From 6bf0a5cb5034a7e684dcc3500e841785237ce2dd Mon Sep 17 00:00:00 2001 From: Daniel Baumann Date: Sun, 7 Apr 2024 19:32:43 +0200 Subject: Adding upstream version 1:115.7.0. Signed-off-by: Daniel Baumann --- .../webkit/PerformanceTests/MotionMark/about.html | 52 + .../PerformanceTests/MotionMark/developer.html | 175 + .../webkit/PerformanceTests/MotionMark/index.html | 67 + .../resources/debug-runner/animometer.css | 774 ++ .../resources/debug-runner/animometer.js | 703 ++ .../MotionMark/resources/debug-runner/graph.js | 615 ++ .../MotionMark/resources/debug-runner/tests.js | 345 + .../MotionMark/resources/extensions.js | 670 ++ .../MotionMark/resources/runner/animometer.css | 520 ++ .../MotionMark/resources/runner/animometer.js | 626 ++ .../resources/runner/benchmark-runner.js | 179 + .../MotionMark/resources/runner/crystal.svg | 92 + .../MotionMark/resources/runner/lines.svg | 26 + .../MotionMark/resources/runner/logo.svg | 26 + .../MotionMark/resources/runner/tests.js | 81 + .../MotionMark/resources/statistics.js | 397 + .../MotionMark/resources/strings.js | 51 + .../MotionMark/tests/3d/resources/webgl.js | 184 + .../MotionMark/tests/3d/webgl.html | 64 + .../bouncing-particles/bouncing-canvas-images.html | 26 + .../bouncing-particles/bouncing-canvas-shapes.html | 18 + .../bouncing-particles/bouncing-css-images.html | 22 + .../bouncing-particles/bouncing-css-shapes.html | 33 + .../bouncing-particles/bouncing-svg-images.html | 18 + .../bouncing-particles/bouncing-svg-shapes.html | 18 + .../bouncing-particles/bouncing-tagged-images.html | 22 + .../resources/bouncing-canvas-images.js | 47 + .../resources/bouncing-canvas-particles.js | 88 + .../resources/bouncing-canvas-shapes.js | 87 + .../resources/bouncing-css-images.js | 61 + .../resources/bouncing-css-shapes.js | 86 + .../resources/bouncing-particles.js | 123 + .../resources/bouncing-svg-images.js | 43 + .../resources/bouncing-svg-particles.js | 67 + .../resources/bouncing-svg-shapes.js | 101 + .../resources/bouncing-tagged-images.js | 106 + .../tests/bouncing-particles/resources/image1.jpg | Bin 0 -> 64004 bytes .../tests/bouncing-particles/resources/image2.jpg | Bin 0 -> 71981 bytes .../tests/bouncing-particles/resources/image3.jpg | Bin 0 -> 71319 bytes .../tests/bouncing-particles/resources/image4.jpg | Bin 0 -> 96373 bytes .../tests/bouncing-particles/resources/image5.jpg | Bin 0 -> 135674 bytes .../tests/dom/compositing-transforms.html | 24 + .../MotionMark/tests/dom/focus.html | 51 + .../MotionMark/tests/dom/leaves.html | 26 + .../MotionMark/tests/dom/particles.html | 24 + .../tests/dom/resources/compositing-transforms.js | 66 + .../tests/dom/resources/dom-particles.js | 73 + .../MotionMark/tests/dom/resources/focus.js | 166 + .../MotionMark/tests/dom/resources/leaves.js | 48 + .../MotionMark/tests/master/canvas-stage.html | 17 + .../MotionMark/tests/master/focus.html | 29 + .../MotionMark/tests/master/image-data.html | 28 + .../MotionMark/tests/master/leaves.html | 25 + .../MotionMark/tests/master/multiply.html | 53 + .../tests/master/resources/canvas-stage.js | 52 + .../tests/master/resources/canvas-tests.js | 311 + .../MotionMark/tests/master/resources/compass.svg | 7 + .../tests/master/resources/compass100.png | Bin 0 -> 3048 bytes .../MotionMark/tests/master/resources/console.svg | 6 + .../tests/master/resources/console100.png | Bin 0 -> 944 bytes .../tests/master/resources/contribute.svg | 6 + .../tests/master/resources/contribute100.png | Bin 0 -> 3599 bytes .../MotionMark/tests/master/resources/debugger.svg | 5 + .../tests/master/resources/debugger100.png | Bin 0 -> 2473 bytes .../MotionMark/tests/master/resources/focus.js | 129 + .../tests/master/resources/image-data.js | 181 + .../tests/master/resources/inspector.svg | 6 + .../tests/master/resources/inspector100.png | Bin 0 -> 1477 bytes .../MotionMark/tests/master/resources/layout.svg | 6 + .../tests/master/resources/layout100.png | Bin 0 -> 423 bytes .../MotionMark/tests/master/resources/leaves.js | 135 + .../MotionMark/tests/master/resources/multiply.js | 119 + .../MotionMark/tests/master/resources/particles.js | 112 + .../tests/master/resources/performance.svg | 6 + .../tests/master/resources/performance100.png | Bin 0 -> 2546 bytes .../MotionMark/tests/master/resources/script.svg | 5 + .../tests/master/resources/script100.png | Bin 0 -> 3192 bytes .../tests/master/resources/shortcuts.svg | 5 + .../tests/master/resources/shortcuts100.png | Bin 0 -> 2763 bytes .../tests/master/resources/standards.svg | 6 + .../tests/master/resources/standards100.png | Bin 0 -> 4363 bytes .../MotionMark/tests/master/resources/storage.svg | 5 + .../tests/master/resources/storage100.png | Bin 0 -> 3167 bytes .../MotionMark/tests/master/resources/styles.svg | 5 + .../tests/master/resources/styles100.png | Bin 0 -> 3875 bytes .../tests/master/resources/svg-particles.js | 111 + .../MotionMark/tests/master/resources/text.js | 116 + .../MotionMark/tests/master/resources/timeline.svg | 6 + .../tests/master/resources/timeline100.png | Bin 0 -> 2039 bytes .../MotionMark/tests/master/svg-particles.html | 38 + .../MotionMark/tests/master/text.html | 82 + .../MotionMark/tests/resources/main.js | 934 ++ .../MotionMark/tests/resources/math.js | 268 + .../MotionMark/tests/resources/stage.css | 27 + .../MotionMark/tests/resources/star.svg | 8 + .../MotionMark/tests/resources/yin-yang.png | Bin 0 -> 4082 bytes .../MotionMark/tests/resources/yin-yang.svg | 17 + .../tests/simple/resources/simple-canvas-paths.js | 453 + .../tests/simple/resources/simple-canvas.js | 35 + .../tests/simple/resources/tiled-canvas-image.js | 119 + .../tests/simple/simple-canvas-paths.html | 18 + .../tests/simple/tiled-canvas-image.html | 16 + .../tests/template/resources/template-canvas.js | 89 + .../tests/template/resources/template-css.js | 46 + .../tests/template/resources/template-svg.js | 46 + .../MotionMark/tests/template/template-canvas.html | 16 + .../MotionMark/tests/template/template-css.html | 16 + .../MotionMark/tests/template/template-svg.html | 16 + .../webkit/PerformanceTests/MotionMark/version | 2 + .../Speedometer/InteractiveRunner.html | 173 + .../PerformanceTests/Speedometer/README_MOZILLA | 13 + .../webkit/PerformanceTests/Speedometer/index.html | 107 + .../Speedometer/resources/benchmark-report.js | 105 + .../Speedometer/resources/benchmark-runner.js | 305 + .../resources/flightjs-example-app/LICENSE.md | 19 + .../resources/flightjs-example-app/README.md | 5 + .../flightjs-example-app/app/boot/page.js | 47 + .../app/component_data/compose_box.js | 93 + .../app/component_data/mail_items.js | 68 + .../app/component_data/move_to.js | 52 + .../app/component_ui/compose_box.js | 113 + .../app/component_ui/folders.js | 34 + .../app/component_ui/mail_controls.js | 67 + .../app/component_ui/mail_items.js | 61 + .../app/component_ui/move_to_selector.js | 79 + .../app/component_ui/with_select.js | 64 + .../flightjs-example-app/app/css/custom.css | 102 + .../resources/flightjs-example-app/app/data.js | 110 + .../flightjs-example-app/app/templates.js | 62 + .../bootstrap/css/bootstrap-responsive.css | 1092 +++ .../bootstrap/css/bootstrap-responsive.min.css | 9 + .../components/bootstrap/css/bootstrap.css | 2470 +++++ .../components/bootstrap/css/bootstrap.min.css | 9 + .../bootstrap/img/glyphicons-halflings-white.png | Bin 0 -> 8777 bytes .../bootstrap/img/glyphicons-halflings.png | Bin 0 -> 12799 bytes .../components/bootstrap/js/bootstrap.js | 2159 +++++ .../components/bootstrap/js/bootstrap.min.js | 6 + .../components/es5-shim/.gitignore | 2 + .../components/es5-shim/CHANGES | 93 + .../components/es5-shim/CONTRIBUTORS.md | 25 + .../components/es5-shim/LICENSE | 19 + .../components/es5-shim/README.md | 161 + .../components/es5-shim/component.json | 54 + .../components/es5-shim/es5-sham.js | 326 + .../components/es5-shim/es5-sham.min.js | 6 + .../components/es5-shim/es5-shim.js | 778 ++ .../components/es5-shim/es5-shim.min.js | 13 + .../components/es5-shim/package.json | 31 + .../components/es5-shim/tests/helpers/h-kill.js | 59 + .../es5-shim/tests/helpers/h-matchers.js | 34 + .../components/es5-shim/tests/helpers/h.js | 3 + .../components/es5-shim/tests/index.html | 62 + .../components/es5-shim/tests/lib/jasmine-html.js | 190 + .../components/es5-shim/tests/lib/jasmine.css | 166 + .../components/es5-shim/tests/lib/jasmine.js | 2477 +++++ .../es5-shim/tests/lib/jasmine_favicon.png | Bin 0 -> 905 bytes .../components/es5-shim/tests/lib/json2.js | 478 + .../components/es5-shim/tests/spec/s-array.js | 1070 +++ .../components/es5-shim/tests/spec/s-date.js | 40 + .../components/es5-shim/tests/spec/s-function.js | 137 + .../components/es5-shim/tests/spec/s-object.js | 84 + .../components/es5-shim/tests/spec/s-string.js | 11 + .../components/flight/.travis.yml | 7 + .../components/flight/lib/advice.js | 69 + .../components/flight/lib/component.js | 308 + .../components/flight/lib/compose.js | 86 + .../components/flight/lib/index.js | 30 + .../components/flight/lib/logger.js | 93 + .../components/flight/lib/registry.js | 220 + .../components/flight/lib/utils.js | 236 + .../components/flight/tools/debug/debug.js | 157 + .../components/jasmine-flight/LICENSE.md | 19 + .../components/jasmine-flight/README.md | 145 + .../components/jasmine-flight/bower.json | 30 + .../jasmine-flight/lib/jasmine-flight.js | 444 + .../jasmine-jquery/lib/jasmine-jquery.js | 659 ++ .../components/jquery/component.json | 13 + .../components/jquery/composer.json | 23 + .../components/jquery/jquery.js | 9472 ++++++++++++++++++++ .../components/jquery/jquery.min.js | 2 + .../components/mustache/mustache.js | 635 ++ .../components/requirejs/require.js | 1993 ++++ .../resources/flightjs-example-app/index.html | 60 + .../resources/flightjs-example-app/karma.conf.js | 58 + .../resources/flightjs-example-app/package.json | 11 + .../resources/flightjs-example-app/requireMain.js | 24 + .../Speedometer/resources/gauge.png | Bin 0 -> 15101 bytes .../Speedometer/resources/gauge@2x.png | Bin 0 -> 33403 bytes .../Speedometer/resources/logo.png | Bin 0 -> 9037 bytes .../Speedometer/resources/logo@2x.png | Bin 0 -> 19309 bytes .../Speedometer/resources/main.css | 286 + .../PerformanceTests/Speedometer/resources/main.js | 246 + .../Speedometer/resources/tests.js | 580 ++ .../StyleBench/InteractiveRunner.html | 174 + .../PerformanceTests/StyleBench/README_MOZILLA | 13 + .../webkit/PerformanceTests/StyleBench/index.html | 79 + .../PerformanceTests/StyleBench/mozilla.patch | 86 + .../StyleBench/resources/benchmark-report.js | 103 + .../StyleBench/resources/benchmark-runner.js | 299 + .../StyleBench/resources/gauge.png | 0 .../StyleBench/resources/gauge@2x.png | 0 .../PerformanceTests/StyleBench/resources/main.css | 286 + .../PerformanceTests/StyleBench/resources/main.js | 246 + .../StyleBench/resources/style-bench.html | 32 + .../StyleBench/resources/style-bench.js | 511 ++ .../PerformanceTests/StyleBench/resources/tests.js | 40 + .../SunSpider/sunspider-0.9.1/3d-cube.js | 337 + .../SunSpider/sunspider-0.9.1/3d-morph.js | 54 + .../SunSpider/sunspider-0.9.1/3d-raytrace.js | 441 + .../sunspider-0.9.1/access-binary-trees.js | 50 + .../SunSpider/sunspider-0.9.1/access-fannkuch.js | 66 + .../SunSpider/sunspider-0.9.1/access-nbody.js | 169 + .../SunSpider/sunspider-0.9.1/access-nsieve.js | 38 + .../sunspider-0.9.1/bitops-3bit-bits-in-byte.js | 32 + .../sunspider-0.9.1/bitops-bits-in-byte.js | 21 + .../sunspider-0.9.1/bitops-bitwise-and.js | 28 + .../sunspider-0.9.1/bitops-nsieve-bits.js | 32 + .../sunspider-0.9.1/controlflow-recursive.js | 25 + .../SunSpider/sunspider-0.9.1/crypto-aes.js | 422 + .../SunSpider/sunspider-0.9.1/crypto-md5.js | 286 + .../SunSpider/sunspider-0.9.1/crypto-sha1.js | 224 + .../SunSpider/sunspider-0.9.1/date-format-tofte.js | 299 + .../SunSpider/sunspider-0.9.1/date-format-xparb.js | 417 + .../SunSpider/sunspider-0.9.1/math-cordic.js | 95 + .../SunSpider/sunspider-0.9.1/math-partial-sums.js | 33 + .../sunspider-0.9.1/math-spectral-norm.js | 51 + .../SunSpider/sunspider-0.9.1/regexp-dna.js | 1712 ++++ .../SunSpider/sunspider-0.9.1/string-base64.js | 135 + .../SunSpider/sunspider-0.9.1/string-fasta.js | 85 + .../SunSpider/sunspider-0.9.1/string-tagcloud.js | 265 + .../sunspider-0.9.1/string-unpack-code.js | 68 + .../sunspider-0.9.1/string-validate-input.js | 89 + .../sunspider-0.9.1/sunspider-standalone-driver.js | 71 + .../SunSpider/sunspider-1.0.1/json2.js | 481 + .../sunspider-1.0.1/sunspider-1.0.1/driver.html | 132 + .../sunspider-1.0.1/sunspider-1.0.1/results.html | 108 + .../sunspider-1.0.1/sunspider-test-contents.js | 7295 +++++++++++++++ .../sunspider-1.0.1/sunspider-test-prefix.js | 2 + .../sunspider-1.0.1/sunspider-analyze-results.js | 280 + .../sunspider-1.0.1/sunspider-compare-results.js | 396 + .../SunSpider/sunspider-1.0.1/sunspider.css | 31 + .../PerformanceTests/resources/statistics.js | 145 + .../webkit/PerformanceTests/six-speed/VERSION | 1 + .../webkit/PerformanceTests/six-speed/test.js | 85 + .../six-speed/tests/arrow-args.es5 | 16 + .../six-speed/tests/arrow-args.es6 | 14 + .../six-speed/tests/arrow-declare.es5 | 14 + .../six-speed/tests/arrow-declare.es6 | 13 + .../PerformanceTests/six-speed/tests/arrow.es5 | 15 + .../PerformanceTests/six-speed/tests/arrow.es6 | 14 + .../six-speed/tests/bindings-compound.es5 | 11 + .../six-speed/tests/bindings-compound.es6 | 14 + .../PerformanceTests/six-speed/tests/bindings.es5 | 8 + .../PerformanceTests/six-speed/tests/bindings.es6 | 10 + .../PerformanceTests/six-speed/tests/classes.es5 | 11 + .../PerformanceTests/six-speed/tests/classes.es6 | 13 + .../PerformanceTests/six-speed/tests/defaults.es5 | 14 + .../PerformanceTests/six-speed/tests/defaults.es6 | 13 + .../six-speed/tests/destructuring-simple.es5 | 14 + .../six-speed/tests/destructuring-simple.es6 | 14 + .../six-speed/tests/destructuring.es5 | 15 + .../six-speed/tests/destructuring.es6 | 13 + .../six-speed/tests/for-of-array.es5 | 13 + .../six-speed/tests/for-of-array.es6 | 13 + .../six-speed/tests/for-of-object.es5 | 13 + .../six-speed/tests/for-of-object.es6 | 24 + .../PerformanceTests/six-speed/tests/generator.es5 | 26 + .../PerformanceTests/six-speed/tests/generator.es6 | 14 + .../six-speed/tests/map-set-lookup.es5 | 21 + .../six-speed/tests/map-set-lookup.es6 | 18 + .../six-speed/tests/map-set-object.es5 | 21 + .../six-speed/tests/map-set-object.es6 | 18 + .../PerformanceTests/six-speed/tests/map-set.es5 | 16 + .../PerformanceTests/six-speed/tests/map-set.es6 | 17 + .../six-speed/tests/map-string.es5 | 12 + .../six-speed/tests/map-string.es6 | 12 + .../six-speed/tests/object-assign.es5 | 28 + .../six-speed/tests/object-assign.es6 | 22 + .../six-speed/tests/object-literal-ext.es5 | 15 + .../six-speed/tests/object-literal-ext.es6 | 14 + .../PerformanceTests/six-speed/tests/regex-u.es5 | 6 + .../PerformanceTests/six-speed/tests/regex-u.es6 | 6 + .../PerformanceTests/six-speed/tests/rest.es5 | 13 + .../PerformanceTests/six-speed/tests/rest.es6 | 13 + .../six-speed/tests/spread-generator.es5 | 27 + .../six-speed/tests/spread-generator.es6 | 11 + .../six-speed/tests/spread-literal.es5 | 8 + .../six-speed/tests/spread-literal.es6 | 5 + .../PerformanceTests/six-speed/tests/spread.es5 | 6 + .../PerformanceTests/six-speed/tests/spread.es6 | 6 + .../PerformanceTests/six-speed/tests/super.es5 | 23 + .../PerformanceTests/six-speed/tests/super.es6 | 25 + .../six-speed/tests/template_string.es5 | 7 + .../six-speed/tests/template_string.es6 | 7 + .../six-speed/tests/template_string_tag.es5 | 11 + .../six-speed/tests/template_string_tag.es6 | 11 + .../webkit/PerformanceTests/wasm-godot/godot.js | 4 + .../webkit/PerformanceTests/wasm-godot/godot.pck | Bin 0 -> 188116 bytes .../webkit/PerformanceTests/wasm-godot/index.html | 397 + .../webkit/PerformanceTests/webaudio/README.md | 13 + .../webkit/PerformanceTests/webaudio/benchmarks.js | 377 + .../webkit/PerformanceTests/webaudio/index.html | 47 + .../PerformanceTests/webaudio/think-mono-38000.wav | Bin 0 -> 160164 bytes .../PerformanceTests/webaudio/think-mono-44100.wav | Bin 0 -> 185868 bytes .../PerformanceTests/webaudio/think-mono-48000.wav | Bin 0 -> 202302 bytes .../PerformanceTests/webaudio/think-mono.wav | Bin 0 -> 185868 bytes .../webaudio/think-stereo-38000.wav | Bin 0 -> 320284 bytes .../webaudio/think-stereo-44100.wav | Bin 0 -> 371692 bytes .../webaudio/think-stereo-48000.wav | Bin 0 -> 404560 bytes .../webkit/PerformanceTests/webaudio/update.sh | 14 + .../PerformanceTests/webaudio/webaudio-bench.js | 240 + 311 files changed, 58678 insertions(+) create mode 100644 third_party/webkit/PerformanceTests/MotionMark/about.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/developer.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/index.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/animometer.css create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/animometer.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/graph.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/tests.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/extensions.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/runner/animometer.css create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/runner/animometer.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/runner/benchmark-runner.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/runner/crystal.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/runner/lines.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/runner/logo.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/runner/tests.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/statistics.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/resources/strings.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/3d/resources/webgl.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/3d/webgl.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-canvas-images.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-canvas-shapes.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-css-images.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-css-shapes.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-svg-images.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-svg-shapes.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-tagged-images.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-images.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-particles.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-shapes.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-css-images.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-css-shapes.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-particles.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-images.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-particles.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-shapes.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-tagged-images.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image1.jpg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image2.jpg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image3.jpg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image4.jpg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image5.jpg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/dom/compositing-transforms.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/dom/focus.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/dom/leaves.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/dom/particles.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/compositing-transforms.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/dom-particles.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/focus.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/leaves.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/canvas-stage.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/focus.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/image-data.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/leaves.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/multiply.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/canvas-stage.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/canvas-tests.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/compass.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/compass100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/console.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/console100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/contribute.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/contribute100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/debugger.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/debugger100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/focus.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/image-data.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/inspector.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/inspector100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/layout.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/layout100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/leaves.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/multiply.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/particles.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/performance.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/performance100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/script.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/script100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/shortcuts.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/shortcuts100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/standards.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/standards100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/storage.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/storage100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/styles.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/styles100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/svg-particles.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/text.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/timeline.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/timeline100.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/svg-particles.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/master/text.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/resources/main.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/resources/math.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/resources/stage.css create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/resources/star.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/resources/yin-yang.png create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/resources/yin-yang.svg create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/simple-canvas-paths.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/simple-canvas.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/tiled-canvas-image.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/simple/simple-canvas-paths.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/simple/tiled-canvas-image.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-canvas.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-css.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-svg.js create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/template/template-canvas.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/template/template-css.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/tests/template/template-svg.html create mode 100644 third_party/webkit/PerformanceTests/MotionMark/version create mode 100644 third_party/webkit/PerformanceTests/Speedometer/InteractiveRunner.html create mode 100644 third_party/webkit/PerformanceTests/Speedometer/README_MOZILLA create mode 100644 third_party/webkit/PerformanceTests/Speedometer/index.html create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/benchmark-report.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/benchmark-runner.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/LICENSE.md create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/README.md create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/boot/page.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/compose_box.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/mail_items.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/move_to.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/compose_box.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/folders.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/mail_controls.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/mail_items.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/move_to_selector.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/with_select.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/css/custom.css create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/data.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/templates.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap-responsive.css create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap-responsive.min.css create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap.css create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap.min.css create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/img/glyphicons-halflings-white.png create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/img/glyphicons-halflings.png create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/js/bootstrap.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/js/bootstrap.min.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/.gitignore create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/CHANGES create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/CONTRIBUTORS.md create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/LICENSE create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/README.md create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/component.json create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/es5-sham.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/es5-sham.min.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/es5-shim.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/es5-shim.min.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/package.json create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/helpers/h-kill.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/helpers/h-matchers.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/helpers/h.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/index.html create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine-html.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine.css create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine_favicon.png create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/json2.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-array.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-date.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-function.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-object.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-string.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/.travis.yml create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/advice.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/component.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/compose.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/index.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/logger.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/registry.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/utils.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/tools/debug/debug.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/LICENSE.md create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/README.md create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/bower.json create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/lib/jasmine-flight.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-jquery/lib/jasmine-jquery.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/component.json create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/composer.json create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/jquery.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/jquery.min.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/mustache/mustache.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/requirejs/require.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/index.html create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/karma.conf.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/package.json create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/requireMain.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/gauge.png create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/gauge@2x.png create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/logo.png create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/logo@2x.png create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/main.css create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/main.js create mode 100644 third_party/webkit/PerformanceTests/Speedometer/resources/tests.js create mode 100644 third_party/webkit/PerformanceTests/StyleBench/InteractiveRunner.html create mode 100644 third_party/webkit/PerformanceTests/StyleBench/README_MOZILLA create mode 100644 third_party/webkit/PerformanceTests/StyleBench/index.html create mode 100644 third_party/webkit/PerformanceTests/StyleBench/mozilla.patch create mode 100644 third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-report.js create mode 100644 third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-runner.js create mode 100644 third_party/webkit/PerformanceTests/StyleBench/resources/gauge.png create mode 100644 third_party/webkit/PerformanceTests/StyleBench/resources/gauge@2x.png create mode 100644 third_party/webkit/PerformanceTests/StyleBench/resources/main.css create mode 100644 third_party/webkit/PerformanceTests/StyleBench/resources/main.js create mode 100644 third_party/webkit/PerformanceTests/StyleBench/resources/style-bench.html create mode 100644 third_party/webkit/PerformanceTests/StyleBench/resources/style-bench.js create mode 100644 third_party/webkit/PerformanceTests/StyleBench/resources/tests.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-cube.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-morph.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-raytrace.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-binary-trees.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-fannkuch.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-nbody.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-nsieve.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-3bit-bits-in-byte.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-bits-in-byte.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-bitwise-and.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-nsieve-bits.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/controlflow-recursive.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/crypto-aes.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/crypto-md5.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/crypto-sha1.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/date-format-tofte.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/date-format-xparb.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-cordic.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-partial-sums.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-spectral-norm.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/regexp-dna.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-base64.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-fasta.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-tagcloud.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-unpack-code.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-validate-input.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/sunspider-standalone-driver.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/json2.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/driver.html create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/results.html create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/sunspider-test-contents.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/sunspider-test-prefix.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-analyze-results.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-compare-results.js create mode 100644 third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider.css create mode 100644 third_party/webkit/PerformanceTests/resources/statistics.js create mode 100644 third_party/webkit/PerformanceTests/six-speed/VERSION create mode 100644 third_party/webkit/PerformanceTests/six-speed/test.js create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/arrow-args.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/arrow-args.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/arrow-declare.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/arrow-declare.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/arrow.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/arrow.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/bindings-compound.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/bindings-compound.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/bindings.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/bindings.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/classes.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/classes.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/defaults.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/defaults.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/destructuring-simple.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/destructuring-simple.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/destructuring.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/destructuring.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/for-of-array.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/for-of-array.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/for-of-object.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/for-of-object.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/generator.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/generator.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/map-set-lookup.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/map-set-lookup.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/map-set-object.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/map-set-object.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/map-set.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/map-set.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/map-string.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/map-string.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/object-assign.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/object-assign.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/object-literal-ext.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/object-literal-ext.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/regex-u.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/regex-u.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/rest.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/rest.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/spread-generator.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/spread-generator.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/spread-literal.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/spread-literal.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/spread.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/spread.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/super.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/super.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/template_string.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/template_string.es6 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/template_string_tag.es5 create mode 100644 third_party/webkit/PerformanceTests/six-speed/tests/template_string_tag.es6 create mode 100644 third_party/webkit/PerformanceTests/wasm-godot/godot.js create mode 100644 third_party/webkit/PerformanceTests/wasm-godot/godot.pck create mode 100644 third_party/webkit/PerformanceTests/wasm-godot/index.html create mode 100644 third_party/webkit/PerformanceTests/webaudio/README.md create mode 100644 third_party/webkit/PerformanceTests/webaudio/benchmarks.js create mode 100644 third_party/webkit/PerformanceTests/webaudio/index.html create mode 100644 third_party/webkit/PerformanceTests/webaudio/think-mono-38000.wav create mode 100644 third_party/webkit/PerformanceTests/webaudio/think-mono-44100.wav create mode 100644 third_party/webkit/PerformanceTests/webaudio/think-mono-48000.wav create mode 100644 third_party/webkit/PerformanceTests/webaudio/think-mono.wav create mode 100644 third_party/webkit/PerformanceTests/webaudio/think-stereo-38000.wav create mode 100644 third_party/webkit/PerformanceTests/webaudio/think-stereo-44100.wav create mode 100644 third_party/webkit/PerformanceTests/webaudio/think-stereo-48000.wav create mode 100755 third_party/webkit/PerformanceTests/webaudio/update.sh create mode 100644 third_party/webkit/PerformanceTests/webaudio/webaudio-bench.js (limited to 'third_party/webkit') diff --git a/third_party/webkit/PerformanceTests/MotionMark/about.html b/third_party/webkit/PerformanceTests/MotionMark/about.html new file mode 100644 index 0000000000..f14638a96b --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/about.html @@ -0,0 +1,52 @@ + + + + + + + About MotionMark + + + + +
+
+ + +
+

About MotionMark

+ +

MotionMark is a web benchmark that focuses on graphics performance. It draws multiple rendering elements, each of which uses the same set of graphics primitives. An element could be an SVG node, an HTML element with CSS style, or a series of canvas operations. Slight variations among the elements avoid trivial caching optimizations by the browser. Although fairly simple, the effects were chosen to reflect techniques commonly used on the web. Tests are visually rich, being designed to stress the graphics system rather than JavaScript.

+ +

After an initial warm-up, each test runs for a fixed period of time. Based on measurements of the browser’s frame rate, MotionMark adjusts the number of elements to draw, and concentrates around a narrow range where the browser starts to fail animating at 60 frames per second (fps). A piecewise linear regression is applied to the data, and the change point is reported as the test's score. The confidence interval is calculated through bootstrapping. MotionMark calculates the geometric mean of all of the tests’ scores to report the single score for the run.

+ +

MotionMark can be run on a wide variety of devices. Using the device’s screen dimensions it adjusts the drawing area into one of three sizes:

+ +
    +
  1. Small (568 x 320), targeted at mobile phones
    2. +
  2. Medium (900 x 600), targeted at tablets and laptops
    3. +
  3. Large (1600 x 800), targeted at desktops
    4. +
+ +

The design of the benchmark is modular. This makes it easy to write new tests and use different controllers, which can assist a developer working on improving the performance of a web engine. For the purpose of a public benchmark, the MotionMark master suite tests a variety of drawing operations using techniques including CSS, SVG, and Canvas:

+ +
    +
  • Multiply: CSS border radius, transforms, opacity
    • +
  • Arcs and Fills: Canvas path fills and arcs
    • +
  • Leaves: CSS-transformed elements
    • +
  • Paths: Canvas line, quadratic, and Bezier paths
    • +
  • Lines: Canvas line segments
    • +
  • Focus: CSS blur filter, opacity
    • +
  • Images: Canvas getImageData() and putImageData()
    • +
  • Design: HTML text rendering
    • +
  • Suits: SVG clip paths, gradients and transforms
    • +
+ +

To achieve consistent results on mobile devices, put the device in landscape orientation. On laptops and desktops, use the default display resolution and make the browser window fullscreen. Make sure that screen automatic display sleep is turned off or set to longer than 8 minutes.

+ +
+
+
+
+ + \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/MotionMark/developer.html b/third_party/webkit/PerformanceTests/MotionMark/developer.html new file mode 100644 index 0000000000..d7387a0e48 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/developer.html @@ -0,0 +1,175 @@ + + + + + + + MotionMark 1.0 - developer + + + + + + + + + + + + + + + + + + +
+
+

MotionMark

+
+
+
+

Suites:

+
    +
    Drop results here
    +
    +
    +

    Options:

    +
    +
      +
    • + +
      • +
    • +

      Display:

      +
        +
        • +
        • +
      +
      • +
    • +

      Tiles:

      +
        +
        • +
        • +
      +
      • +
    • +

      Adjusting the test complexity:

      +
        +
        • +
        • +
        • +
        • +
        • +
      +
      • +
    • + +
      • +
    • +

      Kalman filter estimated error:

      +
        +
        • +
        • +
      +
      • +
    • +

      Time measurement method:

      +
        +
        • +
        • +
        • +
      +
      • +
    +
    +
    +
    +

    For accurate results, please take the browser window full screen, or rotate the device to landscape orientation.

    +
    + + +
    +
    +
    + +
    +
    +
    +
    +
    +
    + +
    +
    +

    MotionMark score

    +
    + on a small screen (phone) + on a medium screen (laptop, tablet) + on a large screen (desktop) +
    +

    +

    +
    +
    +
    +
    +
    +
    +
    + +

    + 'j': Show JSON results
    + 's': Select various results for copy/paste (use repeatedly to cycle) +

    +
    +
    +
    +
    +
    + +

    Graph:

    +

    +

    +
    + +
    +
    +
    +
    + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/index.html b/third_party/webkit/PerformanceTests/MotionMark/index.html new file mode 100644 index 0000000000..c1b1e2e58f --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/index.html @@ -0,0 +1,67 @@ + + + + + + + MotionMark 1.0 + + + + + + + + + + + + + + + +
    +
    + +
    +

    MotionMark is a graphics benchmark that measures a browser’s capability to animate complex scenes at a target frame rate.

    + +

    More details about the benchmark are available. Bigger scores are better.

    +

    For accurate results, please take your browser window full screen, or rotate your device to landscape orientation.

    +

    Please rotate your device.

