0x04,0x07,0x00,0x08,0x00,0x08,0x00,0x08,0x00,0xd3,0x10,0x92, + 0x0c,0x51,0x04,0x08,0x00,0x10,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0x52,0x04,0x0a, + 0x00,0x91,0x08,0x10,0x04,0x0a,0x00,0x0b,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x1c,0x94, + 0x18,0xd3,0x08,0x12,0x04,0x0a,0x00,0x0b,0x00,0x52,0x04,0x0b,0x00,0x51,0x04,0x0b, + 0x00,0x10,0x04,0x0c,0x00,0x0b,0x00,0x0b,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x51, + 0x04,0x0b,0x00,0x10,0x04,0x0c,0x00,0x0b,0x00,0x0c,0x00,0x0b,0x00,0x0b,0x00,0xd1, + 0xa8,0xd0,0x42,0xcf,0x86,0xd5,0x28,0x94,0x24,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10, + 0x04,0x10,0x00,0x01,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x0c,0x00,0x01, + 0x00,0x92,0x08,0x11,0x04,0x01,0x00,0x0c,0x00,0x01,0x00,0x01,0x00,0x94,0x14,0x53, + 0x04,0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x01,0x00,0x01,0x00,0x01, + 0x00,0x01,0x00,0xcf,0x86,0xd5,0x40,0xd4,0x18,0x53,0x04,0x01,0x00,0x52,0x04,0x01, + 0x00,0xd1,0x08,0x10,0x04,0x0c,0x00,0x01,0x00,0x10,0x04,0x0c,0x00,0x01,0x00,0xd3, + 0x18,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x0c,0x00,0x51,0x04,0x0c, + 0x00,0x10,0x04,0x01,0x00,0x0b,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10, + 0x04,0x01,0x00,0x0c,0x00,0xd4,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c, + 0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x06,0x00,0x93,0x0c,0x52,0x04,0x06,0x00,0x11, + 0x04,0x06,0x00,0x01,0x00,0x01,0x00,0xd0,0x3e,0xcf,0x86,0xd5,0x18,0x54,0x04,0x01, + 0x00,0x93,0x10,0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x0c,0x00,0x0c, + 0x00,0x01,0x00,0x54,0x04,0x01,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c, + 0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10, + 0x04,0x01,0x00,0x0c,0x00,0xcf,0x86,0xd5,0x2c,0x94,0x28,0xd3,0x10,0x52,0x04,0x08, + 0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x09,0x00,0xd2,0x0c,0x51,0x04,0x09, + 0x00,0x10,0x04,0x09,0x00,0x0d,0x00,0x91,0x08,0x10,0x04,0x0a,0x00,0x0d,0x00,0x0c, + 0x00,0x06,0x00,0x94,0x0c,0x53,0x04,0x06,0x00,0x12,0x04,0x06,0x00,0x0a,0x00,0x06, + 0x00,0xe4,0x39,0x01,0xd3,0x0c,0xd2,0x06,0xcf,0x06,0x04,0x00,0xcf,0x06,0x06,0x00, + 0xd2,0x30,0xd1,0x06,0xcf,0x06,0x06,0x00,0xd0,0x06,0xcf,0x06,0x06,0x00,0xcf,0x86, + 0x95,0x1e,0x54,0x04,0x06,0x00,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0x91,0x0e, + 0x10,0x0a,0x06,0xff,0xe2,0xab,0x9d,0xcc,0xb8,0x00,0x06,0x00,0x06,0x00,0x06,0x00, + 0xd1,0x80,0xd0,0x3a,0xcf,0x86,0xd5,0x28,0xd4,0x10,0x53,0x04,0x07,0x00,0x52,0x04, + 0x07,0x00,0x11,0x04,0x07,0x00,0x08,0x00,0xd3,0x08,0x12,0x04,0x08,0x00,0x09,0x00, + 0x92,0x0c,0x51,0x04,0x09,0x00,0x10,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0x94,0x0c, + 0x93,0x08,0x12,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,0xcf,0x86,0xd5,0x30, + 0xd4,0x14,0x53,0x04,0x0a,0x00,0x52,0x04,0x0a,0x00,0x91,0x08,0x10,0x04,0x0a,0x00, + 0x10,0x00,0x10,0x00,0xd3,0x10,0x52,0x04,0x0a,0x00,0x91,0x08,0x10,0x04,0x0a,0x00, + 0x0b,0x00,0x0b,0x00,0x92,0x08,0x11,0x04,0x0b,0x00,0x10,0x00,0x10,0x00,0x54,0x04, + 0x10,0x00,0x93,0x0c,0x52,0x04,0x10,0x00,0x11,0x04,0x00,0x00,0x10,0x00,0x10,0x00, + 0xd0,0x32,0xcf,0x86,0xd5,0x14,0x54,0x04,0x10,0x00,0x93,0x0c,0x52,0x04,0x10,0x00, + 0x11,0x04,0x10,0x00,0x00,0x00,0x10,0x00,0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00, + 0xd2,0x08,0x11,0x04,0x10,0x00,0x14,0x00,0x91,0x08,0x10,0x04,0x14,0x00,0x10,0x00, + 0x10,0x00,0xcf,0x86,0xd5,0x28,0xd4,0x14,0x53,0x04,0x10,0x00,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x10,0x00,0x15,0x00,0x10,0x00,0x10,0x00,0x93,0x10,0x92,0x0c,0x51,0x04, + 0x10,0x00,0x10,0x04,0x13,0x00,0x14,0x00,0x14,0x00,0x14,0x00,0xd4,0x0c,0x53,0x04, + 0x14,0x00,0x12,0x04,0x14,0x00,0x11,0x00,0x53,0x04,0x14,0x00,0x52,0x04,0x14,0x00, + 0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x15,0x00,0xe3,0xb9,0x01,0xd2,0xac,0xd1, + 0x68,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x08,0x00,0x94,0x14,0x53,0x04,0x08,0x00,0x52, + 0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,0x00,0x08,0x00,0xcf, + 0x86,0xd5,0x18,0x54,0x04,0x08,0x00,0x53,0x04,0x08,0x00,0x52,0x04,0x08,0x00,0x51, + 0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,0x00,0xd4,0x14,0x53,0x04,0x09,0x00,0x52, + 0x04,0x09,0x00,0x91,0x08,0x10,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0xd3,0x10,0x92, + 0x0c,0x91,0x08,0x10,0x04,0x0b,0x00,0x0a,0x00,0x0a,0x00,0x09,0x00,0x52,0x04,0x0a, + 0x00,0x11,0x04,0x0a,0x00,0x0b,0x00,0xd0,0x06,0xcf,0x06,0x08,0x00,0xcf,0x86,0x55, + 0x04,0x08,0x00,0xd4,0x1c,0x53,0x04,0x08,0x00,0xd2,0x0c,0x51,0x04,0x08,0x00,0x10, + 0x04,0x08,0x00,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,0x0b,0xe6,0xd3, + 0x0c,0x92,0x08,0x11,0x04,0x0b,0xe6,0x0d,0x00,0x00,0x00,0x92,0x0c,0x91,0x08,0x10, + 0x04,0x00,0x00,0x08,0x00,0x08,0x00,0x08,0x00,0xd1,0x6c,0xd0,0x2a,0xcf,0x86,0x55, + 0x04,0x08,0x00,0x94,0x20,0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10, + 0x04,0x00,0x00,0x0d,0x00,0x52,0x04,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x0d, + 0x00,0x00,0x00,0x08,0x00,0xcf,0x86,0x55,0x04,0x08,0x00,0xd4,0x1c,0xd3,0x0c,0x52, + 0x04,0x08,0x00,0x11,0x04,0x08,0x00,0x0d,0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00, + 0x00,0x10,0x04,0x00,0x00,0x08,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10, + 0x04,0x00,0x00,0x0c,0x09,0xd0,0x5a,0xcf,0x86,0xd5,0x18,0x54,0x04,0x08,0x00,0x93, + 0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,0x00,0x00, + 0x00,0xd4,0x20,0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08, + 0x00,0x00,0x00,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00, + 0x00,0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00, + 0x00,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,0x00,0xcf, + 0x86,0x95,0x40,0xd4,0x20,0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10, + 0x04,0x08,0x00,0x00,0x00,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08, + 0x00,0x00,0x00,0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08, + 0x00,0x00,0x00,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00, + 0x00,0x0a,0xe6,0xd2,0x9c,0xd1,0x68,0xd0,0x32,0xcf,0x86,0xd5,0x14,0x54,0x04,0x08, + 0x00,0x53,0x04,0x08,0x00,0x52,0x04,0x0a,0x00,0x11,0x04,0x08,0x00,0x0a,0x00,0x54, + 0x04,0x0a,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0a,0x00,0x0b,0x00,0x0d, + 0x00,0x0d,0x00,0x12,0x04,0x0d,0x00,0x10,0x00,0xcf,0x86,0x95,0x30,0x94,0x2c,0xd3, + 0x18,0xd2,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x12,0x00,0x91,0x08,0x10, + 0x04,0x12,0x00,0x13,0x00,0x13,0x00,0xd2,0x08,0x11,0x04,0x13,0x00,0x14,0x00,0x51, + 0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x15,0x00,0x00,0x00,0x00,0x00,0xd0,0x1e,0xcf, + 0x86,0x95,0x18,0x54,0x04,0x04,0x00,0x53,0x04,0x04,0x00,0x92,0x0c,0x51,0x04,0x04, + 0x00,0x10,0x04,0x00,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0xcf,0x86,0x55,0x04,0x04, + 0x00,0x54,0x04,0x04,0x00,0x93,0x08,0x12,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0xd1, + 0x06,0xcf,0x06,0x04,0x00,0xd0,0x06,0xcf,0x06,0x04,0x00,0xcf,0x86,0xd5,0x14,0x54, + 0x04,0x04,0x00,0x93,0x0c,0x52,0x04,0x04,0x00,0x11,0x04,0x04,0x00,0x00,0x00,0x00, + 0x00,0x54,0x04,0x00,0x00,0x53,0x04,0x04,0x00,0x12,0x04,0x04,0x00,0x00,0x00,0xcf, + 0x86,0xe5,0xa6,0x05,0xe4,0x9f,0x05,0xe3,0x96,0x04,0xe2,0xe4,0x03,0xe1,0xc0,0x01, + 0xd0,0x3e,0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x1c,0x53,0x04,0x01,0x00,0xd2,0x0c, + 0x51,0x04,0x01,0x00,0x10,0x04,0x01,0xda,0x01,0xe4,0x91,0x08,0x10,0x04,0x01,0xe8, + 0x01,0xde,0x01,0xe0,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x04,0x00,0x10,0x04, + 0x04,0x00,0x06,0x00,0x51,0x04,0x06,0x00,0x10,0x04,0x04,0x00,0x01,0x00,0xcf,0x86, + 0xd5,0xaa,0xd4,0x32,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00, + 0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81, + 0x8b,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0x8d,0xe3,0x82, + 0x99,0x00,0x01,0x00,0xd3,0x3c,0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81, + 0x8f,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0x91,0xe3,0x82, + 0x99,0x00,0x01,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81,0x93,0xe3,0x82,0x99, + 0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0x95,0xe3,0x82,0x99,0x00,0x01,0x00, + 0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81,0x97,0xe3,0x82,0x99,0x00,0x01, + 0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0x99,0xe3,0x82,0x99,0x00,0x01,0x00,0xd1,0x0f, + 0x10,0x0b,0x01,0xff,0xe3,0x81,0x9b,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,0x01, + 0xff,0xe3,0x81,0x9d,0xe3,0x82,0x99,0x00,0x01,0x00,0xd4,0x53,0xd3,0x3c,0xd2,0x1e, + 0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81,0x9f,0xe3,0x82,0x99,0x00,0x01,0x00,0x10, + 0x0b,0x01,0xff,0xe3,0x81,0xa1,0xe3,0x82,0x99,0x00,0x01,0x00,0xd1,0x0f,0x10,0x04, + 0x01,0x00,0x01,0xff,0xe3,0x81,0xa4,0xe3,0x82,0x99,0x00,0x10,0x04,0x01,0x00,0x01, + 0xff,0xe3,0x81,0xa6,0xe3,0x82,0x99,0x00,0x92,0x13,0x91,0x0f,0x10,0x04,0x01,0x00, + 0x01,0xff,0xe3,0x81,0xa8,0xe3,0x82,0x99,0x00,0x01,0x00,0x01,0x00,0xd3,0x4a,0xd2, + 0x25,0xd1,0x16,0x10,0x0b,0x01,0xff,0xe3,0x81,0xaf,0xe3,0x82,0x99,0x00,0x01,0xff, + 0xe3,0x81,0xaf,0xe3,0x82,0x9a,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x81,0xb2, + 0xe3,0x82,0x99,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81,0xb2,0xe3,0x82,0x9a, + 0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0xb5,0xe3,0x82,0x99,0x00,0x01,0xff, + 0xe3,0x81,0xb5,0xe3,0x82,0x9a,0x00,0xd2,0x1e,0xd1,0x0f,0x10,0x04,0x01,0x00,0x01, + 0xff,0xe3,0x81,0xb8,0xe3,0x82,0x99,0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0xb8,0xe3, + 0x82,0x9a,0x00,0x01,0x00,0x91,0x16,0x10,0x0b,0x01,0xff,0xe3,0x81,0xbb,0xe3,0x82, + 0x99,0x00,0x01,0xff,0xe3,0x81,0xbb,0xe3,0x82,0x9a,0x00,0x01,0x00,0xd0,0xee,0xcf, + 0x86,0xd5,0x42,0x54,0x04,0x01,0x00,0xd3,0x1b,0x52,0x04,0x01,0x00,0xd1,0x0f,0x10, + 0x0b,0x01,0xff,0xe3,0x81,0x86,0xe3,0x82,0x99,0x00,0x06,0x00,0x10,0x04,0x06,0x00, + 0x00,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x01,0x08,0x10,0x04,0x01,0x08, + 0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x82,0x9d,0xe3,0x82,0x99, + 0x00,0x06,0x00,0xd4,0x32,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x06,0x00,0x01, + 0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3, + 0x82,0xab,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x82,0xad,0xe3, + 0x82,0x99,0x00,0x01,0x00,0xd3,0x3c,0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3, + 0x82,0xaf,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x82,0xb1,0xe3, + 0x82,0x99,0x00,0x01,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x82,0xb3,0xe3,0x82, + 0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x82,0xb5,0xe3,0x82,0x99,0x00,0x01, + 0x00,0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x82,0xb7,0xe3,0x82,0x99,0x00, + 0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x82,0xb9,0xe3,0x82,0x99,0x00,0x01,0x00,0xd1, + 0x0f,0x10,0x0b,0x01,0xff,0xe3,0x82,0xbb,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b, + 0x01,0xff,0xe3,0x82,0xbd,0xe3,0x82,0x99,0x00,0x01,0x00,0xcf,0x86,0xd5,0xd5,0xd4, + 0x53,0xd3,0x3c,0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x82,0xbf,0xe3,0x82, + 0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x83,0x81,0xe3,0x82,0x99,0x00,0x01, + 0x00,0xd1,0x0f,0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x83,0x84,0xe3,0x82,0x99,0x00, + 0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x83,0x86,0xe3,0x82,0x99,0x00,0x92,0x13,0x91, + 0x0f,0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x83,0x88,0xe3,0x82,0x99,0x00,0x01,0x00, + 0x01,0x00,0xd3,0x4a,0xd2,0x25,0xd1,0x16,0x10,0x0b,0x01,0xff,0xe3,0x83,0x8f,0xe3, + 0x82,0x99,0x00,0x01,0xff,0xe3,0x83,0x8f,0xe3,0x82,0x9a,0x00,0x10,0x04,0x01,0x00, + 0x01,0xff,0xe3,0x83,0x92,0xe3,0x82,0x99,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3, + 0x83,0x92,0xe3,0x82,0x9a,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x83,0x95,0xe3, + 0x82,0x99,0x00,0x01,0xff,0xe3,0x83,0x95,0xe3,0x82,0x9a,0x00,0xd2,0x1e,0xd1,0x0f, + 0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x83,0x98,0xe3,0x82,0x99,0x00,0x10,0x0b,0x01, + 0xff,0xe3,0x83,0x98,0xe3,0x82,0x9a,0x00,0x01,0x00,0x91,0x16,0x10,0x0b,0x01,0xff, + 0xe3,0x83,0x9b,0xe3,0x82,0x99,0x00,0x01,0xff,0xe3,0x83,0x9b,0xe3,0x82,0x9a,0x00, + 0x01,0x00,0x54,0x04,0x01,0x00,0xd3,0x22,0x52,0x04,0x01,0x00,0xd1,0x0f,0x10,0x0b, + 0x01,0xff,0xe3,0x82,0xa6,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x04,0x01,0x00,0x01, + 0xff,0xe3,0x83,0xaf,0xe3,0x82,0x99,0x00,0xd2,0x25,0xd1,0x16,0x10,0x0b,0x01,0xff, + 0xe3,0x83,0xb0,0xe3,0x82,0x99,0x00,0x01,0xff,0xe3,0x83,0xb1,0xe3,0x82,0x99,0x00, + 0x10,0x0b,0x01,0xff,0xe3,0x83,0xb2,0xe3,0x82,0x99,0x00,0x01,0x00,0x51,0x04,0x01, + 0x00,0x10,0x0b,0x01,0xff,0xe3,0x83,0xbd,0xe3,0x82,0x99,0x00,0x06,0x00,0xd1,0x65, + 0xd0,0x46,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x52,0x04,0x00,0x00,0x91,0x08, + 0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x18,0x53,0x04, + 0x01,0x00,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x0a,0x00,0x10,0x04, + 0x13,0x00,0x14,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00, + 0x01,0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0x94,0x15,0x93,0x11, + 0x52,0x04,0x01,0x00,0x91,0x09,0x10,0x05,0x01,0xff,0x00,0x01,0x00,0x01,0x00,0x01, + 0x00,0x01,0x00,0xd0,0x32,0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x01,0x00,0x52, + 0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x54, + 0x04,0x04,0x00,0x53,0x04,0x04,0x00,0x92,0x0c,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c, + 0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x08,0x14,0x04,0x08,0x00,0x0a,0x00,0x94, + 0x0c,0x93,0x08,0x12,0x04,0x0a,0x00,0x00,0x00,0x00,0x00,0x06,0x00,0xd2,0xa4,0xd1, + 0x5c,0xd0,0x22,0xcf,0x86,0x95,0x1c,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0x52, + 0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x07,0x00,0x10,0x04,0x07,0x00,0x00, + 0x00,0x01,0x00,0xcf,0x86,0xd5,0x20,0xd4,0x0c,0x93,0x08,0x12,0x04,0x01,0x00,0x0b, + 0x00,0x0b,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x07,0x00,0x06,0x00,0x06, + 0x00,0x06,0x00,0x06,0x00,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0x52,0x04,0x01, + 0x00,0x51,0x04,0x07,0x00,0x10,0x04,0x08,0x00,0x01,0x00,0xd0,0x1e,0xcf,0x86,0x55, + 0x04,0x01,0x00,0x54,0x04,0x01,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01, + 0x00,0x06,0x00,0x06,0x00,0x06,0x00,0x06,0x00,0xcf,0x86,0xd5,0x10,0x94,0x0c,0x53, + 0x04,0x01,0x00,0x12,0x04,0x01,0x00,0x07,0x00,0x01,0x00,0x54,0x04,0x01,0x00,0x53, + 0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x16, + 0x00,0xd1,0x30,0xd0,0x06,0xcf,0x06,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0x54, + 0x04,0x01,0x00,0xd3,0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01, + 0x00,0x07,0x00,0x92,0x0c,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00,0x01,0x00,0x01, + 0x00,0xd0,0x06,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x14,0x54,0x04,0x01,0x00,0x53, + 0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x11,0x04,0x01,0x00,0x07,0x00,0x54,0x04,0x01, + 0x00,0x53,0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01, + 0x00,0x07,0x00,0xcf,0x06,0x04,0x00,0xcf,0x06,0x04,0x00,0xd1,0x48,0xd0,0x40,0xcf, + 0x86,0xd5,0x06,0xcf,0x06,0x04,0x00,0xd4,0x06,0xcf,0x06,0x04,0x00,0xd3,0x2c,0xd2, + 0x06,0xcf,0x06,0x04,0x00,0xd1,0x06,0xcf,0x06,0x04,0x00,0xd0,0x1a,0xcf,0x86,0x55, + 0x04,0x04,0x00,0x54,0x04,0x04,0x00,0x93,0x0c,0x52,0x04,0x04,0x00,0x11,0x04,0x04, + 0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x07,0x00,0xcf,0x06,0x01,0x00,0xcf,0x86,0xcf, + 0x06,0x01,0x00,0xcf,0x86,0xcf,0x06,0x01,0x00,0xe2,0x71,0x05,0xd1,0x8c,0xd0,0x08, + 0xcf,0x86,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x01,0x00,0xd4,0x06, + 0xcf,0x06,0x01,0x00,0xd3,0x06,0xcf,0x06,0x01,0x00,0xd2,0x06,0xcf,0x06,0x01,0x00, + 0xd1,0x06,0xcf,0x06,0x01,0x00,0xd0,0x22,0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x10, + 0x93,0x0c,0x52,0x04,0x01,0x00,0x11,0x04,0x01,0x00,0x08,0x00,0x08,0x00,0x53,0x04, + 0x08,0x00,0x12,0x04,0x08,0x00,0x0a,0x00,0xcf,0x86,0xd5,0x28,0xd4,0x18,0xd3,0x08, + 0x12,0x04,0x0a,0x00,0x0b,0x00,0x52,0x04,0x0b,0x00,0x91,0x08,0x10,0x04,0x0d,0x00, + 0x11,0x00,0x11,0x00,0x93,0x0c,0x52,0x04,0x11,0x00,0x11,0x04,0x11,0x00,0x13,0x00, + 0x13,0x00,0x94,0x14,0x53,0x04,0x13,0x00,0x92,0x0c,0x51,0x04,0x13,0x00,0x10,0x04, + 0x13,0x00,0x14,0x00,0x14,0x00,0x00,0x00,0xe0,0xdb,0x04,0xcf,0x86,0xe5,0xdf,0x01, + 0xd4,0x06,0xcf,0x06,0x04,0x00,0xd3,0x74,0xd2,0x6e,0xd1,0x06,0xcf,0x06,0x04,0x00, + 0xd0,0x3e,0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x04,0x00,0x52,0x04,0x04,0x00, + 0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0x04,0x00,0xd4,0x10,0x93,0x0c, + 0x92,0x08,0x11,0x04,0x04,0x00,0x06,0x00,0x04,0x00,0x04,0x00,0x93,0x10,0x52,0x04, + 0x04,0x00,0x91,0x08,0x10,0x04,0x06,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0xcf,0x86, + 0x95,0x24,0x94,0x20,0x93,0x1c,0xd2,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,0x06,0x00, + 0x04,0x00,0xd1,0x08,0x10,0x04,0x04,0x00,0x06,0x00,0x10,0x04,0x04,0x00,0x00,0x00, + 0x00,0x00,0x0b,0x00,0x0b,0x00,0xcf,0x06,0x0a,0x00,0xd2,0x84,0xd1,0x4c,0xd0,0x16, + 0xcf,0x86,0x55,0x04,0x0a,0x00,0x94,0x0c,0x53,0x04,0x0a,0x00,0x12,0x04,0x0a,0x00, + 0x00,0x00,0x00,0x00,0xcf,0x86,0x55,0x04,0x0a,0x00,0xd4,0x1c,0xd3,0x0c,0x92,0x08, + 0x11,0x04,0x0c,0x00,0x0a,0x00,0x0a,0x00,0x52,0x04,0x0a,0x00,0x51,0x04,0x0a,0x00, + 0x10,0x04,0x0a,0x00,0x0a,0xe6,0xd3,0x08,0x12,0x04,0x0a,0x00,0x0d,0xe6,0x52,0x04, + 0x0d,0xe6,0x11,0x04,0x0a,0xe6,0x0a,0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04, + 0x0a,0x00,0x53,0x04,0x0a,0x00,0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04, + 0x11,0xe6,0x0d,0xe6,0x0b,0x00,0xcf,0x86,0x55,0x04,0x0b,0x00,0x54,0x04,0x0b,0x00, + 0x93,0x0c,0x92,0x08,0x11,0x04,0x0b,0xe6,0x0b,0x00,0x0b,0x00,0x00,0x00,0xd1,0x40, + 0xd0,0x3a,0xcf,0x86,0xd5,0x24,0x54,0x04,0x08,0x00,0xd3,0x10,0x52,0x04,0x08,0x00, + 0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x09,0x00,0x92,0x0c,0x51,0x04,0x09,0x00, + 0x10,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0x94,0x10,0x93,0x0c,0x92,0x08,0x11,0x04, + 0x09,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,0xcf,0x06,0x0a,0x00,0xd0,0x5e, + 0xcf,0x86,0xd5,0x28,0xd4,0x18,0x53,0x04,0x0a,0x00,0x52,0x04,0x0a,0x00,0xd1,0x08, + 0x10,0x04,0x0a,0x00,0x0c,0x00,0x10,0x04,0x0c,0x00,0x11,0x00,0x93,0x0c,0x92,0x08, + 0x11,0x04,0x0c,0x00,0x0d,0x00,0x10,0x00,0x10,0x00,0xd4,0x1c,0x53,0x04,0x0c,0x00, + 0xd2,0x0c,0x51,0x04,0x0c,0x00,0x10,0x04,0x0d,0x00,0x10,0x00,0x51,0x04,0x10,0x00, + 0x10,0x04,0x12,0x00,0x14,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,0x10,0x00,0x11,0x00, + 0x11,0x00,0x92,0x08,0x11,0x04,0x14,0x00,0x15,0x00,0x15,0x00,0xcf,0x86,0xd5,0x1c, + 0x94,0x18,0x93,0x14,0xd2,0x08,0x11,0x04,0x00,0x00,0x15,0x00,0x51,0x04,0x15,0x00, + 0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x54,0x04,0x00,0x00,0xd3,0x10, + 0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x92,0x0c, + 0x51,0x04,0x0d,0x00,0x10,0x04,0x0c,0x00,0x0a,0x00,0x0a,0x00,0xe4,0xf2,0x02,0xe3, + 0x65,0x01,0xd2,0x98,0xd1,0x48,0xd0,0x36,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10, + 0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x09,0x08,0x00,0x08,0x00, + 0x08,0x00,0xd4,0x0c,0x53,0x04,0x08,0x00,0x12,0x04,0x08,0x00,0x00,0x00,0x53,0x04, + 0x0b,0x00,0x92,0x08,0x11,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0x55,0x04, + 0x09,0x00,0x54,0x04,0x09,0x00,0x13,0x04,0x09,0x00,0x00,0x00,0xd0,0x06,0xcf,0x06, + 0x0a,0x00,0xcf,0x86,0xd5,0x2c,0xd4,0x1c,0xd3,0x10,0x52,0x04,0x0a,0x00,0x91,0x08, + 0x10,0x04,0x0a,0x09,0x12,0x00,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00, + 0x0a,0x00,0x53,0x04,0x0a,0x00,0x92,0x08,0x11,0x04,0x0a,0x00,0x00,0x00,0x00,0x00, + 0x54,0x04,0x0b,0xe6,0xd3,0x0c,0x92,0x08,0x11,0x04,0x0b,0xe6,0x0b,0x00,0x0b,0x00, + 0x52,0x04,0x0b,0x00,0x11,0x04,0x11,0x00,0x14,0x00,0xd1,0x60,0xd0,0x22,0xcf,0x86, + 0x55,0x04,0x0a,0x00,0x94,0x18,0x53,0x04,0x0a,0x00,0xd2,0x0c,0x51,0x04,0x0a,0x00, + 0x10,0x04,0x0a,0x00,0x0a,0xdc,0x11,0x04,0x0a,0xdc,0x0a,0x00,0x0a,0x00,0xcf,0x86, + 0xd5,0x24,0x54,0x04,0x0a,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x0a,0x00,0x10,0x04, + 0x0a,0x00,0x0a,0x09,0x00,0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04, + 0x00,0x00,0x0a,0x00,0x54,0x04,0x0b,0x00,0x53,0x04,0x0b,0x00,0x52,0x04,0x0b,0x00, + 0x91,0x08,0x10,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0xd0,0x1e,0xcf,0x86,0x55,0x04, + 0x0b,0x00,0x54,0x04,0x0b,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x0b,0x00,0x10,0x04, + 0x0b,0x00,0x0b,0x07,0x0b,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x34,0xd4,0x20,0xd3,0x10, + 0x92,0x0c,0x91,0x08,0x10,0x04,0x0b,0x09,0x0b,0x00,0x0b,0x00,0x0b,0x00,0x52,0x04, + 0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x00,0x00,0x0b,0x00,0x53,0x04,0x0b,0x00, + 0xd2,0x08,0x11,0x04,0x0b,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x0b,0x00,0x54,0x04, + 0x10,0x00,0x53,0x04,0x10,0x00,0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04, + 0x10,0x00,0x00,0x00,0xd2,0xd0,0xd1,0x50,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x0a,0x00, + 0x54,0x04,0x0a,0x00,0x93,0x10,0x52,0x04,0x0a,0x00,0x51,0x04,0x0a,0x00,0x10,0x04, + 0x0a,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x20,0xd4,0x10,0x53,0x04,0x0a,0x00, + 0x52,0x04,0x0a,0x00,0x11,0x04,0x0a,0x00,0x00,0x00,0x53,0x04,0x0a,0x00,0x92,0x08, + 0x11,0x04,0x0a,0x00,0x00,0x00,0x0a,0x00,0x54,0x04,0x0b,0x00,0x53,0x04,0x0b,0x00, + 0x12,0x04,0x0b,0x00,0x10,0x00,0xd0,0x3a,0xcf,0x86,0x55,0x04,0x0b,0x00,0x54,0x04, + 0x0b,0x00,0xd3,0x1c,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0b,0xe6,0x0b,0x00,0x0b,0xe6, + 0xd1,0x08,0x10,0x04,0x0b,0xdc,0x0b,0x00,0x10,0x04,0x0b,0x00,0x0b,0xe6,0xd2,0x0c, + 0x91,0x08,0x10,0x04,0x0b,0xe6,0x0b,0x00,0x0b,0x00,0x11,0x04,0x0b,0x00,0x0b,0xe6, + 0xcf,0x86,0xd5,0x2c,0xd4,0x18,0x93,0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x0b,0x00, + 0x0b,0xe6,0x10,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x00,0x00, + 0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0b,0x00,0x0b,0x00,0x54,0x04, + 0x0d,0x00,0x93,0x10,0x52,0x04,0x0d,0x00,0x51,0x04,0x0d,0x00,0x10,0x04,0x0d,0x09, + 0x00,0x00,0x00,0x00,0xd1,0x8c,0xd0,0x72,0xcf,0x86,0xd5,0x4c,0xd4,0x30,0xd3,0x18, + 0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00,0x0c,0x00,0x51,0x04,0x0c,0x00, + 0x10,0x04,0x0c,0x00,0x00,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00, + 0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,0x93,0x18,0xd2,0x0c, + 0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04, + 0x0c,0x00,0x00,0x00,0x00,0x00,0x94,0x20,0xd3,0x10,0x52,0x04,0x0c,0x00,0x51,0x04, + 0x0c,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,0x52,0x04,0x0c,0x00,0x51,0x04,0x0c,0x00, + 0x10,0x04,0x0c,0x00,0x00,0x00,0x10,0x00,0xcf,0x86,0x55,0x04,0x10,0x00,0x94,0x10, + 0x93,0x0c,0x52,0x04,0x11,0x00,0x11,0x04,0x10,0x00,0x15,0x00,0x00,0x00,0x11,0x00, + 0xd0,0x06,0xcf,0x06,0x11,0x00,0xcf,0x86,0x55,0x04,0x0b,0x00,0xd4,0x14,0x53,0x04, + 0x0b,0x00,0x52,0x04,0x0b,0x00,0x91,0x08,0x10,0x04,0x0b,0x00,0x0b,0x09,0x00,0x00, + 0x53,0x04,0x0b,0x00,0x92,0x08,0x11,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0xcf,0x06, + 0x02,0xff,0xff,0xcf,0x86,0xcf,0x06,0x02,0xff,0xff,0xd1,0x76,0xd0,0x09,0xcf,0x86, + 0xcf,0x06,0x02,0xff,0xff,0xcf,0x86,0x85,0xd4,0x07,0xcf,0x06,0x02,0xff,0xff,0xd3, + 0x07,0xcf,0x06,0x02,0xff,0xff,0xd2,0x07,0xcf,0x06,0x02,0xff,0xff,0xd1,0x07,0xcf, + 0x06,0x02,0xff,0xff,0xd0,0x18,0xcf,0x86,0x55,0x05,0x02,0xff,0xff,0x94,0x0d,0x93, + 0x09,0x12,0x05,0x02,0xff,0xff,0x00,0x00,0x00,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x24, + 0x94,0x20,0xd3,0x10,0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00, + 0x00,0x00,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0b,0x00,0x0b,0x00, + 0x0b,0x00,0x54,0x04,0x0b,0x00,0x53,0x04,0x0b,0x00,0x12,0x04,0x0b,0x00,0x00,0x00, + 0xd0,0x08,0xcf,0x86,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x01,0x00, + 0xe4,0x9c,0x10,0xe3,0x16,0x08,0xd2,0x06,0xcf,0x06,0x01,0x00,0xe1,0x08,0x04,0xe0, + 0x04,0x02,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10, + 0x08,0x01,0xff,0xe8,0xb1,0x88,0x00,0x01,0xff,0xe6,0x9b,0xb4,0x00,0x10,0x08,0x01, + 0xff,0xe8,0xbb,0x8a,0x00,0x01,0xff,0xe8,0xb3,0x88,0x00,0xd1,0x10,0x10,0x08,0x01, + 0xff,0xe6,0xbb,0x91,0x00,0x01,0xff,0xe4,0xb8,0xb2,0x00,0x10,0x08,0x01,0xff,0xe5, + 0x8f,0xa5,0x00,0x01,0xff,0xe9,0xbe,0x9c,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01, + 0xff,0xe9,0xbe,0x9c,0x00,0x01,0xff,0xe5,0xa5,0x91,0x00,0x10,0x08,0x01,0xff,0xe9, + 0x87,0x91,0x00,0x01,0xff,0xe5,0x96,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5, + 0xa5,0x88,0x00,0x01,0xff,0xe6,0x87,0xb6,0x00,0x10,0x08,0x01,0xff,0xe7,0x99,0xa9, + 0x00,0x01,0xff,0xe7,0xbe,0x85,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01, + 0xff,0xe8,0x98,0xbf,0x00,0x01,0xff,0xe8,0x9e,0xba,0x00,0x10,0x08,0x01,0xff,0xe8, + 0xa3,0xb8,0x00,0x01,0xff,0xe9,0x82,0x8f,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe6, + 0xa8,0x82,0x00,0x01,0xff,0xe6,0xb4,0x9b,0x00,0x10,0x08,0x01,0xff,0xe7,0x83,0x99, + 0x00,0x01,0xff,0xe7,0x8f,0x9e,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe8, + 0x90,0xbd,0x00,0x01,0xff,0xe9,0x85,0xaa,0x00,0x10,0x08,0x01,0xff,0xe9,0xa7,0xb1, + 0x00,0x01,0xff,0xe4,0xba,0x82,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5,0x8d,0xb5, + 0x00,0x01,0xff,0xe6,0xac,0x84,0x00,0x10,0x08,0x01,0xff,0xe7,0x88,0x9b,0x00,0x01, + 0xff,0xe8,0x98,0xad,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01, + 0xff,0xe9,0xb8,0x9e,0x00,0x01,0xff,0xe5,0xb5,0x90,0x00,0x10,0x08,0x01,0xff,0xe6, + 0xbf,0xab,0x00,0x01,0xff,0xe8,0x97,0x8d,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe8, + 0xa5,0xa4,0x00,0x01,0xff,0xe6,0x8b,0x89,0x00,0x10,0x08,0x01,0xff,0xe8,0x87,0x98, + 0x00,0x01,0xff,0xe8,0xa0,0x9f,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5, + 0xbb,0x8a,0x00,0x01,0xff,0xe6,0x9c,0x97,0x00,0x10,0x08,0x01,0xff,0xe6,0xb5,0xaa, + 0x00,0x01,0xff,0xe7,0x8b,0xbc,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe9,0x83,0x8e, + 0x00,0x01,0xff,0xe4,0xbe,0x86,0x00,0x10,0x08,0x01,0xff,0xe5,0x86,0xb7,0x00,0x01, + 0xff,0xe5,0x8b,0x9e,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe6, + 0x93,0x84,0x00,0x01,0xff,0xe6,0xab,0x93,0x00,0x10,0x08,0x01,0xff,0xe7,0x88,0x90, + 0x00,0x01,0xff,0xe7,0x9b,0xa7,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe8,0x80,0x81, + 0x00,0x01,0xff,0xe8,0x98,0x86,0x00,0x10,0x08,0x01,0xff,0xe8,0x99,0x9c,0x00,0x01, + 0xff,0xe8,0xb7,0xaf,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe9,0x9c,0xb2, + 0x00,0x01,0xff,0xe9,0xad,0xaf,0x00,0x10,0x08,0x01,0xff,0xe9,0xb7,0xba,0x00,0x01, + 0xff,0xe7,0xa2,0x8c,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe7,0xa5,0xbf,0x00,0x01, + 0xff,0xe7,0xb6,0xa0,0x00,0x10,0x08,0x01,0xff,0xe8,0x8f,0x89,0x00,0x01,0xff,0xe9, + 0x8c,0x84,0x00,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xe9,0xb9,0xbf,0x00,0x01,0xff,0xe8,0xab,0x96,0x00,0x10,0x08, + 0x01,0xff,0xe5,0xa3,0x9f,0x00,0x01,0xff,0xe5,0xbc,0x84,0x00,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xe7,0xb1,0xa0,0x00,0x01,0xff,0xe8,0x81,0xbe,0x00,0x10,0x08,0x01,0xff, + 0xe7,0x89,0xa2,0x00,0x01,0xff,0xe7,0xa3,0x8a,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xe8,0xb3,0x82,0x00,0x01,0xff,0xe9,0x9b,0xb7,0x00,0x10,0x08,0x01,0xff, + 0xe5,0xa3,0x98,0x00,0x01,0xff,0xe5,0xb1,0xa2,0x00,0xd1,0x10,0x10,0x08,0x01,0xff, + 0xe6,0xa8,0x93,0x00,0x01,0xff,0xe6,0xb7,0x9a,0x00,0x10,0x08,0x01,0xff,0xe6,0xbc, + 0x8f,0x00,0x01,0xff,0xe7,0xb4,0xaf,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xe7,0xb8,0xb7,0x00,0x01,0xff,0xe9,0x99,0x8b,0x00,0x10,0x08,0x01,0xff, + 0xe5,0x8b,0x92,0x00,0x01,0xff,0xe8,0x82,0x8b,0x00,0xd1,0x10,0x10,0x08,0x01,0xff, + 0xe5,0x87,0x9c,0x00,0x01,0xff,0xe5,0x87,0x8c,0x00,0x10,0x08,0x01,0xff,0xe7,0xa8, + 0x9c,0x00,0x01,0xff,0xe7,0xb6,0xbe,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff, + 0xe8,0x8f,0xb1,0x00,0x01,0xff,0xe9,0x99,0xb5,0x00,0x10,0x08,0x01,0xff,0xe8,0xae, + 0x80,0x00,0x01,0xff,0xe6,0x8b,0x8f,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,0xa8, + 0x82,0x00,0x01,0xff,0xe8,0xab,0xbe,0x00,0x10,0x08,0x01,0xff,0xe4,0xb8,0xb9,0x00, + 0x01,0xff,0xe5,0xaf,0xa7,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xe6,0x80,0x92,0x00,0x01,0xff,0xe7,0x8e,0x87,0x00,0x10,0x08,0x01,0xff, + 0xe7,0x95,0xb0,0x00,0x01,0xff,0xe5,0x8c,0x97,0x00,0xd1,0x10,0x10,0x08,0x01,0xff, + 0xe7,0xa3,0xbb,0x00,0x01,0xff,0xe4,0xbe,0xbf,0x00,0x10,0x08,0x01,0xff,0xe5,0xbe, + 0xa9,0x00,0x01,0xff,0xe4,0xb8,0x8d,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff, + 0xe6,0xb3,0x8c,0x00,0x01,0xff,0xe6,0x95,0xb8,0x00,0x10,0x08,0x01,0xff,0xe7,0xb4, + 0xa2,0x00,0x01,0xff,0xe5,0x8f,0x83,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5,0xa1, + 0x9e,0x00,0x01,0xff,0xe7,0x9c,0x81,0x00,0x10,0x08,0x01,0xff,0xe8,0x91,0x89,0x00, + 0x01,0xff,0xe8,0xaa,0xaa,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff, + 0xe6,0xae,0xba,0x00,0x01,0xff,0xe8,0xbe,0xb0,0x00,0x10,0x08,0x01,0xff,0xe6,0xb2, + 0x88,0x00,0x01,0xff,0xe6,0x8b,0xbe,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe8,0x8b, + 0xa5,0x00,0x01,0xff,0xe6,0x8e,0xa0,0x00,0x10,0x08,0x01,0xff,0xe7,0x95,0xa5,0x00, + 0x01,0xff,0xe4,0xba,0xae,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5,0x85, + 0xa9,0x00,0x01,0xff,0xe5,0x87,0x89,0x00,0x10,0x08,0x01,0xff,0xe6,0xa2,0x81,0x00, + 0x01,0xff,0xe7,0xb3,0xa7,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe8,0x89,0xaf,0x00, + 0x01,0xff,0xe8,0xab,0x92,0x00,0x10,0x08,0x01,0xff,0xe9,0x87,0x8f,0x00,0x01,0xff, + 0xe5,0x8b,0xb5,0x00,0xe0,0x04,0x02,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40, + 0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5,0x91,0x82,0x00,0x01,0xff,0xe5,0xa5, + 0xb3,0x00,0x10,0x08,0x01,0xff,0xe5,0xbb,0xac,0x00,0x01,0xff,0xe6,0x97,0x85,0x00, + 0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,0xbf,0xbe,0x00,0x01,0xff,0xe7,0xa4,0xaa,0x00, + 0x10,0x08,0x01,0xff,0xe9,0x96,0xad,0x00,0x01,0xff,0xe9,0xa9,0xaa,0x00,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x01,0xff,0xe9,0xba,0x97,0x00,0x01,0xff,0xe9,0xbb,0x8e,0x00, + 0x10,0x08,0x01,0xff,0xe5,0x8a,0x9b,0x00,0x01,0xff,0xe6,0x9b,0x86,0x00,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xe6,0xad,0xb7,0x00,0x01,0xff,0xe8,0xbd,0xa2,0x00,0x10,0x08, + 0x01,0xff,0xe5,0xb9,0xb4,0x00,0x01,0xff,0xe6,0x86,0x90,0x00,0xd3,0x40,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,0x88,0x80,0x00,0x01,0xff,0xe6,0x92,0x9a,0x00, + 0x10,0x08,0x01,0xff,0xe6,0xbc,0xa3,0x00,0x01,0xff,0xe7,0x85,0x89,0x00,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xe7,0x92,0x89,0x00,0x01,0xff,0xe7,0xa7,0x8a,0x00,0x10,0x08, + 0x01,0xff,0xe7,0xb7,0xb4,0x00,0x01,0xff,0xe8,0x81,0xaf,0x00,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xe8,0xbc,0xa6,0x00,0x01,0xff,0xe8,0x93,0xae,0x00,0x10,0x08, + 0x01,0xff,0xe9,0x80,0xa3,0x00,0x01,0xff,0xe9,0x8d,0x8a,0x00,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xe5,0x88,0x97,0x00,0x01,0xff,0xe5,0x8a,0xa3,0x00,0x10,0x08,0x01,0xff, + 0xe5,0x92,0xbd,0x00,0x01,0xff,0xe7,0x83,0x88,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x01,0xff,0xe8,0xa3,0x82,0x00,0x01,0xff,0xe8,0xaa,0xaa,0x00, + 0x10,0x08,0x01,0xff,0xe5,0xbb,0x89,0x00,0x01,0xff,0xe5,0xbf,0xb5,0x00,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xe6,0x8d,0xbb,0x00,0x01,0xff,0xe6,0xae,0xae,0x00,0x10,0x08, + 0x01,0xff,0xe7,0xb0,0xbe,0x00,0x01,0xff,0xe7,0x8d,0xb5,0x00,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xe4,0xbb,0xa4,0x00,0x01,0xff,0xe5,0x9b,0xb9,0x00,0x10,0x08, + 0x01,0xff,0xe5,0xaf,0xa7,0x00,0x01,0xff,0xe5,0xb6,0xba,0x00,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xe6,0x80,0x9c,0x00,0x01,0xff,0xe7,0x8e,0xb2,0x00,0x10,0x08,0x01,0xff, + 0xe7,0x91,0xa9,0x00,0x01,0xff,0xe7,0xbe,0x9a,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xe8,0x81,0x86,0x00,0x01,0xff,0xe9,0x88,0xb4,0x00,0x10,0x08, + 0x01,0xff,0xe9,0x9b,0xb6,0x00,0x01,0xff,0xe9,0x9d,0x88,0x00,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xe9,0xa0,0x98,0x00,0x01,0xff,0xe4,0xbe,0x8b,0x00,0x10,0x08,0x01,0xff, + 0xe7,0xa6,0xae,0x00,0x01,0xff,0xe9,0x86,0xb4,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xe9,0x9a,0xb8,0x00,0x01,0xff,0xe6,0x83,0xa1,0x00,0x10,0x08,0x01,0xff, + 0xe4,0xba,0x86,0x00,0x01,0xff,0xe5,0x83,0x9a,0x00,0xd1,0x10,0x10,0x08,0x01,0xff, + 0xe5,0xaf,0xae,0x00,0x01,0xff,0xe5,0xb0,0xbf,0x00,0x10,0x08,0x01,0xff,0xe6,0x96, + 0x99,0x00,0x01,0xff,0xe6,0xa8,0x82,0x00,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3, + 0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe7,0x87,0x8e,0x00,0x01,0xff,0xe7, + 0x99,0x82,0x00,0x10,0x08,0x01,0xff,0xe8,0x93,0xbc,0x00,0x01,0xff,0xe9,0x81,0xbc, + 0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe9,0xbe,0x8d,0x00,0x01,0xff,0xe6,0x9a,0x88, + 0x00,0x10,0x08,0x01,0xff,0xe9,0x98,0xae,0x00,0x01,0xff,0xe5,0x8a,0x89,0x00,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,0x9d,0xbb,0x00,0x01,0xff,0xe6,0x9f,0xb3, + 0x00,0x10,0x08,0x01,0xff,0xe6,0xb5,0x81,0x00,0x01,0xff,0xe6,0xba,0x9c,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0xe7,0x90,0x89,0x00,0x01,0xff,0xe7,0x95,0x99,0x00,0x10, + 0x08,0x01,0xff,0xe7,0xa1,0xab,0x00,0x01,0xff,0xe7,0xb4,0x90,0x00,0xd3,0x40,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe9,0xa1,0x9e,0x00,0x01,0xff,0xe5,0x85,0xad, + 0x00,0x10,0x08,0x01,0xff,0xe6,0x88,0xae,0x00,0x01,0xff,0xe9,0x99,0xb8,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0xe5,0x80,0xab,0x00,0x01,0xff,0xe5,0xb4,0x99,0x00,0x10, + 0x08,0x01,0xff,0xe6,0xb7,0xaa,0x00,0x01,0xff,0xe8,0xbc,0xaa,0x00,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x01,0xff,0xe5,0xbe,0x8b,0x00,0x01,0xff,0xe6,0x85,0x84,0x00,0x10, + 0x08,0x01,0xff,0xe6,0xa0,0x97,0x00,0x01,0xff,0xe7,0x8e,0x87,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0xe9,0x9a,0x86,0x00,0x01,0xff,0xe5,0x88,0xa9,0x00,0x10,0x08,0x01, + 0xff,0xe5,0x90,0x8f,0x00,0x01,0xff,0xe5,0xb1,0xa5,0x00,0xd4,0x80,0xd3,0x40,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,0x98,0x93,0x00,0x01,0xff,0xe6,0x9d,0x8e, + 0x00,0x10,0x08,0x01,0xff,0xe6,0xa2,0xa8,0x00,0x01,0xff,0xe6,0xb3,0xa5,0x00,0xd1, + 0x10,0x10,0x08,0x01,0xff,0xe7,0x90,0x86,0x00,0x01,0xff,0xe7,0x97,0xa2,0x00,0x10, + 0x08,0x01,0xff,0xe7,0xbd,0xb9,0x00,0x01,0xff,0xe8,0xa3,0x8f,0x00,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x01,0xff,0xe8,0xa3,0xa1,0x00,0x01,0xff,0xe9,0x87,0x8c,0x00,0x10, + 0x08,0x01,0xff,0xe9,0x9b,0xa2,0x00,0x01,0xff,0xe5,0x8c,0xbf,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0xe6,0xba,0xba,0x00,0x01,0xff,0xe5,0x90,0x9d,0x00,0x10,0x08,0x01, + 0xff,0xe7,0x87,0x90,0x00,0x01,0xff,0xe7,0x92,0x98,0x00,0xd3,0x40,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x01,0xff,0xe8,0x97,0xba,0x00,0x01,0xff,0xe9,0x9a,0xa3,0x00,0x10, + 0x08,0x01,0xff,0xe9,0xb1,0x97,0x00,0x01,0xff,0xe9,0xba,0x9f,0x00,0xd1,0x10,0x10, + 0x08,0x01,0xff,0xe6,0x9e,0x97,0x00,0x01,0xff,0xe6,0xb7,0x8b,0x00,0x10,0x08,0x01, + 0xff,0xe8,0x87,0xa8,0x00,0x01,0xff,0xe7,0xab,0x8b,0x00,0xd2,0x20,0xd1,0x10,0x10, + 0x08,0x01,0xff,0xe7,0xac,0xa0,0x00,0x01,0xff,0xe7,0xb2,0x92,0x00,0x10,0x08,0x01, + 0xff,0xe7,0x8b,0x80,0x00,0x01,0xff,0xe7,0x82,0x99,0x00,0xd1,0x10,0x10,0x08,0x01, + 0xff,0xe8,0xad,0x98,0x00,0x01,0xff,0xe4,0xbb,0x80,0x00,0x10,0x08,0x01,0xff,0xe8, + 0x8c,0xb6,0x00,0x01,0xff,0xe5,0x88,0xba,0x00,0xe2,0xad,0x06,0xe1,0xc4,0x03,0xe0, + 0xcb,0x01,0xcf,0x86,0xd5,0xe4,0xd4,0x74,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x01,0xff,0xe5,0x88,0x87,0x00,0x01,0xff,0xe5,0xba,0xa6,0x00,0x10,0x08,0x01,0xff, + 0xe6,0x8b,0x93,0x00,0x01,0xff,0xe7,0xb3,0x96,0x00,0xd1,0x10,0x10,0x08,0x01,0xff, + 0xe5,0xae,0x85,0x00,0x01,0xff,0xe6,0xb4,0x9e,0x00,0x10,0x08,0x01,0xff,0xe6,0x9a, + 0xb4,0x00,0x01,0xff,0xe8,0xbc,0xbb,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff, + 0xe8,0xa1,0x8c,0x00,0x01,0xff,0xe9,0x99,0x8d,0x00,0x10,0x08,0x01,0xff,0xe8,0xa6, + 0x8b,0x00,0x01,0xff,0xe5,0xbb,0x93,0x00,0x91,0x10,0x10,0x08,0x01,0xff,0xe5,0x85, + 0x80,0x00,0x01,0xff,0xe5,0x97,0x80,0x00,0x01,0x00,0xd3,0x34,0xd2,0x18,0xd1,0x0c, + 0x10,0x08,0x01,0xff,0xe5,0xa1,0x9a,0x00,0x01,0x00,0x10,0x08,0x01,0xff,0xe6,0x99, + 0xb4,0x00,0x01,0x00,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0xe5,0x87,0x9e,0x00, + 0x10,0x08,0x01,0xff,0xe7,0x8c,0xaa,0x00,0x01,0xff,0xe7,0x9b,0x8a,0x00,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x01,0xff,0xe7,0xa4,0xbc,0x00,0x01,0xff,0xe7,0xa5,0x9e,0x00, + 0x10,0x08,0x01,0xff,0xe7,0xa5,0xa5,0x00,0x01,0xff,0xe7,0xa6,0x8f,0x00,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xe9,0x9d,0x96,0x00,0x01,0xff,0xe7,0xb2,0xbe,0x00,0x10,0x08, + 0x01,0xff,0xe7,0xbe,0xbd,0x00,0x01,0x00,0xd4,0x64,0xd3,0x30,0xd2,0x18,0xd1,0x0c, + 0x10,0x08,0x01,0xff,0xe8,0x98,0x92,0x00,0x01,0x00,0x10,0x08,0x01,0xff,0xe8,0xab, + 0xb8,0x00,0x01,0x00,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0xe9,0x80,0xb8,0x00, + 0x10,0x08,0x01,0xff,0xe9,0x83,0xbd,0x00,0x01,0x00,0xd2,0x14,0x51,0x04,0x01,0x00, + 0x10,0x08,0x01,0xff,0xe9,0xa3,0xaf,0x00,0x01,0xff,0xe9,0xa3,0xbc,0x00,0xd1,0x10, + 0x10,0x08,0x01,0xff,0xe9,0xa4,0xa8,0x00,0x01,0xff,0xe9,0xb6,0xb4,0x00,0x10,0x08, + 0x0d,0xff,0xe9,0x83,0x9e,0x00,0x0d,0xff,0xe9,0x9a,0xb7,0x00,0xd3,0x40,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x06,0xff,0xe4,0xbe,0xae,0x00,0x06,0xff,0xe5,0x83,0xa7,0x00, + 0x10,0x08,0x06,0xff,0xe5,0x85,0x8d,0x00,0x06,0xff,0xe5,0x8b,0x89,0x00,0xd1,0x10, + 0x10,0x08,0x06,0xff,0xe5,0x8b,0xa4,0x00,0x06,0xff,0xe5,0x8d,0x91,0x00,0x10,0x08, + 0x06,0xff,0xe5,0x96,0x9d,0x00,0x06,0xff,0xe5,0x98,0x86,0x00,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x06,0xff,0xe5,0x99,0xa8,0x00,0x06,0xff,0xe5,0xa1,0x80,0x00,0x10,0x08, + 0x06,0xff,0xe5,0xa2,0xa8,0x00,0x06,0xff,0xe5,0xb1,0xa4,0x00,0xd1,0x10,0x10,0x08, + 0x06,0xff,0xe5,0xb1,0xae,0x00,0x06,0xff,0xe6,0x82,0x94,0x00,0x10,0x08,0x06,0xff, + 0xe6,0x85,0xa8,0x00,0x06,0xff,0xe6,0x86,0x8e,0x00,0xcf,0x86,0xe5,0x01,0x01,0xd4, + 0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe6,0x87,0xb2,0x00,0x06, + 0xff,0xe6,0x95,0x8f,0x00,0x10,0x08,0x06,0xff,0xe6,0x97,0xa2,0x00,0x06,0xff,0xe6, + 0x9a,0x91,0x00,0xd1,0x10,0x10,0x08,0x06,0xff,0xe6,0xa2,0x85,0x00,0x06,0xff,0xe6, + 0xb5,0xb7,0x00,0x10,0x08,0x06,0xff,0xe6,0xb8,0x9a,0x00,0x06,0xff,0xe6,0xbc,0xa2, + 0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe7,0x85,0xae,0x00,0x06,0xff,0xe7, + 0x88,0xab,0x00,0x10,0x08,0x06,0xff,0xe7,0x90,0xa2,0x00,0x06,0xff,0xe7,0xa2,0x91, + 0x00,0xd1,0x10,0x10,0x08,0x06,0xff,0xe7,0xa4,0xbe,0x00,0x06,0xff,0xe7,0xa5,0x89, + 0x00,0x10,0x08,0x06,0xff,0xe7,0xa5,0x88,0x00,0x06,0xff,0xe7,0xa5,0x90,0x00,0xd3, + 0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe7,0xa5,0x96,0x00,0x06,0xff,0xe7, + 0xa5,0x9d,0x00,0x10,0x08,0x06,0xff,0xe7,0xa6,0x8d,0x00,0x06,0xff,0xe7,0xa6,0x8e, + 0x00,0xd1,0x10,0x10,0x08,0x06,0xff,0xe7,0xa9,0x80,0x00,0x06,0xff,0xe7,0xaa,0x81, + 0x00,0x10,0x08,0x06,0xff,0xe7,0xaf,0x80,0x00,0x06,0xff,0xe7,0xb7,0xb4,0x00,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe7,0xb8,0x89,0x00,0x06,0xff,0xe7,0xb9,0x81, + 0x00,0x10,0x08,0x06,0xff,0xe7,0xbd,0xb2,0x00,0x06,0xff,0xe8,0x80,0x85,0x00,0xd1, + 0x10,0x10,0x08,0x06,0xff,0xe8,0x87,0xad,0x00,0x06,0xff,0xe8,0x89,0xb9,0x00,0x10, + 0x08,0x06,0xff,0xe8,0x89,0xb9,0x00,0x06,0xff,0xe8,0x91,0x97,0x00,0xd4,0x75,0xd3, + 0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe8,0xa4,0x90,0x00,0x06,0xff,0xe8, + 0xa6,0x96,0x00,0x10,0x08,0x06,0xff,0xe8,0xac,0x81,0x00,0x06,0xff,0xe8,0xac,0xb9, + 0x00,0xd1,0x10,0x10,0x08,0x06,0xff,0xe8,0xb3,0x93,0x00,0x06,0xff,0xe8,0xb4,0x88, + 0x00,0x10,0x08,0x06,0xff,0xe8,0xbe,0xb6,0x00,0x06,0xff,0xe9,0x80,0xb8,0x00,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe9,0x9b,0xa3,0x00,0x06,0xff,0xe9,0x9f,0xbf, + 0x00,0x10,0x08,0x06,0xff,0xe9,0xa0,0xbb,0x00,0x0b,0xff,0xe6,0x81,0xb5,0x00,0x91, + 0x11,0x10,0x09,0x0b,0xff,0xf0,0xa4,0x8b,0xae,0x00,0x0b,0xff,0xe8,0x88,0x98,0x00, + 0x00,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,0xe4,0xb8,0xa6,0x00, + 0x08,0xff,0xe5,0x86,0xb5,0x00,0x10,0x08,0x08,0xff,0xe5,0x85,0xa8,0x00,0x08,0xff, + 0xe4,0xbe,0x80,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe5,0x85,0x85,0x00,0x08,0xff, + 0xe5,0x86,0x80,0x00,0x10,0x08,0x08,0xff,0xe5,0x8b,0x87,0x00,0x08,0xff,0xe5,0x8b, + 0xba,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,0xe5,0x96,0x9d,0x00,0x08,0xff, + 0xe5,0x95,0x95,0x00,0x10,0x08,0x08,0xff,0xe5,0x96,0x99,0x00,0x08,0xff,0xe5,0x97, + 0xa2,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe5,0xa1,0x9a,0x00,0x08,0xff,0xe5,0xa2, + 0xb3,0x00,0x10,0x08,0x08,0xff,0xe5,0xa5,0x84,0x00,0x08,0xff,0xe5,0xa5,0x94,0x00, + 0xe0,0x04,0x02,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x08,0xff,0xe5,0xa9,0xa2,0x00,0x08,0xff,0xe5,0xac,0xa8,0x00,0x10,0x08, + 0x08,0xff,0xe5,0xbb,0x92,0x00,0x08,0xff,0xe5,0xbb,0x99,0x00,0xd1,0x10,0x10,0x08, + 0x08,0xff,0xe5,0xbd,0xa9,0x00,0x08,0xff,0xe5,0xbe,0xad,0x00,0x10,0x08,0x08,0xff, + 0xe6,0x83,0x98,0x00,0x08,0xff,0xe6,0x85,0x8e,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x08,0xff,0xe6,0x84,0x88,0x00,0x08,0xff,0xe6,0x86,0x8e,0x00,0x10,0x08,0x08,0xff, + 0xe6,0x85,0xa0,0x00,0x08,0xff,0xe6,0x87,0xb2,0x00,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe6,0x88,0xb4,0x00,0x08,0xff,0xe6,0x8f,0x84,0x00,0x10,0x08,0x08,0xff,0xe6,0x90, + 0x9c,0x00,0x08,0xff,0xe6,0x91,0x92,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x08,0xff,0xe6,0x95,0x96,0x00,0x08,0xff,0xe6,0x99,0xb4,0x00,0x10,0x08,0x08,0xff, + 0xe6,0x9c,0x97,0x00,0x08,0xff,0xe6,0x9c,0x9b,0x00,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe6,0x9d,0x96,0x00,0x08,0xff,0xe6,0xad,0xb9,0x00,0x10,0x08,0x08,0xff,0xe6,0xae, + 0xba,0x00,0x08,0xff,0xe6,0xb5,0x81,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe6,0xbb,0x9b,0x00,0x08,0xff,0xe6,0xbb,0x8b,0x00,0x10,0x08,0x08,0xff,0xe6,0xbc, + 0xa2,0x00,0x08,0xff,0xe7,0x80,0x9e,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe7,0x85, + 0xae,0x00,0x08,0xff,0xe7,0x9e,0xa7,0x00,0x10,0x08,0x08,0xff,0xe7,0x88,0xb5,0x00, + 