    + +
    +
    + +
    + +
    + +
    +
    +
    +
    +
    + on a small screen (phone) + on a medium screen (laptop, tablet) + on a large screen (desktop) +
    +
    +
    +
    +
    +
    +
    +
    +
    + +
    +
    +
    + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/animometer.css b/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/animometer.css new file mode 100644 index 0000000000..7fbf31ee7d --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/animometer.css @@ -0,0 +1,774 @@ +body { + font-size: initial; +} + +body.showing-intro, +body.showing-results, +body.showing-test-graph { + background-color: rgb(96, 96, 96); + background-image: initial; + background-repeat: initial; + background-size: initial; + animation: initial; + will-change: initial; + + color: rgb(235, 235, 235); +} + +section .body { + margin-left: 0; + max-width: initial; + transform: none; +} + +h1 { + font-size: 3em; + margin: 1.5em 0 .5em; + text-align: center; +} + +button { + transform: none !important; + min-width: initial; + transition: none; + animation: none; + will-change: initial; + + display: block; + font-size: 1.5em; + border: 2px solid rgb(235, 235, 235); + color: rgb(235, 235, 235); + background: transparent; + border-radius: 10px; + padding: .5em 2em; +} + +button:hover { + background-color: rgba(255, 255, 255, .1); + cursor: pointer; +} + +button:active { + color: inherit; + background-color: rgba(255, 255, 255, .2); +} + +button:disabled { + border-color: rgba(235, 235, 235, .5); + color: rgba(235, 235, 235, .5); +} + +@media screen and (max-device-width: 414px), + screen and (max-device-height: 414px) and (orientation: landscape) { + h1 { + font-size: 2.5em; + } + + section { + box-sizing: border-box; + width: 100%; + height: 100%; + padding: 0 5px; + } +} + +/* -------------------------------------------------------------------------- */ +/* Tree */ +/* -------------------------------------------------------------------------- */ + +.tree { + padding: 0; + list-style-type: none; +} + +.tree .expand-button { + position: absolute; + clip: rect(0, 0, 0, 0); +} + +.tree .expand-button ~ ul { + display: none; +} + +.tree .expand-button:checked ~ ul { + display: block; +} + +.tree ul { + list-style-type:none; +} + +.tree li { + position: relative; + padding: 0 0 1em 1em; +} + +.tree ul li { + list-style:none; + padding: 1em 0 0 0em; +} + +.tree > li:last-child { + padding-bottom: 0; +} + +.tree-label { + position: relative; + display: inline-block; +} + +label.tree-label { + cursor: pointer; +} + +.tree > li > label.tree-label:before { + position: relative; + z-index: 1; + float: left; + margin: 0 0 0 -2em; + width: 1em; + height: 1em; + content: '\25BA'; + text-align: center; + line-height: 2.5em; + font-size: .5em; +} + +.tree > li > :checked ~ label.tree-label:before { + content: '\25BC'; +} + +.tree .link { + cursor: pointer; + color: #999; + font-style: italic; + margin-left: 2em; +} + +@media screen and (max-device-width: 414px), + screen and (max-device-height: 414px) and (orientation: landscape) { + .tree { + padding-left: 1em; + } + .tree > li > label.tree-label:before { + font-size: 1em; + margin-left: -1.75em; + line-height: 1em; + } +} + +/* -------------------------------------------------------------------------- */ +/* Intro Section */ +/* -------------------------------------------------------------------------- */ + +#intro { + padding: 0; + opacity: initial; + transition: none; +} + +#intro .body > p { + padding: 1em 0; + margin: 0 auto; + text-align: center; +} + +#intro .start-benchmark { + padding: 10vh 0; + text-align: center; +} + +#intro .start-benchmark p { + color: hsl(11, 72%, 50%); + margin-bottom: 1em; + -apple-trailing-word: -apple-partially-balanced; +} + +#intro .start-benchmark button { + margin: 0 auto; +} + + +@media screen and (max-device-width: 414px), + screen and (max-device-height: 414px) and (orientation: landscape) { + #intro.selected { + display: flex; + align-items: center; + justify-content: flex-start; + flex-flow: column; + } + + #intro p { + padding-left: 20px; + padding-right: 20px; + font-size: 1.5em; + } +} + +#intro h2 { + font-size: 1.2em; +} + +#intro .body > div:first-of-type { + width: 100%; + margin: 2em 0 0; + flex-direction: row; + display: flex; + align-content: flex-start; +} + +#suites { + padding-left: 15vw; + padding-right: 3em; + flex: 1 1 30%; +} + +#options { + flex: 10 1 auto; +} + +#intro input[type="number"] { + width: 50px; +} + +#suites input[type="number"] { + display: none; + float: right; +} + +#suites input[type="number"].selected { + display: inline; + margin: 0; +} + +#suites ul ul { + font-size: .8em; + margin: 0; + padding: 0 0 0 1em; +} + +#suites > div { + margin: 3em 0; +} + +#drop-target { + font-size: 1em; + border-radius: 10px; + padding: .5em 2em; + border: 2px solid rgb(235, 235, 235); + color: rgb(235, 235, 235); +} + +#drop-target:hover { + background-color: rgba(255, 255, 255, .1); + cursor: pointer; +} + +#options ul { + margin: 0; + padding: 0; + list-style: none; +} + +#options h3 { + font-size: 1em; + font-weight: inherit; + margin: 0 0 .3em 0; + padding: 0; +} + +#options > form > ul > li { + padding: 0 0 1em 0; +} + +#options ul ul { + padding: 0; +} + +#options li { + padding: .1em 0; +} + +#intro > p { + padding: 0 5px 1em; + font-size: 1em; +} + +#intro .start-benchmark { + padding: 0 0 10vh; + margin-top: 0; +} + +#intro .start-benchmark p { + color: hsl(11, 100%, 66%); +} + +@media screen and (max-device-width: 414px), + screen and (max-device-height: 414px) and (orientation: landscape) { + #intro .body > div:first-of-type { + flex-direction: column; + } + + #suites, + #options { + padding: 0 5px; + margin: 0; + flex: 0 0 auto; + } +} + +/* -------------------------------------------------------------------------- */ +/* Running Section */ +/* -------------------------------------------------------------------------- */ + +#running-test { + display: flex; + align-items: center; + justify-content: center; +} + +#progress { + display: none; +} + +.display-progress-bar #progress { + display: block; + position: fixed; + top: 0; + left: 0; + height: 6px; + width: 100%; + background-color: rgb(128, 128, 128); +} + +.display-progress-bar #progress-completed { + position: absolute; + top: 0; + left: 0; + height: 6px; + width: 0; + background-color: rgb(235, 96, 32); +} + +body.showing-test-container.tiles-big { + overflow: hidden; +} + +body.showing-test-container.tiles-classic { + width: 3000px; + height: 3000px; + overflow: scroll; +} + +/* -------------------------------------------------------------------------- */ +/* Results Section */ +/* -------------------------------------------------------------------------- */ + +#results { + text-align: center; +} + +#results h1, #test-graph h1 { + font-size: 2em; +} + +#results button.small-button { + border: 1px solid rgba(235, 235, 235, .9); + color: rgba(235, 235, 235, .9); + border-radius: 2px; + padding: 1px 4px; + margin: 0 0 0 1em; + font-size: 9px; +} + +#results button.small-button:active { + background-color: rgba(235, 235, 235, .2); + color: inherit; +} + +#results .score, +#test-graph .score { + font-size: 3em; + font-weight: bold; + margin: 0; +} + +#results .confidence, +#test-graph .confidence { + margin-top: 0; + margin-bottom: 1em; + font-size: 1.5em; + font-weight: 400; + text-indent: inherit; + color: inherit; +} + +#results-tables { + direction: rtl; + + display: flex; + + align-items: center; + justify-content: center; + + margin: 3em 0; +} + +#results .table-container > div { + margin-left: 0; +} + +#results #results-score { + float: initial; +} + +#results #results-header { + width: initial; + position: initial; +} + +#results table { + direction: ltr; + min-width: initial; +} + +#results table td.suites-separator { + padding: .5em 0; +} + +#results table tr:nth-child(even) { + background-color: transparent; +} + +#results th { + padding: .5em 0; +} + +#results tr td { + padding: .25em 0; +} + +#results-header td, #results-header th { + text-align: left; +} +#results-header tr td { + padding-right: 1em; +} +#results-score td, #results-score th { + text-align: right; +} +#results .body > button { + margin: 1.5em auto .5em; +} +#results footer { + padding-bottom: 10vh; +} + +@media screen and (max-device-width: 414px), + screen and (max-device-height: 414px) and (orientation: landscape) { + #results.selected { + padding: 0 20px; + } +} + +#overlay { + background: rgba(0, 0, 10, .8); +} + +@supports (-webkit-backdrop-filter: blur(10px)) { + #overlay { + background: rgba(0, 0, 10, .4); + } +} + +#overlay > div div { + border: 1px solid rgb(241, 241, 241); +} + +#overlay button { + margin: 2em auto; + border-color: rgb(241, 241, 241); + color: rgb(241, 241, 241); +} + +#overlay button:hover { + background-color: rgba(255, 255, 255, .1); +} + +#overlay button:active { + background-color: rgba(255, 255, 255, .2); +} + +#results-data .average { + padding-left: 1em; + text-align: right; +} + +#results-data .stdev { + text-align: left; + padding-left: .25em; +} + +#results-data .left { + text-align: left; +} + +#results-data .right { + text-align: right; +} + +#results-data .pad-left { + padding-left: 1em; +} + +#results-data .pad-right { + padding-right: .25em; +} + +#results-data .small { + font-size: .8em; +} + +#results-tables td.noisy-results { + color: rgb(255, 104, 104); +} + +#results-tables div { + direction: ltr; + display: flex; + flex-direction: row; +} + +#test-graph { + flex: 1 0 calc(100% - 40px); +} + +#test-graph h1 { + margin-bottom: 0; +} + +#test-graph header { + position: relative; + text-align:center; +} + +#test-graph header button { + position: absolute; + top: 0; + left: 0; + border-width: 1px; + font-size: 1em; + padding: .5em 1em; +} + +#test-graph .score, #test-graph .confidence { + margin: 0; +} + +#test-graph nav { + position: absolute; + top: 1.5em; + right: 0; + font-size: .7em; + width: 28em; +} + +#test-graph nav ul { + margin: 0 30px 1em 0; + padding: 0; + list-style: none; +} + +#test-graph nav li { + padding: .1em 0; +} + +#test-graph nav li > span { + float: right; +} + +#test-graph nav.hide-data span { + display: none; +} + +/* -------------------------------------------------------------------------- */ +/* Graph Section */ +/* -------------------------------------------------------------------------- */ + +#test-graph-data { + z-index: 1; + font: 10px sans-serif; + color: rgb(235, 235, 235); +} + +#test-graph-data > svg { + fill: none; + overflow: visible; +} + +.axis path, +.axis line { + fill: none; + stroke: #999999; + shape-rendering: crispEdges; +} + +.axis text { + fill: #999; +} + +.yLeft.axis text { + fill: #7add49; +} +.yLeft.axis path, +.yLeft.axis line { + stroke: #7add49; +} +.yRight.axis text { + fill: #fa4925; +} +.yRight.axis path, +.yRight.axis line { + stroke: #fa4925; +} + +.axis.complexity .tick line { + stroke: rgba(200, 200, 200, .6); + stroke-width: 2px; +} + +.axis.complexity .domain, +.axis.complexity text { + stroke: transparent; + fill: transparent; +} + +.marker line { + stroke: #5493D6; +} + +.marker text { + fill: #999; +} + +.mean.complexity line { + stroke: hsla(100, 69%, 58%, .8); + stroke-width: 2px; +} + +.mean.complexity polygon { + fill: hsla(100, 69%, 58%, .05); +} + +.target-fps { + stroke: rgba(250, 73, 37, .4); + stroke-width: 1px; + stroke-dasharray: 10, 10; +} + +.mean.fps line { + stroke: hsla(10, 96%, 56%, .8); + stroke-width: 2px; +} + +.mean.fps polygon { + fill: hsla(10, 96%, 56%, .1); +} + +#regressions line { + stroke: rgba(200, 200, 200, .8); + stroke-width: 2px; +} + +#regressions circle { + fill: rgba(200, 200, 200, .8); +} + +.cursor line { + stroke: rgb(250, 250, 250); + stroke-width: 1px; +} + +.cursor circle, +.cursor text { + fill: rgb(250, 250, 250); +} + +#complexity path { + stroke: rgba(122, 221, 73, .7); + stroke-width: 2px; +} + +#complexity circle { + fill: rgb(122, 221, 73); +} + +#filteredFPS path { + stroke: hsla(30, 96%, 56%, .7); + stroke-width: 1px; +} + +#filteredFPS circle { + fill: hsl(30, 96%, 56%); +} + +#rawFPS path { + stroke: rgba(250, 73, 37, .7); + stroke-width: 1px; +} + +#rawFPS circle { + fill: rgb(250, 73, 37); +} + +#complexity-graph .regression line { + stroke: rgba(253, 253, 253, .8); + stroke-width: 2px; +} + +#complexity-graph .regression circle { + fill: rgba(253, 253, 253, .8); +} + +#complexity-graph .regression polygon { + fill: rgba(253, 253, 253, .05); +} + +#complexity-graph .raw.series line { + stroke: hsla(30, 96%, 56%, .3); + stroke-width: 1px; +} + +#complexity-graph .raw.regression line { + stroke: rgba(30, 96%, 86%, .6); +} + +#complexity-graph .raw.regression polygon { + stroke: rgba(30, 96%, 86%, .05); +} + +#complexity-graph .average.series circle { + fill: hsl(170, 96%, 56%); +} + +#complexity-graph .average.series line { + stroke: hsla(170, 96%, 56%, .2); + stroke-width: 2px; +} + +#complexity-graph .bootstrap .bar { + fill: hsla(260, 56%, 66%, .4); +} + +#complexity-graph .bootstrap .median line { + stroke: hsla(300, 56%, 66%, .8); + stroke-width: 2px; +} + +#complexity-graph .bootstrap .median circle { + fill: hsla(300, 56%, 66%, .8); +} + +#complexity-graph .bootstrap .median polygon { + fill: hsla(300, 56%, 66%, .05); +} diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/animometer.js b/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/animometer.js new file mode 100644 index 0000000000..072cdcc762 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/animometer.js @@ -0,0 +1,703 @@ +ProgressBar = Utilities.createClass( + function(element, ranges) + { + this._element = element; + this._ranges = ranges; + this._currentRange = 0; + this._updateElement(); + }, { + + _updateElement: function() + { + this._element.style.width = (this._currentRange * (100 / this._ranges)) + "%"; + }, + + incrementRange: function() + { + ++this._currentRange; + this._updateElement(); + } +}); + +DeveloperResultsTable = Utilities.createSubclass(ResultsTable, + function(element, headers) + { + ResultsTable.call(this, element, headers); + }, { + + _addGraphButton: function(td, testName, testResult, testData) + { + var button = Utilities.createElement("button", { class: "small-button" }, td); + button.textContent = Strings.text.graph + "…"; + button.testName = testName; + button.testResult = testResult; + button.testData = testData; + + button.addEventListener("click", function(e) { + benchmarkController.showTestGraph(e.target.testName, e.target.testResult, e.target.testData); + }); + }, + + _isNoisyMeasurement: function(jsonExperiment, data, measurement, options) + { + const percentThreshold = 10; + const averageThreshold = 2; + + if (measurement == Strings.json.measurements.percent) + return data[Strings.json.measurements.percent] >= percentThreshold; + + if (jsonExperiment == Strings.json.frameLength && measurement == Strings.json.measurements.average) + return Math.abs(data[Strings.json.measurements.average] - options["frame-rate"]) >= averageThreshold; + + return false; + }, + + _addTest: function(testName, testResult, options, testData) + { + var row = Utilities.createElement("tr", {}, this.element); + + var isNoisy = false; + [Strings.json.complexity, Strings.json.frameLength].forEach(function (experiment) { + var data = testResult[experiment]; + for (var measurement in data) { + if (this._isNoisyMeasurement(experiment, data, measurement, options)) + isNoisy = true; + } + }, this); + + this._flattenedHeaders.forEach(function (header) { + var className = ""; + if (header.className) { + if (typeof header.className == "function") + className = header.className(testResult, options); + else + className = header.className; + } + + if (header.text == Strings.text.testName) { + if (isNoisy) + className += " noisy-results"; + var td = Utilities.createElement("td", { class: className }, row); + td.textContent = testName; + return; + } + + var td = Utilities.createElement("td", { class: className }, row); + if (header.title == Strings.text.graph) { + this._addGraphButton(td, testName, testResult, testData); + } else if (!("text" in header)) { + td.textContent = testResult[header.title]; + } else if (typeof header.text == "string") { + var data = testResult[header.text]; + if (typeof data == "number") + data = data.toFixed(2); + td.textContent = data; + } else + td.textContent = header.text(testResult); + }, this); + } +}); + +Utilities.extendObject(window.benchmarkRunnerClient, { + testsCount: null, + progressBar: null, + + initialize: function(suites, options) + { + this.testsCount = this.iterationCount * suites.reduce(function (count, suite) { return count + suite.tests.length; }, 0); + this.options = options; + }, + + willStartFirstIteration: function() + { + this.results = new ResultsDashboard(this.options); + this.progressBar = new ProgressBar(document.getElementById("progress-completed"), this.testsCount); + }, + + didRunTest: function(testData) + { + this.progressBar.incrementRange(); + this.results.calculateScore(testData); + } +}); + +Utilities.extendObject(window.sectionsManager, { + setSectionHeader: function(sectionIdentifier, title) + { + document.querySelector("#" + sectionIdentifier + " h1").textContent = title; + }, + + populateTable: function(tableIdentifier, headers, dashboard) + { + var table = new DeveloperResultsTable(document.getElementById(tableIdentifier), headers); + table.showIterations(dashboard); + } +}); + +window.optionsManager = +{ + valueForOption: function(name) + { + var formElement = document.forms["benchmark-options"].elements[name]; + if (formElement.type == "checkbox") + return formElement.checked; + else if (formElement.constructor === HTMLCollection) { + for (var i = 0; i < formElement.length; ++i) { + var radio = formElement[i]; + if (radio.checked) + return formElement.value; + } + return null; + } + return formElement.value; + }, + + updateUIFromLocalStorage: function() + { + var formElements = document.forms["benchmark-options"].elements; + + for (var i = 0; i < formElements.length; ++i) { + var formElement = formElements[i]; + var name = formElement.id || formElement.name; + var type = formElement.type; + + var value = localStorage.getItem(name); + if (value === null) + continue; + + if (type == "number") + formElements[name].value = +value; + else if (type == "checkbox") + formElements[name].checked = value == "true"; + else if (type == "radio") + formElements[name].value = value; + } + }, + + updateLocalStorageFromUI: function() + { + var formElements = document.forms["benchmark-options"].elements; + var options = {}; + + for (var i = 0; i < formElements.length; ++i) { + var formElement = formElements[i]; + var name = formElement.id || formElement.name; + var type = formElement.type; + + if (type == "number") + options[name] = +formElement.value; + else if (type == "checkbox") + options[name] = formElement.checked; + else if (type == "radio") { + var radios = formElements[name]; + if (radios.constructor === HTMLCollection) { + for (var j = 0; j < radios.length; ++j) { + var radio = radios[j]; + if (radio.checked) { + options[name] = radio.value; + break; + } + } + } else + options[name] = formElements[name].value; + } + + try { + localStorage.setItem(name, options[name]); + } catch (e) {} + } + + return options; + }, + + updateDisplay: function() + { + document.body.classList.remove("display-minimal"); + document.body.classList.remove("display-progress-bar"); + + document.body.classList.add("display-" + optionsManager.valueForOption("display")); + }, + + updateTiles: function() + { + document.body.classList.remove("tiles-big"); + document.body.classList.remove("tiles-classic"); + + document.body.classList.add("tiles-" + optionsManager.valueForOption("tiles")); + } +}; + +window.suitesManager = +{ + _treeElement: function() + { + return document.querySelector("#suites > .tree"); + }, + + _suitesElements: function() + { + return document.querySelectorAll("#suites > ul > li"); + }, + + _checkboxElement: function(element) + { + return element.querySelector("input[type='checkbox']:not(.expand-button)"); + }, + + _editElement: function(element) + { + return element.querySelector("input[type='number']"); + }, + + _editsElements: function() + { + return document.querySelectorAll("#suites input[type='number']"); + }, + + _localStorageNameForTest: function(suiteName, testName) + { + return suiteName + "/" + testName; + }, + + _updateSuiteCheckboxState: function(suiteCheckbox) + { + var numberEnabledTests = 0; + suiteCheckbox.testsElements.forEach(function(testElement) { + var testCheckbox = this._checkboxElement(testElement); + if (testCheckbox.checked) + ++numberEnabledTests; + }, this); + suiteCheckbox.checked = numberEnabledTests > 0; + suiteCheckbox.indeterminate = numberEnabledTests > 0 && numberEnabledTests < suiteCheckbox.testsElements.length; + }, + + isAtLeastOneTestSelected: function() + { + var suitesElements = this._suitesElements(); + + for (var i = 0; i < suitesElements.length; ++i) { + var suiteElement = suitesElements[i]; + var suiteCheckbox = this._checkboxElement(suiteElement); + + if (suiteCheckbox.checked) + return true; + } + + return false; + }, + + _onChangeSuiteCheckbox: function(event) + { + var selected = event.target.checked; + event.target.testsElements.forEach(function(testElement) { + var testCheckbox = this._checkboxElement(testElement); + testCheckbox.checked = selected; + }, this); + benchmarkController.updateStartButtonState(); + }, + + _onChangeTestCheckbox: function(suiteCheckbox) + { + this._updateSuiteCheckboxState(suiteCheckbox); + benchmarkController.updateStartButtonState(); + }, + + _createSuiteElement: function(treeElement, suite, id) + { + var suiteElement = Utilities.createElement("li", {}, treeElement); + var expand = Utilities.createElement("input", { type: "checkbox", class: "expand-button", id: id }, suiteElement); + var label = Utilities.createElement("label", { class: "tree-label", for: id }, suiteElement); + + var suiteCheckbox = Utilities.createElement("input", { type: "checkbox" }, label); + suiteCheckbox.suite = suite; + suiteCheckbox.onchange = this._onChangeSuiteCheckbox.bind(this); + suiteCheckbox.testsElements = []; + + label.appendChild(document.createTextNode(" " + suite.name)); + return suiteElement; + }, + + _createTestElement: function(listElement, test, suiteCheckbox) + { + var testElement = Utilities.createElement("li", {}, listElement); + var span = Utilities.createElement("label", { class: "tree-label" }, testElement); + + var testCheckbox = Utilities.createElement("input", { type: "checkbox" }, span); + testCheckbox.test = test; + testCheckbox.onchange = function(event) { + this._onChangeTestCheckbox(event.target.suiteCheckbox); + }.bind(this); + testCheckbox.suiteCheckbox = suiteCheckbox; + + suiteCheckbox.testsElements.push(testElement); + span.appendChild(document.createTextNode(" " + test.name + " ")); + + testElement.appendChild(document.createTextNode(" ")); + var link = Utilities.createElement("span", {}, testElement); + link.classList.add("link"); + link.textContent = "link"; + link.suiteName = Utilities.stripNonASCIICharacters(suiteCheckbox.suite.name); + link.testName = test.name; + link.onclick = function(event) { + var element = event.target; + var title = "Link to run “" + element.testName + "” with current options:"; + var url = location.href.split(/[?#]/)[0]; + var options = optionsManager.updateLocalStorageFromUI(); + Utilities.extendObject(options, { + "suite-name": element.suiteName, + "test-name": Utilities.stripNonASCIICharacters(element.testName) + }); + var complexity = suitesManager._editElement(element.parentNode).value; + if (complexity) + options.complexity = complexity; + prompt(title, url + Utilities.convertObjectToQueryString(options)); + }; + + var complexity = Utilities.createElement("input", { type: "number" }, testElement); + complexity.relatedCheckbox = testCheckbox; + complexity.oninput = function(event) { + var relatedCheckbox = event.target.relatedCheckbox; + relatedCheckbox.checked = true; + this._onChangeTestCheckbox(relatedCheckbox.suiteCheckbox); + }.bind(this); + return testElement; + }, + + createElements: function() + { + var treeElement = this._treeElement(); + + Suites.forEach(function(suite, index) { + var suiteElement = this._createSuiteElement(treeElement, suite, "suite-" + index); + var listElement = Utilities.createElement("ul", {}, suiteElement); + var suiteCheckbox = this._checkboxElement(suiteElement); + + suite.tests.forEach(function(test) { + this._createTestElement(listElement, test, suiteCheckbox); + }, this); + }, this); + }, + + updateEditsElementsState: function() + { + var editsElements = this._editsElements(); + var showComplexityInputs = ["fixed", "step"].indexOf(optionsManager.valueForOption("controller")) != -1; + + for (var i = 0; i < editsElements.length; ++i) { + var editElement = editsElements[i]; + if (showComplexityInputs) + editElement.classList.add("selected"); + else + editElement.classList.remove("selected"); + } + }, + + updateUIFromLocalStorage: function() + { + var suitesElements = this._suitesElements(); + + for (var i = 0; i < suitesElements.length; ++i) { + var suiteElement = suitesElements[i]; + var suiteCheckbox = this._checkboxElement(suiteElement); + var suite = suiteCheckbox.suite; + + suiteCheckbox.testsElements.forEach(function(testElement) { + var testCheckbox = this._checkboxElement(testElement); + var testEdit = this._editElement(testElement); + var test = testCheckbox.test; + + var str = localStorage.getItem(this._localStorageNameForTest(suite.name, test.name)); + if (str === null) + return; + + var value = JSON.parse(str); + testCheckbox.checked = value.checked; + testEdit.value = value.complexity; + }, this); + + this._updateSuiteCheckboxState(suiteCheckbox); + } + + benchmarkController.updateStartButtonState(); + }, + + updateLocalStorageFromUI: function() + { + var suitesElements = this._suitesElements(); + var suites = []; + + for (var i = 0; i < suitesElements.length; ++i) { + var suiteElement = suitesElements[i]; + var suiteCheckbox = this._checkboxElement(suiteElement); + var suite = suiteCheckbox.suite; + + var tests = []; + suiteCheckbox.testsElements.forEach(function(testElement) { + var testCheckbox = this._checkboxElement(testElement); + var testEdit = this._editElement(testElement); + var test = testCheckbox.test; + + if (testCheckbox.checked) { + test.complexity = testEdit.value; + tests.push(test); + } + + var value = { checked: testCheckbox.checked, complexity: testEdit.value }; + try { + localStorage.setItem(this._localStorageNameForTest(suite.name, test.name), JSON.stringify(value)); + } catch (e) {} + }, this); + + if (tests.length) + suites.push(new Suite(suiteCheckbox.suite.name, tests)); + } + + return suites; + }, + + suitesFromQueryString: function(suiteName, testName, oskey=null) + { + var suites = []; + var suiteRegExp = new RegExp(suiteName, "i"); + var testRegExp = new RegExp(testName, "i"); + + for (var i = 0; i < Suites.length; ++i) { + var suite = Suites[i]; + if (!Utilities.stripNonASCIICharacters(suite.name).match(suiteRegExp)) + continue; + + var test; + for (var j = 0; j < suite.tests.length; ++j) { + suiteTest = suite.tests[j]; + // MOZILLA: Run all the tests in a given suite + if (typeof(testName) === "undefined") { + let complexity = {"HTMLsuite": { + "CSSbouncingcircles": {"win": 322, "linux64": 322, "osx": 218}, + "CSSbouncingclippedrects": {"win": 520, "linux64": 520, "osx": 75}, + "CSSbouncinggradientcircles": {"win": 402, "linux64": 402, "osx": 97}, + "CSSbouncingblendcircles": {"win": 171, "linux64": 171, "osx": 254}, + "CSSbouncingfiltercircles": {"win": 189, "linux64": 189, "osx": 189}, + "CSSbouncingSVGimages": {"win": 329, "linux64": 329, "osx": 392}, + "CSSbouncingtaggedimages": {"win": 255, "linux64": 255, "osx": 351}, + "Leaves20": {"win": 262, "linux64": 262, "osx": 191}, + "Focus20": {"win": 15, "linux64": 15, "osx": 18}, + "DOMparticlesSVGmasks": {"win": 390, "linux64": 390, "osx": 54}, + "CompositedTransforms": {"win": 400, "linux64": 400, "osx": 75} + }, "Animometer": { + "Multiply": {"win": 391, "linux64": 391, "osx": 193}, + "CanvasArcs": {"win": 1287, "linux64": 1287, "osx": 575}, + "Leaves": {"win": 550, "linux64": 550, "osx": 271}, + "Paths": {"win": 4070, "linux64": 4070, "osx": 2024}, + "CanvasLines": {"win": 4692, "linux64": 4692, "osx": 10932}, + "Focus": {"win": 44, "linux64": 44, "osx": 32}, + "Images": {"win": 293, "linux64": 293, "osx": 188}, + "Design": {"win": 60, "linux64": 60, "osx": 17}, + "Suits": {"win": 210, "linux64": 210, "osx": 145} + } + }; + if (oskey == null) { + oskey = "linux64"; + } + suiteTest.complexity = complexity[suiteName][Utilities.stripNonASCIICharacters(suiteTest.name)][oskey]; + suites.push(new Suite(suiteName, [suiteTest])); + continue; + } + + if (Utilities.stripNonASCIICharacters(suiteTest.name).match(testRegExp)) { + test = suiteTest; + break; + } + } + + if (!test) + continue; + + suites.push(new Suite(suiteName, [test])); + }; + + return suites; + }, + + updateLocalStorageFromJSON: function(results) + { + for (var suiteName in results[Strings.json.results.tests]) { + var suiteResults = results[Strings.json.results.tests][suiteName]; + for (var testName in suiteResults) { + var testResults = suiteResults[testName]; + var data = testResults[Strings.json.controller]; + var complexity = Math.round(data[Strings.json.measurements.average]); + + var value = { checked: true, complexity: complexity }; + try { + localStorage.setItem(this._localStorageNameForTest(suiteName, testName), JSON.stringify(value)); + } catch (e) {} + } + } + } +} + +Utilities.extendObject(window.benchmarkController, { + initialize: function() + { + document.forms["benchmark-options"].addEventListener("change", benchmarkController.onBenchmarkOptionsChanged, true); + document.forms["graph-type"].addEventListener("change", benchmarkController.onGraphTypeChanged, true); + document.forms["time-graph-options"].addEventListener("change", benchmarkController.onTimeGraphOptionsChanged, true); + document.forms["complexity-graph-options"].addEventListener("change", benchmarkController.onComplexityGraphOptionsChanged, true); + optionsManager.updateUIFromLocalStorage(); + optionsManager.updateDisplay(); + optionsManager.updateTiles(); + + if (benchmarkController.startBenchmarkImmediatelyIfEncoded()) + return; + + benchmarkController.addOrientationListenerIfNecessary(); + suitesManager.createElements(); + suitesManager.updateUIFromLocalStorage(); + suitesManager.updateEditsElementsState(); + + var dropTarget = document.getElementById("drop-target"); + function stopEvent(e) { + e.stopPropagation(); + e.preventDefault(); + } + dropTarget.addEventListener("dragenter", stopEvent, false); + dropTarget.addEventListener("dragover", stopEvent, false); + dropTarget.addEventListener("dragleave", stopEvent, false); + dropTarget.addEventListener("drop", function (e) { + e.stopPropagation(); + e.preventDefault(); + + if (!e.dataTransfer.files.length) + return; + + var file = e.dataTransfer.files[0]; + + var reader = new FileReader(); + reader.filename = file.name; + reader.onload = function(e) { + var run = JSON.parse(e.target.result); + if (run.debugOutput instanceof Array) + run = run.debugOutput[0]; + benchmarkRunnerClient.results = new ResultsDashboard(run.options, run.data); + benchmarkController.showResults(); + }; + + reader.readAsText(file); + document.title = "File: " + reader.filename; + }, false); + }, + + updateStartButtonState: function() + { + var startButton = document.getElementById("run-benchmark"); + if ("isInLandscapeOrientation" in this && !this.isInLandscapeOrientation) { + startButton.disabled = true; + return; + } + startButton.disabled = !suitesManager.isAtLeastOneTestSelected(); + }, + + onBenchmarkOptionsChanged: function(event) + { + switch (event.target.name) { + case "controller": + suitesManager.updateEditsElementsState(); + break; + case "display": + optionsManager.updateDisplay(); + break; + case "tiles": + optionsManager.updateTiles(); + break; + } + }, + + startBenchmark: function() + { + benchmarkController.determineCanvasSize(); + benchmarkController.options = optionsManager.updateLocalStorageFromUI(); + benchmarkController.suites = suitesManager.updateLocalStorageFromUI(); + this._startBenchmark(benchmarkController.suites, benchmarkController.options, "running-test"); + }, + + startBenchmarkImmediatelyIfEncoded: function() + { + benchmarkController.options = Utilities.convertQueryStringToObject(location.search); + if (!benchmarkController.options) + return false; + + this.raptor = benchmarkController.options["raptor"]; + benchmarkController.suites = suitesManager.suitesFromQueryString(benchmarkController.options["suite-name"], + benchmarkController.options["test-name"], + benchmarkController.options["oskey"]); + if (!benchmarkController.suites.length) + return false; + + setTimeout(function() { + this._startBenchmark(benchmarkController.suites, benchmarkController.options, "running-test"); + }.bind(this), 0); + return true; + }, + + restartBenchmark: function() + { + this._startBenchmark(benchmarkController.suites, benchmarkController.options, "running-test"); + }, + + showResults: function() + { + if (!this.addedKeyEvent) { + document.addEventListener("keypress", this.handleKeyPress, false); + this.addedKeyEvent = true; + } + + var dashboard = benchmarkRunnerClient.results; + if (["ramp", "ramp30"].indexOf(dashboard.options["controller"]) != -1) + Headers.details[3].disabled = true; + else { + Headers.details[1].disabled = true; + Headers.details[4].disabled = true; + } + + if (dashboard.options[Strings.json.configuration]) { + document.body.classList.remove("small", "medium", "large"); + document.body.classList.add(dashboard.options[Strings.json.configuration]); + } + + var score = dashboard.score; + var item = dashboard._results['iterationsResults'][0]; + var fullNames = new Array; + var values = new Array; + for (var suite in item['testsResults']) { + for (var subtest in item['testsResults'][suite.toString()]) { + fullNames.push(suite.toString() + "-" + subtest.toString().replace(/ /g, '_')); + values.push(item['testsResults'][suite.toString()][subtest.toString()]['frameLength']['average']); + } + } + if (typeof tpRecordTime !== "undefined") { + tpRecordTime(values.join(','), 0, fullNames.join(',')); + } + if (this.raptor) { + _data = ['raptor-benchmark', 'motionmark', item['testsResults']]; + window.postMessage(_data, '*'); + window.sessionStorage.setItem('benchmark_results', JSON.stringify(_data)); + } + + var confidence = ((dashboard.scoreLowerBound / score - 1) * 100).toFixed(2) + + "% / +" + ((dashboard.scoreUpperBound / score - 1) * 100).toFixed(2) + "%"; + sectionsManager.setSectionScore("results", score.toFixed(2), confidence); + sectionsManager.populateTable("results-header", Headers.testName, dashboard); + sectionsManager.populateTable("results-score", Headers.score, dashboard); + sectionsManager.populateTable("results-data", Headers.details, dashboard); + sectionsManager.showSection("results", true); + + suitesManager.updateLocalStorageFromJSON(dashboard.results[0]); + }, + + showTestGraph: function(testName, testResult, testData) + { + sectionsManager.setSectionHeader("test-graph", testName); + sectionsManager.showSection("test-graph", true); + this.updateGraphData(testResult, testData, benchmarkRunnerClient.results.options); + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/graph.js b/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/graph.js new file mode 100644 index 0000000000..4803936219 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/graph.js @@ -0,0 +1,615 @@ +Utilities.extendObject(window.benchmarkController, { + updateGraphData: function(testResult, testData, options) + { + var element = document.getElementById("test-graph-data"); + element.innerHTML = ""; + element._testResult = testResult; + element._options = options; + + var margins = new Insets(30, 30, 30, 40); + var size = Point.elementClientSize(element); + size.y = window.innerHeight - element.offsetTop; + size = size.subtract(margins.size); + + // Convert from compact JSON output to propertied data + var samplesWithProperties = {}; + [Strings.json.controller, Strings.json.complexity, Strings.json.complexityAverage].forEach(function(seriesName) { + var series = testData[Strings.json.samples][seriesName]; + samplesWithProperties[seriesName] = series.toArray(); + }) + + this.createTimeGraph(testResult, samplesWithProperties[Strings.json.controller], testData[Strings.json.marks], testData[Strings.json.controller], options, margins, size); + this.onTimeGraphOptionsChanged(); + + this._showOrHideNodes(true, "form[name=graph-type]"); + document.forms["graph-type"].elements["type"] = "complexity"; + this.createComplexityGraph(testResult, testData[Strings.json.controller], samplesWithProperties, options, margins, size); + this.onComplexityGraphOptionsChanged(); + + this.onGraphTypeChanged(); + }, + + _addRegressionLine: function(parent, xScale, yScale, points, range, isAlongYAxis) + { + var polygon = []; + var line = [] + var xRange = isAlongYAxis ? range : 0; + var yRange = isAlongYAxis ? 0 : range; + for (var i = 0; i < points.length; ++i) { + var point = points[i]; + var x; + if (xRange instanceof Array) + x = xRange[0]; + else + x = point[0] + xRange; + polygon.push(xScale(x), yScale(point[1] + yRange)); + line.push(xScale(point[0]), yScale(point[1])); + } + for (var i = points.length - 1; i >= 0; --i) { + var point = points[i]; + var x; + if (xRange instanceof Array) + x = xRange[1]; + else + x = point[0] - xRange; + polygon.push(xScale(x), yScale(point[1] - yRange)); + } + parent.append("polygon") + .attr("points", polygon.join(",")); + parent.append("line") + .attr("x1", line[0]) + .attr("y1", line[1]) + .attr("x2", line[2]) + .attr("y2", line[3]); + }, + + _addRegression: function(data, svg, xScale, yScale) + { + svg.append("circle") + .attr("cx", xScale(data.segment1[1][0])) + .attr("cy", yScale(data.segment1[1][1])) + .attr("r", 5); + this._addRegressionLine(svg, xScale, yScale, data.segment1, data.stdev); + this._addRegressionLine(svg, xScale, yScale, data.segment2, data.stdev); + }, + + createComplexityGraph: function(result, timeRegressions, data, options, margins, size) + { + var svg = d3.select("#test-graph-data").append("svg") + .attr("id", "complexity-graph") + .attr("class", "hidden") + .attr("width", size.width + margins.left + margins.right) + .attr("height", size.height + margins.top + margins.bottom) + .append("g") + .attr("transform", "translate(" + margins.left + "," + margins.top + ")"); + + var timeSamples = data[Strings.json.controller]; + + var xMin = 100000, xMax = 0; + if (timeRegressions) { + timeRegressions.forEach(function(regression) { + for (var i = regression.startIndex; i <= regression.endIndex; ++i) { + xMin = Math.min(xMin, timeSamples[i].complexity); + xMax = Math.max(xMax, timeSamples[i].complexity); + } + }); + } else { + xMin = d3.min(timeSamples, function(s) { return s.complexity; }); + xMax = d3.max(timeSamples, function(s) { return s.complexity; }); + } + + var xScale = d3.scale.linear() + .range([0, size.width]) + .domain([xMin, xMax]); + var yScale = d3.scale.linear() + .range([size.height, 0]) + .domain([1000/20, 1000/60]); + + var xAxis = d3.svg.axis() + .scale(xScale) + .orient("bottom"); + var yAxis = d3.svg.axis() + .scale(yScale) + .tickValues([1000/20, 1000/25, 1000/30, 1000/35, 1000/40, 1000/45, 1000/50, 1000/55, 1000/60]) + .tickFormat(function(d) { return (1000 / d).toFixed(0); }) + .orient("left"); + + // x-axis + svg.append("g") + .attr("class", "x axis") + .attr("transform", "translate(0," + size.height + ")") + .call(xAxis); + + // y-axis + svg.append("g") + .attr("class", "y axis") + .call(yAxis); + + // time result + var mean = svg.append("g") + .attr("class", "mean complexity"); + var timeResult = result[Strings.json.controller]; + var yMin = yScale.domain()[0], yMax = yScale.domain()[1]; + this._addRegressionLine(mean, xScale, yScale, [[timeResult.average, yMin], [timeResult.average, yMax]], timeResult.stdev, true); + + // regression + this._addRegression(result[Strings.json.complexity], svg.append("g").attr("class", "regression raw"), xScale, yScale); + this._addRegression(result[Strings.json.complexityAverage], svg.append("g").attr("class", "regression average"), xScale, yScale); + + var bootstrapResult = result[Strings.json.complexity][Strings.json.bootstrap]; + if (bootstrapResult) { + var histogram = d3.layout.histogram() + .bins(xScale.ticks(100))(bootstrapResult.data); + var yBootstrapScale = d3.scale.linear() + .range([size.height/2, 0]) + .domain([0, d3.max(histogram, function(d) { return d.y; })]); + group = svg.append("g").attr("class", "bootstrap"); + var bar = group.selectAll(".bar") + .data(histogram) + .enter().append("g") + .attr("class", "bar") + .attr("transform", function(d) { return "translate(" + xScale(d.x) + "," + yBootstrapScale(d.y) + ")"; }); + bar.append("rect") + .attr("x", 1) + .attr("y", size.height/2) + .attr("width", xScale(histogram[1].x) - xScale(histogram[0].x) - 1) + .attr("height", function(d) { return size.height/2 - yBootstrapScale(d.y); }); + group = group.append("g").attr("class", "median"); + this._addRegressionLine(group, xScale, yScale, [[bootstrapResult.median, yMin], [bootstrapResult.median, yMax]], [bootstrapResult.confidenceLow, bootstrapResult.confidenceHigh], true); + group.append("circle") + .attr("cx", xScale(bootstrapResult.median)) + .attr("cy", yScale(1000/60)) + .attr("r", 5); + } + + // series + group = svg.append("g") + .attr("class", "series raw") + .selectAll("line") + .data(data[Strings.json.complexity]) + .enter(); + group.append("line") + .attr("x1", function(d) { return xScale(d.complexity) - 3; }) + .attr("x2", function(d) { return xScale(d.complexity) + 3; }) + .attr("y1", function(d) { return yScale(d.frameLength) - 3; }) + .attr("y2", function(d) { return yScale(d.frameLength) + 3; }); + group.append("line") + .attr("x1", function(d) { return xScale(d.complexity) - 3; }) + .attr("x2", function(d) { return xScale(d.complexity) + 3; }) + .attr("y1", function(d) { return yScale(d.frameLength) + 3; }) + .attr("y2", function(d) { return yScale(d.frameLength) - 3; }); + + group = svg.append("g") + .attr("class", "series average") + .selectAll("circle") + .data(data[Strings.json.complexityAverage]) + .enter(); + group.append("circle") + .attr("cx", function(d) { return xScale(d.complexity); }) + .attr("cy", function(d) { return yScale(d.frameLength); }) + .attr("r", 3) + group.append("line") + .attr("x1", function(d) { return xScale(d.complexity); }) + .attr("x2", function(d) { return xScale(d.complexity); }) + .attr("y1", function(d) { return yScale(d.frameLength - d.stdev); }) + .attr("y2", function(d) { return yScale(d.frameLength + d.stdev); }); + + // Cursor + var cursorGroup = svg.append("g").attr("class", "cursor hidden"); + cursorGroup.append("line") + .attr("class", "x") + .attr("x1", 0) + .attr("x2", 0) + .attr("y1", yScale(yAxis.scale().domain()[0]) + 10) + .attr("y2", yScale(yAxis.scale().domain()[1])); + cursorGroup.append("line") + .attr("class", "y") + .attr("x1", xScale(xAxis.scale().domain()[0]) - 10) + .attr("x2", xScale(xAxis.scale().domain()[1])) + .attr("y1", 0) + .attr("y2", 0) + cursorGroup.append("text") + .attr("class", "label x") + .attr("x", 0) + .attr("y", yScale(yAxis.scale().domain()[0]) + 15) + .attr("baseline-shift", "-100%") + .attr("text-anchor", "middle"); + cursorGroup.append("text") + .attr("class", "label y") + .attr("x", xScale(xAxis.scale().domain()[0]) - 15) + .attr("y", 0) + .attr("baseline-shift", "-30%") + .attr("text-anchor", "end"); + // Area to handle mouse events + var area = svg.append("rect") + .attr("fill", "transparent") + .attr("x", 0) + .attr("y", 0) + .attr("width", size.width) + .attr("height", size.height); + + area.on("mouseover", function() { + document.querySelector("#complexity-graph .cursor").classList.remove("hidden"); + }).on("mouseout", function() { + document.querySelector("#complexity-graph .cursor").classList.add("hidden"); + }).on("mousemove", function() { + var location = d3.mouse(this); + var location_domain = [xScale.invert(location[0]), yScale.invert(location[1])]; + cursorGroup.select("line.x") + .attr("x1", location[0]) + .attr("x2", location[0]); + cursorGroup.select("text.x") + .attr("x", location[0]) + .text(location_domain[0].toFixed(1)); + cursorGroup.select("line.y") + .attr("y1", location[1]) + .attr("y2", location[1]); + cursorGroup.select("text.y") + .attr("y", location[1]) + .text((1000 / location_domain[1]).toFixed(1)); + }); + }, + + createTimeGraph: function(result, samples, marks, regressions, options, margins, size) + { + var svg = d3.select("#test-graph-data").append("svg") + .attr("id", "time-graph") + .attr("width", size.width + margins.left + margins.right) + .attr("height", size.height + margins.top + margins.bottom) + .append("g") + .attr("transform", "translate(" + margins.left + "," + margins.top + ")"); + + // Axis scales + var x = d3.scale.linear() + .range([0, size.width]) + .domain([ + Math.min(d3.min(samples, function(s) { return s.time; }), 0), + d3.max(samples, function(s) { return s.time; })]); + var complexityMax = d3.max(samples, function(s) { + if (s.time > 0) + return s.complexity; + return 0; + }); + + var yLeft = d3.scale.linear() + .range([size.height, 0]) + .domain([0, complexityMax]); + var yRight = d3.scale.linear() + .range([size.height, 0]) + .domain([1000/20, 1000/60]); + + // Axes + var xAxis = d3.svg.axis() + .scale(x) + .orient("bottom") + .tickFormat(function(d) { return (d/1000).toFixed(0); }); + var yAxisLeft = d3.svg.axis() + .scale(yLeft) + .orient("left"); + var yAxisRight = d3.svg.axis() + .scale(yRight) + .tickValues([1000/20, 1000/25, 1000/30, 1000/35, 1000/40, 1000/45, 1000/50, 1000/55, 1000/60]) + .tickFormat(function(d) { return (1000/d).toFixed(0); }) + .orient("right"); + + // x-axis + svg.append("g") + .attr("class", "x axis") + .attr("fill", "rgb(235, 235, 235)") + .attr("transform", "translate(0," + size.height + ")") + .call(xAxis) + .append("text") + .attr("class", "label") + .attr("x", size.width) + .attr("y", -6) + .attr("fill", "rgb(235, 235, 235)") + .style("text-anchor", "end") + .text("time"); + + // yLeft-axis + svg.append("g") + .attr("class", "yLeft axis") + .attr("fill", "#7ADD49") + .call(yAxisLeft) + .append("text") + .attr("class", "label") + .attr("transform", "rotate(-90)") + .attr("y", 6) + .attr("fill", "#7ADD49") + .attr("dy", ".71em") + .style("text-anchor", "end") + .text(Strings.text.complexity); + + // yRight-axis + svg.append("g") + .attr("class", "yRight axis") + .attr("fill", "#FA4925") + .attr("transform", "translate(" + size.width + ", 0)") + .call(yAxisRight) + .append("text") + .attr("class", "label") + .attr("x", 9) + .attr("y", -20) + .attr("fill", "#FA4925") + .attr("dy", ".71em") + .style("text-anchor", "start") + .text(Strings.text.frameRate); + + // marks + var yMin = yRight(yAxisRight.scale().domain()[0]); + var yMax = yRight(yAxisRight.scale().domain()[1]); + for (var markName in marks) { + var mark = marks[markName]; + var xLocation = x(mark.time); + + var markerGroup = svg.append("g") + .attr("class", "marker") + .attr("transform", "translate(" + xLocation + ", 0)"); + markerGroup.append("text") + .attr("transform", "translate(10, " + (yMin - 10) + ") rotate(-90)") + .style("text-anchor", "start") + .text(markName) + markerGroup.append("line") + .attr("x1", 0) + .attr("x2", 0) + .attr("y1", yMin) + .attr("y2", yMax); + } + + if (Strings.json.controller in result) { + var complexity = result[Strings.json.controller]; + var regression = svg.append("g") + .attr("class", "complexity mean"); + this._addRegressionLine(regression, x, yLeft, [[samples[0].time, complexity.average], [samples[samples.length - 1].time, complexity.average]], complexity.stdev); + } + if (Strings.json.frameLength in result) { + var frameLength = result[Strings.json.frameLength]; + var regression = svg.append("g") + .attr("class", "fps mean"); + this._addRegressionLine(regression, x, yRight, [[samples[0].time, 1000/frameLength.average], [samples[samples.length - 1].time, 1000/frameLength.average]], frameLength.stdev); + } + + // right-target + if (options["controller"] == "adaptive") { + var targetFrameLength = 1000 / options["frame-rate"]; + svg.append("line") + .attr("x1", x(0)) + .attr("x2", size.width) + .attr("y1", yRight(targetFrameLength)) + .attr("y2", yRight(targetFrameLength)) + .attr("class", "target-fps marker"); + } + + // Cursor + var cursorGroup = svg.append("g").attr("class", "cursor"); + cursorGroup.append("line") + .attr("x1", 0) + .attr("x2", 0) + .attr("y1", yMin) + .attr("y2", yMin); + + // Data + var allData = samples; + var filteredData = samples.filter(function (sample) { + return "smoothedFrameLength" in sample; + }); + + function addData(name, data, yCoordinateCallback, pointRadius, omitLine) { + var svgGroup = svg.append("g").attr("id", name); + if (!omitLine) { + svgGroup.append("path") + .datum(data) + .attr("d", d3.svg.line() + .x(function(d) { return x(d.time); }) + .y(yCoordinateCallback)); + } + svgGroup.selectAll("circle") + .data(data) + .enter() + .append("circle") + .attr("cx", function(d) { return x(d.time); }) + .attr("cy", yCoordinateCallback) + .attr("r", pointRadius); + + cursorGroup.append("circle") + .attr("class", name) + .attr("r", pointRadius + 2); + } + + addData("complexity", allData, function(d) { return yLeft(d.complexity); }, 2); + addData("rawFPS", allData, function(d) { return yRight(d.frameLength); }, 1); + addData("filteredFPS", filteredData, function(d) { return yRight(d.smoothedFrameLength); }, 2); + + // regressions + var regressionGroup = svg.append("g") + .attr("id", "regressions"); + if (regressions) { + var complexities = []; + regressions.forEach(function (regression) { + if (!isNaN(regression.segment1[0][1]) && !isNaN(regression.segment1[1][1])) { + regressionGroup.append("line") + .attr("x1", x(regression.segment1[0][0])) + .attr("x2", x(regression.segment1[1][0])) + .attr("y1", yRight(regression.segment1[0][1])) + .attr("y2", yRight(regression.segment1[1][1])); + } + if (!isNaN(regression.segment2[0][1]) && !isNaN(regression.segment2[1][1])) { + regressionGroup.append("line") + .attr("x1", x(regression.segment2[0][0])) + .attr("x2", x(regression.segment2[1][0])) + .attr("y1", yRight(regression.segment2[0][1])) + .attr("y2", yRight(regression.segment2[1][1])); + } + // inflection point + regressionGroup.append("circle") + .attr("cx", x(regression.segment1[1][0])) + .attr("cy", yLeft(regression.complexity)) + .attr("r", 5); + complexities.push(regression.complexity); + }); + if (complexities.length) { + var yLeftComplexities = d3.svg.axis() + .scale(yLeft) + .tickValues(complexities) + .tickSize(10) + .orient("left"); + svg.append("g") + .attr("class", "complexity yLeft axis") + .call(yLeftComplexities); + } + } + + // Area to handle mouse events + var area = svg.append("rect") + .attr("fill", "transparent") + .attr("x", 0) + .attr("y", 0) + .attr("width", size.width) + .attr("height", size.height); + + var timeBisect = d3.bisector(function(d) { return d.time; }).right; + var statsToHighlight = ["complexity", "rawFPS", "filteredFPS"]; + area.on("mouseover", function() { + document.querySelector("#time-graph .cursor").classList.remove("hidden"); + document.querySelector("#test-graph nav").classList.remove("hide-data"); + }).on("mouseout", function() { + document.querySelector("#time-graph .cursor").classList.add("hidden"); + document.querySelector("#test-graph nav").classList.add("hide-data"); + }).on("mousemove", function() { + var form = document.forms["time-graph-options"].elements; + + var mx_domain = x.invert(d3.mouse(this)[0]); + var index = Math.min(timeBisect(allData, mx_domain), allData.length - 1); + var data = allData[index]; + var cursor_x = x(data.time); + var cursor_y = yAxisRight.scale().domain()[1]; + var ys = [yRight(yAxisRight.scale().domain()[0]), yRight(yAxisRight.scale().domain()[1])]; + + document.querySelector("#test-graph nav .time").textContent = (data.time / 1000).toFixed(4) + "s (" + index + ")"; + statsToHighlight.forEach(function(name) { + var element = document.querySelector("#test-graph nav ." + name); + var content = ""; + var data_y = null; + switch (name) { + case "complexity": + content = data.complexity; + data_y = yLeft(data.complexity); + break; + case "rawFPS": + content = (1000/data.frameLength).toFixed(2); + data_y = yRight(data.frameLength); + break; + case "filteredFPS": + if ("smoothedFrameLength" in data) { + content = (1000/data.smoothedFrameLength).toFixed(2); + data_y = yRight(data.smoothedFrameLength); + } + break; + } + + element.textContent = content; + + if (form[name].checked && data_y !== null) { + ys.push(data_y); + cursorGroup.select("." + name) + .attr("cx", cursor_x) + .attr("cy", data_y); + document.querySelector("#time-graph .cursor ." + name).classList.remove("hidden"); + } else + document.querySelector("#time-graph .cursor ." + name).classList.add("hidden"); + }); + + if (form["rawFPS"].checked) + cursor_y = Math.max(cursor_y, data.frameLength); + cursorGroup.select("line") + .attr("x1", cursor_x) + .attr("x2", cursor_x) + .attr("y1", Math.min.apply(null, ys)) + .attr("y2", Math.max.apply(null, ys)); + + }); + }, + + _showOrHideNodes: function(isShown, selector) { + var nodeList = document.querySelectorAll(selector); + if (isShown) { + for (var i = 0; i < nodeList.length; ++i) + nodeList[i].classList.remove("hidden"); + } else { + for (var i = 0; i < nodeList.length; ++i) + nodeList[i].classList.add("hidden"); + } + }, + + onComplexityGraphOptionsChanged: function() { + var form = document.forms["complexity-graph-options"].elements; + benchmarkController._showOrHideNodes(form["series-raw"].checked, "#complexity-graph .series.raw"); + benchmarkController._showOrHideNodes(form["series-average"].checked, "#complexity-graph .series.average"); + benchmarkController._showOrHideNodes(form["regression-time-score"].checked, "#complexity-graph .mean.complexity"); + benchmarkController._showOrHideNodes(form["bootstrap-score"].checked, "#complexity-graph .bootstrap"); + benchmarkController._showOrHideNodes(form["complexity-regression-aggregate-raw"].checked, "#complexity-graph .regression.raw"); + benchmarkController._showOrHideNodes(form["complexity-regression-aggregate-average"].checked, "#complexity-graph .regression.average"); + }, + + onTimeGraphOptionsChanged: function() { + var form = document.forms["time-graph-options"].elements; + benchmarkController._showOrHideNodes(form["markers"].checked, ".marker"); + benchmarkController._showOrHideNodes(form["averages"].checked, "#test-graph-data .mean"); + benchmarkController._showOrHideNodes(form["complexity"].checked, "#complexity"); + benchmarkController._showOrHideNodes(form["rawFPS"].checked, "#rawFPS"); + benchmarkController._showOrHideNodes(form["filteredFPS"].checked, "#filteredFPS"); + benchmarkController._showOrHideNodes(form["regressions"].checked, "#regressions"); + }, + + onGraphTypeChanged: function() { + var form = document.forms["graph-type"].elements; + var testResult = document.getElementById("test-graph-data")._testResult; + var isTimeSelected = form["graph-type"].value == "time"; + + benchmarkController._showOrHideNodes(isTimeSelected, "#time-graph"); + benchmarkController._showOrHideNodes(isTimeSelected, "form[name=time-graph-options]"); + benchmarkController._showOrHideNodes(!isTimeSelected, "#complexity-graph"); + benchmarkController._showOrHideNodes(!isTimeSelected, "form[name=complexity-graph-options]"); + + var score = "", mean = ""; + if (isTimeSelected) { + score = testResult[Strings.json.score].toFixed(2); + + var regression = testResult[Strings.json.controller]; + mean = [ + "mean: ", + regression.average.toFixed(2), + " ± ", + regression.stdev.toFixed(2), + " (", + regression.percent.toFixed(2), + "%)"]; + if (regression.concern) { + mean = mean.concat([ + ", worst 5%: ", + regression.concern.toFixed(2)]); + } + mean = mean.join(""); + } else { + var complexityRegression = testResult[Strings.json.complexity]; + var complexityAverageRegression = testResult[Strings.json.complexityAverage]; + + document.getElementById("complexity-regression-aggregate-raw").textContent = complexityRegression.complexity.toFixed(2) + ", ±" + complexityRegression.stdev.toFixed(2) + "ms"; + document.getElementById("complexity-regression-aggregate-average").textContent = complexityAverageRegression.complexity.toFixed(2) + ", ±" + complexityAverageRegression.stdev.toFixed(2) + "ms"; + + var bootstrap = complexityRegression[Strings.json.bootstrap]; + if (bootstrap) { + score = bootstrap.median.toFixed(2); + mean = [ + (bootstrap.confidencePercentage * 100).toFixed(0), + "% CI: ", + bootstrap.confidenceLow.toFixed(2), + "–", + bootstrap.confidenceHigh.toFixed(2) + ].join(""); + } + } + + sectionsManager.setSectionScore("test-graph", score, mean); + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/tests.js b/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/tests.js new file mode 100644 index 0000000000..accaa3c3df --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/debug-runner/tests.js @@ -0,0 +1,345 @@ +Utilities.extendObject(Strings.text, { + samples: "Samples", + complexity: "Time Complexity", + frameRate: "FPS", + confidenceInterval: "80% Confidence Interval", + mergedRawComplexity: "Raw Complexity", + graph: "Graph" +}); + + +Utilities.extendObject(Headers, { + details: [ + { + title: Strings.text.graph + }, + { + title: Strings.text.confidenceInterval, + children: + [ + { + text: function(data) { + return data[Strings.json.complexity][Strings.json.bootstrap].confidenceLow.toFixed(2); + }, + className: "right pad-left pad-right" + }, + { + text: function(data) { + return " - " + data[Strings.json.complexity][Strings.json.bootstrap].confidenceHigh.toFixed(2); + }, + className: "left" + }, + { + text: function(data) { + var bootstrap = data[Strings.json.complexity][Strings.json.bootstrap]; + return (100 * (bootstrap.confidenceLow / bootstrap.median - 1)).toFixed(2) + "%"; + }, + className: "left pad-left small" + }, + { + text: function(data) { + var bootstrap = data[Strings.json.complexity][Strings.json.bootstrap]; + return "+" + (100 * (bootstrap.confidenceHigh / bootstrap.median - 1)).toFixed(2) + "%"; + }, + className: "left pad-left small" + } + ] + }, + { + title: Strings.text.complexity, + children: + [ + { + text: function(data) { + return data[Strings.json.controller][Strings.json.measurements.average].toFixed(2); + }, + className: "average" + }, + { + text: function(data) { + return [ + "± ", + data[Strings.json.controller][Strings.json.measurements.percent].toFixed(2), + "%" + ].join(""); + }, + className: function(data) { + var className = "stdev"; + + if (data[Strings.json.controller][Strings.json.measurements.percent] >= 10) + className += " noisy-results"; + return className; + } + } + ] + }, + { + title: Strings.text.frameRate, + children: + [ + { + text: function(data) { + return data[Strings.json.frameLength][Strings.json.measurements.average].toFixed(2); + }, + className: function(data, options) { + var className = "average"; + if (Math.abs(data[Strings.json.frameLength][Strings.json.measurements.average] - options["frame-rate"]) >= 2) + className += " noisy-results"; + return className; + } + }, + { + text: function(data) { + var frameRateData = data[Strings.json.frameLength]; + return [ + "± ", + frameRateData[Strings.json.measurements.percent].toFixed(2), + "%" + ].join(""); + }, + className: function(data) { + var className = "stdev"; + + if (data[Strings.json.frameLength][Strings.json.measurements.percent] >= 10) + className += " noisy-results"; + return className; + } + } + ] + }, + { + title: Strings.text.mergedRawComplexity, + children: + [ + { + text: function(data) { + return data[Strings.json.complexity][Strings.json.complexity].toFixed(2); + }, + className: "average" + }, + { + text: function(data) { + return [ + "± ", + data[Strings.json.complexity][Strings.json.measurements.stdev].toFixed(2), + "ms" + ].join(""); + }, + className: "stdev" + } + ] + } + ] +}) + +/////////// +// Suites + +Suites.push(new Suite("HTML suite", + [ + { + url: "bouncing-particles/bouncing-css-shapes.html?particleWidth=12&particleHeight=12&shape=circle", + name: "CSS bouncing circles" + }, + { + url: "bouncing-particles/bouncing-css-shapes.html?particleWidth=40&particleHeight=40&shape=rect&clip=star", + name: "CSS bouncing clipped rects" + }, + { + url: "bouncing-particles/bouncing-css-shapes.html?particleWidth=50&particleHeight=50&shape=circle&fill=gradient", + name: "CSS bouncing gradient circles" + }, + { + url: "bouncing-particles/bouncing-css-shapes.html?particleWidth=80&particleHeight=80&shape=circle&blend", + name: "CSS bouncing blend circles" + }, + { + url: "bouncing-particles/bouncing-css-shapes.html?particleWidth=80&particleHeight=80&shape=circle&filter", + name: "CSS bouncing filter circles" + }, + { + url: "bouncing-particles/bouncing-css-images.html?particleWidth=80&particleHeight=80&imageSrc=../resources/yin-yang.svg", + name: "CSS bouncing SVG images" + }, + { + url: "bouncing-particles/bouncing-tagged-images.html?particleWidth=100&particleHeight=100", + name: "CSS bouncing tagged images" + }, + { + url: "dom/leaves.html", + name: "Leaves 2.0" + }, + { + url: "dom/focus.html", + name: "Focus 2.0" + }, + { + url: "dom/particles.html", + name: "DOM particles, SVG masks" + }, + { + url: "dom/compositing-transforms.html?particleWidth=50&particleHeight=50&filters=yes&imageSrc=../resources/yin-yang.svg", + name: "Composited Transforms" + } + ] +)); + +Suites.push(new Suite("Canvas suite", + [ + { + url: "bouncing-particles/bouncing-canvas-shapes.html?particleWidth=40&particleHeight=40&shape=rect&clip=star", + name: "canvas bouncing clipped rects" + }, + { + url: "bouncing-particles/bouncing-canvas-shapes.html?particleWidth=50&particleHeight=50&shape=circle&fill=gradient", + name: "canvas bouncing gradient circles" + }, + { + url: "bouncing-particles/bouncing-canvas-images.html?particleWidth=80&particleHeight=80&imageSrc=../resources/yin-yang.svg", + name: "canvas bouncing SVG images" + }, + { + url: "bouncing-particles/bouncing-canvas-images.html?particleWidth=80&particleHeight=80&imageSrc=../resources/yin-yang.png", + name: "canvas bouncing PNG images" + }, + { + url: "simple/simple-canvas-paths.html?pathType=strokes", + name: "Stroke shapes" + }, + { + url: "simple/simple-canvas-paths.html?pathType=fills", + name: "Fill shapes" + }, + { + url: "simple/tiled-canvas-image.html", + name: "Canvas put/get image data" + }, + ] +)); + +Suites.push(new Suite("SVG suite", + [ + { + url: "bouncing-particles/bouncing-svg-shapes.html?particleWidth=12&particleHeight=12&shape=circle", + name: "SVG bouncing circles", + }, + { + url: "bouncing-particles/bouncing-svg-shapes.html?particleWidth=40&particleHeight=40&shape=rect&clip=star", + name: "SVG bouncing clipped rects", + }, + { + url: "bouncing-particles/bouncing-svg-shapes.html?particleWidth=50&particleHeight=50&shape=circle&fill=gradient", + name: "SVG bouncing gradient circles" + }, + { + url: "bouncing-particles/bouncing-svg-images.html?particleWidth=80&particleHeight=80&imageSrc=../resources/yin-yang.svg", + name: "SVG bouncing SVG images" + }, + { + url: "bouncing-particles/bouncing-svg-images.html?particleWidth=80&particleHeight=80&imageSrc=../resources/yin-yang.png", + name: "SVG bouncing PNG images" + }, + ] +)); + +Suites.push(new Suite("3D Graphics", + [ + { + url: "3d/webgl.html", + name: "WebGL" + }, + ] +)); + +Suites.push(new Suite("Basic canvas path suite", + [ + { + url: "simple/simple-canvas-paths.html?pathType=line&lineCap=butt", + name: "Canvas line segments, butt caps" + }, + { + url: "simple/simple-canvas-paths.html?pathType=line&lineCap=round", + name: "Canvas line segments, round caps" + }, + { + url: "simple/simple-canvas-paths.html?pathType=line&lineCap=square", + name: "Canvas line segments, square caps" + }, + { + url: "simple/simple-canvas-paths.html?pathType=linePath&lineJoin=bevel", + name: "Canvas line path, bevel join" + }, + { + url: "simple/simple-canvas-paths.html?pathType=linePath&lineJoin=round", + name: "Canvas line path, round join" + }, + { + url: "simple/simple-canvas-paths.html?pathType=linePath&lineJoin=miter", + name: "Canvas line path, miter join" + }, + { + url: "simple/simple-canvas-paths.html?pathType=linePath&lineDash=1", + name: "Canvas line path with dash pattern" + }, + { + url: "simple/simple-canvas-paths.html?pathType=quadratic", + name: "Canvas quadratic segments" + }, + { + url: "simple/simple-canvas-paths.html?pathType=quadraticPath", + name: "Canvas quadratic path" + }, + { + url: "simple/simple-canvas-paths.html?pathType=bezier", + name: "Canvas bezier segments" + }, + { + url: "simple/simple-canvas-paths.html?pathType=bezierPath", + name: "Canvas bezier path" + }, + { + url: "simple/simple-canvas-paths.html?&pathType=arcTo", + name: "Canvas arcTo segments" + }, + { + url: "simple/simple-canvas-paths.html?pathType=arc", + name: "Canvas arc segments" + }, + { + url: "simple/simple-canvas-paths.html?pathType=rect", + name: "Canvas rects" + }, + { + url: "simple/simple-canvas-paths.html?pathType=ellipse", + name: "Canvas ellipses" + }, + { + url: "simple/simple-canvas-paths.html?pathType=lineFill", + name: "Canvas line path, fill" + }, + { + url: "simple/simple-canvas-paths.html?pathType=quadraticFill", + name: "Canvas quadratic path, fill" + }, + { + url: "simple/simple-canvas-paths.html?pathType=bezierFill", + name: "Canvas bezier path, fill" + }, + { + url: "simple/simple-canvas-paths.html?&pathType=arcToFill", + name: "Canvas arcTo segments, fill" + }, + { + url: "simple/simple-canvas-paths.html?pathType=arcFill", + name: "Canvas arc segments, fill" + }, + { + url: "simple/simple-canvas-paths.html?pathType=rectFill", + name: "Canvas rects, fill" + }, + { + url: "simple/simple-canvas-paths.html?pathType=ellipseFill", + name: "Canvas ellipses, fill" + } + ] +)); diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/extensions.js b/third_party/webkit/PerformanceTests/MotionMark/resources/extensions.js new file mode 100644 index 0000000000..fb9d500877 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/extensions.js @@ -0,0 +1,670 @@ +Utilities = +{ + _parse: function(str, sep) + { + var output = {}; + str.split(sep).forEach(function(part) { + var item = part.split("="); + var value = decodeURIComponent(item[1]); + if (value[0] == "'" ) + output[item[0]] = value.substr(1, value.length - 2); + else + output[item[0]] = value; + }); + return output; + }, + + parseParameters: function() + { + return this._parse(window.location.search.substr(1), "&"); + }, + + parseArguments: function(str) + { + return this._parse(str, " "); + }, + + extendObject: function(obj1, obj2) + { + for (var attrname in obj2) + obj1[attrname] = obj2[attrname]; + return obj1; + }, + + copyObject: function(obj) + { + return this.extendObject({}, obj); + }, + + mergeObjects: function(obj1, obj2) + { + return this.extendObject(this.copyObject(obj1), obj2); + }, + + createClass: function(classConstructor, classMethods) + { + classConstructor.prototype = classMethods; + return classConstructor; + }, + + createSubclass: function(superclass, classConstructor, classMethods) + { + classConstructor.prototype = Object.create(superclass.prototype); + classConstructor.prototype.constructor = classConstructor; + if (classMethods) + Utilities.extendObject(classConstructor.prototype, classMethods); + return classConstructor; + }, + + createElement: function(name, attrs, parentElement) + { + var element = document.createElement(name); + + for (var key in attrs) + element.setAttribute(key, attrs[key]); + + parentElement.appendChild(element); + return element; + }, + + createSVGElement: function(name, attrs, xlinkAttrs, parentElement) + { + const svgNamespace = "http://www.w3.org/2000/svg"; + const xlinkNamespace = "http://www.w3.org/1999/xlink"; + + var element = document.createElementNS(svgNamespace, name); + + for (var key in attrs) + element.setAttribute(key, attrs[key]); + + for (var key in xlinkAttrs) + element.setAttributeNS(xlinkNamespace, key, xlinkAttrs[key]); + + parentElement.appendChild(element); + return element; + }, + + browserPrefix: function() + { + // Get the HTML element's CSSStyleDeclaration + var styles = window.getComputedStyle(document.documentElement, ''); + + // Convert the styles list to an array + var stylesArray = Array.prototype.slice.call(styles); + + // Concatenate all the styles in one big string + var stylesString = stylesArray.join(''); + + // Search the styles string for a known prefix type, settle on Opera if none is found. + var prefixes = stylesString.match(/-(moz|webkit|ms)-/) || (styles.OLink === '' && ['', 'o']); + + // prefixes has two elements; e.g. for webkit it has ['-webkit-', 'webkit']; + var prefix = prefixes[1]; + + // Have 'O' before 'Moz' in the string so it is matched first. + var dom = ('WebKit|O|Moz|MS').match(new RegExp(prefix, 'i'))[0]; + + // Return all the required prefixes. + return { + dom: dom, + lowercase: prefix, + css: '-' + prefix + '-', + js: prefix[0].toUpperCase() + prefix.substr(1) + }; + }, + + setElementPrefixedProperty: function(element, property, value) + { + element.style[property] = element.style[this.browserPrefix().js + property[0].toUpperCase() + property.substr(1)] = value; + }, + + stripNonASCIICharacters: function(inputString) + { + return inputString.replace(/[ .,]/g, ''); + }, + + convertObjectToQueryString: function(object) + { + var queryString = []; + for (var property in object) { + if (object.hasOwnProperty(property)) + queryString.push(encodeURIComponent(property) + "=" + encodeURIComponent(object[property])); + } + return "?" + queryString.join("&"); + }, + + convertQueryStringToObject: function(queryString) + { + queryString = queryString.substring(1); + if (!queryString) + return null; + + var object = {}; + queryString.split("&").forEach(function(parameter) { + var components = parameter.split("="); + object[components[0]] = components[1]; + }); + return object; + }, + + progressValue: function(value, min, max) + { + return (value - min) / (max - min); + }, + + lerp: function(value, min, max) + { + return min + (max - min) * value; + }, + + toFixedNumber: function(number, precision) + { + if (number.toFixed) + return Number(number.toFixed(precision)); + return number; + } +}; + +Array.prototype.swap = function(i, j) +{ + var t = this[i]; + this[i] = this[j]; + this[j] = t; + return this; +} + +if (!Array.prototype.fill) { + Array.prototype.fill = function(value) { + if (this == null) + throw new TypeError('Array.prototype.fill called on null or undefined'); + + var object = Object(this); + var len = parseInt(object.length, 10); + var start = arguments[1]; + var relativeStart = parseInt(start, 10) || 0; + var k = relativeStart < 0 ? Math.max(len + relativeStart, 0) : Math.min(relativeStart, len); + var end = arguments[2]; + var relativeEnd = end === undefined ? len : (parseInt(end) || 0) ; + var final = relativeEnd < 0 ? Math.max(len + relativeEnd, 0) : Math.min(relativeEnd, len); + + for (; k < final; k++) + object[k] = value; + + return object; + }; +} + +if (!Array.prototype.find) { + Array.prototype.find = function(predicate) { + if (this == null) + throw new TypeError('Array.prototype.find called on null or undefined'); + if (typeof predicate !== 'function') + throw new TypeError('predicate must be a function'); + + var list = Object(this); + var length = list.length >>> 0; + var thisArg = arguments[1]; + var value; + + for (var i = 0; i < length; i++) { + value = list[i]; + if (predicate.call(thisArg, value, i, list)) + return value; + } + return undefined; + }; +} + +Array.prototype.shuffle = function() +{ + for (var index = this.length - 1; index >= 0; --index) { + var randomIndex = Math.floor(Math.random() * (index + 1)); + this.swap(index, randomIndex); + } + return this; +} + +Point = Utilities.createClass( + function(x, y) + { + this.x = x; + this.y = y; + }, { + + // Used when the point object is used as a size object. + get width() + { + return this.x; + }, + + // Used when the point object is used as a size object. + get height() + { + return this.y; + }, + + // Used when the point object is used as a size object. + get center() + { + return new Point(this.x / 2, this.y / 2); + }, + + str: function() + { + return "x = " + this.x + ", y = " + this.y; + }, + + add: function(other) + { + if(isNaN(other.x)) + return new Point(this.x + other, this.y + other); + return new Point(this.x + other.x, this.y + other.y); + }, + + subtract: function(other) + { + if(isNaN(other.x)) + return new Point(this.x - other, this.y - other); + return new Point(this.x - other.x, this.y - other.y); + }, + + multiply: function(other) + { + if(isNaN(other.x)) + return new Point(this.x * other, this.y * other); + return new Point(this.x * other.x, this.y * other.y); + }, + + move: function(angle, velocity, timeDelta) + { + return this.add(Point.pointOnCircle(angle, velocity * (timeDelta / 1000))); + }, + + length: function() { + return Math.sqrt( this.x * this.x + this.y * this.y ); + }, + + normalize: function() { + var l = Math.sqrt( this.x * this.x + this.y * this.y ); + this.x /= l; + this.y /= l; + return this; + } +}); + +Utilities.extendObject(Point, { + zero: new Point(0, 0), + + pointOnCircle: function(angle, radius) + { + return new Point(radius * Math.cos(angle), radius * Math.sin(angle)); + }, + + pointOnEllipse: function(angle, radiuses) + { + return new Point(radiuses.x * Math.cos(angle), radiuses.y * Math.sin(angle)); + }, + + elementClientSize: function(element) + { + var rect = element.getBoundingClientRect(); + return new Point(rect.width, rect.height); + } +}); + +Insets = Utilities.createClass( + function(top, right, bottom, left) + { + this.top = top; + this.right = right; + this.bottom = bottom; + this.left = left; + }, { + + get width() + { + return this.left + this.right; + }, + + get height() + { + return this.top + this.bottom; + }, + + get size() + { + return new Point(this.width, this.height); + } +}); + +Insets.elementPadding = function(element) +{ + var styles = window.getComputedStyle(element); + return new Insets( + parseFloat(styles.paddingTop), + parseFloat(styles.paddingRight), + parseFloat(styles.paddingBottom), + parseFloat(styles.paddingTop)); +} + +UnitBezier = Utilities.createClass( + function(point1, point2) + { + // First and last points in the Bézier curve are assumed to be (0,0) and (!,1) + this._c = point1.multiply(3); + this._b = point2.subtract(point1).multiply(3).subtract(this._c); + this._a = new Point(1, 1).subtract(this._c).subtract(this._b); + }, { + + epsilon: 1e-5, + derivativeEpsilon: 1e-6, + + solve: function(x) + { + return this.sampleY(this.solveForT(x)); + }, + + sampleX: function(t) + { + return ((this._a.x * t + this._b.x) * t + this._c.x) * t; + }, + + sampleY: function(t) + { + return ((this._a.y * t + this._b.y) * t + this._c.y) * t; + }, + + sampleDerivativeX: function(t) + { + return(3 * this._a.x * t + 2 * this._b.x) * t + this._c.x; + }, + + solveForT: function(x) + { + var t0, t1, t2, x2, d2, i; + + for (t2 = x, i = 0; i < 8; ++i) { + x2 = this.sampleX(t2) - x; + if (Math.abs(x2) < this.epsilon) + return t2; + d2 = this.sampleDerivativeX(t2); + if (Math.abs(d2) < this.derivativeEpsilon) + break; + t2 = t2 - x2 / d2; + } + + t0 = 0; + t1 = 1; + t2 = x; + + if (t2 < t0) + return t0; + if (t2 > t1) + return t1; + + while (t0 < t1) { + x2 = this.sampleX(t2); + if (Math.abs(x2 - x) < this.epsilon) + return t2; + if (x > x2) + t0 = t2; + else + t1 = t2; + t2 = (t1 - t0) * .5 + t0; + } + + return t2; + } +}); + +SimplePromise = Utilities.createClass( + function() + { + this._chainedPromise = null; + this._callback = null; + }, { + + then: function (callback) + { + if (this._callback) + throw "SimplePromise doesn't support multiple calls to then"; + + this._callback = callback; + this._chainedPromise = new SimplePromise; + + if (this._resolved) + this.resolve(this._resolvedValue); + + return this._chainedPromise; + }, + + resolve: function (value) + { + if (!this._callback) { + this._resolved = true; + this._resolvedValue = value; + return; + } + + var result = this._callback(value); + if (result instanceof SimplePromise) { + var chainedPromise = this._chainedPromise; + result.then(function (result) { chainedPromise.resolve(result); }); + } else + this._chainedPromise.resolve(result); + } +}); + +var Heap = Utilities.createClass( + function(maxSize, compare) + { + this._maxSize = maxSize; + this._compare = compare; + this._size = 0; + this._values = new Array(this._maxSize); + }, { + + // This is a binary heap represented in an array. The root element is stored + // in the first element in the array. The root is followed by its two children. + // Then its four grandchildren and so on. So every level in the binary heap is + // doubled in the following level. Here is an example of the node indices and + // how they are related to their parents and children. + // =========================================================================== + // 0 1 2 3 4 5 6 + // PARENT -1 0 0 1 1 2 2 + // LEFT 1 3 5 7 9 11 13 + // RIGHT 2 4 6 8 10 12 14 + // =========================================================================== + _parentIndex: function(i) + { + return i > 0 ? Math.floor((i - 1) / 2) : -1; + }, + + _leftIndex: function(i) + { + var leftIndex = i * 2 + 1; + return leftIndex < this._size ? leftIndex : -1; + }, + + _rightIndex: function(i) + { + var rightIndex = i * 2 + 2; + return rightIndex < this._size ? rightIndex : -1; + }, + + // Return the child index that may violate the heap property at index i. + _childIndex: function(i) + { + var left = this._leftIndex(i); + var right = this._rightIndex(i); + + if (left != -1 && right != -1) + return this._compare(this._values[left], this._values[right]) > 0 ? left : right; + + return left != -1 ? left : right; + }, + + init: function() + { + this._size = 0; + }, + + top: function() + { + return this._size ? this._values[0] : NaN; + }, + + push: function(value) + { + if (this._size == this._maxSize) { + // If size is bounded and the new value can be a parent of the top() + // if the size were unbounded, just ignore the new value. + if (this._compare(value, this.top()) > 0) + return; + this.pop(); + } + this._values[this._size++] = value; + this._bubble(this._size - 1); + }, + + pop: function() + { + if (!this._size) + return NaN; + + this._values[0] = this._values[--this._size]; + this._sink(0); + }, + + _bubble: function(i) + { + // Fix the heap property at index i given that parent is the only node that + // may violate the heap property. + for (var pi = this._parentIndex(i); pi != -1; i = pi, pi = this._parentIndex(pi)) { + if (this._compare(this._values[pi], this._values[i]) > 0) + break; + + this._values.swap(pi, i); + } + }, + + _sink: function(i) + { + // Fix the heap property at index i given that each of the left and the right + // sub-trees satisfies the heap property. + for (var ci = this._childIndex(i); ci != -1; i = ci, ci = this._childIndex(ci)) { + if (this._compare(this._values[i], this._values[ci]) > 0) + break; + + this._values.swap(ci, i); + } + }, + + str: function() + { + var out = "Heap[" + this._size + "] = ["; + for (var i = 0; i < this._size; ++i) { + out += this._values[i]; + if (i < this._size - 1) + out += ", "; + } + return out + "]"; + }, + + values: function(size) { + // Return the last "size" heap elements values. + var values = this._values.slice(0, this._size); + return values.sort(this._compare).slice(0, Math.min(size, this._size)); + } +}); + +Utilities.extendObject(Heap, { + createMinHeap: function(maxSize) + { + return new Heap(maxSize, function(a, b) { return b - a; }); + }, + + createMaxHeap: function(maxSize) { + return new Heap(maxSize, function(a, b) { return a - b; }); + } +}); + +var SampleData = Utilities.createClass( + function(fieldMap, data) + { + this.fieldMap = fieldMap || {}; + this.data = data || []; + }, { + + get length() + { + return this.data.length; + }, + + addField: function(name, index) + { + this.fieldMap[name] = index; + }, + + push: function(datum) + { + this.data.push(datum); + }, + + sort: function(sortFunction) + { + this.data.sort(sortFunction); + }, + + slice: function(begin, end) + { + return new SampleData(this.fieldMap, this.data.slice(begin, end)); + }, + + forEach: function(iterationFunction) + { + this.data.forEach(iterationFunction); + }, + + createDatum: function() + { + return []; + }, + + getFieldInDatum: function(datum, fieldName) + { + if (typeof datum === 'number') + datum = this.data[datum]; + return datum[this.fieldMap[fieldName]]; + }, + + setFieldInDatum: function(datum, fieldName, value) + { + if (typeof datum === 'number') + datum = this.data[datum]; + return datum[this.fieldMap[fieldName]] = value; + }, + + at: function(index) + { + return this.data[index]; + }, + + toArray: function() + { + var array = []; + + this.data.forEach(function(datum) { + var newDatum = {}; + array.push(newDatum); + + for (var fieldName in this.fieldMap) { + var value = this.getFieldInDatum(datum, fieldName); + if (value !== null && value !== undefined) + newDatum[fieldName] = value; + } + }, this); + + return array; + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/runner/animometer.css b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/animometer.css new file mode 100644 index 0000000000..86da6bea1c --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/animometer.css @@ -0,0 +1,520 @@ +/* Outer harness */ + +html, +body { + min-height: 100%; +} + +body { + background-color: hsl(0, 0%, 95%); + + font-family: "Helvetica Neue", Helvetica, Verdana, sans-serif; + font-size: 15px; + + cursor: default; + + -webkit-user-select: none; +} + +body.showing-intro, +body.showing-results { + background-color: hsl(35, 100%, 100%); + background-image: url(crystal.svg), url(lines.svg); + background-size: auto 225%, auto 100%; + background-repeat: no-repeat; + + animation: background-fade 1s ease-in 1s, background-color 60s linear infinite 2s; + animation-play-state: paused; + + will-change: background-color; +} + +body.showing-test-container { + overflow: hidden; +} + +body.images-loaded { + animation-play-state: running; +} + +@media screen and (min-width: 667px) { + body { + font-size: 24px; + } + + body.showing-intro, + body.showing-results { + background-size: 200% 100%, 150% auto; + } +} + +@media screen and (min-width: 1025px) { + body.showing-intro, + body.showing-results { + background-size: 150% 100%, 150% auto; + } +} + +::selection { + background-color: black; + color: white; +} + +.hidden { + display: none; +} + +section { + display: none; +} + +section.selected { + display: block; +} + +svg.logo { + width: 350px; + height: 88px; + + max-width: 100%; + + padding-bottom: 1em; + + color: hsl(35, 100%, 50%); + + animation: foreground-color 60s linear infinite 2s; + animation-play-state: paused; + + will-change: color; +} + +body.images-loaded svg.logo { + animation-play-state: running; +} + +@media screen and (min-width: 667px) { + svg.logo { + width: 525px; + height: 130px; + } +} + +section .body { + margin: 0 1em; + max-width: 350px; +} + +section .body p { + margin: 1em 0; + line-height: 1.5em; + + -webkit-user-select: text; + cursor: text; +} + +@media screen and (min-width: 667px) { + section .body { + margin-left: 2.5em; + max-width: 500px; + transform: skewX(-10deg); + } + + section button { + transform: none; + } +} + +button { + background-color: hsl(35, 100%, 50%); + color: white; + + padding: 0.25em; + margin: 1.5em -0.25em 0 0; + + min-width: 50%; + + border: none; + + font-family: inherit; + font-size: inherit; + + transform: skewX(-10deg); + + transition: 100ms filter ease-in-out; + + animation: background-color 60s linear infinite 2s; + animation-play-state: paused; + + will-change: background-color; +} + +body.images-loaded button { + animation-play-state: running; +} + +button:hover { + filter: brightness(115%); +} + +button:active { + filter: brightness(130%); +} + +button:disabled { + opacity: 0.5; + filter: none !important; +} + +@media print { + button { + display: none; + } +} + +.portrait-orientation-check { + display: none; +} + +@media screen and (max-device-width: 1025px) and (orientation: portrait) { + .portrait-orientation-check { + display: block; + } +} + +@media screen and (max-device-width: 1025px) and (orientation: portrait) { + .landscape-orientation-check { + /* This keeps the button color animation in sync with page, while display: none does not. */ + visibility: hidden; + } +} + +@keyframes background-fade { + 100% { + background-color: hsl(35, 100%, 50%); + } +} + +@keyframes background-color { + 0%, 10% { + background-color: hsl(35, 100%, 50%); + } + + 12%, 20% { + background-color: hsl(75, 100%, 30%); + } + + 22%, 30% { + background-color: hsl(115, 100%, 30%); + } + + 32%, 40% { + background-color: hsl(155, 100%, 30%); + } + + 42%, 50% { + background-color: hsl(195, 100%, 30%); + } + + 52%, 60% { + background-color: hsl(235, 100%, 30%); + } + + 62%, 70% { + background-color: hsl(275, 100%, 30%); + } + + 72%, 80% { + background-color: hsl(315, 100%, 30%); + } + + 82%, 90% { + background-color: hsl(355, 100%, 30%); + } + + 92%, 100% { + background-color: hsl(395, 100%, 50%); + } +} + +@keyframes foreground-color { + 0%, 10% { + color: hsl(35, 100%, 50%); + } + + 12%, 20% { + color: hsl(75, 100%, 30%); + } + + 22%, 30% { + color: hsl(115, 100%, 30%); + } + + 32%, 40% { + color: hsl(155, 100%, 30%); + } + + 42%, 50% { + color: hsl(195, 100%, 30%); + } + + 52%, 60% { + color: hsl(235, 100%, 30%); + } + + 62%, 70% { + color: hsl(275, 100%, 30%); + } + + 72%, 80% { + color: hsl(315, 100%, 30%); + } + + 82%, 90% { + color: hsl(355, 100%, 30%); + } + + 92%, 100% { + color: hsl(395, 100%, 50%); + } +} + +/* Intro section, About page */ + +#intro, #about { + padding: 2em; +} + +#intro { + opacity: 0; + transition: opacity 500ms ease-in; +} + +body.images-loaded #intro { + opacity: 1; +} + +#about .body { + transform: none; + margin: 0; + max-width: initial; +} + +#about li { + line-height: 1.5em; +} + +#about button { + padding: .75em 2em; + margin: 1.5em auto 0; + min-width: initial; + transform: skewX(-10deg); +} + +@media screen and (min-width: 667px) { + #about .body { + font-size: .7em; + margin: 1em; + } + + #about ol, #about ul { + padding-left: 3em; + } +} + + +#intro a, #about a, +#intro a:visited, #about a:visited { + color: black; +} + +/* Running test section */ + +.frame-container { + position: absolute; + + top: 50%; + left: 50%; +} + +.frame-container > iframe { + width: 100%; + height: 100%; + + border: 0; + margin: 0; +} + +body.small .frame-container { + width: 568px; + height: 320px; + margin-left: -284px; + margin-top: -160px; +} + +body.medium .frame-container { + width: 900px; + height: 600px; + margin-left: -450px; + margin-top: -300px; +} + +body.large .frame-container { + width: 1600px; + height: 800px; + margin-left: -800px; + margin-top: -400px; +} + +/* Results section */ + +#results { + padding: 2em; +} + +#results .body { + -webkit-user-select: text; +} + +#results .score-container { + padding-bottom: 2em; +} + +#results .table-container { + position: relative; +} + +#results .table-container > div { + margin-left: 40%; +} + +#results .score { + font-size: 5em; + font-weight: bold; + font-style: italic; + line-height: 1; + margin: 0; +} + +#results .confidence { + font-size: 2em; + font-style: italic; + line-height: 1; + margin: 0; + text-indent: 1.75em; + color: hsl(0, 0%, 40%); + padding-bottom: .3em; +} + +#results table { + border-spacing: 0; + margin: 0; + padding: 0; + min-width: 25%; +} + +#results table td, +#results table th { + padding: 0.25em; +} + +#results table td.suites-separator { + padding: 0; +} + +#results table tr:nth-child(even) { + background-color: hsla(0, 0%, 0%, 0.05); +} + +#results #results-header { + top: 0; + left: 0; + width: 40%; + position: absolute; +} + +#results #results-score { + float: left; +} + +#results #results-data span { + font-size: .75em; + color: hsl(0, 0%, 40%); +} + +#results #results-header td, +#results #results-header th { + text-align: right; + padding-right: 1em !important; + padding-left: 0.5em !important; +} + +#results #results-score td, +#results #results-score th { + text-align: left; + padding-right: 0.5em !important; +} + +#results #results-score td { + cursor: text; +} + +@media screen and (min-width: 667px) { + #results .score, + #results .confidence { + font-style: normal; + } +} + +.detail span { + display: none; +} + +body.small .detail .small, +body.medium .detail .medium, +body.large .detail .large { + display: initial; +} + +#overlay { + position: fixed; + + top: 0; + left: 0; + bottom: 0; + right: 0; + + background: hsla(0, 0%, 100%, 0.9); +} + +@supports (-webkit-backdrop-filter: blur(10px)) { + #overlay { + background: hsla(0, 0%, 100%, 0.7); + -webkit-backdrop-filter: blur(20px); + } +} + +#overlay > div { + position: absolute; + + width: 500px; + height: 500px; + + margin-top: -250px; + margin-left: -250px; + + top: 50%; + left: 50%; +} + +#overlay > div div { + overflow: scroll; + + font-size: 12px; + -webkit-user-select: text; + cursor: text; + + max-height: 250px; + + border: 1px solid hsla(0, 0%, 0%, 0.1); + padding: 1em; +} diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/runner/animometer.js b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/animometer.js new file mode 100644 index 0000000000..65e8c5450d --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/animometer.js @@ -0,0 +1,626 @@ +ResultsDashboard = Utilities.createClass( + function(options, testData) + { + this._iterationsSamplers = []; + this._options = options; + this._results = null; + if (testData) { + this._iterationsSamplers = testData; + this._processData(); + } + }, { + + push: function(suitesSamplers) + { + this._iterationsSamplers.push(suitesSamplers); + }, + + _processData: function() + { + this._results = {}; + this._results[Strings.json.results.iterations] = []; + + var iterationsScores = []; + this._iterationsSamplers.forEach(function(iteration, index) { + var testsScores = []; + var testsLowerBoundScores = []; + var testsUpperBoundScores = []; + + var result = {}; + this._results[Strings.json.results.iterations][index] = result; + + var suitesResult = {}; + result[Strings.json.results.tests] = suitesResult; + + for (var suiteName in iteration) { + var suiteData = iteration[suiteName]; + + var suiteResult = {}; + suitesResult[suiteName] = suiteResult; + + for (var testName in suiteData) { + if (!suiteData[testName][Strings.json.result]) + this.calculateScore(suiteData[testName]); + + suiteResult[testName] = suiteData[testName][Strings.json.result]; + delete suiteData[testName][Strings.json.result]; + + testsScores.push(suiteResult[testName][Strings.json.score]); + testsLowerBoundScores.push(suiteResult[testName][Strings.json.scoreLowerBound]); + testsUpperBoundScores.push(suiteResult[testName][Strings.json.scoreUpperBound]); + } + } + + result[Strings.json.score] = Statistics.geometricMean(testsScores); + result[Strings.json.scoreLowerBound] = Statistics.geometricMean(testsLowerBoundScores); + result[Strings.json.scoreUpperBound] = Statistics.geometricMean(testsUpperBoundScores); + iterationsScores.push(result[Strings.json.score]); + }, this); + + this._results[Strings.json.score] = Statistics.sampleMean(iterationsScores.length, iterationsScores.reduce(function(a, b) { return a + b; })); + this._results[Strings.json.scoreLowerBound] = this._results[Strings.json.results.iterations][0][Strings.json.scoreLowerBound]; + this._results[Strings.json.scoreUpperBound] = this._results[Strings.json.results.iterations][0][Strings.json.scoreUpperBound]; + }, + + calculateScore: function(data) + { + var result = {}; + data[Strings.json.result] = result; + var samples = data[Strings.json.samples]; + + var desiredFrameLength = 1000/60; + if (this._options["controller"] == "ramp30") + desiredFrameLength = 1000/30; + + function findRegression(series, profile) { + var minIndex = Math.round(.025 * series.length); + var maxIndex = Math.round(.975 * (series.length - 1)); + var minComplexity = series.getFieldInDatum(minIndex, Strings.json.complexity); + var maxComplexity = series.getFieldInDatum(maxIndex, Strings.json.complexity); + + if (Math.abs(maxComplexity - minComplexity) < 20 && maxIndex - minIndex < 20) { + minIndex = 0; + maxIndex = series.length - 1; + minComplexity = series.getFieldInDatum(minIndex, Strings.json.complexity); + maxComplexity = series.getFieldInDatum(maxIndex, Strings.json.complexity); + } + + var complexityIndex = series.fieldMap[Strings.json.complexity]; + var frameLengthIndex = series.fieldMap[Strings.json.frameLength]; + var regressionOptions = { desiredFrameLength: desiredFrameLength }; + if (profile) + regressionOptions.preferredProfile = profile; + return { + minComplexity: minComplexity, + maxComplexity: maxComplexity, + samples: series.slice(minIndex, maxIndex + 1), + regression: new Regression( + series.data, + function (data, i) { return data[i][complexityIndex]; }, + function (data, i) { return data[i][frameLengthIndex]; }, + minIndex, maxIndex, regressionOptions) + }; + } + + var complexitySamples; + // Convert these samples into SampleData objects if needed + [Strings.json.complexity, Strings.json.complexityAverage, Strings.json.controller].forEach(function(seriesName) { + var series = samples[seriesName]; + if (series && !(series instanceof SampleData)) + samples[seriesName] = new SampleData(series.fieldMap, series.data); + }); + + var isRampController = ["ramp", "ramp30"].indexOf(this._options["controller"]) != -1; + var predominantProfile = ""; + if (isRampController) { + var profiles = {}; + data[Strings.json.controller].forEach(function(regression) { + if (regression[Strings.json.regressions.profile]) { + var profile = regression[Strings.json.regressions.profile]; + profiles[profile] = (profiles[profile] || 0) + 1; + } + }); + + var maxProfileCount = 0; + for (var profile in profiles) { + if (profiles[profile] > maxProfileCount) { + predominantProfile = profile; + maxProfileCount = profiles[profile]; + } + } + } + + [Strings.json.complexity, Strings.json.complexityAverage].forEach(function(seriesName) { + if (!(seriesName in samples)) + return; + + var regression = {}; + result[seriesName] = regression; + var regressionResult = findRegression(samples[seriesName], predominantProfile); + if (seriesName == Strings.json.complexity) + complexitySamples = regressionResult.samples; + var calculation = regressionResult.regression; + regression[Strings.json.regressions.segment1] = [ + [regressionResult.minComplexity, calculation.s1 + calculation.t1 * regressionResult.minComplexity], + [calculation.complexity, calculation.s1 + calculation.t1 * calculation.complexity] + ]; + regression[Strings.json.regressions.segment2] = [ + [calculation.complexity, calculation.s2 + calculation.t2 * calculation.complexity], + [regressionResult.maxComplexity, calculation.s2 + calculation.t2 * regressionResult.maxComplexity] + ]; + regression[Strings.json.complexity] = calculation.complexity; + regression[Strings.json.measurements.stdev] = Math.sqrt(calculation.error / samples[seriesName].length); + }); + + if (isRampController) { + var timeComplexity = new Experiment; + data[Strings.json.controller].forEach(function(regression) { + timeComplexity.sample(regression[Strings.json.complexity]); + }); + + var experimentResult = {}; + result[Strings.json.controller] = experimentResult; + experimentResult[Strings.json.score] = timeComplexity.mean(); + experimentResult[Strings.json.measurements.average] = timeComplexity.mean(); + experimentResult[Strings.json.measurements.stdev] = timeComplexity.standardDeviation(); + experimentResult[Strings.json.measurements.percent] = timeComplexity.percentage(); + + const bootstrapIterations = 2500; + var bootstrapResult = Regression.bootstrap(complexitySamples.data, bootstrapIterations, function(resampleData) { + var complexityIndex = complexitySamples.fieldMap[Strings.json.complexity]; + resampleData.sort(function(a, b) { + return a[complexityIndex] - b[complexityIndex]; + }); + + var resample = new SampleData(complexitySamples.fieldMap, resampleData); + var regressionResult = findRegression(resample, predominantProfile); + return regressionResult.regression.complexity; + }, .8); + + result[Strings.json.complexity][Strings.json.bootstrap] = bootstrapResult; + result[Strings.json.score] = bootstrapResult.median; + result[Strings.json.scoreLowerBound] = bootstrapResult.confidenceLow; + result[Strings.json.scoreUpperBound] = bootstrapResult.confidenceHigh; + } else { + var marks = data[Strings.json.marks]; + var samplingStartIndex = 0, samplingEndIndex = -1; + if (Strings.json.samplingStartTimeOffset in marks) + samplingStartIndex = marks[Strings.json.samplingStartTimeOffset].index; + if (Strings.json.samplingEndTimeOffset in marks) + samplingEndIndex = marks[Strings.json.samplingEndTimeOffset].index; + + var averageComplexity = new Experiment; + var averageFrameLength = new Experiment; + var controllerSamples = samples[Strings.json.controller]; + controllerSamples.forEach(function (sample, i) { + if (i >= samplingStartIndex && (samplingEndIndex == -1 || i < samplingEndIndex)) { + averageComplexity.sample(controllerSamples.getFieldInDatum(sample, Strings.json.complexity)); + var smoothedFrameLength = controllerSamples.getFieldInDatum(sample, Strings.json.smoothedFrameLength); + if (smoothedFrameLength && smoothedFrameLength != -1) + averageFrameLength.sample(smoothedFrameLength); + } + }); + + var experimentResult = {}; + result[Strings.json.controller] = experimentResult; + experimentResult[Strings.json.measurements.average] = averageComplexity.mean(); + experimentResult[Strings.json.measurements.concern] = averageComplexity.concern(Experiment.defaults.CONCERN); + experimentResult[Strings.json.measurements.stdev] = averageComplexity.standardDeviation(); + experimentResult[Strings.json.measurements.percent] = averageComplexity.percentage(); + + experimentResult = {}; + result[Strings.json.frameLength] = experimentResult; + experimentResult[Strings.json.measurements.average] = 1000 / averageFrameLength.mean(); + experimentResult[Strings.json.measurements.concern] = averageFrameLength.concern(Experiment.defaults.CONCERN); + experimentResult[Strings.json.measurements.stdev] = averageFrameLength.standardDeviation(); + experimentResult[Strings.json.measurements.percent] = averageFrameLength.percentage(); + + result[Strings.json.score] = averageComplexity.score(Experiment.defaults.CONCERN); + result[Strings.json.scoreLowerBound] = result[Strings.json.score] - averageFrameLength.standardDeviation(); + result[Strings.json.scoreUpperBound] = result[Strings.json.score] + averageFrameLength.standardDeviation(); + } + }, + + get data() + { + return this._iterationsSamplers; + }, + + get results() + { + if (this._results) + return this._results[Strings.json.results.iterations]; + this._processData(); + return this._results[Strings.json.results.iterations]; + }, + + get options() + { + return this._options; + }, + + _getResultsProperty: function(property) + { + if (this._results) + return this._results[property]; + this._processData(); + return this._results[property]; + }, + + get score() + { + return this._getResultsProperty(Strings.json.score); + }, + + get scoreLowerBound() + { + return this._getResultsProperty(Strings.json.scoreLowerBound); + }, + + get scoreUpperBound() + { + return this._getResultsProperty(Strings.json.scoreUpperBound); + } +}); + +ResultsTable = Utilities.createClass( + function(element, headers) + { + this.element = element; + this._headers = headers; + + this._flattenedHeaders = []; + this._headers.forEach(function(header) { + if (header.disabled) + return; + + if (header.children) + this._flattenedHeaders = this._flattenedHeaders.concat(header.children); + else + this._flattenedHeaders.push(header); + }, this); + + this._flattenedHeaders = this._flattenedHeaders.filter(function (header) { + return !header.disabled; + }); + + this.clear(); + }, { + + clear: function() + { + this.element.textContent = ""; + }, + + _addHeader: function() + { + var thead = Utilities.createElement("thead", {}, this.element); + var row = Utilities.createElement("tr", {}, thead); + + this._headers.forEach(function (header) { + if (header.disabled) + return; + + var th = Utilities.createElement("th", {}, row); + if (header.title != Strings.text.graph) + th.innerHTML = header.title; + if (header.children) + th.colSpan = header.children.length; + }); + }, + + _addBody: function() + { + this.tbody = Utilities.createElement("tbody", {}, this.element); + }, + + _addEmptyRow: function() + { + var row = Utilities.createElement("tr", {}, this.tbody); + this._flattenedHeaders.forEach(function (header) { + return Utilities.createElement("td", { class: "suites-separator" }, row); + }); + }, + + _addTest: function(testName, testResult, options) + { + var row = Utilities.createElement("tr", {}, this.tbody); + + this._flattenedHeaders.forEach(function (header) { + var td = Utilities.createElement("td", {}, row); + if (header.text == Strings.text.testName) { + td.textContent = testName; + } else if (typeof header.text == "string") { + var data = testResult[header.text]; + if (typeof data == "number") + data = data.toFixed(2); + td.innerHTML = data; + } else + td.innerHTML = header.text(testResult); + }, this); + }, + + _addIteration: function(iterationResult, iterationData, options) + { + var testsResults = iterationResult[Strings.json.results.tests]; + for (var suiteName in testsResults) { + this._addEmptyRow(); + var suiteResult = testsResults[suiteName]; + var suiteData = iterationData[suiteName]; + for (var testName in suiteResult) + this._addTest(testName, suiteResult[testName], options, suiteData[testName]); + } + }, + + showIterations: function(dashboard) + { + this.clear(); + this._addHeader(); + this._addBody(); + + var iterationsResults = dashboard.results; + iterationsResults.forEach(function(iterationResult, index) { + this._addIteration(iterationResult, dashboard.data[index], dashboard.options); + }, this); + } +}); + +window.benchmarkRunnerClient = { + iterationCount: 1, + options: null, + results: null, + + initialize: function(suites, options) + { + this.options = options; + }, + + willStartFirstIteration: function() + { + this.results = new ResultsDashboard(this.options); + }, + + didRunSuites: function(suitesSamplers) + { + this.results.push(suitesSamplers); + }, + + didRunTest: function(testData) + { + this.results.calculateScore(testData); + }, + + didFinishLastIteration: function() + { + benchmarkController.showResults(); + } +}; + +window.sectionsManager = +{ + showSection: function(sectionIdentifier, pushState) + { + var sections = document.querySelectorAll("main > section"); + for (var i = 0; i < sections.length; ++i) { + document.body.classList.remove("showing-" + sections[i].id); + } + document.body.classList.add("showing-" + sectionIdentifier); + + var currentSectionElement = document.querySelector("section.selected"); + console.assert(currentSectionElement); + + var newSectionElement = document.getElementById(sectionIdentifier); + console.assert(newSectionElement); + + currentSectionElement.classList.remove("selected"); + newSectionElement.classList.add("selected"); + + if (pushState) + history.pushState({section: sectionIdentifier}, document.title); + }, + + setSectionScore: function(sectionIdentifier, score, confidence) + { + document.querySelector("#" + sectionIdentifier + " .score").textContent = score; + if (confidence) + document.querySelector("#" + sectionIdentifier + " .confidence").textContent = confidence; + }, + + populateTable: function(tableIdentifier, headers, dashboard) + { + var table = new ResultsTable(document.getElementById(tableIdentifier), headers); + table.showIterations(dashboard); + } +}; + +window.benchmarkController = { + initialize: function() + { + benchmarkController.addOrientationListenerIfNecessary(); + }, + + determineCanvasSize: function() { + var match = window.matchMedia("(max-device-width: 760px)"); + if (match.matches) { + document.body.classList.add("small"); + return; + } + + match = window.matchMedia("(max-device-width: 1600px)"); + if (match.matches) { + document.body.classList.add("medium"); + return; + } + + match = window.matchMedia("(max-width: 1600px)"); + if (match.matches) { + document.body.classList.add("medium"); + return; + } + + document.body.classList.add("large"); + }, + + addOrientationListenerIfNecessary: function() { + if (!("orientation" in window)) + return; + + this.orientationQuery = window.matchMedia("(orientation: landscape)"); + this._orientationChanged(this.orientationQuery); + this.orientationQuery.addListener(this._orientationChanged); + }, + + _orientationChanged: function(match) + { + benchmarkController.isInLandscapeOrientation = match.matches; + if (match.matches) + document.querySelector(".start-benchmark p").classList.add("hidden"); + else + document.querySelector(".start-benchmark p").classList.remove("hidden"); + benchmarkController.updateStartButtonState(); + }, + + updateStartButtonState: function() + { + document.getElementById("run-benchmark").disabled = !this.isInLandscapeOrientation; + }, + + _startBenchmark: function(suites, options, frameContainerID) + { + benchmarkController.determineCanvasSize(); + + var configuration = document.body.className.match(/small|medium|large/); + if (configuration) + options[Strings.json.configuration] = configuration[0]; + + benchmarkRunnerClient.initialize(suites, options); + var frameContainer = document.getElementById(frameContainerID); + var runner = new BenchmarkRunner(suites, frameContainer, benchmarkRunnerClient); + runner.runMultipleIterations(); + + sectionsManager.showSection("test-container"); + }, + + startBenchmark: function() + { + var options = { + "test-interval": 30, + "display": "minimal", + "tiles": "big", + "controller": "ramp", + "kalman-process-error": 1, + "kalman-measurement-error": 4, + "time-measurement": "performance" + }; + this._startBenchmark(Suites, options, "test-container"); + }, + + showResults: function() + { + if (!this.addedKeyEvent) { + document.addEventListener("keypress", this.handleKeyPress, false); + this.addedKeyEvent = true; + } + + var dashboard = benchmarkRunnerClient.results; + var score = dashboard.score; + var confidence = "±" + (Statistics.largestDeviationPercentage(dashboard.scoreLowerBound, score, dashboard.scoreUpperBound) * 100).toFixed(2) + "%"; + sectionsManager.setSectionScore("results", score.toFixed(2), confidence); + sectionsManager.populateTable("results-header", Headers.testName, dashboard); + sectionsManager.populateTable("results-score", Headers.score, dashboard); + sectionsManager.populateTable("results-data", Headers.details, dashboard); + sectionsManager.showSection("results", true); + }, + + handleKeyPress: function(event) + { + switch (event.charCode) + { + case 27: // esc + benchmarkController.hideDebugInfo(); + break; + case 106: // j + benchmarkController.showDebugInfo(); + break; + case 115: // s + benchmarkController.selectResults(event.target); + break; + } + }, + + hideDebugInfo: function() + { + var overlay = document.getElementById("overlay"); + if (!overlay) + return; + document.body.removeChild(overlay); + }, + + showDebugInfo: function() + { + if (document.getElementById("overlay")) + return; + + var overlay = Utilities.createElement("div", { + id: "overlay" + }, document.body); + var container = Utilities.createElement("div", {}, overlay); + + var header = Utilities.createElement("h3", {}, container); + header.textContent = "Debug Output"; + + var data = Utilities.createElement("div", {}, container); + data.textContent = "Please wait..."; + setTimeout(function() { + var output = { + options: benchmarkRunnerClient.results.options, + data: benchmarkRunnerClient.results.data + }; + data.textContent = JSON.stringify(output, function(key, value) { + if (typeof value === 'number') + return Utilities.toFixedNumber(value, 3); + return value; + }, 1); + }, 0); + data.onclick = function() { + var selection = window.getSelection(); + selection.removeAllRanges(); + var range = document.createRange(); + range.selectNode(data); + selection.addRange(range); + }; + + var button = Utilities.createElement("button", {}, container); + button.textContent = "Done"; + button.onclick = function() { + benchmarkController.hideDebugInfo(); + }; + }, + + selectResults: function(target) + { + target.selectRange = ((target.selectRange || 0) + 1) % 3; + + var selection = window.getSelection(); + selection.removeAllRanges(); + var range = document.createRange(); + switch (target.selectRange) { + case 0: { + range.selectNode(document.getElementById("results-score")); + break; + } + case 1: { + range.setStart(document.querySelector("#results .score"), 0); + range.setEndAfter(document.querySelector("#results-score"), 0); + break; + } + case 2: { + range.selectNodeContents(document.querySelector("#results .score")); + break; + } + } + selection.addRange(range); + } +}; + +window.addEventListener("load", function() { benchmarkController.initialize(); }); diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/runner/benchmark-runner.js b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/benchmark-runner.js new file mode 100644 index 0000000000..1aa630356c --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/benchmark-runner.js @@ -0,0 +1,179 @@ +BenchmarkRunnerState = Utilities.createClass( + function(suites) + { + this._suites = suites; + this._suiteIndex = -1; + this._testIndex = 0; + this.next(); + }, { + + currentSuite: function() + { + return this._suites[this._suiteIndex]; + }, + + currentTest: function() + { + var suite = this.currentSuite(); + return suite ? suite.tests[this._testIndex] : null; + }, + + isFirstTest: function() + { + return !this._testIndex; + }, + + next: function() + { + this._testIndex++; + + var suite = this._suites[this._suiteIndex]; + if (suite && this._testIndex < suite.tests.length) + return; + + this._testIndex = 0; + do { + this._suiteIndex++; + } while (this._suiteIndex < this._suites.length && this._suites[this._suiteIndex].disabled); + }, + + prepareCurrentTest: function(runner, frame) + { + var test = this.currentTest(); + var promise = new SimplePromise; + + frame.onload = function() { + promise.resolve(); + }; + + frame.src = "tests/" + test.url; + return promise; + } +}); + +BenchmarkRunner = Utilities.createClass( + function(suites, frameContainer, client) + { + this._suites = suites; + this._client = client; + this._frameContainer = frameContainer; + }, { + + _appendFrame: function() + { + var frame = document.createElement("iframe"); + frame.setAttribute("scrolling", "no"); + + this._frameContainer.insertBefore(frame, this._frameContainer.firstChild); + this._frame = frame; + return frame; + }, + + _removeFrame: function() + { + if (this._frame) { + this._frame.parentNode.removeChild(this._frame); + this._frame = null; + } + }, + + _runBenchmarkAndRecordResults: function(state) + { + var promise = new SimplePromise; + var suite = state.currentSuite(); + var test = state.currentTest(); + + if (this._client && this._client.willRunTest) + this._client.willRunTest(suite, test); + + var contentWindow = this._frame.contentWindow; + var self = this; + + var options = { complexity: test.complexity }; + Utilities.extendObject(options, this._client.options); + Utilities.extendObject(options, contentWindow.Utilities.parseParameters()); + + var benchmark = new contentWindow.benchmarkClass(options); + document.body.style.backgroundColor = benchmark.backgroundColor(); + benchmark.run().then(function(testData) { + var suiteResults = self._suitesResults[suite.name] || {}; + suiteResults[test.name] = testData; + self._suitesResults[suite.name] = suiteResults; + + if (self._client && self._client.didRunTest) + self._client.didRunTest(testData); + + state.next(); + if (state.currentSuite() != suite) + self._removeFrame(); + promise.resolve(state); + }); + + return promise; + }, + + step: function(state) + { + if (!state) { + state = new BenchmarkRunnerState(this._suites); + this._suitesResults = {}; + } + + var suite = state.currentSuite(); + if (!suite) { + this._finalize(); + var promise = new SimplePromise; + promise.resolve(); + return promise; + } + + if (state.isFirstTest()) { + this._appendFrame(); + } + + return state.prepareCurrentTest(this, this._frame).then(function(prepareReturnValue) { + return this._runBenchmarkAndRecordResults(state); + }.bind(this)); + }, + + runAllSteps: function(startingState) + { + var nextCallee = this.runAllSteps.bind(this); + this.step(startingState).then(function(nextState) { + if (nextState) + nextCallee(nextState); + }); + }, + + runMultipleIterations: function() + { + var self = this; + var currentIteration = 0; + + this._runNextIteration = function() { + currentIteration++; + if (currentIteration < self._client.iterationCount) + self.runAllSteps(); + else if (this._client && this._client.didFinishLastIteration) { + document.body.style.backgroundColor = ""; + self._client.didFinishLastIteration(); + } + } + + if (this._client && this._client.willStartFirstIteration) + this._client.willStartFirstIteration(); + + this.runAllSteps(); + }, + + _finalize: function() + { + this._removeFrame(); + + if (this._client && this._client.didRunSuites) + this._client.didRunSuites(this._suitesResults); + + if (this._runNextIteration) + this._runNextIteration(); + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/runner/crystal.svg b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/crystal.svg new file mode 100644 index 0000000000..0090df6c0c --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/crystal.svg @@ -0,0 +1,92 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/runner/lines.svg b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/lines.svg new file mode 100644 index 0000000000..83458b8095 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/lines.svg @@ -0,0 +1,26 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/runner/logo.svg b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/logo.svg new file mode 100644 index 0000000000..a7d0eaf375 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/logo.svg @@ -0,0 +1,26 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/runner/tests.js b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/tests.js new file mode 100644 index 0000000000..aa938c5189 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/runner/tests.js @@ -0,0 +1,81 @@ +var Headers = { + testName: [ + { + title: "" + Strings.text.testName + "", + text: Strings.text.testName + } + ], + score: [ + { + title: Strings.text.score, + text: Strings.json.score + } + ], + details: [ + { + title: " ", + text: function(data) { + var bootstrap = data[Strings.json.complexity][Strings.json.bootstrap]; + return "±" + (Statistics.largestDeviationPercentage(bootstrap.confidenceLow, bootstrap.median, bootstrap.confidenceHigh) * 100).toFixed(2) + "%"; + } + } + ] +}; + +var Suite = function(name, tests) { + this.name = name; + this.tests = tests; +}; + +var Suites = []; + +Suites.push(new Suite("Animometer", + [ + { + url: "master/multiply.html", + name: "Multiply" + }, + { + url: "master/canvas-stage.html?pathType=arcs", + name: "Canvas Arcs" + }, + { + url: "master/leaves.html", + name: "Leaves" + }, + { + url: "master/canvas-stage.html?pathType=linePath", + name: "Paths" + }, + { + url: "master/canvas-stage.html?pathType=line&lineCap=square", + name: "Canvas Lines" + }, + { + url: "master/focus.html", + name: "Focus" + }, + { + url: "master/image-data.html", + name: "Images" + }, + { + url: "master/text.html", + name: "Design" + }, + { + url: "master/svg-particles.html", + name: "Suits" + }, + ] +)); + +function suiteFromName(name) +{ + return Suites.find(function(suite) { return suite.name == name; }); +} + +function testFromName(suite, name) +{ + return suite.tests.find(function(test) { return test.name == name; }); +} diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/statistics.js b/third_party/webkit/PerformanceTests/MotionMark/resources/statistics.js new file mode 100644 index 0000000000..9322a797b6 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/statistics.js @@ -0,0 +1,397 @@ +Pseudo = +{ + initialRandomSeed: 49734321, + randomSeed: 49734321, + + resetRandomSeed: function() + { + Pseudo.randomSeed = Pseudo.initialRandomSeed; + }, + + random: function() + { + var randomSeed = Pseudo.randomSeed; + randomSeed = ((randomSeed + 0x7ed55d16) + (randomSeed << 12)) & 0xffffffff; + randomSeed = ((randomSeed ^ 0xc761c23c) ^ (randomSeed >>> 19)) & 0xffffffff; + randomSeed = ((randomSeed + 0x165667b1) + (randomSeed << 5)) & 0xffffffff; + randomSeed = ((randomSeed + 0xd3a2646c) ^ (randomSeed << 9)) & 0xffffffff; + randomSeed = ((randomSeed + 0xfd7046c5) + (randomSeed << 3)) & 0xffffffff; + randomSeed = ((randomSeed ^ 0xb55a4f09) ^ (randomSeed >>> 16)) & 0xffffffff; + Pseudo.randomSeed = randomSeed; + return (randomSeed & 0xfffffff) / 0x10000000; + } +}; + +Statistics = +{ + sampleMean: function(numberOfSamples, sum) + { + if (numberOfSamples < 1) + return 0; + return sum / numberOfSamples; + }, + + // With sum and sum of squares, we can compute the sample standard deviation in O(1). + // See https://rniwa.com/2012-11-10/sample-standard-deviation-in-terms-of-sum-and-square-sum-of-samples/ + unbiasedSampleStandardDeviation: function(numberOfSamples, sum, squareSum) + { + if (numberOfSamples < 2) + return 0; + return Math.sqrt((squareSum - sum * sum / numberOfSamples) / (numberOfSamples - 1)); + }, + + geometricMean: function(values) + { + if (!values.length) + return 0; + var roots = values.map(function(value) { return Math.pow(value, 1 / values.length); }) + return roots.reduce(function(a, b) { return a * b; }); + }, + + // Cumulative distribution function + cdf: function(value, mean, standardDeviation) + { + return 0.5 * (1 + Statistics.erf((value - mean) / (Math.sqrt(2 * standardDeviation * standardDeviation)))); + }, + + // Approximation of Gauss error function, Abramowitz and Stegun 7.1.26 + erf: function(value) + { + var sign = (value >= 0) ? 1 : -1; + value = Math.abs(value); + + var a1 = 0.254829592; + var a2 = -0.284496736; + var a3 = 1.421413741; + var a4 = -1.453152027; + var a5 = 1.061405429; + var p = 0.3275911; + + var t = 1.0 / (1.0 + p * value); + var y = 1.0 - (((((a5 * t + a4) * t) + a3) * t + a2) * t + a1) * t * Math.exp(-value * value); + return sign * y; + }, + + largestDeviationPercentage: function(low, mean, high) + { + return Math.max(Math.abs(low / mean - 1), (high / mean - 1)); + } +}; + +Experiment = Utilities.createClass( + function(includeConcern) + { + if (includeConcern) + this._maxHeap = Heap.createMaxHeap(Experiment.defaults.CONCERN_SIZE); + this.reset(); + }, { + + reset: function() + { + this._sum = 0; + this._squareSum = 0; + this._numberOfSamples = 0; + if (this._maxHeap) + this._maxHeap.init(); + }, + + get sampleCount() + { + return this._numberOfSamples; + }, + + sample: function(value) + { + this._sum += value; + this._squareSum += value * value; + if (this._maxHeap) + this._maxHeap.push(value); + ++this._numberOfSamples; + }, + + mean: function() + { + return Statistics.sampleMean(this._numberOfSamples, this._sum); + }, + + standardDeviation: function() + { + return Statistics.unbiasedSampleStandardDeviation(this._numberOfSamples, this._sum, this._squareSum); + }, + + cdf: function(value) + { + return Statistics.cdf(value, this.mean(), this.standardDeviation()); + }, + + percentage: function() + { + var mean = this.mean(); + return mean ? this.standardDeviation() * 100 / mean : 0; + }, + + concern: function(percentage) + { + if (!this._maxHeap) + return this.mean(); + + var size = Math.ceil(this._numberOfSamples * percentage / 100); + var values = this._maxHeap.values(size); + return values.length ? values.reduce(function(a, b) { return a + b; }) / values.length : 0; + }, + + score: function(percentage) + { + return Statistics.geometricMean([this.mean(), Math.max(this.concern(percentage), 1)]); + } +}); + +Experiment.defaults = +{ + CONCERN: 5, + CONCERN_SIZE: 100, +}; + +Regression = Utilities.createClass( + function(samples, getComplexity, getFrameLength, startIndex, endIndex, options) + { + var desiredFrameLength = options.desiredFrameLength || 1000/60; + var bestProfile; + + if (!options.preferredProfile || options.preferredProfile == Strings.json.profiles.slope) { + var slope = this._calculateRegression(samples, getComplexity, getFrameLength, startIndex, endIndex, { + shouldClip: true, + s1: desiredFrameLength, + t1: 0 + }); + if (!bestProfile || slope.error < bestProfile.error) { + bestProfile = slope; + this.profile = Strings.json.profiles.slope; + } + } + if (!options.preferredProfile || options.preferredProfile == Strings.json.profiles.flat) { + var flat = this._calculateRegression(samples, getComplexity, getFrameLength, startIndex, endIndex, { + shouldClip: true, + s1: desiredFrameLength, + t1: 0, + t2: 0 + }); + + if (!bestProfile || flat.error < bestProfile.error) { + bestProfile = flat; + this.profile = Strings.json.profiles.flat; + } + } + + this.startIndex = Math.min(startIndex, endIndex); + this.endIndex = Math.max(startIndex, endIndex); + + this.complexity = bestProfile.complexity; + this.s1 = bestProfile.s1; + this.t1 = bestProfile.t1; + this.s2 = bestProfile.s2; + this.t2 = bestProfile.t2; + this.stdev1 = bestProfile.stdev1; + this.stdev2 = bestProfile.stdev2; + this.n1 = bestProfile.n1; + this.n2 = bestProfile.n2; + this.error = bestProfile.error; + }, { + + valueAt: function(complexity) + { + if (this.n1 == 1 || complexity > this.complexity) + return this.s2 + this.t2 * complexity; + return this.s1 + this.t1 * complexity; + }, + + // A generic two-segment piecewise regression calculator. Based on Kundu/Ubhaya + // + // Minimize sum of (y - y')^2 + // where y = s1 + t1*x + // y = s2 + t2*x + // y' = s1 + t1*x' = s2 + t2*x' if x_0 <= x' <= x_n + // + // Allows for fixing s1, t1, s2, t2 + // + // x is assumed to be complexity, y is frame length. Can be used for pure complexity-FPS + // analysis or for ramp controllers since complexity monotonically decreases with time. + _calculateRegression: function(samples, getComplexity, getFrameLength, startIndex, endIndex, options) + { + if (startIndex == endIndex) { + // Only one sample point; we can't calculate any regression. + var x = getComplexity(samples, startIndex); + return { + complexity: x, + s1: x, + t1: 0, + s2: x, + t2: 0, + error1: 0, + error2: 0 + }; + } + + // x is expected to increase in complexity + var iterationDirection = endIndex > startIndex ? 1 : -1; + var lowComplexity = getComplexity(samples, startIndex); + var highComplexity = getComplexity(samples, endIndex); + var a1 = 0, b1 = 0, c1 = 0, d1 = 0, h1 = 0, k1 = 0; + var a2 = 0, b2 = 0, c2 = 0, d2 = 0, h2 = 0, k2 = 0; + + // Iterate from low to high complexity + for (var i = startIndex; iterationDirection * (endIndex - i) > -1; i += iterationDirection) { + var x = getComplexity(samples, i); + var y = getFrameLength(samples, i); + a2 += 1; + b2 += x; + c2 += x * x; + d2 += y; + h2 += y * x; + k2 += y * y; + } + + var s1_best, t1_best, s2_best, t2_best, n1_best, n2_best, error1_best, error2_best, x_best, x_prime; + + function setBest(s1, t1, error1, s2, t2, error2, splitIndex, x_prime, x) + { + s1_best = s1; + t1_best = t1; + error1_best = error1; + s2_best = s2; + t2_best = t2; + error2_best = error2; + // Number of samples included in the first segment, inclusive of splitIndex + n1_best = iterationDirection * (splitIndex - startIndex) + 1; + // Number of samples included in the second segment + n2_best = iterationDirection * (endIndex - splitIndex); + if (!options.shouldClip || (x_prime >= lowComplexity && x_prime <= highComplexity)) + x_best = x_prime; + else { + // Discontinuous piecewise regression + x_best = x; + } + } + + // Iterate from startIndex to endIndex - 1, inclusive + for (var i = startIndex; iterationDirection * (endIndex - i) > 0; i += iterationDirection) { + var x = getComplexity(samples, i); + var y = getFrameLength(samples, i); + var xx = x * x; + var yx = y * x; + var yy = y * y; + // a1, b1, etc. is sum from startIndex to i, inclusive + a1 += 1; + b1 += x; + c1 += xx; + d1 += y; + h1 += yx; + k1 += yy; + // a2, b2, etc. is sum from i+1 to endIndex, inclusive + a2 -= 1; + b2 -= x; + c2 -= xx; + d2 -= y; + h2 -= yx; + k2 -= yy; + + var A = c1*d1 - b1*h1; + var B = a1*h1 - b1*d1; + var C = a1*c1 - b1*b1; + var D = c2*d2 - b2*h2; + var E = a2*h2 - b2*d2; + var F = a2*c2 - b2*b2; + var s1 = options.s1 !== undefined ? options.s1 : (A / C); + var t1 = options.t1 !== undefined ? options.t1 : (B / C); + var s2 = options.s2 !== undefined ? options.s2 : (D / F); + var t2 = options.t2 !== undefined ? options.t2 : (E / F); + // Assumes that the two segments meet + var x_prime = (s1 - s2) / (t2 - t1); + + var error1 = (k1 + a1*s1*s1 + c1*t1*t1 - 2*d1*s1 - 2*h1*t1 + 2*b1*s1*t1) || Number.MAX_VALUE; + var error2 = (k2 + a2*s2*s2 + c2*t2*t2 - 2*d2*s2 - 2*h2*t2 + 2*b2*s2*t2) || Number.MAX_VALUE; + + if (i == startIndex) { + setBest(s1, t1, error1, s2, t2, error2, i, x_prime, x); + continue; + } + + if (C == 0 || F == 0) + continue; + + // Projected point is not between this and the next sample + if (x_prime > getComplexity(samples, i + iterationDirection) || x_prime < x) { + // Calculate lambda, which divides the weight of this sample between the two lines + + // These values remove the influence of this sample + var I = c1 - 2*b1*x + a1*xx; + var H = C - I; + var G = A + B*x - C*y; + + var J = D + E*x - F*y; + var K = c2 - 2*b2*x + a2*xx; + + var lambda = (G*F + G*K - H*J) / (I*J + G*K); + if (lambda > 0 && lambda < 1) { + var lambda1 = 1 - lambda; + s1 = options.s1 !== undefined ? options.s1 : ((A - lambda1*(-h1*x + d1*xx + c1*y - b1*yx)) / (C - lambda1*I)); + t1 = options.t1 !== undefined ? options.t1 : ((B - lambda1*(h1 - d1*x - b1*y + a1*yx)) / (C - lambda1*I)); + s2 = options.s2 !== undefined ? options.s2 : ((D + lambda1*(-h2*x + d2*xx + c2*y - b2*yx)) / (F + lambda1*K)); + t2 = options.t2 !== undefined ? options.t2 : ((E + lambda1*(h2 - d2*x - b2*y + a2*yx)) / (F + lambda1*K)); + x_prime = (s1 - s2) / (t2 - t1); + + error1 = ((k1 + a1*s1*s1 + c1*t1*t1 - 2*d1*s1 - 2*h1*t1 + 2*b1*s1*t1) - lambda1 * Math.pow(y - (s1 + t1*x), 2)) || Number.MAX_VALUE; + error2 = ((k2 + a2*s2*s2 + c2*t2*t2 - 2*d2*s2 - 2*h2*t2 + 2*b2*s2*t2) + lambda1 * Math.pow(y - (s2 + t2*x), 2)) || Number.MAX_VALUE; + } else if (t1 != t2) + continue; + } + + if (error1 + error2 < error1_best + error2_best) + setBest(s1, t1, error1, s2, t2, error2, i, x_prime, x); + } + + return { + complexity: x_best, + s1: s1_best, + t1: t1_best, + stdev1: Math.sqrt(error1_best / n1_best), + s2: s2_best, + t2: t2_best, + stdev2: Math.sqrt(error2_best / n2_best), + error: error1_best + error2_best, + n1: n1_best, + n2: n2_best + }; + } +}); + +Utilities.extendObject(Regression, { + bootstrap: function(samples, iterationCount, processResample, confidencePercentage) + { + var sampleLength = samples.length; + var resample = new Array(sampleLength); + + var bootstrapEstimator = new Experiment; + var bootstrapData = new Array(iterationCount); + + Pseudo.resetRandomSeed(); + for (var i = 0; i < iterationCount; ++i) { + for (var j = 0; j < sampleLength; ++j) + resample[j] = samples[Math.floor(Pseudo.random() * sampleLength)]; + + var resampleResult = processResample(resample); + bootstrapEstimator.sample(resampleResult); + bootstrapData[i] = resampleResult; + } + + bootstrapData.sort(function(a, b) { return a - b; }); + return { + confidenceLow: bootstrapData[Math.round((iterationCount - 1) * (1 - confidencePercentage) / 2)], + confidenceHigh: bootstrapData[Math.round((iterationCount - 1) * (1 + confidencePercentage) / 2)], + median: bootstrapData[Math.round(iterationCount / 2)], + mean: bootstrapEstimator.mean(), + data: bootstrapData, + confidencePercentage: confidencePercentage + }; + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/resources/strings.js b/third_party/webkit/PerformanceTests/MotionMark/resources/strings.js new file mode 100644 index 0000000000..b58f67e991 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/resources/strings.js @@ -0,0 +1,51 @@ +var Strings = { + text: { + testName: "Test Name", + score: "Score" + }, + json: { + marks: "marks", + samplingStartTimeOffset: "Start sampling", + samplingEndTimeOffset: "End sampling", + + samples: "samples", + dataFieldMap: "dataFieldMap", + controller: "controller", + time: "time", + complexity: "complexity", + complexityAverage: "complexityAverage", + frameLength: "frameLength", + smoothedFrameLength: "smoothedFrameLength", + + result: "result", + configuration: "configuration", + score: "score", + scoreLowerBound: "scoreLowerBound", + scoreUpperBound: "scoreUpperBound", + bootstrap: "bootstrap", + measurements: { + average: "average", + concern: "concern", + stdev: "stdev", + percent: "percent" + }, + + regressions: { + startIndex: "startIndex", + endIndex: "endIndex", + segment1: "segment1", + segment2: "segment2", + profile: "profile" + }, + + profiles: { + slope: "slope", + flat: "flat" + }, + + results: { + iterations: "iterationsResults", + tests: "testsResults" + } + } +}; diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/3d/resources/webgl.js b/third_party/webkit/PerformanceTests/MotionMark/tests/3d/resources/webgl.js new file mode 100644 index 0000000000..58f5df385e --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/3d/resources/webgl.js @@ -0,0 +1,184 @@ +(function() { + +WebGLStage = Utilities.createSubclass(Stage, + function(element, options) + { + Stage.call(this); + }, + { + + initialize: function(benchmark, options) + { + Stage.prototype.initialize.call(this, benchmark, options); + + this._numTriangles = 0; + this._bufferSize = 0; + + this._gl = this.element.getContext("webgl"); + var gl = this._gl; + + gl.clearColor(0.5, 0.5, 0.5, 1); + + // Create the vertex shader object. + var vertexShader = gl.createShader(gl.VERTEX_SHADER); + + // The source code for the shader is extracted from the + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-canvas-images.html b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-canvas-images.html new file mode 100644 index 0000000000..864c19adcd --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-canvas-images.html @@ -0,0 +1,26 @@ + + + + + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-canvas-shapes.html b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-canvas-shapes.html new file mode 100644 index 0000000000..c759d45c08 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-canvas-shapes.html @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-css-images.html b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-css-images.html new file mode 100644 index 0000000000..058de486de --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-css-images.html @@ -0,0 +1,22 @@ + + + + + + + + +
    + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-css-shapes.html b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-css-shapes.html new file mode 100644 index 0000000000..0c1248f490 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-css-shapes.html @@ -0,0 +1,33 @@ + + + + + + + + +
    + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-svg-images.html b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-svg-images.html new file mode 100644 index 0000000000..2b6a0b9db5 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-svg-images.html @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-svg-shapes.html b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-svg-shapes.html new file mode 100644 index 0000000000..a821231672 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-svg-shapes.html @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-tagged-images.html b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-tagged-images.html new file mode 100644 index 0000000000..f67f14ad36 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/bouncing-tagged-images.html @@ -0,0 +1,22 @@ + + + + + + + + + + + + + + + +
    + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-images.js b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-images.js new file mode 100644 index 0000000000..5fba5ad761 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-images.js @@ -0,0 +1,47 @@ +(function() { + +BouncingCanvasImage = Utilities.createSubclass(BouncingCanvasParticle, + function(stage) + { + BouncingCanvasParticle.call(this, stage, "image"); + this._imageElement = stage.imageElement; + }, { + + _draw: function() + { + this.context.save(); + this.applyRotation(); + this.context.drawImage(this._imageElement, 0, 0, this.size.x, this.size.y); + this.context.restore(); + } +}); + +BouncingCanvasImagesStage = Utilities.createSubclass(BouncingCanvasParticlesStage, + function() + { + BouncingCanvasParticlesStage.call(this); + }, { + + initialize: function(benchmark, options) + { + BouncingCanvasParticlesStage.prototype.initialize.call(this, benchmark, options); + var imageSrc = options["imageSrc"] || "resources/yin-yang.svg"; + this.imageElement = document.querySelector(".hidden[src=\"" + imageSrc + "\"]"); + }, + + createParticle: function() + { + return new BouncingCanvasImage(this); + } +}); + +BouncingCanvasImagesBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new BouncingCanvasImagesStage(), options); + } +); + +window.benchmarkClass = BouncingCanvasImagesBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-particles.js b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-particles.js new file mode 100644 index 0000000000..0a76ba05c3 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-particles.js @@ -0,0 +1,88 @@ +BouncingCanvasParticle = Utilities.createSubclass(BouncingParticle, + function(stage, shape) + { + BouncingParticle.call(this, stage); + this.context = stage.context; + this._shape = shape; + this._clip = stage.clip; + }, { + + applyRotation: function() + { + if (this._shape == "circle") + return; + + this.context.translate(this.size.x / 2, this.size.y / 2); + this.context.rotate(this.rotater.degree() * Math.PI / 180); + this.context.translate(-this.size.x / 2, -this.size.y / 2); + }, + + applyClipping: function() + { + var clipPoints = BouncingCanvasParticle.clips[this._clip]; + if (!clipPoints) + return; + + this.context.beginPath(); + clipPoints.forEach(function(point, index) { + var point = this.size.multiply(point); + if (!index) + this.context.moveTo(point.x, point.y); + else + this.context.lineTo(point.x, point.y); + }, this); + + this.context.closePath(); + this.context.clip(); + }, + + _draw: function() + { + throw "Not implemented"; + }, + + animate: function(timeDelta) + { + BouncingParticle.prototype.animate.call(this, timeDelta); + this.context.save(); + this.context.translate(this.position.x, this.position.y); + this._draw(); + this.context.restore(); + } +}); + +BouncingCanvasParticle.clips = { + star: [ + new Point(0.50, 0.00), + new Point(0.38, 0.38), + new Point(0.00, 0.38), + new Point(0.30, 0.60), + new Point(0.18, 1.00), + new Point(0.50, 0.75), + new Point(0.82, 1.00), + new Point(0.70, 0.60), + new Point(1.00, 0.38), + new Point(0.62, 0.38) + ] +}; + +BouncingCanvasParticlesStage = Utilities.createSubclass(BouncingParticlesStage, + function() + { + BouncingParticlesStage.call(this); + }, { + + initialize: function(benchmark, options) + { + BouncingParticlesStage.prototype.initialize.call(this, benchmark, options); + this.context = this.element.getContext("2d"); + }, + + animate: function(timeDelta) + { + this.context.clearRect(0, 0, this.size.x, this.size.y); + this.particles.forEach(function(particle) { + particle.animate(timeDelta); + }); + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-shapes.js b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-shapes.js new file mode 100644 index 0000000000..49a31cf40d --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-canvas-shapes.js @@ -0,0 +1,87 @@ +(function() { + +BouncingCanvasShape = Utilities.createSubclass(BouncingCanvasParticle, + function(stage) + { + BouncingCanvasParticle.call(this, stage, stage.shape); + this._fill = stage.fill; + this._color0 = Stage.randomColor(); + this._color1 = Stage.randomColor(); + }, { + + _applyFill: function() + { + switch (this._fill) { + case "gradient": + var gradient = this.context.createLinearGradient(0, 0, this.size.width, 0); + gradient.addColorStop(0, this._color0); + gradient.addColorStop(1, this._color1); + this.context.fillStyle = gradient; + break; + + case "solid": + default: + this.context.fillStyle = this._color0; + break; + } + }, + + _drawShape: function() + { + this.context.beginPath(); + + switch (this._shape) { + case "rect": + this.context.rect(0, 0, this.size.width, this.size.height); + break; + + case "circle": + default: + var center = this.size.center; + var radius = Math.min(this.size.x, this.size.y) / 2; + this.context.arc(center.x, center.y, radius, 0, Math.PI * 2, true); + break; + } + + this.context.fill(); + }, + + _draw: function() + { + this.context.save(); + this._applyFill(); + this.applyRotation(); + this.applyClipping(); + this._drawShape(); + this.context.restore(); + } +}); + +BouncingCanvasShapesStage = Utilities.createSubclass(BouncingCanvasParticlesStage, + function () + { + BouncingCanvasParticlesStage.call(this); + }, { + + initialize: function(benchmark, options) + { + BouncingCanvasParticlesStage.prototype.initialize.call(this, benchmark, options); + this.parseShapeParameters(options); + }, + + createParticle: function() + { + return new BouncingCanvasShape(this); + } +}); + +BouncingCanvasShapesBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new BouncingCanvasShapesStage(), options); + } +); + +window.benchmarkClass = BouncingCanvasShapesBenchmark; + +})(); \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-css-images.js b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-css-images.js new file mode 100644 index 0000000000..ce9a48c276 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-css-images.js @@ -0,0 +1,61 @@ +(function() { + +BouncingCssImage = Utilities.createSubclass(BouncingParticle, + function(stage) + { + BouncingParticle.call(this, stage); + + this.element = document.createElement("img"); + this.element.style.width = this.size.x + "px"; + this.element.style.height = this.size.y + "px"; + this.element.setAttribute("src", stage.imageSrc); + + stage.element.appendChild(this.element); + this._move(); + }, { + + _move: function() + { + this.element.style.transform = "translate(" + this.position.x + "px," + this.position.y + "px) " + this.rotater.rotateZ(); + }, + + animate: function(timeDelta) + { + BouncingParticle.prototype.animate.call(this, timeDelta); + this._move(); + } +}); + +BouncingCssImagesStage = Utilities.createSubclass(BouncingParticlesStage, + function() + { + BouncingParticlesStage.call(this); + }, { + + initialize: function(benchmark, options) + { + BouncingParticlesStage.prototype.initialize.call(this, benchmark, options); + this.imageSrc = options["imageSrc"] || "../resources/yin-yang.svg"; + }, + + createParticle: function() + { + return new BouncingCssImage(this); + }, + + particleWillBeRemoved: function(particle) + { + particle.element.remove(); + } +}); + +BouncingCssImagesBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new BouncingCssImagesStage(), options); + } +); + +window.benchmarkClass = BouncingCssImagesBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-css-shapes.js b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-css-shapes.js new file mode 100644 index 0000000000..a1f81863f9 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-css-shapes.js @@ -0,0 +1,86 @@ +(function() { + +BouncingCssShape = Utilities.createSubclass(BouncingParticle, + function(stage) + { + BouncingParticle.call(this, stage); + + this.element = this._createSpan(stage); + + switch (stage.fill) { + case "solid": + default: + this.element.style.backgroundColor = Stage.randomColor(); + break; + + case "gradient": + this.element.style.background = "linear-gradient(" + Stage.randomColor() + ", " + Stage.randomColor() + ")"; + break; + } + + if (stage.blend) + this.element.style.mixBlendMode = Stage.randomStyleMixBlendMode(); + + // Some browsers have not un-prefixed the css filter yet. + if (stage.filter) + Utilities.setElementPrefixedProperty(this.element, "filter", Stage.randomStyleFilter()); + + this._move(); + }, { + + _createSpan: function(stage) + { + var span = document.createElement("span"); + span.className = stage.shape + " " + stage.clip; + span.style.width = this.size.x + "px"; + span.style.height = this.size.y + "px"; + stage.element.appendChild(span); + return span; + }, + + _move: function() + { + this.element.style.transform = "translate(" + this.position.x + "px," + this.position.y + "px)" + this.rotater.rotateZ(); + }, + + animate: function(timeDelta) + { + BouncingParticle.prototype.animate.call(this, timeDelta); + this.rotater.next(timeDelta); + this._move(); + } +}); + +BouncingCssShapesStage = Utilities.createSubclass(BouncingParticlesStage, + function() + { + BouncingParticlesStage.call(this); + }, { + + initialize: function(benchmark, options) + { + BouncingParticlesStage.prototype.initialize.call(this, benchmark, options); + this.parseShapeParameters(options); + }, + + createParticle: function() + { + return new BouncingCssShape(this); + }, + + particleWillBeRemoved: function(particle) + { + particle.element.remove(); + } +}); + +BouncingCssShapesBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new BouncingCssShapesStage(), options); + } +); + +window.benchmarkClass = BouncingCssShapesBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-particles.js b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-particles.js new file mode 100644 index 0000000000..27e02a7085 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-particles.js @@ -0,0 +1,123 @@ +function BouncingParticle(stage) +{ + this._stageSize = stage.size; + this.size = stage.particleSize; + + this.position = Stage.randomPosition(stage.size.subtract(stage.particleSize)); + this._angle = Stage.randomAngle(); + this._velocity = Stage.randomVelocity(stage.maxVelocity); + this.rotater = Stage.randomRotater(); +} + +BouncingParticle.prototype = +{ + get center() + { + return this.position.add(this.size.center); + }, + + animate: function(timeDelta) + { + this.position = this.position.move(this._angle, this._velocity, timeDelta); + this.rotater.next(timeDelta); + + // If particle is going to move off right side + if (this.position.x + this.size.x > this._stageSize.x) { + // If direction is East-South, go West-South. + if (this._angle >= 0 && this._angle < Math.PI / 2) + this._angle = Math.PI - this._angle; + // If angle is East-North, go West-North. + else if (this._angle > Math.PI / 2 * 3) + this._angle = this._angle - (this._angle - Math.PI / 2 * 3) * 2; + // Make sure the particle does not go outside the stage boundaries. + this.position.x = this._stageSize.x - this.size.x; + } + + // If particle is going to move off left side + if (this.position.x < 0) { + // If angle is West-South, go East-South. + if (this._angle > Math.PI / 2 && this._angle < Math.PI) + this._angle = Math.PI - this._angle; + // If angle is West-North, go East-North. + else if (this._angle > Math.PI && this._angle < Math.PI / 2 * 3) + this._angle = this._angle + (Math.PI / 2 * 3 - this._angle) * 2; + // Make sure the particle does not go outside the stage boundaries. + this.position.x = 0; + } + + // If particle is going to move off bottom side + if (this.position.y + this.size.y > this._stageSize.y) { + // If direction is South, go North. + if (this._angle > 0 && this._angle < Math.PI) + this._angle = Math.PI * 2 - this._angle; + // Make sure the particle does not go outside the stage boundaries. + this.position.y = this._stageSize.y - this.size.y; + } + + // If particle is going to move off top side + if (this.position.y < 0) { + // If direction is North, go South. + if (this._angle > Math.PI && this._angle < Math.PI * 2) + this._angle = this._angle - (this._angle - Math.PI) * 2; + // Make sure the particle does not go outside the stage boundaries. + this.position.y = 0; + } + } +} + +BouncingParticlesStage = Utilities.createSubclass(Stage, + function() + { + Stage.call(this); + this.particles = []; + }, { + + initialize: function(benchmark, options) + { + Stage.prototype.initialize.call(this, benchmark, options); + this.particleSize = new Point(parseInt(options["particleWidth"]) || 10, parseInt(options["particleHeight"]) || 10); + this.maxVelocity = Math.max(parseInt(options["maxVelocity"]) || 500, 100); + }, + + parseShapeParameters: function(options) + { + this.shape = options["shape"] || "circle"; + this.fill = options["fill"] || "solid"; + this.clip = options["clip"] || ""; + this.blend = options["blend"] || false; + this.filter = options["filter"] || false; + }, + + animate: function(timeDelta) + { + this.particles.forEach(function(particle) { + particle.animate(timeDelta); + }); + }, + + tune: function(count) + { + if (count == 0) + return; + + if (count > 0) { + for (var i = 0; i < count; ++i) + this.particles.push(this.createParticle()); + return; + } + + count = Math.min(-count, this.particles.length); + + if (typeof(this.particleWillBeRemoved) == "function") { + for (var i = 0; i < count; ++i) + this.particleWillBeRemoved(this.particles[this.particles.length - 1 - i]); + } + + this.particles.splice(-count, count); + }, + + complexity: function() + { + return this.particles.length; + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-images.js b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-images.js new file mode 100644 index 0000000000..2239557312 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-images.js @@ -0,0 +1,43 @@ +(function() { + +BouncingSvgImage = Utilities.createSubclass(BouncingSvgParticle, + function(stage) + { + BouncingSvgParticle.call(this, stage, "image"); + + var attrs = { x: 0, y: 0, width: this.size.x, height: this.size.y }; + var xlinkAttrs = { href: stage.imageSrc }; + this.element = Utilities.createSVGElement("image", attrs, xlinkAttrs, stage.element); + this._move(); + } +); + +BouncingSvgImagesStage = Utilities.createSubclass(BouncingSvgParticlesStage, + function() + { + BouncingSvgParticlesStage.call(this); + }, { + + initialize: function(benchmark, options) + { + BouncingSvgParticlesStage.prototype.initialize.call(this, benchmark, options); + this.imageSrc = options["imageSrc"] || "resources/yin-yang.svg"; + }, + + createParticle: function() + { + return new BouncingSvgImage(this); + } +}); + +BouncingSvgImagesBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new BouncingSvgImagesStage(), options); + } +); + +window.benchmarkClass = BouncingSvgImagesBenchmark; + +})(); + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-particles.js b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-particles.js new file mode 100644 index 0000000000..0988c42d8e --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-particles.js @@ -0,0 +1,67 @@ +BouncingSvgParticle = Utilities.createSubclass(BouncingParticle, + function(stage, shape) + { + BouncingParticle.call(this, stage); + this._shape = shape; + }, { + + _applyClipping: function(stage) + { + if (stage.clip != "star") + return; + + stage.ensureClipStarIsCreated(); + this.element.setAttribute("clip-path", "url(#star-clip)"); + }, + + _move: function() + { + var transform = "translate(" + this.position.x + ", " + this.position.y + ")"; + if (this._shape != "circle") + transform += this.rotater.rotate(this.size.center); + this.element.setAttribute("transform", transform); + }, + + animate: function(timeDelta) + { + BouncingParticle.prototype.animate.call(this, timeDelta); + this._move(); + } +}); + +BouncingSvgParticlesStage = Utilities.createSubclass(BouncingParticlesStage, + function() + { + BouncingParticlesStage.call(this); + }, { + + _createDefs: function() + { + return Utilities.createSVGElement("defs", {}, {}, this.element); + }, + + _ensureDefsIsCreated: function() + { + return this.element.querySelector("defs") || this._createDefs(); + }, + + _createClipStar: function() + { + var attrs = { id: "star-clip", clipPathUnits: "objectBoundingBox" }; + var clipPath = Utilities.createSVGElement("clipPath", attrs, {}, this._ensureDefsIsCreated()); + + attrs = { d: "M.50,0L.38,.38L0,.38L.30,.60L.18,1L.50,.75L.82,1L.70,.60L1,.38L.62,.38z" }; + Utilities.createSVGElement("path", attrs, {}, clipPath); + return clipPath; + }, + + ensureClipStarIsCreated: function() + { + return this.element.querySelector("#star-clip") || this._createClipStar(); + }, + + particleWillBeRemoved: function(particle) + { + particle.element.remove(); + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-shapes.js b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-shapes.js new file mode 100644 index 0000000000..14c917cc31 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-svg-shapes.js @@ -0,0 +1,101 @@ +(function() { + +BouncingSvgShape = Utilities.createSubclass(BouncingSvgParticle, + function(stage) + { + BouncingSvgParticle.call(this, stage, stage.shape); + this._fill = stage.fill; + + this._createShape(stage); + this._applyClipping(stage); + this._applyFill(stage); + + this._move(); + }, { + + _createShape: function(stage) + { + switch (this._shape) { + case "rect": + var attrs = { x: 0, y: 0, width: this.size.x, height: this.size.y }; + this.element = Utilities.createSVGElement("rect", attrs, {}, stage.element); + break; + + case "circle": + default: + var attrs = { cx: this.size.x / 2, cy: this.size.y / 2, r: Math.min(this.size.x, this.size.y) / 2 }; + this.element = Utilities.createSVGElement("circle", attrs, {}, stage.element); + break; + } + }, + + _applyFill: function(stage) + { + switch (this._fill) { + case "gradient": + var gradient = stage.createGradient(2); + this.element.setAttribute("fill", "url(#" + gradient.getAttribute("id") + ")"); + break; + + case "solid": + default: + this.element.setAttribute("fill", Stage.randomColor()); + break; + } + } +}); + +BouncingSvgShapesStage = Utilities.createSubclass(BouncingSvgParticlesStage, + function() + { + BouncingSvgParticlesStage.call(this); + }, { + + initialize: function(benchmark, options) + { + BouncingSvgParticlesStage.prototype.initialize.call(this, benchmark, options); + this.parseShapeParameters(options); + this._gradientsCount = 0; + }, + + createGradient: function(stops) + { + var attrs = { id: "gradient-" + ++this._gradientsCount }; + var gradient = Utilities.createSVGElement("linearGradient", attrs, {}, this._ensureDefsIsCreated()); + + for (var i = 0; i < stops; ++i) { + attrs = { offset: i * 100 / (stops - 1) + "%", 'stop-color': Stage.randomColor() }; + Utilities.createSVGElement("stop", attrs, {}, gradient); + } + + return gradient; + }, + + createParticle: function() + { + return new BouncingSvgShape(this); + }, + + particleWillBeRemoved: function(particle) + { + BouncingSvgParticlesStage.prototype.particleWillBeRemoved.call(this, particle); + + var fill = particle.element.getAttribute("fill"); + if (fill.indexOf("url(#") != 0) + return; + + var gradient = this.element.querySelector(fill.substring(4, fill.length - 1)); + this._ensureDefsIsCreated().removeChild(gradient); + } +}); + +BouncingSvgShapesBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new BouncingSvgShapesStage(), options); + } +); + +window.benchmarkClass = BouncingSvgShapesBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-tagged-images.js b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-tagged-images.js new file mode 100644 index 0000000000..1ef6a091d2 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/bouncing-tagged-images.js @@ -0,0 +1,106 @@ +(function() { + +BouncingTaggedImage = Utilities.createSubclass(BouncingParticle, + function(stage) + { + BouncingParticle.call(this, stage); + + this.element = document.createElement("img"); + this.element.style.width = this.size.x + "px"; + this.element.style.height = this.size.y + "px"; + this.element.setAttribute("src", Stage.randomElementInArray(stage.images).src); + + stage.element.appendChild(this.element); + this._move(); + }, { + + _move: function() + { + this.element.style.transform = "translate(" + this.position.x + "px," + this.position.y + "px) " + this.rotater.rotateZ(); + }, + + animate: function(timeDelta) + { + BouncingParticle.prototype.animate.call(this, timeDelta); + this._move(); + } +}); + +BouncingTaggedImagesStage = Utilities.createSubclass(BouncingParticlesStage, + + function() + { + BouncingParticlesStage.call(this); + }, { + + imageSrcs: [ + "image1", + "image2", + "image3", + "image4", + "image5", + ], + images: [], + + initialize: function(benchmark, options) + { + BouncingParticlesStage.prototype.initialize.call(this, benchmark, options); + + var lastPromise; + var images = this.images; + this.imageSrcs.forEach(function(imageSrc) { + var promise = this._loadImage("resources/" + imageSrc + ".jpg"); + if (!lastPromise) + lastPromise = promise; + else { + lastPromise = lastPromise.then(function(img) { + images.push(img); + return promise; + }); + } + }, this); + + lastPromise.then(function(img) { + images.push(img); + benchmark.readyPromise.resolve(); + }); + }, + + _loadImage: function(src) { + var img = new Image; + var promise = new SimplePromise; + + img.onload = function(e) { + promise.resolve(e.target); + }; + + img.src = src; + return promise; + }, + + createParticle: function() + { + return new BouncingTaggedImage(this); + }, + + particleWillBeRemoved: function(particle) + { + particle.element.remove(); + } +}); + +BouncingTaggedImagesBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new BouncingTaggedImagesStage(), options); + }, { + + waitUntilReady: function() { + this.readyPromise = new SimplePromise; + return this.readyPromise; + } +}); + +window.benchmarkClass = BouncingTaggedImagesBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image1.jpg b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image1.jpg new file mode 100644 index 0000000000..ea7a4c1303 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image1.jpg differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image2.jpg b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image2.jpg new file mode 100644 index 0000000000..697272dcb0 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image2.jpg differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image3.jpg b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image3.jpg new file mode 100644 index 0000000000..6e5964e7a9 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image3.jpg differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image4.jpg b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image4.jpg new file mode 100644 index 0000000000..806f548c44 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image4.jpg differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image5.jpg b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image5.jpg new file mode 100644 index 0000000000..d7971f6bcb Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/bouncing-particles/resources/image5.jpg differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/dom/compositing-transforms.html b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/compositing-transforms.html new file mode 100644 index 0000000000..6d5b0bf5e6 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/compositing-transforms.html @@ -0,0 +1,24 @@ + + + + + + + + +
    + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/dom/focus.html b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/focus.html new file mode 100644 index 0000000000..02264d746f --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/focus.html @@ -0,0 +1,51 @@ + + + + + + + + +
    +
    focus
    +
    + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/dom/leaves.html b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/leaves.html new file mode 100644 index 0000000000..625882ebef --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/leaves.html @@ -0,0 +1,26 @@ + + + + + + + + +
    + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/dom/particles.html b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/particles.html new file mode 100644 index 0000000000..fdc09399c9 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/particles.html @@ -0,0 +1,24 @@ + + + + + + + + +
    + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/compositing-transforms.js b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/compositing-transforms.js new file mode 100644 index 0000000000..9fd401eeeb --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/compositing-transforms.js @@ -0,0 +1,66 @@ +(function() { + +BouncingCompositedImage = Utilities.createSubclass(BouncingParticle, + function(stage) + { + BouncingParticle.call(this, stage); + + this.element = document.createElement("img"); + this.element.style.width = this.size.x + "px"; + this.element.style.height = this.size.y + "px"; + this.element.setAttribute("src", stage.imageSrc); + + if (stage.useFilters) + this.element.style.filter = "hue-rotate(" + Stage.randomAngle() + "rad)"; + + stage.element.appendChild(this.element); + this._move(); + }, { + + _move: function() + { + this.element.style.transform = "translate3d(" + this.position.x + "px," + this.position.y + "px, 0) " + this.rotater.rotateZ(); + }, + + animate: function(timeDelta) + { + BouncingParticle.prototype.animate.call(this, timeDelta); + this._move(); + } +}); + +CompositingTransformsStage = Utilities.createSubclass(BouncingParticlesStage, + function() + { + BouncingParticlesStage.call(this); + }, { + + initialize: function(benchmark, options) + { + BouncingParticlesStage.prototype.initialize.call(this, benchmark, options); + + this.imageSrc = options["imageSrc"] || "../resources/yin-yang.svg"; + this.useFilters = options["filters"] == "yes"; + }, + + createParticle: function() + { + return new BouncingCompositedImage(this); + }, + + particleWillBeRemoved: function(particle) + { + particle.element.remove(); + } +}); + +CompositedTransformsBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new CompositingTransformsStage(), options); + } +); + +window.benchmarkClass = CompositedTransformsBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/dom-particles.js b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/dom-particles.js new file mode 100644 index 0000000000..471444b2e7 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/dom-particles.js @@ -0,0 +1,73 @@ +(function() { + +DOMParticle = Utilities.createSubclass(Particle, + function(stage) + { + this.element = document.createElement("div"); + stage.element.appendChild(this.element); + + Particle.call(this, stage); + }, { + + reset: function() + { + Particle.prototype.reset.call(this); + + this.position = Stage.randomElementInArray(this.stage.emitLocation); + + var angle = Stage.randomInt(0, this.stage.emitSteps) / this.stage.emitSteps * Math.PI * 2 + Stage.dateCounterValue(100) * this.stage.emissionSpin; + this.velocity = new Point(Math.sin(angle), Math.cos(angle)) + .multiply(Stage.random(.5, 2.5)); + + this.element.style.width = this.size.x + "px"; + this.element.style.height = this.size.y + "px"; + this.stage.colorOffset = (this.stage.colorOffset + 1) % 360; + this.element.style.backgroundColor = "hsl(" + this.stage.colorOffset + ", 70%, 45%)"; + }, + + move: function() + { + this.element.style.transform = "translate(" + this.position.x + "px, " + this.position.y + "px)" + this.rotater.rotateZ(); + } +}); + +DOMParticleStage = Utilities.createSubclass(ParticlesStage, + function() + { + ParticlesStage.call(this); + }, { + + initialize: function(benchmark) + { + ParticlesStage.prototype.initialize.call(this, benchmark); + this.emissionSpin = Stage.random(0, 3); + this.emitSteps = Stage.randomInt(4, 6); + this.emitLocation = [ + new Point(this.size.x * .25, this.size.y * .333), + new Point(this.size.x * .5, this.size.y * .25), + new Point(this.size.x * .75, this.size.y * .333) + ]; + this.colorOffset = Stage.randomInt(0, 359); + }, + + createParticle: function() + { + return new DOMParticle(this); + }, + + willRemoveParticle: function(particle) + { + particle.element.remove(); + } +}); + +DOMParticleBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new DOMParticleStage(), options); + } +); + +window.benchmarkClass = DOMParticleBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/focus.js b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/focus.js new file mode 100644 index 0000000000..d7722cdff4 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/focus.js @@ -0,0 +1,166 @@ +(function() { + +var maxVerticalOffset = 50; +var minimumDiameter = 30; +var centerDiameter = 90; +var sizeVariance = 60; +var travelDistance = 50; + +var opacityMultiplier = 30; + +var FocusElement = Utilities.createClass( + function(stage) + { + var size = minimumDiameter + sizeVariance; + + // Size and blurring are a function of depth. + this._depth = Pseudo.random(); + var distance = Utilities.lerp(this._depth, 0, sizeVariance); + size -= distance; + + var top = Stage.random(0, stage.size.height - size) - stage.maxBlurValue * 3; + var left = Stage.random(0, stage.size.width - size) - stage.maxBlurValue * 3; + + this.container = document.createElement('div'); + this.container.style.width = (size + stage.maxBlurValue * 6) + "px"; + this.container.style.height = (size + stage.maxBlurValue * 6) + "px"; + this.container.style.top = top + "px"; + this.container.style.left = left + "px"; + this.container.style.zIndex = Math.round((1 - this._depth) * 10); + + this.particle = Utilities.createElement("div", {}, this.container); + this.particle.style.width = size + "px"; + this.particle.style.height = size + "px"; + this.particle.style.top = (stage.maxBlurValue * 3) + "px"; + this.particle.style.left = (stage.maxBlurValue * 3) + "px"; + + var depthMultiplier = Utilities.lerp(1 - this._depth, 0.8, 1); + this._sinMultiplier = Pseudo.random() * Stage.randomSign() * depthMultiplier * travelDistance; + this._cosMultiplier = Pseudo.random() * Stage.randomSign() * depthMultiplier * travelDistance; + }, { + + hide: function() + { + this.container.style.display = "none"; + }, + + show: function() + { + this.container.style.display = "block"; + }, + + animate: function(stage, sinFactor, cosFactor) + { + var top = sinFactor * this._sinMultiplier; + var left = cosFactor * this._cosMultiplier; + + Utilities.setElementPrefixedProperty(this.container, "filter", "blur(" + stage.getBlurValue(this._depth) + "px) opacity(" + stage.getOpacityValue(this._depth) + "%)"); + this.container.style.transform = "translate3d(" + left + "%, " + top + "%, 0)"; + } +}); + +var FocusStage = Utilities.createSubclass(Stage, + function() + { + Stage.call(this); + }, { + + movementDuration: 2500, + focusDuration: 1000, + + centerObjectDepth: 0.0, + + minBlurValue: 1.5, + maxBlurValue: 15, + maxCenterObjectBlurValue: 5, + + initialize: function(benchmark, options) + { + Stage.prototype.initialize.call(this, benchmark, options); + + this._testElements = []; + this._focalPoint = 0.5; + this._offsetIndex = 0; + + this._centerElement = document.getElementById("center-text"); + this._centerElement.style.width = (centerDiameter + this.maxCenterObjectBlurValue * 6) + "px"; + this._centerElement.style.height = (centerDiameter + this.maxCenterObjectBlurValue * 6) + "px"; + this._centerElement.style.zIndex = Math.round(10 * this.centerObjectDepth); + + var particle = document.querySelector("#center-text div"); + particle.style.width = centerDiameter + "px"; + particle.style.height = centerDiameter + "px"; + particle.style.top = (this.maxCenterObjectBlurValue * 3) + "px"; + particle.style.left = (this.maxCenterObjectBlurValue * 3) + "px"; + + var blur = this.getBlurValue(this.centerObjectDepth, true); + Utilities.setElementPrefixedProperty(this._centerElement, "filter", "blur(" + blur + "px)"); + }, + + complexity: function() + { + return 1 + this._offsetIndex; + }, + + tune: function(count) + { + if (count == 0) + return; + + if (count < 0) { + this._offsetIndex = Math.max(0, this._offsetIndex + count); + for (var i = this._offsetIndex; i < this._testElements.length; ++i) + this._testElements[i].hide(); + return; + } + + var newIndex = this._offsetIndex + count; + for (var i = this._testElements.length; i < newIndex; ++i) { + var obj = new FocusElement(this); + this._testElements.push(obj); + this.element.appendChild(obj.container); + } + for (var i = this._offsetIndex; i < newIndex; ++i) + this._testElements[i].show(); + this._offsetIndex = newIndex; + }, + + animate: function() + { + var time = this._benchmark.timestamp; + var sinFactor = Math.sin(time / this.movementDuration); + var cosFactor = Math.cos(time / this.movementDuration); + + var focusProgress = 0.5 + 0.5 * Math.sin(time / this.focusDuration); + this._focalPoint = focusProgress; + + Utilities.setElementPrefixedProperty(this._centerElement, "filter", "blur(" + this.getBlurValue(this.centerObjectDepth, true) + "px)"); + + for (var i = 0; i < this._offsetIndex; ++i) + this._testElements[i].animate(this, sinFactor, cosFactor); + }, + + getBlurValue: function(depth, isCenter) + { + if (isCenter) + return 1 + Math.abs(depth - this._focalPoint) * (this.maxCenterObjectBlurValue - 1); + + return Utilities.lerp(Math.abs(depth - this._focalPoint), this.minBlurValue, this.maxBlurValue); + }, + + getOpacityValue: function(depth) + { + return Math.max(1, opacityMultiplier * (1 - Math.abs(depth - this._focalPoint))); + }, +}); + +var FocusBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new FocusStage(), options); + } +); + +window.benchmarkClass = FocusBenchmark; + +}()); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/leaves.js b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/leaves.js new file mode 100644 index 0000000000..604c973667 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/dom/resources/leaves.js @@ -0,0 +1,48 @@ +Leaf = Utilities.createSubclass(Particle, + function(stage) + { + this.element = document.createElement("img"); + this.element.setAttribute("src", Stage.randomElementInArray(stage.images).src); + stage.element.appendChild(this.element); + + Particle.call(this, stage); + }, { + + sizeMinimum: 20, + sizeRange: 40, + + reset: function() + { + Particle.prototype.reset.call(this); + this.element.style.width = this.size.x + "px"; + this.element.style.height = this.size.y + "px"; + this._opacity = .01; + this._opacityRate = 0.02 * Stage.random(1, 6); + this._position = new Point(Stage.random(0, this.maxPosition.x), Stage.random(-this.size.height, this.maxPosition.y)); + this._velocity = new Point(Stage.random(-6, -2), .1 * this.size.y + Stage.random(-1, 1)); + }, + + animate: function(timeDelta) + { + this.rotater.next(timeDelta); + + this._position.x += this._velocity.x + 8 * this.stage.focusX; + this._position.y += this._velocity.y; + this._opacity += this._opacityRate; + if (this._opacity > 1) { + this._opacity = 1; + this._opacityRate *= -1; + } else if (this._opacity < 0 || this._position.y > this.stage.size.height) + this.reset(); + + if (this._position.x < -this.size.width || this._position.x > this.stage.size.width) + this._position.x = this._position.x - Math.sign(this._position.x) * (this.size.width + this.stage.size.width); + this.move(); + }, + + move: function() + { + this.element.style.transform = "translate(" + this._position.x + "px, " + this._position.y + "px)" + this.rotater.rotateZ(); + this.element.style.opacity = this._opacity; + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/canvas-stage.html b/third_party/webkit/PerformanceTests/MotionMark/tests/master/canvas-stage.html new file mode 100644 index 0000000000..f86cb44e10 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/canvas-stage.html @@ -0,0 +1,17 @@ + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/focus.html b/third_party/webkit/PerformanceTests/MotionMark/tests/master/focus.html new file mode 100644 index 0000000000..e97a7cd79f --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/focus.html @@ -0,0 +1,29 @@ + + + + + + + + +
    + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/image-data.html b/third_party/webkit/PerformanceTests/MotionMark/tests/master/image-data.html new file mode 100644 index 0000000000..36b52c9d87 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/image-data.html @@ -0,0 +1,28 @@ + + + + + + + + +
    + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/leaves.html b/third_party/webkit/PerformanceTests/MotionMark/tests/master/leaves.html new file mode 100644 index 0000000000..ada054025c --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/leaves.html @@ -0,0 +1,25 @@ + + + + + + + + +
    + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/multiply.html b/third_party/webkit/PerformanceTests/MotionMark/tests/master/multiply.html new file mode 100644 index 0000000000..717aff7d8b --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/multiply.html @@ -0,0 +1,53 @@ + + + + + + + + +
    +
    + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/canvas-stage.js b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/canvas-stage.js new file mode 100644 index 0000000000..22002eccd6 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/canvas-stage.js @@ -0,0 +1,52 @@ +SimpleCanvasStage = Utilities.createSubclass(Stage, + function(canvasObject) + { + Stage.call(this); + this._canvasObject = canvasObject; + this.objects = []; + this.offsetIndex = 0; + }, { + + initialize: function(benchmark, options) + { + Stage.prototype.initialize.call(this, benchmark, options); + this.context = this.element.getContext("2d"); + }, + + tune: function(count) + { + if (count == 0) + return; + + if (count < 0) { + this.offsetIndex = Math.min(this.offsetIndex - count, this.objects.length); + return; + } + + var newIndex = this.offsetIndex - count; + if (newIndex < 0) { + this.offsetIndex = 0; + newIndex = -newIndex; + for (var i = 0; i < newIndex; ++i) { + if (this._canvasObject.constructor === Array) + this.objects.push(new (Stage.randomElementInArray(this._canvasObject))(this)); + else + this.objects.push(new this._canvasObject(this)); + } + } else + this.offsetIndex = newIndex; + }, + + animate: function() + { + var context = this.context; + context.clearRect(0, 0, this.size.x, this.size.y); + for (var i = this.offsetIndex, length = this.objects.length; i < length; ++i) + this.objects[i].draw(context); + }, + + complexity: function() + { + return this.objects.length - this.offsetIndex; + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/canvas-tests.js b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/canvas-tests.js new file mode 100644 index 0000000000..79fc867082 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/canvas-tests.js @@ -0,0 +1,311 @@ +(function() { + +// === PAINT OBJECTS === + +CanvasLineSegment = Utilities.createClass( + function(stage) + { + var circle = Stage.randomInt(0, 3); + this._color = ["#e01040", "#10c030", "#744CBA", "#e05010"][circle]; + this._lineWidth = Math.pow(Pseudo.random(), 12) * 20 + 3; + this._omega = Pseudo.random() * 3 + 0.2; + var theta = Stage.randomAngle(); + this._cosTheta = Math.cos(theta); + this._sinTheta = Math.sin(theta); + this._startX = stage.circleRadius * this._cosTheta + stage.circleX[circle]; + this._startY = stage.circleRadius * this._sinTheta + stage.circleY[circle]; + this._length = Math.pow(Pseudo.random(), 8) * stage.lineLengthMaximum + stage.lineMinimum; + this._segmentDirection = Pseudo.random() > 0.5 ? -1 : 1; + }, { + + draw: function(context) + { + context.strokeStyle = this._color; + context.lineWidth = this._lineWidth; + + this._length += Math.sin(Stage.dateCounterValue(100) * this._omega); + + context.beginPath(); + context.moveTo(this._startX, this._startY); + context.lineTo(this._startX + this._segmentDirection * this._length * this._cosTheta, + this._startY + this._segmentDirection * this._length * this._sinTheta); + context.stroke(); + } +}); + +CanvasArc = Utilities.createClass( + function(stage) + { + var maxX = 6, maxY = 3; + var distanceX = stage.size.x / maxX; + var distanceY = stage.size.y / (maxY + 1); + var randY = Stage.randomInt(0, maxY); + var randX = Stage.randomInt(0, maxX - 1 * (randY % 2)); + + this._point = new Point(distanceX * (randX + (randY % 2) / 2), distanceY * (randY + .5)); + + this._radius = 20 + Math.pow(Pseudo.random(), 5) * (Math.min(distanceX, distanceY) / 1.8); + this._startAngle = Stage.randomAngle(); + this._endAngle = Stage.randomAngle(); + this._omega = (Pseudo.random() - 0.5) * 0.3; + this._counterclockwise = Stage.randomBool(); + var colors = ["#101010", "#808080", "#c0c0c0"]; + colors.push(["#e01040", "#10c030", "#e05010"][(randX + Math.ceil(randY / 2)) % 3]); + this._color = colors[Math.floor(Pseudo.random() * colors.length)]; + this._lineWidth = 1 + Math.pow(Pseudo.random(), 5) * 30; + this._doStroke = Stage.randomInt(0, 3) != 0; + }, { + + draw: function(context) + { + this._startAngle += this._omega; + this._endAngle += this._omega / 2; + + if (this._doStroke) { + context.strokeStyle = this._color; + context.lineWidth = this._lineWidth; + context.beginPath(); + context.arc(this._point.x, this._point.y, this._radius, this._startAngle, this._endAngle, this._counterclockwise); + context.stroke(); + } else { + context.fillStyle = this._color; + context.beginPath(); + context.lineTo(this._point.x, this._point.y); + context.arc(this._point.x, this._point.y, this._radius, this._startAngle, this._endAngle, this._counterclockwise); + context.lineTo(this._point.x, this._point.y); + context.fill(); + } + } +}); + +// CanvasLinePoint contains no draw() method since it is either moveTo or +// lineTo depending on its index. +CanvasLinePoint = Utilities.createClass( + function(stage) + { + var colors = ["#101010", "#808080", "#c0c0c0", "#101010", "#808080", "#c0c0c0", "#e01040"]; + this.color = Stage.randomElementInArray(colors); + this.width = Math.pow(Pseudo.random(), 5) * 20 + 1; + this.isSplit = Pseudo.random() > 0.95; + + var nextPoint; + if (stage.objects.length) + nextPoint = this.randomPoint(stage, stage.objects[stage.objects.length - 1].coordinate); + else + nextPoint = this.randomPoint(stage, this.gridSize.center); + this.point = nextPoint.point; + this.coordinate = nextPoint.coordinate; + }, { + + gridSize: new Point(80, 40), + offsets: [ + new Point(-4, 0), + new Point(2, 0), + new Point(1, -2), + new Point(1, 2), + ], + + randomPoint: function(stage, startCoordinate) + { + var coordinate = startCoordinate; + if (stage.objects.length) { + var offset = Stage.randomElementInArray(this.offsets); + + coordinate = coordinate.add(offset); + if (coordinate.x < 0 || coordinate.x > this.gridSize.width) + coordinate.x -= offset.x * 2; + if (coordinate.y < 0 || coordinate.y > this.gridSize.height) + coordinate.y -= offset.y * 2; + } + + var x = (coordinate.x + .5) * stage.size.x / (this.gridSize.width + 1); + var y = (coordinate.y + .5) * stage.size.y / (this.gridSize.height + 1); + return { + point: new Point(x, y), + coordinate: coordinate + }; + }, + + draw: function(context) + { + context.lineTo(this.point.x, this.point.y); + } +}); + +CanvasQuadraticSegment = Utilities.createSubclass(CanvasLinePoint, + function(stage) + { + CanvasLinePoint.call(this, stage); + // The chosen point is instead the control point. + this._point2 = this.point; + + // Get another random point for the actual end point of the segment. + var nextPoint = this.randomPoint(stage, this.coordinate); + this.point = nextPoint.point; + this.coordinate = nextPoint.coordinate; + }, { + + draw: function(context) + { + context.quadraticCurveTo(this._point2.x, this._point2.y, this.point.x, this.point.y); + } +}); + +CanvasBezierSegment = Utilities.createSubclass(CanvasLinePoint, + function(stage) + { + CanvasLinePoint.call(this, stage); + // The chosen point is instead the first control point. + this._point2 = this.point; + var nextPoint = this.randomPoint(stage, this.coordinate); + this._point3 = nextPoint.point; + + nextPoint = this.randomPoint(stage, nextPoint.coordinate); + this.point = nextPoint.point; + this.coordinate = nextPoint.coordinate; + }, { + + draw: function(context, off) + { + context.bezierCurveTo(this._point2.x, this._point2.y, this._point3.x, this._point3.y, this.point.x, this.point.y); + } +}); + +// === STAGES === + +CanvasLineSegmentStage = Utilities.createSubclass(SimpleCanvasStage, + function() + { + SimpleCanvasStage.call(this, CanvasLineSegment); + }, { + + initialize: function(benchmark, options) + { + SimpleCanvasStage.prototype.initialize.call(this, benchmark, options); + this.context.lineCap = options["lineCap"] || "butt"; + this.lineMinimum = 20; + this.lineLengthMaximum = 40; + this.circleRadius = this.size.x / 8 - .4 * (this.lineMinimum + this.lineLengthMaximum); + this.circleX = [ + 5.5 / 32 * this.size.x, + 12.5 / 32 * this.size.x, + 19.5 / 32 * this.size.x, + 26.5 / 32 * this.size.x, + ]; + this.circleY = [ + 2.1 / 3 * this.size.y, + 0.9 / 3 * this.size.y, + 2.1 / 3 * this.size.y, + 0.9 / 3 * this.size.y + ]; + this.halfSize = this.size.multiply(.5); + this.twoFifthsSizeX = this.size.x * .4; + }, + + animate: function() + { + var context = this.context; + context.clearRect(0, 0, this.size.x, this.size.y); + + var angle = Stage.dateFractionalValue(3000) * Math.PI * 2; + var dx = this.twoFifthsSizeX * Math.cos(angle); + var dy = this.twoFifthsSizeX * Math.sin(angle); + + var gradient = context.createLinearGradient(this.halfSize.x + dx, this.halfSize.y + dy, this.halfSize.x - dx, this.halfSize.y - dy); + var gradientStep = 0.5 + 0.5 * Math.sin(Stage.dateFractionalValue(5000) * Math.PI * 2); + var colorStopStep = Utilities.lerp(gradientStep, -.1, .1); + var brightnessStep = Math.round(Utilities.lerp(gradientStep, 32, 64)); + var color1Step = "rgba(" + brightnessStep + "," + brightnessStep + "," + (brightnessStep << 1) + ",.4)"; + var color2Step = "rgba(" + (brightnessStep << 1) + "," + (brightnessStep << 1) + "," + brightnessStep + ",.4)"; + gradient.addColorStop(0, color1Step); + gradient.addColorStop(.2 + colorStopStep, color1Step); + gradient.addColorStop(.8 - colorStopStep, color2Step); + gradient.addColorStop(1, color2Step); + + context.lineWidth = 15; + for(var i = 0; i < 4; i++) { + context.strokeStyle = ["#e01040", "#10c030", "#744CBA", "#e05010"][i]; + context.fillStyle = ["#70051d", "#016112", "#2F0C6E", "#702701"][i]; + context.beginPath(); + context.arc(this.circleX[i], this.circleY[i], this.circleRadius, 0, Math.PI*2); + context.stroke(); + context.fill(); + context.fillStyle = gradient; + context.fill(); + } + + for (var i = this.offsetIndex, length = this.objects.length; i < length; ++i) + this.objects[i].draw(context); + } +}); + +CanvasLinePathStage = Utilities.createSubclass(SimpleCanvasStage, + function() + { + SimpleCanvasStage.call(this, [CanvasLinePoint, CanvasLinePoint, CanvasQuadraticSegment, CanvasBezierSegment]); + }, { + + initialize: function(benchmark, options) + { + SimpleCanvasStage.prototype.initialize.call(this, benchmark, options); + this.context.lineJoin = options["lineJoin"] || "bevel"; + this.context.lineCap = options["lineCap"] || "butt"; + }, + + animate: function() { + var context = this.context; + + context.clearRect(0, 0, this.size.x, this.size.y); + context.beginPath(); + for (var i = this.offsetIndex, length = this.objects.length; i < length; ++i) { + var object = this.objects[i]; + if (i == this.offsetIndex) { + context.lineWidth = object.width; + context.strokeStyle = object.color; + context.beginPath(); + context.moveTo(object.point.x, object.point.y); + } else { + object.draw(context); + + if (object.isSplit) { + context.stroke(); + + context.lineWidth = object.width; + context.strokeStyle = object.color; + context.beginPath(); + context.moveTo(object.point.x, object.point.y); + } + + if (Pseudo.random() > 0.995) + object.isSplit = !object.isSplit; + } + } + context.stroke(); + } +}); + +// === BENCHMARK === + +CanvasPathBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + var stage; + switch (options["pathType"]) { + case "line": + stage = new CanvasLineSegmentStage(); + break; + case "linePath": + stage = new CanvasLinePathStage(); + break; + case "arcs": + stage = new SimpleCanvasStage(CanvasArc); + break; + } + + Benchmark.call(this, stage, options); + } +); + +window.benchmarkClass = CanvasPathBenchmark; + +})(); \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/compass.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/compass.svg new file mode 100644 index 0000000000..3f94e7a4b2 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/compass.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/compass100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/compass100.png new file mode 100644 index 0000000000..e513ce11e3 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/compass100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/console.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/console.svg new file mode 100644 index 0000000000..e3c7611d2a --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/console.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/console100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/console100.png new file mode 100644 index 0000000000..81f9c1641d Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/console100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/contribute.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/contribute.svg new file mode 100644 index 0000000000..68860efa86 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/contribute.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/contribute100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/contribute100.png new file mode 100644 index 0000000000..790e3dcfca Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/contribute100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/debugger.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/debugger.svg new file mode 100644 index 0000000000..646ddf446c --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/debugger.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/debugger100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/debugger100.png new file mode 100644 index 0000000000..e2652096dc Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/debugger100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/focus.js b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/focus.js new file mode 100644 index 0000000000..04842e744e --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/focus.js @@ -0,0 +1,129 @@ +(function() { + +var minimumDiameter = 30; +var sizeVariance = 20; +var travelDistance = 50; + +var minBlurValue = 1; +var maxBlurValue = 10; + +var opacityMultiplier = 30; +var focusDuration = 1000; +var movementDuration = 2500; + +var FocusElement = Utilities.createClass( + function(stage) + { + var size = minimumDiameter + sizeVariance; + + // Size and blurring are a function of depth. + this._depth = Pseudo.random(); + var distance = Utilities.lerp(this._depth, 0, sizeVariance); + size -= distance; + + var top = Stage.random(0, stage.size.height - size); + var left = Stage.random(0, stage.size.width - size); + + this.particle = document.createElement("div"); + this.particle.style.width = size + "px"; + this.particle.style.height = size + "px"; + this.particle.style.top = top + "px"; + this.particle.style.left = left + "px"; + this.particle.style.zIndex = Math.round((1 - this._depth) * 10); + + var depthMultiplier = Utilities.lerp(1 - this._depth, 0.8, 1); + this._sinMultiplier = Pseudo.random() * Stage.randomSign() * depthMultiplier * travelDistance; + this._cosMultiplier = Pseudo.random() * Stage.randomSign() * depthMultiplier * travelDistance; + + this.animate(stage, 0, 0); + }, { + + hide: function() + { + this.particle.style.display = "none"; + }, + + show: function() + { + this.particle.style.display = "block"; + }, + + animate: function(stage, sinFactor, cosFactor) + { + var top = sinFactor * this._sinMultiplier; + var left = cosFactor * this._cosMultiplier; + var distance = Math.abs(this._depth - stage.focalPoint); + var blur = Utilities.lerp(distance, minBlurValue, maxBlurValue); + var opacity = Math.max(5, opacityMultiplier * (1 - distance)); + + Utilities.setElementPrefixedProperty(this.particle, "filter", "blur(" + blur + "px) opacity(" + opacity + "%)"); + this.particle.style.transform = "translate3d(" + left + "%, " + top + "%, 0)"; + } +}); + +var FocusStage = Utilities.createSubclass(Stage, + function() + { + Stage.call(this); + }, { + + initialize: function(benchmark, options) + { + Stage.prototype.initialize.call(this, benchmark, options); + + this._testElements = []; + this._offsetIndex = 0; + this.focalPoint = 0.5; + }, + + complexity: function() + { + return this._offsetIndex; + }, + + tune: function(count) + { + if (count == 0) + return; + + if (count < 0) { + this._offsetIndex = Math.max(0, this._offsetIndex + count); + for (var i = this._offsetIndex; i < this._testElements.length; ++i) + this._testElements[i].hide(); + return; + } + + var newIndex = this._offsetIndex + count; + for (var i = this._testElements.length; i < newIndex; ++i) { + var obj = new FocusElement(this); + this._testElements.push(obj); + this.element.appendChild(obj.particle); + } + for (var i = this._offsetIndex; i < newIndex; ++i) + this._testElements[i].show(); + this._offsetIndex = newIndex; + }, + + animate: function() + { + var time = this._benchmark.timestamp; + var sinFactor = Math.sin(time / movementDuration); + var cosFactor = Math.cos(time / movementDuration); + + this.focalPoint = 0.5 + 0.5 * Math.sin(time / focusDuration); + + for (var i = 0; i < this._offsetIndex; ++i) + this._testElements[i].animate(this, sinFactor, cosFactor); + } +}); + +var FocusBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new FocusStage(), options); + } +); + +window.benchmarkClass = FocusBenchmark; + +}()); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/image-data.js b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/image-data.js new file mode 100644 index 0000000000..6de5d068bb --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/image-data.js @@ -0,0 +1,181 @@ +(function() { + +var ImageDataStage = Utilities.createSubclass(Stage, + function() { + Stage.call(this); + + this.testElements = []; + this._offsetIndex = 0; + }, { + + imageWidth: 50, + imageHeight: 50, + pixelStride: 4, + rowStride: 200, + weightNegativeThreshold: 0.04, + weightPositiveThreshold: 0.96, + imageSrcs: [ + "compass", + "console", + "contribute", + "debugger", + "inspector", + "layout", + "performance", + "script", + "shortcuts", + "standards", + "storage", + "styles", + "timeline" + ], + images: [], + + initialize: function(benchmark) + { + Stage.prototype.initialize.call(this, benchmark); + + var lastPromise; + var images = this.images; + this.imageSrcs.forEach(function(imageSrc) { + var promise = this._loadImage("resources/" + imageSrc + ".svg"); + if (!lastPromise) + lastPromise = promise; + else { + lastPromise = lastPromise.then(function(img) { + images.push(img); + return promise; + }); + } + }, this); + + lastPromise.then(function(img) { + images.push(img); + benchmark.readyPromise.resolve(); + }.bind(this)); + }, + + _loadImage: function(src) { + var img = new Image; + var promise = new SimplePromise; + + img.addEventListener('load', function onImageLoad(e) { + img.removeEventListener('load', onImageLoad); + promise.resolve(img); + }); + + img.src = src; + return promise; + }, + + tune: function(count) + { + if (count == 0) + return; + + if (count < 0) { + this._offsetIndex = Math.max(this._offsetIndex + count, 0); + for (var i = this._offsetIndex; i < this.testElements.length; ++i) + this.testElements[i].style.display = "none"; + return; + } + + this._offsetIndex = this._offsetIndex + count; + var index = Math.min(this._offsetIndex, this.testElements.length); + for (var i = 0; i < index; ++i) { + this.testElements[i].style.display = "block"; + this._refreshElement(this.testElements[i]); + } + if (this._offsetIndex <= this.testElements.length) + return; + + index = this._offsetIndex - this.testElements.length; + for (var i = 0; i < index; ++i) { + var element = this._createTestElement(); + this.testElements.push(element); + this.element.appendChild(element); + } + }, + + _createTestElement: function() { + var element = document.createElement('canvas'); + element.width = this.imageWidth; + element.height = this.imageHeight; + element.style.width = this.imageWidth + 'px'; + element.style.height = this.imageHeight + 'px'; + + this._refreshElement(element); + return element; + }, + + _refreshElement: function(element) { + var top = Stage.randomInt(0, Math.floor((this.size.height - this.imageHeight) / this.imageHeight)) * this.imageHeight; + var left = Stage.randomInt(0, Math.floor((this.size.width - this.imageWidth) / this.imageWidth)) * this.imageWidth; + + element.style.top = top + 'px'; + element.style.left = left + 'px'; + }, + + animate: function(timeDelta) { + for (var i = 0; i < this._offsetIndex; ++i) { + var element = this.testElements[i]; + var context = element.getContext("2d"); + + // Get image data + var imageData = context.getImageData(0, 0, this.imageWidth, this.imageHeight); + + var didDraw = false, + neighborPixelIndex, + dataLen = imageData.data.length; + for (var j = 0; j < dataLen; j += this.pixelStride) { + if (imageData.data[j + 3] === 0) + continue; + + // get random neighboring pixel color + neighborPixelIndex = this._getRandomNeighboringPixelIndex(j, dataLen); + + // Update the RGB data + imageData.data[j] = imageData.data[neighborPixelIndex]; + imageData.data[j + 1] = imageData.data[neighborPixelIndex + 1]; + imageData.data[j + 2] = imageData.data[neighborPixelIndex + 2]; + imageData.data[j + 3] = imageData.data[neighborPixelIndex + 3]; + didDraw = true; + } + + if (didDraw) + context.putImageData(imageData, 0, 0); + else { + this._refreshElement(element); + element.getContext("2d").drawImage(Stage.randomElementInArray(this.images), 0, 0, this.imageWidth, this.imageHeight); + } + } + }, + + _getRandomNeighboringPixelIndex: function(pixelIdx, pixelArrayLength) + { + var xOffset = Math.floor((Pseudo.random() - this.weightNegativeThreshold) / (this.weightPositiveThreshold - this.weightNegativeThreshold)); + var yOffset = Math.floor((Pseudo.random() - this.weightNegativeThreshold) / (this.weightPositiveThreshold - this.weightNegativeThreshold)); + return (pixelIdx + this.pixelStride * xOffset + this.rowStride * yOffset) % pixelArrayLength; + }, + + complexity: function() + { + return this._offsetIndex; + } +}); + +var ImageDataBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new ImageDataStage(), options); + }, { + + waitUntilReady: function() { + this.readyPromise = new SimplePromise; + return this.readyPromise; + } +}); + +window.benchmarkClass = ImageDataBenchmark; + +}()); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/inspector.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/inspector.svg new file mode 100644 index 0000000000..68cc413052 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/inspector.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/inspector100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/inspector100.png new file mode 100644 index 0000000000..26d1a7d592 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/inspector100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/layout.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/layout.svg new file mode 100644 index 0000000000..73db97eb46 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/layout.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/layout100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/layout100.png new file mode 100644 index 0000000000..5b1ec2806b Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/layout100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/leaves.js b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/leaves.js new file mode 100644 index 0000000000..7a049836ff --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/leaves.js @@ -0,0 +1,135 @@ +Leaf = Utilities.createSubclass(Particle, + function(stage) + { + this.element = document.createElement("img"); + this.element.setAttribute("src", Stage.randomElementInArray(stage.images).src); + var sizeString = this.sizeMinimum + "px"; + this.element.style.width = sizeString; + this.element.style.height = sizeString; + stage.element.appendChild(this.element); + + Particle.call(this, stage); + }, { + + sizeMinimum: 25, + sizeRange: 0, + + reset: function() + { + Particle.prototype.reset.call(this); + this._life = Stage.randomInt(20, 100); + this._position = new Point(Stage.random(0, this.maxPosition.x), Stage.random(-this.size.height, this.maxPosition.y)); + this._velocity = new Point(Stage.random(-6, -2), .1 * this.size.y + Stage.random(-1, 1)); + }, + + animate: function(timeDelta) + { + this.rotater.next(timeDelta); + + this._position.x += this._velocity.x + 8 * this.stage.focusX; + this._position.y += this._velocity.y; + + this._life--; + if (!this._life || this._position.y > this.stage.size.height) + this.reset(); + + if (this._position.x < -this.size.width || this._position.x > this.stage.size.width) + this._position.x = this._position.x - Math.sign(this._position.x) * (this.size.width + this.stage.size.width); + this.move(); + }, + + move: function() + { + this.element.style.transform = "translate(" + this._position.x + "px, " + this._position.y + "px)" + this.rotater.rotateZ(); + } +}); + +Utilities.extendObject(ParticlesStage.prototype, { + + imageSrcs: [ + "compass", + "console", + "contribute", + "debugger", + "inspector", + "layout", + "performance", + "script", + "shortcuts", + "standards", + "storage", + "styles", + "timeline" + ], + images: [], + + initialize: function(benchmark) + { + Stage.prototype.initialize.call(this, benchmark); + + var lastPromise; + var images = this.images; + this.imageSrcs.forEach(function(imageSrc) { + var promise = this._loadImage("../master/resources/" + imageSrc + "100.png"); + if (!lastPromise) + lastPromise = promise; + else { + lastPromise = lastPromise.then(function(img) { + images.push(img); + return promise; + }); + } + }, this); + + lastPromise.then(function(img) { + images.push(img); + benchmark.readyPromise.resolve(); + }); + }, + + _loadImage: function(src) { + var img = new Image; + var promise = new SimplePromise; + + img.onload = function(e) { + promise.resolve(e.target); + }; + + img.src = src; + return promise; + }, + + animate: function(timeDelta) + { + this.focusX = 0.5 + 0.5 * Math.sin(Stage.dateFractionalValue(10000) * Math.PI * 2); + timeDelta /= 4; + this.particles.forEach(function(particle) { + particle.animate(timeDelta); + }); + }, + + createParticle: function() + { + return new Leaf(this); + }, + + willRemoveParticle: function(particle) + { + particle.element.remove(); + } +}); + +LeavesBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new ParticlesStage(), options); + }, { + + waitUntilReady: function() { + this.readyPromise = new SimplePromise; + return this.readyPromise; + } + +}); + +window.benchmarkClass = LeavesBenchmark; diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/multiply.js b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/multiply.js new file mode 100644 index 0000000000..e93cfbb5b9 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/multiply.js @@ -0,0 +1,119 @@ +(function() { + +var MultiplyStage = Utilities.createSubclass(Stage, + function() + { + Stage.call(this); + this.tiles = []; + this._offsetIndex = 0; + }, { + + initialize: function(benchmark, options) + { + Stage.prototype.initialize.call(this, benchmark, options); + var tileSize = Math.round(this.size.height / 25); + + // Fill the scene with elements + var x = Math.round((this.size.width - tileSize) / 2); + var y = Math.round((this.size.height - tileSize) / 2); + var tileStride = tileSize; + var direction = 0; + var spiralCounter = 2; + var nextIndex = 1; + var maxSide = Math.floor(y / tileStride) * 2 + 1; + this._centerSpiralCount = maxSide * maxSide; + for (var i = 0; i < this._centerSpiralCount; ++i) { + this._addTile(x, y, tileSize, Stage.randomInt(0, 359)); + + if (i == nextIndex) { + direction = (direction + 1) % 4; + spiralCounter++; + nextIndex += spiralCounter >> 1; + } + if (direction == 0) + x += tileStride; + else if (direction == 1) + y -= tileStride; + else if (direction == 2) + x -= tileStride; + else + y += tileStride; + } + + this._sidePanelCount = maxSide * Math.floor((this.size.width - x) / tileStride) * 2; + for (var i = 0; i < this._sidePanelCount; ++i) { + var sideX = x + Math.floor(Math.floor(i / maxSide) / 2) * tileStride; + var sideY = y - tileStride * (i % maxSide); + + if (Math.floor(i / maxSide) % 2 == 1) + sideX = this.size.width - sideX - tileSize + 1; + this._addTile(sideX, sideY, tileSize, Stage.randomInt(0, 359)); + } + }, + + _addTile: function(x, y, tileSize, rotateDeg) + { + var tile = Utilities.createElement("div", { class: "div-" + Stage.randomInt(0,6) }, this.element); + var halfTileSize = tileSize / 2; + tile.style.left = x + 'px'; + tile.style.top = y + 'px'; + tile.style.width = tileSize + 'px'; + tile.style.height = tileSize + 'px'; + tile.style.visibility = "hidden"; + + var distance = 1 / tileSize * this.size.multiply(0.5).subtract(new Point(x + halfTileSize, y + halfTileSize)).length(); + this.tiles.push({ + element: tile, + rotate: rotateDeg, + step: Math.max(3, distance / 1.5), + distance: distance, + active: false + }); + }, + + complexity: function() + { + return this._offsetIndex; + }, + + tune: function(count) + { + this._offsetIndex = Math.max(0, Math.min(this._offsetIndex + count, this.tiles.length)); + this._distanceFactor = 1.5 * (1 - 0.5 * Math.max(this._offsetIndex - this._centerSpiralCount, 0) / this._sidePanelCount) / Math.sqrt(this._offsetIndex); + }, + + animate: function() + { + var progress = this._benchmark.timestamp % 10000 / 10000; + var bounceProgress = Math.sin(2 * Math.abs( 0.5 - progress)); + var l = Utilities.lerp(bounceProgress, 20, 50); + var hslPrefix = "hsla(" + Utilities.lerp(progress, 0, 360) + ",100%,"; + + for (var i = 0; i < this._offsetIndex; ++i) { + var tile = this.tiles[i]; + tile.active = true; + tile.element.style.visibility = ""; + tile.rotate += tile.step; + tile.element.style.transform = "rotate(" + tile.rotate + "deg)"; + + var influence = Math.max(.01, 1 - (tile.distance * this._distanceFactor)); + tile.element.style.backgroundColor = hslPrefix + l * Math.tan(influence / 1.25) + "%," + influence + ")"; + } + + for (var i = this._offsetIndex; i < this.tiles.length && this.tiles[i].active; ++i) { + this.tiles[i].active = false; + this.tiles[i].element.style.visibility = "hidden"; + } + } +}); + +var MultiplyBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new MultiplyStage(), options); + } +); + +window.benchmarkClass = MultiplyBenchmark; + +}()); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/particles.js b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/particles.js new file mode 100644 index 0000000000..cf474e4142 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/particles.js @@ -0,0 +1,112 @@ +function Particle(stage) +{ + this.stage = stage; + this.rotater = Stage.randomRotater(); + this.reset(); + this.move(); +} + +Particle.prototype = +{ + sizeMinimum: 40, + sizeRange: 10, + + reset: function() + { + var randSize = Math.round(Math.pow(Pseudo.random(), 4) * this.sizeRange + this.sizeMinimum); + this.size = new Point(randSize, randSize); + this.minPosition = this.size.center; + this.maxPosition = this.stage.size.subtract(this.minPosition); + }, + + animate: function(timeDelta) + { + this.rotater.next(timeDelta); + + this.position = this.position.add(this.velocity.multiply(timeDelta)); + this.velocity.y += 0.03; + + // If particle is going to move off right side + if (this.position.x > this.maxPosition.x) { + if (this.velocity.x > 0) + this.velocity.x *= -1; + this.position.x = this.maxPosition.x; + } else if (this.position.x < this.minPosition.x) { + // If particle is going to move off left side + if (this.velocity.x < 0) + this.velocity.x *= -1; + this.position.x = this.minPosition.x; + } + + // If particle is going to move off bottom side + if (this.position.y > this.maxPosition.y) { + // Adjust direction but maintain magnitude + var magnitude = this.velocity.length(); + this.velocity.x *= 1.5 + .005 * this.size.x; + this.velocity = this.velocity.normalize().multiply(magnitude); + if (Math.abs(this.velocity.y) < 0.7) + this.reset(); + else { + if (this.velocity.y > 0) + this.velocity.y *= -0.999; + this.position.y = this.maxPosition.y; + } + } else if (this.position.y < this.minPosition.y) { + // If particle is going to move off top side + var magnitude = this.velocity.length(); + this.velocity.x *= 1.5 + .005 * this.size.x; + this.velocity = this.velocity.normalize().multiply(magnitude); + if (this.velocity.y < 0) + this.velocity.y *= -0.998; + this.position.y = this.minPosition.y; + } + + this.move(); + }, + + move: function() + { + } +} + +ParticlesStage = Utilities.createSubclass(Stage, + function() + { + Stage.call(this); + this.particles = []; + }, { + + animate: function(timeDelta) + { + timeDelta /= 4; + this.particles.forEach(function(particle) { + particle.animate(timeDelta); + }); + }, + + tune: function(count) + { + if (count == 0) + return; + + if (count > 0) { + for (var i = 0; i < count; ++i) + this.particles.push(this.createParticle()); + return; + } + + count = Math.min(-count, this.particles.length); + + if (typeof(this.willRemoveParticle) == "function") { + for (var i = 0; i < count; ++i) + this.willRemoveParticle(this.particles[i]); + } + + this.particles.splice(0, count); + }, + + complexity: function() + { + return this.particles.length; + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/performance.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/performance.svg new file mode 100644 index 0000000000..37c4e952c1 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/performance.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/performance100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/performance100.png new file mode 100644 index 0000000000..3f8a187596 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/performance100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/script.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/script.svg new file mode 100644 index 0000000000..5e3f9c1b03 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/script.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/script100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/script100.png new file mode 100644 index 0000000000..c2ea55ead7 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/script100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/shortcuts.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/shortcuts.svg new file mode 100644 index 0000000000..edaa84963b --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/shortcuts.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/shortcuts100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/shortcuts100.png new file mode 100644 index 0000000000..aeb23e0a40 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/shortcuts100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/standards.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/standards.svg new file mode 100644 index 0000000000..ac1e6934d8 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/standards.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/standards100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/standards100.png new file mode 100644 index 0000000000..ff386ff163 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/standards100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/storage.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/storage.svg new file mode 100644 index 0000000000..c34a9ed255 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/storage.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/storage100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/storage100.png new file mode 100644 index 0000000000..bc59d92fcf Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/storage100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/styles.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/styles.svg new file mode 100644 index 0000000000..f50cff7d6d --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/styles.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/styles100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/styles100.png new file mode 100644 index 0000000000..7bc9fffe9c Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/styles100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/svg-particles.js b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/svg-particles.js new file mode 100644 index 0000000000..2ce24b56f1 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/svg-particles.js @@ -0,0 +1,111 @@ +(function() { + +SVGParticle = Utilities.createSubclass(Particle, + function(stage) + { + var shapeId = "#shape-" + Stage.randomInt(1, stage.particleTypeCount); + this.isClipPath = Stage.randomBool(); + if (this.isClipPath) { + this.element = Utilities.createSVGElement("rect", { + x: 0, + y: 0, + "clip-path": "url(" + shapeId + ")" + }, {}, stage.element); + } else { + var shapePath = document.querySelector(shapeId + " path"); + this.element = shapePath.cloneNode(); + stage.element.appendChild(this.element); + } + + this.gradient = document.getElementById("default-gradient").cloneNode(true); + this.gradient.id = "gradient-" + stage.gradientsCounter++; + stage.gradientsDefs.appendChild(this.gradient); + this.element.setAttribute("fill", "url(#" + this.gradient.id + ")"); + + Particle.call(this, stage); + }, { + + sizeMinimum: 30, + sizeRange: 40, + + reset: function() + { + Particle.prototype.reset.call(this); + + this.position = Stage.randomElementInArray(this.stage.emitLocation); + + var velocityMagnitude = Stage.random(.5, 2.5); + var angle = Stage.randomInt(0, this.stage.emitSteps) / this.stage.emitSteps * Math.PI * 2 + Stage.dateCounterValue(1000) * this.stage.emissionSpin + velocityMagnitude; + this.velocity = new Point(Math.sin(angle), Math.cos(angle)) + .multiply(velocityMagnitude); + + if (this.isClipPath) { + this.element.setAttribute("width", this.size.x); + this.element.setAttribute("height", this.size.y); + this.transformSuffix = " translate(-" + this.size.center.x + ",-" + this.size.center.y + ")"; + } else + this.transformSuffix = " scale(" + this.size.x + ") translate(-.5,-.5)"; + + this.stage.colorOffset = (this.stage.colorOffset + .5) % 360; + + var transform = this.stage.element.createSVGTransform(); + transform.setRotate(Stage.randomInt(0, 359), 0, 0); + this.gradient.gradientTransform.baseVal.initialize(transform); + + var stops = this.gradient.querySelectorAll("stop"); + stops[0].setAttribute("stop-color", "hsl(" + this.stage.colorOffset + ", 70%, 45%)"); + stops[1].setAttribute("stop-color", "hsl(" + ((this.stage.colorOffset + Stage.randomInt(50,100)) % 360) + ", 70%, 65%)"); + }, + + move: function() + { + this.element.setAttribute("transform", "translate(" + this.position.x + "," + this.position.y + ") " + this.rotater.rotate(Point.zero) + this.transformSuffix); + } +}); + +SVGParticleStage = Utilities.createSubclass(ParticlesStage, + function() + { + ParticlesStage.call(this); + }, { + + initialize: function(benchmark) + { + ParticlesStage.prototype.initialize.call(this, benchmark); + this.emissionSpin = Stage.random(0, 3); + this.emitSteps = Stage.randomInt(4, 6); + this.emitLocation = [ + new Point(this.size.x * .25, this.size.y * .333), + new Point(this.size.x * .5, this.size.y * .25), + new Point(this.size.x * .75, this.size.y * .333) + ]; + this.colorOffset = Stage.randomInt(0, 359); + + this.particleTypeCount = document.querySelectorAll(".shape").length; + this.gradientsDefs = document.getElementById("gradients"); + this.gradientsCounter = 0; + }, + + createParticle: function() + { + return new SVGParticle(this); + }, + + willRemoveParticle: function(particle) + { + particle.element.remove(); + if (particle.gradient) + particle.gradient.remove(); + } +}); + +SVGParticleBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new SVGParticleStage(), options); + } +); + +window.benchmarkClass = SVGParticleBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/text.js b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/text.js new file mode 100644 index 0000000000..c7ebe464b3 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/text.js @@ -0,0 +1,116 @@ +(function() { + +var TextStage = Utilities.createSubclass(Stage, + function() + { + Stage.call(this); + + this.testElements = []; + this._offsetIndex = 0; + }, { + + shadowFalloff: new UnitBezier(new Point(0.015, 0.750), new Point(0.755, 0.235)), + shimmerAverage: 0, + shimmerMax: 0.5, + millisecondsPerRotation: 1000 / (.26 * Math.PI * 2), + particleDistanceX: 1.5, + particleDistanceY: .5, + lightnessMin: 13, + lightnessMax: 94, + gradients: [ + [10, 176, 176, 209, 148, 140], + [171, 120, 154, 245, 196, 154], + [224, 99, 99, 71, 134, 148], + [101, 100, 117, 80, 230, 175], + [232, 165, 30, 69, 186, 172] + ], + + initialize: function(benchmark) + { + Stage.prototype.initialize.call(this, benchmark); + + this._template = document.getElementById("template"); + this._offset = this.size.subtract(Point.elementClientSize(this._template)).multiply(.5); + this._template.style.left = this._offset.width + "px"; + this._template.style.top = this._offset.height + "px"; + + this._stepProgress = 0; + }, + + tune: function(count) + { + if (count == 0) + return; + + if (count < 0) { + this._offsetIndex = Math.max(this._offsetIndex + count, 0); + for (var i = this._offsetIndex; i < this.testElements.length; ++i) + this.testElements[i].style.visibility = "hidden"; + + this._stepProgress = 1 / this._offsetIndex; + return; + } + + this._offsetIndex = this._offsetIndex + count; + this._stepProgress = 1 / this._offsetIndex; + + var index = Math.min(this._offsetIndex, this.testElements.length); + for (var i = 0; i < index; ++i) + this.testElements[i].style.visibility = "visible"; + + if (this._offsetIndex <= this.testElements.length) + return; + + for (var i = this.testElements.length; i < this._offsetIndex; ++i) { + var clone = this._template.cloneNode(true); + this.testElements.push(clone); + this.element.insertBefore(clone, this.element.firstChild); + } + }, + + animate: function(timeDelta) { + var angle = Stage.dateCounterValue(this.millisecondsPerRotation); + + var progress = 0; + var stepX = Math.sin(angle) * this.particleDistanceX; + var stepY = Math.cos(angle) * this.particleDistanceY; + var x = -stepX * 3; + var y = -stepY * 3; + var gradient = this.gradients[Math.floor(angle/(Math.PI * 2)) % this.gradients.length]; + var offset = Stage.dateCounterValue(200); + this._template.style.transform = "translate(" + Math.floor(x) + "px," + Math.floor(y) + "px)"; + for (var i = 0; i < this._offsetIndex; ++i) { + var element = this.testElements[i]; + + var colorProgress = this.shadowFalloff.solve(progress); + var shimmer = Math.sin(offset - colorProgress); + colorProgress = Math.max(Math.min(colorProgress + Utilities.lerp(shimmer, this.shimmerAverage, this.shimmerMax), 1), 0); + var r = Math.round(Utilities.lerp(colorProgress, gradient[0], gradient[3])); + var g = Math.round(Utilities.lerp(colorProgress, gradient[1], gradient[4])); + var b = Math.round(Utilities.lerp(colorProgress, gradient[2], gradient[5])); + element.style.color = "rgb(" + r + "," + g + "," + b + ")"; + + x += stepX; + y += stepY; + element.style.transform = "translate(" + Math.floor(x) + "px," + Math.floor(y) + "px)"; + + progress += this._stepProgress; + } + }, + + complexity: function() + { + return 1 + this._offsetIndex; + } +}); + +var TextBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new TextStage(), options); + } +); + +window.benchmarkClass = TextBenchmark; + +}()); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/timeline.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/timeline.svg new file mode 100644 index 0000000000..cd1e8a4e20 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/timeline.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/timeline100.png b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/timeline100.png new file mode 100644 index 0000000000..b9839f8447 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/master/resources/timeline100.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/svg-particles.html b/third_party/webkit/PerformanceTests/MotionMark/tests/master/svg-particles.html new file mode 100644 index 0000000000..46a19369da --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/svg-particles.html @@ -0,0 +1,38 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/master/text.html b/third_party/webkit/PerformanceTests/MotionMark/tests/master/text.html new file mode 100644 index 0000000000..5e94b8ce95 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/master/text.html @@ -0,0 +1,82 @@ + + + + + + + + +
    +
    + + + + + + + + + + + + + + + + + + + + + + + +
    σχέδιο设计suunnittelu
    designдизайнتصميم
    디자인conceptionデザイン
    konstruktionעיצובdiseño
    +
    +
    + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/resources/main.js b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/main.js new file mode 100644 index 0000000000..b9776d571e --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/main.js @@ -0,0 +1,934 @@ +Sampler = Utilities.createClass( + function(seriesCount, expectedSampleCount, processor) + { + this._processor = processor; + + this.samples = []; + for (var i = 0; i < seriesCount; ++i) { + var array = new Array(expectedSampleCount); + array.fill(0); + this.samples[i] = array; + } + this.sampleCount = 0; + }, { + + record: function() { + // Assume that arguments.length == this.samples.length + for (var i = 0; i < arguments.length; i++) { + this.samples[i][this.sampleCount] = arguments[i]; + } + ++this.sampleCount; + }, + + processSamples: function() + { + var results = {}; + + // Remove unused capacity + this.samples = this.samples.map(function(array) { + return array.slice(0, this.sampleCount); + }, this); + + this._processor.processSamples(results); + + return results; + } +}); + +Controller = Utilities.createClass( + function(benchmark, options) + { + // Initialize timestamps relative to the start of the benchmark + // In start() the timestamps are offset by the start timestamp + this._startTimestamp = 0; + this._endTimestamp = options["test-interval"]; + // Default data series: timestamp, complexity, estimatedFrameLength + var sampleSize = options["sample-capacity"] || (60 * options["test-interval"] / 1000); + this._sampler = new Sampler(options["series-count"] || 3, sampleSize, this); + this._marks = {}; + + this._frameLengthEstimator = new SimpleKalmanEstimator(options["kalman-process-error"], options["kalman-measurement-error"]); + this._isFrameLengthEstimatorEnabled = true; + + // Length of subsequent intervals; a value of 0 means use no intervals + this.intervalSamplingLength = 100; + + this.initialComplexity = 1; + }, { + + set isFrameLengthEstimatorEnabled(enabled) { + this._isFrameLengthEstimatorEnabled = enabled; + }, + + start: function(startTimestamp, stage) + { + this._startTimestamp = startTimestamp; + this._endTimestamp += startTimestamp; + this._previousTimestamp = startTimestamp; + this._measureAndResetInterval(startTimestamp); + this.recordFirstSample(startTimestamp, stage); + }, + + recordFirstSample: function(startTimestamp, stage) + { + this._sampler.record(startTimestamp, stage.complexity(), -1); + this.mark(Strings.json.samplingStartTimeOffset, startTimestamp); + }, + + mark: function(comment, timestamp, data) { + data = data || {}; + data.time = timestamp; + data.index = this._sampler.sampleCount; + this._marks[comment] = data; + }, + + containsMark: function(comment) { + return comment in this._marks; + }, + + _measureAndResetInterval: function(currentTimestamp) + { + var sampleCount = this._sampler.sampleCount; + var averageFrameLength = 0; + + if (this._intervalEndTimestamp) { + var intervalStartTimestamp = this._sampler.samples[0][this._intervalStartIndex]; + averageFrameLength = (currentTimestamp - intervalStartTimestamp) / (sampleCount - this._intervalStartIndex); + } + + this._intervalStartIndex = sampleCount; + this._intervalEndTimestamp = currentTimestamp + this.intervalSamplingLength; + + return averageFrameLength; + }, + + update: function(timestamp, stage) + { + var lastFrameLength = timestamp - this._previousTimestamp; + this._previousTimestamp = timestamp; + + var frameLengthEstimate = -1, intervalAverageFrameLength = -1; + var didFinishInterval = false; + if (!this.intervalSamplingLength) { + if (this._isFrameLengthEstimatorEnabled) { + this._frameLengthEstimator.sample(lastFrameLength); + frameLengthEstimate = this._frameLengthEstimator.estimate; + } + } else if (timestamp >= this._intervalEndTimestamp) { + var intervalStartTimestamp = this._sampler.samples[0][this._intervalStartIndex]; + intervalAverageFrameLength = this._measureAndResetInterval(timestamp); + if (this._isFrameLengthEstimatorEnabled) { + this._frameLengthEstimator.sample(intervalAverageFrameLength); + frameLengthEstimate = this._frameLengthEstimator.estimate; + } + didFinishInterval = true; + this.didFinishInterval(timestamp, stage, intervalAverageFrameLength); + } + + this._sampler.record(timestamp, stage.complexity(), frameLengthEstimate); + this.tune(timestamp, stage, lastFrameLength, didFinishInterval, intervalAverageFrameLength); + }, + + didFinishInterval: function(timestamp, stage, intervalAverageFrameLength) + { + }, + + tune: function(timestamp, stage, lastFrameLength, didFinishInterval, intervalAverageFrameLength) + { + }, + + shouldStop: function(timestamp) + { + return timestamp > this._endTimestamp; + }, + + results: function() + { + return this._sampler.processSamples(); + }, + + _processComplexitySamples: function(complexitySamples, complexityAverageSamples) + { + complexityAverageSamples.addField(Strings.json.complexity, 0); + complexityAverageSamples.addField(Strings.json.frameLength, 1); + complexityAverageSamples.addField(Strings.json.measurements.stdev, 2); + + complexitySamples.sort(function(a, b) { + return complexitySamples.getFieldInDatum(a, Strings.json.complexity) - complexitySamples.getFieldInDatum(b, Strings.json.complexity); + }); + + // Samples averaged based on complexity + var currentComplexity = -1; + var experimentAtComplexity; + function addSample() { + var mean = experimentAtComplexity.mean(); + var stdev = experimentAtComplexity.standardDeviation(); + + var averageSample = complexityAverageSamples.createDatum(); + complexityAverageSamples.push(averageSample); + complexityAverageSamples.setFieldInDatum(averageSample, Strings.json.complexity, currentComplexity); + complexityAverageSamples.setFieldInDatum(averageSample, Strings.json.frameLength, mean); + complexityAverageSamples.setFieldInDatum(averageSample, Strings.json.measurements.stdev, stdev); + } + complexitySamples.forEach(function(sample) { + var sampleComplexity = complexitySamples.getFieldInDatum(sample, Strings.json.complexity); + if (sampleComplexity != currentComplexity) { + if (currentComplexity > -1) + addSample(); + + currentComplexity = sampleComplexity; + experimentAtComplexity = new Experiment; + } + experimentAtComplexity.sample(complexitySamples.getFieldInDatum(sample, Strings.json.frameLength)); + }); + // Finish off the last one + addSample(); + }, + + processSamples: function(results) + { + var complexityExperiment = new Experiment; + var smoothedFrameLengthExperiment = new Experiment; + + var samples = this._sampler.samples; + + for (var markName in this._marks) + this._marks[markName].time -= this._startTimestamp; + results[Strings.json.marks] = this._marks; + + results[Strings.json.samples] = {}; + + var controllerSamples = new SampleData; + results[Strings.json.samples][Strings.json.controller] = controllerSamples; + + controllerSamples.addField(Strings.json.time, 0); + controllerSamples.addField(Strings.json.complexity, 1); + controllerSamples.addField(Strings.json.frameLength, 2); + controllerSamples.addField(Strings.json.smoothedFrameLength, 3); + + var complexitySamples = new SampleData(controllerSamples.fieldMap); + results[Strings.json.samples][Strings.json.complexity] = complexitySamples; + + samples[0].forEach(function(timestamp, i) { + var sample = controllerSamples.createDatum(); + controllerSamples.push(sample); + complexitySamples.push(sample); + + // Represent time in milliseconds + controllerSamples.setFieldInDatum(sample, Strings.json.time, timestamp - this._startTimestamp); + controllerSamples.setFieldInDatum(sample, Strings.json.complexity, samples[1][i]); + + if (i == 0) + controllerSamples.setFieldInDatum(sample, Strings.json.frameLength, 1000/60); + else + controllerSamples.setFieldInDatum(sample, Strings.json.frameLength, timestamp - samples[0][i - 1]); + + if (samples[2][i] != -1) + controllerSamples.setFieldInDatum(sample, Strings.json.smoothedFrameLength, samples[2][i]); + }, this); + + var complexityAverageSamples = new SampleData; + results[Strings.json.samples][Strings.json.complexityAverage] = complexityAverageSamples; + this._processComplexitySamples(complexitySamples, complexityAverageSamples); + } +}); + +FixedController = Utilities.createSubclass(Controller, + function(benchmark, options) + { + Controller.call(this, benchmark, options); + this.initialComplexity = options["complexity"]; + this.intervalSamplingLength = 0; + } +); + +StepController = Utilities.createSubclass(Controller, + function(benchmark, options) + { + Controller.call(this, benchmark, options); + this.initialComplexity = options["complexity"]; + this.intervalSamplingLength = 0; + this._stepped = false; + this._stepTime = options["test-interval"] / 2; + }, { + + start: function(startTimestamp, stage) + { + Controller.prototype.start.call(this, startTimestamp, stage); + this._stepTime += startTimestamp; + }, + + tune: function(timestamp, stage) + { + if (this._stepped || timestamp < this._stepTime) + return; + + this.mark(Strings.json.samplingEndTimeOffset, timestamp); + this._stepped = true; + stage.tune(stage.complexity() * 3); + } +}); + +AdaptiveController = Utilities.createSubclass(Controller, + function(benchmark, options) + { + // Data series: timestamp, complexity, estimatedIntervalFrameLength + Controller.call(this, benchmark, options); + + // All tests start at 0, so we expect to see 60 fps quickly. + this._samplingTimestamp = options["test-interval"] / 2; + this._startedSampling = false; + this._targetFrameRate = options["frame-rate"]; + this._pid = new PIDController(this._targetFrameRate); + + this._intervalFrameCount = 0; + this._numberOfFramesToMeasurePerInterval = 4; + }, { + + start: function(startTimestamp, stage) + { + Controller.prototype.start.call(this, startTimestamp, stage); + + this._samplingTimestamp += startTimestamp; + this._intervalTimestamp = startTimestamp; + }, + + recordFirstSample: function(startTimestamp, stage) + { + this._sampler.record(startTimestamp, stage.complexity(), -1); + }, + + update: function(timestamp, stage) + { + if (!this._startedSampling && timestamp >= this._samplingTimestamp) { + this._startedSampling = true; + this.mark(Strings.json.samplingStartTimeOffset, this._samplingTimestamp); + } + + // Start the work for the next frame. + ++this._intervalFrameCount; + + if (this._intervalFrameCount < this._numberOfFramesToMeasurePerInterval) { + this._sampler.record(timestamp, stage.complexity(), -1); + return; + } + + // Adjust the test to reach the desired FPS. + var intervalLength = timestamp - this._intervalTimestamp; + this._frameLengthEstimator.sample(intervalLength / this._numberOfFramesToMeasurePerInterval); + var intervalEstimatedFrameRate = 1000 / this._frameLengthEstimator.estimate; + var tuneValue = -this._pid.tune(timestamp - this._startTimestamp, intervalLength, intervalEstimatedFrameRate); + tuneValue = tuneValue > 0 ? Math.floor(tuneValue) : Math.ceil(tuneValue); + stage.tune(tuneValue); + + this._sampler.record(timestamp, stage.complexity(), this._frameLengthEstimator.estimate); + + // Start the next interval. + this._intervalFrameCount = 0; + this._intervalTimestamp = timestamp; + } +}); + +RampController = Utilities.createSubclass(Controller, + function(benchmark, options) + { + // The tier warmup takes at most 5 seconds + options["sample-capacity"] = (options["test-interval"] / 1000 + 5) * 60; + Controller.call(this, benchmark, options); + + // Initially start with a tier test to find the bounds + // The number of objects in a tier test is 10^|_tier| + this._tier = -.5; + // The timestamp is first set after the first interval completes + this._tierStartTimestamp = 0; + this._minimumComplexity = 1; + this._maximumComplexity = 1; + + // After the tier range is determined, figure out the number of ramp iterations + var minimumRampLength = 3000; + var totalRampIterations = Math.max(1, Math.floor(this._endTimestamp / minimumRampLength)); + // Give a little extra room to run since the ramps won't be exactly this length + this._rampLength = Math.floor((this._endTimestamp - totalRampIterations * this.intervalSamplingLength) / totalRampIterations); + this._rampDidWarmup = false; + this._rampRegressions = []; + + this._finishedTierSampling = false; + this._changePointEstimator = new Experiment; + this._minimumComplexityEstimator = new Experiment; + // Estimates all frames within an interval + this._intervalFrameLengthEstimator = new Experiment; + }, { + + // If the engine can handle the tier's complexity at the desired frame rate, test for a short + // period, then move on to the next tier + tierFastTestLength: 250, + // If the engine is under stress, let the test run a little longer to let the measurement settle + tierSlowTestLength: 750, + + rampWarmupLength: 200, + + // Used for regression calculations in the ramps + frameLengthDesired: 1000/60, + // Add some tolerance; frame lengths shorter than this are considered to be @ the desired frame length + frameLengthDesiredThreshold: 1000/58, + // During tier sampling get at least this slow to find the right complexity range + frameLengthTierThreshold: 1000/30, + // Try to make each ramp get this slow so that we can cross the break point + frameLengthRampLowerThreshold: 1000/45, + // Do not let the regression calculation at the maximum complexity of a ramp get slower than this threshold + frameLengthRampUpperThreshold: 1000/20, + + start: function(startTimestamp, stage) + { + Controller.prototype.start.call(this, startTimestamp, stage); + this._rampStartTimestamp = 0; + this.intervalSamplingLength = 100; + }, + + didFinishInterval: function(timestamp, stage, intervalAverageFrameLength) + { + if (!this._finishedTierSampling) { + if (this._tierStartTimestamp > 0 && timestamp < this._tierStartTimestamp + this.tierFastTestLength) + return; + + var currentComplexity = stage.complexity(); + var currentFrameLength = this._frameLengthEstimator.estimate; + if (currentFrameLength < this.frameLengthTierThreshold) { + var isAnimatingAt60FPS = currentFrameLength < this.frameLengthDesiredThreshold; + var hasFinishedSlowTierTest = timestamp > this._tierStartTimestamp + this.tierSlowTestLength; + + if (!isAnimatingAt60FPS && !hasFinishedSlowTierTest) + return; + + // We're measuring at 60 fps, so quickly move on to the next tier, or + // we've slower than 60 fps, but we've let this tier run long enough to + // get an estimate + this._lastTierComplexity = currentComplexity; + this._lastTierFrameLength = currentFrameLength; + + this._tier += .5; + var nextTierComplexity = Math.round(Math.pow(10, this._tier)); + stage.tune(nextTierComplexity - currentComplexity); + + // Some tests may be unable to go beyond a certain capacity. If so, don't keep moving up tiers + if (stage.complexity() - currentComplexity > 0 || nextTierComplexity == 1) { + this._tierStartTimestamp = timestamp; + this.mark("Complexity: " + nextTierComplexity, timestamp); + return; + } + } else if (timestamp < this._tierStartTimestamp + this.tierSlowTestLength) + return; + + this._finishedTierSampling = true; + this.isFrameLengthEstimatorEnabled = false; + this.intervalSamplingLength = 120; + + // Extend the test length so that the full test length is made of the ramps + this._endTimestamp += timestamp; + this.mark(Strings.json.samplingStartTimeOffset, timestamp); + + this._minimumComplexity = 1; + this._possibleMinimumComplexity = this._minimumComplexity; + this._minimumComplexityEstimator.sample(this._minimumComplexity); + + // Sometimes this last tier will drop the frame length well below the threshold. + // Avoid going down that far since it means fewer measurements are taken in the 60 fps area. + // Interpolate a maximum complexity that gets us around the lowest threshold. + // Avoid doing this calculation if we never get out of the first tier (where this._lastTierComplexity is undefined). + if (this._lastTierComplexity && this._lastTierComplexity != currentComplexity) + this._maximumComplexity = Math.floor(Utilities.lerp(Utilities.progressValue(this.frameLengthTierThreshold, this._lastTierFrameLength, currentFrameLength), this._lastTierComplexity, currentComplexity)); + else { + // If the browser is capable of handling the most complex version of the test, use that + this._maximumComplexity = currentComplexity; + } + this._possibleMaximumComplexity = this._maximumComplexity; + + // If we get ourselves onto a ramp where the maximum complexity does not yield slow enough FPS, + // We'll use this as a boundary to find a higher maximum complexity for the next ramp + this._lastTierComplexity = currentComplexity; + this._lastTierFrameLength = currentFrameLength; + + // First ramp + stage.tune(this._maximumComplexity - currentComplexity); + this._rampDidWarmup = false; + // Start timestamp represents start of ramp iteration and warm up + this._rampStartTimestamp = timestamp; + return; + } + + if ((timestamp - this._rampStartTimestamp) < this.rampWarmupLength) + return; + + if (this._rampDidWarmup) + return; + + this._rampDidWarmup = true; + this._currentRampLength = this._rampStartTimestamp + this._rampLength - timestamp; + // Start timestamp represents start of ramp down, after warm up + this._rampStartTimestamp = timestamp; + this._rampStartIndex = this._sampler.sampleCount; + }, + + tune: function(timestamp, stage, lastFrameLength, didFinishInterval, intervalAverageFrameLength) + { + if (!this._rampDidWarmup) + return; + + this._intervalFrameLengthEstimator.sample(lastFrameLength); + if (!didFinishInterval) + return; + + var currentComplexity = stage.complexity(); + var intervalFrameLengthMean = this._intervalFrameLengthEstimator.mean(); + var intervalFrameLengthStandardDeviation = this._intervalFrameLengthEstimator.standardDeviation(); + + if (intervalFrameLengthMean < this.frameLengthDesiredThreshold && this._intervalFrameLengthEstimator.cdf(this.frameLengthDesiredThreshold) > .9) { + this._possibleMinimumComplexity = Math.max(this._possibleMinimumComplexity, currentComplexity); + } else if (intervalFrameLengthStandardDeviation > 2) { + // In the case where we might have found a previous interval where 60fps was reached. We hit a significant blip, + // so we should resample this area in the next ramp. + this._possibleMinimumComplexity = 1; + } + if (intervalFrameLengthMean - intervalFrameLengthStandardDeviation > this.frameLengthRampLowerThreshold) + this._possibleMaximumComplexity = Math.min(this._possibleMaximumComplexity, currentComplexity); + this._intervalFrameLengthEstimator.reset(); + + var progress = (timestamp - this._rampStartTimestamp) / this._currentRampLength; + + if (progress < 1) { + // Reframe progress percentage so that the last interval of the ramp can sample at minimum complexity + progress = (timestamp - this._rampStartTimestamp) / (this._currentRampLength - this.intervalSamplingLength); + stage.tune(Math.max(this._minimumComplexity, Math.floor(Utilities.lerp(progress, this._maximumComplexity, this._minimumComplexity))) - currentComplexity); + return; + } + + var regression = new Regression(this._sampler.samples, this._getComplexity, this._getFrameLength, + this._sampler.sampleCount - 1, this._rampStartIndex, { desiredFrameLength: this.frameLengthDesired }); + this._rampRegressions.push(regression); + + var frameLengthAtMaxComplexity = regression.valueAt(this._maximumComplexity); + if (frameLengthAtMaxComplexity < this.frameLengthRampLowerThreshold) + this._possibleMaximumComplexity = Math.floor(Utilities.lerp(Utilities.progressValue(this.frameLengthRampLowerThreshold, frameLengthAtMaxComplexity, this._lastTierFrameLength), this._maximumComplexity, this._lastTierComplexity)); + // If the regression doesn't fit the first segment at all, keep the minimum bound at 1 + if ((timestamp - this._sampler.samples[0][this._sampler.sampleCount - regression.n1]) / this._currentRampLength < .25) + this._possibleMinimumComplexity = 1; + + this._minimumComplexityEstimator.sample(this._possibleMinimumComplexity); + this._minimumComplexity = Math.round(this._minimumComplexityEstimator.mean()); + + if (frameLengthAtMaxComplexity < this.frameLengthRampUpperThreshold) { + this._changePointEstimator.sample(regression.complexity); + // Ideally we'll target the change point in the middle of the ramp. If the range of the ramp is too small, there isn't enough + // range along the complexity (x) axis for a good regression calculation to be made, so force at least a range of 5 + // particles. Make it possible to increase the maximum complexity in case unexpected noise caps the regression too low. + this._maximumComplexity = Math.round(this._minimumComplexity + + Math.max(5, + this._possibleMaximumComplexity - this._minimumComplexity, + (this._changePointEstimator.mean() - this._minimumComplexity) * 2)); + } else { + // The slowest samples weighed the regression too heavily + this._maximumComplexity = Math.max(Math.round(.8 * this._maximumComplexity), this._minimumComplexity + 5); + } + + // Next ramp + stage.tune(this._maximumComplexity - stage.complexity()); + this._rampDidWarmup = false; + // Start timestamp represents start of ramp iteration and warm up + this._rampStartTimestamp = timestamp; + this._possibleMinimumComplexity = 1; + this._possibleMaximumComplexity = this._maximumComplexity; + }, + + _getComplexity: function(samples, i) { + return samples[1][i]; + }, + + _getFrameLength: function(samples, i) { + return samples[0][i] - samples[0][i - 1]; + }, + + processSamples: function(results) + { + Controller.prototype.processSamples.call(this, results); + + // Have samplingTimeOffset represent time 0 + var startTimestamp = this._marks[Strings.json.samplingStartTimeOffset].time; + + for (var markName in results[Strings.json.marks]) { + results[Strings.json.marks][markName].time -= startTimestamp; + } + + var controllerSamples = results[Strings.json.samples][Strings.json.controller]; + controllerSamples.forEach(function(timeSample) { + controllerSamples.setFieldInDatum(timeSample, Strings.json.time, controllerSamples.getFieldInDatum(timeSample, Strings.json.time) - startTimestamp); + }); + + // Aggregate all of the ramps into one big complexity-frameLength dataset + var complexitySamples = new SampleData(controllerSamples.fieldMap); + results[Strings.json.samples][Strings.json.complexity] = complexitySamples; + + results[Strings.json.controller] = []; + this._rampRegressions.forEach(function(ramp) { + var startIndex = ramp.startIndex, endIndex = ramp.endIndex; + var startTime = controllerSamples.getFieldInDatum(startIndex, Strings.json.time); + var endTime = controllerSamples.getFieldInDatum(endIndex, Strings.json.time); + var startComplexity = controllerSamples.getFieldInDatum(startIndex, Strings.json.complexity); + var endComplexity = controllerSamples.getFieldInDatum(endIndex, Strings.json.complexity); + + var regression = {}; + results[Strings.json.controller].push(regression); + + var percentage = (ramp.complexity - startComplexity) / (endComplexity - startComplexity); + var inflectionTime = startTime + percentage * (endTime - startTime); + + regression[Strings.json.regressions.segment1] = [ + [startTime, ramp.s2 + ramp.t2 * startComplexity], + [inflectionTime, ramp.s2 + ramp.t2 * ramp.complexity] + ]; + regression[Strings.json.regressions.segment2] = [ + [inflectionTime, ramp.s1 + ramp.t1 * ramp.complexity], + [endTime, ramp.s1 + ramp.t1 * endComplexity] + ]; + regression[Strings.json.complexity] = ramp.complexity; + regression[Strings.json.regressions.startIndex] = startIndex; + regression[Strings.json.regressions.endIndex] = endIndex; + regression[Strings.json.regressions.profile] = ramp.profile; + + for (var j = startIndex; j <= endIndex; ++j) + complexitySamples.push(controllerSamples.at(j)); + }); + + var complexityAverageSamples = new SampleData; + results[Strings.json.samples][Strings.json.complexityAverage] = complexityAverageSamples; + this._processComplexitySamples(complexitySamples, complexityAverageSamples); + } +}); + +Ramp30Controller = Utilities.createSubclass(RampController, + function(benchmark, options) + { + RampController.call(this, benchmark, options); + }, { + + frameLengthDesired: 1000/30, + frameLengthDesiredThreshold: 1000/29, + frameLengthTierThreshold: 1000/20, + frameLengthRampLowerThreshold: 1000/20, + frameLengthRampUpperThreshold: 1000/12 +}); + +Stage = Utilities.createClass( + function() + { + }, { + + initialize: function(benchmark) + { + this._benchmark = benchmark; + this._element = document.getElementById("stage"); + this._element.setAttribute("width", document.body.offsetWidth); + this._element.setAttribute("height", document.body.offsetHeight); + this._size = Point.elementClientSize(this._element).subtract(Insets.elementPadding(this._element).size); + }, + + get element() + { + return this._element; + }, + + get size() + { + return this._size; + }, + + complexity: function() + { + return 0; + }, + + tune: function() + { + throw "Not implemented"; + }, + + animate: function() + { + throw "Not implemented"; + }, + + clear: function() + { + return this.tune(-this.tune(0)); + } +}); + +Utilities.extendObject(Stage, { + random: function(min, max) + { + return (Pseudo.random() * (max - min)) + min; + }, + + randomBool: function() + { + return !!Math.round(Pseudo.random()); + }, + + randomSign: function() + { + return Pseudo.random() >= .5 ? 1 : -1; + }, + + randomInt: function(min, max) + { + return Math.floor(this.random(min, max + 1)); + }, + + randomPosition: function(maxPosition) + { + return new Point(this.randomInt(0, maxPosition.x), this.randomInt(0, maxPosition.y)); + }, + + randomSquareSize: function(min, max) + { + var side = this.random(min, max); + return new Point(side, side); + }, + + randomVelocity: function(maxVelocity) + { + return this.random(maxVelocity / 8, maxVelocity); + }, + + randomAngle: function() + { + return this.random(0, Math.PI * 2); + }, + + randomColor: function() + { + var min = 32; + var max = 256 - 32; + return "#" + + this.randomInt(min, max).toString(16) + + this.randomInt(min, max).toString(16) + + this.randomInt(min, max).toString(16); + }, + + randomStyleMixBlendMode: function() + { + var mixBlendModeList = [ + 'normal', + 'multiply', + 'screen', + 'overlay', + 'darken', + 'lighten', + 'color-dodge', + 'color-burn', + 'hard-light', + 'soft-light', + 'difference', + 'exclusion', + 'hue', + 'saturation', + 'color', + 'luminosity' + ]; + + return mixBlendModeList[this.randomInt(0, mixBlendModeList.length)]; + }, + + randomStyleFilter: function() + { + var filterList = [ + 'grayscale(50%)', + 'sepia(50%)', + 'saturate(50%)', + 'hue-rotate(180)', + 'invert(50%)', + 'opacity(50%)', + 'brightness(50%)', + 'contrast(50%)', + 'blur(10px)', + 'drop-shadow(10px 10px 10px gray)' + ]; + + return filterList[this.randomInt(0, filterList.length)]; + }, + + randomElementInArray: function(array) + { + return array[Stage.randomInt(0, array.length - 1)]; + }, + + rotatingColor: function(cycleLengthMs, saturation, lightness) + { + return "hsl(" + + Stage.dateFractionalValue(cycleLengthMs) * 360 + ", " + + ((saturation || .8) * 100).toFixed(0) + "%, " + + ((lightness || .35) * 100).toFixed(0) + "%)"; + }, + + // Returns a fractional value that wraps around within [0,1] + dateFractionalValue: function(cycleLengthMs) + { + return (Date.now() / (cycleLengthMs || 2000)) % 1; + }, + + // Returns an increasing value slowed down by factor + dateCounterValue: function(factor) + { + return Date.now() / factor; + }, + + randomRotater: function() + { + return new Rotater(this.random(1000, 10000)); + } +}); + +Rotater = Utilities.createClass( + function(rotateInterval) + { + this._timeDelta = 0; + this._rotateInterval = rotateInterval; + this._isSampling = false; + }, { + + get interval() + { + return this._rotateInterval; + }, + + next: function(timeDelta) + { + this._timeDelta = (this._timeDelta + timeDelta) % this._rotateInterval; + }, + + degree: function() + { + return (360 * this._timeDelta) / this._rotateInterval; + }, + + rotateZ: function() + { + return "rotateZ(" + Math.floor(this.degree()) + "deg)"; + }, + + rotate: function(center) + { + return "rotate(" + Math.floor(this.degree()) + ", " + center.x + "," + center.y + ")"; + } +}); + +Benchmark = Utilities.createClass( + function(stage, options) + { + this._animateLoop = this._animateLoop.bind(this); + + this._stage = stage; + this._stage.initialize(this, options); + + switch (options["time-measurement"]) + { + case "performance": + if (window.performance && window.performance.now) + this._getTimestamp = performance.now.bind(performance); + else + this._getTimestamp = null; + break; + case "raf": + this._getTimestamp = null; + break; + case "date": + this._getTimestamp = Date.now; + break; + } + + options["test-interval"] *= 1000; + switch (options["controller"]) + { + case "fixed": + this._controller = new FixedController(this, options); + break; + case "step": + this._controller = new StepController(this, options); + break; + case "adaptive": + this._controller = new AdaptiveController(this, options); + break; + case "ramp": + this._controller = new RampController(this, options); + break; + case "ramp30": + this._controller = new Ramp30Controller(this, options); + } + }, { + + get stage() + { + return this._stage; + }, + + get timestamp() + { + return this._currentTimestamp - this._startTimestamp; + }, + + backgroundColor: function() + { + var stage = window.getComputedStyle(document.getElementById("stage")); + return stage["background-color"]; + }, + + run: function() + { + return this.waitUntilReady().then(function() { + this._finishPromise = new SimplePromise; + this._previousTimestamp = undefined; + this._didWarmUp = false; + this._stage.tune(this._controller.initialComplexity - this._stage.complexity()); + this._animateLoop(); + return this._finishPromise; + }.bind(this)); + }, + + // Subclasses should override this if they have setup to do prior to commencing. + waitUntilReady: function() + { + var promise = new SimplePromise; + promise.resolve(); + return promise; + }, + + _animateLoop: function(timestamp) + { + timestamp = (this._getTimestamp && this._getTimestamp()) || timestamp; + this._currentTimestamp = timestamp; + + if (this._controller.shouldStop(timestamp)) { + this._finishPromise.resolve(this._controller.results()); + return; + } + + if (!this._didWarmUp) { + if (!this._previousTimestamp) + this._previousTimestamp = timestamp; + else if (timestamp - this._previousTimestamp >= 100) { + this._didWarmUp = true; + this._startTimestamp = timestamp; + this._controller.start(timestamp, this._stage); + this._previousTimestamp = timestamp; + } + + this._stage.animate(0); + requestAnimationFrame(this._animateLoop); + return; + } + + this._controller.update(timestamp, this._stage); + this._stage.animate(timestamp - this._previousTimestamp); + this._previousTimestamp = timestamp; + requestAnimationFrame(this._animateLoop); + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/resources/math.js b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/math.js new file mode 100644 index 0000000000..9c2706e2a3 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/math.js @@ -0,0 +1,268 @@ +SimpleKalmanEstimator = Utilities.createSubclass(Experiment, + function(processError, measurementError) { + Experiment.call(this, false); + var error = .5 * (Math.sqrt(processError * processError + 4 * processError * measurementError) - processError); + this._gain = error / (error + measurementError); + }, { + + sample: function(newMeasurement) + { + if (!this._initialized) { + this._initialized = true; + this.estimate = newMeasurement; + return; + } + + this.estimate = this.estimate + this._gain * (newMeasurement - this.estimate); + }, + + reset: function() + { + Experiment.prototype.reset.call(this); + this._initialized = false; + this.estimate = 0; + } +}); + +PIDController = Utilities.createClass( + function(ysp) + { + this._ysp = ysp; + this._out = 0; + + this._Kp = 0; + this._stage = PIDController.stages.WARMING; + + this._eold = 0; + this._I = 0; + }, { + + // Determines whether the current y is + // before ysp => (below ysp if ysp > y0) || (above ysp if ysp < y0) + // after ysp => (above ysp if ysp > y0) || (below ysp if ysp < y0) + _yPosition: function(y) + { + return (y < this._ysp) == (this._y0 < this._ysp) + ? PIDController.yPositions.BEFORE_SETPOINT + : PIDController.yPositions.AFTER_SETPOINT; + }, + + // Calculate the ultimate distance from y0 after time t. We want to move very + // slowly at the beginning to see how adding few items to the test can affect + // its output. The complexity of a single item might be big enough to keep the + // proportional gain very small but achieves the desired progress. But if y does + // not change significantly after adding few items, that means we need a much + // bigger gain. So we need to move over a cubic curve which increases very + // slowly with small t values but moves very fast with larger t values. + // The basic formula is: y = t^3 + // Change the formula to reach y=1 after 1000 ms: y = (t/1000)^3 + // Change the formula to reach y=(ysp - y0) after 1000 ms: y = (ysp - y0) * (t/1000)^3 + _distanceUltimate: function(t) + { + return (this._ysp - this._y0) * Math.pow(t / 1000, 3); + }, + + // Calculates the distance of y relative to y0. It also ensures we do not return + // zero by returning a epsilon value in the same direction as ultimate distance. + _distance: function(y, du) + { + const epsilon = 0.0001; + var d = y - this._y0; + return du < 0 ? Math.min(d, -epsilon) : Math.max(d, epsilon); + }, + + // Decides how much the proportional gain should be increased during the manual + // gain stage. We choose to use the ratio of the ultimate distance to the current + // distance as an indication of how much the system is responsive. We want + // to keep the increment under control so it does not cause the system instability + // So we choose to take the natural logarithm of this ratio. + _gainIncrement: function(t, y, e) + { + var du = this._distanceUltimate(t); + var d = this._distance(y, du); + return Math.log(du / d) * 0.1; + }, + + // Update the stage of the controller based on its current stage and the system output + _updateStage: function(y) + { + var yPosition = this._yPosition(y); + + switch (this._stage) { + case PIDController.stages.WARMING: + if (yPosition == PIDController.yPositions.AFTER_SETPOINT) + this._stage = PIDController.stages.OVERSHOOT; + break; + + case PIDController.stages.OVERSHOOT: + if (yPosition == PIDController.yPositions.BEFORE_SETPOINT) + this._stage = PIDController.stages.UNDERSHOOT; + break; + + case PIDController.stages.UNDERSHOOT: + if (yPosition == PIDController.yPositions.AFTER_SETPOINT) + this._stage = PIDController.stages.SATURATE; + break; + } + }, + + // Manual tuning is used before calculating the PID controller gains. + _tuneP: function(e) + { + // The output is the proportional term only. + return this._Kp * e; + }, + + // PID tuning function. Kp, Ti and Td were already calculated + _tunePID: function(h, y, e) + { + // Proportional term. + var P = this._Kp * e; + + // Integral term is the area under the curve starting from the beginning + // till the current time. + this._I += (this._Kp / this._Ti) * ((e + this._eold) / 2) * h; + + // Derivative term is the slope of the curve at the current time. + var D = (this._Kp * this._Td) * (e - this._eold) / h; + + // The ouput is a PID function. + return P + this._I + D; + }, + + // Apply different strategies for the tuning based on the stage of the controller. + _tune: function(t, h, y, e) + { + switch (this._stage) { + case PIDController.stages.WARMING: + // This is the first stage of the Zieglerâ€Nichols method. It increments + // the proportional gain till the system output passes the set-point value. + if (typeof this._y0 == "undefined") { + // This is the first time a tuning value is required. We want the test + // to add only one item. So we need to return -1 which forces us to + // choose the initial value of Kp to be = -1 / e + this._y0 = y; + this._Kp = -1 / e; + } else { + // Keep incrementing the Kp as long as we have not reached the + // set-point yet + this._Kp += this._gainIncrement(t, y, e); + } + + return this._tuneP(e); + + case PIDController.stages.OVERSHOOT: + // This is the second stage of the Zieglerâ€Nichols method. It measures the + // oscillation period. + if (typeof this._t0 == "undefined") { + // t is the time of the begining of the first overshot + this._t0 = t; + this._Kp /= 2; + } + + return this._tuneP(e); + + case PIDController.stages.UNDERSHOOT: + // This is the end of the Zieglerâ€Nichols method. We need to calculate the + // integral and derivative periods. + if (typeof this._Ti == "undefined") { + // t is the time of the end of the first overshot + var Tu = t - this._t0; + + // Calculate the system parameters from Kp and Tu assuming + // a "some overshoot" control type. See: + // https://en.wikipedia.org/wiki/Ziegler%E2%80%93Nichols_method + this._Ti = Tu / 2; + this._Td = Tu / 3; + this._Kp = 0.33 * this._Kp; + + // Calculate the tracking time. + this._Tt = Math.sqrt(this._Ti * this._Td); + } + + return this._tunePID(h, y, e); + + case PIDController.stages.SATURATE: + return this._tunePID(h, y, e); + } + + return 0; + }, + + // Ensures the system does not fluctuates. + _saturate: function(v, e) + { + var u = v; + + switch (this._stage) { + case PIDController.stages.OVERSHOOT: + case PIDController.stages.UNDERSHOOT: + // Calculate the min-max values of the saturation actuator. + if (typeof this._min == "undefined") + this._min = this._max = this._out; + else { + this._min = Math.min(this._min, this._out); + this._max = Math.max(this._max, this._out); + } + break; + + case PIDController.stages.SATURATE: + const limitPercentage = 0.90; + var min = this._min > 0 ? Math.min(this._min, this._max * limitPercentage) : this._min; + var max = this._max < 0 ? Math.max(this._max, this._min * limitPercentage) : this._max; + var out = this._out + u; + + // Clip the controller output to the min-max values + out = Math.max(Math.min(max, out), min); + u = out - this._out; + + // Apply the back-calculation and tracking + if (u != v) + u += (this._Kp * this._Tt / this._Ti) * e; + break; + } + + this._out += u; + return u; + }, + + // Called from the benchmark to tune its test. It uses Ziegler-Nichols method + // to calculate the controller parameters. It then returns a PID tuning value. + tune: function(t, h, y) + { + this._updateStage(y); + + // Current error. + var e = this._ysp - y; + var v = this._tune(t, h, y, e); + + // Save e for the next call. + this._eold = e; + + // Apply back-calculation and tracking to avoid integrator windup + return this._saturate(v, e); + } +}); + +Utilities.extendObject(PIDController, { + // This enum will be used to tell whether the system output (or the controller input) + // is moving towards the set-point or away from it. + yPositions: { + BEFORE_SETPOINT: 0, + AFTER_SETPOINT: 1 + }, + + // The Ziegler-Nichols method for is used tuning the PID controller. The workflow of + // the tuning is split into four stages. The first two stages determine the values + // of the PID controller gains. During these two stages we return the proportional + // term only. The third stage is used to determine the min-max values of the + // saturation actuator. In the last stage back-calculation and tracking are applied + // to avoid integrator windup. During the last two stages, we return a PID control + // value. + stages: { + WARMING: 0, // Increase the value of the Kp until the system output reaches ysp. + OVERSHOOT: 1, // Measure the oscillation period and the overshoot value + UNDERSHOOT: 2, // Return PID value and measure the undershoot value + SATURATE: 3 // Return PID value and apply back-calculation and tracking. + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/resources/stage.css b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/stage.css new file mode 100644 index 0000000000..0b6ffdc4a2 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/stage.css @@ -0,0 +1,27 @@ +html { + height: 100%; +} +body { + width: 100%; + height: 100%; + margin: 0; + padding: 0; + background-color: rgb(241, 241, 241); + font-family: "Helvetica Neue", Helvetica, Verdana, sans-serif; +} + +#stage { + position: relative; + width: 100%; + height: 100%; + background-color: rgb(241, 241, 241); + overflow: hidden; +} + +#center-text { + position: absolute; + z-index: 3; + top: 50%; + left: 50%; + transform: translate(-50%, -50%); +} diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/resources/star.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/star.svg new file mode 100644 index 0000000000..3c46ae0419 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/star.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/resources/yin-yang.png b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/yin-yang.png new file mode 100644 index 0000000000..3162f6ec00 Binary files /dev/null and b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/yin-yang.png differ diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/resources/yin-yang.svg b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/yin-yang.svg new file mode 100644 index 0000000000..4412626774 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/resources/yin-yang.svg @@ -0,0 +1,17 @@ + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/simple-canvas-paths.js b/third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/simple-canvas-paths.js new file mode 100644 index 0000000000..cda985b221 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/simple-canvas-paths.js @@ -0,0 +1,453 @@ +(function() { + +// === PAINT OBJECTS === + +CanvasLineSegment = Utilities.createClass( + function(stage) { + var radius = Stage.randomInt(10, 100); + var center = Stage.randomPosition(stage.size); + var delta = Point.pointOnCircle(Stage.randomAngle(), radius/2); + + this._point1 = center.add(delta); + this._point2 = center.subtract(delta); + this._color = Stage.randomColor(); + this._lineWidth = Stage.randomInt(1, 100); + }, { + + draw: function(context) { + context.strokeStyle = this._color; + context.lineWidth = this._lineWidth; + context.beginPath(); + context.moveTo(this._point1.x, this._point1.y); + context.lineTo(this._point2.x, this._point2.y); + context.stroke(); + } +}); + +CanvasLinePoint = Utilities.createClass( + function(stage, coordinateMaximumFactor) { + var pointMaximum = new Point(Math.min(stage.size.x, coordinateMaximumFactor * stage.size.x), Math.min(stage.size.y, coordinateMaximumFactor * stage.size.y)); + this._point = Stage.randomPosition(pointMaximum).add(new Point((stage.size.x - pointMaximum.x) / 2, (stage.size.y - pointMaximum.y) / 2)); + }, { + + draw: function(context) { + context.lineTo(this._point.x, this._point.y); + } +}) + +CanvasQuadraticSegment = Utilities.createClass( + function(stage) { + var maxSize = Stage.randomInt(20, 200); + var toCenter = Stage.randomPosition(stage.size).subtract(new Point(maxSize/2, maxSize/2)); + + this._point1 = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._point2 = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._point3 = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._color = Stage.randomColor(); + this._lineWidth = Stage.randomInt(1, 50); + }, { + + draw: function(context) { + context.strokeStyle = this._color; + context.lineWidth = this._lineWidth; + context.beginPath(); + context.moveTo(this._point1.x, this._point1.y); + context.quadraticCurveTo(this._point2.x, this._point2.y, this._point3.x, this._point3.y); + context.stroke(); + } +}); + +CanvasQuadraticPoint = Utilities.createClass( + function(stage, coordinateMaximumFactor) { + var pointMaximum = Stage.randomPosition(new Point(Math.min(stage.size.x, coordinateMaximumFactor * stage.size.x), Math.min(stage.size.y, coordinateMaximumFactor * stage.size.y))); + this._point1 = Stage.randomPosition(pointMaximum).add(new Point((stage.size.x - pointMaximum.x) / 2, (stage.size.y - pointMaximum.y) / 2)); + this._point2 = Stage.randomPosition(pointMaximum).add(new Point((stage.size.x - pointMaximum.x) / 2, (stage.size.y - pointMaximum.y) / 2)); + }, { + + draw: function(context) { + context.quadraticCurveTo(this._point1.x, this._point1.y, this._point2.x, this._point2.y); + } +}); + +CanvasBezierSegment = Utilities.createClass( + function(stage) { + var maxSize = Stage.randomInt(20, 200); + var toCenter = Stage.randomPosition(stage.size).subtract(new Point(maxSize/2, maxSize/2)); + + this._point1 = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._point2 = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._point3 = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._point4 = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._color = Stage.randomColor(); + this._lineWidth = Stage.randomInt(1, 50); + }, { + + draw: function(context) { + context.strokeStyle = this._color; + context.lineWidth = this._lineWidth; + context.beginPath(); + context.moveTo(this._point1.x, this._point1.y); + context.bezierCurveTo(this._point2.x, this._point2.y, this._point3.x, this._point3.y, this._point4.x, this._point4.y); + context.stroke(); + } +}); + +CanvasBezierPoint = Utilities.createClass( + function(stage, coordinateMaximumFactor) { + var pointMaximum = Stage.randomPosition(new Point(Math.min(stage.size.x, coordinateMaximumFactor * stage.size.x), Math.min(stage.size.y, coordinateMaximumFactor * stage.size.y))); + this._point1 = Stage.randomPosition(pointMaximum).add(new Point((stage.size.x - pointMaximum.x) / 2, (stage.size.y - pointMaximum.y) / 2)); + this._point2 = Stage.randomPosition(pointMaximum).add(new Point((stage.size.x - pointMaximum.x) / 2, (stage.size.y - pointMaximum.y) / 2)); + this._point3 = Stage.randomPosition(pointMaximum).add(new Point((stage.size.x - pointMaximum.x) / 2, (stage.size.y - pointMaximum.y) / 2)); + }, { + + draw: function(context) { + context.bezierCurveTo(this._point1.x, this._point1.y, this._point2.x, this._point2.y, this._point3.x, this._point3.y); + } +}); + +CanvasArcToSegment = Utilities.createClass( + function(stage) { + var maxSize = Stage.randomInt(20, 200); + var toCenter = Stage.randomPosition(stage.size).subtract(new Point(maxSize/2, maxSize/2)); + + this._point1 = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._point2 = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._point3 = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._radius = Stage.randomInt(20, 200); + this._color = Stage.randomColor(); + this._lineWidth = Stage.randomInt(1, 50); + }, { + + draw: function(context) { + context.strokeStyle = this._color; + context.lineWidth = this._lineWidth; + context.beginPath(); + context.moveTo(this._point1.x, this._point1.y); + context.arcTo(this._point2.x, this._point2.y, this._point3.x, this._point3.y, this._radius); + context.stroke(); + } +}); + +CanvasArcToSegmentFill = Utilities.createClass( + function(stage) { + CanvasArcToSegment.call(this, stage); + }, { + + draw: function(context) { + context.fillStyle = this._color; + context.beginPath(); + context.moveTo(this._point1.x, this._point1.y); + context.arcTo(this._point2.x, this._point2.y, this._point3.x, this._point3.y, this._radius); + context.fill(); + } +}); + +CanvasArcSegment = Utilities.createClass( + function(stage) { + var maxSize = Stage.randomInt(20, 200); + var toCenter = Stage.randomPosition(stage.size).subtract(new Point(maxSize/2, maxSize/2)); + + this._point = Stage.randomPosition(new Point(maxSize, maxSize)).add(toCenter); + this._radius = Stage.randomInt(20, 200); + this._startAngle = Stage.randomAngle(); + this._endAngle = Stage.randomAngle(); + this._counterclockwise = Stage.randomBool(); + this._color = Stage.randomColor(); + this._lineWidth = Stage.randomInt(1, 50); + }, { + + draw: function(context) { + context.strokeStyle = this._color; + context.lineWidth = this._lineWidth; + context.beginPath(); + context.arc(this._point.x, this._point.y, this._radius, this._startAngle, this._endAngle, this._counterclockwise); + context.stroke(); + } +}); + +CanvasArcSegmentFill = Utilities.createClass( + function(stage) { + CanvasArcSegment.call(this, stage); + }, { + + draw: function(context) { + context.fillStyle = this._color; + context.beginPath(); + context.arc(this._point.x, this._point.y, this._radius, this._startAngle, this._endAngle, this._counterclockwise); + context.fill(); + } +}); + +CanvasRect = Utilities.createClass( + function(stage) { + this._width = Stage.randomInt(20, 200); + this._height = Stage.randomInt(20, 200); + this._point = Stage.randomPosition(stage.size).subtract(new Point(this._width/2, this._height/2)); + this._color = Stage.randomColor(); + this._lineWidth = Stage.randomInt(1, 20); + }, { + + draw: function(context) { + context.strokeStyle = this._color; + context.lineWidth = this._lineWidth; + context.beginPath(); + context.rect(this._point.x, this._point.y, this._width, this._height); + context.stroke(); + } +}); + +CanvasRectFill = Utilities.createClass( + function(stage) { + CanvasRect.call(this, stage); + }, { + + draw: function(context) { + context.fillStyle = this._color; + context.beginPath(); + context.rect(this._point.x, this._point.y, this._width, this._height); + context.fill(); + } +}); + +CanvasEllipse = Utilities.createClass( + function(stage) { + this._radius = new Point(Stage.randomInt(20, 200), Stage.randomInt(20, 200)); + var toCenter = Stage.randomPosition(stage.size).subtract(this._radius.multiply(.5)); + + this._center = Stage.randomPosition(this._radius).add(toCenter); + this._rotation = Stage.randomAngle(); + this._startAngle = Stage.randomAngle(); + this._endAngle = Stage.randomAngle(); + this._anticlockwise = Stage.randomBool(); + this._color = Stage.randomColor(); + this._lineWidth = Stage.randomInt(1, 20); + }, { + + draw: function(context) { + context.strokeStyle = this._color; + context.lineWidth = this._lineWidth; + context.beginPath(); + context.ellipse(this._center.x, this._center.y, this._radius.width, this._radius.height, this._rotation, this._startAngle, this._endAngle, this._anticlockwise); + context.stroke(); + } +}); + +CanvasEllipseFill = Utilities.createClass( + function(stage) { + CanvasEllipse.call(this, stage); + }, { + + draw: function(context) { + context.fillStyle = this._color; + context.beginPath(); + context.ellipse(this._center.x, this._center.y, this._radius.width, this._radius.height, this._rotation, this._startAngle, this._endAngle, this._anticlockwise); + context.fill(); + } +}); + +CanvasStroke = Utilities.createClass( + function (stage) { + this._object = new (Stage.randomElementInArray(this.objectTypes))(stage); + }, { + + objectTypes: [ + CanvasQuadraticSegment, + CanvasBezierSegment, + CanvasArcToSegment, + CanvasArcSegment, + CanvasRect, + CanvasEllipse + ], + + draw: function(context) { + this._object.draw(context); + } +}); + +CanvasFill = Utilities.createClass( + function (stage) { + this._object = new (Stage.randomElementInArray(this.objectTypes))(stage); + }, { + + objectTypes: [ + CanvasArcToSegmentFill, + CanvasArcSegmentFill, + CanvasRectFill, + CanvasEllipseFill + ], + + draw: function(context) { + this._object.draw(context); + } +}); + +// === STAGES === + +SimpleCanvasPathStrokeStage = Utilities.createSubclass(SimpleCanvasStage, + function(canvasObject) { + SimpleCanvasStage.call(this, canvasObject); + }, { + + animate: function() + { + var context = this.context; + context.clearRect(0, 0, this.size.x, this.size.y); + context.lineWidth = Stage.randomInt(1, 20); + context.strokeStyle = Stage.rotatingColor(); + context.beginPath(); + context.moveTo(this.size.x / 2, this.size.y / 2); + for (var i = 0, length = this.offsetIndex; i < length; ++i) + this.objects[i].draw(context); + context.stroke(); + } +}); + +SimpleCanvasPathFillStage = Utilities.createSubclass(SimpleCanvasStage, + function(canvasObject) { + SimpleCanvasStage.call(this, canvasObject); + }, { + + animate: function() + { + var context = this.context; + context.clearRect(0, 0, this.size.x, this.size.y); + context.fillStyle = Stage.rotatingColor(); + context.beginPath(); + context.moveTo(this.size.x / 2, this.size.y / 2); + for (var i = 0, length = this.offsetIndex; i < length; ++i) + this.objects[i].draw(context); + context.fill(); + } +}); + +CanvasLineSegmentStage = Utilities.createSubclass(SimpleCanvasStage, + function() + { + SimpleCanvasStage.call(this, CanvasLineSegment); + }, { + + initialize: function(benchmark, options) + { + SimpleCanvasStage.prototype.initialize.call(this, benchmark, options); + this.context.lineCap = options["lineCap"] || "butt"; + } +}); + +CanvasLinePathStage = Utilities.createSubclass(SimpleCanvasPathStrokeStage, + function() + { + SimpleCanvasPathStrokeStage.call(this, CanvasLinePoint); + }, { + + initialize: function(benchmark, options) + { + SimpleCanvasPathStrokeStage.prototype.initialize.call(this, benchmark, options); + this.context.lineJoin = options["lineJoin"] || "bevel"; + } +}); + +CanvasLineDashStage = Utilities.createSubclass(SimpleCanvasStage, + function() + { + SimpleCanvasStage.call(this, CanvasLinePoint); + this._step = 0; + }, { + + initialize: function(benchmark, options) + { + SimpleCanvasStage.prototype.initialize.call(this, benchmark, options); + this.context.setLineDash([1, 2, 3, 4, 5, 6, 7, 8, 9, 10]); + this.context.lineWidth = 1; + this.context.strokeStyle = "#000"; + }, + + animate: function() + { + var context = this.context; + context.clearRect(0, 0, this.size.x, this.size.y); + context.lineDashOffset = this._step++; + context.beginPath(); + context.moveTo(this.size.x / 2, this.size.y / 2); + for (var i = 0, length = this.offsetIndex; i < length; ++i) + this.objects[i].draw(context); + context.stroke(); + } +}); + +// === BENCHMARK === + +CanvasPathBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + var stage; + switch (options["pathType"]) { + case "line": + stage = new CanvasLineSegmentStage(); + break; + case "linePath": { + if ("lineJoin" in options) + stage = new CanvasLinePathStage(); + if ("lineDash" in options) + stage = new CanvasLineDashStage(); + break; + } + case "quadratic": + stage = new SimpleCanvasStage(CanvasQuadraticSegment); + break; + case "quadraticPath": + stage = new SimpleCanvasPathStrokeStage(CanvasQuadraticPoint); + break; + case "bezier": + stage = new SimpleCanvasStage(CanvasBezierSegment); + break; + case "bezierPath": + stage = new SimpleCanvasPathStrokeStage(CanvasBezierPoint); + break; + case "arcTo": + stage = new SimpleCanvasStage(CanvasArcToSegment); + break; + case "arc": + stage = new SimpleCanvasStage(CanvasArcSegment); + break; + case "rect": + stage = new SimpleCanvasStage(CanvasRect); + break; + case "ellipse": + stage = new SimpleCanvasStage(CanvasEllipse); + break; + case "lineFill": + stage = new SimpleCanvasPathFillStage(CanvasLinePoint); + break; + case "quadraticFill": + stage = new SimpleCanvasPathFillStage(CanvasQuadraticPoint); + break; + case "bezierFill": + stage = new SimpleCanvasPathFillStage(CanvasBezierPoint); + break; + case "arcToFill": + stage = new SimpleCanvasStage(CanvasArcToSegmentFill); + break; + case "arcFill": + stage = new SimpleCanvasStage(CanvasArcSegmentFill); + break; + case "rectFill": + stage = new SimpleCanvasStage(CanvasRectFill); + break; + case "ellipseFill": + stage = new SimpleCanvasStage(CanvasEllipseFill); + break; + case "strokes": + stage = new SimpleCanvasStage(CanvasStroke); + break; + case "fills": + stage = new SimpleCanvasStage(CanvasFill); + break; + } + + Benchmark.call(this, stage, options); + } +); + +window.benchmarkClass = CanvasPathBenchmark; + +})(); \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/simple-canvas.js b/third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/simple-canvas.js new file mode 100644 index 0000000000..483d535d75 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/simple-canvas.js @@ -0,0 +1,35 @@ +Utilities.extendObject(SimpleCanvasStage.prototype, { + tune: function(count) + { + if (count == 0) + return; + + if (count < 0) { + this.offsetIndex = Math.max(this.offsetIndex + count, 0); + return; + } + + this.offsetIndex = this.offsetIndex + count; + if (this.offsetIndex > this.objects.length) { + // For some tests, it may be easier to see how well the test is going + // by limiting the range of coordinates in which new objects can reside + var coordinateMaximumFactor = Math.min(this.objects.length, Math.min(this.size.x, this.size.y)) / Math.min(this.size.x, this.size.y); + var newIndex = this.offsetIndex - this.objects.length; + for (var i = 0; i < newIndex; ++i) + this.objects.push(new this._canvasObject(this, coordinateMaximumFactor)); + } + }, + + animate: function() + { + var context = this.context; + context.clearRect(0, 0, this.size.x, this.size.y); + for (var i = 0, length = this.offsetIndex; i < length; ++i) + this.objects[i].draw(context); + }, + + complexity: function() + { + return this.offsetIndex; + } +}); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/tiled-canvas-image.js b/third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/tiled-canvas-image.js new file mode 100644 index 0000000000..f5d02b68a4 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/simple/resources/tiled-canvas-image.js @@ -0,0 +1,119 @@ +(function() { + +CanvasImageTile = Utilities.createClass( + function(stage, source) + { + this._context = stage.context; + this._size = stage.tileSize; + this.source = source; + }, { + + getImageData: function() + { + this._imagedata = this._context.getImageData(this.source.x, this.source.y, this._size.width, this._size.height); + }, + + putImageData: function(destination) + { + this._context.putImageData(this._imagedata, destination.x, destination.y); + } +}); + +TiledCanvasImageStage = Utilities.createSubclass(Stage, + function(element, options) + { + Stage.call(this); + }, { + + initialize: function(benchmark, options) + { + Stage.prototype.initialize.call(this, benchmark, options); + this.context = this.element.getContext("2d"); + this._setupTiles(); + }, + + _setupTiles: function() + { + const maxTilesPerRow = 50; + const maxTilesPerCol = 50; + + this.tileSize = this.size.multiply(new Point(1 / maxTilesPerRow, 1 / maxTilesPerCol)); + + this._tiles = new Array(maxTilesPerRow * maxTilesPerCol); + + var source = Point.zero; + for (var index = 0; index < this._tiles.length; ++index) { + this._tiles[index] = new CanvasImageTile(this, source); + source = this._nextTilePosition(source); + } + + this._ctiles = 0; + }, + + _nextTilePosition: function(destination) + { + var next = destination.add(this.tileSize); + + if (next.x >= this._size.width) + return new Point(0, next.y >= this._size.height ? 0 : next.y); + + return new Point(next.x, destination.y); + }, + + tune: function(count) + { + this._ctiles += count; + + this._ctiles = Math.max(this._ctiles, 0); + this._ctiles = Math.min(this._ctiles, this._tiles.length); + }, + + _drawBackground: function() + { + var size = this._benchmark._stage.size; + var gradient = this.context.createLinearGradient(0, 0, size.width, 0); + gradient.addColorStop(0, "red"); + gradient.addColorStop(1, "white"); + this.context.save(); + this.context.fillStyle = gradient; + this.context.fillRect(0, 0, size.width, size.height); + this.context.restore(); + }, + + animate: function(timeDelta) + { + this._drawBackground(); + + if (!this._ctiles) + return; + + this._tiles.shuffle(); + + var destinations = new Array(this._ctiles); + for (var index = 0; index < this._ctiles; ++index) { + this._tiles[index].getImageData(); + destinations[index] = this._tiles[index].source; + } + + destinations.shuffle(); + + for (var index = 0; index < this._ctiles; ++index) + this._tiles[index].putImageData(destinations[index]); + }, + + complexity: function() + { + return this._ctiles; + } +}); + +TiledCanvasImageBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new TiledCanvasImageStage(), options); + } +); + +window.benchmarkClass = TiledCanvasImageBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/simple/simple-canvas-paths.html b/third_party/webkit/PerformanceTests/MotionMark/tests/simple/simple-canvas-paths.html new file mode 100644 index 0000000000..5bb69bc54f --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/simple/simple-canvas-paths.html @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/simple/tiled-canvas-image.html b/third_party/webkit/PerformanceTests/MotionMark/tests/simple/tiled-canvas-image.html new file mode 100644 index 0000000000..c7c0fef774 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/simple/tiled-canvas-image.html @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-canvas.js b/third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-canvas.js new file mode 100644 index 0000000000..b74984c010 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-canvas.js @@ -0,0 +1,89 @@ +(function() { + +function TemplateCanvasObject(stage) +{ + // For the canvas stage, most likely you will need to create your + // animated object since it's only draw time thing. + + // Fill in your object data. +} + +TemplateCanvasObject.prototype = { + _draw: function() + { + // Draw your object. + }, + + animate: function(timeDelta) + { + // Redraw the animated object. The last time this animated + // item was drawn before 'timeDelta'. + + // Move your object. + + // Redraw your object. + this._draw(); + } +}; + +TemplateCanvasStage = Utilities.createSubclass(Stage, + function() + { + Stage.call(this); + }, { + + initialize: function(benchmark, options) + { + Stage.prototype.initialize.call(this, benchmark, options); + this.context = this.element.getContext("2d"); + + // Define a collection for your objects. + }, + + tune: function(count) + { + // If count is -ve, -count elements need to be removed form the + // stage. If count is +ve, +count elements need to be added to + // the stage. + + // Change objects in the stage. + }, + + animate: function(timeDelta) + { + // Animate the elements such that all of them are redrawn. Most + // likely you will need to call TemplateCanvasObject.animate() + // for all your animated objects here. + + // Most likely you will need to clear the canvas with every redraw. + this.context.clearRect(0, 0, this.size.x, this.size.y); + + // Loop through all your objects and ask them to animate. + } +}); + +TemplateCanvasBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new TemplateCanvasStage(), options); + }, { + + // Override this function if the benchmark needs to wait for resources to be + // loaded. + // + // Default implementation returns a resolved promise, so that the benchmark + // benchmark starts right away. Here's an example where we're waiting 5 + // seconds before starting the benchmark. + waitUntilReady: function() + { + var promise = new SimplePromise; + window.setTimeout(function() { + promise.resolve(); + }, 5000); + return promise; + } +}); + +window.benchmarkClass = TemplateCanvasBenchmark; + +})(); \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-css.js b/third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-css.js new file mode 100644 index 0000000000..cdaa814af0 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-css.js @@ -0,0 +1,46 @@ +(function() { + +TemplateCssStage = Utilities.createSubclass(Stage, + function() + { + Stage.call(this); + }, { + + initialize: function(benchmark, options) + { + Stage.prototype.initialize.call(this, benchmark, options); + + // Do initialization here. + }, + + tune: function(count) + { + // If count is -ve, -count elements need to be removed form the + // stage. If count is +ve, +count elements need to be added to + // the stage. + + // Change objects in the stage. + }, + + animate: function(timeDelta) + { + // Animate the elements such that all of them are redrawn. You + // may need to define your object so it keeps its animation data. + // This object should encapsulate a corrosponding HTMLElement. + // You may also define a method called animate() in this object + // and just call this function here for all the elements. + + // Loop through all your objects and ask them to animate. + } +}); + +TemplateCssBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new TemplateCssStage(), options); + } +); + +window.benchmarkClass = TemplateCssBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-svg.js b/third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-svg.js new file mode 100644 index 0000000000..8fee9c3478 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/template/resources/template-svg.js @@ -0,0 +1,46 @@ +(function() { + +TemplateSvgStage = Utilities.createSubclass(Stage, + function() + { + Stage.call(this); + }, { + + initialize: function(benchmark, options) + { + Stage.prototype.initialize.call(this, benchmark, options); + + // Do initialization here. + }, + + tune: function(count) + { + // If count is -ve, -count elements need to be removed form the + // stage. If count is +ve, +count elements need to be added to + // the stage. + + // TODO: Change objects in the stage. + }, + + animate: function(timeDelta) + { + // Animate the elements such that all of them are redrawn. You + // may need to define your object so it keeps its animation data. + // This object should encapsulate a corrosponding SVGElement. + // You may also define a method called animate() in this object + // and just call this function here for all the elements. + + // TODO: Loop through all your objects and ask them to animate. + } +}); + +TemplateSvgBenchmark = Utilities.createSubclass(Benchmark, + function(options) + { + Benchmark.call(this, new TemplateSvgStage(), options); + } +); + +window.benchmarkClass = TemplateSvgBenchmark; + +})(); diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/template/template-canvas.html b/third_party/webkit/PerformanceTests/MotionMark/tests/template/template-canvas.html new file mode 100644 index 0000000000..dcb7f52861 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/template/template-canvas.html @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/template/template-css.html b/third_party/webkit/PerformanceTests/MotionMark/tests/template/template-css.html new file mode 100644 index 0000000000..70eb214e95 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/template/template-css.html @@ -0,0 +1,16 @@ + + + + + + + +
    + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/tests/template/template-svg.html b/third_party/webkit/PerformanceTests/MotionMark/tests/template/template-svg.html new file mode 100644 index 0000000000..7a14fc45d6 --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/tests/template/template-svg.html @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/MotionMark/version b/third_party/webkit/PerformanceTests/MotionMark/version new file mode 100644 index 0000000000..241f47c42d --- /dev/null +++ b/third_party/webkit/PerformanceTests/MotionMark/version @@ -0,0 +1,2 @@ +1.0 +r205655+ \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/InteractiveRunner.html b/third_party/webkit/PerformanceTests/Speedometer/InteractiveRunner.html new file mode 100644 index 0000000000..9cbfaa2889 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/InteractiveRunner.html @@ -0,0 +1,173 @@ + + + +Speedometer 2.1 Interactive Runner + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/Speedometer/README_MOZILLA b/third_party/webkit/PerformanceTests/Speedometer/README_MOZILLA new file mode 100644 index 0000000000..de0cd8c204 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/README_MOZILLA @@ -0,0 +1,13 @@ +The source from this directory was copied from the +PerformanceTests/Speedometer directory of the Webkit repository +at: https://svn.webkit.org/repository/webkit/trunk/PerformanceTests/Speedometer2.1/ + +The SVN revision used was: 294153 + +The contents of this directory are intended for use to "train" the +profile guided optimization (PGO) of Firefox and for benchmarking +scenarios. The files inside this directory are not intended to ship +with Firefox or any other product. If files inside this directory +are useful for other purposes (e.g. JavaScript libraries), consumers +should vendor those files separately, as it is not appropriate to pull +in components of Speedometer for use outside of Speedometer. diff --git a/third_party/webkit/PerformanceTests/Speedometer/index.html b/third_party/webkit/PerformanceTests/Speedometer/index.html new file mode 100644 index 0000000000..acac49d0f0 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/index.html @@ -0,0 +1,107 @@ + + + + + Speedometer 2.1 + + + + + + + + +
    + + +
    +

    + Speedometer is a browser benchmark that measures the responsiveness of Web applications. + It uses demo web applications to simulate user actions such as adding to-do items. +

    +

    + Your browser window is too small. For most accurate results, please make the view port size at least 850px by 650px.
    + It's currently . +

    +
    + +
    +

    About Speedometer

    +
    + +
    +
    +
    +
    +
    + +
    +

    Runs / Minute

    +
    +
    +
    +
    +
    + + +
    +
    + +
    +

    Detailed Results

    +
    +
    +
    +
    + + +
    +

    About Speedometer

    +
    + +
    +

    About Speedometer 2.1

    + +

    Speedometer tests a browser's Web app responsiveness by timing simulated user interactions.