0x08,0xff,0xe7,0x8a,0xaf,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x08,0xff,0xe7,0x8c,0xaa,0x00,0x08,0xff,0xe7,0x91,0xb1,0x00,0x10,0x08,0x08,0xff, + 0xe7,0x94,0x86,0x00,0x08,0xff,0xe7,0x94,0xbb,0x00,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe7,0x98,0x9d,0x00,0x08,0xff,0xe7,0x98,0x9f,0x00,0x10,0x08,0x08,0xff,0xe7,0x9b, + 0x8a,0x00,0x08,0xff,0xe7,0x9b,0x9b,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe7,0x9b,0xb4,0x00,0x08,0xff,0xe7,0x9d,0x8a,0x00,0x10,0x08,0x08,0xff,0xe7,0x9d, + 0x80,0x00,0x08,0xff,0xe7,0xa3,0x8c,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe7,0xaa, + 0xb1,0x00,0x08,0xff,0xe7,0xaf,0x80,0x00,0x10,0x08,0x08,0xff,0xe7,0xb1,0xbb,0x00, + 0x08,0xff,0xe7,0xb5,0x9b,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe7,0xb7,0xb4,0x00,0x08,0xff,0xe7,0xbc,0xbe,0x00,0x10,0x08,0x08,0xff,0xe8,0x80, + 0x85,0x00,0x08,0xff,0xe8,0x8d,0x92,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe8,0x8f, + 0xaf,0x00,0x08,0xff,0xe8,0x9d,0xb9,0x00,0x10,0x08,0x08,0xff,0xe8,0xa5,0x81,0x00, + 0x08,0xff,0xe8,0xa6,0x86,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,0xe8,0xa6, + 0x96,0x00,0x08,0xff,0xe8,0xaa,0xbf,0x00,0x10,0x08,0x08,0xff,0xe8,0xab,0xb8,0x00, + 0x08,0xff,0xe8,0xab,0x8b,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe8,0xac,0x81,0x00, + 0x08,0xff,0xe8,0xab,0xbe,0x00,0x10,0x08,0x08,0xff,0xe8,0xab,0xad,0x00,0x08,0xff, + 0xe8,0xac,0xb9,0x00,0xcf,0x86,0x95,0xde,0xd4,0x81,0xd3,0x40,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x08,0xff,0xe8,0xae,0x8a,0x00,0x08,0xff,0xe8,0xb4,0x88,0x00,0x10,0x08, + 0x08,0xff,0xe8,0xbc,0xb8,0x00,0x08,0xff,0xe9,0x81,0xb2,0x00,0xd1,0x10,0x10,0x08, + 0x08,0xff,0xe9,0x86,0x99,0x00,0x08,0xff,0xe9,0x89,0xb6,0x00,0x10,0x08,0x08,0xff, + 0xe9,0x99,0xbc,0x00,0x08,0xff,0xe9,0x9b,0xa3,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x08,0xff,0xe9,0x9d,0x96,0x00,0x08,0xff,0xe9,0x9f,0x9b,0x00,0x10,0x08,0x08,0xff, + 0xe9,0x9f,0xbf,0x00,0x08,0xff,0xe9,0xa0,0x8b,0x00,0xd1,0x10,0x10,0x08,0x08,0xff, + 0xe9,0xa0,0xbb,0x00,0x08,0xff,0xe9,0xac,0x92,0x00,0x10,0x08,0x08,0xff,0xe9,0xbe, + 0x9c,0x00,0x08,0xff,0xf0,0xa2,0xa1,0x8a,0x00,0xd3,0x45,0xd2,0x22,0xd1,0x12,0x10, + 0x09,0x08,0xff,0xf0,0xa2,0xa1,0x84,0x00,0x08,0xff,0xf0,0xa3,0x8f,0x95,0x00,0x10, + 0x08,0x08,0xff,0xe3,0xae,0x9d,0x00,0x08,0xff,0xe4,0x80,0x98,0x00,0xd1,0x11,0x10, + 0x08,0x08,0xff,0xe4,0x80,0xb9,0x00,0x08,0xff,0xf0,0xa5,0x89,0x89,0x00,0x10,0x09, + 0x08,0xff,0xf0,0xa5,0xb3,0x90,0x00,0x08,0xff,0xf0,0xa7,0xbb,0x93,0x00,0x92,0x14, + 0x91,0x10,0x10,0x08,0x08,0xff,0xe9,0xbd,0x83,0x00,0x08,0xff,0xe9,0xbe,0x8e,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0xe1,0x94,0x01,0xe0,0x08,0x01,0xcf,0x86,0xd5,0x42, + 0xd4,0x14,0x93,0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00, + 0x00,0x00,0x00,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00, + 0x01,0x00,0x01,0x00,0x52,0x04,0x00,0x00,0xd1,0x0d,0x10,0x04,0x00,0x00,0x04,0xff, + 0xd7,0x99,0xd6,0xb4,0x00,0x10,0x04,0x01,0x1a,0x01,0xff,0xd7,0xb2,0xd6,0xb7,0x00, + 0xd4,0x42,0x53,0x04,0x01,0x00,0xd2,0x16,0x51,0x04,0x01,0x00,0x10,0x09,0x01,0xff, + 0xd7,0xa9,0xd7,0x81,0x00,0x01,0xff,0xd7,0xa9,0xd7,0x82,0x00,0xd1,0x16,0x10,0x0b, + 0x01,0xff,0xd7,0xa9,0xd6,0xbc,0xd7,0x81,0x00,0x01,0xff,0xd7,0xa9,0xd6,0xbc,0xd7, + 0x82,0x00,0x10,0x09,0x01,0xff,0xd7,0x90,0xd6,0xb7,0x00,0x01,0xff,0xd7,0x90,0xd6, + 0xb8,0x00,0xd3,0x43,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd7,0x90,0xd6,0xbc, + 0x00,0x01,0xff,0xd7,0x91,0xd6,0xbc,0x00,0x10,0x09,0x01,0xff,0xd7,0x92,0xd6,0xbc, + 0x00,0x01,0xff,0xd7,0x93,0xd6,0xbc,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd7,0x94, + 0xd6,0xbc,0x00,0x01,0xff,0xd7,0x95,0xd6,0xbc,0x00,0x10,0x09,0x01,0xff,0xd7,0x96, + 0xd6,0xbc,0x00,0x00,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd7,0x98,0xd6, + 0xbc,0x00,0x01,0xff,0xd7,0x99,0xd6,0xbc,0x00,0x10,0x09,0x01,0xff,0xd7,0x9a,0xd6, + 0xbc,0x00,0x01,0xff,0xd7,0x9b,0xd6,0xbc,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xd7, + 0x9c,0xd6,0xbc,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xd7,0x9e,0xd6,0xbc,0x00,0x00, + 0x00,0xcf,0x86,0x95,0x85,0x94,0x81,0xd3,0x3e,0xd2,0x1f,0xd1,0x12,0x10,0x09,0x01, + 0xff,0xd7,0xa0,0xd6,0xbc,0x00,0x01,0xff,0xd7,0xa1,0xd6,0xbc,0x00,0x10,0x04,0x00, + 0x00,0x01,0xff,0xd7,0xa3,0xd6,0xbc,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xd7,0xa4, + 0xd6,0xbc,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xd7,0xa6,0xd6,0xbc,0x00,0x01,0xff, + 0xd7,0xa7,0xd6,0xbc,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd7,0xa8,0xd6, + 0xbc,0x00,0x01,0xff,0xd7,0xa9,0xd6,0xbc,0x00,0x10,0x09,0x01,0xff,0xd7,0xaa,0xd6, + 0xbc,0x00,0x01,0xff,0xd7,0x95,0xd6,0xb9,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd7, + 0x91,0xd6,0xbf,0x00,0x01,0xff,0xd7,0x9b,0xd6,0xbf,0x00,0x10,0x09,0x01,0xff,0xd7, + 0xa4,0xd6,0xbf,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd0,0x1a,0xcf,0x86,0x55,0x04, + 0x01,0x00,0x54,0x04,0x01,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x01,0x00,0x0c,0x00, + 0x0c,0x00,0x0c,0x00,0xcf,0x86,0x95,0x24,0xd4,0x10,0x93,0x0c,0x92,0x08,0x11,0x04, + 0x0c,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x00,0x00, + 0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd3,0x5a,0xd2,0x06, + 0xcf,0x06,0x01,0x00,0xd1,0x14,0xd0,0x06,0xcf,0x06,0x01,0x00,0xcf,0x86,0x95,0x08, + 0x14,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd0,0x1a,0xcf,0x86,0x95,0x14,0x54,0x04, + 0x01,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00, + 0x01,0x00,0xcf,0x86,0xd5,0x0c,0x94,0x08,0x13,0x04,0x01,0x00,0x00,0x00,0x05,0x00, + 0x54,0x04,0x05,0x00,0x53,0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04, + 0x06,0x00,0x07,0x00,0x00,0x00,0xd2,0xce,0xd1,0xa5,0xd0,0x37,0xcf,0x86,0xd5,0x15, + 0x54,0x05,0x06,0xff,0x00,0x53,0x04,0x08,0x00,0x92,0x08,0x11,0x04,0x08,0x00,0x00, + 0x00,0x00,0x00,0x94,0x1c,0xd3,0x10,0x52,0x04,0x01,0xe6,0x51,0x04,0x0a,0xe6,0x10, + 0x04,0x0a,0xe6,0x10,0xdc,0x52,0x04,0x10,0xdc,0x11,0x04,0x10,0xdc,0x11,0xe6,0x01, + 0x00,0xcf,0x86,0xd5,0x38,0xd4,0x24,0xd3,0x14,0x52,0x04,0x01,0x00,0xd1,0x08,0x10, + 0x04,0x01,0x00,0x06,0x00,0x10,0x04,0x06,0x00,0x07,0x00,0x92,0x0c,0x91,0x08,0x10, + 0x04,0x07,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x01, + 0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd4,0x18,0xd3,0x10,0x52, + 0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x12,0x04,0x01, + 0x00,0x00,0x00,0x93,0x18,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x06, + 0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd0,0x06,0xcf, + 0x06,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0x54,0x04,0x01,0x00,0x53,0x04,0x01, + 0x00,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x00, + 0x00,0x01,0xff,0x00,0xd1,0x50,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x94,0x14,0x93,0x10, + 0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00, + 0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0x18,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00, + 0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x06,0x00,0x94,0x14, + 0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x06,0x00,0x01,0x00,0x01,0x00,0x01,0x00, + 0x01,0x00,0x01,0x00,0xd0,0x2f,0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x15,0x93,0x11, + 0x92,0x0d,0x91,0x09,0x10,0x05,0x01,0xff,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01, + 0x00,0x53,0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01, + 0x00,0x00,0x00,0xcf,0x86,0xd5,0x38,0xd4,0x18,0xd3,0x0c,0x92,0x08,0x11,0x04,0x00, + 0x00,0x01,0x00,0x01,0x00,0x92,0x08,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd3, + 0x0c,0x92,0x08,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd2,0x08,0x11,0x04,0x00, + 0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0xd4,0x20,0xd3, + 0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x52, + 0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x53,0x05,0x00, + 0xff,0x00,0xd2,0x0d,0x91,0x09,0x10,0x05,0x00,0xff,0x00,0x04,0x00,0x04,0x00,0x91, + 0x08,0x10,0x04,0x03,0x00,0x01,0x00,0x01,0x00,0x83,0xe2,0x46,0x3e,0xe1,0x1f,0x3b, + 0xe0,0x9c,0x39,0xcf,0x86,0xe5,0x40,0x26,0xc4,0xe3,0x16,0x14,0xe2,0xef,0x11,0xe1, + 0xd0,0x10,0xe0,0x60,0x07,0xcf,0x86,0xe5,0x53,0x03,0xe4,0x4c,0x02,0xe3,0x3d,0x01, + 0xd2,0x94,0xd1,0x70,0xd0,0x4a,0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x07,0x00, + 0x52,0x04,0x07,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x07,0x00,0x07,0x00,0x07,0x00, + 0xd4,0x14,0x93,0x10,0x52,0x04,0x07,0x00,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00, + 0x00,0x00,0x07,0x00,0x53,0x04,0x07,0x00,0xd2,0x0c,0x51,0x04,0x07,0x00,0x10,0x04, + 0x07,0x00,0x00,0x00,0x51,0x04,0x07,0x00,0x10,0x04,0x00,0x00,0x07,0x00,0xcf,0x86, + 0x95,0x20,0xd4,0x10,0x53,0x04,0x07,0x00,0x52,0x04,0x07,0x00,0x11,0x04,0x07,0x00, + 0x00,0x00,0x53,0x04,0x07,0x00,0x52,0x04,0x07,0x00,0x11,0x04,0x07,0x00,0x00,0x00, + 0x00,0x00,0xd0,0x06,0xcf,0x06,0x07,0x00,0xcf,0x86,0x55,0x04,0x07,0x00,0x54,0x04, + 0x07,0x00,0x53,0x04,0x07,0x00,0x92,0x0c,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00, + 0x00,0x00,0x00,0x00,0xd1,0x40,0xd0,0x3a,0xcf,0x86,0xd5,0x20,0x94,0x1c,0x93,0x18, + 0xd2,0x0c,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00,0x00,0x00,0x51,0x04,0x00,0x00, + 0x10,0x04,0x00,0x00,0x07,0x00,0x07,0x00,0x07,0x00,0x54,0x04,0x07,0x00,0x93,0x10, + 0x52,0x04,0x07,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x07,0x00,0x07,0x00, + 0xcf,0x06,0x08,0x00,0xd0,0x46,0xcf,0x86,0xd5,0x2c,0xd4,0x20,0x53,0x04,0x08,0x00, + 0xd2,0x0c,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x10,0x00,0xd1,0x08,0x10,0x04, + 0x10,0x00,0x12,0x00,0x10,0x04,0x12,0x00,0x00,0x00,0x53,0x04,0x0a,0x00,0x12,0x04, + 0x0a,0x00,0x00,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x10,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x08,0x14,0x04, + 0x00,0x00,0x0a,0x00,0x54,0x04,0x0a,0x00,0x53,0x04,0x0a,0x00,0x52,0x04,0x0a,0x00, + 0x91,0x08,0x10,0x04,0x0a,0x00,0x0a,0xdc,0x00,0x00,0xd2,0x5e,0xd1,0x06,0xcf,0x06, + 0x00,0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,0x0a,0x00,0x53,0x04,0x0a,0x00, + 0x52,0x04,0x0a,0x00,0x91,0x08,0x10,0x04,0x0a,0x00,0x00,0x00,0x00,0x00,0x0a,0x00, + 0xcf,0x86,0xd5,0x18,0x54,0x04,0x0a,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04, + 0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd4,0x14,0x93,0x10,0x92,0x0c, + 0x91,0x08,0x10,0x04,0x10,0xdc,0x10,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x53,0x04, + 0x10,0x00,0x12,0x04,0x10,0x00,0x00,0x00,0xd1,0x70,0xd0,0x36,0xcf,0x86,0xd5,0x18, + 0x54,0x04,0x05,0x00,0x53,0x04,0x05,0x00,0x52,0x04,0x05,0x00,0x51,0x04,0x05,0x00, + 0x10,0x04,0x05,0x00,0x10,0x00,0x94,0x18,0xd3,0x08,0x12,0x04,0x05,0x00,0x00,0x00, + 0x52,0x04,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x13,0x00,0x13,0x00,0x05,0x00, + 0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x05,0x00,0x92,0x0c,0x51,0x04,0x05,0x00, + 0x10,0x04,0x05,0x00,0x00,0x00,0x00,0x00,0x10,0x00,0x54,0x04,0x10,0x00,0xd3,0x0c, + 0x52,0x04,0x10,0x00,0x11,0x04,0x10,0x00,0x10,0xe6,0x92,0x0c,0x51,0x04,0x10,0xe6, + 0x10,0x04,0x10,0xe6,0x00,0x00,0x00,0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04, + 0x07,0x00,0x53,0x04,0x07,0x00,0x52,0x04,0x07,0x00,0x51,0x04,0x07,0x00,0x10,0x04, + 0x00,0x00,0x07,0x00,0x08,0x00,0xcf,0x86,0x95,0x1c,0xd4,0x0c,0x93,0x08,0x12,0x04, + 0x08,0x00,0x00,0x00,0x08,0x00,0x93,0x0c,0x52,0x04,0x08,0x00,0x11,0x04,0x08,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0xd3,0xba,0xd2,0x80,0xd1,0x34,0xd0,0x1a,0xcf,0x86, + 0x55,0x04,0x05,0x00,0x94,0x10,0x93,0x0c,0x52,0x04,0x05,0x00,0x11,0x04,0x05,0x00, + 0x07,0x00,0x05,0x00,0x05,0x00,0xcf,0x86,0x95,0x14,0x94,0x10,0x53,0x04,0x05,0x00, + 0x52,0x04,0x05,0x00,0x11,0x04,0x05,0x00,0x07,0x00,0x07,0x00,0x07,0x00,0xd0,0x2a, + 0xcf,0x86,0xd5,0x14,0x54,0x04,0x07,0x00,0x53,0x04,0x07,0x00,0x52,0x04,0x07,0x00, + 0x11,0x04,0x07,0x00,0x00,0x00,0x94,0x10,0x53,0x04,0x07,0x00,0x92,0x08,0x11,0x04, + 0x07,0x00,0x00,0x00,0x00,0x00,0x12,0x00,0xcf,0x86,0xd5,0x10,0x54,0x04,0x12,0x00, + 0x93,0x08,0x12,0x04,0x12,0x00,0x00,0x00,0x12,0x00,0x54,0x04,0x12,0x00,0x53,0x04, + 0x12,0x00,0x12,0x04,0x12,0x00,0x00,0x00,0xd1,0x34,0xd0,0x12,0xcf,0x86,0x55,0x04, + 0x10,0x00,0x94,0x08,0x13,0x04,0x10,0x00,0x00,0x00,0x10,0x00,0xcf,0x86,0x55,0x04, + 0x10,0x00,0x94,0x18,0xd3,0x08,0x12,0x04,0x10,0x00,0x00,0x00,0x52,0x04,0x00,0x00, + 0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x00,0x00,0xcf,0x06,0x00,0x00, + 0xd2,0x06,0xcf,0x06,0x10,0x00,0xd1,0x40,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x10,0x00, + 0x54,0x04,0x10,0x00,0x93,0x10,0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04, + 0x10,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x14,0x54,0x04,0x10,0x00,0x93,0x0c, + 0x52,0x04,0x10,0x00,0x11,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x94,0x08,0x13,0x04, + 0x10,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xe4,0xce,0x02,0xe3,0x45,0x01, + 0xd2,0xd0,0xd1,0x70,0xd0,0x52,0xcf,0x86,0xd5,0x20,0x94,0x1c,0xd3,0x0c,0x52,0x04, + 0x07,0x00,0x11,0x04,0x07,0x00,0x00,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x07,0x00, + 0x00,0x00,0x07,0x00,0x07,0x00,0x07,0x00,0x54,0x04,0x07,0x00,0xd3,0x10,0x52,0x04, + 0x07,0x00,0x51,0x04,0x07,0x00,0x10,0x04,0x00,0x00,0x07,0x00,0xd2,0x0c,0x91,0x08, + 0x10,0x04,0x07,0x00,0x00,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x07,0x00,0x00,0x00, + 0x10,0x04,0x00,0x00,0x07,0x00,0xcf,0x86,0x95,0x18,0x54,0x04,0x0b,0x00,0x93,0x10, + 0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x00,0x00,0x0b,0x00,0x0b,0x00, + 0x10,0x00,0xd0,0x32,0xcf,0x86,0xd5,0x18,0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00, + 0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x00,0x00,0x94,0x14, + 0x93,0x10,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00, + 0x10,0x00,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x11,0x00,0xd3,0x14, + 0xd2,0x0c,0x51,0x04,0x11,0x00,0x10,0x04,0x11,0x00,0x00,0x00,0x11,0x04,0x11,0x00, + 0x00,0x00,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x11,0x00,0x11,0x00, + 0xd1,0x40,0xd0,0x3a,0xcf,0x86,0xd5,0x1c,0x54,0x04,0x09,0x00,0x53,0x04,0x09,0x00, + 0xd2,0x08,0x11,0x04,0x09,0x00,0x0b,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00, + 0x09,0x00,0x54,0x04,0x0a,0x00,0x53,0x04,0x0a,0x00,0xd2,0x08,0x11,0x04,0x0a,0x00, + 0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0a,0x00,0xcf,0x06,0x00,0x00, + 0xd0,0x1a,0xcf,0x86,0x55,0x04,0x0d,0x00,0x54,0x04,0x0d,0x00,0x53,0x04,0x0d,0x00, + 0x52,0x04,0x00,0x00,0x11,0x04,0x11,0x00,0x0d,0x00,0xcf,0x86,0x95,0x14,0x54,0x04, + 0x11,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x00,0x00,0x11,0x00,0x11,0x00,0x11,0x00, + 0x11,0x00,0xd2,0xec,0xd1,0xa4,0xd0,0x76,0xcf,0x86,0xd5,0x48,0xd4,0x28,0xd3,0x14, + 0x52,0x04,0x08,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,0x08,0x00,0x10,0x04,0x08,0x00, + 0x00,0x00,0x52,0x04,0x00,0x00,0xd1,0x08,0x10,0x04,0x08,0x00,0x08,0xdc,0x10,0x04, + 0x08,0x00,0x08,0xe6,0xd3,0x10,0x52,0x04,0x08,0x00,0x91,0x08,0x10,0x04,0x00,0x00, + 0x08,0x00,0x08,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x08,0x00,0x08,0x00, + 0x08,0x00,0x54,0x04,0x08,0x00,0xd3,0x0c,0x52,0x04,0x08,0x00,0x11,0x04,0x14,0x00, + 0x00,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x08,0xe6,0x08,0x01,0x10,0x04,0x08,0xdc, + 0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x08,0x09,0xcf,0x86,0x95,0x28, + 0xd4,0x14,0x53,0x04,0x08,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x53,0x04,0x08,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x08,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x0b,0x00,0xd0,0x0a,0xcf,0x86,0x15,0x04,0x10,0x00, + 0x00,0x00,0xcf,0x86,0x55,0x04,0x10,0x00,0xd4,0x24,0xd3,0x14,0x52,0x04,0x10,0x00, + 0xd1,0x08,0x10,0x04,0x10,0x00,0x10,0xe6,0x10,0x04,0x10,0xdc,0x00,0x00,0x92,0x0c, + 0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x93,0x10,0x52,0x04, + 0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd1,0x54, + 0xd0,0x26,0xcf,0x86,0x55,0x04,0x0b,0x00,0x54,0x04,0x0b,0x00,0xd3,0x0c,0x52,0x04, + 0x0b,0x00,0x11,0x04,0x0b,0x00,0x00,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00, + 0x0b,0x00,0x0b,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x14,0x54,0x04,0x0b,0x00,0x93,0x0c, + 0x52,0x04,0x0b,0x00,0x11,0x04,0x0b,0x00,0x00,0x00,0x0b,0x00,0x54,0x04,0x0b,0x00, + 0x93,0x10,0x92,0x0c,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,0x00,0x00,0x00,0x00, + 0x0b,0x00,0xd0,0x42,0xcf,0x86,0xd5,0x28,0x54,0x04,0x10,0x00,0xd3,0x0c,0x92,0x08, + 0x11,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00, + 0x10,0x00,0x10,0x00,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x94,0x14, + 0x53,0x04,0x00,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00, + 0x10,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd3,0x96,0xd2,0x68,0xd1,0x24,0xd0,0x06, + 0xcf,0x06,0x0b,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,0x53,0x04,0x0b,0x00,0x92,0x0c, + 0x91,0x08,0x10,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0xd0,0x1e,0xcf,0x86,0x55,0x04,0x11,0x00,0x54,0x04,0x11,0x00,0x93,0x10,0x92,0x0c, + 0x51,0x04,0x11,0x00,0x10,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86, + 0x55,0x04,0x11,0x00,0x54,0x04,0x11,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x11,0x00, + 0x10,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0x92,0x08,0x11,0x04,0x00,0x00,0x11,0x00, + 0x11,0x00,0xd1,0x28,0xd0,0x22,0xcf,0x86,0x55,0x04,0x14,0x00,0xd4,0x0c,0x93,0x08, + 0x12,0x04,0x14,0x00,0x14,0xe6,0x00,0x00,0x53,0x04,0x14,0x00,0x92,0x08,0x11,0x04, + 0x14,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xd2,0x2a, + 0xd1,0x24,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04, + 0x0b,0x00,0x53,0x04,0x0b,0x00,0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04, + 0x0b,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1,0x58,0xd0,0x12,0xcf,0x86,0x55,0x04, + 0x14,0x00,0x94,0x08,0x13,0x04,0x14,0x00,0x00,0x00,0x14,0x00,0xcf,0x86,0x95,0x40, + 0xd4,0x24,0xd3,0x0c,0x52,0x04,0x14,0x00,0x11,0x04,0x14,0x00,0x14,0xdc,0xd2,0x0c, + 0x51,0x04,0x14,0xe6,0x10,0x04,0x14,0xe6,0x14,0xdc,0x91,0x08,0x10,0x04,0x14,0xe6, + 0x14,0xdc,0x14,0xdc,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0xdc,0x14,0x00, + 0x14,0x00,0x14,0x00,0x92,0x08,0x11,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x15,0x00, + 0x93,0x10,0x52,0x04,0x15,0x00,0x51,0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,0x00, + 0x00,0x00,0xcf,0x86,0xe5,0x0f,0x06,0xe4,0xf8,0x03,0xe3,0x02,0x02,0xd2,0xfb,0xd1, + 0x4c,0xd0,0x06,0xcf,0x06,0x0c,0x00,0xcf,0x86,0xd5,0x2c,0xd4,0x1c,0xd3,0x10,0x52, + 0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x09,0x0c,0x00,0x52,0x04,0x0c, + 0x00,0x11,0x04,0x0c,0x00,0x00,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x00,0x00,0x0c, + 0x00,0x0c,0x00,0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00, + 0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x09,0xd0,0x69,0xcf,0x86,0xd5, + 0x32,0x54,0x04,0x0b,0x00,0x53,0x04,0x0b,0x00,0xd2,0x15,0x51,0x04,0x0b,0x00,0x10, + 0x0d,0x0b,0xff,0xf0,0x91,0x82,0x99,0xf0,0x91,0x82,0xba,0x00,0x0b,0x00,0x91,0x11, + 0x10,0x0d,0x0b,0xff,0xf0,0x91,0x82,0x9b,0xf0,0x91,0x82,0xba,0x00,0x0b,0x00,0x0b, + 0x00,0xd4,0x1d,0x53,0x04,0x0b,0x00,0x92,0x15,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b, + 0x00,0x0b,0xff,0xf0,0x91,0x82,0xa5,0xf0,0x91,0x82,0xba,0x00,0x0b,0x00,0x53,0x04, + 0x0b,0x00,0x92,0x10,0xd1,0x08,0x10,0x04,0x0b,0x00,0x0b,0x09,0x10,0x04,0x0b,0x07, + 0x0b,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x20,0x94,0x1c,0xd3,0x0c,0x92,0x08,0x11,0x04, + 0x0b,0x00,0x00,0x00,0x00,0x00,0x52,0x04,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00, + 0x14,0x00,0x00,0x00,0x0d,0x00,0xd4,0x14,0x53,0x04,0x0d,0x00,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x0d,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x0d,0x00,0x92,0x08, + 0x11,0x04,0x0d,0x00,0x00,0x00,0x00,0x00,0xd1,0x96,0xd0,0x5c,0xcf,0x86,0xd5,0x18, + 0x94,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x0d,0xe6,0x10,0x04,0x0d,0xe6,0x0d,0x00, + 0x0d,0x00,0x0d,0x00,0x0d,0x00,0xd4,0x26,0x53,0x04,0x0d,0x00,0x52,0x04,0x0d,0x00, + 0x51,0x04,0x0d,0x00,0x10,0x0d,0x0d,0xff,0xf0,0x91,0x84,0xb1,0xf0,0x91,0x84,0xa7, + 0x00,0x0d,0xff,0xf0,0x91,0x84,0xb2,0xf0,0x91,0x84,0xa7,0x00,0x93,0x18,0xd2,0x0c, + 0x51,0x04,0x0d,0x00,0x10,0x04,0x0d,0x00,0x0d,0x09,0x91,0x08,0x10,0x04,0x0d,0x09, + 0x00,0x00,0x0d,0x00,0x0d,0x00,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x52,0x04, + 0x0d,0x00,0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x10,0x00, + 0x54,0x04,0x10,0x00,0x93,0x18,0xd2,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00, + 0x10,0x07,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd0,0x06, + 0xcf,0x06,0x0d,0x00,0xcf,0x86,0xd5,0x40,0xd4,0x2c,0xd3,0x10,0x92,0x0c,0x91,0x08, + 0x10,0x04,0x0d,0x09,0x0d,0x00,0x0d,0x00,0x0d,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04, + 0x0d,0x00,0x11,0x00,0x10,0x04,0x11,0x07,0x11,0x00,0x91,0x08,0x10,0x04,0x11,0x00, + 