    + +

    + This benchmark simulates user actions for adding, completing, and removing to-do items using multiple examples in TodoMVC. + Each example in TodoMVC implements the same todo application using DOM APIs in different ways. + Some call DOM APIs directly from ECMAScript 5 (ES5), ECMASCript 2015 (ES6), ES6 transpiled to ES5, and Elm transpiled to ES5. + Others use one of eleven popular JavaScript frameworks: React, React with Redux, Ember.js, Backbone.js, + AngularJS, (new) Angular, Vue.js, jQuery, Preact, Inferno, and Flight. + + Many of these frameworks are used on the most popular websites in the world, such as Facebook and Twitter. + The performance of these types of operations depends on the speed of the DOM APIs, the JavaScript engine, + CSS style resolution, layout, and other technologies. +

    + +

    + Although user-driven actions like mouse movements and keyboard input cannot be accurately emulated in JavaScript, + Speedometer does its best to faithfully replay a typical workload within the demo applications. + To make the run time long enough to measure with the limited precision, + we synchronously execute a large number of the operations, such as adding one hundred to-do items. +

    + +

    + Modern browser engines execute some work asynchronously as an optimization strategy to reduce the run time of synchronous operations. + While returning control back to JavaScript execution as soon as possible is worth pursuing, + the run time cost of such an asynchronous work should still be taken into a holistic measurement of web application performance. + In addition, some modern JavaScript frameworks such as Vue.js and Preact call into DOM APIs asynchronously as an optimization technique. + Speedometer approximates the run time of this asynchronous work in the UI thread with a zero-second timer + that is scheduled immediately after each execution of synchronous operations. +

    + +

    + Speedometer does not attempt to measure concurrent asynchronous work that does not directly impact the UI thread, + which tends not to affect app responsiveness. +

    + +

    + Note: Speedometer should not be used as a way to compare the performance of different JavaScript frameworks + as work load differs greatly in each framework. +

    +
    +
    + + diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/benchmark-report.js b/third_party/webkit/PerformanceTests/Speedometer/resources/benchmark-report.js new file mode 100644 index 0000000000..972fbb0529 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/benchmark-report.js @@ -0,0 +1,105 @@ +// This file can be customized to report results as needed. + +(function () { + if ((!window.testRunner && location.search != '?webkit' && location.hash != '#webkit') + && location.search != '?gecko' && location.search != '?raptor') + return; + + if (window.testRunner) + testRunner.waitUntilDone(); + + var scriptElement = document.createElement('script'); + scriptElement.src = '../resources/runner.js'; + document.head.appendChild(scriptElement); + + var styleElement = document.createElement('style'); + styleElement.textContent = 'pre { padding-top: 600px; }'; + document.head.appendChild(styleElement); + + var createTest; + var valuesByIteration = new Array; + + window.onload = function () { + document.body.removeChild(document.querySelector('main')); + startBenchmark(); + } + + window.benchmarkClient = { + iterationCount: 5, // Use 4 different instances of DRT/WTR to run 5 iterations. + willStartFirstIteration: function (iterationCount) { + createTest = function (name, aggregator, isLastTest) { + return { + customIterationCount: iterationCount, + doNotIgnoreInitialRun: true, + doNotMeasureMemoryUsage: true, + continueTesting: !isLastTest, + unit: 'ms', + name: name, + aggregator: aggregator}; + } + if (window.PerfTestRunner) { + PerfTestRunner.prepareToMeasureValuesAsync(createTest(null, 'Total')); + } + }, + didRunSuites: function (measuredValues) { + if (window.PerfTestRunner) + PerfTestRunner.measureValueAsync(measuredValues.total); + valuesByIteration.push(measuredValues.tests); + }, + didFinishLastIteration: function () { + document.head.removeChild(document.querySelector('style')); + + var measuredValuesByFullName = {}; + function addToMeasuredValue(value, fullName, aggregator) { + var values = measuredValuesByFullName[fullName] || new Array; + measuredValuesByFullName[fullName] = values; + values.push(value); + values.aggregator = aggregator; + } + + valuesByIteration.forEach(function (measuredValues) { + for (var suiteName in measuredValues) { + var suite = measuredValues[suiteName]; + for (var testName in suite.tests) { + var test = suite.tests[testName]; + for (var subtestName in test.tests) + addToMeasuredValue(test.tests[subtestName], suiteName + '/' + testName + '/' + subtestName); + addToMeasuredValue(test.total, suiteName + '/' + testName, 'Total'); + } + addToMeasuredValue(suite.total, suiteName, 'Total'); + } + }); + + var fullNames = new Array; + for (var fullName in measuredValuesByFullName) { + fullNames.push(fullName); + } + + if (typeof tpRecordTime !== "undefined" || location.search == '?raptor') { + var values = new Array; + var allNames = new Array; + for (var i = 0; i < fullNames.length; i++) { + vals = measuredValuesByFullName[fullNames[i]]; + values.push(vals); + for (var count=0; count < vals.length; count ++) { + allNames.push(fullNames[i]); + } + } + + if (location.search == '?raptor') { + _data = ['raptor-benchmark', 'speedometer', measuredValuesByFullName]; + console.log('speedometer source about to post results to the raptor webext'); + window.postMessage(_data, '*'); + window.sessionStorage.setItem('benchmark_results', JSON.stringify(_data)); + } else { + tpRecordTime(values.join(','), 0, allNames.join(',')); + } + } else { + for (var i = 0; i < fullNames.length; i++) { + var values = measuredValuesByFullName[fullNames[i]]; + PerfTestRunner.reportValues(createTest(fullNames[i], values.aggregator, i + 1 == fullNames.length), values); + } + } + } + }; +})(); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/benchmark-runner.js b/third_party/webkit/PerformanceTests/Speedometer/resources/benchmark-runner.js new file mode 100644 index 0000000000..751992b4f1 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/benchmark-runner.js @@ -0,0 +1,305 @@ +// FIXME: Use the real promise if available. +// FIXME: Make sure this interface is compatible with the real Promise. +function SimplePromise() { + this._chainedPromise = null; + this._callback = null; +} + +SimplePromise.prototype.then = function (callback) { + if (this._callback) + throw "SimplePromise doesn't support multiple calls to then"; + this._callback = callback; + this._chainedPromise = new SimplePromise; + + if (this._resolved) + this.resolve(this._resolvedValue); + + return this._chainedPromise; +} + +SimplePromise.prototype.resolve = function (value) { + if (!this._callback) { + this._resolved = true; + this._resolvedValue = value; + return; + } + + var result = this._callback(value); + if (result instanceof SimplePromise) { + var chainedPromise = this._chainedPromise; + result.then(function (result) { chainedPromise.resolve(result); }); + } else + this._chainedPromise.resolve(result); +} + +function BenchmarkTestStep(testName, testFunction) { + this.name = testName; + this.run = testFunction; +} + +function BenchmarkRunner(suites, client) { + this._suites = suites; + this._prepareReturnValue = null; + this._client = client; +} + +BenchmarkRunner.prototype.waitForElement = function (selector) { + var promise = new SimplePromise; + var contentDocument = this._frame.contentDocument; + + function resolveIfReady() { + var element = contentDocument.querySelector(selector); + if (element) { + window.requestAnimationFrame(function () { + return promise.resolve(element); + }); + return; + } + setTimeout(resolveIfReady, 50); + } + + resolveIfReady(); + return promise; +} + +BenchmarkRunner.prototype._removeFrame = function () { + if (this._frame) { + this._frame.parentNode.removeChild(this._frame); + this._frame = null; + } +} + +BenchmarkRunner.prototype._appendFrame = function (src) { + var frame = document.createElement('iframe'); + frame.style.width = '800px'; + frame.style.height = '600px'; + frame.style.border = '0px none'; + frame.style.position = 'absolute'; + frame.setAttribute('scrolling', 'no'); + + var marginLeft = parseInt(getComputedStyle(document.body).marginLeft); + var marginTop = parseInt(getComputedStyle(document.body).marginTop); + if (window.innerWidth > 800 + marginLeft && window.innerHeight > 600 + marginTop) { + frame.style.left = marginLeft + 'px'; + frame.style.top = marginTop + 'px'; + } else { + frame.style.left = '0px'; + frame.style.top = '0px'; + } + + if (this._client && this._client.willAddTestFrame) + this._client.willAddTestFrame(frame); + + document.body.insertBefore(frame, document.body.firstChild); + this._frame = frame; + return frame; +} + +BenchmarkRunner.prototype._waitAndWarmUp = function () { + var startTime = Date.now(); + + function Fibonacci(n) { + if (Date.now() - startTime > 100) + return; + if (n <= 0) + return 0; + else if (n == 1) + return 1; + return Fibonacci(n - 2) + Fibonacci(n - 1); + } + + var promise = new SimplePromise; + setTimeout(function () { + Fibonacci(100); + promise.resolve(); + }, 200); + return promise; +} + +BenchmarkRunner.prototype._writeMark = function(name) { + if (window.performance && window.performance.mark) + window.performance.mark(name); +} + +// This function ought be as simple as possible. Don't even use SimplePromise. +BenchmarkRunner.prototype._runTest = function(suite, test, prepareReturnValue, callback) +{ + var self = this; + var now = window.performance && window.performance.now ? function () { return window.performance.now(); } : Date.now; + + var contentWindow = self._frame.contentWindow; + var contentDocument = self._frame.contentDocument; + + self._writeMark(suite.name + '.' + test.name + '-start'); + var startTime = now(); + test.run(prepareReturnValue, contentWindow, contentDocument); + var endTime = now(); + self._writeMark(suite.name + '.' + test.name + '-sync-end'); + + var syncTime = endTime - startTime; + + var startTime = now(); + setTimeout(function () { + // Some browsers don't immediately update the layout for paint. + // Force the layout here to ensure we're measuring the layout time. + var height = self._frame.contentDocument.body.getBoundingClientRect().height; + var endTime = now(); + self._frame.contentWindow._unusedHeightValue = height; // Prevent dead code elimination. + self._writeMark(suite.name + '.' + test.name + '-async-end'); + window.requestAnimationFrame(function () { + callback(syncTime, endTime - startTime, height); + }); + }, 0); +} + +function BenchmarkState(suites) { + this._suites = suites; + this._suiteIndex = -1; + this._testIndex = 0; + this.next(); +} + +BenchmarkState.prototype.currentSuite = function() { + return this._suites[this._suiteIndex]; +} + +BenchmarkState.prototype.currentTest = function () { + var suite = this.currentSuite(); + return suite ? suite.tests[this._testIndex] : null; +} + +BenchmarkState.prototype.next = function () { + this._testIndex++; + + var suite = this._suites[this._suiteIndex]; + if (suite && this._testIndex < suite.tests.length) + return this; + + this._testIndex = 0; + do { + this._suiteIndex++; + } while (this._suiteIndex < this._suites.length && this._suites[this._suiteIndex].disabled); + + return this; +} + +BenchmarkState.prototype.isFirstTest = function () { + return !this._testIndex; +} + +BenchmarkState.prototype.prepareCurrentSuite = function (runner, frame) { + var suite = this.currentSuite(); + var promise = new SimplePromise; + frame.onload = function () { + suite.prepare(runner, frame.contentWindow, frame.contentDocument).then(function (result) { promise.resolve(result); }); + } + frame.src = 'resources/' + suite.url; + return promise; +} + +BenchmarkRunner.prototype.step = function (state) { + if (!state) { + state = new BenchmarkState(this._suites); + this._measuredValues = {tests: {}, total: 0, mean: NaN, geomean: NaN, score: NaN}; + } + + var suite = state.currentSuite(); + if (!suite) { + this._finalize(); + var promise = new SimplePromise; + promise.resolve(); + return promise; + } + + if (state.isFirstTest()) { + this._removeFrame(); + var self = this; + return state.prepareCurrentSuite(this, this._appendFrame()).then(function (prepareReturnValue) { + self._prepareReturnValue = prepareReturnValue; + return self._runTestAndRecordResults(state); + }); + } + + return this._runTestAndRecordResults(state); +} + +BenchmarkRunner.prototype.runAllSteps = function (startingState) { + var nextCallee = this.runAllSteps.bind(this); + this.step(startingState).then(function (nextState) { + if (nextState) + nextCallee(nextState); + }); +} + +BenchmarkRunner.prototype.runMultipleIterations = function (iterationCount) { + var self = this; + var currentIteration = 0; + + this._runNextIteration = function () { + currentIteration++; + if (currentIteration < iterationCount) + self.runAllSteps(); + else if (this._client && this._client.didFinishLastIteration) + this._client.didFinishLastIteration(); + } + + if (this._client && this._client.willStartFirstIteration) + this._client.willStartFirstIteration(iterationCount); + + self.runAllSteps(); +} + +BenchmarkRunner.prototype._runTestAndRecordResults = function (state) { + var promise = new SimplePromise; + var suite = state.currentSuite(); + var test = state.currentTest(); + + if (this._client && this._client.willRunTest) + this._client.willRunTest(suite, test); + + var self = this; + setTimeout(function () { + self._runTest(suite, test, self._prepareReturnValue, function (syncTime, asyncTime) { + var suiteResults = self._measuredValues.tests[suite.name] || {tests:{}, total: 0}; + var total = syncTime + asyncTime; + self._measuredValues.tests[suite.name] = suiteResults; + suiteResults.tests[test.name] = {tests: {'Sync': syncTime, 'Async': asyncTime}, total: total}; + suiteResults.total += total; + + if (self._client && self._client.didRunTest) + self._client.didRunTest(suite, test); + + state.next(); + promise.resolve(state); + }); + }, 0); + return promise; +} + +BenchmarkRunner.prototype._finalize = function () { + this._removeFrame(); + + if (this._client && this._client.didRunSuites) { + var product = 1; + var values = []; + for (var suiteName in this._measuredValues.tests) { + var suiteTotal = this._measuredValues.tests[suiteName].total; + product *= suiteTotal; + values.push(suiteTotal); + } + + values.sort(function (a, b) { return a - b }); // Avoid the loss of significance for the sum. + var total = values.reduce(function (a, b) { return a + b }); + var geomean = Math.pow(product, 1 / values.length); + + var correctionFactor = 3; // This factor makes the test score look reasonably fit within 0 to 140. + this._measuredValues.total = total; + this._measuredValues.mean = total / values.length; + this._measuredValues.geomean = geomean; + this._measuredValues.score = 60 * 1000 / geomean / correctionFactor; + this._client.didRunSuites(this._measuredValues); + } + + if (this._runNextIteration) + this._runNextIteration(); +} diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/LICENSE.md b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/LICENSE.md new file mode 100644 index 0000000000..631a81ed8c --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/LICENSE.md @@ -0,0 +1,19 @@ +Copyright (c) Twitter Inc + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/README.md b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/README.md new file mode 100644 index 0000000000..901be3df39 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/README.md @@ -0,0 +1,5 @@ +# Flight example app + +[![Build Status](https://travis-ci.org/flightjs/example-app.png?branch=master)](http://travis-ci.org/flightjs/example-app) + +An example Flight application. diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/boot/page.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/boot/page.js new file mode 100644 index 0000000000..f561f8e2c6 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/boot/page.js @@ -0,0 +1,47 @@ +'use strict'; + +define( + + [ + 'app/component_data/mail_items', + 'app/component_data/compose_box', + 'app/component_data/move_to', + 'app/component_ui/mail_items', + 'app/component_ui/mail_controls', + 'app/component_ui/compose_box', + 'app/component_ui/folders', + 'app/component_ui/move_to_selector' + ], + + function( + MailItemsData, + ComposeBoxData, + MoveToData, + MailItemsUI, + MailControlsUI, + ComposeBoxUI, + FoldersUI, + MoveToSelectorUI) { + + function initialize() { + MailItemsData.attachTo(document); + ComposeBoxData.attachTo(document, { + selectedFolders: ['inbox'] + }); + MoveToData.attachTo(document); + MailItemsUI.attachTo('#mail_items', { + itemContainerSelector: '#mail_items_TB', + selectedFolders: ['inbox'] + }); + MailControlsUI.attachTo('#mail_controls'); + ComposeBoxUI.attachTo('#compose_box'); + FoldersUI.attachTo('#folders'); + MoveToSelectorUI.attachTo('#move_to_selector', { + moveActionSelector: '#move_mail', + selectedFolders: ['inbox'] + }); + } + + return initialize; + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/compose_box.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/compose_box.js new file mode 100644 index 0000000000..e728086f02 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/compose_box.js @@ -0,0 +1,93 @@ +'use strict'; + +define( + + [ + 'flight/lib/component', + 'components/mustache/mustache', + 'app/data', + 'app/templates' + ], + + function(defineComponent, Mustache, dataStore, templates) { + return defineComponent(composeBox); + + function composeBox() { + + this.defaultAttrs({ + dataStore: dataStore, + recipientHintId: 'recipient_hint', + subjectHint: 'Subject', + messageHint: 'Message', + toHint: 'To', + forwardPrefix: 'Fw', + replyPrefix: 'Re' + }); + + this.serveComposeBox = function(ev, data) { + this.trigger("dataComposeBoxServed", { + markup: this.renderComposeBox(data.type, data.relatedMailId), + type: data.type}); + }; + + this.getSubject = function(type, relatedMailId) { + var relatedMail = this.attr.dataStore.mail.filter(function(each) { + return each.id == relatedMailId; + })[0]; + + var subject = relatedMail && relatedMail.subject; + + var subjectLookup = { + newMail: this.attr.subjectHint, + forward: this.attr.forwardPrefix + ": " + subject, + reply: this.attr.replyPrefix + ": " + subject + } + + return subjectLookup[type]; + }; + + this.renderComposeBox = function(type, relatedMailId) { + var recipientId = this.getRecipientId(type, relatedMailId); + var contacts = this.attr.dataStore.contacts.map(function(contact) { + contact.recipient = (contact.id == recipientId); + return contact; + }); + + return Mustache.render(templates.composeBox, { + newMail: type == 'newMail', + reply: type == 'reply', + subject: this.getSubject(type, relatedMailId), + message: this.attr.messageHint, + contacts: contacts + }); + }; + + this.getRecipientId = function(type, relatedMailId) { + var relatedMail = (type == 'reply') && this.attr.dataStore.mail.filter(function(each) { + return each.id == relatedMailId; + })[0]; + + return relatedMail && relatedMail.contact_id || this.attr.recipientHintId; + }; + + + this.send = function(ev, data) { + this.attr.dataStore.mail.push({ + id: String(Date.now()), + contact_id: data.to_id, + folders: ["sent"], + time: Date.now(), + subject: data.subject, + message: data.message + }); + this.trigger('dataMailItemsRefreshRequested', {folder: data.currentFolder}); + }; + + this.after("initialize", function() { + this.on("uiComposeBoxRequested", this.serveComposeBox); + this.on("uiSendRequested", this.send); + }); + } + + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/mail_items.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/mail_items.js new file mode 100644 index 0000000000..380ff9a0e8 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/mail_items.js @@ -0,0 +1,68 @@ +'use strict'; + +define( + + [ + 'flight/lib/component', + 'components/mustache/mustache', + 'app/data', + 'app/templates' + ], + + function(defineComponent, Mustache, dataStore, templates) { + return defineComponent(mailItems); + + function mailItems() { + + this.defaultAttrs({ + folder: 'inbox', + dataStore: dataStore + }); + + this.serveMailItems = function(ev, data) { + var folder = (data && data.folder) || this.attr.folder; + this.trigger("dataMailItemsServed", {markup: this.renderItems(this.assembleItems(folder))}) + }; + + this.renderItems = function(items) { + return Mustache.render(templates.mailItem, {mailItems: items}); + }; + + this.assembleItems = function(folder) { + var items = []; + + this.attr.dataStore.mail.forEach(function(each) { + if (each.folders && each.folders.indexOf(folder) > -1) { + items.push(this.getItemForView(each)); + } + }, this); + + return items; + }; + + this.getItemForView = function(itemData) { + var thisItem, thisContact, msg + + thisItem = {id: itemData.id, important: itemData.important}; + + thisContact = this.attr.dataStore.contacts.filter(function(contact) { + return contact.id == itemData.contact_id + })[0]; + thisItem.name = [thisContact.firstName, thisContact.lastName].join(' '); + + var subj = itemData.subject; + thisItem.formattedSubject = subj.length > 70 ? subj.slice(0, 70) + "..." : subj; + + var msg = itemData.message; + thisItem.formattedMessage = msg.length > 70 ? msg.slice(0, 70) + "..." : msg; + + return thisItem; + }; + + this.after("initialize", function() { + this.on("uiMailItemsRequested", this.serveMailItems); + this.on("dataMailItemsRefreshRequested", this.serveMailItems); + }); + } + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/move_to.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/move_to.js new file mode 100644 index 0000000000..46f248540b --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_data/move_to.js @@ -0,0 +1,52 @@ +'use strict'; + +define( + + [ + 'flight/lib/component', + 'components/mustache/mustache', + 'app/data', + 'app/templates' + ], + + function(defineComponent, Mustache, dataStore, templates) { + return defineComponent(moveTo); + + function moveTo() { + + this.defaultAttrs({ + dataStore: dataStore + }); + + this.serveAvailableFolders = function(ev, data) { + this.trigger("dataMoveToItemsServed", { + markup: this.renderFolderSelector(this.getOtherFolders(data.folder)) + }) + }; + + this.renderFolderSelector = function(items) { + return Mustache.render(templates.moveToSelector, {moveToItems: items}); + }; + + this.moveItems = function(ev, data) { + var itemsToMoveIds = data.itemIds + this.attr.dataStore.mail.forEach(function(item) { + if (itemsToMoveIds.indexOf(item.id) > -1) { + item.folders = [data.toFolder]; + } + }); + this.trigger('dataMailItemsRefreshRequested', {folder: data.fromFolder}); + }; + + this.getOtherFolders = function(folder) { + return this.attr.dataStore.folders.filter(function(e) {return e != folder}); + }; + + this.after("initialize", function() { + this.on("uiAvailableFoldersRequested", this.serveAvailableFolders); + this.on("uiMoveItemsRequested", this.moveItems); + }); + } + + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/compose_box.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/compose_box.js new file mode 100644 index 0000000000..feb14040be --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/compose_box.js @@ -0,0 +1,113 @@ +'use strict'; + +define( + + [ + 'flight/lib/component' + ], + + function(defineComponent) { + + return defineComponent(composeBox); + + function composeBox() { + + this.defaultAttrs({ + newMailType: 'newMail', + forwardMailType: 'forward', + replyMailType: 'reply', + hintClass: 'hint', + selectedFolders: [], + selectedMailItems: [], + + //selectors + composeControl: '.compose', + newControlSelector: '#new_mail', + cancelSelector: '#cancel_composed', + sendSelector: '#send_composed', + toSelector: '#compose_to', + subjectSelector: '#compose_subject', + messageSelector: '#compose_message', + recipientSelector: '#recipient_select', + recipientHintSelector: '#recipient_hint', + selectedRecipientSelector: '#recipient_select :selected', + hintSelector: 'div.hint' + }); + + this.newMail = function() { + this.requestComposeBox(this.attr.newMailType); + }; + + this.forward = function() { + this.requestComposeBox(this.attr.forwardMailType, this.attr.selectedMailItems); + }; + + this.reply = function() { + this.requestComposeBox(this.attr.replyMailType, this.attr.selectedMailItems); + }; + + this.requestComposeBox = function(type, relatedMailId) { + this.trigger('uiComposeBoxRequested', {type: type, relatedMailId: relatedMailId}); + }; + + this.launchComposeBox = function(ev, data) { + var focusSelector = (data.type == this.attr.replyMailType) ? 'messageSelector' : 'toSelector'; + this.$node.html(data.markup).show(); + this.select(focusSelector).focus(); + }; + + this.cancel = function() { + this.$node.html('').hide(); + }; + + this.requestSend = function() { + var data = { + to_id: this.select('selectedRecipientSelector').attr('id'), + subject: this.select('subjectSelector').text(), + message: this.select('messageSelector').text(), + currentFolder: this.attr.selectedFolders[0] + }; + this.trigger('uiSendRequested', data); + this.$node.hide(); + }; + + this.enableSend = function() { + this.select('recipientHintSelector').attr('disabled', 'disabled'); + this.select('sendSelector').removeAttr('disabled'); + }; + + this.removeHint = function(ev, data) { + $(ev.target).html('').removeClass(this.attr.hintClass); + }; + + this.updateMailItemSelections = function(ev, data) { + this.attr.selectedMailItems = data.selectedIds; + } + + this.updateFolderSelections = function(ev, data) { + this.attr.selectedFolders = data.selectedIds; + } + + this.after('initialize', function() { + this.on(document, 'dataComposeBoxServed', this.launchComposeBox); + this.on(document, 'uiForwardMail', this.forward); + this.on(document, 'uiReplyToMail', this.reply); + this.on(document, 'uiMailItemSelectionChanged', this.updateMailItemSelections); + this.on(document, 'uiFolderSelectionChanged', this.updateFolderSelections); + + //the following bindings use delegation so that the event target is read at event time + this.on(document, "click", { + 'cancelSelector': this.cancel, + 'sendSelector': this.requestSend, + 'newControlSelector': this.newMail + }); + this.on('change', { + 'recipientSelector': this.enableSend + }); + this.on('keydown', { + 'hintSelector': this.removeHint + }); + }); + } + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/folders.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/folders.js new file mode 100644 index 0000000000..f8504939eb --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/folders.js @@ -0,0 +1,34 @@ +'use strict'; + +define( + + [ + 'flight/lib/component', + './with_select' + ], + + function(defineComponent, withSelect) { + + return defineComponent(folders, withSelect); + + function folders() { + + this.defaultAttrs({ + selectedClass: 'selected', + selectionChangedEvent: 'uiFolderSelectionChanged', + + //selectors + itemSelector: 'li.folder-item', + selectedItemSelector: 'li.folder-item.selected' + }); + + this.fetchMailItems = function(ev, data) { + this.trigger('uiMailItemsRequested', {folder: data.selectedIds[0]}); + } + + this.after('initialize', function() { + this.on('uiFolderSelectionChanged', this.fetchMailItems); + }); + } + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/mail_controls.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/mail_controls.js new file mode 100644 index 0000000000..959f554502 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/mail_controls.js @@ -0,0 +1,67 @@ +'use strict'; + +define( + [ + 'flight/lib/component' + ], + + function(defineComponent) { + + return defineComponent(mailControls); + + function mailControls() { + this.defaultAttrs({ + //selectors + actionControlsSelector: 'button.mail-action', + deleteControlSelector: '#delete_mail', + moveControlSelector: '#move_mail', + forwardControlSelector: '#forward', + replyControlSelector: '#reply', + singleItemActionSelector: 'button.single-item' + }); + + this.disableAll = function() { + this.select('actionControlsSelector').attr('disabled', 'disabled'); + }; + + this.restyleOnSelectionChange = function(ev, data) { + if (data.selectedIds.length > 1) { + this.select('actionControlsSelector').not('button.single-item').removeAttr('disabled'); + this.select('singleItemActionSelector').attr('disabled', 'disabled'); + } else if (data.selectedIds.length == 1) { + this.select('actionControlsSelector').removeAttr('disabled'); + } else { + this.disableAll(); + } + }; + + this.deleteMail = function(ev, data) { + this.trigger('uiDeleteMail'); + }; + + this.moveMail = function(ev, data) { + this.trigger('uiMoveMail'); + }; + + this.forwardMail = function(ev, data) { + this.trigger('uiForwardMail'); + }; + + this.replyToMail = function(ev, data) { + this.trigger('uiReplyToMail'); + }; + + this.after('initialize', function() { + this.on('.mail-action', 'click', { + 'deleteControlSelector': this.deleteMail, + 'moveControlSelector': this.moveMail, + 'forwardControlSelector': this.forwardMail, + 'replyControlSelector': this.replyToMail + }); + this.on(document, 'uiMailItemSelectionChanged', this.restyleOnSelectionChange); + this.on(document, 'uiFolderSelectionChanged', this.disableAll); + }); + } + } +); + diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/mail_items.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/mail_items.js new file mode 100644 index 0000000000..29b5cfd665 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/mail_items.js @@ -0,0 +1,61 @@ +'use strict'; + +define( + + [ + 'flight/lib/component', + './with_select' + ], + + function(defineComponent, withSelect) { + + return defineComponent(mailItems, withSelect); + + function mailItems() { + + this.defaultAttrs({ + deleteFolder: 'trash', + selectedClass: 'selected', + allowMultiSelect: true, + selectionChangedEvent: 'uiMailItemSelectionChanged', + selectedMailItems: [], + selectedFolders: [], + //selectors + itemSelector: 'tr.mail-item', + selectedItemSelector: 'tr.mail-item.selected' + }); + + this.renderItems = function(ev, data) { + this.select('itemContainerSelector').html(data.markup); + //new items, so no selections + this.trigger('uiMailItemSelectionChanged', {selectedIds: []}); + } + + this.updateMailItemSelections = function(ev, data) { + this.attr.selectedMailItems = data.selectedIds; + } + + this.updateFolderSelections = function(ev, data) { + this.attr.selectedFolders = data.selectedIds; + } + + this.requestDeletion = function() { + this.trigger('uiMoveItemsRequested', { + itemIds: this.attr.selectedMailItems, + fromFolder: this.attr.selectedFolders[0], + toFolder: this.attr.deleteFolder + }); + }; + + this.after('initialize', function() { + this.on(document, 'dataMailItemsServed', this.renderItems); + this.on(document, 'uiDeleteMail', this.requestDeletion); + + this.on('uiMailItemSelectionChanged', this.updateMailItemSelections); + this.on(document, 'uiFolderSelectionChanged', this.updateFolderSelections); + + this.trigger('uiMailItemsRequested'); + }); + } + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/move_to_selector.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/move_to_selector.js new file mode 100644 index 0000000000..e077e6aff3 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/move_to_selector.js @@ -0,0 +1,79 @@ +'use strict'; + +define( + + [ + 'flight/lib/component', + './with_select' + ], + + function(defineComponent, withSelect) { + + return defineComponent(moveToSelector, withSelect); + + function moveToSelector() { + + this.defaultAttrs({ + selectionChangedEvent: 'uiMoveToSelectionChanged', + selectedMailItems: [], + selectedFolders: [], + //selectors + itemSelector: 'li.move-to-item', + selectedItemSelector: 'li.move-to-item.selected' + }); + + this.requestSelectorWidget = function(ev, data) { + this.trigger('uiAvailableFoldersRequested', { + folder: this.attr.selectedFolders[0] + }) + }; + + this.launchSelector = function(ev, data) { + var controlPosition = $(this.attr.moveActionSelector).offset(); + this.$node.html(data.markup).show().css({ + left: controlPosition.left, + top: controlPosition.top + $(this.attr.moveActionSelector).outerHeight(), + width: $(this.attr.moveActionSelector).outerWidth() + }); + window.setTimeout( + (function() { + this.on(document, 'click', this.hideSelector) + }).bind(this), 0); + }; + + this.hideSelector = function() { + this.off(document, 'click', this.hideSelector); + this.$node.hide(); + } + + this.updateMailItemSelections = function(ev, data) { + this.attr.selectedMailItems = data.selectedIds; + } + + this.updateFolderSelections = function(ev, data) { + this.attr.selectedFolders = data.selectedIds; + } + + this.requestMoveTo = function(ev, data) { + this.trigger('uiMoveItemsRequested', { + itemIds: this.attr.selectedMailItems, + fromFolder: this.attr.selectedFolders[0], + toFolder: data.selectedIds[0] + }); + this.$node.hide(); + }; + + this.after('initialize', function() { + //show selector widget + this.on(document, 'uiMoveMail', this.requestSelectorWidget); + this.on(document, 'dataMoveToItemsServed', this.launchSelector); + //listen for other selections + this.on(document, 'uiMailItemSelectionChanged', this.updateMailItemSelections); + this.on(document, 'uiFolderSelectionChanged', this.updateFolderSelections); + //move items + this.on('uiMoveToSelectionChanged', this.requestMoveTo); + + }); + } + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/with_select.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/with_select.js new file mode 100644 index 0000000000..2a99feaadf --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/component_ui/with_select.js @@ -0,0 +1,64 @@ +'use strict'; + +define( + + function() { + + return withSelect; + + function withSelect() { + + this.defaultAttrs({ + selectedIds: [] + }); + + this.initializeSelections = function() { + this.select('selectedItemSelector').toArray().forEach(function(el) { + this.attr.selectedIds.push(el.getAttribute('id')); + }, this); + }; + + this.getSelectedIds = function() { + return this.attr.selectedIds; + }; + + this.toggleItemSelect = function(ev, data) { + var $item = $(data.el), append; + + if ($item.hasClass(this.attr.selectedClass)) { + this.unselectItem($item); + } else { + append = this.attr.allowMultiSelect && (ev.metaKey || ev.ctrlKey || ev.shiftKey); + this.selectItem($item, append); + } + }; + + this.selectItem = function($item, append) { + if (!append) { + this.select('selectedItemSelector').removeClass(this.attr.selectedClass); + this.attr.selectedIds = []; + } + $item.addClass(this.attr.selectedClass); + + this.attr.selectedIds.push($item.attr('id')); + this.trigger(this.attr.selectionChangedEvent, {selectedIds: this.attr.selectedIds}); + }; + + this.unselectItem = function($item) { + $item.removeClass(this.attr.selectedClass); + + var thisIdIndex = this.attr.selectedIds.indexOf($item.attr('id')); + this.attr.selectedIds.splice(thisIdIndex, 1); + this.trigger(this.attr.selectionChangedEvent, {selectedIds: this.attr.selectedIds}); + }; + + this.after("initialize", function() { + this.on('click', { + 'itemSelector': this.toggleItemSelect + }); + + this.initializeSelections(); + }); + } + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/css/custom.css b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/css/custom.css new file mode 100644 index 0000000000..697197a075 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/css/custom.css @@ -0,0 +1,102 @@ +.modal.fade.in { + left: 5%; + top: 10%; + margin: auto auto auto auto; +} + +table { + -webkit-touch-callout: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +td.mailContact, +span.mailSubject, +span.mailMessage { + font-size: 15px; +} + +td.mailContact, +span.mailSubject { + font-weight: bold; +} + +tr.mail-item.selected td, +li.folder-item.selected, +li.move-to-item.selected { + background-color: #D9EDF7; +} + +tr.mail-item.selected:hover td, +li.folder-item.selected:hover, +li.move-to-item.selected:hover { + background-color: #C1E1FF; +} + +li.folder-item:hover, +li.move-to-item:hover { + background-color: #EDEDED; +} + +li.folder-item, +li.move-to-item { + padding: 3px 0; + margin-left: -15px; + font-size: 15px; + cursor:pointer; +} + +li.move-to-item { + text-align: center; + margin-right: -15px; +} + +#new_mail { + width: 100px; +} + +div.compose-box { + position: absolute; + z-index: 10; + background-color: #FFFFFF; + width: 350px; + border: 1px solid; +} + +div.compose-body { + padding: 0; +} + +div.compose-header { + font-size: 15px; +} + +#recipient_select { + width: 90%; + margin-bottom: 0; + font-weight: bold; +} + +div.hint { + border: 1px solid #EAEAEA; + color:#CACACA; +} + +#compose_message { + height: 180px; +} + +#compose_subject, +#compose_message { + font-size: 15px; + padding: 15px; +} + +#move_to_selector { + position: absolute; + z-index: 10; + background-color: #FFFFFF; + border: 1px solid; +} \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/data.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/data.js new file mode 100644 index 0000000000..3a567c2264 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/data.js @@ -0,0 +1,110 @@ +'use strict'; + +define( + function() { + return { + folders: ["inbox", "later", "sent", "trash"], + contacts: [ + { + "id": "contact_342", + "firstName": "Michael", + "lastName": "Smith", + "email": "ms@proxyweb.com" + }, + { + "id": "contact_377", + "firstName": "Mary", + "lastName": "Jones", + "email": "mary@jones.net" + }, + { + "id": "contact_398", + "firstName": "Billy", + "lastName": "Idiot", + "email": "william_idiot@gmail.com" + } + ], + mail: [ + { + "id": "mail_2139", + "contact_id": "contact_342", + "folders": ["inbox"], + "time": 1334891976104, + "subject": "Consectetur adipiscing elit", + "message": "Vestibulum vestibulum varius diam in iaculis. Praesent ultrices dui vitae nibh malesuada non iaculis ante vulputate. Suspendisse feugiat ultricies egestas. Aenean a odio libero. Quisque mollis leo et est euismod sit amet dignissim sapien venenatis. Morbi interdum adipiscing massa" + }, + { + "id": "mail_2143", + "contact_id": "contact_377", + "folders": ["inbox", "later"], + "important": "true", + "time": 1334884976104, + "subject": "Neque porro quisquam velit!!", + "message": "Curabitur sollicitudin mi eget sapien posuere semper. Fusce at neque et lacus luctus vulputate vehicula ac enim" + }, + { + "id": "mail_2154", + "contact_id": "contact_398", + "folders": ["inbox"], + "important": "true", + "unread": "true", + "time": 1334874976199, + "subject": "Proin egestas aliquam :)", + "message": "Aenean nec erat id ipsum faucibus tristique. Nam blandit est lacinia turpis consectetur elementum. Nulla in risus ut sapien dignissim feugiat. Proin ultrices sodales imperdiet. Vestibulum vehicula blandit tincidunt. Vivamus posuere rhoncus orci, porta commodo mauris aliquam nec" + }, + { + "id": "mail_2176", + "contact_id": "contact_377", + "folders": ["inbox"], + "time": 1334884976104, + "subject": "Sed ut perspiciatis unde omnis?", + "message": "laudantium, totam rem aperiam, eaque ipsa quae ab illo inventore veritatis et quasi architecto beatae vitae dicta sunt explicabo. Nemo enim ipsam voluptatem quia voluptas sit aspernatur aut odit aut fugit, sed quia consequuntur magni dolores eos qui ratione voluptatem sequi nesciunt. Neque porro quisquam est, qui dolorem ipsum quia dolor sit amet, consectetur, adipisci velit, sed quia non numquam eius modi tempora incidunt ut labore et dolore magnam aliquam quaerat voluptatem." + }, + { + "id": "mail_2191", + "contact_id": "contact_398", + "folders": ["inbox"], + "unread": "true", + "time": 1334874976199, + "subject": "At vero eos et accusamus!", + "message": "Nam libero tempore, cum soluta nobis est eligendi optio cumque nihil impedit quo minus id quod maxime placeat facere possimus, omnis voluptas assumenda est, omnis dolor repellendus. Temporibus autem quibusdam et aut officiis debitis aut rerum necessitatibus saepe eveniet ut et voluptates repudiandae sint et molestiae non recusandae. Itaque earum rerum hic tenetur a sapiente delectus, ut aut reiciendis voluptatibus maiores alias consequatur aut perferendis doloribus asperiores repellat" + }, + { + "id": "mail_2203", + "contact_id": "contact_377", + "folders": ["later"], + "important": "true", + "time": 1334874576199, + "subject": "Mi netus convallis", + "message": "Egestas morbi at. Curabitur aliquet et commodo nonummy, aliquam quis arcu, sed pellentesque vitae molestie mattis magna, in eget, risus nulla vivamus vulputate" + }, + { + "id": "mail_2212", + "contact_id": "contact_398", + "folders": ["sent"], + "time": 1334874579867, + "subject": "Fusce tristique pretium eros a gravida", + "message": "Proin malesuada" + }, + { + "id": "mail_2021", + "contact_id": "contact_342", + "folders": ["trash"], + "time": 1134874579824, + "subject": "Phasellus vitae interdum nulla.", + "message": "Pellentesque quam eros, mollis quis vulputate eget, pellentesque nec ipsum. Cras dignissim fringilla ligula, ac ullamcorper dui convallis blandit. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Etiam id nunc ac orci hendrerit faucibus vel in ante. Mauris nec est turpis, ut fringilla mi. Suspendisse vel tortor at nulla facilisis venenatis in sit amet ligula." + }, + { + "id": "mail_1976", + "contact_id": "contact_377", + "folders": ["trash"], + "time": 1034874579813, + "subject": "Fusce tristique pretium :(", + "message": "aliquam quis arcu." + } + ] + }; + return data; + } +); + diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/templates.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/templates.js new file mode 100644 index 0000000000..99625bd830 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/app/templates.js @@ -0,0 +1,62 @@ +'use strict'; + +define( + function() { + var mailItem = + '{{#mailItems}}\ + \ + {{#important}}\ + Important\ + {{/important}}\ + {{^important}}\ +  \ + {{/important}}\ + {{name}}\ + \ + \ + {{formattedSubject}}\ + \ + \ + - {{formattedMessage}}\ + \ + \ + \ + {{/mailItems}}'; + + var composeBox = + '\ +
    \ +
    \ + {{subject}}\ +
    \ +
    \ + {{message}}\ +
    \ +
    \ +
    \ + \ + \ +
    '; + + var moveToSelector = + ''; + + return { + mailItem: mailItem, + composeBox: composeBox, + moveToSelector: moveToSelector + } + } + +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap-responsive.css b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap-responsive.css new file mode 100644 index 0000000000..a3352d774c --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap-responsive.css @@ -0,0 +1,1092 @@ +/*! + * Bootstrap Responsive v2.2.2 + * + * Copyright 2012 Twitter, Inc + * Licensed under the Apache License v2.0 + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Designed and built with all the love in the world @twitter by @mdo and @fat. + */ + +@-ms-viewport { + width: device-width; +} + +.clearfix { + *zoom: 1; +} + +.clearfix:before, +.clearfix:after { + display: table; + line-height: 0; + content: ""; +} + +.clearfix:after { + clear: both; +} + +.hide-text { + font: 0/0 a; + color: transparent; + text-shadow: none; + background-color: transparent; + border: 0; +} + +.input-block-level { + display: block; + width: 100%; + min-height: 30px; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +.hidden { + display: none; + visibility: hidden; +} + +.visible-phone { + display: none !important; +} + +.visible-tablet { + display: none !important; +} + +.hidden-desktop { + display: none !important; +} + +.visible-desktop { + display: inherit !important; +} + +@media (min-width: 768px) and (max-width: 979px) { + .hidden-desktop { + display: inherit !important; + } + .visible-desktop { + display: none !important ; + } + .visible-tablet { + display: inherit !important; + } + .hidden-tablet { + display: none !important; + } +} + +@media (max-width: 767px) { + .hidden-desktop { + display: inherit !important; + } + .visible-desktop { + display: none !important; + } + .visible-phone { + display: inherit !important; + } + .hidden-phone { + display: none !important; + } +} + +@media (min-width: 1200px) { + .row { + margin-left: -30px; + *zoom: 1; + } + .row:before, + .row:after { + display: table; + line-height: 0; + content: ""; + } + .row:after { + clear: both; + } + [class*="span"] { + float: left; + min-height: 1px; + margin-left: 30px; + } + .container, + .navbar-static-top .container, + .navbar-fixed-top .container, + .navbar-fixed-bottom .container { + width: 1170px; + } + .span12 { + width: 1170px; + } + .span11 { + width: 1070px; + } + .span10 { + width: 970px; + } + .span9 { + width: 870px; + } + .span8 { + width: 770px; + } + .span7 { + width: 670px; + } + .span6 { + width: 570px; + } + .span5 { + width: 470px; + } + .span4 { + width: 370px; + } + .span3 { + width: 270px; + } + .span2 { + width: 170px; + } + .span1 { + width: 70px; + } + .offset12 { + margin-left: 1230px; + } + .offset11 { + margin-left: 1130px; + } + .offset10 { + margin-left: 1030px; + } + .offset9 { + margin-left: 930px; + } + .offset8 { + margin-left: 830px; + } + .offset7 { + margin-left: 730px; + } + .offset6 { + margin-left: 630px; + } + .offset5 { + margin-left: 530px; + } + .offset4 { + margin-left: 430px; + } + .offset3 { + margin-left: 330px; + } + .offset2 { + margin-left: 230px; + } + .offset1 { + margin-left: 130px; + } + .row-fluid { + width: 100%; + *zoom: 1; + } + .row-fluid:before, + .row-fluid:after { + display: table; + line-height: 0; + content: ""; + } + .row-fluid:after { + clear: both; + } + .row-fluid [class*="span"] { + display: block; + float: left; + width: 100%; + min-height: 30px; + margin-left: 2.564102564102564%; + *margin-left: 2.5109110747408616%; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; + } + .row-fluid [class*="span"]:first-child { + margin-left: 0; + } + .row-fluid .controls-row [class*="span"] + [class*="span"] { + margin-left: 2.564102564102564%; + } + .row-fluid .span12 { + width: 100%; + *width: 99.94680851063829%; + } + .row-fluid .span11 { + width: 91.45299145299145%; + *width: 91.39979996362975%; + } + .row-fluid .span10 { + width: 82.90598290598291%; + *width: 82.8527914166212%; + } + .row-fluid .span9 { + width: 74.35897435897436%; + *width: 74.30578286961266%; + } + .row-fluid .span8 { + width: 65.81196581196582%; + *width: 65.75877432260411%; + } + .row-fluid .span7 { + width: 57.26495726495726%; + *width: 57.21176577559556%; + } + .row-fluid .span6 { + width: 48.717948717948715%; + *width: 48.664757228587014%; + } + .row-fluid .span5 { + width: 40.17094017094017%; + *width: 40.11774868157847%; + } + .row-fluid .span4 { + width: 31.623931623931625%; + *width: 31.570740134569924%; + } + .row-fluid .span3 { + width: 23.076923076923077%; + *width: 23.023731587561375%; + } + .row-fluid .span2 { + width: 14.52991452991453%; + *width: 14.476723040552828%; + } + .row-fluid .span1 { + width: 5.982905982905983%; + *width: 5.929714493544281%; + } + .row-fluid .offset12 { + margin-left: 105.12820512820512%; + *margin-left: 105.02182214948171%; + } + .row-fluid .offset12:first-child { + margin-left: 102.56410256410257%; + *margin-left: 102.45771958537915%; + } + .row-fluid .offset11 { + margin-left: 96.58119658119658%; + *margin-left: 96.47481360247316%; + } + .row-fluid .offset11:first-child { + margin-left: 94.01709401709402%; + *margin-left: 93.91071103837061%; + } + .row-fluid .offset10 { + margin-left: 88.03418803418803%; + *margin-left: 87.92780505546462%; + } + .row-fluid .offset10:first-child { + margin-left: 85.47008547008548%; + *margin-left: 85.36370249136206%; + } + .row-fluid .offset9 { + margin-left: 79.48717948717949%; + *margin-left: 79.38079650845607%; + } + .row-fluid .offset9:first-child { + margin-left: 76.92307692307693%; + *margin-left: 76.81669394435352%; + } + .row-fluid .offset8 { + margin-left: 70.94017094017094%; + *margin-left: 70.83378796144753%; + } + .row-fluid .offset8:first-child { + margin-left: 68.37606837606839%; + *margin-left: 68.26968539734497%; + } + .row-fluid .offset7 { + margin-left: 62.393162393162385%; + *margin-left: 62.28677941443899%; + } + .row-fluid .offset7:first-child { + margin-left: 59.82905982905982%; + *margin-left: 59.72267685033642%; + } + .row-fluid .offset6 { + margin-left: 53.84615384615384%; + *margin-left: 53.739770867430444%; + } + .row-fluid .offset6:first-child { + margin-left: 51.28205128205128%; + *margin-left: 51.175668303327875%; + } + .row-fluid .offset5 { + margin-left: 45.299145299145295%; + *margin-left: 45.1927623204219%; + } + .row-fluid .offset5:first-child { + margin-left: 42.73504273504273%; + *margin-left: 42.62865975631933%; + } + .row-fluid .offset4 { + margin-left: 36.75213675213675%; + *margin-left: 36.645753773413354%; + } + .row-fluid .offset4:first-child { + margin-left: 34.18803418803419%; + *margin-left: 34.081651209310785%; + } + .row-fluid .offset3 { + margin-left: 28.205128205128204%; + *margin-left: 28.0987452264048%; + } + .row-fluid .offset3:first-child { + margin-left: 25.641025641025642%; + *margin-left: 25.53464266230224%; + } + .row-fluid .offset2 { + margin-left: 19.65811965811966%; + *margin-left: 19.551736679396257%; + } + .row-fluid .offset2:first-child { + margin-left: 17.094017094017094%; + *margin-left: 16.98763411529369%; + } + .row-fluid .offset1 { + margin-left: 11.11111111111111%; + *margin-left: 11.004728132387708%; + } + .row-fluid .offset1:first-child { + margin-left: 8.547008547008547%; + *margin-left: 8.440625568285142%; + } + input, + textarea, + .uneditable-input { + margin-left: 0; + } + .controls-row [class*="span"] + [class*="span"] { + margin-left: 30px; + } + input.span12, + textarea.span12, + .uneditable-input.span12 { + width: 1156px; + } + input.span11, + textarea.span11, + .uneditable-input.span11 { + width: 1056px; + } + input.span10, + textarea.span10, + .uneditable-input.span10 { + width: 956px; + } + input.span9, + textarea.span9, + .uneditable-input.span9 { + width: 856px; + } + input.span8, + textarea.span8, + .uneditable-input.span8 { + width: 756px; + } + input.span7, + textarea.span7, + .uneditable-input.span7 { + width: 656px; + } + input.span6, + textarea.span6, + .uneditable-input.span6 { + width: 556px; + } + input.span5, + textarea.span5, + .uneditable-input.span5 { + width: 456px; + } + input.span4, + textarea.span4, + .uneditable-input.span4 { + width: 356px; + } + input.span3, + textarea.span3, + .uneditable-input.span3 { + width: 256px; + } + input.span2, + textarea.span2, + .uneditable-input.span2 { + width: 156px; + } + input.span1, + textarea.span1, + .uneditable-input.span1 { + width: 56px; + } + .thumbnails { + margin-left: -30px; + } + .thumbnails > li { + margin-left: 30px; + } + .row-fluid .thumbnails { + margin-left: 0; + } +} + +@media (min-width: 768px) and (max-width: 979px) { + .row { + margin-left: -20px; + *zoom: 1; + } + .row:before, + .row:after { + display: table; + line-height: 0; + content: ""; + } + .row:after { + clear: both; + } + [class*="span"] { + float: left; + min-height: 1px; + margin-left: 20px; + } + .container, + .navbar-static-top .container, + .navbar-fixed-top .container, + .navbar-fixed-bottom .container { + width: 724px; + } + .span12 { + width: 724px; + } + .span11 { + width: 662px; + } + .span10 { + width: 600px; + } + .span9 { + width: 538px; + } + .span8 { + width: 476px; + } + .span7 { + width: 414px; + } + .span6 { + width: 352px; + } + .span5 { + width: 290px; + } + .span4 { + width: 228px; + } + .span3 { + width: 166px; + } + .span2 { + width: 104px; + } + .span1 { + width: 42px; + } + .offset12 { + margin-left: 764px; + } + .offset11 { + margin-left: 702px; + } + .offset10 { + margin-left: 640px; + } + .offset9 { + margin-left: 578px; + } + .offset8 { + margin-left: 516px; + } + .offset7 { + margin-left: 454px; + } + .offset6 { + margin-left: 392px; + } + .offset5 { + margin-left: 330px; + } + .offset4 { + margin-left: 268px; + } + .offset3 { + margin-left: 206px; + } + .offset2 { + margin-left: 144px; + } + .offset1 { + margin-left: 82px; + } + .row-fluid { + width: 100%; + *zoom: 1; + } + .row-fluid:before, + .row-fluid:after { + display: table; + line-height: 0; + content: ""; + } + .row-fluid:after { + clear: both; + } + .row-fluid [class*="span"] { + display: block; + float: left; + width: 100%; + min-height: 30px; + margin-left: 2.7624309392265194%; + *margin-left: 2.709239449864817%; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; + } + .row-fluid [class*="span"]:first-child { + margin-left: 0; + } + .row-fluid .controls-row [class*="span"] + [class*="span"] { + margin-left: 2.7624309392265194%; + } + .row-fluid .span12 { + width: 100%; + *width: 99.94680851063829%; + } + .row-fluid .span11 { + width: 91.43646408839778%; + *width: 91.38327259903608%; + } + .row-fluid .span10 { + width: 82.87292817679558%; + *width: 82.81973668743387%; + } + .row-fluid .span9 { + width: 74.30939226519337%; + *width: 74.25620077583166%; + } + .row-fluid .span8 { + width: 65.74585635359117%; + *width: 65.69266486422946%; + } + .row-fluid .span7 { + width: 57.18232044198895%; + *width: 57.12912895262725%; + } + .row-fluid .span6 { + width: 48.61878453038674%; + *width: 48.56559304102504%; + } + .row-fluid .span5 { + width: 40.05524861878453%; + *width: 40.00205712942283%; + } + .row-fluid .span4 { + width: 31.491712707182323%; + *width: 31.43852121782062%; + } + .row-fluid .span3 { + width: 22.92817679558011%; + *width: 22.87498530621841%; + } + .row-fluid .span2 { + width: 14.3646408839779%; + *width: 14.311449394616199%; + } + .row-fluid .span1 { + width: 5.801104972375691%; + *width: 5.747913483013988%; + } + .row-fluid .offset12 { + margin-left: 105.52486187845304%; + *margin-left: 105.41847889972962%; + } + .row-fluid .offset12:first-child { + margin-left: 102.76243093922652%; + *margin-left: 102.6560479605031%; + } + .row-fluid .offset11 { + margin-left: 96.96132596685082%; + *margin-left: 96.8549429881274%; + } + .row-fluid .offset11:first-child { + margin-left: 94.1988950276243%; + *margin-left: 94.09251204890089%; + } + .row-fluid .offset10 { + margin-left: 88.39779005524862%; + *margin-left: 88.2914070765252%; + } + .row-fluid .offset10:first-child { + margin-left: 85.6353591160221%; + *margin-left: 85.52897613729868%; + } + .row-fluid .offset9 { + margin-left: 79.8342541436464%; + *margin-left: 79.72787116492299%; + } + .row-fluid .offset9:first-child { + margin-left: 77.07182320441989%; + *margin-left: 76.96544022569647%; + } + .row-fluid .offset8 { + margin-left: 71.2707182320442%; + *margin-left: 71.16433525332079%; + } + .row-fluid .offset8:first-child { + margin-left: 68.50828729281768%; + *margin-left: 68.40190431409427%; + } + .row-fluid .offset7 { + margin-left: 62.70718232044199%; + *margin-left: 62.600799341718584%; + } + .row-fluid .offset7:first-child { + margin-left: 59.94475138121547%; + *margin-left: 59.838368402492065%; + } + .row-fluid .offset6 { + margin-left: 54.14364640883978%; + *margin-left: 54.037263430116376%; + } + .row-fluid .offset6:first-child { + margin-left: 51.38121546961326%; + *margin-left: 51.27483249088986%; + } + .row-fluid .offset5 { + margin-left: 45.58011049723757%; + *margin-left: 45.47372751851417%; + } + .row-fluid .offset5:first-child { + margin-left: 42.81767955801105%; + *margin-left: 42.71129657928765%; + } + .row-fluid .offset4 { + margin-left: 37.01657458563536%; + *margin-left: 36.91019160691196%; + } + .row-fluid .offset4:first-child { + margin-left: 34.25414364640884%; + *margin-left: 34.14776066768544%; + } + .row-fluid .offset3 { + margin-left: 28.45303867403315%; + *margin-left: 28.346655695309746%; + } + .row-fluid .offset3:first-child { + margin-left: 25.69060773480663%; + *margin-left: 25.584224756083227%; + } + .row-fluid .offset2 { + margin-left: 19.88950276243094%; + *margin-left: 19.783119783707537%; + } + .row-fluid .offset2:first-child { + margin-left: 17.12707182320442%; + *margin-left: 17.02068884448102%; + } + .row-fluid .offset1 { + margin-left: 11.32596685082873%; + *margin-left: 11.219583872105325%; + } + .row-fluid .offset1:first-child { + margin-left: 8.56353591160221%; + *margin-left: 8.457152932878806%; + } + input, + textarea, + .uneditable-input { + margin-left: 0; + } + .controls-row [class*="span"] + [class*="span"] { + margin-left: 20px; + } + input.span12, + textarea.span12, + .uneditable-input.span12 { + width: 710px; + } + input.span11, + textarea.span11, + .uneditable-input.span11 { + width: 648px; + } + input.span10, + textarea.span10, + .uneditable-input.span10 { + width: 586px; + } + input.span9, + textarea.span9, + .uneditable-input.span9 { + width: 524px; + } + input.span8, + textarea.span8, + .uneditable-input.span8 { + width: 462px; + } + input.span7, + textarea.span7, + .uneditable-input.span7 { + width: 400px; + } + input.span6, + textarea.span6, + .uneditable-input.span6 { + width: 338px; + } + input.span5, + textarea.span5, + .uneditable-input.span5 { + width: 276px; + } + input.span4, + textarea.span4, + .uneditable-input.span4 { + width: 214px; + } + input.span3, + textarea.span3, + .uneditable-input.span3 { + width: 152px; + } + input.span2, + textarea.span2, + .uneditable-input.span2 { + width: 90px; + } + input.span1, + textarea.span1, + .uneditable-input.span1 { + width: 28px; + } +} + +@media (max-width: 767px) { + body { + padding-right: 20px; + padding-left: 20px; + } + .navbar-fixed-top, + .navbar-fixed-bottom, + .navbar-static-top { + margin-right: -20px; + margin-left: -20px; + } + .container-fluid { + padding: 0; + } + .dl-horizontal dt { + float: none; + width: auto; + clear: none; + text-align: left; + } + .dl-horizontal dd { + margin-left: 0; + } + .container { + width: auto; + } + .row-fluid { + width: 100%; + } + .row, + .thumbnails { + margin-left: 0; + } + .thumbnails > li { + float: none; + margin-left: 0; + } + [class*="span"], + .uneditable-input[class*="span"], + .row-fluid [class*="span"] { + display: block; + float: none; + width: 100%; + margin-left: 0; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; + } + .span12, + .row-fluid .span12 { + width: 100%; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; + } + .row-fluid [class*="offset"]:first-child { + margin-left: 0; + } + .input-large, + .input-xlarge, + .input-xxlarge, + input[class*="span"], + select[class*="span"], + textarea[class*="span"], + .uneditable-input { + display: block; + width: 100%; + min-height: 30px; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; + } + .input-prepend input, + .input-append input, + .input-prepend input[class*="span"], + .input-append input[class*="span"] { + display: inline-block; + width: auto; + } + .controls-row [class*="span"] + [class*="span"] { + margin-left: 0; + } + .modal { + position: fixed; + top: 20px; + right: 20px; + left: 20px; + width: auto; + margin: 0; + } + .modal.fade { + top: -100px; + } + .modal.fade.in { + top: 20px; + } +} + +@media (max-width: 480px) { + .nav-collapse { + -webkit-transform: translate3d(0, 0, 0); + } + .page-header h1 small { + display: block; + line-height: 20px; + } + input[type="checkbox"], + input[type="radio"] { + border: 1px solid #ccc; + } + .form-horizontal .control-label { + float: none; + width: auto; + padding-top: 0; + text-align: left; + } + .form-horizontal .controls { + margin-left: 0; + } + .form-horizontal .control-list { + padding-top: 0; + } + .form-horizontal .form-actions { + padding-right: 10px; + padding-left: 10px; + } + .media .pull-left, + .media .pull-right { + display: block; + float: none; + margin-bottom: 10px; + } + .media-object { + margin-right: 0; + margin-left: 0; + } + .modal { + top: 10px; + right: 10px; + left: 10px; + } + .modal-header .close { + padding: 10px; + margin: -10px; + } + .carousel-caption { + position: static; + } +} + +@media (max-width: 979px) { + body { + padding-top: 0; + } + .navbar-fixed-top, + .navbar-fixed-bottom { + position: static; + } + .navbar-fixed-top { + margin-bottom: 20px; + } + .navbar-fixed-bottom { + margin-top: 20px; + } + .navbar-fixed-top .navbar-inner, + .navbar-fixed-bottom .navbar-inner { + padding: 5px; + } + .navbar .container { + width: auto; + padding: 0; + } + .navbar .brand { + padding-right: 10px; + padding-left: 10px; + margin: 0 0 0 -5px; + } + .nav-collapse { + clear: both; + } + .nav-collapse .nav { + float: none; + margin: 0 0 10px; + } + .nav-collapse .nav > li { + float: none; + } + .nav-collapse .nav > li > a { + margin-bottom: 2px; + } + .nav-collapse .nav > .divider-vertical { + display: none; + } + .nav-collapse .nav .nav-header { + color: #777777; + text-shadow: none; + } + .nav-collapse .nav > li > a, + .nav-collapse .dropdown-menu a { + padding: 9px 15px; + font-weight: bold; + color: #777777; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; + } + .nav-collapse .btn { + padding: 4px 10px 4px; + font-weight: normal; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + } + .nav-collapse .dropdown-menu li + li a { + margin-bottom: 2px; + } + .nav-collapse .nav > li > a:hover, + .nav-collapse .dropdown-menu a:hover { + background-color: #f2f2f2; + } + .navbar-inverse .nav-collapse .nav > li > a, + .navbar-inverse .nav-collapse .dropdown-menu a { + color: #999999; + } + .navbar-inverse .nav-collapse .nav > li > a:hover, + .navbar-inverse .nav-collapse .dropdown-menu a:hover { + background-color: #111111; + } + .nav-collapse.in .btn-group { + padding: 0; + margin-top: 5px; + } + .nav-collapse .dropdown-menu { + position: static; + top: auto; + left: auto; + display: none; + float: none; + max-width: none; + padding: 0; + margin: 0 15px; + background-color: transparent; + border: none; + -webkit-border-radius: 0; + -moz-border-radius: 0; + border-radius: 0; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; + } + .nav-collapse .open > .dropdown-menu { + display: block; + } + .nav-collapse .dropdown-menu:before, + .nav-collapse .dropdown-menu:after { + display: none; + } + .nav-collapse .dropdown-menu .divider { + display: none; + } + .nav-collapse .nav > li > .dropdown-menu:before, + .nav-collapse .nav > li > .dropdown-menu:after { + display: none; + } + .nav-collapse .navbar-form, + .nav-collapse .navbar-search { + float: none; + padding: 10px 15px; + margin: 10px 0; + border-top: 1px solid #f2f2f2; + border-bottom: 1px solid #f2f2f2; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1); + -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1); + } + .navbar-inverse .nav-collapse .navbar-form, + .navbar-inverse .nav-collapse .navbar-search { + border-top-color: #111111; + border-bottom-color: #111111; + } + .navbar .nav-collapse .nav.pull-right { + float: none; + margin-left: 0; + } + .nav-collapse, + .nav-collapse.collapse { + height: 0; + overflow: hidden; + } + .navbar .btn-navbar { + display: block; + } + .navbar-static .navbar-inner { + padding-right: 10px; + padding-left: 10px; + } +} + +@media (min-width: 980px) { + .nav-collapse.collapse { + height: auto !important; + overflow: visible !important; + } +} diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap-responsive.min.css b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap-responsive.min.css new file mode 100644 index 0000000000..5cb833ff08 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap-responsive.min.css @@ -0,0 +1,9 @@ +/*! + * Bootstrap Responsive v2.2.2 + * + * Copyright 2012 Twitter, Inc + * Licensed under the Apache License v2.0 + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Designed and built with all the love in the world @twitter by @mdo and @fat. + */@-ms-viewport{width:device-width}.clearfix{*zoom:1}.clearfix:before,.clearfix:after{display:table;line-height:0;content:""}.clearfix:after{clear:both}.hide-text{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.input-block-level{display:block;width:100%;min-height:30px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.hidden{display:none;visibility:hidden}.visible-phone{display:none!important}.visible-tablet{display:none!important}.hidden-desktop{display:none!important}.visible-desktop{display:inherit!important}@media(min-width:768px) and (max-width:979px){.hidden-desktop{display:inherit!important}.visible-desktop{display:none!important}.visible-tablet{display:inherit!important}.hidden-tablet{display:none!important}}@media(max-width:767px){.hidden-desktop{display:inherit!important}.visible-desktop{display:none!important}.visible-phone{display:inherit!important}.hidden-phone{display:none!important}}@media(min-width:1200px){.row{margin-left:-30px;*zoom:1}.row:before,.row:after{display:table;line-height:0;content:""}.row:after{clear:both}[class*="span"]{float:left;min-height:1px;margin-left:30px}.container,.navbar-static-top .container,.navbar-fixed-top .container,.navbar-fixed-bottom .container{width:1170px}.span12{width:1170px}.span11{width:1070px}.span10{width:970px}.span9{width:870px}.span8{width:770px}.span7{width:670px}.span6{width:570px}.span5{width:470px}.span4{width:370px}.span3{width:270px}.span2{width:170px}.span1{width:70px}.offset12{margin-left:1230px}.offset11{margin-left:1130px}.offset10{margin-left:1030px}.offset9{margin-left:930px}.offset8{margin-left:830px}.offset7{margin-left:730px}.offset6{margin-left:630px}.offset5{margin-left:530px}.offset4{margin-left:430px}.offset3{margin-left:330px}.offset2{margin-left:230px}.offset1{margin-left:130px}.row-fluid{width:100%;*zoom:1}.row-fluid:before,.row-fluid:after{display:table;line-height:0;content:""}.row-fluid:after{clear:both}.row-fluid [class*="span"]{display:block;float:left;width:100%;min-height:30px;margin-left:2.564102564102564%;*margin-left:2.5109110747408616%;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.row-fluid [class*="span"]:first-child{margin-left:0}.row-fluid .controls-row [class*="span"]+[class*="span"]{margin-left:2.564102564102564%}.row-fluid .span12{width:100%;*width:99.94680851063829%}.row-fluid .span11{width:91.45299145299145%;*width:91.39979996362975%}.row-fluid .span10{width:82.90598290598291%;*width:82.8527914166212%}.row-fluid .span9{width:74.35897435897436%;*width:74.30578286961266%}.row-fluid .span8{width:65.81196581196582%;*width:65.75877432260411%}.row-fluid .span7{width:57.26495726495726%;*width:57.21176577559556%}.row-fluid .span6{width:48.717948717948715%;*width:48.664757228587014%}.row-fluid .span5{width:40.17094017094017%;*width:40.11774868157847%}.row-fluid .span4{width:31.623931623931625%;*width:31.570740134569924%}.row-fluid .span3{width:23.076923076923077%;*width:23.023731587561375%}.row-fluid .span2{width:14.52991452991453%;*width:14.476723040552828%}.row-fluid .span1{width:5.982905982905983%;*width:5.929714493544281%}.row-fluid .offset12{margin-left:105.12820512820512%;*margin-left:105.02182214948171%}.row-fluid .offset12:first-child{margin-left:102.56410256410257%;*margin-left:102.45771958537915%}.row-fluid .offset11{margin-left:96.58119658119658%;*margin-left:96.47481360247316%}.row-fluid .offset11:first-child{margin-left:94.01709401709402%;*margin-left:93.91071103837061%}.row-fluid .offset10{margin-left:88.03418803418803%;*margin-left:87.92780505546462%}.row-fluid .offset10:first-child{margin-left:85.47008547008548%;*margin-left:85.36370249136206%}.row-fluid .offset9{margin-left:79.48717948717949%;*margin-left:79.38079650845607%}.row-fluid .offset9:first-child{margin-left:76.92307692307693%;*margin-left:76.81669394435352%}.row-fluid .offset8{margin-left:70.94017094017094%;*margin-left:70.83378796144753%}.row-fluid .offset8:first-child{margin-left:68.37606837606839%;*margin-left:68.26968539734497%}.row-fluid .offset7{margin-left:62.393162393162385%;*margin-left:62.28677941443899%}.row-fluid .offset7:first-child{margin-left:59.82905982905982%;*margin-left:59.72267685033642%}.row-fluid .offset6{margin-left:53.84615384615384%;*margin-left:53.739770867430444%}.row-fluid .offset6:first-child{margin-left:51.28205128205128%;*margin-left:51.175668303327875%}.row-fluid .offset5{margin-left:45.299145299145295%;*margin-left:45.1927623204219%}.row-fluid .offset5:first-child{margin-left:42.73504273504273%;*margin-left:42.62865975631933%}.row-fluid .offset4{margin-left:36.75213675213675%;*margin-left:36.645753773413354%}.row-fluid .offset4:first-child{margin-left:34.18803418803419%;*margin-left:34.081651209310785%}.row-fluid .offset3{margin-left:28.205128205128204%;*margin-left:28.0987452264048%}.row-fluid .offset3:first-child{margin-left:25.641025641025642%;*margin-left:25.53464266230224%}.row-fluid .offset2{margin-left:19.65811965811966%;*margin-left:19.551736679396257%}.row-fluid .offset2:first-child{margin-left:17.094017094017094%;*margin-left:16.98763411529369%}.row-fluid .offset1{margin-left:11.11111111111111%;*margin-left:11.004728132387708%}.row-fluid .offset1:first-child{margin-left:8.547008547008547%;*margin-left:8.440625568285142%}input,textarea,.uneditable-input{margin-left:0}.controls-row [class*="span"]+[class*="span"]{margin-left:30px}input.span12,textarea.span12,.uneditable-input.span12{width:1156px}input.span11,textarea.span11,.uneditable-input.span11{width:1056px}input.span10,textarea.span10,.uneditable-input.span10{width:956px}input.span9,textarea.span9,.uneditable-input.span9{width:856px}input.span8,textarea.span8,.uneditable-input.span8{width:756px}input.span7,textarea.span7,.uneditable-input.span7{width:656px}input.span6,textarea.span6,.uneditable-input.span6{width:556px}input.span5,textarea.span5,.uneditable-input.span5{width:456px}input.span4,textarea.span4,.uneditable-input.span4{width:356px}input.span3,textarea.span3,.uneditable-input.span3{width:256px}input.span2,textarea.span2,.uneditable-input.span2{width:156px}input.span1,textarea.span1,.uneditable-input.span1{width:56px}.thumbnails{margin-left:-30px}.thumbnails>li{margin-left:30px}.row-fluid .thumbnails{margin-left:0}}@media(min-width:768px) and (max-width:979px){.row{margin-left:-20px;*zoom:1}.row:before,.row:after{display:table;line-height:0;content:""}.row:after{clear:both}[class*="span"]{float:left;min-height:1px;margin-left:20px}.container,.navbar-static-top .container,.navbar-fixed-top .container,.navbar-fixed-bottom .container{width:724px}.span12{width:724px}.span11{width:662px}.span10{width:600px}.span9{width:538px}.span8{width:476px}.span7{width:414px}.span6{width:352px}.span5{width:290px}.span4{width:228px}.span3{width:166px}.span2{width:104px}.span1{width:42px}.offset12{margin-left:764px}.offset11{margin-left:702px}.offset10{margin-left:640px}.offset9{margin-left:578px}.offset8{margin-left:516px}.offset7{margin-left:454px}.offset6{margin-left:392px}.offset5{margin-left:330px}.offset4{margin-left:268px}.offset3{margin-left:206px}.offset2{margin-left:144px}.offset1{margin-left:82px}.row-fluid{width:100%;*zoom:1}.row-fluid:before,.row-fluid:after{display:table;line-height:0;content:""}.row-fluid:after{clear:both}.row-fluid [class*="span"]{display:block;float:left;width:100%;min-height:30px;margin-left:2.7624309392265194%;*margin-left:2.709239449864817%;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.row-fluid [class*="span"]:first-child{margin-left:0}.row-fluid .controls-row [class*="span"]+[class*="span"]{margin-left:2.7624309392265194%}.row-fluid .span12{width:100%;*width:99.94680851063829%}.row-fluid .span11{width:91.43646408839778%;*width:91.38327259903608%}.row-fluid .span10{width:82.87292817679558%;*width:82.81973668743387%}.row-fluid .span9{width:74.30939226519337%;*width:74.25620077583166%}.row-fluid .span8{width:65.74585635359117%;*width:65.69266486422946%}.row-fluid .span7{width:57.18232044198895%;*width:57.12912895262725%}.row-fluid .span6{width:48.61878453038674%;*width:48.56559304102504%}.row-fluid .span5{width:40.05524861878453%;*width:40.00205712942283%}.row-fluid .span4{width:31.491712707182323%;*width:31.43852121782062%}.row-fluid .span3{width:22.92817679558011%;*width:22.87498530621841%}.row-fluid .span2{width:14.3646408839779%;*width:14.311449394616199%}.row-fluid .span1{width:5.801104972375691%;*width:5.747913483013988%}.row-fluid .offset12{margin-left:105.52486187845304%;*margin-left:105.41847889972962%}.row-fluid .offset12:first-child{margin-left:102.76243093922652%;*margin-left:102.6560479605031%}.row-fluid .offset11{margin-left:96.96132596685082%;*margin-left:96.8549429881274%}.row-fluid .offset11:first-child{margin-left:94.1988950276243%;*margin-left:94.09251204890089%}.row-fluid .offset10{margin-left:88.39779005524862%;*margin-left:88.2914070765252%}.row-fluid .offset10:first-child{margin-left:85.6353591160221%;*margin-left:85.52897613729868%}.row-fluid .offset9{margin-left:79.8342541436464%;*margin-left:79.72787116492299%}.row-fluid .offset9:first-child{margin-left:77.07182320441989%;*margin-left:76.96544022569647%}.row-fluid .offset8{margin-left:71.2707182320442%;*margin-left:71.16433525332079%}.row-fluid .offset8:first-child{margin-left:68.50828729281768%;*margin-left:68.40190431409427%}.row-fluid .offset7{margin-left:62.70718232044199%;*margin-left:62.600799341718584%}.row-fluid .offset7:first-child{margin-left:59.94475138121547%;*margin-left:59.838368402492065%}.row-fluid .offset6{margin-left:54.14364640883978%;*margin-left:54.037263430116376%}.row-fluid .offset6:first-child{margin-left:51.38121546961326%;*margin-left:51.27483249088986%}.row-fluid .offset5{margin-left:45.58011049723757%;*margin-left:45.47372751851417%}.row-fluid .offset5:first-child{margin-left:42.81767955801105%;*margin-left:42.71129657928765%}.row-fluid .offset4{margin-left:37.01657458563536%;*margin-left:36.91019160691196%}.row-fluid .offset4:first-child{margin-left:34.25414364640884%;*margin-left:34.14776066768544%}.row-fluid .offset3{margin-left:28.45303867403315%;*margin-left:28.346655695309746%}.row-fluid .offset3:first-child{margin-left:25.69060773480663%;*margin-left:25.584224756083227%}.row-fluid .offset2{margin-left:19.88950276243094%;*margin-left:19.783119783707537%}.row-fluid .offset2:first-child{margin-left:17.12707182320442%;*margin-left:17.02068884448102%}.row-fluid .offset1{margin-left:11.32596685082873%;*margin-left:11.219583872105325%}.row-fluid .offset1:first-child{margin-left:8.56353591160221%;*margin-left:8.457152932878806%}input,textarea,.uneditable-input{margin-left:0}.controls-row [class*="span"]+[class*="span"]{margin-left:20px}input.span12,textarea.span12,.uneditable-input.span12{width:710px}input.span11,textarea.span11,.uneditable-input.span11{width:648px}input.span10,textarea.span10,.uneditable-input.span10{width:586px}input.span9,textarea.span9,.uneditable-input.span9{width:524px}input.span8,textarea.span8,.uneditable-input.span8{width:462px}input.span7,textarea.span7,.uneditable-input.span7{width:400px}input.span6,textarea.span6,.uneditable-input.span6{width:338px}input.span5,textarea.span5,.uneditable-input.span5{width:276px}input.span4,textarea.span4,.uneditable-input.span4{width:214px}input.span3,textarea.span3,.uneditable-input.span3{width:152px}input.span2,textarea.span2,.uneditable-input.span2{width:90px}input.span1,textarea.span1,.uneditable-input.span1{width:28px}}@media(max-width:767px){body{padding-right:20px;padding-left:20px}.navbar-fixed-top,.navbar-fixed-bottom,.navbar-static-top{margin-right:-20px;margin-left:-20px}.container-fluid{padding:0}.dl-horizontal dt{float:none;width:auto;clear:none;text-align:left}.dl-horizontal dd{margin-left:0}.container{width:auto}.row-fluid{width:100%}.row,.thumbnails{margin-left:0}.thumbnails>li{float:none;margin-left:0}[class*="span"],.uneditable-input[class*="span"],.row-fluid [class*="span"]{display:block;float:none;width:100%;margin-left:0;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.span12,.row-fluid .span12{width:100%;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.row-fluid [class*="offset"]:first-child{margin-left:0}.input-large,.input-xlarge,.input-xxlarge,input[class*="span"],select[class*="span"],textarea[class*="span"],.uneditable-input{display:block;width:100%;min-height:30px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.input-prepend input,.input-append input,.input-prepend input[class*="span"],.input-append input[class*="span"]{display:inline-block;width:auto}.controls-row [class*="span"]+[class*="span"]{margin-left:0}.modal{position:fixed;top:20px;right:20px;left:20px;width:auto;margin:0}.modal.fade{top:-100px}.modal.fade.in{top:20px}}@media(max-width:480px){.nav-collapse{-webkit-transform:translate3d(0,0,0)}.page-header h1 small{display:block;line-height:20px}input[type="checkbox"],input[type="radio"]{border:1px solid #ccc}.form-horizontal .control-label{float:none;width:auto;padding-top:0;text-align:left}.form-horizontal .controls{margin-left:0}.form-horizontal .control-list{padding-top:0}.form-horizontal .form-actions{padding-right:10px;padding-left:10px}.media .pull-left,.media .pull-right{display:block;float:none;margin-bottom:10px}.media-object{margin-right:0;margin-left:0}.modal{top:10px;right:10px;left:10px}.modal-header .close{padding:10px;margin:-10px}.carousel-caption{position:static}}@media(max-width:979px){body{padding-top:0}.navbar-fixed-top,.navbar-fixed-bottom{position:static}.navbar-fixed-top{margin-bottom:20px}.navbar-fixed-bottom{margin-top:20px}.navbar-fixed-top .navbar-inner,.navbar-fixed-bottom .navbar-inner{padding:5px}.navbar .container{width:auto;padding:0}.navbar .brand{padding-right:10px;padding-left:10px;margin:0 0 0 -5px}.nav-collapse{clear:both}.nav-collapse .nav{float:none;margin:0 0 10px}.nav-collapse .nav>li{float:none}.nav-collapse .nav>li>a{margin-bottom:2px}.nav-collapse .nav>.divider-vertical{display:none}.nav-collapse .nav .nav-header{color:#777;text-shadow:none}.nav-collapse .nav>li>a,.nav-collapse .dropdown-menu a{padding:9px 15px;font-weight:bold;color:#777;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.nav-collapse .btn{padding:4px 10px 4px;font-weight:normal;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.nav-collapse .dropdown-menu li+li a{margin-bottom:2px}.nav-collapse .nav>li>a:hover,.nav-collapse .dropdown-menu a:hover{background-color:#f2f2f2}.navbar-inverse .nav-collapse .nav>li>a,.navbar-inverse .nav-collapse .dropdown-menu a{color:#999}.navbar-inverse .nav-collapse .nav>li>a:hover,.navbar-inverse .nav-collapse .dropdown-menu a:hover{background-color:#111}.nav-collapse.in .btn-group{padding:0;margin-top:5px}.nav-collapse .dropdown-menu{position:static;top:auto;left:auto;display:none;float:none;max-width:none;padding:0;margin:0 15px;background-color:transparent;border:0;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}.nav-collapse .open>.dropdown-menu{display:block}.nav-collapse .dropdown-menu:before,.nav-collapse .dropdown-menu:after{display:none}.nav-collapse .dropdown-menu .divider{display:none}.nav-collapse .nav>li>.dropdown-menu:before,.nav-collapse .nav>li>.dropdown-menu:after{display:none}.nav-collapse .navbar-form,.nav-collapse .navbar-search{float:none;padding:10px 15px;margin:10px 0;border-top:1px solid #f2f2f2;border-bottom:1px solid #f2f2f2;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.1);-moz-box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.1);box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.1)}.navbar-inverse .nav-collapse .navbar-form,.navbar-inverse .nav-collapse .navbar-search{border-top-color:#111;border-bottom-color:#111}.navbar .nav-collapse .nav.pull-right{float:none;margin-left:0}.nav-collapse,.nav-collapse.collapse{height:0;overflow:hidden}.navbar .btn-navbar{display:block}.navbar-static .navbar-inner{padding-right:10px;padding-left:10px}}@media(min-width:980px){.nav-collapse.collapse{height:auto!important;overflow:visible!important}} diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap.css b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap.css new file mode 100644 index 0000000000..54d06c6ec4 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap.css @@ -0,0 +1,2470 @@ +/*! + * Bootstrap v1.4.0 + * + * Copyright 2011 Twitter, Inc + * Licensed under the Apache License v2.0 + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Designed and built with all the love in the world @twitter by @mdo and @fat. + * Date: Sun Dec 25 20:18:31 PST 2011 + */ +/* Reset.less + * Props to Eric Meyer (meyerweb.com) for his CSS reset file. We're using an adapted version here that cuts out some of the reset HTML elements we will never need here (i.e., dfn, samp, etc). + * ------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- */ +html, body { + margin: 0; + padding: 0; +} +h1, +h2, +h3, +h4, +h5, +h6, +p, +blockquote, +pre, +a, +abbr, +acronym, +address, +cite, +code, +del, +dfn, +em, +img, +q, +s, +samp, +small, +strike, +strong, +sub, +sup, +tt, +var, +dd, +dl, +dt, +li, +ol, +ul, +fieldset, +form, +label, +legend, +button, +table, +caption, +tbody, +tfoot, +thead, +tr, +th, +td { + margin: 0; + padding: 0; + border: 0; + font-weight: normal; + font-style: normal; + font-size: 100%; + line-height: 1; + font-family: inherit; +} +table { + border-collapse: collapse; + border-spacing: 0; +} +ol, ul { + list-style: none; +} +q:before, +q:after, +blockquote:before, +blockquote:after { + content: ""; +} +html { + overflow-y: scroll; + font-size: 100%; + -webkit-text-size-adjust: 100%; + -ms-text-size-adjust: 100%; +} +a:focus { + outline: thin dotted; +} +a:hover, a:active { + outline: 0; +} +article, +aside, +details, +figcaption, +figure, +footer, +header, +hgroup, +nav, +section { + display: block; +} +audio, canvas, video { + display: inline-block; + *display: inline; + *zoom: 1; +} +audio:not([controls]) { + display: none; +} +sub, sup { + font-size: 75%; + line-height: 0; + position: relative; + vertical-align: baseline; +} +sup { + top: -0.5em; +} +sub { + bottom: -0.25em; +} +img { + border: 0; + -ms-interpolation-mode: bicubic; +} +button, +input, +select, +textarea { + font-size: 100%; + margin: 0; + vertical-align: baseline; + *vertical-align: middle; +} +button, input { + line-height: normal; + *overflow: visible; +} +button::-moz-focus-inner, input::-moz-focus-inner { + border: 0; + padding: 0; +} +button, +input[type="button"], +input[type="reset"], +input[type="submit"] { + cursor: pointer; + -webkit-appearance: button; +} +input[type="search"] { + -webkit-appearance: textfield; + -webkit-box-sizing: content-box; + -moz-box-sizing: content-box; + box-sizing: content-box; +} +input[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} +textarea { + overflow: auto; + vertical-align: top; +} +/* Variables.less + * Variables to customize the look and feel of Bootstrap + * ----------------------------------------------------- */ +/* Mixins.less + * Snippets of reusable CSS to develop faster and keep code readable + * ----------------------------------------------------------------- */ +/* + * Scaffolding + * Basic and global styles for generating a grid system, structural layout, and page templates + * ------------------------------------------------------------------------------------------- */ +body { + background-color: #ffffff; + margin: 0; + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 13px; + font-weight: normal; + line-height: 18px; + color: #404040; +} +.container { + width: 940px; + margin-left: auto; + margin-right: auto; + zoom: 1; +} +.container:before, .container:after { + display: table; + content: ""; + zoom: 1; +} +.container:after { + clear: both; +} +.container-fluid { + position: relative; + min-width: 940px; + padding-left: 20px; + padding-right: 20px; + zoom: 1; +} +.container-fluid:before, .container-fluid:after { + display: table; + content: ""; + zoom: 1; +} +.container-fluid:after { + clear: both; +} +.container-fluid > .sidebar { + position: absolute; + top: 0; + left: 20px; + width: 220px; +} +.container-fluid > .content { + margin-left: 240px; +} +a { + color: #0069d6; + text-decoration: none; + line-height: inherit; + font-weight: inherit; +} +a:hover { + color: #00438a; + text-decoration: underline; +} +.pull-right { + float: right; +} +.pull-left { + float: left; +} +.hide { + display: none; +} +.show { + display: block; +} +.row { + zoom: 1; + margin-left: -20px; +} +.row:before, .row:after { + display: table; + content: ""; + zoom: 1; +} +.row:after { + clear: both; +} +.row > [class*="span"] { + display: inline; + float: left; + margin-left: 20px; +} +.span1 { + width: 40px; +} +.span2 { + width: 100px; +} +.span3 { + width: 160px; +} +.span4 { + width: 220px; +} +.span5 { + width: 280px; +} +.span6 { + width: 340px; +} +.span7 { + width: 400px; +} +.span8 { + width: 460px; +} +.span9 { + width: 520px; +} +.span10 { + width: 580px; +} +.span11 { + width: 640px; +} +.span12 { + width: 700px; +} +.span13 { + width: 760px; +} +.span14 { + width: 820px; +} +.span15 { + width: 880px; +} +.span16 { + width: 940px; +} +.span17 { + width: 1000px; +} +.span18 { + width: 1060px; +} +.span19 { + width: 1120px; +} +.span20 { + width: 1180px; +} +.span21 { + width: 1240px; +} +.span22 { + width: 1300px; +} +.span23 { + width: 1360px; +} +.span24 { + width: 1420px; +} +.row > .offset1 { + margin-left: 80px; +} +.row > .offset2 { + margin-left: 140px; +} +.row > .offset3 { + margin-left: 200px; +} +.row > .offset4 { + margin-left: 260px; +} +.row > .offset5 { + margin-left: 320px; +} +.row > .offset6 { + margin-left: 380px; +} +.row > .offset7 { + margin-left: 440px; +} +.row > .offset8 { + margin-left: 500px; +} +.row > .offset9 { + margin-left: 560px; +} +.row > .offset10 { + margin-left: 620px; +} +.row > .offset11 { + margin-left: 680px; +} +.row > .offset12 { + margin-left: 740px; +} +.span-one-third { + width: 300px; +} +.span-two-thirds { + width: 620px; +} +.row > .offset-one-third { + margin-left: 340px; +} +.row > .offset-two-thirds { + margin-left: 660px; +} +/* Typography.less + * Headings, body text, lists, code, and more for a versatile and durable typography system + * ---------------------------------------------------------------------------------------- */ +p { + font-size: 13px; + font-weight: normal; + line-height: 18px; + margin-bottom: 9px; +} +p small { + font-size: 11px; + color: #bfbfbf; +} +h1, +h2, +h3, +h4, +h5, +h6 { + font-weight: bold; + color: #404040; +} +h1 small, +h2 small, +h3 small, +h4 small, +h5 small, +h6 small { + color: #bfbfbf; +} +h1 { + margin-bottom: 18px; + font-size: 30px; + line-height: 36px; +} +h1 small { + font-size: 18px; +} +h2 { + font-size: 24px; + line-height: 36px; +} +h2 small { + font-size: 14px; +} +h3, +h4, +h5, +h6 { + line-height: 36px; +} +h3 { + font-size: 18px; +} +h3 small { + font-size: 14px; +} +h4 { + font-size: 16px; +} +h4 small { + font-size: 12px; +} +h5 { + font-size: 14px; +} +h6 { + font-size: 13px; + color: #bfbfbf; + text-transform: uppercase; +} +ul, ol { + margin: 0 0 18px 25px; +} +ul ul, +ul ol, +ol ol, +ol ul { + margin-bottom: 0; +} +ul { + list-style: disc; +} +ol { + list-style: decimal; +} +li { + line-height: 18px; + color: #808080; +} +ul.unstyled { + list-style: none; + margin-left: 0; +} +dl { + margin-bottom: 18px; +} +dl dt, dl dd { + line-height: 18px; +} +dl dt { + font-weight: bold; +} +dl dd { + margin-left: 9px; +} +hr { + margin: 20px 0 19px; + border: 0; + border-bottom: 1px solid #eee; +} +strong { + font-style: inherit; + font-weight: bold; +} +em { + font-style: italic; + font-weight: inherit; + line-height: inherit; +} +.muted { + color: #bfbfbf; +} +blockquote { + margin-bottom: 18px; + border-left: 5px solid #eee; + padding-left: 15px; +} +blockquote p { + font-size: 14px; + font-weight: 300; + line-height: 18px; + margin-bottom: 0; +} +blockquote small { + display: block; + font-size: 12px; + font-weight: 300; + line-height: 18px; + color: #bfbfbf; +} +blockquote small:before { + content: '\2014 \00A0'; +} +address { + display: block; + line-height: 18px; + margin-bottom: 18px; +} +code, pre { + padding: 0 3px 2px; + font-family: Monaco, Andale Mono, Courier New, monospace; + font-size: 12px; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; +} +code { + background-color: #fee9cc; + color: rgba(0, 0, 0, 0.75); + padding: 1px 3px; +} +pre { + background-color: #f5f5f5; + display: block; + padding: 8.5px; + margin: 0 0 18px; + line-height: 18px; + font-size: 12px; + border: 1px solid #ccc; + border: 1px solid rgba(0, 0, 0, 0.15); + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; + white-space: pre; + white-space: pre-wrap; + word-wrap: break-word; +} +/* Forms.less + * Base styles for various input types, form layouts, and states + * ------------------------------------------------------------- */ +form { + margin-bottom: 18px; +} +fieldset { + margin-bottom: 18px; + padding-top: 18px; +} +fieldset legend { + display: block; + padding-left: 150px; + font-size: 19.5px; + line-height: 1; + color: #404040; + *padding: 0 0 5px 145px; + /* IE6-7 */ + + *line-height: 1.5; + /* IE6-7 */ + +} +form .clearfix { + margin-bottom: 18px; + zoom: 1; +} +form .clearfix:before, form .clearfix:after { + display: table; + content: ""; + zoom: 1; +} +form .clearfix:after { + clear: both; +} +label, +input, +select, +textarea { + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 13px; + font-weight: normal; + line-height: normal; +} +label { + padding-top: 6px; + font-size: 13px; + line-height: 18px; + float: left; + width: 130px; + text-align: right; + color: #404040; +} +form .input { + margin-left: 150px; +} +input[type=checkbox], input[type=radio] { + cursor: pointer; +} +input, +textarea, +select, +.uneditable-input { + display: inline-block; + width: 210px; + height: 18px; + padding: 4px; + font-size: 13px; + line-height: 18px; + color: #808080; + border: 1px solid #ccc; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; +} +select { + padding: initial; +} +input[type=checkbox], input[type=radio] { + width: auto; + height: auto; + padding: 0; + margin: 3px 0; + *margin-top: 0; + /* IE6-7 */ + + line-height: normal; + border: none; +} +input[type=file] { + background-color: #ffffff; + padding: initial; + border: initial; + line-height: initial; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; +} +input[type=button], input[type=reset], input[type=submit] { + width: auto; + height: auto; +} +select, input[type=file] { + height: 27px; + *height: auto; + line-height: 27px; + *margin-top: 4px; + /* For IE7, add top margin to align select with labels */ + +} +select[multiple] { + height: inherit; + background-color: #ffffff; +} +textarea { + height: auto; +} +.uneditable-input { + background-color: #ffffff; + display: block; + border-color: #eee; + -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025); + -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025); + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025); + cursor: not-allowed; +} +:-moz-placeholder { + color: #bfbfbf; +} +::-webkit-input-placeholder { + color: #bfbfbf; +} +input, textarea { + -webkit-transition: border linear 0.2s, box-shadow linear 0.2s; + -moz-transition: border linear 0.2s, box-shadow linear 0.2s; + -ms-transition: border linear 0.2s, box-shadow linear 0.2s; + -o-transition: border linear 0.2s, box-shadow linear 0.2s; + transition: border linear 0.2s, box-shadow linear 0.2s; + -webkit-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1); + -moz-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1); + box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1); +} +input:focus, textarea:focus { + outline: 0; + border-color: rgba(82, 168, 236, 0.8); + -webkit-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1), 0 0 8px rgba(82, 168, 236, 0.6); + -moz-box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1), 0 0 8px rgba(82, 168, 236, 0.6); + box-shadow: inset 0 1px 3px rgba(0, 0, 0, 0.1), 0 0 8px rgba(82, 168, 236, 0.6); +} +input[type=file]:focus, input[type=checkbox]:focus, select:focus { + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; + outline: 1px dotted #666; +} +form .clearfix.error > label, form .clearfix.error .help-block, form .clearfix.error .help-inline { + color: #b94a48; +} +form .clearfix.error input, form .clearfix.error textarea { + color: #b94a48; + border-color: #ee5f5b; +} +form .clearfix.error input:focus, form .clearfix.error textarea:focus { + border-color: #e9322d; + -webkit-box-shadow: 0 0 6px #f8b9b7; + -moz-box-shadow: 0 0 6px #f8b9b7; + box-shadow: 0 0 6px #f8b9b7; +} +form .clearfix.error .input-prepend .add-on, form .clearfix.error .input-append .add-on { + color: #b94a48; + background-color: #fce6e6; + border-color: #b94a48; +} +form .clearfix.warning > label, form .clearfix.warning .help-block, form .clearfix.warning .help-inline { + color: #c09853; +} +form .clearfix.warning input, form .clearfix.warning textarea { + color: #c09853; + border-color: #ccae64; +} +form .clearfix.warning input:focus, form .clearfix.warning textarea:focus { + border-color: #be9a3f; + -webkit-box-shadow: 0 0 6px #e5d6b1; + -moz-box-shadow: 0 0 6px #e5d6b1; + box-shadow: 0 0 6px #e5d6b1; +} +form .clearfix.warning .input-prepend .add-on, form .clearfix.warning .input-append .add-on { + color: #c09853; + background-color: #d2b877; + border-color: #c09853; +} +form .clearfix.success > label, form .clearfix.success .help-block, form .clearfix.success .help-inline { + color: #468847; +} +form .clearfix.success input, form .clearfix.success textarea { + color: #468847; + border-color: #57a957; +} +form .clearfix.success input:focus, form .clearfix.success textarea:focus { + border-color: #458845; + -webkit-box-shadow: 0 0 6px #9acc9a; + -moz-box-shadow: 0 0 6px #9acc9a; + box-shadow: 0 0 6px #9acc9a; +} +form .clearfix.success .input-prepend .add-on, form .clearfix.success .input-append .add-on { + color: #468847; + background-color: #bcddbc; + border-color: #468847; +} +.input-mini, +input.mini, +textarea.mini, +select.mini { + width: 60px; +} +.input-small, +input.small, +textarea.small, +select.small { + width: 90px; +} +.input-medium, +input.medium, +textarea.medium, +select.medium { + width: 150px; +} +.input-large, +input.large, +textarea.large, +select.large { + width: 210px; +} +.input-xlarge, +input.xlarge, +textarea.xlarge, +select.xlarge { + width: 270px; +} +.input-xxlarge, +input.xxlarge, +textarea.xxlarge, +select.xxlarge { + width: 530px; +} +textarea.xxlarge { + overflow-y: auto; +} +input.span1, textarea.span1 { + display: inline-block; + float: none; + width: 30px; + margin-left: 0; +} +input.span2, textarea.span2 { + display: inline-block; + float: none; + width: 90px; + margin-left: 0; +} +input.span3, textarea.span3 { + display: inline-block; + float: none; + width: 150px; + margin-left: 0; +} +input.span4, textarea.span4 { + display: inline-block; + float: none; + width: 210px; + margin-left: 0; +} +input.span5, textarea.span5 { + display: inline-block; + float: none; + width: 270px; + margin-left: 0; +} +input.span6, textarea.span6 { + display: inline-block; + float: none; + width: 330px; + margin-left: 0; +} +input.span7, textarea.span7 { + display: inline-block; + float: none; + width: 390px; + margin-left: 0; +} +input.span8, textarea.span8 { + display: inline-block; + float: none; + width: 450px; + margin-left: 0; +} +input.span9, textarea.span9 { + display: inline-block; + float: none; + width: 510px; + margin-left: 0; +} +input.span10, textarea.span10 { + display: inline-block; + float: none; + width: 570px; + margin-left: 0; +} +input.span11, textarea.span11 { + display: inline-block; + float: none; + width: 630px; + margin-left: 0; +} +input.span12, textarea.span12 { + display: inline-block; + float: none; + width: 690px; + margin-left: 0; +} +input.span13, textarea.span13 { + display: inline-block; + float: none; + width: 750px; + margin-left: 0; +} +input.span14, textarea.span14 { + display: inline-block; + float: none; + width: 810px; + margin-left: 0; +} +input.span15, textarea.span15 { + display: inline-block; + float: none; + width: 870px; + margin-left: 0; +} +input.span16, textarea.span16 { + display: inline-block; + float: none; + width: 930px; + margin-left: 0; +} +input[disabled], +select[disabled], +textarea[disabled], +input[readonly], +select[readonly], +textarea[readonly] { + background-color: #f5f5f5; + border-color: #ddd; + cursor: not-allowed; +} +.actions { + background: #f5f5f5; + margin-top: 18px; + margin-bottom: 18px; + padding: 17px 20px 18px 150px; + border-top: 1px solid #ddd; + -webkit-border-radius: 0 0 3px 3px; + -moz-border-radius: 0 0 3px 3px; + border-radius: 0 0 3px 3px; +} +.actions .secondary-action { + float: right; +} +.actions .secondary-action a { + line-height: 30px; +} +.actions .secondary-action a:hover { + text-decoration: underline; +} +.help-inline, .help-block { + font-size: 13px; + line-height: 18px; + color: #bfbfbf; +} +.help-inline { + padding-left: 5px; + *position: relative; + /* IE6-7 */ + + *top: -5px; + /* IE6-7 */ + +} +.help-block { + display: block; + max-width: 600px; +} +.inline-inputs { + color: #808080; +} +.inline-inputs span { + padding: 0 2px 0 1px; +} +.input-prepend input, .input-append input { + -webkit-border-radius: 0 3px 3px 0; + -moz-border-radius: 0 3px 3px 0; + border-radius: 0 3px 3px 0; +} +.input-prepend .add-on, .input-append .add-on { + position: relative; + background: #f5f5f5; + border: 1px solid #ccc; + z-index: 2; + float: left; + display: block; + width: auto; + min-width: 16px; + height: 18px; + padding: 4px 4px 4px 5px; + margin-right: -1px; + font-weight: normal; + line-height: 18px; + color: #bfbfbf; + text-align: center; + text-shadow: 0 1px 0 #ffffff; + -webkit-border-radius: 3px 0 0 3px; + -moz-border-radius: 3px 0 0 3px; + border-radius: 3px 0 0 3px; +} +.input-prepend .active, .input-append .active { + background: #a9dba9; + border-color: #46a546; +} +.input-prepend .add-on { + *margin-top: 1px; + /* IE6-7 */ + +} +.input-append input { + float: left; + -webkit-border-radius: 3px 0 0 3px; + -moz-border-radius: 3px 0 0 3px; + border-radius: 3px 0 0 3px; +} +.input-append .add-on { + -webkit-border-radius: 0 3px 3px 0; + -moz-border-radius: 0 3px 3px 0; + border-radius: 0 3px 3px 0; + margin-right: 0; + margin-left: -1px; +} +.inputs-list { + margin: 0 0 5px; + width: 100%; +} +.inputs-list li { + display: block; + padding: 0; + width: 100%; +} +.inputs-list label { + display: block; + float: none; + width: auto; + padding: 0; + margin-left: 20px; + line-height: 18px; + text-align: left; + white-space: normal; +} +.inputs-list label strong { + color: #808080; +} +.inputs-list label small { + font-size: 11px; + font-weight: normal; +} +.inputs-list .inputs-list { + margin-left: 25px; + margin-bottom: 10px; + padding-top: 0; +} +.inputs-list:first-child { + padding-top: 6px; +} +.inputs-list li + li { + padding-top: 2px; +} +.inputs-list input[type=radio], .inputs-list input[type=checkbox] { + margin-bottom: 0; + margin-left: -20px; + float: left; +} +.form-stacked { + padding-left: 20px; +} +.form-stacked fieldset { + padding-top: 9px; +} +.form-stacked legend { + padding-left: 0; +} +.form-stacked label { + display: block; + float: none; + width: auto; + font-weight: bold; + text-align: left; + line-height: 20px; + padding-top: 0; +} +.form-stacked .clearfix { + margin-bottom: 9px; +} +.form-stacked .clearfix div.input { + margin-left: 0; +} +.form-stacked .inputs-list { + margin-bottom: 0; +} +.form-stacked .inputs-list li { + padding-top: 0; +} +.form-stacked .inputs-list li label { + font-weight: normal; + padding-top: 0; +} +.form-stacked div.clearfix.error { + padding-top: 10px; + padding-bottom: 10px; + padding-left: 10px; + margin-top: 0; + margin-left: -10px; +} +.form-stacked .actions { + margin-left: -20px; + padding-left: 20px; +} +/* + * Tables.less + * Tables for, you guessed it, tabular data + * ---------------------------------------- */ +table { + width: 100%; + margin-bottom: 18px; + padding: 0; + font-size: 13px; + border-collapse: collapse; +} +table th, table td { + padding: 10px 10px 9px; + line-height: 18px; + text-align: left; +} +table th { + padding-top: 9px; + font-weight: bold; + vertical-align: middle; +} +table td { + vertical-align: top; + border-top: 1px solid #ddd; +} +table tbody th { + border-top: 1px solid #ddd; + vertical-align: top; +} +.condensed-table th, .condensed-table td { + padding: 5px 5px 4px; +} +.bordered-table { + border: 1px solid #ddd; + border-collapse: separate; + *border-collapse: collapse; + /* IE7, collapse table to remove spacing */ + + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} +.bordered-table th + th, .bordered-table td + td, .bordered-table th + td { + border-left: 1px solid #ddd; +} +.bordered-table thead tr:first-child th:first-child, .bordered-table tbody tr:first-child td:first-child { + -webkit-border-radius: 4px 0 0 0; + -moz-border-radius: 4px 0 0 0; + border-radius: 4px 0 0 0; +} +.bordered-table thead tr:first-child th:last-child, .bordered-table tbody tr:first-child td:last-child { + -webkit-border-radius: 0 4px 0 0; + -moz-border-radius: 0 4px 0 0; + border-radius: 0 4px 0 0; +} +.bordered-table tbody tr:last-child td:first-child { + -webkit-border-radius: 0 0 0 4px; + -moz-border-radius: 0 0 0 4px; + border-radius: 0 0 0 4px; +} +.bordered-table tbody tr:last-child td:last-child { + -webkit-border-radius: 0 0 4px 0; + -moz-border-radius: 0 0 4px 0; + border-radius: 0 0 4px 0; +} +table .span1 { + width: 20px; +} +table .span2 { + width: 60px; +} +table .span3 { + width: 100px; +} +table .span4 { + width: 140px; +} +table .span5 { + width: 180px; +} +table .span6 { + width: 220px; +} +table .span7 { + width: 260px; +} +table .span8 { + width: 300px; +} +table .span9 { + width: 340px; +} +table .span10 { + width: 380px; +} +table .span11 { + width: 420px; +} +table .span12 { + width: 460px; +} +table .span13 { + width: 500px; +} +table .span14 { + width: 540px; +} +table .span15 { + width: 580px; +} +table .span16 { + width: 620px; +} +.zebra-striped tbody tr:nth-child(odd) td, .zebra-striped tbody tr:nth-child(odd) th { + background-color: #f9f9f9; +} +.zebra-striped tbody tr:hover td, .zebra-striped tbody tr:hover th { + background-color: #f5f5f5; +} +table .header { + cursor: pointer; +} +table .header:after { + content: ""; + float: right; + margin-top: 7px; + border-width: 0 4px 4px; + border-style: solid; + border-color: #000 transparent; + visibility: hidden; +} +table .headerSortUp, table .headerSortDown { + background-color: rgba(141, 192, 219, 0.25); + text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75); +} +table .header:hover:after { + visibility: visible; +} +table .headerSortDown:after, table .headerSortDown:hover:after { + visibility: visible; + filter: alpha(opacity=60); + -khtml-opacity: 0.6; + -moz-opacity: 0.6; + opacity: 0.6; +} +table .headerSortUp:after { + border-bottom: none; + border-left: 4px solid transparent; + border-right: 4px solid transparent; + border-top: 4px solid #000; + visibility: visible; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; + filter: alpha(opacity=60); + -khtml-opacity: 0.6; + -moz-opacity: 0.6; + opacity: 0.6; +} +table .blue { + color: #049cdb; + border-bottom-color: #049cdb; +} +table .headerSortUp.blue, table .headerSortDown.blue { + background-color: #ade6fe; +} +table .green { + color: #46a546; + border-bottom-color: #46a546; +} +table .headerSortUp.green, table .headerSortDown.green { + background-color: #cdeacd; +} +table .red { + color: #9d261d; + border-bottom-color: #9d261d; +} +table .headerSortUp.red, table .headerSortDown.red { + background-color: #f4c8c5; +} +table .yellow { + color: #ffc40d; + border-bottom-color: #ffc40d; +} +table .headerSortUp.yellow, table .headerSortDown.yellow { + background-color: #fff6d9; +} +table .orange { + color: #f89406; + border-bottom-color: #f89406; +} +table .headerSortUp.orange, table .headerSortDown.orange { + background-color: #fee9cc; +} +table .purple { + color: #7a43b6; + border-bottom-color: #7a43b6; +} +table .headerSortUp.purple, table .headerSortDown.purple { + background-color: #e2d5f0; +} +/* Patterns.less + * Repeatable UI elements outside the base styles provided from the scaffolding + * ---------------------------------------------------------------------------- */ +.topbar { + height: 40px; + position: fixed; + top: 0; + left: 0; + right: 0; + z-index: 10000; + overflow: visible; +} +.topbar a { + color: #bfbfbf; + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); +} +.topbar h3 a:hover, .topbar .brand:hover, .topbar ul .active > a { + background-color: #333; + background-color: rgba(255, 255, 255, 0.05); + color: #ffffff; + text-decoration: none; +} +.topbar h3 { + position: relative; +} +.topbar h3 a, .topbar .brand { + float: left; + display: block; + padding: 8px 20px 12px; + margin-left: -20px; + color: #ffffff; + font-size: 20px; + font-weight: 200; + line-height: 1; +} +.topbar p { + margin: 0; + line-height: 40px; +} +.topbar p a:hover { + background-color: transparent; + color: #ffffff; +} +.topbar form { + float: left; + margin: 5px 0 0 0; + position: relative; + filter: alpha(opacity=100); + -khtml-opacity: 1; + -moz-opacity: 1; + opacity: 1; +} +.topbar form.pull-right { + float: right; +} +.topbar input { + background-color: #444; + background-color: rgba(255, 255, 255, 0.3); + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: normal; + font-weight: 13px; + line-height: 1; + padding: 4px 9px; + color: #ffffff; + color: rgba(255, 255, 255, 0.75); + border: 1px solid #111; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0px rgba(255, 255, 255, 0.25); + -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0px rgba(255, 255, 255, 0.25); + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0px rgba(255, 255, 255, 0.25); + -webkit-transition: none; + -moz-transition: none; + -ms-transition: none; + -o-transition: none; + transition: none; +} +.topbar input:-moz-placeholder { + color: #e6e6e6; +} +.topbar input::-webkit-input-placeholder { + color: #e6e6e6; +} +.topbar input:hover { + background-color: #bfbfbf; + background-color: rgba(255, 255, 255, 0.5); + color: #ffffff; +} +.topbar input:focus, .topbar input.focused { + outline: 0; + background-color: #ffffff; + color: #404040; + text-shadow: 0 1px 0 #ffffff; + border: 0; + padding: 5px 10px; + -webkit-box-shadow: 0 0 3px rgba(0, 0, 0, 0.15); + -moz-box-shadow: 0 0 3px rgba(0, 0, 0, 0.15); + box-shadow: 0 0 3px rgba(0, 0, 0, 0.15); +} +.topbar-inner, .topbar .fill { + background-color: #222; + background-color: #222222; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#333333), to(#222222)); + background-image: -moz-linear-gradient(top, #333333, #222222); + background-image: -ms-linear-gradient(top, #333333, #222222); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #333333), color-stop(100%, #222222)); + background-image: -webkit-linear-gradient(top, #333333, #222222); + background-image: -o-linear-gradient(top, #333333, #222222); + background-image: linear-gradient(top, #333333, #222222); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#333333', endColorstr='#222222', GradientType=0); + -webkit-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); + -moz-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); + box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); +} +.topbar div > ul, .nav { + display: block; + float: left; + margin: 0 10px 0 0; + position: relative; + left: 0; +} +.topbar div > ul > li, .nav > li { + display: block; + float: left; +} +.topbar div > ul a, .nav a { + display: block; + float: none; + padding: 10px 10px 11px; + line-height: 19px; + text-decoration: none; +} +.topbar div > ul a:hover, .nav a:hover { + color: #ffffff; + text-decoration: none; +} +.topbar div > ul .active > a, .nav .active > a { + background-color: #222; + background-color: rgba(0, 0, 0, 0.5); +} +.topbar div > ul.secondary-nav, .nav.secondary-nav { + float: right; + margin-left: 10px; + margin-right: 0; +} +.topbar div > ul.secondary-nav .menu-dropdown, +.nav.secondary-nav .menu-dropdown, +.topbar div > ul.secondary-nav .dropdown-menu, +.nav.secondary-nav .dropdown-menu { + right: 0; + border: 0; +} +.topbar div > ul a.menu:hover, +.nav a.menu:hover, +.topbar div > ul li.open .menu, +.nav li.open .menu, +.topbar div > ul .dropdown-toggle:hover, +.nav .dropdown-toggle:hover, +.topbar div > ul .dropdown.open .dropdown-toggle, +.nav .dropdown.open .dropdown-toggle { + background: #444; + background: rgba(255, 255, 255, 0.05); +} +.topbar div > ul .menu-dropdown, +.nav .menu-dropdown, +.topbar div > ul .dropdown-menu, +.nav .dropdown-menu { + background-color: #333; +} +.topbar div > ul .menu-dropdown a.menu, +.nav .menu-dropdown a.menu, +.topbar div > ul .dropdown-menu a.menu, +.nav .dropdown-menu a.menu, +.topbar div > ul .menu-dropdown .dropdown-toggle, +.nav .menu-dropdown .dropdown-toggle, +.topbar div > ul .dropdown-menu .dropdown-toggle, +.nav .dropdown-menu .dropdown-toggle { + color: #ffffff; +} +.topbar div > ul .menu-dropdown a.menu.open, +.nav .menu-dropdown a.menu.open, +.topbar div > ul .dropdown-menu a.menu.open, +.nav .dropdown-menu a.menu.open, +.topbar div > ul .menu-dropdown .dropdown-toggle.open, +.nav .menu-dropdown .dropdown-toggle.open, +.topbar div > ul .dropdown-menu .dropdown-toggle.open, +.nav .dropdown-menu .dropdown-toggle.open { + background: #444; + background: rgba(255, 255, 255, 0.05); +} +.topbar div > ul .menu-dropdown li a, +.nav .menu-dropdown li a, +.topbar div > ul .dropdown-menu li a, +.nav .dropdown-menu li a { + color: #999; + text-shadow: 0 1px 0 rgba(0, 0, 0, 0.5); +} +.topbar div > ul .menu-dropdown li a:hover, +.nav .menu-dropdown li a:hover, +.topbar div > ul .dropdown-menu li a:hover, +.nav .dropdown-menu li a:hover { + background-color: #191919; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#292929), to(#191919)); + background-image: -moz-linear-gradient(top, #292929, #191919); + background-image: -ms-linear-gradient(top, #292929, #191919); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #292929), color-stop(100%, #191919)); + background-image: -webkit-linear-gradient(top, #292929, #191919); + background-image: -o-linear-gradient(top, #292929, #191919); + background-image: linear-gradient(top, #292929, #191919); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#292929', endColorstr='#191919', GradientType=0); + color: #ffffff; +} +.topbar div > ul .menu-dropdown .active a, +.nav .menu-dropdown .active a, +.topbar div > ul .dropdown-menu .active a, +.nav .dropdown-menu .active a { + color: #ffffff; +} +.topbar div > ul .menu-dropdown .divider, +.nav .menu-dropdown .divider, +.topbar div > ul .dropdown-menu .divider, +.nav .dropdown-menu .divider { + background-color: #222; + border-color: #444; +} +.topbar ul .menu-dropdown li a, .topbar ul .dropdown-menu li a { + padding: 4px 15px; +} +li.menu, .dropdown { + position: relative; +} +a.menu:after, .dropdown-toggle:after { + width: 0; + height: 0; + display: inline-block; + content: "↓"; + text-indent: -99999px; + vertical-align: top; + margin-top: 8px; + margin-left: 4px; + border-left: 4px solid transparent; + border-right: 4px solid transparent; + border-top: 4px solid #ffffff; + filter: alpha(opacity=50); + -khtml-opacity: 0.5; + -moz-opacity: 0.5; + opacity: 0.5; +} +.menu-dropdown, .dropdown-menu { + background-color: #ffffff; + float: left; + display: none; + position: absolute; + top: 40px; + z-index: 900; + min-width: 160px; + max-width: 220px; + _width: 160px; + margin-left: 0; + margin-right: 0; + padding: 6px 0; + zoom: 1; + border-color: #999; + border-color: rgba(0, 0, 0, 0.2); + border-style: solid; + border-width: 0 1px 1px; + -webkit-border-radius: 0 0 6px 6px; + -moz-border-radius: 0 0 6px 6px; + border-radius: 0 0 6px 6px; + -webkit-box-shadow: 0 2px 4px rgba(0, 0, 0, 0.2); + -moz-box-shadow: 0 2px 4px rgba(0, 0, 0, 0.2); + box-shadow: 0 2px 4px rgba(0, 0, 0, 0.2); + -webkit-background-clip: padding-box; + -moz-background-clip: padding-box; + background-clip: padding-box; +} +.menu-dropdown li, .dropdown-menu li { + float: none; + display: block; + background-color: none; +} +.menu-dropdown .divider, .dropdown-menu .divider { + height: 1px; + margin: 5px 0; + overflow: hidden; + background-color: #eee; + border-bottom: 1px solid #ffffff; +} +.topbar .dropdown-menu a, .dropdown-menu a { + display: block; + padding: 4px 15px; + clear: both; + font-weight: normal; + line-height: 18px; + color: #808080; + text-shadow: 0 1px 0 #ffffff; +} +.topbar .dropdown-menu a:hover, +.dropdown-menu a:hover, +.topbar .dropdown-menu a.hover, +.dropdown-menu a.hover { + background-color: #dddddd; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#eeeeee), to(#dddddd)); + background-image: -moz-linear-gradient(top, #eeeeee, #dddddd); + background-image: -ms-linear-gradient(top, #eeeeee, #dddddd); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #eeeeee), color-stop(100%, #dddddd)); + background-image: -webkit-linear-gradient(top, #eeeeee, #dddddd); + background-image: -o-linear-gradient(top, #eeeeee, #dddddd); + background-image: linear-gradient(top, #eeeeee, #dddddd); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#dddddd', GradientType=0); + color: #404040; + text-decoration: none; + -webkit-box-shadow: inset 0 1px 0 rgba(0, 0, 0, 0.025), inset 0 -1px rgba(0, 0, 0, 0.025); + -moz-box-shadow: inset 0 1px 0 rgba(0, 0, 0, 0.025), inset 0 -1px rgba(0, 0, 0, 0.025); + box-shadow: inset 0 1px 0 rgba(0, 0, 0, 0.025), inset 0 -1px rgba(0, 0, 0, 0.025); +} +.open .menu, +.dropdown.open .menu, +.open .dropdown-toggle, +.dropdown.open .dropdown-toggle { + color: #ffffff; + background: #ccc; + background: rgba(0, 0, 0, 0.3); +} +.open .menu-dropdown, +.dropdown.open .menu-dropdown, +.open .dropdown-menu, +.dropdown.open .dropdown-menu { + display: block; +} +.tabs, .pills { + margin: 0 0 18px; + padding: 0; + list-style: none; + zoom: 1; +} +.tabs:before, +.pills:before, +.tabs:after, +.pills:after { + display: table; + content: ""; + zoom: 1; +} +.tabs:after, .pills:after { + clear: both; +} +.tabs > li, .pills > li { + float: left; +} +.tabs > li > a, .pills > li > a { + display: block; +} +.tabs { + border-color: #ddd; + border-style: solid; + border-width: 0 0 1px; +} +.tabs > li { + position: relative; + margin-bottom: -1px; +} +.tabs > li > a { + padding: 0 15px; + margin-right: 2px; + line-height: 34px; + border: 1px solid transparent; + -webkit-border-radius: 4px 4px 0 0; + -moz-border-radius: 4px 4px 0 0; + border-radius: 4px 4px 0 0; +} +.tabs > li > a:hover { + text-decoration: none; + background-color: #eee; + border-color: #eee #eee #ddd; +} +.tabs .active > a, .tabs .active > a:hover { + color: #808080; + background-color: #ffffff; + border: 1px solid #ddd; + border-bottom-color: transparent; + cursor: default; +} +.tabs .menu-dropdown, .tabs .dropdown-menu { + top: 35px; + border-width: 1px; + -webkit-border-radius: 0 6px 6px 6px; + -moz-border-radius: 0 6px 6px 6px; + border-radius: 0 6px 6px 6px; +} +.tabs a.menu:after, .tabs .dropdown-toggle:after { + border-top-color: #999; + margin-top: 15px; + margin-left: 5px; +} +.tabs li.open.menu .menu, .tabs .open.dropdown .dropdown-toggle { + border-color: #999; +} +.tabs li.open a.menu:after, .tabs .dropdown.open .dropdown-toggle:after { + border-top-color: #555; +} +.pills a { + margin: 5px 3px 5px 0; + padding: 0 15px; + line-height: 30px; + text-shadow: 0 1px 1px #ffffff; + -webkit-border-radius: 15px; + -moz-border-radius: 15px; + border-radius: 15px; +} +.pills a:hover { + color: #ffffff; + text-decoration: none; + text-shadow: 0 1px 1px rgba(0, 0, 0, 0.25); + background-color: #00438a; +} +.pills .active a { + color: #ffffff; + text-shadow: 0 1px 1px rgba(0, 0, 0, 0.25); + background-color: #0069d6; +} +.pills-vertical > li { + float: none; +} +.tab-content > .tab-pane, +.pill-content > .pill-pane, +.tab-content > div, +.pill-content > div { + display: none; +} +.tab-content > .active, .pill-content > .active { + display: block; +} +.breadcrumb { + padding: 7px 14px; + margin: 0 0 18px; + background-color: #f5f5f5; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#ffffff), to(#f5f5f5)); + background-image: -moz-linear-gradient(top, #ffffff, #f5f5f5); + background-image: -ms-linear-gradient(top, #ffffff, #f5f5f5); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #ffffff), color-stop(100%, #f5f5f5)); + background-image: -webkit-linear-gradient(top, #ffffff, #f5f5f5); + background-image: -o-linear-gradient(top, #ffffff, #f5f5f5); + background-image: linear-gradient(top, #ffffff, #f5f5f5); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#f5f5f5', GradientType=0); + border: 1px solid #ddd; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: inset 0 1px 0 #ffffff; + -moz-box-shadow: inset 0 1px 0 #ffffff; + box-shadow: inset 0 1px 0 #ffffff; +} +.breadcrumb li { + display: inline; + text-shadow: 0 1px 0 #ffffff; +} +.breadcrumb .divider { + padding: 0 5px; + color: #bfbfbf; +} +.breadcrumb .active a { + color: #404040; +} +.hero-unit { + background-color: #f5f5f5; + margin-bottom: 30px; + padding: 60px; + -webkit-border-radius: 6px; + -moz-border-radius: 6px; + border-radius: 6px; +} +.hero-unit h1 { + margin-bottom: 0; + font-size: 60px; + line-height: 1; + letter-spacing: -1px; +} +.hero-unit p { + font-size: 18px; + font-weight: 200; + line-height: 27px; +} +footer { + margin-top: 17px; + padding-top: 17px; + border-top: 1px solid #eee; +} +.page-header { + margin-bottom: 17px; + border-bottom: 1px solid #ddd; + -webkit-box-shadow: 0 1px 0 rgba(255, 255, 255, 0.5); + -moz-box-shadow: 0 1px 0 rgba(255, 255, 255, 0.5); + box-shadow: 0 1px 0 rgba(255, 255, 255, 0.5); +} +.page-header h1 { + margin-bottom: 8px; +} +.btn.danger, +.alert-message.danger, +.btn.danger:hover, +.alert-message.danger:hover, +.btn.error, +.alert-message.error, +.btn.error:hover, +.alert-message.error:hover, +.btn.success, +.alert-message.success, +.btn.success:hover, +.alert-message.success:hover, +.btn.info, +.alert-message.info, +.btn.info:hover, +.alert-message.info:hover { + color: #ffffff; +} +.btn .close, .alert-message .close { + font-family: Arial, sans-serif; + line-height: 18px; +} +.btn.danger, +.alert-message.danger, +.btn.error, +.alert-message.error { + background-color: #c43c35; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#ee5f5b), to(#c43c35)); + background-image: -moz-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -ms-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #ee5f5b), color-stop(100%, #c43c35)); + background-image: -webkit-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -o-linear-gradient(top, #ee5f5b, #c43c35); + background-image: linear-gradient(top, #ee5f5b, #c43c35); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#c43c35', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #c43c35 #c43c35 #882a25; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); +} +.btn.success, .alert-message.success { + background-color: #57a957; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#62c462), to(#57a957)); + background-image: -moz-linear-gradient(top, #62c462, #57a957); + background-image: -ms-linear-gradient(top, #62c462, #57a957); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #62c462), color-stop(100%, #57a957)); + background-image: -webkit-linear-gradient(top, #62c462, #57a957); + background-image: -o-linear-gradient(top, #62c462, #57a957); + background-image: linear-gradient(top, #62c462, #57a957); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#62c462', endColorstr='#57a957', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #57a957 #57a957 #3d773d; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); +} +.btn.info, .alert-message.info { + background-color: #339bb9; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#5bc0de), to(#339bb9)); + background-image: -moz-linear-gradient(top, #5bc0de, #339bb9); + background-image: -ms-linear-gradient(top, #5bc0de, #339bb9); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #5bc0de), color-stop(100%, #339bb9)); + background-image: -webkit-linear-gradient(top, #5bc0de, #339bb9); + background-image: -o-linear-gradient(top, #5bc0de, #339bb9); + background-image: linear-gradient(top, #5bc0de, #339bb9); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#5bc0de', endColorstr='#339bb9', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #339bb9 #339bb9 #22697d; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); +} +.btn { + cursor: pointer; + display: inline-block; + background-color: #e6e6e6; + background-repeat: no-repeat; + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), color-stop(25%, #ffffff), to(#e6e6e6)); + background-image: -webkit-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: -moz-linear-gradient(top, #ffffff, #ffffff 25%, #e6e6e6); + background-image: -ms-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: -o-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + background-image: linear-gradient(#ffffff, #ffffff 25%, #e6e6e6); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#e6e6e6', GradientType=0); + padding: 5px 14px 6px; + text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75); + color: #333; + font-size: 13px; + line-height: normal; + border: 1px solid #ccc; + border-bottom-color: #bbb; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + -webkit-transition: 0.1s linear all; + -moz-transition: 0.1s linear all; + -ms-transition: 0.1s linear all; + -o-transition: 0.1s linear all; + transition: 0.1s linear all; +} +.btn:hover { + background-position: 0 -15px; + color: #333; + text-decoration: none; +} +.btn:focus { + outline: 1px dotted #666; +} +.btn.primary { + color: #ffffff; + background-color: #0064cd; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#049cdb), to(#0064cd)); + background-image: -moz-linear-gradient(top, #049cdb, #0064cd); + background-image: -ms-linear-gradient(top, #049cdb, #0064cd); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #049cdb), color-stop(100%, #0064cd)); + background-image: -webkit-linear-gradient(top, #049cdb, #0064cd); + background-image: -o-linear-gradient(top, #049cdb, #0064cd); + background-image: linear-gradient(top, #049cdb, #0064cd); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#049cdb', endColorstr='#0064cd', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #0064cd #0064cd #003f81; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); +} +.btn.active, .btn:active { + -webkit-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.25), 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.25), 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.25), 0 1px 2px rgba(0, 0, 0, 0.05); +} +.btn.disabled { + cursor: default; + background-image: none; + filter: progid:DXImageTransform.Microsoft.gradient(enabled = false); + filter: alpha(opacity=65); + -khtml-opacity: 0.65; + -moz-opacity: 0.65; + opacity: 0.65; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; +} +.btn[disabled] { + cursor: default; + background-image: none; + filter: progid:DXImageTransform.Microsoft.gradient(enabled = false); + filter: alpha(opacity=65); + -khtml-opacity: 0.65; + -moz-opacity: 0.65; + opacity: 0.65; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; +} +.btn.large { + font-size: 15px; + line-height: normal; + padding: 9px 14px 9px; + -webkit-border-radius: 6px; + -moz-border-radius: 6px; + border-radius: 6px; +} +.btn.small { + padding: 7px 9px 7px; + font-size: 11px; +} +:root .alert-message, :root .btn { + border-radius: 0 \0; +} +button.btn::-moz-focus-inner, input[type=submit].btn::-moz-focus-inner { + padding: 0; + border: 0; +} +.close { + float: right; + color: #000000; + font-size: 20px; + font-weight: bold; + line-height: 13.5px; + text-shadow: 0 1px 0 #ffffff; + filter: alpha(opacity=25); + -khtml-opacity: 0.25; + -moz-opacity: 0.25; + opacity: 0.25; +} +.close:hover { + color: #000000; + text-decoration: none; + filter: alpha(opacity=40); + -khtml-opacity: 0.4; + -moz-opacity: 0.4; + opacity: 0.4; +} +.alert-message { + position: relative; + padding: 7px 15px; + margin-bottom: 18px; + color: #404040; + background-color: #eedc94; + background-repeat: repeat-x; + background-image: -khtml-gradient(linear, left top, left bottom, from(#fceec1), to(#eedc94)); + background-image: -moz-linear-gradient(top, #fceec1, #eedc94); + background-image: -ms-linear-gradient(top, #fceec1, #eedc94); + background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0%, #fceec1), color-stop(100%, #eedc94)); + background-image: -webkit-linear-gradient(top, #fceec1, #eedc94); + background-image: -o-linear-gradient(top, #fceec1, #eedc94); + background-image: linear-gradient(top, #fceec1, #eedc94); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#fceec1', endColorstr='#eedc94', GradientType=0); + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + border-color: #eedc94 #eedc94 #e4c652; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5); + border-width: 1px; + border-style: solid; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); + -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.25); +} +.alert-message .close { + margin-top: 1px; + *margin-top: 0; +} +.alert-message a { + font-weight: bold; + color: #404040; +} +.alert-message.danger p a, +.alert-message.error p a, +.alert-message.success p a, +.alert-message.info p a { + color: #ffffff; +} +.alert-message h5 { + line-height: 18px; +} +.alert-message p { + margin-bottom: 0; +} +.alert-message div { + margin-top: 5px; + margin-bottom: 2px; + line-height: 28px; +} +.alert-message .btn { + -webkit-box-shadow: 0 1px 0 rgba(255, 255, 255, 0.25); + -moz-box-shadow: 0 1px 0 rgba(255, 255, 255, 0.25); + box-shadow: 0 1px 0 rgba(255, 255, 255, 0.25); +} +.alert-message.block-message { + background-image: none; + background-color: #fdf5d9; + filter: progid:DXImageTransform.Microsoft.gradient(enabled = false); + padding: 14px; + border-color: #fceec1; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; +} +.alert-message.block-message ul, .alert-message.block-message p { + margin-right: 30px; +} +.alert-message.block-message ul { + margin-bottom: 0; +} +.alert-message.block-message li { + color: #404040; +} +.alert-message.block-message .alert-actions { + margin-top: 5px; +} +.alert-message.block-message.error, .alert-message.block-message.success, .alert-message.block-message.info { + color: #404040; + text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5); +} +.alert-message.block-message.error { + background-color: #fddfde; + border-color: #fbc7c6; +} +.alert-message.block-message.success { + background-color: #d1eed1; + border-color: #bfe7bf; +} +.alert-message.block-message.info { + background-color: #ddf4fb; + border-color: #c6edf9; +} +.alert-message.block-message.danger p a, +.alert-message.block-message.error p a, +.alert-message.block-message.success p a, +.alert-message.block-message.info p a { + color: #404040; +} +.pagination { + height: 36px; + margin: 18px 0; +} +.pagination ul { + float: left; + margin: 0; + border: 1px solid #ddd; + border: 1px solid rgba(0, 0, 0, 0.15); + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05); +} +.pagination li { + display: inline; +} +.pagination a { + float: left; + padding: 0 14px; + line-height: 34px; + border-right: 1px solid; + border-right-color: #ddd; + border-right-color: rgba(0, 0, 0, 0.15); + *border-right-color: #ddd; + /* IE6-7 */ + + text-decoration: none; +} +.pagination a:hover, .pagination .active a { + background-color: #c7eefe; +} +.pagination .disabled a, .pagination .disabled a:hover { + background-color: transparent; + color: #bfbfbf; +} +.pagination .next a { + border: 0; +} +.well { + background-color: #f5f5f5; + margin-bottom: 20px; + padding: 19px; + min-height: 20px; + border: 1px solid #eee; + border: 1px solid rgba(0, 0, 0, 0.05); + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); +} +.well blockquote { + border-color: #ddd; + border-color: rgba(0, 0, 0, 0.15); +} +.modal-backdrop { + background-color: #000000; + position: fixed; + top: 0; + left: 0; + right: 0; + bottom: 0; + z-index: 10000; +} +.modal-backdrop.fade { + opacity: 0; +} +.modal-backdrop, .modal-backdrop.fade.in { + filter: alpha(opacity=80); + -khtml-opacity: 0.8; + -moz-opacity: 0.8; + opacity: 0.8; +} +.modal { + position: fixed; + top: 50%; + left: 50%; + z-index: 11000; + max-height: 500px; + overflow: auto; + width: 560px; + margin: -250px 0 0 -280px; + background-color: #ffffff; + border: 1px solid #999; + border: 1px solid rgba(0, 0, 0, 0.3); + *border: 1px solid #999; + /* IE6-7 */ + + -webkit-border-radius: 6px; + -moz-border-radius: 6px; + border-radius: 6px; + -webkit-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); + -moz-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); + box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); + -webkit-background-clip: padding-box; + -moz-background-clip: padding-box; + background-clip: padding-box; +} +.modal .close { + margin-top: 7px; +} +.modal.fade { + -webkit-transition: opacity .3s linear, top .3s ease-out; + -moz-transition: opacity .3s linear, top .3s ease-out; + -ms-transition: opacity .3s linear, top .3s ease-out; + -o-transition: opacity .3s linear, top .3s ease-out; + transition: opacity .3s linear, top .3s ease-out; + top: -25%; +} +.modal.fade.in { + top: 50%; +} +.modal-header { + border-bottom: 1px solid #eee; + padding: 5px 15px; +} +.modal-body { + padding: 15px; +} +.modal-body form { + margin-bottom: 0; +} +.modal-footer { + background-color: #f5f5f5; + padding: 14px 15px 15px; + border-top: 1px solid #ddd; + -webkit-border-radius: 0 0 6px 6px; + -moz-border-radius: 0 0 6px 6px; + border-radius: 0 0 6px 6px; + -webkit-box-shadow: inset 0 1px 0 #ffffff; + -moz-box-shadow: inset 0 1px 0 #ffffff; + box-shadow: inset 0 1px 0 #ffffff; + zoom: 1; + margin-bottom: 0; +} +.modal-footer:before, .modal-footer:after { + display: table; + content: ""; + zoom: 1; +} +.modal-footer:after { + clear: both; +} +.modal-footer .btn { + float: right; + margin-left: 5px; +} +.modal .popover, .modal .twipsy { + z-index: 12000; +} +.twipsy { + display: block; + position: absolute; + visibility: visible; + padding: 5px; + font-size: 11px; + z-index: 1000; + filter: alpha(opacity=80); + -khtml-opacity: 0.8; + -moz-opacity: 0.8; + opacity: 0.8; +} +.twipsy.fade.in { + filter: alpha(opacity=80); + -khtml-opacity: 0.8; + -moz-opacity: 0.8; + opacity: 0.8; +} +.twipsy.above .twipsy-arrow { + bottom: 0; + left: 50%; + margin-left: -5px; + border-left: 5px solid transparent; + border-right: 5px solid transparent; + border-top: 5px solid #000000; +} +.twipsy.left .twipsy-arrow { + top: 50%; + right: 0; + margin-top: -5px; + border-top: 5px solid transparent; + border-bottom: 5px solid transparent; + border-left: 5px solid #000000; +} +.twipsy.below .twipsy-arrow { + top: 0; + left: 50%; + margin-left: -5px; + border-left: 5px solid transparent; + border-right: 5px solid transparent; + border-bottom: 5px solid #000000; +} +.twipsy.right .twipsy-arrow { + top: 50%; + left: 0; + margin-top: -5px; + border-top: 5px solid transparent; + border-bottom: 5px solid transparent; + border-right: 5px solid #000000; +} +.twipsy-inner { + padding: 3px 8px; + background-color: #000000; + color: white; + text-align: center; + max-width: 200px; + text-decoration: none; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} +.twipsy-arrow { + position: absolute; + width: 0; + height: 0; +} +.popover { + position: absolute; + top: 0; + left: 0; + z-index: 1000; + padding: 5px; + display: none; +} +.popover.above .arrow { + bottom: 0; + left: 50%; + margin-left: -5px; + border-left: 5px solid transparent; + border-right: 5px solid transparent; + border-top: 5px solid #000000; +} +.popover.right .arrow { + top: 50%; + left: 0; + margin-top: -5px; + border-top: 5px solid transparent; + border-bottom: 5px solid transparent; + border-right: 5px solid #000000; +} +.popover.below .arrow { + top: 0; + left: 50%; + margin-left: -5px; + border-left: 5px solid transparent; + border-right: 5px solid transparent; + border-bottom: 5px solid #000000; +} +.popover.left .arrow { + top: 50%; + right: 0; + margin-top: -5px; + border-top: 5px solid transparent; + border-bottom: 5px solid transparent; + border-left: 5px solid #000000; +} +.popover .arrow { + position: absolute; + width: 0; + height: 0; +} +.popover .inner { + background: #000000; + background: rgba(0, 0, 0, 0.8); + padding: 3px; + overflow: hidden; + width: 280px; + -webkit-border-radius: 6px; + -moz-border-radius: 6px; + border-radius: 6px; + -webkit-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); + -moz-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); + box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); +} +.popover .title { + background-color: #f5f5f5; + padding: 9px 15px; + line-height: 1; + -webkit-border-radius: 3px 3px 0 0; + -moz-border-radius: 3px 3px 0 0; + border-radius: 3px 3px 0 0; + border-bottom: 1px solid #eee; +} +.popover .content { + background-color: #ffffff; + padding: 14px; + -webkit-border-radius: 0 0 3px 3px; + -moz-border-radius: 0 0 3px 3px; + border-radius: 0 0 3px 3px; + -webkit-background-clip: padding-box; + -moz-background-clip: padding-box; + background-clip: padding-box; +} +.popover .content p, .popover .content ul, .popover .content ol { + margin-bottom: 0; +} +.fade { + -webkit-transition: opacity 0.15s linear; + -moz-transition: opacity 0.15s linear; + -ms-transition: opacity 0.15s linear; + -o-transition: opacity 0.15s linear; + transition: opacity 0.15s linear; + opacity: 0; +} +.fade.in { + opacity: 1; +} +.label { + padding: 1px 3px 2px; + font-size: 9.75px; + font-weight: bold; + color: #ffffff; + text-transform: uppercase; + white-space: nowrap; + background-color: #bfbfbf; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; + text-shadow: none; +} +.label.important { + background-color: #c43c35; +} +.label.warning { + background-color: #f89406; +} +.label.success { + background-color: #46a546; +} +.label.notice { + background-color: #62cffc; +} +.media-grid { + margin-left: -20px; + margin-bottom: 0; + zoom: 1; +} +.media-grid:before, .media-grid:after { + display: table; + content: ""; + zoom: 1; +} +.media-grid:after { + clear: both; +} +.media-grid li { + display: inline; +} +.media-grid a { + float: left; + padding: 4px; + margin: 0 0 18px 20px; + border: 1px solid #ddd; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075); + -moz-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075); + box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075); +} +.media-grid a img { + display: block; +} +.media-grid a:hover { + border-color: #0069d6; + -webkit-box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25); + -moz-box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25); + box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25); +} \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap.min.css b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap.min.css new file mode 100644 index 0000000000..140f731dfa --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/css/bootstrap.min.css @@ -0,0 +1,9 @@ +/*! + * Bootstrap v2.2.2 + * + * Copyright 2012 Twitter, Inc + * Licensed under the Apache License v2.0 + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Designed and built with all the love in the world @twitter by @mdo and @fat. + */article,aside,details,figcaption,figure,footer,header,hgroup,nav,section{display:block}audio,canvas,video{display:inline-block;*display:inline;*zoom:1}audio:not([controls]){display:none}html{font-size:100%;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%}a:focus{outline:thin dotted #333;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}a:hover,a:active{outline:0}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sup{top:-0.5em}sub{bottom:-0.25em}img{width:auto\9;height:auto;max-width:100%;vertical-align:middle;border:0;-ms-interpolation-mode:bicubic}#map_canvas img,.google-maps img{max-width:none}button,input,select,textarea{margin:0;font-size:100%;vertical-align:middle}button,input{*overflow:visible;line-height:normal}button::-moz-focus-inner,input::-moz-focus-inner{padding:0;border:0}button,html input[type="button"],input[type="reset"],input[type="submit"]{cursor:pointer;-webkit-appearance:button}label,select,button,input[type="button"],input[type="reset"],input[type="submit"],input[type="radio"],input[type="checkbox"]{cursor:pointer}input[type="search"]{-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;-webkit-appearance:textfield}input[type="search"]::-webkit-search-decoration,input[type="search"]::-webkit-search-cancel-button{-webkit-appearance:none}textarea{overflow:auto;vertical-align:top}@media print{*{color:#000!important;text-shadow:none!important;background:transparent!important;box-shadow:none!important}a,a:visited{text-decoration:underline}a[href]:after{content:" (" attr(href) ")"}abbr[title]:after{content:" (" attr(title) ")"}.ir a:after,a[href^="javascript:"]:after,a[href^="#"]:after{content:""}pre,blockquote{border:1px solid #999;page-break-inside:avoid}thead{display:table-header-group}tr,img{page-break-inside:avoid}img{max-width:100%!important}@page{margin:.5cm}p,h2,h3{orphans:3;widows:3}h2,h3{page-break-after:avoid}}.clearfix{*zoom:1}.clearfix:before,.clearfix:after{display:table;line-height:0;content:""}.clearfix:after{clear:both}.hide-text{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.input-block-level{display:block;width:100%;min-height:30px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}body{margin:0;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:14px;line-height:20px;color:#333;background-color:#fff}a{color:#08c;text-decoration:none}a:hover{color:#005580;text-decoration:underline}.img-rounded{-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px}.img-polaroid{padding:4px;background-color:#fff;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.2);-webkit-box-shadow:0 1px 3px rgba(0,0,0,0.1);-moz-box-shadow:0 1px 3px rgba(0,0,0,0.1);box-shadow:0 1px 3px rgba(0,0,0,0.1)}.img-circle{-webkit-border-radius:500px;-moz-border-radius:500px;border-radius:500px}.row{margin-left:-20px;*zoom:1}.row:before,.row:after{display:table;line-height:0;content:""}.row:after{clear:both}[class*="span"]{float:left;min-height:1px;margin-left:20px}.container,.navbar-static-top .container,.navbar-fixed-top .container,.navbar-fixed-bottom .container{width:940px}.span12{width:940px}.span11{width:860px}.span10{width:780px}.span9{width:700px}.span8{width:620px}.span7{width:540px}.span6{width:460px}.span5{width:380px}.span4{width:300px}.span3{width:220px}.span2{width:140px}.span1{width:60px}.offset12{margin-left:980px}.offset11{margin-left:900px}.offset10{margin-left:820px}.offset9{margin-left:740px}.offset8{margin-left:660px}.offset7{margin-left:580px}.offset6{margin-left:500px}.offset5{margin-left:420px}.offset4{margin-left:340px}.offset3{margin-left:260px}.offset2{margin-left:180px}.offset1{margin-left:100px}.row-fluid{width:100%;*zoom:1}.row-fluid:before,.row-fluid:after{display:table;line-height:0;content:""}.row-fluid:after{clear:both}.row-fluid [class*="span"]{display:block;float:left;width:100%;min-height:30px;margin-left:2.127659574468085%;*margin-left:2.074468085106383%;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.row-fluid [class*="span"]:first-child{margin-left:0}.row-fluid .controls-row [class*="span"]+[class*="span"]{margin-left:2.127659574468085%}.row-fluid .span12{width:100%;*width:99.94680851063829%}.row-fluid .span11{width:91.48936170212765%;*width:91.43617021276594%}.row-fluid .span10{width:82.97872340425532%;*width:82.92553191489361%}.row-fluid .span9{width:74.46808510638297%;*width:74.41489361702126%}.row-fluid .span8{width:65.95744680851064%;*width:65.90425531914893%}.row-fluid .span7{width:57.44680851063829%;*width:57.39361702127659%}.row-fluid .span6{width:48.93617021276595%;*width:48.88297872340425%}.row-fluid .span5{width:40.42553191489362%;*width:40.37234042553192%}.row-fluid .span4{width:31.914893617021278%;*width:31.861702127659576%}.row-fluid .span3{width:23.404255319148934%;*width:23.351063829787233%}.row-fluid .span2{width:14.893617021276595%;*width:14.840425531914894%}.row-fluid .span1{width:6.382978723404255%;*width:6.329787234042553%}.row-fluid .offset12{margin-left:104.25531914893617%;*margin-left:104.14893617021275%}.row-fluid .offset12:first-child{margin-left:102.12765957446808%;*margin-left:102.02127659574467%}.row-fluid .offset11{margin-left:95.74468085106382%;*margin-left:95.6382978723404%}.row-fluid .offset11:first-child{margin-left:93.61702127659574%;*margin-left:93.51063829787232%}.row-fluid .offset10{margin-left:87.23404255319149%;*margin-left:87.12765957446807%}.row-fluid .offset10:first-child{margin-left:85.1063829787234%;*margin-left:84.99999999999999%}.row-fluid .offset9{margin-left:78.72340425531914%;*margin-left:78.61702127659572%}.row-fluid .offset9:first-child{margin-left:76.59574468085106%;*margin-left:76.48936170212764%}.row-fluid .offset8{margin-left:70.2127659574468%;*margin-left:70.10638297872339%}.row-fluid .offset8:first-child{margin-left:68.08510638297872%;*margin-left:67.9787234042553%}.row-fluid .offset7{margin-left:61.70212765957446%;*margin-left:61.59574468085106%}.row-fluid .offset7:first-child{margin-left:59.574468085106375%;*margin-left:59.46808510638297%}.row-fluid .offset6{margin-left:53.191489361702125%;*margin-left:53.085106382978715%}.row-fluid .offset6:first-child{margin-left:51.063829787234035%;*margin-left:50.95744680851063%}.row-fluid .offset5{margin-left:44.68085106382979%;*margin-left:44.57446808510638%}.row-fluid .offset5:first-child{margin-left:42.5531914893617%;*margin-left:42.4468085106383%}.row-fluid .offset4{margin-left:36.170212765957444%;*margin-left:36.06382978723405%}.row-fluid .offset4:first-child{margin-left:34.04255319148936%;*margin-left:33.93617021276596%}.row-fluid .offset3{margin-left:27.659574468085104%;*margin-left:27.5531914893617%}.row-fluid .offset3:first-child{margin-left:25.53191489361702%;*margin-left:25.425531914893618%}.row-fluid .offset2{margin-left:19.148936170212764%;*margin-left:19.04255319148936%}.row-fluid .offset2:first-child{margin-left:17.02127659574468%;*margin-left:16.914893617021278%}.row-fluid .offset1{margin-left:10.638297872340425%;*margin-left:10.53191489361702%}.row-fluid .offset1:first-child{margin-left:8.51063829787234%;*margin-left:8.404255319148938%}[class*="span"].hide,.row-fluid [class*="span"].hide{display:none}[class*="span"].pull-right,.row-fluid [class*="span"].pull-right{float:right}.container{margin-right:auto;margin-left:auto;*zoom:1}.container:before,.container:after{display:table;line-height:0;content:""}.container:after{clear:both}.container-fluid{padding-right:20px;padding-left:20px;*zoom:1}.container-fluid:before,.container-fluid:after{display:table;line-height:0;content:""}.container-fluid:after{clear:both}p{margin:0 0 10px}.lead{margin-bottom:20px;font-size:21px;font-weight:200;line-height:30px}small{font-size:85%}strong{font-weight:bold}em{font-style:italic}cite{font-style:normal}.muted{color:#999}a.muted:hover{color:#808080}.text-warning{color:#c09853}a.text-warning:hover{color:#a47e3c}.text-error{color:#b94a48}a.text-error:hover{color:#953b39}.text-info{color:#3a87ad}a.text-info:hover{color:#2d6987}.text-success{color:#468847}a.text-success:hover{color:#356635}h1,h2,h3,h4,h5,h6{margin:10px 0;font-family:inherit;font-weight:bold;line-height:20px;color:inherit;text-rendering:optimizelegibility}h1 small,h2 small,h3 small,h4 small,h5 small,h6 small{font-weight:normal;line-height:1;color:#999}h1,h2,h3{line-height:40px}h1{font-size:38.5px}h2{font-size:31.5px}h3{font-size:24.5px}h4{font-size:17.5px}h5{font-size:14px}h6{font-size:11.9px}h1 small{font-size:24.5px}h2 small{font-size:17.5px}h3 small{font-size:14px}h4 small{font-size:14px}.page-header{padding-bottom:9px;margin:20px 0 30px;border-bottom:1px solid #eee}ul,ol{padding:0;margin:0 0 10px 25px}ul ul,ul ol,ol ol,ol ul{margin-bottom:0}li{line-height:20px}ul.unstyled,ol.unstyled{margin-left:0;list-style:none}ul.inline,ol.inline{margin-left:0;list-style:none}ul.inline>li,ol.inline>li{display:inline-block;padding-right:5px;padding-left:5px}dl{margin-bottom:20px}dt,dd{line-height:20px}dt{font-weight:bold}dd{margin-left:10px}.dl-horizontal{*zoom:1}.dl-horizontal:before,.dl-horizontal:after{display:table;line-height:0;content:""}.dl-horizontal:after{clear:both}.dl-horizontal dt{float:left;width:160px;overflow:hidden;clear:left;text-align:right;text-overflow:ellipsis;white-space:nowrap}.dl-horizontal dd{margin-left:180px}hr{margin:20px 0;border:0;border-top:1px solid #eee;border-bottom:1px solid #fff}abbr[title],abbr[data-original-title]{cursor:help;border-bottom:1px dotted #999}abbr.initialism{font-size:90%;text-transform:uppercase}blockquote{padding:0 0 0 15px;margin:0 0 20px;border-left:5px solid #eee}blockquote p{margin-bottom:0;font-size:16px;font-weight:300;line-height:25px}blockquote small{display:block;line-height:20px;color:#999}blockquote small:before{content:'\2014 \00A0'}blockquote.pull-right{float:right;padding-right:15px;padding-left:0;border-right:5px solid #eee;border-left:0}blockquote.pull-right p,blockquote.pull-right small{text-align:right}blockquote.pull-right small:before{content:''}blockquote.pull-right small:after{content:'\00A0 \2014'}q:before,q:after,blockquote:before,blockquote:after{content:""}address{display:block;margin-bottom:20px;font-style:normal;line-height:20px}code,pre{padding:0 3px 2px;font-family:Monaco,Menlo,Consolas,"Courier New",monospace;font-size:12px;color:#333;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}code{padding:2px 4px;color:#d14;white-space:nowrap;background-color:#f7f7f9;border:1px solid #e1e1e8}pre{display:block;padding:9.5px;margin:0 0 10px;font-size:13px;line-height:20px;word-break:break-all;word-wrap:break-word;white-space:pre;white-space:pre-wrap;background-color:#f5f5f5;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.15);-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}pre.prettyprint{margin-bottom:20px}pre code{padding:0;color:inherit;white-space:pre;white-space:pre-wrap;background-color:transparent;border:0}.pre-scrollable{max-height:340px;overflow-y:scroll}form{margin:0 0 20px}fieldset{padding:0;margin:0;border:0}legend{display:block;width:100%;padding:0;margin-bottom:20px;font-size:21px;line-height:40px;color:#333;border:0;border-bottom:1px solid #e5e5e5}legend small{font-size:15px;color:#999}label,input,button,select,textarea{font-size:14px;font-weight:normal;line-height:20px}input,button,select,textarea{font-family:"Helvetica Neue",Helvetica,Arial,sans-serif}label{display:block;margin-bottom:5px}select,textarea,input[type="text"],input[type="password"],input[type="datetime"],input[type="datetime-local"],input[type="date"],input[type="month"],input[type="time"],input[type="week"],input[type="number"],input[type="email"],input[type="url"],input[type="search"],input[type="tel"],input[type="color"],.uneditable-input{display:inline-block;height:20px;padding:4px 6px;margin-bottom:10px;font-size:14px;line-height:20px;color:#555;vertical-align:middle;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}input,textarea,.uneditable-input{width:206px}textarea{height:auto}textarea,input[type="text"],input[type="password"],input[type="datetime"],input[type="datetime-local"],input[type="date"],input[type="month"],input[type="time"],input[type="week"],input[type="number"],input[type="email"],input[type="url"],input[type="search"],input[type="tel"],input[type="color"],.uneditable-input{background-color:#fff;border:1px solid #ccc;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);-webkit-transition:border linear .2s,box-shadow linear .2s;-moz-transition:border linear .2s,box-shadow linear .2s;-o-transition:border linear .2s,box-shadow linear .2s;transition:border linear .2s,box-shadow linear .2s}textarea:focus,input[type="text"]:focus,input[type="password"]:focus,input[type="datetime"]:focus,input[type="datetime-local"]:focus,input[type="date"]:focus,input[type="month"]:focus,input[type="time"]:focus,input[type="week"]:focus,input[type="number"]:focus,input[type="email"]:focus,input[type="url"]:focus,input[type="search"]:focus,input[type="tel"]:focus,input[type="color"]:focus,.uneditable-input:focus{border-color:rgba(82,168,236,0.8);outline:0;outline:thin dotted \9;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 8px rgba(82,168,236,0.6);-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 8px rgba(82,168,236,0.6);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 8px rgba(82,168,236,0.6)}input[type="radio"],input[type="checkbox"]{margin:4px 0 0;margin-top:1px \9;*margin-top:0;line-height:normal}input[type="file"],input[type="image"],input[type="submit"],input[type="reset"],input[type="button"],input[type="radio"],input[type="checkbox"]{width:auto}select,input[type="file"]{height:30px;*margin-top:4px;line-height:30px}select{width:220px;background-color:#fff;border:1px solid #ccc}select[multiple],select[size]{height:auto}select:focus,input[type="file"]:focus,input[type="radio"]:focus,input[type="checkbox"]:focus{outline:thin dotted #333;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}.uneditable-input,.uneditable-textarea{color:#999;cursor:not-allowed;background-color:#fcfcfc;border-color:#ccc;-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,0.025);-moz-box-shadow:inset 0 1px 2px rgba(0,0,0,0.025);box-shadow:inset 0 1px 2px rgba(0,0,0,0.025)}.uneditable-input{overflow:hidden;white-space:nowrap}.uneditable-textarea{width:auto;height:auto}input:-moz-placeholder,textarea:-moz-placeholder{color:#999}input:-ms-input-placeholder,textarea:-ms-input-placeholder{color:#999}input::-webkit-input-placeholder,textarea::-webkit-input-placeholder{color:#999}.radio,.checkbox{min-height:20px;padding-left:20px}.radio input[type="radio"],.checkbox input[type="checkbox"]{float:left;margin-left:-20px}.controls>.radio:first-child,.controls>.checkbox:first-child{padding-top:5px}.radio.inline,.checkbox.inline{display:inline-block;padding-top:5px;margin-bottom:0;vertical-align:middle}.radio.inline+.radio.inline,.checkbox.inline+.checkbox.inline{margin-left:10px}.input-mini{width:60px}.input-small{width:90px}.input-medium{width:150px}.input-large{width:210px}.input-xlarge{width:270px}.input-xxlarge{width:530px}input[class*="span"],select[class*="span"],textarea[class*="span"],.uneditable-input[class*="span"],.row-fluid input[class*="span"],.row-fluid select[class*="span"],.row-fluid textarea[class*="span"],.row-fluid .uneditable-input[class*="span"]{float:none;margin-left:0}.input-append input[class*="span"],.input-append .uneditable-input[class*="span"],.input-prepend input[class*="span"],.input-prepend .uneditable-input[class*="span"],.row-fluid input[class*="span"],.row-fluid select[class*="span"],.row-fluid textarea[class*="span"],.row-fluid .uneditable-input[class*="span"],.row-fluid .input-prepend [class*="span"],.row-fluid .input-append [class*="span"]{display:inline-block}input,textarea,.uneditable-input{margin-left:0}.controls-row [class*="span"]+[class*="span"]{margin-left:20px}input.span12,textarea.span12,.uneditable-input.span12{width:926px}input.span11,textarea.span11,.uneditable-input.span11{width:846px}input.span10,textarea.span10,.uneditable-input.span10{width:766px}input.span9,textarea.span9,.uneditable-input.span9{width:686px}input.span8,textarea.span8,.uneditable-input.span8{width:606px}input.span7,textarea.span7,.uneditable-input.span7{width:526px}input.span6,textarea.span6,.uneditable-input.span6{width:446px}input.span5,textarea.span5,.uneditable-input.span5{width:366px}input.span4,textarea.span4,.uneditable-input.span4{width:286px}input.span3,textarea.span3,.uneditable-input.span3{width:206px}input.span2,textarea.span2,.uneditable-input.span2{width:126px}input.span1,textarea.span1,.uneditable-input.span1{width:46px}.controls-row{*zoom:1}.controls-row:before,.controls-row:after{display:table;line-height:0;content:""}.controls-row:after{clear:both}.controls-row [class*="span"],.row-fluid .controls-row [class*="span"]{float:left}.controls-row .checkbox[class*="span"],.controls-row .radio[class*="span"]{padding-top:5px}input[disabled],select[disabled],textarea[disabled],input[readonly],select[readonly],textarea[readonly]{cursor:not-allowed;background-color:#eee}input[type="radio"][disabled],input[type="checkbox"][disabled],input[type="radio"][readonly],input[type="checkbox"][readonly]{background-color:transparent}.control-group.warning .control-label,.control-group.warning .help-block,.control-group.warning .help-inline{color:#c09853}.control-group.warning .checkbox,.control-group.warning .radio,.control-group.warning input,.control-group.warning select,.control-group.warning textarea{color:#c09853}.control-group.warning input,.control-group.warning select,.control-group.warning textarea{border-color:#c09853;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075)}.control-group.warning input:focus,.control-group.warning select:focus,.control-group.warning textarea:focus{border-color:#a47e3c;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #dbc59e;-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #dbc59e;box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #dbc59e}.control-group.warning .input-prepend .add-on,.control-group.warning .input-append .add-on{color:#c09853;background-color:#fcf8e3;border-color:#c09853}.control-group.error .control-label,.control-group.error .help-block,.control-group.error .help-inline{color:#b94a48}.control-group.error .checkbox,.control-group.error .radio,.control-group.error input,.control-group.error select,.control-group.error textarea{color:#b94a48}.control-group.error input,.control-group.error select,.control-group.error textarea{border-color:#b94a48;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075)}.control-group.error input:focus,.control-group.error select:focus,.control-group.error textarea:focus{border-color:#953b39;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #d59392;-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #d59392;box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #d59392}.control-group.error .input-prepend .add-on,.control-group.error .input-append .add-on{color:#b94a48;background-color:#f2dede;border-color:#b94a48}.control-group.success .control-label,.control-group.success .help-block,.control-group.success .help-inline{color:#468847}.control-group.success .checkbox,.control-group.success .radio,.control-group.success input,.control-group.success select,.control-group.success textarea{color:#468847}.control-group.success input,.control-group.success select,.control-group.success textarea{border-color:#468847;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075)}.control-group.success input:focus,.control-group.success select:focus,.control-group.success textarea:focus{border-color:#356635;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #7aba7b;-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #7aba7b;box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #7aba7b}.control-group.success .input-prepend .add-on,.control-group.success .input-append .add-on{color:#468847;background-color:#dff0d8;border-color:#468847}.control-group.info .control-label,.control-group.info .help-block,.control-group.info .help-inline{color:#3a87ad}.control-group.info .checkbox,.control-group.info .radio,.control-group.info input,.control-group.info select,.control-group.info textarea{color:#3a87ad}.control-group.info input,.control-group.info select,.control-group.info textarea{border-color:#3a87ad;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075)}.control-group.info input:focus,.control-group.info select:focus,.control-group.info textarea:focus{border-color:#2d6987;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #7ab5d3;-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #7ab5d3;box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 6px #7ab5d3}.control-group.info .input-prepend .add-on,.control-group.info .input-append .add-on{color:#3a87ad;background-color:#d9edf7;border-color:#3a87ad}input:focus:invalid,textarea:focus:invalid,select:focus:invalid{color:#b94a48;border-color:#ee5f5b}input:focus:invalid:focus,textarea:focus:invalid:focus,select:focus:invalid:focus{border-color:#e9322d;-webkit-box-shadow:0 0 6px #f8b9b7;-moz-box-shadow:0 0 6px #f8b9b7;box-shadow:0 0 6px #f8b9b7}.form-actions{padding:19px 20px 20px;margin-top:20px;margin-bottom:20px;background-color:#f5f5f5;border-top:1px solid #e5e5e5;*zoom:1}.form-actions:before,.form-actions:after{display:table;line-height:0;content:""}.form-actions:after{clear:both}.help-block,.help-inline{color:#595959}.help-block{display:block;margin-bottom:10px}.help-inline{display:inline-block;*display:inline;padding-left:5px;vertical-align:middle;*zoom:1}.input-append,.input-prepend{margin-bottom:5px;font-size:0;white-space:nowrap}.input-append input,.input-prepend input,.input-append select,.input-prepend select,.input-append .uneditable-input,.input-prepend .uneditable-input,.input-append .dropdown-menu,.input-prepend .dropdown-menu{font-size:14px}.input-append input,.input-prepend input,.input-append select,.input-prepend select,.input-append .uneditable-input,.input-prepend .uneditable-input{position:relative;margin-bottom:0;*margin-left:0;vertical-align:top;-webkit-border-radius:0 4px 4px 0;-moz-border-radius:0 4px 4px 0;border-radius:0 4px 4px 0}.input-append input:focus,.input-prepend input:focus,.input-append select:focus,.input-prepend select:focus,.input-append .uneditable-input:focus,.input-prepend .uneditable-input:focus{z-index:2}.input-append .add-on,.input-prepend .add-on{display:inline-block;width:auto;height:20px;min-width:16px;padding:4px 5px;font-size:14px;font-weight:normal;line-height:20px;text-align:center;text-shadow:0 1px 0 #fff;background-color:#eee;border:1px solid #ccc}.input-append .add-on,.input-prepend .add-on,.input-append .btn,.input-prepend .btn,.input-append .btn-group>.dropdown-toggle,.input-prepend .btn-group>.dropdown-toggle{vertical-align:top;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.input-append .active,.input-prepend .active{background-color:#a9dba9;border-color:#46a546}.input-prepend .add-on,.input-prepend .btn{margin-right:-1px}.input-prepend .add-on:first-child,.input-prepend .btn:first-child{-webkit-border-radius:4px 0 0 4px;-moz-border-radius:4px 0 0 4px;border-radius:4px 0 0 4px}.input-append input,.input-append select,.input-append .uneditable-input{-webkit-border-radius:4px 0 0 4px;-moz-border-radius:4px 0 0 4px;border-radius:4px 0 0 4px}.input-append input+.btn-group .btn:last-child,.input-append select+.btn-group .btn:last-child,.input-append .uneditable-input+.btn-group .btn:last-child{-webkit-border-radius:0 4px 4px 0;-moz-border-radius:0 4px 4px 0;border-radius:0 4px 4px 0}.input-append .add-on,.input-append .btn,.input-append .btn-group{margin-left:-1px}.input-append .add-on:last-child,.input-append .btn:last-child,.input-append .btn-group:last-child>.dropdown-toggle{-webkit-border-radius:0 4px 4px 0;-moz-border-radius:0 4px 4px 0;border-radius:0 4px 4px 0}.input-prepend.input-append input,.input-prepend.input-append select,.input-prepend.input-append .uneditable-input{-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.input-prepend.input-append input+.btn-group .btn,.input-prepend.input-append select+.btn-group .btn,.input-prepend.input-append .uneditable-input+.btn-group .btn{-webkit-border-radius:0 4px 4px 0;-moz-border-radius:0 4px 4px 0;border-radius:0 4px 4px 0}.input-prepend.input-append .add-on:first-child,.input-prepend.input-append .btn:first-child{margin-right:-1px;-webkit-border-radius:4px 0 0 4px;-moz-border-radius:4px 0 0 4px;border-radius:4px 0 0 4px}.input-prepend.input-append .add-on:last-child,.input-prepend.input-append .btn:last-child{margin-left:-1px;-webkit-border-radius:0 4px 4px 0;-moz-border-radius:0 4px 4px 0;border-radius:0 4px 4px 0}.input-prepend.input-append .btn-group:first-child{margin-left:0}input.search-query{padding-right:14px;padding-right:4px \9;padding-left:14px;padding-left:4px \9;margin-bottom:0;-webkit-border-radius:15px;-moz-border-radius:15px;border-radius:15px}.form-search .input-append .search-query,.form-search .input-prepend .search-query{-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.form-search .input-append .search-query{-webkit-border-radius:14px 0 0 14px;-moz-border-radius:14px 0 0 14px;border-radius:14px 0 0 14px}.form-search .input-append .btn{-webkit-border-radius:0 14px 14px 0;-moz-border-radius:0 14px 14px 0;border-radius:0 14px 14px 0}.form-search .input-prepend .search-query{-webkit-border-radius:0 14px 14px 0;-moz-border-radius:0 14px 14px 0;border-radius:0 14px 14px 0}.form-search .input-prepend .btn{-webkit-border-radius:14px 0 0 14px;-moz-border-radius:14px 0 0 14px;border-radius:14px 0 0 14px}.form-search input,.form-inline input,.form-horizontal input,.form-search textarea,.form-inline textarea,.form-horizontal textarea,.form-search select,.form-inline select,.form-horizontal select,.form-search .help-inline,.form-inline .help-inline,.form-horizontal .help-inline,.form-search .uneditable-input,.form-inline .uneditable-input,.form-horizontal .uneditable-input,.form-search .input-prepend,.form-inline .input-prepend,.form-horizontal .input-prepend,.form-search .input-append,.form-inline .input-append,.form-horizontal .input-append{display:inline-block;*display:inline;margin-bottom:0;vertical-align:middle;*zoom:1}.form-search .hide,.form-inline .hide,.form-horizontal .hide{display:none}.form-search label,.form-inline label,.form-search .btn-group,.form-inline .btn-group{display:inline-block}.form-search .input-append,.form-inline .input-append,.form-search .input-prepend,.form-inline .input-prepend{margin-bottom:0}.form-search .radio,.form-search .checkbox,.form-inline .radio,.form-inline .checkbox{padding-left:0;margin-bottom:0;vertical-align:middle}.form-search .radio input[type="radio"],.form-search .checkbox input[type="checkbox"],.form-inline .radio input[type="radio"],.form-inline .checkbox input[type="checkbox"]{float:left;margin-right:3px;margin-left:0}.control-group{margin-bottom:10px}legend+.control-group{margin-top:20px;-webkit-margin-top-collapse:separate}.form-horizontal .control-group{margin-bottom:20px;*zoom:1}.form-horizontal .control-group:before,.form-horizontal .control-group:after{display:table;line-height:0;content:""}.form-horizontal .control-group:after{clear:both}.form-horizontal .control-label{float:left;width:160px;padding-top:5px;text-align:right}.form-horizontal .controls{*display:inline-block;*padding-left:20px;margin-left:180px;*margin-left:0}.form-horizontal .controls:first-child{*padding-left:180px}.form-horizontal .help-block{margin-bottom:0}.form-horizontal input+.help-block,.form-horizontal select+.help-block,.form-horizontal textarea+.help-block,.form-horizontal .uneditable-input+.help-block,.form-horizontal .input-prepend+.help-block,.form-horizontal .input-append+.help-block{margin-top:10px}.form-horizontal .form-actions{padding-left:180px}table{max-width:100%;background-color:transparent;border-collapse:collapse;border-spacing:0}.table{width:100%;margin-bottom:20px}.table th,.table td{padding:8px;line-height:20px;text-align:left;vertical-align:top;border-top:1px solid #ddd}.table th{font-weight:bold}.table thead th{vertical-align:bottom}.table caption+thead tr:first-child th,.table caption+thead tr:first-child td,.table colgroup+thead tr:first-child th,.table colgroup+thead tr:first-child td,.table thead:first-child tr:first-child th,.table thead:first-child tr:first-child td{border-top:0}.table tbody+tbody{border-top:2px solid #ddd}.table .table{background-color:#fff}.table-condensed th,.table-condensed td{padding:4px 5px}.table-bordered{border:1px solid #ddd;border-collapse:separate;*border-collapse:collapse;border-left:0;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.table-bordered th,.table-bordered td{border-left:1px solid #ddd}.table-bordered caption+thead tr:first-child th,.table-bordered caption+tbody tr:first-child th,.table-bordered caption+tbody tr:first-child td,.table-bordered colgroup+thead tr:first-child th,.table-bordered colgroup+tbody tr:first-child th,.table-bordered colgroup+tbody tr:first-child td,.table-bordered thead:first-child tr:first-child th,.table-bordered tbody:first-child tr:first-child th,.table-bordered tbody:first-child tr:first-child td{border-top:0}.table-bordered thead:first-child tr:first-child>th:first-child,.table-bordered tbody:first-child tr:first-child>td:first-child{-webkit-border-top-left-radius:4px;border-top-left-radius:4px;-moz-border-radius-topleft:4px}.table-bordered thead:first-child tr:first-child>th:last-child,.table-bordered tbody:first-child tr:first-child>td:last-child{-webkit-border-top-right-radius:4px;border-top-right-radius:4px;-moz-border-radius-topright:4px}.table-bordered thead:last-child tr:last-child>th:first-child,.table-bordered tbody:last-child tr:last-child>td:first-child,.table-bordered tfoot:last-child tr:last-child>td:first-child{-webkit-border-bottom-left-radius:4px;border-bottom-left-radius:4px;-moz-border-radius-bottomleft:4px}.table-bordered thead:last-child tr:last-child>th:last-child,.table-bordered tbody:last-child tr:last-child>td:last-child,.table-bordered tfoot:last-child tr:last-child>td:last-child{-webkit-border-bottom-right-radius:4px;border-bottom-right-radius:4px;-moz-border-radius-bottomright:4px}.table-bordered tfoot+tbody:last-child tr:last-child td:first-child{-webkit-border-bottom-left-radius:0;border-bottom-left-radius:0;-moz-border-radius-bottomleft:0}.table-bordered tfoot+tbody:last-child tr:last-child td:last-child{-webkit-border-bottom-right-radius:0;border-bottom-right-radius:0;-moz-border-radius-bottomright:0}.table-bordered caption+thead tr:first-child th:first-child,.table-bordered caption+tbody tr:first-child td:first-child,.table-bordered colgroup+thead tr:first-child th:first-child,.table-bordered colgroup+tbody tr:first-child td:first-child{-webkit-border-top-left-radius:4px;border-top-left-radius:4px;-moz-border-radius-topleft:4px}.table-bordered caption+thead tr:first-child th:last-child,.table-bordered caption+tbody tr:first-child td:last-child,.table-bordered colgroup+thead tr:first-child th:last-child,.table-bordered colgroup+tbody tr:first-child td:last-child{-webkit-border-top-right-radius:4px;border-top-right-radius:4px;-moz-border-radius-topright:4px}.table-striped tbody>tr:nth-child(odd)>td,.table-striped tbody>tr:nth-child(odd)>th{background-color:#f9f9f9}.table-hover tbody tr:hover td,.table-hover tbody tr:hover th{background-color:#f5f5f5}table td[class*="span"],table th[class*="span"],.row-fluid table td[class*="span"],.row-fluid table th[class*="span"]{display:table-cell;float:none;margin-left:0}.table td.span1,.table th.span1{float:none;width:44px;margin-left:0}.table td.span2,.table th.span2{float:none;width:124px;margin-left:0}.table td.span3,.table th.span3{float:none;width:204px;margin-left:0}.table td.span4,.table th.span4{float:none;width:284px;margin-left:0}.table td.span5,.table th.span5{float:none;width:364px;margin-left:0}.table td.span6,.table th.span6{float:none;width:444px;margin-left:0}.table td.span7,.table th.span7{float:none;width:524px;margin-left:0}.table td.span8,.table th.span8{float:none;width:604px;margin-left:0}.table td.span9,.table th.span9{float:none;width:684px;margin-left:0}.table td.span10,.table th.span10{float:none;width:764px;margin-left:0}.table td.span11,.table th.span11{float:none;width:844px;margin-left:0}.table td.span12,.table th.span12{float:none;width:924px;margin-left:0}.table tbody tr.success td{background-color:#dff0d8}.table tbody tr.error td{background-color:#f2dede}.table tbody tr.warning td{background-color:#fcf8e3}.table tbody tr.info td{background-color:#d9edf7}.table-hover tbody tr.success:hover td{background-color:#d0e9c6}.table-hover tbody tr.error:hover td{background-color:#ebcccc}.table-hover tbody tr.warning:hover td{background-color:#faf2cc}.table-hover tbody tr.info:hover td{background-color:#c4e3f3}[class^="icon-"],[class*=" icon-"]{display:inline-block;width:14px;height:14px;margin-top:1px;*margin-right:.3em;line-height:14px;vertical-align:text-top;background-image:url("../img/glyphicons-halflings.png");background-position:14px 14px;background-repeat:no-repeat}.icon-white,.nav-pills>.active>a>[class^="icon-"],.nav-pills>.active>a>[class*=" icon-"],.nav-list>.active>a>[class^="icon-"],.nav-list>.active>a>[class*=" icon-"],.navbar-inverse .nav>.active>a>[class^="icon-"],.navbar-inverse .nav>.active>a>[class*=" icon-"],.dropdown-menu>li>a:hover>[class^="icon-"],.dropdown-menu>li>a:hover>[class*=" icon-"],.dropdown-menu>.active>a>[class^="icon-"],.dropdown-menu>.active>a>[class*=" icon-"],.dropdown-submenu:hover>a>[class^="icon-"],.dropdown-submenu:hover>a>[class*=" icon-"]{background-image:url("../img/glyphicons-halflings-white.png")}.icon-glass{background-position:0 0}.icon-music{background-position:-24px 0}.icon-search{background-position:-48px 0}.icon-envelope{background-position:-72px 0}.icon-heart{background-position:-96px 0}.icon-star{background-position:-120px 0}.icon-star-empty{background-position:-144px 0}.icon-user{background-position:-168px 0}.icon-film{background-position:-192px 0}.icon-th-large{background-position:-216px 0}.icon-th{background-position:-240px 0}.icon-th-list{background-position:-264px 0}.icon-ok{background-position:-288px 0}.icon-remove{background-position:-312px 0}.icon-zoom-in{background-position:-336px 0}.icon-zoom-out{background-position:-360px 0}.icon-off{background-position:-384px 0}.icon-signal{background-position:-408px 0}.icon-cog{background-position:-432px 0}.icon-trash{background-position:-456px 0}.icon-home{background-position:0 -24px}.icon-file{background-position:-24px -24px}.icon-time{background-position:-48px -24px}.icon-road{background-position:-72px -24px}.icon-download-alt{background-position:-96px -24px}.icon-download{background-position:-120px -24px}.icon-upload{background-position:-144px -24px}.icon-inbox{background-position:-168px -24px}.icon-play-circle{background-position:-192px -24px}.icon-repeat{background-position:-216px -24px}.icon-refresh{background-position:-240px -24px}.icon-list-alt{background-position:-264px -24px}.icon-lock{background-position:-287px -24px}.icon-flag{background-position:-312px -24px}.icon-headphones{background-position:-336px -24px}.icon-volume-off{background-position:-360px -24px}.icon-volume-down{background-position:-384px -24px}.icon-volume-up{background-position:-408px -24px}.icon-qrcode{background-position:-432px -24px}.icon-barcode{background-position:-456px -24px}.icon-tag{background-position:0 -48px}.icon-tags{background-position:-25px -48px}.icon-book{background-position:-48px -48px}.icon-bookmark{background-position:-72px -48px}.icon-print{background-position:-96px -48px}.icon-camera{background-position:-120px -48px}.icon-font{background-position:-144px -48px}.icon-bold{background-position:-167px -48px}.icon-italic{background-position:-192px -48px}.icon-text-height{background-position:-216px -48px}.icon-text-width{background-position:-240px -48px}.icon-align-left{background-position:-264px -48px}.icon-align-center{background-position:-288px -48px}.icon-align-right{background-position:-312px -48px}.icon-align-justify{background-position:-336px -48px}.icon-list{background-position:-360px -48px}.icon-indent-left{background-position:-384px -48px}.icon-indent-right{background-position:-408px -48px}.icon-facetime-video{background-position:-432px -48px}.icon-picture{background-position:-456px -48px}.icon-pencil{background-position:0 -72px}.icon-map-marker{background-position:-24px -72px}.icon-adjust{background-position:-48px -72px}.icon-tint{background-position:-72px -72px}.icon-edit{background-position:-96px -72px}.icon-share{background-position:-120px -72px}.icon-check{background-position:-144px -72px}.icon-move{background-position:-168px -72px}.icon-step-backward{background-position:-192px -72px}.icon-fast-backward{background-position:-216px -72px}.icon-backward{background-position:-240px -72px}.icon-play{background-position:-264px -72px}.icon-pause{background-position:-288px -72px}.icon-stop{background-position:-312px -72px}.icon-forward{background-position:-336px -72px}.icon-fast-forward{background-position:-360px -72px}.icon-step-forward{background-position:-384px -72px}.icon-eject{background-position:-408px -72px}.icon-chevron-left{background-position:-432px -72px}.icon-chevron-right{background-position:-456px -72px}.icon-plus-sign{background-position:0 -96px}.icon-minus-sign{background-position:-24px -96px}.icon-remove-sign{background-position:-48px -96px}.icon-ok-sign{background-position:-72px -96px}.icon-question-sign{background-position:-96px -96px}.icon-info-sign{background-position:-120px -96px}.icon-screenshot{background-position:-144px -96px}.icon-remove-circle{background-position:-168px -96px}.icon-ok-circle{background-position:-192px -96px}.icon-ban-circle{background-position:-216px -96px}.icon-arrow-left{background-position:-240px -96px}.icon-arrow-right{background-position:-264px -96px}.icon-arrow-up{background-position:-289px -96px}.icon-arrow-down{background-position:-312px -96px}.icon-share-alt{background-position:-336px -96px}.icon-resize-full{background-position:-360px -96px}.icon-resize-small{background-position:-384px -96px}.icon-plus{background-position:-408px -96px}.icon-minus{background-position:-433px -96px}.icon-asterisk{background-position:-456px -96px}.icon-exclamation-sign{background-position:0 -120px}.icon-gift{background-position:-24px -120px}.icon-leaf{background-position:-48px -120px}.icon-fire{background-position:-72px -120px}.icon-eye-open{background-position:-96px -120px}.icon-eye-close{background-position:-120px -120px}.icon-warning-sign{background-position:-144px -120px}.icon-plane{background-position:-168px -120px}.icon-calendar{background-position:-192px -120px}.icon-random{width:16px;background-position:-216px -120px}.icon-comment{background-position:-240px -120px}.icon-magnet{background-position:-264px -120px}.icon-chevron-up{background-position:-288px -120px}.icon-chevron-down{background-position:-313px -119px}.icon-retweet{background-position:-336px -120px}.icon-shopping-cart{background-position:-360px -120px}.icon-folder-close{background-position:-384px -120px}.icon-folder-open{width:16px;background-position:-408px -120px}.icon-resize-vertical{background-position:-432px -119px}.icon-resize-horizontal{background-position:-456px -118px}.icon-hdd{background-position:0 -144px}.icon-bullhorn{background-position:-24px -144px}.icon-bell{background-position:-48px -144px}.icon-certificate{background-position:-72px -144px}.icon-thumbs-up{background-position:-96px -144px}.icon-thumbs-down{background-position:-120px -144px}.icon-hand-right{background-position:-144px -144px}.icon-hand-left{background-position:-168px -144px}.icon-hand-up{background-position:-192px -144px}.icon-hand-down{background-position:-216px -144px}.icon-circle-arrow-right{background-position:-240px -144px}.icon-circle-arrow-left{background-position:-264px -144px}.icon-circle-arrow-up{background-position:-288px -144px}.icon-circle-arrow-down{background-position:-312px -144px}.icon-globe{background-position:-336px -144px}.icon-wrench{background-position:-360px -144px}.icon-tasks{background-position:-384px -144px}.icon-filter{background-position:-408px -144px}.icon-briefcase{background-position:-432px -144px}.icon-fullscreen{background-position:-456px -144px}.dropup,.dropdown{position:relative}.dropdown-toggle{*margin-bottom:-3px}.dropdown-toggle:active,.open .dropdown-toggle{outline:0}.caret{display:inline-block;width:0;height:0;vertical-align:top;border-top:4px solid #000;border-right:4px solid transparent;border-left:4px solid transparent;content:""}.dropdown .caret{margin-top:8px;margin-left:2px}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:160px;padding:5px 0;margin:2px 0 0;list-style:none;background-color:#fff;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.2);*border-right-width:2px;*border-bottom-width:2px;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 5px 10px rgba(0,0,0,0.2);-moz-box-shadow:0 5px 10px rgba(0,0,0,0.2);box-shadow:0 5px 10px rgba(0,0,0,0.2);-webkit-background-clip:padding-box;-moz-background-clip:padding;background-clip:padding-box}.dropdown-menu.pull-right{right:0;left:auto}.dropdown-menu .divider{*width:100%;height:1px;margin:9px 1px;*margin:-5px 0 5px;overflow:hidden;background-color:#e5e5e5;border-bottom:1px solid #fff}.dropdown-menu li>a{display:block;padding:3px 20px;clear:both;font-weight:normal;line-height:20px;color:#333;white-space:nowrap}.dropdown-menu li>a:hover,.dropdown-menu li>a:focus,.dropdown-submenu:hover>a{color:#fff;text-decoration:none;background-color:#0081c2;background-image:-moz-linear-gradient(top,#08c,#0077b3);background-image:-webkit-gradient(linear,0 0,0 100%,from(#08c),to(#0077b3));background-image:-webkit-linear-gradient(top,#08c,#0077b3);background-image:-o-linear-gradient(top,#08c,#0077b3);background-image:linear-gradient(to bottom,#08c,#0077b3);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc',endColorstr='#ff0077b3',GradientType=0)}.dropdown-menu .active>a,.dropdown-menu .active>a:hover{color:#fff;text-decoration:none;background-color:#0081c2;background-image:-moz-linear-gradient(top,#08c,#0077b3);background-image:-webkit-gradient(linear,0 0,0 100%,from(#08c),to(#0077b3));background-image:-webkit-linear-gradient(top,#08c,#0077b3);background-image:-o-linear-gradient(top,#08c,#0077b3);background-image:linear-gradient(to bottom,#08c,#0077b3);background-repeat:repeat-x;outline:0;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc',endColorstr='#ff0077b3',GradientType=0)}.dropdown-menu .disabled>a,.dropdown-menu .disabled>a:hover{color:#999}.dropdown-menu .disabled>a:hover{text-decoration:none;cursor:default;background-color:transparent;background-image:none;filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.open{*z-index:1000}.open>.dropdown-menu{display:block}.pull-right>.dropdown-menu{right:0;left:auto}.dropup .caret,.navbar-fixed-bottom .dropdown .caret{border-top:0;border-bottom:4px solid #000;content:""}.dropup .dropdown-menu,.navbar-fixed-bottom .dropdown .dropdown-menu{top:auto;bottom:100%;margin-bottom:1px}.dropdown-submenu{position:relative}.dropdown-submenu>.dropdown-menu{top:0;left:100%;margin-top:-6px;margin-left:-1px;-webkit-border-radius:0 6px 6px 6px;-moz-border-radius:0 6px 6px 6px;border-radius:0 6px 6px 6px}.dropdown-submenu:hover>.dropdown-menu{display:block}.dropup .dropdown-submenu>.dropdown-menu{top:auto;bottom:0;margin-top:0;margin-bottom:-2px;-webkit-border-radius:5px 5px 5px 0;-moz-border-radius:5px 5px 5px 0;border-radius:5px 5px 5px 0}.dropdown-submenu>a:after{display:block;float:right;width:0;height:0;margin-top:5px;margin-right:-10px;border-color:transparent;border-left-color:#ccc;border-style:solid;border-width:5px 0 5px 5px;content:" "}.dropdown-submenu:hover>a:after{border-left-color:#fff}.dropdown-submenu.pull-left{float:none}.dropdown-submenu.pull-left>.dropdown-menu{left:-100%;margin-left:10px;-webkit-border-radius:6px 0 6px 6px;-moz-border-radius:6px 0 6px 6px;border-radius:6px 0 6px 6px}.dropdown .dropdown-menu .nav-header{padding-right:20px;padding-left:20px}.typeahead{z-index:1051;margin-top:2px;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.well{min-height:20px;padding:19px;margin-bottom:20px;background-color:#f5f5f5;border:1px solid #e3e3e3;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.05);-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.05);box-shadow:inset 0 1px 1px rgba(0,0,0,0.05)}.well blockquote{border-color:#ddd;border-color:rgba(0,0,0,0.15)}.well-large{padding:24px;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px}.well-small{padding:9px;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.fade{opacity:0;-webkit-transition:opacity .15s linear;-moz-transition:opacity .15s linear;-o-transition:opacity .15s linear;transition:opacity .15s linear}.fade.in{opacity:1}.collapse{position:relative;height:0;overflow:hidden;-webkit-transition:height .35s ease;-moz-transition:height .35s ease;-o-transition:height .35s ease;transition:height .35s ease}.collapse.in{height:auto}.close{float:right;font-size:20px;font-weight:bold;line-height:20px;color:#000;text-shadow:0 1px 0 #fff;opacity:.2;filter:alpha(opacity=20)}.close:hover{color:#000;text-decoration:none;cursor:pointer;opacity:.4;filter:alpha(opacity=40)}button.close{padding:0;cursor:pointer;background:transparent;border:0;-webkit-appearance:none}.btn{display:inline-block;*display:inline;padding:4px 12px;margin-bottom:0;*margin-left:.3em;font-size:14px;line-height:20px;color:#333;text-align:center;text-shadow:0 1px 1px rgba(255,255,255,0.75);vertical-align:middle;cursor:pointer;background-color:#f5f5f5;*background-color:#e6e6e6;background-image:-moz-linear-gradient(top,#fff,#e6e6e6);background-image:-webkit-gradient(linear,0 0,0 100%,from(#fff),to(#e6e6e6));background-image:-webkit-linear-gradient(top,#fff,#e6e6e6);background-image:-o-linear-gradient(top,#fff,#e6e6e6);background-image:linear-gradient(to bottom,#fff,#e6e6e6);background-repeat:repeat-x;border:1px solid #bbb;*border:0;border-color:#e6e6e6 #e6e6e6 #bfbfbf;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);border-bottom-color:#a2a2a2;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff',endColorstr='#ffe6e6e6',GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);*zoom:1;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05);-moz-box-shadow:inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05);box-shadow:inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05)}.btn:hover,.btn:active,.btn.active,.btn.disabled,.btn[disabled]{color:#333;background-color:#e6e6e6;*background-color:#d9d9d9}.btn:active,.btn.active{background-color:#ccc \9}.btn:first-child{*margin-left:0}.btn:hover{color:#333;text-decoration:none;background-position:0 -15px;-webkit-transition:background-position .1s linear;-moz-transition:background-position .1s linear;-o-transition:background-position .1s linear;transition:background-position .1s linear}.btn:focus{outline:thin dotted #333;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}.btn.active,.btn:active{background-image:none;outline:0;-webkit-box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05);-moz-box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05);box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05)}.btn.disabled,.btn[disabled]{cursor:default;background-image:none;opacity:.65;filter:alpha(opacity=65);-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}.btn-large{padding:11px 19px;font-size:17.5px;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px}.btn-large [class^="icon-"],.btn-large [class*=" icon-"]{margin-top:4px}.btn-small{padding:2px 10px;font-size:11.9px;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.btn-small [class^="icon-"],.btn-small [class*=" icon-"]{margin-top:0}.btn-mini [class^="icon-"],.btn-mini [class*=" icon-"]{margin-top:-1px}.btn-mini{padding:0 6px;font-size:10.5px;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.btn-block{display:block;width:100%;padding-right:0;padding-left:0;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.btn-block+.btn-block{margin-top:5px}input[type="submit"].btn-block,input[type="reset"].btn-block,input[type="button"].btn-block{width:100%}.btn-primary.active,.btn-warning.active,.btn-danger.active,.btn-success.active,.btn-info.active,.btn-inverse.active{color:rgba(255,255,255,0.75)}.btn{border-color:#c5c5c5;border-color:rgba(0,0,0,0.15) rgba(0,0,0,0.15) rgba(0,0,0,0.25)}.btn-primary{color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25);background-color:#006dcc;*background-color:#04c;background-image:-moz-linear-gradient(top,#08c,#04c);background-image:-webkit-gradient(linear,0 0,0 100%,from(#08c),to(#04c));background-image:-webkit-linear-gradient(top,#08c,#04c);background-image:-o-linear-gradient(top,#08c,#04c);background-image:linear-gradient(to bottom,#08c,#04c);background-repeat:repeat-x;border-color:#04c #04c #002a80;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc',endColorstr='#ff0044cc',GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.btn-primary:hover,.btn-primary:active,.btn-primary.active,.btn-primary.disabled,.btn-primary[disabled]{color:#fff;background-color:#04c;*background-color:#003bb3}.btn-primary:active,.btn-primary.active{background-color:#039 \9}.btn-warning{color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25);background-color:#faa732;*background-color:#f89406;background-image:-moz-linear-gradient(top,#fbb450,#f89406);background-image:-webkit-gradient(linear,0 0,0 100%,from(#fbb450),to(#f89406));background-image:-webkit-linear-gradient(top,#fbb450,#f89406);background-image:-o-linear-gradient(top,#fbb450,#f89406);background-image:linear-gradient(to bottom,#fbb450,#f89406);background-repeat:repeat-x;border-color:#f89406 #f89406 #ad6704;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffbb450',endColorstr='#fff89406',GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.btn-warning:hover,.btn-warning:active,.btn-warning.active,.btn-warning.disabled,.btn-warning[disabled]{color:#fff;background-color:#f89406;*background-color:#df8505}.btn-warning:active,.btn-warning.active{background-color:#c67605 \9}.btn-danger{color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25);background-color:#da4f49;*background-color:#bd362f;background-image:-moz-linear-gradient(top,#ee5f5b,#bd362f);background-image:-webkit-gradient(linear,0 0,0 100%,from(#ee5f5b),to(#bd362f));background-image:-webkit-linear-gradient(top,#ee5f5b,#bd362f);background-image:-o-linear-gradient(top,#ee5f5b,#bd362f);background-image:linear-gradient(to bottom,#ee5f5b,#bd362f);background-repeat:repeat-x;border-color:#bd362f #bd362f #802420;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffee5f5b',endColorstr='#ffbd362f',GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.btn-danger:hover,.btn-danger:active,.btn-danger.active,.btn-danger.disabled,.btn-danger[disabled]{color:#fff;background-color:#bd362f;*background-color:#a9302a}.btn-danger:active,.btn-danger.active{background-color:#942a25 \9}.btn-success{color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25);background-color:#5bb75b;*background-color:#51a351;background-image:-moz-linear-gradient(top,#62c462,#51a351);background-image:-webkit-gradient(linear,0 0,0 100%,from(#62c462),to(#51a351));background-image:-webkit-linear-gradient(top,#62c462,#51a351);background-image:-o-linear-gradient(top,#62c462,#51a351);background-image:linear-gradient(to bottom,#62c462,#51a351);background-repeat:repeat-x;border-color:#51a351 #51a351 #387038;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff62c462',endColorstr='#ff51a351',GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.btn-success:hover,.btn-success:active,.btn-success.active,.btn-success.disabled,.btn-success[disabled]{color:#fff;background-color:#51a351;*background-color:#499249}.btn-success:active,.btn-success.active{background-color:#408140 \9}.btn-info{color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25);background-color:#49afcd;*background-color:#2f96b4;background-image:-moz-linear-gradient(top,#5bc0de,#2f96b4);background-image:-webkit-gradient(linear,0 0,0 100%,from(#5bc0de),to(#2f96b4));background-image:-webkit-linear-gradient(top,#5bc0de,#2f96b4);background-image:-o-linear-gradient(top,#5bc0de,#2f96b4);background-image:linear-gradient(to bottom,#5bc0de,#2f96b4);background-repeat:repeat-x;border-color:#2f96b4 #2f96b4 #1f6377;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de',endColorstr='#ff2f96b4',GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.btn-info:hover,.btn-info:active,.btn-info.active,.btn-info.disabled,.btn-info[disabled]{color:#fff;background-color:#2f96b4;*background-color:#2a85a0}.btn-info:active,.btn-info.active{background-color:#24748c \9}.btn-inverse{color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25);background-color:#363636;*background-color:#222;background-image:-moz-linear-gradient(top,#444,#222);background-image:-webkit-gradient(linear,0 0,0 100%,from(#444),to(#222));background-image:-webkit-linear-gradient(top,#444,#222);background-image:-o-linear-gradient(top,#444,#222);background-image:linear-gradient(to bottom,#444,#222);background-repeat:repeat-x;border-color:#222 #222 #000;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff444444',endColorstr='#ff222222',GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.btn-inverse:hover,.btn-inverse:active,.btn-inverse.active,.btn-inverse.disabled,.btn-inverse[disabled]{color:#fff;background-color:#222;*background-color:#151515}.btn-inverse:active,.btn-inverse.active{background-color:#080808 \9}button.btn,input[type="submit"].btn{*padding-top:3px;*padding-bottom:3px}button.btn::-moz-focus-inner,input[type="submit"].btn::-moz-focus-inner{padding:0;border:0}button.btn.btn-large,input[type="submit"].btn.btn-large{*padding-top:7px;*padding-bottom:7px}button.btn.btn-small,input[type="submit"].btn.btn-small{*padding-top:3px;*padding-bottom:3px}button.btn.btn-mini,input[type="submit"].btn.btn-mini{*padding-top:1px;*padding-bottom:1px}.btn-link,.btn-link:active,.btn-link[disabled]{background-color:transparent;background-image:none;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}.btn-link{color:#08c;cursor:pointer;border-color:transparent;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.btn-link:hover{color:#005580;text-decoration:underline;background-color:transparent}.btn-link[disabled]:hover{color:#333;text-decoration:none}.btn-group{position:relative;display:inline-block;*display:inline;*margin-left:.3em;font-size:0;white-space:nowrap;vertical-align:middle;*zoom:1}.btn-group:first-child{*margin-left:0}.btn-group+.btn-group{margin-left:5px}.btn-toolbar{margin-top:10px;margin-bottom:10px;font-size:0}.btn-toolbar>.btn+.btn,.btn-toolbar>.btn-group+.btn,.btn-toolbar>.btn+.btn-group{margin-left:5px}.btn-group>.btn{position:relative;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.btn-group>.btn+.btn{margin-left:-1px}.btn-group>.btn,.btn-group>.dropdown-menu,.btn-group>.popover{font-size:14px}.btn-group>.btn-mini{font-size:10.5px}.btn-group>.btn-small{font-size:11.9px}.btn-group>.btn-large{font-size:17.5px}.btn-group>.btn:first-child{margin-left:0;-webkit-border-bottom-left-radius:4px;border-bottom-left-radius:4px;-webkit-border-top-left-radius:4px;border-top-left-radius:4px;-moz-border-radius-bottomleft:4px;-moz-border-radius-topleft:4px}.btn-group>.btn:last-child,.btn-group>.dropdown-toggle{-webkit-border-top-right-radius:4px;border-top-right-radius:4px;-webkit-border-bottom-right-radius:4px;border-bottom-right-radius:4px;-moz-border-radius-topright:4px;-moz-border-radius-bottomright:4px}.btn-group>.btn.large:first-child{margin-left:0;-webkit-border-bottom-left-radius:6px;border-bottom-left-radius:6px;-webkit-border-top-left-radius:6px;border-top-left-radius:6px;-moz-border-radius-bottomleft:6px;-moz-border-radius-topleft:6px}.btn-group>.btn.large:last-child,.btn-group>.large.dropdown-toggle{-webkit-border-top-right-radius:6px;border-top-right-radius:6px;-webkit-border-bottom-right-radius:6px;border-bottom-right-radius:6px;-moz-border-radius-topright:6px;-moz-border-radius-bottomright:6px}.btn-group>.btn:hover,.btn-group>.btn:focus,.btn-group>.btn:active,.btn-group>.btn.active{z-index:2}.btn-group .dropdown-toggle:active,.btn-group.open .dropdown-toggle{outline:0}.btn-group>.btn+.dropdown-toggle{*padding-top:5px;padding-right:8px;*padding-bottom:5px;padding-left:8px;-webkit-box-shadow:inset 1px 0 0 rgba(255,255,255,0.125),inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05);-moz-box-shadow:inset 1px 0 0 rgba(255,255,255,0.125),inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05);box-shadow:inset 1px 0 0 rgba(255,255,255,0.125),inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05)}.btn-group>.btn-mini+.dropdown-toggle{*padding-top:2px;padding-right:5px;*padding-bottom:2px;padding-left:5px}.btn-group>.btn-small+.dropdown-toggle{*padding-top:5px;*padding-bottom:4px}.btn-group>.btn-large+.dropdown-toggle{*padding-top:7px;padding-right:12px;*padding-bottom:7px;padding-left:12px}.btn-group.open .dropdown-toggle{background-image:none;-webkit-box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05);-moz-box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05);box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05)}.btn-group.open .btn.dropdown-toggle{background-color:#e6e6e6}.btn-group.open .btn-primary.dropdown-toggle{background-color:#04c}.btn-group.open .btn-warning.dropdown-toggle{background-color:#f89406}.btn-group.open .btn-danger.dropdown-toggle{background-color:#bd362f}.btn-group.open .btn-success.dropdown-toggle{background-color:#51a351}.btn-group.open .btn-info.dropdown-toggle{background-color:#2f96b4}.btn-group.open .btn-inverse.dropdown-toggle{background-color:#222}.btn .caret{margin-top:8px;margin-left:0}.btn-mini .caret,.btn-small .caret,.btn-large .caret{margin-top:6px}.btn-large .caret{border-top-width:5px;border-right-width:5px;border-left-width:5px}.dropup .btn-large .caret{border-bottom-width:5px}.btn-primary .caret,.btn-warning .caret,.btn-danger .caret,.btn-info .caret,.btn-success .caret,.btn-inverse .caret{border-top-color:#fff;border-bottom-color:#fff}.btn-group-vertical{display:inline-block;*display:inline;*zoom:1}.btn-group-vertical>.btn{display:block;float:none;max-width:100%;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.btn-group-vertical>.btn+.btn{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn:first-child{-webkit-border-radius:4px 4px 0 0;-moz-border-radius:4px 4px 0 0;border-radius:4px 4px 0 0}.btn-group-vertical>.btn:last-child{-webkit-border-radius:0 0 4px 4px;-moz-border-radius:0 0 4px 4px;border-radius:0 0 4px 4px}.btn-group-vertical>.btn-large:first-child{-webkit-border-radius:6px 6px 0 0;-moz-border-radius:6px 6px 0 0;border-radius:6px 6px 0 0}.btn-group-vertical>.btn-large:last-child{-webkit-border-radius:0 0 6px 6px;-moz-border-radius:0 0 6px 6px;border-radius:0 0 6px 6px}.alert{padding:8px 35px 8px 14px;margin-bottom:20px;text-shadow:0 1px 0 rgba(255,255,255,0.5);background-color:#fcf8e3;border:1px solid #fbeed5;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.alert,.alert h4{color:#c09853}.alert h4{margin:0}.alert .close{position:relative;top:-2px;right:-21px;line-height:20px}.alert-success{color:#468847;background-color:#dff0d8;border-color:#d6e9c6}.alert-success h4{color:#468847}.alert-danger,.alert-error{color:#b94a48;background-color:#f2dede;border-color:#eed3d7}.alert-danger h4,.alert-error h4{color:#b94a48}.alert-info{color:#3a87ad;background-color:#d9edf7;border-color:#bce8f1}.alert-info h4{color:#3a87ad}.alert-block{padding-top:14px;padding-bottom:14px}.alert-block>p,.alert-block>ul{margin-bottom:0}.alert-block p+p{margin-top:5px}.nav{margin-bottom:20px;margin-left:0;list-style:none}.nav>li>a{display:block}.nav>li>a:hover{text-decoration:none;background-color:#eee}.nav>li>a>img{max-width:none}.nav>.pull-right{float:right}.nav-header{display:block;padding:3px 15px;font-size:11px;font-weight:bold;line-height:20px;color:#999;text-shadow:0 1px 0 rgba(255,255,255,0.5);text-transform:uppercase}.nav li+.nav-header{margin-top:9px}.nav-list{padding-right:15px;padding-left:15px;margin-bottom:0}.nav-list>li>a,.nav-list .nav-header{margin-right:-15px;margin-left:-15px;text-shadow:0 1px 0 rgba(255,255,255,0.5)}.nav-list>li>a{padding:3px 15px}.nav-list>.active>a,.nav-list>.active>a:hover{color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.2);background-color:#08c}.nav-list [class^="icon-"],.nav-list [class*=" icon-"]{margin-right:2px}.nav-list .divider{*width:100%;height:1px;margin:9px 1px;*margin:-5px 0 5px;overflow:hidden;background-color:#e5e5e5;border-bottom:1px solid #fff}.nav-tabs,.nav-pills{*zoom:1}.nav-tabs:before,.nav-pills:before,.nav-tabs:after,.nav-pills:after{display:table;line-height:0;content:""}.nav-tabs:after,.nav-pills:after{clear:both}.nav-tabs>li,.nav-pills>li{float:left}.nav-tabs>li>a,.nav-pills>li>a{padding-right:12px;padding-left:12px;margin-right:2px;line-height:14px}.nav-tabs{border-bottom:1px solid #ddd}.nav-tabs>li{margin-bottom:-1px}.nav-tabs>li>a{padding-top:8px;padding-bottom:8px;line-height:20px;border:1px solid transparent;-webkit-border-radius:4px 4px 0 0;-moz-border-radius:4px 4px 0 0;border-radius:4px 4px 0 0}.nav-tabs>li>a:hover{border-color:#eee #eee #ddd}.nav-tabs>.active>a,.nav-tabs>.active>a:hover{color:#555;cursor:default;background-color:#fff;border:1px solid #ddd;border-bottom-color:transparent}.nav-pills>li>a{padding-top:8px;padding-bottom:8px;margin-top:2px;margin-bottom:2px;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px}.nav-pills>.active>a,.nav-pills>.active>a:hover{color:#fff;background-color:#08c}.nav-stacked>li{float:none}.nav-stacked>li>a{margin-right:0}.nav-tabs.nav-stacked{border-bottom:0}.nav-tabs.nav-stacked>li>a{border:1px solid #ddd;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.nav-tabs.nav-stacked>li:first-child>a{-webkit-border-top-right-radius:4px;border-top-right-radius:4px;-webkit-border-top-left-radius:4px;border-top-left-radius:4px;-moz-border-radius-topright:4px;-moz-border-radius-topleft:4px}.nav-tabs.nav-stacked>li:last-child>a{-webkit-border-bottom-right-radius:4px;border-bottom-right-radius:4px;-webkit-border-bottom-left-radius:4px;border-bottom-left-radius:4px;-moz-border-radius-bottomright:4px;-moz-border-radius-bottomleft:4px}.nav-tabs.nav-stacked>li>a:hover{z-index:2;border-color:#ddd}.nav-pills.nav-stacked>li>a{margin-bottom:3px}.nav-pills.nav-stacked>li:last-child>a{margin-bottom:1px}.nav-tabs .dropdown-menu{-webkit-border-radius:0 0 6px 6px;-moz-border-radius:0 0 6px 6px;border-radius:0 0 6px 6px}.nav-pills .dropdown-menu{-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px}.nav .dropdown-toggle .caret{margin-top:6px;border-top-color:#08c;border-bottom-color:#08c}.nav .dropdown-toggle:hover .caret{border-top-color:#005580;border-bottom-color:#005580}.nav-tabs .dropdown-toggle .caret{margin-top:8px}.nav .active .dropdown-toggle .caret{border-top-color:#fff;border-bottom-color:#fff}.nav-tabs .active .dropdown-toggle .caret{border-top-color:#555;border-bottom-color:#555}.nav>.dropdown.active>a:hover{cursor:pointer}.nav-tabs .open .dropdown-toggle,.nav-pills .open .dropdown-toggle,.nav>li.dropdown.open.active>a:hover{color:#fff;background-color:#999;border-color:#999}.nav li.dropdown.open .caret,.nav li.dropdown.open.active .caret,.nav li.dropdown.open a:hover .caret{border-top-color:#fff;border-bottom-color:#fff;opacity:1;filter:alpha(opacity=100)}.tabs-stacked .open>a:hover{border-color:#999}.tabbable{*zoom:1}.tabbable:before,.tabbable:after{display:table;line-height:0;content:""}.tabbable:after{clear:both}.tab-content{overflow:auto}.tabs-below>.nav-tabs,.tabs-right>.nav-tabs,.tabs-left>.nav-tabs{border-bottom:0}.tab-content>.tab-pane,.pill-content>.pill-pane{display:none}.tab-content>.active,.pill-content>.active{display:block}.tabs-below>.nav-tabs{border-top:1px solid #ddd}.tabs-below>.nav-tabs>li{margin-top:-1px;margin-bottom:0}.tabs-below>.nav-tabs>li>a{-webkit-border-radius:0 0 4px 4px;-moz-border-radius:0 0 4px 4px;border-radius:0 0 4px 4px}.tabs-below>.nav-tabs>li>a:hover{border-top-color:#ddd;border-bottom-color:transparent}.tabs-below>.nav-tabs>.active>a,.tabs-below>.nav-tabs>.active>a:hover{border-color:transparent #ddd #ddd #ddd}.tabs-left>.nav-tabs>li,.tabs-right>.nav-tabs>li{float:none}.tabs-left>.nav-tabs>li>a,.tabs-right>.nav-tabs>li>a{min-width:74px;margin-right:0;margin-bottom:3px}.tabs-left>.nav-tabs{float:left;margin-right:19px;border-right:1px solid #ddd}.tabs-left>.nav-tabs>li>a{margin-right:-1px;-webkit-border-radius:4px 0 0 4px;-moz-border-radius:4px 0 0 4px;border-radius:4px 0 0 4px}.tabs-left>.nav-tabs>li>a:hover{border-color:#eee #ddd #eee #eee}.tabs-left>.nav-tabs .active>a,.tabs-left>.nav-tabs .active>a:hover{border-color:#ddd transparent #ddd #ddd;*border-right-color:#fff}.tabs-right>.nav-tabs{float:right;margin-left:19px;border-left:1px solid #ddd}.tabs-right>.nav-tabs>li>a{margin-left:-1px;-webkit-border-radius:0 4px 4px 0;-moz-border-radius:0 4px 4px 0;border-radius:0 4px 4px 0}.tabs-right>.nav-tabs>li>a:hover{border-color:#eee #eee #eee #ddd}.tabs-right>.nav-tabs .active>a,.tabs-right>.nav-tabs .active>a:hover{border-color:#ddd #ddd #ddd transparent;*border-left-color:#fff}.nav>.disabled>a{color:#999}.nav>.disabled>a:hover{text-decoration:none;cursor:default;background-color:transparent}.navbar{*position:relative;*z-index:2;margin-bottom:20px;overflow:visible}.navbar-inner{min-height:40px;padding-right:20px;padding-left:20px;background-color:#fafafa;background-image:-moz-linear-gradient(top,#fff,#f2f2f2);background-image:-webkit-gradient(linear,0 0,0 100%,from(#fff),to(#f2f2f2));background-image:-webkit-linear-gradient(top,#fff,#f2f2f2);background-image:-o-linear-gradient(top,#fff,#f2f2f2);background-image:linear-gradient(to bottom,#fff,#f2f2f2);background-repeat:repeat-x;border:1px solid #d4d4d4;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff',endColorstr='#fff2f2f2',GradientType=0);*zoom:1;-webkit-box-shadow:0 1px 4px rgba(0,0,0,0.065);-moz-box-shadow:0 1px 4px rgba(0,0,0,0.065);box-shadow:0 1px 4px rgba(0,0,0,0.065)}.navbar-inner:before,.navbar-inner:after{display:table;line-height:0;content:""}.navbar-inner:after{clear:both}.navbar .container{width:auto}.nav-collapse.collapse{height:auto;overflow:visible}.navbar .brand{display:block;float:left;padding:10px 20px 10px;margin-left:-20px;font-size:20px;font-weight:200;color:#777;text-shadow:0 1px 0 #fff}.navbar .brand:hover{text-decoration:none}.navbar-text{margin-bottom:0;line-height:40px;color:#777}.navbar-link{color:#777}.navbar-link:hover{color:#333}.navbar .divider-vertical{height:40px;margin:0 9px;border-right:1px solid #fff;border-left:1px solid #f2f2f2}.navbar .btn,.navbar .btn-group{margin-top:5px}.navbar .btn-group .btn,.navbar .input-prepend .btn,.navbar .input-append .btn{margin-top:0}.navbar-form{margin-bottom:0;*zoom:1}.navbar-form:before,.navbar-form:after{display:table;line-height:0;content:""}.navbar-form:after{clear:both}.navbar-form input,.navbar-form select,.navbar-form .radio,.navbar-form .checkbox{margin-top:5px}.navbar-form input,.navbar-form select,.navbar-form .btn{display:inline-block;margin-bottom:0}.navbar-form input[type="image"],.navbar-form input[type="checkbox"],.navbar-form input[type="radio"]{margin-top:3px}.navbar-form .input-append,.navbar-form .input-prepend{margin-top:5px;white-space:nowrap}.navbar-form .input-append input,.navbar-form .input-prepend input{margin-top:0}.navbar-search{position:relative;float:left;margin-top:5px;margin-bottom:0}.navbar-search .search-query{padding:4px 14px;margin-bottom:0;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:13px;font-weight:normal;line-height:1;-webkit-border-radius:15px;-moz-border-radius:15px;border-radius:15px}.navbar-static-top{position:static;margin-bottom:0}.navbar-static-top .navbar-inner{-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.navbar-fixed-top,.navbar-fixed-bottom{position:fixed;right:0;left:0;z-index:1030;margin-bottom:0}.navbar-fixed-top .navbar-inner,.navbar-static-top .navbar-inner{border-width:0 0 1px}.navbar-fixed-bottom .navbar-inner{border-width:1px 0 0}.navbar-fixed-top .navbar-inner,.navbar-fixed-bottom .navbar-inner{padding-right:0;padding-left:0;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.navbar-static-top .container,.navbar-fixed-top .container,.navbar-fixed-bottom .container{width:940px}.navbar-fixed-top{top:0}.navbar-fixed-top .navbar-inner,.navbar-static-top .navbar-inner{-webkit-box-shadow:0 1px 10px rgba(0,0,0,0.1);-moz-box-shadow:0 1px 10px rgba(0,0,0,0.1);box-shadow:0 1px 10px rgba(0,0,0,0.1)}.navbar-fixed-bottom{bottom:0}.navbar-fixed-bottom .navbar-inner{-webkit-box-shadow:0 -1px 10px rgba(0,0,0,0.1);-moz-box-shadow:0 -1px 10px rgba(0,0,0,0.1);box-shadow:0 -1px 10px rgba(0,0,0,0.1)}.navbar .nav{position:relative;left:0;display:block;float:left;margin:0 10px 0 0}.navbar .nav.pull-right{float:right;margin-right:0}.navbar .nav>li{float:left}.navbar .nav>li>a{float:none;padding:10px 15px 10px;color:#777;text-decoration:none;text-shadow:0 1px 0 #fff}.navbar .nav .dropdown-toggle .caret{margin-top:8px}.navbar .nav>li>a:focus,.navbar .nav>li>a:hover{color:#333;text-decoration:none;background-color:transparent}.navbar .nav>.active>a,.navbar .nav>.active>a:hover,.navbar .nav>.active>a:focus{color:#555;text-decoration:none;background-color:#e5e5e5;-webkit-box-shadow:inset 0 3px 8px rgba(0,0,0,0.125);-moz-box-shadow:inset 0 3px 8px rgba(0,0,0,0.125);box-shadow:inset 0 3px 8px rgba(0,0,0,0.125)}.navbar .btn-navbar{display:none;float:right;padding:7px 10px;margin-right:5px;margin-left:5px;color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25);background-color:#ededed;*background-color:#e5e5e5;background-image:-moz-linear-gradient(top,#f2f2f2,#e5e5e5);background-image:-webkit-gradient(linear,0 0,0 100%,from(#f2f2f2),to(#e5e5e5));background-image:-webkit-linear-gradient(top,#f2f2f2,#e5e5e5);background-image:-o-linear-gradient(top,#f2f2f2,#e5e5e5);background-image:linear-gradient(to bottom,#f2f2f2,#e5e5e5);background-repeat:repeat-x;border-color:#e5e5e5 #e5e5e5 #bfbfbf;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff2f2f2',endColorstr='#ffe5e5e5',GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.075);-moz-box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.075);box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.075)}.navbar .btn-navbar:hover,.navbar .btn-navbar:active,.navbar .btn-navbar.active,.navbar .btn-navbar.disabled,.navbar .btn-navbar[disabled]{color:#fff;background-color:#e5e5e5;*background-color:#d9d9d9}.navbar .btn-navbar:active,.navbar .btn-navbar.active{background-color:#ccc \9}.navbar .btn-navbar .icon-bar{display:block;width:18px;height:2px;background-color:#f5f5f5;-webkit-border-radius:1px;-moz-border-radius:1px;border-radius:1px;-webkit-box-shadow:0 1px 0 rgba(0,0,0,0.25);-moz-box-shadow:0 1px 0 rgba(0,0,0,0.25);box-shadow:0 1px 0 rgba(0,0,0,0.25)}.btn-navbar .icon-bar+.icon-bar{margin-top:3px}.navbar .nav>li>.dropdown-menu:before{position:absolute;top:-7px;left:9px;display:inline-block;border-right:7px solid transparent;border-bottom:7px solid #ccc;border-left:7px solid transparent;border-bottom-color:rgba(0,0,0,0.2);content:''}.navbar .nav>li>.dropdown-menu:after{position:absolute;top:-6px;left:10px;display:inline-block;border-right:6px solid transparent;border-bottom:6px solid #fff;border-left:6px solid transparent;content:''}.navbar-fixed-bottom .nav>li>.dropdown-menu:before{top:auto;bottom:-7px;border-top:7px solid #ccc;border-bottom:0;border-top-color:rgba(0,0,0,0.2)}.navbar-fixed-bottom .nav>li>.dropdown-menu:after{top:auto;bottom:-6px;border-top:6px solid #fff;border-bottom:0}.navbar .nav li.dropdown>a:hover .caret{border-top-color:#555;border-bottom-color:#555}.navbar .nav li.dropdown.open>.dropdown-toggle,.navbar .nav li.dropdown.active>.dropdown-toggle,.navbar .nav li.dropdown.open.active>.dropdown-toggle{color:#555;background-color:#e5e5e5}.navbar .nav li.dropdown>.dropdown-toggle .caret{border-top-color:#777;border-bottom-color:#777}.navbar .nav li.dropdown.open>.dropdown-toggle .caret,.navbar .nav li.dropdown.active>.dropdown-toggle .caret,.navbar .nav li.dropdown.open.active>.dropdown-toggle .caret{border-top-color:#555;border-bottom-color:#555}.navbar .pull-right>li>.dropdown-menu,.navbar .nav>li>.dropdown-menu.pull-right{right:0;left:auto}.navbar .pull-right>li>.dropdown-menu:before,.navbar .nav>li>.dropdown-menu.pull-right:before{right:12px;left:auto}.navbar .pull-right>li>.dropdown-menu:after,.navbar .nav>li>.dropdown-menu.pull-right:after{right:13px;left:auto}.navbar .pull-right>li>.dropdown-menu .dropdown-menu,.navbar .nav>li>.dropdown-menu.pull-right .dropdown-menu{right:100%;left:auto;margin-right:-1px;margin-left:0;-webkit-border-radius:6px 0 6px 6px;-moz-border-radius:6px 0 6px 6px;border-radius:6px 0 6px 6px}.navbar-inverse .navbar-inner{background-color:#1b1b1b;background-image:-moz-linear-gradient(top,#222,#111);background-image:-webkit-gradient(linear,0 0,0 100%,from(#222),to(#111));background-image:-webkit-linear-gradient(top,#222,#111);background-image:-o-linear-gradient(top,#222,#111);background-image:linear-gradient(to bottom,#222,#111);background-repeat:repeat-x;border-color:#252525;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff222222',endColorstr='#ff111111',GradientType=0)}.navbar-inverse .brand,.navbar-inverse .nav>li>a{color:#999;text-shadow:0 -1px 0 rgba(0,0,0,0.25)}.navbar-inverse .brand:hover,.navbar-inverse .nav>li>a:hover{color:#fff}.navbar-inverse .brand{color:#999}.navbar-inverse .navbar-text{color:#999}.navbar-inverse .nav>li>a:focus,.navbar-inverse .nav>li>a:hover{color:#fff;background-color:transparent}.navbar-inverse .nav .active>a,.navbar-inverse .nav .active>a:hover,.navbar-inverse .nav .active>a:focus{color:#fff;background-color:#111}.navbar-inverse .navbar-link{color:#999}.navbar-inverse .navbar-link:hover{color:#fff}.navbar-inverse .divider-vertical{border-right-color:#222;border-left-color:#111}.navbar-inverse .nav li.dropdown.open>.dropdown-toggle,.navbar-inverse .nav li.dropdown.active>.dropdown-toggle,.navbar-inverse .nav li.dropdown.open.active>.dropdown-toggle{color:#fff;background-color:#111}.navbar-inverse .nav li.dropdown>a:hover .caret{border-top-color:#fff;border-bottom-color:#fff}.navbar-inverse .nav li.dropdown>.dropdown-toggle .caret{border-top-color:#999;border-bottom-color:#999}.navbar-inverse .nav li.dropdown.open>.dropdown-toggle .caret,.navbar-inverse .nav li.dropdown.active>.dropdown-toggle .caret,.navbar-inverse .nav li.dropdown.open.active>.dropdown-toggle .caret{border-top-color:#fff;border-bottom-color:#fff}.navbar-inverse .navbar-search .search-query{color:#fff;background-color:#515151;border-color:#111;-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,0.1),0 1px 0 rgba(255,255,255,0.15);-moz-box-shadow:inset 0 1px 2px rgba(0,0,0,0.1),0 1px 0 rgba(255,255,255,0.15);box-shadow:inset 0 1px 2px rgba(0,0,0,0.1),0 1px 0 rgba(255,255,255,0.15);-webkit-transition:none;-moz-transition:none;-o-transition:none;transition:none}.navbar-inverse .navbar-search .search-query:-moz-placeholder{color:#ccc}.navbar-inverse .navbar-search .search-query:-ms-input-placeholder{color:#ccc}.navbar-inverse .navbar-search .search-query::-webkit-input-placeholder{color:#ccc}.navbar-inverse .navbar-search .search-query:focus,.navbar-inverse .navbar-search .search-query.focused{padding:5px 15px;color:#333;text-shadow:0 1px 0 #fff;background-color:#fff;border:0;outline:0;-webkit-box-shadow:0 0 3px rgba(0,0,0,0.15);-moz-box-shadow:0 0 3px rgba(0,0,0,0.15);box-shadow:0 0 3px rgba(0,0,0,0.15)}.navbar-inverse .btn-navbar{color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25);background-color:#0e0e0e;*background-color:#040404;background-image:-moz-linear-gradient(top,#151515,#040404);background-image:-webkit-gradient(linear,0 0,0 100%,from(#151515),to(#040404));background-image:-webkit-linear-gradient(top,#151515,#040404);background-image:-o-linear-gradient(top,#151515,#040404);background-image:linear-gradient(to bottom,#151515,#040404);background-repeat:repeat-x;border-color:#040404 #040404 #000;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff151515',endColorstr='#ff040404',GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.navbar-inverse .btn-navbar:hover,.navbar-inverse .btn-navbar:active,.navbar-inverse .btn-navbar.active,.navbar-inverse .btn-navbar.disabled,.navbar-inverse .btn-navbar[disabled]{color:#fff;background-color:#040404;*background-color:#000}.navbar-inverse .btn-navbar:active,.navbar-inverse .btn-navbar.active{background-color:#000 \9}.breadcrumb{padding:8px 15px;margin:0 0 20px;list-style:none;background-color:#f5f5f5;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.breadcrumb>li{display:inline-block;*display:inline;text-shadow:0 1px 0 #fff;*zoom:1}.breadcrumb>li>.divider{padding:0 5px;color:#ccc}.breadcrumb>.active{color:#999}.pagination{margin:20px 0}.pagination ul{display:inline-block;*display:inline;margin-bottom:0;margin-left:0;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;*zoom:1;-webkit-box-shadow:0 1px 2px rgba(0,0,0,0.05);-moz-box-shadow:0 1px 2px rgba(0,0,0,0.05);box-shadow:0 1px 2px rgba(0,0,0,0.05)}.pagination ul>li{display:inline}.pagination ul>li>a,.pagination ul>li>span{float:left;padding:4px 12px;line-height:20px;text-decoration:none;background-color:#fff;border:1px solid #ddd;border-left-width:0}.pagination ul>li>a:hover,.pagination ul>.active>a,.pagination ul>.active>span{background-color:#f5f5f5}.pagination ul>.active>a,.pagination ul>.active>span{color:#999;cursor:default}.pagination ul>.disabled>span,.pagination ul>.disabled>a,.pagination ul>.disabled>a:hover{color:#999;cursor:default;background-color:transparent}.pagination ul>li:first-child>a,.pagination ul>li:first-child>span{border-left-width:1px;-webkit-border-bottom-left-radius:4px;border-bottom-left-radius:4px;-webkit-border-top-left-radius:4px;border-top-left-radius:4px;-moz-border-radius-bottomleft:4px;-moz-border-radius-topleft:4px}.pagination ul>li:last-child>a,.pagination ul>li:last-child>span{-webkit-border-top-right-radius:4px;border-top-right-radius:4px;-webkit-border-bottom-right-radius:4px;border-bottom-right-radius:4px;-moz-border-radius-topright:4px;-moz-border-radius-bottomright:4px}.pagination-centered{text-align:center}.pagination-right{text-align:right}.pagination-large ul>li>a,.pagination-large ul>li>span{padding:11px 19px;font-size:17.5px}.pagination-large ul>li:first-child>a,.pagination-large ul>li:first-child>span{-webkit-border-bottom-left-radius:6px;border-bottom-left-radius:6px;-webkit-border-top-left-radius:6px;border-top-left-radius:6px;-moz-border-radius-bottomleft:6px;-moz-border-radius-topleft:6px}.pagination-large ul>li:last-child>a,.pagination-large ul>li:last-child>span{-webkit-border-top-right-radius:6px;border-top-right-radius:6px;-webkit-border-bottom-right-radius:6px;border-bottom-right-radius:6px;-moz-border-radius-topright:6px;-moz-border-radius-bottomright:6px}.pagination-mini ul>li:first-child>a,.pagination-small ul>li:first-child>a,.pagination-mini ul>li:first-child>span,.pagination-small ul>li:first-child>span{-webkit-border-bottom-left-radius:3px;border-bottom-left-radius:3px;-webkit-border-top-left-radius:3px;border-top-left-radius:3px;-moz-border-radius-bottomleft:3px;-moz-border-radius-topleft:3px}.pagination-mini ul>li:last-child>a,.pagination-small ul>li:last-child>a,.pagination-mini ul>li:last-child>span,.pagination-small ul>li:last-child>span{-webkit-border-top-right-radius:3px;border-top-right-radius:3px;-webkit-border-bottom-right-radius:3px;border-bottom-right-radius:3px;-moz-border-radius-topright:3px;-moz-border-radius-bottomright:3px}.pagination-small ul>li>a,.pagination-small ul>li>span{padding:2px 10px;font-size:11.9px}.pagination-mini ul>li>a,.pagination-mini ul>li>span{padding:0 6px;font-size:10.5px}.pager{margin:20px 0;text-align:center;list-style:none;*zoom:1}.pager:before,.pager:after{display:table;line-height:0;content:""}.pager:after{clear:both}.pager li{display:inline}.pager li>a,.pager li>span{display:inline-block;padding:5px 14px;background-color:#fff;border:1px solid #ddd;-webkit-border-radius:15px;-moz-border-radius:15px;border-radius:15px}.pager li>a:hover{text-decoration:none;background-color:#f5f5f5}.pager .next>a,.pager .next>span{float:right}.pager .previous>a,.pager .previous>span{float:left}.pager .disabled>a,.pager .disabled>a:hover,.pager .disabled>span{color:#999;cursor:default;background-color:#fff}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop,.modal-backdrop.fade.in{opacity:.8;filter:alpha(opacity=80)}.modal{position:fixed;top:10%;left:50%;z-index:1050;width:560px;margin-left:-280px;background-color:#fff;border:1px solid #999;border:1px solid rgba(0,0,0,0.3);*border:1px solid #999;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;outline:0;-webkit-box-shadow:0 3px 7px rgba(0,0,0,0.3);-moz-box-shadow:0 3px 7px rgba(0,0,0,0.3);box-shadow:0 3px 7px rgba(0,0,0,0.3);-webkit-background-clip:padding-box;-moz-background-clip:padding-box;background-clip:padding-box}.modal.fade{top:-25%;-webkit-transition:opacity .3s linear,top .3s ease-out;-moz-transition:opacity .3s linear,top .3s ease-out;-o-transition:opacity .3s linear,top .3s ease-out;transition:opacity .3s linear,top .3s ease-out}.modal.fade.in{top:10%}.modal-header{padding:9px 15px;border-bottom:1px solid #eee}.modal-header .close{margin-top:2px}.modal-header h3{margin:0;line-height:30px}.modal-body{position:relative;max-height:400px;padding:15px;overflow-y:auto}.modal-form{margin-bottom:0}.modal-footer{padding:14px 15px 15px;margin-bottom:0;text-align:right;background-color:#f5f5f5;border-top:1px solid #ddd;-webkit-border-radius:0 0 6px 6px;-moz-border-radius:0 0 6px 6px;border-radius:0 0 6px 6px;*zoom:1;-webkit-box-shadow:inset 0 1px 0 #fff;-moz-box-shadow:inset 0 1px 0 #fff;box-shadow:inset 0 1px 0 #fff}.modal-footer:before,.modal-footer:after{display:table;line-height:0;content:""}.modal-footer:after{clear:both}.modal-footer .btn+.btn{margin-bottom:0;margin-left:5px}.modal-footer .btn-group .btn+.btn{margin-left:-1px}.modal-footer .btn-block+.btn-block{margin-left:0}.tooltip{position:absolute;z-index:1030;display:block;padding:5px;font-size:11px;opacity:0;filter:alpha(opacity=0);visibility:visible}.tooltip.in{opacity:.8;filter:alpha(opacity=80)}.tooltip.top{margin-top:-3px}.tooltip.right{margin-left:3px}.tooltip.bottom{margin-top:3px}.tooltip.left{margin-left:-3px}.tooltip-inner{max-width:200px;padding:3px 8px;color:#fff;text-align:center;text-decoration:none;background-color:#000;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.tooltip-arrow{position:absolute;width:0;height:0;border-color:transparent;border-style:solid}.tooltip.top .tooltip-arrow{bottom:0;left:50%;margin-left:-5px;border-top-color:#000;border-width:5px 5px 0}.tooltip.right .tooltip-arrow{top:50%;left:0;margin-top:-5px;border-right-color:#000;border-width:5px 5px 5px 0}.tooltip.left .tooltip-arrow{top:50%;right:0;margin-top:-5px;border-left-color:#000;border-width:5px 0 5px 5px}.tooltip.bottom .tooltip-arrow{top:0;left:50%;margin-left:-5px;border-bottom-color:#000;border-width:0 5px 5px}.popover{position:absolute;top:0;left:0;z-index:1010;display:none;width:236px;padding:1px;text-align:left;white-space:normal;background-color:#fff;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.2);-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 5px 10px rgba(0,0,0,0.2);-moz-box-shadow:0 5px 10px rgba(0,0,0,0.2);box-shadow:0 5px 10px rgba(0,0,0,0.2);-webkit-background-clip:padding-box;-moz-background-clip:padding;background-clip:padding-box}.popover.top{margin-top:-10px}.popover.right{margin-left:10px}.popover.bottom{margin-top:10px}.popover.left{margin-left:-10px}.popover-title{padding:8px 14px;margin:0;font-size:14px;font-weight:normal;line-height:18px;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;-webkit-border-radius:5px 5px 0 0;-moz-border-radius:5px 5px 0 0;border-radius:5px 5px 0 0}.popover-content{padding:9px 14px}.popover .arrow,.popover .arrow:after{position:absolute;display:block;width:0;height:0;border-color:transparent;border-style:solid}.popover .arrow{border-width:11px}.popover .arrow:after{border-width:10px;content:""}.popover.top .arrow{bottom:-11px;left:50%;margin-left:-11px;border-top-color:#999;border-top-color:rgba(0,0,0,0.25);border-bottom-width:0}.popover.top .arrow:after{bottom:1px;margin-left:-10px;border-top-color:#fff;border-bottom-width:0}.popover.right .arrow{top:50%;left:-11px;margin-top:-11px;border-right-color:#999;border-right-color:rgba(0,0,0,0.25);border-left-width:0}.popover.right .arrow:after{bottom:-10px;left:1px;border-right-color:#fff;border-left-width:0}.popover.bottom .arrow{top:-11px;left:50%;margin-left:-11px;border-bottom-color:#999;border-bottom-color:rgba(0,0,0,0.25);border-top-width:0}.popover.bottom .arrow:after{top:1px;margin-left:-10px;border-bottom-color:#fff;border-top-width:0}.popover.left .arrow{top:50%;right:-11px;margin-top:-11px;border-left-color:#999;border-left-color:rgba(0,0,0,0.25);border-right-width:0}.popover.left .arrow:after{right:1px;bottom:-10px;border-left-color:#fff;border-right-width:0}.thumbnails{margin-left:-20px;list-style:none;*zoom:1}.thumbnails:before,.thumbnails:after{display:table;line-height:0;content:""}.thumbnails:after{clear:both}.row-fluid .thumbnails{margin-left:0}.thumbnails>li{float:left;margin-bottom:20px;margin-left:20px}.thumbnail{display:block;padding:4px;line-height:20px;border:1px solid #ddd;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;-webkit-box-shadow:0 1px 3px rgba(0,0,0,0.055);-moz-box-shadow:0 1px 3px rgba(0,0,0,0.055);box-shadow:0 1px 3px rgba(0,0,0,0.055);-webkit-transition:all .2s ease-in-out;-moz-transition:all .2s ease-in-out;-o-transition:all .2s ease-in-out;transition:all .2s ease-in-out}a.thumbnail:hover{border-color:#08c;-webkit-box-shadow:0 1px 4px rgba(0,105,214,0.25);-moz-box-shadow:0 1px 4px rgba(0,105,214,0.25);box-shadow:0 1px 4px rgba(0,105,214,0.25)}.thumbnail>img{display:block;max-width:100%;margin-right:auto;margin-left:auto}.thumbnail .caption{padding:9px;color:#555}.media,.media-body{overflow:hidden;*overflow:visible;zoom:1}.media,.media .media{margin-top:15px}.media:first-child{margin-top:0}.media-object{display:block}.media-heading{margin:0 0 5px}.media .pull-left{margin-right:10px}.media .pull-right{margin-left:10px}.media-list{margin-left:0;list-style:none}.label,.badge{display:inline-block;padding:2px 4px;font-size:11.844px;font-weight:bold;line-height:14px;color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25);white-space:nowrap;vertical-align:baseline;background-color:#999}.label{-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.badge{padding-right:9px;padding-left:9px;-webkit-border-radius:9px;-moz-border-radius:9px;border-radius:9px}.label:empty,.badge:empty{display:none}a.label:hover,a.badge:hover{color:#fff;text-decoration:none;cursor:pointer}.label-important,.badge-important{background-color:#b94a48}.label-important[href],.badge-important[href]{background-color:#953b39}.label-warning,.badge-warning{background-color:#f89406}.label-warning[href],.badge-warning[href]{background-color:#c67605}.label-success,.badge-success{background-color:#468847}.label-success[href],.badge-success[href]{background-color:#356635}.label-info,.badge-info{background-color:#3a87ad}.label-info[href],.badge-info[href]{background-color:#2d6987}.label-inverse,.badge-inverse{background-color:#333}.label-inverse[href],.badge-inverse[href]{background-color:#1a1a1a}.btn .label,.btn .badge{position:relative;top:-1px}.btn-mini .label,.btn-mini .badge{top:0}@-webkit-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@-moz-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@-ms-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@-o-keyframes progress-bar-stripes{from{background-position:0 0}to{background-position:40px 0}}@keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}.progress{height:20px;margin-bottom:20px;overflow:hidden;background-color:#f7f7f7;background-image:-moz-linear-gradient(top,#f5f5f5,#f9f9f9);background-image:-webkit-gradient(linear,0 0,0 100%,from(#f5f5f5),to(#f9f9f9));background-image:-webkit-linear-gradient(top,#f5f5f5,#f9f9f9);background-image:-o-linear-gradient(top,#f5f5f5,#f9f9f9);background-image:linear-gradient(to bottom,#f5f5f5,#f9f9f9);background-repeat:repeat-x;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff5f5f5',endColorstr='#fff9f9f9',GradientType=0);-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,0.1);-moz-box-shadow:inset 0 1px 2px rgba(0,0,0,0.1);box-shadow:inset 0 1px 2px rgba(0,0,0,0.1)}.progress .bar{float:left;width:0;height:100%;font-size:12px;color:#fff;text-align:center;text-shadow:0 -1px 0 rgba(0,0,0,0.25);background-color:#0e90d2;background-image:-moz-linear-gradient(top,#149bdf,#0480be);background-image:-webkit-gradient(linear,0 0,0 100%,from(#149bdf),to(#0480be));background-image:-webkit-linear-gradient(top,#149bdf,#0480be);background-image:-o-linear-gradient(top,#149bdf,#0480be);background-image:linear-gradient(to bottom,#149bdf,#0480be);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff149bdf',endColorstr='#ff0480be',GradientType=0);-webkit-box-shadow:inset 0 -1px 0 rgba(0,0,0,0.15);-moz-box-shadow:inset 0 -1px 0 rgba(0,0,0,0.15);box-shadow:inset 0 -1px 0 rgba(0,0,0,0.15);-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;-webkit-transition:width .6s ease;-moz-transition:width .6s ease;-o-transition:width .6s ease;transition:width .6s ease}.progress .bar+.bar{-webkit-box-shadow:inset 1px 0 0 rgba(0,0,0,0.15),inset 0 -1px 0 rgba(0,0,0,0.15);-moz-box-shadow:inset 1px 0 0 rgba(0,0,0,0.15),inset 0 -1px 0 rgba(0,0,0,0.15);box-shadow:inset 1px 0 0 rgba(0,0,0,0.15),inset 0 -1px 0 rgba(0,0,0,0.15)}.progress-striped .bar{background-color:#149bdf;background-image:-webkit-gradient(linear,0 100%,100% 0,color-stop(0.25,rgba(255,255,255,0.15)),color-stop(0.25,transparent),color-stop(0.5,transparent),color-stop(0.5,rgba(255,255,255,0.15)),color-stop(0.75,rgba(255,255,255,0.15)),color-stop(0.75,transparent),to(transparent));background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-moz-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);-webkit-background-size:40px 40px;-moz-background-size:40px 40px;-o-background-size:40px 40px;background-size:40px 40px}.progress.active .bar{-webkit-animation:progress-bar-stripes 2s linear infinite;-moz-animation:progress-bar-stripes 2s linear infinite;-ms-animation:progress-bar-stripes 2s linear infinite;-o-animation:progress-bar-stripes 2s linear infinite;animation:progress-bar-stripes 2s linear infinite}.progress-danger .bar,.progress .bar-danger{background-color:#dd514c;background-image:-moz-linear-gradient(top,#ee5f5b,#c43c35);background-image:-webkit-gradient(linear,0 0,0 100%,from(#ee5f5b),to(#c43c35));background-image:-webkit-linear-gradient(top,#ee5f5b,#c43c35);background-image:-o-linear-gradient(top,#ee5f5b,#c43c35);background-image:linear-gradient(to bottom,#ee5f5b,#c43c35);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffee5f5b',endColorstr='#ffc43c35',GradientType=0)}.progress-danger.progress-striped .bar,.progress-striped .bar-danger{background-color:#ee5f5b;background-image:-webkit-gradient(linear,0 100%,100% 0,color-stop(0.25,rgba(255,255,255,0.15)),color-stop(0.25,transparent),color-stop(0.5,transparent),color-stop(0.5,rgba(255,255,255,0.15)),color-stop(0.75,rgba(255,255,255,0.15)),color-stop(0.75,transparent),to(transparent));background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-moz-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent)}.progress-success .bar,.progress .bar-success{background-color:#5eb95e;background-image:-moz-linear-gradient(top,#62c462,#57a957);background-image:-webkit-gradient(linear,0 0,0 100%,from(#62c462),to(#57a957));background-image:-webkit-linear-gradient(top,#62c462,#57a957);background-image:-o-linear-gradient(top,#62c462,#57a957);background-image:linear-gradient(to bottom,#62c462,#57a957);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff62c462',endColorstr='#ff57a957',GradientType=0)}.progress-success.progress-striped .bar,.progress-striped .bar-success{background-color:#62c462;background-image:-webkit-gradient(linear,0 100%,100% 0,color-stop(0.25,rgba(255,255,255,0.15)),color-stop(0.25,transparent),color-stop(0.5,transparent),color-stop(0.5,rgba(255,255,255,0.15)),color-stop(0.75,rgba(255,255,255,0.15)),color-stop(0.75,transparent),to(transparent));background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-moz-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent)}.progress-info .bar,.progress .bar-info{background-color:#4bb1cf;background-image:-moz-linear-gradient(top,#5bc0de,#339bb9);background-image:-webkit-gradient(linear,0 0,0 100%,from(#5bc0de),to(#339bb9));background-image:-webkit-linear-gradient(top,#5bc0de,#339bb9);background-image:-o-linear-gradient(top,#5bc0de,#339bb9);background-image:linear-gradient(to bottom,#5bc0de,#339bb9);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de',endColorstr='#ff339bb9',GradientType=0)}.progress-info.progress-striped .bar,.progress-striped .bar-info{background-color:#5bc0de;background-image:-webkit-gradient(linear,0 100%,100% 0,color-stop(0.25,rgba(255,255,255,0.15)),color-stop(0.25,transparent),color-stop(0.5,transparent),color-stop(0.5,rgba(255,255,255,0.15)),color-stop(0.75,rgba(255,255,255,0.15)),color-stop(0.75,transparent),to(transparent));background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-moz-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent)}.progress-warning .bar,.progress .bar-warning{background-color:#faa732;background-image:-moz-linear-gradient(top,#fbb450,#f89406);background-image:-webkit-gradient(linear,0 0,0 100%,from(#fbb450),to(#f89406));background-image:-webkit-linear-gradient(top,#fbb450,#f89406);background-image:-o-linear-gradient(top,#fbb450,#f89406);background-image:linear-gradient(to bottom,#fbb450,#f89406);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffbb450',endColorstr='#fff89406',GradientType=0)}.progress-warning.progress-striped .bar,.progress-striped .bar-warning{background-color:#fbb450;background-image:-webkit-gradient(linear,0 100%,100% 0,color-stop(0.25,rgba(255,255,255,0.15)),color-stop(0.25,transparent),color-stop(0.5,transparent),color-stop(0.5,rgba(255,255,255,0.15)),color-stop(0.75,rgba(255,255,255,0.15)),color-stop(0.75,transparent),to(transparent));background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-moz-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent)}.accordion{margin-bottom:20px}.accordion-group{margin-bottom:2px;border:1px solid #e5e5e5;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.accordion-heading{border-bottom:0}.accordion-heading .accordion-toggle{display:block;padding:8px 15px}.accordion-toggle{cursor:pointer}.accordion-inner{padding:9px 15px;border-top:1px solid #e5e5e5}.carousel{position:relative;margin-bottom:20px;line-height:1}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner>.item{position:relative;display:none;-webkit-transition:.6s ease-in-out left;-moz-transition:.6s ease-in-out left;-o-transition:.6s ease-in-out left;transition:.6s ease-in-out left}.carousel-inner>.item>img{display:block;line-height:1}.carousel-inner>.active,.carousel-inner>.next,.carousel-inner>.prev{display:block}.carousel-inner>.active{left:0}.carousel-inner>.next,.carousel-inner>.prev{position:absolute;top:0;width:100%}.carousel-inner>.next{left:100%}.carousel-inner>.prev{left:-100%}.carousel-inner>.next.left,.carousel-inner>.prev.right{left:0}.carousel-inner>.active.left{left:-100%}.carousel-inner>.active.right{left:100%}.carousel-control{position:absolute;top:40%;left:15px;width:40px;height:40px;margin-top:-20px;font-size:60px;font-weight:100;line-height:30px;color:#fff;text-align:center;background:#222;border:3px solid #fff;-webkit-border-radius:23px;-moz-border-radius:23px;border-radius:23px;opacity:.5;filter:alpha(opacity=50)}.carousel-control.right{right:15px;left:auto}.carousel-control:hover{color:#fff;text-decoration:none;opacity:.9;filter:alpha(opacity=90)}.carousel-caption{position:absolute;right:0;bottom:0;left:0;padding:15px;background:#333;background:rgba(0,0,0,0.75)}.carousel-caption h4,.carousel-caption p{line-height:20px;color:#fff}.carousel-caption h4{margin:0 0 5px}.carousel-caption p{margin-bottom:0}.hero-unit{padding:60px;margin-bottom:30px;font-size:18px;font-weight:200;line-height:30px;color:inherit;background-color:#eee;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px}.hero-unit h1{margin-bottom:0;font-size:60px;line-height:1;letter-spacing:-1px;color:inherit}.hero-unit li{line-height:30px}.pull-right{float:right}.pull-left{float:left}.hide{display:none}.show{display:block}.invisible{visibility:hidden}.affix{position:fixed} diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/img/glyphicons-halflings-white.png b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/img/glyphicons-halflings-white.png new file mode 100644 index 0000000000..3bf6484a29 Binary files /dev/null and b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/img/glyphicons-halflings-white.png differ diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/img/glyphicons-halflings.png b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/img/glyphicons-halflings.png new file mode 100644 index 0000000000..a996999320 Binary files /dev/null and b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/img/glyphicons-halflings.png differ diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/js/bootstrap.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/js/bootstrap.js new file mode 100644 index 0000000000..6c15a58329 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/js/bootstrap.js @@ -0,0 +1,2159 @@ +/* =================================================== + * bootstrap-transition.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#transitions + * =================================================== + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ========================================================== */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* CSS TRANSITION SUPPORT (http://www.modernizr.com/) + * ======================================================= */ + + $(function () { + + $.support.transition = (function () { + + var transitionEnd = (function () { + + var el = document.createElement('bootstrap') + , transEndEventNames = { + 'WebkitTransition' : 'webkitTransitionEnd' + , 'MozTransition' : 'transitionend' + , 'OTransition' : 'oTransitionEnd otransitionend' + , 'transition' : 'transitionend' + } + , name + + for (name in transEndEventNames){ + if (el.style[name] !== undefined) { + return transEndEventNames[name] + } + } + + }()) + + return transitionEnd && { + end: transitionEnd + } + + })() + + }) + +}(window.jQuery);/* ========================================================== + * bootstrap-alert.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#alerts + * ========================================================== + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ========================================================== */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* ALERT CLASS DEFINITION + * ====================== */ + + var dismiss = '[data-dismiss="alert"]' + , Alert = function (el) { + $(el).on('click', dismiss, this.close) + } + + Alert.prototype.close = function (e) { + var $this = $(this) + , selector = $this.attr('data-target') + , $parent + + if (!selector) { + selector = $this.attr('href') + selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7 + } + + $parent = $(selector) + + e && e.preventDefault() + + $parent.length || ($parent = $this.hasClass('alert') ? $this : $this.parent()) + + $parent.trigger(e = $.Event('close')) + + if (e.isDefaultPrevented()) return + + $parent.removeClass('in') + + function removeElement() { + $parent + .trigger('closed') + .remove() + } + + $.support.transition && $parent.hasClass('fade') ? + $parent.on($.support.transition.end, removeElement) : + removeElement() + } + + + /* ALERT PLUGIN DEFINITION + * ======================= */ + + var old = $.fn.alert + + $.fn.alert = function (option) { + return this.each(function () { + var $this = $(this) + , data = $this.data('alert') + if (!data) $this.data('alert', (data = new Alert(this))) + if (typeof option == 'string') data[option].call($this) + }) + } + + $.fn.alert.Constructor = Alert + + + /* ALERT NO CONFLICT + * ================= */ + + $.fn.alert.noConflict = function () { + $.fn.alert = old + return this + } + + + /* ALERT DATA-API + * ============== */ + + $(document).on('click.alert.data-api', dismiss, Alert.prototype.close) + +}(window.jQuery);/* ============================================================ + * bootstrap-button.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#buttons + * ============================================================ + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============================================================ */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* BUTTON PUBLIC CLASS DEFINITION + * ============================== */ + + var Button = function (element, options) { + this.$element = $(element) + this.options = $.extend({}, $.fn.button.defaults, options) + } + + Button.prototype.setState = function (state) { + var d = 'disabled' + , $el = this.$element + , data = $el.data() + , val = $el.is('input') ? 'val' : 'html' + + state = state + 'Text' + data.resetText || $el.data('resetText', $el[val]()) + + $el[val](data[state] || this.options[state]) + + // push to event loop to allow forms to submit + setTimeout(function () { + state == 'loadingText' ? + $el.addClass(d).attr(d, d) : + $el.removeClass(d).removeAttr(d) + }, 0) + } + + Button.prototype.toggle = function () { + var $parent = this.$element.closest('[data-toggle="buttons-radio"]') + + $parent && $parent + .find('.active') + .removeClass('active') + + this.$element.toggleClass('active') + } + + + /* BUTTON PLUGIN DEFINITION + * ======================== */ + + var old = $.fn.button + + $.fn.button = function (option) { + return this.each(function () { + var $this = $(this) + , data = $this.data('button') + , options = typeof option == 'object' && option + if (!data) $this.data('button', (data = new Button(this, options))) + if (option == 'toggle') data.toggle() + else if (option) data.setState(option) + }) + } + + $.fn.button.defaults = { + loadingText: 'loading...' + } + + $.fn.button.Constructor = Button + + + /* BUTTON NO CONFLICT + * ================== */ + + $.fn.button.noConflict = function () { + $.fn.button = old + return this + } + + + /* BUTTON DATA-API + * =============== */ + + $(document).on('click.button.data-api', '[data-toggle^=button]', function (e) { + var $btn = $(e.target) + if (!$btn.hasClass('btn')) $btn = $btn.closest('.btn') + $btn.button('toggle') + }) + +}(window.jQuery);/* ========================================================== + * bootstrap-carousel.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#carousel + * ========================================================== + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ========================================================== */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* CAROUSEL CLASS DEFINITION + * ========================= */ + + var Carousel = function (element, options) { + this.$element = $(element) + this.options = options + this.options.pause == 'hover' && this.$element + .on('mouseenter', $.proxy(this.pause, this)) + .on('mouseleave', $.proxy(this.cycle, this)) + } + + Carousel.prototype = { + + cycle: function (e) { + if (!e) this.paused = false + this.options.interval + && !this.paused + && (this.interval = setInterval($.proxy(this.next, this), this.options.interval)) + return this + } + + , to: function (pos) { + var $active = this.$element.find('.item.active') + , children = $active.parent().children() + , activePos = children.index($active) + , that = this + + if (pos > (children.length - 1) || pos < 0) return + + if (this.sliding) { + return this.$element.one('slid', function () { + that.to(pos) + }) + } + + if (activePos == pos) { + return this.pause().cycle() + } + + return this.slide(pos > activePos ? 'next' : 'prev', $(children[pos])) + } + + , pause: function (e) { + if (!e) this.paused = true + if (this.$element.find('.next, .prev').length && $.support.transition.end) { + this.$element.trigger($.support.transition.end) + this.cycle() + } + clearInterval(this.interval) + this.interval = null + return this + } + + , next: function () { + if (this.sliding) return + return this.slide('next') + } + + , prev: function () { + if (this.sliding) return + return this.slide('prev') + } + + , slide: function (type, next) { + var $active = this.$element.find('.item.active') + , $next = next || $active[type]() + , isCycling = this.interval + , direction = type == 'next' ? 'left' : 'right' + , fallback = type == 'next' ? 'first' : 'last' + , that = this + , e + + this.sliding = true + + isCycling && this.pause() + + $next = $next.length ? $next : this.$element.find('.item')[fallback]() + + e = $.Event('slide', { + relatedTarget: $next[0] + }) + + if ($next.hasClass('active')) return + + if ($.support.transition && this.$element.hasClass('slide')) { + this.$element.trigger(e) + if (e.isDefaultPrevented()) return + $next.addClass(type) + $next[0].offsetWidth // force reflow + $active.addClass(direction) + $next.addClass(direction) + this.$element.one($.support.transition.end, function () { + $next.removeClass([type, direction].join(' ')).addClass('active') + $active.removeClass(['active', direction].join(' ')) + that.sliding = false + setTimeout(function () { that.$element.trigger('slid') }, 0) + }) + } else { + this.$element.trigger(e) + if (e.isDefaultPrevented()) return + $active.removeClass('active') + $next.addClass('active') + this.sliding = false + this.$element.trigger('slid') + } + + isCycling && this.cycle() + + return this + } + + } + + + /* CAROUSEL PLUGIN DEFINITION + * ========================== */ + + var old = $.fn.carousel + + $.fn.carousel = function (option) { + return this.each(function () { + var $this = $(this) + , data = $this.data('carousel') + , options = $.extend({}, $.fn.carousel.defaults, typeof option == 'object' && option) + , action = typeof option == 'string' ? option : options.slide + if (!data) $this.data('carousel', (data = new Carousel(this, options))) + if (typeof option == 'number') data.to(option) + else if (action) data[action]() + else if (options.interval) data.cycle() + }) + } + + $.fn.carousel.defaults = { + interval: 5000 + , pause: 'hover' + } + + $.fn.carousel.Constructor = Carousel + + + /* CAROUSEL NO CONFLICT + * ==================== */ + + $.fn.carousel.noConflict = function () { + $.fn.carousel = old + return this + } + + /* CAROUSEL DATA-API + * ================= */ + + $(document).on('click.carousel.data-api', '[data-slide]', function (e) { + var $this = $(this), href + , $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7 + , options = $.extend({}, $target.data(), $this.data()) + $target.carousel(options) + e.preventDefault() + }) + +}(window.jQuery);/* ============================================================= + * bootstrap-collapse.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#collapse + * ============================================================= + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============================================================ */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* COLLAPSE PUBLIC CLASS DEFINITION + * ================================ */ + + var Collapse = function (element, options) { + this.$element = $(element) + this.options = $.extend({}, $.fn.collapse.defaults, options) + + if (this.options.parent) { + this.$parent = $(this.options.parent) + } + + this.options.toggle && this.toggle() + } + + Collapse.prototype = { + + constructor: Collapse + + , dimension: function () { + var hasWidth = this.$element.hasClass('width') + return hasWidth ? 'width' : 'height' + } + + , show: function () { + var dimension + , scroll + , actives + , hasData + + if (this.transitioning) return + + dimension = this.dimension() + scroll = $.camelCase(['scroll', dimension].join('-')) + actives = this.$parent && this.$parent.find('> .accordion-group > .in') + + if (actives && actives.length) { + hasData = actives.data('collapse') + if (hasData && hasData.transitioning) return + actives.collapse('hide') + hasData || actives.data('collapse', null) + } + + this.$element[dimension](0) + this.transition('addClass', $.Event('show'), 'shown') + $.support.transition && this.$element[dimension](this.$element[0][scroll]) + } + + , hide: function () { + var dimension + if (this.transitioning) return + dimension = this.dimension() + this.reset(this.$element[dimension]()) + this.transition('removeClass', $.Event('hide'), 'hidden') + this.$element[dimension](0) + } + + , reset: function (size) { + var dimension = this.dimension() + + this.$element + .removeClass('collapse') + [dimension](size || 'auto') + [0].offsetWidth + + this.$element[size !== null ? 'addClass' : 'removeClass']('collapse') + + return this + } + + , transition: function (method, startEvent, completeEvent) { + var that = this + , complete = function () { + if (startEvent.type == 'show') that.reset() + that.transitioning = 0 + that.$element.trigger(completeEvent) + } + + this.$element.trigger(startEvent) + + if (startEvent.isDefaultPrevented()) return + + this.transitioning = 1 + + this.$element[method]('in') + + $.support.transition && this.$element.hasClass('collapse') ? + this.$element.one($.support.transition.end, complete) : + complete() + } + + , toggle: function () { + this[this.$element.hasClass('in') ? 'hide' : 'show']() + } + + } + + + /* COLLAPSE PLUGIN DEFINITION + * ========================== */ + + var old = $.fn.collapse + + $.fn.collapse = function (option) { + return this.each(function () { + var $this = $(this) + , data = $this.data('collapse') + , options = typeof option == 'object' && option + if (!data) $this.data('collapse', (data = new Collapse(this, options))) + if (typeof option == 'string') data[option]() + }) + } + + $.fn.collapse.defaults = { + toggle: true + } + + $.fn.collapse.Constructor = Collapse + + + /* COLLAPSE NO CONFLICT + * ==================== */ + + $.fn.collapse.noConflict = function () { + $.fn.collapse = old + return this + } + + + /* COLLAPSE DATA-API + * ================= */ + + $(document).on('click.collapse.data-api', '[data-toggle=collapse]', function (e) { + var $this = $(this), href + , target = $this.attr('data-target') + || e.preventDefault() + || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '') //strip for ie7 + , option = $(target).data('collapse') ? 'toggle' : $this.data() + $this[$(target).hasClass('in') ? 'addClass' : 'removeClass']('collapsed') + $(target).collapse(option) + }) + +}(window.jQuery);/* ============================================================ + * bootstrap-dropdown.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#dropdowns + * ============================================================ + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============================================================ */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* DROPDOWN CLASS DEFINITION + * ========================= */ + + var toggle = '[data-toggle=dropdown]' + , Dropdown = function (element) { + var $el = $(element).on('click.dropdown.data-api', this.toggle) + $('html').on('click.dropdown.data-api', function () { + $el.parent().removeClass('open') + }) + } + + Dropdown.prototype = { + + constructor: Dropdown + + , toggle: function (e) { + var $this = $(this) + , $parent + , isActive + + if ($this.is('.disabled, :disabled')) return + + $parent = getParent($this) + + isActive = $parent.hasClass('open') + + clearMenus() + + if (!isActive) { + $parent.toggleClass('open') + } + + $this.focus() + + return false + } + + , keydown: function (e) { + var $this + , $items + , $active + , $parent + , isActive + , index + + if (!/(38|40|27)/.test(e.keyCode)) return + + $this = $(this) + + e.preventDefault() + e.stopPropagation() + + if ($this.is('.disabled, :disabled')) return + + $parent = getParent($this) + + isActive = $parent.hasClass('open') + + if (!isActive || (isActive && e.keyCode == 27)) return $this.click() + + $items = $('[role=menu] li:not(.divider):visible a', $parent) + + if (!$items.length) return + + index = $items.index($items.filter(':focus')) + + if (e.keyCode == 38 && index > 0) index-- // up + if (e.keyCode == 40 && index < $items.length - 1) index++ // down + if (!~index) index = 0 + + $items + .eq(index) + .focus() + } + + } + + function clearMenus() { + $(toggle).each(function () { + getParent($(this)).removeClass('open') + }) + } + + function getParent($this) { + var selector = $this.attr('data-target') + , $parent + + if (!selector) { + selector = $this.attr('href') + selector = selector && /#/.test(selector) && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7 + } + + $parent = $(selector) + $parent.length || ($parent = $this.parent()) + + return $parent + } + + + /* DROPDOWN PLUGIN DEFINITION + * ========================== */ + + var old = $.fn.dropdown + + $.fn.dropdown = function (option) { + return this.each(function () { + var $this = $(this) + , data = $this.data('dropdown') + if (!data) $this.data('dropdown', (data = new Dropdown(this))) + if (typeof option == 'string') data[option].call($this) + }) + } + + $.fn.dropdown.Constructor = Dropdown + + + /* DROPDOWN NO CONFLICT + * ==================== */ + + $.fn.dropdown.noConflict = function () { + $.fn.dropdown = old + return this + } + + + /* APPLY TO STANDARD DROPDOWN ELEMENTS + * =================================== */ + + $(document) + .on('click.dropdown.data-api touchstart.dropdown.data-api', clearMenus) + .on('click.dropdown touchstart.dropdown.data-api', '.dropdown form', function (e) { e.stopPropagation() }) + .on('touchstart.dropdown.data-api', '.dropdown-menu', function (e) { e.stopPropagation() }) + .on('click.dropdown.data-api touchstart.dropdown.data-api' , toggle, Dropdown.prototype.toggle) + .on('keydown.dropdown.data-api touchstart.dropdown.data-api', toggle + ', [role=menu]' , Dropdown.prototype.keydown) + +}(window.jQuery);/* ========================================================= + * bootstrap-modal.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#modals + * ========================================================= + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ========================================================= */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* MODAL CLASS DEFINITION + * ====================== */ + + var Modal = function (element, options) { + this.options = options + this.$element = $(element) + .delegate('[data-dismiss="modal"]', 'click.dismiss.modal', $.proxy(this.hide, this)) + this.options.remote && this.$element.find('.modal-body').load(this.options.remote) + } + + Modal.prototype = { + + constructor: Modal + + , toggle: function () { + return this[!this.isShown ? 'show' : 'hide']() + } + + , show: function () { + var that = this + , e = $.Event('show') + + this.$element.trigger(e) + + if (this.isShown || e.isDefaultPrevented()) return + + this.isShown = true + + this.escape() + + this.backdrop(function () { + var transition = $.support.transition && that.$element.hasClass('fade') + + if (!that.$element.parent().length) { + that.$element.appendTo(document.body) //don't move modals dom position + } + + that.$element + .show() + + if (transition) { + that.$element[0].offsetWidth // force reflow + } + + that.$element + .addClass('in') + .attr('aria-hidden', false) + + that.enforceFocus() + + transition ? + that.$element.one($.support.transition.end, function () { that.$element.focus().trigger('shown') }) : + that.$element.focus().trigger('shown') + + }) + } + + , hide: function (e) { + e && e.preventDefault() + + var that = this + + e = $.Event('hide') + + this.$element.trigger(e) + + if (!this.isShown || e.isDefaultPrevented()) return + + this.isShown = false + + this.escape() + + $(document).off('focusin.modal') + + this.$element + .removeClass('in') + .attr('aria-hidden', true) + + $.support.transition && this.$element.hasClass('fade') ? + this.hideWithTransition() : + this.hideModal() + } + + , enforceFocus: function () { + var that = this + $(document).on('focusin.modal', function (e) { + if (that.$element[0] !== e.target && !that.$element.has(e.target).length) { + that.$element.focus() + } + }) + } + + , escape: function () { + var that = this + if (this.isShown && this.options.keyboard) { + this.$element.on('keyup.dismiss.modal', function ( e ) { + e.which == 27 && that.hide() + }) + } else if (!this.isShown) { + this.$element.off('keyup.dismiss.modal') + } + } + + , hideWithTransition: function () { + var that = this + , timeout = setTimeout(function () { + that.$element.off($.support.transition.end) + that.hideModal() + }, 500) + + this.$element.one($.support.transition.end, function () { + clearTimeout(timeout) + that.hideModal() + }) + } + + , hideModal: function (that) { + this.$element + .hide() + .trigger('hidden') + + this.backdrop() + } + + , removeBackdrop: function () { + this.$backdrop.remove() + this.$backdrop = null + } + + , backdrop: function (callback) { + var that = this + , animate = this.$element.hasClass('fade') ? 'fade' : '' + + if (this.isShown && this.options.backdrop) { + var doAnimate = $.support.transition && animate + + this.$backdrop = $('
    ') + .appendTo(document.body) + + this.$backdrop.click( + this.options.backdrop == 'static' ? + $.proxy(this.$element[0].focus, this.$element[0]) + : $.proxy(this.hide, this) + ) + + if (doAnimate) this.$backdrop[0].offsetWidth // force reflow + + this.$backdrop.addClass('in') + + doAnimate ? + this.$backdrop.one($.support.transition.end, callback) : + callback() + + } else if (!this.isShown && this.$backdrop) { + this.$backdrop.removeClass('in') + + $.support.transition && this.$element.hasClass('fade')? + this.$backdrop.one($.support.transition.end, $.proxy(this.removeBackdrop, this)) : + this.removeBackdrop() + + } else if (callback) { + callback() + } + } + } + + + /* MODAL PLUGIN DEFINITION + * ======================= */ + + var old = $.fn.modal + + $.fn.modal = function (option) { + return this.each(function () { + var $this = $(this) + , data = $this.data('modal') + , options = $.extend({}, $.fn.modal.defaults, $this.data(), typeof option == 'object' && option) + if (!data) $this.data('modal', (data = new Modal(this, options))) + if (typeof option == 'string') data[option]() + else if (options.show) data.show() + }) + } + + $.fn.modal.defaults = { + backdrop: true + , keyboard: true + , show: true + } + + $.fn.modal.Constructor = Modal + + + /* MODAL NO CONFLICT + * ================= */ + + $.fn.modal.noConflict = function () { + $.fn.modal = old + return this + } + + + /* MODAL DATA-API + * ============== */ + + $(document).on('click.modal.data-api', '[data-toggle="modal"]', function (e) { + var $this = $(this) + , href = $this.attr('href') + , $target = $($this.attr('data-target') || (href && href.replace(/.*(?=#[^\s]+$)/, ''))) //strip for ie7 + , option = $target.data('modal') ? 'toggle' : $.extend({ remote:!/#/.test(href) && href }, $target.data(), $this.data()) + + e.preventDefault() + + $target + .modal(option) + .one('hide', function () { + $this.focus() + }) + }) + +}(window.jQuery); +/* =========================================================== + * bootstrap-tooltip.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#tooltips + * Inspired by the original jQuery.tipsy by Jason Frame + * =========================================================== + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ========================================================== */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* TOOLTIP PUBLIC CLASS DEFINITION + * =============================== */ + + var Tooltip = function (element, options) { + this.init('tooltip', element, options) + } + + Tooltip.prototype = { + + constructor: Tooltip + + , init: function (type, element, options) { + var eventIn + , eventOut + + this.type = type + this.$element = $(element) + this.options = this.getOptions(options) + this.enabled = true + + if (this.options.trigger == 'click') { + this.$element.on('click.' + this.type, this.options.selector, $.proxy(this.toggle, this)) + } else if (this.options.trigger != 'manual') { + eventIn = this.options.trigger == 'hover' ? 'mouseenter' : 'focus' + eventOut = this.options.trigger == 'hover' ? 'mouseleave' : 'blur' + this.$element.on(eventIn + '.' + this.type, this.options.selector, $.proxy(this.enter, this)) + this.$element.on(eventOut + '.' + this.type, this.options.selector, $.proxy(this.leave, this)) + } + + this.options.selector ? + (this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) : + this.fixTitle() + } + + , getOptions: function (options) { + options = $.extend({}, $.fn[this.type].defaults, options, this.$element.data()) + + if (options.delay && typeof options.delay == 'number') { + options.delay = { + show: options.delay + , hide: options.delay + } + } + + return options + } + + , enter: function (e) { + var self = $(e.currentTarget)[this.type](this._options).data(this.type) + + if (!self.options.delay || !self.options.delay.show) return self.show() + + clearTimeout(this.timeout) + self.hoverState = 'in' + this.timeout = setTimeout(function() { + if (self.hoverState == 'in') self.show() + }, self.options.delay.show) + } + + , leave: function (e) { + var self = $(e.currentTarget)[this.type](this._options).data(this.type) + + if (this.timeout) clearTimeout(this.timeout) + if (!self.options.delay || !self.options.delay.hide) return self.hide() + + self.hoverState = 'out' + this.timeout = setTimeout(function() { + if (self.hoverState == 'out') self.hide() + }, self.options.delay.hide) + } + + , show: function () { + var $tip + , inside + , pos + , actualWidth + , actualHeight + , placement + , tp + + if (this.hasContent() && this.enabled) { + $tip = this.tip() + this.setContent() + + if (this.options.animation) { + $tip.addClass('fade') + } + + placement = typeof this.options.placement == 'function' ? + this.options.placement.call(this, $tip[0], this.$element[0]) : + this.options.placement + + inside = /in/.test(placement) + + $tip + .detach() + .css({ top: 0, left: 0, display: 'block' }) + .insertAfter(this.$element) + + pos = this.getPosition(inside) + + actualWidth = $tip[0].offsetWidth + actualHeight = $tip[0].offsetHeight + + switch (inside ? placement.split(' ')[1] : placement) { + case 'bottom': + tp = {top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2} + break + case 'top': + tp = {top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2} + break + case 'left': + tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth} + break + case 'right': + tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width} + break + } + + $tip + .offset(tp) + .addClass(placement) + .addClass('in') + } + } + + , setContent: function () { + var $tip = this.tip() + , title = this.getTitle() + + $tip.find('.tooltip-inner')[this.options.html ? 'html' : 'text'](title) + $tip.removeClass('fade in top bottom left right') + } + + , hide: function () { + var that = this + , $tip = this.tip() + + $tip.removeClass('in') + + function removeWithAnimation() { + var timeout = setTimeout(function () { + $tip.off($.support.transition.end).detach() + }, 500) + + $tip.one($.support.transition.end, function () { + clearTimeout(timeout) + $tip.detach() + }) + } + + $.support.transition && this.$tip.hasClass('fade') ? + removeWithAnimation() : + $tip.detach() + + return this + } + + , fixTitle: function () { + var $e = this.$element + if ($e.attr('title') || typeof($e.attr('data-original-title')) != 'string') { + $e.attr('data-original-title', $e.attr('title') || '').removeAttr('title') + } + } + + , hasContent: function () { + return this.getTitle() + } + + , getPosition: function (inside) { + return $.extend({}, (inside ? {top: 0, left: 0} : this.$element.offset()), { + width: this.$element[0].offsetWidth + , height: this.$element[0].offsetHeight + }) + } + + , getTitle: function () { + var title + , $e = this.$element + , o = this.options + + title = $e.attr('data-original-title') + || (typeof o.title == 'function' ? o.title.call($e[0]) : o.title) + + return title + } + + , tip: function () { + return this.$tip = this.$tip || $(this.options.template) + } + + , validate: function () { + if (!this.$element[0].parentNode) { + this.hide() + this.$element = null + this.options = null + } + } + + , enable: function () { + this.enabled = true + } + + , disable: function () { + this.enabled = false + } + + , toggleEnabled: function () { + this.enabled = !this.enabled + } + + , toggle: function (e) { + var self = $(e.currentTarget)[this.type](this._options).data(this.type) + self[self.tip().hasClass('in') ? 'hide' : 'show']() + } + + , destroy: function () { + this.hide().$element.off('.' + this.type).removeData(this.type) + } + + } + + + /* TOOLTIP PLUGIN DEFINITION + * ========================= */ + + var old = $.fn.tooltip + + $.fn.tooltip = function ( option ) { + return this.each(function () { + var $this = $(this) + , data = $this.data('tooltip') + , options = typeof option == 'object' && option + if (!data) $this.data('tooltip', (data = new Tooltip(this, options))) + if (typeof option == 'string') data[option]() + }) + } + + $.fn.tooltip.Constructor = Tooltip + + $.fn.tooltip.defaults = { + animation: true + , placement: 'top' + , selector: false + , template: '
    ' + , trigger: 'hover' + , title: '' + , delay: 0 + , html: false + } + + + /* TOOLTIP NO CONFLICT + * =================== */ + + $.fn.tooltip.noConflict = function () { + $.fn.tooltip = old + return this + } + +}(window.jQuery);/* =========================================================== + * bootstrap-popover.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#popovers + * =========================================================== + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * =========================================================== */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* POPOVER PUBLIC CLASS DEFINITION + * =============================== */ + + var Popover = function (element, options) { + this.init('popover', element, options) + } + + + /* NOTE: POPOVER EXTENDS BOOTSTRAP-TOOLTIP.js + ========================================== */ + + Popover.prototype = $.extend({}, $.fn.tooltip.Constructor.prototype, { + + constructor: Popover + + , setContent: function () { + var $tip = this.tip() + , title = this.getTitle() + , content = this.getContent() + + $tip.find('.popover-title')[this.options.html ? 'html' : 'text'](title) + $tip.find('.popover-content')[this.options.html ? 'html' : 'text'](content) + + $tip.removeClass('fade top bottom left right in') + } + + , hasContent: function () { + return this.getTitle() || this.getContent() + } + + , getContent: function () { + var content + , $e = this.$element + , o = this.options + + content = $e.attr('data-content') + || (typeof o.content == 'function' ? o.content.call($e[0]) : o.content) + + return content + } + + , tip: function () { + if (!this.$tip) { + this.$tip = $(this.options.template) + } + return this.$tip + } + + , destroy: function () { + this.hide().$element.off('.' + this.type).removeData(this.type) + } + + }) + + + /* POPOVER PLUGIN DEFINITION + * ======================= */ + + var old = $.fn.popover + + $.fn.popover = function (option) { + return this.each(function () { + var $this = $(this) + , data = $this.data('popover') + , options = typeof option == 'object' && option + if (!data) $this.data('popover', (data = new Popover(this, options))) + if (typeof option == 'string') data[option]() + }) + } + + $.fn.popover.Constructor = Popover + + $.fn.popover.defaults = $.extend({} , $.fn.tooltip.defaults, { + placement: 'right' + , trigger: 'click' + , content: '' + , template: '

    ' + }) + + + /* POPOVER NO CONFLICT + * =================== */ + + $.fn.popover.noConflict = function () { + $.fn.popover = old + return this + } + +}(window.jQuery);/* ============================================================= + * bootstrap-scrollspy.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#scrollspy + * ============================================================= + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============================================================== */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* SCROLLSPY CLASS DEFINITION + * ========================== */ + + function ScrollSpy(element, options) { + var process = $.proxy(this.process, this) + , $element = $(element).is('body') ? $(window) : $(element) + , href + this.options = $.extend({}, $.fn.scrollspy.defaults, options) + this.$scrollElement = $element.on('scroll.scroll-spy.data-api', process) + this.selector = (this.options.target + || ((href = $(element).attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7 + || '') + ' .nav li > a' + this.$body = $('body') + this.refresh() + this.process() + } + + ScrollSpy.prototype = { + + constructor: ScrollSpy + + , refresh: function () { + var self = this + , $targets + + this.offsets = $([]) + this.targets = $([]) + + $targets = this.$body + .find(this.selector) + .map(function () { + var $el = $(this) + , href = $el.data('target') || $el.attr('href') + , $href = /^#\w/.test(href) && $(href) + return ( $href + && $href.length + && [[ $href.position().top + self.$scrollElement.scrollTop(), href ]] ) || null + }) + .sort(function (a, b) { return a[0] - b[0] }) + .each(function () { + self.offsets.push(this[0]) + self.targets.push(this[1]) + }) + } + + , process: function () { + var scrollTop = this.$scrollElement.scrollTop() + this.options.offset + , scrollHeight = this.$scrollElement[0].scrollHeight || this.$body[0].scrollHeight + , maxScroll = scrollHeight - this.$scrollElement.height() + , offsets = this.offsets + , targets = this.targets + , activeTarget = this.activeTarget + , i + + if (scrollTop >= maxScroll) { + return activeTarget != (i = targets.last()[0]) + && this.activate ( i ) + } + + for (i = offsets.length; i--;) { + activeTarget != targets[i] + && scrollTop >= offsets[i] + && (!offsets[i + 1] || scrollTop <= offsets[i + 1]) + && this.activate( targets[i] ) + } + } + + , activate: function (target) { + var active + , selector + + this.activeTarget = target + + $(this.selector) + .parent('.active') + .removeClass('active') + + selector = this.selector + + '[data-target="' + target + '"],' + + this.selector + '[href="' + target + '"]' + + active = $(selector) + .parent('li') + .addClass('active') + + if (active.parent('.dropdown-menu').length) { + active = active.closest('li.dropdown').addClass('active') + } + + active.trigger('activate') + } + + } + + + /* SCROLLSPY PLUGIN DEFINITION + * =========================== */ + + var old = $.fn.scrollspy + + $.fn.scrollspy = function (option) { + return this.each(function () { + var $this = $(this) + , data = $this.data('scrollspy') + , options = typeof option == 'object' && option + if (!data) $this.data('scrollspy', (data = new ScrollSpy(this, options))) + if (typeof option == 'string') data[option]() + }) + } + + $.fn.scrollspy.Constructor = ScrollSpy + + $.fn.scrollspy.defaults = { + offset: 10 + } + + + /* SCROLLSPY NO CONFLICT + * ===================== */ + + $.fn.scrollspy.noConflict = function () { + $.fn.scrollspy = old + return this + } + + + /* SCROLLSPY DATA-API + * ================== */ + + $(window).on('load', function () { + $('[data-spy="scroll"]').each(function () { + var $spy = $(this) + $spy.scrollspy($spy.data()) + }) + }) + +}(window.jQuery);/* ======================================================== + * bootstrap-tab.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#tabs + * ======================================================== + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ======================================================== */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* TAB CLASS DEFINITION + * ==================== */ + + var Tab = function (element) { + this.element = $(element) + } + + Tab.prototype = { + + constructor: Tab + + , show: function () { + var $this = this.element + , $ul = $this.closest('ul:not(.dropdown-menu)') + , selector = $this.attr('data-target') + , previous + , $target + , e + + if (!selector) { + selector = $this.attr('href') + selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7 + } + + if ( $this.parent('li').hasClass('active') ) return + + previous = $ul.find('.active:last a')[0] + + e = $.Event('show', { + relatedTarget: previous + }) + + $this.trigger(e) + + if (e.isDefaultPrevented()) return + + $target = $(selector) + + this.activate($this.parent('li'), $ul) + this.activate($target, $target.parent(), function () { + $this.trigger({ + type: 'shown' + , relatedTarget: previous + }) + }) + } + + , activate: function ( element, container, callback) { + var $active = container.find('> .active') + , transition = callback + && $.support.transition + && $active.hasClass('fade') + + function next() { + $active + .removeClass('active') + .find('> .dropdown-menu > .active') + .removeClass('active') + + element.addClass('active') + + if (transition) { + element[0].offsetWidth // reflow for transition + element.addClass('in') + } else { + element.removeClass('fade') + } + + if ( element.parent('.dropdown-menu') ) { + element.closest('li.dropdown').addClass('active') + } + + callback && callback() + } + + transition ? + $active.one($.support.transition.end, next) : + next() + + $active.removeClass('in') + } + } + + + /* TAB PLUGIN DEFINITION + * ===================== */ + + var old = $.fn.tab + + $.fn.tab = function ( option ) { + return this.each(function () { + var $this = $(this) + , data = $this.data('tab') + if (!data) $this.data('tab', (data = new Tab(this))) + if (typeof option == 'string') data[option]() + }) + } + + $.fn.tab.Constructor = Tab + + + /* TAB NO CONFLICT + * =============== */ + + $.fn.tab.noConflict = function () { + $.fn.tab = old + return this + } + + + /* TAB DATA-API + * ============ */ + + $(document).on('click.tab.data-api', '[data-toggle="tab"], [data-toggle="pill"]', function (e) { + e.preventDefault() + $(this).tab('show') + }) + +}(window.jQuery);/* ============================================================= + * bootstrap-typeahead.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#typeahead + * ============================================================= + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============================================================ */ + + +!function($){ + + "use strict"; // jshint ;_; + + + /* TYPEAHEAD PUBLIC CLASS DEFINITION + * ================================= */ + + var Typeahead = function (element, options) { + this.$element = $(element) + this.options = $.extend({}, $.fn.typeahead.defaults, options) + this.matcher = this.options.matcher || this.matcher + this.sorter = this.options.sorter || this.sorter + this.highlighter = this.options.highlighter || this.highlighter + this.updater = this.options.updater || this.updater + this.source = this.options.source + this.$menu = $(this.options.menu) + this.shown = false + this.listen() + } + + Typeahead.prototype = { + + constructor: Typeahead + + , select: function () { + var val = this.$menu.find('.active').attr('data-value') + this.$element + .val(this.updater(val)) + .change() + return this.hide() + } + + , updater: function (item) { + return item + } + + , show: function () { + var pos = $.extend({}, this.$element.position(), { + height: this.$element[0].offsetHeight + }) + + this.$menu + .insertAfter(this.$element) + .css({ + top: pos.top + pos.height + , left: pos.left + }) + .show() + + this.shown = true + return this + } + + , hide: function () { + this.$menu.hide() + this.shown = false + return this + } + + , lookup: function (event) { + var items + + this.query = this.$element.val() + + if (!this.query || this.query.length < this.options.minLength) { + return this.shown ? this.hide() : this + } + + items = $.isFunction(this.source) ? this.source(this.query, $.proxy(this.process, this)) : this.source + + return items ? this.process(items) : this + } + + , process: function (items) { + var that = this + + items = $.grep(items, function (item) { + return that.matcher(item) + }) + + items = this.sorter(items) + + if (!items.length) { + return this.shown ? this.hide() : this + } + + return this.render(items.slice(0, this.options.items)).show() + } + + , matcher: function (item) { + return ~item.toLowerCase().indexOf(this.query.toLowerCase()) + } + + , sorter: function (items) { + var beginswith = [] + , caseSensitive = [] + , caseInsensitive = [] + , item + + while (item = items.shift()) { + if (!item.toLowerCase().indexOf(this.query.toLowerCase())) beginswith.push(item) + else if (~item.indexOf(this.query)) caseSensitive.push(item) + else caseInsensitive.push(item) + } + + return beginswith.concat(caseSensitive, caseInsensitive) + } + + , highlighter: function (item) { + var query = this.query.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, '\\$&') + return item.replace(new RegExp('(' + query + ')', 'ig'), function ($1, match) { + return '' + match + '' + }) + } + + , render: function (items) { + var that = this + + items = $(items).map(function (i, item) { + i = $(that.options.item).attr('data-value', item) + i.find('a').html(that.highlighter(item)) + return i[0] + }) + + items.first().addClass('active') + this.$menu.html(items) + return this + } + + , next: function (event) { + var active = this.$menu.find('.active').removeClass('active') + , next = active.next() + + if (!next.length) { + next = $(this.$menu.find('li')[0]) + } + + next.addClass('active') + } + + , prev: function (event) { + var active = this.$menu.find('.active').removeClass('active') + , prev = active.prev() + + if (!prev.length) { + prev = this.$menu.find('li').last() + } + + prev.addClass('active') + } + + , listen: function () { + this.$element + .on('blur', $.proxy(this.blur, this)) + .on('keypress', $.proxy(this.keypress, this)) + .on('keyup', $.proxy(this.keyup, this)) + + if (this.eventSupported('keydown')) { + this.$element.on('keydown', $.proxy(this.keydown, this)) + } + + this.$menu + .on('click', $.proxy(this.click, this)) + .on('mouseenter', 'li', $.proxy(this.mouseenter, this)) + } + + , eventSupported: function(eventName) { + var isSupported = eventName in this.$element + if (!isSupported) { + this.$element.setAttribute(eventName, 'return;') + isSupported = typeof this.$element[eventName] === 'function' + } + return isSupported + } + + , move: function (e) { + if (!this.shown) return + + switch(e.keyCode) { + case 9: // tab + case 13: // enter + case 27: // escape + e.preventDefault() + break + + case 38: // up arrow + e.preventDefault() + this.prev() + break + + case 40: // down arrow + e.preventDefault() + this.next() + break + } + + e.stopPropagation() + } + + , keydown: function (e) { + this.suppressKeyPressRepeat = ~$.inArray(e.keyCode, [40,38,9,13,27]) + this.move(e) + } + + , keypress: function (e) { + if (this.suppressKeyPressRepeat) return + this.move(e) + } + + , keyup: function (e) { + switch(e.keyCode) { + case 40: // down arrow + case 38: // up arrow + case 16: // shift + case 17: // ctrl + case 18: // alt + break + + case 9: // tab + case 13: // enter + if (!this.shown) return + this.select() + break + + case 27: // escape + if (!this.shown) return + this.hide() + break + + default: + this.lookup() + } + + e.stopPropagation() + e.preventDefault() + } + + , blur: function (e) { + var that = this + setTimeout(function () { that.hide() }, 150) + } + + , click: function (e) { + e.stopPropagation() + e.preventDefault() + this.select() + } + + , mouseenter: function (e) { + this.$menu.find('.active').removeClass('active') + $(e.currentTarget).addClass('active') + } + + } + + + /* TYPEAHEAD PLUGIN DEFINITION + * =========================== */ + + var old = $.fn.typeahead + + $.fn.typeahead = function (option) { + return this.each(function () { + var $this = $(this) + , data = $this.data('typeahead') + , options = typeof option == 'object' && option + if (!data) $this.data('typeahead', (data = new Typeahead(this, options))) + if (typeof option == 'string') data[option]() + }) + } + + $.fn.typeahead.defaults = { + source: [] + , items: 8 + , menu: '
      ' + , item: '
      • ' + , minLength: 1 + } + + $.fn.typeahead.Constructor = Typeahead + + + /* TYPEAHEAD NO CONFLICT + * =================== */ + + $.fn.typeahead.noConflict = function () { + $.fn.typeahead = old + return this + } + + + /* TYPEAHEAD DATA-API + * ================== */ + + $(document).on('focus.typeahead.data-api', '[data-provide="typeahead"]', function (e) { + var $this = $(this) + if ($this.data('typeahead')) return + e.preventDefault() + $this.typeahead($this.data()) + }) + +}(window.jQuery); +/* ========================================================== + * bootstrap-affix.js v2.2.2 + * http://twitter.github.com/bootstrap/javascript.html#affix + * ========================================================== + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ========================================================== */ + + +!function ($) { + + "use strict"; // jshint ;_; + + + /* AFFIX CLASS DEFINITION + * ====================== */ + + var Affix = function (element, options) { + this.options = $.extend({}, $.fn.affix.defaults, options) + this.$window = $(window) + .on('scroll.affix.data-api', $.proxy(this.checkPosition, this)) + .on('click.affix.data-api', $.proxy(function () { setTimeout($.proxy(this.checkPosition, this), 1) }, this)) + this.$element = $(element) + this.checkPosition() + } + + Affix.prototype.checkPosition = function () { + if (!this.$element.is(':visible')) return + + var scrollHeight = $(document).height() + , scrollTop = this.$window.scrollTop() + , position = this.$element.offset() + , offset = this.options.offset + , offsetBottom = offset.bottom + , offsetTop = offset.top + , reset = 'affix affix-top affix-bottom' + , affix + + if (typeof offset != 'object') offsetBottom = offsetTop = offset + if (typeof offsetTop == 'function') offsetTop = offset.top() + if (typeof offsetBottom == 'function') offsetBottom = offset.bottom() + + affix = this.unpin != null && (scrollTop + this.unpin <= position.top) ? + false : offsetBottom != null && (position.top + this.$element.height() >= scrollHeight - offsetBottom) ? + 'bottom' : offsetTop != null && scrollTop <= offsetTop ? + 'top' : false + + if (this.affixed === affix) return + + this.affixed = affix + this.unpin = affix == 'bottom' ? position.top - scrollTop : null + + this.$element.removeClass(reset).addClass('affix' + (affix ? '-' + affix : '')) + } + + + /* AFFIX PLUGIN DEFINITION + * ======================= */ + + var old = $.fn.affix + + $.fn.affix = function (option) { + return this.each(function () { + var $this = $(this) + , data = $this.data('affix') + , options = typeof option == 'object' && option + if (!data) $this.data('affix', (data = new Affix(this, options))) + if (typeof option == 'string') data[option]() + }) + } + + $.fn.affix.Constructor = Affix + + $.fn.affix.defaults = { + offset: 0 + } + + + /* AFFIX NO CONFLICT + * ================= */ + + $.fn.affix.noConflict = function () { + $.fn.affix = old + return this + } + + + /* AFFIX DATA-API + * ============== */ + + $(window).on('load', function () { + $('[data-spy="affix"]').each(function () { + var $spy = $(this) + , data = $spy.data() + + data.offset = data.offset || {} + + data.offsetBottom && (data.offset.bottom = data.offsetBottom) + data.offsetTop && (data.offset.top = data.offsetTop) + + $spy.affix(data) + }) + }) + + +}(window.jQuery); \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/js/bootstrap.min.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/js/bootstrap.min.js new file mode 100644 index 0000000000..6eeb15ce3b --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/bootstrap/js/bootstrap.min.js @@ -0,0 +1,6 @@ +/*! +* Bootstrap.js by @fat & @mdo +* Copyright 2012 Twitter, Inc. +* http://www.apache.org/licenses/LICENSE-2.0.txt +*/ +!function($){"use strict";$(function(){$.support.transition=function(){var transitionEnd=function(){var name,el=document.createElement("bootstrap"),transEndEventNames={WebkitTransition:"webkitTransitionEnd",MozTransition:"transitionend",OTransition:"oTransitionEnd otransitionend",transition:"transitionend"};for(name in transEndEventNames)if(void 0!==el.style[name])return transEndEventNames[name]}();return transitionEnd&&{end:transitionEnd}}()})}(window.jQuery),!function($){"use strict";var dismiss='[data-dismiss="alert"]',Alert=function(el){$(el).on("click",dismiss,this.close)};Alert.prototype.close=function(e){function removeElement(){$parent.trigger("closed").remove()}var $parent,$this=$(this),selector=$this.attr("data-target");selector||(selector=$this.attr("href"),selector=selector&&selector.replace(/.*(?=#[^\s]*$)/,"")),$parent=$(selector),e&&e.preventDefault(),$parent.length||($parent=$this.hasClass("alert")?$this:$this.parent()),$parent.trigger(e=$.Event("close")),e.isDefaultPrevented()||($parent.removeClass("in"),$.support.transition&&$parent.hasClass("fade")?$parent.on($.support.transition.end,removeElement):removeElement())};var old=$.fn.alert;$.fn.alert=function(option){return this.each(function(){var $this=$(this),data=$this.data("alert");data||$this.data("alert",data=new Alert(this)),"string"==typeof option&&data[option].call($this)})},$.fn.alert.Constructor=Alert,$.fn.alert.noConflict=function(){return $.fn.alert=old,this},$(document).on("click.alert.data-api",dismiss,Alert.prototype.close)}(window.jQuery),!function($){"use strict";var Button=function(element,options){this.$element=$(element),this.options=$.extend({},$.fn.button.defaults,options)};Button.prototype.setState=function(state){var d="disabled",$el=this.$element,data=$el.data(),val=$el.is("input")?"val":"html";state+="Text",data.resetText||$el.data("resetText",$el[val]()),$el[val](data[state]||this.options[state]),setTimeout(function(){"loadingText"==state?$el.addClass(d).attr(d,d):$el.removeClass(d).removeAttr(d)},0)},Button.prototype.toggle=function(){var $parent=this.$element.closest('[data-toggle="buttons-radio"]');$parent&&$parent.find(".active").removeClass("active"),this.$element.toggleClass("active")};var old=$.fn.button;$.fn.button=function(option){return this.each(function(){var $this=$(this),data=$this.data("button"),options="object"==typeof option&&option;data||$this.data("button",data=new Button(this,options)),"toggle"==option?data.toggle():option&&data.setState(option)})},$.fn.button.defaults={loadingText:"loading..."},$.fn.button.Constructor=Button,$.fn.button.noConflict=function(){return $.fn.button=old,this},$(document).on("click.button.data-api","[data-toggle^=button]",function(e){var $btn=$(e.target);$btn.hasClass("btn")||($btn=$btn.closest(".btn")),$btn.button("toggle")})}(window.jQuery),!function($){"use strict";var Carousel=function(element,options){this.$element=$(element),this.options=options,"hover"==this.options.pause&&this.$element.on("mouseenter",$.proxy(this.pause,this)).on("mouseleave",$.proxy(this.cycle,this))};Carousel.prototype={cycle:function(e){return e||(this.paused=!1),this.options.interval&&!this.paused&&(this.interval=setInterval($.proxy(this.next,this),this.options.interval)),this},to:function(pos){var $active=this.$element.find(".item.active"),children=$active.parent().children(),activePos=children.index($active),that=this;if(!(pos>children.length-1||0>pos))return this.sliding?this.$element.one("slid",function(){that.to(pos)}):activePos==pos?this.pause().cycle():this.slide(pos>activePos?"next":"prev",$(children[pos]))},pause:function(e){return e||(this.paused=!0),this.$element.find(".next, .prev").length&&$.support.transition.end&&(this.$element.trigger($.support.transition.end),this.cycle()),clearInterval(this.interval),this.interval=null,this},next:function(){return this.sliding?void 0:this.slide("next")},prev:function(){return this.sliding?void 0:this.slide("prev")},slide:function(type,next){var e,$active=this.$element.find(".item.active"),$next=next||$active[type](),isCycling=this.interval,direction="next"==type?"left":"right",fallback="next"==type?"first":"last",that=this;if(this.sliding=!0,isCycling&&this.pause(),$next=$next.length?$next:this.$element.find(".item")[fallback](),e=$.Event("slide",{relatedTarget:$next[0]}),!$next.hasClass("active")){if($.support.transition&&this.$element.hasClass("slide")){if(this.$element.trigger(e),e.isDefaultPrevented())return;$next.addClass(type),$next[0].offsetWidth,$active.addClass(direction),$next.addClass(direction),this.$element.one($.support.transition.end,function(){$next.removeClass([type,direction].join(" ")).addClass("active"),$active.removeClass(["active",direction].join(" ")),that.sliding=!1,setTimeout(function(){that.$element.trigger("slid")},0)})}else{if(this.$element.trigger(e),e.isDefaultPrevented())return;$active.removeClass("active"),$next.addClass("active"),this.sliding=!1,this.$element.trigger("slid")}return isCycling&&this.cycle(),this}}};var old=$.fn.carousel;$.fn.carousel=function(option){return this.each(function(){var $this=$(this),data=$this.data("carousel"),options=$.extend({},$.fn.carousel.defaults,"object"==typeof option&&option),action="string"==typeof option?option:options.slide;data||$this.data("carousel",data=new Carousel(this,options)),"number"==typeof option?data.to(option):action?data[action]():options.interval&&data.cycle()})},$.fn.carousel.defaults={interval:5e3,pause:"hover"},$.fn.carousel.Constructor=Carousel,$.fn.carousel.noConflict=function(){return $.fn.carousel=old,this},$(document).on("click.carousel.data-api","[data-slide]",function(e){var href,$this=$(this),$target=$($this.attr("data-target")||(href=$this.attr("href"))&&href.replace(/.*(?=#[^\s]+$)/,"")),options=$.extend({},$target.data(),$this.data());$target.carousel(options),e.preventDefault()})}(window.jQuery),!function($){"use strict";var Collapse=function(element,options){this.$element=$(element),this.options=$.extend({},$.fn.collapse.defaults,options),this.options.parent&&(this.$parent=$(this.options.parent)),this.options.toggle&&this.toggle()};Collapse.prototype={constructor:Collapse,dimension:function(){var hasWidth=this.$element.hasClass("width");return hasWidth?"width":"height"},show:function(){var dimension,scroll,actives,hasData;if(!this.transitioning){if(dimension=this.dimension(),scroll=$.camelCase(["scroll",dimension].join("-")),actives=this.$parent&&this.$parent.find("> .accordion-group > .in"),actives&&actives.length){if(hasData=actives.data("collapse"),hasData&&hasData.transitioning)return;actives.collapse("hide"),hasData||actives.data("collapse",null)}this.$element[dimension](0),this.transition("addClass",$.Event("show"),"shown"),$.support.transition&&this.$element[dimension](this.$element[0][scroll])}},hide:function(){var dimension;this.transitioning||(dimension=this.dimension(),this.reset(this.$element[dimension]()),this.transition("removeClass",$.Event("hide"),"hidden"),this.$element[dimension](0))},reset:function(size){var dimension=this.dimension();return this.$element.removeClass("collapse")[dimension](size||"auto")[0].offsetWidth,this.$element[null!==size?"addClass":"removeClass"]("collapse"),this},transition:function(method,startEvent,completeEvent){var that=this,complete=function(){"show"==startEvent.type&&that.reset(),that.transitioning=0,that.$element.trigger(completeEvent)};this.$element.trigger(startEvent),startEvent.isDefaultPrevented()||(this.transitioning=1,this.$element[method]("in"),$.support.transition&&this.$element.hasClass("collapse")?this.$element.one($.support.transition.end,complete):complete())},toggle:function(){this[this.$element.hasClass("in")?"hide":"show"]()}};var old=$.fn.collapse;$.fn.collapse=function(option){return this.each(function(){var $this=$(this),data=$this.data("collapse"),options="object"==typeof option&&option;data||$this.data("collapse",data=new Collapse(this,options)),"string"==typeof option&&data[option]()})},$.fn.collapse.defaults={toggle:!0},$.fn.collapse.Constructor=Collapse,$.fn.collapse.noConflict=function(){return $.fn.collapse=old,this},$(document).on("click.collapse.data-api","[data-toggle=collapse]",function(e){var href,$this=$(this),target=$this.attr("data-target")||e.preventDefault()||(href=$this.attr("href"))&&href.replace(/.*(?=#[^\s]+$)/,""),option=$(target).data("collapse")?"toggle":$this.data();$this[$(target).hasClass("in")?"addClass":"removeClass"]("collapsed"),$(target).collapse(option)})}(window.jQuery),!function($){"use strict";function clearMenus(){$(toggle).each(function(){getParent($(this)).removeClass("open")})}function getParent($this){var $parent,selector=$this.attr("data-target");return selector||(selector=$this.attr("href"),selector=selector&&/#/.test(selector)&&selector.replace(/.*(?=#[^\s]*$)/,"")),$parent=$(selector),$parent.length||($parent=$this.parent()),$parent}var toggle="[data-toggle=dropdown]",Dropdown=function(element){var $el=$(element).on("click.dropdown.data-api",this.toggle);$("html").on("click.dropdown.data-api",function(){$el.parent().removeClass("open")})};Dropdown.prototype={constructor:Dropdown,toggle:function(){var $parent,isActive,$this=$(this);if(!$this.is(".disabled, :disabled"))return $parent=getParent($this),isActive=$parent.hasClass("open"),clearMenus(),isActive||$parent.toggleClass("open"),$this.focus(),!1},keydown:function(e){var $this,$items,$parent,isActive,index;if(/(38|40|27)/.test(e.keyCode)&&($this=$(this),e.preventDefault(),e.stopPropagation(),!$this.is(".disabled, :disabled"))){if($parent=getParent($this),isActive=$parent.hasClass("open"),!isActive||isActive&&27==e.keyCode)return $this.click();$items=$("[role=menu] li:not(.divider):visible a",$parent),$items.length&&(index=$items.index($items.filter(":focus")),38==e.keyCode&&index>0&&index--,40==e.keyCode&&$items.length-1>index&&index++,~index||(index=0),$items.eq(index).focus())}}};var old=$.fn.dropdown;$.fn.dropdown=function(option){return this.each(function(){var $this=$(this),data=$this.data("dropdown");data||$this.data("dropdown",data=new Dropdown(this)),"string"==typeof option&&data[option].call($this)})},$.fn.dropdown.Constructor=Dropdown,$.fn.dropdown.noConflict=function(){return $.fn.dropdown=old,this},$(document).on("click.dropdown.data-api touchstart.dropdown.data-api",clearMenus).on("click.dropdown touchstart.dropdown.data-api",".dropdown form",function(e){e.stopPropagation()}).on("touchstart.dropdown.data-api",".dropdown-menu",function(e){e.stopPropagation()}).on("click.dropdown.data-api touchstart.dropdown.data-api",toggle,Dropdown.prototype.toggle).on("keydown.dropdown.data-api touchstart.dropdown.data-api",toggle+", [role=menu]",Dropdown.prototype.keydown)}(window.jQuery),!function($){"use strict";var Modal=function(element,options){this.options=options,this.$element=$(element).delegate('[data-dismiss="modal"]',"click.dismiss.modal",$.proxy(this.hide,this)),this.options.remote&&this.$element.find(".modal-body").load(this.options.remote)};Modal.prototype={constructor:Modal,toggle:function(){return this[this.isShown?"hide":"show"]()},show:function(){var that=this,e=$.Event("show");this.$element.trigger(e),this.isShown||e.isDefaultPrevented()||(this.isShown=!0,this.escape(),this.backdrop(function(){var transition=$.support.transition&&that.$element.hasClass("fade");that.$element.parent().length||that.$element.appendTo(document.body),that.$element.show(),transition&&that.$element[0].offsetWidth,that.$element.addClass("in").attr("aria-hidden",!1),that.enforceFocus(),transition?that.$element.one($.support.transition.end,function(){that.$element.focus().trigger("shown")}):that.$element.focus().trigger("shown")}))},hide:function(e){e&&e.preventDefault(),e=$.Event("hide"),this.$element.trigger(e),this.isShown&&!e.isDefaultPrevented()&&(this.isShown=!1,this.escape(),$(document).off("focusin.modal"),this.$element.removeClass("in").attr("aria-hidden",!0),$.support.transition&&this.$element.hasClass("fade")?this.hideWithTransition():this.hideModal())},enforceFocus:function(){var that=this;$(document).on("focusin.modal",function(e){that.$element[0]===e.target||that.$element.has(e.target).length||that.$element.focus()})},escape:function(){var that=this;this.isShown&&this.options.keyboard?this.$element.on("keyup.dismiss.modal",function(e){27==e.which&&that.hide()}):this.isShown||this.$element.off("keyup.dismiss.modal")},hideWithTransition:function(){var that=this,timeout=setTimeout(function(){that.$element.off($.support.transition.end),that.hideModal()},500);this.$element.one($.support.transition.end,function(){clearTimeout(timeout),that.hideModal()})},hideModal:function(){this.$element.hide().trigger("hidden"),this.backdrop()},removeBackdrop:function(){this.$backdrop.remove(),this.$backdrop=null},backdrop:function(callback){var animate=this.$element.hasClass("fade")?"fade":"";if(this.isShown&&this.options.backdrop){var doAnimate=$.support.transition&&animate;this.$backdrop=$('
      ').appendTo(document.body),this.$backdrop.click("static"==this.options.backdrop?$.proxy(this.$element[0].focus,this.$element[0]):$.proxy(this.hide,this)),doAnimate&&this.$backdrop[0].offsetWidth,this.$backdrop.addClass("in"),doAnimate?this.$backdrop.one($.support.transition.end,callback):callback()}else!this.isShown&&this.$backdrop?(this.$backdrop.removeClass("in"),$.support.transition&&this.$element.hasClass("fade")?this.$backdrop.one($.support.transition.end,$.proxy(this.removeBackdrop,this)):this.removeBackdrop()):callback&&callback()}};var old=$.fn.modal;$.fn.modal=function(option){return this.each(function(){var $this=$(this),data=$this.data("modal"),options=$.extend({},$.fn.modal.defaults,$this.data(),"object"==typeof option&&option);data||$this.data("modal",data=new Modal(this,options)),"string"==typeof option?data[option]():options.show&&data.show()})},$.fn.modal.defaults={backdrop:!0,keyboard:!0,show:!0},$.fn.modal.Constructor=Modal,$.fn.modal.noConflict=function(){return $.fn.modal=old,this},$(document).on("click.modal.data-api",'[data-toggle="modal"]',function(e){var $this=$(this),href=$this.attr("href"),$target=$($this.attr("data-target")||href&&href.replace(/.*(?=#[^\s]+$)/,"")),option=$target.data("modal")?"toggle":$.extend({remote:!/#/.test(href)&&href},$target.data(),$this.data());e.preventDefault(),$target.modal(option).one("hide",function(){$this.focus()})})}(window.jQuery),!function($){"use strict";var Tooltip=function(element,options){this.init("tooltip",element,options)};Tooltip.prototype={constructor:Tooltip,init:function(type,element,options){var eventIn,eventOut;this.type=type,this.$element=$(element),this.options=this.getOptions(options),this.enabled=!0,"click"==this.options.trigger?this.$element.on("click."+this.type,this.options.selector,$.proxy(this.toggle,this)):"manual"!=this.options.trigger&&(eventIn="hover"==this.options.trigger?"mouseenter":"focus",eventOut="hover"==this.options.trigger?"mouseleave":"blur",this.$element.on(eventIn+"."+this.type,this.options.selector,$.proxy(this.enter,this)),this.$element.on(eventOut+"."+this.type,this.options.selector,$.proxy(this.leave,this))),this.options.selector?this._options=$.extend({},this.options,{trigger:"manual",selector:""}):this.fixTitle()},getOptions:function(options){return options=$.extend({},$.fn[this.type].defaults,options,this.$element.data()),options.delay&&"number"==typeof options.delay&&(options.delay={show:options.delay,hide:options.delay}),options},enter:function(e){var self=$(e.currentTarget)[this.type](this._options).data(this.type);return self.options.delay&&self.options.delay.show?(clearTimeout(this.timeout),self.hoverState="in",this.timeout=setTimeout(function(){"in"==self.hoverState&&self.show()},self.options.delay.show),void 0):self.show()},leave:function(e){var self=$(e.currentTarget)[this.type](this._options).data(this.type);return this.timeout&&clearTimeout(this.timeout),self.options.delay&&self.options.delay.hide?(self.hoverState="out",this.timeout=setTimeout(function(){"out"==self.hoverState&&self.hide()},self.options.delay.hide),void 0):self.hide()},show:function(){var $tip,inside,pos,actualWidth,actualHeight,placement,tp;if(this.hasContent()&&this.enabled){switch($tip=this.tip(),this.setContent(),this.options.animation&&$tip.addClass("fade"),placement="function"==typeof this.options.placement?this.options.placement.call(this,$tip[0],this.$element[0]):this.options.placement,inside=/in/.test(placement),$tip.detach().css({top:0,left:0,display:"block"}).insertAfter(this.$element),pos=this.getPosition(inside),actualWidth=$tip[0].offsetWidth,actualHeight=$tip[0].offsetHeight,inside?placement.split(" ")[1]:placement){case"bottom":tp={top:pos.top+pos.height,left:pos.left+pos.width/2-actualWidth/2};break;case"top":tp={top:pos.top-actualHeight,left:pos.left+pos.width/2-actualWidth/2};break;case"left":tp={top:pos.top+pos.height/2-actualHeight/2,left:pos.left-actualWidth};break;case"right":tp={top:pos.top+pos.height/2-actualHeight/2,left:pos.left+pos.width}}$tip.offset(tp).addClass(placement).addClass("in")}},setContent:function(){var $tip=this.tip(),title=this.getTitle();$tip.find(".tooltip-inner")[this.options.html?"html":"text"](title),$tip.removeClass("fade in top bottom left right")},hide:function(){function removeWithAnimation(){var timeout=setTimeout(function(){$tip.off($.support.transition.end).detach()},500);$tip.one($.support.transition.end,function(){clearTimeout(timeout),$tip.detach()})}var $tip=this.tip();return $tip.removeClass("in"),$.support.transition&&this.$tip.hasClass("fade")?removeWithAnimation():$tip.detach(),this},fixTitle:function(){var $e=this.$element;($e.attr("title")||"string"!=typeof $e.attr("data-original-title"))&&$e.attr("data-original-title",$e.attr("title")||"").removeAttr("title")},hasContent:function(){return this.getTitle()},getPosition:function(inside){return $.extend({},inside?{top:0,left:0}:this.$element.offset(),{width:this.$element[0].offsetWidth,height:this.$element[0].offsetHeight})},getTitle:function(){var title,$e=this.$element,o=this.options;return title=$e.attr("data-original-title")||("function"==typeof o.title?o.title.call($e[0]):o.title)},tip:function(){return this.$tip=this.$tip||$(this.options.template)},validate:function(){this.$element[0].parentNode||(this.hide(),this.$element=null,this.options=null)},enable:function(){this.enabled=!0},disable:function(){this.enabled=!1},toggleEnabled:function(){this.enabled=!this.enabled},toggle:function(e){var self=$(e.currentTarget)[this.type](this._options).data(this.type);self[self.tip().hasClass("in")?"hide":"show"]()},destroy:function(){this.hide().$element.off("."+this.type).removeData(this.type)}};var old=$.fn.tooltip;$.fn.tooltip=function(option){return this.each(function(){var $this=$(this),data=$this.data("tooltip"),options="object"==typeof option&&option;data||$this.data("tooltip",data=new Tooltip(this,options)),"string"==typeof option&&data[option]()})},$.fn.tooltip.Constructor=Tooltip,$.fn.tooltip.defaults={animation:!0,placement:"top",selector:!1,template:'
      ',trigger:"hover",title:"",delay:0,html:!1},$.fn.tooltip.noConflict=function(){return $.fn.tooltip=old,this}}(window.jQuery),!function($){"use strict";var Popover=function(element,options){this.init("popover",element,options)};Popover.prototype=$.extend({},$.fn.tooltip.Constructor.prototype,{constructor:Popover,setContent:function(){var $tip=this.tip(),title=this.getTitle(),content=this.getContent();$tip.find(".popover-title")[this.options.html?"html":"text"](title),$tip.find(".popover-content")[this.options.html?"html":"text"](content),$tip.removeClass("fade top bottom left right in")},hasContent:function(){return this.getTitle()||this.getContent()},getContent:function(){var content,$e=this.$element,o=this.options;return content=$e.attr("data-content")||("function"==typeof o.content?o.content.call($e[0]):o.content)},tip:function(){return this.$tip||(this.$tip=$(this.options.template)),this.$tip},destroy:function(){this.hide().$element.off("."+this.type).removeData(this.type)}});var old=$.fn.popover;$.fn.popover=function(option){return this.each(function(){var $this=$(this),data=$this.data("popover"),options="object"==typeof option&&option;data||$this.data("popover",data=new Popover(this,options)),"string"==typeof option&&data[option]()})},$.fn.popover.Constructor=Popover,$.fn.popover.defaults=$.extend({},$.fn.tooltip.defaults,{placement:"right",trigger:"click",content:"",template:'