0x10,0x00,0x00,0x00,0x53,0x04,0x0d,0x00,0x92,0x0c,0x51,0x04,0x0d,0x00,0x10,0x04, + 0x10,0x00,0x11,0x00,0x11,0x00,0xd4,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04, + 0x00,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x93,0x10,0x52,0x04,0x10,0x00, + 0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd2,0xc8,0xd1,0x48, + 0xd0,0x42,0xcf,0x86,0xd5,0x18,0x54,0x04,0x10,0x00,0x93,0x10,0x92,0x0c,0x51,0x04, + 0x10,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x54,0x04,0x10,0x00, + 0xd3,0x14,0x52,0x04,0x10,0x00,0xd1,0x08,0x10,0x04,0x10,0x00,0x10,0x09,0x10,0x04, + 0x10,0x07,0x10,0x00,0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x12,0x00, + 0x00,0x00,0xcf,0x06,0x00,0x00,0xd0,0x52,0xcf,0x86,0xd5,0x3c,0xd4,0x28,0xd3,0x10, + 0x52,0x04,0x11,0x00,0x51,0x04,0x11,0x00,0x10,0x04,0x11,0x00,0x00,0x00,0xd2,0x0c, + 0x91,0x08,0x10,0x04,0x11,0x00,0x00,0x00,0x11,0x00,0x51,0x04,0x11,0x00,0x10,0x04, + 0x00,0x00,0x11,0x00,0x53,0x04,0x11,0x00,0x52,0x04,0x11,0x00,0x51,0x04,0x11,0x00, + 0x10,0x04,0x00,0x00,0x11,0x00,0x94,0x10,0x53,0x04,0x11,0x00,0x92,0x08,0x11,0x04, + 0x11,0x00,0x00,0x00,0x00,0x00,0x10,0x00,0xcf,0x86,0x55,0x04,0x10,0x00,0xd4,0x18, + 0x53,0x04,0x10,0x00,0x92,0x10,0xd1,0x08,0x10,0x04,0x10,0x00,0x10,0x07,0x10,0x04, + 0x10,0x09,0x00,0x00,0x00,0x00,0x53,0x04,0x10,0x00,0x92,0x08,0x11,0x04,0x10,0x00, + 0x00,0x00,0x00,0x00,0xe1,0x27,0x01,0xd0,0x8a,0xcf,0x86,0xd5,0x44,0xd4,0x2c,0xd3, + 0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x11,0x00,0x10,0x00,0x10,0x00,0x91,0x08,0x10, + 0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x52,0x04,0x10,0x00,0xd1,0x08,0x10,0x04,0x10, + 0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x93,0x14,0x92,0x10,0xd1,0x08,0x10, + 0x04,0x10,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0xd4, + 0x14,0x53,0x04,0x10,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x10, + 0x00,0x10,0x00,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x10, + 0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0xd2,0x0c,0x51,0x04,0x10, + 0x00,0x10,0x04,0x00,0x00,0x14,0x07,0x91,0x08,0x10,0x04,0x10,0x07,0x10,0x00,0x10, + 0x00,0xcf,0x86,0xd5,0x6a,0xd4,0x42,0xd3,0x14,0x52,0x04,0x10,0x00,0xd1,0x08,0x10, + 0x04,0x10,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0xd2,0x19,0xd1,0x08,0x10, + 0x04,0x10,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0xff,0xf0,0x91,0x8d,0x87,0xf0, + 0x91,0x8c,0xbe,0x00,0x91,0x11,0x10,0x0d,0x10,0xff,0xf0,0x91,0x8d,0x87,0xf0,0x91, + 0x8d,0x97,0x00,0x10,0x09,0x00,0x00,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x11, + 0x00,0x00,0x00,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x52, + 0x04,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0xd4,0x1c,0xd3, + 0x0c,0x52,0x04,0x10,0x00,0x11,0x04,0x00,0x00,0x10,0xe6,0x52,0x04,0x10,0xe6,0x91, + 0x08,0x10,0x04,0x10,0xe6,0x00,0x00,0x00,0x00,0x93,0x10,0x52,0x04,0x10,0xe6,0x91, + 0x08,0x10,0x04,0x10,0xe6,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xe3, + 0x30,0x01,0xd2,0xb7,0xd1,0x48,0xd0,0x06,0xcf,0x06,0x12,0x00,0xcf,0x86,0x95,0x3c, + 0xd4,0x1c,0x93,0x18,0xd2,0x0c,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x09,0x12,0x00, + 0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x07,0x12,0x00,0x12,0x00,0x53,0x04,0x12,0x00, + 0xd2,0x0c,0x51,0x04,0x12,0x00,0x10,0x04,0x00,0x00,0x12,0x00,0xd1,0x08,0x10,0x04, + 0x00,0x00,0x12,0x00,0x10,0x04,0x14,0xe6,0x15,0x00,0x00,0x00,0xd0,0x45,0xcf,0x86, + 0x55,0x04,0x10,0x00,0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00,0xd2,0x15,0x51,0x04, + 0x10,0x00,0x10,0x04,0x10,0x00,0x10,0xff,0xf0,0x91,0x92,0xb9,0xf0,0x91,0x92,0xba, + 0x00,0xd1,0x11,0x10,0x0d,0x10,0xff,0xf0,0x91,0x92,0xb9,0xf0,0x91,0x92,0xb0,0x00, + 0x10,0x00,0x10,0x0d,0x10,0xff,0xf0,0x91,0x92,0xb9,0xf0,0x91,0x92,0xbd,0x00,0x10, + 0x00,0xcf,0x86,0x95,0x24,0xd4,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x10,0x00,0x10, + 0x04,0x10,0x09,0x10,0x07,0x10,0x00,0x00,0x00,0x53,0x04,0x10,0x00,0x92,0x08,0x11, + 0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0, + 0x40,0xcf,0x86,0x55,0x04,0x10,0x00,0x54,0x04,0x10,0x00,0xd3,0x0c,0x52,0x04,0x10, + 0x00,0x11,0x04,0x10,0x00,0x00,0x00,0xd2,0x1e,0x51,0x04,0x10,0x00,0x10,0x0d,0x10, + 0xff,0xf0,0x91,0x96,0xb8,0xf0,0x91,0x96,0xaf,0x00,0x10,0xff,0xf0,0x91,0x96,0xb9, + 0xf0,0x91,0x96,0xaf,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x10,0x09,0xcf, + 0x86,0x95,0x2c,0xd4,0x1c,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x10,0x07,0x10, + 0x00,0x10,0x00,0x10,0x00,0x92,0x08,0x11,0x04,0x10,0x00,0x11,0x00,0x11,0x00,0x53, + 0x04,0x11,0x00,0x52,0x04,0x11,0x00,0x11,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0xd2, + 0xa0,0xd1,0x5c,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x10,0x00,0x54,0x04,0x10,0x00,0x53, + 0x04,0x10,0x00,0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x10, + 0x09,0xcf,0x86,0xd5,0x24,0xd4,0x14,0x93,0x10,0x52,0x04,0x10,0x00,0x91,0x08,0x10, + 0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x10,0x00,0x92,0x08,0x11, + 0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x94,0x14,0x53,0x04,0x12,0x00,0x52,0x04,0x12, + 0x00,0x91,0x08,0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd0,0x2a,0xcf, + 0x86,0x55,0x04,0x0d,0x00,0x54,0x04,0x0d,0x00,0xd3,0x10,0x52,0x04,0x0d,0x00,0x51, + 0x04,0x0d,0x00,0x10,0x04,0x0d,0x09,0x0d,0x07,0x92,0x0c,0x91,0x08,0x10,0x04,0x15, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0x95,0x14,0x94,0x10,0x53,0x04,0x0d, + 0x00,0x92,0x08,0x11,0x04,0x0d,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd1, + 0x40,0xd0,0x3a,0xcf,0x86,0xd5,0x20,0x54,0x04,0x11,0x00,0x53,0x04,0x11,0x00,0xd2, + 0x0c,0x51,0x04,0x11,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x00, + 0x00,0x11,0x00,0x11,0x00,0x94,0x14,0x53,0x04,0x11,0x00,0x92,0x0c,0x51,0x04,0x11, + 0x00,0x10,0x04,0x11,0x00,0x11,0x09,0x00,0x00,0x11,0x00,0xcf,0x06,0x00,0x00,0xcf, + 0x06,0x00,0x00,0xe4,0x59,0x01,0xd3,0xb2,0xd2,0x5c,0xd1,0x28,0xd0,0x22,0xcf,0x86, + 0x55,0x04,0x14,0x00,0x54,0x04,0x14,0x00,0x53,0x04,0x14,0x00,0x92,0x10,0xd1,0x08, + 0x10,0x04,0x14,0x00,0x14,0x09,0x10,0x04,0x14,0x07,0x14,0x00,0x00,0x00,0xcf,0x06, + 0x00,0x00,0xd0,0x0a,0xcf,0x86,0x15,0x04,0x00,0x00,0x10,0x00,0xcf,0x86,0x55,0x04, + 0x10,0x00,0x54,0x04,0x10,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x10,0x00,0x10,0x04, + 0x10,0x00,0x00,0x00,0x00,0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04, + 0x00,0x00,0x10,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x1a,0xcf,0x86,0x55,0x04, + 0x00,0x00,0x94,0x10,0x53,0x04,0x15,0x00,0x92,0x08,0x11,0x04,0x00,0x00,0x15,0x00, + 0x15,0x00,0x15,0x00,0xcf,0x86,0xd5,0x14,0x54,0x04,0x15,0x00,0x53,0x04,0x15,0x00, + 0x92,0x08,0x11,0x04,0x00,0x00,0x15,0x00,0x15,0x00,0x94,0x1c,0x93,0x18,0xd2,0x0c, + 0x91,0x08,0x10,0x04,0x15,0x09,0x15,0x00,0x15,0x00,0x91,0x08,0x10,0x04,0x15,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd2,0xa0,0xd1,0x3c,0xd0,0x1e,0xcf,0x86, + 0x55,0x04,0x13,0x00,0x54,0x04,0x13,0x00,0x93,0x10,0x52,0x04,0x13,0x00,0x91,0x08, + 0x10,0x04,0x13,0x09,0x13,0x00,0x13,0x00,0x13,0x00,0xcf,0x86,0x95,0x18,0x94,0x14, + 0x93,0x10,0x52,0x04,0x13,0x00,0x51,0x04,0x13,0x00,0x10,0x04,0x13,0x00,0x13,0x09, + 0x00,0x00,0x13,0x00,0x13,0x00,0xd0,0x46,0xcf,0x86,0xd5,0x2c,0xd4,0x10,0x93,0x0c, + 0x52,0x04,0x13,0x00,0x11,0x04,0x15,0x00,0x13,0x00,0x13,0x00,0x53,0x04,0x13,0x00, + 0xd2,0x0c,0x91,0x08,0x10,0x04,0x13,0x00,0x13,0x09,0x13,0x00,0x91,0x08,0x10,0x04, + 0x13,0x00,0x14,0x00,0x13,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x13,0x00, + 0x10,0x04,0x13,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0x55,0x04, + 0x10,0x00,0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00,0x92,0x0c,0x91,0x08,0x10,0x04, + 0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xe3,0xa9,0x01,0xd2, + 0xb0,0xd1,0x6c,0xd0,0x3e,0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x12,0x00,0x92, + 0x0c,0x91,0x08,0x10,0x04,0x12,0x00,0x00,0x00,0x12,0x00,0x12,0x00,0x12,0x00,0x54, + 0x04,0x12,0x00,0xd3,0x10,0x52,0x04,0x12,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12, + 0x00,0x00,0x00,0x52,0x04,0x12,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x12, + 0x09,0xcf,0x86,0xd5,0x14,0x94,0x10,0x93,0x0c,0x52,0x04,0x12,0x00,0x11,0x04,0x12, + 0x00,0x00,0x00,0x00,0x00,0x12,0x00,0x94,0x14,0x53,0x04,0x12,0x00,0x52,0x04,0x12, + 0x00,0x91,0x08,0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,0x12,0x00,0xd0,0x3e,0xcf, + 0x86,0xd5,0x14,0x54,0x04,0x12,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x00,0x00,0x12, + 0x00,0x12,0x00,0x12,0x00,0xd4,0x14,0x53,0x04,0x12,0x00,0x92,0x0c,0x91,0x08,0x10, + 0x04,0x00,0x00,0x12,0x00,0x12,0x00,0x12,0x00,0x93,0x10,0x52,0x04,0x12,0x00,0x51, + 0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1, + 0xa0,0xd0,0x52,0xcf,0x86,0xd5,0x24,0x94,0x20,0xd3,0x10,0x52,0x04,0x13,0x00,0x51, + 0x04,0x13,0x00,0x10,0x04,0x13,0x00,0x00,0x00,0x92,0x0c,0x51,0x04,0x13,0x00,0x10, + 0x04,0x00,0x00,0x13,0x00,0x13,0x00,0x13,0x00,0x54,0x04,0x13,0x00,0xd3,0x10,0x52, + 0x04,0x13,0x00,0x51,0x04,0x13,0x00,0x10,0x04,0x13,0x00,0x00,0x00,0xd2,0x0c,0x51, + 0x04,0x00,0x00,0x10,0x04,0x13,0x00,0x00,0x00,0x51,0x04,0x13,0x00,0x10,0x04,0x00, + 0x00,0x13,0x00,0xcf,0x86,0xd5,0x28,0xd4,0x18,0x93,0x14,0xd2,0x0c,0x51,0x04,0x13, + 0x00,0x10,0x04,0x13,0x07,0x13,0x00,0x11,0x04,0x13,0x09,0x13,0x00,0x00,0x00,0x53, + 0x04,0x13,0x00,0x92,0x08,0x11,0x04,0x13,0x00,0x00,0x00,0x00,0x00,0x94,0x20,0xd3, + 0x10,0x52,0x04,0x14,0x00,0x51,0x04,0x14,0x00,0x10,0x04,0x00,0x00,0x14,0x00,0x92, + 0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00,0x14,0x00,0x14,0x00,0x14,0x00,0xd0, + 0x52,0xcf,0x86,0xd5,0x3c,0xd4,0x14,0x53,0x04,0x14,0x00,0x52,0x04,0x14,0x00,0x51, + 0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x14, + 0x00,0x10,0x04,0x00,0x00,0x14,0x00,0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x14, + 0x09,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x94, + 0x10,0x53,0x04,0x14,0x00,0x92,0x08,0x11,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00, + 0x00,0xcf,0x06,0x00,0x00,0xd2,0x2a,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf, + 0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x14,0x00,0x53,0x04,0x14, + 0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd1, + 0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x15, + 0x00,0x54,0x04,0x15,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,0x15,0x00,0x00,0x00,0x00, + 0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x15,0x00,0xd0, + 0xca,0xcf,0x86,0xd5,0xc2,0xd4,0x54,0xd3,0x06,0xcf,0x06,0x09,0x00,0xd2,0x06,0xcf, + 0x06,0x09,0x00,0xd1,0x24,0xd0,0x06,0xcf,0x06,0x09,0x00,0xcf,0x86,0x55,0x04,0x09, + 0x00,0x94,0x14,0x53,0x04,0x09,0x00,0x52,0x04,0x09,0x00,0x51,0x04,0x09,0x00,0x10, + 0x04,0x09,0x00,0x10,0x00,0x10,0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,0x10, + 0x00,0x53,0x04,0x10,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,0x11,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd3,0x68,0xd2,0x46,0xd1,0x40,0xd0, + 0x06,0xcf,0x06,0x09,0x00,0xcf,0x86,0x55,0x04,0x09,0x00,0xd4,0x20,0xd3,0x10,0x92, + 0x0c,0x51,0x04,0x09,0x00,0x10,0x04,0x09,0x00,0x10,0x00,0x10,0x00,0x52,0x04,0x10, + 0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x00,0x00,0x93,0x10,0x52,0x04,0x09, + 0x00,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x11, + 0x00,0xd1,0x1c,0xd0,0x06,0xcf,0x06,0x11,0x00,0xcf,0x86,0x95,0x10,0x94,0x0c,0x93, + 0x08,0x12,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00, + 0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x86,0xd5,0x4c,0xd4,0x06,0xcf, + 0x06,0x0b,0x00,0xd3,0x40,0xd2,0x3a,0xd1,0x34,0xd0,0x2e,0xcf,0x86,0x55,0x04,0x0b, + 0x00,0xd4,0x14,0x53,0x04,0x0b,0x00,0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10, + 0x04,0x0b,0x00,0x00,0x00,0x53,0x04,0x15,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x15, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf, + 0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1,0x4c,0xd0,0x44,0xcf, + 0x86,0xd5,0x3c,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,0x11,0x00,0xd2, + 0x2a,0xd1,0x24,0xd0,0x06,0xcf,0x06,0x11,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,0x93, + 0x10,0x52,0x04,0x11,0x00,0x51,0x04,0x11,0x00,0x10,0x04,0x11,0x00,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00, + 0x00,0xcf,0x86,0xcf,0x06,0x00,0x00,0xe0,0xd2,0x01,0xcf,0x86,0xd5,0x06,0xcf,0x06, + 0x00,0x00,0xe4,0x0b,0x01,0xd3,0x06,0xcf,0x06,0x0c,0x00,0xd2,0x84,0xd1,0x50,0xd0, + 0x1e,0xcf,0x86,0x55,0x04,0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x0c,0x00,0x92, + 0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5, + 0x18,0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00,0x52,0x04,0x10,0x00,0x51,0x04,0x10, + 0x00,0x10,0x04,0x10,0x00,0x00,0x00,0x94,0x14,0x53,0x04,0x10,0x00,0xd2,0x08,0x11, + 0x04,0x10,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x10,0x00,0x00,0x00,0xd0,0x06,0xcf, + 0x06,0x00,0x00,0xcf,0x86,0xd5,0x08,0x14,0x04,0x00,0x00,0x10,0x00,0xd4,0x10,0x53, + 0x04,0x10,0x00,0x52,0x04,0x10,0x00,0x11,0x04,0x10,0x00,0x00,0x00,0x93,0x10,0x52, + 0x04,0x10,0x01,0x91,0x08,0x10,0x04,0x10,0x01,0x10,0x00,0x00,0x00,0x00,0x00,0xd1, + 0x6c,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x10,0x00,0x54,0x04,0x10,0x00,0x93,0x10,0x52, + 0x04,0x10,0xe6,0x51,0x04,0x10,0xe6,0x10,0x04,0x10,0xe6,0x10,0x00,0x10,0x00,0xcf, + 0x86,0xd5,0x24,0xd4,0x10,0x93,0x0c,0x52,0x04,0x10,0x00,0x11,0x04,0x10,0x00,0x00, + 0x00,0x00,0x00,0x53,0x04,0x10,0x00,0x92,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,0x00, + 0x00,0x10,0x00,0x10,0x00,0xd4,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x10,0x00,0x10, + 0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x53,0x04,0x10,0x00,0x52,0x04,0x00, + 0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0xd0,0x0e,0xcf,0x86,0x95, + 0x08,0x14,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf, + 0x06,0x00,0x00,0xd2,0x30,0xd1,0x0c,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x06,0x14, + 0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,0x14,0x00,0x53,0x04,0x14,0x00,0x92, + 0x0c,0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf, + 0x06,0x00,0x00,0xd1,0x4c,0xd0,0x06,0xcf,0x06,0x0d,0x00,0xcf,0x86,0xd5,0x2c,0x94, + 0x28,0xd3,0x10,0x52,0x04,0x0d,0x00,0x91,0x08,0x10,0x04,0x0d,0x00,0x15,0x00,0x15, + 0x00,0xd2,0x0c,0x51,0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,0x00,0x51,0x04,0x00, + 0x00,0x10,0x04,0x00,0x00,0x15,0x00,0x0d,0x00,0x54,0x04,0x0d,0x00,0x53,0x04,0x0d, + 0x00,0x52,0x04,0x0d,0x00,0x51,0x04,0x0d,0x00,0x10,0x04,0x0d,0x00,0x15,0x00,0xd0, + 0x1e,0xcf,0x86,0x95,0x18,0x94,0x14,0x53,0x04,0x15,0x00,0x52,0x04,0x00,0x00,0x51, + 0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0x00,0x00,0xcf,0x86,0x55, + 0x04,0x00,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x12,0x00,0x13, + 0x00,0x15,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xcf,0x06,0x12,0x00,0xe2, + 0xc6,0x01,0xd1,0x8e,0xd0,0x86,0xcf,0x86,0xd5,0x48,0xd4,0x06,0xcf,0x06,0x12,0x00, + 0xd3,0x06,0xcf,0x06,0x12,0x00,0xd2,0x06,0xcf,0x06,0x12,0x00,0xd1,0x06,0xcf,0x06, + 0x12,0x00,0xd0,0x06,0xcf,0x06,0x12,0x00,0xcf,0x86,0x55,0x04,0x12,0x00,0xd4,0x14, + 0x53,0x04,0x12,0x00,0x52,0x04,0x12,0x00,0x91,0x08,0x10,0x04,0x12,0x00,0x14,0x00, + 0x14,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x14,0x00,0x15,0x00,0x15,0x00,0x00,0x00, + 0xd4,0x36,0xd3,0x06,0xcf,0x06,0x12,0x00,0xd2,0x2a,0xd1,0x06,0xcf,0x06,0x12,0x00, + 0xd0,0x06,0xcf,0x06,0x12,0x00,0xcf,0x86,0x55,0x04,0x12,0x00,0x54,0x04,0x12,0x00, + 0x93,0x10,0x92,0x0c,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00, + 0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x86,0xcf,0x06,0x00,0x00, + 0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,0xd5,0xa2,0xd4,0x9c,0xd3,0x74, + 0xd2,0x26,0xd1,0x20,0xd0,0x1a,0xcf,0x86,0x95,0x14,0x94,0x10,0x93,0x0c,0x92,0x08, + 0x11,0x04,0x0c,0x00,0x13,0x00,0x13,0x00,0x13,0x00,0x13,0x00,0x13,0x00,0xcf,0x06, + 0x13,0x00,0xcf,0x06,0x13,0x00,0xd1,0x48,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04, + 0x13,0x00,0x53,0x04,0x13,0x00,0x52,0x04,0x13,0x00,0x51,0x04,0x13,0x00,0x10,0x04, + 0x13,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x18,0x54,0x04,0x00,0x00,0x93,0x10, + 0x92,0x0c,0x51,0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0x94,0x0c,0x93,0x08,0x12,0x04,0x00,0x00,0x15,0x00,0x00,0x00,0x13,0x00,0xcf,0x06, + 0x13,0x00,0xd2,0x22,0xd1,0x06,0xcf,0x06,0x13,0x00,0xd0,0x06,0xcf,0x06,0x13,0x00, + 0xcf,0x86,0x55,0x04,0x13,0x00,0x54,0x04,0x13,0x00,0x53,0x04,0x13,0x00,0x12,0x04, + 0x13,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06, + 0x00,0x00,0xd3,0x7f,0xd2,0x79,0xd1,0x34,0xd0,0x06,0xcf,0x06,0x10,0x00,0xcf,0x86, + 0x55,0x04,0x10,0x00,0xd4,0x14,0x53,0x04,0x10,0x00,0x92,0x0c,0x51,0x04,0x10,0x00, + 0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x10,0x00,0x52,0x04,0x10,0x00, + 0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd0,0x3f,0xcf,0x86,0xd5,0x2c, + 0xd4,0x14,0x53,0x04,0x10,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x53,0x04,0x10,0x00,0xd2,0x08,0x11,0x04,0x10,0x00,0x00,0x00, + 0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x01,0x10,0x00,0x94,0x0d,0x93,0x09,0x12,0x05, + 0x10,0xff,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00, + 0x00,0xcf,0x06,0x00,0x00,0xe1,0x96,0x04,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00, + 0xcf,0x86,0xe5,0x33,0x04,0xe4,0x83,0x02,0xe3,0xf8,0x01,0xd2,0x26,0xd1,0x06,0xcf, + 0x06,0x05,0x00,0xd0,0x06,0xcf,0x06,0x05,0x00,0xcf,0x86,0x55,0x04,0x05,0x00,0x54, + 0x04,0x05,0x00,0x93,0x0c,0x52,0x04,0x05,0x00,0x11,0x04,0x05,0x00,0x00,0x00,0x00, + 0x00,0xd1,0xef,0xd0,0x2a,0xcf,0x86,0x55,0x04,0x05,0x00,0x94,0x20,0xd3,0x10,0x52, + 0x04,0x05,0x00,0x51,0x04,0x05,0x00,0x10,0x04,0x05,0x00,0x00,0x00,0x92,0x0c,0x91, + 0x08,0x10,0x04,0x00,0x00,0x0a,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0xcf,0x86,0xd5, + 0x2a,0x54,0x04,0x05,0x00,0x53,0x04,0x05,0x00,0x52,0x04,0x05,0x00,0x51,0x04,0x05, + 0x00,0x10,0x0d,0x05,0xff,0xf0,0x9d,0x85,0x97,0xf0,0x9d,0x85,0xa5,0x00,0x05,0xff, + 0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0x00,0xd4,0x75,0xd3,0x61,0xd2,0x44,0xd1, + 0x22,0x10,0x11,0x05,0xff,0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0xf0,0x9d,0x85, + 0xae,0x00,0x05,0xff,0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0xf0,0x9d,0x85,0xaf, + 0x00,0x10,0x11,0x05,0xff,0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0xf0,0x9d,0x85, + 0xb0,0x00,0x05,0xff,0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0xf0,0x9d,0x85,0xb1, + 0x00,0xd1,0x15,0x10,0x11,0x05,0xff,0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0xf0, + 0x9d,0x85,0xb2,0x00,0x05,0xd8,0x10,0x04,0x05,0xd8,0x05,0x01,0xd2,0x08,0x11,0x04, + 0x05,0x01,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x05,0xe2,0x05,0xd8,0xd3,0x12, + 0x92,0x0d,0x51,0x04,0x05,0xd8,0x10,0x04,0x05,0xd8,0x05,0xff,0x00,0x05,0xff,0x00, + 0x92,0x0e,0x51,0x05,0x05,0xff,0x00,0x10,0x05,0x05,0xff,0x00,0x05,0xdc,0x05,0xdc, + 0xd0,0x97,0xcf,0x86,0xd5,0x28,0x94,0x24,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x05,0xdc, + 0x10,0x04,0x05,0xdc,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x05,0xe6,0x05,0xe6, + 0x92,0x08,0x11,0x04,0x05,0xe6,0x05,0xdc,0x05,0x00,0x05,0x00,0xd4,0x14,0x53,0x04, + 0x05,0x00,0xd2,0x08,0x11,0x04,0x05,0x00,0x05,0xe6,0x11,0x04,0x05,0xe6,0x05,0x00, + 0x53,0x04,0x05,0x00,0xd2,0x15,0x51,0x04,0x05,0x00,0x10,0x04,0x05,0x00,0x05,0xff, + 0xf0,0x9d,0x86,0xb9,0xf0,0x9d,0x85,0xa5,0x00,0xd1,0x1e,0x10,0x0d,0x05,0xff,0xf0, + 0x9d,0x86,0xba,0xf0,0x9d,0x85,0xa5,0x00,0x05,0xff,0xf0,0x9d,0x86,0xb9,0xf0,0x9d, + 0x85,0xa5,0xf0,0x9d,0x85,0xae,0x00,0x10,0x11,0x05,0xff,0xf0,0x9d,0x86,0xba,0xf0, + 0x9d,0x85,0xa5,0xf0,0x9d,0x85,0xae,0x00,0x05,0xff,0xf0,0x9d,0x86,0xb9,0xf0,0x9d, + 0x85,0xa5,0xf0,0x9d,0x85,0xaf,0x00,0xcf,0x86,0xd5,0x31,0xd4,0x21,0x93,0x1d,0x92, + 0x19,0x91,0x15,0x10,0x11,0x05,0xff,0xf0,0x9d,0x86,0xba,0xf0,0x9d,0x85,0xa5,0xf0, + 0x9d,0x85,0xaf,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0x53,0x04,0x05,0x00, + 0x52,0x04,0x05,0x00,0x11,0x04,0x05,0x00,0x11,0x00,0x94,0x14,0x53,0x04,0x11,0x00, + 0x92,0x0c,0x91,0x08,0x10,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, + 0xd2,0x44,0xd1,0x28,0xd0,0x06,0xcf,0x06,0x08,0x00,0xcf,0x86,0x95,0x1c,0x94,0x18, + 0x93,0x14,0xd2,0x08,0x11,0x04,0x08,0x00,0x08,0xe6,0x91,0x08,0x10,0x04,0x08,0xe6, + 0x08,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00, + 0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x14,0x00,0x93,0x08,0x12,0x04,0x14,0x00, + 0x00,0x00,0x00,0x00,0xd1,0x40,0xd0,0x06,0xcf,0x06,0x07,0x00,0xcf,0x86,0xd5,0x18, + 0x54,0x04,0x07,0x00,0x93,0x10,0x52,0x04,0x07,0x00,0x51,0x04,0x07,0x00,0x10,0x04, + 0x07,0x00,0x00,0x00,0x00,0x00,0x54,0x04,0x09,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04, + 0x09,0x00,0x14,0x00,0x14,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xe3,0x5f,0x01,0xd2,0xb4,0xd1,0x24,0xd0, + 0x06,0xcf,0x06,0x05,0x00,0xcf,0x86,0x95,0x18,0x54,0x04,0x05,0x00,0x93,0x10,0x52, + 0x04,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,0x00,0x05,0x00,0x05, + 