      '}),$.fn.popover.noConflict=function(){return $.fn.popover=old,this}}(window.jQuery),!function($){"use strict";function ScrollSpy(element,options){var href,process=$.proxy(this.process,this),$element=$(element).is("body")?$(window):$(element);this.options=$.extend({},$.fn.scrollspy.defaults,options),this.$scrollElement=$element.on("scroll.scroll-spy.data-api",process),this.selector=(this.options.target||(href=$(element).attr("href"))&&href.replace(/.*(?=#[^\s]+$)/,"")||"")+" .nav li > a",this.$body=$("body"),this.refresh(),this.process()}ScrollSpy.prototype={constructor:ScrollSpy,refresh:function(){var $targets,self=this;this.offsets=$([]),this.targets=$([]),$targets=this.$body.find(this.selector).map(function(){var $el=$(this),href=$el.data("target")||$el.attr("href"),$href=/^#\w/.test(href)&&$(href);return $href&&$href.length&&[[$href.position().top+self.$scrollElement.scrollTop(),href]]||null}).sort(function(a,b){return a[0]-b[0]}).each(function(){self.offsets.push(this[0]),self.targets.push(this[1])})},process:function(){var i,scrollTop=this.$scrollElement.scrollTop()+this.options.offset,scrollHeight=this.$scrollElement[0].scrollHeight||this.$body[0].scrollHeight,maxScroll=scrollHeight-this.$scrollElement.height(),offsets=this.offsets,targets=this.targets,activeTarget=this.activeTarget;if(scrollTop>=maxScroll)return activeTarget!=(i=targets.last()[0])&&this.activate(i);for(i=offsets.length;i--;)activeTarget!=targets[i]&&scrollTop>=offsets[i]&&(!offsets[i+1]||offsets[i+1]>=scrollTop)&&this.activate(targets[i])},activate:function(target){var active,selector;this.activeTarget=target,$(this.selector).parent(".active").removeClass("active"),selector=this.selector+'[data-target="'+target+'"],'+this.selector+'[href="'+target+'"]',active=$(selector).parent("li").addClass("active"),active.parent(".dropdown-menu").length&&(active=active.closest("li.dropdown").addClass("active")),active.trigger("activate")}};var old=$.fn.scrollspy;$.fn.scrollspy=function(option){return this.each(function(){var $this=$(this),data=$this.data("scrollspy"),options="object"==typeof option&&option;data||$this.data("scrollspy",data=new ScrollSpy(this,options)),"string"==typeof option&&data[option]()})},$.fn.scrollspy.Constructor=ScrollSpy,$.fn.scrollspy.defaults={offset:10},$.fn.scrollspy.noConflict=function(){return $.fn.scrollspy=old,this},$(window).on("load",function(){$('[data-spy="scroll"]').each(function(){var $spy=$(this);$spy.scrollspy($spy.data())})})}(window.jQuery),!function($){"use strict";var Tab=function(element){this.element=$(element)};Tab.prototype={constructor:Tab,show:function(){var previous,$target,e,$this=this.element,$ul=$this.closest("ul:not(.dropdown-menu)"),selector=$this.attr("data-target");selector||(selector=$this.attr("href"),selector=selector&&selector.replace(/.*(?=#[^\s]*$)/,"")),$this.parent("li").hasClass("active")||(previous=$ul.find(".active:last a")[0],e=$.Event("show",{relatedTarget:previous}),$this.trigger(e),e.isDefaultPrevented()||($target=$(selector),this.activate($this.parent("li"),$ul),this.activate($target,$target.parent(),function(){$this.trigger({type:"shown",relatedTarget:previous})})))},activate:function(element,container,callback){function next(){$active.removeClass("active").find("> .dropdown-menu > .active").removeClass("active"),element.addClass("active"),transition?(element[0].offsetWidth,element.addClass("in")):element.removeClass("fade"),element.parent(".dropdown-menu")&&element.closest("li.dropdown").addClass("active"),callback&&callback()}var $active=container.find("> .active"),transition=callback&&$.support.transition&&$active.hasClass("fade");transition?$active.one($.support.transition.end,next):next(),$active.removeClass("in")}};var old=$.fn.tab;$.fn.tab=function(option){return this.each(function(){var $this=$(this),data=$this.data("tab");data||$this.data("tab",data=new Tab(this)),"string"==typeof option&&data[option]()})},$.fn.tab.Constructor=Tab,$.fn.tab.noConflict=function(){return $.fn.tab=old,this},$(document).on("click.tab.data-api",'[data-toggle="tab"], [data-toggle="pill"]',function(e){e.preventDefault(),$(this).tab("show")})}(window.jQuery),!function($){"use strict";var Typeahead=function(element,options){this.$element=$(element),this.options=$.extend({},$.fn.typeahead.defaults,options),this.matcher=this.options.matcher||this.matcher,this.sorter=this.options.sorter||this.sorter,this.highlighter=this.options.highlighter||this.highlighter,this.updater=this.options.updater||this.updater,this.source=this.options.source,this.$menu=$(this.options.menu),this.shown=!1,this.listen()};Typeahead.prototype={constructor:Typeahead,select:function(){var val=this.$menu.find(".active").attr("data-value");return this.$element.val(this.updater(val)).change(),this.hide()},updater:function(item){return item},show:function(){var pos=$.extend({},this.$element.position(),{height:this.$element[0].offsetHeight});return this.$menu.insertAfter(this.$element).css({top:pos.top+pos.height,left:pos.left}).show(),this.shown=!0,this},hide:function(){return this.$menu.hide(),this.shown=!1,this},lookup:function(){var items;return this.query=this.$element.val(),!this.query||this.query.length"+match+""})},render:function(items){var that=this;return items=$(items).map(function(i,item){return i=$(that.options.item).attr("data-value",item),i.find("a").html(that.highlighter(item)),i[0]}),items.first().addClass("active"),this.$menu.html(items),this},next:function(){var active=this.$menu.find(".active").removeClass("active"),next=active.next();next.length||(next=$(this.$menu.find("li")[0])),next.addClass("active")},prev:function(){var active=this.$menu.find(".active").removeClass("active"),prev=active.prev();prev.length||(prev=this.$menu.find("li").last()),prev.addClass("active")},listen:function(){this.$element.on("blur",$.proxy(this.blur,this)).on("keypress",$.proxy(this.keypress,this)).on("keyup",$.proxy(this.keyup,this)),this.eventSupported("keydown")&&this.$element.on("keydown",$.proxy(this.keydown,this)),this.$menu.on("click",$.proxy(this.click,this)).on("mouseenter","li",$.proxy(this.mouseenter,this))},eventSupported:function(eventName){var isSupported=eventName in this.$element;return isSupported||(this.$element.setAttribute(eventName,"return;"),isSupported="function"==typeof this.$element[eventName]),isSupported},move:function(e){if(this.shown){switch(e.keyCode){case 9:case 13:case 27:e.preventDefault();break;case 38:e.preventDefault(),this.prev();break;case 40:e.preventDefault(),this.next()}e.stopPropagation()}},keydown:function(e){this.suppressKeyPressRepeat=~$.inArray(e.keyCode,[40,38,9,13,27]),this.move(e)},keypress:function(e){this.suppressKeyPressRepeat||this.move(e)},keyup:function(e){switch(e.keyCode){case 40:case 38:case 16:case 17:case 18:break;case 9:case 13:if(!this.shown)return;this.select();break;case 27:if(!this.shown)return;this.hide();break;default:this.lookup()}e.stopPropagation(),e.preventDefault()},blur:function(){var that=this;setTimeout(function(){that.hide()},150)},click:function(e){e.stopPropagation(),e.preventDefault(),this.select()},mouseenter:function(e){this.$menu.find(".active").removeClass("active"),$(e.currentTarget).addClass("active")}};var old=$.fn.typeahead;$.fn.typeahead=function(option){return this.each(function(){var $this=$(this),data=$this.data("typeahead"),options="object"==typeof option&&option;data||$this.data("typeahead",data=new Typeahead(this,options)),"string"==typeof option&&data[option]()})},$.fn.typeahead.defaults={source:[],items:8,menu:'
        ',item:'
        • ',minLength:1},$.fn.typeahead.Constructor=Typeahead,$.fn.typeahead.noConflict=function(){return $.fn.typeahead=old,this},$(document).on("focus.typeahead.data-api",'[data-provide="typeahead"]',function(e){var $this=$(this);$this.data("typeahead")||(e.preventDefault(),$this.typeahead($this.data()))})}(window.jQuery),!function($){"use strict";var Affix=function(element,options){this.options=$.extend({},$.fn.affix.defaults,options),this.$window=$(window).on("scroll.affix.data-api",$.proxy(this.checkPosition,this)).on("click.affix.data-api",$.proxy(function(){setTimeout($.proxy(this.checkPosition,this),1)},this)),this.$element=$(element),this.checkPosition()};Affix.prototype.checkPosition=function(){if(this.$element.is(":visible")){var affix,scrollHeight=$(document).height(),scrollTop=this.$window.scrollTop(),position=this.$element.offset(),offset=this.options.offset,offsetBottom=offset.bottom,offsetTop=offset.top,reset="affix affix-top affix-bottom";"object"!=typeof offset&&(offsetBottom=offsetTop=offset),"function"==typeof offsetTop&&(offsetTop=offset.top()),"function"==typeof offsetBottom&&(offsetBottom=offset.bottom()),affix=null!=this.unpin&&scrollTop+this.unpin<=position.top?!1:null!=offsetBottom&&position.top+this.$element.height()>=scrollHeight-offsetBottom?"bottom":null!=offsetTop&&offsetTop>=scrollTop?"top":!1,this.affixed!==affix&&(this.affixed=affix,this.unpin="bottom"==affix?position.top-scrollTop:null,this.$element.removeClass(reset).addClass("affix"+(affix?"-"+affix:"")))}};var old=$.fn.affix;$.fn.affix=function(option){return this.each(function(){var $this=$(this),data=$this.data("affix"),options="object"==typeof option&&option;data||$this.data("affix",data=new Affix(this,options)),"string"==typeof option&&data[option]()})},$.fn.affix.Constructor=Affix,$.fn.affix.defaults={offset:0},$.fn.affix.noConflict=function(){return $.fn.affix=old,this},$(window).on("load",function(){$('[data-spy="affix"]').each(function(){var $spy=$(this),data=$spy.data();data.offset=data.offset||{},data.offsetBottom&&(data.offset.bottom=data.offsetBottom),data.offsetTop&&(data.offset.top=data.offsetTop),$spy.affix(data)})})}(window.jQuery); \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/.gitignore b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/.gitignore new file mode 100644 index 0000000000..fd4f2b066b --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/.gitignore @@ -0,0 +1,2 @@ +node_modules +.DS_Store diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/CHANGES b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/CHANGES new file mode 100644 index 0000000000..f6f4f046e5 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/CHANGES @@ -0,0 +1,93 @@ + +2.0.0 + - Separate reliable shims from dubious shims (shams). + +1.2.10 + - Group-effort Style Cleanup + - Took a stab at fixing Object.defineProperty on IE8 without + bad side-effects. (@hax) + - Object.isExtensible no longer fakes it. (@xavierm) + - Date.prototype.toISOString no longer deals with partial + ISO dates, per spec (@kitcambridge) + - More (mostly from @bryanforbes) + +1.2.9 + - Corrections to toISOString by @kitcambridge + - Fixed three bugs in array methods revealed by Jasmine tests. + - Cleaned up Function.prototype.bind with more fixes and tests from + @bryanforbes. + +1.2.8 + - Actually fixed problems with Function.prototype.bind, and regressions + from 1.2.7 (@bryanforbes, @jdalton #36) + +1.2.7 - REGRESSED + - Fixed problems with Function.prototype.bind when called as a constructor. + (@jdalton #36) + +1.2.6 + - Revised Date.parse to match ES 5.1 (kitcambridge) + +1.2.5 + - Fixed a bug for padding it Date..toISOString (tadfisher issue #33) + +1.2.4 + - Fixed a descriptor bug in Object.defineProperty (raynos) + +1.2.3 + - Cleaned up RequireJS and + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine-html.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine-html.js new file mode 100644 index 0000000000..73834010f6 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine-html.js @@ -0,0 +1,190 @@ +jasmine.TrivialReporter = function(doc) { + this.document = doc || document; + this.suiteDivs = {}; + this.logRunningSpecs = false; +}; + +jasmine.TrivialReporter.prototype.createDom = function(type, attrs, childrenVarArgs) { + var el = document.createElement(type); + + for (var i = 2; i < arguments.length; i++) { + var child = arguments[i]; + + if (typeof child === 'string') { + el.appendChild(document.createTextNode(child)); + } else { + if (child) { el.appendChild(child); } + } + } + + for (var attr in attrs) { + if (attr == "className") { + el[attr] = attrs[attr]; + } else { + el.setAttribute(attr, attrs[attr]); + } + } + + return el; +}; + +jasmine.TrivialReporter.prototype.reportRunnerStarting = function(runner) { + var showPassed, showSkipped; + + this.outerDiv = this.createDom('div', { className: 'jasmine_reporter' }, + this.createDom('div', { className: 'banner' }, + this.createDom('div', { className: 'logo' }, + this.createDom('span', { className: 'title' }, "Jasmine"), + this.createDom('span', { className: 'version' }, runner.env.versionString())), + this.createDom('div', { className: 'options' }, + "Show ", + showPassed = this.createDom('input', { id: "__jasmine_TrivialReporter_showPassed__", type: 'checkbox' }), + this.createDom('label', { "for": "__jasmine_TrivialReporter_showPassed__" }, " passed "), + showSkipped = this.createDom('input', { id: "__jasmine_TrivialReporter_showSkipped__", type: 'checkbox' }), + this.createDom('label', { "for": "__jasmine_TrivialReporter_showSkipped__" }, " skipped") + ) + ), + + this.runnerDiv = this.createDom('div', { className: 'runner running' }, + this.createDom('a', { className: 'run_spec', href: '?' }, "run all"), + this.runnerMessageSpan = this.createDom('span', {}, "Running..."), + this.finishedAtSpan = this.createDom('span', { className: 'finished-at' }, "")) + ); + + this.document.body.appendChild(this.outerDiv); + + var suites = runner.suites(); + for (var i = 0; i < suites.length; i++) { + var suite = suites[i]; + var suiteDiv = this.createDom('div', { className: 'suite' }, + this.createDom('a', { className: 'run_spec', href: '?spec=' + encodeURIComponent(suite.getFullName()) }, "run"), + this.createDom('a', { className: 'description', href: '?spec=' + encodeURIComponent(suite.getFullName()) }, suite.description)); + this.suiteDivs[suite.id] = suiteDiv; + var parentDiv = this.outerDiv; + if (suite.parentSuite) { + parentDiv = this.suiteDivs[suite.parentSuite.id]; + } + parentDiv.appendChild(suiteDiv); + } + + this.startedAt = new Date(); + + var self = this; + showPassed.onclick = function(evt) { + if (showPassed.checked) { + self.outerDiv.className += ' show-passed'; + } else { + self.outerDiv.className = self.outerDiv.className.replace(/ show-passed/, ''); + } + }; + + showSkipped.onclick = function(evt) { + if (showSkipped.checked) { + self.outerDiv.className += ' show-skipped'; + } else { + self.outerDiv.className = self.outerDiv.className.replace(/ show-skipped/, ''); + } + }; +}; + +jasmine.TrivialReporter.prototype.reportRunnerResults = function(runner) { + var results = runner.results(); + var className = (results.failedCount > 0) ? "runner failed" : "runner passed"; + this.runnerDiv.setAttribute("class", className); + //do it twice for IE + this.runnerDiv.setAttribute("className", className); + var specs = runner.specs(); + var specCount = 0; + for (var i = 0; i < specs.length; i++) { + if (this.specFilter(specs[i])) { + specCount++; + } + } + var message = "" + specCount + " spec" + (specCount == 1 ? "" : "s" ) + ", " + results.failedCount + " failure" + ((results.failedCount == 1) ? "" : "s"); + message += " in " + ((new Date().getTime() - this.startedAt.getTime()) / 1000) + "s"; + this.runnerMessageSpan.replaceChild(this.createDom('a', { className: 'description', href: '?'}, message), this.runnerMessageSpan.firstChild); + + this.finishedAtSpan.appendChild(document.createTextNode("Finished at " + new Date().toString())); +}; + +jasmine.TrivialReporter.prototype.reportSuiteResults = function(suite) { + var results = suite.results(); + var status = results.passed() ? 'passed' : 'failed'; + if (results.totalCount === 0) { // todo: change this to check results.skipped + status = 'skipped'; + } + this.suiteDivs[suite.id].className += " " + status; +}; + +jasmine.TrivialReporter.prototype.reportSpecStarting = function(spec) { + if (this.logRunningSpecs) { + this.log('>> Jasmine Running ' + spec.suite.description + ' ' + spec.description + '...'); + } +}; + +jasmine.TrivialReporter.prototype.reportSpecResults = function(spec) { + var results = spec.results(); + var status = results.passed() ? 'passed' : 'failed'; + if (results.skipped) { + status = 'skipped'; + } + var specDiv = this.createDom('div', { className: 'spec ' + status }, + this.createDom('a', { className: 'run_spec', href: '?spec=' + encodeURIComponent(spec.getFullName()) }, "run"), + this.createDom('a', { + className: 'description', + href: '?spec=' + encodeURIComponent(spec.getFullName()), + title: spec.getFullName() + }, spec.description)); + + + var resultItems = results.getItems(); + var messagesDiv = this.createDom('div', { className: 'messages' }); + for (var i = 0; i < resultItems.length; i++) { + var result = resultItems[i]; + + if (result.type == 'log') { + messagesDiv.appendChild(this.createDom('div', {className: 'resultMessage log'}, result.toString())); + } else if (result.type == 'expect' && result.passed && !result.passed()) { + messagesDiv.appendChild(this.createDom('div', {className: 'resultMessage fail'}, result.message)); + + if (result.trace.stack) { + messagesDiv.appendChild(this.createDom('div', {className: 'stackTrace'}, result.trace.stack)); + } + } + } + + if (messagesDiv.childNodes.length > 0) { + specDiv.appendChild(messagesDiv); + } + + this.suiteDivs[spec.suite.id].appendChild(specDiv); +}; + +jasmine.TrivialReporter.prototype.log = function() { + var console = jasmine.getGlobal().console; + if (console && console.log) { + if (console.log.apply) { + console.log.apply(console, arguments); + } else { + console.log(arguments); // ie fix: console.log.apply doesn't exist on ie + } + } +}; + +jasmine.TrivialReporter.prototype.getLocation = function() { + return this.document.location; +}; + +jasmine.TrivialReporter.prototype.specFilter = function(spec) { + var paramMap = {}; + var params = this.getLocation().search.substring(1).split('&'); + for (var i = 0; i < params.length; i++) { + var p = params[i].split('='); + paramMap[decodeURIComponent(p[0])] = decodeURIComponent(p[1]); + } + + if (!paramMap.spec) { + return true; + } + return spec.getFullName().indexOf(paramMap.spec) === 0; +}; diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine.css b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine.css new file mode 100644 index 0000000000..6583fe7c66 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine.css @@ -0,0 +1,166 @@ +body { + font-family: "Helvetica Neue Light", "Lucida Grande", "Calibri", "Arial", sans-serif; +} + + +.jasmine_reporter a:visited, .jasmine_reporter a { + color: #303; +} + +.jasmine_reporter a:hover, .jasmine_reporter a:active { + color: blue; +} + +.run_spec { + float:right; + padding-right: 5px; + font-size: .8em; + text-decoration: none; +} + +.jasmine_reporter { + margin: 0 5px; +} + +.banner { + color: #303; + background-color: #fef; + padding: 5px; +} + +.logo { + float: left; + font-size: 1.1em; + padding-left: 5px; +} + +.logo .version { + font-size: .6em; + padding-left: 1em; +} + +.runner.running { + background-color: yellow; +} + + +.options { + text-align: right; + font-size: .8em; +} + + + + +.suite { + border: 1px outset gray; + margin: 5px 0; + padding-left: 1em; +} + +.suite .suite { + margin: 5px; +} + +.suite.passed { + background-color: #dfd; +} + +.suite.failed { + background-color: #fdd; +} + +.spec { + margin: 5px; + padding-left: 1em; + clear: both; +} + +.spec.failed, .spec.passed, .spec.skipped { + padding-bottom: 5px; + border: 1px solid gray; +} + +.spec.failed { + background-color: #fbb; + border-color: red; +} + +.spec.passed { + background-color: #bfb; + border-color: green; +} + +.spec.skipped { + background-color: #bbb; +} + +.messages { + border-left: 1px dashed gray; + padding-left: 1em; + padding-right: 1em; +} + +.passed { + background-color: #cfc; + display: none; +} + +.failed { + background-color: #fbb; +} + +.skipped { + color: #777; + background-color: #eee; + display: none; +} + + +/*.resultMessage {*/ + /*white-space: pre;*/ +/*}*/ + +.resultMessage span.result { + display: block; + line-height: 2em; + color: black; +} + +.resultMessage .mismatch { + color: black; +} + +.stackTrace { + white-space: pre; + font-size: .8em; + margin-left: 10px; + max-height: 5em; + overflow: auto; + border: 1px inset red; + padding: 1em; + background: #eef; +} + +.finished-at { + padding-left: 1em; + font-size: .6em; +} + +.show-passed .passed, +.show-skipped .skipped { + display: block; +} + + +#jasmine_content { + position:fixed; + right: 100%; +} + +.runner { + border: 1px solid gray; + display: block; + margin: 5px 0; + padding: 2px 0 2px 10px; +} diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine.js new file mode 100644 index 0000000000..70d7d25e18 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine.js @@ -0,0 +1,2477 @@ +var isCommonJS = typeof window == "undefined"; + +/** + * Top level namespace for Jasmine, a lightweight JavaScript BDD/spec/testing framework. + * + * @namespace + */ +var jasmine = {}; +if (isCommonJS) exports.jasmine = jasmine; +/** + * @private + */ +jasmine.unimplementedMethod_ = function() { + throw new Error("unimplemented method"); +}; + +/** + * Use jasmine.undefined instead of undefined, since undefined is just + * a plain old variable and may be redefined by somebody else. + * + * @private + */ +jasmine.undefined = jasmine.___undefined___; + +/** + * Show diagnostic messages in the console if set to true + * + */ +jasmine.VERBOSE = false; + +/** + * Default interval in milliseconds for event loop yields (e.g. to allow network activity or to refresh the screen with the HTML-based runner). Small values here may result in slow test running. Zero means no updates until all tests have completed. + * + */ +jasmine.DEFAULT_UPDATE_INTERVAL = 250; + +/** + * Default timeout interval in milliseconds for waitsFor() blocks. + */ +jasmine.DEFAULT_TIMEOUT_INTERVAL = 5000; + +jasmine.getGlobal = function() { + function getGlobal() { + return this; + } + + return getGlobal(); +}; + +/** + * Allows for bound functions to be compared. Internal use only. + * + * @ignore + * @private + * @param base {Object} bound 'this' for the function + * @param name {Function} function to find + */ +jasmine.bindOriginal_ = function(base, name) { + var original = base[name]; + if (original.apply) { + return function() { + return original.apply(base, arguments); + }; + } else { + // IE support + return jasmine.getGlobal()[name]; + } +}; + +jasmine.setTimeout = jasmine.bindOriginal_(jasmine.getGlobal(), 'setTimeout'); +jasmine.clearTimeout = jasmine.bindOriginal_(jasmine.getGlobal(), 'clearTimeout'); +jasmine.setInterval = jasmine.bindOriginal_(jasmine.getGlobal(), 'setInterval'); +jasmine.clearInterval = jasmine.bindOriginal_(jasmine.getGlobal(), 'clearInterval'); + +jasmine.MessageResult = function(values) { + this.type = 'log'; + this.values = values; + this.trace = new Error(); // todo: test better +}; + +jasmine.MessageResult.prototype.toString = function() { + var text = ""; + for (var i = 0; i < this.values.length; i++) { + if (i > 0) text += " "; + if (jasmine.isString_(this.values[i])) { + text += this.values[i]; + } else { + text += jasmine.pp(this.values[i]); + } + } + return text; +}; + +jasmine.ExpectationResult = function(params) { + this.type = 'expect'; + this.matcherName = params.matcherName; + this.passed_ = params.passed; + this.expected = params.expected; + this.actual = params.actual; + this.message = this.passed_ ? 'Passed.' : params.message; + + var trace = (params.trace || new Error(this.message)); + this.trace = this.passed_ ? '' : trace; +}; + +jasmine.ExpectationResult.prototype.toString = function () { + return this.message; +}; + +jasmine.ExpectationResult.prototype.passed = function () { + return this.passed_; +}; + +/** + * Getter for the Jasmine environment. Ensures one gets created + */ +jasmine.getEnv = function() { + var env = jasmine.currentEnv_ = jasmine.currentEnv_ || new jasmine.Env(); + return env; +}; + +/** + * @ignore + * @private + * @param value + * @returns {Boolean} + */ +jasmine.isArray_ = function(value) { + return jasmine.isA_("Array", value); +}; + +/** + * @ignore + * @private + * @param value + * @returns {Boolean} + */ +jasmine.isString_ = function(value) { + return jasmine.isA_("String", value); +}; + +/** + * @ignore + * @private + * @param value + * @returns {Boolean} + */ +jasmine.isNumber_ = function(value) { + return jasmine.isA_("Number", value); +}; + +/** + * @ignore + * @private + * @param {String} typeName + * @param value + * @returns {Boolean} + */ +jasmine.isA_ = function(typeName, value) { + return Object.prototype.toString.apply(value) === '[object ' + typeName + ']'; +}; + +/** + * Pretty printer for expecations. Takes any object and turns it into a human-readable string. + * + * @param value {Object} an object to be outputted + * @returns {String} + */ +jasmine.pp = function(value) { + var stringPrettyPrinter = new jasmine.StringPrettyPrinter(); + stringPrettyPrinter.format(value); + return stringPrettyPrinter.string; +}; + +/** + * Returns true if the object is a DOM Node. + * + * @param {Object} obj object to check + * @returns {Boolean} + */ +jasmine.isDomNode = function(obj) { + return obj.nodeType > 0; +}; + +/** + * Returns a matchable 'generic' object of the class type. For use in expecations of type when values don't matter. + * + * @example + * // don't care about which function is passed in, as long as it's a function + * expect(mySpy).toHaveBeenCalledWith(jasmine.any(Function)); + * + * @param {Class} clazz + * @returns matchable object of the type clazz + */ +jasmine.any = function(clazz) { + return new jasmine.Matchers.Any(clazz); +}; + +/** + * Jasmine Spies are test doubles that can act as stubs, spies, fakes or when used in an expecation, mocks. + * + * Spies should be created in test setup, before expectations. They can then be checked, using the standard Jasmine + * expectation syntax. Spies can be checked if they were called or not and what the calling params were. + * + * A Spy has the following fields: wasCalled, callCount, mostRecentCall, and argsForCall (see docs). + * + * Spies are torn down at the end of every spec. + * + * Note: Do not call new jasmine.Spy() directly - a spy must be created using spyOn, jasmine.createSpy or jasmine.createSpyObj. + * + * @example + * // a stub + * var myStub = jasmine.createSpy('myStub'); // can be used anywhere + * + * // spy example + * var foo = { + * not: function(bool) { return !bool; } + * } + * + * // actual foo.not will not be called, execution stops + * spyOn(foo, 'not'); + + // foo.not spied upon, execution will continue to implementation + * spyOn(foo, 'not').andCallThrough(); + * + * // fake example + * var foo = { + * not: function(bool) { return !bool; } + * } + * + * // foo.not(val) will return val + * spyOn(foo, 'not').andCallFake(function(value) {return value;}); + * + * // mock example + * foo.not(7 == 7); + * expect(foo.not).toHaveBeenCalled(); + * expect(foo.not).toHaveBeenCalledWith(true); + * + * @constructor + * @see spyOn, jasmine.createSpy, jasmine.createSpyObj + * @param {String} name + */ +jasmine.Spy = function(name) { + /** + * The name of the spy, if provided. + */ + this.identity = name || 'unknown'; + /** + * Is this Object a spy? + */ + this.isSpy = true; + /** + * The actual function this spy stubs. + */ + this.plan = function() { + }; + /** + * Tracking of the most recent call to the spy. + * @example + * var mySpy = jasmine.createSpy('foo'); + * mySpy(1, 2); + * mySpy.mostRecentCall.args = [1, 2]; + */ + this.mostRecentCall = {}; + + /** + * Holds arguments for each call to the spy, indexed by call count + * @example + * var mySpy = jasmine.createSpy('foo'); + * mySpy(1, 2); + * mySpy(7, 8); + * mySpy.mostRecentCall.args = [7, 8]; + * mySpy.argsForCall[0] = [1, 2]; + * mySpy.argsForCall[1] = [7, 8]; + */ + this.argsForCall = []; + this.calls = []; +}; + +/** + * Tells a spy to call through to the actual implemenatation. + * + * @example + * var foo = { + * bar: function() { // do some stuff } + * } + * + * // defining a spy on an existing property: foo.bar + * spyOn(foo, 'bar').andCallThrough(); + */ +jasmine.Spy.prototype.andCallThrough = function() { + this.plan = this.originalValue; + return this; +}; + +/** + * For setting the return value of a spy. + * + * @example + * // defining a spy from scratch: foo() returns 'baz' + * var foo = jasmine.createSpy('spy on foo').andReturn('baz'); + * + * // defining a spy on an existing property: foo.bar() returns 'baz' + * spyOn(foo, 'bar').andReturn('baz'); + * + * @param {Object} value + */ +jasmine.Spy.prototype.andReturn = function(value) { + this.plan = function() { + return value; + }; + return this; +}; + +/** + * For throwing an exception when a spy is called. + * + * @example + * // defining a spy from scratch: foo() throws an exception w/ message 'ouch' + * var foo = jasmine.createSpy('spy on foo').andThrow('baz'); + * + * // defining a spy on an existing property: foo.bar() throws an exception w/ message 'ouch' + * spyOn(foo, 'bar').andThrow('baz'); + * + * @param {String} exceptionMsg + */ +jasmine.Spy.prototype.andThrow = function(exceptionMsg) { + this.plan = function() { + throw exceptionMsg; + }; + return this; +}; + +/** + * Calls an alternate implementation when a spy is called. + * + * @example + * var baz = function() { + * // do some stuff, return something + * } + * // defining a spy from scratch: foo() calls the function baz + * var foo = jasmine.createSpy('spy on foo').andCall(baz); + * + * // defining a spy on an existing property: foo.bar() calls an anonymnous function + * spyOn(foo, 'bar').andCall(function() { return 'baz';} ); + * + * @param {Function} fakeFunc + */ +jasmine.Spy.prototype.andCallFake = function(fakeFunc) { + this.plan = fakeFunc; + return this; +}; + +/** + * Resets all of a spy's the tracking variables so that it can be used again. + * + * @example + * spyOn(foo, 'bar'); + * + * foo.bar(); + * + * expect(foo.bar.callCount).toEqual(1); + * + * foo.bar.reset(); + * + * expect(foo.bar.callCount).toEqual(0); + */ +jasmine.Spy.prototype.reset = function() { + this.wasCalled = false; + this.callCount = 0; + this.argsForCall = []; + this.calls = []; + this.mostRecentCall = {}; +}; + +jasmine.createSpy = function(name) { + + var spyObj = function() { + spyObj.wasCalled = true; + spyObj.callCount++; + var args = jasmine.util.argsToArray(arguments); + spyObj.mostRecentCall.object = this; + spyObj.mostRecentCall.args = args; + spyObj.argsForCall.push(args); + spyObj.calls.push({object: this, args: args}); + return spyObj.plan.apply(this, arguments); + }; + + var spy = new jasmine.Spy(name); + + for (var prop in spy) { + spyObj[prop] = spy[prop]; + } + + spyObj.reset(); + + return spyObj; +}; + +/** + * Determines whether an object is a spy. + * + * @param {jasmine.Spy|Object} putativeSpy + * @returns {Boolean} + */ +jasmine.isSpy = function(putativeSpy) { + return putativeSpy && putativeSpy.isSpy; +}; + +/** + * Creates a more complicated spy: an Object that has every property a function that is a spy. Used for stubbing something + * large in one call. + * + * @param {String} baseName name of spy class + * @param {Array} methodNames array of names of methods to make spies + */ +jasmine.createSpyObj = function(baseName, methodNames) { + if (!jasmine.isArray_(methodNames) || methodNames.length === 0) { + throw new Error('createSpyObj requires a non-empty array of method names to create spies for'); + } + var obj = {}; + for (var i = 0; i < methodNames.length; i++) { + obj[methodNames[i]] = jasmine.createSpy(baseName + '.' + methodNames[i]); + } + return obj; +}; + +/** + * All parameters are pretty-printed and concatenated together, then written to the current spec's output. + * + * Be careful not to leave calls to jasmine.log in production code. + */ +jasmine.log = function() { + var spec = jasmine.getEnv().currentSpec; + spec.log.apply(spec, arguments); +}; + +/** + * Function that installs a spy on an existing object's method name. Used within a Spec to create a spy. + * + * @example + * // spy example + * var foo = { + * not: function(bool) { return !bool; } + * } + * spyOn(foo, 'not'); // actual foo.not will not be called, execution stops + * + * @see jasmine.createSpy + * @param obj + * @param methodName + * @returns a Jasmine spy that can be chained with all spy methods + */ +var spyOn = function(obj, methodName) { + return jasmine.getEnv().currentSpec.spyOn(obj, methodName); +}; +if (isCommonJS) exports.spyOn = spyOn; + +/** + * Creates a Jasmine spec that will be added to the current suite. + * + * // TODO: pending tests + * + * @example + * it('should be true', function() { + * expect(true).toEqual(true); + * }); + * + * @param {String} desc description of this specification + * @param {Function} func defines the preconditions and expectations of the spec + */ +var it = function(desc, func) { + return jasmine.getEnv().it(desc, func); +}; +if (isCommonJS) exports.it = it; + +/** + * Creates a disabled Jasmine spec. + * + * A convenience method that allows existing specs to be disabled temporarily during development. + * + * @param {String} desc description of this specification + * @param {Function} func defines the preconditions and expectations of the spec + */ +var xit = function(desc, func) { + return jasmine.getEnv().xit(desc, func); +}; +if (isCommonJS) exports.xit = xit; + +/** + * Starts a chain for a Jasmine expectation. + * + * It is passed an Object that is the actual value and should chain to one of the many + * jasmine.Matchers functions. + * + * @param {Object} actual Actual value to test against and expected value + */ +var expect = function(actual) { + return jasmine.getEnv().currentSpec.expect(actual); +}; +if (isCommonJS) exports.expect = expect; + +/** + * Defines part of a jasmine spec. Used in cominbination with waits or waitsFor in asynchrnous specs. + * + * @param {Function} func Function that defines part of a jasmine spec. + */ +var runs = function(func) { + jasmine.getEnv().currentSpec.runs(func); +}; +if (isCommonJS) exports.runs = runs; + +/** + * Waits a fixed time period before moving to the next block. + * + * @deprecated Use waitsFor() instead + * @param {Number} timeout milliseconds to wait + */ +var waits = function(timeout) { + jasmine.getEnv().currentSpec.waits(timeout); +}; +if (isCommonJS) exports.waits = waits; + +/** + * Waits for the latchFunction to return true before proceeding to the next block. + * + * @param {Function} latchFunction + * @param {String} optional_timeoutMessage + * @param {Number} optional_timeout + */ +var waitsFor = function(latchFunction, optional_timeoutMessage, optional_timeout) { + jasmine.getEnv().currentSpec.waitsFor.apply(jasmine.getEnv().currentSpec, arguments); +}; +if (isCommonJS) exports.waitsFor = waitsFor; + +/** + * A function that is called before each spec in a suite. + * + * Used for spec setup, including validating assumptions. + * + * @param {Function} beforeEachFunction + */ +var beforeEach = function(beforeEachFunction) { + jasmine.getEnv().beforeEach(beforeEachFunction); +}; +if (isCommonJS) exports.beforeEach = beforeEach; + +/** + * A function that is called after each spec in a suite. + * + * Used for restoring any state that is hijacked during spec execution. + * + * @param {Function} afterEachFunction + */ +var afterEach = function(afterEachFunction) { + jasmine.getEnv().afterEach(afterEachFunction); +}; +if (isCommonJS) exports.afterEach = afterEach; + +/** + * Defines a suite of specifications. + * + * Stores the description and all defined specs in the Jasmine environment as one suite of specs. Variables declared + * are accessible by calls to beforeEach, it, and afterEach. Describe blocks can be nested, allowing for specialization + * of setup in some tests. + * + * @example + * // TODO: a simple suite + * + * // TODO: a simple suite with a nested describe block + * + * @param {String} description A string, usually the class under test. + * @param {Function} specDefinitions function that defines several specs. + */ +var describe = function(description, specDefinitions) { + return jasmine.getEnv().describe(description, specDefinitions); +}; +if (isCommonJS) exports.describe = describe; + +/** + * Disables a suite of specifications. Used to disable some suites in a file, or files, temporarily during development. + * + * @param {String} description A string, usually the class under test. + * @param {Function} specDefinitions function that defines several specs. + */ +var xdescribe = function(description, specDefinitions) { + return jasmine.getEnv().xdescribe(description, specDefinitions); +}; +if (isCommonJS) exports.xdescribe = xdescribe; + + +// Provide the XMLHttpRequest class for IE 5.x-6.x: +jasmine.XmlHttpRequest = (typeof XMLHttpRequest == "undefined") ? function() { + function tryIt(f) { + try { + return f(); + } catch(e) { + } + return null; + } + + var xhr = tryIt(function() { + return new ActiveXObject("Msxml2.XMLHTTP.6.0"); + }) || + tryIt(function() { + return new ActiveXObject("Msxml2.XMLHTTP.3.0"); + }) || + tryIt(function() { + return new ActiveXObject("Msxml2.XMLHTTP"); + }) || + tryIt(function() { + return new ActiveXObject("Microsoft.XMLHTTP"); + }); + + if (!xhr) throw new Error("This browser does not support XMLHttpRequest."); + + return xhr; +} : XMLHttpRequest; +/** + * @namespace + */ +jasmine.util = {}; + +/** + * Declare that a child class inherit it's prototype from the parent class. + * + * @private + * @param {Function} childClass + * @param {Function} parentClass + */ +jasmine.util.inherit = function(childClass, parentClass) { + /** + * @private + */ + var subclass = function() { + }; + subclass.prototype = parentClass.prototype; + childClass.prototype = new subclass(); +}; + +jasmine.util.formatException = function(e) { + var lineNumber; + if (e.line) { + lineNumber = e.line; + } + else if (e.lineNumber) { + lineNumber = e.lineNumber; + } + + var file; + + if (e.sourceURL) { + file = e.sourceURL; + } + else if (e.fileName) { + file = e.fileName; + } + + var message = (e.name && e.message) ? (e.name + ': ' + e.message) : e.toString(); + + if (file && lineNumber) { + message += ' in ' + file + ' (line ' + lineNumber + ')'; + } + + return message; +}; + +jasmine.util.htmlEscape = function(str) { + if (!str) return str; + return str.replace(/&/g, '&') + .replace(//g, '>'); +}; + +jasmine.util.argsToArray = function(args) { + var arrayOfArgs = []; + for (var i = 0; i < args.length; i++) arrayOfArgs.push(args[i]); + return arrayOfArgs; +}; + +jasmine.util.extend = function(destination, source) { + for (var property in source) destination[property] = source[property]; + return destination; +}; + +/** + * Environment for Jasmine + * + * @constructor + */ +jasmine.Env = function() { + this.currentSpec = null; + this.currentSuite = null; + this.currentRunner_ = new jasmine.Runner(this); + + this.reporter = new jasmine.MultiReporter(); + + this.updateInterval = jasmine.DEFAULT_UPDATE_INTERVAL; + this.defaultTimeoutInterval = jasmine.DEFAULT_TIMEOUT_INTERVAL; + this.lastUpdate = 0; + this.specFilter = function() { + return true; + }; + + this.nextSpecId_ = 0; + this.nextSuiteId_ = 0; + this.equalityTesters_ = []; + + // wrap matchers + this.matchersClass = function() { + jasmine.Matchers.apply(this, arguments); + }; + jasmine.util.inherit(this.matchersClass, jasmine.Matchers); + + jasmine.Matchers.wrapInto_(jasmine.Matchers.prototype, this.matchersClass); +}; + + +jasmine.Env.prototype.setTimeout = jasmine.setTimeout; +jasmine.Env.prototype.clearTimeout = jasmine.clearTimeout; +jasmine.Env.prototype.setInterval = jasmine.setInterval; +jasmine.Env.prototype.clearInterval = jasmine.clearInterval; + +/** + * @returns an object containing jasmine version build info, if set. + */ +jasmine.Env.prototype.version = function () { + if (jasmine.version_) { + return jasmine.version_; + } else { + throw new Error('Version not set'); + } +}; + +/** + * @returns string containing jasmine version build info, if set. + */ +jasmine.Env.prototype.versionString = function() { + if (!jasmine.version_) { + return "version unknown"; + } + + var version = this.version(); + var versionString = version.major + "." + version.minor + "." + version.build; + if (version.release_candidate) { + versionString += ".rc" + version.release_candidate + } + versionString += " revision " + version.revision; + return versionString; +}; + +/** + * @returns a sequential integer starting at 0 + */ +jasmine.Env.prototype.nextSpecId = function () { + return this.nextSpecId_++; +}; + +/** + * @returns a sequential integer starting at 0 + */ +jasmine.Env.prototype.nextSuiteId = function () { + return this.nextSuiteId_++; +}; + +/** + * Register a reporter to receive status updates from Jasmine. + * @param {jasmine.Reporter} reporter An object which will receive status updates. + */ +jasmine.Env.prototype.addReporter = function(reporter) { + this.reporter.addReporter(reporter); +}; + +jasmine.Env.prototype.execute = function() { + this.currentRunner_.execute(); +}; + +jasmine.Env.prototype.describe = function(description, specDefinitions) { + var suite = new jasmine.Suite(this, description, specDefinitions, this.currentSuite); + + var parentSuite = this.currentSuite; + if (parentSuite) { + parentSuite.add(suite); + } else { + this.currentRunner_.add(suite); + } + + this.currentSuite = suite; + + var declarationError = null; + try { + specDefinitions.call(suite); + } catch(e) { + declarationError = e; + } + + if (declarationError) { + this.it("encountered a declaration exception", function() { + throw declarationError; + }); + } + + this.currentSuite = parentSuite; + + return suite; +}; + +jasmine.Env.prototype.beforeEach = function(beforeEachFunction) { + if (this.currentSuite) { + this.currentSuite.beforeEach(beforeEachFunction); + } else { + this.currentRunner_.beforeEach(beforeEachFunction); + } +}; + +jasmine.Env.prototype.currentRunner = function () { + return this.currentRunner_; +}; + +jasmine.Env.prototype.afterEach = function(afterEachFunction) { + if (this.currentSuite) { + this.currentSuite.afterEach(afterEachFunction); + } else { + this.currentRunner_.afterEach(afterEachFunction); + } + +}; + +jasmine.Env.prototype.xdescribe = function(desc, specDefinitions) { + return { + execute: function() { + } + }; +}; + +jasmine.Env.prototype.it = function(description, func) { + var spec = new jasmine.Spec(this, this.currentSuite, description); + this.currentSuite.add(spec); + this.currentSpec = spec; + + if (func) { + spec.runs(func); + } + + return spec; +}; + +jasmine.Env.prototype.xit = function(desc, func) { + return { + id: this.nextSpecId(), + runs: function() { + } + }; +}; + +jasmine.Env.prototype.compareObjects_ = function(a, b, mismatchKeys, mismatchValues) { + if (a.__Jasmine_been_here_before__ === b && b.__Jasmine_been_here_before__ === a) { + return true; + } + + a.__Jasmine_been_here_before__ = b; + b.__Jasmine_been_here_before__ = a; + + var hasKey = function(obj, keyName) { + return obj !== null && obj[keyName] !== jasmine.undefined; + }; + + for (var property in b) { + if (!hasKey(a, property) && hasKey(b, property)) { + mismatchKeys.push("expected has key '" + property + "', but missing from actual."); + } + } + for (property in a) { + if (!hasKey(b, property) && hasKey(a, property)) { + mismatchKeys.push("expected missing key '" + property + "', but present in actual."); + } + } + for (property in b) { + if (property == '__Jasmine_been_here_before__') continue; + if (!this.equals_(a[property], b[property], mismatchKeys, mismatchValues)) { + mismatchValues.push("'" + property + "' was '" + (b[property] ? jasmine.util.htmlEscape(b[property].toString()) : b[property]) + "' in expected, but was '" + (a[property] ? jasmine.util.htmlEscape(a[property].toString()) : a[property]) + "' in actual."); + } + } + + if (jasmine.isArray_(a) && jasmine.isArray_(b) && a.length != b.length) { + mismatchValues.push("arrays were not the same length"); + } + + delete a.__Jasmine_been_here_before__; + delete b.__Jasmine_been_here_before__; + return (mismatchKeys.length === 0 && mismatchValues.length === 0); +}; + +jasmine.Env.prototype.equals_ = function(a, b, mismatchKeys, mismatchValues) { + mismatchKeys = mismatchKeys || []; + mismatchValues = mismatchValues || []; + + for (var i = 0; i < this.equalityTesters_.length; i++) { + var equalityTester = this.equalityTesters_[i]; + var result = equalityTester(a, b, this, mismatchKeys, mismatchValues); + if (result !== jasmine.undefined) return result; + } + + if (a === b) return true; + + if (a === jasmine.undefined || a === null || b === jasmine.undefined || b === null) { + return (a == jasmine.undefined && b == jasmine.undefined); + } + + if (jasmine.isDomNode(a) && jasmine.isDomNode(b)) { + return a === b; + } + + if (a instanceof Date && b instanceof Date) { + return a.getTime() == b.getTime(); + } + + if (a instanceof jasmine.Matchers.Any) { + return a.matches(b); + } + + if (b instanceof jasmine.Matchers.Any) { + return b.matches(a); + } + + if (jasmine.isString_(a) && jasmine.isString_(b)) { + return (a == b); + } + + if (jasmine.isNumber_(a) && jasmine.isNumber_(b)) { + return (a == b); + } + + if (typeof a === "object" && typeof b === "object") { + return this.compareObjects_(a, b, mismatchKeys, mismatchValues); + } + + //Straight check + return (a === b); +}; + +jasmine.Env.prototype.contains_ = function(haystack, needle) { + if (jasmine.isArray_(haystack)) { + for (var i = 0; i < haystack.length; i++) { + if (this.equals_(haystack[i], needle)) return true; + } + return false; + } + return haystack.indexOf(needle) >= 0; +}; + +jasmine.Env.prototype.addEqualityTester = function(equalityTester) { + this.equalityTesters_.push(equalityTester); +}; +/** No-op base class for Jasmine reporters. + * + * @constructor + */ +jasmine.Reporter = function() { +}; + +//noinspection JSUnusedLocalSymbols +jasmine.Reporter.prototype.reportRunnerStarting = function(runner) { +}; + +//noinspection JSUnusedLocalSymbols +jasmine.Reporter.prototype.reportRunnerResults = function(runner) { +}; + +//noinspection JSUnusedLocalSymbols +jasmine.Reporter.prototype.reportSuiteResults = function(suite) { +}; + +//noinspection JSUnusedLocalSymbols +jasmine.Reporter.prototype.reportSpecStarting = function(spec) { +}; + +//noinspection JSUnusedLocalSymbols +jasmine.Reporter.prototype.reportSpecResults = function(spec) { +}; + +//noinspection JSUnusedLocalSymbols +jasmine.Reporter.prototype.log = function(str) { +}; + +/** + * Blocks are functions with executable code that make up a spec. + * + * @constructor + * @param {jasmine.Env} env + * @param {Function} func + * @param {jasmine.Spec} spec + */ +jasmine.Block = function(env, func, spec) { + this.env = env; + this.func = func; + this.spec = spec; +}; + +jasmine.Block.prototype.execute = function(onComplete) { + try { + this.func.apply(this.spec); + } catch (e) { + this.spec.fail(e); + } + onComplete(); +}; +/** JavaScript API reporter. + * + * @constructor + */ +jasmine.JsApiReporter = function() { + this.started = false; + this.finished = false; + this.suites_ = []; + this.results_ = {}; +}; + +jasmine.JsApiReporter.prototype.reportRunnerStarting = function(runner) { + this.started = true; + var suites = runner.topLevelSuites(); + for (var i = 0; i < suites.length; i++) { + var suite = suites[i]; + this.suites_.push(this.summarize_(suite)); + } +}; + +jasmine.JsApiReporter.prototype.suites = function() { + return this.suites_; +}; + +jasmine.JsApiReporter.prototype.summarize_ = function(suiteOrSpec) { + var isSuite = suiteOrSpec instanceof jasmine.Suite; + var summary = { + id: suiteOrSpec.id, + name: suiteOrSpec.description, + type: isSuite ? 'suite' : 'spec', + children: [] + }; + + if (isSuite) { + var children = suiteOrSpec.children(); + for (var i = 0; i < children.length; i++) { + summary.children.push(this.summarize_(children[i])); + } + } + return summary; +}; + +jasmine.JsApiReporter.prototype.results = function() { + return this.results_; +}; + +jasmine.JsApiReporter.prototype.resultsForSpec = function(specId) { + return this.results_[specId]; +}; + +//noinspection JSUnusedLocalSymbols +jasmine.JsApiReporter.prototype.reportRunnerResults = function(runner) { + this.finished = true; +}; + +//noinspection JSUnusedLocalSymbols +jasmine.JsApiReporter.prototype.reportSuiteResults = function(suite) { +}; + +//noinspection JSUnusedLocalSymbols +jasmine.JsApiReporter.prototype.reportSpecResults = function(spec) { + this.results_[spec.id] = { + messages: spec.results().getItems(), + result: spec.results().failedCount > 0 ? "failed" : "passed" + }; +}; + +//noinspection JSUnusedLocalSymbols +jasmine.JsApiReporter.prototype.log = function(str) { +}; + +jasmine.JsApiReporter.prototype.resultsForSpecs = function(specIds){ + var results = {}; + for (var i = 0; i < specIds.length; i++) { + var specId = specIds[i]; + results[specId] = this.summarizeResult_(this.results_[specId]); + } + return results; +}; + +jasmine.JsApiReporter.prototype.summarizeResult_ = function(result){ + var summaryMessages = []; + var messagesLength = result.messages.length; + for (var messageIndex = 0; messageIndex < messagesLength; messageIndex++) { + var resultMessage = result.messages[messageIndex]; + summaryMessages.push({ + text: resultMessage.type == 'log' ? resultMessage.toString() : jasmine.undefined, + passed: resultMessage.passed ? resultMessage.passed() : true, + type: resultMessage.type, + message: resultMessage.message, + trace: { + stack: resultMessage.passed && !resultMessage.passed() ? resultMessage.trace.stack : jasmine.undefined + } + }); + } + + return { + result : result.result, + messages : summaryMessages + }; +}; + +/** + * @constructor + * @param {jasmine.Env} env + * @param actual + * @param {jasmine.Spec} spec + */ +jasmine.Matchers = function(env, actual, spec, opt_isNot) { + this.env = env; + this.actual = actual; + this.spec = spec; + this.isNot = opt_isNot || false; + this.reportWasCalled_ = false; +}; + +// todo: @deprecated as of Jasmine 0.11, remove soon [xw] +jasmine.Matchers.pp = function(str) { + throw new Error("jasmine.Matchers.pp() is no longer supported, please use jasmine.pp() instead!"); +}; + +// todo: @deprecated Deprecated as of Jasmine 0.10. Rewrite your custom matchers to return true or false. [xw] +jasmine.Matchers.prototype.report = function(result, failing_message, details) { + throw new Error("As of jasmine 0.11, custom matchers must be implemented differently -- please see jasmine docs"); +}; + +jasmine.Matchers.wrapInto_ = function(prototype, matchersClass) { + for (var methodName in prototype) { + if (methodName == 'report') continue; + var orig = prototype[methodName]; + matchersClass.prototype[methodName] = jasmine.Matchers.matcherFn_(methodName, orig); + } +}; + +jasmine.Matchers.matcherFn_ = function(matcherName, matcherFunction) { + return function() { + var matcherArgs = jasmine.util.argsToArray(arguments); + var result = matcherFunction.apply(this, arguments); + + if (this.isNot) { + result = !result; + } + + if (this.reportWasCalled_) return result; + + var message; + if (!result) { + if (this.message) { + message = this.message.apply(this, arguments); + if (jasmine.isArray_(message)) { + message = message[this.isNot ? 1 : 0]; + } + } else { + var englishyPredicate = matcherName.replace(/[A-Z]/g, function(s) { return ' ' + s.toLowerCase(); }); + message = "Expected " + jasmine.pp(this.actual) + (this.isNot ? " not " : " ") + englishyPredicate; + if (matcherArgs.length > 0) { + for (var i = 0; i < matcherArgs.length; i++) { + if (i > 0) message += ","; + message += " " + jasmine.pp(matcherArgs[i]); + } + } + message += "."; + } + } + var expectationResult = new jasmine.ExpectationResult({ + matcherName: matcherName, + passed: result, + expected: matcherArgs.length > 1 ? matcherArgs : matcherArgs[0], + actual: this.actual, + message: message + }); + this.spec.addMatcherResult(expectationResult); + return jasmine.undefined; + }; +}; + + + + +/** + * toBe: compares the actual to the expected using === + * @param expected + */ +jasmine.Matchers.prototype.toBe = function(expected) { + return this.actual === expected; +}; + +/** + * toNotBe: compares the actual to the expected using !== + * @param expected + * @deprecated as of 1.0. Use not.toBe() instead. + */ +jasmine.Matchers.prototype.toNotBe = function(expected) { + return this.actual !== expected; +}; + +/** + * toEqual: compares the actual to the expected using common sense equality. Handles Objects, Arrays, etc. + * + * @param expected + */ +jasmine.Matchers.prototype.toEqual = function(expected) { + return this.env.equals_(this.actual, expected); +}; + +/** + * toNotEqual: compares the actual to the expected using the ! of jasmine.Matchers.toEqual + * @param expected + * @deprecated as of 1.0. Use not.toNotEqual() instead. + */ +jasmine.Matchers.prototype.toNotEqual = function(expected) { + return !this.env.equals_(this.actual, expected); +}; + +/** + * Matcher that compares the actual to the expected using a regular expression. Constructs a RegExp, so takes + * a pattern or a String. + * + * @param expected + */ +jasmine.Matchers.prototype.toMatch = function(expected) { + return new RegExp(expected).test(this.actual); +}; + +/** + * Matcher that compares the actual to the expected using the boolean inverse of jasmine.Matchers.toMatch + * @param expected + * @deprecated as of 1.0. Use not.toMatch() instead. + */ +jasmine.Matchers.prototype.toNotMatch = function(expected) { + return !(new RegExp(expected).test(this.actual)); +}; + +/** + * Matcher that compares the actual to jasmine.undefined. + */ +jasmine.Matchers.prototype.toBeDefined = function() { + return (this.actual !== jasmine.undefined); +}; + +/** + * Matcher that compares the actual to jasmine.undefined. + */ +jasmine.Matchers.prototype.toBeUndefined = function() { + return (this.actual === jasmine.undefined); +}; + +/** + * Matcher that compares the actual to null. + */ +jasmine.Matchers.prototype.toBeNull = function() { + return (this.actual === null); +}; + +/** + * Matcher that boolean not-nots the actual. + */ +jasmine.Matchers.prototype.toBeTruthy = function() { + return !!this.actual; +}; + + +/** + * Matcher that boolean nots the actual. + */ +jasmine.Matchers.prototype.toBeFalsy = function() { + return !this.actual; +}; + + +/** + * Matcher that checks to see if the actual, a Jasmine spy, was called. + */ +jasmine.Matchers.prototype.toHaveBeenCalled = function() { + if (arguments.length > 0) { + throw new Error('toHaveBeenCalled does not take arguments, use toHaveBeenCalledWith'); + } + + if (!jasmine.isSpy(this.actual)) { + throw new Error('Expected a spy, but got ' + jasmine.pp(this.actual) + '.'); + } + + this.message = function() { + return [ + "Expected spy " + this.actual.identity + " to have been called.", + "Expected spy " + this.actual.identity + " not to have been called." + ]; + }; + + return this.actual.wasCalled; +}; + +/** @deprecated Use expect(xxx).toHaveBeenCalled() instead */ +jasmine.Matchers.prototype.wasCalled = jasmine.Matchers.prototype.toHaveBeenCalled; + +/** + * Matcher that checks to see if the actual, a Jasmine spy, was not called. + * + * @deprecated Use expect(xxx).not.toHaveBeenCalled() instead + */ +jasmine.Matchers.prototype.wasNotCalled = function() { + if (arguments.length > 0) { + throw new Error('wasNotCalled does not take arguments'); + } + + if (!jasmine.isSpy(this.actual)) { + throw new Error('Expected a spy, but got ' + jasmine.pp(this.actual) + '.'); + } + + this.message = function() { + return [ + "Expected spy " + this.actual.identity + " to not have been called.", + "Expected spy " + this.actual.identity + " to have been called." + ]; + }; + + return !this.actual.wasCalled; +}; + +/** + * Matcher that checks to see if the actual, a Jasmine spy, was called with a set of parameters. + * + * @example + * + */ +jasmine.Matchers.prototype.toHaveBeenCalledWith = function() { + var expectedArgs = jasmine.util.argsToArray(arguments); + if (!jasmine.isSpy(this.actual)) { + throw new Error('Expected a spy, but got ' + jasmine.pp(this.actual) + '.'); + } + this.message = function() { + if (this.actual.callCount === 0) { + // todo: what should the failure message for .not.toHaveBeenCalledWith() be? is this right? test better. [xw] + return [ + "Expected spy " + this.actual.identity + " to have been called with " + jasmine.pp(expectedArgs) + " but it was never called.", + "Expected spy " + this.actual.identity + " not to have been called with " + jasmine.pp(expectedArgs) + " but it was." + ]; + } else { + return [ + "Expected spy " + this.actual.identity + " to have been called with " + jasmine.pp(expectedArgs) + " but was called with " + jasmine.pp(this.actual.argsForCall), + "Expected spy " + this.actual.identity + " not to have been called with " + jasmine.pp(expectedArgs) + " but was called with " + jasmine.pp(this.actual.argsForCall) + ]; + } + }; + + return this.env.contains_(this.actual.argsForCall, expectedArgs); +}; + +/** @deprecated Use expect(xxx).toHaveBeenCalledWith() instead */ +jasmine.Matchers.prototype.wasCalledWith = jasmine.Matchers.prototype.toHaveBeenCalledWith; + +/** @deprecated Use expect(xxx).not.toHaveBeenCalledWith() instead */ +jasmine.Matchers.prototype.wasNotCalledWith = function() { + var expectedArgs = jasmine.util.argsToArray(arguments); + if (!jasmine.isSpy(this.actual)) { + throw new Error('Expected a spy, but got ' + jasmine.pp(this.actual) + '.'); + } + + this.message = function() { + return [ + "Expected spy not to have been called with " + jasmine.pp(expectedArgs) + " but it was", + "Expected spy to have been called with " + jasmine.pp(expectedArgs) + " but it was" + ]; + }; + + return !this.env.contains_(this.actual.argsForCall, expectedArgs); +}; + +/** + * Matcher that checks that the expected item is an element in the actual Array. + * + * @param {Object} expected + */ +jasmine.Matchers.prototype.toContain = function(expected) { + return this.env.contains_(this.actual, expected); +}; + +/** + * Matcher that checks that the expected item is NOT an element in the actual Array. + * + * @param {Object} expected + * @deprecated as of 1.0. Use not.toNotContain() instead. + */ +jasmine.Matchers.prototype.toNotContain = function(expected) { + return !this.env.contains_(this.actual, expected); +}; + +jasmine.Matchers.prototype.toBeLessThan = function(expected) { + return this.actual < expected; +}; + +jasmine.Matchers.prototype.toBeGreaterThan = function(expected) { + return this.actual > expected; +}; + +/** + * Matcher that checks that the expected item is equal to the actual item + * up to a given level of decimal precision (default 2). + * + * @param {Number} expected + * @param {Number} precision + */ +jasmine.Matchers.prototype.toBeCloseTo = function(expected, precision) { + if (!(precision === 0)) { + precision = precision || 2; + } + var multiplier = Math.pow(10, precision); + var actual = Math.round(this.actual * multiplier); + expected = Math.round(expected * multiplier); + return expected == actual; +}; + +/** + * Matcher that checks that the expected exception was thrown by the actual. + * + * @param {String} expected + */ +jasmine.Matchers.prototype.toThrow = function(expected) { + var result = false; + var exception; + if (typeof this.actual != 'function') { + throw new Error('Actual is not a function'); + } + try { + this.actual(); + } catch (e) { + exception = e; + } + if (exception) { + result = (expected === jasmine.undefined || this.env.equals_(exception.message || exception, expected.message || expected)); + } + + var not = this.isNot ? "not " : ""; + + this.message = function() { + if (exception && (expected === jasmine.undefined || !this.env.equals_(exception.message || exception, expected.message || expected))) { + return ["Expected function " + not + "to throw", expected ? expected.message || expected : "an exception", ", but it threw", exception.message || exception].join(' '); + } else { + return "Expected function to throw an exception."; + } + }; + + return result; +}; + +jasmine.Matchers.Any = function(expectedClass) { + this.expectedClass = expectedClass; +}; + +jasmine.Matchers.Any.prototype.matches = function(other) { + if (this.expectedClass == String) { + return typeof other == 'string' || other instanceof String; + } + + if (this.expectedClass == Number) { + return typeof other == 'number' || other instanceof Number; + } + + if (this.expectedClass == Function) { + return typeof other == 'function' || other instanceof Function; + } + + if (this.expectedClass == Object) { + return typeof other == 'object'; + } + + return other instanceof this.expectedClass; +}; + +jasmine.Matchers.Any.prototype.toString = function() { + return ''; +}; + +/** + * @constructor + */ +jasmine.MultiReporter = function() { + this.subReporters_ = []; +}; +jasmine.util.inherit(jasmine.MultiReporter, jasmine.Reporter); + +jasmine.MultiReporter.prototype.addReporter = function(reporter) { + this.subReporters_.push(reporter); +}; + +(function() { + var functionNames = [ + "reportRunnerStarting", + "reportRunnerResults", + "reportSuiteResults", + "reportSpecStarting", + "reportSpecResults", + "log" + ]; + for (var i = 0; i < functionNames.length; i++) { + var functionName = functionNames[i]; + jasmine.MultiReporter.prototype[functionName] = (function(functionName) { + return function() { + for (var j = 0; j < this.subReporters_.length; j++) { + var subReporter = this.subReporters_[j]; + if (subReporter[functionName]) { + subReporter[functionName].apply(subReporter, arguments); + } + } + }; + })(functionName); + } +})(); +/** + * Holds results for a set of Jasmine spec. Allows for the results array to hold another jasmine.NestedResults + * + * @constructor + */ +jasmine.NestedResults = function() { + /** + * The total count of results + */ + this.totalCount = 0; + /** + * Number of passed results + */ + this.passedCount = 0; + /** + * Number of failed results + */ + this.failedCount = 0; + /** + * Was this suite/spec skipped? + */ + this.skipped = false; + /** + * @ignore + */ + this.items_ = []; +}; + +/** + * Roll up the result counts. + * + * @param result + */ +jasmine.NestedResults.prototype.rollupCounts = function(result) { + this.totalCount += result.totalCount; + this.passedCount += result.passedCount; + this.failedCount += result.failedCount; +}; + +/** + * Adds a log message. + * @param values Array of message parts which will be concatenated later. + */ +jasmine.NestedResults.prototype.log = function(values) { + this.items_.push(new jasmine.MessageResult(values)); +}; + +/** + * Getter for the results: message & results. + */ +jasmine.NestedResults.prototype.getItems = function() { + return this.items_; +}; + +/** + * Adds a result, tracking counts (total, passed, & failed) + * @param {jasmine.ExpectationResult|jasmine.NestedResults} result + */ +jasmine.NestedResults.prototype.addResult = function(result) { + if (result.type != 'log') { + if (result.items_) { + this.rollupCounts(result); + } else { + this.totalCount++; + if (result.passed()) { + this.passedCount++; + } else { + this.failedCount++; + } + } + } + this.items_.push(result); +}; + +/** + * @returns {Boolean} True if everything below passed + */ +jasmine.NestedResults.prototype.passed = function() { + return this.passedCount === this.totalCount; +}; +/** + * Base class for pretty printing for expectation results. + */ +jasmine.PrettyPrinter = function() { + this.ppNestLevel_ = 0; +}; + +/** + * Formats a value in a nice, human-readable string. + * + * @param value + */ +jasmine.PrettyPrinter.prototype.format = function(value) { + if (this.ppNestLevel_ > 40) { + throw new Error('jasmine.PrettyPrinter: format() nested too deeply!'); + } + + this.ppNestLevel_++; + try { + if (value === jasmine.undefined) { + this.emitScalar('undefined'); + } else if (value === null) { + this.emitScalar('null'); + } else if (value === jasmine.getGlobal()) { + this.emitScalar(''); + } else if (value instanceof jasmine.Matchers.Any) { + this.emitScalar(value.toString()); + } else if (typeof value === 'string') { + this.emitString(value); + } else if (jasmine.isSpy(value)) { + this.emitScalar("spy on " + value.identity); + } else if (value instanceof RegExp) { + this.emitScalar(value.toString()); + } else if (typeof value === 'function') { + this.emitScalar('Function'); + } else if (typeof value.nodeType === 'number') { + this.emitScalar('HTMLNode'); + } else if (value instanceof Date) { + this.emitScalar('Date(' + value + ')'); + } else if (value.__Jasmine_been_here_before__) { + this.emitScalar(''); + } else if (jasmine.isArray_(value) || typeof value == 'object') { + value.__Jasmine_been_here_before__ = true; + if (jasmine.isArray_(value)) { + this.emitArray(value); + } else { + this.emitObject(value); + } + delete value.__Jasmine_been_here_before__; + } else { + this.emitScalar(value.toString()); + } + } finally { + this.ppNestLevel_--; + } +}; + +jasmine.PrettyPrinter.prototype.iterateObject = function(obj, fn) { + for (var property in obj) { + if (property == '__Jasmine_been_here_before__') continue; + fn(property, obj.__lookupGetter__ ? (obj.__lookupGetter__(property) !== jasmine.undefined && + obj.__lookupGetter__(property) !== null) : false); + } +}; + +jasmine.PrettyPrinter.prototype.emitArray = jasmine.unimplementedMethod_; +jasmine.PrettyPrinter.prototype.emitObject = jasmine.unimplementedMethod_; +jasmine.PrettyPrinter.prototype.emitScalar = jasmine.unimplementedMethod_; +jasmine.PrettyPrinter.prototype.emitString = jasmine.unimplementedMethod_; + +jasmine.StringPrettyPrinter = function() { + jasmine.PrettyPrinter.call(this); + + this.string = ''; +}; +jasmine.util.inherit(jasmine.StringPrettyPrinter, jasmine.PrettyPrinter); + +jasmine.StringPrettyPrinter.prototype.emitScalar = function(value) { + this.append(value); +}; + +jasmine.StringPrettyPrinter.prototype.emitString = function(value) { + this.append("'" + value + "'"); +}; + +jasmine.StringPrettyPrinter.prototype.emitArray = function(array) { + this.append('[ '); + for (var i = 0; i < array.length; i++) { + if (i > 0) { + this.append(', '); + } + this.format(array[i]); + } + this.append(' ]'); +}; + +jasmine.StringPrettyPrinter.prototype.emitObject = function(obj) { + var self = this; + this.append('{ '); + var first = true; + + this.iterateObject(obj, function(property, isGetter) { + if (first) { + first = false; + } else { + self.append(', '); + } + + self.append(property); + self.append(' : '); + if (isGetter) { + self.append(''); + } else { + self.format(obj[property]); + } + }); + + this.append(' }'); +}; + +jasmine.StringPrettyPrinter.prototype.append = function(value) { + this.string += value; +}; +jasmine.Queue = function(env) { + this.env = env; + this.blocks = []; + this.running = false; + this.index = 0; + this.offset = 0; + this.abort = false; +}; + +jasmine.Queue.prototype.addBefore = function(block) { + this.blocks.unshift(block); +}; + +jasmine.Queue.prototype.add = function(block) { + this.blocks.push(block); +}; + +jasmine.Queue.prototype.insertNext = function(block) { + this.blocks.splice((this.index + this.offset + 1), 0, block); + this.offset++; +}; + +jasmine.Queue.prototype.start = function(onComplete) { + this.running = true; + this.onComplete = onComplete; + this.next_(); +}; + +jasmine.Queue.prototype.isRunning = function() { + return this.running; +}; + +jasmine.Queue.LOOP_DONT_RECURSE = true; + +jasmine.Queue.prototype.next_ = function() { + var self = this; + var goAgain = true; + + while (goAgain) { + goAgain = false; + + if (self.index < self.blocks.length && !this.abort) { + var calledSynchronously = true; + var completedSynchronously = false; + + var onComplete = function () { + if (jasmine.Queue.LOOP_DONT_RECURSE && calledSynchronously) { + completedSynchronously = true; + return; + } + + if (self.blocks[self.index].abort) { + self.abort = true; + } + + self.offset = 0; + self.index++; + + var now = new Date().getTime(); + if (self.env.updateInterval && now - self.env.lastUpdate > self.env.updateInterval) { + self.env.lastUpdate = now; + self.env.setTimeout(function() { + self.next_(); + }, 0); + } else { + if (jasmine.Queue.LOOP_DONT_RECURSE && completedSynchronously) { + goAgain = true; + } else { + self.next_(); + } + } + }; + self.blocks[self.index].execute(onComplete); + + calledSynchronously = false; + if (completedSynchronously) { + onComplete(); + } + + } else { + self.running = false; + if (self.onComplete) { + self.onComplete(); + } + } + } +}; + +jasmine.Queue.prototype.results = function() { + var results = new jasmine.NestedResults(); + for (var i = 0; i < this.blocks.length; i++) { + if (this.blocks[i].results) { + results.addResult(this.blocks[i].results()); + } + } + return results; +}; + + +/** + * Runner + * + * @constructor + * @param {jasmine.Env} env + */ +jasmine.Runner = function(env) { + var self = this; + self.env = env; + self.queue = new jasmine.Queue(env); + self.before_ = []; + self.after_ = []; + self.suites_ = []; +}; + +jasmine.Runner.prototype.execute = function() { + var self = this; + if (self.env.reporter.reportRunnerStarting) { + self.env.reporter.reportRunnerStarting(this); + } + self.queue.start(function () { + self.finishCallback(); + }); +}; + +jasmine.Runner.prototype.beforeEach = function(beforeEachFunction) { + beforeEachFunction.typeName = 'beforeEach'; + this.before_.splice(0,0,beforeEachFunction); +}; + +jasmine.Runner.prototype.afterEach = function(afterEachFunction) { + afterEachFunction.typeName = 'afterEach'; + this.after_.splice(0,0,afterEachFunction); +}; + + +jasmine.Runner.prototype.finishCallback = function() { + this.env.reporter.reportRunnerResults(this); +}; + +jasmine.Runner.prototype.addSuite = function(suite) { + this.suites_.push(suite); +}; + +jasmine.Runner.prototype.add = function(block) { + if (block instanceof jasmine.Suite) { + this.addSuite(block); + } + this.queue.add(block); +}; + +jasmine.Runner.prototype.specs = function () { + var suites = this.suites(); + var specs = []; + for (var i = 0; i < suites.length; i++) { + specs = specs.concat(suites[i].specs()); + } + return specs; +}; + +jasmine.Runner.prototype.suites = function() { + return this.suites_; +}; + +jasmine.Runner.prototype.topLevelSuites = function() { + var topLevelSuites = []; + for (var i = 0; i < this.suites_.length; i++) { + if (!this.suites_[i].parentSuite) { + topLevelSuites.push(this.suites_[i]); + } + } + return topLevelSuites; +}; + +jasmine.Runner.prototype.results = function() { + return this.queue.results(); +}; +/** + * Internal representation of a Jasmine specification, or test. + * + * @constructor + * @param {jasmine.Env} env + * @param {jasmine.Suite} suite + * @param {String} description + */ +jasmine.Spec = function(env, suite, description) { + if (!env) { + throw new Error('jasmine.Env() required'); + } + if (!suite) { + throw new Error('jasmine.Suite() required'); + } + var spec = this; + spec.id = env.nextSpecId ? env.nextSpecId() : null; + spec.env = env; + spec.suite = suite; + spec.description = description; + spec.queue = new jasmine.Queue(env); + + spec.afterCallbacks = []; + spec.spies_ = []; + + spec.results_ = new jasmine.NestedResults(); + spec.results_.description = description; + spec.matchersClass = null; +}; + +jasmine.Spec.prototype.getFullName = function() { + return this.suite.getFullName() + ' ' + this.description + '.'; +}; + + +jasmine.Spec.prototype.results = function() { + return this.results_; +}; + +/** + * All parameters are pretty-printed and concatenated together, then written to the spec's output. + * + * Be careful not to leave calls to jasmine.log in production code. + */ +jasmine.Spec.prototype.log = function() { + return this.results_.log(arguments); +}; + +jasmine.Spec.prototype.runs = function (func) { + var block = new jasmine.Block(this.env, func, this); + this.addToQueue(block); + return this; +}; + +jasmine.Spec.prototype.addToQueue = function (block) { + if (this.queue.isRunning()) { + this.queue.insertNext(block); + } else { + this.queue.add(block); + } +}; + +/** + * @param {jasmine.ExpectationResult} result + */ +jasmine.Spec.prototype.addMatcherResult = function(result) { + this.results_.addResult(result); +}; + +jasmine.Spec.prototype.expect = function(actual) { + var positive = new (this.getMatchersClass_())(this.env, actual, this); + positive.not = new (this.getMatchersClass_())(this.env, actual, this, true); + return positive; +}; + +/** + * Waits a fixed time period before moving to the next block. + * + * @deprecated Use waitsFor() instead + * @param {Number} timeout milliseconds to wait + */ +jasmine.Spec.prototype.waits = function(timeout) { + var waitsFunc = new jasmine.WaitsBlock(this.env, timeout, this); + this.addToQueue(waitsFunc); + return this; +}; + +/** + * Waits for the latchFunction to return true before proceeding to the next block. + * + * @param {Function} latchFunction + * @param {String} optional_timeoutMessage + * @param {Number} optional_timeout + */ +jasmine.Spec.prototype.waitsFor = function(latchFunction, optional_timeoutMessage, optional_timeout) { + var latchFunction_ = null; + var optional_timeoutMessage_ = null; + var optional_timeout_ = null; + + for (var i = 0; i < arguments.length; i++) { + var arg = arguments[i]; + switch (typeof arg) { + case 'function': + latchFunction_ = arg; + break; + case 'string': + optional_timeoutMessage_ = arg; + break; + case 'number': + optional_timeout_ = arg; + break; + } + } + + var waitsForFunc = new jasmine.WaitsForBlock(this.env, optional_timeout_, latchFunction_, optional_timeoutMessage_, this); + this.addToQueue(waitsForFunc); + return this; +}; + +jasmine.Spec.prototype.fail = function (e) { + var expectationResult = new jasmine.ExpectationResult({ + passed: false, + message: e ? jasmine.util.formatException(e) : 'Exception', + trace: { stack: e.stack } + }); + this.results_.addResult(expectationResult); +}; + +jasmine.Spec.prototype.getMatchersClass_ = function() { + return this.matchersClass || this.env.matchersClass; +}; + +jasmine.Spec.prototype.addMatchers = function(matchersPrototype) { + var parent = this.getMatchersClass_(); + var newMatchersClass = function() { + parent.apply(this, arguments); + }; + jasmine.util.inherit(newMatchersClass, parent); + jasmine.Matchers.wrapInto_(matchersPrototype, newMatchersClass); + this.matchersClass = newMatchersClass; +}; + +jasmine.Spec.prototype.finishCallback = function() { + this.env.reporter.reportSpecResults(this); +}; + +jasmine.Spec.prototype.finish = function(onComplete) { + this.removeAllSpies(); + this.finishCallback(); + if (onComplete) { + onComplete(); + } +}; + +jasmine.Spec.prototype.after = function(doAfter) { + if (this.queue.isRunning()) { + this.queue.add(new jasmine.Block(this.env, doAfter, this)); + } else { + this.afterCallbacks.unshift(doAfter); + } +}; + +jasmine.Spec.prototype.execute = function(onComplete) { + var spec = this; + if (!spec.env.specFilter(spec)) { + spec.results_.skipped = true; + spec.finish(onComplete); + return; + } + + this.env.reporter.reportSpecStarting(this); + + spec.env.currentSpec = spec; + + spec.addBeforesAndAftersToQueue(); + + spec.queue.start(function () { + spec.finish(onComplete); + }); +}; + +jasmine.Spec.prototype.addBeforesAndAftersToQueue = function() { + var runner = this.env.currentRunner(); + var i; + + for (var suite = this.suite; suite; suite = suite.parentSuite) { + for (i = 0; i < suite.before_.length; i++) { + this.queue.addBefore(new jasmine.Block(this.env, suite.before_[i], this)); + } + } + for (i = 0; i < runner.before_.length; i++) { + this.queue.addBefore(new jasmine.Block(this.env, runner.before_[i], this)); + } + for (i = 0; i < this.afterCallbacks.length; i++) { + this.queue.add(new jasmine.Block(this.env, this.afterCallbacks[i], this)); + } + for (suite = this.suite; suite; suite = suite.parentSuite) { + for (i = 0; i < suite.after_.length; i++) { + this.queue.add(new jasmine.Block(this.env, suite.after_[i], this)); + } + } + for (i = 0; i < runner.after_.length; i++) { + this.queue.add(new jasmine.Block(this.env, runner.after_[i], this)); + } +}; + +jasmine.Spec.prototype.explodes = function() { + throw 'explodes function should not have been called'; +}; + +jasmine.Spec.prototype.spyOn = function(obj, methodName, ignoreMethodDoesntExist) { + if (obj == jasmine.undefined) { + throw "spyOn could not find an object to spy upon for " + methodName + "()"; + } + + if (!ignoreMethodDoesntExist && obj[methodName] === jasmine.undefined) { + throw methodName + '() method does not exist'; + } + + if (!ignoreMethodDoesntExist && obj[methodName] && obj[methodName].isSpy) { + throw new Error(methodName + ' has already been spied upon'); + } + + var spyObj = jasmine.createSpy(methodName); + + this.spies_.push(spyObj); + spyObj.baseObj = obj; + spyObj.methodName = methodName; + spyObj.originalValue = obj[methodName]; + + obj[methodName] = spyObj; + + return spyObj; +}; + +jasmine.Spec.prototype.removeAllSpies = function() { + for (var i = 0; i < this.spies_.length; i++) { + var spy = this.spies_[i]; + spy.baseObj[spy.methodName] = spy.originalValue; + } + this.spies_ = []; +}; + +/** + * Internal representation of a Jasmine suite. + * + * @constructor + * @param {jasmine.Env} env + * @param {String} description + * @param {Function} specDefinitions + * @param {jasmine.Suite} parentSuite + */ +jasmine.Suite = function(env, description, specDefinitions, parentSuite) { + var self = this; + self.id = env.nextSuiteId ? env.nextSuiteId() : null; + self.description = description; + self.queue = new jasmine.Queue(env); + self.parentSuite = parentSuite; + self.env = env; + self.before_ = []; + self.after_ = []; + self.children_ = []; + self.suites_ = []; + self.specs_ = []; +}; + +jasmine.Suite.prototype.getFullName = function() { + var fullName = this.description; + for (var parentSuite = this.parentSuite; parentSuite; parentSuite = parentSuite.parentSuite) { + fullName = parentSuite.description + ' ' + fullName; + } + return fullName; +}; + +jasmine.Suite.prototype.finish = function(onComplete) { + this.env.reporter.reportSuiteResults(this); + this.finished = true; + if (typeof(onComplete) == 'function') { + onComplete(); + } +}; + +jasmine.Suite.prototype.beforeEach = function(beforeEachFunction) { + beforeEachFunction.typeName = 'beforeEach'; + this.before_.unshift(beforeEachFunction); +}; + +jasmine.Suite.prototype.afterEach = function(afterEachFunction) { + afterEachFunction.typeName = 'afterEach'; + this.after_.unshift(afterEachFunction); +}; + +jasmine.Suite.prototype.results = function() { + return this.queue.results(); +}; + +jasmine.Suite.prototype.add = function(suiteOrSpec) { + this.children_.push(suiteOrSpec); + if (suiteOrSpec instanceof jasmine.Suite) { + this.suites_.push(suiteOrSpec); + this.env.currentRunner().addSuite(suiteOrSpec); + } else { + this.specs_.push(suiteOrSpec); + } + this.queue.add(suiteOrSpec); +}; + +jasmine.Suite.prototype.specs = function() { + return this.specs_; +}; + +jasmine.Suite.prototype.suites = function() { + return this.suites_; +}; + +jasmine.Suite.prototype.children = function() { + return this.children_; +}; + +jasmine.Suite.prototype.execute = function(onComplete) { + var self = this; + this.queue.start(function () { + self.finish(onComplete); + }); +}; +jasmine.WaitsBlock = function(env, timeout, spec) { + this.timeout = timeout; + jasmine.Block.call(this, env, null, spec); +}; + +jasmine.util.inherit(jasmine.WaitsBlock, jasmine.Block); + +jasmine.WaitsBlock.prototype.execute = function (onComplete) { + if (jasmine.VERBOSE) { + this.env.reporter.log('>> Jasmine waiting for ' + this.timeout + ' ms...'); + } + this.env.setTimeout(function () { + onComplete(); + }, this.timeout); +}; +/** + * A block which waits for some condition to become true, with timeout. + * + * @constructor + * @extends jasmine.Block + * @param {jasmine.Env} env The Jasmine environment. + * @param {Number} timeout The maximum time in milliseconds to wait for the condition to become true. + * @param {Function} latchFunction A function which returns true when the desired condition has been met. + * @param {String} message The message to display if the desired condition hasn't been met within the given time period. + * @param {jasmine.Spec} spec The Jasmine spec. + */ +jasmine.WaitsForBlock = function(env, timeout, latchFunction, message, spec) { + this.timeout = timeout || env.defaultTimeoutInterval; + this.latchFunction = latchFunction; + this.message = message; + this.totalTimeSpentWaitingForLatch = 0; + jasmine.Block.call(this, env, null, spec); +}; +jasmine.util.inherit(jasmine.WaitsForBlock, jasmine.Block); + +jasmine.WaitsForBlock.TIMEOUT_INCREMENT = 10; + +jasmine.WaitsForBlock.prototype.execute = function(onComplete) { + if (jasmine.VERBOSE) { + this.env.reporter.log('>> Jasmine waiting for ' + (this.message || 'something to happen')); + } + var latchFunctionResult; + try { + latchFunctionResult = this.latchFunction.apply(this.spec); + } catch (e) { + this.spec.fail(e); + onComplete(); + return; + } + + if (latchFunctionResult) { + onComplete(); + } else if (this.totalTimeSpentWaitingForLatch >= this.timeout) { + var message = 'timed out after ' + this.timeout + ' msec waiting for ' + (this.message || 'something to happen'); + this.spec.fail({ + name: 'timeout', + message: message + }); + + this.abort = true; + onComplete(); + } else { + this.totalTimeSpentWaitingForLatch += jasmine.WaitsForBlock.TIMEOUT_INCREMENT; + var self = this; + this.env.setTimeout(function() { + self.execute(onComplete); + }, jasmine.WaitsForBlock.TIMEOUT_INCREMENT); + } +}; +// Mock setTimeout, clearTimeout +// Contributed by Pivotal Computer Systems, www.pivotalsf.com + +jasmine.FakeTimer = function() { + this.reset(); + + var self = this; + self.setTimeout = function(funcToCall, millis) { + self.timeoutsMade++; + self.scheduleFunction(self.timeoutsMade, funcToCall, millis, false); + return self.timeoutsMade; + }; + + self.setInterval = function(funcToCall, millis) { + self.timeoutsMade++; + self.scheduleFunction(self.timeoutsMade, funcToCall, millis, true); + return self.timeoutsMade; + }; + + self.clearTimeout = function(timeoutKey) { + self.scheduledFunctions[timeoutKey] = jasmine.undefined; + }; + + self.clearInterval = function(timeoutKey) { + self.scheduledFunctions[timeoutKey] = jasmine.undefined; + }; + +}; + +jasmine.FakeTimer.prototype.reset = function() { + this.timeoutsMade = 0; + this.scheduledFunctions = {}; + this.nowMillis = 0; +}; + +jasmine.FakeTimer.prototype.tick = function(millis) { + var oldMillis = this.nowMillis; + var newMillis = oldMillis + millis; + this.runFunctionsWithinRange(oldMillis, newMillis); + this.nowMillis = newMillis; +}; + +jasmine.FakeTimer.prototype.runFunctionsWithinRange = function(oldMillis, nowMillis) { + var scheduledFunc; + var funcsToRun = []; + for (var timeoutKey in this.scheduledFunctions) { + scheduledFunc = this.scheduledFunctions[timeoutKey]; + if (scheduledFunc != jasmine.undefined && + scheduledFunc.runAtMillis >= oldMillis && + scheduledFunc.runAtMillis <= nowMillis) { + funcsToRun.push(scheduledFunc); + this.scheduledFunctions[timeoutKey] = jasmine.undefined; + } + } + + if (funcsToRun.length > 0) { + funcsToRun.sort(function(a, b) { + return a.runAtMillis - b.runAtMillis; + }); + for (var i = 0; i < funcsToRun.length; ++i) { + try { + var funcToRun = funcsToRun[i]; + this.nowMillis = funcToRun.runAtMillis; + funcToRun.funcToCall(); + if (funcToRun.recurring) { + this.scheduleFunction(funcToRun.timeoutKey, + funcToRun.funcToCall, + funcToRun.millis, + true); + } + } catch(e) { + } + } + this.runFunctionsWithinRange(oldMillis, nowMillis); + } +}; + +jasmine.FakeTimer.prototype.scheduleFunction = function(timeoutKey, funcToCall, millis, recurring) { + this.scheduledFunctions[timeoutKey] = { + runAtMillis: this.nowMillis + millis, + funcToCall: funcToCall, + recurring: recurring, + timeoutKey: timeoutKey, + millis: millis + }; +}; + +/** + * @namespace + */ +jasmine.Clock = { + defaultFakeTimer: new jasmine.FakeTimer(), + + reset: function() { + jasmine.Clock.assertInstalled(); + jasmine.Clock.defaultFakeTimer.reset(); + }, + + tick: function(millis) { + jasmine.Clock.assertInstalled(); + jasmine.Clock.defaultFakeTimer.tick(millis); + }, + + runFunctionsWithinRange: function(oldMillis, nowMillis) { + jasmine.Clock.defaultFakeTimer.runFunctionsWithinRange(oldMillis, nowMillis); + }, + + scheduleFunction: function(timeoutKey, funcToCall, millis, recurring) { + jasmine.Clock.defaultFakeTimer.scheduleFunction(timeoutKey, funcToCall, millis, recurring); + }, + + useMock: function() { + if (!jasmine.Clock.isInstalled()) { + var spec = jasmine.getEnv().currentSpec; + spec.after(jasmine.Clock.uninstallMock); + + jasmine.Clock.installMock(); + } + }, + + installMock: function() { + jasmine.Clock.installed = jasmine.Clock.defaultFakeTimer; + }, + + uninstallMock: function() { + jasmine.Clock.assertInstalled(); + jasmine.Clock.installed = jasmine.Clock.real; + }, + + real: { + setTimeout: jasmine.getGlobal().setTimeout, + clearTimeout: jasmine.getGlobal().clearTimeout, + setInterval: jasmine.getGlobal().setInterval, + clearInterval: jasmine.getGlobal().clearInterval + }, + + assertInstalled: function() { + if (!jasmine.Clock.isInstalled()) { + throw new Error("Mock clock is not installed, use jasmine.Clock.useMock()"); + } + }, + + isInstalled: function() { + return jasmine.Clock.installed == jasmine.Clock.defaultFakeTimer; + }, + + installed: null +}; +jasmine.Clock.installed = jasmine.Clock.real; + +//else for IE support +jasmine.getGlobal().setTimeout = function(funcToCall, millis) { + if (jasmine.Clock.installed.setTimeout.apply) { + return jasmine.Clock.installed.setTimeout.apply(this, arguments); + } else { + return jasmine.Clock.installed.setTimeout(funcToCall, millis); + } +}; + +jasmine.getGlobal().setInterval = function(funcToCall, millis) { + if (jasmine.Clock.installed.setInterval.apply) { + return jasmine.Clock.installed.setInterval.apply(this, arguments); + } else { + return jasmine.Clock.installed.setInterval(funcToCall, millis); + } +}; + +jasmine.getGlobal().clearTimeout = function(timeoutKey) { + if (jasmine.Clock.installed.clearTimeout.apply) { + return jasmine.Clock.installed.clearTimeout.apply(this, arguments); + } else { + return jasmine.Clock.installed.clearTimeout(timeoutKey); + } +}; + +jasmine.getGlobal().clearInterval = function(timeoutKey) { + if (jasmine.Clock.installed.clearTimeout.apply) { + return jasmine.Clock.installed.clearInterval.apply(this, arguments); + } else { + return jasmine.Clock.installed.clearInterval(timeoutKey); + } +}; + +jasmine.version_= { + "major": 1, + "minor": 1, + "build": 0, + "revision": 1308618948, + "release_candidate": 1 +}; diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine_favicon.png b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine_favicon.png new file mode 100644 index 0000000000..218f3b4371 Binary files /dev/null and b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/jasmine_favicon.png differ diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/json2.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/json2.js new file mode 100644 index 0000000000..ac5807921f --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/lib/json2.js @@ -0,0 +1,478 @@ +/* + http://www.JSON.org/json2.js + 2009-08-17 + + Public Domain. + + NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK. + + See http://www.JSON.org/js.html + + This file creates a global JSON object containing two methods: stringify + and parse. + + JSON.stringify(value, replacer, space) + value any JavaScript value, usually an object or array. + + replacer an optional parameter that determines how object + values are stringified for objects. It can be a + function or an array of strings. + + space an optional parameter that specifies the indentation + of nested structures. If it is omitted, the text will + be packed without extra whitespace. If it is a number, + it will specify the number of spaces to indent at each + level. If it is a string (such as '\t' or ' '), + it contains the characters used to indent at each level. + + This method produces a JSON text from a JavaScript value. + + When an object value is found, if the object contains a toJSON + method, its toJSON method will be called and the result will be + stringified. A toJSON method does not serialize: it returns the + value represented by the name/value pair that should be serialized, + or undefined if nothing should be serialized. The toJSON method + will be passed the key associated with the value, and this will be + bound to the value + + For example, this would serialize Dates as ISO strings. + + Date.prototype.toJSON = function (key) { + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + return this.getUTCFullYear() + '-' + + f(this.getUTCMonth() + 1) + '-' + + f(this.getUTCDate()) + 'T' + + f(this.getUTCHours()) + ':' + + f(this.getUTCMinutes()) + ':' + + f(this.getUTCSeconds()) + 'Z'; + }; + + You can provide an optional replacer method. It will be passed the + key and value of each member, with this bound to the containing + object. The value that is returned from your method will be + serialized. If your method returns undefined, then the member will + be excluded from the serialization. + + If the replacer parameter is an array of strings, then it will be + used to select the members to be serialized. It filters the results + such that only members with keys listed in the replacer array are + stringified. + + Values that do not have JSON representations, such as undefined or + functions, will not be serialized. Such values in objects will be + dropped; in arrays they will be replaced with null. You can use + a replacer function to replace those with JSON values. + JSON.stringify(undefined) returns undefined. + + The optional space parameter produces a stringification of the + value that is filled with line breaks and indentation to make it + easier to read. + + If the space parameter is a non-empty string, then that string will + be used for indentation. If the space parameter is a number, then + the indentation will be that many spaces. + + Example: + + text = JSON.stringify(['e', {pluribus: 'unum'}]); + // text is '["e",{"pluribus":"unum"}]' + + + text = JSON.stringify(['e', {pluribus: 'unum'}], null, '\t'); + // text is '[\n\t"e",\n\t{\n\t\t"pluribus": "unum"\n\t}\n]' + + text = JSON.stringify([new Date()], function (key, value) { + return this[key] instanceof Date ? + 'Date(' + this[key] + ')' : value; + }); + // text is '["Date(---current time---)"]' + + + JSON.parse(text, reviver) + This method parses a JSON text to produce an object or array. + It can throw a SyntaxError exception. + + The optional reviver parameter is a function that can filter and + transform the results. It receives each of the keys and values, + and its return value is used instead of the original value. + If it returns what it received, then the structure is not modified. + If it returns undefined then the member is deleted. + + Example: + + // Parse the text. Values that look like ISO date strings will + // be converted to Date objects. + + myData = JSON.parse(text, function (key, value) { + var a; + if (typeof value === 'string') { + a = +/^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value); + if (a) { + return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4], + +a[5], +a[6])); + } + } + return value; + }); + + myData = JSON.parse('["Date(09/09/2001)"]', function (key, value) { + var d; + if (typeof value === 'string' && + value.slice(0, 5) === 'Date(' && + value.slice(-1) === ')') { + d = new Date(value.slice(5, -1)); + if (d) { + return d; + } + } + return value; + }); + + + This is a reference implementation. You are free to copy, modify, or + redistribute. + + This code should be minified before deployment. + See http://javascript.crockford.com/jsmin.html + + USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO + NOT CONTROL. +*/ + +/*jslint evil: true */ + +/*members "", "\b", "\t", "\n", "\f", "\r", "\"", JSON, "\\", apply, + call, charCodeAt, getUTCDate, getUTCFullYear, getUTCHours, + getUTCMinutes, getUTCMonth, getUTCSeconds, hasOwnProperty, join, + lastIndex, length, parse, prototype, push, replace, slice, stringify, + test, toJSON, toString, valueOf +*/ + +"use strict"; + +// Create a JSON object only if one does not already exist. We create the +// methods in a closure to avoid creating global variables. + +if (!this.JSON) { + this.JSON = {}; +} + +(function () { + + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + if (typeof Date.prototype.toJSON !== 'function') { + + Date.prototype.toJSON = function (key) { + + return isFinite(this.valueOf()) ? + this.getUTCFullYear() + '-' + + f(this.getUTCMonth() + 1) + '-' + + f(this.getUTCDate()) + 'T' + + f(this.getUTCHours()) + ':' + + f(this.getUTCMinutes()) + ':' + + f(this.getUTCSeconds()) + 'Z' : null; + }; + + String.prototype.toJSON = + Number.prototype.toJSON = + Boolean.prototype.toJSON = function (key) { + return this.valueOf(); + }; + } + + var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + gap, + indent, + meta = { // table of character substitutions + '\b': '\\b', + '\t': '\\t', + '\n': '\\n', + '\f': '\\f', + '\r': '\\r', + '"' : '\\"', + '\\': '\\\\' + }, + rep; + + + function quote(string) { + +// If the string contains no control characters, no quote characters, and no +// backslash characters, then we can safely slap some quotes around it. +// Otherwise we must also replace the offending characters with safe escape +// sequences. + + escapable.lastIndex = 0; + return escapable.test(string) ? + '"' + string.replace(escapable, function (a) { + var c = meta[a]; + return typeof c === 'string' ? c : + '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }) + '"' : + '"' + string + '"'; + } + + + function str(key, holder) { +// Produce a string from holder[key]. + + var i, // The loop counter. + k, // The member key. + v, // The member value. + length, + mind = gap, + partial, + value = holder[key]; + +// If the value has a toJSON method, call it to obtain a replacement value. + + if (value && typeof value === 'object' && + typeof value.toJSON === 'function') { + value = value.toJSON(key); + } + +// If we were called with a replacer function, then call the replacer to +// obtain a replacement value. + + if (typeof rep === 'function') { + value = rep.call(holder, key, value); + } + +// What happens next depends on the value's type. + + switch (typeof value) { + case 'string': + return quote(value); + + case 'number': + +// JSON numbers must be finite. Encode non-finite numbers as null. + + return isFinite(value) ? String(value) : 'null'; + + case 'boolean': + case 'null': + +// If the value is a boolean or null, convert it to a string. Note: +// typeof null does not produce 'null'. The case is included here in +// the remote chance that this gets fixed someday. + + return String(value); + +// If the type is 'object', we might be dealing with an object or an array or +// null. + + case 'object': + +// Due to a specification blunder in ECMAScript, typeof null is 'object', +// so watch out for that case. + + if (!value) { + return 'null'; + } + +// Make an array to hold the partial results of stringifying this object value. + + gap += indent; + partial = []; + +// Is the value an array? + + if (Object.prototype.toString.apply(value) === '[object Array]') { + +// The value is an array. Stringify every element. Use null as a placeholder +// for non-JSON values. + + length = value.length; + for (i = 0; i < length; i += 1) { + partial[i] = str(i, value) || 'null'; + } + +// Join all of the elements together, separated with commas, and wrap them in +// brackets. + + v = partial.length === 0 ? '[]' : + gap ? '[\n' + gap + + partial.join(',\n' + gap) + '\n' + + mind + ']' : + '[' + partial.join(',') + ']'; + gap = mind; + return v; + } + +// If the replacer is an array, use it to select the members to be stringified. + + if (rep && typeof rep === 'object') { + length = rep.length; + for (i = 0; i < length; i += 1) { + k = rep[i]; + if (typeof k === 'string') { + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } else { + +// Otherwise, iterate through all of the keys in the object. + + for (k in value) { + if (Object.hasOwnProperty.call(value, k)) { + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } + +// Join all of the member texts together, separated with commas, +// and wrap them in braces. + + v = partial.length === 0 ? '{}' : + gap ? '{\n' + gap + partial.join(',\n' + gap) + '\n' + + mind + '}' : '{' + partial.join(',') + '}'; + gap = mind; + return v; + } + } + +// If the JSON object does not yet have a stringify method, give it one. + + if (typeof JSON.stringify !== 'function') { + JSON.stringify = function (value, replacer, space) { +// The stringify method takes a value and an optional replacer, and an optional +// space parameter, and returns a JSON text. The replacer can be a function +// that can replace values, or an array of strings that will select the keys. +// A default replacer method can be provided. Use of the space parameter can +// produce text that is more easily readable. + + var i; + gap = ''; + indent = ''; + +// If the space parameter is a number, make an indent string containing that +// many spaces. + + if (typeof space === 'number') { + for (i = 0; i < space; i += 1) { + indent += ' '; + } + +// If the space parameter is a string, it will be used as the indent string. + + } else if (typeof space === 'string') { + indent = space; + } + +// If there is a replacer, it must be a function or an array. +// Otherwise, throw an error. + + rep = replacer; + if (replacer && typeof replacer !== 'function' && + (typeof replacer !== 'object' || + typeof replacer.length !== 'number')) { + throw new Error('JSON.stringify'); + } + +// Make a fake root object containing our value under the key of ''. +// Return the result of stringifying the value. + + return str('', {'': value}); + }; + } + + +// If the JSON object does not yet have a parse method, give it one. + + if (typeof JSON.parse !== 'function') { + JSON.parse = function (text, reviver) { + +// The parse method takes a text and an optional reviver function, and returns +// a JavaScript value if the text is a valid JSON text. + + var j; + + function walk(holder, key) { + +// The walk method is used to recursively walk the resulting structure so +// that modifications can be made. + + var k, v, value = holder[key]; + if (value && typeof value === 'object') { + for (k in value) { + if (Object.hasOwnProperty.call(value, k)) { + v = walk(value, k); + if (v !== undefined) { + value[k] = v; + } else { + delete value[k]; + } + } + } + } + return reviver.call(holder, key, value); + } + + +// Parsing happens in four stages. In the first stage, we replace certain +// Unicode characters with escape sequences. JavaScript handles many characters +// incorrectly, either silently deleting them, or treating them as line endings. + + cx.lastIndex = 0; + if (cx.test(text)) { + text = text.replace(cx, function (a) { + return '\\u' + + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }); + } + +// In the second stage, we run the text against regular expressions that look +// for non-JSON patterns. We are especially concerned with '()' and 'new' +// because they can cause invocation, and '=' because it can cause mutation. +// But just to be safe, we want to reject all unexpected forms. + +// We split the second stage into 4 regexp operations in order to work around +// crippling inefficiencies in IE's and Safari's regexp engines. First we +// replace the JSON backslash pairs with '@' (a non-JSON character). Second, we +// replace all simple value tokens with ']' characters. Third, we delete all +// open brackets that follow a colon or comma or that begin the text. Finally, +// we look to see that the remaining characters are only whitespace or ']' or +// ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval. + + if (/^[\],:{}\s]*$/. +test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@'). +replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']'). +replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) { + +// In the third stage we use the eval function to compile the text into a +// JavaScript structure. The '{' operator is subject to a syntactic ambiguity +// in JavaScript: it can begin a block or an object literal. We wrap the text +// in parens to eliminate the ambiguity. + + j = eval('(' + text + ')'); + +// In the optional fourth stage, we recursively walk the new structure, passing +// each name/value pair to a reviver function for possible transformation. + + return typeof reviver === 'function' ? + walk({'': j}, '') : j; + } + +// If the text is not JSON parseable, then a SyntaxError is thrown. + + throw new SyntaxError('JSON.parse'); + }; + } +}()); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-array.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-array.js new file mode 100644 index 0000000000..6c353d85b7 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-array.js @@ -0,0 +1,1070 @@ +describe('Array', function() { + var testSubject; + beforeEach(function() { + testSubject = [2, 3, undefined, true, 'hej', null, false, 0]; + delete testSubject[1]; + }); + function createArrayLikeFromArray(arr) { + var o = {}; + Array.prototype.forEach.call(arr, function(e, i) { + o[i]=e; + }); + o.length = arr.length; + return o; + }; + + describe('forEach', function() { + "use strict"; + var expected, actual; + + beforeEach(function() { + expected = {0:2, 2: undefined, 3:true, 4: 'hej', 5:null, 6:false, 7:0 }; + actual = {}; + }); + it('should pass the right parameters', function() { + var callback = jasmine.createSpy('callback'), + array = ['1']; + array.forEach(callback); + expect(callback).toHaveBeenCalledWith('1', 0, array); + }); + it('should not affect elements added to the array after it has begun', function() { + var arr = [1,2,3], + i = 0; + arr.forEach(function(a) { + i++; + arr.push(a+3); + }); + expect(arr).toEqual([1,2,3,4,5,6]); + expect(i).toBe(3); + }); + + it('should set the right context when given none', function() { + var context; + [1].forEach(function() {context = this;}); + expect(context).toBe(function() {return this}.call()); + }); + it('should iterate all', function() { + testSubject.forEach(function(obj, index) { + actual[index] = obj; + }); + expect(actual).toExactlyMatch(expected); + }); + it('should iterate all using a context', function() { + var o = { a: actual }; + + testSubject.forEach(function(obj, index) { + this.a[index] = obj; + }, o); + expect(actual).toExactlyMatch(expected); + }); + + it('should iterate all in an array-like object', function() { + var ts = createArrayLikeFromArray(testSubject); + Array.prototype.forEach.call(ts, function(obj, index) { + actual[index] = obj; + }); + expect(actual).toExactlyMatch(expected); + }); + it('should iterate all in an array-like object using a context', function() { + var ts = createArrayLikeFromArray(testSubject), + o = { a: actual }; + + Array.prototype.forEach.call(ts, function(obj, index) { + this.a[index] = obj; + }, o); + expect(actual).toExactlyMatch(expected); + }); + }); + describe('some', function() { + var actual, expected, numberOfRuns; + + beforeEach(function() { + expected = {0:2, 2: undefined, 3:true }; + actual = {}; + numberOfRuns = 0; + }); + + it('should pass the correct values along to the callback', function() { + var callback = jasmine.createSpy('callback'); + var array = ['1']; + array.some(callback); + expect(callback).toHaveBeenCalledWith('1', 0, array); + }); + it('should not affect elements added to the array after it has begun', function() { + var arr = [1,2,3], + i = 0; + arr.some(function(a) { + i++; + arr.push(a+3); + return i > 3; + }); + expect(arr).toEqual([1,2,3,4,5,6]); + expect(i).toBe(3); + }); + it('should set the right context when given none', function() { + var context; + [1].some(function() {context = this;}); + expect(context).toBe(function() {return this}.call()); + }); + + it('should return false if it runs to the end', function() { + actual = testSubject.some(function() {}); + expect(actual).toBeFalsy(); + }); + it('should return true if it is stopped somewhere', function() { + actual = testSubject.some(function() { return true; }); + expect(actual).toBeTruthy(); + }); + it('should return false if there are no elements', function() { + actual = [].some(function() { return true; }); + expect(actual).toBeFalsy(); + }); + + it('should stop after 3 elements', function() { + testSubject.some(function(obj, index) { + actual[index] = obj; + numberOfRuns += 1; + if(numberOfRuns == 3) { + return true; + } + return false; + }); + expect(actual).toExactlyMatch(expected); + }); + it('should stop after 3 elements using a context', function() { + var o = { a: actual }; + testSubject.some(function(obj, index) { + this.a[index] = obj; + numberOfRuns += 1; + if(numberOfRuns == 3) { + return true; + } + return false; + }, o); + expect(actual).toExactlyMatch(expected); + }); + + it('should stop after 3 elements in an array-like object', function() { + var ts = createArrayLikeFromArray(testSubject); + Array.prototype.some.call(ts, function(obj, index) { + actual[index] = obj; + numberOfRuns += 1; + if(numberOfRuns == 3) { + return true; + } + return false; + }); + expect(actual).toExactlyMatch(expected); + }); + it('should stop after 3 elements in an array-like object using a context', function() { + var ts = createArrayLikeFromArray(testSubject); + var o = { a: actual }; + Array.prototype.some.call(ts, function(obj, index) { + this.a[index] = obj; + numberOfRuns += 1; + if(numberOfRuns == 3) { + return true; + } + return false; + }, o); + expect(actual).toExactlyMatch(expected); + }); + }); + describe('every', function() { + var actual, expected, numberOfRuns; + + beforeEach(function() { + expected = {0:2, 2: undefined, 3:true }; + actual = {}; + numberOfRuns = 0; + }); + + it('should pass the correct values along to the callback', function() { + var callback = jasmine.createSpy('callback'); + var array = ['1']; + array.every(callback); + expect(callback).toHaveBeenCalledWith('1', 0, array); + }); + it('should not affect elements added to the array after it has begun', function() { + var arr = [1,2,3], + i = 0; + arr.every(function(a) { + i++; + arr.push(a+3); + return i <= 3; + }); + expect(arr).toEqual([1,2,3,4,5,6]); + expect(i).toBe(3); + }); + it('should set the right context when given none', function() { + var context; + [1].every(function() {context = this;}); + expect(context).toBe(function() {return this}.call()); + }); + + it('should return true if the array is empty', function() { + actual = [].every(function() { return true; }); + expect(actual).toBeTruthy(); + + actual = [].every(function() { return false; }); + expect(actual).toBeTruthy(); + }); + it('should return true if it runs to the end', function() { + actual = [1,2,3].every(function() { return true; }); + expect(actual).toBeTruthy(); + }); + it('should return false if it is stopped before the end', function() { + actual = [1,2,3].every(function() { return false; }); + expect(actual).toBeFalsy(); + }); + + it('should return after 3 elements', function() { + testSubject.every(function(obj, index) { + actual[index] = obj; + numberOfRuns += 1; + if(numberOfRuns == 3) { + return false; + } + return true; + }); + expect(actual).toExactlyMatch(expected); + }); + it('should stop after 3 elements using a context', function() { + var o = { a: actual }; + testSubject.every(function(obj, index) { + this.a[index] = obj; + numberOfRuns += 1; + if(numberOfRuns == 3) { + return false; + } + return true; + }, o); + expect(actual).toExactlyMatch(expected); + }); + + it('should stop after 3 elements in an array-like object', function() { + var ts = createArrayLikeFromArray(testSubject); + Array.prototype.every.call(ts, function(obj, index) { + actual[index] = obj; + numberOfRuns += 1; + if(numberOfRuns == 3) { + return false; + } + return true; + }); + expect(actual).toExactlyMatch(expected); + }); + it('should stop after 3 elements in an array-like object using a context', function() { + var ts = createArrayLikeFromArray(testSubject); + var o = { a: actual }; + Array.prototype.every.call(ts, function(obj, index) { + this.a[index] = obj; + numberOfRuns += 1; + if(numberOfRuns == 3) { + return false; + } + return true; + }, o); + expect(actual).toExactlyMatch(expected); + }); + }); + + describe('indexOf', function() { + "use strict"; + var actual, expected, testSubject; + + beforeEach(function() { + testSubject = [2, 3, undefined, true, 'hej', null, 2, false, 0]; + delete testSubject[1]; + + }); + + it('should find the element', function() { + expected = 4; + actual = testSubject.indexOf('hej'); + expect(actual).toEqual(expected); + }); + it('should not find the element', function() { + expected = -1; + actual = testSubject.indexOf('mus'); + expect(actual).toEqual(expected); + }); + it('should find undefined as well', function() { + expected = -1; + actual = testSubject.indexOf(undefined); + expect(actual).not.toEqual(expected); + }); + it('should skip unset indexes', function() { + expected = 2; + actual = testSubject.indexOf(undefined); + expect(actual).toEqual(expected); + }); + it('should use a strict test', function() { + actual = testSubject.indexOf(null); + expect(actual).toEqual(5); + + actual = testSubject.indexOf('2'); + expect(actual).toEqual(-1); + }); + it('should skip the first if fromIndex is set', function() { + expect(testSubject.indexOf(2, 2)).toEqual(6); + expect(testSubject.indexOf(2, 0)).toEqual(0); + expect(testSubject.indexOf(2, 6)).toEqual(6); + }); + it('should work with negative fromIndex', function() { + expect(testSubject.indexOf(2, -3)).toEqual(6); + expect(testSubject.indexOf(2, -9)).toEqual(0); + }); + it('should work with fromIndex being greater than the length', function() { + expect(testSubject.indexOf('hej', 20)).toEqual(-1); + }); + it('should work with fromIndex being negative and greater than the length', function() { + expect(testSubject.indexOf('hej', -20)).toEqual(4); + }); + + describe('Array-like', function ArrayLike() { + var indexOf = Array.prototype.indexOf, + testAL; + beforeEach(function beforeEach() { + testAL = {}; + testSubject = [2, 3, undefined, true, 'hej', null, 2, false, 0]; + testSubject.forEach(function (o,i) { + testAL[i] = o; + }); + testAL.length = testSubject.length; + }); + it('should find the element (array-like)', function() { + expected = 4; + actual = indexOf.call(testAL, 'hej'); + expect(actual).toEqual(expected); + }); + it('should not find the element (array-like)', function() { + expected = -1; + actual = indexOf.call(testAL, 'mus'); + expect(actual).toEqual(expected); + }); + it('should find undefined as well (array-like)', function() { + expected = -1; + actual = indexOf.call(testAL, undefined); + expect(actual).not.toEqual(expected); + }); + it('should skip unset indexes (array-like)', function() { + expected = 2; + actual = indexOf.call(testAL, undefined); + expect(actual).toEqual(expected); + }); + it('should use a strict test (array-like)', function() { + actual = Array.prototype.indexOf.call(testAL, null); + expect(actual).toEqual(5); + + actual = Array.prototype.indexOf.call(testAL, '2'); + expect(actual).toEqual(-1); + }); + it('should skip the first if fromIndex is set (array-like)', function() { + expect(indexOf.call(testAL, 2, 2)).toEqual(6); + expect(indexOf.call(testAL, 2, 0)).toEqual(0); + expect(indexOf.call(testAL, 2, 6)).toEqual(6); + }); + it('should work with negative fromIndex (array-like)', function() { + expect(indexOf.call(testAL, 2, -3)).toEqual(6); + expect(indexOf.call(testAL, 2, -9)).toEqual(0); + }); + it('should work with fromIndex being greater than the length (array-like)', function() { + expect(indexOf.call(testAL, 'hej', 20)).toEqual(-1); + }); + it('should work with fromIndex being negative and greater than the length (array-like)', function() { + expect(indexOf.call(testAL, 'hej', -20)).toEqual(4); + }); + }); + }); + describe('lastIndexOf', function() { + "use strict"; + var actual, expected, testSubject, testAL; + + beforeEach(function() { + testSubject = [2, 3, undefined, true, 'hej', null, 2, 3, false, 0]; + delete testSubject[1]; + delete testSubject[7]; + }); + describe('Array', function() { + it('should find the element', function() { + expected = 4; + actual = testSubject.lastIndexOf('hej'); + expect(actual).toEqual(expected); + }); + it('should not find the element', function() { + expected = -1; + actual = testSubject.lastIndexOf('mus'); + expect(actual).toEqual(expected); + }); + it('should find undefined as well', function() { + expected = -1; + actual = testSubject.lastIndexOf(undefined); + expect(actual).not.toEqual(expected); + }); + it('should skip unset indexes', function() { + expected = 2; + actual = testSubject.lastIndexOf(undefined); + expect(actual).toEqual(expected); + }); + it('should use a strict test', function() { + actual = testSubject.lastIndexOf(null); + expect(actual).toEqual(5); + + actual = testSubject.lastIndexOf('2'); + expect(actual).toEqual(-1); + }); + it('should skip the first if fromIndex is set', function() { + expect(testSubject.lastIndexOf(2, 2)).toEqual(0); + expect(testSubject.lastIndexOf(2, 0)).toEqual(0); + expect(testSubject.lastIndexOf(2, 6)).toEqual(6); + }); + it('should work with negative fromIndex', function() { + expect(testSubject.lastIndexOf(2, -3)).toEqual(6); + expect(testSubject.lastIndexOf(2, -9)).toEqual(0); + }); + it('should work with fromIndex being greater than the length', function() { + expect(testSubject.lastIndexOf(2, 20)).toEqual(6); + }); + it('should work with fromIndex being negative and greater than the length', function() { + expect(testSubject.lastIndexOf(2, -20)).toEqual(-1); + }); + }); + + describe('Array like', function() { + var lastIndexOf = Array.prototype.lastIndexOf, + testAL; + beforeEach(function() { + testAL = {}; + testSubject.forEach(function (o,i) { + testAL[i] = o; + }); + testAL.length = testSubject.length; + }); + it('should find the element (array-like)', function() { + expected = 4; + actual = lastIndexOf.call(testAL, 'hej'); + expect(actual).toEqual(expected); + }); + it('should not find the element (array-like)', function() { + expected = -1; + actual = lastIndexOf.call(testAL, 'mus'); + expect(actual).toEqual(expected); + }); + it('should find undefined as well (array-like)', function() { + expected = -1; + actual = lastIndexOf.call(testAL, undefined); + expect(actual).not.toEqual(expected); + }); + it('should skip unset indexes (array-like)', function() { + expected = 2; + actual = lastIndexOf.call(testAL, undefined); + expect(actual).toEqual(expected); + }); + it('should use a strict test (array-like)', function() { + actual = lastIndexOf.call(testAL, null); + expect(actual).toEqual(5); + + actual = lastIndexOf.call(testAL, '2'); + expect(actual).toEqual(-1); + }); + it('should skip the first if fromIndex is set', function() { + expect(lastIndexOf.call(testAL, 2, 2)).toEqual(0); + expect(lastIndexOf.call(testAL, 2, 0)).toEqual(0); + expect(lastIndexOf.call(testAL, 2, 6)).toEqual(6); + }); + it('should work with negative fromIndex', function() { + expect(lastIndexOf.call(testAL, 2, -3)).toEqual(6); + expect(lastIndexOf.call(testAL, 2, -9)).toEqual(0); + }); + it('should work with fromIndex being greater than the length', function() { + expect(lastIndexOf.call(testAL, 2, 20)).toEqual(6); + }); + it('should work with fromIndex being negative and greater than the length', function() { + expect(lastIndexOf.call(testAL, 2, -20)).toEqual(-1); + }); + }); + }); + + describe('filter', function() { + var filteredArray, + callback = function callback(o, i, arr) { + return ( + i != 3 && i != 5 + ); + }; + + beforeEach(function() { + testSubject = [2, 3, undefined, true, 'hej', 3, null, false, 0]; + delete testSubject[1]; + filteredArray = [2, undefined, 'hej', null, false, 0]; + }); + describe('Array object', function() { + + it('should call the callback with the proper arguments', function() { + var callback = jasmine.createSpy('callback'), + arr = ['1']; + arr.filter(callback); + expect(callback).toHaveBeenCalledWith('1', 0, arr); + }); + it('should not affect elements added to the array after it has begun', function() { + var arr = [1,2,3], + i = 0; + arr.filter(function(a) { + i++; + if(i <= 4) { + arr.push(a+3); + } + return true; + }); + expect(arr).toEqual([1,2,3,4,5,6]); + expect(i).toBe(3); + }); + it('should skip non-set values', function() { + var passedValues = {}; + testSubject = [1,2,3,4]; + delete testSubject[1]; + testSubject.filter(function(o, i) { + passedValues[i] = o; + return true; + }); + expect(passedValues).toExactlyMatch(testSubject); + }); + it('should pass the right context to the filter', function() { + var passedValues = {}; + testSubject = [1,2,3,4]; + delete testSubject[1]; + testSubject.filter(function(o, i) { + this[i] = o; + return true; + }, passedValues); + expect(passedValues).toExactlyMatch(testSubject); + }); + it('should set the right context when given none', function() { + var context; + [1].filter(function() {context = this;}); + expect(context).toBe(function() {return this}.call()); + }); + it('should remove only the values for which the callback returns false', function() { + var result = testSubject.filter(callback); + expect(result).toExactlyMatch(filteredArray); + }); + it('should leave the original array untouched', function() { + var copy = testSubject.slice(); + testSubject.filter(callback); + expect(testSubject).toExactlyMatch(copy); + }); + it('should not be affected by same-index mutation', function () { + var results = [1, 2, 3] + .filter(function (value, index, array) { + array[index] = 'a'; + return true; + }); + expect(results).toEqual([1, 2, 3]); + }); + }); + describe('Array like', function() { + beforeEach(function() { + testSubject = createArrayLikeFromArray(testSubject); + }); + it('should call the callback with the proper arguments', function() { + var callback = jasmine.createSpy('callback'), + arr = createArrayLikeFromArray(['1']); + Array.prototype.filter.call(arr, callback); + expect(callback).toHaveBeenCalledWith('1', 0, arr); + }); + it('should not affect elements added to the array after it has begun', function() { + var arr = createArrayLikeFromArray([1,2,3]), + i = 0; + Array.prototype.filter.call(arr, function(a) { + i++; + if(i <= 4) { + arr[i+2] = a+3; + } + return true; + }); + delete arr.length; + expect(arr).toExactlyMatch([1,2,3,4,5,6]); + expect(i).toBe(3); + }); + it('should skip non-set values', function() { + var passedValues = {}; + testSubject = createArrayLikeFromArray([1,2,3,4]); + delete testSubject[1]; + Array.prototype.filter.call(testSubject, function(o, i) { + passedValues[i] = o; + return true; + }); + delete testSubject.length; + expect(passedValues).toExactlyMatch(testSubject); + }); + it('should set the right context when given none', function() { + var context; + Array.prototype.filter.call(createArrayLikeFromArray([1]), function() {context = this;}, undefined); + expect(context).toBe(function() {return this}.call()); + }); + it('should pass the right context to the filter', function() { + var passedValues = {}; + testSubject = createArrayLikeFromArray([1,2,3,4]); + delete testSubject[1]; + Array.prototype.filter.call(testSubject, function(o, i) { + this[i] = o; + return true; + }, passedValues); + delete testSubject.length; + expect(passedValues).toExactlyMatch(testSubject); + }); + it('should remove only the values for which the callback returns false', function() { + var result = Array.prototype.filter.call(testSubject, callback); + expect(result).toExactlyMatch(filteredArray); + }); + it('should leave the original array untouched', function() { + var copy = createArrayLikeFromArray(testSubject); + Array.prototype.filter.call(testSubject, callback); + expect(testSubject).toExactlyMatch(copy); + }); + }); + }); + describe('map', function() { + var callback; + beforeEach(function() { + var i = 0; + callback = function() { + return i++; + }; + }); + describe('Array object', function() { + it('should call callback with the right parameters', function() { + var callback = jasmine.createSpy('callback'), + array = [1]; + array.map(callback); + expect(callback).toHaveBeenCalledWith(1, 0, array); + }); + it('should set the context correctly', function() { + var context = {}; + testSubject.map(function(o,i) { + this[i] = o; + }, context); + expect(context).toExactlyMatch(testSubject); + }); + it('should set the right context when given none', function() { + var context; + [1].map(function() {context = this;}); + expect(context).toBe(function() {return this}.call()); + }); + it('should not change the array it is called on', function() { + var copy = testSubject.slice(); + testSubject.map(callback); + expect(testSubject).toExactlyMatch(copy); + }); + it('should only run for the number of objects in the array when it started', function() { + var arr = [1,2,3], + i = 0; + arr.map(function(o) { + arr.push(o+3); + i++; + return o; + }); + expect(arr).toExactlyMatch([1,2,3,4,5,6]); + expect(i).toBe(3); + }); + it('should properly translate the values as according to the callback', function() { + var result = testSubject.map(callback), + expected = [0,0,1,2,3,4,5,6]; + delete expected[1]; + expect(result).toExactlyMatch(expected); + }); + it('should skip non-existing values', function() { + var array = [1,2,3,4], + i = 0; + delete array[2]; + array.map(function() { + i++; + }); + expect(i).toBe(3); + }); + }); + describe('Array-like', function() { + beforeEach(function() { + testSubject = createArrayLikeFromArray(testSubject); + }); + it('should call callback with the right parameters', function() { + var callback = jasmine.createSpy('callback'), + array = createArrayLikeFromArray([1]); + Array.prototype.map.call(array, callback); + expect(callback).toHaveBeenCalledWith(1, 0, array); + }); + it('should set the context correctly', function() { + var context = {}; + Array.prototype.map.call(testSubject, function(o,i) { + this[i] = o; + }, context); + delete testSubject.length; + expect(context).toExactlyMatch(testSubject); + }); + it('should set the right context when given none', function() { + var context; + Array.prototype.map.call(createArrayLikeFromArray([1]), function() {context = this;}); + expect(context).toBe(function() {return this}.call()); + }); + it('should not change the array it is called on', function() { + var copy = createArrayLikeFromArray(testSubject); + Array.prototype.map.call(testSubject, callback); + expect(testSubject).toExactlyMatch(copy); + }); + it('should only run for the number of objects in the array when it started', function() { + var arr = createArrayLikeFromArray([1,2,3]), + i = 0; + Array.prototype.map.call(arr, function(o) { + Array.prototype.push.call(arr, o+3); + i++; + return o; + }); + delete arr.length; + expect(arr).toExactlyMatch([1,2,3,4,5,6]); + expect(i).toBe(3); + }); + it('should properly translate the values as according to the callback', function() { + var result = Array.prototype.map.call(testSubject, callback), + expected = [0,0,1,2,3,4,5,6]; + delete expected[1]; + expect(result).toExactlyMatch(expected); + }); + it('should skip non-existing values', function() { + var array = createArrayLikeFromArray([1,2,3,4]), + i = 0; + delete array[2]; + Array.prototype.map.call(array, function() { + i++; + }); + expect(i).toBe(3); + }); + }); + }); + + describe('reduce', function() { + beforeEach(function() { + testSubject = [1,2,3]; + }); + + describe('Array', function() { + it('should pass the correct arguments to the callback', function() { + var spy = jasmine.createSpy().andReturn(0); + testSubject.reduce(spy); + expect(spy.calls[0].args).toExactlyMatch([1, 2, 1, testSubject]); + }); + it('should start with the right initialValue', function() { + var spy = jasmine.createSpy().andReturn(0); + testSubject.reduce(spy, 0); + expect(spy.calls[0].args).toExactlyMatch([0, 1, 0, testSubject]); + }); + it('should not affect elements added to the array after it has begun', function() { + var arr = [1,2,3], + i = 0; + arr.reduce(function(a, b) { + i++; + if(i <= 4) { + arr.push(a+3); + }; + return b; + }); + expect(arr).toEqual([1,2,3,4,5]); + expect(i).toBe(2); + }); + it('should work as expected for empty arrays', function() { + var spy = jasmine.createSpy(); + expect(function() { + [].reduce(spy); + }).toThrow(); + expect(spy).not.toHaveBeenCalled(); + }); + it('should throw correctly if no callback is given', function() { + expect(function() { + testSubject.reduce(); + }).toThrow(); + }); + it('should return the expected result', function() { + expect(testSubject.reduce(function(a,b) { + return (a||'').toString()+(b||'').toString(); + })).toEqual(testSubject.join('')); + }); + it('should not directly affect the passed array', function() { + var copy = testSubject.slice(); + testSubject.reduce(function(a,b) { + return a+b; + }); + expect(testSubject).toEqual(copy); + }); + it('should skip non-set values', function() { + delete testSubject[1]; + var visited = {}; + testSubject.reduce(function(a,b) { + if(a) + visited[a] = true; + if(b) + visited[b] = true; + return 0; + }); + + expect(visited).toEqual({ '1': true, '3': true }); + }); + it('should have the right length', function() { + expect(testSubject.reduce.length).toBe(1); + }); + }); + describe('Array-like objects', function() { + beforeEach(function() { + testSubject = createArrayLikeFromArray(testSubject); + testSubject.reduce = Array.prototype.reduce; + }); + it('should pass the correct arguments to the callback', function() { + var spy = jasmine.createSpy().andReturn(0); + testSubject.reduce(spy); + expect(spy.calls[0].args).toExactlyMatch([1, 2, 1, testSubject]); + }); + it('should start with the right initialValue', function() { + var spy = jasmine.createSpy().andReturn(0); + testSubject.reduce(spy, 0); + expect(spy.calls[0].args).toExactlyMatch([0, 1, 0, testSubject]); + }); + it('should not affect elements added to the array after it has begun', function() { + var arr = createArrayLikeFromArray([1,2,3]), + i = 0; + Array.prototype.reduce.call(arr, function(a, b) { + i++; + if(i <= 4) { + arr[i+2] = a+3; + }; + return b; + }); + expect(arr).toEqual({ + 0: 1, + 1: 2, + 2: 3, + 3: 4, + 4: 5, + length: 3 + }); + expect(i).toBe(2); + }); + it('should work as expected for empty arrays', function() { + var spy = jasmine.createSpy(); + expect(function() { + Array.prototype.reduce.call({length: 0}, spy); + }).toThrow(); + expect(spy).not.toHaveBeenCalled(); + }); + it('should throw correctly if no callback is given', function() { + expect(function() { + testSubject.reduce(); + }).toThrow(); + }); + it('should return the expected result', function() { + expect(testSubject.reduce(function(a,b) { + return (a||'').toString()+(b||'').toString(); + })).toEqual('123'); + }); + it('should not directly affect the passed array', function() { + var copy = createArrayLikeFromArray(testSubject); + testSubject.reduce(function(a,b) { + return a+b; + }); + delete(testSubject.reduce); + expect(testSubject).toEqual(copy); + }); + it('should skip non-set values', function() { + delete testSubject[1]; + var visited = {}; + testSubject.reduce(function(a,b) { + if(a) + visited[a] = true; + if(b) + visited[b] = true; + return 0; + }); + + expect(visited).toEqual({ '1': true, '3': true }); + }); + it('should have the right length', function() { + expect(testSubject.reduce.length).toBe(1); + }); + }); + }); + describe('reduceRight', function() { + beforeEach(function() { + testSubject = [1,2,3]; + }); + + describe('Array', function() { + it('should pass the correct arguments to the callback', function() { + var spy = jasmine.createSpy().andReturn(0); + testSubject.reduceRight(spy); + expect(spy.calls[0].args).toExactlyMatch([3, 2, 1, testSubject]); + }); + it('should start with the right initialValue', function() { + var spy = jasmine.createSpy().andReturn(0); + testSubject.reduceRight(spy, 0); + expect(spy.calls[0].args).toExactlyMatch([0, 3, 2, testSubject]); + }); + it('should not affect elements added to the array after it has begun', function() { + var arr = [1,2,3], + i = 0; + arr.reduceRight(function(a, b) { + i++; + if(i <= 4) { + arr.push(a+3); + }; + return b; + }); + expect(arr).toEqual([1,2,3,6,5]); + expect(i).toBe(2); + }); + it('should work as expected for empty arrays', function() { + var spy = jasmine.createSpy(); + expect(function() { + [].reduceRight(spy); + }).toThrow(); + expect(spy).not.toHaveBeenCalled(); + }); + it('should throw correctly if no callback is given', function() { + expect(function() { + testSubject.reduceRight(); + }).toThrow(); + }); + it('should return the expected result', function() { + expect(testSubject.reduceRight(function(a,b) { + return (a||'').toString()+(b||'').toString(); + })).toEqual('321'); + }); + it('should not directly affect the passed array', function() { + var copy = testSubject.slice(); + testSubject.reduceRight(function(a,b) { + return a+b; + }); + expect(testSubject).toEqual(copy); + }); + it('should skip non-set values', function() { + delete testSubject[1]; + var visited = {}; + testSubject.reduceRight(function(a,b) { + if(a) + visited[a] = true; + if(b) + visited[b] = true; + return 0; + }); + + expect(visited).toEqual({ '1': true, '3': true }); + }); + it('should have the right length', function() { + expect(testSubject.reduceRight.length).toBe(1); + }); + }); + describe('Array-like objects', function() { + beforeEach(function() { + testSubject = createArrayLikeFromArray(testSubject); + testSubject.reduceRight = Array.prototype.reduceRight; + }); + it('should pass the correct arguments to the callback', function() { + var spy = jasmine.createSpy().andReturn(0); + testSubject.reduceRight(spy); + expect(spy.calls[0].args).toExactlyMatch([3, 2, 1, testSubject]); + }); + it('should start with the right initialValue', function() { + var spy = jasmine.createSpy().andReturn(0); + testSubject.reduceRight(spy, 0); + expect(spy.calls[0].args).toExactlyMatch([0, 3, 2, testSubject]); + }); + it('should not affect elements added to the array after it has begun', function() { + var arr = createArrayLikeFromArray([1,2,3]), + i = 0; + Array.prototype.reduceRight.call(arr, function(a, b) { + i++; + if(i <= 4) { + arr[i+2] = a+3; + }; + return b; + }); + expect(arr).toEqual({ + 0: 1, + 1: 2, + 2: 3, + 3: 6, + 4: 5, + length: 3 // does not get updated on property assignment + }); + expect(i).toBe(2); + }); + it('should work as expected for empty arrays', function() { + var spy = jasmine.createSpy(); + expect(function() { + Array.prototype.reduceRight.call({length:0}, spy); + }).toThrow(); + expect(spy).not.toHaveBeenCalled(); + }); + it('should throw correctly if no callback is given', function() { + expect(function() { + testSubject.reduceRight(); + }).toThrow(); + }); + it('should return the expected result', function() { + expect(testSubject.reduceRight(function(a,b) { + return (a||'').toString()+(b||'').toString(); + })).toEqual('321'); + }); + it('should not directly affect the passed array', function() { + var copy = createArrayLikeFromArray(testSubject); + testSubject.reduceRight(function(a,b) { + return a+b; + }); + delete(testSubject.reduceRight); + expect(testSubject).toEqual(copy); + }); + it('should skip non-set values', function() { + delete testSubject[1]; + var visited = {}; + testSubject.reduceRight(function(a,b) { + if(a) + visited[a] = true; + if(b) + visited[b] = true; + return 0; + }); + + expect(visited).toEqual({ '1': true, '3': true }); + }); + it('should have the right length', function() { + expect(testSubject.reduceRight.length).toBe(1); + }); + }); + }); + + describe('isArray', function () { + it('should work for Array', function () { + var ret = Array.isArray([]); + + expect(ret).toBe(true); + }); + + it('should fail for other objects', function () { + var objects = [ + "someString", + true, + false, + 42, + 0, + {}, + Object.create(null), + /foo/, + arguments, + document.getElementsByTagName("div") + ]; + + objects.forEach(function (v) { + expect(Array.isArray(v)).toBe(false); + }); + }); + }); + + +}); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-date.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-date.js new file mode 100644 index 0000000000..26ab28529e --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-date.js @@ -0,0 +1,40 @@ +describe('Date', function () { + + describe('now', function () { + it('should be the current time', function () { + expect(Date.now() === new Date().getTime()).toBe(true); + }); + }); + + describe("parse", function () { + // TODO: Write the rest of the test. + + it('should support extended years', function () { + + expect(Date.parse('0001-01-01T00:00:00Z')).toBe(-62135596800000); + expect(Date.parse('+275760-09-13T00:00:00.000Z')).toBe(8.64e15); + expect(Date.parse('+033658-09-27T01:46:40.000Z')).toBe(1e15); + expect(Date.parse('-000001-01-01T00:00:00Z')).toBe(-62198755200000); + expect(Date.parse('+002009-12-15T00:00:00Z')).toBe(1260835200000); + + }); + + }); + + describe("toISOString", function () { + // TODO: write the rest of the test. + + it('should support extended years', function () { + expect(new Date(-62198755200000).toISOString().indexOf('-000001-01-01')).toBe(0); + expect(new Date(8.64e15).toISOString().indexOf('+275760-09-13')).toBe(0); + }); + }); + + describe("toJSON", function () { + it('should return the isoString when stringified', function () { + var date = new Date(); + expect(JSON.stringify(date.toISOString())).toBe(JSON.stringify(date)); + }) + }); + +}); \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-function.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-function.js new file mode 100644 index 0000000000..adb6023fc2 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-function.js @@ -0,0 +1,137 @@ + +describe('Function', function() { + "use strict"; + describe('bind', function() { + var actual, expected, + testSubject; + + testSubject = { + push: function(o) { + this.a.push(o); + } + }; + + function func() { + Array.prototype.forEach.call(arguments, function(a) { + this.push(a); + }, this); + return this; + }; + + beforeEach(function() { + actual = []; + testSubject.a = []; + }); + + it('binds properly without a context', function() { + var context; + testSubject.func = function() { + context = this; + }.bind(); + testSubject.func(); + expect(context).toBe(function() {return this}.call()); + }); + it('binds properly without a context, and still supplies bound arguments', function() { + var a, context; + testSubject.func = function() { + a = Array.prototype.slice.call(arguments); + context = this; + }.bind(undefined, 1,2,3); + testSubject.func(1,2,3); + expect(a).toEqual([1,2,3,1,2,3]); + expect(context).toBe(function() {return this}.call()); + }); + it('binds a context properly', function() { + testSubject.func = func.bind(actual); + testSubject.func(1,2,3); + expect(actual).toEqual([1,2,3]); + expect(testSubject.a).toEqual([]); + }); + it('binds a context and supplies bound arguments', function() { + testSubject.func = func.bind(actual, 1,2,3); + testSubject.func(4,5,6); + expect(actual).toEqual([1,2,3,4,5,6]); + expect(testSubject.a).toEqual([]); + }); + + it('returns properly without binding a context', function() { + testSubject.func = function() { + return this; + }.bind(); + var context = testSubject.func(); + expect(context).toBe(function() {return this}.call()); + }); + it('returns properly without binding a context, and still supplies bound arguments', function() { + var context; + testSubject.func = function() { + context = this; + return Array.prototype.slice.call(arguments); + }.bind(undefined, 1,2,3); + actual = testSubject.func(1,2,3); + expect(context).toBe(function() {return this}.call()); + expect(actual).toEqual([1,2,3,1,2,3]); + }); + it('returns properly while binding a context properly', function() { + var ret; + testSubject.func = func.bind(actual); + ret = testSubject.func(1,2,3); + expect(ret).toBe(actual); + expect(ret).not.toBe(testSubject); + }); + it('returns properly while binding a context and supplies bound arguments', function() { + var ret; + testSubject.func = func.bind(actual, 1,2,3); + ret = testSubject.func(4,5,6); + expect(ret).toBe(actual); + expect(ret).not.toBe(testSubject); + }); + it('passes the correct arguments as a constructor', function() { + var ret, expected = { name: "Correct" }; + testSubject.func = function(arg) { + return arg; + }.bind({ name: "Incorrect" }); + ret = new testSubject.func(expected); + expect(ret).toBe(expected); + }); + it('returns the return value of the bound function when called as a constructor', function () { + var oracle = [1, 2, 3]; + var subject = function () { + return oracle; + }.bind(null); + var result = new subject; + expect(result).toBe(oracle); + }); + it('returns the correct value if constructor returns primitive', function() { + var oracle = [1, 2, 3]; + var subject = function () { + return oracle; + }.bind(null); + var result = new subject; + expect(result).toBe(oracle); + + oracle = {}; + result = new subject; + expect(result).toBe(oracle); + + oracle = function(){}; + result = new subject; + expect(result).toBe(oracle); + + oracle = "asdf"; + result = new subject; + expect(result).not.toBe(oracle); + + oracle = null; + result = new subject; + expect(result).not.toBe(oracle); + + oracle = true; + result = new subject; + expect(result).not.toBe(oracle); + + oracle = 1; + result = new subject; + expect(result).not.toBe(oracle); + }); + }); +}); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-object.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-object.js new file mode 100644 index 0000000000..8f2a87ad8f --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-object.js @@ -0,0 +1,84 @@ +describe('Object', function () { + "use strict"; + + describe("Object.keys", function () { + var obj = { + "str": "boz", + "obj": { }, + "arr": [], + "bool": true, + "num": 42, + "null": null, + "undefined": undefined + }; + + var loopedValues = []; + for (var k in obj) { + loopedValues.push(k); + } + + var keys = Object.keys(obj); + it('should have correct length', function () { + expect(keys.length).toBe(7); + }); + + it('should return an Array', function () { + expect(Array.isArray(keys)).toBe(true); + }); + + it('should return names which are own properties', function () { + keys.forEach(function (name) { + expect(obj.hasOwnProperty(name)).toBe(true); + }); + }); + + it('should return names which are enumerable', function () { + keys.forEach(function (name) { + expect(loopedValues.indexOf(name)).toNotBe(-1); + }) + }); + + it('should throw error for non object', function () { + var e = {}; + expect(function () { + try { + Object.keys(42) + } catch (err) { + throw e; + } + }).toThrow(e); + }); + }); + + describe("Object.isExtensible", function () { + var obj = { }; + + it('should return true if object is extensible', function () { + expect(Object.isExtensible(obj)).toBe(true); + }); + + it('should return false if object is not extensible', function () { + expect(Object.isExtensible(Object.preventExtensions(obj))).toBe(false); + }); + + it('should return false if object is seal', function () { + expect(Object.isExtensible(Object.seal(obj))).toBe(false); + }); + + it('should return false if object is freeze', function () { + expect(Object.isExtensible(Object.freeze(obj))).toBe(false); + }); + + it('should throw error for non object', function () { + var e1 = {}; + expect(function () { + try { + Object.isExtensible(42) + } catch (err) { + throw e1; + } + }).toThrow(e1); + }); + }); + +}); \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-string.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-string.js new file mode 100644 index 0000000000..c31498dd8a --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/es5-shim/tests/spec/s-string.js @@ -0,0 +1,11 @@ +describe('String', function() { + "use strict"; + describe("trim", function() { + var test = "\x09\x0A\x0B\x0C\x0D\x20\xA0\u1680\u180E\u2000\u2001\u2002\u2003\u2004\u2005\u2006\u2007\u2008\u2009\u200A\u202F\u205F\u3000\u2028\u2029\uFEFFHello, World!\x09\x0A\x0B\x0C\x0D\x20\xA0\u1680\u180E\u2000\u2001\u2002\u2003\u2004\u2005\u2006\u2007\u2008\u2009\u200A\u202F\u205F\u3000\u2028\u2029\uFEFF"; + + it('trims all ES5 whitespace', function() { + expect(test.trim()).toEqual("Hello, World!"); + expect(test.trim().length).toEqual(13); + }); + }); +}); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/.travis.yml b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/.travis.yml new file mode 100644 index 0000000000..03c6680383 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/.travis.yml @@ -0,0 +1,7 @@ +language: node_js +node_js: + - 0.8 +before_script: + - "export DISPLAY=:99.0" + - "sh -e /etc/init.d/xvfb start" +script: "npm install; make standalone; phantomjs test/phantom-jasmine/run_jasmine_test.coffee test/run/jasmine_test.html" diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/advice.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/advice.js new file mode 100644 index 0000000000..0f4686929a --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/advice.js @@ -0,0 +1,69 @@ +// ========================================== +// Copyright 2013 Twitter, Inc +// Licensed under The MIT License +// http://opensource.org/licenses/MIT +// ========================================== + +"use strict"; + +define( + + [ + './utils', + './compose' + ], + + function (util, compose) { + + var advice = { + + around: function(base, wrapped) { + return function composedAround() { + // unpacking arguments by hand benchmarked faster + var i = 0, l = arguments.length, args = new Array(l + 1); + args[0] = base.bind(this); + for (; i < l; i++) args[i + 1] = arguments[i]; + + return wrapped.apply(this, args); + } + }, + + before: function(base, before) { + var beforeFn = (typeof before == 'function') ? before : before.obj[before.fnName]; + return function composedBefore() { + beforeFn.apply(this, arguments); + return base.apply(this, arguments); + } + }, + + after: function(base, after) { + var afterFn = (typeof after == 'function') ? after : after.obj[after.fnName]; + return function composedAfter() { + var res = (base.unbound || base).apply(this, arguments); + afterFn.apply(this, arguments); + return res; + } + }, + + // a mixin that allows other mixins to augment existing functions by adding additional + // code before, after or around. + withAdvice: function() { + ['before', 'after', 'around'].forEach(function(m) { + this[m] = function(method, fn) { + + compose.unlockProperty(this, method, function() { + if (typeof this[method] == 'function') { + return this[method] = advice[m](this[method], fn); + } else { + return this[method] = fn; + } + }); + + }; + }, this); + } + }; + + return advice; + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/component.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/component.js new file mode 100644 index 0000000000..d9a5077ac9 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/component.js @@ -0,0 +1,308 @@ +// ========================================== +// Copyright 2013 Twitter, Inc +// Licensed under The MIT License +// http://opensource.org/licenses/MIT +// ========================================== + +"use strict"; + +define( + + [ + './advice', + './utils', + './compose', + './registry' + ], + + function(advice, utils, compose, registry) { + + var functionNameRegEx = /function (.*?)\s?\(/; + var componentId = 0; + + function teardownInstance(instanceInfo){ + instanceInfo.events.slice().forEach(function(event) { + var args = [event.type]; + + event.element && args.unshift(event.element); + (typeof event.callback == 'function') && args.push(event.callback); + + this.off.apply(this, args); + }, instanceInfo.instance); + } + + + function teardown() { + teardownInstance(registry.findInstanceInfo(this)); + } + + //teardown for all instances of this constructor + function teardownAll() { + var componentInfo = registry.findComponentInfo(this); + + componentInfo && Object.keys(componentInfo.instances).forEach(function(k) { + var info = componentInfo.instances[k]; + info.instance.teardown(); + }); + } + + function checkSerializable(type, data) { + try { + window.postMessage(data, '*'); + } catch(e) { + console.log('unserializable data for event',type,':',data); + throw new Error( + ["The event", type, "on component", this.toString(), "was triggered with non-serializable data"].join(" ") + ); + } + } + + //common mixin allocates basic functionality - used by all component prototypes + //callback context is bound to component + function withBaseComponent() { + + // delegate trigger, bind and unbind to an element + // if $element not supplied, use component's node + // other arguments are passed on + // event can be either a string specifying the type + // of the event, or a hash specifying both the type + // and a default function to be called. + this.trigger = function() { + var $element, type, data, event, defaultFn; + var lastIndex = arguments.length - 1, lastArg = arguments[lastIndex]; + + if (typeof lastArg != "string" && !(lastArg && lastArg.defaultBehavior)) { + lastIndex--; + data = lastArg; + } + + if (lastIndex == 1) { + $element = $(arguments[0]); + event = arguments[1]; + } else { + $element = this.$node; + event = arguments[0]; + } + + if (event.defaultBehavior) { + defaultFn = event.defaultBehavior; + event = $.Event(event.type); + } + + type = event.type || event; + + if (window.DEBUG && window.DEBUG.enabled && window.postMessage) { + checkSerializable.call(this, type, data); + } + + if (typeof this.attr.eventData === 'object') { + data = $.extend(true, {}, this.attr.eventData, data); + } + + $element.trigger((event || type), data); + + if (defaultFn && !event.isDefaultPrevented()) { + (this[defaultFn] || defaultFn).call(this); + } + + return $element; + }; + + this.on = function() { + var $element, type, callback, originalCb; + var lastIndex = arguments.length - 1, origin = arguments[lastIndex]; + + if (typeof origin == "object") { + //delegate callback + originalCb = utils.delegate( + this.resolveDelegateRules(origin) + ); + } else { + originalCb = origin; + } + + if (lastIndex == 2) { + $element = $(arguments[0]); + type = arguments[1]; + } else { + $element = this.$node; + type = arguments[0]; + } + + if (typeof originalCb != 'function' && typeof originalCb != 'object') { + throw new Error("Unable to bind to '" + type + "' because the given callback is not a function or an object"); + } + + callback = originalCb.bind(this); + callback.target = originalCb; + + // if the original callback is already branded by jQuery's guid, copy it to the context-bound version + if (originalCb.guid) { + callback.guid = originalCb.guid; + } + + $element.on(type, callback); + + // get jquery's guid from our bound fn, so unbinding will work + originalCb.guid = callback.guid; + + return callback; + }; + + this.off = function() { + var $element, type, callback; + var lastIndex = arguments.length - 1; + + if (typeof arguments[lastIndex] == "function") { + callback = arguments[lastIndex]; + lastIndex -= 1; + } + + if (lastIndex == 1) { + $element = $(arguments[0]); + type = arguments[1]; + } else { + $element = this.$node; + type = arguments[0]; + } + + return $element.off(type, callback); + }; + + this.resolveDelegateRules = function(ruleInfo) { + var rules = {}; + + Object.keys(ruleInfo).forEach(function(r) { + if (!r in this.attr) { + throw new Error('Component "' + this.toString() + '" wants to listen on "' + r + '" but no such attribute was defined.'); + } + rules[this.attr[r]] = ruleInfo[r]; + }, this); + + return rules; + }; + + this.defaultAttrs = function(defaults) { + utils.push(this.defaults, defaults, true) || (this.defaults = defaults); + }; + + this.select = function(attributeKey) { + return this.$node.find(this.attr[attributeKey]); + }; + + this.initialize = $.noop; + this.teardown = teardown; + } + + function attachTo(selector/*, options args */) { + // unpacking arguments by hand benchmarked faster + var l = arguments.length; + var args = new Array(l - 1); + for (var i = 1; i < l; i++) args[i - 1] = arguments[i]; + + if (!selector) { + throw new Error("Component needs to be attachTo'd a jQuery object, native node or selector string"); + } + + var options = utils.merge.apply(utils, args); + + $(selector).each(function(i, node) { + var rawNode = node.jQuery ? node[0] : node; + var componentInfo = registry.findComponentInfo(this) + if (componentInfo && componentInfo.isAttachedTo(rawNode)) { + //already attached + return; + } + + new this(node, options); + }.bind(this)); + } + + // define the constructor for a custom component type + // takes an unlimited number of mixin functions as arguments + // typical api call with 3 mixins: define(timeline, withTweetCapability, withScrollCapability); + function define(/*mixins*/) { + // unpacking arguments by hand benchmarked faster + var l = arguments.length; + var mixins = new Array(l); + for (var i = 0; i < l; i++) mixins[i] = arguments[i]; + + Component.toString = function() { + var prettyPrintMixins = mixins.map(function(mixin) { + if (mixin.name == null) { + //function name property not supported by this browser, use regex + var m = mixin.toString().match(functionNameRegEx); + return (m && m[1]) ? m[1] : ""; + } else { + return (mixin.name != "withBaseComponent") ? mixin.name : ""; + } + }).filter(Boolean).join(', '); + return prettyPrintMixins; + }; + + if (window.DEBUG && window.DEBUG.enabled) { + Component.describe = Component.toString(); + } + + //'options' is optional hash to be merged with 'defaults' in the component definition + function Component(node, options) { + options = options || {}; + this.identity = componentId++; + + if (!node) { + throw new Error("Component needs a node"); + } + + if (node.jquery) { + this.node = node[0]; + this.$node = node; + } else { + this.node = node; + this.$node = $(node); + } + + this.toString = Component.toString; + if (window.DEBUG && window.DEBUG.enabled) { + this.describe = this.toString(); + } + + //merge defaults with supplied options + //put options in attr.__proto__ to avoid merge overhead + var attr = Object.create(options); + for (var key in this.defaults) { + if (!options.hasOwnProperty(key)) { + attr[key] = this.defaults[key]; + } + } + this.attr = attr; + + Object.keys(this.defaults || {}).forEach(function(key) { + if (this.defaults[key] === null && this.attr[key] === null) { + throw new Error('Required attribute "' + key + '" not specified in attachTo for component "' + this.toString() + '".'); + } + }, this); + + this.initialize.call(this, options); + } + + Component.attachTo = attachTo; + Component.teardownAll = teardownAll; + + // prepend common mixins to supplied list, then mixin all flavors + mixins.unshift(withBaseComponent, advice.withAdvice, registry.withRegistration); + + compose.mixin(Component.prototype, mixins); + + return Component; + } + + define.teardownAll = function() { + registry.components.slice().forEach(function(c) { + c.component.teardownAll(); + }); + registry.reset(); + }; + + return define; + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/compose.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/compose.js new file mode 100644 index 0000000000..c1343e7fe8 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/compose.js @@ -0,0 +1,86 @@ +// ========================================== +// Copyright 2013 Twitter, Inc +// Licensed under The MIT License +// http://opensource.org/licenses/MIT +// ========================================== + +"use strict"; + +define( + + [ + './utils', + '../tools/debug/debug' + ], + + function(util, debug) { + + //enumerables are shims - getOwnPropertyDescriptor shim doesn't work + var canWriteProtect = debug.enabled && !util.isEnumerable(Object, 'getOwnPropertyDescriptor'); + //whitelist of unlockable property names + var dontLock = ['mixedIn']; + + if (canWriteProtect) { + //IE8 getOwnPropertyDescriptor is built-in but throws exeption on non DOM objects + try { + Object.getOwnPropertyDescriptor(Object, 'keys'); + } catch(e) { + canWriteProtect = false; + } + } + + function setPropertyWritability(obj, isWritable) { + if (!canWriteProtect) { + return; + } + + var props = Object.create(null); + + Object.keys(obj).forEach( + function (key) { + if (dontLock.indexOf(key) < 0) { + var desc = Object.getOwnPropertyDescriptor(obj, key); + desc.writable = isWritable; + props[key] = desc; + } + } + ); + + Object.defineProperties(obj, props); + } + + function unlockProperty(obj, prop, op) { + var writable; + + if (!canWriteProtect || !obj.hasOwnProperty(prop)) { + op.call(obj); + return; + } + + writable = Object.getOwnPropertyDescriptor(obj, prop).writable; + Object.defineProperty(obj, prop, { writable: true }); + op.call(obj); + Object.defineProperty(obj, prop, { writable: writable }); + } + + function mixin(base, mixins) { + base.mixedIn = base.hasOwnProperty('mixedIn') ? base.mixedIn : []; + + mixins.forEach(function(mixin) { + if (base.mixedIn.indexOf(mixin) == -1) { + setPropertyWritability(base, false); + mixin.call(base); + base.mixedIn.push(mixin); + } + }); + + setPropertyWritability(base, true); + } + + return { + mixin: mixin, + unlockProperty: unlockProperty + }; + + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/index.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/index.js new file mode 100644 index 0000000000..1604b253b9 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/index.js @@ -0,0 +1,30 @@ +// ========================================== +// Copyright 2013 Twitter, Inc +// Licensed under The MIT License +// http://opensource.org/licenses/MIT +// ========================================== + +define( + + [ + './advice', + './component', + './compose', + './logger', + './registry', + './utils' + ], + + function (advice, component, compose, logger, registry, utils) { + + return { + advice: advice, + component: component, + compose: compose, + logger: logger, + registry: registry, + utils: utils + }; + + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/logger.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/logger.js new file mode 100644 index 0000000000..2c89b1bd20 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/logger.js @@ -0,0 +1,93 @@ +// ========================================== +// Copyright 2013 Twitter, Inc +// Licensed under The MIT License +// http://opensource.org/licenses/MIT +// ========================================== + +"use strict"; + +define( + + [ + './compose', + './utils' + ], + + function (compose, util) { + + var actionSymbols = { + on:'<-', + trigger: '->', + off: 'x ' + }; + + function elemToString(elem) { + var tagStr = elem.tagName ? elem.tagName.toLowerCase() : elem.toString(); + var classStr = elem.className ? "." + (elem.className) : ""; + var result = tagStr + classStr; + return elem.tagName ? ['\'', '\''].join(result) : result; + } + + function log(action, component, eventArgs) { + + var name, elem, fn, fnName, logFilter, toRegExp, actionLoggable, nameLoggable; + + if (typeof eventArgs[eventArgs.length-1] == 'function') { + fn = eventArgs.pop(); + fn = fn.unbound || fn; //use unbound version if any (better info) + } + + if (typeof eventArgs[eventArgs.length - 1] == 'object') { + eventArgs.pop(); //trigger data arg - not logged right now + } + + if (eventArgs.length == 2) { + elem = eventArgs[0]; + name = eventArgs[1]; + } else { + elem = component.$node[0]; + name = eventArgs[0]; + } + + if (window.DEBUG && window.DEBUG.enabled) { + logFilter = DEBUG.events.logFilter; + + // no regex for you, actions... + actionLoggable = logFilter.actions=="all" || (logFilter.actions.indexOf(action) > -1); + // event name filter allow wildcards or regex... + toRegExp = function(expr) { + return expr.test ? expr : new RegExp("^" + expr.replace(/\*/g, ".*") + "$"); + }; + nameLoggable = + logFilter.eventNames=="all" || + logFilter.eventNames.some(function(e) {return toRegExp(e).test(name)}); + + if (actionLoggable && nameLoggable) { + console.info( + actionSymbols[action], + action, + '[' + name + ']', + elemToString(elem), + component.constructor.toString(), + fn && (fnName = fn.name || fn.displayName) && '-> ' + fnName + ); + } + } + } + + + function withLogging() { + this.before('trigger', function() { + log('trigger', this, util.toArray(arguments)); + }); + this.before('on', function() { + log('on', this, util.toArray(arguments)); + }); + this.before('off', function(eventArgs) { + log('off', this, util.toArray(arguments)); + }); + } + + return withLogging; + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/registry.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/registry.js new file mode 100644 index 0000000000..baaa3b10a7 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/registry.js @@ -0,0 +1,220 @@ +// ========================================== +// Copyright 2013 Twitter, Inc +// Licensed under The MIT License +// http://opensource.org/licenses/MIT +// ========================================== + +"use strict"; + +define( + + [ + './utils' + ], + + function (util) { + + function parseEventArgs(instance, args) { + var element, type, callback; + var end = args.length; + + if (typeof args[end - 1] === 'function') { + end -= 1; + callback = args[end]; + } + + if (typeof args[end - 1] === 'object') { + end -= 1; + } + + if (end == 2) { + element = args[0]; + type = args[1]; + } else { + element = instance.node; + type = args[0]; + } + + return { + element: element, + type: type, + callback: callback + }; + } + + function matchEvent(a, b) { + return ( + (a.element == b.element) && + (a.type == b.type) && + (b.callback == null || (a.callback == b.callback)) + ); + } + + function Registry() { + + var registry = this; + + (this.reset = function() { + this.components = []; + this.allInstances = {}; + this.events = []; + }).call(this); + + function ComponentInfo(component) { + this.component = component; + this.attachedTo = []; + this.instances = {}; + + this.addInstance = function(instance) { + var instanceInfo = new InstanceInfo(instance); + this.instances[instance.identity] = instanceInfo; + this.attachedTo.push(instance.node); + + return instanceInfo; + } + + this.removeInstance = function(instance) { + delete this.instances[instance.identity]; + var indexOfNode = this.attachedTo.indexOf(instance.node); + (indexOfNode > -1) && this.attachedTo.splice(indexOfNode, 1); + + if (!this.instances.length) { + //if I hold no more instances remove me from registry + registry.removeComponentInfo(this); + } + } + + this.isAttachedTo = function(node) { + return this.attachedTo.indexOf(node) > -1; + } + } + + function InstanceInfo(instance) { + this.instance = instance; + this.events = []; + + this.addBind = function(event) { + this.events.push(event); + registry.events.push(event); + }; + + this.removeBind = function(event) { + for (var i = 0, e; e = this.events[i]; i++) { + if (matchEvent(e, event)) { + this.events.splice(i, 1); + } + } + } + } + + this.addInstance = function(instance) { + var component = this.findComponentInfo(instance); + + if (!component) { + component = new ComponentInfo(instance.constructor); + this.components.push(component); + } + + var inst = component.addInstance(instance); + + this.allInstances[instance.identity] = inst; + + return component; + }; + + this.removeInstance = function(instance) { + var index, instInfo = this.findInstanceInfo(instance); + + //remove from component info + var componentInfo = this.findComponentInfo(instance); + componentInfo && componentInfo.removeInstance(instance); + + //remove from registry + delete this.allInstances[instance.identity]; + }; + + this.removeComponentInfo = function(componentInfo) { + var index = this.components.indexOf(componentInfo); + (index > -1) && this.components.splice(index, 1); + }; + + this.findComponentInfo = function(which) { + var component = which.attachTo ? which : which.constructor; + + for (var i = 0, c; c = this.components[i]; i++) { + if (c.component === component) { + return c; + } + } + + return null; + }; + + this.findInstanceInfo = function(instance) { + return this.allInstances[instance.identity] || null; + }; + + this.findInstanceInfoByNode = function(node) { + var result = []; + Object.keys(this.allInstances).forEach(function(k) { + var thisInstanceInfo = this.allInstances[k]; + if(thisInstanceInfo.instance.node === node) { + result.push(thisInstanceInfo); + } + }, this); + return result; + }; + + this.on = function(componentOn) { + var instance = registry.findInstanceInfo(this), boundCallback; + + // unpacking arguments by hand benchmarked faster + var l = arguments.length, i = 1; + var otherArgs = new Array(l - 1); + for (; i < l; i++) otherArgs[i - 1] = arguments[i]; + + if (instance) { + boundCallback = componentOn.apply(null, otherArgs); + if (boundCallback) { + otherArgs[otherArgs.length-1] = boundCallback; + } + var event = parseEventArgs(this, otherArgs); + instance.addBind(event); + } + }; + + this.off = function(el, type, callback) { + var event = parseEventArgs(this, arguments), + instance = registry.findInstanceInfo(this); + + if (instance) { + instance.removeBind(event); + } + }; + + //debug tools may want to add advice to trigger + if (window.DEBUG && DEBUG.enabled) { + registry.trigger = new Function; + } + + this.teardown = function() { + registry.removeInstance(this); + }; + + this.withRegistration = function() { + this.before('initialize', function() { + registry.addInstance(this); + }); + + this.around('on', registry.on); + this.after('off', registry.off); + //debug tools may want to add advice to trigger + window.DEBUG && DEBUG.enabled && this.after('trigger', registry.trigger); + this.after('teardown', {obj:registry, fnName:'teardown'}); + }; + + } + + return new Registry; + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/utils.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/utils.js new file mode 100644 index 0000000000..31af777348 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/lib/utils.js @@ -0,0 +1,236 @@ +// ========================================== +// Copyright 2013 Twitter, Inc +// Licensed under The MIT License +// http://opensource.org/licenses/MIT +// ========================================== + +"use strict"; + +define( + + [], + + function () { + + var arry = []; + var DEFAULT_INTERVAL = 100; + + var utils = { + + isDomObj: function(obj) { + return !!(obj.nodeType || (obj === window)); + }, + + toArray: function(obj, from) { + return arry.slice.call(obj, from); + }, + + // returns new object representing multiple objects merged together + // optional final argument is boolean which specifies if merge is recursive + // original objects are unmodified + // + // usage: + // var base = {a:2, b:6}; + // var extra = {b:3, c:4}; + // merge(base, extra); //{a:2, b:3, c:4} + // base; //{a:2, b:6} + // + // var base = {a:2, b:6}; + // var extra = {b:3, c:4}; + // var extraExtra = {a:4, d:9}; + // merge(base, extra, extraExtra); //{a:4, b:3, c:4. d: 9} + // base; //{a:2, b:6} + // + // var base = {a:2, b:{bb:4, cc:5}}; + // var extra = {a:4, b:{cc:7, dd:1}}; + // merge(base, extra, true); //{a:4, b:{bb:4, cc:7, dd:1}} + // base; //{a:2, b:6} + + merge: function(/*obj1, obj2,....deepCopy*/) { + // unpacking arguments by hand benchmarked faster + var l = arguments.length, + i = 0, + args = new Array(l + 1); + for (; i < l; i++) args[i + 1] = arguments[i]; + + if (l === 0) { + return {}; + } + + //start with empty object so a copy is created + args[0] = {}; + + if (args[args.length - 1] === true) { + //jquery extend requires deep copy as first arg + args.pop(); + args.unshift(true); + } + + return $.extend.apply(undefined, args); + }, + + // updates base in place by copying properties of extra to it + // optionally clobber protected + // usage: + // var base = {a:2, b:6}; + // var extra = {c:4}; + // push(base, extra); //{a:2, b:6, c:4} + // base; //{a:2, b:6, c:4} + // + // var base = {a:2, b:6}; + // var extra = {b: 4 c:4}; + // push(base, extra, true); //Error ("utils.push attempted to overwrite 'b' while running in protected mode") + // base; //{a:2, b:6} + // + // objects with the same key will merge recursively when protect is false + // eg: + // var base = {a:16, b:{bb:4, cc:10}}; + // var extra = {b:{cc:25, dd:19}, c:5}; + // push(base, extra); //{a:16, {bb:4, cc:25, dd:19}, c:5} + // + push: function(base, extra, protect) { + if (base) { + Object.keys(extra || {}).forEach(function(key) { + if (base[key] && protect) { + throw Error("utils.push attempted to overwrite '" + key + "' while running in protected mode"); + } + + if (typeof base[key] == "object" && typeof extra[key] == "object") { + //recurse + this.push(base[key], extra[key]); + } else { + //no protect, so extra wins + base[key] = extra[key]; + } + }, this); + } + + return base; + }, + + isEnumerable: function(obj, property) { + return Object.keys(obj).indexOf(property) > -1; + }, + + //build a function from other function(s) + //util.compose(a,b,c) -> a(b(c())); + //implementation lifted from underscore.js (c) 2009-2012 Jeremy Ashkenas + compose: function() { + var funcs = arguments; + + return function() { + var args = arguments; + + for (var i = funcs.length-1; i >= 0; i--) { + args = [funcs[i].apply(this, args)]; + } + + return args[0]; + }; + }, + + // Can only unique arrays of homogeneous primitives, e.g. an array of only strings, an array of only booleans, or an array of only numerics + uniqueArray: function(array) { + var u = {}, a = []; + + for (var i = 0, l = array.length; i < l; ++i) { + if (u.hasOwnProperty(array[i])) { + continue; + } + + a.push(array[i]); + u[array[i]] = 1; + } + + return a; + }, + + debounce: function(func, wait, immediate) { + if (typeof wait != 'number') { + wait = DEFAULT_INTERVAL; + } + + var timeout, result; + + return function() { + var context = this, args = arguments; + var later = function() { + timeout = null; + if (!immediate) { + result = func.apply(context, args); + } + }; + var callNow = immediate && !timeout; + + clearTimeout(timeout); + timeout = setTimeout(later, wait); + + if (callNow) { + result = func.apply(context, args); + } + + return result; + }; + }, + + throttle: function(func, wait) { + if (typeof wait != 'number') { + wait = DEFAULT_INTERVAL; + } + + var context, args, timeout, throttling, more, result; + var whenDone = this.debounce(function(){ + more = throttling = false; + }, wait); + + return function() { + context = this; args = arguments; + var later = function() { + timeout = null; + if (more) { + result = func.apply(context, args); + } + whenDone(); + }; + + if (!timeout) { + timeout = setTimeout(later, wait); + } + + if (throttling) { + more = true; + } else { + throttling = true; + result = func.apply(context, args); + } + + whenDone(); + return result; + }; + }, + + countThen: function(num, base) { + return function() { + if (!--num) { return base.apply(this, arguments); } + }; + }, + + delegate: function(rules) { + return function(e, data) { + var target = $(e.target), parent; + + Object.keys(rules).forEach(function(selector) { + if ((parent = target.closest(selector)).length) { + data = data || {}; + data.el = parent[0]; + return rules[selector].apply(this, [e, data]); + } + }, this); + }; + } + + }; + + return utils; + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/tools/debug/debug.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/tools/debug/debug.js new file mode 100644 index 0000000000..b2e4fdfeff --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/flight/tools/debug/debug.js @@ -0,0 +1,157 @@ +"use strict"; + +define( + + [ + '../../lib/registry', + '../../lib/utils' + ], + + function(registry, utils) { + + var logFilter; + + //****************************************************************************************** + // Search object model + //****************************************************************************************** + + function traverse(util, searchTerm, options) { + var options = options || {}; + var obj = options.obj || window; + var path = options.path || ((obj==window) ? "window" : ""); + var props = Object.keys(obj); + props.forEach(function(prop) { + if ((tests[util] || util)(searchTerm, obj, prop)){ + console.log([path, ".", prop].join(""), "->",["(", typeof obj[prop], ")"].join(""), obj[prop]); + } + if(Object.prototype.toString.call(obj[prop])=="[object Object]" && (obj[prop] != obj) && path.split(".").indexOf(prop) == -1) { + traverse(util, searchTerm, {obj: obj[prop], path: [path,prop].join(".")}); + } + }); + } + + function search(util, expected, searchTerm, options) { + if (!expected || typeof searchTerm == expected) { + traverse(util, searchTerm, options); + } else { + console.error([searchTerm, 'must be', expected].join(' ')) + } + } + + var tests = { + 'name': function(searchTerm, obj, prop) {return searchTerm == prop}, + 'nameContains': function(searchTerm, obj, prop) {return prop.indexOf(searchTerm)>-1}, + 'type': function(searchTerm, obj, prop) {return obj[prop] instanceof searchTerm}, + 'value': function(searchTerm, obj, prop) {return obj[prop] === searchTerm}, + 'valueCoerced': function(searchTerm, obj, prop) {return obj[prop] == searchTerm} + } + + function byName(searchTerm, options) {search('name', 'string', searchTerm, options);}; + function byNameContains(searchTerm, options) {search('nameContains', 'string', searchTerm, options);}; + function byType(searchTerm, options) {search('type', 'function', searchTerm, options);}; + function byValue(searchTerm, options) {search('value', null, searchTerm, options);}; + function byValueCoerced(searchTerm, options) {search('valueCoerced', null, searchTerm, options);}; + function custom(fn, options) {traverse(fn, null, options);}; + + //****************************************************************************************** + // Event logging + //****************************************************************************************** + + var ALL = 'all'; //no filter + + //no logging by default + var defaultEventNamesFilter = []; + var defaultActionsFilter = []; + + var logFilter = retrieveLogFilter(); + + function filterEventLogsByAction(/*actions*/) { + var actions = [].slice.call(arguments); + + logFilter.eventNames.length || (logFilter.eventNames = ALL); + logFilter.actions = actions.length ? actions : ALL; + saveLogFilter(); + } + + function filterEventLogsByName(/*eventNames*/) { + var eventNames = [].slice.call(arguments); + + logFilter.actions.length || (logFilter.actions = ALL); + logFilter.eventNames = eventNames.length ? eventNames : ALL; + saveLogFilter(); + } + + function hideAllEventLogs() { + logFilter.actions = []; + logFilter.eventNames = []; + saveLogFilter(); + } + + function showAllEventLogs() { + logFilter.actions = ALL; + logFilter.eventNames = ALL; + saveLogFilter(); + } + + function saveLogFilter() { + if (window.localStorage) { + localStorage.setItem('logFilter_eventNames', logFilter.eventNames); + localStorage.setItem('logFilter_actions', logFilter.actions); + } + } + + function retrieveLogFilter() { + var result = { + eventNames: (window.localStorage && localStorage.getItem('logFilter_eventNames')) || defaultEventNamesFilter, + actions: (window.localStorage && localStorage.getItem('logFilter_actions')) || defaultActionsFilter + }; + //reconstitute arrays + Object.keys(result).forEach(function(k) { + var thisProp = result[k]; + if (typeof thisProp == 'string' && thisProp !== ALL) { + result[k] = thisProp.split(','); + } + }); + return result; + } + + return { + + enable: function(enable) { + this.enabled = !!enable; + + if (enable && window.console) { + console.info('Booting in DEBUG mode'); + console.info('You can configure event logging with DEBUG.events.logAll()/logNone()/logByName()/logByAction()'); + } + + window.DEBUG = this; + }, + + find: { + byName: byName, + byNameContains: byNameContains, + byType: byType, + byValue: byValue, + byValueCoerced: byValueCoerced, + custom: custom + }, + + events: { + logFilter: logFilter, + + // Accepts any number of action args + // e.g. DEBUG.events.logByAction("on", "off") + logByAction: filterEventLogsByAction, + + // Accepts any number of event name args (inc. regex or wildcards) + // e.g. DEBUG.events.logByName(/ui.*/, "*Thread*"); + logByName: filterEventLogsByName, + + logAll: showAllEventLogs, + logNone: hideAllEventLogs + } + }; + } +); + diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/LICENSE.md b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/LICENSE.md new file mode 100644 index 0000000000..57ccdff5f7 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/LICENSE.md @@ -0,0 +1,19 @@ +Copyright (c) 2013 Twitter, Inc and others + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/README.md b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/README.md new file mode 100644 index 0000000000..aa8b0f84c8 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/README.md @@ -0,0 +1,145 @@ +# jasmine-flight [![Build Status](https://travis-ci.org/flightjs/jasmine-flight.png?branch=master)](http://travis-ci.org/flightjs/jasmine-flight) + +Extensions to the Jasmine test framework for use with [Flight](https://github.com/flightjs/flight) + +# Getting started + +Include [jasmine-flight.js](https://raw.github.com/flightjs/jasmine-flight/master/lib/jasmine-flight.js) +in your app and load it in your test runner. + +Or install it with [Bower](http://bower.io/): + +```bash +bower install --save-dev jasmine-flight +``` + +**N.B.** jasmine-flight depends on +[jasmine](https://github.com/pivotal/jasmine) and +[jasmine-jquery](https://github.com/velesin/jasmine-jquery) + +## Components + +```javascript +describeComponent('path/to/component', function () { + beforeEach(function () { + setupComponent(); + }); + + it('should do x', function () { + // a component instance is now accessible as this.component + // the component root node is attached to the DOM + // the component root node is also available as this.$node + }); +}); +``` + +## Mixins + +```javascript +describeMixin('path/to/mixin', function () { + // initialize the component and attach it to the DOM + beforeEach(function () { + setupComponent(); + }); + + it('should do x', function () { + expect(this.component.doSomething()).toBe(expected); + }); +}); +``` + +## Event spy + +```javascript +describeComponent('data/twitter_profile', function () { + beforeEach(function () { + setupComponent(); + }); + + describe('listens for uiNeedsTwitterUserId', function () { + // was the event triggered? + it('and triggers dataTwitterUserId', function () { + var eventSpy = spyOnEvent(document, 'dataTwitterProfile'); + $(document).trigger('uiNeedsTwitterUserId', { + screen_name: 'tbrd' + }); + expect(eventSpy).toHaveBeenTriggeredOn(document); + }); + + // is the user id correct? + it('and has correct id', function () { + var eventSpy = spyOnEvent(document, 'dataTwitterUserId'); + $(document).trigger('uiNeedsTwitteruserId', { + screen_name: 'tbrd' + }); + expect(eventSpy.mostRecentCall.data).toEqual({ + screen_name: 'tbrd', + id: 4149861 + }); + }); + }); +}); +``` + +## setupComponent + +```javascript +setupComponent(optionalFixture, optionalOptions); +``` + +Calling `setupComponent` twice will create an instance, tear it down and create a new one. + +### HTML Fixtures + +```javascript +describeComponent('ui/twitter_profile', function () { + // is the component attached to the fixture? + it('this.component.$node has class "foo"', function () { + setupComponent('Test'); + expect(this.component.$node).toHaveClass('foo'); + }); +}); +``` + +### Component Options + +```javascript +describeComponent('data/twitter_profile', function () { + // is the option set correctly? + it('this.component.attr.baseUrl is set', function () { + setupComponent({ + baseUrl: 'http://twitter.com/1.1/' + }); + expect(this.component.attr.baseUrl).toBe('http://twitter.com/1.1/'); + }); +}); +``` + +# Teardown + +Components are automatically torn down after each test. + +## Contributing to this project + +Anyone and everyone is welcome to contribute. Please take a moment to +review the [guidelines for contributing](CONTRIBUTING.md). + +* [Bug reports](CONTRIBUTING.md#bugs) +* [Feature requests](CONTRIBUTING.md#features) +* [Pull requests](CONTRIBUTING.md#pull-requests) + +## Authors + +* [@tbrd](http://github.com/tbrd) + +## Thanks + +* [@esbie](http://github.com/esbie) and + [@skilldrick](http://github.com/skilldrick) for creating the original + `describeComponent` & `describeMixin` methods. + +## License + +Copyright 2013 Twitter, Inc and other contributors. + +Licensed under the MIT License diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/bower.json b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/bower.json new file mode 100644 index 0000000000..dd5f09f08e --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/bower.json @@ -0,0 +1,30 @@ +{ + "name": "jasmine-flight", + "version": "1.1.0", + "description": "Extensions to the Jasmine test framework for use with Flight", + "main": "lib/jasmine-flight.js", + "keywords": [ + "flight", + "jasmine", + "test" + ], + "ignore": [ + ".*", + "test", + "package.json", + "karma.conf.js", + "CONTRIBUTING.md", + "CHANGELOG.md" + ], + "devDependencies": { + "flight": "~1.0.9" + }, + "gitHead": "5174302b9a87ebdda99de6a436ec2a64200fc5ff", + "readme": "# jasmine-flight [![Build Status](https://travis-ci.org/flightjs/jasmine-flight.png?branch=master)](http://travis-ci.org/flightjs/jasmine-flight)\n\nExtensions to the Jasmine test framework for use with [Flight](https://github.com/flightjs/flight)\n\n# Getting started\n\nInclude [jasmine-flight.js](https://raw.github.com/flightjs/jasmine-flight/master/lib/jasmine-flight.js)\nin your app and load it in your test runner.\n\nOr install it with [Bower](http://bower.io/):\n\n```bash\nbower install --save-dev jasmine-flight\n```\n\n**N.B.** jasmine-flight depends on\n[jasmine](https://github.com/pivotal/jasmine) and\n[jasmine-jquery](https://github.com/velesin/jasmine-jquery)\n\n## Components\n\n```javascript\ndescribeComponent('path/to/component', function () {\n beforeEach(function () {\n setupComponent();\n });\n\n it('should do x', function () {\n // a component instance is now accessible as this.component\n // the component root node is attached to the DOM\n // the component root node is also available as this.$node\n });\n});\n```\n\n## Mixins\n\n```javascript\ndescribeMixin('path/to/mixin', function () {\n // initialize the component and attach it to the DOM\n beforeEach(function () {\n setupComponent();\n });\n\n it('should do x', function () {\n expect(this.component.doSomething()).toBe(expected);\n });\n});\n```\n\n## Event spy\n\n```javascript\ndescribeComponent('data/twitter_profile', function () {\n beforeEach(function () {\n setupComponent();\n });\n\n describe('listens for uiNeedsTwitterUserId', function () {\n // was the event triggered?\n it('and triggers dataTwitterUserId', function () {\n var eventSpy = spyOnEvent(document, 'dataTwitterProfile');\n $(document).trigger('uiNeedsTwitterUserId', {\n screen_name: 'tbrd'\n });\n expect(eventSpy).toHaveBeenTriggeredOn(document);\n });\n\n // is the user id correct?\n it('and has correct id', function () {\n var eventSpy = spyOnEvent(document, 'dataTwitterUserId');\n $(document).trigger('uiNeedsTwitteruserId', {\n screen_name: 'tbrd'\n });\n expect(eventSpy.mostRecentCall.data).toEqual({\n screen_name: 'tbrd',\n id: 4149861\n });\n });\n });\n});\n```\n\n## setupComponent\n\n```javascript\nsetupComponent(optionalFixture, optionalOptions);\n```\n\nCalling `setupComponent` twice will create an instance, tear it down and create a new one.\n\n### HTML Fixtures\n\n```javascript\ndescribeComponent('ui/twitter_profile', function () {\n // is the component attached to the fixture?\n it('this.component.$node has class \"foo\"', function () {\n setupComponent('Test');\n expect(this.component.$node).toHaveClass('foo');\n });\n});\n```\n\n### Component Options\n\n```javascript\ndescribeComponent('data/twitter_profile', function () {\n // is the option set correctly?\n it('this.component.attr.baseUrl is set', function () {\n setupComponent({\n baseUrl: 'http://twitter.com/1.1/'\n });\n expect(this.component.attr.baseUrl).toBe('http://twitter.com/1.1/');\n });\n});\n```\n\n# Teardown\n\nComponents are automatically torn down after each test.\n\n## Contributing to this project\n\nAnyone and everyone is welcome to contribute. Please take a moment to\nreview the [guidelines for contributing](CONTRIBUTING.md).\n\n* [Bug reports](CONTRIBUTING.md#bugs)\n* [Feature requests](CONTRIBUTING.md#features)\n* [Pull requests](CONTRIBUTING.md#pull-requests)\n\n## Authors\n\n* [@tbrd](http://github.com/tbrd)\n\n## Thanks\n\n* [@esbie](http://github.com/esbie) and\n [@skilldrick](http://github.com/skilldrick) for creating the original\n `describeComponent` & `describeMixin` methods.\n\n## License\n\nCopyright 2013 Twitter, Inc and other contributors.\n\nLicensed under the MIT License\n", + "readmeFilename": "README.md", + "_id": "jasmine-flight@1.1.0", + "repository": { + "type": "git", + "url": "git://github.com/flightjs/jasmine-flight.git" + } +} \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/lib/jasmine-flight.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/lib/jasmine-flight.js new file mode 100644 index 0000000000..8ec76b4e1d --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-flight/lib/jasmine-flight.js @@ -0,0 +1,444 @@ +/** + * Copyright 2013, Twitter Inc. and other contributors + * Licensed under the MIT License + */ + +(function (root) { + 'use strict'; + + jasmine.flight = {}; + + /** + * Wrapper for describe. Load component before each test. + * + * @param componentPath + * @param specDefinitions + */ + + root.describeComponent = function (componentPath, specDefinitions) { + jasmine.getEnv().describeComponent(componentPath, specDefinitions); + }; + + jasmine.Env.prototype.describeComponent = function (componentPath, specDefinitions) { + describe(componentPath, function () { + beforeEach(function () { + this.Component = this.component = this.$node = null; + + var requireCallback = function (registry, Component) { + registry.reset(); + this.Component = Component; + }.bind(this); + + require(['flight/lib/registry', componentPath], requireCallback); + + waitsFor(function () { + return this.Component !== null; + }.bind(this)); + }); + + afterEach(function () { + if (this.$node) { + this.$node.remove(); + this.$node = null; + } + + var requireCallback = function (defineComponent) { + if (this.component) { + this.component = null; + } + + this.Component = null; + defineComponent.teardownAll(); + }.bind(this); + + require(['flight/lib/component'], requireCallback); + + waitsFor(function () { + return this.Component === null; + }.bind(this)); + }); + + specDefinitions.apply(this); + }); + }; + + /** + * Wrapper for describe. Load mixin before each test. + * + * @param mixinPath + * @param specDefinitions + */ + + root.describeMixin = function (mixinPath, specDefinitions) { + jasmine.getEnv().describeMixin(mixinPath, specDefinitions); + }; + + jasmine.Env.prototype.describeMixin = function (mixinPath, specDefinitions) { + describe(mixinPath, function () { + beforeEach(function () { + this.Component = this.component = this.$node = null; + + var requireCallback = function (registry, defineComponent, Mixin) { + registry.reset(); + this.Component = defineComponent(function () {}, Mixin); + }.bind(this); + + require(['flight/lib/registry', 'flight/lib/component', mixinPath], requireCallback); + + waitsFor(function () { + return this.Component !== null; + }); + }); + + afterEach(function () { + if (this.$node) { + this.$node.remove(); + this.$node = null; + } + + var requireCallback = function (defineComponent) { + if (this.component) { + this.component = null; + } + + this.Component = null; + defineComponent.teardownAll(); + }.bind(this); + + require(['flight/lib/component'], requireCallback); + + waitsFor(function () { + return this.Component === null; + }.bind(this)); + }); + + specDefinitions.apply(this); + }); + }; + + /** + * Wrapper for describe. Load module before each test. + * + * @param modulePath + * @param specDefinitions + */ + + root.describeModule = function (modulePath, specDefinitions) { + return jasmine.getEnv().describeModule(modulePath, specDefinitions); + }; + + jasmine.Env.prototype.describeModule = function (modulePath, specDefinitions) { + describe(modulePath, function () { + beforeEach(function () { + this.module = null; + + var requireCallback = function (module) { + this.module = module; + }.bind(this); + + require([modulePath], requireCallback); + + waitsFor(function () { + return this.module !== null; + }); + }); + + specDefinitions.apply(this); + }); + }; + + /** + * Create root node and initialize component. Fixture should be html string + * or jQuery object. + * + * @param fixture {String} (Optional) + * @param options {Options} (Optional) + */ + + root.setupComponent = function (fixture, options) { + jasmine.getEnv().currentSpec.setupComponent(fixture, options); + }; + + jasmine.Spec.prototype.setupComponent = function (fixture, options) { + if (this.component) { + this.component.teardown(); + this.$node.remove(); + } + + this.$node = $('
        '); + $('body').append(this.$node); + + if (fixture instanceof jQuery || typeof fixture === 'string') { + this.$node.append(fixture); + } else { + options = fixture; + fixture = null; + } + + options = options === undefined ? {} : options; + + this.component = new this.Component(this.$node, options); + }; + + + (function (namespace) { + var eventsData = { + spiedEvents: {}, + handlers: [] + }; + + namespace.formatElement = function ($element) { + var limit = 200; + var output = ''; + + if ($element instanceof jQuery) { + output = jasmine.JQuery.elementToString($element); + if (output.length > limit) { + output = output.slice(0, 200) + '...'; + } + } else { + //$element should always be a jQuery object + output = 'element is not a jQuery object'; + } + + return output; + }; + + namespace.compareColors = function (color1, color2) { + if (color1.charAt(0) === color2.charAt(0)) { + return color1 === color2; + } else { + return namespace.hex2rgb(color1) === namespace.hex2rgb(color2); + } + }; + + namespace.hex2rgb = function (colorString) { + if (colorString.charAt(0) !== '#') return colorString; + // note: hexStr should be #rrggbb + var hex = parseInt(colorString.substring(1), 16); + var r = (hex & 0xff0000) >> 16; + var g = (hex & 0x00ff00) >> 8; + var b = hex & 0x0000ff; + return 'rgb(' + r + ', ' + g + ', ' + b + ')'; + }; + + namespace.events = { + spyOn: function (selector, eventName) { + eventsData.spiedEvents[[selector, eventName]] = { + callCount: 0, + calls: [], + mostRecentCall: {}, + name: eventName + }; + + var handler = function (e, data) { + var call = { + event: e, + args: jasmine.util.argsToArray(arguments), + data: data + }; + eventsData.spiedEvents[[selector, eventName]].callCount++; + eventsData.spiedEvents[[selector, eventName]].calls.push(call); + eventsData.spiedEvents[[selector, eventName]].mostRecentCall = call; + }; + + jQuery(selector).on(eventName, handler); + eventsData.handlers.push(handler); + return eventsData.spiedEvents[[selector, eventName]]; + }, + + eventArgs: function (selector, eventName, expectedArg) { + var actualArgs = eventsData.spiedEvents[[selector, eventName]].mostRecentCall.args; + + if (!actualArgs) { + throw 'No event spy found on ' + eventName + '. Try adding a call to spyOnEvent or make sure that the selector the event is triggered on and the selector being spied on are correct.'; + } + + // remove extra event metadata if it is not tested for + if ((actualArgs.length === 2) && typeof actualArgs[1] === 'object' && + expectedArg && !expectedArg.scribeContext && !expectedArg.sourceEventData && !expectedArg.scribeData) { + actualArgs[1] = $.extend({}, actualArgs[1]); + delete actualArgs[1].sourceEventData; + delete actualArgs[1].scribeContext; + delete actualArgs[1].scribeData; + } + + return actualArgs; + }, + + wasTriggered: function (selector, event) { + var spiedEvent = eventsData.spiedEvents[[selector, event]]; + return spiedEvent && spiedEvent.callCount > 0; + }, + + wasTriggeredWith: function (selector, eventName, expectedArg, env) { + var actualArgs = jasmine.flight.events.eventArgs(selector, eventName, expectedArg); + return actualArgs && env.contains_(actualArgs, expectedArg); + }, + + wasTriggeredWithData: function (selector, eventName, expectedArg, env) { + var actualArgs = jasmine.flight.events.eventArgs(selector, eventName, expectedArg); + var valid; + + if (actualArgs) { + valid = false; + for (var i = 0; i < actualArgs.length; i++) { + if (jasmine.flight.validateHash(expectedArg, actualArgs[i])) { + return true; + } + } + return valid; + } + + return false; + }, + + cleanUp: function () { + eventsData.spiedEvents = {}; + eventsData.handlers = []; + } + }; + + namespace.validateHash = function (a, b, intersection) { + var validHash; + for (var field in a) { + if ((typeof a[field] === 'object') && (typeof b[field] === 'object')) { + validHash = jasmine.flight.validateHash(a[field], b[field]); + } else if (intersection && (typeof a[field] === 'undefined' || typeof b[field] === 'undefined')) { + validHash = true; + } else { + validHash = (a[field] === b[field]); + } + if (!validHash) { + break; + } + } + return validHash; + }; + })(jasmine.flight); + + beforeEach(function () { + this.addMatchers({ + toHaveBeenTriggeredOn: function () { + var selector = arguments[0]; + var eventName = typeof this.actual === 'string' ? this.actual : this.actual.name; + var wasTriggered = jasmine.flight.events.wasTriggered(selector, eventName); + + this.message = function () { + var $pp = function (obj) { + var description; + var attr; + + if (!(obj instanceof jQuery)) { + obj = $(obj); + } + + description = [ + obj.get(0).nodeName + ]; + + attr = obj.get(0).attributes || []; + + for (var x = 0; x < attr.length; x++) { + description.push(attr[x].name + '="' + attr[x].value + '"'); + } + + return '<' + description.join(' ') + '>'; + }; + + if (wasTriggered) { + return [ + '
        Expected event ' + eventName + ' to have been triggered on' + selector, + '
        Expected event ' + eventName + ' not to have been triggered on' + selector + ]; + } else { + return [ + 'Expected event ' + eventName + ' to have been triggered on ' + $pp(selector), + 'Expected event ' + eventName + ' not to have been triggered on ' + $pp(selector) + ]; + } + }; + + return wasTriggered; + }, + + toHaveBeenTriggeredOnAndWith: function () { + var selector = arguments[0]; + var expectedArg = arguments[1]; + var exactMatch = !arguments[2]; + var wasTriggered = jasmine.flight.events.wasTriggered(selector, this.actual); + + this.message = function () { + var $pp = function (obj) { + var description; + var attr; + + if (!(obj instanceof jQuery)) { + obj = $(obj); + } + + description = [ + obj.get(0).nodeName + ]; + + attr = obj.get(0).attributes || []; + + for (var x = 0; x < attr.length; x++) { + description.push(attr[x].name + '="' + attr[x].value + '"'); + } + + return '<' + description.join(' ') + '>'; + }; + + if (wasTriggered) { + var actualArg = jasmine.flight.events.eventArgs(selector, this.actual, expectedArg)[1]; + return [ + '
        Expected event ' + this.actual.name + ' to have been triggered on' + selector, + '
        Expected event ' + this.actual.name + ' not to have been triggered on' + selector + ]; + } else { + return [ + 'Expected event ' + this.actual.name + ' to have been triggered on ' + $pp(selector), + 'Expected event ' + this.actual.name + ' not to have been triggered on ' + $pp(selector) + ]; + } + }; + + if (!wasTriggered) { + return false; + } + + if (exactMatch) { + return jasmine.flight.events.wasTriggeredWith(selector, this.actual, expectedArg, this.env); + } else { + return jasmine.flight.events.wasTriggeredWithData(selector, this.actual, expectedArg, this.env); + } + }, + + toHaveCss: function (prop, val) { + var result; + if (val instanceof RegExp) { + result = val.test(this.actual.css(prop)); + } else if (prop.match(/color/)) { + //IE returns colors as hex strings; other browsers return rgb(r, g, b) strings + result = jasmine.flight.compareColors(this.actual.css(prop), val); + } else { + result = this.actual.css(prop) === val; + //sometimes .css() returns strings when it should return numbers + if (!result && typeof val === 'number') { + result = parseFloat(this.actual.css(prop), 10) === val; + } + } + + this.actual = jasmine.flight.formatElement(this.actual); + return result; + } + }); + }); + + root.spyOnEvent = function (selector, eventName) { + jasmine.JQuery.events.spyOn(selector, eventName); + return jasmine.flight.events.spyOn(selector, eventName); + }; + +}(this)); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-jquery/lib/jasmine-jquery.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-jquery/lib/jasmine-jquery.js new file mode 100644 index 0000000000..3a5a028945 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jasmine-jquery/lib/jasmine-jquery.js @@ -0,0 +1,659 @@ +/*! + Jasmine-jQuery: a set of jQuery helpers for Jasmine tests. + + Version 1.5.2 + + https://github.com/velesin/jasmine-jquery + + Copyright (c) 2010-2013 Wojciech Zawistowski, Travis Jeffery + + Permission is hereby granted, free of charge, to any person obtaining + a copy of this software and associated documentation files (the + "Software"), to deal in the Software without restriction, including + without limitation the rights to use, copy, modify, merge, publish, + distribute, sublicense, and/or sell copies of the Software, and to + permit persons to whom the Software is furnished to do so, subject to + the following conditions: + + The above copyright notice and this permission notice shall be + included in all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND + NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE + LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION + OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION + WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. +*/ +var readFixtures = function() { + return jasmine.getFixtures().proxyCallTo_('read', arguments) +} + +var preloadFixtures = function() { + jasmine.getFixtures().proxyCallTo_('preload', arguments) +} + +var loadFixtures = function() { + jasmine.getFixtures().proxyCallTo_('load', arguments) +} + +var appendLoadFixtures = function() { + jasmine.getFixtures().proxyCallTo_('appendLoad', arguments) +} + +var setFixtures = function(html) { + jasmine.getFixtures().proxyCallTo_('set', arguments) +} + +var appendSetFixtures = function() { + jasmine.getFixtures().proxyCallTo_('appendSet', arguments) +} + +var sandbox = function(attributes) { + return jasmine.getFixtures().sandbox(attributes) +} + +var spyOnEvent = function(selector, eventName) { + return jasmine.JQuery.events.spyOn(selector, eventName) +} + +var preloadStyleFixtures = function() { + jasmine.getStyleFixtures().proxyCallTo_('preload', arguments) +} + +var loadStyleFixtures = function() { + jasmine.getStyleFixtures().proxyCallTo_('load', arguments) +} + +var appendLoadStyleFixtures = function() { + jasmine.getStyleFixtures().proxyCallTo_('appendLoad', arguments) +} + +var setStyleFixtures = function(html) { + jasmine.getStyleFixtures().proxyCallTo_('set', arguments) +} + +var appendSetStyleFixtures = function(html) { + jasmine.getStyleFixtures().proxyCallTo_('appendSet', arguments) +} + +var loadJSONFixtures = function() { + return jasmine.getJSONFixtures().proxyCallTo_('load', arguments) +} + +var getJSONFixture = function(url) { + return jasmine.getJSONFixtures().proxyCallTo_('read', arguments)[url] +} + +jasmine.spiedEventsKey = function (selector, eventName) { + return [$(selector).selector, eventName].toString() +} + +jasmine.getFixtures = function() { + return jasmine.currentFixtures_ = jasmine.currentFixtures_ || new jasmine.Fixtures() +} + +jasmine.getStyleFixtures = function() { + return jasmine.currentStyleFixtures_ = jasmine.currentStyleFixtures_ || new jasmine.StyleFixtures() +} + +jasmine.Fixtures = function() { + this.containerId = 'jasmine-fixtures' + this.fixturesCache_ = {} + this.fixturesPath = 'spec/javascripts/fixtures' +} + +jasmine.Fixtures.prototype.set = function(html) { + this.cleanUp() + this.createContainer_(html) +} + +jasmine.Fixtures.prototype.appendSet= function(html) { + this.addToContainer_(html) +} + +jasmine.Fixtures.prototype.preload = function() { + this.read.apply(this, arguments) +} + +jasmine.Fixtures.prototype.load = function() { + this.cleanUp() + this.createContainer_(this.read.apply(this, arguments)) +} + +jasmine.Fixtures.prototype.appendLoad = function() { + this.addToContainer_(this.read.apply(this, arguments)) +} + +jasmine.Fixtures.prototype.read = function() { + var htmlChunks = [] + + var fixtureUrls = arguments + for(var urlCount = fixtureUrls.length, urlIndex = 0; urlIndex < urlCount; urlIndex++) { + htmlChunks.push(this.getFixtureHtml_(fixtureUrls[urlIndex])) + } + + return htmlChunks.join('') +} + +jasmine.Fixtures.prototype.clearCache = function() { + this.fixturesCache_ = {} +} + +jasmine.Fixtures.prototype.cleanUp = function() { + $('#' + this.containerId).remove() +} + +jasmine.Fixtures.prototype.sandbox = function(attributes) { + var attributesToSet = attributes || {} + return $('
        ').attr(attributesToSet) +} + +jasmine.Fixtures.prototype.createContainer_ = function(html) { + var container + if(html instanceof $) { + container = $('
        ') + container.html(html) + } else { + container = '
        ' + html + '
        ' + } + $(document.body).append(container) +} + +jasmine.Fixtures.prototype.addToContainer_ = function(html){ + var container = $(document.body).find('#'+this.containerId).append(html) + if(!container.length){ + this.createContainer_(html) + } +} + +jasmine.Fixtures.prototype.getFixtureHtml_ = function(url) { + if (typeof this.fixturesCache_[url] === 'undefined') { + this.loadFixtureIntoCache_(url) + } + return this.fixturesCache_[url] +} + +jasmine.Fixtures.prototype.loadFixtureIntoCache_ = function(relativeUrl) { + var url = this.makeFixtureUrl_(relativeUrl) + var request = $.ajax({ + type: "GET", + url: url + "?" + new Date().getTime(), + async: false + }) + this.fixturesCache_[relativeUrl] = request.responseText +} + +jasmine.Fixtures.prototype.makeFixtureUrl_ = function(relativeUrl){ + return this.fixturesPath.match('/$') ? this.fixturesPath + relativeUrl : this.fixturesPath + '/' + relativeUrl +} + +jasmine.Fixtures.prototype.proxyCallTo_ = function(methodName, passedArguments) { + return this[methodName].apply(this, passedArguments) +} + + +jasmine.StyleFixtures = function() { + this.fixturesCache_ = {} + this.fixturesNodes_ = [] + this.fixturesPath = 'spec/javascripts/fixtures' +} + +jasmine.StyleFixtures.prototype.set = function(css) { + this.cleanUp() + this.createStyle_(css) +} + +jasmine.StyleFixtures.prototype.appendSet = function(css) { + this.createStyle_(css) +} + +jasmine.StyleFixtures.prototype.preload = function() { + this.read_.apply(this, arguments) +} + +jasmine.StyleFixtures.prototype.load = function() { + this.cleanUp() + this.createStyle_(this.read_.apply(this, arguments)) +} + +jasmine.StyleFixtures.prototype.appendLoad = function() { + this.createStyle_(this.read_.apply(this, arguments)) +} + +jasmine.StyleFixtures.prototype.cleanUp = function() { + while(this.fixturesNodes_.length) { + this.fixturesNodes_.pop().remove() + } +} + +jasmine.StyleFixtures.prototype.createStyle_ = function(html) { + var styleText = $('
        ').html(html).text(), + style = $('') + + this.fixturesNodes_.push(style) + + $('head').append(style) +} + +jasmine.StyleFixtures.prototype.clearCache = jasmine.Fixtures.prototype.clearCache + +jasmine.StyleFixtures.prototype.read_ = jasmine.Fixtures.prototype.read + +jasmine.StyleFixtures.prototype.getFixtureHtml_ = jasmine.Fixtures.prototype.getFixtureHtml_ + +jasmine.StyleFixtures.prototype.loadFixtureIntoCache_ = jasmine.Fixtures.prototype.loadFixtureIntoCache_ + +jasmine.StyleFixtures.prototype.makeFixtureUrl_ = jasmine.Fixtures.prototype.makeFixtureUrl_ + +jasmine.StyleFixtures.prototype.proxyCallTo_ = jasmine.Fixtures.prototype.proxyCallTo_ + +jasmine.getJSONFixtures = function() { + return jasmine.currentJSONFixtures_ = jasmine.currentJSONFixtures_ || new jasmine.JSONFixtures() +} + +jasmine.JSONFixtures = function() { + this.fixturesCache_ = {} + this.fixturesPath = 'spec/javascripts/fixtures/json' +} + +jasmine.JSONFixtures.prototype.load = function() { + this.read.apply(this, arguments) + return this.fixturesCache_ +} + +jasmine.JSONFixtures.prototype.read = function() { + var fixtureUrls = arguments + for(var urlCount = fixtureUrls.length, urlIndex = 0; urlIndex < urlCount; urlIndex++) { + this.getFixtureData_(fixtureUrls[urlIndex]) + } + return this.fixturesCache_ +} + +jasmine.JSONFixtures.prototype.clearCache = function() { + this.fixturesCache_ = {} +} + +jasmine.JSONFixtures.prototype.getFixtureData_ = function(url) { + this.loadFixtureIntoCache_(url) + return this.fixturesCache_[url] +} + +jasmine.JSONFixtures.prototype.loadFixtureIntoCache_ = function(relativeUrl) { + var self = this + var url = this.fixturesPath.match('/$') ? this.fixturesPath + relativeUrl : this.fixturesPath + '/' + relativeUrl + $.ajax({ + async: false, // must be synchronous to guarantee that no tests are run before fixture is loaded + cache: false, + dataType: 'json', + url: url, + success: function(data) { + self.fixturesCache_[relativeUrl] = data + }, + error: function(jqXHR, status, errorThrown) { + throw Error('JSONFixture could not be loaded: ' + url + ' (status: ' + status + ', message: ' + errorThrown.message + ')') + } + }) +} + +jasmine.JSONFixtures.prototype.proxyCallTo_ = function(methodName, passedArguments) { + return this[methodName].apply(this, passedArguments) +} + +jasmine.JQuery = function() {} + +jasmine.JQuery.browserTagCaseIndependentHtml = function(html) { + return $('
        ').append(html).html() +} + +jasmine.JQuery.elementToString = function(element) { + var domEl = $(element).get(0) + if (domEl == undefined || domEl.cloneNode) + return $('
        ').append($(element).clone()).html() + else + return element.toString() +} + +jasmine.JQuery.matchersClass = {} + +!function(namespace) { + var data = { + spiedEvents: {}, + handlers: [] + } + + namespace.events = { + spyOn: function(selector, eventName) { + var handler = function(e) { + data.spiedEvents[jasmine.spiedEventsKey(selector, eventName)] = jasmine.util.argsToArray(arguments) + } + $(selector).on(eventName, handler) + data.handlers.push(handler) + return { + selector: selector, + eventName: eventName, + handler: handler, + reset: function(){ + delete data.spiedEvents[jasmine.spiedEventsKey(selector, eventName)] + } + } + }, + + args: function(selector, eventName) { + var actualArgs = data.spiedEvents[jasmine.spiedEventsKey(selector, eventName)]; + + if (!actualArgs) { + throw "There is no spy for " + eventName + " on " + selector.toString() + ". Make sure to create a spy using spyOnEvent."; + } + + return actualArgs; + }, + + wasTriggered: function(selector, eventName) { + return !!(data.spiedEvents[jasmine.spiedEventsKey(selector, eventName)]) + }, + + wasTriggeredWith: function(selector, eventName, expectedArgs, env) { + var actualArgs = jasmine.JQuery.events.args(selector, eventName).slice(1); + if (Object.prototype.toString.call(expectedArgs) !== '[object Array]') { + actualArgs = actualArgs[0]; + } + return env.equals_(expectedArgs, actualArgs); + }, + + wasPrevented: function(selector, eventName) { + var args = data.spiedEvents[jasmine.spiedEventsKey(selector, eventName)], + e = args ? args[0] : undefined; + return e && e.isDefaultPrevented() + }, + + wasStopped: function(selector, eventName) { + var args = data.spiedEvents[jasmine.spiedEventsKey(selector, eventName)], + e = args ? args[0] : undefined; + return e && e.isPropagationStopped() + }, + + cleanUp: function() { + data.spiedEvents = {} + data.handlers = [] + } + } +}(jasmine.JQuery) + +!function(){ + var jQueryMatchers = { + toHaveClass: function(className) { + return this.actual.hasClass(className) + }, + + toHaveCss: function(css){ + for (var prop in css){ + if (this.actual.css(prop) !== css[prop]) return false + } + return true + }, + + toBeVisible: function() { + return this.actual.is(':visible') + }, + + toBeHidden: function() { + return this.actual.is(':hidden') + }, + + toBeSelected: function() { + return this.actual.is(':selected') + }, + + toBeChecked: function() { + return this.actual.is(':checked') + }, + + toBeEmpty: function() { + return this.actual.is(':empty') + }, + + toExist: function() { + return $(document).find(this.actual).length + }, + + toHaveLength: function(length) { + return this.actual.length === length + }, + + toHaveAttr: function(attributeName, expectedAttributeValue) { + return hasProperty(this.actual.attr(attributeName), expectedAttributeValue) + }, + + toHaveProp: function(propertyName, expectedPropertyValue) { + return hasProperty(this.actual.prop(propertyName), expectedPropertyValue) + }, + + toHaveId: function(id) { + return this.actual.attr('id') == id + }, + + toHaveHtml: function(html) { + return this.actual.html() == jasmine.JQuery.browserTagCaseIndependentHtml(html) + }, + + toContainHtml: function(html){ + var actualHtml = this.actual.html() + var expectedHtml = jasmine.JQuery.browserTagCaseIndependentHtml(html) + return (actualHtml.indexOf(expectedHtml) >= 0) + }, + + toHaveText: function(text) { + var trimmedText = $.trim(this.actual.text()) + if (text && $.isFunction(text.test)) { + return text.test(trimmedText) + } else { + return trimmedText == text + } + }, + + toContainText: function(text) { + var trimmedText = $.trim(this.actual.text()) + if (text && $.isFunction(text.test)) { + return text.test(trimmedText) + } else { + return trimmedText.indexOf(text) != -1; + } + }, + + toHaveValue: function(value) { + return this.actual.val() === value + }, + + toHaveData: function(key, expectedValue) { + return hasProperty(this.actual.data(key), expectedValue) + }, + + toBe: function(selector) { + return this.actual.is(selector) + }, + + toContain: function(selector) { + return this.actual.find(selector).length + }, + + toBeDisabled: function(selector){ + return this.actual.is(':disabled') + }, + + toBeFocused: function(selector) { + return this.actual[0] === this.actual[0].ownerDocument.activeElement + }, + + toHandle: function(event) { + + var events = $._data(this.actual.get(0), "events") + + if(!events || !event || typeof event !== "string") { + return false + } + + var namespaces = event.split(".") + var eventType = namespaces.shift() + var sortedNamespaces = namespaces.slice(0).sort() + var namespaceRegExp = new RegExp("(^|\\.)" + sortedNamespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") + + if(events[eventType] && namespaces.length) { + for(var i = 0; i < events[eventType].length; i++) { + var namespace = events[eventType][i].namespace + if(namespaceRegExp.test(namespace)) { + return true + } + } + } else { + return events[eventType] && events[eventType].length > 0 + } + }, + + // tests the existence of a specific event binding + handler + toHandleWith: function(eventName, eventHandler) { + var stack = $._data(this.actual.get(0), "events")[eventName] + for (var i = 0; i < stack.length; i++) { + if (stack[i].handler == eventHandler) return true + } + return false + } + } + + var hasProperty = function(actualValue, expectedValue) { + if (expectedValue === undefined) return actualValue !== undefined + return actualValue == expectedValue + } + + var bindMatcher = function(methodName) { + var builtInMatcher = jasmine.Matchers.prototype[methodName] + + jasmine.JQuery.matchersClass[methodName] = function() { + if (this.actual + && (this.actual instanceof $ + || jasmine.isDomNode(this.actual))) { + this.actual = $(this.actual) + var result = jQueryMatchers[methodName].apply(this, arguments) + var element + if (this.actual.get && (element = this.actual.get()[0]) && !$.isWindow(element) && element.tagName !== "HTML") + this.actual = jasmine.JQuery.elementToString(this.actual) + return result + } + + if (builtInMatcher) { + return builtInMatcher.apply(this, arguments) + } + + return false + } + } + + for(var methodName in jQueryMatchers) { + bindMatcher(methodName) + } +}() + +beforeEach(function() { + this.addMatchers(jasmine.JQuery.matchersClass) + this.addMatchers({ + toHaveBeenTriggeredOn: function(selector) { + this.message = function() { + return [ + "Expected event " + this.actual + " to have been triggered on " + selector, + "Expected event " + this.actual + " not to have been triggered on " + selector + ] + } + return jasmine.JQuery.events.wasTriggered(selector, this.actual) + } + }) + this.addMatchers({ + toHaveBeenTriggered: function(){ + var eventName = this.actual.eventName, + selector = this.actual.selector + this.message = function() { + return [ + "Expected event " + eventName + " to have been triggered on " + selector, + "Expected event " + eventName + " not to have been triggered on " + selector + ] + } + return jasmine.JQuery.events.wasTriggered(selector, eventName) + } + }) + this.addMatchers({ + toHaveBeenTriggeredOnAndWith: function() { + var selector = arguments[0], + expectedArgs = arguments[1], + wasTriggered = jasmine.JQuery.events.wasTriggered(selector, this.actual); + this.message = function() { + if (wasTriggered) { + var actualArgs = jasmine.JQuery.events.args(selector, this.actual, expectedArgs)[1]; + return [ + "Expected event " + this.actual + " to have been triggered with " + jasmine.pp(expectedArgs) + " but it was triggered with " + jasmine.pp(actualArgs), + "Expected event " + this.actual + " not to have been triggered with " + jasmine.pp(expectedArgs) + " but it was triggered with " + jasmine.pp(actualArgs) + ] + } else { + return [ + "Expected event " + this.actual + " to have been triggered on " + selector, + "Expected event " + this.actual + " not to have been triggered on " + selector + ] + } + } + return wasTriggered && jasmine.JQuery.events.wasTriggeredWith(selector, this.actual, expectedArgs, this.env); + } + }) + this.addMatchers({ + toHaveBeenPreventedOn: function(selector) { + this.message = function() { + return [ + "Expected event " + this.actual + " to have been prevented on " + selector, + "Expected event " + this.actual + " not to have been prevented on " + selector + ] + } + return jasmine.JQuery.events.wasPrevented(selector, this.actual) + } + }) + this.addMatchers({ + toHaveBeenPrevented: function() { + var eventName = this.actual.eventName, + selector = this.actual.selector + this.message = function() { + return [ + "Expected event " + eventName + " to have been prevented on " + selector, + "Expected event " + eventName + " not to have been prevented on " + selector + ] + } + return jasmine.JQuery.events.wasPrevented(selector, eventName) + } + }) + this.addMatchers({ + toHaveBeenStoppedOn: function(selector) { + this.message = function() { + return [ + "Expected event " + this.actual + " to have been stopped on " + selector, + "Expected event " + this.actual + " not to have been stopped on " + selector + ] + } + return jasmine.JQuery.events.wasStopped(selector, this.actual) + } + }) + this.addMatchers({ + toHaveBeenStopped: function() { + var eventName = this.actual.eventName, + selector = this.actual.selector + this.message = function() { + return [ + "Expected event " + eventName + " to have been stopped on " + selector, + "Expected event " + eventName + " not to have been stopped on " + selector + ] + } + return jasmine.JQuery.events.wasStopped(selector, eventName) + } + }) +}) + +afterEach(function() { + jasmine.getFixtures().cleanUp() + jasmine.getStyleFixtures().cleanUp() + jasmine.JQuery.events.cleanUp() +}) diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/component.json b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/component.json new file mode 100644 index 0000000000..0d213f7cd8 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/component.json @@ -0,0 +1,13 @@ +{ + "name": "jquery", + "version": "1.8.3", + "main": "./jquery.js", + "dependencies": {}, + "_id": "jquery@1.8.3", + "readme": "ERROR: No README.md file found!", + "description": "ERROR: No README.md file found!", + "repository": { + "type": "git", + "url": "git://github.com/components/jquery.git" + } +} \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/composer.json b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/composer.json new file mode 100644 index 0000000000..5b46d89fad --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/composer.json @@ -0,0 +1,23 @@ +{ + "name": "components/jquery", + "description": "jQuery JavaScript Library", + "type": "component", + "homepage": "http://jquery.com", + "license": "MIT", + "support": { + "irc": "irc://irc.freenode.org/jquery", + "issues": "http://bugs.jquery.com", + "forum": "http://forum.jquery.com", + "wiki": "http://docs.jquery.com/", + "source": "https://github.com/jquery/jquery" + }, + "authors": [ + { + "name": "John Resig", + "email": "jeresig@gmail.com" + } + ], + "extra": { + "js": "jquery.js" + } +} diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/jquery.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/jquery.js new file mode 100644 index 0000000000..1ddd8ebd6c --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/jquery.js @@ -0,0 +1,9472 @@ +/*! + * jQuery JavaScript Library v1.8.3 + * http://jquery.com/ + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://jquery.org/license + * + * Date: Tue Nov 13 2012 08:20:33 GMT-0500 (Eastern Standard Time) + */ +(function( window, undefined ) { +var + // A central reference to the root jQuery(document) + rootjQuery, + + // The deferred used on DOM ready + readyList, + + // Use the correct document accordingly with window argument (sandbox) + document = window.document, + location = window.location, + navigator = window.navigator, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // Save a reference to some core methods + core_push = Array.prototype.push, + core_slice = Array.prototype.slice, + core_indexOf = Array.prototype.indexOf, + core_toString = Object.prototype.toString, + core_hasOwn = Object.prototype.hasOwnProperty, + core_trim = String.prototype.trim, + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Used for matching numbers + core_pnum = /[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source, + + // Used for detecting and trimming whitespace + core_rnotwhite = /\S/, + core_rspace = /\s+/, + + // Make sure we trim BOM and NBSP (here's looking at you, Safari 5.0 and IE) + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + rquickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g, + rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g, + + // Matches dashed string for camelizing + rmsPrefix = /^-ms-/, + rdashAlpha = /-([\da-z])/gi, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // The ready event handler and self cleanup method + DOMContentLoaded = function() { + if ( document.addEventListener ) { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + } else if ( document.readyState === "complete" ) { + // we're here because readyState === "complete" in oldIE + // which is good enough for us to call the dom ready! + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = ( context && context.nodeType ? context.ownerDocument || context : document ); + + // scripts is true for back-compat + selector = jQuery.parseHTML( match[1], doc, true ); + if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) { + this.attr.call( selector, context, true ); + } + + return jQuery.merge( this, selector ); + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.8.3", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return core_slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Add the callback + jQuery.ready.promise().done( fn ); + + return this; + }, + + eq: function( i ) { + i = +i; + return i === -1 ? + this.slice( i ) : + this.slice( i, i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( core_slice.apply( this, arguments ), + "slice", core_slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: core_push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger("ready").off("ready"); + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + isWindow: function( obj ) { + return obj != null && obj == obj.window; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ core_toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !core_hasOwn.call(obj, "constructor") && + !core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || core_hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + var name; + for ( name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + // data: string of html + // context (optional): If specified, the fragment will be created in this context, defaults to document + // scripts (optional): If true, will include scripts passed in the html string + parseHTML: function( data, context, scripts ) { + var parsed; + if ( !data || typeof data !== "string" ) { + return null; + } + if ( typeof context === "boolean" ) { + scripts = context; + context = 0; + } + context = context || document; + + // Single tag + if ( (parsed = rsingleTag.exec( data )) ) { + return [ context.createElement( parsed[1] ) ]; + } + + parsed = jQuery.buildFragment( [ data ], context, scripts ? null : [] ); + return jQuery.merge( [], + (parsed.cacheable ? jQuery.clone( parsed.fragment ) : parsed.fragment).childNodes ); + }, + + parseJSON: function( data ) { + if ( !data || typeof data !== "string") { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return ( new Function( "return " + data ) )(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + if ( !data || typeof data !== "string" ) { + return null; + } + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && core_rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + }, + + // args is for internal usage only + each: function( obj, callback, args ) { + var name, + i = 0, + length = obj.length, + isObj = length === undefined || jQuery.isFunction( obj ); + + if ( args ) { + if ( isObj ) { + for ( name in obj ) { + if ( callback.apply( obj[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( obj[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in obj ) { + if ( callback.call( obj[ name ], name, obj[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( obj[ i ], i, obj[ i++ ] ) === false ) { + break; + } + } + } + } + + return obj; + }, + + // Use native String.trim function wherever possible + trim: core_trim && !core_trim.call("\uFEFF\xA0") ? + function( text ) { + return text == null ? + "" : + core_trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var type, + ret = results || []; + + if ( arr != null ) { + // The window, strings (and functions) also have 'length' + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + type = jQuery.type( arr ); + + if ( arr.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( arr ) ) { + core_push.call( ret, arr ); + } else { + jQuery.merge( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + var len; + + if ( arr ) { + if ( core_indexOf ) { + return core_indexOf.call( arr, elem, i ); + } + + len = arr.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in arr && arr[ i ] === elem ) { + return i; + } + } + } + + return -1; + }, + + merge: function( first, second ) { + var l = second.length, + i = first.length, + j = 0; + + if ( typeof l === "number" ) { + for ( ; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var retVal, + ret = [], + i = 0, + length = elems.length; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, + ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + var tmp, args, proxy; + + if ( typeof context === "string" ) { + tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + args = core_slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context, args.concat( core_slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || jQuery.guid++; + + return proxy; + }, + + // Multifunctional method to get and set values of a collection + // The value/s can optionally be executed if it's a function + access: function( elems, fn, key, value, chainable, emptyGet, pass ) { + var exec, + bulk = key == null, + i = 0, + length = elems.length; + + // Sets many values + if ( key && typeof key === "object" ) { + for ( i in key ) { + jQuery.access( elems, fn, i, key[i], 1, emptyGet, value ); + } + chainable = 1; + + // Sets one value + } else if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = pass === undefined && jQuery.isFunction( value ); + + if ( bulk ) { + // Bulk operations only iterate when executing function values + if ( exec ) { + exec = fn; + fn = function( elem, key, value ) { + return exec.call( jQuery( elem ), value ); + }; + + // Otherwise they run against the entire set + } else { + fn.call( elems, value ); + fn = null; + } + } + + if ( fn ) { + for (; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + } + + chainable = 1; + } + + return chainable ? + elems : + + // Gets + bulk ? + fn.call( elems ) : + length ? fn( elems[0], key ) : emptyGet; + }, + + now: function() { + return ( new Date() ).getTime(); + } +}); + +jQuery.ready.promise = function( obj ) { + if ( !readyList ) { + + readyList = jQuery.Deferred(); + + // Catch cases where $(document).ready() is called after the browser event has already occurred. + // we once tried to use readyState "interactive" here, but it caused issues like the one + // discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15 + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + setTimeout( jQuery.ready, 1 ); + + // Standards-based browsers support DOMContentLoaded + } else if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else { + // Ensure firing before onload, maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var top = false; + + try { + top = window.frameElement == null && document.documentElement; + } catch(e) {} + + if ( top && top.doScroll ) { + (function doScrollCheck() { + if ( !jQuery.isReady ) { + + try { + // Use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + top.doScroll("left"); + } catch(e) { + return setTimeout( doScrollCheck, 50 ); + } + + // and execute any waiting functions + jQuery.ready(); + } + })(); + } + } + } + return readyList.promise( obj ); +}; + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); +// String to Object options format cache +var optionsCache = {}; + +// Convert String-formatted options into Object-formatted ones and store in cache +function createOptions( options ) { + var object = optionsCache[ options ] = {}; + jQuery.each( options.split( core_rspace ), function( _, flag ) { + object[ flag ] = true; + }); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + ( optionsCache[ options ] || createOptions( options ) ) : + jQuery.extend( {}, options ); + + var // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list was already fired + fired, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = !options.once && [], + // Fire callbacks + fire = function( data ) { + memory = options.memory && data; + fired = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + firing = true; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) { + memory = false; // To prevent further calls using add + break; + } + } + firing = false; + if ( list ) { + if ( stack ) { + if ( stack.length ) { + fire( stack.shift() ); + } + } else if ( memory ) { + list = []; + } else { + self.disable(); + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + // First, we save the current length + var start = list.length; + (function add( args ) { + jQuery.each( args, function( _, arg ) { + var type = jQuery.type( arg ); + if ( type === "function" ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && type !== "string" ) { + // Inspect recursively + add( arg ); + } + }); + })( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away + } else if ( memory ) { + firingStart = start; + fire( memory ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + jQuery.each( arguments, function( _, arg ) { + var index; + while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + // Handle firing indexes + if ( firing ) { + if ( index <= firingLength ) { + firingLength--; + } + if ( index <= firingIndex ) { + firingIndex--; + } + } + } + }); + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + return jQuery.inArray( fn, list ) > -1; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + if ( list && ( !fired || stack ) ) { + if ( firing ) { + stack.push( args ); + } else { + fire( args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; +jQuery.extend({ + + Deferred: function( func ) { + var tuples = [ + // action, add listener, listener list, final state + [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ], + [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ], + [ "notify", "progress", jQuery.Callbacks("memory") ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + then: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + return jQuery.Deferred(function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + var action = tuple[ 0 ], + fn = fns[ i ]; + // deferred[ done | fail | progress ] for forwarding actions to newDefer + deferred[ tuple[1] ]( jQuery.isFunction( fn ) ? + function() { + var returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise() + .done( newDefer.resolve ) + .fail( newDefer.reject ) + .progress( newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + } : + newDefer[ action ] + ); + }); + fns = null; + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Keep pipe for back-compat + promise.pipe = promise.then; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 3 ]; + + // promise[ done | fail | progress ] = list.add + promise[ tuple[1] ] = list.add; + + // Handle state + if ( stateString ) { + list.add(function() { + // state = [ resolved | rejected ] + state = stateString; + + // [ reject_list | resolve_list ].disable; progress_list.lock + }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock ); + } + + // deferred[ resolve | reject | notify ] = list.fire + deferred[ tuple[0] ] = list.fire; + deferred[ tuple[0] + "With" ] = list.fireWith; + }); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( subordinate /* , ..., subordinateN */ ) { + var i = 0, + resolveValues = core_slice.call( arguments ), + length = resolveValues.length, + + // the count of uncompleted subordinates + remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0, + + // the master Deferred. If resolveValues consist of only a single Deferred, just use that. + deferred = remaining === 1 ? subordinate : jQuery.Deferred(), + + // Update function for both resolve and progress values + updateFunc = function( i, contexts, values ) { + return function( value ) { + contexts[ i ] = this; + values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value; + if( values === progressValues ) { + deferred.notifyWith( contexts, values ); + } else if ( !( --remaining ) ) { + deferred.resolveWith( contexts, values ); + } + }; + }, + + progressValues, progressContexts, resolveContexts; + + // add listeners to Deferred subordinates; treat others as resolved + if ( length > 1 ) { + progressValues = new Array( length ); + progressContexts = new Array( length ); + resolveContexts = new Array( length ); + for ( ; i < length; i++ ) { + if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) { + resolveValues[ i ].promise() + .done( updateFunc( i, resolveContexts, resolveValues ) ) + .fail( deferred.reject ) + .progress( updateFunc( i, progressContexts, progressValues ) ); + } else { + --remaining; + } + } + } + + // if we're not waiting on anything, resolve the master + if ( !remaining ) { + deferred.resolveWith( resolveContexts, resolveValues ); + } + + return deferred.promise(); + } +}); +jQuery.support = (function() { + + var support, + all, + a, + select, + opt, + input, + fragment, + eventName, + i, + isSupported, + clickFn, + div = document.createElement("div"); + + // Setup + div.setAttribute( "className", "t" ); + div.innerHTML = "
        a"; + + // Support tests won't run in some limited or non-browser environments + all = div.getElementsByTagName("*"); + a = div.getElementsByTagName("a")[ 0 ]; + if ( !all || !a || !all.length ) { + return {}; + } + + // First batch of tests + select = document.createElement("select"); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName("input")[ 0 ]; + + a.style.cssText = "top:1px;float:left;opacity:.5"; + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute("href") === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.5/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Tests for enctype support on a form (#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav>", + + // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode + boxModel: ( document.compatMode === "CSS1Compat" ), + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true, + boxSizingReliable: true, + pixelPosition: false + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", clickFn = function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent("onclick"); + div.detachEvent( "onclick", clickFn ); + } + + // Check if a radio maintains its value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute( "type", "radio" ); + support.radioValue = input.value === "t"; + + input.setAttribute( "checked", "checked" ); + + // #11217 - WebKit loses check when the name is after the checked attribute + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.lastChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + fragment.removeChild( input ); + fragment.appendChild( div ); + + // Technique from Juriy Zaytsev + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for ( i in { + submit: true, + change: true, + focusin: true + }) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + // Run tests that need a body at doc ready + jQuery(function() { + var container, div, tds, marginDiv, + divReset = "padding:0;margin:0;border:0;display:block;overflow:hidden;", + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + container = document.createElement("div"); + container.style.cssText = "visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px"; + body.insertBefore( container, body.firstChild ); + + // Construct the test element + div = document.createElement("div"); + container.appendChild( div ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + div.innerHTML = "
        t
        "; + tds = div.getElementsByTagName("td"); + tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none"; + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE <= 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Check box-sizing and margin behavior + div.innerHTML = ""; + div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;"; + support.boxSizing = ( div.offsetWidth === 4 ); + support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 ); + + // NOTE: To any future maintainer, we've window.getComputedStyle + // because jsdom on node.js will break without it. + if ( window.getComputedStyle ) { + support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%"; + support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px"; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + marginDiv = document.createElement("div"); + marginDiv.style.cssText = div.style.cssText = divReset; + marginDiv.style.marginRight = marginDiv.style.width = "0"; + div.style.width = "1px"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight ); + } + + if ( typeof div.style.zoom !== "undefined" ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.innerHTML = ""; + div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1"; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = "block"; + div.style.overflow = "visible"; + div.innerHTML = "
        "; + div.firstChild.style.width = "5px"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); + + container.style.zoom = 1; + } + + // Null elements to avoid leaks in IE + body.removeChild( container ); + container = div = tds = marginDiv = null; + }); + + // Null elements to avoid leaks in IE + fragment.removeChild( div ); + all = a = select = opt = input = fragment = div = null; + + return support; +})(); +var rbrace = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + deletedIds: [], + + // Remove at next major release (1.9/2.0) + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ internalKey ] = id = jQuery.deletedIds.pop() || jQuery.guid++; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, i, l, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split(" "); + } + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject( cache[ id ] ) ) { + return; + } + } + + // Destroy the cache + if ( isNode ) { + jQuery.cleanData( [ elem ], true ); + + // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080) + } else if ( jQuery.support.deleteExpando || cache != cache.window ) { + delete cache[ id ]; + + // When all else fails, null + } else { + cache[ id ] = null; + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + var noData = elem.nodeName && jQuery.noData[ elem.nodeName.toLowerCase() ]; + + // nodes accept data unless otherwise specified; rejection can be conditional + return !noData || noData !== true && elem.getAttribute("classid") === noData; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var parts, part, attr, name, l, + elem = this[0], + i = 0, + data = null; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = jQuery.data( elem ); + + if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) { + attr = elem.attributes; + for ( l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( !name.indexOf( "data-" ) ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( elem, name, data[ name ] ); + } + } + jQuery._data( elem, "parsedAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + parts = key.split( ".", 2 ); + parts[1] = parts[1] ? "." + parts[1] : ""; + part = parts[1] + "!"; + + return jQuery.access( this, function( value ) { + + if ( value === undefined ) { + data = this.triggerHandler( "getData" + part, [ parts[0] ] ); + + // Try to fetch any internally stored data first + if ( data === undefined && elem ) { + data = jQuery.data( elem, key ); + data = dataAttr( elem, key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + } + + parts[1] = value; + this.each(function() { + var self = jQuery( this ); + + self.triggerHandler( "setData" + part, parts ); + jQuery.data( this, key, value ); + self.triggerHandler( "changeData" + part, parts ); + }); + }, null, value, arguments.length > 1, null, false ); + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + // Only convert to a number if it doesn't change the string + +data + "" === data ? +data : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + var name; + for ( name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} +jQuery.extend({ + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || jQuery.isArray(data) ) { + queue = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // not intended for public consumption - generates a queueHooks object, or returns the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return jQuery._data( elem, key ) || jQuery._data( elem, key, { + empty: jQuery.Callbacks("once memory").add(function() { + jQuery.removeData( elem, type + "queue", true ); + jQuery.removeData( elem, key, true ); + }) + }); + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[0], type ); + } + + return data === undefined ? + this : + this.each(function() { + var queue = jQuery.queue( this, type, data ); + + // ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while( i-- ) { + tmp = jQuery._data( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +}); +var nodeHook, boolHook, fixSpecified, + rclass = /[\t\r\n]/g, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea|)$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( core_rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( setClass.indexOf( " " + classNames[ c ] + " " ) < 0 ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var removes, className, elem, c, cl, i, l; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + if ( (value && typeof value === "string") || value === undefined ) { + removes = ( value || "" ).split( core_rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + if ( elem.nodeType === 1 && elem.className ) { + + className = (" " + elem.className + " ").replace( rclass, " " ); + + // loop over each item in the removal list + for ( c = 0, cl = removes.length; c < cl; c++ ) { + // Remove until there is nothing to remove, + while ( className.indexOf(" " + removes[ c ] + " ") >= 0 ) { + className = className.replace( " " + removes[ c ] + " " , " " ); + } + } + elem.className = value ? jQuery.trim( className ) : ""; + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( core_rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space separated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) >= 0 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var val, + self = jQuery(this); + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, option, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one" || index < 0, + values = one ? null : [], + max = one ? index + 1 : options.length, + i = index < 0 ? + max : + one ? index : 0; + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // oldIE doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + // Don't return options that are disabled or in a disabled optgroup + ( jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null ) && + ( !option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + // Unused in 1.8, left in so attrFn-stabbers won't die; remove in 1.9 + attrFn: {}, + + attr: function( elem, name, value, pass ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( pass && jQuery.isFunction( jQuery.fn[ name ] ) ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, value + "" ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var propName, attrNames, name, isBool, + i = 0; + + if ( value && elem.nodeType === 1 ) { + + attrNames = value.split( core_rspace ); + + for ( ; i < attrNames.length; i++ ) { + name = attrNames[ i ]; + + if ( name ) { + propName = jQuery.propFix[ name ] || name; + isBool = rboolean.test( name ); + + // See #9699 for explanation of this approach (setting first, then removal) + // Do not do this for boolean attributes (see #10870) + if ( !isBool ) { + jQuery.attr( elem, name, "" ); + } + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( isBool && propName in elem ) { + elem[ propName ] = false; + } + } + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + fixSpecified = { + name: true, + id: true, + coords: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + return ret && ( fixSpecified[ name ] ? ret.value !== "" : ret.specified ) ? + ret.value : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return ( ret.value = value + "" ); + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = value + "" ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); +var rformElems = /^(?:textarea|input|select)$/i, + rtypenamespace = /^([^\.]*|)(?:\.(.+)|)$/, + rhoverHack = /(?:^|\s)hover(\.\S+|)\b/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); + }; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = jQuery.trim( hoverHack(types) ).split( " " ); + for ( t = 0; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var t, tns, type, origType, namespaces, origCount, + j, events, special, eventType, handleObj, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ); + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = jQuery.trim( hoverHack( types || "" ) ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + delete elemData.handle; + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, "events", true ); + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } + + // Event object or event type + var cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType, + type = event.type || event, + namespaces = []; + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "!" ) >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf( "." ) >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.exclusive = exclusive; + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; + + // Handle a global trigger + if ( !elem ) { + + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + for ( old = elem; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old === (elem.ownerDocument || document) ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event || window.event ); + + var i, j, cur, ret, selMatch, matched, matches, handleObj, sel, related, + handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = core_slice.call( arguments ), + run_all = !event.exclusive && !event.namespace, + special = jQuery.event.special[ event.type ] || {}, + handlerQueue = []; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers that should run if there are delegated events + // Avoid non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !(event.button && event.type === "click") ) { + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + + // Don't process clicks (ONLY) on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.disabled !== true || event.type !== "click" ) { + selMatch = {}; + matches = []; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) >= 0 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Target should not be a text node (#504, Safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // For mouse/key events, metaKey==false if it's undefined (#3368, #11328; IE6/7/8) + event.metaKey = !!event.metaKey; + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + + focus: { + delegateType: "focusin" + }, + blur: { + delegateType: "focusout" + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + var name = "on" + type; + + if ( elem.detachEvent ) { + + // #8545, #7054, preventing memory leaks for custom events in IE6-8 + // detachEvent needed property on element, by name of that event, to properly expose it to GC + if ( typeof elem[ name ] === "undefined" ) { + elem[ name ] = null; + } + + elem.detachEvent( name, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !jQuery._data( form, "_submit_attached" ) ) { + jQuery.event.add( form, "submit._submit", function( event ) { + event._submit_bubble = true; + }); + jQuery._data( form, "_submit_attached", true ); + } + }); + // return undefined since we don't need an event listener + }, + + postDispatch: function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( event._submit_bubble ) { + delete event._submit_bubble; + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + } + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + } + // Allow triggered, simulated change events (#11500) + jQuery.event.simulate( "change", this, event, true ); + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "_change_attached" ) ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + jQuery._data( elem, "_change_attached", true ); + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return !rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { // && selector != null + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on( types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); + return this; + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length === 1 ? this.off( selector, "**" ) : this.off( types, selector || "**", fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); +/*! + * Sizzle CSS Selector Engine + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://sizzlejs.com/ + */ +(function( window, undefined ) { + +var cachedruns, + assertGetIdNotName, + Expr, + getText, + isXML, + contains, + compile, + sortOrder, + hasDuplicate, + outermostContext, + + baseHasDuplicate = true, + strundefined = "undefined", + + expando = ( "sizcache" + Math.random() ).replace( ".", "" ), + + Token = String, + document = window.document, + docElem = document.documentElement, + dirruns = 0, + done = 0, + pop = [].pop, + push = [].push, + slice = [].slice, + // Use a stripped-down indexOf if a native one is unavailable + indexOf = [].indexOf || function( elem ) { + var i = 0, + len = this.length; + for ( ; i < len; i++ ) { + if ( this[i] === elem ) { + return i; + } + } + return -1; + }, + + // Augment a function for special use by Sizzle + markFunction = function( fn, value ) { + fn[ expando ] = value == null || value; + return fn; + }, + + createCache = function() { + var cache = {}, + keys = []; + + return markFunction(function( key, value ) { + // Only keep the most recent entries + if ( keys.push( key ) > Expr.cacheLength ) { + delete cache[ keys.shift() ]; + } + + // Retrieve with (key + " ") to avoid collision with native Object.prototype properties (see Issue #157) + return (cache[ key + " " ] = value); + }, cache ); + }, + + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + + // Regex + + // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + // http://www.w3.org/TR/css3-syntax/#characters + characterEncoding = "(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+", + + // Loosely modeled on CSS identifier characters + // An unquoted value should be a CSS identifier (http://www.w3.org/TR/css3-selectors/#attribute-selectors) + // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = characterEncoding.replace( "w", "w#" ), + + // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors + operators = "([*^$|!~]?=)", + attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace + + "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]", + + // Prefer arguments not in parens/brackets, + // then attribute selectors and non-pseudos (denoted by :), + // then anything else + // These preferences are here to reduce the number of selectors + // needing tokenize in the PSEUDO preFilter + pseudos = ":(" + characterEncoding + ")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|([^()[\\]]*|(?:(?:" + attributes + ")|[^:]|\\\\.)*|.*))\\)|)", + + // For matchExpr.POS and matchExpr.needsContext + pos = ":(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*" ), + rpseudo = new RegExp( pseudos ), + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/, + + rnot = /^:not/, + rsibling = /[\x20\t\r\n\f]*[+~]/, + rendsWithNot = /:not\($/, + + rheader = /h\d/i, + rinputs = /input|select|textarea|button/i, + + rbackslash = /\\(?!\\)/g, + + matchExpr = { + "ID": new RegExp( "^#(" + characterEncoding + ")" ), + "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ), + "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ), + "TAG": new RegExp( "^(" + characterEncoding.replace( "w", "w*" ) + ")" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "POS": new RegExp( pos, "i" ), + "CHILD": new RegExp( "^:(only|nth|first|last)-child(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + // For use in libraries implementing .is() + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|" + pos, "i" ) + }, + + // Support + + // Used for testing something on an element + assert = function( fn ) { + var div = document.createElement("div"); + + try { + return fn( div ); + } catch (e) { + return false; + } finally { + // release memory in IE + div = null; + } + }, + + // Check if getElementsByTagName("*") returns only elements + assertTagNameNoComments = assert(function( div ) { + div.appendChild( document.createComment("") ); + return !div.getElementsByTagName("*").length; + }), + + // Check if getAttribute returns normalized href attributes + assertHrefNotNormalized = assert(function( div ) { + div.innerHTML = ""; + return div.firstChild && typeof div.firstChild.getAttribute !== strundefined && + div.firstChild.getAttribute("href") === "#"; + }), + + // Check if attributes should be retrieved by attribute nodes + assertAttributes = assert(function( div ) { + div.innerHTML = ""; + var type = typeof div.lastChild.getAttribute("multiple"); + // IE8 returns a string for some attributes even when not present + return type !== "boolean" && type !== "string"; + }), + + // Check if getElementsByClassName can be trusted + assertUsableClassName = assert(function( div ) { + // Opera can't find a second classname (in 9.6) + div.innerHTML = ""; + if ( !div.getElementsByClassName || !div.getElementsByClassName("e").length ) { + return false; + } + + // Safari 3.2 caches class attributes and doesn't catch changes + div.lastChild.className = "e"; + return div.getElementsByClassName("e").length === 2; + }), + + // Check if getElementById returns elements by name + // Check if getElementsByName privileges form controls or returns elements by ID + assertUsableName = assert(function( div ) { + // Inject content + div.id = expando + 0; + div.innerHTML = "
        "; + docElem.insertBefore( div, docElem.firstChild ); + + // Test + var pass = document.getElementsByName && + // buggy browsers will return fewer than the correct 2 + document.getElementsByName( expando ).length === 2 + + // buggy browsers will return more than the correct 0 + document.getElementsByName( expando + 0 ).length; + assertGetIdNotName = !document.getElementById( expando ); + + // Cleanup + docElem.removeChild( div ); + + return pass; + }); + +// If slice is not available, provide a backup +try { + slice.call( docElem.childNodes, 0 )[0].nodeType; +} catch ( e ) { + slice = function( i ) { + var elem, + results = []; + for ( ; (elem = this[i]); i++ ) { + results.push( elem ); + } + return results; + }; +} + +function Sizzle( selector, context, results, seed ) { + results = results || []; + context = context || document; + var match, elem, xml, m, + nodeType = context.nodeType; + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + if ( nodeType !== 1 && nodeType !== 9 ) { + return []; + } + + xml = isXML( context ); + + if ( !xml && !seed ) { + if ( (match = rquickExpr.exec( selector )) ) { + // Speed-up: Sizzle("#ID") + if ( (m = match[1]) ) { + if ( nodeType === 9 ) { + elem = context.getElementById( m ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE, Opera, and Webkit return items + // by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + } else { + // Context is not a document + if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) && + contains( context, elem ) && elem.id === m ) { + results.push( elem ); + return results; + } + } + + // Speed-up: Sizzle("TAG") + } else if ( match[2] ) { + push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) ); + return results; + + // Speed-up: Sizzle(".CLASS") + } else if ( (m = match[3]) && assertUsableClassName && context.getElementsByClassName ) { + push.apply( results, slice.call(context.getElementsByClassName( m ), 0) ); + return results; + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed, xml ); +} + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + return Sizzle( expr, null, null, [ elem ] ).length > 0; +}; + +// Returns a function to use in pseudos for input types +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +// Returns a function to use in pseudos for buttons +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} + +// Returns a function to use in pseudos for positionals +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); +} + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( nodeType ) { + if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (see #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + } else { + + // If no nodeType, this is expected to be an array + for ( ; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } + return ret; +}; + +isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +// Element contains another +contains = Sizzle.contains = docElem.contains ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && adown.contains && adown.contains(bup) ); + } : + docElem.compareDocumentPosition ? + function( a, b ) { + return b && !!( a.compareDocumentPosition( b ) & 16 ); + } : + function( a, b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + return false; + }; + +Sizzle.attr = function( elem, name ) { + var val, + xml = isXML( elem ); + + if ( !xml ) { + name = name.toLowerCase(); + } + if ( (val = Expr.attrHandle[ name ]) ) { + return val( elem ); + } + if ( xml || assertAttributes ) { + return elem.getAttribute( name ); + } + val = elem.getAttributeNode( name ); + return val ? + typeof elem[ name ] === "boolean" ? + elem[ name ] ? name : null : + val.specified ? val.value : null : + null; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + // IE6/7 return a modified href + attrHandle: assertHrefNotNormalized ? + {} : + { + "href": function( elem ) { + return elem.getAttribute( "href", 2 ); + }, + "type": function( elem ) { + return elem.getAttribute("type"); + } + }, + + find: { + "ID": assertGetIdNotName ? + function( id, context, xml ) { + if ( typeof context.getElementById !== strundefined && !xml ) { + var m = context.getElementById( id ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + } : + function( id, context, xml ) { + if ( typeof context.getElementById !== strundefined && !xml ) { + var m = context.getElementById( id ); + + return m ? + m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ? + [m] : + undefined : + []; + } + }, + + "TAG": assertTagNameNoComments ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== strundefined ) { + return context.getElementsByTagName( tag ); + } + } : + function( tag, context ) { + var results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + var elem, + tmp = [], + i = 0; + + for ( ; (elem = results[i]); i++ ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }, + + "NAME": assertUsableName && function( tag, context ) { + if ( typeof context.getElementsByName !== strundefined ) { + return context.getElementsByName( name ); + } + }, + + "CLASS": assertUsableClassName && function( className, context, xml ) { + if ( typeof context.getElementsByClassName !== strundefined && !xml ) { + return context.getElementsByClassName( className ); + } + } + }, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( rbackslash, "" ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[4] || match[5] || "" ).replace( rbackslash, "" ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 3 xn-component of xn+y argument ([+-]?\d*n|) + 4 sign of xn-component + 5 x of xn-component + 6 sign of y-component + 7 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1] === "nth" ) { + // nth-child requires argument + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[3] = +( match[3] ? match[4] + (match[5] || 1) : 2 * ( match[2] === "even" || match[2] === "odd" ) ); + match[4] = +( ( match[6] + match[7] ) || match[2] === "odd" ); + + // other types prohibit arguments + } else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var unquoted, excess; + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + if ( match[3] ) { + match[2] = match[3]; + } else if ( (unquoted = match[4]) ) { + // Only check arguments that contain a pseudo + if ( rpseudo.test(unquoted) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { + + // excess is a negative index + unquoted = unquoted.slice( 0, excess ); + match[0] = match[0].slice( 0, excess ); + } + match[2] = unquoted; + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + "ID": assertGetIdNotName ? + function( id ) { + id = id.replace( rbackslash, "" ); + return function( elem ) { + return elem.getAttribute("id") === id; + }; + } : + function( id ) { + id = id.replace( rbackslash, "" ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id"); + return node && node.value === id; + }; + }, + + "TAG": function( nodeName ) { + if ( nodeName === "*" ) { + return function() { return true; }; + } + nodeName = nodeName.replace( rbackslash, "" ).toLowerCase(); + + return function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ expando ][ className + " " ]; + + return pattern || + (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) && + classCache( className, function( elem ) { + return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" ); + }); + }, + + "ATTR": function( name, operator, check ) { + return function( elem, context ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.substr( result.length - check.length ) === check : + operator === "~=" ? ( " " + result + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.substr( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + + "CHILD": function( type, argument, first, last ) { + + if ( type === "nth" ) { + return function( elem ) { + var node, diff, + parent = elem.parentNode; + + if ( first === 1 && last === 0 ) { + return true; + } + + if ( parent ) { + diff = 0; + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + diff++; + if ( elem === node ) { + break; + } + } + } + } + + // Incorporate the offset (or cast to NaN), then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + }; + } + + return function( elem ) { + var node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + /* falls through */ + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf.call( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + return !results.pop(); + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "contains": markFunction(function( text ) { + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + "enabled": function( elem ) { + return elem.disabled === false; + }, + + "disabled": function( elem ) { + return elem.disabled === true; + }, + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)), + // not comment, processing instructions, or others + // Thanks to Diego Perini for the nodeName shortcut + // Greater than "@" means alpha characters (specifically not starting with "#" or "?") + var nodeType; + elem = elem.firstChild; + while ( elem ) { + if ( elem.nodeName > "@" || (nodeType = elem.nodeType) === 3 || nodeType === 4 ) { + return false; + } + elem = elem.nextSibling; + } + return true; + }, + + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "text": function( elem ) { + var type, attr; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && + (type = elem.type) === "text" && + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === type ); + }, + + // Input types + "radio": createInputPseudo("radio"), + "checkbox": createInputPseudo("checkbox"), + "file": createInputPseudo("file"), + "password": createInputPseudo("password"), + "image": createInputPseudo("image"), + + "submit": createButtonPseudo("submit"), + "reset": createButtonPseudo("reset"), + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "focus": function( elem ) { + var doc = elem.ownerDocument; + return elem === doc.activeElement && (!doc.hasFocus || doc.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); + }, + + "active": function( elem ) { + return elem === elem.ownerDocument.activeElement; + }, + + // Positional types + "first": createPositionalPseudo(function() { + return [ 0 ]; + }), + + "last": createPositionalPseudo(function( matchIndexes, length ) { + return [ length - 1 ]; + }), + + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), + + "even": createPositionalPseudo(function( matchIndexes, length ) { + for ( var i = 0; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function( matchIndexes, length ) { + for ( var i = 1; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + for ( var i = argument < 0 ? argument + length : argument; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + for ( var i = argument < 0 ? argument + length : argument; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; + +function siblingCheck( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; +} + +sortOrder = docElem.compareDocumentPosition ? + function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + return ( !a.compareDocumentPosition || !b.compareDocumentPosition ? + a.compareDocumentPosition : + a.compareDocumentPosition(b) & 4 + ) ? -1 : 1; + } : + function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + +// Always assume the presence of duplicates if sort doesn't +// pass them to our comparison function (as in Google Chrome). +[0, 0].sort( sortOrder ); +baseHasDuplicate = !hasDuplicate; + +// Document sorting and removing duplicates +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + i = 1, + j = 0; + + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( ; (elem = results[i]); i++ ) { + if ( elem === results[ i - 1 ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + return results; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +function tokenize( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ expando ][ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + // Don't consume trailing commas as valid + soFar = soFar.slice( match[0].length ) || soFar; + } + groups.push( tokens = [] ); + } + + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + tokens.push( matched = new Token( match.shift() ) ); + soFar = soFar.slice( matched.length ); + + // Cast descendant combinators to space + matched.type = match[0].replace( rtrim, " " ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match ))) ) { + + tokens.push( matched = new Token( match.shift() ) ); + soFar = soFar.slice( matched.length ); + matched.type = type; + matched.matches = match; + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + checkNonElements = base && combinator.dir === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( checkNonElements || elem.nodeType === 1 ) { + return matcher( elem, context, xml ); + } + } + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + // We can't set arbitrary data on XML nodes, so they don't benefit from dir caching + if ( !xml ) { + var cache, + dirkey = dirruns + " " + doneName + " ", + cachedkey = dirkey + cachedruns; + while ( (elem = elem[ dir ]) ) { + if ( checkNonElements || elem.nodeType === 1 ) { + if ( (cache = elem[ expando ]) === cachedkey ) { + return elem.sizset; + } else if ( typeof cache === "string" && cache.indexOf(dirkey) === 0 ) { + if ( elem.sizset ) { + return elem; + } + } else { + elem[ expando ] = cachedkey; + if ( matcher( elem, context, xml ) ) { + elem.sizset = true; + return elem; + } + elem.sizset = false; + } + } + } + } else { + while ( (elem = elem[ dir ]) ) { + if ( checkNonElements || elem.nodeType === 1 ) { + if ( matcher( elem, context, xml ) ) { + return elem; + } + } + } + } + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[0]; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( (elem = temp[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + // Restore matcherIn since elem is not yet a final match + temp.push( (matcherIn[i] = elem) ); + } + } + postFinder( null, (matcherOut = []), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) && + (temp = postFinder ? indexOf.call( seed, elem ) : preMap[i]) > -1 ) { + + seed[temp] = !(results[temp] = elem); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + }); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf.call( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + return ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + } ]; + + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ]; + } else { + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && tokens.slice( 0, i - 1 ).join("").replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && tokens.join("") + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, expandContext ) { + var elem, j, matcher, + setMatched = [], + matchedCount = 0, + i = "0", + unmatched = seed && [], + outermost = expandContext != null, + contextBackup = outermostContext, + // We must always have either seed elements or context + elems = seed || byElement && Expr.find["TAG"]( "*", expandContext && context.parentNode || context ), + // Nested matchers should use non-integer dirruns + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.E); + + if ( outermost ) { + outermostContext = context !== document && context; + cachedruns = superMatcher.el; + } + + // Add elements passing elementMatchers directly to results + for ( ; (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + for ( j = 0; (matcher = elementMatchers[j]); j++ ) { + if ( matcher( elem, context, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + cachedruns = ++superMatcher.el; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // Apply set filters to unmatched elements + matchedCount += i; + if ( bySet && i !== matchedCount ) { + for ( j = 0; (matcher = setMatchers[j]); j++ ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + superMatcher.el = 0; + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, group /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ expando ][ selector + " " ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !group ) { + group = tokenize( selector ); + } + i = group.length; + while ( i-- ) { + cached = matcherFromTokens( group[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + } + return cached; +}; + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results ); + } + return results; +} + +function select( selector, context, results, seed, xml ) { + var i, tokens, token, type, find, + match = tokenize( selector ), + j = match.length; + + if ( !seed ) { + // Try to minimize operations if there is only one group + if ( match.length === 1 ) { + + // Take a shortcut and set the context if the root selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && !xml && + Expr.relative[ tokens[1].type ] ) { + + context = Expr.find["ID"]( token.matches[0].replace( rbackslash, "" ), context, xml )[0]; + if ( !context ) { + return results; + } + + selector = selector.slice( tokens.shift().length ); + } + + // Fetch a seed set for right-to-left matching + for ( i = matchExpr["POS"].test( selector ) ? -1 : tokens.length - 1; i >= 0; i-- ) { + token = tokens[i]; + + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( rbackslash, "" ), + rsibling.test( tokens[0].type ) && context.parentNode || context, + xml + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && tokens.join(""); + if ( !selector ) { + push.apply( results, slice.call( seed, 0 ) ); + return results; + } + + break; + } + } + } + } + } + + // Compile and execute a filtering function + // Provide `match` to avoid retokenization if we modified the selector above + compile( selector, match )( + seed, + context, + xml, + results, + rsibling.test( selector ) + ); + return results; +} + +if ( document.querySelectorAll ) { + (function() { + var disconnectedMatch, + oldSelect = select, + rescape = /'|\\/g, + rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g, + + // qSa(:focus) reports false when true (Chrome 21), no need to also add to buggyMatches since matches checks buggyQSA + // A support test would require too much code (would include document ready) + rbuggyQSA = [ ":focus" ], + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + // A support test would require too much code (would include document ready) + // just skip matchesSelector for :active + rbuggyMatches = [ ":active" ], + matches = docElem.matchesSelector || + docElem.mozMatchesSelector || + docElem.webkitMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector; + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( div ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explictly + // setting a boolean content attribute, + // since its presence should be enough + // http://bugs.jquery.com/ticket/12359 + div.innerHTML = ""; + + // IE8 - Some boolean attributes are not treated correctly + if ( !div.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here (do not put tests after this one) + if ( !div.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + }); + + assert(function( div ) { + + // Opera 10-12/IE9 - ^= $= *= and empty values + // Should not select anything + div.innerHTML = "

        "; + if ( div.querySelectorAll("[test^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here (do not put tests after this one) + div.innerHTML = ""; + if ( !div.querySelectorAll(":enabled").length ) { + rbuggyQSA.push(":enabled", ":disabled"); + } + }); + + // rbuggyQSA always contains :focus, so no need for a length check + rbuggyQSA = /* rbuggyQSA.length && */ new RegExp( rbuggyQSA.join("|") ); + + select = function( selector, context, results, seed, xml ) { + // Only use querySelectorAll when not filtering, + // when this is not xml, + // and when no QSA bugs apply + if ( !seed && !xml && !rbuggyQSA.test( selector ) ) { + var groups, i, + old = true, + nid = expando, + newContext = context, + newSelector = context.nodeType === 9 && selector; + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + groups = tokenize( selector ); + + if ( (old = context.getAttribute("id")) ) { + nid = old.replace( rescape, "\\$&" ); + } else { + context.setAttribute( "id", nid ); + } + nid = "[id='" + nid + "'] "; + + i = groups.length; + while ( i-- ) { + groups[i] = nid + groups[i].join(""); + } + newContext = rsibling.test( selector ) && context.parentNode || context; + newSelector = groups.join(","); + } + + if ( newSelector ) { + try { + push.apply( results, slice.call( newContext.querySelectorAll( + newSelector + ), 0 ) ); + return results; + } catch(qsaError) { + } finally { + if ( !old ) { + context.removeAttribute("id"); + } + } + } + } + + return oldSelect( selector, context, results, seed, xml ); + }; + + if ( matches ) { + assert(function( div ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + disconnectedMatch = matches.call( div, "div" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + try { + matches.call( div, "[test!='']:sizzle" ); + rbuggyMatches.push( "!=", pseudos ); + } catch ( e ) {} + }); + + // rbuggyMatches always contains :active and :focus, so no need for a length check + rbuggyMatches = /* rbuggyMatches.length && */ new RegExp( rbuggyMatches.join("|") ); + + Sizzle.matchesSelector = function( elem, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); + + // rbuggyMatches always contains :active, so no need for an existence check + if ( !isXML( elem ) && !rbuggyMatches.test( expr ) && !rbuggyQSA.test( expr ) ) { + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch(e) {} + } + + return Sizzle( expr, null, null, [ elem ] ).length > 0; + }; + } + })(); +} + +// Deprecated +Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Back-compat +function setFilters() {} +Expr.filters = setFilters.prototype = Expr.pseudos; +Expr.setFilters = new setFilters(); + +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.pseudos; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})( window ); +var runtil = /Until$/, + rparentsprev = /^(?:parents|prev(?:Until|All))/, + isSimple = /^.[^:#\[\.,]*$/, + rneedsContext = jQuery.expr.match.needsContext, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var i, l, length, n, r, ret, + self = this; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + ret = this.pushStack( "", "find", selector ); + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var i, + targets = jQuery( target, this ), + len = targets.length; + + return this.filter(function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + rneedsContext.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + ret = [], + pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( ; i < l; i++ ) { + cur = this[i]; + + while ( cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11 ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + } + cur = cur.parentNode; + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter(selector) + ); + } +}); + +jQuery.fn.andSelf = jQuery.fn.addBack; + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +function sibling( cur, dir ) { + do { + cur = cur[ dir ]; + } while ( cur && cur.nodeType !== 1 ); + + return cur; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( this.length > 1 && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, core_slice.call( arguments ).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, + rtagName = /<([\w:]+)/, + rtbody = /]", "i"), + rcheckableType = /^(?:checkbox|radio)$/, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*\s*$/g, + wrapMap = { + option: [ 1, "" ], + legend: [ 1, "
        ", "
        " ], + thead: [ 1, "", "
        " ], + tr: [ 2, "", "
        " ], + td: [ 3, "", "
        " ], + col: [ 2, "", "
        " ], + area: [ 1, "", "" ], + _default: [ 0, "", "" ] + }, + safeFragment = createSafeFragment( document ), + fragmentDiv = safeFragment.appendChild( document.createElement("div") ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags, +// unless wrapped in a div with non-breaking characters in front of it. +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "X
        ", "
        " ]; +} + +jQuery.fn.extend({ + text: function( value ) { + return jQuery.access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) ); + }, null, value, arguments.length ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + var isFunction = jQuery.isFunction( html ); + + return this.each(function(i) { + jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( !isDisconnected( this[0] ) ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } + + if ( arguments.length ) { + var set = jQuery.clean( arguments ); + return this.pushStack( jQuery.merge( set, this ), "before", this.selector ); + } + }, + + after: function() { + if ( !isDisconnected( this[0] ) ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } + + if ( arguments.length ) { + var set = jQuery.clean( arguments ); + return this.pushStack( jQuery.merge( this, set ), "after", this.selector ); + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + return jQuery.access( this, function( value ) { + var elem = this[0] || {}, + i = 0, + l = this.length; + + if ( value === undefined ) { + return elem.nodeType === 1 ? + elem.innerHTML.replace( rinlinejQuery, "" ) : + undefined; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + ( jQuery.support.htmlSerialize || !rnoshimcache.test( value ) ) && + ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) && + !wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) { + + value = value.replace( rxhtmlTag, "<$1>" ); + + try { + for (; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + elem = this[i] || {}; + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName( "*" ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch(e) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function( value ) { + if ( !isDisconnected( this[0] ) ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } + + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + + // Flatten any nested arrays + args = [].concat.apply( [], args ); + + var results, first, fragment, iNoClone, + i = 0, + value = args[0], + scripts = [], + l = this.length; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && l > 1 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call( this, i, table ? self.html() : undefined ); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + results = jQuery.buildFragment( args, this, scripts ); + fragment = results.fragment; + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + // Use the original fragment for the last item instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + // Fragments from the fragment cache must always be cloned and never used in place. + for ( iNoClone = results.cacheable || l - 1; i < l; i++ ) { + callback.call( + table && jQuery.nodeName( this[i], "table" ) ? + findOrAppend( this[i], "tbody" ) : + this[i], + i === iNoClone ? + fragment : + jQuery.clone( fragment, true, true ) + ); + } + } + + // Fix #11809: Avoid leaking memory + fragment = first = null; + + if ( scripts.length ) { + jQuery.each( scripts, function( i, elem ) { + if ( elem.src ) { + if ( jQuery.ajax ) { + jQuery.ajax({ + url: elem.src, + type: "GET", + dataType: "script", + async: false, + global: false, + "throws": true + }); + } else { + jQuery.error("no ajax"); + } + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + }); + } + } + + return this; + } +}); + +function findOrAppend( elem, tag ) { + return elem.getElementsByTagName( tag )[0] || elem.appendChild( elem.ownerDocument.createElement( tag ) ); +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var type, i, l, + oldData = jQuery._data( src ), + curData = jQuery._data( dest, oldData ), + events = oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + + // make the cloned public data object a copy from the original + if ( curData.data ) { + curData.data = jQuery.extend( {}, curData.data ); + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + if ( nodeName === "object" ) { + // IE6-10 improperly clones children of object elements using classid. + // IE10 throws NoModificationAllowedError if parent is null, #12132. + if ( dest.parentNode ) { + dest.outerHTML = src.outerHTML; + } + + // This path appears unavoidable for IE9. When cloning an object + // element in IE9, the outerHTML strategy above is not sufficient. + // If the src has innerHTML and the destination does not, + // copy the src.innerHTML into the dest.innerHTML. #10324 + if ( jQuery.support.html5Clone && (src.innerHTML && !jQuery.trim(dest.innerHTML)) ) { + dest.innerHTML = src.innerHTML; + } + + } else if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + + dest.defaultChecked = dest.checked = src.checked; + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + + // IE blanks contents when cloning scripts + } else if ( nodeName === "script" && dest.text !== src.text ) { + dest.text = src.text; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, context, scripts ) { + var fragment, cacheable, cachehit, + first = args[ 0 ]; + + // Set context from what may come in as undefined or a jQuery collection or a node + // Updated to fix #12266 where accessing context[0] could throw an exception in IE9/10 & + // also doubles as fix for #8950 where plain objects caused createDocumentFragment exception + context = context || document; + context = !context.nodeType && context[0] || context; + context = context.ownerDocument || context; + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put or elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 + if ( args.length === 1 && typeof first === "string" && first.length < 512 && context === document && + first.charAt(0) === "<" && !rnocache.test( first ) && + (jQuery.support.checkClone || !rchecked.test( first )) && + (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) { + + // Mark cacheable and look for a hit + cacheable = true; + fragment = jQuery.fragments[ first ]; + cachehit = fragment !== undefined; + } + + if ( !fragment ) { + fragment = context.createDocumentFragment(); + jQuery.clean( args, context, fragment, scripts ); + + // Update the cache, but only store false + // unless this is a second parsing of the same content + if ( cacheable ) { + jQuery.fragments[ first ] = cachehit && fragment; + } + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + i = 0, + ret = [], + insert = jQuery( selector ), + l = insert.length, + parent = this.length === 1 && this[0].parentNode; + + if ( (parent == null || parent && parent.nodeType === 11 && parent.childNodes.length === 1) && l === 1 ) { + insert[ original ]( this[0] ); + return this; + } else { + for ( ; i < l; i++ ) { + elems = ( i > 0 ? this.clone(true) : this ).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( typeof elem.getElementsByTagName !== "undefined" ) { + return elem.getElementsByTagName( "*" ); + + } else if ( typeof elem.querySelectorAll !== "undefined" ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( rcheckableType.test( elem.type ) ) { + elem.defaultChecked = elem.checked; + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var srcElements, + destElements, + i, + clone; + + if ( jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) { + clone = elem.cloneNode( true ); + + // IE<=8 does not properly clone detached, unknown element nodes + } else { + fragmentDiv.innerHTML = elem.outerHTML; + fragmentDiv.removeChild( clone = fragmentDiv.firstChild ); + } + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var i, j, elem, tag, wrap, depth, div, hasBody, tbody, len, handleScript, jsTags, + safe = context === document && safeFragment, + ret = []; + + // Ensure that context is a document + if ( !context || typeof context.createDocumentFragment === "undefined" ) { + context = document; + } + + // Use the already-created safe fragment if context permits + for ( i = 0; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Ensure a safe container in which to render the html + safe = safe || createSafeFragment( context ); + div = context.createElement("div"); + safe.appendChild( div ); + + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1>"); + + // Go to html and back, then peel off extra wrappers + tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + depth = wrap[0]; + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted from table fragments + if ( !jQuery.support.tbody ) { + + // String was a , *may* have spurious + hasBody = rtbody.test(elem); + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare or + wrap[1] === "
        " && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + + // Take out of fragment container (we need a fresh div each time) + div.parentNode.removeChild( div ); + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + jQuery.merge( ret, elem ); + } + } + + // Fix #11356: Clear elements from safeFragment + if ( div ) { + elem = div = safe = null; + } + + // Reset defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + if ( !jQuery.support.appendChecked ) { + for ( i = 0; (elem = ret[i]) != null; i++ ) { + if ( jQuery.nodeName( elem, "input" ) ) { + fixDefaultChecked( elem ); + } else if ( typeof elem.getElementsByTagName !== "undefined" ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } + } + } + + // Append elements to a provided document fragment + if ( fragment ) { + // Special handling of each script element + handleScript = function( elem ) { + // Check if we consider it executable + if ( !elem.type || rscriptType.test( elem.type ) ) { + // Detach the script and store it in the scripts array (if provided) or the fragment + // Return truthy to indicate that it has been handled + return scripts ? + scripts.push( elem.parentNode ? elem.parentNode.removeChild( elem ) : elem ) : + fragment.appendChild( elem ); + } + }; + + for ( i = 0; (elem = ret[i]) != null; i++ ) { + // Check if we're done after handling an executable script + if ( !( jQuery.nodeName( elem, "script" ) && handleScript( elem ) ) ) { + // Append to fragment and handle embedded scripts + fragment.appendChild( elem ); + if ( typeof elem.getElementsByTagName !== "undefined" ) { + // handleScript alters the DOM, so use jQuery.merge to ensure snapshot iteration + jsTags = jQuery.grep( jQuery.merge( [], elem.getElementsByTagName("script") ), handleScript ); + + // Splice the scripts into ret after their former ancestor and advance our index beyond them + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + i += jsTags.length; + } + } + } + } + + return ret; + }, + + cleanData: function( elems, /* internal */ acceptData ) { + var data, id, elem, type, + i = 0, + internalKey = jQuery.expando, + cache = jQuery.cache, + deleteExpando = jQuery.support.deleteExpando, + special = jQuery.event.special; + + for ( ; (elem = elems[i]) != null; i++ ) { + + if ( acceptData || jQuery.acceptData( elem ) ) { + + id = elem[ internalKey ]; + data = id && cache[ id ]; + + if ( data ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Remove cache only if it was not already removed by jQuery.event.remove + if ( cache[ id ] ) { + + delete cache[ id ]; + + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( deleteExpando ) { + delete elem[ internalKey ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( internalKey ); + + } else { + elem[ internalKey ] = null; + } + + jQuery.deletedIds.push( id ); + } + } + } + } + } +}); +// Limit scope pollution from any deprecated API +(function() { + +var matched, browser; + +// Use of jQuery.browser is frowned upon. +// More details: http://api.jquery.com/jQuery.browser +// jQuery.uaMatch maintained for back-compat +jQuery.uaMatch = function( ua ) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec( ua ) || + /(webkit)[ \/]([\w.]+)/.exec( ua ) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec( ua ) || + /(msie) ([\w.]+)/.exec( ua ) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec( ua ) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; +}; + +matched = jQuery.uaMatch( navigator.userAgent ); +browser = {}; + +if ( matched.browser ) { + browser[ matched.browser ] = true; + browser.version = matched.version; +} + +// Chrome is Webkit, but Webkit is also Safari. +if ( browser.chrome ) { + browser.webkit = true; +} else if ( browser.webkit ) { + browser.safari = true; +} + +jQuery.browser = browser; + +jQuery.sub = function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; +}; + +})(); +var curCSS, iframe, iframeDoc, + ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + rposition = /^(top|right|bottom|left)$/, + // swappable if display is none or starts with table except "table", "table-cell", or "table-caption" + // see here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rmargin = /^margin/, + rnumsplit = new RegExp( "^(" + core_pnum + ")(.*)$", "i" ), + rnumnonpx = new RegExp( "^(" + core_pnum + ")(?!px)[a-z%]+$", "i" ), + rrelNum = new RegExp( "^([-+])=(" + core_pnum + ")", "i" ), + elemdisplay = { BODY: "block" }, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: 0, + fontWeight: 400 + }, + + cssExpand = [ "Top", "Right", "Bottom", "Left" ], + cssPrefixes = [ "Webkit", "O", "Moz", "ms" ], + + eventsToggle = jQuery.fn.toggle; + +// return a css property mapped to a potentially vendor prefixed property +function vendorPropName( style, name ) { + + // shortcut for names that are not vendor prefixed + if ( name in style ) { + return name; + } + + // check for vendor prefixed names + var capName = name.charAt(0).toUpperCase() + name.slice(1), + origName = name, + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in style ) { + return name; + } + } + + return origName; +} + +function isHidden( elem, el ) { + elem = el || elem; + return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem ); +} + +function showHide( elements, show ) { + var elem, display, + values = [], + index = 0, + length = elements.length; + + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + values[ index ] = jQuery._data( elem, "olddisplay" ); + if ( show ) { + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !values[ index ] && elem.style.display === "none" ) { + elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( elem.style.display === "" && isHidden( elem ) ) { + values[ index ] = jQuery._data( elem, "olddisplay", css_defaultDisplay(elem.nodeName) ); + } + } else { + display = curCSS( elem, "display" ); + + if ( !values[ index ] && display !== "none" ) { + jQuery._data( elem, "olddisplay", display ); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( index = 0; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + if ( !show || elem.style.display === "none" || elem.style.display === "" ) { + elem.style.display = show ? values[ index ] || "" : "none"; + } + } + + return elements; +} + +jQuery.fn.extend({ + css: function( name, value ) { + return jQuery.access( this, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + }, + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state, fn2 ) { + var bool = typeof state === "boolean"; + + if ( jQuery.isFunction( state ) && jQuery.isFunction( fn2 ) ) { + return eventsToggle.apply( this, arguments ); + } + + return this.each(function() { + if ( bool ? state : isHidden( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + }); + } +}); + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = jQuery.camelCase( name ), + style = elem.style; + + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, numeric, extra ) { + var val, num, hooks, + origName = jQuery.camelCase( name ); + + // Make sure that we're working with the right name + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name ); + } + + //convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Return, converting to number if forced or a qualifier was provided and val looks numeric + if ( numeric || extra !== undefined ) { + num = parseFloat( val ); + return numeric || jQuery.isNumeric( num ) ? num || 0 : val; + } + return val; + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; + } +}); + +// NOTE: To any future maintainer, we've window.getComputedStyle +// because jsdom on node.js will break without it. +if ( window.getComputedStyle ) { + curCSS = function( elem, name ) { + var ret, width, minWidth, maxWidth, + computed = window.getComputedStyle( elem, null ), + style = elem.style; + + if ( computed ) { + + // getPropertyValue is only needed for .css('filter') in IE9, see #12537 + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right + // Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels + // this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values + if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) { + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret; + }; +} else if ( document.documentElement.currentStyle ) { + curCSS = function( elem, name ) { + var left, rsLeft, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // Avoid setting ret to empty string here + // so we don't default to auto + if ( ret == null && style && style[ name ] ) { + ret = style[ name ]; + } + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + // but not position css attributes, as those are proportional to the parent element instead + // and we can't measure the parent instead because it might trigger a "stacking dolls" problem + if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) { + + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : ret; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +function setPositiveNumber( elem, value, subtract ) { + var matches = rnumsplit.exec( value ); + return matches ? + Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) : + value; +} + +function augmentWidthOrHeight( elem, name, extra, isBorderBox ) { + var i = extra === ( isBorderBox ? "border" : "content" ) ? + // If we already have the right measurement, avoid augmentation + 4 : + // Otherwise initialize for horizontal or vertical properties + name === "width" ? 1 : 0, + + val = 0; + + for ( ; i < 4; i += 2 ) { + // both box models exclude margin, so add it if we want it + if ( extra === "margin" ) { + // we use jQuery.css instead of curCSS here + // because of the reliableMarginRight CSS hook! + val += jQuery.css( elem, extra + cssExpand[ i ], true ); + } + + // From this point on we use curCSS for maximum performance (relevant in animations) + if ( isBorderBox ) { + // border-box includes padding, so remove it if we want content + if ( extra === "content" ) { + val -= parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0; + } + + // at this point, extra isn't border nor margin, so remove border + if ( extra !== "margin" ) { + val -= parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; + } + } else { + // at this point, extra isn't content, so add padding + val += parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0; + + // at this point, extra isn't content nor padding, so add border + if ( extra !== "padding" ) { + val += parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; + } + } + } + + return val; +} + +function getWidthOrHeight( elem, name, extra ) { + + // Start with offset property, which is equivalent to the border-box value + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + valueIsBorderBox = true, + isBorderBox = jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box"; + + // some non-html elements return undefined for offsetWidth, so check for null/undefined + // svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285 + // MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668 + if ( val <= 0 || val == null ) { + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ]; + } + + // Computed unit is not pixels. Stop here and return. + if ( rnumnonpx.test(val) ) { + return val; + } + + // we need the check for style in case a browser which returns unreliable values + // for getComputedStyle silently falls back to the reliable elem.style + valueIsBorderBox = isBorderBox && ( jQuery.support.boxSizingReliable || val === elem.style[ name ] ); + + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + } + + // use the active box-sizing model to add/subtract irrelevant styles + return ( val + + augmentWidthOrHeight( + elem, + name, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox + ) + ) + "px"; +} + + +// Try to determine the default display value of an element +function css_defaultDisplay( nodeName ) { + if ( elemdisplay[ nodeName ] ) { + return elemdisplay[ nodeName ]; + } + + var elem = jQuery( "<" + nodeName + ">" ).appendTo( document.body ), + display = elem.css("display"); + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // Use the already-created iframe if possible + iframe = document.body.appendChild( + iframe || jQuery.extend( document.createElement("iframe"), { + frameBorder: 0, + width: 0, + height: 0 + }) + ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write(""); + iframeDoc.close(); + } + + elem = iframeDoc.body.appendChild( iframeDoc.createElement(nodeName) ); + + display = curCSS( elem, "display" ); + document.body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + + return display; +} + +jQuery.each([ "height", "width" ], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + // certain elements can have dimension info if we invisibly show them + // however, it must have a current display style that would benefit from this + if ( elem.offsetWidth === 0 && rdisplayswap.test( curCSS( elem, "display" ) ) ) { + return jQuery.swap( elem, cssShow, function() { + return getWidthOrHeight( elem, name, extra ); + }); + } else { + return getWidthOrHeight( elem, name, extra ); + } + } + }, + + set: function( elem, value, extra ) { + return setPositiveNumber( elem, value, extra ? + augmentWidthOrHeight( + elem, + name, + extra, + jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box" + ) : 0 + ); + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( 0.01 * parseFloat( RegExp.$1 ) ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle, + opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 + if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" && + style.removeAttribute ) { + + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); + + // if there there is no filter style applied in a css rule, we are done + if ( currentStyle && !currentStyle.filter ) { + return; + } + } + + // otherwise, set new filter values + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +// These hooks cannot be added until DOM ready because the support test +// for it is not run until after DOM ready +jQuery(function() { + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + return jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + return curCSS( elem, "marginRight" ); + } + }); + } + }; + } + + // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084 + // getComputedStyle returns percent when specified for top/left/bottom/right + // rather than make the css module depend on the offset module, we just check for it here + if ( !jQuery.support.pixelPosition && jQuery.fn.position ) { + jQuery.each( [ "top", "left" ], function( i, prop ) { + jQuery.cssHooks[ prop ] = { + get: function( elem, computed ) { + if ( computed ) { + var ret = curCSS( elem, prop ); + // if curCSS returns percentage, fallback to offset + return rnumnonpx.test( ret ) ? jQuery( elem ).position()[ prop ] + "px" : ret; + } + } + }; + }); + } + +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + return ( elem.offsetWidth === 0 && elem.offsetHeight === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || curCSS( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + +// These hooks are used by animate to expand properties +jQuery.each({ + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i, + + // assumes a single number if not a string + parts = typeof value === "string" ? value.split(" ") : [ value ], + expanded = {}; + + for ( i = 0; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( !rmargin.test( prefix ) ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +}); +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + rselectTextarea = /^(?:select|textarea)/i; + +jQuery.fn.extend({ + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +//Serialize an array of form elements or a set of +//key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value ); + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); +}; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && jQuery.type( obj ) === "object" ) { + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} +var + // Document location + ajaxLocParts, + ajaxLocation, + + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /)<[^<]*)*<\/script>/gi, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = ["*/"] + ["*"]; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, list, placeBefore, + dataTypes = dataTypeExpression.toLowerCase().split( core_rspace ), + i = 0, + length = dataTypes.length; + + if ( jQuery.isFunction( func ) ) { + // For each dataType in the dataTypeExpression + for ( ; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var selection, + list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ); + + for ( ; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } +} + +jQuery.fn.load = function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + } + + // Don't do a request if no elements are being requested + if ( !this.length ) { + return this; + } + + var selector, type, response, + self = this, + off = url.indexOf(" "); + + if ( off >= 0 ) { + selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // If it's a function + if ( jQuery.isFunction( params ) ) { + + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( params && typeof params === "object" ) { + type = "POST"; + } + + // Request the remote document + jQuery.ajax({ + url: url, + + // if "type" variable is undefined, then "GET" method will be used + type: type, + dataType: "html", + data: params, + complete: function( jqXHR, status ) { + if ( callback ) { + self.each( callback, response || [ jqXHR.responseText, status, jqXHR ] ); + } + } + }).done(function( responseText ) { + + // Save response for use in complete callback + response = arguments; + + // See if a selector was specified + self.html( selector ? + + // Create a dummy div to hold the results + jQuery("
        ") + + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append( responseText.replace( rscript, "" ) ) + + // Locate the specified elements + .find( selector ) : + + // If not, just inject the full result + responseText ); + + }); + + return this; +}; + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.on( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + if ( settings ) { + // Building a settings object + ajaxExtend( target, jQuery.ajaxSettings ); + } else { + // Extending ajaxSettings + settings = target; + target = jQuery.ajaxSettings; + } + ajaxExtend( target, settings ); + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": allTypes + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + context: true, + url: true + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // ifModified key + ifModifiedKey, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // The jqXHR state + state = 0, + // Default abort message + strAbort = "canceled", + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || strAbort; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + modified = jqXHR.getResponseHeader("Last-Modified"); + if ( modified ) { + jQuery.lastModified[ ifModifiedKey ] = modified; + } + modified = jqXHR.getResponseHeader("Etag"); + if ( modified ) { + jQuery.etag[ ifModifiedKey ] = modified; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + isSuccess = ajaxConvert( s, response ); + statusText = isSuccess.state; + success = isSuccess.data; + error = isSuccess.error; + isSuccess = !error; + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if ( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.add; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for ( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.always( tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( core_rspace ); + + // A cross-domain request is in order when we have a protocol:host:port mismatch + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] !== ajaxLocParts[ 1 ] || parts[ 2 ] !== ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( state === 2 ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already and return + return jqXHR.abort(); + + } + + // aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( state < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + throw e; + } + } + } + + return jqXHR; + }, + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields; + + // Fill responseXXX fields + for ( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + var conv, conv2, current, tmp, + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(), + prev = dataTypes[ 0 ], + converters = {}, + i = 0; + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + // Convert to each sequential dataType, tolerating list modification + for ( ; (current = dataTypes[++i]); ) { + + // There's only work to do if current dataType is non-auto + if ( current !== "*" ) { + + // Convert response if prev dataType is non-auto and differs from current + if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split(" "); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.splice( i--, 0, current ); + } + + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s["throws"] ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current }; + } + } + } + } + + // Update prev for next iteration + prev = current; + } + } + + return { state: "success", data: response }; +} +var oldCallbacks = [], + rquestion = /\?/, + rjsonp = /(=)\?(?=&|$)|\?\?/, + nonce = jQuery.now(); + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) ); + this[ callback ] = true; + return callback; + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var callbackName, overwritten, responseContainer, + data = s.data, + url = s.url, + hasCallback = s.jsonp !== false, + replaceInUrl = hasCallback && rjsonp.test( url ), + replaceInData = hasCallback && !replaceInUrl && typeof data === "string" && + !( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") && + rjsonp.test( data ); + + // Handle iff the expected data type is "jsonp" or we have a parameter to set + if ( s.dataTypes[ 0 ] === "jsonp" || replaceInUrl || replaceInData ) { + + // Get callback name, remembering preexisting value associated with it + callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ? + s.jsonpCallback() : + s.jsonpCallback; + overwritten = window[ callbackName ]; + + // Insert callback into url or form data + if ( replaceInUrl ) { + s.url = url.replace( rjsonp, "$1" + callbackName ); + } else if ( replaceInData ) { + s.data = data.replace( rjsonp, "$1" + callbackName ); + } else if ( hasCallback ) { + s.url += ( rquestion.test( url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName; + } + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( callbackName + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Install callback + window[ callbackName ] = function() { + responseContainer = arguments; + }; + + // Clean-up function (fires after converters) + jqXHR.always(function() { + // Restore preexisting value + window[ callbackName ] = overwritten; + + // Save back as free + if ( s[ callbackName ] ) { + // make sure that re-using the options doesn't screw things around + s.jsonpCallback = originalSettings.jsonpCallback; + + // save the callback name for future use + oldCallbacks.push( callbackName ); + } + + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( overwritten ) ) { + overwritten( responseContainer[ 0 ] ); + } + + responseContainer = overwritten = undefined; + }); + + // Delegate to script + return "script"; + } +}); +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); +var xhrCallbacks, + // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var handle, i, + xhr = s.xhr(); + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occurred + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + + // When requesting binary data, IE6-9 will throw an exception + // on any attempt to access responseText (#11426) + try { + responses.text = xhr.responseText; + } catch( e ) { + } + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + if ( !s.async ) { + // if we're in sync mode we fire the callback + callback(); + } else if ( xhr.readyState === 4 ) { + // (IE6 & IE7) if it's in cache and has been + // retrieved directly we need to fire the callback + setTimeout( callback, 0 ); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} +var fxNow, timerId, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = new RegExp( "^(?:([-+])=|)(" + core_pnum + ")([a-z%]*)$", "i" ), + rrun = /queueHooks$/, + animationPrefilters = [ defaultPrefilter ], + tweeners = { + "*": [function( prop, value ) { + var end, unit, + tween = this.createTween( prop, value ), + parts = rfxnum.exec( value ), + target = tween.cur(), + start = +target || 0, + scale = 1, + maxIterations = 20; + + if ( parts ) { + end = +parts[2]; + unit = parts[3] || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" && start ) { + // Iteratively approximate from a nonzero starting point + // Prefer the current property, because this process will be trivial if it uses the same units + // Fallback to end or a simple constant + start = jQuery.css( tween.elem, prop, true ) || end || 1; + + do { + // If previous iteration zeroed out, double until we get *something* + // Use a string for doubling factor so we don't accidentally see scale as unchanged below + scale = scale || ".5"; + + // Adjust and apply + start = start / scale; + jQuery.style( tween.elem, prop, start + unit ); + + // Update scale, tolerating zero or NaN from tween.cur() + // And breaking the loop if scale is unchanged or perfect, or if we've just had enough + } while ( scale !== (scale = tween.cur() / target) && scale !== 1 && --maxIterations ); + } + + tween.unit = unit; + tween.start = start; + // If a +=/-= token was provided, we're doing a relative animation + tween.end = parts[1] ? start + ( parts[1] + 1 ) * end : end; + } + return tween; + }] + }; + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout(function() { + fxNow = undefined; + }, 0 ); + return ( fxNow = jQuery.now() ); +} + +function createTweens( animation, props ) { + jQuery.each( props, function( prop, value ) { + var collection = ( tweeners[ prop ] || [] ).concat( tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( collection[ index ].call( animation, prop, value ) ) { + + // we're done with this property + return; + } + } + }); +} + +function Animation( elem, properties, options ) { + var result, + index = 0, + tweenerIndex = 0, + length = animationPrefilters.length, + deferred = jQuery.Deferred().always( function() { + // don't match elem in the :animated selector + delete tick.elem; + }), + tick = function() { + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + // archaic crash bug won't allow us to use 1 - ( 0.5 || 0 ) (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ]); + + if ( percent < 1 && length ) { + return remaining; + } else { + deferred.resolveWith( elem, [ animation ] ); + return false; + } + }, + animation = deferred.promise({ + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { specialEasing: {} }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end, easing ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + // if we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // resolve when we played the last frame + // otherwise, reject + if ( gotoEnd ) { + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + }), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length ; index++ ) { + result = animationPrefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + return result; + } + } + + createTweens( animation, props ); + + if ( jQuery.isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + jQuery.fx.timer( + jQuery.extend( tick, { + anim: animation, + queue: animation.opts.queue, + elem: elem + }) + ); + + // attach callbacks from options + return animation.progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = jQuery.camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( jQuery.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // not quite $.extend, this wont overwrite keys already present. + // also - reusing 'index' from above because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweener: function( props, callback ) { + if ( jQuery.isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.split(" "); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length ; index++ ) { + prop = props[ index ]; + tweeners[ prop ] = tweeners[ prop ] || []; + tweeners[ prop ].unshift( callback ); + } + }, + + prefilter: function( callback, prepend ) { + if ( prepend ) { + animationPrefilters.unshift( callback ); + } else { + animationPrefilters.push( callback ); + } + } +}); + +function defaultPrefilter( elem, props, opts ) { + var index, prop, value, length, dataShow, toggle, tween, hooks, oldfire, + anim = this, + style = elem.style, + orig = {}, + handled = [], + hidden = elem.nodeType && isHidden( elem ); + + // handle queue: false promises + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always(function() { + // doing this makes sure that the complete handler will be called + // before this completes + anim.always(function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + }); + }); + } + + // height/width overflow pass + if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height animated + if ( jQuery.css( elem, "display" ) === "inline" && + jQuery.css( elem, "float" ) === "none" ) { + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( !jQuery.support.inlineBlockNeedsLayout || css_defaultDisplay( elem.nodeName ) === "inline" ) { + style.display = "inline-block"; + + } else { + style.zoom = 1; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + if ( !jQuery.support.shrinkWrapBlocks ) { + anim.done(function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + }); + } + } + + + // show/hide pass + for ( index in props ) { + value = props[ index ]; + if ( rfxtypes.exec( value ) ) { + delete props[ index ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + continue; + } + handled.push( index ); + } + } + + length = handled.length; + if ( length ) { + dataShow = jQuery._data( elem, "fxshow" ) || jQuery._data( elem, "fxshow", {} ); + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + + // store state if its toggle - enables .stop().toggle() to "reverse" + if ( toggle ) { + dataShow.hidden = !hidden; + } + if ( hidden ) { + jQuery( elem ).show(); + } else { + anim.done(function() { + jQuery( elem ).hide(); + }); + } + anim.done(function() { + var prop; + jQuery.removeData( elem, "fxshow", true ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + }); + for ( index = 0 ; index < length ; index++ ) { + prop = handled[ index ]; + tween = anim.createTween( prop, hidden ? dataShow[ prop ] : 0 ); + orig[ prop ] = dataShow[ prop ] || jQuery.style( elem, prop ); + + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = tween.start; + if ( hidden ) { + tween.end = tween.start; + tween.start = prop === "width" || prop === "height" ? 1 : 0; + } + } + } + } +} + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || "swing"; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + if ( tween.elem[ tween.prop ] != null && + (!tween.elem.style || tween.elem.style[ tween.prop ] == null) ) { + return tween.elem[ tween.prop ]; + } + + // passing any value as a 4th parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails + // so, simple values such as "10px" are parsed to Float. + // complex values such as "rotate(1rad)" are returned as is. + result = jQuery.css( tween.elem, tween.prop, false, "" ); + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + // use step hook for back compat - use cssHook if its there - use .style if its + // available and use plain properties where available + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.style && ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || jQuery.cssHooks[ tween.prop ] ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Remove in 2.0 - this supports IE8's panic based approach +// to setting things on disconnected nodes + +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.each([ "toggle", "show", "hide" ], function( i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" || + // special check for .toggle( handler, handler, ... ) + ( !i && jQuery.isFunction( speed ) && jQuery.isFunction( easing ) ) ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +}); + +jQuery.fn.extend({ + fadeTo: function( speed, to, easing, callback ) { + + // show any hidden elements after setting opacity to 0 + return this.filter( isHidden ).css( "opacity", 0 ).show() + + // animate to the value specified + .end().animate({ opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations resolve immediately + if ( empty ) { + anim.stop( true ); + } + }; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each(function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = jQuery._data( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) { + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // start the next in the queue if the last step wasn't forced + // timers currently will call their complete callbacks, which will dequeue + // but only if they were gotoEnd + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + }); + } +}); + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + attrs = { height: type }, + i = 0; + + // if we include width, step value is 1 to do all cssExpand values, + // if we don't include width, step value is 2 to skip over Left and Right + includeWidth = includeWidth? 1 : 0; + for( ; i < 4 ; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show"), + slideUp: genFx("hide"), + slideToggle: genFx("toggle"), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; + + // normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p*Math.PI ) / 2; + } +}; + +jQuery.timers = []; +jQuery.fx = Tween.prototype.init; +jQuery.fx.tick = function() { + var timer, + timers = jQuery.timers, + i = 0; + + fxNow = jQuery.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + // Checks the timer has not already been removed + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + if ( timer() && jQuery.timers.push( timer ) && !timerId ) { + timerId = setInterval( jQuery.fx.tick, jQuery.fx.interval ); + } +}; + +jQuery.fx.interval = 13; + +jQuery.fx.stop = function() { + clearInterval( timerId ); + timerId = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + // Default speed + _default: 400 +}; + +// Back Compat <1.8 extension point +jQuery.fx.step = {}; + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} +var rroot = /^(?:body|html)$/i; + +jQuery.fn.offset = function( options ) { + if ( arguments.length ) { + return options === undefined ? + this : + this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + var docElem, body, win, clientTop, clientLeft, scrollTop, scrollLeft, + box = { top: 0, left: 0 }, + elem = this[ 0 ], + doc = elem && elem.ownerDocument; + + if ( !doc ) { + return; + } + + if ( (body = doc.body) === elem ) { + return jQuery.offset.bodyOffset( elem ); + } + + docElem = doc.documentElement; + + // Make sure it's not a disconnected DOM node + if ( !jQuery.contains( docElem, elem ) ) { + return box; + } + + // If we don't have gBCR, just use 0,0 rather than error + // BlackBerry 5, iOS 3 (original iPhone) + if ( typeof elem.getBoundingClientRect !== "undefined" ) { + box = elem.getBoundingClientRect(); + } + win = getWindow( doc ); + clientTop = docElem.clientTop || body.clientTop || 0; + clientLeft = docElem.clientLeft || body.clientLeft || 0; + scrollTop = win.pageYOffset || docElem.scrollTop; + scrollLeft = win.pageXOffset || docElem.scrollLeft; + return { + top: box.top + scrollTop - clientTop, + left: box.left + scrollLeft - clientLeft + }; +}; + +jQuery.offset = { + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if ( options.top != null ) { + props.top = ( options.top - curOffset.top ) + curTop; + } + if ( options.left != null ) { + props.left = ( options.left - curOffset.left ) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + + position: function() { + if ( !this[0] ) { + return; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent || document.body; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) { + var top = /Y/.test( prop ); + + jQuery.fn[ method ] = function( val ) { + return jQuery.access( this, function( elem, method, val ) { + var win = getWindow( elem ); + + if ( val === undefined ) { + return win ? (prop in win) ? win[ prop ] : + win.document.documentElement[ method ] : + elem[ method ]; + } + + if ( win ) { + win.scrollTo( + !top ? val : jQuery( win ).scrollLeft(), + top ? val : jQuery( win ).scrollTop() + ); + + } else { + elem[ method ] = val; + } + }, method, val, arguments.length, null ); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} +// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods +jQuery.each( { Height: "height", Width: "width" }, function( name, type ) { + jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, function( defaultExtra, funcName ) { + // margin is only for outerHeight, outerWidth + jQuery.fn[ funcName ] = function( margin, value ) { + var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ), + extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" ); + + return jQuery.access( this, function( elem, type, value ) { + var doc; + + if ( jQuery.isWindow( elem ) ) { + // As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there + // isn't a whole lot we can do. See pull request at this URL for discussion: + // https://github.com/jquery/jquery/pull/764 + return elem.document.documentElement[ "client" + name ]; + } + + // Get document width or height + if ( elem.nodeType === 9 ) { + doc = elem.documentElement; + + // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest + // unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it. + return Math.max( + elem.body[ "scroll" + name ], doc[ "scroll" + name ], + elem.body[ "offset" + name ], doc[ "offset" + name ], + doc[ "client" + name ] + ); + } + + return value === undefined ? + // Get width or height on the element, requesting but not forcing parseFloat + jQuery.css( elem, type, value, extra ) : + + // Set width or height on the element + jQuery.style( elem, type, value, extra ); + }, type, chainable ? margin : undefined, chainable, null ); + }; + }); +}); +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; + +// Expose jQuery as an AMD module, but only for AMD loaders that +// understand the issues with loading multiple versions of jQuery +// in a page that all might call define(). The loader will indicate +// they have special allowances for multiple jQuery versions by +// specifying define.amd.jQuery = true. Register as a named module, +// since jQuery can be concatenated with other files that may use define, +// but not use a proper concatenation script that understands anonymous +// AMD modules. A named AMD is safest and most robust way to register. +// Lowercase jquery is used because AMD module names are derived from +// file names, and jQuery is normally delivered in a lowercase file name. +// Do this after creating the global so that if an AMD module wants to call +// noConflict to hide this version of jQuery, it will work. +if ( typeof define === "function" && define.amd && define.amd.jQuery ) { + define( "jquery", [], function () { return jQuery; } ); +} + +})( window ); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/jquery.min.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/jquery.min.js new file mode 100644 index 0000000000..3883779527 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/jquery/jquery.min.js @@ -0,0 +1,2 @@ +/*! jQuery v1.8.3 jquery.com | jquery.org/license */ +(function(e,t){function _(e){var t=M[e]={};return v.each(e.split(y),function(e,n){t[n]=!0}),t}function H(e,n,r){if(r===t&&e.nodeType===1){var i="data-"+n.replace(P,"-$1").toLowerCase();r=e.getAttribute(i);if(typeof r=="string"){try{r=r==="true"?!0:r==="false"?!1:r==="null"?null:+r+""===r?+r:D.test(r)?v.parseJSON(r):r}catch(s){}v.data(e,n,r)}else r=t}return r}function B(e){var t;for(t in e){if(t==="data"&&v.isEmptyObject(e[t]))continue;if(t!=="toJSON")return!1}return!0}function et(){return!1}function tt(){return!0}function ut(e){return!e||!e.parentNode||e.parentNode.nodeType===11}function at(e,t){do e=e[t];while(e&&e.nodeType!==1);return e}function ft(e,t,n){t=t||0;if(v.isFunction(t))return v.grep(e,function(e,r){var i=!!t.call(e,r,e);return i===n});if(t.nodeType)return v.grep(e,function(e,r){return e===t===n});if(typeof t=="string"){var r=v.grep(e,function(e){return e.nodeType===1});if(it.test(t))return v.filter(t,r,!n);t=v.filter(t,r)}return v.grep(e,function(e,r){return v.inArray(e,t)>=0===n})}function lt(e){var t=ct.split("|"),n=e.createDocumentFragment();if(n.createElement)while(t.length)n.createElement(t.pop());return n}function Lt(e,t){return e.getElementsByTagName(t)[0]||e.appendChild(e.ownerDocument.createElement(t))}function At(e,t){if(t.nodeType!==1||!v.hasData(e))return;var n,r,i,s=v._data(e),o=v._data(t,s),u=s.events;if(u){delete o.handle,o.events={};for(n in u)for(r=0,i=u[n].length;r").appendTo(i.body),n=t.css("display");t.remove();if(n==="none"||n===""){Pt=i.body.appendChild(Pt||v.extend(i.createElement("iframe"),{frameBorder:0,width:0,height:0}));if(!Ht||!Pt.createElement)Ht=(Pt.contentWindow||Pt.contentDocument).document,Ht.write(""),Ht.close();t=Ht.body.appendChild(Ht.createElement(e)),n=Dt(t,"display"),i.body.removeChild(Pt)}return Wt[e]=n,n}function fn(e,t,n,r){var i;if(v.isArray(t))v.each(t,function(t,i){n||sn.test(e)?r(e,i):fn(e+"["+(typeof i=="object"?t:"")+"]",i,n,r)});else if(!n&&v.type(t)==="object")for(i in t)fn(e+"["+i+"]",t[i],n,r);else r(e,t)}function Cn(e){return function(t,n){typeof t!="string"&&(n=t,t="*");var r,i,s,o=t.toLowerCase().split(y),u=0,a=o.length;if(v.isFunction(n))for(;u)[^>]*$|#([\w\-]*)$)/,E=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,S=/^[\],:{}\s]*$/,x=/(?:^|:|,)(?:\s*\[)+/g,T=/\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,N=/"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g,C=/^-ms-/,k=/-([\da-z])/gi,L=function(e,t){return(t+"").toUpperCase()},A=function(){i.addEventListener?(i.removeEventListener("DOMContentLoaded",A,!1),v.ready()):i.readyState==="complete"&&(i.detachEvent("onreadystatechange",A),v.ready())},O={};v.fn=v.prototype={constructor:v,init:function(e,n,r){var s,o,u,a;if(!e)return this;if(e.nodeType)return this.context=this[0]=e,this.length=1,this;if(typeof e=="string"){e.charAt(0)==="<"&&e.charAt(e.length-1)===">"&&e.length>=3?s=[null,e,null]:s=w.exec(e);if(s&&(s[1]||!n)){if(s[1])return n=n instanceof v?n[0]:n,a=n&&n.nodeType?n.ownerDocument||n:i,e=v.parseHTML(s[1],a,!0),E.test(s[1])&&v.isPlainObject(n)&&this.attr.call(e,n,!0),v.merge(this,e);o=i.getElementById(s[2]);if(o&&o.parentNode){if(o.id!==s[2])return r.find(e);this.length=1,this[0]=o}return this.context=i,this.selector=e,this}return!n||n.jquery?(n||r).find(e):this.constructor(n).find(e)}return v.isFunction(e)?r.ready(e):(e.selector!==t&&(this.selector=e.selector,this.context=e.context),v.makeArray(e,this))},selector:"",jquery:"1.8.3",length:0,size:function(){return this.length},toArray:function(){return l.call(this)},get:function(e){return e==null?this.toArray():e<0?this[this.length+e]:this[e]},pushStack:function(e,t,n){var r=v.merge(this.constructor(),e);return r.prevObject=this,r.context=this.context,t==="find"?r.selector=this.selector+(this.selector?" ":"")+n:t&&(r.selector=this.selector+"."+t+"("+n+")"),r},each:function(e,t){return v.each(this,e,t)},ready:function(e){return v.ready.promise().done(e),this},eq:function(e){return e=+e,e===-1?this.slice(e):this.slice(e,e+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(l.apply(this,arguments),"slice",l.call(arguments).join(","))},map:function(e){return this.pushStack(v.map(this,function(t,n){return e.call(t,n,t)}))},end:function(){return this.prevObject||this.constructor(null)},push:f,sort:[].sort,splice:[].splice},v.fn.init.prototype=v.fn,v.extend=v.fn.extend=function(){var e,n,r,i,s,o,u=arguments[0]||{},a=1,f=arguments.length,l=!1;typeof u=="boolean"&&(l=u,u=arguments[1]||{},a=2),typeof u!="object"&&!v.isFunction(u)&&(u={}),f===a&&(u=this,--a);for(;a0)return;r.resolveWith(i,[v]),v.fn.trigger&&v(i).trigger("ready").off("ready")},isFunction:function(e){return v.type(e)==="function"},isArray:Array.isArray||function(e){return v.type(e)==="array"},isWindow:function(e){return e!=null&&e==e.window},isNumeric:function(e){return!isNaN(parseFloat(e))&&isFinite(e)},type:function(e){return e==null?String(e):O[h.call(e)]||"object"},isPlainObject:function(e){if(!e||v.type(e)!=="object"||e.nodeType||v.isWindow(e))return!1;try{if(e.constructor&&!p.call(e,"constructor")&&!p.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(n){return!1}var r;for(r in e);return r===t||p.call(e,r)},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},error:function(e){throw new Error(e)},parseHTML:function(e,t,n){var r;return!e||typeof e!="string"?null:(typeof t=="boolean"&&(n=t,t=0),t=t||i,(r=E.exec(e))?[t.createElement(r[1])]:(r=v.buildFragment([e],t,n?null:[]),v.merge([],(r.cacheable?v.clone(r.fragment):r.fragment).childNodes)))},parseJSON:function(t){if(!t||typeof t!="string")return null;t=v.trim(t);if(e.JSON&&e.JSON.parse)return e.JSON.parse(t);if(S.test(t.replace(T,"@").replace(N,"]").replace(x,"")))return(new Function("return "+t))();v.error("Invalid JSON: "+t)},parseXML:function(n){var r,i;if(!n||typeof n!="string")return null;try{e.DOMParser?(i=new DOMParser,r=i.parseFromString(n,"text/xml")):(r=new ActiveXObject("Microsoft.XMLDOM"),r.async="false",r.loadXML(n))}catch(s){r=t}return(!r||!r.documentElement||r.getElementsByTagName("parsererror").length)&&v.error("Invalid XML: "+n),r},noop:function(){},globalEval:function(t){t&&g.test(t)&&(e.execScript||function(t){e.eval.call(e,t)})(t)},camelCase:function(e){return e.replace(C,"ms-").replace(k,L)},nodeName:function(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()},each:function(e,n,r){var i,s=0,o=e.length,u=o===t||v.isFunction(e);if(r){if(u){for(i in e)if(n.apply(e[i],r)===!1)break}else for(;s0&&e[0]&&e[a-1]||a===0||v.isArray(e));if(f)for(;u-1)a.splice(n,1),i&&(n<=o&&o--,n<=u&&u--)}),this},has:function(e){return v.inArray(e,a)>-1},empty:function(){return a=[],this},disable:function(){return a=f=n=t,this},disabled:function(){return!a},lock:function(){return f=t,n||c.disable(),this},locked:function(){return!f},fireWith:function(e,t){return t=t||[],t=[e,t.slice?t.slice():t],a&&(!r||f)&&(i?f.push(t):l(t)),this},fire:function(){return c.fireWith(this,arguments),this},fired:function(){return!!r}};return c},v.extend({Deferred:function(e){var t=[["resolve","done",v.Callbacks("once memory"),"resolved"],["reject","fail",v.Callbacks("once memory"),"rejected"],["notify","progress",v.Callbacks("memory")]],n="pending",r={state:function(){return n},always:function(){return i.done(arguments).fail(arguments),this},then:function(){var e=arguments;return v.Deferred(function(n){v.each(t,function(t,r){var s=r[0],o=e[t];i[r[1]](v.isFunction(o)?function(){var e=o.apply(this,arguments);e&&v.isFunction(e.promise)?e.promise().done(n.resolve).fail(n.reject).progress(n.notify):n[s+"With"](this===i?n:this,[e])}:n[s])}),e=null}).promise()},promise:function(e){return e!=null?v.extend(e,r):r}},i={};return r.pipe=r.then,v.each(t,function(e,s){var o=s[2],u=s[3];r[s[1]]=o.add,u&&o.add(function(){n=u},t[e^1][2].disable,t[2][2].lock),i[s[0]]=o.fire,i[s[0]+"With"]=o.fireWith}),r.promise(i),e&&e.call(i,i),i},when:function(e){var t=0,n=l.call(arguments),r=n.length,i=r!==1||e&&v.isFunction(e.promise)?r:0,s=i===1?e:v.Deferred(),o=function(e,t,n){return function(r){t[e]=this,n[e]=arguments.length>1?l.call(arguments):r,n===u?s.notifyWith(t,n):--i||s.resolveWith(t,n)}},u,a,f;if(r>1){u=new Array(r),a=new Array(r),f=new Array(r);for(;t
        a",n=p.getElementsByTagName("*"),r=p.getElementsByTagName("a")[0];if(!n||!r||!n.length)return{};s=i.createElement("select"),o=s.appendChild(i.createElement("option")),u=p.getElementsByTagName("input")[0],r.style.cssText="top:1px;float:left;opacity:.5",t={leadingWhitespace:p.firstChild.nodeType===3,tbody:!p.getElementsByTagName("tbody").length,htmlSerialize:!!p.getElementsByTagName("link").length,style:/top/.test(r.getAttribute("style")),hrefNormalized:r.getAttribute("href")==="/a",opacity:/^0.5/.test(r.style.opacity),cssFloat:!!r.style.cssFloat,checkOn:u.value==="on",optSelected:o.selected,getSetAttribute:p.className!=="t",enctype:!!i.createElement("form").enctype,html5Clone:i.createElement("nav").cloneNode(!0).outerHTML!=="<:nav>",boxModel:i.compatMode==="CSS1Compat",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0,boxSizingReliable:!0,pixelPosition:!1},u.checked=!0,t.noCloneChecked=u.cloneNode(!0).checked,s.disabled=!0,t.optDisabled=!o.disabled;try{delete p.test}catch(d){t.deleteExpando=!1}!p.addEventListener&&p.attachEvent&&p.fireEvent&&(p.attachEvent("onclick",h=function(){t.noCloneEvent=!1}),p.cloneNode(!0).fireEvent("onclick"),p.detachEvent("onclick",h)),u=i.createElement("input"),u.value="t",u.setAttribute("type","radio"),t.radioValue=u.value==="t",u.setAttribute("checked","checked"),u.setAttribute("name","t"),p.appendChild(u),a=i.createDocumentFragment(),a.appendChild(p.lastChild),t.checkClone=a.cloneNode(!0).cloneNode(!0).lastChild.checked,t.appendChecked=u.checked,a.removeChild(u),a.appendChild(p);if(p.attachEvent)for(l in{submit:!0,change:!0,focusin:!0})f="on"+l,c=f in p,c||(p.setAttribute(f,"return;"),c=typeof p[f]=="function"),t[l+"Bubbles"]=c;return v(function(){var n,r,s,o,u="padding:0;margin:0;border:0;display:block;overflow:hidden;",a=i.getElementsByTagName("body")[0];if(!a)return;n=i.createElement("div"),n.style.cssText="visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px",a.insertBefore(n,a.firstChild),r=i.createElement("div"),n.appendChild(r),r.innerHTML="
        t
        ",s=r.getElementsByTagName("td"),s[0].style.cssText="padding:0;margin:0;border:0;display:none",c=s[0].offsetHeight===0,s[0].style.display="",s[1].style.display="none",t.reliableHiddenOffsets=c&&s[0].offsetHeight===0,r.innerHTML="",r.style.cssText="box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;",t.boxSizing=r.offsetWidth===4,t.doesNotIncludeMarginInBodyOffset=a.offsetTop!==1,e.getComputedStyle&&(t.pixelPosition=(e.getComputedStyle(r,null)||{}).top!=="1%",t.boxSizingReliable=(e.getComputedStyle(r,null)||{width:"4px"}).width==="4px",o=i.createElement("div"),o.style.cssText=r.style.cssText=u,o.style.marginRight=o.style.width="0",r.style.width="1px",r.appendChild(o),t.reliableMarginRight=!parseFloat((e.getComputedStyle(o,null)||{}).marginRight)),typeof r.style.zoom!="undefined"&&(r.innerHTML="",r.style.cssText=u+"width:1px;padding:1px;display:inline;zoom:1",t.inlineBlockNeedsLayout=r.offsetWidth===3,r.style.display="block",r.style.overflow="visible",r.innerHTML="
        ",r.firstChild.style.width="5px",t.shrinkWrapBlocks=r.offsetWidth!==3,n.style.zoom=1),a.removeChild(n),n=r=s=o=null}),a.removeChild(p),n=r=s=o=u=a=p=null,t}();var D=/(?:\{[\s\S]*\}|\[[\s\S]*\])$/,P=/([A-Z])/g;v.extend({cache:{},deletedIds:[],uuid:0,expando:"jQuery"+(v.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(e){return e=e.nodeType?v.cache[e[v.expando]]:e[v.expando],!!e&&!B(e)},data:function(e,n,r,i){if(!v.acceptData(e))return;var s,o,u=v.expando,a=typeof n=="string",f=e.nodeType,l=f?v.cache:e,c=f?e[u]:e[u]&&u;if((!c||!l[c]||!i&&!l[c].data)&&a&&r===t)return;c||(f?e[u]=c=v.deletedIds.pop()||v.guid++:c=u),l[c]||(l[c]={},f||(l[c].toJSON=v.noop));if(typeof n=="object"||typeof n=="function")i?l[c]=v.extend(l[c],n):l[c].data=v.extend(l[c].data,n);return s=l[c],i||(s.data||(s.data={}),s=s.data),r!==t&&(s[v.camelCase(n)]=r),a?(o=s[n],o==null&&(o=s[v.camelCase(n)])):o=s,o},removeData:function(e,t,n){if(!v.acceptData(e))return;var r,i,s,o=e.nodeType,u=o?v.cache:e,a=o?e[v.expando]:v.expando;if(!u[a])return;if(t){r=n?u[a]:u[a].data;if(r){v.isArray(t)||(t in r?t=[t]:(t=v.camelCase(t),t in r?t=[t]:t=t.split(" ")));for(i=0,s=t.length;i1,null,!1))},removeData:function(e){return this.each(function(){v.removeData(this,e)})}}),v.extend({queue:function(e,t,n){var r;if(e)return t=(t||"fx")+"queue",r=v._data(e,t),n&&(!r||v.isArray(n)?r=v._data(e,t,v.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){t=t||"fx";var n=v.queue(e,t),r=n.length,i=n.shift(),s=v._queueHooks(e,t),o=function(){v.dequeue(e,t)};i==="inprogress"&&(i=n.shift(),r--),i&&(t==="fx"&&n.unshift("inprogress"),delete s.stop,i.call(e,o,s)),!r&&s&&s.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return v._data(e,n)||v._data(e,n,{empty:v.Callbacks("once memory").add(function(){v.removeData(e,t+"queue",!0),v.removeData(e,n,!0)})})}}),v.fn.extend({queue:function(e,n){var r=2;return typeof e!="string"&&(n=e,e="fx",r--),arguments.length1)},removeAttr:function(e){return this.each(function(){v.removeAttr(this,e)})},prop:function(e,t){return v.access(this,v.prop,e,t,arguments.length>1)},removeProp:function(e){return e=v.propFix[e]||e,this.each(function(){try{this[e]=t,delete this[e]}catch(n){}})},addClass:function(e){var t,n,r,i,s,o,u;if(v.isFunction(e))return this.each(function(t){v(this).addClass(e.call(this,t,this.className))});if(e&&typeof e=="string"){t=e.split(y);for(n=0,r=this.length;n=0)r=r.replace(" "+n[s]+" "," ");i.className=e?v.trim(r):""}}}return this},toggleClass:function(e,t){var n=typeof e,r=typeof t=="boolean";return v.isFunction(e)?this.each(function(n){v(this).toggleClass(e.call(this,n,this.className,t),t)}):this.each(function(){if(n==="string"){var i,s=0,o=v(this),u=t,a=e.split(y);while(i=a[s++])u=r?u:!o.hasClass(i),o[u?"addClass":"removeClass"](i)}else if(n==="undefined"||n==="boolean")this.className&&v._data(this,"__className__",this.className),this.className=this.className||e===!1?"":v._data(this,"__className__")||""})},hasClass:function(e){var t=" "+e+" ",n=0,r=this.length;for(;n=0)return!0;return!1},val:function(e){var n,r,i,s=this[0];if(!arguments.length){if(s)return n=v.valHooks[s.type]||v.valHooks[s.nodeName.toLowerCase()],n&&"get"in n&&(r=n.get(s,"value"))!==t?r:(r=s.value,typeof r=="string"?r.replace(R,""):r==null?"":r);return}return i=v.isFunction(e),this.each(function(r){var s,o=v(this);if(this.nodeType!==1)return;i?s=e.call(this,r,o.val()):s=e,s==null?s="":typeof s=="number"?s+="":v.isArray(s)&&(s=v.map(s,function(e){return e==null?"":e+""})),n=v.valHooks[this.type]||v.valHooks[this.nodeName.toLowerCase()];if(!n||!("set"in n)||n.set(this,s,"value")===t)this.value=s})}}),v.extend({valHooks:{option:{get:function(e){var t=e.attributes.value;return!t||t.specified?e.value:e.text}},select:{get:function(e){var t,n,r=e.options,i=e.selectedIndex,s=e.type==="select-one"||i<0,o=s?null:[],u=s?i+1:r.length,a=i<0?u:s?i:0;for(;a=0}),n.length||(e.selectedIndex=-1),n}}},attrFn:{},attr:function(e,n,r,i){var s,o,u,a=e.nodeType;if(!e||a===3||a===8||a===2)return;if(i&&v.isFunction(v.fn[n]))return v(e)[n](r);if(typeof e.getAttribute=="undefined")return v.prop(e,n,r);u=a!==1||!v.isXMLDoc(e),u&&(n=n.toLowerCase(),o=v.attrHooks[n]||(X.test(n)?F:j));if(r!==t){if(r===null){v.removeAttr(e,n);return}return o&&"set"in o&&u&&(s=o.set(e,r,n))!==t?s:(e.setAttribute(n,r+""),r)}return o&&"get"in o&&u&&(s=o.get(e,n))!==null?s:(s=e.getAttribute(n),s===null?t:s)},removeAttr:function(e,t){var n,r,i,s,o=0;if(t&&e.nodeType===1){r=t.split(y);for(;o=0}})});var $=/^(?:textarea|input|select)$/i,J=/^([^\.]*|)(?:\.(.+)|)$/,K=/(?:^|\s)hover(\.\S+|)\b/,Q=/^key/,G=/^(?:mouse|contextmenu)|click/,Y=/^(?:focusinfocus|focusoutblur)$/,Z=function(e){return v.event.special.hover?e:e.replace(K,"mouseenter$1 mouseleave$1")};v.event={add:function(e,n,r,i,s){var o,u,a,f,l,c,h,p,d,m,g;if(e.nodeType===3||e.nodeType===8||!n||!r||!(o=v._data(e)))return;r.handler&&(d=r,r=d.handler,s=d.selector),r.guid||(r.guid=v.guid++),a=o.events,a||(o.events=a={}),u=o.handle,u||(o.handle=u=function(e){return typeof v=="undefined"||!!e&&v.event.triggered===e.type?t:v.event.dispatch.apply(u.elem,arguments)},u.elem=e),n=v.trim(Z(n)).split(" ");for(f=0;f=0&&(y=y.slice(0,-1),a=!0),y.indexOf(".")>=0&&(b=y.split("."),y=b.shift(),b.sort());if((!s||v.event.customEvent[y])&&!v.event.global[y])return;n=typeof n=="object"?n[v.expando]?n:new v.Event(y,n):new v.Event(y),n.type=y,n.isTrigger=!0,n.exclusive=a,n.namespace=b.join("."),n.namespace_re=n.namespace?new RegExp("(^|\\.)"+b.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,h=y.indexOf(":")<0?"on"+y:"";if(!s){u=v.cache;for(f in u)u[f].events&&u[f].events[y]&&v.event.trigger(n,r,u[f].handle.elem,!0);return}n.result=t,n.target||(n.target=s),r=r!=null?v.makeArray(r):[],r.unshift(n),p=v.event.special[y]||{};if(p.trigger&&p.trigger.apply(s,r)===!1)return;m=[[s,p.bindType||y]];if(!o&&!p.noBubble&&!v.isWindow(s)){g=p.delegateType||y,l=Y.test(g+y)?s:s.parentNode;for(c=s;l;l=l.parentNode)m.push([l,g]),c=l;c===(s.ownerDocument||i)&&m.push([c.defaultView||c.parentWindow||e,g])}for(f=0;f=0:v.find(h,this,null,[s]).length),u[h]&&f.push(c);f.length&&w.push({elem:s,matches:f})}d.length>m&&w.push({elem:this,matches:d.slice(m)});for(r=0;r0?this.on(t,null,e,n):this.trigger(t)},Q.test(t)&&(v.event.fixHooks[t]=v.event.keyHooks),G.test(t)&&(v.event.fixHooks[t]=v.event.mouseHooks)}),function(e,t){function nt(e,t,n,r){n=n||[],t=t||g;var i,s,a,f,l=t.nodeType;if(!e||typeof e!="string")return n;if(l!==1&&l!==9)return[];a=o(t);if(!a&&!r)if(i=R.exec(e))if(f=i[1]){if(l===9){s=t.getElementById(f);if(!s||!s.parentNode)return n;if(s.id===f)return n.push(s),n}else if(t.ownerDocument&&(s=t.ownerDocument.getElementById(f))&&u(t,s)&&s.id===f)return n.push(s),n}else{if(i[2])return S.apply(n,x.call(t.getElementsByTagName(e),0)),n;if((f=i[3])&&Z&&t.getElementsByClassName)return S.apply(n,x.call(t.getElementsByClassName(f),0)),n}return vt(e.replace(j,"$1"),t,n,r,a)}function rt(e){return function(t){var n=t.nodeName.toLowerCase();return n==="input"&&t.type===e}}function it(e){return function(t){var n=t.nodeName.toLowerCase();return(n==="input"||n==="button")&&t.type===e}}function st(e){return N(function(t){return t=+t,N(function(n,r){var i,s=e([],n.length,t),o=s.length;while(o--)n[i=s[o]]&&(n[i]=!(r[i]=n[i]))})})}function ot(e,t,n){if(e===t)return n;var r=e.nextSibling;while(r){if(r===t)return-1;r=r.nextSibling}return 1}function ut(e,t){var n,r,s,o,u,a,f,l=L[d][e+" "];if(l)return t?0:l.slice(0);u=e,a=[],f=i.preFilter;while(u){if(!n||(r=F.exec(u)))r&&(u=u.slice(r[0].length)||u),a.push(s=[]);n=!1;if(r=I.exec(u))s.push(n=new m(r.shift())),u=u.slice(n.length),n.type=r[0].replace(j," ");for(o in i.filter)(r=J[o].exec(u))&&(!f[o]||(r=f[o](r)))&&(s.push(n=new m(r.shift())),u=u.slice(n.length),n.type=o,n.matches=r);if(!n)break}return t?u.length:u?nt.error(e):L(e,a).slice(0)}function at(e,t,r){var i=t.dir,s=r&&t.dir==="parentNode",o=w++;return t.first?function(t,n,r){while(t=t[i])if(s||t.nodeType===1)return e(t,n,r)}:function(t,r,u){if(!u){var a,f=b+" "+o+" ",l=f+n;while(t=t[i])if(s||t.nodeType===1){if((a=t[d])===l)return t.sizset;if(typeof a=="string"&&a.indexOf(f)===0){if(t.sizset)return t}else{t[d]=l;if(e(t,r,u))return t.sizset=!0,t;t.sizset=!1}}}else while(t=t[i])if(s||t.nodeType===1)if(e(t,r,u))return t}}function ft(e){return e.length>1?function(t,n,r){var i=e.length;while(i--)if(!e[i](t,n,r))return!1;return!0}:e[0]}function lt(e,t,n,r,i){var s,o=[],u=0,a=e.length,f=t!=null;for(;u-1&&(s[f]=!(o[f]=c))}}else g=lt(g===o?g.splice(d,g.length):g),i?i(null,o,g,a):S.apply(o,g)})}function ht(e){var t,n,r,s=e.length,o=i.relative[e[0].type],u=o||i.relative[" "],a=o?1:0,f=at(function(e){return e===t},u,!0),l=at(function(e){return T.call(t,e)>-1},u,!0),h=[function(e,n,r){return!o&&(r||n!==c)||((t=n).nodeType?f(e,n,r):l(e,n,r))}];for(;a1&&ft(h),a>1&&e.slice(0,a-1).join("").replace(j,"$1"),n,a0,s=e.length>0,o=function(u,a,f,l,h){var p,d,v,m=[],y=0,w="0",x=u&&[],T=h!=null,N=c,C=u||s&&i.find.TAG("*",h&&a.parentNode||a),k=b+=N==null?1:Math.E;T&&(c=a!==g&&a,n=o.el);for(;(p=C[w])!=null;w++){if(s&&p){for(d=0;v=e[d];d++)if(v(p,a,f)){l.push(p);break}T&&(b=k,n=++o.el)}r&&((p=!v&&p)&&y--,u&&x.push(p))}y+=w;if(r&&w!==y){for(d=0;v=t[d];d++)v(x,m,a,f);if(u){if(y>0)while(w--)!x[w]&&!m[w]&&(m[w]=E.call(l));m=lt(m)}S.apply(l,m),T&&!u&&m.length>0&&y+t.length>1&&nt.uniqueSort(l)}return T&&(b=k,c=N),x};return o.el=0,r?N(o):o}function dt(e,t,n){var r=0,i=t.length;for(;r2&&(f=u[0]).type==="ID"&&t.nodeType===9&&!s&&i.relative[u[1].type]){t=i.find.ID(f.matches[0].replace($,""),t,s)[0];if(!t)return n;e=e.slice(u.shift().length)}for(o=J.POS.test(e)?-1:u.length-1;o>=0;o--){f=u[o];if(i.relative[l=f.type])break;if(c=i.find[l])if(r=c(f.matches[0].replace($,""),z.test(u[0].type)&&t.parentNode||t,s)){u.splice(o,1),e=r.length&&u.join("");if(!e)return S.apply(n,x.call(r,0)),n;break}}}return a(e,h)(r,t,s,n,z.test(e)),n}function mt(){}var n,r,i,s,o,u,a,f,l,c,h=!0,p="undefined",d=("sizcache"+Math.random()).replace(".",""),m=String,g=e.document,y=g.documentElement,b=0,w=0,E=[].pop,S=[].push,x=[].slice,T=[].indexOf||function(e){var t=0,n=this.length;for(;ti.cacheLength&&delete e[t.shift()],e[n+" "]=r},e)},k=C(),L=C(),A=C(),O="[\\x20\\t\\r\\n\\f]",M="(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+",_=M.replace("w","w#"),D="([*^$|!~]?=)",P="\\["+O+"*("+M+")"+O+"*(?:"+D+O+"*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|("+_+")|)|)"+O+"*\\]",H=":("+M+")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|([^()[\\]]*|(?:(?:"+P+")|[^:]|\\\\.)*|.*))\\)|)",B=":(even|odd|eq|gt|lt|nth|first|last)(?:\\("+O+"*((?:-\\d)?\\d*)"+O+"*\\)|)(?=[^-]|$)",j=new RegExp("^"+O+"+|((?:^|[^\\\\])(?:\\\\.)*)"+O+"+$","g"),F=new RegExp("^"+O+"*,"+O+"*"),I=new RegExp("^"+O+"*([\\x20\\t\\r\\n\\f>+~])"+O+"*"),q=new RegExp(H),R=/^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/,U=/^:not/,z=/[\x20\t\r\n\f]*[+~]/,W=/:not\($/,X=/h\d/i,V=/input|select|textarea|button/i,$=/\\(?!\\)/g,J={ID:new RegExp("^#("+M+")"),CLASS:new RegExp("^\\.("+M+")"),NAME:new RegExp("^\\[name=['\"]?("+M+")['\"]?\\]"),TAG:new RegExp("^("+M.replace("w","w*")+")"),ATTR:new RegExp("^"+P),PSEUDO:new RegExp("^"+H),POS:new RegExp(B,"i"),CHILD:new RegExp("^:(only|nth|first|last)-child(?:\\("+O+"*(even|odd|(([+-]|)(\\d*)n|)"+O+"*(?:([+-]|)"+O+"*(\\d+)|))"+O+"*\\)|)","i"),needsContext:new RegExp("^"+O+"*[>+~]|"+B,"i")},K=function(e){var t=g.createElement("div");try{return e(t)}catch(n){return!1}finally{t=null}},Q=K(function(e){return e.appendChild(g.createComment("")),!e.getElementsByTagName("*").length}),G=K(function(e){return e.innerHTML="",e.firstChild&&typeof e.firstChild.getAttribute!==p&&e.firstChild.getAttribute("href")==="#"}),Y=K(function(e){e.innerHTML="";var t=typeof e.lastChild.getAttribute("multiple");return t!=="boolean"&&t!=="string"}),Z=K(function(e){return e.innerHTML="",!e.getElementsByClassName||!e.getElementsByClassName("e").length?!1:(e.lastChild.className="e",e.getElementsByClassName("e").length===2)}),et=K(function(e){e.id=d+0,e.innerHTML="
        ",y.insertBefore(e,y.firstChild);var t=g.getElementsByName&&g.getElementsByName(d).length===2+g.getElementsByName(d+0).length;return r=!g.getElementById(d),y.removeChild(e),t});try{x.call(y.childNodes,0)[0].nodeType}catch(tt){x=function(e){var t,n=[];for(;t=this[e];e++)n.push(t);return n}}nt.matches=function(e,t){return nt(e,null,null,t)},nt.matchesSelector=function(e,t){return nt(t,null,null,[e]).length>0},s=nt.getText=function(e){var t,n="",r=0,i=e.nodeType;if(i){if(i===1||i===9||i===11){if(typeof e.textContent=="string")return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=s(e)}else if(i===3||i===4)return e.nodeValue}else for(;t=e[r];r++)n+=s(t);return n},o=nt.isXML=function(e){var t=e&&(e.ownerDocument||e).documentElement;return t?t.nodeName!=="HTML":!1},u=nt.contains=y.contains?function(e,t){var n=e.nodeType===9?e.documentElement:e,r=t&&t.parentNode;return e===r||!!(r&&r.nodeType===1&&n.contains&&n.contains(r))}:y.compareDocumentPosition?function(e,t){return t&&!!(e.compareDocumentPosition(t)&16)}:function(e,t){while(t=t.parentNode)if(t===e)return!0;return!1},nt.attr=function(e,t){var n,r=o(e);return r||(t=t.toLowerCase()),(n=i.attrHandle[t])?n(e):r||Y?e.getAttribute(t):(n=e.getAttributeNode(t),n?typeof e[t]=="boolean"?e[t]?t:null:n.specified?n.value:null:null)},i=nt.selectors={cacheLength:50,createPseudo:N,match:J,attrHandle:G?{}:{href:function(e){return e.getAttribute("href",2)},type:function(e){return e.getAttribute("type")}},find:{ID:r?function(e,t,n){if(typeof t.getElementById!==p&&!n){var r=t.getElementById(e);return r&&r.parentNode?[r]:[]}}:function(e,n,r){if(typeof n.getElementById!==p&&!r){var i=n.getElementById(e);return i?i.id===e||typeof i.getAttributeNode!==p&&i.getAttributeNode("id").value===e?[i]:t:[]}},TAG:Q?function(e,t){if(typeof t.getElementsByTagName!==p)return t.getElementsByTagName(e)}:function(e,t){var n=t.getElementsByTagName(e);if(e==="*"){var r,i=[],s=0;for(;r=n[s];s++)r.nodeType===1&&i.push(r);return i}return n},NAME:et&&function(e,t){if(typeof t.getElementsByName!==p)return t.getElementsByName(name)},CLASS:Z&&function(e,t,n){if(typeof t.getElementsByClassName!==p&&!n)return t.getElementsByClassName(e)}},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace($,""),e[3]=(e[4]||e[5]||"").replace($,""),e[2]==="~="&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),e[1]==="nth"?(e[2]||nt.error(e[0]),e[3]=+(e[3]?e[4]+(e[5]||1):2*(e[2]==="even"||e[2]==="odd")),e[4]=+(e[6]+e[7]||e[2]==="odd")):e[2]&&nt.error(e[0]),e},PSEUDO:function(e){var t,n;if(J.CHILD.test(e[0]))return null;if(e[3])e[2]=e[3];else if(t=e[4])q.test(t)&&(n=ut(t,!0))&&(n=t.indexOf(")",t.length-n)-t.length)&&(t=t.slice(0,n),e[0]=e[0].slice(0,n)),e[2]=t;return e.slice(0,3)}},filter:{ID:r?function(e){return e=e.replace($,""),function(t){return t.getAttribute("id")===e}}:function(e){return e=e.replace($,""),function(t){var n=typeof t.getAttributeNode!==p&&t.getAttributeNode("id");return n&&n.value===e}},TAG:function(e){return e==="*"?function(){return!0}:(e=e.replace($,"").toLowerCase(),function(t){return t.nodeName&&t.nodeName.toLowerCase()===e})},CLASS:function(e){var t=k[d][e+" "];return t||(t=new RegExp("(^|"+O+")"+e+"("+O+"|$)"))&&k(e,function(e){return t.test(e.className||typeof e.getAttribute!==p&&e.getAttribute("class")||"")})},ATTR:function(e,t,n){return function(r,i){var s=nt.attr(r,e);return s==null?t==="!=":t?(s+="",t==="="?s===n:t==="!="?s!==n:t==="^="?n&&s.indexOf(n)===0:t==="*="?n&&s.indexOf(n)>-1:t==="$="?n&&s.substr(s.length-n.length)===n:t==="~="?(" "+s+" ").indexOf(n)>-1:t==="|="?s===n||s.substr(0,n.length+1)===n+"-":!1):!0}},CHILD:function(e,t,n,r){return e==="nth"?function(e){var t,i,s=e.parentNode;if(n===1&&r===0)return!0;if(s){i=0;for(t=s.firstChild;t;t=t.nextSibling)if(t.nodeType===1){i++;if(e===t)break}}return i-=r,i===n||i%n===0&&i/n>=0}:function(t){var n=t;switch(e){case"only":case"first":while(n=n.previousSibling)if(n.nodeType===1)return!1;if(e==="first")return!0;n=t;case"last":while(n=n.nextSibling)if(n.nodeType===1)return!1;return!0}}},PSEUDO:function(e,t){var n,r=i.pseudos[e]||i.setFilters[e.toLowerCase()]||nt.error("unsupported pseudo: "+e);return r[d]?r(t):r.length>1?(n=[e,e,"",t],i.setFilters.hasOwnProperty(e.toLowerCase())?N(function(e,n){var i,s=r(e,t),o=s.length;while(o--)i=T.call(e,s[o]),e[i]=!(n[i]=s[o])}):function(e){return r(e,0,n)}):r}},pseudos:{not:N(function(e){var t=[],n=[],r=a(e.replace(j,"$1"));return r[d]?N(function(e,t,n,i){var s,o=r(e,null,i,[]),u=e.length;while(u--)if(s=o[u])e[u]=!(t[u]=s)}):function(e,i,s){return t[0]=e,r(t,null,s,n),!n.pop()}}),has:N(function(e){return function(t){return nt(e,t).length>0}}),contains:N(function(e){return function(t){return(t.textContent||t.innerText||s(t)).indexOf(e)>-1}}),enabled:function(e){return e.disabled===!1},disabled:function(e){return e.disabled===!0},checked:function(e){var t=e.nodeName.toLowerCase();return t==="input"&&!!e.checked||t==="option"&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,e.selected===!0},parent:function(e){return!i.pseudos.empty(e)},empty:function(e){var t;e=e.firstChild;while(e){if(e.nodeName>"@"||(t=e.nodeType)===3||t===4)return!1;e=e.nextSibling}return!0},header:function(e){return X.test(e.nodeName)},text:function(e){var t,n;return e.nodeName.toLowerCase()==="input"&&(t=e.type)==="text"&&((n=e.getAttribute("type"))==null||n.toLowerCase()===t)},radio:rt("radio"),checkbox:rt("checkbox"),file:rt("file"),password:rt("password"),image:rt("image"),submit:it("submit"),reset:it("reset"),button:function(e){var t=e.nodeName.toLowerCase();return t==="input"&&e.type==="button"||t==="button"},input:function(e){return V.test(e.nodeName)},focus:function(e){var t=e.ownerDocument;return e===t.activeElement&&(!t.hasFocus||t.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},active:function(e){return e===e.ownerDocument.activeElement},first:st(function(){return[0]}),last:st(function(e,t){return[t-1]}),eq:st(function(e,t,n){return[n<0?n+t:n]}),even:st(function(e,t){for(var n=0;n=0;)e.push(r);return e}),gt:st(function(e,t,n){for(var r=n<0?n+t:n;++r",e.querySelectorAll("[selected]").length||i.push("\\["+O+"*(?:checked|disabled|ismap|multiple|readonly|selected|value)"),e.querySelectorAll(":checked").length||i.push(":checked")}),K(function(e){e.innerHTML="