0x00,0xd0,0x6a,0xcf,0x86,0xd5,0x18,0x54,0x04,0x05,0x00,0x53,0x04,0x05,0x00,0x52, + 0x04,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,0x00,0xd4,0x34,0xd3, + 0x1c,0xd2,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x05,0x00,0x00,0x00,0xd1,0x08,0x10, + 0x04,0x00,0x00,0x05,0x00,0x10,0x04,0x05,0x00,0x00,0x00,0xd2,0x0c,0x91,0x08,0x10, + 0x04,0x00,0x00,0x05,0x00,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05, + 0x00,0x53,0x04,0x05,0x00,0xd2,0x0c,0x51,0x04,0x05,0x00,0x10,0x04,0x00,0x00,0x05, + 0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x05,0x00,0x05,0x00,0xcf,0x86,0x95,0x20,0x94, + 0x1c,0x93,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x05,0x00,0x07,0x00,0x05,0x00,0x91, + 0x08,0x10,0x04,0x00,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0xd1, + 0xa4,0xd0,0x6a,0xcf,0x86,0xd5,0x48,0xd4,0x28,0xd3,0x10,0x52,0x04,0x05,0x00,0x51, + 0x04,0x05,0x00,0x10,0x04,0x00,0x00,0x05,0x00,0xd2,0x0c,0x51,0x04,0x05,0x00,0x10, + 0x04,0x05,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x05,0x00,0x05,0x00,0xd3, + 0x10,0x52,0x04,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,0x00,0x52, + 0x04,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,0x00,0x54,0x04,0x05, + 0x00,0x53,0x04,0x05,0x00,0xd2,0x0c,0x51,0x04,0x05,0x00,0x10,0x04,0x00,0x00,0x05, + 0x00,0x51,0x04,0x05,0x00,0x10,0x04,0x05,0x00,0x00,0x00,0xcf,0x86,0x95,0x34,0xd4, + 0x20,0xd3,0x14,0x52,0x04,0x05,0x00,0xd1,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x10, + 0x04,0x05,0x00,0x00,0x00,0x92,0x08,0x11,0x04,0x00,0x00,0x05,0x00,0x05,0x00,0x93, + 0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,0x00,0x05,0x00,0x05, + 0x00,0x05,0x00,0xcf,0x06,0x05,0x00,0xd2,0x26,0xd1,0x06,0xcf,0x06,0x05,0x00,0xd0, + 0x1a,0xcf,0x86,0x55,0x04,0x05,0x00,0x94,0x10,0x93,0x0c,0x52,0x04,0x05,0x00,0x11, + 0x04,0x08,0x00,0x00,0x00,0x05,0x00,0x05,0x00,0xcf,0x06,0x05,0x00,0xd1,0x06,0xcf, + 0x06,0x05,0x00,0xd0,0x06,0xcf,0x06,0x05,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,0x53, + 0x04,0x05,0x00,0xd2,0x08,0x11,0x04,0x05,0x00,0x09,0x00,0x11,0x04,0x00,0x00,0x05, + 0x00,0x05,0x00,0x05,0x00,0xd4,0x52,0xd3,0x06,0xcf,0x06,0x11,0x00,0xd2,0x46,0xd1, + 0x06,0xcf,0x06,0x11,0x00,0xd0,0x3a,0xcf,0x86,0xd5,0x20,0xd4,0x0c,0x53,0x04,0x11, + 0x00,0x12,0x04,0x11,0x00,0x00,0x00,0x53,0x04,0x00,0x00,0x92,0x0c,0x51,0x04,0x00, + 0x00,0x10,0x04,0x00,0x00,0x11,0x00,0x11,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x91, + 0x08,0x10,0x04,0x00,0x00,0x11,0x00,0x11,0x00,0x11,0x00,0x11,0x00,0x00,0x00,0xcf, + 0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xe0,0xc2,0x03,0xcf,0x86, + 0xe5,0x03,0x01,0xd4,0xfc,0xd3,0xc0,0xd2,0x66,0xd1,0x60,0xd0,0x5a,0xcf,0x86,0xd5, + 0x2c,0xd4,0x14,0x93,0x10,0x52,0x04,0x12,0xe6,0x51,0x04,0x12,0xe6,0x10,0x04,0x12, + 0xe6,0x00,0x00,0x12,0xe6,0x53,0x04,0x12,0xe6,0x92,0x10,0xd1,0x08,0x10,0x04,0x12, + 0xe6,0x00,0x00,0x10,0x04,0x00,0x00,0x12,0xe6,0x12,0xe6,0x94,0x28,0xd3,0x18,0xd2, + 0x0c,0x51,0x04,0x12,0xe6,0x10,0x04,0x00,0x00,0x12,0xe6,0x91,0x08,0x10,0x04,0x12, + 0xe6,0x00,0x00,0x12,0xe6,0x92,0x0c,0x51,0x04,0x12,0xe6,0x10,0x04,0x12,0xe6,0x00, + 0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1,0x54,0xd0, + 0x36,0xcf,0x86,0x55,0x04,0x15,0x00,0xd4,0x14,0x53,0x04,0x15,0x00,0x52,0x04,0x15, + 0x00,0x91,0x08,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0xd3,0x10,0x52,0x04,0x15, + 0xe6,0x51,0x04,0x15,0xe6,0x10,0x04,0x15,0xe6,0x15,0x00,0x52,0x04,0x15,0x00,0x11, + 0x04,0x15,0x00,0x00,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,0x53,0x04,0x15,0x00,0xd2, + 0x08,0x11,0x04,0x15,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x15,0x00,0x00,0x00,0x00, + 0x00,0xcf,0x06,0x00,0x00,0xd2,0x36,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf, + 0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x15,0x00,0xd4,0x0c,0x53,0x04,0x15,0x00,0x12, + 0x04,0x15,0x00,0x15,0xe6,0x53,0x04,0x15,0x00,0xd2,0x08,0x11,0x04,0x15,0x00,0x00, + 0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x15,0x00,0xcf,0x06,0x00,0x00,0xcf, + 0x06,0x00,0x00,0xd4,0x82,0xd3,0x7c,0xd2,0x3e,0xd1,0x06,0xcf,0x06,0x10,0x00,0xd0, + 0x06,0xcf,0x06,0x10,0x00,0xcf,0x86,0x95,0x2c,0xd4,0x18,0x93,0x14,0x52,0x04,0x10, + 0x00,0xd1,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x10, + 0x00,0x93,0x10,0x52,0x04,0x10,0xdc,0x51,0x04,0x10,0xdc,0x10,0x04,0x10,0xdc,0x00, + 0x00,0x00,0x00,0x00,0x00,0xd1,0x38,0xd0,0x06,0xcf,0x06,0x12,0x00,0xcf,0x86,0x95, + 0x2c,0xd4,0x18,0xd3,0x08,0x12,0x04,0x12,0x00,0x12,0xe6,0x92,0x0c,0x51,0x04,0x12, + 0xe6,0x10,0x04,0x12,0x07,0x15,0x00,0x00,0x00,0x53,0x04,0x12,0x00,0xd2,0x08,0x11, + 0x04,0x12,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x12,0x00,0x00,0x00,0xcf,0x06,0x00, + 0x00,0xcf,0x06,0x00,0x00,0xd3,0x82,0xd2,0x48,0xd1,0x24,0xd0,0x06,0xcf,0x06,0x00, + 0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x93,0x10,0x92,0x0c,0x91, + 0x08,0x10,0x04,0x00,0x00,0x14,0x00,0x14,0x00,0x14,0x00,0x14,0x00,0xd0,0x1e,0xcf, + 0x86,0x55,0x04,0x14,0x00,0x54,0x04,0x14,0x00,0x93,0x10,0x52,0x04,0x14,0x00,0x91, + 0x08,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1, + 0x34,0xd0,0x2e,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10, + 0x04,0x00,0x00,0x15,0x00,0x15,0x00,0x15,0x00,0x15,0x00,0x15,0x00,0x54,0x04,0x15, + 0x00,0x53,0x04,0x15,0x00,0x52,0x04,0x15,0x00,0x11,0x04,0x15,0x00,0x00,0x00,0xcf, + 0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xe2,0xb2,0x01,0xe1,0x41,0x01,0xd0,0x6e,0xcf, + 0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x52,0x04,0x0d,0x00,0x91,0x08,0x10,0x04,0x00, + 0x00,0x0d,0x00,0x0d,0x00,0x0d,0x00,0x0d,0x00,0xd4,0x30,0xd3,0x20,0xd2,0x10,0xd1, + 0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0xd1,0x08,0x10, + 0x04,0x0d,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0x92,0x0c,0x91,0x08,0x10, + 0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0x0d,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x0d, + 0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0x0d,0x00,0x92,0x10,0xd1,0x08,0x10,0x04,0x00, + 0x00,0x0d,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0x00,0x00,0xcf,0x86,0xd5,0x74,0xd4, + 0x34,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0x51, + 0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00, + 0x00,0x0d,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x0d, + 0x00,0x0d,0x00,0xd3,0x20,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x10, + 0x04,0x0d,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x0d,0x00,0x00,0x00,0x10,0x04,0x00, + 0x00,0x0d,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x10,0x04,0x00, + 0x00,0x0d,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x10,0x04,0x00,0x00,0x0d, + 0x00,0xd4,0x30,0xd3,0x20,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x10, + 0x04,0x0d,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x0d,0x00,0x00,0x00,0x10,0x04,0x00, + 0x00,0x0d,0x00,0x92,0x0c,0x51,0x04,0x0d,0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0x0d, + 0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x0d,0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0x0d, + 0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0xd1,0x08,0x10, + 0x04,0x0d,0x00,0x00,0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0xd0,0x56,0xcf,0x86,0xd5, + 0x20,0xd4,0x14,0x53,0x04,0x0d,0x00,0x92,0x0c,0x51,0x04,0x0d,0x00,0x10,0x04,0x00, + 0x00,0x0d,0x00,0x0d,0x00,0x53,0x04,0x0d,0x00,0x12,0x04,0x0d,0x00,0x00,0x00,0xd4, + 0x28,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0x91, + 0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0x92,0x0c,0x51,0x04,0x0d,0x00,0x10, + 0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0x53,0x04,0x0d,0x00,0x12,0x04,0x0d,0x00,0x00, + 0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x93,0x0c,0x92,0x08,0x11, + 0x04,0x0d,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x86,0xe5, + 0x96,0x05,0xe4,0x28,0x03,0xe3,0xed,0x01,0xd2,0xa0,0xd1,0x1c,0xd0,0x16,0xcf,0x86, + 0x55,0x04,0x0a,0x00,0x94,0x0c,0x53,0x04,0x0a,0x00,0x12,0x04,0x0a,0x00,0x00,0x00, + 0x0a,0x00,0xcf,0x06,0x0a,0x00,0xd0,0x46,0xcf,0x86,0xd5,0x10,0x54,0x04,0x0a,0x00, + 0x93,0x08,0x12,0x04,0x0a,0x00,0x00,0x00,0x00,0x00,0xd4,0x14,0x53,0x04,0x0c,0x00, + 0x52,0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,0xd3,0x10, + 0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0x52,0x04, + 0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x10,0x00,0xcf,0x86,0xd5,0x28, + 0xd4,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00,0x0c,0x00, + 0x0c,0x00,0x0c,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00, + 0x0c,0x00,0x0c,0x00,0x0c,0x00,0x54,0x04,0x10,0x00,0x93,0x0c,0x52,0x04,0x10,0x00, + 0x11,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd1,0xe4,0xd0,0x5a,0xcf,0x86,0xd5,0x20, + 0x94,0x1c,0x53,0x04,0x0b,0x00,0xd2,0x0c,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00, + 0x10,0x00,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x0b,0x00,0xd4,0x14, + 0x53,0x04,0x0b,0x00,0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00, + 0x14,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x0b,0x00,0x0c,0x00, + 0x0c,0x00,0x52,0x04,0x0c,0x00,0xd1,0x08,0x10,0x04,0x0c,0x00,0x0b,0x00,0x10,0x04, + 0x0c,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x4c,0xd4,0x2c,0xd3,0x18,0xd2,0x0c,0x51,0x04, + 0x0c,0x00,0x10,0x04,0x0b,0x00,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0b,0x00, + 0x0c,0x00,0xd2,0x08,0x11,0x04,0x0c,0x00,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04, + 0x0b,0x00,0x0c,0x00,0xd3,0x10,0x52,0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04, + 0x0c,0x00,0x0b,0x00,0x52,0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00, + 0x0b,0x00,0xd4,0x18,0x53,0x04,0x0c,0x00,0xd2,0x08,0x11,0x04,0x0c,0x00,0x0d,0x00, + 0x91,0x08,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x0c,0x00,0xd2,0x10, + 0xd1,0x08,0x10,0x04,0x0c,0x00,0x0b,0x00,0x10,0x04,0x0c,0x00,0x0b,0x00,0xd1,0x08, + 0x10,0x04,0x0b,0x00,0x0c,0x00,0x10,0x04,0x0c,0x00,0x0b,0x00,0xd0,0x4e,0xcf,0x86, + 0xd5,0x34,0xd4,0x14,0x53,0x04,0x0c,0x00,0xd2,0x08,0x11,0x04,0x0c,0x00,0x0b,0x00, + 0x11,0x04,0x0b,0x00,0x0c,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0b,0x00, + 0x0c,0x00,0x0c,0x00,0x0c,0x00,0x92,0x0c,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00, + 0x12,0x00,0x12,0x00,0x94,0x14,0x53,0x04,0x12,0x00,0x52,0x04,0x12,0x00,0x91,0x08, + 0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00, + 0x94,0x10,0x93,0x0c,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x0c,0x00,0x0c,0x00, + 0x0c,0x00,0xd2,0x7e,0xd1,0x78,0xd0,0x3e,0xcf,0x86,0xd5,0x1c,0x94,0x18,0x93,0x14, + 0x92,0x10,0xd1,0x08,0x10,0x04,0x0b,0x00,0x0c,0x00,0x10,0x04,0x0c,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0x0b,0x00,0x54,0x04,0x0b,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04, + 0x0b,0x00,0x0c,0x00,0x0c,0x00,0x92,0x0c,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00, + 0x12,0x00,0x00,0x00,0xcf,0x86,0xd5,0x24,0xd4,0x14,0x53,0x04,0x0b,0x00,0x92,0x0c, + 0x91,0x08,0x10,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x93,0x0c,0x92,0x08, + 0x11,0x04,0x0c,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x94,0x10,0x93,0x0c,0x52,0x04, + 0x13,0x00,0x11,0x04,0x13,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00, + 0xd1,0x58,0xd0,0x3a,0xcf,0x86,0x55,0x04,0x0c,0x00,0xd4,0x20,0xd3,0x10,0x92,0x0c, + 0x91,0x08,0x10,0x04,0x0c,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x52,0x04,0x10,0x00, + 0x91,0x08,0x10,0x04,0x10,0x00,0x11,0x00,0x11,0x00,0x93,0x10,0x52,0x04,0x0c,0x00, + 0x51,0x04,0x0c,0x00,0x10,0x04,0x10,0x00,0x0c,0x00,0x0c,0x00,0xcf,0x86,0x55,0x04, + 0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x0c,0x00,0x52,0x04,0x0c,0x00,0x91,0x08, + 0x10,0x04,0x0c,0x00,0x10,0x00,0x11,0x00,0xd0,0x16,0xcf,0x86,0x95,0x10,0x54,0x04, + 0x0c,0x00,0x93,0x08,0x12,0x04,0x0c,0x00,0x10,0x00,0x10,0x00,0x0c,0x00,0xcf,0x86, + 0xd5,0x34,0xd4,0x28,0xd3,0x10,0x52,0x04,0x0c,0x00,0x91,0x08,0x10,0x04,0x0c,0x00, + 0x10,0x00,0x0c,0x00,0xd2,0x0c,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x10,0x00, + 0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x11,0x00,0x93,0x08,0x12,0x04,0x11,0x00, + 0x10,0x00,0x10,0x00,0x54,0x04,0x0c,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04, + 0x0c,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x11,0x00,0xd3,0xfc,0xd2,0x6c,0xd1,0x3c, + 0xd0,0x1e,0xcf,0x86,0x55,0x04,0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x0c,0x00, + 0x52,0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x10,0x00,0xcf,0x86, + 0x95,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x10,0x00, + 0x0c,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0xd0,0x06,0xcf,0x06,0x0c,0x00, + 0xcf,0x86,0x55,0x04,0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x0c,0x00,0xd2,0x0c, + 0x91,0x08,0x10,0x04,0x10,0x00,0x0c,0x00,0x0c,0x00,0xd1,0x08,0x10,0x04,0x0c,0x00, + 0x10,0x00,0x10,0x04,0x10,0x00,0x11,0x00,0xd1,0x54,0xd0,0x1a,0xcf,0x86,0x55,0x04, + 0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x0c,0x00,0x52,0x04,0x0c,0x00,0x11,0x04, + 0x0c,0x00,0x10,0x00,0xcf,0x86,0xd5,0x1c,0x94,0x18,0xd3,0x08,0x12,0x04,0x0d,0x00, + 0x10,0x00,0x92,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x11,0x00,0x11,0x00, + 0x0c,0x00,0xd4,0x08,0x13,0x04,0x0c,0x00,0x10,0x00,0x53,0x04,0x10,0x00,0x92,0x0c, + 0x51,0x04,0x10,0x00,0x10,0x04,0x12,0x00,0x10,0x00,0x10,0x00,0xd0,0x1e,0xcf,0x86, + 0x55,0x04,0x10,0x00,0x94,0x14,0x93,0x10,0x52,0x04,0x10,0x00,0x91,0x08,0x10,0x04, + 0x12,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0xcf,0x86,0x55,0x04,0x10,0x00, + 0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00,0x92,0x0c,0x51,0x04,0x10,0x00,0x10,0x04, + 0x10,0x00,0x0c,0x00,0x0c,0x00,0xe2,0x19,0x01,0xd1,0xa8,0xd0,0x7e,0xcf,0x86,0xd5, + 0x4c,0xd4,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0d,0x00,0x0c,0x00,0x0c, + 0x00,0x0c,0x00,0x0c,0x00,0xd3,0x1c,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x0d, + 0x00,0x0c,0x00,0xd1,0x08,0x10,0x04,0x0c,0x00,0x0d,0x00,0x10,0x04,0x0c,0x00,0x0d, + 0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x0c,0x00,0x0d,0x00,0x10,0x04,0x0c,0x00,0x0d, + 0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x0d,0x00,0xd4,0x1c,0xd3,0x0c,0x52, + 0x04,0x0c,0x00,0x11,0x04,0x0c,0x00,0x0d,0x00,0x52,0x04,0x0c,0x00,0x91,0x08,0x10, + 0x04,0x0d,0x00,0x0c,0x00,0x0d,0x00,0x93,0x10,0x52,0x04,0x0c,0x00,0x91,0x08,0x10, + 0x04,0x0d,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0xcf,0x86,0x95,0x24,0x94,0x20,0x93, + 0x1c,0xd2,0x10,0xd1,0x08,0x10,0x04,0x0c,0x00,0x10,0x00,0x10,0x04,0x10,0x00,0x11, + 0x00,0x91,0x08,0x10,0x04,0x11,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0x10,0x00,0x10, + 0x00,0xd0,0x06,0xcf,0x06,0x0c,0x00,0xcf,0x86,0xd5,0x30,0xd4,0x10,0x93,0x0c,0x52, + 0x04,0x0c,0x00,0x11,0x04,0x0c,0x00,0x10,0x00,0x10,0x00,0x93,0x1c,0xd2,0x10,0xd1, + 0x08,0x10,0x04,0x11,0x00,0x12,0x00,0x10,0x04,0x12,0x00,0x13,0x00,0x91,0x08,0x10, + 0x04,0x13,0x00,0x15,0x00,0x00,0x00,0x00,0x00,0xd4,0x14,0x53,0x04,0x10,0x00,0x52, + 0x04,0x10,0x00,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd3,0x10,0x52, + 0x04,0x10,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x13,0x00,0x92,0x10,0xd1, + 0x08,0x10,0x04,0x13,0x00,0x14,0x00,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0xd1, + 0x1c,0xd0,0x06,0xcf,0x06,0x0c,0x00,0xcf,0x86,0x55,0x04,0x0c,0x00,0x54,0x04,0x0c, + 0x00,0x93,0x08,0x12,0x04,0x0c,0x00,0x00,0x00,0x00,0x00,0xd0,0x06,0xcf,0x06,0x10, + 0x00,0xcf,0x86,0xd5,0x24,0x54,0x04,0x10,0x00,0xd3,0x10,0x52,0x04,0x10,0x00,0x91, + 0x08,0x10,0x04,0x10,0x00,0x14,0x00,0x14,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x14, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x94,0x0c,0x53,0x04,0x15,0x00,0x12,0x04,0x15, + 0x00,0x00,0x00,0x00,0x00,0xe4,0x40,0x02,0xe3,0xc9,0x01,0xd2,0x5c,0xd1,0x34,0xd0, + 0x16,0xcf,0x86,0x95,0x10,0x94,0x0c,0x53,0x04,0x10,0x00,0x12,0x04,0x10,0x00,0x00, + 0x00,0x10,0x00,0x10,0x00,0xcf,0x86,0x95,0x18,0xd4,0x08,0x13,0x04,0x10,0x00,0x00, + 0x00,0x53,0x04,0x10,0x00,0x92,0x08,0x11,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x10, + 0x00,0xd0,0x22,0xcf,0x86,0xd5,0x0c,0x94,0x08,0x13,0x04,0x10,0x00,0x00,0x00,0x10, + 0x00,0x94,0x10,0x53,0x04,0x10,0x00,0x52,0x04,0x10,0x00,0x11,0x04,0x10,0x00,0x00, + 0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1,0xc0,0xd0,0x5e,0xcf,0x86,0xd5,0x30,0xd4, + 0x14,0x53,0x04,0x13,0x00,0x52,0x04,0x13,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x15, + 0x00,0x15,0x00,0x53,0x04,0x11,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x11,0x00,0x12, + 0x00,0x12,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x13,0x00,0xd4,0x08,0x13, + 0x04,0x12,0x00,0x13,0x00,0xd3,0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x12,0x00,0x13, + 0x00,0x10,0x04,0x13,0x00,0x12,0x00,0x12,0x00,0x52,0x04,0x12,0x00,0x51,0x04,0x12, + 0x00,0x10,0x04,0x12,0x00,0x15,0x00,0xcf,0x86,0xd5,0x28,0xd4,0x14,0x53,0x04,0x12, + 0x00,0x52,0x04,0x12,0x00,0x91,0x08,0x10,0x04,0x13,0x00,0x14,0x00,0x14,0x00,0x53, + 0x04,0x12,0x00,0x52,0x04,0x12,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x13, + 0x00,0xd4,0x0c,0x53,0x04,0x13,0x00,0x12,0x04,0x13,0x00,0x14,0x00,0xd3,0x1c,0xd2, + 0x10,0xd1,0x08,0x10,0x04,0x14,0x00,0x15,0x00,0x10,0x04,0x00,0x00,0x14,0x00,0x51, + 0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0x92,0x0c,0x51,0x04,0x00,0x00,0x10, + 0x04,0x14,0x00,0x15,0x00,0x14,0x00,0xd0,0x62,0xcf,0x86,0xd5,0x24,0xd4,0x14,0x93, + 0x10,0x52,0x04,0x11,0x00,0x91,0x08,0x10,0x04,0x11,0x00,0x12,0x00,0x12,0x00,0x12, + 0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x12,0x00,0x13,0x00,0x13,0x00,0x14,0x00,0xd4, + 0x2c,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0x91, + 0x08,0x10,0x04,0x00,0x00,0x15,0x00,0x15,0x00,0xd2,0x0c,0x51,0x04,0x15,0x00,0x10, + 0x04,0x15,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x15,0x00,0x53,0x04,0x14,0x00,0x92, + 0x08,0x11,0x04,0x14,0x00,0x15,0x00,0x15,0x00,0xcf,0x86,0xd5,0x30,0x94,0x2c,0xd3, + 0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x11,0x00,0x14,0x00,0x10,0x04,0x14,0x00,0x15, + 0x00,0x15,0x00,0xd2,0x0c,0x51,0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,0x00,0x91, + 0x08,0x10,0x04,0x00,0x00,0x15,0x00,0x15,0x00,0x13,0x00,0x94,0x14,0x93,0x10,0x52, + 0x04,0x13,0x00,0x51,0x04,0x13,0x00,0x10,0x04,0x13,0x00,0x14,0x00,0x14,0x00,0x14, + 0x00,0xd2,0x70,0xd1,0x40,0xd0,0x06,0xcf,0x06,0x15,0x00,0xcf,0x86,0xd5,0x10,0x54, + 0x04,0x15,0x00,0x93,0x08,0x12,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0xd4,0x10,0x53, + 0x04,0x14,0x00,0x52,0x04,0x14,0x00,0x11,0x04,0x14,0x00,0x00,0x00,0xd3,0x08,0x12, + 0x04,0x15,0x00,0x00,0x00,0x92,0x0c,0x51,0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00, + 0x00,0x00,0x00,0xd0,0x2a,0xcf,0x86,0x95,0x24,0xd4,0x14,0x93,0x10,0x92,0x0c,0x51, + 0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x93,0x0c,0x52, + 0x04,0x15,0x00,0x11,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00, + 0x00,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00, + 0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55, + 0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11, + 0x04,0x00,0x00,0x02,0x00,0xe4,0xf9,0x12,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00, + 0xd2,0xc2,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd0,0x44,0xcf,0x86,0xd5,0x3c, + 0xd4,0x06,0xcf,0x06,0x05,0x00,0xd3,0x06,0xcf,0x06,0x05,0x00,0xd2,0x2a,0xd1,0x06, + 0xcf,0x06,0x05,0x00,0xd0,0x06,0xcf,0x06,0x05,0x00,0xcf,0x86,0x95,0x18,0x54,0x04, + 0x05,0x00,0x93,0x10,0x52,0x04,0x05,0x00,0x51,0x04,0x05,0x00,0x10,0x04,0x05,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x0b,0x00,0xcf,0x06,0x0b,0x00,0xcf,0x86, + 0xd5,0x3c,0xd4,0x06,0xcf,0x06,0x0b,0x00,0xd3,0x06,0xcf,0x06,0x0b,0x00,0xd2,0x06, + 0xcf,0x06,0x0b,0x00,0xd1,0x24,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x0b,0x00,0x54,0x04, + 0x0b,0x00,0x93,0x10,0x52,0x04,0x0b,0x00,0x91,0x08,0x10,0x04,0x0b,0x00,0x00,0x00, + 0x00,0x00,0x00,0x00,0xcf,0x06,0x0c,0x00,0xcf,0x06,0x0c,0x00,0xd4,0x32,0xd3,0x2c, + 0xd2,0x26,0xd1,0x20,0xd0,0x1a,0xcf,0x86,0x95,0x14,0x54,0x04,0x0c,0x00,0x53,0x04, + 0x0c,0x00,0x52,0x04,0x0c,0x00,0x11,0x04,0x0c,0x00,0x00,0x00,0x11,0x00,0xcf,0x06, + 0x11,0x00,0xcf,0x06,0x11,0x00,0xcf,0x06,0x11,0x00,0xcf,0x06,0x11,0x00,0xcf,0x06, + 0x11,0x00,0xd1,0x48,0xd0,0x40,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x11,0x00,0xd4,0x06, + 0xcf,0x06,0x11,0x00,0xd3,0x06,0xcf,0x06,0x11,0x00,0xd2,0x26,0xd1,0x06,0xcf,0x06, + 0x11,0x00,0xd0,0x1a,0xcf,0x86,0x55,0x04,0x11,0x00,0x94,0x10,0x93,0x0c,0x92,0x08, + 0x11,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x13,0x00,0xcf,0x06,0x13,0x00, + 0xcf,0x06,0x13,0x00,0xcf,0x86,0xcf,0x06,0x13,0x00,0xd0,0x44,0xcf,0x86,0xd5,0x06, + 0xcf,0x06,0x13,0x00,0xd4,0x36,0xd3,0x06,0xcf,0x06,0x13,0x00,0xd2,0x06,0xcf,0x06, + 0x13,0x00,0xd1,0x06,0xcf,0x06,0x13,0x00,0xd0,0x06,0xcf,0x06,0x13,0x00,0xcf,0x86, + 0x55,0x04,0x13,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x13,0x00, + 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x86, + 0xd5,0x06,0xcf,0x06,0x00,0x00,0xe4,0x68,0x11,0xe3,0x51,0x10,0xe2,0x17,0x08,0xe1, + 