        ",e.querySelectorAll("[test^='']").length&&i.push("[*^$]="+O+"*(?:\"\"|'')"),e.innerHTML="",e.querySelectorAll(":enabled").length||i.push(":enabled",":disabled")}),i=new RegExp(i.join("|")),vt=function(e,r,s,o,u){if(!o&&!u&&!i.test(e)){var a,f,l=!0,c=d,h=r,p=r.nodeType===9&&e;if(r.nodeType===1&&r.nodeName.toLowerCase()!=="object"){a=ut(e),(l=r.getAttribute("id"))?c=l.replace(n,"\\$&"):r.setAttribute("id",c),c="[id='"+c+"'] ",f=a.length;while(f--)a[f]=c+a[f].join("");h=z.test(e)&&r.parentNode||r,p=a.join(",")}if(p)try{return S.apply(s,x.call(h.querySelectorAll(p),0)),s}catch(v){}finally{l||r.removeAttribute("id")}}return t(e,r,s,o,u)},u&&(K(function(t){e=u.call(t,"div");try{u.call(t,"[test!='']:sizzle"),s.push("!=",H)}catch(n){}}),s=new RegExp(s.join("|")),nt.matchesSelector=function(t,n){n=n.replace(r,"='$1']");if(!o(t)&&!s.test(n)&&!i.test(n))try{var a=u.call(t,n);if(a||e||t.document&&t.document.nodeType!==11)return a}catch(f){}return nt(n,null,null,[t]).length>0})}(),i.pseudos.nth=i.pseudos.eq,i.filters=mt.prototype=i.pseudos,i.setFilters=new mt,nt.attr=v.attr,v.find=nt,v.expr=nt.selectors,v.expr[":"]=v.expr.pseudos,v.unique=nt.uniqueSort,v.text=nt.getText,v.isXMLDoc=nt.isXML,v.contains=nt.contains}(e);var nt=/Until$/,rt=/^(?:parents|prev(?:Until|All))/,it=/^.[^:#\[\.,]*$/,st=v.expr.match.needsContext,ot={children:!0,contents:!0,next:!0,prev:!0};v.fn.extend({find:function(e){var t,n,r,i,s,o,u=this;if(typeof e!="string")return v(e).filter(function(){for(t=0,n=u.length;t0)for(i=r;i=0:v.filter(e,this).length>0:this.filter(e).length>0)},closest:function(e,t){var n,r=0,i=this.length,s=[],o=st.test(e)||typeof e!="string"?v(e,t||this.context):0;for(;r-1:v.find.matchesSelector(n,e)){s.push(n);break}n=n.parentNode}}return s=s.length>1?v.unique(s):s,this.pushStack(s,"closest",e)},index:function(e){return e?typeof e=="string"?v.inArray(this[0],v(e)):v.inArray(e.jquery?e[0]:e,this):this[0]&&this[0].parentNode?this.prevAll().length:-1},add:function(e,t){var n=typeof e=="string"?v(e,t):v.makeArray(e&&e.nodeType?[e]:e),r=v.merge(this.get(),n);return this.pushStack(ut(n[0])||ut(r[0])?r:v.unique(r))},addBack:function(e){return this.add(e==null?this.prevObject:this.prevObject.filter(e))}}),v.fn.andSelf=v.fn.addBack,v.each({parent:function(e){var t=e.parentNode;return t&&t.nodeType!==11?t:null},parents:function(e){return v.dir(e,"parentNode")},parentsUntil:function(e,t,n){return v.dir(e,"parentNode",n)},next:function(e){return at(e,"nextSibling")},prev:function(e){return at(e,"previousSibling")},nextAll:function(e){return v.dir(e,"nextSibling")},prevAll:function(e){return v.dir(e,"previousSibling")},nextUntil:function(e,t,n){return v.dir(e,"nextSibling",n)},prevUntil:function(e,t,n){return v.dir(e,"previousSibling",n)},siblings:function(e){return v.sibling((e.parentNode||{}).firstChild,e)},children:function(e){return v.sibling(e.firstChild)},contents:function(e){return v.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:v.merge([],e.childNodes)}},function(e,t){v.fn[e]=function(n,r){var i=v.map(this,t,n);return nt.test(e)||(r=n),r&&typeof r=="string"&&(i=v.filter(r,i)),i=this.length>1&&!ot[e]?v.unique(i):i,this.length>1&&rt.test(e)&&(i=i.reverse()),this.pushStack(i,e,l.call(arguments).join(","))}}),v.extend({filter:function(e,t,n){return n&&(e=":not("+e+")"),t.length===1?v.find.matchesSelector(t[0],e)?[t[0]]:[]:v.find.matches(e,t)},dir:function(e,n,r){var i=[],s=e[n];while(s&&s.nodeType!==9&&(r===t||s.nodeType!==1||!v(s).is(r)))s.nodeType===1&&i.push(s),s=s[n];return i},sibling:function(e,t){var n=[];for(;e;e=e.nextSibling)e.nodeType===1&&e!==t&&n.push(e);return n}});var ct="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",ht=/ jQuery\d+="(?:null|\d+)"/g,pt=/^\s+/,dt=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,vt=/<([\w:]+)/,mt=/]","i"),Et=/^(?:checkbox|radio)$/,St=/checked\s*(?:[^=]|=\s*.checked.)/i,xt=/\/(java|ecma)script/i,Tt=/^\s*\s*$/g,Nt={option:[1,""],legend:[1,"
        ","
        "],thead:[1,"","
        "],tr:[2,"","
        "],td:[3,"","
        "],col:[2,"","
        "],area:[1,"",""],_default:[0,"",""]},Ct=lt(i),kt=Ct.appendChild(i.createElement("div"));Nt.optgroup=Nt.option,Nt.tbody=Nt.tfoot=Nt.colgroup=Nt.caption=Nt.thead,Nt.th=Nt.td,v.support.htmlSerialize||(Nt._default=[1,"X
        ","
        "]),v.fn.extend({text:function(e){return v.access(this,function(e){return e===t?v.text(this):this.empty().append((this[0]&&this[0].ownerDocument||i).createTextNode(e))},null,e,arguments.length)},wrapAll:function(e){if(v.isFunction(e))return this.each(function(t){v(this).wrapAll(e.call(this,t))});if(this[0]){var t=v(e,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){var e=this;while(e.firstChild&&e.firstChild.nodeType===1)e=e.firstChild;return e}).append(this)}return this},wrapInner:function(e){return v.isFunction(e)?this.each(function(t){v(this).wrapInner(e.call(this,t))}):this.each(function(){var t=v(this),n=t.contents();n.length?n.wrapAll(e):t.append(e)})},wrap:function(e){var t=v.isFunction(e);return this.each(function(n){v(this).wrapAll(t?e.call(this,n):e)})},unwrap:function(){return this.parent().each(function(){v.nodeName(this,"body")||v(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(e){(this.nodeType===1||this.nodeType===11)&&this.appendChild(e)})},prepend:function(){return this.domManip(arguments,!0,function(e){(this.nodeType===1||this.nodeType===11)&&this.insertBefore(e,this.firstChild)})},before:function(){if(!ut(this[0]))return this.domManip(arguments,!1,function(e){this.parentNode.insertBefore(e,this)});if(arguments.length){var e=v.clean(arguments);return this.pushStack(v.merge(e,this),"before",this.selector)}},after:function(){if(!ut(this[0]))return this.domManip(arguments,!1,function(e){this.parentNode.insertBefore(e,this.nextSibling)});if(arguments.length){var e=v.clean(arguments);return this.pushStack(v.merge(this,e),"after",this.selector)}},remove:function(e,t){var n,r=0;for(;(n=this[r])!=null;r++)if(!e||v.filter(e,[n]).length)!t&&n.nodeType===1&&(v.cleanData(n.getElementsByTagName("*")),v.cleanData([n])),n.parentNode&&n.parentNode.removeChild(n);return this},empty:function(){var e,t=0;for(;(e=this[t])!=null;t++){e.nodeType===1&&v.cleanData(e.getElementsByTagName("*"));while(e.firstChild)e.removeChild(e.firstChild)}return this},clone:function(e,t){return e=e==null?!1:e,t=t==null?e:t,this.map(function(){return v.clone(this,e,t)})},html:function(e){return v.access(this,function(e){var n=this[0]||{},r=0,i=this.length;if(e===t)return n.nodeType===1?n.innerHTML.replace(ht,""):t;if(typeof e=="string"&&!yt.test(e)&&(v.support.htmlSerialize||!wt.test(e))&&(v.support.leadingWhitespace||!pt.test(e))&&!Nt[(vt.exec(e)||["",""])[1].toLowerCase()]){e=e.replace(dt,"<$1>");try{for(;r1&&typeof f=="string"&&St.test(f))return this.each(function(){v(this).domManip(e,n,r)});if(v.isFunction(f))return this.each(function(i){var s=v(this);e[0]=f.call(this,i,n?s.html():t),s.domManip(e,n,r)});if(this[0]){i=v.buildFragment(e,this,l),o=i.fragment,s=o.firstChild,o.childNodes.length===1&&(o=s);if(s){n=n&&v.nodeName(s,"tr");for(u=i.cacheable||c-1;a0?this.clone(!0):this).get(),v(o[i])[t](r),s=s.concat(r);return this.pushStack(s,e,o.selector)}}),v.extend({clone:function(e,t,n){var r,i,s,o;v.support.html5Clone||v.isXMLDoc(e)||!wt.test("<"+e.nodeName+">")?o=e.cloneNode(!0):(kt.innerHTML=e.outerHTML,kt.removeChild(o=kt.firstChild));if((!v.support.noCloneEvent||!v.support.noCloneChecked)&&(e.nodeType===1||e.nodeType===11)&&!v.isXMLDoc(e)){Ot(e,o),r=Mt(e),i=Mt(o);for(s=0;r[s];++s)i[s]&&Ot(r[s],i[s])}if(t){At(e,o);if(n){r=Mt(e),i=Mt(o);for(s=0;r[s];++s)At(r[s],i[s])}}return r=i=null,o},clean:function(e,t,n,r){var s,o,u,a,f,l,c,h,p,d,m,g,y=t===i&&Ct,b=[];if(!t||typeof t.createDocumentFragment=="undefined")t=i;for(s=0;(u=e[s])!=null;s++){typeof u=="number"&&(u+="");if(!u)continue;if(typeof u=="string")if(!gt.test(u))u=t.createTextNode(u);else{y=y||lt(t),c=t.createElement("div"),y.appendChild(c),u=u.replace(dt,"<$1>"),a=(vt.exec(u)||["",""])[1].toLowerCase(),f=Nt[a]||Nt._default,l=f[0],c.innerHTML=f[1]+u+f[2];while(l--)c=c.lastChild;if(!v.support.tbody){h=mt.test(u),p=a==="table"&&!h?c.firstChild&&c.firstChild.childNodes:f[1]===""&&!h?c.childNodes:[];for(o=p.length-1;o>=0;--o)v.nodeName(p[o],"tbody")&&!p[o].childNodes.length&&p[o].parentNode.removeChild(p[o])}!v.support.leadingWhitespace&&pt.test(u)&&c.insertBefore(t.createTextNode(pt.exec(u)[0]),c.firstChild),u=c.childNodes,c.parentNode.removeChild(c)}u.nodeType?b.push(u):v.merge(b,u)}c&&(u=c=y=null);if(!v.support.appendChecked)for(s=0;(u=b[s])!=null;s++)v.nodeName(u,"input")?_t(u):typeof u.getElementsByTagName!="undefined"&&v.grep(u.getElementsByTagName("input"),_t);if(n){m=function(e){if(!e.type||xt.test(e.type))return r?r.push(e.parentNode?e.parentNode.removeChild(e):e):n.appendChild(e)};for(s=0;(u=b[s])!=null;s++)if(!v.nodeName(u,"script")||!m(u))n.appendChild(u),typeof u.getElementsByTagName!="undefined"&&(g=v.grep(v.merge([],u.getElementsByTagName("script")),m),b.splice.apply(b,[s+1,0].concat(g)),s+=g.length)}return b},cleanData:function(e,t){var n,r,i,s,o=0,u=v.expando,a=v.cache,f=v.support.deleteExpando,l=v.event.special;for(;(i=e[o])!=null;o++)if(t||v.acceptData(i)){r=i[u],n=r&&a[r];if(n){if(n.events)for(s in n.events)l[s]?v.event.remove(i,s):v.removeEvent(i,s,n.handle);a[r]&&(delete a[r],f?delete i[u]:i.removeAttribute?i.removeAttribute(u):i[u]=null,v.deletedIds.push(r))}}}}),function(){var e,t;v.uaMatch=function(e){e=e.toLowerCase();var t=/(chrome)[ \/]([\w.]+)/.exec(e)||/(webkit)[ \/]([\w.]+)/.exec(e)||/(opera)(?:.*version|)[ \/]([\w.]+)/.exec(e)||/(msie) ([\w.]+)/.exec(e)||e.indexOf("compatible")<0&&/(mozilla)(?:.*? rv:([\w.]+)|)/.exec(e)||[];return{browser:t[1]||"",version:t[2]||"0"}},e=v.uaMatch(o.userAgent),t={},e.browser&&(t[e.browser]=!0,t.version=e.version),t.chrome?t.webkit=!0:t.webkit&&(t.safari=!0),v.browser=t,v.sub=function(){function e(t,n){return new e.fn.init(t,n)}v.extend(!0,e,this),e.superclass=this,e.fn=e.prototype=this(),e.fn.constructor=e,e.sub=this.sub,e.fn.init=function(r,i){return i&&i instanceof v&&!(i instanceof e)&&(i=e(i)),v.fn.init.call(this,r,i,t)},e.fn.init.prototype=e.fn;var t=e(i);return e}}();var Dt,Pt,Ht,Bt=/alpha\([^)]*\)/i,jt=/opacity=([^)]*)/,Ft=/^(top|right|bottom|left)$/,It=/^(none|table(?!-c[ea]).+)/,qt=/^margin/,Rt=new RegExp("^("+m+")(.*)$","i"),Ut=new RegExp("^("+m+")(?!px)[a-z%]+$","i"),zt=new RegExp("^([-+])=("+m+")","i"),Wt={BODY:"block"},Xt={position:"absolute",visibility:"hidden",display:"block"},Vt={letterSpacing:0,fontWeight:400},$t=["Top","Right","Bottom","Left"],Jt=["Webkit","O","Moz","ms"],Kt=v.fn.toggle;v.fn.extend({css:function(e,n){return v.access(this,function(e,n,r){return r!==t?v.style(e,n,r):v.css(e,n)},e,n,arguments.length>1)},show:function(){return Yt(this,!0)},hide:function(){return Yt(this)},toggle:function(e,t){var n=typeof e=="boolean";return v.isFunction(e)&&v.isFunction(t)?Kt.apply(this,arguments):this.each(function(){(n?e:Gt(this))?v(this).show():v(this).hide()})}}),v.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=Dt(e,"opacity");return n===""?"1":n}}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":v.support.cssFloat?"cssFloat":"styleFloat"},style:function(e,n,r,i){if(!e||e.nodeType===3||e.nodeType===8||!e.style)return;var s,o,u,a=v.camelCase(n),f=e.style;n=v.cssProps[a]||(v.cssProps[a]=Qt(f,a)),u=v.cssHooks[n]||v.cssHooks[a];if(r===t)return u&&"get"in u&&(s=u.get(e,!1,i))!==t?s:f[n];o=typeof r,o==="string"&&(s=zt.exec(r))&&(r=(s[1]+1)*s[2]+parseFloat(v.css(e,n)),o="number");if(r==null||o==="number"&&isNaN(r))return;o==="number"&&!v.cssNumber[a]&&(r+="px");if(!u||!("set"in u)||(r=u.set(e,r,i))!==t)try{f[n]=r}catch(l){}},css:function(e,n,r,i){var s,o,u,a=v.camelCase(n);return n=v.cssProps[a]||(v.cssProps[a]=Qt(e.style,a)),u=v.cssHooks[n]||v.cssHooks[a],u&&"get"in u&&(s=u.get(e,!0,i)),s===t&&(s=Dt(e,n)),s==="normal"&&n in Vt&&(s=Vt[n]),r||i!==t?(o=parseFloat(s),r||v.isNumeric(o)?o||0:s):s},swap:function(e,t,n){var r,i,s={};for(i in t)s[i]=e.style[i],e.style[i]=t[i];r=n.call(e);for(i in t)e.style[i]=s[i];return r}}),e.getComputedStyle?Dt=function(t,n){var r,i,s,o,u=e.getComputedStyle(t,null),a=t.style;return u&&(r=u.getPropertyValue(n)||u[n],r===""&&!v.contains(t.ownerDocument,t)&&(r=v.style(t,n)),Ut.test(r)&&qt.test(n)&&(i=a.width,s=a.minWidth,o=a.maxWidth,a.minWidth=a.maxWidth=a.width=r,r=u.width,a.width=i,a.minWidth=s,a.maxWidth=o)),r}:i.documentElement.currentStyle&&(Dt=function(e,t){var n,r,i=e.currentStyle&&e.currentStyle[t],s=e.style;return i==null&&s&&s[t]&&(i=s[t]),Ut.test(i)&&!Ft.test(t)&&(n=s.left,r=e.runtimeStyle&&e.runtimeStyle.left,r&&(e.runtimeStyle.left=e.currentStyle.left),s.left=t==="fontSize"?"1em":i,i=s.pixelLeft+"px",s.left=n,r&&(e.runtimeStyle.left=r)),i===""?"auto":i}),v.each(["height","width"],function(e,t){v.cssHooks[t]={get:function(e,n,r){if(n)return e.offsetWidth===0&&It.test(Dt(e,"display"))?v.swap(e,Xt,function(){return tn(e,t,r)}):tn(e,t,r)},set:function(e,n,r){return Zt(e,n,r?en(e,t,r,v.support.boxSizing&&v.css(e,"boxSizing")==="border-box"):0)}}}),v.support.opacity||(v.cssHooks.opacity={get:function(e,t){return jt.test((t&&e.currentStyle?e.currentStyle.filter:e.style.filter)||"")?.01*parseFloat(RegExp.$1)+"":t?"1":""},set:function(e,t){var n=e.style,r=e.currentStyle,i=v.isNumeric(t)?"alpha(opacity="+t*100+")":"",s=r&&r.filter||n.filter||"";n.zoom=1;if(t>=1&&v.trim(s.replace(Bt,""))===""&&n.removeAttribute){n.removeAttribute("filter");if(r&&!r.filter)return}n.filter=Bt.test(s)?s.replace(Bt,i):s+" "+i}}),v(function(){v.support.reliableMarginRight||(v.cssHooks.marginRight={get:function(e,t){return v.swap(e,{display:"inline-block"},function(){if(t)return Dt(e,"marginRight")})}}),!v.support.pixelPosition&&v.fn.position&&v.each(["top","left"],function(e,t){v.cssHooks[t]={get:function(e,n){if(n){var r=Dt(e,t);return Ut.test(r)?v(e).position()[t]+"px":r}}}})}),v.expr&&v.expr.filters&&(v.expr.filters.hidden=function(e){return e.offsetWidth===0&&e.offsetHeight===0||!v.support.reliableHiddenOffsets&&(e.style&&e.style.display||Dt(e,"display"))==="none"},v.expr.filters.visible=function(e){return!v.expr.filters.hidden(e)}),v.each({margin:"",padding:"",border:"Width"},function(e,t){v.cssHooks[e+t]={expand:function(n){var r,i=typeof n=="string"?n.split(" "):[n],s={};for(r=0;r<4;r++)s[e+$t[r]+t]=i[r]||i[r-2]||i[0];return s}},qt.test(e)||(v.cssHooks[e+t].set=Zt)});var rn=/%20/g,sn=/\[\]$/,on=/\r?\n/g,un=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,an=/^(?:select|textarea)/i;v.fn.extend({serialize:function(){return v.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?v.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||an.test(this.nodeName)||un.test(this.type))}).map(function(e,t){var n=v(this).val();return n==null?null:v.isArray(n)?v.map(n,function(e,n){return{name:t.name,value:e.replace(on,"\r\n")}}):{name:t.name,value:n.replace(on,"\r\n")}}).get()}}),v.param=function(e,n){var r,i=[],s=function(e,t){t=v.isFunction(t)?t():t==null?"":t,i[i.length]=encodeURIComponent(e)+"="+encodeURIComponent(t)};n===t&&(n=v.ajaxSettings&&v.ajaxSettings.traditional);if(v.isArray(e)||e.jquery&&!v.isPlainObject(e))v.each(e,function(){s(this.name,this.value)});else for(r in e)fn(r,e[r],n,s);return i.join("&").replace(rn,"+")};var ln,cn,hn=/#.*$/,pn=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,dn=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,vn=/^(?:GET|HEAD)$/,mn=/^\/\//,gn=/\?/,yn=/)<[^<]*)*<\/script>/gi,bn=/([?&])_=[^&]*/,wn=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,En=v.fn.load,Sn={},xn={},Tn=["*/"]+["*"];try{cn=s.href}catch(Nn){cn=i.createElement("a"),cn.href="",cn=cn.href}ln=wn.exec(cn.toLowerCase())||[],v.fn.load=function(e,n,r){if(typeof e!="string"&&En)return En.apply(this,arguments);if(!this.length)return this;var i,s,o,u=this,a=e.indexOf(" ");return a>=0&&(i=e.slice(a,e.length),e=e.slice(0,a)),v.isFunction(n)?(r=n,n=t):n&&typeof n=="object"&&(s="POST"),v.ajax({url:e,type:s,dataType:"html",data:n,complete:function(e,t){r&&u.each(r,o||[e.responseText,t,e])}}).done(function(e){o=arguments,u.html(i?v("
        ").append(e.replace(yn,"")).find(i):e)}),this},v.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,t){v.fn[t]=function(e){return this.on(t,e)}}),v.each(["get","post"],function(e,n){v[n]=function(e,r,i,s){return v.isFunction(r)&&(s=s||i,i=r,r=t),v.ajax({type:n,url:e,data:r,success:i,dataType:s})}}),v.extend({getScript:function(e,n){return v.get(e,t,n,"script")},getJSON:function(e,t,n){return v.get(e,t,n,"json")},ajaxSetup:function(e,t){return t?Ln(e,v.ajaxSettings):(t=e,e=v.ajaxSettings),Ln(e,t),e},ajaxSettings:{url:cn,isLocal:dn.test(ln[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":Tn},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":e.String,"text html":!0,"text json":v.parseJSON,"text xml":v.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:Cn(Sn),ajaxTransport:Cn(xn),ajax:function(e,n){function T(e,n,s,a){var l,y,b,w,S,T=n;if(E===2)return;E=2,u&&clearTimeout(u),o=t,i=a||"",x.readyState=e>0?4:0,s&&(w=An(c,x,s));if(e>=200&&e<300||e===304)c.ifModified&&(S=x.getResponseHeader("Last-Modified"),S&&(v.lastModified[r]=S),S=x.getResponseHeader("Etag"),S&&(v.etag[r]=S)),e===304?(T="notmodified",l=!0):(l=On(c,w),T=l.state,y=l.data,b=l.error,l=!b);else{b=T;if(!T||e)T="error",e<0&&(e=0)}x.status=e,x.statusText=(n||T)+"",l?d.resolveWith(h,[y,T,x]):d.rejectWith(h,[x,T,b]),x.statusCode(g),g=t,f&&p.trigger("ajax"+(l?"Success":"Error"),[x,c,l?y:b]),m.fireWith(h,[x,T]),f&&(p.trigger("ajaxComplete",[x,c]),--v.active||v.event.trigger("ajaxStop"))}typeof e=="object"&&(n=e,e=t),n=n||{};var r,i,s,o,u,a,f,l,c=v.ajaxSetup({},n),h=c.context||c,p=h!==c&&(h.nodeType||h instanceof v)?v(h):v.event,d=v.Deferred(),m=v.Callbacks("once memory"),g=c.statusCode||{},b={},w={},E=0,S="canceled",x={readyState:0,setRequestHeader:function(e,t){if(!E){var n=e.toLowerCase();e=w[n]=w[n]||e,b[e]=t}return this},getAllResponseHeaders:function(){return E===2?i:null},getResponseHeader:function(e){var n;if(E===2){if(!s){s={};while(n=pn.exec(i))s[n[1].toLowerCase()]=n[2]}n=s[e.toLowerCase()]}return n===t?null:n},overrideMimeType:function(e){return E||(c.mimeType=e),this},abort:function(e){return e=e||S,o&&o.abort(e),T(0,e),this}};d.promise(x),x.success=x.done,x.error=x.fail,x.complete=m.add,x.statusCode=function(e){if(e){var t;if(E<2)for(t in e)g[t]=[g[t],e[t]];else t=e[x.status],x.always(t)}return this},c.url=((e||c.url)+"").replace(hn,"").replace(mn,ln[1]+"//"),c.dataTypes=v.trim(c.dataType||"*").toLowerCase().split(y),c.crossDomain==null&&(a=wn.exec(c.url.toLowerCase()),c.crossDomain=!(!a||a[1]===ln[1]&&a[2]===ln[2]&&(a[3]||(a[1]==="http:"?80:443))==(ln[3]||(ln[1]==="http:"?80:443)))),c.data&&c.processData&&typeof c.data!="string"&&(c.data=v.param(c.data,c.traditional)),kn(Sn,c,n,x);if(E===2)return x;f=c.global,c.type=c.type.toUpperCase(),c.hasContent=!vn.test(c.type),f&&v.active++===0&&v.event.trigger("ajaxStart");if(!c.hasContent){c.data&&(c.url+=(gn.test(c.url)?"&":"?")+c.data,delete c.data),r=c.url;if(c.cache===!1){var N=v.now(),C=c.url.replace(bn,"$1_="+N);c.url=C+(C===c.url?(gn.test(c.url)?"&":"?")+"_="+N:"")}}(c.data&&c.hasContent&&c.contentType!==!1||n.contentType)&&x.setRequestHeader("Content-Type",c.contentType),c.ifModified&&(r=r||c.url,v.lastModified[r]&&x.setRequestHeader("If-Modified-Since",v.lastModified[r]),v.etag[r]&&x.setRequestHeader("If-None-Match",v.etag[r])),x.setRequestHeader("Accept",c.dataTypes[0]&&c.accepts[c.dataTypes[0]]?c.accepts[c.dataTypes[0]]+(c.dataTypes[0]!=="*"?", "+Tn+"; q=0.01":""):c.accepts["*"]);for(l in c.headers)x.setRequestHeader(l,c.headers[l]);if(!c.beforeSend||c.beforeSend.call(h,x,c)!==!1&&E!==2){S="abort";for(l in{success:1,error:1,complete:1})x[l](c[l]);o=kn(xn,c,n,x);if(!o)T(-1,"No Transport");else{x.readyState=1,f&&p.trigger("ajaxSend",[x,c]),c.async&&c.timeout>0&&(u=setTimeout(function(){x.abort("timeout")},c.timeout));try{E=1,o.send(b,T)}catch(k){if(!(E<2))throw k;T(-1,k)}}return x}return x.abort()},active:0,lastModified:{},etag:{}});var Mn=[],_n=/\?/,Dn=/(=)\?(?=&|$)|\?\?/,Pn=v.now();v.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Mn.pop()||v.expando+"_"+Pn++;return this[e]=!0,e}}),v.ajaxPrefilter("json jsonp",function(n,r,i){var s,o,u,a=n.data,f=n.url,l=n.jsonp!==!1,c=l&&Dn.test(f),h=l&&!c&&typeof a=="string"&&!(n.contentType||"").indexOf("application/x-www-form-urlencoded")&&Dn.test(a);if(n.dataTypes[0]==="jsonp"||c||h)return s=n.jsonpCallback=v.isFunction(n.jsonpCallback)?n.jsonpCallback():n.jsonpCallback,o=e[s],c?n.url=f.replace(Dn,"$1"+s):h?n.data=a.replace(Dn,"$1"+s):l&&(n.url+=(_n.test(f)?"&":"?")+n.jsonp+"="+s),n.converters["script json"]=function(){return u||v.error(s+" was not called"),u[0]},n.dataTypes[0]="json",e[s]=function(){u=arguments},i.always(function(){e[s]=o,n[s]&&(n.jsonpCallback=r.jsonpCallback,Mn.push(s)),u&&v.isFunction(o)&&o(u[0]),u=o=t}),"script"}),v.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){return v.globalEval(e),e}}}),v.ajaxPrefilter("script",function(e){e.cache===t&&(e.cache=!1),e.crossDomain&&(e.type="GET",e.global=!1)}),v.ajaxTransport("script",function(e){if(e.crossDomain){var n,r=i.head||i.getElementsByTagName("head")[0]||i.documentElement;return{send:function(s,o){n=i.createElement("script"),n.async="async",e.scriptCharset&&(n.charset=e.scriptCharset),n.src=e.url,n.onload=n.onreadystatechange=function(e,i){if(i||!n.readyState||/loaded|complete/.test(n.readyState))n.onload=n.onreadystatechange=null,r&&n.parentNode&&r.removeChild(n),n=t,i||o(200,"success")},r.insertBefore(n,r.firstChild)},abort:function(){n&&n.onload(0,1)}}}});var Hn,Bn=e.ActiveXObject?function(){for(var e in Hn)Hn[e](0,1)}:!1,jn=0;v.ajaxSettings.xhr=e.ActiveXObject?function(){return!this.isLocal&&Fn()||In()}:Fn,function(e){v.extend(v.support,{ajax:!!e,cors:!!e&&"withCredentials"in e})}(v.ajaxSettings.xhr()),v.support.ajax&&v.ajaxTransport(function(n){if(!n.crossDomain||v.support.cors){var r;return{send:function(i,s){var o,u,a=n.xhr();n.username?a.open(n.type,n.url,n.async,n.username,n.password):a.open(n.type,n.url,n.async);if(n.xhrFields)for(u in n.xhrFields)a[u]=n.xhrFields[u];n.mimeType&&a.overrideMimeType&&a.overrideMimeType(n.mimeType),!n.crossDomain&&!i["X-Requested-With"]&&(i["X-Requested-With"]="XMLHttpRequest");try{for(u in i)a.setRequestHeader(u,i[u])}catch(f){}a.send(n.hasContent&&n.data||null),r=function(e,i){var u,f,l,c,h;try{if(r&&(i||a.readyState===4)){r=t,o&&(a.onreadystatechange=v.noop,Bn&&delete Hn[o]);if(i)a.readyState!==4&&a.abort();else{u=a.status,l=a.getAllResponseHeaders(),c={},h=a.responseXML,h&&h.documentElement&&(c.xml=h);try{c.text=a.responseText}catch(p){}try{f=a.statusText}catch(p){f=""}!u&&n.isLocal&&!n.crossDomain?u=c.text?200:404:u===1223&&(u=204)}}}catch(d){i||s(-1,d)}c&&s(u,f,c,l)},n.async?a.readyState===4?setTimeout(r,0):(o=++jn,Bn&&(Hn||(Hn={},v(e).unload(Bn)),Hn[o]=r),a.onreadystatechange=r):r()},abort:function(){r&&r(0,1)}}}});var qn,Rn,Un=/^(?:toggle|show|hide)$/,zn=new RegExp("^(?:([-+])=|)("+m+")([a-z%]*)$","i"),Wn=/queueHooks$/,Xn=[Gn],Vn={"*":[function(e,t){var n,r,i=this.createTween(e,t),s=zn.exec(t),o=i.cur(),u=+o||0,a=1,f=20;if(s){n=+s[2],r=s[3]||(v.cssNumber[e]?"":"px");if(r!=="px"&&u){u=v.css(i.elem,e,!0)||n||1;do a=a||".5",u/=a,v.style(i.elem,e,u+r);while(a!==(a=i.cur()/o)&&a!==1&&--f)}i.unit=r,i.start=u,i.end=s[1]?u+(s[1]+1)*n:n}return i}]};v.Animation=v.extend(Kn,{tweener:function(e,t){v.isFunction(e)?(t=e,e=["*"]):e=e.split(" ");var n,r=0,i=e.length;for(;r-1,f={},l={},c,h;a?(l=i.position(),c=l.top,h=l.left):(c=parseFloat(o)||0,h=parseFloat(u)||0),v.isFunction(t)&&(t=t.call(e,n,s)),t.top!=null&&(f.top=t.top-s.top+c),t.left!=null&&(f.left=t.left-s.left+h),"using"in t?t.using.call(e,f):i.css(f)}},v.fn.extend({position:function(){if(!this[0])return;var e=this[0],t=this.offsetParent(),n=this.offset(),r=er.test(t[0].nodeName)?{top:0,left:0}:t.offset();return n.top-=parseFloat(v.css(e,"marginTop"))||0,n.left-=parseFloat(v.css(e,"marginLeft"))||0,r.top+=parseFloat(v.css(t[0],"borderTopWidth"))||0,r.left+=parseFloat(v.css(t[0],"borderLeftWidth"))||0,{top:n.top-r.top,left:n.left-r.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||i.body;while(e&&!er.test(e.nodeName)&&v.css(e,"position")==="static")e=e.offsetParent;return e||i.body})}}),v.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(e,n){var r=/Y/.test(n);v.fn[e]=function(i){return v.access(this,function(e,i,s){var o=tr(e);if(s===t)return o?n in o?o[n]:o.document.documentElement[i]:e[i];o?o.scrollTo(r?v(o).scrollLeft():s,r?s:v(o).scrollTop()):e[i]=s},e,i,arguments.length,null)}}),v.each({Height:"height",Width:"width"},function(e,n){v.each({padding:"inner"+e,content:n,"":"outer"+e},function(r,i){v.fn[i]=function(i,s){var o=arguments.length&&(r||typeof i!="boolean"),u=r||(i===!0||s===!0?"margin":"border");return v.access(this,function(n,r,i){var s;return v.isWindow(n)?n.document.documentElement["client"+e]:n.nodeType===9?(s=n.documentElement,Math.max(n.body["scroll"+e],s["scroll"+e],n.body["offset"+e],s["offset"+e],s["client"+e])):i===t?v.css(n,r,i,u):v.style(n,r,i,u)},n,o?i:t,o,null)}})}),e.jQuery=e.$=v,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return v})})(window); \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/mustache/mustache.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/mustache/mustache.js new file mode 100644 index 0000000000..7286ecf299 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/components/mustache/mustache.js @@ -0,0 +1,635 @@ +/*! + * mustache.js - Logic-less {{mustache}} templates with JavaScript + * http://github.com/janl/mustache.js + */ + +/*global define: false*/ + +var Mustache; + +/*! + * mustache.js - Logic-less {{mustache}} templates with JavaScript + * http://github.com/janl/mustache.js + */ + +/*global define: false*/ + +var Mustache; + +(function (exports) { + if (typeof module !== "undefined" && module.exports) { + module.exports = exports; // CommonJS + } else if (typeof define === "function") { + define(exports); // AMD + } else { + Mustache = exports; // + + + + + diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/karma.conf.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/karma.conf.js new file mode 100644 index 0000000000..ea88ff9b82 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/karma.conf.js @@ -0,0 +1,58 @@ +// Karma configuration file +// +// For all available config options and default values, see: +// https://github.com/karma-runner/karma/blob/stable/lib/config.js#L54 + + +// base path, that will be used to resolve files and exclude +basePath = ''; + +// list of files / patterns to load in the browser +files = [ + 'components/es5-shim/es5-shim.js', + 'components/es5-shim/es5-sham.js', + + // frameworks + JASMINE, + JASMINE_ADAPTER, + REQUIRE, + REQUIRE_ADAPTER, + + // loaded without require + 'components/jquery/jquery.js', + 'components/jasmine-jquery/lib/jasmine-jquery.js', + 'components/jasmine-flight/lib/jasmine-flight.js', + + // loaded with require + {pattern: 'components/flight/**/*.js', included: false}, + {pattern: 'components/mustache/**/*.js', included: false}, + {pattern: 'app/**/*.js', included: false}, + {pattern: 'test/fixtures/**/*.html', included: false}, + {pattern: 'test/spec/**/*.js', included: false}, + + 'test/test-main.js' +]; + +// list of files to exclude +exclude = [ + +]; + +// use dots reporter, as travis terminal does not support escaping sequences +reporters = [ + 'dots' +]; + +// enable / disable watching file and executing tests whenever any file changes +// CLI --auto-watch --no-auto-watch +autoWatch = true; + +// start these browsers +browsers = [ + 'Chrome', + 'Firefox' +]; + +// auto run tests on start (when browsers are captured) and exit +// CLI --single-run --no-single-run +singleRun = false; diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/package.json b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/package.json new file mode 100644 index 0000000000..8879c8d51d --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/package.json @@ -0,0 +1,11 @@ +{ + "private": true, + "name": "flight-example-app", + "version": "0.0.0", + "devDependencies": { + "karma": "~0.8.5" + }, + "scripts": { + "test": "./node_modules/.bin/karma start --single-run --browsers Firefox" + } +} diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/requireMain.js b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/requireMain.js new file mode 100644 index 0000000000..ce8aa51299 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/flightjs-example-app/requireMain.js @@ -0,0 +1,24 @@ +requirejs.config({ + baseUrl: '', + paths: { + 'flight': 'components/flight' + } +}); + +require( + [ + 'flight/lib/compose', + 'flight/lib/registry', + 'flight/lib/advice', + 'flight/lib/logger', + 'flight/tools/debug/debug' + ], + + function(compose, registry, advice, withLogging, debug) { + debug.enable(true); + compose.mixin(registry, [advice.withAdvice, withLogging]); + require(['app/boot/page'], function(initialize) { + initialize(); + }); + } +); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/gauge.png b/third_party/webkit/PerformanceTests/Speedometer/resources/gauge.png new file mode 100644 index 0000000000..35febef169 Binary files /dev/null and b/third_party/webkit/PerformanceTests/Speedometer/resources/gauge.png differ diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/gauge@2x.png b/third_party/webkit/PerformanceTests/Speedometer/resources/gauge@2x.png new file mode 100644 index 0000000000..215d7c24cb Binary files /dev/null and b/third_party/webkit/PerformanceTests/Speedometer/resources/gauge@2x.png differ diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/logo.png b/third_party/webkit/PerformanceTests/Speedometer/resources/logo.png new file mode 100644 index 0000000000..524a6c8419 Binary files /dev/null and b/third_party/webkit/PerformanceTests/Speedometer/resources/logo.png differ diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/logo@2x.png b/third_party/webkit/PerformanceTests/Speedometer/resources/logo@2x.png new file mode 100644 index 0000000000..1869587104 Binary files /dev/null and b/third_party/webkit/PerformanceTests/Speedometer/resources/logo@2x.png differ diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/main.css b/third_party/webkit/PerformanceTests/Speedometer/resources/main.css new file mode 100644 index 0000000000..126cdcdbca --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/main.css @@ -0,0 +1,286 @@ +body { + background-color: rgb(46, 51, 55); + color: rgb(235, 235, 235); + font-family: "Helvetica Neue", Helvetica, Verdana, sans-serif; +} + +::selection { + color: rgb(46, 51, 55); + background-color: rgb(235, 235, 235); +} + +h1, +button { + font-family: "Futura-Medium", Futura, "Helvetica Neue", Helvetica, Verdana, sans-serif; +} + +code { + font-family: Menlo, Monaco, monospace; + font-size: smaller; +} + +button { + cursor: pointer; +} + +hr { + border: 1px solid rgb(235, 235, 235); + width: 50%; + margin: 40px auto; +} + +img { + -webkit-user-select: none; + -webkit-user-drag: none; +} + +main { + display: block; + position: absolute; + width: 800px; + height: 600px; + top: 50%; + left: 50%; + margin-top: -321px; + margin-left: -421px; + padding: 15px; + border: 6px solid rgb(235, 235, 235); + border-radius: 20px; +} + +#logo { + position: absolute; + left: -70px; + top: 115px; + width: 75px; + height: 406px; +} + +h1 { + margin-top: 30px; + font-size: 40px; + font-weight: normal; + color: rgb(235, 235, 235); + text-align: center; +} + +p { + font-size: 16px; + line-height: 21px; +} + +a { + color: inherit; +} + +.buttons { + margin-top: 30px; + text-align: center; +} + +button { + -webkit-appearance: none; + border: 3px solid rgb(235, 235, 235); + border-radius: 10px; + min-width: 200px; + padding: 5px 20px; + margin: 0 40px; + font-size: 25px; + color: rgb(235, 235, 235); + background-color: transparent; + + -webkit-user-select: none; +} + +button:active { + background-color: rgb(235, 235, 235); + color: rgb(46, 51, 55); + border-color: rgb(235, 235, 235) !important; +} + +button:focus { + outline: none; + border-color: rgb(232, 79, 79); +} + +section { + display: none; +} + +section > p { + margin: 10px 20px; +} + +section.selected { + display: block; +} + +#testContainer { + position: absolute; + top: 15px; + left: 15px; + width: 800px; + height: 600px; +} + +section#home > p { + margin: 0 auto; + width: 70%; + text-align: center; +} + +section#home > p:first-child { + margin-top: 160px; + text-align: center; +} + +section#home > .show-about { + margin-top: 100px; +} + +section#home > .buttons { + margin-top: 80px; +} + +section#running > #progress { + position: absolute; + bottom: -6px; + left: 60px; + right: 60px; + height: 6px; + background-color: rgb(128, 128, 128); + border-left: 6px solid rgb(46, 51, 55); + border-right: 6px solid rgb(46, 51, 55); +} + +section#running #progress-completed { + position: absolute; + top: 0; + left: 0; + height: 6px; + width: 0; + background-color: rgb(235, 235, 235); +} + +section#running > #info { + position: absolute; + bottom: -25px; + left: 60px; + right: 60px; + height: 12px; + color: rgb(128, 128, 128); + text-align: center; + font-size: 12px; +} + +section#summarized-results > #result-number, +section#summarized-results > #confidence-number { + font-family: "Futura-CondensedMedium", Futura, "Helvetica Neue", Helvetica, Verdana, sans-serif; +} + +section#summarized-results > #result-number { + text-align: center; + font-size: 145px; + line-height: 145px; +} + +section#summarized-results > #confidence-number { + text-align: center; + font-size: 36px; + line-height: 36px; + color: rgb(128, 128, 128); +} + +section#detailed-results > table { + float: left; + width: 50%; +} + +section#detailed-results > .arithmetic-mean { + clear: both; + padding-top: 32px; + text-align: center; +} + +section#detailed-results > .arithmetic-mean > label { + font-weight: bold; + margin-right: 10px; + color: rgb(128, 128, 128); +} + +section#detailed-results > .show-about { + margin-top: 30px; + text-align: center; +} + +section#about h1 { + margin-top: 10px; + margin-bottom: 0px; + font-size: 25px; +} + +section#about .note { + color: rgb(128, 128, 128); +} + +table { + border-spacing: 0; + border-collapse: collapse; +} + +th, +td { + padding: 5px; +} + +th { + text-align: right; + color: rgb(128, 128, 128); +} + +.gauge { + position: relative; + width: 738px; + height: 78px; + background-image: url(gauge.png); + background-size: 100% 100%; + background-repat: no-repeat; + margin: 0 auto; +} + +.gauge > .window { + position: absolute; + left: 0; + top: 33px; + bottom: 0; + right: 0; + overflow: hidden; +} + +.gauge > .window > .needle { + position: absolute; + left: 363px; + bottom: -88px; + width: 4px; + height: 400px; + background-color: rgb(247, 148, 29); + + -webkit-transform: rotate(-70deg); + -webkit-transform-origin: 2px 400px; + + -moz-transform: rotate(-70deg); + -moz-transform-origin: 2px 400px; + + transform: rotate(-70deg); + transform-origin: 2px 400px; +} + +@media (-webkit-min-device-pixel-ratio: 2), (min--moz-device-pixel-ratio: 2), (min-resolution: 2dppx), (min-resolution: 192dpi) { + #logo { + content: url(logo@2x.png); /* FIXME: This does not work in Firefox. */ + } + + .gauge { + background-image: url(gauge@2x.png); + } +} diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/main.js b/third_party/webkit/PerformanceTests/Speedometer/resources/main.js new file mode 100644 index 0000000000..2ab877744b --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/main.js @@ -0,0 +1,246 @@ +window.benchmarkClient = { + displayUnit: 'runs/min', + iterationCount: 10, + stepCount: null, + suitesCount: null, + _measuredValuesList: [], + _finishedTestCount: 0, + _progressCompleted: null, + willAddTestFrame: function (frame) { + var main = document.querySelector('main'); + var style = getComputedStyle(main); + frame.style.left = main.offsetLeft + parseInt(style.borderLeftWidth) + parseInt(style.paddingLeft) + 'px'; + frame.style.top = main.offsetTop + parseInt(style.borderTopWidth) + parseInt(style.paddingTop) + 'px'; + }, + willRunTest: function (suite, test) { + document.getElementById('info').textContent = suite.name + ' ( ' + this._finishedTestCount + ' / ' + this.stepCount + ' )'; + }, + didRunTest: function () { + this._finishedTestCount++; + this._progressCompleted.style.width = (this._finishedTestCount * 100 / this.stepCount) + '%'; + }, + didRunSuites: function (measuredValues) { + this._measuredValuesList.push(measuredValues); + }, + willStartFirstIteration: function () { + this._measuredValuesList = []; + this._finishedTestCount = 0; + this._progressCompleted = document.getElementById('progress-completed'); + document.getElementById('logo-link').onclick = function (event) { event.preventDefault(); return false; } + }, + didFinishLastIteration: function () { + document.getElementById('logo-link').onclick = null; + + var results = this._computeResults(this._measuredValuesList, this.displayUnit); + + this._updateGaugeNeedle(results.mean); + document.getElementById('result-number').textContent = results.formattedMean; + if (results.formattedDelta) + document.getElementById('confidence-number').textContent = '\u00b1 ' + results.formattedDelta; + + this._populateDetailedResults(results.formattedValues); + document.getElementById('results-with-statistics').textContent = results.formattedMeanAndDelta; + + if (this.displayUnit == 'ms') { + document.getElementById('show-summary').style.display = 'none'; + showResultDetails(); + } else + showResultsSummary(); + }, + _computeResults: function (measuredValuesList, displayUnit) { + var suitesCount = this.suitesCount; + function valueForUnit(measuredValues) { + if (displayUnit == 'ms') + return measuredValues.geomean; + return measuredValues.score; + } + + function sigFigFromPercentDelta(percentDelta) { + return Math.ceil(-Math.log(percentDelta)/Math.log(10)) + 3; + } + + function toSigFigPrecision(number, sigFig) { + var nonDecimalDigitCount = number < 1 ? 0 : (Math.floor(Math.log(number)/Math.log(10)) + 1); + return number.toPrecision(Math.max(nonDecimalDigitCount, Math.min(6, sigFig))); + } + + var values = measuredValuesList.map(valueForUnit); + var sum = values.reduce(function (a, b) { return a + b; }, 0); + var arithmeticMean = sum / values.length; + var meanSigFig = 4; + var formattedDelta; + var formattedPercentDelta; + if (window.Statistics) { + var delta = Statistics.confidenceIntervalDelta(0.95, values.length, sum, Statistics.squareSum(values)); + if (!isNaN(delta)) { + var percentDelta = delta * 100 / arithmeticMean; + meanSigFig = sigFigFromPercentDelta(percentDelta); + formattedDelta = toSigFigPrecision(delta, 2); + formattedPercentDelta = toSigFigPrecision(percentDelta, 2) + '%'; + } + } + + var formattedMean = toSigFigPrecision(arithmeticMean, Math.max(meanSigFig, 3)); + + return { + formattedValues: values.map(function (value) { + return toSigFigPrecision(value, 4) + ' ' + displayUnit; + }), + mean: arithmeticMean, + formattedMean: formattedMean, + formattedDelta: formattedDelta, + formattedMeanAndDelta: formattedMean + (formattedDelta ? ' \xb1 ' + formattedDelta + ' (' + formattedPercentDelta + ')' : ''), + }; + }, + _addDetailedResultsRow: function (table, iterationNumber, value) { + var row = document.createElement('tr'); + var th = document.createElement('th'); + th.textContent = 'Iteration ' + (iterationNumber + 1); + var td = document.createElement('td'); + td.textContent = value; + row.appendChild(th); + row.appendChild(td); + table.appendChild(row); + }, + _updateGaugeNeedle: function (rpm) { + var needleAngle = Math.max(0, Math.min(rpm, 140)) - 70; + var needleRotationValue = 'rotate(' + needleAngle + 'deg)'; + + var gaugeNeedleElement = document.querySelector('#summarized-results > .gauge .needle'); + gaugeNeedleElement.style.setProperty('-webkit-transform', needleRotationValue); + gaugeNeedleElement.style.setProperty('-moz-transform', needleRotationValue); + gaugeNeedleElement.style.setProperty('-ms-transform', needleRotationValue); + gaugeNeedleElement.style.setProperty('transform', needleRotationValue); + }, + _populateDetailedResults: function (formattedValues) { + var resultsTables = document.querySelectorAll('.results-table'); + var i = 0; + resultsTables[0].innerHTML = ''; + for (; i < Math.ceil(formattedValues.length / 2); i++) + this._addDetailedResultsRow(resultsTables[0], i, formattedValues[i]); + resultsTables[1].innerHTML = ''; + for (; i < formattedValues.length; i++) + this._addDetailedResultsRow(resultsTables[1], i, formattedValues[i]); + }, + prepareUI: function () { + window.addEventListener('popstate', function (event) { + if (event.state) { + var sectionToShow = event.state.section; + if (sectionToShow) { + var sections = document.querySelectorAll('main > section'); + for (var i = 0; i < sections.length; i++) { + if (sections[i].id === sectionToShow) + return showSection(sectionToShow, false); + } + } + } + return showSection('home', false); + }, false); + + function updateScreenSize() { + // FIXME: Detect when the window size changes during the test. + var screenIsTooSmall = window.innerWidth < 850 || window.innerHeight < 650; + document.getElementById('screen-size').textContent = window.innerWidth + 'px by ' + window.innerHeight + 'px'; + document.getElementById('screen-size-warning').style.display = screenIsTooSmall ? null : 'none'; + } + + window.addEventListener('resize', updateScreenSize); + updateScreenSize(); + } +} + +function enableOneSuite(suites, suiteToEnable) +{ + suiteToEnable = suiteToEnable.toLowerCase(); + var found = false; + for (var i = 0; i < suites.length; i++) { + var currentSuite = suites[i]; + if (currentSuite.name.toLowerCase() == suiteToEnable) { + currentSuite.disabled = false; + found = true; + } else + currentSuite.disabled = true; + } + return found; +} + +function startBenchmark() { + if (location.search.length > 1) { + var parts = location.search.substring(1).split('&'); + for (var i = 0; i < parts.length; i++) { + var keyValue = parts[i].split('='); + var key = keyValue[0]; + var value = keyValue[1]; + switch (key) { + case 'unit': + if (value == 'ms') + benchmarkClient.displayUnit = 'ms'; + else + console.error('Invalid unit: ' + value); + break; + case 'iterationCount': + var parsedValue = parseInt(value); + if (!isNaN(parsedValue)) + benchmarkClient.iterationCount = parsedValue; + else + console.error('Invalid iteration count: ' + value); + break; + case 'suite': + if (!enableOneSuite(Suites, value)) { + alert('Suite "' + value + '" does not exist. No tests to run.'); + return false; + } + break; + } + } + } + + var enabledSuites = Suites.filter(function (suite) { return !suite.disabled; }); + var totalSubtestsCount = enabledSuites.reduce(function (testsCount, suite) { return testsCount + suite.tests.length; }, 0); + benchmarkClient.stepCount = benchmarkClient.iterationCount * totalSubtestsCount; + benchmarkClient.suitesCount = enabledSuites.length; + var runner = new BenchmarkRunner(Suites, benchmarkClient); + runner.runMultipleIterations(benchmarkClient.iterationCount); + + return true; +} + +function showSection(sectionIdentifier, pushState) { + var currentSectionElement = document.querySelector('section.selected'); + console.assert(currentSectionElement); + + var newSectionElement = document.getElementById(sectionIdentifier); + console.assert(newSectionElement); + + currentSectionElement.classList.remove('selected'); + newSectionElement.classList.add('selected'); + + if (pushState) + history.pushState({section: sectionIdentifier}, document.title); +} + +function showHome() { + showSection('home', true); +} + +function startTest() { + if (startBenchmark()) + showSection('running'); +} + +function showResultsSummary() { + showSection('summarized-results', true); +} + +function showResultDetails() { + showSection('detailed-results', true); +} + +function showAbout() { + showSection('about', true); +} + +window.addEventListener('DOMContentLoaded', function () { + if (benchmarkClient.prepareUI) + benchmarkClient.prepareUI(); +}); diff --git a/third_party/webkit/PerformanceTests/Speedometer/resources/tests.js b/third_party/webkit/PerformanceTests/Speedometer/resources/tests.js new file mode 100644 index 0000000000..c8261e3550 --- /dev/null +++ b/third_party/webkit/PerformanceTests/Speedometer/resources/tests.js @@ -0,0 +1,580 @@ +var numberOfItemsToAdd = 100; +var Suites = []; +var ENTER_KEY_CODE = 13; + +var triggerEnter = function (element, type) { + var event = document.createEvent('Events'); + event.initEvent(type, true, true); + event.keyCode = ENTER_KEY_CODE; + event.which = ENTER_KEY_CODE; + event.key = 'ENTER'; + element.dispatchEvent(event); +} + +Suites.push({ + name: 'VanillaJS-TodoMVC', + url: 'todomvc/vanilla-examples/vanillajs/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('.new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + newTodo.dispatchEvent(new Event('change')); + triggerEnter(newTodo, 'keypress'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (newTodo, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingAllItems', function (newTodo, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'Vanilla-ES2015-TodoMVC', + url: 'todomvc/vanilla-examples/es2015/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('.new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + newTodo.dispatchEvent(new Event('change')); + triggerEnter(newTodo, 'keypress'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (params, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingItems', function (params, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'Vanilla-ES2015-Babel-Webpack-TodoMVC', + url: 'todomvc/vanilla-examples/es2015-babel-webpack/dist/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('.new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + newTodo.dispatchEvent(new Event('change')); + triggerEnter(newTodo, 'keypress'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (params, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingItems', function (params, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'React-TodoMVC', + url: 'todomvc/architecture-examples/react/index.html', + prepare: function (runner, contentWindow, contentDocument) { + contentWindow.app.Utils.store = function () {} + return runner.waitForElement('.new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + newTodo.dispatchEvent(new Event('input', { + bubbles: true, + cancelable: true + })); + triggerEnter(newTodo, 'keydown'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (newTodo, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingAllItems', function (newTodo, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'React-Redux-TodoMVC', + url: 'todomvc/architecture-examples/react-redux/dist/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('.new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + triggerEnter(newTodo, 'keydown'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (params, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingItems', function (params, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'EmberJS-TodoMVC', + url: 'todomvc/architecture-examples/emberjs/dist/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('#new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + triggerEnter(newTodo, 'keydown'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (params, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingItems', function (params, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'EmberJS-Debug-TodoMVC', + url: 'todomvc/architecture-examples/emberjs-debug/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('#new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + triggerEnter(newTodo, 'keydown'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (params, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingItems', function (params, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'BackboneJS-TodoMVC', + url: 'todomvc/architecture-examples/backbone/index.html', + prepare: function (runner, contentWindow, contentDocument) { + contentWindow.Backbone.sync = function () {} + return runner.waitForElement('#appIsReady').then(function (element) { + var newTodo = contentDocument.querySelector('.new-todo'); + newTodo.focus(); + return newTodo; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + triggerEnter(newTodo, 'keypress'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (newTodo, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < numberOfItemsToAdd; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingAllItems', function (newTodo, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < numberOfItemsToAdd; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'AngularJS-TodoMVC', + url: 'todomvc/architecture-examples/angularjs/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('#new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + var submitEvent = document.createEvent('Event'); + submitEvent.initEvent('submit', true, true); + var inputEvent = document.createEvent('Event'); + inputEvent.initEvent('input', true, true); + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + newTodo.dispatchEvent(inputEvent); + newTodo.form.dispatchEvent(submitEvent); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (newTodo, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingAllItems', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) + contentDocument.querySelector('.destroy').click(); + }), + ] +}); + +Suites.push({ + name: 'Angular2-TypeScript-TodoMVC', + url: 'todomvc/architecture-examples/angular/dist/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('.new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + newTodo.dispatchEvent(new Event('input', { + bubbles: true, + cancelable: true + })); + triggerEnter(newTodo, 'keyup'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (params, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingItems', function (params, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'VueJS-TodoMVC', + url: 'todomvc/architecture-examples/vuejs-cli/dist/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('.new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + newTodo.dispatchEvent(new Event('input', { + bubbles: true, + cancelable: true + })); + triggerEnter(newTodo, 'keyup'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (newTodo, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingAllItems', function (newTodo, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'jQuery-TodoMVC', + url: 'todomvc/architecture-examples/jquery/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('#appIsReady').then(function (element) { + var newTodo = contentDocument.getElementById('new-todo'); + newTodo.focus(); + return newTodo; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + triggerEnter(newTodo, 'keyup'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (newTodo, contentWindow, contentDocument) { + var checkboxes = contentDocument.getElementsByClassName('toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingAllItems', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) + contentDocument.querySelector('.destroy').click(); + }), + ] +}) + +Suites.push({ + name: 'Preact-TodoMVC', + url: 'todomvc/architecture-examples/preact/dist/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('.new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + triggerEnter(newTodo, 'keydown'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (params, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingItems', function (params, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +Suites.push({ + name: 'Inferno-TodoMVC', + url: 'todomvc/architecture-examples/inferno/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('.new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + newTodo.dispatchEvent(new Event('change', { + bubbles: true, + cancelable: true + })); + triggerEnter(newTodo, 'keydown'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (params, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingItems', function (params, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < numberOfItemsToAdd; i++) + contentDocument.querySelector('.destroy').click(); + }), + ] +}); + +function processElmWorkQueue(contentWindow) +{ + contentWindow.elmWork(); + var callbacks = contentWindow.rAFCallbackList; + var i = 0; + while (i < callbacks.length) { + callbacks[i](); + i++; + } + contentWindow.rAFCallbackList = []; +} + +Suites.push({ + name: 'Elm-TodoMVC', + url: 'todomvc/functional-prog-examples/elm/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('.new-todo').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + newTodo.dispatchEvent(new Event('input', { + bubbles: true, + cancelable: true + })); + processElmWorkQueue(contentWindow); + triggerEnter(newTodo, 'keydown'); + processElmWorkQueue(contentWindow); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (params, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) { + checkboxes[i].click(); + processElmWorkQueue(contentWindow); + } + }), + new BenchmarkTestStep('DeletingItems', function (params, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + contentDocument.querySelector('.destroy').click(); + processElmWorkQueue(contentWindow); + } + }), + ] +}); + +Suites.push({ + name: 'Flight-TodoMVC', + url: 'todomvc/dependency-examples/flight/flight/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('#appIsReady').then(function (element) { + var newTodo = contentDocument.getElementById('new-todo'); + newTodo.focus(); + return newTodo; + }); + }, + tests: [ + new BenchmarkTestStep('Adding' + numberOfItemsToAdd + 'Items', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < numberOfItemsToAdd; i++) { + newTodo.value = 'Something to do ' + i; + triggerEnter(newTodo, 'keydown'); + } + }), + new BenchmarkTestStep('CompletingAllItems', function (params, contentWindow, contentDocument) { + var checkboxes = contentDocument.querySelectorAll('.toggle'); + for (var i = 0; i < checkboxes.length; i++) + checkboxes[i].click(); + }), + new BenchmarkTestStep('DeletingItems', function (params, contentWindow, contentDocument) { + var deleteButtons = contentDocument.querySelectorAll('.destroy'); + for (var i = 0; i < deleteButtons.length; i++) + deleteButtons[i].click(); + }), + ] +}); + +var actionCount = 50; +Suites.push({ + disabled: true, + name: 'FlightJS-MailClient', + url: 'flightjs-example-app/index.html', + prepare: function (runner, contentWindow, contentDocument) { + return runner.waitForElement('.span8').then(function (element) { + element.focus(); + return element; + }); + }, + tests: [ + new BenchmarkTestStep('OpeningTabs' + actionCount + 'Times', function (newTodo, contentWindow, contentDocument) { + contentDocument.getElementById('inbox').click(); + for (var i = 0; i < actionCount; i++) { + contentDocument.getElementById('later').click(); + contentDocument.getElementById('sent').click(); + contentDocument.getElementById('trash').click(); + contentDocument.getElementById('inbox').click(); + } + }), + new BenchmarkTestStep('MovingEmails' + actionCount + 'Times', function (newTodo, contentWindow, contentDocument) { + contentDocument.getElementById('inbox').click(); + for (var i = 0; i < actionCount; i++) { + contentDocument.getElementById('mail_2139').click(); + contentDocument.getElementById('move_mail').click(); + contentDocument.querySelector('#move_to_selector #later').click(); + contentDocument.getElementById('later').click(); + contentDocument.getElementById('mail_2139').click(); + contentDocument.getElementById('move_mail').click(); + contentDocument.querySelector('#move_to_selector #trash').click(); + contentDocument.getElementById('trash').click(); + contentDocument.getElementById('mail_2139').click(); + contentDocument.getElementById('move_mail').click(); + contentDocument.querySelector('#move_to_selector #inbox').click(); + contentDocument.getElementById('inbox').click(); + } + }), + new BenchmarkTestStep('Sending' + actionCount + 'NewEmails', function (newTodo, contentWindow, contentDocument) { + for (var i = 0; i < actionCount; i++) { + contentDocument.getElementById('new_mail').click(); + contentDocument.getElementById('recipient_select').selectedIndex = 1; + var subject = contentDocument.getElementById('compose_subject'); + var message = contentDocument.getElementById('compose_message'); + subject.focus(); + contentWindow.$(subject).trigger('keydown'); + contentWindow.$(subject).text('Hello'); + message.focus(); + contentWindow.$(message).trigger('keydown'); + contentWindow.$(message).text('Hello,\n\nThis is a test message.\n\n- WebKitten'); + contentDocument.getElementById('send_composed').click(); + } + }), + ] +}); diff --git a/third_party/webkit/PerformanceTests/StyleBench/InteractiveRunner.html b/third_party/webkit/PerformanceTests/StyleBench/InteractiveRunner.html new file mode 100644 index 0000000000..9750dcbd5c --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/InteractiveRunner.html @@ -0,0 +1,174 @@ + + + +Speedometer 2.0 Interactive Runner + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/StyleBench/README_MOZILLA b/third_party/webkit/PerformanceTests/StyleBench/README_MOZILLA new file mode 100644 index 0000000000..02677c4223 --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/README_MOZILLA @@ -0,0 +1,13 @@ +The source from this directory was copied from the +PerformanceTests/StyleBench directory of the Webkit repository +at: https://svn.webkit.org/repository/webkit/trunk + +The SVN revision used was: 234578 + +The contents of this directory are intended for use to "train" the +profile guided optimization (PGO) of Firefox and for benchmarking +scenarios. The files inside this directory are not intended to ship +with Firefox or any other product. If files inside this directory +are useful for other purposes (e.g. JavaScript libraries), consumers +should vendor those files separately, as it is not appropriate to pull +in components of StyleBench for use outside of StyleBench. diff --git a/third_party/webkit/PerformanceTests/StyleBench/index.html b/third_party/webkit/PerformanceTests/StyleBench/index.html new file mode 100644 index 0000000000..83dc2345a1 --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/index.html @@ -0,0 +1,79 @@ + + + + + StyleBench 0.3 + + + + + + + + + +
        + + +
        +

        + StyleBench is a browser benchmark that measures the performance of the style resolution mechanism. +

        +

        + Your browser window is too small. For most accurate results, please make the viewport size at least 850px by 650px.
        + It's currently . +         +

        + +
        +

        About StyleBench

        +
        + +
        +
        +
        +
        +
        + +
        +

        Runs / Minute

        +
        +
        +
        +
        +
        + + +
        +
        + +
        +

        Detailed Results

        +
        +
        +
        +
        + + +
        +

        About StyleBench

        + + +
        +

        About StyleBench

        + +

        StyleBench tests performance of CSS style resolution and style invalidation. Each test run creates a large document and a large stylesheet using varying settings. It then applies a series of mutations to the document and measures the time to update the rendering. The resulting layout is simple, most of the pressure is on selector matching.

        + +

        StyleBench uses Speedometer framework for UI and measurements.

        +
        +
        +

        Access via 'file:' protocol

        +

        To run locally, launch a web server under PerformanceTests directory with 'python -m SimpleHTTPServer 8001' and access via http://localhost:8001/StyleBench. +

        +

        + Individual tests (without measurement) can also be run locally by opening PerformanceTests/StyleBench/resources/style-bench.html +