0x06,0x04,0xe0,0x03,0x02,0xcf,0x86,0xe5,0x06,0x01,0xd4,0x82,0xd3,0x41,0xd2,0x21, + 0xd1,0x10,0x10,0x08,0x05,0xff,0xe4,0xb8,0xbd,0x00,0x05,0xff,0xe4,0xb8,0xb8,0x00, + 0x10,0x08,0x05,0xff,0xe4,0xb9,0x81,0x00,0x05,0xff,0xf0,0xa0,0x84,0xa2,0x00,0xd1, + 0x10,0x10,0x08,0x05,0xff,0xe4,0xbd,0xa0,0x00,0x05,0xff,0xe4,0xbe,0xae,0x00,0x10, + 0x08,0x05,0xff,0xe4,0xbe,0xbb,0x00,0x05,0xff,0xe5,0x80,0x82,0x00,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x05,0xff,0xe5,0x81,0xba,0x00,0x05,0xff,0xe5,0x82,0x99,0x00,0x10, + 0x08,0x05,0xff,0xe5,0x83,0xa7,0x00,0x05,0xff,0xe5,0x83,0x8f,0x00,0xd1,0x11,0x10, + 0x08,0x05,0xff,0xe3,0x92,0x9e,0x00,0x05,0xff,0xf0,0xa0,0x98,0xba,0x00,0x10,0x08, + 0x05,0xff,0xe5,0x85,0x8d,0x00,0x05,0xff,0xe5,0x85,0x94,0x00,0xd3,0x42,0xd2,0x21, + 0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x85,0xa4,0x00,0x05,0xff,0xe5,0x85,0xb7,0x00, + 0x10,0x09,0x05,0xff,0xf0,0xa0,0x94,0x9c,0x00,0x05,0xff,0xe3,0x92,0xb9,0x00,0xd1, + 0x10,0x10,0x08,0x05,0xff,0xe5,0x85,0xa7,0x00,0x05,0xff,0xe5,0x86,0x8d,0x00,0x10, + 0x09,0x05,0xff,0xf0,0xa0,0x95,0x8b,0x00,0x05,0xff,0xe5,0x86,0x97,0x00,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x86,0xa4,0x00,0x05,0xff,0xe4,0xbb,0x8c,0x00, + 0x10,0x08,0x05,0xff,0xe5,0x86,0xac,0x00,0x05,0xff,0xe5,0x86,0xb5,0x00,0xd1,0x11, + 0x10,0x09,0x05,0xff,0xf0,0xa9,0x87,0x9f,0x00,0x05,0xff,0xe5,0x87,0xb5,0x00,0x10, + 0x08,0x05,0xff,0xe5,0x88,0x83,0x00,0x05,0xff,0xe3,0x93,0x9f,0x00,0xd4,0x80,0xd3, + 0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x88,0xbb,0x00,0x05,0xff,0xe5, + 0x89,0x86,0x00,0x10,0x08,0x05,0xff,0xe5,0x89,0xb2,0x00,0x05,0xff,0xe5,0x89,0xb7, + 0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe3,0x94,0x95,0x00,0x05,0xff,0xe5,0x8b,0x87, + 0x00,0x10,0x08,0x05,0xff,0xe5,0x8b,0x89,0x00,0x05,0xff,0xe5,0x8b,0xa4,0x00,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x8b,0xba,0x00,0x05,0xff,0xe5,0x8c,0x85, + 0x00,0x10,0x08,0x05,0xff,0xe5,0x8c,0x86,0x00,0x05,0xff,0xe5,0x8c,0x97,0x00,0xd1, + 0x10,0x10,0x08,0x05,0xff,0xe5,0x8d,0x89,0x00,0x05,0xff,0xe5,0x8d,0x91,0x00,0x10, + 0x08,0x05,0xff,0xe5,0x8d,0x9a,0x00,0x05,0xff,0xe5,0x8d,0xb3,0x00,0xd3,0x39,0xd2, + 0x18,0x91,0x10,0x10,0x08,0x05,0xff,0xe5,0x8d,0xbd,0x00,0x05,0xff,0xe5,0x8d,0xbf, + 0x00,0x05,0xff,0xe5,0x8d,0xbf,0x00,0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa0,0xa8, + 0xac,0x00,0x05,0xff,0xe7,0x81,0xb0,0x00,0x10,0x08,0x05,0xff,0xe5,0x8f,0x8a,0x00, + 0x05,0xff,0xe5,0x8f,0x9f,0x00,0xd2,0x21,0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa0, + 0xad,0xa3,0x00,0x05,0xff,0xe5,0x8f,0xab,0x00,0x10,0x08,0x05,0xff,0xe5,0x8f,0xb1, + 0x00,0x05,0xff,0xe5,0x90,0x86,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x92,0x9e, + 0x00,0x05,0xff,0xe5,0x90,0xb8,0x00,0x10,0x08,0x05,0xff,0xe5,0x91,0x88,0x00,0x05, + 0xff,0xe5,0x91,0xa8,0x00,0xcf,0x86,0xe5,0x02,0x01,0xd4,0x80,0xd3,0x40,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x92,0xa2,0x00,0x05,0xff,0xe5,0x93,0xb6,0x00, + 0x10,0x08,0x05,0xff,0xe5,0x94,0x90,0x00,0x05,0xff,0xe5,0x95,0x93,0x00,0xd1,0x10, + 0x10,0x08,0x05,0xff,0xe5,0x95,0xa3,0x00,0x05,0xff,0xe5,0x96,0x84,0x00,0x10,0x08, + 0x05,0xff,0xe5,0x96,0x84,0x00,0x05,0xff,0xe5,0x96,0x99,0x00,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x05,0xff,0xe5,0x96,0xab,0x00,0x05,0xff,0xe5,0x96,0xb3,0x00,0x10,0x08, + 0x05,0xff,0xe5,0x97,0x82,0x00,0x05,0xff,0xe5,0x9c,0x96,0x00,0xd1,0x10,0x10,0x08, + 0x05,0xff,0xe5,0x98,0x86,0x00,0x05,0xff,0xe5,0x9c,0x97,0x00,0x10,0x08,0x05,0xff, + 0xe5,0x99,0x91,0x00,0x05,0xff,0xe5,0x99,0xb4,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x05,0xff,0xe5,0x88,0x87,0x00,0x05,0xff,0xe5,0xa3,0xae,0x00,0x10,0x08, + 0x05,0xff,0xe5,0x9f,0x8e,0x00,0x05,0xff,0xe5,0x9f,0xb4,0x00,0xd1,0x10,0x10,0x08, + 0x05,0xff,0xe5,0xa0,0x8d,0x00,0x05,0xff,0xe5,0x9e,0x8b,0x00,0x10,0x08,0x05,0xff, + 0xe5,0xa0,0xb2,0x00,0x05,0xff,0xe5,0xa0,0xb1,0x00,0xd2,0x21,0xd1,0x11,0x10,0x08, + 0x05,0xff,0xe5,0xa2,0xac,0x00,0x05,0xff,0xf0,0xa1,0x93,0xa4,0x00,0x10,0x08,0x05, + 0xff,0xe5,0xa3,0xb2,0x00,0x05,0xff,0xe5,0xa3,0xb7,0x00,0xd1,0x10,0x10,0x08,0x05, + 0xff,0xe5,0xa4,0x86,0x00,0x05,0xff,0xe5,0xa4,0x9a,0x00,0x10,0x08,0x05,0xff,0xe5, + 0xa4,0xa2,0x00,0x05,0xff,0xe5,0xa5,0xa2,0x00,0xd4,0x7b,0xd3,0x42,0xd2,0x22,0xd1, + 0x12,0x10,0x09,0x05,0xff,0xf0,0xa1,0x9a,0xa8,0x00,0x05,0xff,0xf0,0xa1,0x9b,0xaa, + 0x00,0x10,0x08,0x05,0xff,0xe5,0xa7,0xac,0x00,0x05,0xff,0xe5,0xa8,0x9b,0x00,0xd1, + 0x10,0x10,0x08,0x05,0xff,0xe5,0xa8,0xa7,0x00,0x05,0xff,0xe5,0xa7,0x98,0x00,0x10, + 0x08,0x05,0xff,0xe5,0xa9,0xa6,0x00,0x05,0xff,0xe3,0x9b,0xae,0x00,0xd2,0x18,0x91, + 0x10,0x10,0x08,0x05,0xff,0xe3,0x9b,0xbc,0x00,0x05,0xff,0xe5,0xac,0x88,0x00,0x05, + 0xff,0xe5,0xac,0xbe,0x00,0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa1,0xa7,0x88,0x00, + 0x05,0xff,0xe5,0xaf,0x83,0x00,0x10,0x08,0x05,0xff,0xe5,0xaf,0x98,0x00,0x05,0xff, + 0xe5,0xaf,0xa7,0x00,0xd3,0x41,0xd2,0x21,0xd1,0x11,0x10,0x08,0x05,0xff,0xe5,0xaf, + 0xb3,0x00,0x05,0xff,0xf0,0xa1,0xac,0x98,0x00,0x10,0x08,0x05,0xff,0xe5,0xaf,0xbf, + 0x00,0x05,0xff,0xe5,0xb0,0x86,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0xbd,0x93, + 0x00,0x05,0xff,0xe5,0xb0,0xa2,0x00,0x10,0x08,0x05,0xff,0xe3,0x9e,0x81,0x00,0x05, + 0xff,0xe5,0xb1,0xa0,0x00,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0xb1,0xae, + 0x00,0x05,0xff,0xe5,0xb3,0x80,0x00,0x10,0x08,0x05,0xff,0xe5,0xb2,0x8d,0x00,0x05, + 0xff,0xf0,0xa1,0xb7,0xa4,0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe5,0xb5,0x83,0x00, + 0x05,0xff,0xf0,0xa1,0xb7,0xa6,0x00,0x10,0x08,0x05,0xff,0xe5,0xb5,0xae,0x00,0x05, + 0xff,0xe5,0xb5,0xab,0x00,0xe0,0x04,0x02,0xcf,0x86,0xd5,0xfe,0xd4,0x82,0xd3,0x40, + 0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0xb5,0xbc,0x00,0x05,0xff,0xe5,0xb7, + 0xa1,0x00,0x10,0x08,0x05,0xff,0xe5,0xb7,0xa2,0x00,0x05,0xff,0xe3,0xa0,0xaf,0x00, + 0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0xb7,0xbd,0x00,0x05,0xff,0xe5,0xb8,0xa8,0x00, + 0x10,0x08,0x05,0xff,0xe5,0xb8,0xbd,0x00,0x05,0xff,0xe5,0xb9,0xa9,0x00,0xd2,0x21, + 0xd1,0x11,0x10,0x08,0x05,0xff,0xe3,0xa1,0xa2,0x00,0x05,0xff,0xf0,0xa2,0x86,0x83, + 0x00,0x10,0x08,0x05,0xff,0xe3,0xa1,0xbc,0x00,0x05,0xff,0xe5,0xba,0xb0,0x00,0xd1, + 0x10,0x10,0x08,0x05,0xff,0xe5,0xba,0xb3,0x00,0x05,0xff,0xe5,0xba,0xb6,0x00,0x10, + 0x08,0x05,0xff,0xe5,0xbb,0x8a,0x00,0x05,0xff,0xf0,0xaa,0x8e,0x92,0x00,0xd3,0x3b, + 0xd2,0x22,0xd1,0x11,0x10,0x08,0x05,0xff,0xe5,0xbb,0xbe,0x00,0x05,0xff,0xf0,0xa2, + 0x8c,0xb1,0x00,0x10,0x09,0x05,0xff,0xf0,0xa2,0x8c,0xb1,0x00,0x05,0xff,0xe8,0x88, + 0x81,0x00,0x51,0x08,0x05,0xff,0xe5,0xbc,0xa2,0x00,0x10,0x08,0x05,0xff,0xe3,0xa3, + 0x87,0x00,0x05,0xff,0xf0,0xa3,0x8a,0xb8,0x00,0xd2,0x21,0xd1,0x11,0x10,0x09,0x05, + 0xff,0xf0,0xa6,0x87,0x9a,0x00,0x05,0xff,0xe5,0xbd,0xa2,0x00,0x10,0x08,0x05,0xff, + 0xe5,0xbd,0xab,0x00,0x05,0xff,0xe3,0xa3,0xa3,0x00,0xd1,0x10,0x10,0x08,0x05,0xff, + 0xe5,0xbe,0x9a,0x00,0x05,0xff,0xe5,0xbf,0x8d,0x00,0x10,0x08,0x05,0xff,0xe5,0xbf, + 0x97,0x00,0x05,0xff,0xe5,0xbf,0xb9,0x00,0xd4,0x81,0xd3,0x41,0xd2,0x20,0xd1,0x10, + 0x10,0x08,0x05,0xff,0xe6,0x82,0x81,0x00,0x05,0xff,0xe3,0xa4,0xba,0x00,0x10,0x08, + 0x05,0xff,0xe3,0xa4,0x9c,0x00,0x05,0xff,0xe6,0x82,0x94,0x00,0xd1,0x11,0x10,0x09, + 0x05,0xff,0xf0,0xa2,0x9b,0x94,0x00,0x05,0xff,0xe6,0x83,0x87,0x00,0x10,0x08,0x05, + 0xff,0xe6,0x85,0x88,0x00,0x05,0xff,0xe6,0x85,0x8c,0x00,0xd2,0x20,0xd1,0x10,0x10, + 0x08,0x05,0xff,0xe6,0x85,0x8e,0x00,0x05,0xff,0xe6,0x85,0x8c,0x00,0x10,0x08,0x05, + 0xff,0xe6,0x85,0xba,0x00,0x05,0xff,0xe6,0x86,0x8e,0x00,0xd1,0x10,0x10,0x08,0x05, + 0xff,0xe6,0x86,0xb2,0x00,0x05,0xff,0xe6,0x86,0xa4,0x00,0x10,0x08,0x05,0xff,0xe6, + 0x86,0xaf,0x00,0x05,0xff,0xe6,0x87,0x9e,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10, + 0x08,0x05,0xff,0xe6,0x87,0xb2,0x00,0x05,0xff,0xe6,0x87,0xb6,0x00,0x10,0x08,0x05, + 0xff,0xe6,0x88,0x90,0x00,0x05,0xff,0xe6,0x88,0x9b,0x00,0xd1,0x10,0x10,0x08,0x05, + 0xff,0xe6,0x89,0x9d,0x00,0x05,0xff,0xe6,0x8a,0xb1,0x00,0x10,0x08,0x05,0xff,0xe6, + 0x8b,0x94,0x00,0x05,0xff,0xe6,0x8d,0x90,0x00,0xd2,0x21,0xd1,0x11,0x10,0x09,0x05, + 0xff,0xf0,0xa2,0xac,0x8c,0x00,0x05,0xff,0xe6,0x8c,0xbd,0x00,0x10,0x08,0x05,0xff, + 0xe6,0x8b,0xbc,0x00,0x05,0xff,0xe6,0x8d,0xa8,0x00,0xd1,0x10,0x10,0x08,0x05,0xff, + 0xe6,0x8e,0x83,0x00,0x05,0xff,0xe6,0x8f,0xa4,0x00,0x10,0x09,0x05,0xff,0xf0,0xa2, + 0xaf,0xb1,0x00,0x05,0xff,0xe6,0x90,0xa2,0x00,0xcf,0x86,0xe5,0x03,0x01,0xd4,0x81, + 0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x8f,0x85,0x00,0x05,0xff, + 0xe6,0x8e,0xa9,0x00,0x10,0x08,0x05,0xff,0xe3,0xa8,0xae,0x00,0x05,0xff,0xe6,0x91, + 0xa9,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x91,0xbe,0x00,0x05,0xff,0xe6,0x92, + 0x9d,0x00,0x10,0x08,0x05,0xff,0xe6,0x91,0xb7,0x00,0x05,0xff,0xe3,0xa9,0xac,0x00, + 0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x95,0x8f,0x00,0x05,0xff,0xe6,0x95, + 0xac,0x00,0x10,0x09,0x05,0xff,0xf0,0xa3,0x80,0x8a,0x00,0x05,0xff,0xe6,0x97,0xa3, + 0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x9b,0xb8,0x00,0x05,0xff,0xe6,0x99,0x89, + 0x00,0x10,0x08,0x05,0xff,0xe3,0xac,0x99,0x00,0x05,0xff,0xe6,0x9a,0x91,0x00,0xd3, + 0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe3,0xac,0x88,0x00,0x05,0xff,0xe3, + 0xab,0xa4,0x00,0x10,0x08,0x05,0xff,0xe5,0x86,0x92,0x00,0x05,0xff,0xe5,0x86,0x95, + 0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x9c,0x80,0x00,0x05,0xff,0xe6,0x9a,0x9c, + 0x00,0x10,0x08,0x05,0xff,0xe8,0x82,0xad,0x00,0x05,0xff,0xe4,0x8f,0x99,0x00,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x9c,0x97,0x00,0x05,0xff,0xe6,0x9c,0x9b, + 0x00,0x10,0x08,0x05,0xff,0xe6,0x9c,0xa1,0x00,0x05,0xff,0xe6,0x9d,0x9e,0x00,0xd1, + 0x11,0x10,0x08,0x05,0xff,0xe6,0x9d,0x93,0x00,0x05,0xff,0xf0,0xa3,0x8f,0x83,0x00, + 0x10,0x08,0x05,0xff,0xe3,0xad,0x89,0x00,0x05,0xff,0xe6,0x9f,0xba,0x00,0xd4,0x82, + 0xd3,0x41,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x9e,0x85,0x00,0x05,0xff, + 0xe6,0xa1,0x92,0x00,0x10,0x08,0x05,0xff,0xe6,0xa2,0x85,0x00,0x05,0xff,0xf0,0xa3, + 0x91,0xad,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xa2,0x8e,0x00,0x05,0xff,0xe6, + 0xa0,0x9f,0x00,0x10,0x08,0x05,0xff,0xe6,0xa4,0x94,0x00,0x05,0xff,0xe3,0xae,0x9d, + 0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xa5,0x82,0x00,0x05,0xff,0xe6, + 0xa6,0xa3,0x00,0x10,0x08,0x05,0xff,0xe6,0xa7,0xaa,0x00,0x05,0xff,0xe6,0xaa,0xa8, + 0x00,0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa3,0x9a,0xa3,0x00,0x05,0xff,0xe6,0xab, + 0x9b,0x00,0x10,0x08,0x05,0xff,0xe3,0xb0,0x98,0x00,0x05,0xff,0xe6,0xac,0xa1,0x00, + 0xd3,0x42,0xd2,0x21,0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa3,0xa2,0xa7,0x00,0x05, + 0xff,0xe6,0xad,0x94,0x00,0x10,0x08,0x05,0xff,0xe3,0xb1,0x8e,0x00,0x05,0xff,0xe6, + 0xad,0xb2,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xae,0x9f,0x00,0x05,0xff,0xe6, + 0xae,0xba,0x00,0x10,0x08,0x05,0xff,0xe6,0xae,0xbb,0x00,0x05,0xff,0xf0,0xa3,0xaa, + 0x8d,0x00,0xd2,0x23,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa1,0xb4,0x8b,0x00,0x05, + 0xff,0xf0,0xa3,0xab,0xba,0x00,0x10,0x08,0x05,0xff,0xe6,0xb1,0x8e,0x00,0x05,0xff, + 0xf0,0xa3,0xb2,0xbc,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xb2,0xbf,0x00,0x05, + 0xff,0xe6,0xb3,0x8d,0x00,0x10,0x08,0x05,0xff,0xe6,0xb1,0xa7,0x00,0x05,0xff,0xe6, + 0xb4,0x96,0x00,0xe1,0x1d,0x04,0xe0,0x0c,0x02,0xcf,0x86,0xe5,0x08,0x01,0xd4,0x82, + 0xd3,0x41,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xb4,0xbe,0x00,0x05,0xff, + 0xe6,0xb5,0xb7,0x00,0x10,0x08,0x05,0xff,0xe6,0xb5,0x81,0x00,0x05,0xff,0xe6,0xb5, + 0xa9,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xb5,0xb8,0x00,0x05,0xff,0xe6,0xb6, + 0x85,0x00,0x10,0x09,0x05,0xff,0xf0,0xa3,0xb4,0x9e,0x00,0x05,0xff,0xe6,0xb4,0xb4, + 0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xb8,0xaf,0x00,0x05,0xff,0xe6, + 0xb9,0xae,0x00,0x10,0x08,0x05,0xff,0xe3,0xb4,0xb3,0x00,0x05,0xff,0xe6,0xbb,0x8b, + 0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe6,0xbb,0x87,0x00,0x05,0xff,0xf0,0xa3,0xbb, + 0x91,0x00,0x10,0x08,0x05,0xff,0xe6,0xb7,0xb9,0x00,0x05,0xff,0xe6,0xbd,0xae,0x00, + 0xd3,0x42,0xd2,0x22,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa3,0xbd,0x9e,0x00,0x05, + 0xff,0xf0,0xa3,0xbe,0x8e,0x00,0x10,0x08,0x05,0xff,0xe6,0xbf,0x86,0x00,0x05,0xff, + 0xe7,0x80,0xb9,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0x80,0x9e,0x00,0x05,0xff, + 0xe7,0x80,0x9b,0x00,0x10,0x08,0x05,0xff,0xe3,0xb6,0x96,0x00,0x05,0xff,0xe7,0x81, + 0x8a,0x00,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0x81,0xbd,0x00,0x05,0xff, + 0xe7,0x81,0xb7,0x00,0x10,0x08,0x05,0xff,0xe7,0x82,0xad,0x00,0x05,0xff,0xf0,0xa0, + 0x94,0xa5,0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe7,0x85,0x85,0x00,0x05,0xff,0xf0, + 0xa4,0x89,0xa3,0x00,0x10,0x08,0x05,0xff,0xe7,0x86,0x9c,0x00,0x05,0xff,0xf0,0xa4, + 0x8e,0xab,0x00,0xd4,0x7b,0xd3,0x43,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7, + 0x88,0xa8,0x00,0x05,0xff,0xe7,0x88,0xb5,0x00,0x10,0x08,0x05,0xff,0xe7,0x89,0x90, + 0x00,0x05,0xff,0xf0,0xa4,0x98,0x88,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0x8a, + 0x80,0x00,0x05,0xff,0xe7,0x8a,0x95,0x00,0x10,0x09,0x05,0xff,0xf0,0xa4,0x9c,0xb5, + 0x00,0x05,0xff,0xf0,0xa4,0xa0,0x94,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff, + 0xe7,0x8d,0xba,0x00,0x05,0xff,0xe7,0x8e,0x8b,0x00,0x10,0x08,0x05,0xff,0xe3,0xba, + 0xac,0x00,0x05,0xff,0xe7,0x8e,0xa5,0x00,0x51,0x08,0x05,0xff,0xe3,0xba,0xb8,0x00, + 0x10,0x08,0x05,0xff,0xe7,0x91,0x87,0x00,0x05,0xff,0xe7,0x91,0x9c,0x00,0xd3,0x42, + 0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0x91,0xb1,0x00,0x05,0xff,0xe7,0x92, + 0x85,0x00,0x10,0x08,0x05,0xff,0xe7,0x93,0x8a,0x00,0x05,0xff,0xe3,0xbc,0x9b,0x00, + 0xd1,0x11,0x10,0x08,0x05,0xff,0xe7,0x94,0xa4,0x00,0x05,0xff,0xf0,0xa4,0xb0,0xb6, + 0x00,0x10,0x08,0x05,0xff,0xe7,0x94,0xbe,0x00,0x05,0xff,0xf0,0xa4,0xb2,0x92,0x00, + 0xd2,0x22,0xd1,0x11,0x10,0x08,0x05,0xff,0xe7,0x95,0xb0,0x00,0x05,0xff,0xf0,0xa2, + 0x86,0x9f,0x00,0x10,0x08,0x05,0xff,0xe7,0x98,0x90,0x00,0x05,0xff,0xf0,0xa4,0xbe, + 0xa1,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa4,0xbe,0xb8,0x00,0x05,0xff,0xf0, + 0xa5,0x81,0x84,0x00,0x10,0x08,0x05,0xff,0xe3,0xbf,0xbc,0x00,0x05,0xff,0xe4,0x80, + 0x88,0x00,0xcf,0x86,0xe5,0x04,0x01,0xd4,0x7d,0xd3,0x3c,0xd2,0x23,0xd1,0x11,0x10, + 0x08,0x05,0xff,0xe7,0x9b,0xb4,0x00,0x05,0xff,0xf0,0xa5,0x83,0xb3,0x00,0x10,0x09, + 0x05,0xff,0xf0,0xa5,0x83,0xb2,0x00,0x05,0xff,0xf0,0xa5,0x84,0x99,0x00,0x91,0x11, + 0x10,0x09,0x05,0xff,0xf0,0xa5,0x84,0xb3,0x00,0x05,0xff,0xe7,0x9c,0x9e,0x00,0x05, + 0xff,0xe7,0x9c,0x9f,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0x9d,0x8a, + 0x00,0x05,0xff,0xe4,0x80,0xb9,0x00,0x10,0x08,0x05,0xff,0xe7,0x9e,0x8b,0x00,0x05, + 0xff,0xe4,0x81,0x86,0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe4,0x82,0x96,0x00,0x05, + 0xff,0xf0,0xa5,0x90,0x9d,0x00,0x10,0x08,0x05,0xff,0xe7,0xa1,0x8e,0x00,0x05,0xff, + 0xe7,0xa2,0x8c,0x00,0xd3,0x43,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0xa3, + 0x8c,0x00,0x05,0xff,0xe4,0x83,0xa3,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0x98,0xa6, + 0x00,0x05,0xff,0xe7,0xa5,0x96,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0x9a, + 0x9a,0x00,0x05,0xff,0xf0,0xa5,0x9b,0x85,0x00,0x10,0x08,0x05,0xff,0xe7,0xa6,0x8f, + 0x00,0x05,0xff,0xe7,0xa7,0xab,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe4, + 0x84,0xaf,0x00,0x05,0xff,0xe7,0xa9,0x80,0x00,0x10,0x08,0x05,0xff,0xe7,0xa9,0x8a, + 0x00,0x05,0xff,0xe7,0xa9,0x8f,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0xa5, + 0xbc,0x00,0x05,0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0xaa, + 0xa7,0x00,0x05,0xff,0xe7,0xab,0xae,0x00,0xd4,0x83,0xd3,0x42,0xd2,0x21,0xd1,0x11, + 0x10,0x08,0x05,0xff,0xe4,0x88,0x82,0x00,0x05,0xff,0xf0,0xa5,0xae,0xab,0x00,0x10, + 0x08,0x05,0xff,0xe7,0xaf,0x86,0x00,0x05,0xff,0xe7,0xaf,0x89,0x00,0xd1,0x11,0x10, + 0x08,0x05,0xff,0xe4,0x88,0xa7,0x00,0x05,0xff,0xf0,0xa5,0xb2,0x80,0x00,0x10,0x08, + 0x05,0xff,0xe7,0xb3,0x92,0x00,0x05,0xff,0xe4,0x8a,0xa0,0x00,0xd2,0x21,0xd1,0x10, + 0x10,0x08,0x05,0xff,0xe7,0xb3,0xa8,0x00,0x05,0xff,0xe7,0xb3,0xa3,0x00,0x10,0x08, + 0x05,0xff,0xe7,0xb4,0x80,0x00,0x05,0xff,0xf0,0xa5,0xbe,0x86,0x00,0xd1,0x10,0x10, + 0x08,0x05,0xff,0xe7,0xb5,0xa3,0x00,0x05,0xff,0xe4,0x8c,0x81,0x00,0x10,0x08,0x05, + 0xff,0xe7,0xb7,0x87,0x00,0x05,0xff,0xe7,0xb8,0x82,0x00,0xd3,0x44,0xd2,0x22,0xd1, + 0x10,0x10,0x08,0x05,0xff,0xe7,0xb9,0x85,0x00,0x05,0xff,0xe4,0x8c,0xb4,0x00,0x10, + 0x09,0x05,0xff,0xf0,0xa6,0x88,0xa8,0x00,0x05,0xff,0xf0,0xa6,0x89,0x87,0x00,0xd1, + 0x11,0x10,0x08,0x05,0xff,0xe4,0x8d,0x99,0x00,0x05,0xff,0xf0,0xa6,0x8b,0x99,0x00, + 0x10,0x08,0x05,0xff,0xe7,0xbd,0xba,0x00,0x05,0xff,0xf0,0xa6,0x8c,0xbe,0x00,0xd2, + 0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0xbe,0x95,0x00,0x05,0xff,0xe7,0xbf,0xba, + 0x00,0x10,0x08,0x05,0xff,0xe8,0x80,0x85,0x00,0x05,0xff,0xf0,0xa6,0x93,0x9a,0x00, + 0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa6,0x94,0xa3,0x00,0x05,0xff,0xe8,0x81,0xa0, + 0x00,0x10,0x09,0x05,0xff,0xf0,0xa6,0x96,0xa8,0x00,0x05,0xff,0xe8,0x81,0xb0,0x00, + 0xe0,0x11,0x02,0xcf,0x86,0xe5,0x07,0x01,0xd4,0x85,0xd3,0x42,0xd2,0x21,0xd1,0x11, + 0x10,0x09,0x05,0xff,0xf0,0xa3,0x8d,0x9f,0x00,0x05,0xff,0xe4,0x8f,0x95,0x00,0x10, + 0x08,0x05,0xff,0xe8,0x82,0xb2,0x00,0x05,0xff,0xe8,0x84,0x83,0x00,0xd1,0x10,0x10, + 0x08,0x05,0xff,0xe4,0x90,0x8b,0x00,0x05,0xff,0xe8,0x84,0xbe,0x00,0x10,0x08,0x05, + 0xff,0xe5,0xaa,0xb5,0x00,0x05,0xff,0xf0,0xa6,0x9e,0xa7,0x00,0xd2,0x23,0xd1,0x12, + 0x10,0x09,0x05,0xff,0xf0,0xa6,0x9e,0xb5,0x00,0x05,0xff,0xf0,0xa3,0x8e,0x93,0x00, + 0x10,0x09,0x05,0xff,0xf0,0xa3,0x8e,0x9c,0x00,0x05,0xff,0xe8,0x88,0x81,0x00,0xd1, + 0x10,0x10,0x08,0x05,0xff,0xe8,0x88,0x84,0x00,0x05,0xff,0xe8,0xbe,0x9e,0x00,0x10, + 0x08,0x05,0xff,0xe4,0x91,0xab,0x00,0x05,0xff,0xe8,0x8a,0x91,0x00,0xd3,0x41,0xd2, + 0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x8a,0x8b,0x00,0x05,0xff,0xe8,0x8a,0x9d, + 0x00,0x10,0x08,0x05,0xff,0xe5,0x8a,0xb3,0x00,0x05,0xff,0xe8,0x8a,0xb1,0x00,0xd1, + 0x10,0x10,0x08,0x05,0xff,0xe8,0x8a,0xb3,0x00,0x05,0xff,0xe8,0x8a,0xbd,0x00,0x10, + 0x08,0x05,0xff,0xe8,0x8b,0xa6,0x00,0x05,0xff,0xf0,0xa6,0xac,0xbc,0x00,0xd2,0x20, + 0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x8b,0xa5,0x00,0x05,0xff,0xe8,0x8c,0x9d,0x00, + 0x10,0x08,0x05,0xff,0xe8,0x8d,0xa3,0x00,0x05,0xff,0xe8,0x8e,0xad,0x00,0xd1,0x10, + 0x10,0x08,0x05,0xff,0xe8,0x8c,0xa3,0x00,0x05,0xff,0xe8,0x8e,0xbd,0x00,0x10,0x08, + 0x05,0xff,0xe8,0x8f,0xa7,0x00,0x05,0xff,0xe8,0x91,0x97,0x00,0xd4,0x85,0xd3,0x43, + 0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x8d,0x93,0x00,0x05,0xff,0xe8,0x8f, + 0x8a,0x00,0x10,0x08,0x05,0xff,0xe8,0x8f,0x8c,0x00,0x05,0xff,0xe8,0x8f,0x9c,0x00, + 0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa6,0xb0,0xb6,0x00,0x05,0xff,0xf0,0xa6,0xb5, + 0xab,0x00,0x10,0x09,0x05,0xff,0xf0,0xa6,0xb3,0x95,0x00,0x05,0xff,0xe4,0x94,0xab, + 0x00,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x93,0xb1,0x00,0x05,0xff,0xe8, + 0x93,0xb3,0x00,0x10,0x08,0x05,0xff,0xe8,0x94,0x96,0x00,0x05,0xff,0xf0,0xa7,0x8f, + 0x8a,0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe8,0x95,0xa4,0x00,0x05,0xff,0xf0,0xa6, + 0xbc,0xac,0x00,0x10,0x08,0x05,0xff,0xe4,0x95,0x9d,0x00,0x05,0xff,0xe4,0x95,0xa1, + 0x00,0xd3,0x42,0xd2,0x22,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa6,0xbe,0xb1,0x00, + 0x05,0xff,0xf0,0xa7,0x83,0x92,0x00,0x10,0x08,0x05,0xff,0xe4,0x95,0xab,0x00,0x05, + 0xff,0xe8,0x99,0x90,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x99,0x9c,0x00,0x05, + 0xff,0xe8,0x99,0xa7,0x00,0x10,0x08,0x05,0xff,0xe8,0x99,0xa9,0x00,0x05,0xff,0xe8, + 0x9a,0xa9,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x9a,0x88,0x00,0x05, + 0xff,0xe8,0x9c,0x8e,0x00,0x10,0x08,0x05,0xff,0xe8,0x9b,0xa2,0x00,0x05,0xff,0xe8, + 0x9d,0xb9,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x9c,0xa8,0x00,0x05,0xff,0xe8, + 0x9d,0xab,0x00,0x10,0x08,0x05,0xff,0xe8,0x9e,0x86,0x00,0x05,0xff,0xe4,0x97,0x97, + 0x00,0xcf,0x86,0xe5,0x08,0x01,0xd4,0x83,0xd3,0x41,0xd2,0x20,0xd1,0x10,0x10,0x08, + 0x05,0xff,0xe8,0x9f,0xa1,0x00,0x05,0xff,0xe8,0xa0,0x81,0x00,0x10,0x08,0x05,0xff, + 0xe4,0x97,0xb9,0x00,0x05,0xff,0xe8,0xa1,0xa0,0x00,0xd1,0x11,0x10,0x08,0x05,0xff, + 0xe8,0xa1,0xa3,0x00,0x05,0xff,0xf0,0xa7,0x99,0xa7,0x00,0x10,0x08,0x05,0xff,0xe8, + 0xa3,0x97,0x00,0x05,0xff,0xe8,0xa3,0x9e,0x00,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05, + 0xff,0xe4,0x98,0xb5,0x00,0x05,0xff,0xe8,0xa3,0xba,0x00,0x10,0x08,0x05,0xff,0xe3, + 0x92,0xbb,0x00,0x05,0xff,0xf0,0xa7,0xa2,0xae,0x00,0xd1,0x11,0x10,0x09,0x05,0xff, + 0xf0,0xa7,0xa5,0xa6,0x00,0x05,0xff,0xe4,0x9a,0xbe,0x00,0x10,0x08,0x05,0xff,0xe4, + 0x9b,0x87,0x00,0x05,0xff,0xe8,0xaa,0xa0,0x00,0xd3,0x41,0xd2,0x21,0xd1,0x10,0x10, + 0x08,0x05,0xff,0xe8,0xab,0xad,0x00,0x05,0xff,0xe8,0xae,0x8a,0x00,0x10,0x08,0x05, + 0xff,0xe8,0xb1,0x95,0x00,0x05,0xff,0xf0,0xa7,0xb2,0xa8,0x00,0xd1,0x10,0x10,0x08, + 0x05,0xff,0xe8,0xb2,0xab,0x00,0x05,0xff,0xe8,0xb3,0x81,0x00,0x10,0x08,0x05,0xff, + 0xe8,0xb4,0x9b,0x00,0x05,0xff,0xe8,0xb5,0xb7,0x00,0xd2,0x22,0xd1,0x12,0x10,0x09, + 0x05,0xff,0xf0,0xa7,0xbc,0xaf,0x00,0x05,0xff,0xf0,0xa0,0xa0,0x84,0x00,0x10,0x08, + 0x05,0xff,0xe8,0xb7,0x8b,0x00,0x05,0xff,0xe8,0xb6,0xbc,0x00,0xd1,0x11,0x10,0x08, + 0x05,0xff,0xe8,0xb7,0xb0,0x00,0x05,0xff,0xf0,0xa0,0xa3,0x9e,0x00,0x10,0x08,0x05, + 0xff,0xe8,0xbb,0x94,0x00,0x05,0xff,0xe8,0xbc,0xb8,0x00,0xd4,0x84,0xd3,0x43,0xd2, + 0x22,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa8,0x97,0x92,0x00,0x05,0xff,0xf0,0xa8, + 0x97,0xad,0x00,0x10,0x08,0x05,0xff,0xe9,0x82,0x94,0x00,0x05,0xff,0xe9,0x83,0xb1, + 0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe9,0x84,0x91,0x00,0x05,0xff,0xf0,0xa8,0x9c, + 0xae,0x00,0x10,0x08,0x05,0xff,0xe9,0x84,0x9b,0x00,0x05,0xff,0xe9,0x88,0xb8,0x00, + 0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe9,0x8b,0x97,0x00,0x05,0xff,0xe9,0x8b, + 0x98,0x00,0x10,0x08,0x05,0xff,0xe9,0x89,0xbc,0x00,0x05,0xff,0xe9,0x8f,0xb9,0x00, + 0xd1,0x11,0x10,0x08,0x05,0xff,0xe9,0x90,0x95,0x00,0x05,0xff,0xf0,0xa8,0xaf,0xba, + 0x00,0x10,0x08,0x05,0xff,0xe9,0x96,0x8b,0x00,0x05,0xff,0xe4,0xa6,0x95,0x00,0xd3, + 0x43,0xd2,0x21,0xd1,0x11,0x10,0x08,0x05,0xff,0xe9,0x96,0xb7,0x00,0x05,0xff,0xf0, + 0xa8,0xb5,0xb7,0x00,0x10,0x08,0x05,0xff,0xe4,0xa7,0xa6,0x00,0x05,0xff,0xe9,0x9b, + 0x83,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0xb6,0xb2,0x00,0x05,0xff,0xe9,0x9c, + 0xa3,0x00,0x10,0x09,0x05,0xff,0xf0,0xa9,0x85,0x85,0x00,0x05,0xff,0xf0,0xa9,0x88, + 0x9a,0x00,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe4,0xa9,0xae,0x00,0x05,0xff, + 0xe4,0xa9,0xb6,0x00,0x10,0x08,0x05,0xff,0xe9,0x9f,0xa0,0x00,0x05,0xff,0xf0,0xa9, + 0x90,0x8a,0x00,0x91,0x11,0x10,0x08,0x05,0xff,0xe4,0xaa,0xb2,0x00,0x05,0xff,0xf0, + 0xa9,0x92,0x96,0x00,0x05,0xff,0xe9,0xa0,0x8b,0x00,0xe2,0x10,0x01,0xe1,0x09,0x01, + 0xe0,0x02,0x01,0xcf,0x86,0x95,0xfb,0xd4,0x82,0xd3,0x41,0xd2,0x21,0xd1,0x11,0x10, + 0x08,0x05,0xff,0xe9,0xa0,0xa9,0x00,0x05,0xff,0xf0,0xa9,0x96,0xb6,0x00,0x10,0x08, + 0x05,0xff,0xe9,0xa3,0xa2,0x00,0x05,0xff,0xe4,0xac,0xb3,0x00,0xd1,0x10,0x10,0x08, + 0x05,0xff,0xe9,0xa4,0xa9,0x00,0x05,0xff,0xe9,0xa6,0xa7,0x00,0x10,0x08,0x05,0xff, + 0xe9,0xa7,0x82,0x00,0x05,0xff,0xe9,0xa7,0xbe,0x00,0xd2,0x21,0xd1,0x11,0x10,0x08, + 0x05,0xff,0xe4,0xaf,0x8e,0x00,0x05,0xff,0xf0,0xa9,0xac,0xb0,0x00,0x10,0x08,0x05, + 0xff,0xe9,0xac,0x92,0x00,0x05,0xff,0xe9,0xb1,0x80,0x00,0xd1,0x10,0x10,0x08,0x05, + 0xff,0xe9,0xb3,0xbd,0x00,0x05,0xff,0xe4,0xb3,0x8e,0x00,0x10,0x08,0x05,0xff,0xe4, + 0xb3,0xad,0x00,0x05,0xff,0xe9,0xb5,0xa7,0x00,0xd3,0x44,0xd2,0x23,0xd1,0x11,0x10, + 0x09,0x05,0xff,0xf0,0xaa,0x83,0x8e,0x00,0x05,0xff,0xe4,0xb3,0xb8,0x00,0x10,0x09, + 0x05,0xff,0xf0,0xaa,0x84,0x85,0x00,0x05,0xff,0xf0,0xaa,0x88,0x8e,0x00,0xd1,0x11, + 0x10,0x09,0x05,0xff,0xf0,0xaa,0x8a,0x91,0x00,0x05,0xff,0xe9,0xba,0xbb,0x00,0x10, + 0x08,0x05,0xff,0xe4,0xb5,0x96,0x00,0x05,0xff,0xe9,0xbb,0xb9,0x00,0xd2,0x20,0xd1, + 0x10,0x10,0x08,0x05,0xff,0xe9,0xbb,0xbe,0x00,0x05,0xff,0xe9,0xbc,0x85,0x00,0x10, + 0x08,0x05,0xff,0xe9,0xbc,0x8f,0x00,0x05,0xff,0xe9,0xbc,0x96,0x00,0x91,0x11,0x10, + 0x08,0x05,0xff,0xe9,0xbc,0xbb,0x00,0x05,0xff,0xf0,0xaa,0x98,0x80,0x00,0x00,0x00, + 0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xd3,0x06, + 0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00, + 0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00, + 0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xd3,0x08, + 0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd1,0x08, + 0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86, + 0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,0x06, + 0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06, + 0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x53,0x04, + 0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xcf,0x86,0xd5,0xc0, + 0xd4,0x60,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06, + 0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06, + 0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00, + 0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06, + 0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04, + 0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00, + 0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00, + 0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00, + 0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06, + 0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00, + 0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00, + 0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xd4,0x60, + 0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00, + 0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00, + 0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06, + 0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00, + 0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00, + 0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xd3,0x08, + 0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd1,0x08, + 0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86, + 0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,0x06, + 0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06, + 0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x53,0x04, + 0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xe0,0x83,0x01,0xcf, + 0x86,0xd5,0xc0,0xd4,0x60,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf, + 0x86,0xcf,0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf, + 0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf, + 0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1, + 0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00, + 0x00,0x54,0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00, + 0x00,0x02,0x00,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf, + 0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf, + 0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00, + 0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf, + 0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54, + 0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02, + 0x00,0xd4,0x60,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf, + 0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf, + 0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00, + 0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf, + 0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54, + 0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02, + 0x00,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00, + 0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00, + 0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3, + 0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00, + 0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00, + 0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xcf, + 0x86,0xd5,0xc0,0xd4,0x60,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf, + 0x86,0xcf,0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf, + 0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf, + 0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1, + 0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00, + 0x00,0x54,0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00, + 0x00,0x02,0x00,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf, + 0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf, + 0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00, + 0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf, + 0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54, + 0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02, + 0x00,0xd4,0xd9,0xd3,0x81,0xd2,0x79,0xd1,0x71,0xd0,0x69,0xcf,0x86,0xd5,0x60,0xd4, + 0x59,0xd3,0x52,0xd2,0x33,0xd1,0x2c,0xd0,0x25,0xcf,0x86,0x95,0x1e,0x94,0x19,0x93, + 0x14,0x92,0x0f,0x91,0x0a,0x10,0x05,0x00,0xff,0x00,0x05,0xff,0x00,0x00,0xff,0x00, + 0x00,0xff,0x00,0x00,0xff,0x00,0x00,0xff,0x00,0x05,0xff,0x00,0xcf,0x06,0x05,0xff, + 0x00,0xcf,0x06,0x00,0xff,0x00,0xd1,0x07,0xcf,0x06,0x07,0xff,0x00,0xd0,0x07,0xcf, + 0x06,0x07,0xff,0x00,0xcf,0x86,0x55,0x05,0x07,0xff,0x00,0x14,0x05,0x07,0xff,0x00, + 0x00,0xff,0x00,0xcf,0x06,0x00,0xff,0x00,0xcf,0x06,0x00,0xff,0x00,0xcf,0x06,0x00, + 0xff,0x00,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86, + 0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd1,0x08,0xcf,0x86, + 0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,0xd5,0x06, + 0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,0x00,0x00, + 0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,0x06, + 0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x53,0x04,0x00,0x00, + 0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xcf,0x86,0xcf,0x06,0x02,0x00, + 0x81,0x80,0xcf,0x86,0x85,0x84,0xcf,0x86,0xcf,0x06,0x02,0x00,0x00,0x00,0x00,0x00 +}; diff --git a/lib/ext2fs/utf8n.h b/lib/ext2fs/utf8n.h new file mode 100644 index 0000000..c214f58 --- /dev/null +++ b/lib/ext2fs/utf8n.h @@ -0,0 +1,120 @@ +/* + * Copyright (c) 2014 SGI. + * All rights reserved. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation. + * + * This program is distributed in the hope that it would be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + */ + +/* This code is copied from the linux kernel. We have a userspace + * version here to such that hashes will match that implementation. + */ + +#ifndef UTF8NORM_H +#define UTF8NORM_H + +#include <stdint.h> +#include <unistd.h> +#include <string.h> + +/* Encoding a unicode version number as a single unsigned int. */ +#define UNICODE_MAJ_SHIFT (16) +#define UNICODE_MIN_SHIFT (8) + +#define UNICODE_AGE(MAJ, MIN, REV) \ + (((unsigned int)(MAJ) << UNICODE_MAJ_SHIFT) | \ + ((unsigned int)(MIN) << UNICODE_MIN_SHIFT) | \ + ((unsigned int)(REV))) + +/* Highest unicode version supported by the data tables. */ +extern int utf8version_is_supported(uint8_t maj, uint8_t min, uint8_t rev); +extern int utf8version_latest(void); + +/* + * Look for the correct const struct utf8data for a unicode version. + * Returns NULL if the version requested is too new. + * + * Two normalization forms are supported: nfdi and nfdicf. + * + * nfdi: + * - Apply unicode normalization form NFD. + * - Remove any Default_Ignorable_Code_Point. + * + * nfdicf: + * - Apply unicode normalization form NFD. + * - Remove any Default_Ignorable_Code_Point. + * - Apply a full casefold (C + F). + */ +extern const struct utf8data *utf8nfdi(unsigned int maxage); +extern const struct utf8data *utf8nfdicf(unsigned int maxage); + +/* + * Determine the maximum age of any unicode character in the string. + * Returns 0 if only unassigned code points are present. + * Returns -1 if the input is not valid UTF-8. + */ +extern int utf8agemax(const struct utf8data *data, const char *s); +extern int utf8nagemax(const struct utf8data *data, const char *s, size_t len); + +/* + * Determine the minimum age of any unicode character in the string. + * Returns 0 if any unassigned code points are present. + * Returns -1 if the input is not valid UTF-8. + */ +extern int utf8agemin(const struct utf8data *data, const char *s); +extern int utf8nagemin(const struct utf8data *data, const char *s, size_t len); + +/* + * Determine the length of the normalized from of the string, + * excluding any terminating NULL byte. + * Returns 0 if only ignorable code points are present. + * Returns -1 if the input is not valid UTF-8. + */ +extern ssize_t utf8len(const struct utf8data *data, const char *s); +extern ssize_t utf8nlen(const struct utf8data *data, const char *s, size_t len); + +/* Needed in struct utf8cursor below. */ +#define UTF8HANGULLEAF (12) + +/* + * Cursor structure used by the normalizer. + */ +struct utf8cursor { + const struct utf8data *data; + const char *s; + const char *p; + const char *ss; + const char *sp; + unsigned int len; + unsigned int slen; + short int ccc; + short int nccc; + unsigned char hangul[UTF8HANGULLEAF]; +}; + +/* + * Initialize a utf8cursor to normalize a string. + * Returns 0 on success. + * Returns -1 on failure. + */ +extern int utf8cursor(struct utf8cursor *u8c, const struct utf8data *data, + const char *s); +extern int utf8ncursor(struct utf8cursor *u8c, const struct utf8data *data, + const char *s, size_t len); + +/* + * Get the next byte in the normalization. + * Returns a value > 0 && < 256 on success. + * Returns 0 when the end of the normalization is reached. + * Returns -1 if the string being normalized is not valid UTF-8. + */ +extern int utf8byte(struct utf8cursor *u8c); + +#endif /* UTF8NORM_H */ diff --git a/lib/ext2fs/valid_blk.c b/lib/ext2fs/valid_blk.c new file mode 100644 index 0000000..db5d90a --- /dev/null +++ b/lib/ext2fs/valid_blk.c @@ -0,0 +1,68 @@ +/* + * valid_blk.c --- does the inode have valid blocks? + * + * Copyright 1997 by Theodore Ts'o + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <string.h> +#include <time.h> + +#include "ext2_fs.h" +#include "ext2fs.h" + +/* + * This function returns 1 if the inode's block entries actually + * contain block entries. + */ +int ext2fs_inode_has_valid_blocks2(ext2_filsys fs, struct ext2_inode *inode) +{ + /* + * Only directories, regular files, and some symbolic links + * have valid block entries. + */ + if (!LINUX_S_ISDIR(inode->i_mode) && !LINUX_S_ISREG(inode->i_mode) && + !LINUX_S_ISLNK(inode->i_mode)) + return 0; + + /* + * If the symbolic link is a "fast symlink", then the symlink + * target is stored in the block entries. + */ + if (LINUX_S_ISLNK (inode->i_mode)) { + if (ext2fs_file_acl_block(fs, inode) == 0) { + /* With no EA block, we can rely on i_blocks */ + if (inode->i_blocks == 0) + return 0; + } else { + /* With an EA block, life gets more tricky */ + if (inode->i_size >= EXT2_N_BLOCKS*4) + return 1; /* definitely using i_block[] */ + if (inode->i_size > 4 && inode->i_block[1] == 0) + return 1; /* definitely using i_block[] */ + return 0; /* Probably a fast symlink */ + } + } + + /* + * If this inode has inline data, it shouldn't have valid block + * entries. + */ + if (inode->i_flags & EXT4_INLINE_DATA_FL) + return 0; + return 1; +} + +int ext2fs_inode_has_valid_blocks(struct ext2_inode *inode) +{ + return ext2fs_inode_has_valid_blocks2(NULL, inode); +} diff --git a/lib/ext2fs/version.c b/lib/ext2fs/version.c new file mode 100644 index 0000000..f8c8acf --- /dev/null +++ b/lib/ext2fs/version.c @@ -0,0 +1,57 @@ +/* + * version.c --- Return the version of the ext2 library + * + * Copyright (C) 1997 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#include <string.h> +#include <stdio.h> +#include <ctype.h> + +#include "ext2_fs.h" +#include "ext2fs.h" + +#include "../../version.h" + +static const char *lib_version = E2FSPROGS_VERSION; +static const char *lib_date = E2FSPROGS_DATE; + +int ext2fs_parse_version_string(const char *ver_string) +{ + const char *cp; + int version = 0, dot_count = 0; + + for (cp = ver_string; *cp; cp++) { + if (*cp == '.') { + if (dot_count++) + break; + else + continue; + } + if (!isdigit(*cp)) + break; + version = (version * 10) + (*cp - '0'); + } + return version; +} + + +int ext2fs_get_library_version(const char **ver_string, + const char **date_string) +{ + if (ver_string) + *ver_string = lib_version; + if (date_string) + *date_string = lib_date; + + return ext2fs_parse_version_string(lib_version); +} diff --git a/lib/ext2fs/windows_io.c b/lib/ext2fs/windows_io.c new file mode 100644 index 0000000..83aea68 --- /dev/null +++ b/lib/ext2fs/windows_io.c @@ -0,0 +1,1031 @@ +/* + * windows_io.c --- This is the Windows implementation of the I/O manager. + * + * Implements a one-block write-through cache. + * + * Copyright (C) 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, + * 2002 by Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include <windows.h> +#include <winioctl.h> +#include <io.h> + +#if !defined(__FreeBSD__) && !defined(__NetBSD__) && !defined(__OpenBSD__) +#define _XOPEN_SOURCE 600 +#define _DARWIN_C_SOURCE +#define _FILE_OFFSET_BITS 64 +#ifndef _LARGEFILE_SOURCE +#define _LARGEFILE_SOURCE +#endif +#ifndef _LARGEFILE64_SOURCE +#define _LARGEFILE64_SOURCE +#endif +#ifndef _GNU_SOURCE +#define _GNU_SOURCE +#endif +#endif + +#include "config.h" +#include <stdio.h> +#include <string.h> +#if HAVE_UNISTD_H +#include <unistd.h> +#endif +#if HAVE_ERRNO_H +#include <errno.h> +#endif +#include <fcntl.h> +#include <time.h> +#if HAVE_SYS_TYPES_H +#include <sys/types.h> +#endif +#define PR_GET_DUMPABLE 3 +#if HAVE_SYS_STAT_H +#include <sys/stat.h> +#endif +#include <fcntl.h> + +#undef ALIGN_DEBUG + +//#define DEBUG +#ifdef DEBUG +#define TRACE(...) {\ + char __log[256];\ + snprintf(__log, sizeof(__log), __VA_ARGS__);\ + __log[sizeof(__log)-1] = 0;\ + OutputDebugString(__log);\ + } +#else +#define TRACE(...) do { } while (0); +#endif + +#include "ext2_fs.h" +#include "ext2fs.h" +#include "ext2fsP.h" + +/* + * For checking structure magic numbers... + */ + +#define EXT2_CHECK_MAGIC(struct, code) \ + if ((struct)->magic != (code)) return (code) +#define EXT2_CHECK_MAGIC_RETURN(struct, code, ret) \ + if ((struct)->magic != (code)) return (ret) + +#define EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL 0x10ed + +struct windows_cache { + char *buf; + unsigned long long block; + int access_time; + unsigned dirty:1; + unsigned in_use:1; +}; + +#define CACHE_SIZE 8 +#define WRITE_DIRECT_SIZE 4 /* Must be smaller than CACHE_SIZE */ +#define READ_DIRECT_SIZE 4 /* Should be smaller than CACHE_SIZE */ + +struct windows_private_data { + int magic; + char name[MAX_PATH]; + HANDLE handle; + char dos_device[MAX_PATH]; + char cf_device[MAX_PATH]; + int dev; + int flags; + int align; + int access_time; + ext2_loff_t offset; + struct windows_cache cache[CACHE_SIZE]; + void *bounce; + struct struct_io_stats io_stats; +}; + +#define IS_ALIGNED(n, align) ((((uintptr_t) n) & \ + ((uintptr_t) ((align)-1))) == 0) + +static int fake_dos_name_for_device(struct windows_private_data *data) +{ + if (strncmp(data->name, "\\\\", 2) == 0) { + data->dos_device[0] = 0; + strcpy(data->cf_device, data->name); + return 0; + } + + _snprintf(data->dos_device, MAX_PATH, "fakedevice%lu", GetCurrentProcessId()); + + if (!DefineDosDevice(DDD_RAW_TARGET_PATH, data->dos_device, data->name)) + return 1; + + _snprintf(data->cf_device, MAX_PATH, "\\\\.\\%s", data->dos_device); + TRACE("e2fsprogs::fake_dos_name_for_device::DefineDosDevice(\"%s\")", data->dos_device); + + return 0; +} + +static void remove_fake_dos_name(struct windows_private_data *data) +{ + if (*data->dos_device) { + TRACE("e2fsprogs::remove_fake_dos_name::DefineDosDevice(\"%s\")", data->dos_device); + DefineDosDevice(DDD_RAW_TARGET_PATH | DDD_EXACT_MATCH_ON_REMOVE | DDD_REMOVE_DEFINITION, data->dos_device, data->name); + } +} + +static errcode_t windows_get_stats(io_channel channel, io_stats *stats) +{ + errcode_t retval = 0; + + struct windows_private_data *data; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct windows_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL); + + if (stats) + *stats = &data->io_stats; + + return retval; +} + +/* + * Here are the raw I/O functions + */ +static errcode_t raw_read_blk(io_channel channel, + struct windows_private_data *data, + unsigned long long block, + int count, void *bufv) +{ + errcode_t retval; + ssize_t size; + ext2_loff_t location; + DWORD actual = 0; + unsigned char *buf = bufv; + ssize_t really_read = 0; + + size = (count < 0) ? -count : count * channel->block_size; + data->io_stats.bytes_read += size; + location = ((ext2_loff_t) block * channel->block_size) + data->offset; + + if (data->flags & IO_FLAG_FORCE_BOUNCE) { + if (SetFilePointer(data->handle, location, NULL, FILE_BEGIN) == INVALID_SET_FILE_POINTER) { + retval = GetLastError(); + goto error_out; + } + goto bounce_read; + } + + if (SetFilePointer(data->handle, location, NULL, FILE_BEGIN) == INVALID_SET_FILE_POINTER) { + retval = GetLastError(); + goto error_out; + } + if ((channel->align == 0) || (IS_ALIGNED(buf, channel->align) && IS_ALIGNED(size, channel->align))) { + if (!ReadFile(data->handle, buf, size, &actual, NULL)) { + retval = GetLastError(); + goto error_out; + } + if (actual != size) { + short_read: + if (actual < 0) { + retval = GetLastError(); + actual = 0; + } else + retval = EXT2_ET_SHORT_READ; + goto error_out; + } + return 0; + } + + /* + * The buffer or size which we're trying to read isn't aligned + * to the O_DIRECT rules, so we need to do this the hard way... + */ +bounce_read: + while (size > 0) { + if (!ReadFile(data->handle, data->bounce, channel->block_size, &actual, NULL)) { + retval = GetLastError(); + goto error_out; + } + if (actual != channel->block_size) { + actual = really_read; + buf -= really_read; + size += really_read; + goto short_read; + } + actual = size; + if (size > channel->block_size) + actual = channel->block_size; + memcpy(buf, data->bounce, actual); + really_read += actual; + size -= actual; + buf += actual; + } + return 0; + +error_out: + if (actual >= 0 && actual < size) + memset((char *) buf+actual, 0, size-actual); + if (channel->read_error) + retval = (channel->read_error)(channel, block, count, buf, + size, actual, retval); + return retval; +} + +static errcode_t raw_write_blk(io_channel channel, + struct windows_private_data *data, + unsigned long long block, + int count, const void *bufv) +{ + ssize_t size; + ext2_loff_t location; + DWORD actual = 0; + errcode_t retval; + const unsigned char *buf = bufv; + + if (count == 1) + size = channel->block_size; + else { + if (count < 0) + size = -count; + else + size = count * channel->block_size; + } + data->io_stats.bytes_written += size; + + location = ((ext2_loff_t) block * channel->block_size) + data->offset; + + if (data->flags & IO_FLAG_FORCE_BOUNCE) { + if (SetFilePointer(data->handle, location, NULL, FILE_BEGIN) == INVALID_SET_FILE_POINTER) { + retval = GetLastError(); + goto error_out; + } + goto bounce_write; + } + + if (SetFilePointer(data->handle, location, NULL, FILE_BEGIN) == INVALID_SET_FILE_POINTER) { + retval = GetLastError(); + goto error_out; + } + + SetLastError(0); + + if ((channel->align == 0) || (IS_ALIGNED(buf, channel->align) && IS_ALIGNED(size, channel->align))) { + if (!WriteFile(data->handle, buf, size, &actual, NULL)) { + retval = GetLastError(); + goto error_out; + } + + if (actual != size) { + short_write: + retval = EXT2_ET_SHORT_WRITE; + goto error_out; + } + return 0; + } + + /* + * The buffer or size which we're trying to write isn't aligned + * to the O_DIRECT rules, so we need to do this the hard way... + */ +bounce_write: + while (size > 0) { + if (size < channel->block_size) { + if (!ReadFile(data->handle, data->bounce, channel->block_size, &actual, NULL)) { + retval = GetLastError(); + goto error_out; + } + if (actual != channel->block_size) { + if (actual < 0) { + retval = GetLastError(); + goto error_out; + } + memset((char *) data->bounce + actual, 0, + channel->block_size - actual); + } + } + actual = size; + if (size > channel->block_size) + actual = channel->block_size; + memcpy(data->bounce, buf, actual); + if (SetFilePointer(data->handle, location, NULL, FILE_BEGIN) == INVALID_SET_FILE_POINTER) { + retval = GetLastError(); + goto error_out; + } + if (!WriteFile(data->handle, data->bounce, channel->block_size, &actual, NULL)) { + retval = GetLastError(); + goto error_out; + } + + if (actual != channel->block_size) + goto short_write; + size -= actual; + buf += actual; + location += actual; + } + return 0; + +error_out: + if (channel->write_error) + retval = (channel->write_error)(channel, block, count, buf, + size, actual, retval); + return retval; +} + + +/* + * Here we implement the cache functions + */ + +/* Allocate the cache buffers */ +static errcode_t alloc_cache(io_channel channel, + struct windows_private_data *data) +{ + errcode_t retval; + struct windows_cache *cache; + int i; + + data->access_time = 0; + for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) { + cache->block = 0; + cache->access_time = 0; + cache->dirty = 0; + cache->in_use = 0; + if (cache->buf) + ext2fs_free_mem(&cache->buf); + retval = io_channel_alloc_buf(channel, 0, &cache->buf); + if (retval) + return retval; + } + if (channel->align || data->flags & IO_FLAG_FORCE_BOUNCE) { + if (data->bounce) + ext2fs_free_mem(&data->bounce); + retval = io_channel_alloc_buf(channel, 0, &data->bounce); + } + return retval; +} + +/* Free the cache buffers */ +static void free_cache(struct windows_private_data *data) +{ + struct windows_cache *cache; + int i; + + data->access_time = 0; + for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) { + cache->block = 0; + cache->access_time = 0; + cache->dirty = 0; + cache->in_use = 0; + if (cache->buf) + ext2fs_free_mem(&cache->buf); + } + if (data->bounce) + ext2fs_free_mem(&data->bounce); +} + +#ifndef NO_IO_CACHE +/* + * Try to find a block in the cache. If the block is not found, and + * eldest is a non-zero pointer, then fill in eldest with the cache + * entry to that should be reused. + */ +static struct windows_cache *find_cached_block(struct windows_private_data *data, + unsigned long long block, + struct windows_cache **eldest) +{ + struct windows_cache *cache, *unused_cache, *oldest_cache; + int i; + + unused_cache = oldest_cache = 0; + for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) { + if (!cache->in_use) { + if (!unused_cache) + unused_cache = cache; + continue; + } + if (cache->block == block) { + cache->access_time = ++data->access_time; + return cache; + } + if (!oldest_cache || + (cache->access_time < oldest_cache->access_time)) + oldest_cache = cache; + } + if (eldest) + *eldest = (unused_cache) ? unused_cache : oldest_cache; + return 0; +} + +/* + * Reuse a particular cache entry for another block. + */ +static void reuse_cache(io_channel channel, struct windows_private_data *data, + struct windows_cache *cache, unsigned long long block) +{ + if (cache->dirty && cache->in_use) + raw_write_blk(channel, data, cache->block, 1, cache->buf); + + cache->in_use = 1; + cache->dirty = 0; + cache->block = block; + cache->access_time = ++data->access_time; +} + +/* + * Flush all of the blocks in the cache + */ +static errcode_t flush_cached_blocks(io_channel channel, + struct windows_private_data *data, + int invalidate) +{ + struct windows_cache *cache; + errcode_t retval, retval2; + int i; + + retval2 = 0; + for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) { + if (!cache->in_use) + continue; + + if (invalidate) + cache->in_use = 0; + + if (!cache->dirty) + continue; + + retval = raw_write_blk(channel, data, + cache->block, 1, cache->buf); + if (retval) + retval2 = retval; + else + cache->dirty = 0; + } + return retval2; +} +#endif /* NO_IO_CACHE */ + +static errcode_t windows_open_channel(struct windows_private_data *data, + int flags, io_channel *channel, + io_manager io_mgr) +{ + io_channel io = NULL; + errcode_t retval; + ext2fs_struct_stat st; + + retval = ext2fs_get_mem(sizeof(struct struct_io_channel), &io); + if (retval) + goto cleanup; + memset(io, 0, sizeof(struct struct_io_channel)); + io->magic = EXT2_ET_MAGIC_IO_CHANNEL; + + io->manager = io_mgr; + retval = ext2fs_get_mem(strlen(data->name)+1, &io->name); + if (retval) + goto cleanup; + + strcpy(io->name, data->name); + io->private_data = data; + io->block_size = 1024; + io->read_error = 0; + io->write_error = 0; + io->refcount = 1; + +#if defined(O_DIRECT) + if (flags & IO_FLAG_DIRECT_IO) + io->align = ext2fs_get_dio_alignment(data->dev); +#endif + + /* + * If the device is really a block device, then set the + * appropriate flag, otherwise we can set DISCARD_ZEROES flag + * because we are going to use punch hole instead of discard + * and if it succeed, subsequent read from sparse area returns + * zero. + */ + if (ext2fs_fstat(data->dev, &st) == 0) { + if (ext2fsP_is_disk_device(st.st_mode)) + io->flags |= CHANNEL_FLAGS_BLOCK_DEVICE; + else + io->flags |= CHANNEL_FLAGS_DISCARD_ZEROES; + } + + if ((retval = alloc_cache(io, data))) + goto cleanup; + +#ifdef BLKROGET + if (flags & IO_FLAG_RW) { + int error; + int readonly = 0; + + /* Is the block device actually writable? */ + error = ioctl(data->dev, BLKROGET, &readonly); + if (!error && readonly) { + retval = EPERM; + goto cleanup; + } + } +#endif + + *channel = io; + return 0; + +cleanup: + if (data) { + if (data->dev >= 0) + close(data->dev); + free_cache(data); + ext2fs_free_mem(&data); + } + if (io) { + if (io->name) { + ext2fs_free_mem(&io->name); + } + ext2fs_free_mem(&io); + } + return retval; +} + +static DWORD windows_open_device(struct windows_private_data *data, int open_flags) +{ + DWORD ret = 0; + + if (*data->name != '\\') + strcpy(data->cf_device, data->name); + else if (fake_dos_name_for_device(data)) + return -1; + + DWORD desired_access = GENERIC_READ | ((open_flags & O_RDWR) ? GENERIC_WRITE : 0); + DWORD share_mode = (open_flags & O_EXCL) ? 0 : FILE_SHARE_READ | ((open_flags & O_RDWR) ? FILE_SHARE_WRITE : 0); + DWORD flags_and_attributes = +#if defined(O_DIRECT) + (open_flags & O_DIRECT) ? (FILE_FLAG_NO_BUFFERING | FILE_FLAG_WRITE_THROUGH) : FILE_ATTRIBUTE_NORMAL; +#else + FILE_FLAG_NO_BUFFERING | FILE_FLAG_WRITE_THROUGH; +#endif + + data->handle = CreateFile(data->cf_device, desired_access, share_mode, NULL, OPEN_EXISTING, + flags_and_attributes, NULL); + + if (data->handle == INVALID_HANDLE_VALUE) { + ret = GetLastError(); + goto invalid_handle; + } + + TRACE("e2fsprogs::windows_open_device::CreateFile(\"%s\") = %p", data->cf_device, data->handle); + + data->dev = _open_osfhandle((intptr_t)data->handle, 0); + if (data->dev < 0) { + ret = GetLastError() ? GetLastError() : 9999; + goto osfhandle_error; + } + + TRACE("e2fsprogs::windows_open_device::_open_osfhandle(%p) = %d", data->handle, data->dev); + + return 0; + +osfhandle_error: + TRACE("e2fsprogs::windows_open_device::CloseHandle(%p)", data->handle); + CloseHandle(data->handle); +invalid_handle: + remove_fake_dos_name(data); + TRACE("e2fsprogs::windows_open_device() = %lu, errno = %d", ret, errno); + return ret; +} + +static struct windows_private_data *init_private_data(const char *name, int flags) +{ + struct windows_private_data *data = NULL; + + if (ext2fs_get_mem(sizeof(struct windows_private_data), &data)) + return NULL; + + memset(data, 0, sizeof(struct windows_private_data)); + strncpy(data->name, name, sizeof(data->name) - 1); + data->magic = EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL; + data->io_stats.num_fields = 2; + data->flags = flags; + data->handle = INVALID_HANDLE_VALUE; + + return data; +} + +static errcode_t windows_open(const char *name, int flags, io_channel *channel) +{ + int open_flags; + struct windows_private_data *data; + + if (name == 0) + return EXT2_ET_BAD_DEVICE_NAME; + + data = init_private_data(name, flags); + if (!data) + return EXT2_ET_NO_MEMORY; + + open_flags = (flags & IO_FLAG_RW) ? O_RDWR : O_RDONLY; + if (flags & IO_FLAG_EXCLUSIVE) + open_flags |= O_EXCL; +#if defined(O_DIRECT) + if (flags & IO_FLAG_DIRECT_IO) + open_flags |= O_DIRECT; +#endif + + if (windows_open_device(data, open_flags)) { + ext2fs_free_mem(&data); + return EXT2_ET_BAD_DEVICE_NAME; + } + + return windows_open_channel(data, flags, channel, windows_io_manager); +} + +static errcode_t windows_close(io_channel channel) +{ + struct windows_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct windows_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL); + + if (--channel->refcount > 0) + return 0; + +#ifndef NO_IO_CACHE + retval = flush_cached_blocks(channel, data, 0); +#endif + + remove_fake_dos_name(data); + + if (_close(data->dev) != 0) + retval = errno; + + TRACE("e2fsprogs::windows_close::_close(%d)", data->dev); + + free_cache(data); + + ext2fs_free_mem(&channel->private_data); + if (channel->name) + ext2fs_free_mem(&channel->name); + ext2fs_free_mem(&channel); + return retval; +} + +static errcode_t windows_set_blksize(io_channel channel, int blksize) +{ + struct windows_private_data *data; + errcode_t retval; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct windows_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL); + + if (channel->block_size != blksize) { +#ifndef NO_IO_CACHE + if ((retval = flush_cached_blocks(channel, data, 0))) + return retval; +#endif + + channel->block_size = blksize; + free_cache(data); + if ((retval = alloc_cache(channel, data))) + return retval; + } + return 0; +} + +static errcode_t windows_read_blk64(io_channel channel, unsigned long long block, int count, void *buf) +{ + struct windows_private_data *data; + struct windows_cache *cache, *reuse[READ_DIRECT_SIZE]; + errcode_t retval; + char *cp; + int i, j; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct windows_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL); + +#ifdef NO_IO_CACHE + return raw_read_blk(channel, data, block, count, buf); +#else + /* + * If we're doing an odd-sized read or a very large read, + * flush out the cache and then do a direct read. + */ + if (count < 0 || count > WRITE_DIRECT_SIZE) { + if ((retval = flush_cached_blocks(channel, data, 0))) + return retval; + return raw_read_blk(channel, data, block, count, buf); + } + + cp = buf; + while (count > 0) { + /* If it's in the cache, use it! */ + if ((cache = find_cached_block(data, block, &reuse[0]))) { +#ifdef DEBUG + printf("Using cached block %lu\n", block); +#endif + memcpy(cp, cache->buf, channel->block_size); + count--; + block++; + cp += channel->block_size; + continue; + } + if (count == 1) { + /* + * Special case where we read directly into the + * cache buffer; important in the O_DIRECT case + */ + cache = reuse[0]; + reuse_cache(channel, data, cache, block); + if ((retval = raw_read_blk(channel, data, block, 1, + cache->buf))) { + cache->in_use = 0; + return retval; + } + memcpy(cp, cache->buf, channel->block_size); + return 0; + } + + /* + * Find the number of uncached blocks so we can do a + * single read request + */ + for (i=1; i < count; i++) + if (find_cached_block(data, block+i, &reuse[i])) + break; +#ifdef DEBUG + printf("Reading %d blocks starting at %lu\n", i, block); +#endif + if ((retval = raw_read_blk(channel, data, block, i, cp))) + return retval; + + /* Save the results in the cache */ + for (j=0; j < i; j++) { + count--; + cache = reuse[j]; + reuse_cache(channel, data, cache, block++); + memcpy(cache->buf, cp, channel->block_size); + cp += channel->block_size; + } + } + return 0; +#endif /* NO_IO_CACHE */ +} + +static errcode_t windows_read_blk(io_channel channel, unsigned long block, + int count, void *buf) +{ + return windows_read_blk64(channel, block, count, buf); +} + +static errcode_t windows_write_blk64(io_channel channel, + unsigned long long block, + int count, const void *buf) +{ + struct windows_private_data *data; + struct windows_cache *cache, *reuse; + errcode_t retval = 0; + const char *cp; + int writethrough; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct windows_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL); + +#ifdef NO_IO_CACHE + return raw_write_blk(channel, data, block, count, buf); +#else + /* + * If we're doing an odd-sized write or a very large write, + * flush out the cache completely and then do a direct write. + */ + if (count < 0 || count > WRITE_DIRECT_SIZE) { + if ((retval = flush_cached_blocks(channel, data, 1))) + return retval; + return raw_write_blk(channel, data, block, count, buf); + } + + /* + * For a moderate-sized multi-block write, first force a write + * if we're in write-through cache mode, and then fill the + * cache with the blocks. + */ + writethrough = channel->flags & CHANNEL_FLAGS_WRITETHROUGH; + if (writethrough) + retval = raw_write_blk(channel, data, block, count, buf); + + cp = buf; + while (count > 0) { + cache = find_cached_block(data, block, &reuse); + if (!cache) { + cache = reuse; + reuse_cache(channel, data, cache, block); + } + if (cache->buf != cp) + memcpy(cache->buf, cp, channel->block_size); + cache->dirty = !writethrough; + count--; + block++; + cp += channel->block_size; + } + return retval; +#endif /* NO_IO_CACHE */ +} + +static errcode_t windows_cache_readahead(io_channel channel, + unsigned long long block, + unsigned long long count) +{ + return EXT2_ET_OP_NOT_SUPPORTED; +} + +static errcode_t windows_write_blk(io_channel channel, unsigned long block, + int count, const void *buf) +{ + return windows_write_blk64(channel, block, count, buf); +} + +static errcode_t windows_write_byte(io_channel channel, unsigned long offset, + int size, const void *buf) +{ + return EXT2_ET_UNIMPLEMENTED; +} + +HANDLE windows_get_handle(io_channel channel) +{ + struct windows_private_data *data; + + EXT2_CHECK_MAGIC_RETURN(channel, EXT2_ET_MAGIC_IO_CHANNEL, INVALID_HANDLE_VALUE); + data = (struct windows_private_data *) channel->private_data; + EXT2_CHECK_MAGIC_RETURN(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL, INVALID_HANDLE_VALUE); + + return data->handle; +} + +/* + * Flush data buffers to disk. + */ +static errcode_t windows_flush(io_channel channel) +{ + struct windows_private_data *data; + errcode_t retval = 0; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct windows_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL); + +#ifndef NO_IO_CACHE + retval = flush_cached_blocks(channel, data, 0); +#endif + + return retval; +} + +static errcode_t windows_set_option(io_channel channel, const char *option, + const char *arg) +{ + struct windows_private_data *data; + unsigned long long tmp; + char *end; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct windows_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL); + + if (!strcmp(option, "offset")) { + if (!arg) + return EXT2_ET_INVALID_ARGUMENT; + + tmp = strtoull(arg, &end, 0); + if (*end) + return EXT2_ET_INVALID_ARGUMENT; + data->offset = tmp; + if (data->offset < 0) + return EXT2_ET_INVALID_ARGUMENT; + return 0; + } + return EXT2_ET_INVALID_ARGUMENT; +} + +static errcode_t windows_discard(io_channel channel, unsigned long long block, + unsigned long long count) +{ + TRACE("e2fsprogs::windows_discard::EXT2_ET_UNIMPLEMENTED"); + return EXT2_ET_UNIMPLEMENTED; +} + +/* parameters might not be used if OS doesn't support zeroout */ +#if __GNUC_PREREQ (4, 6) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wunused-parameter" +#endif +static errcode_t windows_zeroout(io_channel channel, unsigned long long block, + unsigned long long count) +{ + struct windows_private_data *data; + int ret; + + EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL); + data = (struct windows_private_data *) channel->private_data; + EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL); + + if (channel->flags & CHANNEL_FLAGS_BLOCK_DEVICE) { + /* Not implemented until the BLKZEROOUT mess is fixed */ + goto unimplemented; + } else { + /* Regular file, try to use truncate/punch/zero. */ + struct stat statbuf; + + if (count == 0) + return 0; + /* + * If we're trying to zero a range past the end of the file, + * extend the file size, then truncate everything. + */ + ret = fstat(data->dev, &statbuf); + if (ret) + goto err; + if ((unsigned long long) statbuf.st_size < + (block + count) * channel->block_size + data->offset) { + ret = ftruncate(data->dev, + (block + count) * channel->block_size + data->offset); + if (ret) + goto err; + } + goto unimplemented; + } +err: + if (ret < 0) { + if (errno == EOPNOTSUPP) + goto unimplemented; + return errno; + } + return 0; +unimplemented: + return EXT2_ET_UNIMPLEMENTED; +} + +int ext2fs_open_file(const char *pathname, int flags, mode_t mode) +{ + flags |= O_BINARY; + + if (mode) +#if defined(HAVE_OPEN64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED) + return open64(pathname, flags, mode); + else + return open64(pathname, flags); +#else + return open(pathname, flags, mode); + else + return open(pathname, flags); +#endif +} + +int ext2fs_stat(const char *path, ext2fs_struct_stat *buf) +{ +#if defined(HAVE_FSTAT64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED) + return stat64(path, buf); +#else + return stat(path, buf); +#endif +} + +int ext2fs_fstat(int fd, ext2fs_struct_stat *buf) +{ +#if defined(HAVE_FSTAT64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED) + return fstat64(fd, buf); +#else + return fstat(fd, buf); +#endif +} + +#if __GNUC_PREREQ (4, 6) +#pragma GCC diagnostic pop +#endif + +static struct struct_io_manager struct_windows_manager = { + .magic = EXT2_ET_MAGIC_IO_MANAGER, + .name = "Windows I/O Manager", + .open = windows_open, + .close = windows_close, + .set_blksize = windows_set_blksize, + .read_blk = windows_read_blk, + .write_blk = windows_write_blk, + .flush = windows_flush, + .write_byte = windows_write_byte, + .set_option = windows_set_option, + .get_stats = windows_get_stats, + .read_blk64 = windows_read_blk64, + .write_blk64 = windows_write_blk64, + .discard = windows_discard, + .cache_readahead = windows_cache_readahead, + .zeroout = windows_zeroout, +}; + +io_manager windows_io_manager = &struct_windows_manager; diff --git a/lib/ext2fs/write_bb_file.c b/lib/ext2fs/write_bb_file.c new file mode 100644 index 0000000..5834340 --- /dev/null +++ b/lib/ext2fs/write_bb_file.c @@ -0,0 +1,35 @@ +/* + * write_bb_file.c --- write a list of bad blocks to a FILE * + * + * Copyright (C) 1994, 1995 Theodore Ts'o. + * + * %Begin-Header% + * This file may be redistributed under the terms of the GNU Library + * General Public License, version 2. + * %End-Header% + */ + +#include "config.h" +#include <stdio.h> + +#include "ext2_fs.h" +#include "ext2fs.h" + +errcode_t ext2fs_write_bb_FILE(ext2_badblocks_list bb_list, + unsigned int flags EXT2FS_ATTR((unused)), + FILE *f) +{ + badblocks_iterate bb_iter; + blk_t blk; + errcode_t retval; + + retval = ext2fs_badblocks_list_iterate_begin(bb_list, &bb_iter); + if (retval) + return retval; + + while (ext2fs_badblocks_list_iterate(bb_iter, &blk)) { + fprintf(f, "%u\n", blk); + } + ext2fs_badblocks_list_iterate_end(bb_iter); + return 0; +} |