        +
        + + + diff --git a/third_party/webkit/PerformanceTests/StyleBench/mozilla.patch b/third_party/webkit/PerformanceTests/StyleBench/mozilla.patch new file mode 100644 index 0000000000..2c3988f2ff --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/mozilla.patch @@ -0,0 +1,86 @@ +diff --git a/third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-report.js b/third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-report.js +index b33021d9d9ce..58b3e46982d1 100644 +--- a/third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-report.js ++++ b/third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-report.js +@@ -1,12 +1,13 @@ + // This file can be customized to report results as needed. + + (function () { +- if (!window.testRunner && location.search != '?webkit' && location.hash != '#webkit') ++ if (!window.testRunner && location.search != '?webkit' && location.hash != '#webkit' && ++ location.search != '?gecko' && location.search != '?raptor') + return; + + if (window.testRunner) + testRunner.waitUntilDone(); + + var scriptElement = document.createElement('script'); + scriptElement.src = '../resources/runner.js'; + document.head.appendChild(scriptElement); +@@ -31,20 +32,22 @@ + customIterationCount: iterationCount, + doNotIgnoreInitialRun: true, + doNotMeasureMemoryUsage: true, + continueTesting: !isLastTest, + unit: unit, + name: name, + aggregator: aggregator}; + } +- PerfTestRunner.prepareToMeasureValuesAsync(createTest(null, 'Geometric')); ++ if (window.PerfTestRunner) ++ PerfTestRunner.prepareToMeasureValuesAsync(createTest(null, 'Geometric')); + }, + didRunSuites: function (measuredValues) { +- PerfTestRunner.measureValueAsync(measuredValues.geomean); ++ if (window.PerfTestRunner) ++ PerfTestRunner.measureValueAsync(measuredValues.geomean); + valuesByIteration.push(measuredValues); + }, + didFinishLastIteration: function () { + document.head.removeChild(document.querySelector('style')); + + var measuredValuesByFullName = {}; + function addToMeasuredValue(value, fullName, aggregator) { + var values = measuredValuesByFullName[fullName] || new Array; +@@ -63,21 +66,37 @@ + for (var subtestName in test.tests) + addToMeasuredValue(test.tests[subtestName], suiteName + '/' + testName + '/' + subtestName); + addToMeasuredValue(test.total, suiteName + '/' + testName, 'Total'); + } + addToMeasuredValue(suite.total, suiteName, 'Total'); + } + }); + +- PerfTestRunner.reportValues(createTest(null, null, false, 'pt'), scores); ++ if (window.PerfTestRunner) ++ PerfTestRunner.reportValues(createTest(null, null, false, 'pt'), scores); + + var fullNames = new Array; + for (var fullName in measuredValuesByFullName) + fullNames.push(fullName); + +- for (var i = 0; i < fullNames.length; i++) { +- var values = measuredValuesByFullName[fullNames[i]]; +- PerfTestRunner.reportValues(createTest(fullNames[i], values.aggregator, i + 1 == fullNames.length), values); ++ if (location.search == '?raptor') { ++ var data = ['raptor-benchmark', 'speedometer', measuredValuesByFullName]; ++ window.postMessage(data, '*'); ++ } else if (typeof tpRecordTime !== "undefined") { ++ var values = new Array; ++ var allNames = new Array; ++ for (var i = 0; i < fullNames.length; i++) { ++ var vals = measuredValuesByFullName[fullNames[i]]; ++ values.push(vals); ++ for (var count = 0; count < vals.length; count ++) ++ allNames.push(fullNames[i]); ++ } ++ tpRecordTime(values.join(','), 0, allNames.join(',')); ++ } else if (window.PerfTestRunner) { ++ for (var i = 0; i < fullNames.length; i++) { ++ var values = measuredValuesByFullName[fullNames[i]]; ++ PerfTestRunner.reportValues(createTest(fullNames[i], values.aggregator, i + 1 == fullNames.length), values); ++ } + } + } + }; + })(); diff --git a/third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-report.js b/third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-report.js new file mode 100644 index 0000000000..a02619a6d1 --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-report.js @@ -0,0 +1,103 @@ +// This file can be customized to report results as needed. + +(function () { + if (!window.testRunner && location.search != '?webkit' && location.hash != '#webkit' && + location.search != '?gecko' && location.search != '?raptor') + return; + + if (window.testRunner) + testRunner.waitUntilDone(); + + var scriptElement = document.createElement('script'); + scriptElement.src = '../resources/runner.js'; + document.head.appendChild(scriptElement); + + var styleElement = document.createElement('style'); + styleElement.textContent = 'pre { padding-top: 600px; }'; + document.head.appendChild(styleElement); + + var createTest; + var valuesByIteration = new Array; + + window.onload = function () { + document.body.removeChild(document.querySelector('main')); + startBenchmark(); + } + + window.benchmarkClient = { + iterationCount: 5, // Use 4 different instances of DRT/WTR to run 5 iterations. + willStartFirstIteration: function (iterationCount) { + createTest = function (name, aggregator, isLastTest, unit = 'ms') { + return { + customIterationCount: iterationCount, + doNotIgnoreInitialRun: true, + doNotMeasureMemoryUsage: true, + continueTesting: !isLastTest, + unit: unit, + name: name, + aggregator: aggregator}; + } + if (window.PerfTestRunner) + PerfTestRunner.prepareToMeasureValuesAsync(createTest(null, 'Geometric')); + }, + didRunSuites: function (measuredValues) { + if (window.PerfTestRunner) + PerfTestRunner.measureValueAsync(measuredValues.geomean); + valuesByIteration.push(measuredValues); + }, + didFinishLastIteration: function () { + document.head.removeChild(document.querySelector('style')); + + var measuredValuesByFullName = {}; + function addToMeasuredValue(value, fullName, aggregator) { + var values = measuredValuesByFullName[fullName] || new Array; + measuredValuesByFullName[fullName] = values; + values.push(value); + values.aggregator = aggregator; + } + + var scores = []; + valuesByIteration.forEach(function (measuredValues) { + scores.push(measuredValues.score); + for (var suiteName in measuredValues.tests) { + var suite = measuredValues.tests[suiteName]; + for (var testName in suite.tests) { + var test = suite.tests[testName]; + for (var subtestName in test.tests) + addToMeasuredValue(test.tests[subtestName], suiteName + '/' + testName + '/' + subtestName); + addToMeasuredValue(test.total, suiteName + '/' + testName, 'Total'); + } + addToMeasuredValue(suite.total, suiteName, 'Total'); + } + }); + + if (window.PerfTestRunner) + PerfTestRunner.reportValues(createTest(null, null, false, 'pt'), scores); + + var fullNames = new Array; + for (var fullName in measuredValuesByFullName) + fullNames.push(fullName); + + if (location.search == '?raptor') { + var data = ['raptor-benchmark', 'speedometer', measuredValuesByFullName]; + window.postMessage(data, '*'); + window.sessionStorage.setItem('benchmark_results', JSON.stringify(data)); + } else if (typeof tpRecordTime !== "undefined") { + var values = new Array; + var allNames = new Array; + for (var i = 0; i < fullNames.length; i++) { + var vals = measuredValuesByFullName[fullNames[i]]; + values.push(vals); + for (var count = 0; count < vals.length; count ++) + allNames.push(fullNames[i]); + } + tpRecordTime(values.join(','), 0, allNames.join(',')); + } else if (window.PerfTestRunner) { + for (var i = 0; i < fullNames.length; i++) { + var values = measuredValuesByFullName[fullNames[i]]; + PerfTestRunner.reportValues(createTest(fullNames[i], values.aggregator, i + 1 == fullNames.length), values); + } + } + } + }; +})(); diff --git a/third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-runner.js b/third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-runner.js new file mode 100644 index 0000000000..a248182594 --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/resources/benchmark-runner.js @@ -0,0 +1,299 @@ +// FIXME: Use the real promise if available. +// FIXME: Make sure this interface is compatible with the real Promise. +function SimplePromise() { + this._chainedPromise = null; + this._callback = null; +} + +SimplePromise.prototype.then = function (callback) { + if (this._callback) + throw "SimplePromise doesn't support multiple calls to then"; + this._callback = callback; + this._chainedPromise = new SimplePromise; + + if (this._resolved) + this.resolve(this._resolvedValue); + + return this._chainedPromise; +} + +SimplePromise.prototype.resolve = function (value) { + if (!this._callback) { + this._resolved = true; + this._resolvedValue = value; + return; + } + + var result = this._callback(value); + if (result instanceof SimplePromise) { + var chainedPromise = this._chainedPromise; + result.then(function (result) { chainedPromise.resolve(result); }); + } else + this._chainedPromise.resolve(result); +} + +function BenchmarkTestStep(testName, testFunction) { + this.name = testName; + this.run = testFunction; +} + +function BenchmarkRunner(suites, client) { + this._suites = suites; + this._prepareReturnValue = null; + this._client = client; +} + +BenchmarkRunner.prototype.waitForElement = function (selector) { + var promise = new SimplePromise; + var contentDocument = this._frame.contentDocument; + + function resolveIfReady() { + var element = contentDocument.querySelector(selector); + if (element) + return promise.resolve(element); + setTimeout(resolveIfReady, 50); + } + + resolveIfReady(); + return promise; +} + +BenchmarkRunner.prototype._removeFrame = function () { + if (this._frame) { + this._frame.parentNode.removeChild(this._frame); + this._frame = null; + } +} + +BenchmarkRunner.prototype._appendFrame = function (src) { + var frame = document.createElement('iframe'); + frame.style.width = '800px'; + frame.style.height = '600px'; + frame.style.border = '0px none'; + frame.style.position = 'absolute'; + frame.setAttribute('scrolling', 'no'); + + var marginLeft = parseInt(getComputedStyle(document.body).marginLeft); + var marginTop = parseInt(getComputedStyle(document.body).marginTop); + if (window.innerWidth > 800 + marginLeft && window.innerHeight > 600 + marginTop) { + frame.style.left = marginLeft + 'px'; + frame.style.top = marginTop + 'px'; + } else { + frame.style.left = '0px'; + frame.style.top = '0px'; + } + + if (this._client && this._client.willAddTestFrame) + this._client.willAddTestFrame(frame); + + document.body.insertBefore(frame, document.body.firstChild); + this._frame = frame; + return frame; +} + +BenchmarkRunner.prototype._waitAndWarmUp = function () { + var startTime = Date.now(); + + function Fibonacci(n) { + if (Date.now() - startTime > 100) + return; + if (n <= 0) + return 0; + else if (n == 1) + return 1; + return Fibonacci(n - 2) + Fibonacci(n - 1); + } + + var promise = new SimplePromise; + setTimeout(function () { + Fibonacci(100); + promise.resolve(); + }, 200); + return promise; +} + +BenchmarkRunner.prototype._writeMark = function(name) { + if (window.performance && window.performance.mark) + window.performance.mark(name); +} + +// This function ought be as simple as possible. Don't even use SimplePromise. +BenchmarkRunner.prototype._runTest = function(suite, test, prepareReturnValue, callback) +{ + var self = this; + var now = window.performance && window.performance.now ? function () { return window.performance.now(); } : Date.now; + + var contentWindow = self._frame.contentWindow; + var contentDocument = self._frame.contentDocument; + + self._writeMark(suite.name + '.' + test.name + '-start'); + var startTime = now(); + test.run(prepareReturnValue, contentWindow, contentDocument); + var endTime = now(); + self._writeMark(suite.name + '.' + test.name + '-sync-end'); + + var syncTime = endTime - startTime; + + var startTime = now(); + setTimeout(function () { + // Some browsers don't immediately update the layout for paint. + // Force the layout here to ensure we're measuring the layout time. + var height = self._frame.contentDocument.body.getBoundingClientRect().height; + var endTime = now(); + self._frame.contentWindow._unusedHeightValue = height; // Prevent dead code elimination. + self._writeMark(suite.name + '.' + test.name + '-async-end'); + callback(syncTime, endTime - startTime, height); + }, 0); +} + +function BenchmarkState(suites) { + this._suites = suites; + this._suiteIndex = -1; + this._testIndex = 0; + this.next(); +} + +BenchmarkState.prototype.currentSuite = function() { + return this._suites[this._suiteIndex]; +} + +BenchmarkState.prototype.currentTest = function () { + var suite = this.currentSuite(); + return suite ? suite.tests[this._testIndex] : null; +} + +BenchmarkState.prototype.next = function () { + this._testIndex++; + + var suite = this._suites[this._suiteIndex]; + if (suite && this._testIndex < suite.tests.length) + return this; + + this._testIndex = 0; + do { + this._suiteIndex++; + } while (this._suiteIndex < this._suites.length && this._suites[this._suiteIndex].disabled); + + return this; +} + +BenchmarkState.prototype.isFirstTest = function () { + return !this._testIndex; +} + +BenchmarkState.prototype.prepareCurrentSuite = function (runner, frame) { + var suite = this.currentSuite(); + var promise = new SimplePromise; + frame.onload = function () { + suite.prepare(runner, frame.contentWindow, frame.contentDocument).then(function (result) { promise.resolve(result); }); + } + frame.src = 'resources/' + suite.url; + return promise; +} + +BenchmarkRunner.prototype.step = function (state) { + if (!state) { + state = new BenchmarkState(this._suites); + this._measuredValues = {tests: {}, total: 0, mean: NaN, geomean: NaN, score: NaN}; + } + + var suite = state.currentSuite(); + if (!suite) { + this._finalize(); + var promise = new SimplePromise; + promise.resolve(); + return promise; + } + + if (state.isFirstTest()) { + this._removeFrame(); + var self = this; + return state.prepareCurrentSuite(this, this._appendFrame()).then(function (prepareReturnValue) { + self._prepareReturnValue = prepareReturnValue; + return self._runTestAndRecordResults(state); + }); + } + + return this._runTestAndRecordResults(state); +} + +BenchmarkRunner.prototype.runAllSteps = function (startingState) { + var nextCallee = this.runAllSteps.bind(this); + this.step(startingState).then(function (nextState) { + if (nextState) + nextCallee(nextState); + }); +} + +BenchmarkRunner.prototype.runMultipleIterations = function (iterationCount) { + var self = this; + var currentIteration = 0; + + this._runNextIteration = function () { + currentIteration++; + if (currentIteration < iterationCount) + self.runAllSteps(); + else if (this._client && this._client.didFinishLastIteration) + this._client.didFinishLastIteration(); + } + + if (this._client && this._client.willStartFirstIteration) + this._client.willStartFirstIteration(iterationCount); + + self.runAllSteps(); +} + +BenchmarkRunner.prototype._runTestAndRecordResults = function (state) { + var promise = new SimplePromise; + var suite = state.currentSuite(); + var test = state.currentTest(); + + if (this._client && this._client.willRunTest) + this._client.willRunTest(suite, test); + + var self = this; + setTimeout(function () { + self._runTest(suite, test, self._prepareReturnValue, function (syncTime, asyncTime) { + var suiteResults = self._measuredValues.tests[suite.name] || {tests:{}, total: 0}; + var total = syncTime + asyncTime; + self._measuredValues.tests[suite.name] = suiteResults; + suiteResults.tests[test.name] = {tests: {'Sync': syncTime, 'Async': asyncTime}, total: total}; + suiteResults.total += total; + + if (self._client && self._client.didRunTest) + self._client.didRunTest(suite, test); + + state.next(); + promise.resolve(state); + }); + }, 0); + return promise; +} + +BenchmarkRunner.prototype._finalize = function () { + this._removeFrame(); + + if (this._client && this._client.didRunSuites) { + var product = 1; + var values = []; + for (var suiteName in this._measuredValues.tests) { + var suiteTotal = this._measuredValues.tests[suiteName].total; + product *= suiteTotal; + values.push(suiteTotal); + } + + values.sort(function (a, b) { return a - b }); // Avoid the loss of significance for the sum. + var total = values.reduce(function (a, b) { return a + b }); + var geomean = Math.pow(product, 1 / values.length); + + var correctionFactor = 1.5; // This factor makes the test score look reasonably fit within 0 to 140. + this._measuredValues.total = total; + this._measuredValues.mean = total / values.length; + this._measuredValues.geomean = geomean; + this._measuredValues.score = 60 * 1000 / geomean / correctionFactor; + this._client.didRunSuites(this._measuredValues); + } + + if (this._runNextIteration) + this._runNextIteration(); +} diff --git a/third_party/webkit/PerformanceTests/StyleBench/resources/gauge.png b/third_party/webkit/PerformanceTests/StyleBench/resources/gauge.png new file mode 100644 index 0000000000..e69de29bb2 diff --git a/third_party/webkit/PerformanceTests/StyleBench/resources/gauge@2x.png b/third_party/webkit/PerformanceTests/StyleBench/resources/gauge@2x.png new file mode 100644 index 0000000000..e69de29bb2 diff --git a/third_party/webkit/PerformanceTests/StyleBench/resources/main.css b/third_party/webkit/PerformanceTests/StyleBench/resources/main.css new file mode 100644 index 0000000000..126cdcdbca --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/resources/main.css @@ -0,0 +1,286 @@ +body { + background-color: rgb(46, 51, 55); + color: rgb(235, 235, 235); + font-family: "Helvetica Neue", Helvetica, Verdana, sans-serif; +} + +::selection { + color: rgb(46, 51, 55); + background-color: rgb(235, 235, 235); +} + +h1, +button { + font-family: "Futura-Medium", Futura, "Helvetica Neue", Helvetica, Verdana, sans-serif; +} + +code { + font-family: Menlo, Monaco, monospace; + font-size: smaller; +} + +button { + cursor: pointer; +} + +hr { + border: 1px solid rgb(235, 235, 235); + width: 50%; + margin: 40px auto; +} + +img { + -webkit-user-select: none; + -webkit-user-drag: none; +} + +main { + display: block; + position: absolute; + width: 800px; + height: 600px; + top: 50%; + left: 50%; + margin-top: -321px; + margin-left: -421px; + padding: 15px; + border: 6px solid rgb(235, 235, 235); + border-radius: 20px; +} + +#logo { + position: absolute; + left: -70px; + top: 115px; + width: 75px; + height: 406px; +} + +h1 { + margin-top: 30px; + font-size: 40px; + font-weight: normal; + color: rgb(235, 235, 235); + text-align: center; +} + +p { + font-size: 16px; + line-height: 21px; +} + +a { + color: inherit; +} + +.buttons { + margin-top: 30px; + text-align: center; +} + +button { + -webkit-appearance: none; + border: 3px solid rgb(235, 235, 235); + border-radius: 10px; + min-width: 200px; + padding: 5px 20px; + margin: 0 40px; + font-size: 25px; + color: rgb(235, 235, 235); + background-color: transparent; + + -webkit-user-select: none; +} + +button:active { + background-color: rgb(235, 235, 235); + color: rgb(46, 51, 55); + border-color: rgb(235, 235, 235) !important; +} + +button:focus { + outline: none; + border-color: rgb(232, 79, 79); +} + +section { + display: none; +} + +section > p { + margin: 10px 20px; +} + +section.selected { + display: block; +} + +#testContainer { + position: absolute; + top: 15px; + left: 15px; + width: 800px; + height: 600px; +} + +section#home > p { + margin: 0 auto; + width: 70%; + text-align: center; +} + +section#home > p:first-child { + margin-top: 160px; + text-align: center; +} + +section#home > .show-about { + margin-top: 100px; +} + +section#home > .buttons { + margin-top: 80px; +} + +section#running > #progress { + position: absolute; + bottom: -6px; + left: 60px; + right: 60px; + height: 6px; + background-color: rgb(128, 128, 128); + border-left: 6px solid rgb(46, 51, 55); + border-right: 6px solid rgb(46, 51, 55); +} + +section#running #progress-completed { + position: absolute; + top: 0; + left: 0; + height: 6px; + width: 0; + background-color: rgb(235, 235, 235); +} + +section#running > #info { + position: absolute; + bottom: -25px; + left: 60px; + right: 60px; + height: 12px; + color: rgb(128, 128, 128); + text-align: center; + font-size: 12px; +} + +section#summarized-results > #result-number, +section#summarized-results > #confidence-number { + font-family: "Futura-CondensedMedium", Futura, "Helvetica Neue", Helvetica, Verdana, sans-serif; +} + +section#summarized-results > #result-number { + text-align: center; + font-size: 145px; + line-height: 145px; +} + +section#summarized-results > #confidence-number { + text-align: center; + font-size: 36px; + line-height: 36px; + color: rgb(128, 128, 128); +} + +section#detailed-results > table { + float: left; + width: 50%; +} + +section#detailed-results > .arithmetic-mean { + clear: both; + padding-top: 32px; + text-align: center; +} + +section#detailed-results > .arithmetic-mean > label { + font-weight: bold; + margin-right: 10px; + color: rgb(128, 128, 128); +} + +section#detailed-results > .show-about { + margin-top: 30px; + text-align: center; +} + +section#about h1 { + margin-top: 10px; + margin-bottom: 0px; + font-size: 25px; +} + +section#about .note { + color: rgb(128, 128, 128); +} + +table { + border-spacing: 0; + border-collapse: collapse; +} + +th, +td { + padding: 5px; +} + +th { + text-align: right; + color: rgb(128, 128, 128); +} + +.gauge { + position: relative; + width: 738px; + height: 78px; + background-image: url(gauge.png); + background-size: 100% 100%; + background-repat: no-repeat; + margin: 0 auto; +} + +.gauge > .window { + position: absolute; + left: 0; + top: 33px; + bottom: 0; + right: 0; + overflow: hidden; +} + +.gauge > .window > .needle { + position: absolute; + left: 363px; + bottom: -88px; + width: 4px; + height: 400px; + background-color: rgb(247, 148, 29); + + -webkit-transform: rotate(-70deg); + -webkit-transform-origin: 2px 400px; + + -moz-transform: rotate(-70deg); + -moz-transform-origin: 2px 400px; + + transform: rotate(-70deg); + transform-origin: 2px 400px; +} + +@media (-webkit-min-device-pixel-ratio: 2), (min--moz-device-pixel-ratio: 2), (min-resolution: 2dppx), (min-resolution: 192dpi) { + #logo { + content: url(logo@2x.png); /* FIXME: This does not work in Firefox. */ + } + + .gauge { + background-image: url(gauge@2x.png); + } +} diff --git a/third_party/webkit/PerformanceTests/StyleBench/resources/main.js b/third_party/webkit/PerformanceTests/StyleBench/resources/main.js new file mode 100644 index 0000000000..2ab877744b --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/resources/main.js @@ -0,0 +1,246 @@ +window.benchmarkClient = { + displayUnit: 'runs/min', + iterationCount: 10, + stepCount: null, + suitesCount: null, + _measuredValuesList: [], + _finishedTestCount: 0, + _progressCompleted: null, + willAddTestFrame: function (frame) { + var main = document.querySelector('main'); + var style = getComputedStyle(main); + frame.style.left = main.offsetLeft + parseInt(style.borderLeftWidth) + parseInt(style.paddingLeft) + 'px'; + frame.style.top = main.offsetTop + parseInt(style.borderTopWidth) + parseInt(style.paddingTop) + 'px'; + }, + willRunTest: function (suite, test) { + document.getElementById('info').textContent = suite.name + ' ( ' + this._finishedTestCount + ' / ' + this.stepCount + ' )'; + }, + didRunTest: function () { + this._finishedTestCount++; + this._progressCompleted.style.width = (this._finishedTestCount * 100 / this.stepCount) + '%'; + }, + didRunSuites: function (measuredValues) { + this._measuredValuesList.push(measuredValues); + }, + willStartFirstIteration: function () { + this._measuredValuesList = []; + this._finishedTestCount = 0; + this._progressCompleted = document.getElementById('progress-completed'); + document.getElementById('logo-link').onclick = function (event) { event.preventDefault(); return false; } + }, + didFinishLastIteration: function () { + document.getElementById('logo-link').onclick = null; + + var results = this._computeResults(this._measuredValuesList, this.displayUnit); + + this._updateGaugeNeedle(results.mean); + document.getElementById('result-number').textContent = results.formattedMean; + if (results.formattedDelta) + document.getElementById('confidence-number').textContent = '\u00b1 ' + results.formattedDelta; + + this._populateDetailedResults(results.formattedValues); + document.getElementById('results-with-statistics').textContent = results.formattedMeanAndDelta; + + if (this.displayUnit == 'ms') { + document.getElementById('show-summary').style.display = 'none'; + showResultDetails(); + } else + showResultsSummary(); + }, + _computeResults: function (measuredValuesList, displayUnit) { + var suitesCount = this.suitesCount; + function valueForUnit(measuredValues) { + if (displayUnit == 'ms') + return measuredValues.geomean; + return measuredValues.score; + } + + function sigFigFromPercentDelta(percentDelta) { + return Math.ceil(-Math.log(percentDelta)/Math.log(10)) + 3; + } + + function toSigFigPrecision(number, sigFig) { + var nonDecimalDigitCount = number < 1 ? 0 : (Math.floor(Math.log(number)/Math.log(10)) + 1); + return number.toPrecision(Math.max(nonDecimalDigitCount, Math.min(6, sigFig))); + } + + var values = measuredValuesList.map(valueForUnit); + var sum = values.reduce(function (a, b) { return a + b; }, 0); + var arithmeticMean = sum / values.length; + var meanSigFig = 4; + var formattedDelta; + var formattedPercentDelta; + if (window.Statistics) { + var delta = Statistics.confidenceIntervalDelta(0.95, values.length, sum, Statistics.squareSum(values)); + if (!isNaN(delta)) { + var percentDelta = delta * 100 / arithmeticMean; + meanSigFig = sigFigFromPercentDelta(percentDelta); + formattedDelta = toSigFigPrecision(delta, 2); + formattedPercentDelta = toSigFigPrecision(percentDelta, 2) + '%'; + } + } + + var formattedMean = toSigFigPrecision(arithmeticMean, Math.max(meanSigFig, 3)); + + return { + formattedValues: values.map(function (value) { + return toSigFigPrecision(value, 4) + ' ' + displayUnit; + }), + mean: arithmeticMean, + formattedMean: formattedMean, + formattedDelta: formattedDelta, + formattedMeanAndDelta: formattedMean + (formattedDelta ? ' \xb1 ' + formattedDelta + ' (' + formattedPercentDelta + ')' : ''), + }; + }, + _addDetailedResultsRow: function (table, iterationNumber, value) { + var row = document.createElement('tr'); + var th = document.createElement('th'); + th.textContent = 'Iteration ' + (iterationNumber + 1); + var td = document.createElement('td'); + td.textContent = value; + row.appendChild(th); + row.appendChild(td); + table.appendChild(row); + }, + _updateGaugeNeedle: function (rpm) { + var needleAngle = Math.max(0, Math.min(rpm, 140)) - 70; + var needleRotationValue = 'rotate(' + needleAngle + 'deg)'; + + var gaugeNeedleElement = document.querySelector('#summarized-results > .gauge .needle'); + gaugeNeedleElement.style.setProperty('-webkit-transform', needleRotationValue); + gaugeNeedleElement.style.setProperty('-moz-transform', needleRotationValue); + gaugeNeedleElement.style.setProperty('-ms-transform', needleRotationValue); + gaugeNeedleElement.style.setProperty('transform', needleRotationValue); + }, + _populateDetailedResults: function (formattedValues) { + var resultsTables = document.querySelectorAll('.results-table'); + var i = 0; + resultsTables[0].innerHTML = ''; + for (; i < Math.ceil(formattedValues.length / 2); i++) + this._addDetailedResultsRow(resultsTables[0], i, formattedValues[i]); + resultsTables[1].innerHTML = ''; + for (; i < formattedValues.length; i++) + this._addDetailedResultsRow(resultsTables[1], i, formattedValues[i]); + }, + prepareUI: function () { + window.addEventListener('popstate', function (event) { + if (event.state) { + var sectionToShow = event.state.section; + if (sectionToShow) { + var sections = document.querySelectorAll('main > section'); + for (var i = 0; i < sections.length; i++) { + if (sections[i].id === sectionToShow) + return showSection(sectionToShow, false); + } + } + } + return showSection('home', false); + }, false); + + function updateScreenSize() { + // FIXME: Detect when the window size changes during the test. + var screenIsTooSmall = window.innerWidth < 850 || window.innerHeight < 650; + document.getElementById('screen-size').textContent = window.innerWidth + 'px by ' + window.innerHeight + 'px'; + document.getElementById('screen-size-warning').style.display = screenIsTooSmall ? null : 'none'; + } + + window.addEventListener('resize', updateScreenSize); + updateScreenSize(); + } +} + +function enableOneSuite(suites, suiteToEnable) +{ + suiteToEnable = suiteToEnable.toLowerCase(); + var found = false; + for (var i = 0; i < suites.length; i++) { + var currentSuite = suites[i]; + if (currentSuite.name.toLowerCase() == suiteToEnable) { + currentSuite.disabled = false; + found = true; + } else + currentSuite.disabled = true; + } + return found; +} + +function startBenchmark() { + if (location.search.length > 1) { + var parts = location.search.substring(1).split('&'); + for (var i = 0; i < parts.length; i++) { + var keyValue = parts[i].split('='); + var key = keyValue[0]; + var value = keyValue[1]; + switch (key) { + case 'unit': + if (value == 'ms') + benchmarkClient.displayUnit = 'ms'; + else + console.error('Invalid unit: ' + value); + break; + case 'iterationCount': + var parsedValue = parseInt(value); + if (!isNaN(parsedValue)) + benchmarkClient.iterationCount = parsedValue; + else + console.error('Invalid iteration count: ' + value); + break; + case 'suite': + if (!enableOneSuite(Suites, value)) { + alert('Suite "' + value + '" does not exist. No tests to run.'); + return false; + } + break; + } + } + } + + var enabledSuites = Suites.filter(function (suite) { return !suite.disabled; }); + var totalSubtestsCount = enabledSuites.reduce(function (testsCount, suite) { return testsCount + suite.tests.length; }, 0); + benchmarkClient.stepCount = benchmarkClient.iterationCount * totalSubtestsCount; + benchmarkClient.suitesCount = enabledSuites.length; + var runner = new BenchmarkRunner(Suites, benchmarkClient); + runner.runMultipleIterations(benchmarkClient.iterationCount); + + return true; +} + +function showSection(sectionIdentifier, pushState) { + var currentSectionElement = document.querySelector('section.selected'); + console.assert(currentSectionElement); + + var newSectionElement = document.getElementById(sectionIdentifier); + console.assert(newSectionElement); + + currentSectionElement.classList.remove('selected'); + newSectionElement.classList.add('selected'); + + if (pushState) + history.pushState({section: sectionIdentifier}, document.title); +} + +function showHome() { + showSection('home', true); +} + +function startTest() { + if (startBenchmark()) + showSection('running'); +} + +function showResultsSummary() { + showSection('summarized-results', true); +} + +function showResultDetails() { + showSection('detailed-results', true); +} + +function showAbout() { + showSection('about', true); +} + +window.addEventListener('DOMContentLoaded', function () { + if (benchmarkClient.prepareUI) + benchmarkClient.prepareUI(); +}); diff --git a/third_party/webkit/PerformanceTests/StyleBench/resources/style-bench.html b/third_party/webkit/PerformanceTests/StyleBench/resources/style-bench.html new file mode 100644 index 0000000000..ce55e10e3b --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/resources/style-bench.html @@ -0,0 +1,32 @@ + + + +
        +
        + + + +
        + + diff --git a/third_party/webkit/PerformanceTests/StyleBench/resources/style-bench.js b/third_party/webkit/PerformanceTests/StyleBench/resources/style-bench.js new file mode 100644 index 0000000000..f2dc17596f --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/resources/style-bench.js @@ -0,0 +1,511 @@ +class Random +{ + constructor(seed) + { + this.seed = seed % 2147483647; + if (this.seed <= 0) + this.seed += 2147483646; + } + + get next() + { + return this.seed = this.seed * 16807 % 2147483647; + } + + underOne() + { + return (this.next % 1048576) / 1048576; + } + + chance(chance) + { + return this.underOne() < chance; + } + + number(under) + { + return this.next % under; + } + + numberSquareWeightedToLow(under) + { + const random = this.underOne(); + const random2 = random * random; + return Math.floor(random2 * under); + } +} + +function nextAnimationFrame() +{ + return new Promise(resolve => requestAnimationFrame(resolve)); +} + +class StyleBench +{ + static defaultConfiguration() + { + return { + name: 'Default', + elementTypeCount: 10, + idChance: 0.05, + elementChance: 0.5, + classCount: 200, + classChance: 0.3, + starChance: 0.05, + attributeChance: 0.02, + attributeCount: 10, + attributeValueCount: 20, + attributeOperators: ['','='], + elementClassChance: 0.5, + elementMaximumClasses: 3, + elementAttributeChance: 0.2, + elementMaximumAttributes: 3, + combinators: [' ', '>',], + pseudoClasses: [], + pseudoClassChance: 0, + beforeAfterChance: 0, + maximumSelectorLength: 6, + ruleCount: 5000, + elementCount: 20000, + maximumTreeDepth: 6, + maximumTreeWidth: 50, + repeatingSequenceChance: 0.2, + repeatingSequenceMaximumLength: 3, + leafMutationChance: 0.1, + styleSeed: 1, + domSeed: 2, + stepCount: 5, + mutationsPerStep: 100, + }; + } + + static descendantCombinatorConfiguration() + { + return Object.assign(this.defaultConfiguration(), { + name: 'Descendant and child combinators', + }); + } + + static siblingCombinatorConfiguration() + { + return Object.assign(this.defaultConfiguration(), { + name: 'Sibling combinators', + combinators: [' ', ' ', '>', '>', '~', '+',], + }); + } + + static structuralPseudoClassConfiguration() + { + return Object.assign(this.defaultConfiguration(), { + name: 'Structural pseudo classes', + pseudoClassChance: 0.1, + pseudoClasses: [ + 'first-child', + 'last-child', + 'first-of-type', + 'last-of-type', + 'only-of-type', + 'empty', + ], + }); + } + + static nthPseudoClassConfiguration() + { + return Object.assign(this.defaultConfiguration(), { + name: 'Nth pseudo classes', + pseudoClassChance: 0.1, + pseudoClasses: [ + 'nth-child(2n+1)', + 'nth-last-child(3n)', + 'nth-of-type(3n)', + 'nth-last-of-type(4n)', + ], + }); + } + + static beforeAndAfterConfiguration() + { + return Object.assign(this.defaultConfiguration(), { + name: 'Before and after pseudo elements', + beforeAfterChance: 0.1, + }); + } + + static predefinedConfigurations() + { + return [ + this.descendantCombinatorConfiguration(), + this.siblingCombinatorConfiguration(), + this.structuralPseudoClassConfiguration(), + this.nthPseudoClassConfiguration(), + this.beforeAndAfterConfiguration(), + ]; + } + + constructor(configuration) + { + this.configuration = configuration; + this.idCount = 0; + + this.baseStyle = document.createElement("style"); + this.baseStyle.textContent = ` + #testroot { + font-size: 10px; + line-height: 10px; + } + #testroot * { + display: inline-block; + height:10px; + min-width:10px; + } + `; + document.head.appendChild(this.baseStyle); + + this.random = new Random(this.configuration.styleSeed); + this.makeStyle(); + + this.random = new Random(this.configuration.domSeed); + this.makeTree(); + } + + randomElementName() + { + const elementTypeCount = this.configuration.elementTypeCount; + return `elem${ this.random.numberSquareWeightedToLow(elementTypeCount) }`; + } + + randomClassName() + { + const classCount = this.configuration.classCount; + return `class${ this.random.numberSquareWeightedToLow(classCount) }`; + } + + randomClassNameFromRange(range) + { + const maximum = Math.round(range * this.configuration.classCount); + return `class${ this.random.numberSquareWeightedToLow(maximum) }`; + } + + randomAttributeName() + { + const attributeCount = this.configuration.attributeCount; + return `attr${ this.random.numberSquareWeightedToLow(attributeCount) }`; + } + + randomAttributeValue() + { + const attributeValueCount = this.configuration.attributeValueCount; + const valueNum = this.random.numberSquareWeightedToLow(attributeValueCount); + if (valueNum == 0) + return ""; + if (valueNum == 1) + return "val"; + return `val${valueNum}`; + } + + randomCombinator() + { + const combinators = this.configuration.combinators; + return combinators[this.random.number(combinators.length)] + } + + randomPseudoClass(isLast) + { + const pseudoClasses = this.configuration.pseudoClasses; + const pseudoClass = pseudoClasses[this.random.number(pseudoClasses.length)] + if (!isLast && pseudoClass == 'empty') + return this.randomPseudoClass(isLast); + return pseudoClass; + } + + randomId() + { + const idCount = this.configuration.idChance * this.configuration.elementCount ; + return `id${ this.random.number(idCount) }`; + } + + randomAttributeSelector() + { + const name = this.randomAttributeName(); + const operators = this.configuration.attributeOperators; + const operator = operators[this.random.numberSquareWeightedToLow(operators.length)]; + if (operator == '') + return `[${name}]`; + const value = this.randomAttributeValue(); + return `[${name}${operator}"${value}"]`; + } + + makeCompoundSelector(index, length) + { + const isFirst = index == 0; + const isLast = index == length - 1; + const usePseudoClass = this.random.chance(this.configuration.pseudoClassChance) && this.configuration.pseudoClasses.length; + const useId = isFirst && this.random.chance(this.configuration.idChance); + const useElement = !useId && (usePseudoClass || this.random.chance(this.configuration.elementChance)); // :nth-of-type etc only make sense with element + const useAttribute = !useId && this.random.chance(this.configuration.attributeChance); + const useIdElementOrAttribute = useId || useElement || useAttribute; + const useStar = !useIdElementOrAttribute && !isFirst && this.random.chance(this.configuration.starChance); + const useClass = !useId && !useStar && (!useIdElementOrAttribute || this.random.chance(this.configuration.classChance)); + const useBeforeOrAfter = isLast && this.random.chance(this.configuration.beforeAfterChance); + let result = ""; + if (useElement) + result += this.randomElementName(); + if (useStar) + result = "*"; + if (useId) + result += "#" + this.randomId(); + if (useClass) { + const classCount = this.random.numberSquareWeightedToLow(2) + 1; + for (let i = 0; i < classCount; ++i) { + // Use a smaller pool of class names on the left side of the selectors to create containers. + result += "." + this.randomClassNameFromRange((index + 1) / length); + } + } + if (useAttribute) + result += this.randomAttributeSelector(); + + if (usePseudoClass) + result += ":" + this.randomPseudoClass(isLast); + if (useBeforeOrAfter) { + if (this.random.chance(0.5)) + result += "::before"; + else + result += "::after"; + } + return result; + } + + makeSelector() + { + const length = this.random.number(this.configuration.maximumSelectorLength) + 1; + let result = this.makeCompoundSelector(0, length); + for (let i = 1; i < length; ++i) { + const combinator = this.randomCombinator(); + if (combinator != ' ') + result += " " + combinator; + result += " " + this.makeCompoundSelector(i, length); + } + return result; + } + + get randomColorComponent() + { + return this.random.next % 256; + } + + makeDeclaration(selector) + { + let declaration = `background-color: rgb(${this.randomColorComponent}, ${this.randomColorComponent}, ${this.randomColorComponent});`; + + if (selector.endsWith('::before') || selector.endsWith('::after')) + declaration += " content: ''; min-width:5px; display:inline-block;"; + + return declaration; + } + + makeRule() + { + const selector = this.makeSelector(); + return selector + " { " + this.makeDeclaration(selector) + " }"; + } + + makeStylesheet(size) + { + let cssText = ""; + for (let i = 0; i < size; ++i) + cssText += this.makeRule() + "\n"; + return cssText; + } + + makeStyle() + { + this.testStyle = document.createElement("style"); + this.testStyle.textContent = this.makeStylesheet(this.configuration.ruleCount); + + document.head.appendChild(this.testStyle); + } + + makeElement() + { + const element = document.createElement(this.randomElementName()); + const hasClasses = this.random.chance(this.configuration.elementClassChance); + const hasAttributes = this.random.chance(this.configuration.elementAttributeChance); + if (hasClasses) { + const count = this.random.numberSquareWeightedToLow(this.configuration.elementMaximumClasses) + 1; + for (let i = 0; i < count; ++i) + element.classList.add(this.randomClassName()); + } + if (hasAttributes) { + const count = this.random.number(this.configuration.elementMaximumAttributes) + 1; + for (let i = 0; i < count; ++i) + element.setAttribute(this.randomAttributeName(), this.randomAttributeValue()); + } + const hasId = this.random.chance(this.configuration.idChance); + if (hasId) { + element.id = `id${ this.idCount }`; + this.idCount++; + } + return element; + } + + makeTreeWithDepth(parent, remainingCount, depth) + { + const maximumDepth = this.configuration.maximumTreeDepth; + const maximumWidth = this.configuration.maximumTreeWidth; + const nonEmptyChance = (maximumDepth - depth) / maximumDepth; + + const shouldRepeat = this.random.chance(this.configuration.repeatingSequenceChance); + const repeatingSequenceLength = shouldRepeat ? this.random.number(this.configuration.repeatingSequenceMaximumLength) + 1 : 0; + + let childCount = 0; + if (depth == 0) + childCount = remainingCount; + else if (this.random.chance(nonEmptyChance)) + childCount = this.random.number(maximumWidth * depth / maximumDepth); + + let repeatingSequence = []; + let repeatingSequenceSize = 0; + for (let i = 0; i < childCount; ++i) { + if (shouldRepeat && repeatingSequence.length == repeatingSequenceLength && repeatingSequenceSize < remainingCount) { + for (const subtree of repeatingSequence) + parent.appendChild(subtree.cloneNode(true)); + remainingCount -= repeatingSequenceSize; + if (!remainingCount) + return 0; + continue; + } + const element = this.makeElement(); + parent.appendChild(element); + + if (!--remainingCount) + return 0; + remainingCount = this.makeTreeWithDepth(element, remainingCount, depth + 1); + if (!remainingCount) + return 0; + + if (shouldRepeat && repeatingSequence.length < repeatingSequenceLength) { + repeatingSequence.push(element); + repeatingSequenceSize += element.querySelectorAll("*").length + 1; + } + } + return remainingCount; + } + + makeTree() + { + this.testRoot = document.querySelector("#testroot"); + const elementCount = this.configuration.elementCount; + + this.makeTreeWithDepth(this.testRoot, elementCount, 0); + + this.updateCachedTestElements(); + } + + updateCachedTestElements() + { + this.testElements = this.testRoot.querySelectorAll("*"); + } + + randomTreeElement() + { + const randomIndex = this.random.number(this.testElements.length); + return this.testElements[randomIndex] + } + + addClasses(count) + { + for (let i = 0; i < count;) { + const element = this.randomTreeElement(); + // There are more leaves than branches. Avoid skewing towards leaf mutations. + if (!element.firstChild && !this.random.chance(this.configuration.leafMutationChance)) + continue; + ++i; + const classList = element.classList; + classList.add(this.randomClassName()); + } + } + + removeClasses(count) + { + for (let i = 0; i < count;) { + const element = this.randomTreeElement(); + const classList = element.classList; + if (!element.firstChild && !this.random.chance(this.configuration.leafMutationChance)) + continue; + if (!classList.length) + continue; + ++i; + classList.remove(classList[0]); + } + } + + addLeafElements(count) + { + for (let i = 0; i < count;) { + const parent = this.randomTreeElement(); + // Avoid altering tree shape by turning many leaves into containers. + if (!parent.firstChild) + continue; + ++i; + const children = parent.childNodes; + const index = this.random.number(children.length + 1); + parent.insertBefore(this.makeElement(), children[index]); + } + this.updateCachedTestElements(); + } + + removeLeafElements(count) + { + for (let i = 0; i < count;) { + const element = this.randomTreeElement(); + + const canRemove = !element.firstChild && element.parentNode; + if (!canRemove) + continue; + ++i; + element.parentNode.removeChild(element); + } + this.updateCachedTestElements(); + } + + mutateAttributes(count) + { + for (let i = 0; i < count;) { + const element = this.randomTreeElement(); + // There are more leaves than branches. Avoid skewing towards leaf mutations. + if (!element.firstChild && !this.random.chance(this.configuration.leafMutationChance)) + continue; + const attributeNames = element.getAttributeNames(); + let mutatedAttributes = false; + for (const name of attributeNames) { + if (name == "class" || name == "id") + continue; + if (this.random.chance(0.5)) + element.removeAttribute(name); + else + element.setAttribute(name, this.randomAttributeValue()); + mutatedAttributes = true; + } + if (!mutatedAttributes) { + const attributeCount = this.random.number(this.configuration.elementMaximumAttributes) + 1; + for (let j = 0; j < attributeCount; ++j) + element.setAttribute(this.randomAttributeName(), this.randomAttributeValue()); + } + ++i; + } + } + + async runForever() + { + while (true) { + this.addClasses(10); + this.removeClasses(10); + this.addLeafElements(10); + this.removeLeafElements(10); + this.mutateAttributes(10); + + await nextAnimationFrame(); + } + } +} diff --git a/third_party/webkit/PerformanceTests/StyleBench/resources/tests.js b/third_party/webkit/PerformanceTests/StyleBench/resources/tests.js new file mode 100644 index 0000000000..85778316fa --- /dev/null +++ b/third_party/webkit/PerformanceTests/StyleBench/resources/tests.js @@ -0,0 +1,40 @@ +function makeSteps(configuration) +{ + const steps = []; + for (i = 0; i < configuration.stepCount; ++i) { + steps.push(new BenchmarkTestStep(`Adding classes - ${i}`, (bench, contentWindow, contentDocument) => { + bench.addClasses(configuration.mutationsPerStep); + })); + steps.push(new BenchmarkTestStep(`Removing classes - ${i}`, (bench, contentWindow, contentDocument) => { + bench.removeClasses(configuration.mutationsPerStep); + })); + steps.push(new BenchmarkTestStep(`Mutating attributes - ${i}`, (bench, contentWindow, contentDocument) => { + bench.mutateAttributes(configuration.mutationsPerStep); + })); + steps.push(new BenchmarkTestStep(`Adding leaf elements - ${i}`, (bench, contentWindow, contentDocument) => { + bench.addLeafElements(configuration.mutationsPerStep); + })); + steps.push(new BenchmarkTestStep(`Removing leaf elements - ${i}`, (bench, contentWindow, contentDocument) => { + bench.removeLeafElements(configuration.mutationsPerStep); + })); + } + return steps; +} + +function makeSuite(configuration) +{ + return { + name: configuration.name, + url: 'style-bench.html', + prepare: (runner, contentWindow, contentDocument) => { + return runner.waitForElement('#testroot').then((element) => { + return contentWindow.createBenchmark(configuration); + }); + }, + tests: makeSteps(configuration), + }; +} + +var Suites = []; +for (const configuration of StyleBench.predefinedConfigurations()) + Suites.push(makeSuite(configuration)); diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-cube.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-cube.js new file mode 100644 index 0000000000..588eaf97ad --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-cube.js @@ -0,0 +1,337 @@ +// 3D Cube Rotation +// http://www.speich.net/computer/moztesting/3d.htm +// Created by Simon Speich + +var Q = new Array(); +var MTrans = new Array(); // transformation matrix +var MQube = new Array(); // position information of qube +var I = new Array(); // entity matrix +var Origin = new Object(); +var Testing = new Object(); +var LoopTimer; + +var DisplArea = new Object(); +DisplArea.Width = 300; +DisplArea.Height = 300; + +function DrawLine(From, To) { + var x1 = From.V[0]; + var x2 = To.V[0]; + var y1 = From.V[1]; + var y2 = To.V[1]; + var dx = Math.abs(x2 - x1); + var dy = Math.abs(y2 - y1); + var x = x1; + var y = y1; + var IncX1, IncY1; + var IncX2, IncY2; + var Den; + var Num; + var NumAdd; + var NumPix; + + if (x2 >= x1) { IncX1 = 1; IncX2 = 1; } + else { IncX1 = -1; IncX2 = -1; } + if (y2 >= y1) { IncY1 = 1; IncY2 = 1; } + else { IncY1 = -1; IncY2 = -1; } + if (dx >= dy) { + IncX1 = 0; + IncY2 = 0; + Den = dx; + Num = dx / 2; + NumAdd = dy; + NumPix = dx; + } + else { + IncX2 = 0; + IncY1 = 0; + Den = dy; + Num = dy / 2; + NumAdd = dx; + NumPix = dy; + } + + NumPix = Math.round(Q.LastPx + NumPix); + + var i = Q.LastPx; + for (; i < NumPix; i++) { + Num += NumAdd; + if (Num >= Den) { + Num -= Den; + x += IncX1; + y += IncY1; + } + x += IncX2; + y += IncY2; + } + Q.LastPx = NumPix; +} + +function CalcCross(V0, V1) { + var Cross = new Array(); + Cross[0] = V0[1]*V1[2] - V0[2]*V1[1]; + Cross[1] = V0[2]*V1[0] - V0[0]*V1[2]; + Cross[2] = V0[0]*V1[1] - V0[1]*V1[0]; + return Cross; +} + +function CalcNormal(V0, V1, V2) { + var A = new Array(); var B = new Array(); + for (var i = 0; i < 3; i++) { + A[i] = V0[i] - V1[i]; + B[i] = V2[i] - V1[i]; + } + A = CalcCross(A, B); + var Length = Math.sqrt(A[0]*A[0] + A[1]*A[1] + A[2]*A[2]); + for (var i = 0; i < 3; i++) A[i] = A[i] / Length; + A[3] = 1; + return A; +} + +function CreateP(X,Y,Z) { + this.V = [X,Y,Z,1]; +} + +// multiplies two matrices +function MMulti(M1, M2) { + var M = [[],[],[],[]]; + var i = 0; + var j = 0; + for (; i < 4; i++) { + j = 0; + for (; j < 4; j++) M[i][j] = M1[i][0] * M2[0][j] + M1[i][1] * M2[1][j] + M1[i][2] * M2[2][j] + M1[i][3] * M2[3][j]; + } + return M; +} + +//multiplies matrix with vector +function VMulti(M, V) { + var Vect = new Array(); + var i = 0; + for (;i < 4; i++) Vect[i] = M[i][0] * V[0] + M[i][1] * V[1] + M[i][2] * V[2] + M[i][3] * V[3]; + return Vect; +} + +function VMulti2(M, V) { + var Vect = new Array(); + var i = 0; + for (;i < 3; i++) Vect[i] = M[i][0] * V[0] + M[i][1] * V[1] + M[i][2] * V[2]; + return Vect; +} + +// add to matrices +function MAdd(M1, M2) { + var M = [[],[],[],[]]; + var i = 0; + var j = 0; + for (; i < 4; i++) { + j = 0; + for (; j < 4; j++) M[i][j] = M1[i][j] + M2[i][j]; + } + return M; +} + +function Translate(M, Dx, Dy, Dz) { + var T = [ + [1,0,0,Dx], + [0,1,0,Dy], + [0,0,1,Dz], + [0,0,0,1] + ]; + return MMulti(T, M); +} + +function RotateX(M, Phi) { + var a = Phi; + a *= Math.PI / 180; + var Cos = Math.cos(a); + var Sin = Math.sin(a); + var R = [ + [1,0,0,0], + [0,Cos,-Sin,0], + [0,Sin,Cos,0], + [0,0,0,1] + ]; + return MMulti(R, M); +} + +function RotateY(M, Phi) { + var a = Phi; + a *= Math.PI / 180; + var Cos = Math.cos(a); + var Sin = Math.sin(a); + var R = [ + [Cos,0,Sin,0], + [0,1,0,0], + [-Sin,0,Cos,0], + [0,0,0,1] + ]; + return MMulti(R, M); +} + +function RotateZ(M, Phi) { + var a = Phi; + a *= Math.PI / 180; + var Cos = Math.cos(a); + var Sin = Math.sin(a); + var R = [ + [Cos,-Sin,0,0], + [Sin,Cos,0,0], + [0,0,1,0], + [0,0,0,1] + ]; + return MMulti(R, M); +} + +function DrawQube() { + // calc current normals + var CurN = new Array(); + var i = 5; + Q.LastPx = 0; + for (; i > -1; i--) CurN[i] = VMulti2(MQube, Q.Normal[i]); + if (CurN[0][2] < 0) { + if (!Q.Line[0]) { DrawLine(Q[0], Q[1]); Q.Line[0] = true; }; + if (!Q.Line[1]) { DrawLine(Q[1], Q[2]); Q.Line[1] = true; }; + if (!Q.Line[2]) { DrawLine(Q[2], Q[3]); Q.Line[2] = true; }; + if (!Q.Line[3]) { DrawLine(Q[3], Q[0]); Q.Line[3] = true; }; + } + if (CurN[1][2] < 0) { + if (!Q.Line[2]) { DrawLine(Q[3], Q[2]); Q.Line[2] = true; }; + if (!Q.Line[9]) { DrawLine(Q[2], Q[6]); Q.Line[9] = true; }; + if (!Q.Line[6]) { DrawLine(Q[6], Q[7]); Q.Line[6] = true; }; + if (!Q.Line[10]) { DrawLine(Q[7], Q[3]); Q.Line[10] = true; }; + } + if (CurN[2][2] < 0) { + if (!Q.Line[4]) { DrawLine(Q[4], Q[5]); Q.Line[4] = true; }; + if (!Q.Line[5]) { DrawLine(Q[5], Q[6]); Q.Line[5] = true; }; + if (!Q.Line[6]) { DrawLine(Q[6], Q[7]); Q.Line[6] = true; }; + if (!Q.Line[7]) { DrawLine(Q[7], Q[4]); Q.Line[7] = true; }; + } + if (CurN[3][2] < 0) { + if (!Q.Line[4]) { DrawLine(Q[4], Q[5]); Q.Line[4] = true; }; + if (!Q.Line[8]) { DrawLine(Q[5], Q[1]); Q.Line[8] = true; }; + if (!Q.Line[0]) { DrawLine(Q[1], Q[0]); Q.Line[0] = true; }; + if (!Q.Line[11]) { DrawLine(Q[0], Q[4]); Q.Line[11] = true; }; + } + if (CurN[4][2] < 0) { + if (!Q.Line[11]) { DrawLine(Q[4], Q[0]); Q.Line[11] = true; }; + if (!Q.Line[3]) { DrawLine(Q[0], Q[3]); Q.Line[3] = true; }; + if (!Q.Line[10]) { DrawLine(Q[3], Q[7]); Q.Line[10] = true; }; + if (!Q.Line[7]) { DrawLine(Q[7], Q[4]); Q.Line[7] = true; }; + } + if (CurN[5][2] < 0) { + if (!Q.Line[8]) { DrawLine(Q[1], Q[5]); Q.Line[8] = true; }; + if (!Q.Line[5]) { DrawLine(Q[5], Q[6]); Q.Line[5] = true; }; + if (!Q.Line[9]) { DrawLine(Q[6], Q[2]); Q.Line[9] = true; }; + if (!Q.Line[1]) { DrawLine(Q[2], Q[1]); Q.Line[1] = true; }; + } + Q.Line = [false,false,false,false,false,false,false,false,false,false,false,false]; + Q.LastPx = 0; +} + +function Loop() { + if (Testing.LoopCount > Testing.LoopMax) return; + var TestingStr = String(Testing.LoopCount); + while (TestingStr.length < 3) TestingStr = "0" + TestingStr; + MTrans = Translate(I, -Q[8].V[0], -Q[8].V[1], -Q[8].V[2]); + MTrans = RotateX(MTrans, 1); + MTrans = RotateY(MTrans, 3); + MTrans = RotateZ(MTrans, 5); + MTrans = Translate(MTrans, Q[8].V[0], Q[8].V[1], Q[8].V[2]); + MQube = MMulti(MTrans, MQube); + var i = 8; + for (; i > -1; i--) { + Q[i].V = VMulti(MTrans, Q[i].V); + } + DrawQube(); + Testing.LoopCount++; + Loop(); +} + +function Init(CubeSize) { + // init/reset vars + Origin.V = [150,150,20,1]; + Testing.LoopCount = 0; + Testing.LoopMax = 50; + Testing.TimeMax = 0; + Testing.TimeAvg = 0; + Testing.TimeMin = 0; + Testing.TimeTemp = 0; + Testing.TimeTotal = 0; + Testing.Init = false; + + // transformation matrix + MTrans = [ + [1,0,0,0], + [0,1,0,0], + [0,0,1,0], + [0,0,0,1] + ]; + + // position information of qube + MQube = [ + [1,0,0,0], + [0,1,0,0], + [0,0,1,0], + [0,0,0,1] + ]; + + // entity matrix + I = [ + [1,0,0,0], + [0,1,0,0], + [0,0,1,0], + [0,0,0,1] + ]; + + // create qube + Q[0] = new CreateP(-CubeSize,-CubeSize, CubeSize); + Q[1] = new CreateP(-CubeSize, CubeSize, CubeSize); + Q[2] = new CreateP( CubeSize, CubeSize, CubeSize); + Q[3] = new CreateP( CubeSize,-CubeSize, CubeSize); + Q[4] = new CreateP(-CubeSize,-CubeSize,-CubeSize); + Q[5] = new CreateP(-CubeSize, CubeSize,-CubeSize); + Q[6] = new CreateP( CubeSize, CubeSize,-CubeSize); + Q[7] = new CreateP( CubeSize,-CubeSize,-CubeSize); + + // center of gravity + Q[8] = new CreateP(0, 0, 0); + + // anti-clockwise edge check + Q.Edge = [[0,1,2],[3,2,6],[7,6,5],[4,5,1],[4,0,3],[1,5,6]]; + + // calculate squad normals + Q.Normal = new Array(); + for (var i = 0; i < Q.Edge.length; i++) Q.Normal[i] = CalcNormal(Q[Q.Edge[i][0]].V, Q[Q.Edge[i][1]].V, Q[Q.Edge[i][2]].V); + + // line drawn ? + Q.Line = [false,false,false,false,false,false,false,false,false,false,false,false]; + + // create line pixels + Q.NumPx = 9 * 2 * CubeSize; + for (var i = 0; i < Q.NumPx; i++) CreateP(0,0,0); + + MTrans = Translate(MTrans, Origin.V[0], Origin.V[1], Origin.V[2]); + MQube = MMulti(MTrans, MQube); + + var i = 0; + for (; i < 9; i++) { + Q[i].V = VMulti(MTrans, Q[i].V); + } + DrawQube(); + Testing.Init = true; + Loop(); +} + +for ( var i = 20; i <= 160; i *= 2 ) { + Init(i); +} + +Q = null; +MTrans = null; +MQube = null; +I = null; +Origin = null; +Testing = null; +LoopTime = null; +DisplArea = null; diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-morph.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-morph.js new file mode 100644 index 0000000000..f55bedde48 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-morph.js @@ -0,0 +1,54 @@ +/* + * Copyright (C) 2007 Apple Inc. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY APPLE COMPUTER, INC. ``AS IS'' AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL APPLE COMPUTER, INC. OR + * CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + * PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + * PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY + * OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +var loops = 15 +var nx = 120 +var nz = 120 + +function morph(a, f) { + var PI2nx = Math.PI * 8/nx + var sin = Math.sin + var f30 = -(50 * sin(f*Math.PI*2)) + + for (var i = 0; i < nz; ++i) { + for (var j = 0; j < nx; ++j) { + a[3*(i*nx+j)+1] = sin((j-1) * PI2nx ) * -f30 + } + } +} + + +var a = Array() +for (var i=0; i < nx*nz*3; ++i) + a[i] = 0 + +for (var i = 0; i < loops; ++i) { + morph(a, i/loops) +} + +testOutput = 0; +for (var i = 0; i < nx; i++) + testOutput += a[3*(i*nx+i)+1]; +a = null; diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-raytrace.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-raytrace.js new file mode 100644 index 0000000000..38f5a2956d --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/3d-raytrace.js @@ -0,0 +1,441 @@ +/* + * Copyright (C) 2007 Apple Inc. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY APPLE COMPUTER, INC. ``AS IS'' AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL APPLE COMPUTER, INC. OR + * CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + * PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + * PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY + * OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +function createVector(x,y,z) { + return new Array(x,y,z); +} + +function sqrLengthVector(self) { + return self[0] * self[0] + self[1] * self[1] + self[2] * self[2]; +} + +function lengthVector(self) { + return Math.sqrt(self[0] * self[0] + self[1] * self[1] + self[2] * self[2]); +} + +function addVector(self, v) { + self[0] += v[0]; + self[1] += v[1]; + self[2] += v[2]; + return self; +} + +function subVector(self, v) { + self[0] -= v[0]; + self[1] -= v[1]; + self[2] -= v[2]; + return self; +} + +function scaleVector(self, scale) { + self[0] *= scale; + self[1] *= scale; + self[2] *= scale; + return self; +} + +function normaliseVector(self) { + var len = Math.sqrt(self[0] * self[0] + self[1] * self[1] + self[2] * self[2]); + self[0] /= len; + self[1] /= len; + self[2] /= len; + return self; +} + +function add(v1, v2) { + return new Array(v1[0] + v2[0], v1[1] + v2[1], v1[2] + v2[2]); +} + +function sub(v1, v2) { + return new Array(v1[0] - v2[0], v1[1] - v2[1], v1[2] - v2[2]); +} + +function scalev(v1, v2) { + return new Array(v1[0] * v2[0], v1[1] * v2[1], v1[2] * v2[2]); +} + +function dot(v1, v2) { + return v1[0] * v2[0] + v1[1] * v2[1] + v1[2] * v2[2]; +} + +function scale(v, scale) { + return [v[0] * scale, v[1] * scale, v[2] * scale]; +} + +function cross(v1, v2) { + return [v1[1] * v2[2] - v1[2] * v2[1], + v1[2] * v2[0] - v1[0] * v2[2], + v1[0] * v2[1] - v1[1] * v2[0]]; + +} + +function normalise(v) { + var len = lengthVector(v); + return [v[0] / len, v[1] / len, v[2] / len]; +} + +function transformMatrix(self, v) { + var vals = self; + var x = vals[0] * v[0] + vals[1] * v[1] + vals[2] * v[2] + vals[3]; + var y = vals[4] * v[0] + vals[5] * v[1] + vals[6] * v[2] + vals[7]; + var z = vals[8] * v[0] + vals[9] * v[1] + vals[10] * v[2] + vals[11]; + return [x, y, z]; +} + +function invertMatrix(self) { + var temp = new Array(16); + var tx = -self[3]; + var ty = -self[7]; + var tz = -self[11]; + for (h = 0; h < 3; h++) + for (v = 0; v < 3; v++) + temp[h + v * 4] = self[v + h * 4]; + for (i = 0; i < 11; i++) + self[i] = temp[i]; + self[3] = tx * self[0] + ty * self[1] + tz * self[2]; + self[7] = tx * self[4] + ty * self[5] + tz * self[6]; + self[11] = tx * self[8] + ty * self[9] + tz * self[10]; + return self; +} + + +// Triangle intersection using barycentric coord method +function Triangle(p1, p2, p3) { + var edge1 = sub(p3, p1); + var edge2 = sub(p2, p1); + var normal = cross(edge1, edge2); + if (Math.abs(normal[0]) > Math.abs(normal[1])) + if (Math.abs(normal[0]) > Math.abs(normal[2])) + this.axis = 0; + else + this.axis = 2; + else + if (Math.abs(normal[1]) > Math.abs(normal[2])) + this.axis = 1; + else + this.axis = 2; + var u = (this.axis + 1) % 3; + var v = (this.axis + 2) % 3; + var u1 = edge1[u]; + var v1 = edge1[v]; + + var u2 = edge2[u]; + var v2 = edge2[v]; + this.normal = normalise(normal); + this.nu = normal[u] / normal[this.axis]; + this.nv = normal[v] / normal[this.axis]; + this.nd = dot(normal, p1) / normal[this.axis]; + var det = u1 * v2 - v1 * u2; + this.eu = p1[u]; + this.ev = p1[v]; + this.nu1 = u1 / det; + this.nv1 = -v1 / det; + this.nu2 = v2 / det; + this.nv2 = -u2 / det; + this.material = [0.7, 0.7, 0.7]; +} + +Triangle.prototype.intersect = function(orig, dir, near, far) { + var u = (this.axis + 1) % 3; + var v = (this.axis + 2) % 3; + var d = dir[this.axis] + this.nu * dir[u] + this.nv * dir[v]; + var t = (this.nd - orig[this.axis] - this.nu * orig[u] - this.nv * orig[v]) / d; + if (t < near || t > far) + return null; + var Pu = orig[u] + t * dir[u] - this.eu; + var Pv = orig[v] + t * dir[v] - this.ev; + var a2 = Pv * this.nu1 + Pu * this.nv1; + if (a2 < 0) + return null; + var a3 = Pu * this.nu2 + Pv * this.nv2; + if (a3 < 0) + return null; + + if ((a2 + a3) > 1) + return null; + return t; +} + +function Scene(a_triangles) { + this.triangles = a_triangles; + this.lights = []; + this.ambient = [0,0,0]; + this.background = [0.8,0.8,1]; +} +var zero = new Array(0,0,0); + +Scene.prototype.intersect = function(origin, dir, near, far) { + var closest = null; + for (i = 0; i < this.triangles.length; i++) { + var triangle = this.triangles[i]; + var d = triangle.intersect(origin, dir, near, far); + if (d == null || d > far || d < near) + continue; + far = d; + closest = triangle; + } + + if (!closest) + return [this.background[0],this.background[1],this.background[2]]; + + var normal = closest.normal; + var hit = add(origin, scale(dir, far)); + if (dot(dir, normal) > 0) + normal = [-normal[0], -normal[1], -normal[2]]; + + var colour = null; + if (closest.shader) { + colour = closest.shader(closest, hit, dir); + } else { + colour = closest.material; + } + + // do reflection + var reflected = null; + if (colour.reflection > 0.001) { + var reflection = addVector(scale(normal, -2*dot(dir, normal)), dir); + reflected = this.intersect(hit, reflection, 0.0001, 1000000); + if (colour.reflection >= 0.999999) + return reflected; + } + + var l = [this.ambient[0], this.ambient[1], this.ambient[2]]; + for (var i = 0; i < this.lights.length; i++) { + var light = this.lights[i]; + var toLight = sub(light, hit); + var distance = lengthVector(toLight); + scaleVector(toLight, 1.0/distance); + distance -= 0.0001; + if (this.blocked(hit, toLight, distance)) + continue; + var nl = dot(normal, toLight); + if (nl > 0) + addVector(l, scale(light.colour, nl)); + } + l = scalev(l, colour); + if (reflected) { + l = addVector(scaleVector(l, 1 - colour.reflection), scaleVector(reflected, colour.reflection)); + } + return l; +} + +Scene.prototype.blocked = function(O, D, far) { + var near = 0.0001; + var closest = null; + for (i = 0; i < this.triangles.length; i++) { + var triangle = this.triangles[i]; + var d = triangle.intersect(O, D, near, far); + if (d == null || d > far || d < near) + continue; + return true; + } + + return false; +} + + +// this camera code is from notes i made ages ago, it is from *somewhere* -- i cannot remember where +// that somewhere is +function Camera(origin, lookat, up) { + var zaxis = normaliseVector(subVector(lookat, origin)); + var xaxis = normaliseVector(cross(up, zaxis)); + var yaxis = normaliseVector(cross(xaxis, subVector([0,0,0], zaxis))); + var m = new Array(16); + m[0] = xaxis[0]; m[1] = xaxis[1]; m[2] = xaxis[2]; + m[4] = yaxis[0]; m[5] = yaxis[1]; m[6] = yaxis[2]; + m[8] = zaxis[0]; m[9] = zaxis[1]; m[10] = zaxis[2]; + invertMatrix(m); + m[3] = 0; m[7] = 0; m[11] = 0; + this.origin = origin; + this.directions = new Array(4); + this.directions[0] = normalise([-0.7, 0.7, 1]); + this.directions[1] = normalise([ 0.7, 0.7, 1]); + this.directions[2] = normalise([ 0.7, -0.7, 1]); + this.directions[3] = normalise([-0.7, -0.7, 1]); + this.directions[0] = transformMatrix(m, this.directions[0]); + this.directions[1] = transformMatrix(m, this.directions[1]); + this.directions[2] = transformMatrix(m, this.directions[2]); + this.directions[3] = transformMatrix(m, this.directions[3]); +} + +Camera.prototype.generateRayPair = function(y) { + rays = new Array(new Object(), new Object()); + rays[0].origin = this.origin; + rays[1].origin = this.origin; + rays[0].dir = addVector(scale(this.directions[0], y), scale(this.directions[3], 1 - y)); + rays[1].dir = addVector(scale(this.directions[1], y), scale(this.directions[2], 1 - y)); + return rays; +} + +function renderRows(camera, scene, pixels, width, height, starty, stopy) { + for (var y = starty; y < stopy; y++) { + var rays = camera.generateRayPair(y / height); + for (var x = 0; x < width; x++) { + var xp = x / width; + var origin = addVector(scale(rays[0].origin, xp), scale(rays[1].origin, 1 - xp)); + var dir = normaliseVector(addVector(scale(rays[0].dir, xp), scale(rays[1].dir, 1 - xp))); + var l = scene.intersect(origin, dir); + pixels[y][x] = l; + } + } +} + +Camera.prototype.render = function(scene, pixels, width, height) { + var cam = this; + var row = 0; + renderRows(cam, scene, pixels, width, height, 0, height); +} + + + +function raytraceScene() +{ + var startDate = new Date().getTime(); + var numTriangles = 2 * 6; + var triangles = new Array();//numTriangles); + var tfl = createVector(-10, 10, -10); + var tfr = createVector( 10, 10, -10); + var tbl = createVector(-10, 10, 10); + var tbr = createVector( 10, 10, 10); + var bfl = createVector(-10, -10, -10); + var bfr = createVector( 10, -10, -10); + var bbl = createVector(-10, -10, 10); + var bbr = createVector( 10, -10, 10); + + // cube!!! + // front + var i = 0; + + triangles[i++] = new Triangle(tfl, tfr, bfr); + triangles[i++] = new Triangle(tfl, bfr, bfl); + // back + triangles[i++] = new Triangle(tbl, tbr, bbr); + triangles[i++] = new Triangle(tbl, bbr, bbl); + // triangles[i-1].material = [0.7,0.2,0.2]; + // triangles[i-1].material.reflection = 0.8; + // left + triangles[i++] = new Triangle(tbl, tfl, bbl); + // triangles[i-1].reflection = 0.6; + triangles[i++] = new Triangle(tfl, bfl, bbl); + // triangles[i-1].reflection = 0.6; + // right + triangles[i++] = new Triangle(tbr, tfr, bbr); + triangles[i++] = new Triangle(tfr, bfr, bbr); + // top + triangles[i++] = new Triangle(tbl, tbr, tfr); + triangles[i++] = new Triangle(tbl, tfr, tfl); + // bottom + triangles[i++] = new Triangle(bbl, bbr, bfr); + triangles[i++] = new Triangle(bbl, bfr, bfl); + + //Floor!!!! + var green = createVector(0.0, 0.4, 0.0); + var grey = createVector(0.4, 0.4, 0.4); + grey.reflection = 1.0; + var floorShader = function(tri, pos, view) { + var x = ((pos[0]/32) % 2 + 2) % 2; + var z = ((pos[2]/32 + 0.3) % 2 + 2) % 2; + if (x < 1 != z < 1) { + //in the real world we use the fresnel term... + // var angle = 1-dot(view, tri.normal); + // angle *= angle; + // angle *= angle; + // angle *= angle; + //grey.reflection = angle; + return grey; + } else + return green; + } + var ffl = createVector(-1000, -30, -1000); + var ffr = createVector( 1000, -30, -1000); + var fbl = createVector(-1000, -30, 1000); + var fbr = createVector( 1000, -30, 1000); + triangles[i++] = new Triangle(fbl, fbr, ffr); + triangles[i-1].shader = floorShader; + triangles[i++] = new Triangle(fbl, ffr, ffl); + triangles[i-1].shader = floorShader; + + var _scene = new Scene(triangles); + _scene.lights[0] = createVector(20, 38, -22); + _scene.lights[0].colour = createVector(0.7, 0.3, 0.3); + _scene.lights[1] = createVector(-23, 40, 17); + _scene.lights[1].colour = createVector(0.7, 0.3, 0.3); + _scene.lights[2] = createVector(23, 20, 17); + _scene.lights[2].colour = createVector(0.7, 0.7, 0.7); + _scene.ambient = createVector(0.1, 0.1, 0.1); + // _scene.background = createVector(0.7, 0.7, 1.0); + + var size = 30; + var pixels = new Array(); + for (var y = 0; y < size; y++) { + pixels[y] = new Array(); + for (var x = 0; x < size; x++) { + pixels[y][x] = 0; + } + } + + var _camera = new Camera(createVector(-40, 40, 40), createVector(0, 0, 0), createVector(0, 1, 0)); + _camera.render(_scene, pixels, size, size); + + return pixels; +} + +function arrayToCanvasCommands(pixels) +{ + var s = '\nvar pixels = ['; + var size = 30; + for (var y = 0; y < size; y++) { + s += "["; + for (var x = 0; x < size; x++) { + s += "[" + pixels[y][x] + "],"; + } + s+= "],"; + } + s += '];\n var canvas = document.getElementById("renderCanvas").getContext("2d");\n\ +\n\ +\n\ + var size = 30;\n\ + canvas.fillStyle = "red";\n\ + canvas.fillRect(0, 0, size, size);\n\ + canvas.scale(1, -1);\n\ + canvas.translate(0, -size);\n\ +\n\ + if (!canvas.setFillColor)\n\ + canvas.setFillColor = function(r, g, b, a) {\n\ + this.fillStyle = "rgb("+[Math.floor(r * 255), Math.floor(g * 255), Math.floor(b * 255)]+")";\n\ + }\n\ +\n\ +for (var y = 0; y < size; y++) {\n\ + for (var x = 0; x < size; x++) {\n\ + var l = pixels[y][x];\n\ + canvas.setFillColor(l[0], l[1], l[2], 1);\n\ + canvas.fillRect(x, y, 1, 1);\n\ + }\n\ +}'; + + return s; +} + +testOutput = arrayToCanvasCommands(raytraceScene()); diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-binary-trees.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-binary-trees.js new file mode 100644 index 0000000000..04b826a749 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-binary-trees.js @@ -0,0 +1,50 @@ +/* The Great Computer Language Shootout + http://shootout.alioth.debian.org/ + contributed by Isaac Gouy */ + +function TreeNode(left,right,item){ + this.left = left; + this.right = right; + this.item = item; +} + +TreeNode.prototype.itemCheck = function(){ + if (this.left==null) return this.item; + else return this.item + this.left.itemCheck() - this.right.itemCheck(); +} + +function bottomUpTree(item,depth){ + if (depth>0){ + return new TreeNode( + bottomUpTree(2*item-1, depth-1) + ,bottomUpTree(2*item, depth-1) + ,item + ); + } + else { + return new TreeNode(null,null,item); + } +} + +var ret; + +for ( var n = 4; n <= 7; n += 1 ) { + var minDepth = 4; + var maxDepth = Math.max(minDepth + 2, n); + var stretchDepth = maxDepth + 1; + + var check = bottomUpTree(0,stretchDepth).itemCheck(); + + var longLivedTree = bottomUpTree(0,maxDepth); + for (var depth=minDepth; depth<=maxDepth; depth+=2){ + var iterations = 1 << (maxDepth - depth + minDepth); + + check = 0; + for (var i=1; i<=iterations; i++){ + check += bottomUpTree(i,depth).itemCheck(); + check += bottomUpTree(-i,depth).itemCheck(); + } + } + + ret = longLivedTree.itemCheck(); +} diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-fannkuch.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-fannkuch.js new file mode 100644 index 0000000000..cc3bcaa431 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-fannkuch.js @@ -0,0 +1,66 @@ +/* The Great Computer Language Shootout + http://shootout.alioth.debian.org/ + contributed by Isaac Gouy */ + +function fannkuch(n) { + var check = 0; + var perm = Array(n); + var perm1 = Array(n); + var count = Array(n); + var maxPerm = Array(n); + var maxFlipsCount = 0; + var m = n - 1; + + for (var i = 0; i < n; i++) perm1[i] = i; + var r = n; + + while (true) { + // write-out the first 30 permutations + if (check < 30){ + var s = ""; + for(var i=0; i> 1; + for (var i = 0; i < k2; i++) { + var temp = perm[i]; perm[i] = perm[k - i]; perm[k - i] = temp; + } + flipsCount++; + } + + if (flipsCount > maxFlipsCount) { + maxFlipsCount = flipsCount; + for (var i = 0; i < n; i++) maxPerm[i] = perm1[i]; + } + } + + while (true) { + if (r == n) return maxFlipsCount; + var perm0 = perm1[0]; + var i = 0; + while (i < r) { + var j = i + 1; + perm1[i] = perm1[j]; + i = j; + } + perm1[r] = perm0; + + count[r] = count[r] - 1; + if (count[r] > 0) break; + r++; + } + } +} + +var n = 8; +var ret = fannkuch(n); + diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-nbody.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-nbody.js new file mode 100644 index 0000000000..dc85e9df8b --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/access-nbody.js @@ -0,0 +1,169 @@ +/* The Great Computer Language Shootout + http://shootout.alioth.debian.org/ + contributed by Isaac Gouy */ + +var PI = 3.141592653589793; +var SOLAR_MASS = 4 * PI * PI; +var DAYS_PER_YEAR = 365.24; + +function Body(x,y,z,vx,vy,vz,mass){ + this.x = x; + this.y = y; + this.z = z; + this.vx = vx; + this.vy = vy; + this.vz = vz; + this.mass = mass; +} + +Body.prototype.offsetMomentum = function(px,py,pz) { + this.vx = -px / SOLAR_MASS; + this.vy = -py / SOLAR_MASS; + this.vz = -pz / SOLAR_MASS; + return this; +} + +function Jupiter(){ + return new Body( + 4.84143144246472090e+00, + -1.16032004402742839e+00, + -1.03622044471123109e-01, + 1.66007664274403694e-03 * DAYS_PER_YEAR, + 7.69901118419740425e-03 * DAYS_PER_YEAR, + -6.90460016972063023e-05 * DAYS_PER_YEAR, + 9.54791938424326609e-04 * SOLAR_MASS + ); +} + +function Saturn(){ + return new Body( + 8.34336671824457987e+00, + 4.12479856412430479e+00, + -4.03523417114321381e-01, + -2.76742510726862411e-03 * DAYS_PER_YEAR, + 4.99852801234917238e-03 * DAYS_PER_YEAR, + 2.30417297573763929e-05 * DAYS_PER_YEAR, + 2.85885980666130812e-04 * SOLAR_MASS + ); +} + +function Uranus(){ + return new Body( + 1.28943695621391310e+01, + -1.51111514016986312e+01, + -2.23307578892655734e-01, + 2.96460137564761618e-03 * DAYS_PER_YEAR, + 2.37847173959480950e-03 * DAYS_PER_YEAR, + -2.96589568540237556e-05 * DAYS_PER_YEAR, + 4.36624404335156298e-05 * SOLAR_MASS + ); +} + +function Neptune(){ + return new Body( + 1.53796971148509165e+01, + -2.59193146099879641e+01, + 1.79258772950371181e-01, + 2.68067772490389322e-03 * DAYS_PER_YEAR, + 1.62824170038242295e-03 * DAYS_PER_YEAR, + -9.51592254519715870e-05 * DAYS_PER_YEAR, + 5.15138902046611451e-05 * SOLAR_MASS + ); +} + +function Sun(){ + return new Body(0.0, 0.0, 0.0, 0.0, 0.0, 0.0, SOLAR_MASS); +} + + +function NBodySystem(bodies){ + this.bodies = bodies; + var px = 0.0; + var py = 0.0; + var pz = 0.0; + var size = this.bodies.length; + for (var i=0; i0){ + for (var i=1; i<=prefixWidth; i++) s = " " + s; + } + return s; +} + +function nsieve(m, isPrime){ + var i, k, count; + + for (i=2; i<=m; i++) { isPrime[i] = true; } + count = 0; + + for (i=2; i<=m; i++){ + if (isPrime[i]) { + for (k=i+i; k<=m; k+=i) isPrime[k] = false; + count++; + } + } + return count; +} + +function sieve() { + for (var i = 1; i <= 3; i++ ) { + var m = (1<> ((b << 1) & 14)); +c += 3 & (bi3b >> ((b >> 2) & 14)); +c += 3 & (bi3b >> ((b >> 5) & 6)); +return c; + +/* +lir4,0xE994; 9 instructions, no memory access, minimal register dependence, 6 shifts, 2 adds, 1 inline assign +rlwinmr5,r3,1,28,30 +rlwinmr6,r3,30,28,30 +rlwinmr7,r3,27,29,30 +rlwnmr8,r4,r5,30,31 +rlwnmr9,r4,r6,30,31 +rlwnmr10,r4,r7,30,31 +addr3,r8,r9 +addr3,r3,r10 +*/ +} + + +function TimeFunc(func) { +var x, y, t; +for(var x=0; x<500; x++) +for(var y=0; y<256; y++) func(y); +} + +TimeFunc(fast3bitlookup); diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-bits-in-byte.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-bits-in-byte.js new file mode 100644 index 0000000000..679040ff87 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-bits-in-byte.js @@ -0,0 +1,21 @@ +// Copyright (c) 2004 by Arthur Langereis (arthur_ext at domain xfinitegames, tld com) + + +// 1 op = 2 assigns, 16 compare/branches, 8 ANDs, (0-8) ADDs, 8 SHLs +// O(n) +function bitsinbyte(b) { +var m = 1, c = 0; +while(m<0x100) { +if(b & m) c++; +m <<= 1; +} +return c; +} + +function TimeFunc(func) { +var x, y, t; +for(var x=0; x<350; x++) +for(var y=0; y<256; y++) func(y); +} + +TimeFunc(bitsinbyte); diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-bitwise-and.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-bitwise-and.js new file mode 100644 index 0000000000..852ed115ec --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-bitwise-and.js @@ -0,0 +1,28 @@ +/* + * Copyright (C) 2007 Apple Inc. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY APPLE COMPUTER, INC. ``AS IS'' AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL APPLE COMPUTER, INC. OR + * CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + * PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + * PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY + * OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +bitwiseAndValue = 4294967296; +for (var i = 0; i < 600000; i++) + bitwiseAndValue = bitwiseAndValue & i; diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-nsieve-bits.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-nsieve-bits.js new file mode 100644 index 0000000000..150adf015c --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/bitops-nsieve-bits.js @@ -0,0 +1,32 @@ +// The Great Computer Language Shootout +// http://shootout.alioth.debian.org +// +// Contributed by Ian Osgood + +function pad(n,width) { + var s = n.toString(); + while (s.length < width) s = ' ' + s; + return s; +} + +function primes(isPrime, n) { + var i, count = 0, m = 10000<>5; + + for (i=0; i>5] & 1<<(i&31)) { + for (var j=i+i; j>5] &= ~(1<<(j&31)); + count++; + } +} + +function sieve() { + for (var i = 4; i <= 4; i++) { + var isPrime = new Array((10000<>5); + primes(isPrime, i); + } +} + +sieve(); diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/controlflow-recursive.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/controlflow-recursive.js new file mode 100644 index 0000000000..2b27ff2880 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/controlflow-recursive.js @@ -0,0 +1,25 @@ +// The Computer Language Shootout +// http://shootout.alioth.debian.org/ +// contributed by Isaac Gouy + +function ack(m,n){ + if (m==0) { return n+1; } + if (n==0) { return ack(m-1,1); } + return ack(m-1, ack(m,n-1) ); +} + +function fib(n) { + if (n < 2){ return 1; } + return fib(n-2) + fib(n-1); +} + +function tak(x,y,z) { + if (y >= x) return z; + return tak(tak(x-1,y,z), tak(y-1,z,x), tak(z-1,x,y)); +} + +for ( var i = 3; i <= 5; i++ ) { + ack(3,i); + fib(17.0+i); + tak(3*i+3,2*i+2,i+1); +} diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/crypto-aes.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/crypto-aes.js new file mode 100644 index 0000000000..3c2080a50c --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/crypto-aes.js @@ -0,0 +1,422 @@ +/* - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - */ + +/* + * AES Cipher function: encrypt 'input' with Rijndael algorithm + * + * takes byte-array 'input' (16 bytes) + * 2D byte-array key schedule 'w' (Nr+1 x Nb bytes) + * + * applies Nr rounds (10/12/14) using key schedule w for 'add round key' stage + * + * returns byte-array encrypted value (16 bytes) + */ +function Cipher(input, w) { // main Cipher function [§5.1] + var Nb = 4; // block size (in words): no of columns in state (fixed at 4 for AES) + var Nr = w.length/Nb - 1; // no of rounds: 10/12/14 for 128/192/256-bit keys + + var state = [[],[],[],[]]; // initialise 4xNb byte-array 'state' with input [§3.4] + for (var i=0; i<4*Nb; i++) state[i%4][Math.floor(i/4)] = input[i]; + + state = AddRoundKey(state, w, 0, Nb); + + for (var round=1; round 6 && i%Nk == 4) { + temp = SubWord(temp); + } + for (var t=0; t<4; t++) w[i][t] = w[i-Nk][t] ^ temp[t]; + } + + return w; +} + +function SubWord(w) { // apply SBox to 4-byte word w + for (var i=0; i<4; i++) w[i] = Sbox[w[i]]; + return w; +} + +function RotWord(w) { // rotate 4-byte word w left by one byte + w[4] = w[0]; + for (var i=0; i<4; i++) w[i] = w[i+1]; + return w; +} + + +// Sbox is pre-computed multiplicative inverse in GF(2^8) used in SubBytes and KeyExpansion [§5.1.1] +var Sbox = [0x63,0x7c,0x77,0x7b,0xf2,0x6b,0x6f,0xc5,0x30,0x01,0x67,0x2b,0xfe,0xd7,0xab,0x76, + 0xca,0x82,0xc9,0x7d,0xfa,0x59,0x47,0xf0,0xad,0xd4,0xa2,0xaf,0x9c,0xa4,0x72,0xc0, + 0xb7,0xfd,0x93,0x26,0x36,0x3f,0xf7,0xcc,0x34,0xa5,0xe5,0xf1,0x71,0xd8,0x31,0x15, + 0x04,0xc7,0x23,0xc3,0x18,0x96,0x05,0x9a,0x07,0x12,0x80,0xe2,0xeb,0x27,0xb2,0x75, + 0x09,0x83,0x2c,0x1a,0x1b,0x6e,0x5a,0xa0,0x52,0x3b,0xd6,0xb3,0x29,0xe3,0x2f,0x84, + 0x53,0xd1,0x00,0xed,0x20,0xfc,0xb1,0x5b,0x6a,0xcb,0xbe,0x39,0x4a,0x4c,0x58,0xcf, + 0xd0,0xef,0xaa,0xfb,0x43,0x4d,0x33,0x85,0x45,0xf9,0x02,0x7f,0x50,0x3c,0x9f,0xa8, + 0x51,0xa3,0x40,0x8f,0x92,0x9d,0x38,0xf5,0xbc,0xb6,0xda,0x21,0x10,0xff,0xf3,0xd2, + 0xcd,0x0c,0x13,0xec,0x5f,0x97,0x44,0x17,0xc4,0xa7,0x7e,0x3d,0x64,0x5d,0x19,0x73, + 0x60,0x81,0x4f,0xdc,0x22,0x2a,0x90,0x88,0x46,0xee,0xb8,0x14,0xde,0x5e,0x0b,0xdb, + 0xe0,0x32,0x3a,0x0a,0x49,0x06,0x24,0x5c,0xc2,0xd3,0xac,0x62,0x91,0x95,0xe4,0x79, + 0xe7,0xc8,0x37,0x6d,0x8d,0xd5,0x4e,0xa9,0x6c,0x56,0xf4,0xea,0x65,0x7a,0xae,0x08, + 0xba,0x78,0x25,0x2e,0x1c,0xa6,0xb4,0xc6,0xe8,0xdd,0x74,0x1f,0x4b,0xbd,0x8b,0x8a, + 0x70,0x3e,0xb5,0x66,0x48,0x03,0xf6,0x0e,0x61,0x35,0x57,0xb9,0x86,0xc1,0x1d,0x9e, + 0xe1,0xf8,0x98,0x11,0x69,0xd9,0x8e,0x94,0x9b,0x1e,0x87,0xe9,0xce,0x55,0x28,0xdf, + 0x8c,0xa1,0x89,0x0d,0xbf,0xe6,0x42,0x68,0x41,0x99,0x2d,0x0f,0xb0,0x54,0xbb,0x16]; + +// Rcon is Round Constant used for the Key Expansion [1st col is 2^(r-1) in GF(2^8)] [§5.2] +var Rcon = [ [0x00, 0x00, 0x00, 0x00], + [0x01, 0x00, 0x00, 0x00], + [0x02, 0x00, 0x00, 0x00], + [0x04, 0x00, 0x00, 0x00], + [0x08, 0x00, 0x00, 0x00], + [0x10, 0x00, 0x00, 0x00], + [0x20, 0x00, 0x00, 0x00], + [0x40, 0x00, 0x00, 0x00], + [0x80, 0x00, 0x00, 0x00], + [0x1b, 0x00, 0x00, 0x00], + [0x36, 0x00, 0x00, 0x00] ]; + + +/* - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - */ + +/* + * Use AES to encrypt 'plaintext' with 'password' using 'nBits' key, in 'Counter' mode of operation + * - see http://csrc.nist.gov/publications/nistpubs/800-38a/sp800-38a.pdf + * for each block + * - outputblock = cipher(counter, key) + * - cipherblock = plaintext xor outputblock + */ +function AESEncryptCtr(plaintext, password, nBits) { + if (!(nBits==128 || nBits==192 || nBits==256)) return ''; // standard allows 128/192/256 bit keys + + // for this example script, generate the key by applying Cipher to 1st 16/24/32 chars of password; + // for real-world applications, a more secure approach would be to hash the password e.g. with SHA-1 + var nBytes = nBits/8; // no bytes in key + var pwBytes = new Array(nBytes); + for (var i=0; i>> i*8) & 0xff; + for (var i=0; i<4; i++) counterBlock[i+4] = (nonce/0x100000000 >>> i*8) & 0xff; + + // generate key schedule - an expansion of the key into distinct Key Rounds for each round + var keySchedule = KeyExpansion(key); + + var blockCount = Math.ceil(plaintext.length/blockSize); + var ciphertext = new Array(blockCount); // ciphertext as array of strings + + for (var b=0; b>> c*8) & 0xff; + for (var c=0; c<4; c++) counterBlock[15-c-4] = (b/0x100000000 >>> c*8) + + var cipherCntr = Cipher(counterBlock, keySchedule); // -- encrypt counter block -- + + // calculate length of final block: + var blockLength = b>> c*8) & 0xff; + for (var c=0; c<4; c++) counterBlock[15-c-4] = ((b/0x100000000-1) >>> c*8) & 0xff; + + var cipherCntr = Cipher(counterBlock, keySchedule); // encrypt counter block + + ciphertext[b] = unescCtrlChars(ciphertext[b]); + + var pt = ''; + for (var i=0; i>18 & 0x3f; + h2 = bits>>12 & 0x3f; + h3 = bits>>6 & 0x3f; + h4 = bits & 0x3f; + + // end of string? index to '=' in b64 + if (isNaN(o3)) h4 = 64; + if (isNaN(o2)) h3 = 64; + + // use hexets to index into b64, and append result to encoded string + enc += b64.charAt(h1) + b64.charAt(h2) + b64.charAt(h3) + b64.charAt(h4); + } while (i < str.length); + + return enc; +} + +function decodeBase64(str) { + var o1, o2, o3, h1, h2, h3, h4, bits, i=0, enc=''; + + do { // unpack four hexets into three octets using index points in b64 + h1 = b64.indexOf(str.charAt(i++)); + h2 = b64.indexOf(str.charAt(i++)); + h3 = b64.indexOf(str.charAt(i++)); + h4 = b64.indexOf(str.charAt(i++)); + + bits = h1<<18 | h2<<12 | h3<<6 | h4; + + o1 = bits>>16 & 0xff; + o2 = bits>>8 & 0xff; + o3 = bits & 0xff; + + if (h3 == 64) enc += String.fromCharCode(o1); + else if (h4 == 64) enc += String.fromCharCode(o1, o2); + else enc += String.fromCharCode(o1, o2, o3); + } while (i < str.length); + + return decodeUTF8(enc); // decode UTF-8 byte-array back to Unicode +} + +function encodeUTF8(str) { // encode multi-byte string into utf-8 multiple single-byte characters + str = str.replace( + /[\u0080-\u07ff]/g, // U+0080 - U+07FF = 2-byte chars + function(c) { + var cc = c.charCodeAt(0); + return String.fromCharCode(0xc0 | cc>>6, 0x80 | cc&0x3f); } + ); + str = str.replace( + /[\u0800-\uffff]/g, // U+0800 - U+FFFF = 3-byte chars + function(c) { + var cc = c.charCodeAt(0); + return String.fromCharCode(0xe0 | cc>>12, 0x80 | cc>>6&0x3F, 0x80 | cc&0x3f); } + ); + return str; +} + +function decodeUTF8(str) { // decode utf-8 encoded string back into multi-byte characters + str = str.replace( + /[\u00c0-\u00df][\u0080-\u00bf]/g, // 2-byte chars + function(c) { + var cc = (c.charCodeAt(0)&0x1f)<<6 | c.charCodeAt(1)&0x3f; + return String.fromCharCode(cc); } + ); + str = str.replace( + /[\u00e0-\u00ef][\u0080-\u00bf][\u0080-\u00bf]/g, // 3-byte chars + function(c) { + var cc = (c.charCodeAt(0)&0x0f)<<12 | (c.charCodeAt(1)&0x3f<<6) | c.charCodeAt(2)&0x3f; + return String.fromCharCode(cc); } + ); + return str; +} + + +function byteArrayToHexStr(b) { // convert byte array to hex string for displaying test vectors + var s = ''; + for (var i=0; i> 5] |= 0x80 << ((len) % 32); + x[(((len + 64) >>> 9) << 4) + 14] = len; + + var a = 1732584193; + var b = -271733879; + var c = -1732584194; + var d = 271733878; + + for(var i = 0; i < x.length; i += 16) + { + var olda = a; + var oldb = b; + var oldc = c; + var oldd = d; + + a = md5_ff(a, b, c, d, x[i+ 0], 7 , -680876936); + d = md5_ff(d, a, b, c, x[i+ 1], 12, -389564586); + c = md5_ff(c, d, a, b, x[i+ 2], 17, 606105819); + b = md5_ff(b, c, d, a, x[i+ 3], 22, -1044525330); + a = md5_ff(a, b, c, d, x[i+ 4], 7 , -176418897); + d = md5_ff(d, a, b, c, x[i+ 5], 12, 1200080426); + c = md5_ff(c, d, a, b, x[i+ 6], 17, -1473231341); + b = md5_ff(b, c, d, a, x[i+ 7], 22, -45705983); + a = md5_ff(a, b, c, d, x[i+ 8], 7 , 1770035416); + d = md5_ff(d, a, b, c, x[i+ 9], 12, -1958414417); + c = md5_ff(c, d, a, b, x[i+10], 17, -42063); + b = md5_ff(b, c, d, a, x[i+11], 22, -1990404162); + a = md5_ff(a, b, c, d, x[i+12], 7 , 1804603682); + d = md5_ff(d, a, b, c, x[i+13], 12, -40341101); + c = md5_ff(c, d, a, b, x[i+14], 17, -1502002290); + b = md5_ff(b, c, d, a, x[i+15], 22, 1236535329); + + a = md5_gg(a, b, c, d, x[i+ 1], 5 , -165796510); + d = md5_gg(d, a, b, c, x[i+ 6], 9 , -1069501632); + c = md5_gg(c, d, a, b, x[i+11], 14, 643717713); + b = md5_gg(b, c, d, a, x[i+ 0], 20, -373897302); + a = md5_gg(a, b, c, d, x[i+ 5], 5 , -701558691); + d = md5_gg(d, a, b, c, x[i+10], 9 , 38016083); + c = md5_gg(c, d, a, b, x[i+15], 14, -660478335); + b = md5_gg(b, c, d, a, x[i+ 4], 20, -405537848); + a = md5_gg(a, b, c, d, x[i+ 9], 5 , 568446438); + d = md5_gg(d, a, b, c, x[i+14], 9 , -1019803690); + c = md5_gg(c, d, a, b, x[i+ 3], 14, -187363961); + b = md5_gg(b, c, d, a, x[i+ 8], 20, 1163531501); + a = md5_gg(a, b, c, d, x[i+13], 5 , -1444681467); + d = md5_gg(d, a, b, c, x[i+ 2], 9 , -51403784); + c = md5_gg(c, d, a, b, x[i+ 7], 14, 1735328473); + b = md5_gg(b, c, d, a, x[i+12], 20, -1926607734); + + a = md5_hh(a, b, c, d, x[i+ 5], 4 , -378558); + d = md5_hh(d, a, b, c, x[i+ 8], 11, -2022574463); + c = md5_hh(c, d, a, b, x[i+11], 16, 1839030562); + b = md5_hh(b, c, d, a, x[i+14], 23, -35309556); + a = md5_hh(a, b, c, d, x[i+ 1], 4 , -1530992060); + d = md5_hh(d, a, b, c, x[i+ 4], 11, 1272893353); + c = md5_hh(c, d, a, b, x[i+ 7], 16, -155497632); + b = md5_hh(b, c, d, a, x[i+10], 23, -1094730640); + a = md5_hh(a, b, c, d, x[i+13], 4 , 681279174); + d = md5_hh(d, a, b, c, x[i+ 0], 11, -358537222); + c = md5_hh(c, d, a, b, x[i+ 3], 16, -722521979); + b = md5_hh(b, c, d, a, x[i+ 6], 23, 76029189); + a = md5_hh(a, b, c, d, x[i+ 9], 4 , -640364487); + d = md5_hh(d, a, b, c, x[i+12], 11, -421815835); + c = md5_hh(c, d, a, b, x[i+15], 16, 530742520); + b = md5_hh(b, c, d, a, x[i+ 2], 23, -995338651); + + a = md5_ii(a, b, c, d, x[i+ 0], 6 , -198630844); + d = md5_ii(d, a, b, c, x[i+ 7], 10, 1126891415); + c = md5_ii(c, d, a, b, x[i+14], 15, -1416354905); + b = md5_ii(b, c, d, a, x[i+ 5], 21, -57434055); + a = md5_ii(a, b, c, d, x[i+12], 6 , 1700485571); + d = md5_ii(d, a, b, c, x[i+ 3], 10, -1894986606); + c = md5_ii(c, d, a, b, x[i+10], 15, -1051523); + b = md5_ii(b, c, d, a, x[i+ 1], 21, -2054922799); + a = md5_ii(a, b, c, d, x[i+ 8], 6 , 1873313359); + d = md5_ii(d, a, b, c, x[i+15], 10, -30611744); + c = md5_ii(c, d, a, b, x[i+ 6], 15, -1560198380); + b = md5_ii(b, c, d, a, x[i+13], 21, 1309151649); + a = md5_ii(a, b, c, d, x[i+ 4], 6 , -145523070); + d = md5_ii(d, a, b, c, x[i+11], 10, -1120210379); + c = md5_ii(c, d, a, b, x[i+ 2], 15, 718787259); + b = md5_ii(b, c, d, a, x[i+ 9], 21, -343485551); + + a = safe_add(a, olda); + b = safe_add(b, oldb); + c = safe_add(c, oldc); + d = safe_add(d, oldd); + } + return Array(a, b, c, d); + +} + +/* + * These functions implement the four basic operations the algorithm uses. + */ +function md5_cmn(q, a, b, x, s, t) +{ + return safe_add(bit_rol(safe_add(safe_add(a, q), safe_add(x, t)), s),b); +} +function md5_ff(a, b, c, d, x, s, t) +{ + return md5_cmn((b & c) | ((~b) & d), a, b, x, s, t); +} +function md5_gg(a, b, c, d, x, s, t) +{ + return md5_cmn((b & d) | (c & (~d)), a, b, x, s, t); +} +function md5_hh(a, b, c, d, x, s, t) +{ + return md5_cmn(b ^ c ^ d, a, b, x, s, t); +} +function md5_ii(a, b, c, d, x, s, t) +{ + return md5_cmn(c ^ (b | (~d)), a, b, x, s, t); +} + +/* + * Calculate the HMAC-MD5, of a key and some data + */ +function core_hmac_md5(key, data) +{ + var bkey = str2binl(key); + if(bkey.length > 16) bkey = core_md5(bkey, key.length * chrsz); + + var ipad = Array(16), opad = Array(16); + for(var i = 0; i < 16; i++) + { + ipad[i] = bkey[i] ^ 0x36363636; + opad[i] = bkey[i] ^ 0x5C5C5C5C; + } + + var hash = core_md5(ipad.concat(str2binl(data)), 512 + data.length * chrsz); + return core_md5(opad.concat(hash), 512 + 128); +} + +/* + * Add integers, wrapping at 2^32. This uses 16-bit operations internally + * to work around bugs in some JS interpreters. + */ +function safe_add(x, y) +{ + var lsw = (x & 0xFFFF) + (y & 0xFFFF); + var msw = (x >> 16) + (y >> 16) + (lsw >> 16); + return (msw << 16) | (lsw & 0xFFFF); +} + +/* + * Bitwise rotate a 32-bit number to the left. + */ +function bit_rol(num, cnt) +{ + return (num << cnt) | (num >>> (32 - cnt)); +} + +/* + * Convert a string to an array of little-endian words + * If chrsz is ASCII, characters >255 have their hi-byte silently ignored. + */ +function str2binl(str) +{ + var bin = Array(); + var mask = (1 << chrsz) - 1; + for(var i = 0; i < str.length * chrsz; i += chrsz) + bin[i>>5] |= (str.charCodeAt(i / chrsz) & mask) << (i%32); + return bin; +} + +/* + * Convert an array of little-endian words to a string + */ +function binl2str(bin) +{ + var str = ""; + var mask = (1 << chrsz) - 1; + for(var i = 0; i < bin.length * 32; i += chrsz) + str += String.fromCharCode((bin[i>>5] >>> (i % 32)) & mask); + return str; +} + +/* + * Convert an array of little-endian words to a hex string. + */ +function binl2hex(binarray) +{ + var hex_tab = hexcase ? "0123456789ABCDEF" : "0123456789abcdef"; + var str = ""; + for(var i = 0; i < binarray.length * 4; i++) + { + str += hex_tab.charAt((binarray[i>>2] >> ((i%4)*8+4)) & 0xF) + + hex_tab.charAt((binarray[i>>2] >> ((i%4)*8 )) & 0xF); + } + return str; +} + +/* + * Convert an array of little-endian words to a base-64 string + */ +function binl2b64(binarray) +{ + var tab = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; + var str = ""; + for(var i = 0; i < binarray.length * 4; i += 3) + { + var triplet = (((binarray[i >> 2] >> 8 * ( i %4)) & 0xFF) << 16) + | (((binarray[i+1 >> 2] >> 8 * ((i+1)%4)) & 0xFF) << 8 ) + | ((binarray[i+2 >> 2] >> 8 * ((i+2)%4)) & 0xFF); + for(var j = 0; j < 4; j++) + { + if(i * 8 + j * 6 > binarray.length * 32) str += b64pad; + else str += tab.charAt((triplet >> 6*(3-j)) & 0x3F); + } + } + return str; +} + +var plainText = "Rebellious subjects, enemies to peace,\n\ +Profaners of this neighbour-stained steel,--\n\ +Will they not hear? What, ho! you men, you beasts,\n\ +That quench the fire of your pernicious rage\n\ +With purple fountains issuing from your veins,\n\ +On pain of torture, from those bloody hands\n\ +Throw your mistemper'd weapons to the ground,\n\ +And hear the sentence of your moved prince.\n\ +Three civil brawls, bred of an airy word,\n\ +By thee, old Capulet, and Montague,\n\ +Have thrice disturb'd the quiet of our streets,\n\ +And made Verona's ancient citizens\n\ +Cast by their grave beseeming ornaments,\n\ +To wield old partisans, in hands as old,\n\ +Canker'd with peace, to part your canker'd hate:\n\ +If ever you disturb our streets again,\n\ +Your lives shall pay the forfeit of the peace.\n\ +For this time, all the rest depart away:\n\ +You Capulet; shall go along with me:\n\ +And, Montague, come you this afternoon,\n\ +To know our further pleasure in this case,\n\ +To old Free-town, our common judgment-place.\n\ +Once more, on pain of death, all men depart." + +for (var i = 0; i <4; i++) { + plainText += plainText; +} + +var md5Output = hex_md5(plainText); diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/crypto-sha1.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/crypto-sha1.js new file mode 100644 index 0000000000..5d5bd6b56a --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/crypto-sha1.js @@ -0,0 +1,224 @@ +/* + * A JavaScript implementation of the Secure Hash Algorithm, SHA-1, as defined + * in FIPS PUB 180-1 + * Version 2.1a Copyright Paul Johnston 2000 - 2002. + * Other contributors: Greg Holt, Andrew Kepert, Ydnar, Lostinet + * Distributed under the BSD License + * See http://pajhome.org.uk/crypt/md5 for details. + */ + +/* + * Configurable variables. You may need to tweak these to be compatible with + * the server-side, but the defaults work in most cases. + */ +var hexcase = 0; /* hex output format. 0 - lowercase; 1 - uppercase */ +var b64pad = ""; /* base-64 pad character. "=" for strict RFC compliance */ +var chrsz = 8; /* bits per input character. 8 - ASCII; 16 - Unicode */ + +/* + * These are the functions you'll usually want to call + * They take string arguments and return either hex or base-64 encoded strings + */ +function hex_sha1(s){return binb2hex(core_sha1(str2binb(s),s.length * chrsz));} +function b64_sha1(s){return binb2b64(core_sha1(str2binb(s),s.length * chrsz));} +function str_sha1(s){return binb2str(core_sha1(str2binb(s),s.length * chrsz));} +function hex_hmac_sha1(key, data){ return binb2hex(core_hmac_sha1(key, data));} +function b64_hmac_sha1(key, data){ return binb2b64(core_hmac_sha1(key, data));} +function str_hmac_sha1(key, data){ return binb2str(core_hmac_sha1(key, data));} + +/* + * Perform a simple self-test to see if the VM is working + */ +function sha1_vm_test() +{ + return hex_sha1("abc") == "a9993e364706816aba3e25717850c26c9cd0d89d"; +} + +/* + * Calculate the SHA-1 of an array of big-endian words, and a bit length + */ +function core_sha1(x, len) +{ + /* append padding */ + x[len >> 5] |= 0x80 << (24 - len % 32); + x[((len + 64 >> 9) << 4) + 15] = len; + + var w = Array(80); + var a = 1732584193; + var b = -271733879; + var c = -1732584194; + var d = 271733878; + var e = -1009589776; + + for(var i = 0; i < x.length; i += 16) + { + var olda = a; + var oldb = b; + var oldc = c; + var oldd = d; + var olde = e; + + for(var j = 0; j < 80; j++) + { + if(j < 16) w[j] = x[i + j]; + else w[j] = rol(w[j-3] ^ w[j-8] ^ w[j-14] ^ w[j-16], 1); + var t = safe_add(safe_add(rol(a, 5), sha1_ft(j, b, c, d)), + safe_add(safe_add(e, w[j]), sha1_kt(j))); + e = d; + d = c; + c = rol(b, 30); + b = a; + a = t; + } + + a = safe_add(a, olda); + b = safe_add(b, oldb); + c = safe_add(c, oldc); + d = safe_add(d, oldd); + e = safe_add(e, olde); + } + return Array(a, b, c, d, e); + +} + +/* + * Perform the appropriate triplet combination function for the current + * iteration + */ +function sha1_ft(t, b, c, d) +{ + if(t < 20) return (b & c) | ((~b) & d); + if(t < 40) return b ^ c ^ d; + if(t < 60) return (b & c) | (b & d) | (c & d); + return b ^ c ^ d; +} + +/* + * Determine the appropriate additive constant for the current iteration + */ +function sha1_kt(t) +{ + return (t < 20) ? 1518500249 : (t < 40) ? 1859775393 : + (t < 60) ? -1894007588 : -899497514; +} + +/* + * Calculate the HMAC-SHA1 of a key and some data + */ +function core_hmac_sha1(key, data) +{ + var bkey = str2binb(key); + if(bkey.length > 16) bkey = core_sha1(bkey, key.length * chrsz); + + var ipad = Array(16), opad = Array(16); + for(var i = 0; i < 16; i++) + { + ipad[i] = bkey[i] ^ 0x36363636; + opad[i] = bkey[i] ^ 0x5C5C5C5C; + } + + var hash = core_sha1(ipad.concat(str2binb(data)), 512 + data.length * chrsz); + return core_sha1(opad.concat(hash), 512 + 160); +} + +/* + * Add integers, wrapping at 2^32. This uses 16-bit operations internally + * to work around bugs in some JS interpreters. + */ +function safe_add(x, y) +{ + var lsw = (x & 0xFFFF) + (y & 0xFFFF); + var msw = (x >> 16) + (y >> 16) + (lsw >> 16); + return (msw << 16) | (lsw & 0xFFFF); +} + +/* + * Bitwise rotate a 32-bit number to the left. + */ +function rol(num, cnt) +{ + return (num << cnt) | (num >>> (32 - cnt)); +} + +/* + * Convert an 8-bit or 16-bit string to an array of big-endian words + * In 8-bit function, characters >255 have their hi-byte silently ignored. + */ +function str2binb(str) +{ + var bin = Array(); + var mask = (1 << chrsz) - 1; + for(var i = 0; i < str.length * chrsz; i += chrsz) + bin[i>>5] |= (str.charCodeAt(i / chrsz) & mask) << (32 - chrsz - i%32); + return bin; +} + +/* + * Convert an array of big-endian words to a string + */ +function binb2str(bin) +{ + var str = ""; + var mask = (1 << chrsz) - 1; + for(var i = 0; i < bin.length * 32; i += chrsz) + str += String.fromCharCode((bin[i>>5] >>> (32 - chrsz - i%32)) & mask); + return str; +} + +/* + * Convert an array of big-endian words to a hex string. + */ +function binb2hex(binarray) +{ + var hex_tab = hexcase ? "0123456789ABCDEF" : "0123456789abcdef"; + var str = ""; + for(var i = 0; i < binarray.length * 4; i++) + { + str += hex_tab.charAt((binarray[i>>2] >> ((3 - i%4)*8+4)) & 0xF) + + hex_tab.charAt((binarray[i>>2] >> ((3 - i%4)*8 )) & 0xF); + } + return str; +} + +/* + * Convert an array of big-endian words to a base-64 string + */ +function binb2b64(binarray) +{ + var tab = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; + var str = ""; + for(var i = 0; i < binarray.length * 4; i += 3) + { + var triplet = (((binarray[i >> 2] >> 8 * (3 - i %4)) & 0xFF) << 16) + | (((binarray[i+1 >> 2] >> 8 * (3 - (i+1)%4)) & 0xFF) << 8 ) + | ((binarray[i+2 >> 2] >> 8 * (3 - (i+2)%4)) & 0xFF); + for(var j = 0; j < 4; j++) + { + if(i * 8 + j * 6 > binarray.length * 32) str += b64pad; + else str += tab.charAt((triplet >> 6*(3-j)) & 0x3F); + } + } + return str; +} + + +var plainText = "Two households, both alike in dignity,\n\ +In fair Verona, where we lay our scene,\n\ +From ancient grudge break to new mutiny,\n\ +Where civil blood makes civil hands unclean.\n\ +From forth the fatal loins of these two foes\n\ +A pair of star-cross'd lovers take their life;\n\ +Whole misadventured piteous overthrows\n\ +Do with their death bury their parents' strife.\n\ +The fearful passage of their death-mark'd love,\n\ +And the continuance of their parents' rage,\n\ +Which, but their children's end, nought could remove,\n\ +Is now the two hours' traffic of our stage;\n\ +The which if you with patient ears attend,\n\ +What here shall miss, our toil shall strive to mend."; + +for (var i = 0; i <4; i++) { + plainText += plainText; +} + +var sha1Output = hex_sha1(plainText); diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/date-format-tofte.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/date-format-tofte.js new file mode 100644 index 0000000000..172224302a --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/date-format-tofte.js @@ -0,0 +1,299 @@ +function arrayExists(array, x) { + for (var i = 0; i < array.length; i++) { + if (array[i] == x) return true; + } + return false; +} + +Date.prototype.formatDate = function (input,time) { + // formatDate : + // a PHP date like function, for formatting date strings + // See: http://www.php.net/date + // + // input : format string + // time : epoch time (seconds, and optional) + // + // if time is not passed, formatting is based on + // the current "this" date object's set time. + // + // supported: + // a, A, B, d, D, F, g, G, h, H, i, j, l (lowercase L), L, + // m, M, n, O, r, s, S, t, U, w, W, y, Y, z + // + // unsupported: + // I (capital i), T, Z + + var switches = ["a", "A", "B", "d", "D", "F", "g", "G", "h", "H", + "i", "j", "l", "L", "m", "M", "n", "O", "r", "s", + "S", "t", "U", "w", "W", "y", "Y", "z"]; + var daysLong = ["Sunday", "Monday", "Tuesday", "Wednesday", + "Thursday", "Friday", "Saturday"]; + var daysShort = ["Sun", "Mon", "Tue", "Wed", + "Thu", "Fri", "Sat"]; + var monthsShort = ["Jan", "Feb", "Mar", "Apr", + "May", "Jun", "Jul", "Aug", "Sep", + "Oct", "Nov", "Dec"]; + var monthsLong = ["January", "February", "March", "April", + "May", "June", "July", "August", "September", + "October", "November", "December"]; + var daysSuffix = ["st", "nd", "rd", "th", "th", "th", "th", // 1st - 7th + "th", "th", "th", "th", "th", "th", "th", // 8th - 14th + "th", "th", "th", "th", "th", "th", "st", // 15th - 21st + "nd", "rd", "th", "th", "th", "th", "th", // 22nd - 28th + "th", "th", "st"]; // 29th - 31st + + function a() { + // Lowercase Ante meridiem and Post meridiem + return self.getHours() > 11? "pm" : "am"; + } + function A() { + // Uppercase Ante meridiem and Post meridiem + return self.getHours() > 11? "PM" : "AM"; + } + + function B(){ + // Swatch internet time. code simply grabbed from ppk, + // since I was feeling lazy: + // http://www.xs4all.nl/~ppk/js/beat.html + var off = (self.getTimezoneOffset() + 60)*60; + var theSeconds = (self.getHours() * 3600) + + (self.getMinutes() * 60) + + self.getSeconds() + off; + var beat = Math.floor(theSeconds/86.4); + if (beat > 1000) beat -= 1000; + if (beat < 0) beat += 1000; + if ((""+beat).length == 1) beat = "00"+beat; + if ((""+beat).length == 2) beat = "0"+beat; + return beat; + } + + function d() { + // Day of the month, 2 digits with leading zeros + return new String(self.getDate()).length == 1? + "0"+self.getDate() : self.getDate(); + } + function D() { + // A textual representation of a day, three letters + return daysShort[self.getDay()]; + } + function F() { + // A full textual representation of a month + return monthsLong[self.getMonth()]; + } + function g() { + // 12-hour format of an hour without leading zeros + return self.getHours() > 12? self.getHours()-12 : self.getHours(); + } + function G() { + // 24-hour format of an hour without leading zeros + return self.getHours(); + } + function h() { + // 12-hour format of an hour with leading zeros + if (self.getHours() > 12) { + var s = new String(self.getHours()-12); + return s.length == 1? + "0"+ (self.getHours()-12) : self.getHours()-12; + } else { + var s = new String(self.getHours()); + return s.length == 1? + "0"+self.getHours() : self.getHours(); + } + } + function H() { + // 24-hour format of an hour with leading zeros + return new String(self.getHours()).length == 1? + "0"+self.getHours() : self.getHours(); + } + function i() { + // Minutes with leading zeros + return new String(self.getMinutes()).length == 1? + "0"+self.getMinutes() : self.getMinutes(); + } + function j() { + // Day of the month without leading zeros + return self.getDate(); + } + function l() { + // A full textual representation of the day of the week + return daysLong[self.getDay()]; + } + function L() { + // leap year or not. 1 if leap year, 0 if not. + // the logic should match iso's 8601 standard. + var y_ = Y(); + if ( + (y_ % 4 == 0 && y_ % 100 != 0) || + (y_ % 4 == 0 && y_ % 100 == 0 && y_ % 400 == 0) + ) { + return 1; + } else { + return 0; + } + } + function m() { + // Numeric representation of a month, with leading zeros + return self.getMonth() < 9? + "0"+(self.getMonth()+1) : + self.getMonth()+1; + } + function M() { + // A short textual representation of a month, three letters + return monthsShort[self.getMonth()]; + } + function n() { + // Numeric representation of a month, without leading zeros + return self.getMonth()+1; + } + function O() { + // Difference to Greenwich time (GMT) in hours + var os = Math.abs(self.getTimezoneOffset()); + var h = ""+Math.floor(os/60); + var m = ""+(os%60); + h.length == 1? h = "0"+h:1; + m.length == 1? m = "0"+m:1; + return self.getTimezoneOffset() < 0 ? "+"+h+m : "-"+h+m; + } + function r() { + // RFC 822 formatted date + var r; // result + // Thu , 21 Dec 2000 + r = D() + ", " + j() + " " + M() + " " + Y() + + // 16 : 01 : 07 +0200 + " " + H() + ":" + i() + ":" + s() + " " + O(); + return r; + } + function S() { + // English ordinal suffix for the day of the month, 2 characters + return daysSuffix[self.getDate()-1]; + } + function s() { + // Seconds, with leading zeros + return new String(self.getSeconds()).length == 1? + "0"+self.getSeconds() : self.getSeconds(); + } + function t() { + + // thanks to Matt Bannon for some much needed code-fixes here! + var daysinmonths = [null,31,28,31,30,31,30,31,31,30,31,30,31]; + if (L()==1 && n()==2) return 29; // leap day + return daysinmonths[n()]; + } + function U() { + // Seconds since the Unix Epoch (January 1 1970 00:00:00 GMT) + return Math.round(self.getTime()/1000); + } + function W() { + // Weeknumber, as per ISO specification: + // http://www.cl.cam.ac.uk/~mgk25/iso-time.html + + // if the day is three days before newyears eve, + // there's a chance it's "week 1" of next year. + // here we check for that. + var beforeNY = 364+L() - z(); + var afterNY = z(); + var weekday = w()!=0?w()-1:6; // makes sunday (0), into 6. + if (beforeNY <= 2 && weekday <= 2-beforeNY) { + return 1; + } + // similarly, if the day is within threedays of newyears + // there's a chance it belongs in the old year. + var ny = new Date("January 1 " + Y() + " 00:00:00"); + var nyDay = ny.getDay()!=0?ny.getDay()-1:6; + if ( + (afterNY <= 2) && + (nyDay >=4) && + (afterNY >= (6-nyDay)) + ) { + // Since I'm not sure we can just always return 53, + // i call the function here again, using the last day + // of the previous year, as the date, and then just + // return that week. + var prevNY = new Date("December 31 " + (Y()-1) + " 00:00:00"); + return prevNY.formatDate("W"); + } + + // week 1, is the week that has the first thursday in it. + // note that this value is not zero index. + if (nyDay <= 3) { + // first day of the year fell on a thursday, or earlier. + return 1 + Math.floor( ( z() + nyDay ) / 7 ); + } else { + // first day of the year fell on a friday, or later. + return 1 + Math.floor( ( z() - ( 7 - nyDay ) ) / 7 ); + } + } + function w() { + // Numeric representation of the day of the week + return self.getDay(); + } + + function Y() { + // A full numeric representation of a year, 4 digits + + // we first check, if getFullYear is supported. if it + // is, we just use that. ppks code is nice, but wont + // work with dates outside 1900-2038, or something like that + if (self.getFullYear) { + var newDate = new Date("January 1 2001 00:00:00 +0000"); + var x = newDate .getFullYear(); + if (x == 2001) { + // i trust the method now + return self.getFullYear(); + } + } + // else, do this: + // codes thanks to ppk: + // http://www.xs4all.nl/~ppk/js/introdate.html + var x = self.getYear(); + var y = x % 100; + y += (y < 38) ? 2000 : 1900; + return y; + } + function y() { + // A two-digit representation of a year + var y = Y()+""; + return y.substring(y.length-2,y.length); + } + function z() { + // The day of the year, zero indexed! 0 through 366 + var t = new Date("January 1 " + Y() + " 00:00:00"); + var diff = self.getTime() - t.getTime(); + return Math.floor(diff/1000/60/60/24); + } + + var self = this; + if (time) { + // save time + var prevTime = self.getTime(); + self.setTime(time); + } + + var ia = input.split(""); + var ij = 0; + while (ia[ij]) { + if (ia[ij] == "\\") { + // this is our way of allowing users to escape stuff + ia.splice(ij,1); + } else { + if (arrayExists(switches,ia[ij])) { + ia[ij] = eval(ia[ij] + "()"); + } + } + ij++; + } + // reset time, back to what it was + if (prevTime) { + self.setTime(prevTime); + } + return ia.join(""); +} + +var date = new Date("1/1/2007 1:11:11"); + +for (i = 0; i < 500; ++i) { + var shortFormat = date.formatDate("Y-m-d"); + var longFormat = date.formatDate("l, F d, Y g:i:s A"); + date.setTime(date.getTime() + 84266956); +} + diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/date-format-xparb.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/date-format-xparb.js new file mode 100644 index 0000000000..767cfcc133 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/date-format-xparb.js @@ -0,0 +1,417 @@ +/* + * Copyright (C) 2004 Baron Schwartz + * + * This program is free software; you can redistribute it and/or modify it + * under the terms of the GNU Lesser General Public License as published by the + * Free Software Foundation, version 2.1. + * + * This program is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS + * FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more + * details. + */ + +Date.parseFunctions = {count:0}; +Date.parseRegexes = []; +Date.formatFunctions = {count:0}; + +Date.prototype.dateFormat = function(format) { + if (Date.formatFunctions[format] == null) { + Date.createNewFormat(format); + } + var func = Date.formatFunctions[format]; + return this[func](); +} + +Date.createNewFormat = function(format) { + var funcName = "format" + Date.formatFunctions.count++; + Date.formatFunctions[format] = funcName; + var code = "Date.prototype." + funcName + " = function(){return "; + var special = false; + var ch = ''; + for (var i = 0; i < format.length; ++i) { + ch = format.charAt(i); + if (!special && ch == "\\") { + special = true; + } + else if (special) { + special = false; + code += "'" + String.escape(ch) + "' + "; + } + else { + code += Date.getFormatCode(ch); + } + } + eval(code.substring(0, code.length - 3) + ";}"); +} + +Date.getFormatCode = function(character) { + switch (character) { + case "d": + return "String.leftPad(this.getDate(), 2, '0') + "; + case "D": + return "Date.dayNames[this.getDay()].substring(0, 3) + "; + case "j": + return "this.getDate() + "; + case "l": + return "Date.dayNames[this.getDay()] + "; + case "S": + return "this.getSuffix() + "; + case "w": + return "this.getDay() + "; + case "z": + return "this.getDayOfYear() + "; + case "W": + return "this.getWeekOfYear() + "; + case "F": + return "Date.monthNames[this.getMonth()] + "; + case "m": + return "String.leftPad(this.getMonth() + 1, 2, '0') + "; + case "M": + return "Date.monthNames[this.getMonth()].substring(0, 3) + "; + case "n": + return "(this.getMonth() + 1) + "; + case "t": + return "this.getDaysInMonth() + "; + case "L": + return "(this.isLeapYear() ? 1 : 0) + "; + case "Y": + return "this.getFullYear() + "; + case "y": + return "('' + this.getFullYear()).substring(2, 4) + "; + case "a": + return "(this.getHours() < 12 ? 'am' : 'pm') + "; + case "A": + return "(this.getHours() < 12 ? 'AM' : 'PM') + "; + case "g": + return "((this.getHours() %12) ? this.getHours() % 12 : 12) + "; + case "G": + return "this.getHours() + "; + case "h": + return "String.leftPad((this.getHours() %12) ? this.getHours() % 12 : 12, 2, '0') + "; + case "H": + return "String.leftPad(this.getHours(), 2, '0') + "; + case "i": + return "String.leftPad(this.getMinutes(), 2, '0') + "; + case "s": + return "String.leftPad(this.getSeconds(), 2, '0') + "; + case "O": + return "this.getGMTOffset() + "; + case "T": + return "this.getTimezone() + "; + case "Z": + return "(this.getTimezoneOffset() * -60) + "; + default: + return "'" + String.escape(character) + "' + "; + } +} + +Date.parseDate = function(input, format) { + if (Date.parseFunctions[format] == null) { + Date.createParser(format); + } + var func = Date.parseFunctions[format]; + return Date[func](input); +} + +Date.createParser = function(format) { + var funcName = "parse" + Date.parseFunctions.count++; + var regexNum = Date.parseRegexes.length; + var currentGroup = 1; + Date.parseFunctions[format] = funcName; + + var code = "Date." + funcName + " = function(input){\n" + + "var y = -1, m = -1, d = -1, h = -1, i = -1, s = -1;\n" + + "var d = new Date();\n" + + "y = d.getFullYear();\n" + + "m = d.getMonth();\n" + + "d = d.getDate();\n" + + "var results = input.match(Date.parseRegexes[" + regexNum + "]);\n" + + "if (results && results.length > 0) {" + var regex = ""; + + var special = false; + var ch = ''; + for (var i = 0; i < format.length; ++i) { + ch = format.charAt(i); + if (!special && ch == "\\") { + special = true; + } + else if (special) { + special = false; + regex += String.escape(ch); + } + else { + obj = Date.formatCodeToRegex(ch, currentGroup); + currentGroup += obj.g; + regex += obj.s; + if (obj.g && obj.c) { + code += obj.c; + } + } + } + + code += "if (y > 0 && m >= 0 && d > 0 && h >= 0 && i >= 0 && s >= 0)\n" + + "{return new Date(y, m, d, h, i, s);}\n" + + "else if (y > 0 && m >= 0 && d > 0 && h >= 0 && i >= 0)\n" + + "{return new Date(y, m, d, h, i);}\n" + + "else if (y > 0 && m >= 0 && d > 0 && h >= 0)\n" + + "{return new Date(y, m, d, h);}\n" + + "else if (y > 0 && m >= 0 && d > 0)\n" + + "{return new Date(y, m, d);}\n" + + "else if (y > 0 && m >= 0)\n" + + "{return new Date(y, m);}\n" + + "else if (y > 0)\n" + + "{return new Date(y);}\n" + + "}return null;}"; + + Date.parseRegexes[regexNum] = new RegExp("^" + regex + "$"); + eval(code); +} + +Date.formatCodeToRegex = function(character, currentGroup) { + switch (character) { + case "D": + return {g:0, + c:null, + s:"(?:Sun|Mon|Tue|Wed|Thu|Fri|Sat)"}; + case "j": + case "d": + return {g:1, + c:"d = parseInt(results[" + currentGroup + "], 10);\n", + s:"(\\d{1,2})"}; + case "l": + return {g:0, + c:null, + s:"(?:" + Date.dayNames.join("|") + ")"}; + case "S": + return {g:0, + c:null, + s:"(?:st|nd|rd|th)"}; + case "w": + return {g:0, + c:null, + s:"\\d"}; + case "z": + return {g:0, + c:null, + s:"(?:\\d{1,3})"}; + case "W": + return {g:0, + c:null, + s:"(?:\\d{2})"}; + case "F": + return {g:1, + c:"m = parseInt(Date.monthNumbers[results[" + currentGroup + "].substring(0, 3)], 10);\n", + s:"(" + Date.monthNames.join("|") + ")"}; + case "M": + return {g:1, + c:"m = parseInt(Date.monthNumbers[results[" + currentGroup + "]], 10);\n", + s:"(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)"}; + case "n": + case "m": + return {g:1, + c:"m = parseInt(results[" + currentGroup + "], 10) - 1;\n", + s:"(\\d{1,2})"}; + case "t": + return {g:0, + c:null, + s:"\\d{1,2}"}; + case "L": + return {g:0, + c:null, + s:"(?:1|0)"}; + case "Y": + return {g:1, + c:"y = parseInt(results[" + currentGroup + "], 10);\n", + s:"(\\d{4})"}; + case "y": + return {g:1, + c:"var ty = parseInt(results[" + currentGroup + "], 10);\n" + + "y = ty > Date.y2kYear ? 1900 + ty : 2000 + ty;\n", + s:"(\\d{1,2})"}; + case "a": + return {g:1, + c:"if (results[" + currentGroup + "] == 'am') {\n" + + "if (h == 12) { h = 0; }\n" + + "} else { if (h < 12) { h += 12; }}", + s:"(am|pm)"}; + case "A": + return {g:1, + c:"if (results[" + currentGroup + "] == 'AM') {\n" + + "if (h == 12) { h = 0; }\n" + + "} else { if (h < 12) { h += 12; }}", + s:"(AM|PM)"}; + case "g": + case "G": + case "h": + case "H": + return {g:1, + c:"h = parseInt(results[" + currentGroup + "], 10);\n", + s:"(\\d{1,2})"}; + case "i": + return {g:1, + c:"i = parseInt(results[" + currentGroup + "], 10);\n", + s:"(\\d{2})"}; + case "s": + return {g:1, + c:"s = parseInt(results[" + currentGroup + "], 10);\n", + s:"(\\d{2})"}; + case "O": + return {g:0, + c:null, + s:"[+-]\\d{4}"}; + case "T": + return {g:0, + c:null, + s:"[A-Z]{3}"}; + case "Z": + return {g:0, + c:null, + s:"[+-]\\d{1,5}"}; + default: + return {g:0, + c:null, + s:String.escape(character)}; + } +} + +Date.prototype.getTimezone = function() { + return this.toString().replace( + /^.*? ([A-Z]{3}) [0-9]{4}.*$/, "$1").replace( + /^.*?\(([A-Z])[a-z]+ ([A-Z])[a-z]+ ([A-Z])[a-z]+\)$/, "$1$2$3"); +} + +Date.prototype.getGMTOffset = function() { + return (this.getTimezoneOffset() > 0 ? "-" : "+") + + String.leftPad(Math.floor(this.getTimezoneOffset() / 60), 2, "0") + + String.leftPad(this.getTimezoneOffset() % 60, 2, "0"); +} + +Date.prototype.getDayOfYear = function() { + var num = 0; + Date.daysInMonth[1] = this.isLeapYear() ? 29 : 28; + for (var i = 0; i < this.getMonth(); ++i) { + num += Date.daysInMonth[i]; + } + return num + this.getDate() - 1; +} + +Date.prototype.getWeekOfYear = function() { + // Skip to Thursday of this week + var now = this.getDayOfYear() + (4 - this.getDay()); + // Find the first Thursday of the year + var jan1 = new Date(this.getFullYear(), 0, 1); + var then = (7 - jan1.getDay() + 4); + document.write(then); + return String.leftPad(((now - then) / 7) + 1, 2, "0"); +} + +Date.prototype.isLeapYear = function() { + var year = this.getFullYear(); + return ((year & 3) == 0 && (year % 100 || (year % 400 == 0 && year))); +} + +Date.prototype.getFirstDayOfMonth = function() { + var day = (this.getDay() - (this.getDate() - 1)) % 7; + return (day < 0) ? (day + 7) : day; +} + +Date.prototype.getLastDayOfMonth = function() { + var day = (this.getDay() + (Date.daysInMonth[this.getMonth()] - this.getDate())) % 7; + return (day < 0) ? (day + 7) : day; +} + +Date.prototype.getDaysInMonth = function() { + Date.daysInMonth[1] = this.isLeapYear() ? 29 : 28; + return Date.daysInMonth[this.getMonth()]; +} + +Date.prototype.getSuffix = function() { + switch (this.getDate()) { + case 1: + case 21: + case 31: + return "st"; + case 2: + case 22: + return "nd"; + case 3: + case 23: + return "rd"; + default: + return "th"; + } +} + +String.escape = function(string) { + return string.replace(/('|\\)/g, "\\$1"); +} + +String.leftPad = function (val, size, ch) { + var result = new String(val); + if (ch == null) { + ch = " "; + } + while (result.length < size) { + result = ch + result; + } + return result; +} + +Date.daysInMonth = [31,28,31,30,31,30,31,31,30,31,30,31]; +Date.monthNames = + ["January", + "February", + "March", + "April", + "May", + "June", + "July", + "August", + "September", + "October", + "November", + "December"]; +Date.dayNames = + ["Sunday", + "Monday", + "Tuesday", + "Wednesday", + "Thursday", + "Friday", + "Saturday"]; +Date.y2kYear = 50; +Date.monthNumbers = { + Jan:0, + Feb:1, + Mar:2, + Apr:3, + May:4, + Jun:5, + Jul:6, + Aug:7, + Sep:8, + Oct:9, + Nov:10, + Dec:11}; +Date.patterns = { + ISO8601LongPattern:"Y-m-d H:i:s", + ISO8601ShortPattern:"Y-m-d", + ShortDatePattern: "n/j/Y", + LongDatePattern: "l, F d, Y", + FullDateTimePattern: "l, F d, Y g:i:s A", + MonthDayPattern: "F d", + ShortTimePattern: "g:i A", + LongTimePattern: "g:i:s A", + SortableDateTimePattern: "Y-m-d\\TH:i:s", + UniversalSortableDateTimePattern: "Y-m-d H:i:sO", + YearMonthPattern: "F, Y"}; + +var date = new Date("1/1/2007 1:11:11"); + +for (i = 0; i < 4000; ++i) { + var shortFormat = date.dateFormat("Y-m-d"); + var longFormat = date.dateFormat("l, F d, Y g:i:s A"); + date.setTime(date.getTime() + 84266956); +} diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-cordic.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-cordic.js new file mode 100644 index 0000000000..152844c765 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-cordic.js @@ -0,0 +1,95 @@ +/* + * Copyright (C) Rich Moore. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY CONTRIBUTORS ``AS IS'' AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL APPLE COMPUTER, INC. OR + * CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + * PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + * PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY + * OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +/////. Start CORDIC + +var AG_CONST = 0.6072529350; + +function FIXED(X) +{ + return X * 65536.0; +} + +function FLOAT(X) +{ + return X / 65536.0; +} + +function DEG2RAD(X) +{ + return 0.017453 * (X); +} + +var Angles = [ + FIXED(45.0), FIXED(26.565), FIXED(14.0362), FIXED(7.12502), + FIXED(3.57633), FIXED(1.78991), FIXED(0.895174), FIXED(0.447614), + FIXED(0.223811), FIXED(0.111906), FIXED(0.055953), + FIXED(0.027977) + ]; + + +function cordicsincos() { + var X; + var Y; + var TargetAngle; + var CurrAngle; + var Step; + + X = FIXED(AG_CONST); /* AG_CONST * cos(0) */ + Y = 0; /* AG_CONST * sin(0) */ + + TargetAngle = FIXED(28.027); + CurrAngle = 0; + for (Step = 0; Step < 12; Step++) { + var NewX; + if (TargetAngle > CurrAngle) { + NewX = X - (Y >> Step); + Y = (X >> Step) + Y; + X = NewX; + CurrAngle += Angles[Step]; + } else { + NewX = X + (Y >> Step); + Y = -(X >> Step) + Y; + X = NewX; + CurrAngle -= Angles[Step]; + } + } +} + +///// End CORDIC + +function cordic( runs ) { + var start = new Date(); + + for ( var i = 0 ; i < runs ; i++ ) { + cordicsincos(); + } + + var end = new Date(); + + return end.getTime() - start.getTime(); +} + +cordic(25000); diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-partial-sums.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-partial-sums.js new file mode 100644 index 0000000000..e385e5cf3b --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-partial-sums.js @@ -0,0 +1,33 @@ +// The Computer Language Shootout +// http://shootout.alioth.debian.org/ +// contributed by Isaac Gouy + +function partial(n){ + var a1 = a2 = a3 = a4 = a5 = a6 = a7 = a8 = a9 = 0.0; + var twothirds = 2.0/3.0; + var alt = -1.0; + var k2 = k3 = sk = ck = 0.0; + + for (var k = 1; k <= n; k++){ + k2 = k*k; + k3 = k2*k; + sk = Math.sin(k); + ck = Math.cos(k); + alt = -alt; + + a1 += Math.pow(twothirds,k-1); + a2 += Math.pow(k,-0.5); + a3 += 1.0/(k*(k+1.0)); + a4 += 1.0/(k3 * sk*sk); + a5 += 1.0/(k3 * ck*ck); + a6 += 1.0/k; + a7 += 1.0/k2; + a8 += alt/k; + a9 += alt/(2*k -1); + } +} + +for (var i = 1024; i <= 16384; i *= 2) { + partial(i); +} + diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-spectral-norm.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-spectral-norm.js new file mode 100644 index 0000000000..c917ae5908 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/math-spectral-norm.js @@ -0,0 +1,51 @@ +// The Great Computer Language Shootout +// http://shootout.alioth.debian.org/ +// +// contributed by Ian Osgood + +function A(i,j) { + return 1/((i+j)*(i+j+1)/2+i+1); +} + +function Au(u,v) { + for (var i=0; i.*\n|\n/g,"") +clen = dnaInput.length + +var dnaOutputString; + +for(i in seqs) + dnaOutputString += seqs[i].source + " " + (dnaInput.match(seqs[i]) || []).length + "\n"; + // match returns null if no matches, so replace with empty + +for(k in subs) + dnaInput = dnaInput.replace(k, subs[k]) // FIXME: Would like this to be a global substitution in a future version of SunSpider. + // search string, replacement string, flags diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-base64.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-base64.js new file mode 100644 index 0000000000..31876c47d3 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-base64.js @@ -0,0 +1,135 @@ +/* ***** BEGIN LICENSE BLOCK ***** + * Version: MPL 1.1/GPL 2.0/LGPL 2.1 + * + * The contents of this file are subject to the Mozilla Public License Version + * 1.1 (the "License"); you may not use this file except in compliance with + * the License. You may obtain a copy of the License at + * http://www.mozilla.org/MPL/ + * + * Software distributed under the License is distributed on an "AS IS" basis, + * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License + * for the specific language governing rights and limitations under the + * License. + * + * The Original Code is Mozilla XML-RPC Client component. + * + * The Initial Developer of the Original Code is + * Digital Creations 2, Inc. + * Portions created by the Initial Developer are Copyright (C) 2000 + * the Initial Developer. All Rights Reserved. + * + * Contributor(s): + * Martijn Pieters (original author) + * Samuel Sieb + * + * Alternatively, the contents of this file may be used under the terms of + * either the GNU General Public License Version 2 or later (the "GPL"), or + * the GNU Lesser General Public License Version 2.1 or later (the "LGPL"), + * in which case the provisions of the GPL or the LGPL are applicable instead + * of those above. If you wish to allow use of your version of this file only + * under the terms of either the GPL or the LGPL, and not to allow others to + * use your version of this file under the terms of the MPL, indicate your + * decision by deleting the provisions above and replace them with the notice + * and other provisions required by the GPL or the LGPL. If you do not delete + * the provisions above, a recipient may use your version of this file under + * the terms of any one of the MPL, the GPL or the LGPL. + * + * ***** END LICENSE BLOCK ***** */ + +// From: http://lxr.mozilla.org/mozilla/source/extensions/xml-rpc/src/nsXmlRpcClient.js#956 + +/* Convert data (an array of integers) to a Base64 string. */ +var toBase64Table = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; +var base64Pad = '='; + +function toBase64(data) { + var result = ''; + var length = data.length; + var i; + // Convert every three bytes to 4 ascii characters. + for (i = 0; i < (length - 2); i += 3) { + result += toBase64Table[data.charCodeAt(i) >> 2]; + result += toBase64Table[((data.charCodeAt(i) & 0x03) << 4) + (data.charCodeAt(i+1) >> 4)]; + result += toBase64Table[((data.charCodeAt(i+1) & 0x0f) << 2) + (data.charCodeAt(i+2) >> 6)]; + result += toBase64Table[data.charCodeAt(i+2) & 0x3f]; + } + + // Convert the remaining 1 or 2 bytes, pad out to 4 characters. + if (length%3) { + i = length - (length%3); + result += toBase64Table[data.charCodeAt(i) >> 2]; + if ((length%3) == 2) { + result += toBase64Table[((data.charCodeAt(i) & 0x03) << 4) + (data.charCodeAt(i+1) >> 4)]; + result += toBase64Table[(data.charCodeAt(i+1) & 0x0f) << 2]; + result += base64Pad; + } else { + result += toBase64Table[(data.charCodeAt(i) & 0x03) << 4]; + result += base64Pad + base64Pad; + } + } + + return result; +} + +/* Convert Base64 data to a string */ +var toBinaryTable = [ + -1,-1,-1,-1, -1,-1,-1,-1, -1,-1,-1,-1, -1,-1,-1,-1, + -1,-1,-1,-1, -1,-1,-1,-1, -1,-1,-1,-1, -1,-1,-1,-1, + -1,-1,-1,-1, -1,-1,-1,-1, -1,-1,-1,62, -1,-1,-1,63, + 52,53,54,55, 56,57,58,59, 60,61,-1,-1, -1, 0,-1,-1, + -1, 0, 1, 2, 3, 4, 5, 6, 7, 8, 9,10, 11,12,13,14, + 15,16,17,18, 19,20,21,22, 23,24,25,-1, -1,-1,-1,-1, + -1,26,27,28, 29,30,31,32, 33,34,35,36, 37,38,39,40, + 41,42,43,44, 45,46,47,48, 49,50,51,-1, -1,-1,-1,-1 +]; + +function base64ToString(data) { + var result = ''; + var leftbits = 0; // number of bits decoded, but yet to be appended + var leftdata = 0; // bits decoded, but yet to be appended + + // Convert one by one. + for (var i = 0; i < data.length; i++) { + var c = toBinaryTable[data.charCodeAt(i) & 0x7f]; + var padding = (data.charCodeAt(i) == base64Pad.charCodeAt(0)); + // Skip illegal characters and whitespace + if (c == -1) continue; + + // Collect data into leftdata, update bitcount + leftdata = (leftdata << 6) | c; + leftbits += 6; + + // If we have 8 or more bits, append 8 bits to the result + if (leftbits >= 8) { + leftbits -= 8; + // Append if not padding. + if (!padding) + result += String.fromCharCode((leftdata >> leftbits) & 0xff); + leftdata &= (1 << leftbits) - 1; + } + } + + // If there are any bits left, the base64 string was corrupted + if (leftbits) + throw Components.Exception('Corrupted base64 string'); + + return result; +} + +var str = ""; + +for ( var i = 0; i < 8192; i++ ) + str += String.fromCharCode( (25 * Math.random()) + 97 ); + +for ( var i = 8192; i <= 16384; i *= 2 ) { + + var base64; + + base64 = toBase64(str); + base64ToString(base64); + + // Double the string + str += str; +} + +toBinaryTable = null; diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-fasta.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-fasta.js new file mode 100644 index 0000000000..f2111a4608 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-fasta.js @@ -0,0 +1,85 @@ +// The Great Computer Language Shootout +// http://shootout.alioth.debian.org +// +// Contributed by Ian Osgood + +var last = 42, A = 3877, C = 29573, M = 139968; + +function rand(max) { + last = (last * A + C) % M; + return max * last / M; +} + +var ALU = + "GGCCGGGCGCGGTGGCTCACGCCTGTAATCCCAGCACTTTGG" + + "GAGGCCGAGGCGGGCGGATCACCTGAGGTCAGGAGTTCGAGA" + + "CCAGCCTGGCCAACATGGTGAAACCCCGTCTCTACTAAAAAT" + + "ACAAAAATTAGCCGGGCGTGGTGGCGCGCGCCTGTAATCCCA" + + "GCTACTCGGGAGGCTGAGGCAGGAGAATCGCTTGAACCCGGG" + + "AGGCGGAGGTTGCAGTGAGCCGAGATCGCGCCACTGCACTCC" + + "AGCCTGGGCGACAGAGCGAGACTCCGTCTCAAAAA"; + +var IUB = { + a:0.27, c:0.12, g:0.12, t:0.27, + B:0.02, D:0.02, H:0.02, K:0.02, + M:0.02, N:0.02, R:0.02, S:0.02, + V:0.02, W:0.02, Y:0.02 +} + +var HomoSap = { + a: 0.3029549426680, + c: 0.1979883004921, + g: 0.1975473066391, + t: 0.3015094502008 +} + +function makeCumulative(table) { + var last = null; + for (var c in table) { + if (last) table[c] += table[last]; + last = c; + } +} + +function fastaRepeat(n, seq) { + var seqi = 0, lenOut = 60; + while (n>0) { + if (n0) { + if (n= 0x7f) { + validates = false; + break; + } + } + + if (!validates) + continue; + + var url = "http://example.com/tag/" + tag.replace(" ", "").toLowerCase(); + var popularity = tagInfo[i].popularity; + var color = 'rgb(' + Math.floor(255 * (popularity - 12) / 20) + ', 0, 255)'; + output += ' ' + tag + ' \n'; + } + + output += ''; + output.replace(" ", " "); + + return output; +} + +var tagcloud = makeTagCloud(tagInfo); +tagInfo = null; diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-unpack-code.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-unpack-code.js new file mode 100644 index 0000000000..224bb13d72 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-unpack-code.js @@ -0,0 +1,68 @@ +// This test case unpacks the compressed code for the MochiKit, +// jQuery, Dojo and Prototype JavaScript libraries. + +/*** + MochiKit.MochiKit 1.3.1 : PACKED VERSION + THIS FILE IS AUTOMATICALLY GENERATED. If creating patches, please + diff against the source tree, not this file. + + See for documentation, downloads, license, etc. + + (c) 2005 Bob Ippolito. All rights Reserved. +***/ + +for (var i = 0; i < 2; i++) { + +var decompressedMochiKit = function(p,a,c,k,e,d){e=function(c){return(c35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)d[e(c)]=k[c]||e(c);k=[function(e){return d[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('if(H(1q)!="L"){1q.2X("B.J")}if(H(B)=="L"){B={}}if(H(B.J)=="L"){B.J={}}B.J.1Y="1.3.1";B.J.1r="B.J";B.J.2l=G(7V,vR){if(7V===O){7V={}}R(u i=1;i=0;i--){aw.e9(o[i])}}N{X.1c(o)}}F X},1R:G(7U,1i,av){if(!av){av=0}if(1i){u l=1i.K;if(H(l)!="2y"){if(H(B.15)!="L"){1i=B.15.2G(1i);l=1i.K}N{14 Y 3p("au 2E an at-as 3W B.15 2E ar")}}if(!7U){7U=[]}R(u i=av;i>b},vG:G(a,b){F a>>>b},eq:G(a,b){F a==b},ne:G(a,b){F a!=b},gt:G(a,b){F a>b},ge:G(a,b){F a>=b},lt:G(a,b){F al){7T=l}}69=[];R(i=0;i<7T;i++){u fa=[];R(u j=1;j0){ap=m.2o(me.am,ap)}u 4o=me.f7;if(!4o){4o=D}F me.f5.1w(4o,ap)};7Q.f7=f6;7Q.f5=ao;7Q.am=5f;F 7Q},lF:G(7P){u mp=B.J.1O;R(u k in 7P){u f4=7P[k];if(H(f4)=="G"){7P[k]=mp(f4,7P)}}},5u:G(mo,mn,ml,mk){B.J.ae.5M(mo,mn,ml,mk)},mj:{"5L":1h,"1n":1h,"2y":1h},2f:G(a,b){if(a==b){F 0}u f3=(H(a)=="L"||a===O);u f2=(H(b)=="L"||b===O);if(f3&&f2){F 0}N{if(f3){F-1}N{if(f2){F 1}}}u m=B.J;u f1=m.mj;if(!(H(a)in f1&&H(b)in f1)){1f{F m.ae.3C(a,b)}1e(e){if(e!=m.4d){14 e}}}if(ab){F 1}}u f0=m.U;14 Y 3p(f0(a)+" 3W "+f0(b)+" 9v 2E be vv")},eM:G(a,b){F B.J.2f(a.9P(),b.9P())},eL:G(a,b){u mi=B.J.2f;u 7O=a.K;u al=0;if(7O>b.K){al=1;7O=b.K}N{if(7O0))){u kv=B.S.d5(3s);3s=kv[0];68=kv[1]}N{if(M.K==1){u o=3s;3s=[];68=[];R(u k in o){u v=o[k];if(H(v)!="G"){3s.1c(k);68.1c(v)}}}}u W=[];u lT=28.2a(3s.K,68.K);u eT=B.J.af;R(u i=0;i=2J){14 I.25}5c+=3a;F W}}},4c:G(aa,p,q){u m=B.J;u I=B.15;u lb=m.2r(I.1Q,m.1R(O,M,1));u 2r=m.2r;u 1a=I.1a;F{U:G(){F"4c(...)"},1l:m.24("U"),1a:G(){F aa.1w(D,2r(1a,lb))}}},ep:G(aa,1V,I){1V=B.15.1Q(1V);u m=B.J;F{U:G(){F"ep(...)"},1l:m.24("U"),1a:G(){F aa.1w(I,1V.1a())}}},55:G(p,q){u I=B.15;u m=B.J;if(M.K==1){F I.1Q(M[0])}u 64=m.2r(I.1Q,M);F{U:G(){F"55(...)"},1l:m.24("U"),1a:G(){1M(64.K>1){1f{F 64[0].1a()}1e(e){if(e!=I.25){14 e}64.2P()}}if(64.K==1){u a9=64.2P();D.1a=m.1O("1a",a9);F D.1a()}14 I.25}}},9Z:G(3b,1V){u I=B.15;1V=I.1Q(1V);F{U:G(){F"9Z(...)"},1l:B.J.24("U"),1a:G(){u W=1V.1a();if(!3b(W)){D.1a=G(){14 I.25};D.1a()}F W}}},eo:G(3b,1V){1V=B.15.1Q(1V);u m=B.J;u 1O=m.1O;F{"U":G(){F"eo(...)"},"1l":m.24("U"),"1a":G(){1M(1h){u W=1V.1a();if(!3b(W)){2K}}D.1a=1O("1a",1V);F W}}},a7:G(63,2u,la){2u.62[63]=-1;u m=B.J;u l9=m.eI;F{U:G(){F"en("+63+", ...)"},1l:m.24("U"),1a:G(){u W;u i=2u.62[63];if(i==2u.29){W=la.1a();2u.a8.1c(W);2u.29+=1;2u.62[63]+=1}N{W=2u.a8[i-2u.2a];2u.62[63]+=1;if(i==2u.2a&&l9(2u.62)!=2u.2a){2u.2a+=1;2u.a8.2P()}}F W}}},en:G(a6,n){u W=[];u 2u={"62":[],"a8":[],"29":-1,"2a":-1};if(M.K==1){n=2}u I=B.15;a6=I.1Q(a6);u a7=I.a7;R(u i=0;i0&&4k>=2J)||(3a<0&&4k<=2J)){14 B.15.25}u W=4k;4k+=3a;F W},U:G(){F"7I("+[4k,2J,3a].2b(", ")+")"},1l:B.J.24("U")}},l0:G(a5,l7){u x=l7||0;u I=B.15;a5=I.1Q(a5);1f{1M(1h){x+=a5.1a()}}1e(e){if(e!=I.25){14 e}}F x},em:G(a4){u I=B.15;a4=I.1Q(a4);1f{1M(1h){a4.1a()}}1e(e){if(e!=I.25){14 e}}},9a:G(7J,1A,I){u m=B.J;if(M.K>2){1A=m.1O(1A,I)}if(m.3A(7J)){1f{R(u i=0;i<7J.K;i++){1A(7J[i])}}1e(e){if(e!=B.15.25){14 e}}}N{I=B.15;I.em(I.4c(1A,7J))}},kZ:G(l6,1A){u I=B.15;1f{I.a0(1A,l6).1a();F 1m}1e(e){if(e!=I.25){14 e}F 1h}},kY:G(l5,4j){u W=B.15.2G(l5);if(M.K==1){4j=B.J.2f}W.iz(4j);F W},kX:G(l4){u W=B.15.2G(l4);W.vg();F W},kW:G(l3,1A){u I=B.15;1f{I.a1(1A,l3).1a();F 1h}1e(e){if(e!=I.25){14 e}F 1m}},kV:G(1g,5b){if(B.J.3A(5b)){R(u i=0;i<5b.K;i++){1g.1c(5b[i])}}N{u I=B.15;5b=I.1Q(5b);1f{1M(1h){1g.1c(5b.1a())}}1e(e){if(e!=I.25){14 e}}}F 1g},ek:G(a3,eH){u m=B.J;u I=B.15;if(M.K<2){eH=m.4i.eE}a3=I.1Q(a3);u pk=L;u k=L;u v;G eF(){v=a3.1a();k=eH(v)}G l2(){u 7j=v;v=L;F 7j}u eG=1h;F{U:G(){F"ek(...)"},1a:G(){1M(k==pk){eF();if(eG){eG=1m;2K}}pk=k;F[k,{1a:G(){if(v==L){eF()}if(k!=pk){14 I.25}F l2()}}]}}},kU:G(a2,eD){u m=B.J;u I=B.15;if(M.K<2){eD=m.4i.eE}a2=I.1Q(a2);u ey=[];u eA=1h;u ez;1M(1h){1f{u eB=a2.1a();u 2h=eD(eB)}1e(e){if(e==I.25){2K}14 e}if(eA||2h!=ez){u eC=[];ey.1c([2h,eC])}eC.1c(eB);eA=1m;ez=2h}F ey},9X:G(ex){u i=0;F{U:G(){F"9X(...)"},1l:B.J.24("U"),1a:G(){if(i>=ex.K){14 B.15.25}F ex[i++]}}},eh:G(ew){F(ew&&H(ew.ei)=="G")},9V:G(l1){F{U:G(){F"9V(...)"},1l:B.J.24("U"),1a:G(){u W=l1.ei();if(W===O||W===L){14 B.15.25}F W}}}});B.15.1W=["9Y","9X","eh","9V",];B.15.1z=["25","9W","1Q","eu","et","7b","1a","es","a1","a0","er","4c","ep","55","9Z","eo","en","2G","7H","7I","l0","em","9a","kZ","kY","kX","kW","kV","ek","kU"];B.15.2d=G(){u m=B.J;D.25=Y m.5a("25");D.9Y=Y m.4a();D.9W("ej",m.3A,D.9X);D.9W("ei",D.eh,D.9V);D.2k={":3e":D.1z,":1p":m.2o(D.1z,D.1W)};m.3f(D)};B.15.2d();if(!B.3d){7H=B.15.7H}B.J.2Y(D,B.15);if(H(1q)!="L"){1q.2X("B.1H");1q.2M("B.J")}if(H(1x)!="L"){1x.26("B.J",[])}1f{if(H(B.J)=="L"){14""}}1e(e){14"B.1H 3F on B.J!"}if(H(B.1H)=="L"){B.1H={}}B.1H.1r="B.1H";B.1H.1Y="1.3.1";B.1H.1K=G(){F"["+D.1r+" "+D.1Y+"]"};B.1H.1l=G(){F D.1K()};B.1H.1z=["5C","49","7A","kR","2L","5Z","kG","ch","kE","kC"];B.1H.1W=["ef","e8","e7"];B.1H.49=G(1P,kT,3z){D.1P=1P;D.3N=kT;D.3z=3z;D.vf=Y 3Q()};B.1H.49.1U={U:G(){u m=B.J;F"49("+m.2r(m.U,[D.1P,D.3N,D.3z]).2b(", ")+")"},1l:B.J.24("U")};B.J.2l(B.1H,{ef:G(7F){u I=B.1H;if(H(7F)=="1n"){7F=I.5C[7F]}F G(1t){u 7G=1t.3N;if(H(7G)=="1n"){7G=I.5C[7G]}F 7G>=7F}},e8:G(){u kS=B.1H.49;R(u i=0;i=0&&D.4h.K>D.ec){D.4h.2P()}},c8:G(9U){u ea=0;if(!(H(9U)=="L"||9U===O)){ea=28.29(0,D.4h.K-9U)}F D.4h.9T(ea)},kJ:G(7B){if(H(7B)=="L"||7B===O){7B=30}u 9S=D.c8(7B);if(9S.K){u 1g=2r(G(m){F"\\n ["+m.1P+"] "+m.3N+": "+m.3z.2b(" ")},9S);1g.e9("va "+9S.K+" v9:");F 1g.2b("")}F""},v8:G(kI){if(H(B.1I)=="L"){cq(D.kJ())}N{B.1I.bY(kI||1m)}}};B.1H.2d=G(){D.5C={8M:40,8L:50,8K:30,8J:20,8I:10};u m=B.J;m.5u("49",D.e8,D.e7);u 61=m.2z;u e6=D.7A;u 60=e6.1U.kH;m.2l(D.7A.1U,{kF:61(60,"8I"),5Z:61(60,"8J"),dE:61(60,"8M"),kD:61(60,"8L"),kB:61(60,"8K")});u I=D;u 5Y=G(1b){F G(){I.2L[1b].1w(I.2L,M)}};D.5Z=5Y("5Z");D.kG=5Y("dE");D.ch=5Y("kF");D.kE=5Y("kD");D.kC=5Y("kB");D.2L=Y e6();D.2L.e5=1h;D.2k={":3e":D.1z,":1p":m.2o(D.1z,D.1W)};m.3f(D)};if(H(5X)=="L"&&H(2v)!="L"&&2v.kA&&H(kz)!="L"){5X=G(){5X.3G=M;u ev=2v.kA("v7");ev.v6("5X",1m,1h);kz(ev)}}B.1H.2d();B.J.2Y(D,B.1H);if(H(1q)!="L"){1q.2X("B.1D")}if(H(B)=="L"){B={}}if(H(B.1D)=="L"){B.1D={}}B.1D.1r="B.1D";B.1D.1Y="1.3.1";B.1D.1K=G(){F"["+D.1r+" "+D.1Y+"]"};B.1D.1l=G(){F D.1K()};B.1D.ks=G(1y){1y=1y+"";if(H(1y)!="1n"||1y.K===0){F O}u 7z=1y.2R("-");if(7z.K===0){F O}F Y 3Q(7z[0],7z[1]-1,7z[2])};B.1D.ky=/(\\d{4,})(?:-(\\d{1,2})(?:-(\\d{1,2})(?:[T ](\\d{1,2}):(\\d{1,2})(?::(\\d{1,2})(?:\\.(\\d+))?)?(?:(Z)|([+-])(\\d{1,2})(?::(\\d{1,2}))?)?)?)?)?/;B.1D.kr=G(1y){1y=1y+"";if(H(1y)!="1n"||1y.K===0){F O}u X=1y.3C(B.1D.ky);if(H(X)=="L"||X===O){F O}u 5W,7y,7x,9R,2a,9Q,7w;5W=3w(X[1],10);if(H(X[2])=="L"||X[2]===""){F Y 3Q(5W)}7y=3w(X[2],10)-1;7x=3w(X[3],10);if(H(X[4])=="L"||X[4]===""){F Y 3Q(5W,7y,7x)}9R=3w(X[4],10);2a=3w(X[5],10);9Q=(H(X[6])!="L"&&X[6]!=="")?3w(X[6],10):0;if(H(X[7])!="L"&&X[7]!==""){7w=28.ha(c5*4M("0."+X[7]))}N{7w=0}if((H(X[8])=="L"||X[8]==="")&&(H(X[9])=="L"||X[9]==="")){F Y 3Q(5W,7y,7x,9R,2a,9Q,7w)}u 58;if(H(X[9])!="L"&&X[9]!==""){58=3w(X[10],10)*v5;if(H(X[11])!="L"&&X[11]!==""){58+=3w(X[11],10)*kw}if(X[9]=="-"){58=-58}}N{58=0}F Y 3Q(3Q.v4(5W,7y,7x,9R,2a,9Q,7w)-58)};B.1D.dY=G(2g,kx){if(H(2g)=="L"||2g===O){F O}u hh=2g.v3();u mm=2g.v2();u ss=2g.v1();u 1g=[((kx&&(hh<10))?"0"+hh:hh),((mm<10)?"0"+mm:mm),((ss<10)?"0"+ss:ss)];F 1g.2b(":")};B.1D.kq=G(2g,7v){if(H(2g)=="L"||2g===O){F O}u ku=7v?"T":" ";u kt=7v?"Z":"";if(7v){2g=Y 3Q(2g.9P()+(2g.v0()*kw))}F B.1D.dX(2g)+ku+B.1D.dY(2g,7v)+kt};B.1D.dX=G(2g){if(H(2g)=="L"||2g===O){F O}u e4=B.1D.e3;F[2g.dZ(),e4(2g.e1()+1),e4(2g.e0())].2b("-")};B.1D.kp=G(d){d=d+"";if(H(d)!="1n"||d.K===0){F O}u a=d.2R("/");F Y 3Q(a[2],a[0]-1,a[1])};B.1D.e3=G(n){F(n>9)?n:"0"+n};B.1D.ko=G(d){if(H(d)=="L"||d===O){F O}u e2=B.1D.e3;F[e2(d.e1()+1),e2(d.e0()),d.dZ()].2b("/")};B.1D.kn=G(d){if(H(d)=="L"||d===O){F O}F[d.e1()+1,d.e0(),d.dZ()].2b("/")};B.1D.1z=["ks","kr","dY","kq","dX","kp","ko","kn"];B.1D.1W=[];B.1D.2k={":3e":B.1D.1z,":1p":B.1D.1z};B.1D.2d=G(){u 2w=D.1r+".";R(u k in D){u o=D[k];if(H(o)=="G"&&H(o.1r)=="L"){1f{o.1r=2w+k}1e(e){}}}};B.1D.2d();if(H(B.J)!="L"){B.J.2Y(D,B.1D)}N{(G(km,dW){if((H(1x)=="L"&&H(1q)=="L")||(H(B.3d)=="5L"&&B.3d)){u 1p=dW.2k[":1p"];R(u i=0;i<1p.K;i++){km[1p[i]]=dW[1p[i]]}}})(D,B.1D)}if(H(1q)!="L"){1q.2X("B.1s")}if(H(B)=="L"){B={}}if(H(B.1s)=="L"){B.1s={}}B.1s.1r="B.1s";B.1s.1Y="1.3.1";B.1s.1K=G(){F"["+D.1r+" "+D.1Y+"]"};B.1s.1l=G(){F D.1K()};B.1s.ke=G(kl,kk,kj,ki,kh,dV,kg,9N,kf){F G(1P){1P=4M(1P);if(H(1P)=="L"||1P===O||k8(1P)){F kl}u 9L=kk;u 9K=kj;if(1P<0){1P=-1P}N{9L=9L.23(/-/,"")}u me=M.2U;u 9M=B.1s.dJ(ki);if(kh){1P=1P*3k;9K=9M.9y+9K}1P=B.1s.dK(1P,dV);u 9O=1P.2R(/\\./);u 3r=9O[0];u 3P=(9O.K==1)?"":9O[1];u X="";1M(3r.K9N){u i=3r.K-9N;X=9M.9A+3r.2W(i,3r.K)+X;3r=3r.2W(0,i)}}X=3r+X;if(dV>0){1M(3P.K=0)){D.9u()}},jR:G(X){D.9x(X);D.jX()},9x:G(X){D.2H=((X 2C 2x)?1:0);D.53[D.2H]=X;D.9u()},dD:G(){if(D.2H!=-1){if(!D.7l){14 Y B.1k.dj(D)}D.7l=1m;F}},3o:G(X){D.dD();if(X 2C B.1k.2t){14 Y 2x("2t jW 9v aB be 7r if jV jU jT jS of a 3o")}D.9x(X)},52:G(X){D.dD();u I=B.1k;if(X 2C I.2t){14 Y 2x("2t jW 9v aB be 7r if jV jU jT jS of a 3o")}if(!(X 2C 2x)){X=Y I.9p(X)}D.9x(X)},jP:G(fn){if(M.K>1){fn=B.J.2z.1w(O,M)}F D.9w(fn,fn)},5Q:G(fn){if(M.K>1){fn=B.J.2z.1w(O,M)}F D.9w(fn,O)},jA:G(fn){if(M.K>1){fn=B.J.2z.1w(O,M)}F D.9w(O,fn)},9w:G(cb,eb){if(D.7r){14 Y 2x("uQ uP 9v 2E be re-uO")}D.55.1c([cb,eb]);if(D.2H>=0){D.9u()}F D},9u:G(){u dC=D.55;u 56=D.2H;u X=D.53[56];u I=D;u cb=O;1M(dC.K>0&&D.54===0){u 2n=dC.2P();u f=2n[56];if(f===O){2V}1f{X=f(X);56=((X 2C 2x)?1:0);if(X 2C B.1k.2t){cb=G(X){I.jR(X)};D.jQ()}}1e(3O){56=1;if(!(3O 2C 2x)){3O=Y B.1k.9p(3O)}X=3O}}D.2H=56;D.53[56]=X;if(cb&&D.54){X.jP(cb);X.7r=1h}}};B.J.2l(B.1k,{dk:G(){F dB("("+M[0].jN+")")},dp:G(uN){u d=Y B.1k.2t();d.3o.1w(d,M);F d},9q:G(uM){u d=Y B.1k.2t();d.52.1w(d,M);F d},do:G(){u I=M.2U;if(!I.7q){u dy=[G(){F Y 7q()},G(){F Y dA("jO.dz")},G(){F Y dA("uL.dz")},G(){F Y dA("jO.dz.4.0")},G(){14 Y B.1k.dh("uK uJ 2E uI 7q")}];R(u i=0;i1){u m=B.J;u qs=m.dw.1w(O,m.1R(O,M,1));if(qs){5F+="?"+qs}}2s.cp("uB",5F,1h);F I.dl(2s)},jv:G(5F){u I=B.1k;u d=I.dn.1w(I,M);d=d.5Q(I.dk);F d},dm:G(jJ,dv){u d=Y B.1k.2t();u m=B.J;if(H(dv)!="L"){d.5Q(G(){F dv})}u jI=uA(m.1O("3o",d),28.8B(jJ*c5));d.7m=G(){1f{uz(jI)}1e(e){}};F d},ju:G(jH,1A){u m=B.J;u jG=m.2z.1w(m,m.1R(O,M,1));F B.1k.dm(jH).5Q(G(X){F jG()})}});B.1k.5O=G(){D.5S=[];D.4e=1m;D.id=D.7n()};B.1k.5O.1U={bX:B.1k.5O,uy:G(){d=Y B.1k.2t();if(D.4e){D.5S.1c(d)}N{D.4e=1h;d.3o(D)}F d},jF:G(){if(!D.4e){14 3p("ux to jF an jE 5O")}D.4e=1m;if(D.5S.K>0){D.4e=1h;D.5S.2P().3o(D)}},7n:B.J.4f(),U:G(){u 9t;if(D.4e){9t="4e, "+D.5S.K+" 5S"}N{9t="jE"}F"5O("+D.id+", "+9t+")"},1l:B.J.24("U")};B.1k.7i=G(2G,du,jC,jB,jD){D.2G=2G;D.9r=Y 7o(D.2G.K);D.55=[];D.id=D.7n();D.2H=-1;D.54=0;D.53=[O,O];D.7m=jD;D.7l=1m;if(D.2G.K===0&&!du){D.3o(D.9r)}D.dr=0;D.jz=du;D.jy=jC;D.jx=jB;u 9s=0;B.J.2r(B.J.1O(G(d){d.5Q(B.J.1O(D.dt,D),9s,1h);d.jA(B.J.1O(D.dt,D),9s,1m);9s+=1},D),D.2G)};B.J.2l(B.1k.7i.1U,B.1k.2t.1U);B.J.2l(B.1k.7i.1U,{dt:G(ds,7k,5R){D.9r[ds]=[7k,5R];D.dr+=1;if(D.2H!==0){if(7k&&D.jz){D.3o([ds,5R])}N{if(!7k&&D.jy){D.52(5R)}N{if(D.dr==D.2G.K){D.3o(D.9r)}}}}if(!7k&&D.jx){5R=O}F 5R}});B.1k.jt=G(jw){u d=Y B.1k.7i(jw,1m,1h,1m);d.5Q(G(dq){u 7j=[];R(u i=0;i=0){u 9m=Q.1S[Q.j4];7d.1c(1b);7c.1c((9m.3m)?9m.3m:9m.7X);F O}7d.1c(1b);7c.1c("");F O}if(4Y=="cu"||4Y=="P"||4Y=="8d"||4Y=="6m"){F Q.5h}7d.1c(1b);7c.1c(Q.3m||"");F O}F Q.5h});F[7d,7c]},94:G(1N,1A){u I=B.S;u d3=I.1Z;u W;1f{I.1Z=1N;W=1A()}1e(e){I.1Z=d3;14 e}I.1Z=d3;F W},j3:G(1b,j2,3y,j1){B.S.9b.5M(1b,j2,3y,j1)},9k:G(1j,7a){u im=B.15;u I=B.S;u 1Q=im.1Q;u iY=im.7b;u 4c=im.4c;u iX=I.9b;u iZ=I.9k;u iW=B.J.4d;1M(1h){if(H(1j)=="L"||1j===O){F O}if(H(1j.3T)!="L"&&1j.3T>0){F 1j}if(H(1j)=="2y"||H(1j)=="5L"){1j=1j.1l()}if(H(1j)=="1n"){F I.1Z.4S(1j)}if(H(1j.j0)=="G"){1j=1j.j0(7a);2V}if(H(1j)=="G"){1j=1j(7a);2V}u 9l=O;1f{9l=1Q(1j)}1e(e){}if(9l){F 4c(iZ,9l,iY(7a))}1f{1j=iX.3C(1j,7a);2V}1e(e){if(e!=iW){14 e}}F I.1Z.4S(1j.1l())}F L},iV:G(1j,79,iU){u o={};o[79]=iU;1f{F B.S.4X(1j,o)}1e(e){}F O},iT:G(1j,79){u I=B.S;u d2=I.4U.99[79];1j=I.1E(1j);1f{if(d2){F 1j[d2]}F 1j.fm(79)}1e(e){}F O},4X:G(1j,5K){u Q=1j;u I=B.S;if(H(1j)=="1n"){Q=I.1E(1j)}if(5K){u d0=B.J.8Z;if(I.4U.6X){R(u k in 5K){u v=5K[k];if(H(v)=="3n"&&H(Q[k])=="3n"){d0(Q[k],v)}N{if(k.2W(0,2)=="on"){if(H(v)=="1n"){v=Y cZ(v)}Q[k]=v}N{Q.4p(k,v)}}}}N{u iS=I.4U.99;R(k in 5K){v=5K[k];u d1=iS[k];if(k=="1T"&&H(v)=="1n"){Q.1T.3x=v}N{if(H(d1)=="1n"){Q[d1]=v}N{if(H(Q[k])=="3n"&&H(v)=="3n"){d0(Q[k],v)}N{if(k.2W(0,2)=="on"){if(H(v)=="1n"){v=Y cZ(v)}Q[k]=v}N{Q.4p(k,v)}}}}}}}F Q},9j:G(1j){u Q=1j;u I=B.S;if(H(1j)=="1n"){Q=I.1E(1j)}u 78=[I.9k(B.J.1R(O,M,1),Q)];u iR=B.J.2o;1M(78.K){u n=78.2P();if(H(n)=="L"||n===O){}N{if(H(n.3T)=="2y"){Q.2c(n)}N{78=iR(n,78)}}}F Q},iQ:G(1j){u Q=1j;u I=B.S;if(H(1j)=="1n"){Q=I.1E(1j);M[0]=Q}u cY;1M((cY=Q.6n)){Q.6S(cY)}if(M.K<2){F Q}N{F I.9j.1w(D,M)}},cX:G(1b,4b){u Q;u I=B.S;u m=B.J;if(H(4b)=="1n"||H(4b)=="2y"){u 3G=m.1R([1b,O],M,1);F M.2U.1w(D,3G)}if(H(1b)=="1n"){if(4b&&"1b"in 4b&&!I.4U.6X){1b=("<"+1b+" 1b=\\""+I.9c(4b.1b)+"\\">")}Q=I.1Z.2S(1b)}N{Q=1b}if(4b){I.4X(Q,4b)}if(M.K<=2){F Q}N{u 3G=m.1R([Q],M,2);F I.9j.1w(D,3G)}},cw:G(){u m=B.J;F m.2z.1w(D,m.1R([B.S.cX],M))},cs:G(5J,1d){u I=B.S;5J=I.1E(5J);u cW=5J.3t;if(1d){1d=I.1E(1d);cW.uj(1d,5J)}N{cW.6S(5J)}F 1d},1E:G(id){u I=B.S;if(M.K==1){F((H(id)=="1n")?I.1Z.hN(id):id)}N{F B.J.2r(I.1E,M)}},4q:G(iP,cV,cU){if(M.K==2){cU=cV}u I=B.S;u el=I.1E(iP);u 77=I.1Z;if(!el||el==77){F L}if(el.iO){F el.iO[cV]}if(H(77.5k)=="L"){F L}if(77.5k===O){F L}u 9i=77.5k.g4(el,O);if(H(9i)=="L"||9i===O){F L}F 9i.6q(cU)},aH:G(76,9g,4W){u I=B.S;if(H(76)=="L"||76===O){76="*"}if(H(4W)=="L"||4W===O){4W=I.1Z}4W=I.1E(4W);u 9h=(4W.fr(76)||I.1Z.1p);if(H(9g)=="L"||9g===O){F B.J.1R(O,9h)}u cR=[];R(u i=0;i<9h.K;i++){u cS=9h[i];u cT=cS.3M.2R(" ");R(u j=0;j/g,">")},iB:G(2q){F B.S.cG(2q).2b("")},cG:G(2q,1g){if(H(1g)=="L"||1g===O){1g=[]}u 70=[2q];u I=B.S;u cB=I.9c;u iA=I.4U;1M(70.K){2q=70.hP();if(H(2q)=="1n"){1g.1c(2q)}N{if(2q.3T==1){1g.1c("<"+2q.cD.8G());u 71=[];u cF=iA(2q);R(u i=0;i");70.1c("");u cC=2q.5h;R(i=cC.K-1;i>=0;i--){70.1c(cC[i])}}N{1g.1c("/>")}}N{if(2q.3T==3){1g.1c(cB(2q.iv))}}}}F 1g},97:G(ix,cA){u m=B.J;u iy=m.1R(O,M,1);B.15.9a(m.47(O,m.2r(B.S.1E,iy)),G(cA){cA.1T.3u=ix})},iw:G(1j,iu){u W=[];(G(1j){u cn=1j.5h;if(cn){R(u i=0;i0){u it=m.47;2T=G(1j){F it(2T.ir,1j.6Y)};2T.cx={};B.15.9a(6Z.6Y,G(a){2T.cx[a.1b]=a.3m});2T.ir=G(a){F(2T.cx[a.1b]!=a.3m)};2T.6X=1m;2T.99={"iq":"3M","ip":"ud","uc":"ub","R":"u9"}}N{2T=G(1j){F 1j.6Y};2T.6X=1h;2T.99={}}D.4U=2T;u 1C=D.cw;D.io=1C("ul");D.il=1C("ol");D.ik=1C("li");D.ij=1C("td");D.cm=1C("tr");D.ii=1C("u8");D.ih=1C("u7");D.ig=1C("u6");D.ie=1C("u5");D.ic=1C("th");D.cv=1C("ck");D.8d=1C("cj");D.A=1C("a");D.6m=1C("4u");D.ib=1C("u4");D.ia=1C("2e");D.i9=1C("tt");D.i8=1C("4O");D.i7=1C("h1");D.i6=1C("h2");D.i5=1C("h3");D.i4=1C("br");D.i3=1C("hr");D.i2=1C("u3");D.i1=1C("u2");D.cu=1C("u1");D.P=1C("p");D.ct=1C("u0");D.i0=1C("hJ");D.hZ=1C("tZ");D.hY=1C("tY");D.hX=1C("tX");D.hW=1C("tW");D.hV=1C("tV");D.hU=m.2z(D.97,"98");D.hT=m.2z(D.97,"8c");D.hS=D.cs;D.$=D.1E;D.2k={":3e":D.1z,":1p":m.2o(D.1z,D.1W)};m.3f(D)}});B.S.2d(((H(2O)=="L")?D:2O));if(!B.3d){95=B.S.95;94=B.S.94}B.J.2Y(D,B.S);if(H(1q)!="L"){1q.2X("B.1I");1q.2M("B.1H");1q.2M("B.J")}if(H(1x)!="L"){1x.26("B.1H",[]);1x.26("B.J",[])}1f{if(H(B.J)=="L"||H(B.1H)=="L"){14""}}1e(e){14"B.1I 3F on B.J 3W B.1H!"}if(H(B.1I)=="L"){B.1I={}}B.1I.1r="B.1I";B.1I.1Y="1.3.1";B.1I.1K=G(){F"["+D.1r+" "+D.1Y+"]"};B.1I.1l=G(){F D.1K()};B.1I.bY=G(6W){u m=B.1I;6W=!(!6W);if(m.3l&&m.3l.8Q!=6W){m.3l.hA();m.3l=O}if(!m.3l||m.3l.8P){m.3l=Y m.1I(6W,B.1H.2L)}F m.3l};B.1I.1I=G(4R,6V){if(H(6V)=="L"||6V===O){6V=B.1H.2L}D.2L=6V;u tU=B.J.2l;u c3=B.J.8Z;u 1O=B.J.1O;u hM=B.J.4L;u 2m=2O;u 6U="tT";if(H(B.S)!="L"){2m=B.S.cr()}if(!4R){u 5F=2m.tS.tR.2R("?")[0].23(/[:\\/.><&]/g,"hR");u 1b=6U+"hR"+5F;u 5D=2m.cp("",1b,"tQ,tP,3V=hQ");if(!5D){cq("tO tN to cp tM 2O tL to hP-up tK.");F L}5D.2v.fl(""+"<5E><8Y>[B.1I]"+"<5s>");5D.2v.hG();5D.2v.8Y+=" "+2m.2v.8Y;2m=5D}u 1N=2m.2v;D.1N=1N;u 21=1N.hN(6U);u c4=!!21;if(21&&H(21.5B)!="L"){21.5B.2L=D.2L;21.5B.6K();F 21.5B}if(c4){u cl;1M((cl=21.6n)){21.6S(cl)}}N{21=1N.2S("4u");21.id=6U}21.5B=D;u 8T=1N.2S("ck");u 8S=1N.2S("ck");u 6O=1N.2S("2e");u 6N=1N.2S("2e");u 6M=1N.2S("2e");u 6L=1N.2S("2e");u 3L=1N.2S("4u");u 42=1N.2S("4u");u 8U=6U+"tz";D.8N=hM(D.8N);u 4T=[];u 6R=O;u cf=G(1t){u 6T=1t.3N;if(H(6T)=="2y"){6T=B.1H.5C[6T]}F 6T};u cd=G(1t){F 1t.3z.2b(" ")};u ca=1O(G(1t){u 8W=cf(1t);u 7X=cd(1t);u c=D.8N[8W];u p=1N.2S("cj");p.3M="B-49 B-5C-"+8W;p.1T.3x="ty: 2N; 4F-8X: -hL-4O-3y; 4F-8X: -o-4O-3y; 4F-8X: 4O-3y; 4F-8X: 4O-tx; hK-3y: 2K-hK; 3y-hJ: tw; 3U: "+c;p.2c(1N.4S(8W+": "+7X));42.2c(p);42.2c(1N.2S("br"));if(3L.ci>3L.hI){3L.4C=0}N{3L.4C=3L.hI}},D);u hD=G(1t){4T[4T.K]=1t;ca(1t)};u hF=G(){u cg,ce;1f{cg=Y 8V(8T.3m);ce=Y 8V(8S.3m)}1e(e){ch("2x in 47 tv: "+e.43);F O}F G(1t){F(cg.hH(cf(1t))&&ce.hH(cd(1t)))}};u cc=G(){1M(42.6n){42.6S(42.6n)}};u hB=G(){4T=[];cc()};u bZ=1O(G(){if(D.8P){F}D.8P=1h;if(B.1I.3l==D){B.1I.3l=O}D.2L.c9(8U);21.5B=O;if(4R){21.3t.6S(21)}N{D.2m.hG()}},D);u c7=G(){cc();R(u i=0;i<4T.K;i++){u 1t=4T[i];if(6R===O||6R(1t)){ca(1t)}}};D.6K=G(){6R=hF();c7();D.2L.c9(8U);D.2L.hE(8U,6R,hD)};u c0=1O(G(){4T=D.2L.c8();c7()},D);u c2=1O(G(6Q){6Q=6Q||2O.6D;2h=6Q.6w||6Q.8t;if(2h==13){D.6K()}},D);u 31="3u: 8c; z-c6: c5; 2I: 2N; 6f: 2N; 6P: tu; 5A: 3k%; he-3U: 4F; c1: "+D.8O;if(4R){31+="; 3V: ts; 3E-3D: fO 8a 8y"}N{31+="; 3V: 3k%;"}21.1T.3x=31;if(!c4){1N.5s.2c(21)}31={"3x":"5A: 33%; 3u: 8Q; c1: "+D.8O};c3(8T,{"3m":"8L|8M|8K|8J|8I","hC":c2,"1T":31});21.2c(8T);c3(8S,{"3m":".*","hC":c2,"1T":31});21.2c(8S);31="5A: 8%; 3u:8Q; c1: "+D.8O;6O.2c(1N.4S("tq"));6O.8R=1O("6K",D);6O.1T.3x=31;21.2c(6O);6N.2c(1N.4S("tp"));6N.8R=c0;6N.1T.3x=31;21.2c(6N);6M.2c(1N.4S("tn"));6M.8R=hB;6M.1T.3x=31;21.2c(6M);6L.2c(1N.4S("tm"));6L.8R=bZ;6L.1T.3x=31;21.2c(6L);3L.1T.3x="fS: tk; 5A: 3k%";42.1T.3x="5A: 3k%; 3V: "+(4R?"tj":"3k%");3L.2c(42);21.2c(3L);D.6K();c0();if(4R){D.2m=L}N{D.2m=2m}D.8Q=4R;D.hA=bZ;D.8P=1m;F D};B.1I.1I.1U={"8O":"ti tg,tf-te","8N":{"8M":"1v","8L":"gU","8K":"1F","8J":"8y","8I":"bx"}};B.1I.1W=["1I"];B.1I.1z=["bY"];B.1I.2d=G(){D.2k={":3e":D.1z,":1p":B.J.2o(D.1z,D.1W)};B.J.3f(D);B.1I.3l=O};B.1I.2d();B.J.2Y(D,B.1I);if(H(1q)!="L"){1q.2X("B.V");1q.2M("B.J")}if(H(1x)!="L"){1x.26("B.J",[])}1f{if(H(B.J)=="L"){14""}}1e(e){14"B.V 3F on B.J"}if(H(B.V)=="L"){B.V={}}B.V.1r="B.V";B.V.1Y="1.3.1";B.V.1K=G(){F"["+D.1r+" "+D.1Y+"]"};B.V.1l=G(){F D.1K()};B.V.V=G(1v,hz,1F,6J){if(H(6J)=="L"||6J===O){6J=1}D.1B={r:1v,g:hz,b:1F,a:6J}};B.V.V.1U={bX:B.V.V,tc:G(hy){u 1B=D.1B;u m=B.V;F m.V.3Y(1B.r,1B.g,1B.b,hy)},tb:G(1o){u 1G=D.41();1G.h=1o;u m=B.V;F m.V.4H(1G)},ta:G(hx){u 1G=D.41();1G.s=hx;u m=B.V;F m.V.4H(1G)},t9:G(hw){u 1G=D.41();1G.l=hw;u m=B.V;F m.V.4H(1G)},t8:G(hv){u 1G=D.41();1G.l=28.29(1G.l-hv,0);u m=B.V;F m.V.4H(1G)},t7:G(hu){u 1G=D.41();1G.l=28.2a(1G.l+hu,1);u m=B.V;F m.V.4H(1G)},fJ:G(ht,5z){if(H(5z)=="L"||5z===O){5z=0.5}u sf=1-5z;u s=D.1B;u d=ht.1B;u df=5z;F B.V.V.3Y((s.r*sf)+(d.r*df),(s.g*sf)+(d.g*df),(s.b*sf)+(d.b*df),(s.a*sf)+(d.a*df))},h4:G(hs){u a=D.6r();u b=hs.6r();F B.J.2f([a.r,a.g,a.b,a.a],[b.r,b.g,b.b,b.a])},hq:G(){F D.41().b>0.5},t6:G(){F(!D.hq())},t5:G(){u c=D.41();u 2Z=B.V.6F;u W=D.ho;if(!W){u 5y=(2Z(c.h,bF).6I(0)+","+2Z(c.s,3k).hp(4)+"%"+","+2Z(c.l,3k).hp(4)+"%");u a=c.a;if(a>=1){a=1;W="1G("+5y+")"}N{if(a<=0){a=0}W="t4("+5y+","+a+")"}D.ho=W}F W},hl:G(){u c=D.1B;u 2Z=B.V.6F;u W=D.hn;if(!W){u 5y=(2Z(c.r,3h).6I(0)+","+2Z(c.g,3h).6I(0)+","+2Z(c.b,3h).6I(0));if(c.a!=1){W="t3("+5y+","+c.a+")"}N{W="1B("+5y+")"}D.hn=W}F W},6r:G(){F B.J.4L(D.1B)},t2:G(){u m=B.V;u c=D.1B;u 2Z=B.V.6F;u W=D.hm;if(!W){W=("#"+m.6E(2Z(c.r,3h))+m.6E(2Z(c.g,3h))+m.6E(2Z(c.b,3h)));D.hm=W}F W},t1:G(){u 2Q=D.2Q;u c=D.1B;if(H(2Q)=="L"||2Q===O){2Q=B.V.bA(D.1B);D.2Q=2Q}F B.J.4L(2Q)},41:G(){u 1G=D.1G;u c=D.1B;if(H(1G)=="L"||1G===O){1G=B.V.bC(D.1B);D.1G=1G}F B.J.4L(1G)},1l:G(){F D.hl()},U:G(){u c=D.1B;u hk=[c.r,c.g,c.b,c.a];F D.bX.1r+"("+hk.2b(", ")+")"}};B.J.2l(B.V.V,{3Y:G(1v,bW,1F,8H){u hj=B.V.V;if(M.K==1){u 1B=1v;1v=1B.r;bW=1B.g;1F=1B.b;if(H(1B.a)=="L"){8H=L}N{8H=1B.a}}F Y hj(1v,bW,1F,8H)},4H:G(1o,t0,sZ,sY){u m=B.V;F m.V.3Y(m.bB.1w(m,M))},sX:G(1o,sW,sV,sU){u m=B.V;F m.V.3Y(m.bz.1w(m,M))},hi:G(1b){u 8F=B.V.V;if(1b.3Z(0)=="\\""){1b=1b.3H(1,1b.K-2)}u bV=8F.by[1b.8G()];if(H(bV)=="1n"){F 8F.bT(bV)}N{if(1b=="aP"){F 8F.sT()}}F O},8f:G(4Q){u I=B.V.V;u bU=4Q.3H(0,3);if(bU=="1B"){F I.h9(4Q)}N{if(bU=="1G"){F I.h8(4Q)}N{if(4Q.3Z(0)=="#"){F I.bT(4Q)}}}F I.hi(4Q)},bT:G(4P){if(4P.3Z(0)=="#"){4P=4P.2W(1)}u 8E=[];u i,5x;if(4P.K==3){R(i=0;i<3;i++){5x=4P.3H(i,1);8E.1c(3w(5x+5x,16)/3h)}}N{R(i=0;i<6;i+=2){5x=4P.3H(i,2);8E.1c(3w(5x,16)/3h)}}u bS=B.V.V;F bS.3Y.1w(bS,8E)},bG:G(4O,hf,hg,4N){if(4N.2A(4O)===0){4N=4N.2W(4N.2A("(",3)+1,4N.K-1)}u bR=4N.2R(/\\s*,\\s*/);u bP=[];R(u i=0;i0){F 8D}}F O},ba:G(Q){u 2F=B.V.V;F 2F.bN(Q,"aZ","he-3U")||2F.sN()},sM:G(Q){u 2F=B.V.V;F 2F.bN(Q,"3U","3U")||2F.sL()},sK:G(){F B.J.4L(B.V.V.by)}});B.J.2l(B.V,{6F:G(v,8C){v*=8C;if(v<0){F 0}N{if(v>8C){F 8C}N{F v}}},hc:G(n1,n2,1o){if(1o>6){1o-=6}N{if(1o<0){1o+=6}}u 2i;if(1o<1){2i=n1+(n2-n1)*1o}N{if(1o<3){2i=n2}N{if(1o<4){2i=n1+(n2-n1)*(4-1o)}N{2i=n1}}}F 2i},bz:G(1o,5w,3i,bM){if(M.K==1){u 2Q=1o;1o=2Q.h;5w=2Q.s;3i=2Q.v;bM=2Q.a}u 1v;u 3K;u 1F;if(5w===0){1v=0;3K=0;1F=0}N{u i=28.8B(1o*6);u f=(1o*6)-i;u p=3i*(1-5w);u q=3i*(1-(5w*f));u t=3i*(1-(5w*(1-f)));hd(i){3j 1:1v=q;3K=3i;1F=p;2K;3j 2:1v=p;3K=3i;1F=t;2K;3j 3:1v=p;3K=q;1F=3i;2K;3j 4:1v=t;3K=p;1F=3i;2K;3j 5:1v=3i;3K=p;1F=q;2K;3j 6:3j 0:1v=3i;3K=t;1F=p;2K}}F{r:1v,g:3K,b:1F,a:bM}},bB:G(1o,5v,3v,bL){if(M.K==1){u 1G=1o;1o=1G.h;5v=1G.s;3v=1G.l;bL=1G.a}u 1v;u 8A;u 1F;if(5v===0){1v=3v;8A=3v;1F=3v}N{u m2;if(3v<=0.5){m2=3v*(1+5v)}N{m2=3v+5v-(3v*5v)}u m1=(2*3v)-m2;u f=B.V.hc;u h6=1o*6;1v=f(m1,m2,h6+2);8A=f(m1,m2,h6);1F=f(m1,m2,h6-2)}F{r:1v,g:8A,b:1F,a:bL}},bA:G(1v,4K,1F,bK){if(M.K==1){u 1B=1v;1v=1B.r;4K=1B.g;1F=1B.b;bK=1B.a}u 29=28.29(28.29(1v,4K),1F);u 2a=28.2a(28.2a(1v,4K),1F);u 1o;u 8z;u hb=29;if(2a==29){1o=0;8z=0}N{u 6H=(29-2a);8z=6H/29;if(1v==29){1o=(4K-1F)/6H}N{if(4K==29){1o=2+((1F-1v)/6H)}N{1o=4+((1v-4K)/6H)}}1o/=6;if(1o<0){1o+=1}if(1o>1){1o-=1}}F{h:1o,s:8z,v:hb,a:bK}},bC:G(1v,4J,1F,bI){if(M.K==1){u 1B=1v;1v=1B.r;4J=1B.g;1F=1B.b;bI=1B.a}u 29=28.29(1v,28.29(4J,1F));u 2a=28.2a(1v,28.2a(4J,1F));u 1o;u 6G;u bJ=(29+2a)/2;u 4I=29-2a;if(4I===0){1o=0;6G=0}N{if(bJ<=0.5){6G=4I/(29+2a)}N{6G=4I/(2-29-2a)}if(1v==29){1o=(4J-1F)/4I}N{if(4J==29){1o=2+((1F-1v)/4I)}N{1o=4+((1v-4J)/4I)}}1o/=6;if(1o<0){1o+=1}if(1o>1){1o-=1}}F{h:1o,s:6G,l:bJ,a:bI}},6E:G(1P){1P=28.ha(1P);u bH=1P.1l(16);if(1P<16){F"0"+bH}F bH},2d:G(){u m=B.J;D.V.h9=m.1O(D.V.bG,D.V,"1B","3Y",[1/3h,1/3h,1/3h,1]);D.V.h8=m.1O(D.V.bG,D.V,"1G","4H",[1/bF,0.bE,0.bE,1]);u 4G=1/3;u bD={8y:[0,0,0],1F:[0,0,1],gY:[0.6,0.4,0.2],gX:[0,1,1],sJ:[4G,4G,4G],gR:[0.5,0.5,0.5],bx:[0,1,0],sI:[2*4G,2*4G,2*4G],gN:[1,0,1],gL:[1,0.5,0],gK:[0.5,0,0.5],1v:[1,0,0],aP:[0,0,0,0],4F:[1,1,1],gI:[1,1,0]};u h7=G(1b,r,g,b,a){u W=D.3Y(r,g,b,a);D[1b]=G(){F W};F W};R(u k in bD){u 1b=k+"V";u h5=m.2o([h7,D.V,1b],bD[k]);D.V[1b]=m.1O.1w(O,h5)}u h0=G(){R(u i=0;i1){u 1d=B.S.1E(M[0]);u 2D=M[1];u 1i=M[2];u 1A=M[3];R(u i=5o.K-1;i>=0;i--){u o=5o[i];if(o[0]===1d&&o[1]===2D&&o[4]===1i&&o[5]===1A){I.6t(o);5o.4y(i,1);F 1h}}}N{u 5n=m.bi(5o,bh);if(5n>=0){I.6t(bh);5o.4y(5n,1);F 1h}}F 1m},8i:G(1d,2D){1d=B.S.1E(1d);u m=B.J;u 8l=m.bg(m.1R(O,M,1));u I=B.1u;u bd=I.6t;u 4z=I.4x;if(8l.K===0){R(u i=4z.K-1;i>=0;i--){u 4A=4z[i];if(4A[0]===1d){bd(4A);4z.4y(i,1)}}}N{u bf={};R(u i=0;i<8l.K;i++){bf[8l[i]]=1h}R(u i=4z.K-1;i>=0;i--){u 4A=4z[i];if(4A[0]===1d&&4A[1]in bf){bd(4A);4z.4y(i,1)}}}},8h:G(1d,2D){u bc=B.1u.4x;1d=B.S.1E(1d);u 3G=B.J.1R(O,M,2);u 5m=[];R(u i=0;i1){u e=Y 2x("mZ bb mY in mX \'2D\', mW bb mV");e.bb=5m;14 e}}}});B.1u.1W=[];B.1u.1z=["6s","8j","8h","8i"];B.1u.2d=G(2m){u m=B.J;D.1Z=2v;D.3X=2m;1f{D.6s(2O,"g8",D.g7)}1e(e){}D.2k={":3e":D.1z,":1p":m.2o(D.1z,D.1W)};m.3f(D)};B.1u.2d(D);if(!B.3d){6s=B.1u.6s;8j=B.1u.8j;8i=B.1u.8i;8h=B.1u.8h}B.J.2Y(D,B.1u);if(H(1q)!="L"){1q.2X("B.1X");1q.2M("B.J");1q.2M("B.S");1q.2M("B.V")}if(H(1x)!="L"){1x.26("B.J",[]);1x.26("B.S",[]);1x.26("B.V",[])}1f{if(H(B.J)=="L"||H(B.S)=="L"||H(B.V)=="L"){14""}}1e(e){14"B.1X 3F on B.J, B.S 3W B.V!"}if(H(B.1X)=="L"){B.1X={}}B.1X.1r="B.1X";B.1X.1Y="1.3.1";B.1X.1K=G(){F"["+D.1r+" "+D.1Y+"]"};B.1X.1l=G(){F D.1K()};B.1X.aI=G(e,g6){e=B.S.1E(e);D.fN(g6);if(D.1S.fL){e=D.g5(e)}u 4w=D.1S.3U;u C=B.V.V;if(D.1S.3U=="aW"){4w=C.ba(e)}N{if(!(4w 2C C)){4w=C.8f(4w)}}D.82=(4w.6r().a<=0);u 5l=D.1S.aV;if(D.1S.aV=="fM"){5l=C.ba(e.8g)}N{if(!(5l 2C C)){5l=C.8f(5l)}}D.g3(e,4w,5l)};B.1X.aI.1U={g5:G(e){u mU=e.3t;u 1N=B.S.b9();if(H(1N.5k)=="L"||1N.5k===O){F e}u 4v=1N.5k.g4(e,O);if(H(4v)=="L"||4v===O){F e}u b8=B.S.6m({"1T":{3u:"8c",mT:4v.6q("6p-3D"),85:4v.6q("6p-3g"),mS:4v.6q("6p-6f"),86:4v.6q("6p-2I"),6p:"2N"}});b8.6o=e.6o;e.6o="";e.2c(b8);F e},g3:G(e,b7,8e){if(D.1S.3E){D.g2(e,8e)}if(D.fy()){D.fX(e,b7,8e)}if(D.fx()){D.fV(e,b7,8e)}},g2:G(el,g1){u b6="6l 8a "+D.aQ(g1);u g0="3E-2I: "+b6;u fZ="3E-3g: "+b6;u fY="1T=\'"+g0+";"+fZ+"\'";el.6o="<4u "+fY+">"+el.6o+""},fX:G(el,fW,b5){u b4=D.b1(b5);R(u i=0;i=0;i--){b2.2c(D.b0(fU,b3,i,"6f"))}el.1T.mP=0;el.2c(b2)},b1:G(fT){u 2q=B.S;F 2q.6m({1T:{aZ:fT.1l()}})},b0:G(aY,fQ,n,aX){u 6k=B.S.8d();u 2p=6k.1T;2p.aZ=aY.1l();2p.3u="8c";2p.3V="6l";2p.fS="fR";2p.mO="6l";u 8b=D.aQ(aY,fQ);if(D.1S.3E&&n===0){2p.mN="8a";2p.mM="6l";2p.84="2N";2p.83="2N";2p.mL="2N";2p.3V="2N";2p.fP=8b.1l()}N{if(8b){2p.fP=8b.1l();2p.mK="8a";2p.mJ="2N 6l"}}if(!D.1S.4r&&(n==(D.1S.89-1))){2p.3V="fO"}D.fI(6k,n,aX);D.fG(6k,n,aX);F 6k},fN:G(fK){D.1S={6g:"1p",3U:"aW",aV:"fM",5j:1h,3E:1m,4r:1m,fL:1m};B.J.2l(D.1S,fK);D.1S.89=(D.1S.4r?2:4)},aL:G(){u 88=D.1S.6g;if(D.6h(88,"1p","3D")){F""}u aU=(88.2A("tl")!=-1);u aT=(88.2A("tr")!=-1);if(aU&&aT){F""}if(aU){F"2I"}if(aT){F"3g"}F""},aK:G(){u 87=D.1S.6g;if(D.6h(87,"1p","6f")){F""}u aS=(87.2A("bl")!=-1);u aR=(87.2A("br")!=-1);if(aS&&aR){F""}if(aS){F"2I"}if(aR){F"3g"}F""},aQ:G(aN,aO){if(aN=="aP"){F aO}N{if(D.1S.3E){F D.1S.3E}N{if(D.1S.5j){F aO.fJ(aN)}}}F""},fI:G(el,n,fH){u 6j=D.fE(n)+"px";u aM=(fH=="3D"?D.aL():D.aK());u 4t=el.1T;if(aM=="2I"){4t.86=6j;4t.85="2N"}N{if(aM=="3g"){4t.85=6j;4t.86="2N"}N{4t.86=6j;4t.85=6j}}},fG:G(el,n,fF){u 6i=D.fz(n)+"px";u aJ=(fF=="3D"?D.aL():D.aK());u 4s=el.1T;if(aJ=="2I"){4s.84=6i;4s.83="2N"}N{if(aJ=="3g"){4s.83=6i;4s.84="2N"}N{4s.84=6i;4s.83=6i}}},fE:G(n){if(D.82){F 0}u o=D.1S;if(o.4r&&o.5j){u fD=[1,0];F fD[n]}N{if(o.4r){u fC=[2,1];F fC[n]}N{if(o.5j){u fB=[3,2,1,0];F fB[n]}N{u fA=[5,3,2,1];F fA[n]}}}},fz:G(n){u o=D.1S;u 5i;if(o.4r&&(o.5j||D.82)){F 1}N{if(o.4r){5i=[1,0]}N{if(o.5j){5i=[2,1,1,1]}N{if(o.3E){5i=[0,2,0,0]}N{if(D.82){5i=[5,3,2,1]}N{F 0}}}}}F 5i[n]},6h:G(1y){R(u i=1;i")}}})()}',62,1976,'||||||||||||||||||||||||||||||var|||||||MochiKit||this||return|function|typeof|self|Base|length|undefined|arguments|else|null||elem|for|DOM||repr|Color|rval|res|new||||||throw|Iter|||||next|name|push|src|catch|try|lst|true|obj|node|Async|toString|false|string|hue|all|dojo|NAME|Format|msg|Signal|red|apply|JSAN|str|EXPORT|func|rgb|_425|DateTime|getElement|blue|hsl|Logging|LoggingPane|type|__repr__|_event|while|doc|bind|num|iter|extend|options|style|prototype|seq|EXPORT_OK|Visual|VERSION|_document||_434||replace|forwardCall|StopIteration|use||Math|max|min|join|appendChild|__new__|button|compare|date|key|val|_329|EXPORT_TAGS|update|win|pair|concat|_596|dom|map|req|Deferred|sync|document|base|Error|number|partial|indexOf||instanceof|sig|not|cls|list|fired|left|stop|break|logger|require|0px|window|shift|hsv|split|createElement|_423|callee|continue|substring|provide|_exportSymbols|ccc||_464|||||||||step|pred|_51|__compat__|common|nameFunctions|right|255|_517|case|100|_loggingPane|value|object|callback|TypeError|_251|_246|_113|parentNode|display|_522|parseInt|cssText|wrap|info|isArrayLike|end|match|top|border|depends|args|substr|mouse|code|_519|_443|className|level|err|frac|Date|_135|_85|nodeType|color|height|and|_window|fromRGB|charAt||asHSL|_444|message||||filter||LogMessage|AdapterRegistry|_366|imap|NotFound|locked|counter|_262|_messages|operator|cmp|_165|_161|pairs|arr|_52|setAttribute|computedStyle|compact|_614|_610|div|_576|_572|_observers|splice|_565|_566|_555|scrollTop|page|modifier|white|_541|fromHSL|_539|_535|_528|clone|parseFloat|_505|pre|_499|_497|_427|createTextNode|_446|attributeArray|_388|_379|updateNodeAttributes|_341|_326||box|errback|results|paused|chain|_285||ofs||NamedError|_175|_147|_122|_83|_54|_17|childNodes|_619|blend|defaultView|_574|_569|idx|_562|must|_554|_specialKeys|body|Coordinates|registerComparator|_521|_516|hex|mid|_478|width|loggingPane|LogLevel|nwin|head|url|setElementClass|callStack|path|dest|_359|boolean|register|Dimensions|DeferredLock|_313|addCallback|_310|waiting|onreadystatechange|_290|LOCALE|year|printfire|_214|log|_213|_211|pos|_155|_153||typeMatcher|listMinMax|_114|_40|itr|typ|_19|_634|_625|bottom|corners|_hasString|_612|_608|_595|1px|DIV|firstChild|innerHTML|padding|getPropertyValue|asRGB|connect|_disconnect|_559|middle|which|clientY|scrollLeft|clientX|client|charCode|relatedTarget|event|toColorPart|clampColorComponent|_537|_534|toFixed|_468|buildAndApplyFilter|_442|_441|_440|_439|position|_463|_447|removeChild|_449|uid|_428|_426|compliant|attributes|_422|_409|_412|_400|_395|_390|_389|_377|_375|_363|attr|ctx|repeat|_340|_339|isNotEmpty|_335|_333|opera|DeferredList|ret|_309|silentlyCancelled|canceller|_nextId|Array|_293|XMLHttpRequest|chained|_281|tail|_252|_225|msec|day|month|iso|Logger|_208|listeners|_200|_198|_194|_196|reduce|range|_169|_162|truth|registerRepr|_121|_70|_58|_56|_47|_45|_41|_13|_1|script|text|uri|documentElement|_630|_629|isTransparent|borderRightWidth|borderLeftWidth|marginRight|marginLeft|_602|_599|numSlices|solid|_597|block|SPAN|_579|fromString|offsetParent|signal|disconnectAll|disconnect|_570|_563|_557|preventDefault|stopPropagation|clientTop|clientLeft|pageY|pageX|keyCode|meta|ctrl|alt|target|black|_532|_524|floor|_513|_512|_500|_495|toLowerCase|_487|DEBUG|INFO|WARNING|FATAL|ERROR|colorTable|logFont|closed|inline|onclick|_438|_437|_445|RegExp|_452|space|title|updatetree|||||withDocument|withWindow||setDisplayForElement|none|renames|forEach|domConverters|escapeHTML|addElementClass|removeElementClass|once|_378|_380|_376|appendChildNodes|coerceToDOM|_355|opt|clientWidth|opacity|GenericError|fail|resultList|_307|_301|_fire|can|addCallbacks|_resback|percent|decimal|separator|twoDigitFloat|_274|_273|_264|_257|_250|_249|_254|_248|_243|_242|fmt|_240|_245|getTime|sec|hour|_209|slice|_206|iterateNextIter|registerIteratorFactory|arrayLikeIter|iteratorRegistry|takewhile|ifilterfalse|ifilter|_181|_176|_168|_166|_159|_tee|deque|arg|fun|jsonRegistry|reprString|reprRegistry|comparatorRegistry|urlEncode|_110|_108|cur|_95|_87|_71|im_preargs||_53|_57|_46|present|like|array|Argument|_15|_12|_632|_631|_633|SUBMODULES|only|_628|_627|_626|roundElement|_624|getElementsByTagAndClassName|_RoundCorners|_613|_whichSideBottom|_whichSideTop|_609|_605|_606|transparent|_borderColor|_604|_603|_601|_600|bgColor|fromElement|_594|_592|backgroundColor|_createCornerSlice|_createCorner|_590|_589|_587|_586|_581|_578|_577|currentDocument|fromBackground|errors|_568|_564||sigs|flattenArguments|_561|findIdentical|_560|_558||_556|attachEvent|addEventListener|funcOrStr|Event||_548|fromCharCode|String|_specialMacKeys|any|green|_namedColors|hsvToRGB|rgbToHSV|hslToRGB|rgbToHSL|_542|01|360|_fromColorString|_540|_536|_538|_529|_523|_518|fromComputedStyle|_511|_507|_508|_506|_501|fromHexString|_498|_496|_486|__class__|createLoggingPane|_459|_461|font|_462|_430|_435|1000|index|_460|getMessages|removeListener|_451||_457|_450|infore|_448|_456|logDebug|offsetHeight|span|input|_436|TR||HTML|open|alert|currentWindow|swapDOM|SELECT|FORM|INPUT|createDOMFunc|ignoreAttr|_421|call|_417|_410|_415|nodeName|_414|_413|emitHTML|good|_406|_399|_397|_393|_392|addLoadEvent|addToCallStack|_387|_386|_381|_382|_383|_373|_372|_369|createDOM|_365|Function|_360|_362|_358|_344|nodeWalk|formContents|_337|_338|_334|_332|offsetTop|offsetLeft|visibility|parentElement|||XMLHttpRequestError|BrowserComplianceError|CancelledError|AlreadyCalledError|evalJSONRequest|sendXMLHttpRequest|wait|doSimpleXMLHttpRequest|getXMLHttpRequest|succeed|_312|finishedCount|_308|_cbDeferred|_303|_297|queryString|_nothing|_289|XMLHTTP|ActiveXObject|eval|_284|_check|error|_279|default|rstrip|lstrip|formatLocale|roundToFixed|truncToFixed|_276|pow|_272|_271|_270|sign|_265|_263|tmp|_238|_232|toISODate|toISOTime|getFullYear|getDate|getMonth|_230|_padTwo|_228|useNativeConsole|_212|compareLogMessage|isLogMessage|unshift|_207||maxSize|_202|_199|logLevelAtLeast|console|hasIterateNext|iterateNext|arrayLike|groupby||exhaust|tee|dropwhile|applymap||islice|izip|cycle|count||_189|_188|_183|_185|_184|_186|_187|_182|identity|fetch|_180|_177|listMin|reprNumber|reprArrayLike|compareArrayLike|compareDateLike|isDateLike|findValue|_128|__export__|keyComparator|_124|_118|_93|_94|_90|_88|_84|_77|_68|_67|_66|_65|_60|im_func|_55|im_self|_48|_44|_42|_39|_36|_33|_27|_26|_25|_22|_24|_20|javascript|write|getAttribute||org|www|http|getElementsByTagName|roundClass|_623|_622|_621|_620|_isBottomRounded|_isTopRounded|_borderSize|_618|_617|_616|_615|_marginSize|_611|_setBorder|_607|_setMargin|blendedColor|_598|__unstable__wrapElement|fromParent|_setOptions|2px|borderColor|_593|hidden|overflow|_591|_588|_roundBottomCorners|_585|_roundTopCorners|_584|_583|_582|_580|_renderBorder|_roundCornersImpl|getComputedStyle|_doWrap|_571|_unloadCache|onunload|detachEvent|removeEventListener|_listener|objOrFunc|_552||_551|_549|onload|delete|112|KEY_F|KEY_|MINUS|KEY_SEMICOLON|KEY_DELETE|KEY_INSERT|KEY_ARROW_DOWN|KEY_ARROW_RIGHT|KEY_ARROW_UP||KEY_ARROW_LEFT|KEY_HOME|KEY_END|KEY_PAGE_DOWN|KEY_PAGE_UP|KEY_ENTER|KEY_NUM_PAD_CLEAR|63236|mousemove|contextmenu|click|mouseout|mouseover|_src|yellow|708090|purple|orange|ff00ff|magenta|778899|d3d3d3|808080|gray|696969|2f4f4f|darkred|a9a9a9|00ffff|cyan|brown|_547|_546||||compareRGB|_545||_543|fromHSLString|fromRGBString|round|_533|_hslValue|switch|background|_503|_504||fromName|_488|col|toRGBString|_hexString|_rgbString|_hslString|toPrecision|isLight||_481|_477|_476|_475|_474|_473|_469|_466|closePane|_458|onkeypress|_454|addListener|_455|close|test|scrollHeight|option|word|moz|_431|getElementById|html|pop|200|_|removeElement|showElement|hideElement|CANVAS|STRONG|FIELDSET|LEGEND|OPTGROUP|OPTION|TEXTAREA|LABEL|HR|BR|H3|H2|H1|PRE|TT|BUTTON|IMG|TH||TABLE||TFOOT|THEAD|TBODY|TD|LI|OL|||UL|checked|class|ignoreAttrFilter||_424|_419|nodeValue|scrapeText|_416|_418|sort|_411|toHTML|_404|hasElementClass|_403|_402|_401|swapElementClass|_398|_394|toggleElementClass|_391|focusOnLoad|_newCallStack|currentStyle|_371|replaceChildNodes|_364|_361|getNodeAttribute|_357|setNodeAttribute|_354|_352|_350|_353|toDOM|_346|_345|registerDOMConverter|selectedIndex|setElementPosition|setElementDimensions|tagName|absolute|getBoxObjectFor|getBoundingClientRect|elementPosition|_325|_324|_322|_323|offsetWidth|elementDimensions|clientHeight|innerWidth|getViewportDimensions|setOpacity|status|_317|deferred|_316|_newNamedError|maybeDeferred||gatherResults|callLater|loadJSONDoc|_311|consumeErrors|fireOnOneErrback|fireOnOneCallback|addErrback|_305|_304|_306|unlocked|release|_300|_299|_298|_296|_xhr_onreadystatechange|_xhr_canceller|304|responseText|Msxml2|addBoth|_pause|_continue|result|the|are|they|instances|_unpause|cancel|_280|_278|en_US|strip|percentFormat|twoDigitAverage|numberFormatter|_277|_275|isNaN|_259|_258|_260|_255|_253|_numberFormatter|_241|_239|_237|_236|_235|_234|_233|_231|toAmericanDate|toPaddedAmericanDate|americanDate|toISOTimestamp|isoTimestamp|isoDate|foot|sep||60000|_221|_isoRegexp|dispatchEvent|createEvent|warning|logWarning|fatal|logFatal|debug|logError|baseLog|_210|getMessageText|logToConsole|dispatchListeners|_204|_203|ident|_201|postError|alertListener|_197|_192|groupby_as_array|iextend|some|reversed|sorted|every|sum|_190|eat|_174|_173|_172|_171|_167|_163|_158|_157|_151|_144|_141||_139|_136|_134||_133|_132|zip|merge|isUndefined|isCallable|listMax|_131|_130|encodeURIComponent||_127|method|parseQueryString|evalJSON|registerJSON|serializeJSON|objMin|objMax|reverseKeyComparator|arrayEqual|objEqual|bindMethods|xfilter|xmap|isEmpty|isNull|isUndefinedOrNull|itemgetter|items|keys|setdefault|_126|_120|decodeURIComponent|_119|len|_109|_107|_104|_105|_101|_102|_98|||_100|_97|_96|_91|json|__json__|_82|_81|_80|_79|_76||_75|_74|_73|_69|_primitives|_64|_63||_62|_61|_59|_wrapDumbFunction|_49|_50|_31|_30|_21|_7|application|MochiKit_|createElementNS|namespaceURI|lastIndexOf|xul|there|gatekeeper|keymaster|mozilla|getElementsComputedStyle|_hasSingleTextChild|borderWidth|borderStyle|borderBottomWidth|borderTopWidth|borderTopStyle|fontSize|paddingBottom|insertBefore|paddingTop|marginBottom|marginTop|_575|property|see|handling|thrown|Multiple|element|||given|123|KEY_NUM_PAD_|105|KEY_APOSTROPHE|222|KEY_RIGHT_SQUARE_BRACKET|221|KEY_REVERSE_SOLIDUS|220|KEY_LEFT_SQUARE_BRACKET||219|KEY_GRAVE_ACCENT|192|KEY_SOLIDUS|191|KEY_FULL_STOP|190|KEY_HYPHEN|189||KEY_COMMA|188|KEY_EQUALS_SIGN|187|186|KEY_SCROLL_LOCK|145|KEY_NUM_LOCK|144|KEY_NUM_PAD_SOLIDUS|111|KEY_NUM_PAD_FULL_STOP|110|KEY_NUM_PAD_HYPHEN|109|KEY_NUM_PAD_PLUS_SIGN|107|KEY_NUM_PAD_ASTERISK|106|KEY_SELECT|KEY_WINDOWS_RIGHT|KEY_WINDOWS_LEFT|KEY_PRINT_SCREEN|KEY_SPACEBAR|KEY_ESCAPE|KEY_CAPS_LOCK|KEY_PAUSE|KEY_ALT|KEY_CTRL|KEY_SHIFT|KEY_TAB|KEY_BACKSPACE|63242|63272|63302|63233|63235|63232|63234|63273|63275|63277|63276|63289|returnValue|cancelBubble|keypress|KEY_UNKNOWN|keyup|keydown|shiftKey|metaKey||ctrlKey|altKey|toElement|srcElement|9acd32||yellowgreen||ffff00|f5f5f5|whitesmoke||ffffff|f5deb3|wheat|ee82ee|violet|40e0d0|turquoise|ff6347|tomato|d8bfd8|thistle|008080|teal|d2b48c|tan|4682b4|steelblue|00ff7f|springgreen|fffafa|snow|slategrey|slategray|6a5acd|slateblue|87ceeb|skyblue|c0c0c0|silver|a0522d|sienna|fff5ee|seashell|2e8b57|seagreen|f4a460|sandybrown|fa8072|salmon|8b4513|saddlebrown|4169e1|royalblue|bc8f8f|rosybrown|ff0000|800080|b0e0e6|powderblue|dda0dd|plum|ffc0cb|pink|cd853f||peru|ffdab9|peachpuff|ffefd5|papayawhip|db7093|palevioletred|afeeee|paleturquoise|98fb98|palegreen|eee8aa||palegoldenrod|da70d6|orchid|ff4500|orangered|ffa500|6b8e23|olivedrab|808000|olive|fdf5e6|oldlace|000080|navy|ffdead|navajowhite|ffe4b5|moccasin|ffe4e1|mistyrose|f5fffa|mintcream|191970|midnightblue|c71585|mediumvioletred|48d1cc|mediumturquoise|00fa9a|mediumspringgreen|7b68ee|mediumslateblue|3cb371|mediumseagreen|9370db|mediumpurple|ba55d3|mediumorchid|0000cd|mediumblue|66cdaa|mediumaquamarine|800000|maroon|faf0e6|linen|32cd32|limegreen|00ff00|lime|ffffe0|lightyellow|b0c4de|lightsteelblue|lightslategrey|lightslategray||87cefa|lightskyblue|20b2aa|lightseagreen|ffa07a|lightsalmon|ffb6c1|lightpink|lightgrey|90ee90|lightgreen|lightgray|fafad2|lightgoldenrodyellow|e0ffff|lightcyan|f08080|lightcoral|add8e6|lightblue|fffacd|lemonchiffon|7cfc00|lawngreen|fff0f5|lavenderblush|e6e6fa|lavender|f0e68c|khaki|fffff0|ivory|4b0082|indigo|cd5c5c|indianred|ff69b4|hotpink|f0fff0|honeydew|grey|adff2f|greenyellow|008000|daa520|goldenrod|ffd700||gold|f8f8ff|ghostwhite|dcdcdc|gainsboro|fuchsia|228b22|forestgreen|fffaf0|floralwhite|b22222|firebrick|1e90ff|dodgerblue|dimgrey|dimgray|00bfff|deepskyblue|ff1493|deeppink|9400d3|darkviolet|00ced1|darkturquoise|darkslategrey|darkslategray|483d8b|darkslateblue|8fbc8f|darkseagreen|e9967a|darksalmon|8b0000|9932cc|darkorchid|ff8c00|darkorange|556b2f|darkolivegreen|8b008b|darkmagenta|bdb76b|darkkhaki|darkgrey|006400|darkgreen|darkgray|b8860b|darkgoldenrod|008b8b|darkcyan|00008b|darkblue|dc143c|crimson|fff8dc|cornsilk|6495ed|cornflowerblue|ff7f50|coral|d2691e||chocolate|7fff00|chartreuse|5f9ea0|cadetblue|deb887|burlywood|a52a2a|8a2be2|blueviolet|0000ff|ffebcd||blanchedalmond|000000|ffe4c4|bisque|f5f5dc|beige|f0ffff|azure|7fffd4|aquamarine|aqua|faebd7|antiquewhite|f0f8ff|aliceblue|lightGray|darkGray|namedColors|blackColor|fromText|whiteColor|_510|_509|PI|rad|deg|transparentColor|_494|_493|_492|fromHSV|_491|_490|_489|asHSV|toHexString|rgba|hsla|toHSLString|isDark|lighterColorWithLevel|darkerColorWithLevel|colorWithLightness|colorWithSaturation|colorWithHue|colorWithAlpha||serif|sans|Verdana||8pt|8em|auto||Close|Clear||Load|Filter||10em||fixed|regex|emergency|line|margin|_Listener|dtd|loose|html4|w3|EN|Transitional|DTD|W3C|PUBLIC|DOCTYPE|blocking|due|debugging|able|Not|resizable|dependent|href|location|_MochiKit_LoggingPane|_429|canvas|strong|fieldset|legend|optgroup|select|form|textarea|label|img|table|tfoot|thead|tbody|htmlFor||useMap|usemap|defaultChecked|hasChildNodes|quot|amp|_405|focus|replaceChild|checkbox||radio|_win|BODY||safari|version|userAgent|navigator|innerHeight|alpha|khtml|Tried|acquire|clearTimeout|setTimeout|GET|ignore|send|abort|failed|Request|readyState|support|does|Browser|Microsoft|_288|_287|used|Deferreds|Chained|success|unfired|fr_FR|de_DE|00|abs|search|pattern|Invalid|getTimezoneOffset|getSeconds|getMinutes|getHours|UTC|3600000|initEvent|Events|debuggingBookmarklet|MESSAGES|LAST|_205|clear|ninfo|nlevel|timestamp|reverse|takes|initial|with|sequence|empty|iterable|numbers|dateLike|escape|find|forward|unregister|unescape|Object|compared|item|contains|logor|logand|cle|clt|cge|cgt|cne|ceq|zrshift|rshift|lshift|xor|mul|mod|sub|add|neg|lognot|_9|_2'.split('|'),0,{}) + + +/* + * jQuery 1.2.1 - New Wave Javascript + * + * Copyright (c) 2007 John Resig (jquery.com) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * $Date: 2007-09-16 23:42:06 -0400 (Sun, 16 Sep 2007) $ + * $Rev: 3353 $ + */ + +var decompressedJQuery = function(p,a,c,k,e,r){e=function(c){return(c35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('(G(){9(1m E!="W")H w=E;H E=18.15=G(a,b){I 6 7u E?6.5N(a,b):1u E(a,b)};9(1m $!="W")H D=$;18.$=E;H u=/^[^<]*(<(.|\\s)+>)[^>]*$|^#(\\w+)$/;E.1b=E.3A={5N:G(c,a){c=c||U;9(1m c=="1M"){H m=u.2S(c);9(m&&(m[1]||!a)){9(m[1])c=E.4D([m[1]],a);J{H b=U.3S(m[3]);9(b)9(b.22!=m[3])I E().1Y(c);J{6[0]=b;6.K=1;I 6}J c=[]}}J I 1u E(a).1Y(c)}J 9(E.1n(c))I 1u E(U)[E.1b.2d?"2d":"39"](c);I 6.6v(c.1c==1B&&c||(c.4c||c.K&&c!=18&&!c.1y&&c[0]!=W&&c[0].1y)&&E.2h(c)||[c])},4c:"1.2.1",7Y:G(){I 6.K},K:0,21:G(a){I a==W?E.2h(6):6[a]},2o:G(a){H b=E(a);b.4Y=6;I b},6v:G(a){6.K=0;1B.3A.1a.16(6,a);I 6},N:G(a,b){I E.N(6,a,b)},4I:G(a){H b=-1;6.N(G(i){9(6==a)b=i});I b},1x:G(f,d,e){H c=f;9(f.1c==3X)9(d==W)I 6.K&&E[e||"1x"](6[0],f)||W;J{c={};c[f]=d}I 6.N(G(a){L(H b 1i c)E.1x(e?6.R:6,b,E.1e(6,c[b],e,a,b))})},17:G(b,a){I 6.1x(b,a,"3C")},2g:G(e){9(1m e!="5i"&&e!=S)I 6.4n().3g(U.6F(e));H t="";E.N(e||6,G(){E.N(6.3j,G(){9(6.1y!=8)t+=6.1y!=1?6.6x:E.1b.2g([6])})});I t},5m:G(b){9(6[0])E(b,6[0].3H).6u().3d(6[0]).1X(G(){H a=6;1W(a.1w)a=a.1w;I a}).3g(6);I 6},8m:G(a){I 6.N(G(){E(6).6q().5m(a)})},8d:G(a){I 6.N(G(){E(6).5m(a)})},3g:G(){I 6.3z(1q,Q,1,G(a){6.58(a)})},6j:G(){I 6.3z(1q,Q,-1,G(a){6.3d(a,6.1w)})},6g:G(){I 6.3z(1q,P,1,G(a){6.12.3d(a,6)})},50:G(){I 6.3z(1q,P,-1,G(a){6.12.3d(a,6.2q)})},2D:G(){I 6.4Y||E([])},1Y:G(t){H b=E.1X(6,G(a){I E.1Y(t,a)});I 6.2o(/[^+>] [^+>]/.14(t)||t.1g("..")>-1?E.4V(b):b)},6u:G(e){H f=6.1X(G(){I 6.67?E(6.67)[0]:6.4R(Q)});H d=f.1Y("*").4O().N(G(){9(6[F]!=W)6[F]=S});9(e===Q)6.1Y("*").4O().N(G(i){H c=E.M(6,"2P");L(H a 1i c)L(H b 1i c[a])E.1j.1f(d[i],a,c[a][b],c[a][b].M)});I f},1E:G(t){I 6.2o(E.1n(t)&&E.2W(6,G(b,a){I t.16(b,[a])})||E.3m(t,6))},5V:G(t){I 6.2o(t.1c==3X&&E.3m(t,6,Q)||E.2W(6,G(a){I(t.1c==1B||t.4c)?E.2A(a,t)<0:a!=t}))},1f:G(t){I 6.2o(E.1R(6.21(),t.1c==3X?E(t).21():t.K!=W&&(!t.11||E.11(t,"2Y"))?t:[t]))},3t:G(a){I a?E.3m(a,6).K>0:P},7c:G(a){I 6.3t("."+a)},3i:G(b){9(b==W){9(6.K){H c=6[0];9(E.11(c,"24")){H e=c.4Z,a=[],Y=c.Y,2G=c.O=="24-2G";9(e<0)I S;L(H i=2G?e:0,33=2G?e+1:Y.K;i<33;i++){H d=Y[i];9(d.26){H b=E.V.1h&&!d.9V["1Q"].9L?d.2g:d.1Q;9(2G)I b;a.1a(b)}}I a}J I 6[0].1Q.1p(/\\r/g,"")}}J I 6.N(G(){9(b.1c==1B&&/4k|5j/.14(6.O))6.2Q=(E.2A(6.1Q,b)>=0||E.2A(6.2H,b)>=0);J 9(E.11(6,"24")){H a=b.1c==1B?b:[b];E("9h",6).N(G(){6.26=(E.2A(6.1Q,a)>=0||E.2A(6.2g,a)>=0)});9(!a.K)6.4Z=-1}J 6.1Q=b})},4o:G(a){I a==W?(6.K?6[0].3O:S):6.4n().3g(a)},6H:G(a){I 6.50(a).28()},6E:G(i){I 6.2J(i,i+1)},2J:G(){I 6.2o(1B.3A.2J.16(6,1q))},1X:G(b){I 6.2o(E.1X(6,G(a,i){I b.2O(a,i,a)}))},4O:G(){I 6.1f(6.4Y)},3z:G(f,d,g,e){H c=6.K>1,a;I 6.N(G(){9(!a){a=E.4D(f,6.3H);9(g<0)a.8U()}H b=6;9(d&&E.11(6,"1I")&&E.11(a[0],"4m"))b=6.4l("1K")[0]||6.58(U.5B("1K"));E.N(a,G(){H a=c?6.4R(Q):6;9(!5A(0,a))e.2O(b,a)})})}};G 5A(i,b){H a=E.11(b,"1J");9(a){9(b.3k)E.3G({1d:b.3k,3e:P,1V:"1J"});J E.5f(b.2g||b.6s||b.3O||"");9(b.12)b.12.3b(b)}J 9(b.1y==1)E("1J",b).N(5A);I a}E.1k=E.1b.1k=G(){H c=1q[0]||{},a=1,2c=1q.K,5e=P;9(c.1c==8o){5e=c;c=1q[1]||{}}9(2c==1){c=6;a=0}H b;L(;a<2c;a++)9((b=1q[a])!=S)L(H i 1i b){9(c==b[i])6r;9(5e&&1m b[i]==\'5i\'&&c[i])E.1k(c[i],b[i]);J 9(b[i]!=W)c[i]=b[i]}I c};H F="15"+(1u 3D()).3B(),6p=0,5c={};E.1k({8a:G(a){18.$=D;9(a)18.15=w;I E},1n:G(a){I!!a&&1m a!="1M"&&!a.11&&a.1c!=1B&&/G/i.14(a+"")},4a:G(a){I a.2V&&!a.1G||a.37&&a.3H&&!a.3H.1G},5f:G(a){a=E.36(a);9(a){9(18.6l)18.6l(a);J 9(E.V.1N)18.56(a,0);J 3w.2O(18,a)}},11:G(b,a){I b.11&&b.11.27()==a.27()},1L:{},M:G(c,d,b){c=c==18?5c:c;H a=c[F];9(!a)a=c[F]=++6p;9(d&&!E.1L[a])E.1L[a]={};9(b!=W)E.1L[a][d]=b;I d?E.1L[a][d]:a},30:G(c,b){c=c==18?5c:c;H a=c[F];9(b){9(E.1L[a]){2E E.1L[a][b];b="";L(b 1i E.1L[a])1T;9(!b)E.30(c)}}J{2a{2E c[F]}29(e){9(c.53)c.53(F)}2E E.1L[a]}},N:G(a,b,c){9(c){9(a.K==W)L(H i 1i a)b.16(a[i],c);J L(H i=0,48=a.K;i<48;i++)9(b.16(a[i],c)===P)1T}J{9(a.K==W)L(H i 1i a)b.2O(a[i],i,a[i]);J L(H i=0,48=a.K,3i=a[0];i<48&&b.2O(3i,i,3i)!==P;3i=a[++i]){}}I a},1e:G(c,b,d,e,a){9(E.1n(b))b=b.2O(c,[e]);H f=/z-?4I|7T-?7Q|1r|69|7P-?1H/i;I b&&b.1c==4W&&d=="3C"&&!f.14(a)?b+"2T":b},1o:{1f:G(b,c){E.N((c||"").2l(/\\s+/),G(i,a){9(!E.1o.3K(b.1o,a))b.1o+=(b.1o?" ":"")+a})},28:G(b,c){b.1o=c!=W?E.2W(b.1o.2l(/\\s+/),G(a){I!E.1o.3K(c,a)}).66(" "):""},3K:G(t,c){I E.2A(c,(t.1o||t).3s().2l(/\\s+/))>-1}},2k:G(e,o,f){L(H i 1i o){e.R["3r"+i]=e.R[i];e.R[i]=o[i]}f.16(e,[]);L(H i 1i o)e.R[i]=e.R["3r"+i]},17:G(e,p){9(p=="1H"||p=="2N"){H b={},42,41,d=["7J","7I","7G","7F"];E.N(d,G(){b["7C"+6]=0;b["7B"+6+"5Z"]=0});E.2k(e,b,G(){9(E(e).3t(\':3R\')){42=e.7A;41=e.7w}J{e=E(e.4R(Q)).1Y(":4k").5W("2Q").2D().17({4C:"1P",2X:"4F",19:"2Z",7o:"0",1S:"0"}).5R(e.12)[0];H a=E.17(e.12,"2X")||"3V";9(a=="3V")e.12.R.2X="7g";42=e.7e;41=e.7b;9(a=="3V")e.12.R.2X="3V";e.12.3b(e)}});I p=="1H"?42:41}I E.3C(e,p)},3C:G(h,j,i){H g,2w=[],2k=[];G 3n(a){9(!E.V.1N)I P;H b=U.3o.3Z(a,S);I!b||b.4y("3n")==""}9(j=="1r"&&E.V.1h){g=E.1x(h.R,"1r");I g==""?"1":g}9(j.1t(/4u/i))j=y;9(!i&&h.R[j])g=h.R[j];J 9(U.3o&&U.3o.3Z){9(j.1t(/4u/i))j="4u";j=j.1p(/([A-Z])/g,"-$1").2p();H d=U.3o.3Z(h,S);9(d&&!3n(h))g=d.4y(j);J{L(H a=h;a&&3n(a);a=a.12)2w.4w(a);L(a=0;a<2w.K;a++)9(3n(2w[a])){2k[a]=2w[a].R.19;2w[a].R.19="2Z"}g=j=="19"&&2k[2w.K-1]!=S?"2s":U.3o.3Z(h,S).4y(j)||"";L(a=0;a<2k.K;a++)9(2k[a]!=S)2w[a].R.19=2k[a]}9(j=="1r"&&g=="")g="1"}J 9(h.3Q){H f=j.1p(/\\-(\\w)/g,G(m,c){I c.27()});g=h.3Q[j]||h.3Q[f];9(!/^\\d+(2T)?$/i.14(g)&&/^\\d/.14(g)){H k=h.R.1S;H e=h.4v.1S;h.4v.1S=h.3Q.1S;h.R.1S=g||0;g=h.R.71+"2T";h.R.1S=k;h.4v.1S=e}}I g},4D:G(a,e){H r=[];e=e||U;E.N(a,G(i,d){9(!d)I;9(d.1c==4W)d=d.3s();9(1m d=="1M"){d=d.1p(/(<(\\w+)[^>]*?)\\/>/g,G(m,a,b){I b.1t(/^(70|6Z|6Y|9Q|4t|9N|9K|3a|9G|9E)$/i)?m:a+">"});H s=E.36(d).2p(),1s=e.5B("1s"),2x=[];H c=!s.1g("<9y")&&[1,"<24>",""]||!s.1g("<9w")&&[1,"<6T>",""]||s.1t(/^<(9u|1K|9t|9r|9p)/)&&[1,"<1I>",""]||!s.1g("<4m")&&[2,"<1I><1K>",""]||(!s.1g("<9m")||!s.1g("<9k"))&&[3,"<1I><1K><4m>",""]||!s.1g("<6Y")&&[2,"<1I><1K><6L>",""]||E.V.1h&&[1,"1s<1s>",""]||[0,"",""];1s.3O=c[1]+d+c[2];1W(c[0]--)1s=1s.5p;9(E.V.1h){9(!s.1g("<1I")&&s.1g("<1K")<0)2x=1s.1w&&1s.1w.3j;J 9(c[1]=="<1I>"&&s.1g("<1K")<0)2x=1s.3j;L(H n=2x.K-1;n>=0;--n)9(E.11(2x[n],"1K")&&!2x[n].3j.K)2x[n].12.3b(2x[n]);9(/^\\s/.14(d))1s.3d(e.6F(d.1t(/^\\s*/)[0]),1s.1w)}d=E.2h(1s.3j)}9(0===d.K&&(!E.11(d,"2Y")&&!E.11(d,"24")))I;9(d[0]==W||E.11(d,"2Y")||d.Y)r.1a(d);J r=E.1R(r,d)});I r},1x:G(c,d,a){H e=E.4a(c)?{}:E.5o;9(d=="26"&&E.V.1N)c.12.4Z;9(e[d]){9(a!=W)c[e[d]]=a;I c[e[d]]}J 9(E.V.1h&&d=="R")I E.1x(c.R,"9e",a);J 9(a==W&&E.V.1h&&E.11(c,"2Y")&&(d=="9d"||d=="9a"))I c.97(d).6x;J 9(c.37){9(a!=W){9(d=="O"&&E.11(c,"4t")&&c.12)6G"O 94 93\'t 92 91";c.90(d,a)}9(E.V.1h&&/6C|3k/.14(d)&&!E.4a(c))I c.4p(d,2);I c.4p(d)}J{9(d=="1r"&&E.V.1h){9(a!=W){c.69=1;c.1E=(c.1E||"").1p(/6O\\([^)]*\\)/,"")+(3I(a).3s()=="8S"?"":"6O(1r="+a*6A+")")}I c.1E?(3I(c.1E.1t(/1r=([^)]*)/)[1])/6A).3s():""}d=d.1p(/-([a-z])/8Q,G(z,b){I b.27()});9(a!=W)c[d]=a;I c[d]}},36:G(t){I(t||"").1p(/^\\s+|\\s+$/g,"")},2h:G(a){H r=[];9(1m a!="8P")L(H i=0,2c=a.K;i<2c;i++)r.1a(a[i]);J r=a.2J(0);I r},2A:G(b,a){L(H i=0,2c=a.K;i<2c;i++)9(a[i]==b)I i;I-1},1R:G(a,b){9(E.V.1h){L(H i=0;b[i];i++)9(b[i].1y!=8)a.1a(b[i])}J L(H i=0;b[i];i++)a.1a(b[i]);I a},4V:G(b){H r=[],2f={};2a{L(H i=0,6y=b.K;i<6y;i++){H a=E.M(b[i]);9(!2f[a]){2f[a]=Q;r.1a(b[i])}}}29(e){r=b}I r},2W:G(b,a,c){9(1m a=="1M")a=3w("P||G(a,i){I "+a+"}");H d=[];L(H i=0,4g=b.K;i<4g;i++)9(!c&&a(b[i],i)||c&&!a(b[i],i))d.1a(b[i]);I d},1X:G(c,b){9(1m b=="1M")b=3w("P||G(a){I "+b+"}");H d=[];L(H i=0,4g=c.K;i<4g;i++){H a=b(c[i],i);9(a!==S&&a!=W){9(a.1c!=1B)a=[a];d=d.8M(a)}}I d}});H v=8K.8I.2p();E.V={4s:(v.1t(/.+(?:8F|8E|8C|8B)[\\/: ]([\\d.]+)/)||[])[1],1N:/6w/.14(v),34:/34/.14(v),1h:/1h/.14(v)&&!/34/.14(v),35:/35/.14(v)&&!/(8z|6w)/.14(v)};H y=E.V.1h?"4h":"5h";E.1k({5g:!E.V.1h||U.8y=="8x",4h:E.V.1h?"4h":"5h",5o:{"L":"8w","8v":"1o","4u":y,5h:y,4h:y,3O:"3O",1o:"1o",1Q:"1Q",3c:"3c",2Q:"2Q",8u:"8t",26:"26",8s:"8r"}});E.N({1D:"a.12",8q:"15.4e(a,\'12\')",8p:"15.2I(a,2,\'2q\')",8n:"15.2I(a,2,\'4d\')",8l:"15.4e(a,\'2q\')",8k:"15.4e(a,\'4d\')",8j:"15.5d(a.12.1w,a)",8i:"15.5d(a.1w)",6q:"15.11(a,\'8h\')?a.8f||a.8e.U:15.2h(a.3j)"},G(i,n){E.1b[i]=G(a){H b=E.1X(6,n);9(a&&1m a=="1M")b=E.3m(a,b);I 6.2o(E.4V(b))}});E.N({5R:"3g",8c:"6j",3d:"6g",8b:"50",89:"6H"},G(i,n){E.1b[i]=G(){H a=1q;I 6.N(G(){L(H j=0,2c=a.K;j<2c;j++)E(a[j])[n](6)})}});E.N({5W:G(a){E.1x(6,a,"");6.53(a)},88:G(c){E.1o.1f(6,c)},87:G(c){E.1o.28(6,c)},86:G(c){E.1o[E.1o.3K(6,c)?"28":"1f"](6,c)},28:G(a){9(!a||E.1E(a,[6]).r.K){E.30(6);6.12.3b(6)}},4n:G(){E("*",6).N(G(){E.30(6)});1W(6.1w)6.3b(6.1w)}},G(i,n){E.1b[i]=G(){I 6.N(n,1q)}});E.N(["85","5Z"],G(i,a){H n=a.2p();E.1b[n]=G(h){I 6[0]==18?E.V.1N&&3y["84"+a]||E.5g&&38.33(U.2V["5a"+a],U.1G["5a"+a])||U.1G["5a"+a]:6[0]==U?38.33(U.1G["6n"+a],U.1G["6m"+a]):h==W?(6.K?E.17(6[0],n):S):6.17(n,h.1c==3X?h:h+"2T")}});H C=E.V.1N&&3x(E.V.4s)<83?"(?:[\\\\w*57-]|\\\\\\\\.)":"(?:[\\\\w\\82-\\81*57-]|\\\\\\\\.)",6k=1u 47("^>\\\\s*("+C+"+)"),6i=1u 47("^("+C+"+)(#)("+C+"+)"),6h=1u 47("^([#.]?)("+C+"*)");E.1k({55:{"":"m[2]==\'*\'||15.11(a,m[2])","#":"a.4p(\'22\')==m[2]",":":{80:"im[3]-0",2I:"m[3]-0==i",6E:"m[3]-0==i",3v:"i==0",3u:"i==r.K-1",6f:"i%2==0",6e:"i%2","3v-46":"a.12.4l(\'*\')[0]==a","3u-46":"15.2I(a.12.5p,1,\'4d\')==a","7X-46":"!15.2I(a.12.5p,2,\'4d\')",1D:"a.1w",4n:"!a.1w",7W:"(a.6s||a.7V||15(a).2g()||\'\').1g(m[3])>=0",3R:\'"1P"!=a.O&&15.17(a,"19")!="2s"&&15.17(a,"4C")!="1P"\',1P:\'"1P"==a.O||15.17(a,"19")=="2s"||15.17(a,"4C")=="1P"\',7U:"!a.3c",3c:"a.3c",2Q:"a.2Q",26:"a.26||15.1x(a,\'26\')",2g:"\'2g\'==a.O",4k:"\'4k\'==a.O",5j:"\'5j\'==a.O",54:"\'54\'==a.O",52:"\'52\'==a.O",51:"\'51\'==a.O",6d:"\'6d\'==a.O",6c:"\'6c\'==a.O",2r:\'"2r"==a.O||15.11(a,"2r")\',4t:"/4t|24|6b|2r/i.14(a.11)",3K:"15.1Y(m[3],a).K",7S:"/h\\\\d/i.14(a.11)",7R:"15.2W(15.32,G(1b){I a==1b.T;}).K"}},6a:[/^(\\[) *@?([\\w-]+) *([!*$^~=]*) *(\'?"?)(.*?)\\4 *\\]/,/^(:)([\\w-]+)\\("?\'?(.*?(\\(.*?\\))?[^(]*?)"?\'?\\)/,1u 47("^([:.#]*)("+C+"+)")],3m:G(a,c,b){H d,2b=[];1W(a&&a!=d){d=a;H f=E.1E(a,c,b);a=f.t.1p(/^\\s*,\\s*/,"");2b=b?c=f.r:E.1R(2b,f.r)}I 2b},1Y:G(t,o){9(1m t!="1M")I[t];9(o&&!o.1y)o=S;o=o||U;H d=[o],2f=[],3u;1W(t&&3u!=t){H r=[];3u=t;t=E.36(t);H l=P;H g=6k;H m=g.2S(t);9(m){H p=m[1].27();L(H i=0;d[i];i++)L(H c=d[i].1w;c;c=c.2q)9(c.1y==1&&(p=="*"||c.11.27()==p.27()))r.1a(c);d=r;t=t.1p(g,"");9(t.1g(" ")==0)6r;l=Q}J{g=/^([>+~])\\s*(\\w*)/i;9((m=g.2S(t))!=S){r=[];H p=m[2],1R={};m=m[1];L(H j=0,31=d.K;j<31;j++){H n=m=="~"||m=="+"?d[j].2q:d[j].1w;L(;n;n=n.2q)9(n.1y==1){H h=E.M(n);9(m=="~"&&1R[h])1T;9(!p||n.11.27()==p.27()){9(m=="~")1R[h]=Q;r.1a(n)}9(m=="+")1T}}d=r;t=E.36(t.1p(g,""));l=Q}}9(t&&!l){9(!t.1g(",")){9(o==d[0])d.44();2f=E.1R(2f,d);r=d=[o];t=" "+t.68(1,t.K)}J{H k=6i;H m=k.2S(t);9(m){m=[0,m[2],m[3],m[1]]}J{k=6h;m=k.2S(t)}m[2]=m[2].1p(/\\\\/g,"");H f=d[d.K-1];9(m[1]=="#"&&f&&f.3S&&!E.4a(f)){H q=f.3S(m[2]);9((E.V.1h||E.V.34)&&q&&1m q.22=="1M"&&q.22!=m[2])q=E(\'[@22="\'+m[2]+\'"]\',f)[0];d=r=q&&(!m[3]||E.11(q,m[3]))?[q]:[]}J{L(H i=0;d[i];i++){H a=m[1]=="#"&&m[3]?m[3]:m[1]!=""||m[0]==""?"*":m[2];9(a=="*"&&d[i].11.2p()=="5i")a="3a";r=E.1R(r,d[i].4l(a))}9(m[1]==".")r=E.4X(r,m[2]);9(m[1]=="#"){H e=[];L(H i=0;r[i];i++)9(r[i].4p("22")==m[2]){e=[r[i]];1T}r=e}d=r}t=t.1p(k,"")}}9(t){H b=E.1E(t,r);d=r=b.r;t=E.36(b.t)}}9(t)d=[];9(d&&o==d[0])d.44();2f=E.1R(2f,d);I 2f},4X:G(r,m,a){m=" "+m+" ";H c=[];L(H i=0;r[i];i++){H b=(" "+r[i].1o+" ").1g(m)>=0;9(!a&&b||a&&!b)c.1a(r[i])}I c},1E:G(t,r,h){H d;1W(t&&t!=d){d=t;H p=E.6a,m;L(H i=0;p[i];i++){m=p[i].2S(t);9(m){t=t.7O(m[0].K);m[2]=m[2].1p(/\\\\/g,"");1T}}9(!m)1T;9(m[1]==":"&&m[2]=="5V")r=E.1E(m[3],r,Q).r;J 9(m[1]==".")r=E.4X(r,m[2],h);J 9(m[1]=="["){H g=[],O=m[3];L(H i=0,31=r.K;i<31;i++){H a=r[i],z=a[E.5o[m[2]]||m[2]];9(z==S||/6C|3k|26/.14(m[2]))z=E.1x(a,m[2])||\'\';9((O==""&&!!z||O=="="&&z==m[5]||O=="!="&&z!=m[5]||O=="^="&&z&&!z.1g(m[5])||O=="$="&&z.68(z.K-m[5].K)==m[5]||(O=="*="||O=="~=")&&z.1g(m[5])>=0)^h)g.1a(a)}r=g}J 9(m[1]==":"&&m[2]=="2I-46"){H e={},g=[],14=/(\\d*)n\\+?(\\d*)/.2S(m[3]=="6f"&&"2n"||m[3]=="6e"&&"2n+1"||!/\\D/.14(m[3])&&"n+"+m[3]||m[3]),3v=(14[1]||1)-0,d=14[2]-0;L(H i=0,31=r.K;i<31;i++){H j=r[i],12=j.12,22=E.M(12);9(!e[22]){H c=1;L(H n=12.1w;n;n=n.2q)9(n.1y==1)n.4U=c++;e[22]=Q}H b=P;9(3v==1){9(d==0||j.4U==d)b=Q}J 9((j.4U+d)%3v==0)b=Q;9(b^h)g.1a(j)}r=g}J{H f=E.55[m[1]];9(1m f!="1M")f=E.55[m[1]][m[2]];f=3w("P||G(a,i){I "+f+"}");r=E.2W(r,f,h)}}I{r:r,t:t}},4e:G(b,c){H d=[];H a=b[c];1W(a&&a!=U){9(a.1y==1)d.1a(a);a=a[c]}I d},2I:G(a,e,c,b){e=e||1;H d=0;L(;a;a=a[c])9(a.1y==1&&++d==e)1T;I a},5d:G(n,a){H r=[];L(;n;n=n.2q){9(n.1y==1&&(!a||n!=a))r.1a(n)}I r}});E.1j={1f:G(g,e,c,h){9(E.V.1h&&g.4j!=W)g=18;9(!c.2u)c.2u=6.2u++;9(h!=W){H d=c;c=G(){I d.16(6,1q)};c.M=h;c.2u=d.2u}H i=e.2l(".");e=i[0];c.O=i[1];H b=E.M(g,"2P")||E.M(g,"2P",{});H f=E.M(g,"2t",G(){H a;9(1m E=="W"||E.1j.4T)I a;a=E.1j.2t.16(g,1q);I a});H j=b[e];9(!j){j=b[e]={};9(g.4S)g.4S(e,f,P);J g.7N("43"+e,f)}j[c.2u]=c;6.1Z[e]=Q},2u:1,1Z:{},28:G(d,c,b){H e=E.M(d,"2P"),2L,4I;9(1m c=="1M"){H a=c.2l(".");c=a[0]}9(e){9(c&&c.O){b=c.4Q;c=c.O}9(!c){L(c 1i e)6.28(d,c)}J 9(e[c]){9(b)2E e[c][b.2u];J L(b 1i e[c])9(!a[1]||e[c][b].O==a[1])2E e[c][b];L(2L 1i e[c])1T;9(!2L){9(d.4P)d.4P(c,E.M(d,"2t"),P);J d.7M("43"+c,E.M(d,"2t"));2L=S;2E e[c]}}L(2L 1i e)1T;9(!2L){E.30(d,"2P");E.30(d,"2t")}}},1F:G(d,b,e,c,f){b=E.2h(b||[]);9(!e){9(6.1Z[d])E("*").1f([18,U]).1F(d,b)}J{H a,2L,1b=E.1n(e[d]||S),4N=!b[0]||!b[0].2M;9(4N)b.4w(6.4M({O:d,2m:e}));b[0].O=d;9(E.1n(E.M(e,"2t")))a=E.M(e,"2t").16(e,b);9(!1b&&e["43"+d]&&e["43"+d].16(e,b)===P)a=P;9(4N)b.44();9(f&&f.16(e,b)===P)a=P;9(1b&&c!==P&&a!==P&&!(E.11(e,\'a\')&&d=="4L")){6.4T=Q;e[d]()}6.4T=P}I a},2t:G(d){H a;d=E.1j.4M(d||18.1j||{});H b=d.O.2l(".");d.O=b[0];H c=E.M(6,"2P")&&E.M(6,"2P")[d.O],3q=1B.3A.2J.2O(1q,1);3q.4w(d);L(H j 1i c){3q[0].4Q=c[j];3q[0].M=c[j].M;9(!b[1]||c[j].O==b[1]){H e=c[j].16(6,3q);9(a!==P)a=e;9(e===P){d.2M();d.3p()}}}9(E.V.1h)d.2m=d.2M=d.3p=d.4Q=d.M=S;I a},4M:G(c){H a=c;c=E.1k({},a);c.2M=G(){9(a.2M)a.2M();a.7L=P};c.3p=G(){9(a.3p)a.3p();a.7K=Q};9(!c.2m&&c.65)c.2m=c.65;9(E.V.1N&&c.2m.1y==3)c.2m=a.2m.12;9(!c.4K&&c.4J)c.4K=c.4J==c.2m?c.7H:c.4J;9(c.64==S&&c.63!=S){H e=U.2V,b=U.1G;c.64=c.63+(e&&e.2R||b.2R||0);c.7E=c.7D+(e&&e.2B||b.2B||0)}9(!c.3Y&&(c.61||c.60))c.3Y=c.61||c.60;9(!c.5F&&c.5D)c.5F=c.5D;9(!c.3Y&&c.2r)c.3Y=(c.2r&1?1:(c.2r&2?3:(c.2r&4?2:0)));I c}};E.1b.1k({3W:G(c,a,b){I c=="5Y"?6.2G(c,a,b):6.N(G(){E.1j.1f(6,c,b||a,b&&a)})},2G:G(d,b,c){I 6.N(G(){E.1j.1f(6,d,G(a){E(6).5X(a);I(c||b).16(6,1q)},c&&b)})},5X:G(a,b){I 6.N(G(){E.1j.28(6,a,b)})},1F:G(c,a,b){I 6.N(G(){E.1j.1F(c,a,6,Q,b)})},7x:G(c,a,b){9(6[0])I E.1j.1F(c,a,6[0],P,b)},25:G(){H a=1q;I 6.4L(G(e){6.4H=0==6.4H?1:0;e.2M();I a[6.4H].16(6,[e])||P})},7v:G(f,g){G 4G(e){H p=e.4K;1W(p&&p!=6)2a{p=p.12}29(e){p=6};9(p==6)I P;I(e.O=="4x"?f:g).16(6,[e])}I 6.4x(4G).5U(4G)},2d:G(f){5T();9(E.3T)f.16(U,[E]);J E.3l.1a(G(){I f.16(6,[E])});I 6}});E.1k({3T:P,3l:[],2d:G(){9(!E.3T){E.3T=Q;9(E.3l){E.N(E.3l,G(){6.16(U)});E.3l=S}9(E.V.35||E.V.34)U.4P("5S",E.2d,P);9(!18.7t.K)E(18).39(G(){E("#4E").28()})}}});E.N(("7s,7r,39,7q,6n,5Y,4L,7p,"+"7n,7m,7l,4x,5U,7k,24,"+"51,7j,7i,7h,3U").2l(","),G(i,o){E.1b[o]=G(f){I f?6.3W(o,f):6.1F(o)}});H x=P;G 5T(){9(x)I;x=Q;9(E.V.35||E.V.34)U.4S("5S",E.2d,P);J 9(E.V.1h){U.7f("<7d"+"7y 22=4E 7z=Q "+"3k=//:><\\/1J>");H a=U.3S("4E");9(a)a.62=G(){9(6.2C!="1l")I;E.2d()};a=S}J 9(E.V.1N)E.4B=4j(G(){9(U.2C=="5Q"||U.2C=="1l"){4A(E.4B);E.4B=S;E.2d()}},10);E.1j.1f(18,"39",E.2d)}E.1b.1k({39:G(g,d,c){9(E.1n(g))I 6.3W("39",g);H e=g.1g(" ");9(e>=0){H i=g.2J(e,g.K);g=g.2J(0,e)}c=c||G(){};H f="4z";9(d)9(E.1n(d)){c=d;d=S}J{d=E.3a(d);f="5P"}H h=6;E.3G({1d:g,O:f,M:d,1l:G(a,b){9(b=="1C"||b=="5O")h.4o(i?E("<1s/>").3g(a.40.1p(/<1J(.|\\s)*?\\/1J>/g,"")).1Y(i):a.40);56(G(){h.N(c,[a.40,b,a])},13)}});I 6},7a:G(){I E.3a(6.5M())},5M:G(){I 6.1X(G(){I E.11(6,"2Y")?E.2h(6.79):6}).1E(G(){I 6.2H&&!6.3c&&(6.2Q||/24|6b/i.14(6.11)||/2g|1P|52/i.14(6.O))}).1X(G(i,c){H b=E(6).3i();I b==S?S:b.1c==1B?E.1X(b,G(a,i){I{2H:c.2H,1Q:a}}):{2H:c.2H,1Q:b}}).21()}});E.N("5L,5K,6t,5J,5I,5H".2l(","),G(i,o){E.1b[o]=G(f){I 6.3W(o,f)}});H B=(1u 3D).3B();E.1k({21:G(d,b,a,c){9(E.1n(b)){a=b;b=S}I E.3G({O:"4z",1d:d,M:b,1C:a,1V:c})},78:G(b,a){I E.21(b,S,a,"1J")},77:G(c,b,a){I E.21(c,b,a,"45")},76:G(d,b,a,c){9(E.1n(b)){a=b;b={}}I E.3G({O:"5P",1d:d,M:b,1C:a,1V:c})},75:G(a){E.1k(E.59,a)},59:{1Z:Q,O:"4z",2z:0,5G:"74/x-73-2Y-72",6o:Q,3e:Q,M:S},49:{},3G:G(s){H f,2y=/=(\\?|%3F)/g,1v,M;s=E.1k(Q,s,E.1k(Q,{},E.59,s));9(s.M&&s.6o&&1m s.M!="1M")s.M=E.3a(s.M);9(s.1V=="4b"){9(s.O.2p()=="21"){9(!s.1d.1t(2y))s.1d+=(s.1d.1t(/\\?/)?"&":"?")+(s.4b||"5E")+"=?"}J 9(!s.M||!s.M.1t(2y))s.M=(s.M?s.M+"&":"")+(s.4b||"5E")+"=?";s.1V="45"}9(s.1V=="45"&&(s.M&&s.M.1t(2y)||s.1d.1t(2y))){f="4b"+B++;9(s.M)s.M=s.M.1p(2y,"="+f);s.1d=s.1d.1p(2y,"="+f);s.1V="1J";18[f]=G(a){M=a;1C();1l();18[f]=W;2a{2E 18[f]}29(e){}}}9(s.1V=="1J"&&s.1L==S)s.1L=P;9(s.1L===P&&s.O.2p()=="21")s.1d+=(s.1d.1t(/\\?/)?"&":"?")+"57="+(1u 3D()).3B();9(s.M&&s.O.2p()=="21"){s.1d+=(s.1d.1t(/\\?/)?"&":"?")+s.M;s.M=S}9(s.1Z&&!E.5b++)E.1j.1F("5L");9(!s.1d.1g("8g")&&s.1V=="1J"){H h=U.4l("9U")[0];H g=U.5B("1J");g.3k=s.1d;9(!f&&(s.1C||s.1l)){H j=P;g.9R=g.62=G(){9(!j&&(!6.2C||6.2C=="5Q"||6.2C=="1l")){j=Q;1C();1l();h.3b(g)}}}h.58(g);I}H k=P;H i=18.6X?1u 6X("9P.9O"):1u 6W();i.9M(s.O,s.1d,s.3e);9(s.M)i.5C("9J-9I",s.5G);9(s.5y)i.5C("9H-5x-9F",E.49[s.1d]||"9D, 9C 9B 9A 5v:5v:5v 9z");i.5C("X-9x-9v","6W");9(s.6U)s.6U(i);9(s.1Z)E.1j.1F("5H",[i,s]);H c=G(a){9(!k&&i&&(i.2C==4||a=="2z")){k=Q;9(d){4A(d);d=S}1v=a=="2z"&&"2z"||!E.6S(i)&&"3U"||s.5y&&E.6R(i,s.1d)&&"5O"||"1C";9(1v=="1C"){2a{M=E.6Q(i,s.1V)}29(e){1v="5k"}}9(1v=="1C"){H b;2a{b=i.5s("6P-5x")}29(e){}9(s.5y&&b)E.49[s.1d]=b;9(!f)1C()}J E.5r(s,i,1v);1l();9(s.3e)i=S}};9(s.3e){H d=4j(c,13);9(s.2z>0)56(G(){9(i){i.9q();9(!k)c("2z")}},s.2z)}2a{i.9o(s.M)}29(e){E.5r(s,i,S,e)}9(!s.3e)c();I i;G 1C(){9(s.1C)s.1C(M,1v);9(s.1Z)E.1j.1F("5I",[i,s])}G 1l(){9(s.1l)s.1l(i,1v);9(s.1Z)E.1j.1F("6t",[i,s]);9(s.1Z&&!--E.5b)E.1j.1F("5K")}},5r:G(s,a,b,e){9(s.3U)s.3U(a,b,e);9(s.1Z)E.1j.1F("5J",[a,s,e])},5b:0,6S:G(r){2a{I!r.1v&&9n.9l=="54:"||(r.1v>=6N&&r.1v<9j)||r.1v==6M||E.V.1N&&r.1v==W}29(e){}I P},6R:G(a,c){2a{H b=a.5s("6P-5x");I a.1v==6M||b==E.49[c]||E.V.1N&&a.1v==W}29(e){}I P},6Q:G(r,b){H c=r.5s("9i-O");H d=b=="6K"||!b&&c&&c.1g("6K")>=0;H a=d?r.9g:r.40;9(d&&a.2V.37=="5k")6G"5k";9(b=="1J")E.5f(a);9(b=="45")a=3w("("+a+")");I a},3a:G(a){H s=[];9(a.1c==1B||a.4c)E.N(a,G(){s.1a(3f(6.2H)+"="+3f(6.1Q))});J L(H j 1i a)9(a[j]&&a[j].1c==1B)E.N(a[j],G(){s.1a(3f(j)+"="+3f(6))});J s.1a(3f(j)+"="+3f(a[j]));I s.66("&").1p(/%20/g,"+")}});E.1b.1k({1A:G(b,a){I b?6.1U({1H:"1A",2N:"1A",1r:"1A"},b,a):6.1E(":1P").N(G(){6.R.19=6.3h?6.3h:"";9(E.17(6,"19")=="2s")6.R.19="2Z"}).2D()},1z:G(b,a){I b?6.1U({1H:"1z",2N:"1z",1r:"1z"},b,a):6.1E(":3R").N(G(){6.3h=6.3h||E.17(6,"19");9(6.3h=="2s")6.3h="2Z";6.R.19="2s"}).2D()},6J:E.1b.25,25:G(a,b){I E.1n(a)&&E.1n(b)?6.6J(a,b):a?6.1U({1H:"25",2N:"25",1r:"25"},a,b):6.N(G(){E(6)[E(6).3t(":1P")?"1A":"1z"]()})},9c:G(b,a){I 6.1U({1H:"1A"},b,a)},9b:G(b,a){I 6.1U({1H:"1z"},b,a)},99:G(b,a){I 6.1U({1H:"25"},b,a)},98:G(b,a){I 6.1U({1r:"1A"},b,a)},96:G(b,a){I 6.1U({1r:"1z"},b,a)},95:G(c,a,b){I 6.1U({1r:a},c,b)},1U:G(k,i,h,g){H j=E.6D(i,h,g);I 6[j.3L===P?"N":"3L"](G(){j=E.1k({},j);H f=E(6).3t(":1P"),3y=6;L(H p 1i k){9(k[p]=="1z"&&f||k[p]=="1A"&&!f)I E.1n(j.1l)&&j.1l.16(6);9(p=="1H"||p=="2N"){j.19=E.17(6,"19");j.2U=6.R.2U}}9(j.2U!=S)6.R.2U="1P";j.3M=E.1k({},k);E.N(k,G(c,a){H e=1u E.2j(3y,j,c);9(/25|1A|1z/.14(a))e[a=="25"?f?"1A":"1z":a](k);J{H b=a.3s().1t(/^([+-]=)?([\\d+-.]+)(.*)$/),1O=e.2b(Q)||0;9(b){H d=3I(b[2]),2i=b[3]||"2T";9(2i!="2T"){3y.R[c]=(d||1)+2i;1O=((d||1)/e.2b(Q))*1O;3y.R[c]=1O+2i}9(b[1])d=((b[1]=="-="?-1:1)*d)+1O;e.3N(1O,d,2i)}J e.3N(1O,a,"")}});I Q})},3L:G(a,b){9(E.1n(a)){b=a;a="2j"}9(!a||(1m a=="1M"&&!b))I A(6[0],a);I 6.N(G(){9(b.1c==1B)A(6,a,b);J{A(6,a).1a(b);9(A(6,a).K==1)b.16(6)}})},9f:G(){H a=E.32;I 6.N(G(){L(H i=0;i-8O?r:3I(E.17(6.T,6.1e))||0},3N:G(c,b,e){6.5u=(1u 3D()).3B();6.1O=c;6.2D=b;6.2i=e||6.2i||"2T";6.2v=6.1O;6.4q=6.4i=0;6.4r();H f=6;G t(){I f.2F()}t.T=6.T;E.32.1a(t);9(E.32.K==1){H d=4j(G(){H a=E.32;L(H i=0;i6.Y.2e+6.5u){6.2v=6.2D;6.4q=6.4i=1;6.4r();6.Y.3M[6.1e]=Q;H a=Q;L(H i 1i 6.Y.3M)9(6.Y.3M[i]!==Q)a=P;9(a){9(6.Y.19!=S){6.T.R.2U=6.Y.2U;6.T.R.19=6.Y.19;9(E.17(6.T,"19")=="2s")6.T.R.19="2Z"}9(6.Y.1z)6.T.R.19="2s";9(6.Y.1z||6.Y.1A)L(H p 1i 6.Y.3M)E.1x(6.T.R,p,6.Y.3P[p])}9(a&&E.1n(6.Y.1l))6.Y.1l.16(6.T);I P}J{H n=t-6.5u;6.4i=n/6.Y.2e;6.4q=E.3J[6.Y.3J||(E.3J.5q?"5q":"6B")](6.4i,n,0,1,6.Y.2e);6.2v=6.1O+((6.2D-6.1O)*6.4q);6.4r()}I Q}};E.2j.2F={2R:G(a){a.T.2R=a.2v},2B:G(a){a.T.2B=a.2v},1r:G(a){E.1x(a.T.R,"1r",a.2v)},6z:G(a){a.T.R[a.1e]=a.2v+a.2i}};E.1b.6m=G(){H c=0,3E=0,T=6[0],5t;9(T)8L(E.V){H b=E.17(T,"2X")=="4F",1D=T.12,23=T.23,2K=T.3H,4f=1N&&3x(4s)<8J;9(T.6V){5w=T.6V();1f(5w.1S+38.33(2K.2V.2R,2K.1G.2R),5w.3E+38.33(2K.2V.2B,2K.1G.2B));9(1h){H d=E("4o").17("8H");d=(d=="8G"||E.5g&&3x(4s)>=7)&&2||d;1f(-d,-d)}}J{1f(T.5l,T.5z);1W(23){1f(23.5l,23.5z);9(35&&/^t[d|h]$/i.14(1D.37)||!4f)d(23);9(4f&&!b&&E.17(23,"2X")=="4F")b=Q;23=23.23}1W(1D.37&&!/^1G|4o$/i.14(1D.37)){9(!/^8D|1I-9S.*$/i.14(E.17(1D,"19")))1f(-1D.2R,-1D.2B);9(35&&E.17(1D,"2U")!="3R")d(1D);1D=1D.12}9(4f&&b)1f(-2K.1G.5l,-2K.1G.5z)}5t={3E:3E,1S:c}}I 5t;G d(a){1f(E.17(a,"9T"),E.17(a,"8A"))}G 1f(l,t){c+=3x(l)||0;3E+=3x(t)||0}}})();',62,616,'||||||this|||if|||||||||||||||||||||||||||||||||function|var|return|else|length|for|data|each|type|false|true|style|null|elem|document|browser|undefined||options|||nodeName|parentNode||test|jQuery|apply|css|window|display|push|fn|constructor|url|prop|add|indexOf|msie|in|event|extend|complete|typeof|isFunction|className|replace|arguments|opacity|div|match|new|status|firstChild|attr|nodeType|hide|show|Array|success|parent|filter|trigger|body|height|table|script|tbody|cache|string|safari|start|hidden|value|merge|left|break|animate|dataType|while|map|find|global||get|id|offsetParent|select|toggle|selected|toUpperCase|remove|catch|try|cur|al|ready|duration|done|text|makeArray|unit|fx|swap|split|target||pushStack|toLowerCase|nextSibling|button|none|handle|guid|now|stack|tb|jsre|timeout|inArray|scrollTop|readyState|end|delete|step|one|name|nth|slice|doc|ret|preventDefault|width|call|events|checked|scrollLeft|exec|px|overflow|documentElement|grep|position|form|block|removeData|rl|timers|max|opera|mozilla|trim|tagName|Math|load|param|removeChild|disabled|insertBefore|async|encodeURIComponent|append|oldblock|val|childNodes|src|readyList|multiFilter|color|defaultView|stopPropagation|args|old|toString|is|last|first|eval|parseInt|self|domManip|prototype|getTime|curCSS|Date|top||ajax|ownerDocument|parseFloat|easing|has|queue|curAnim|custom|innerHTML|orig|currentStyle|visible|getElementById|isReady|error|static|bind|String|which|getComputedStyle|responseText|oWidth|oHeight|on|shift|json|child|RegExp|ol|lastModified|isXMLDoc|jsonp|jquery|previousSibling|dir|safari2|el|styleFloat|state|setInterval|radio|getElementsByTagName|tr|empty|html|getAttribute|pos|update|version|input|float|runtimeStyle|unshift|mouseover|getPropertyValue|GET|clearInterval|safariTimer|visibility|clean|__ie_init|absolute|handleHover|lastToggle|index|fromElement|relatedTarget|click|fix|evt|andSelf|removeEventListener|handler|cloneNode|addEventListener|triggered|nodeIndex|unique|Number|classFilter|prevObject|selectedIndex|after|submit|password|removeAttribute|file|expr|setTimeout|_|appendChild|ajaxSettings|client|active|win|sibling|deep|globalEval|boxModel|cssFloat|object|checkbox|parsererror|offsetLeft|wrapAll|dequeue|props|lastChild|swing|handleError|getResponseHeader|results|startTime|00|box|Modified|ifModified|offsetTop|evalScript|createElement|setRequestHeader|ctrlKey|callback|metaKey|contentType|ajaxSend|ajaxSuccess|ajaxError|ajaxStop|ajaxStart|serializeArray|init|notmodified|POST|loaded|appendTo|DOMContentLoaded|bindReady|mouseout|not|removeAttr|unbind|unload|Width|keyCode|charCode|onreadystatechange|clientX|pageX|srcElement|join|outerHTML|substr|zoom|parse|textarea|reset|image|odd|even|before|quickClass|quickID|prepend|quickChild|execScript|offset|scroll|processData|uuid|contents|continue|textContent|ajaxComplete|clone|setArray|webkit|nodeValue|fl|_default|100|linear|href|speed|eq|createTextNode|throw|replaceWith|splice|_toggle|xml|colgroup|304|200|alpha|Last|httpData|httpNotModified|httpSuccess|fieldset|beforeSend|getBoundingClientRect|XMLHttpRequest|ActiveXObject|col|br|abbr|pixelLeft|urlencoded|www|application|ajaxSetup|post|getJSON|getScript|elements|serialize|clientWidth|hasClass|scr|clientHeight|write|relative|keyup|keypress|keydown|change|mousemove|mouseup|mousedown|right|dblclick|resize|focus|blur|frames|instanceof|hover|offsetWidth|triggerHandler|ipt|defer|offsetHeight|border|padding|clientY|pageY|Left|Right|toElement|Bottom|Top|cancelBubble|returnValue|detachEvent|attachEvent|substring|line|weight|animated|header|font|enabled|innerText|contains|only|size|gt|lt|uFFFF|u0128|417|inner|Height|toggleClass|removeClass|addClass|replaceAll|noConflict|insertAfter|prependTo|wrap|contentWindow|contentDocument|http|iframe|children|siblings|prevAll|nextAll|wrapInner|prev|Boolean|next|parents|maxLength|maxlength|readOnly|readonly|class|htmlFor|CSS1Compat|compatMode|compatible|borderTopWidth|ie|ra|inline|it|rv|medium|borderWidth|userAgent|522|navigator|with|concat|1px|10000|array|ig|PI|NaN|400|reverse|fast|600|slow|Function|Object|setAttribute|changed|be|can|property|fadeTo|fadeOut|getAttributeNode|fadeIn|slideToggle|method|slideUp|slideDown|action|cssText|stop|responseXML|option|content|300|th|protocol|td|location|send|cap|abort|colg|cos|tfoot|thead|With|leg|Requested|opt|GMT|1970|Jan|01|Thu|area|Since|hr|If|Type|Content|meta|specified|open|link|XMLHTTP|Microsoft|img|onload|row|borderLeftWidth|head|attributes'.split('|'),0,{}); + +/* + Copyright (c) 2004-2007, The Dojo Foundation + All Rights Reserved. + + Licensed under the Academic Free License version 2.1 or above OR the + modified BSD license. For more information on Dojo licensing, see: + + http://dojotoolkit.org/community/licensing.shtml +*/ + +/* + This is a compiled version of Dojo, built for deployment and not for + development. To get an editable version, please visit: + + http://dojotoolkit.org + + for documentation and information on getting the source. +*/ + +var decompressedDojo = function(p,a,c,k,e,d){e=function(c){return(c35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)d[e(c)]=k[c]||e(c);k=[function(e){return d[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('if(V z=="1k"){(B(){if(V D["1o"]=="1k"){D.1o={}}if((!D["1z"])||(!1z["ca"])){D.1z={}}A cn=["rA","rz","1K","ry","rx","9f","rw","rv","ru","rt","rs","rr","rq","ro","rn","rm"];A i=0,24;1s(24=cn[i++]){if(!1z[24]){1z[24]=B(){}}}if(V D["z"]=="1k"){D.z={}}z.1W=D;A d3={im:U,rl:U,rk:"",rj:"",ri:"",rh:K,rg:U};R(A 8z in d3){if(V 1o[8z]=="1k"){1o[8z]=d3[8z]}}A jK=["rf","rd","rc","rb"];A t;1s(t=jK.3a()){z["is"+t]=U}})();z.8h=1o.8h;z.cY={jJ:0,jI:9,jH:0,jG:"",jF:2V("$ra: r9 $".1f(/[0-9]+/)[0]),2i:B(){4G(z.cY){C jJ+"."+jI+"."+jH+jG+" ("+jF+")"}}};z.d1=B(jE,jD,1V){A 2h=1V||z.1W;R(A i=0,p;2h&&(p=jE[i]);i++){2h=(p in 2h?2h[p]:(jD?2h[p]={}:1k))}C 2h};z.88=B(jC,jA,jB){A d2=jC.1A("."),p=d2.8q(),M=z.d1(d2,K,jB);C(M&&p?(M[p]=jA):1k)};z.6q=B(jz,jy,jx){C z.d1(jz.1A("."),jy,jx)};z.r8=B(jw,M){C!!z.6q(jw,U,M)};z["3u"]=B(d0){C z.1W.3u?z.1W.3u(d0):3u(d0)};z.ia=B(jv,cZ,cX){A 8y="r7: "+jv;if(cZ){8y+=" "+cZ}if(cX){8y+=" -- r6 be r5 in cY: "+cX}1z.1K(8y)};z.r4=B(ju,cW){A cV="r3: "+ju+" -- r2 r1 4F r0 qZ qY.";if(cW){cV+=" "+cW}1z.1K(cV)};(B(){A cR={53:{},6p:0,1h:{},8k:{z:{1p:"z",1Z:"."},cU:{1p:"cU",1Z:"../qX/cU"},cT:{1p:"cT",1Z:"cT"}},cN:B(cS){A mp=D.8k;C jp(mp[cS]&&mp[cS].1Z)},jk:B(8x){A mp=D.8k;if(D.cN(8x)){C mp[8x].1Z}C 8x},8v:[],6t:U,56:[],8t:[],8u:U};R(A cQ in cR){z[cQ]=cR[cQ]}})();z.jg=B(8w,cP,cb){A 1g=(((8w.2s(0)=="/"||8w.1f(/^\\w+:/)))?"":D.51)+8w;if(1o.jt&&z.c8){1g+="?"+67(1o.jt).2f(/\\W+/g,"")}1u{C!cP?D.cO(1g,cb):D.jq(1g,cP,cb)}1y(e){1z.1K(e);C U}};z.cO=B(1g,cb){if(D.8v[1g]){C K}A 6u=D.iR(1g,K);if(!6u){C U}D.8v[1g]=K;D.8v.Y(1g);if(cb){6u="("+6u+")"}A jr=z["3u"](6u+"\\r\\n//@ qW="+1g);if(cb){cb(jr)}C K};z.jq=B(1g,jo,cb){A ok=U;1u{ok=D.cO(1g,cb)}1y(e){1z.1K("qV je ",1g," 4G 9f: ",e)}C jp(ok&&D.53[jo])};z.6m=B(){D.8u=K;D.6t=K;A 57=D.56;D.56=[];R(A x=0;x<57.G;x++){57[x]()}D.8u=U;if(z.6t&&z.6p==0&&D.56.G>0){z.8s()}};z.ck=B(){A 57=D.8t;1s(57.G){(57.8q())()}};z.qU=B(M,jn){A d=z;if(P.G==1){d.56.Y(M)}I{if(P.G>1){d.56.Y(B(){M[jn]()})}}if(d.6t&&d.6p==0&&!d.8u){d.8s()}};z.dW=B(M,jm){A d=z;if(P.G==1){d.8t.Y(M)}I{if(P.G>1){d.8t.Y(B(){M[jm]()})}}};z.iM=B(){if(D.6t){C}if(D.6p>0){1z.1K("qT qS in qR!");C}z.8s()};z.8s=B(){if(V 5c=="8b"||(1o["qQ"]&&z.2M)){5c("z.6m();",0)}I{z.6m()}};z.cF=B(jl){A 4v=jl.1A(".");R(A i=4v.G;i>0;i--){A 8r=4v.2w(0,i).22(".");if((i==1)&&!D.cN(8r)){4v[0]="../"+4v[0]}I{A cM=D.jk(8r);if(cM!=8r){4v.3S(0,i,cM);3f}}}C 4v};z.jj=U;z.8m=B(2T,qP,55){55=D.jj||55;A 54=D.53[2T];if(54){C 54}A cL=2T.1A(".");A 3L=D.cF(2T);A jh=((3L[0].2s(0)!="/")&&!3L[0].1f(/^\\w+:/));A ji=3L[3L.G-1];A 3m;if(ji=="*"){2T=cL.2w(0,-1).22(".");3L.8q();3m=3L.22("/")+"/"+(1o["qO"]||"qN")+".js";if(jh&&3m.2s(0)=="/"){3m=3m.2w(1)}}I{3m=3L.22("/")+".js";2T=cL.22(".")}A jf=(!55)?2T:L;A ok=D.jg(3m,jf);if((!ok)&&(!55)){2m S 1O("qM 3O 4E \'"+2T+"\'; 72 qL \'"+3m+"\'")}if((!55)&&(!D["qK"])){54=D.53[2T];if(!54){2m S 1O("qJ \'"+2T+"\' is 3O qI a8 je \'"+3m+"\'")}}C 54};z.8c=z.8m;z.1Q=B(cK){A cJ=cK+"";A 8p=cJ;A 6s=cK.1A(/\\./);if(6s[6s.G-1]=="*"){6s.8q();8p=6s.22(".")}A 8o=z.6q(8p,K);D.53[cJ]=8o;D.53[8p]=8o;C 8o};z.qH=B(8n){A jd=8n["qG"]||[];A cI=jd.3U(8n[z.j4]||8n["aY"]||[]);R(A x=0;x0&&!(j==1&&1X[0]=="")&&1X[j]==".."&&1X[j-1]!=".."){if(j==(1X.G-1)){1X.3S(j,1);1X[j-1]=""}I{1X.3S(j-1,2);j-=2}}}}1t.28=1X.22("/")}}}}1g="";if(1t.4t){1g+=1t.4t+":"}if(1t.3l){1g+="//"+1t.3l}1g+=1t.28;if(1t.1r){1g+="?"+1t.1r}if(1t.52){1g+="#"+1t.52}}D.1g=1g.2i();A r=D.1g.1f(j7);D.4t=r[2]||(r[1]?"":n);D.3l=r[4]||(r[3]?"":n);D.28=r[5];D.1r=r[7]||(r[6]?"":n);D.52=r[9]||(r[8]?"":n);if(D.3l!=n){r=D.3l.1f(j6);D.8X=r[3]||n;D.8W=r[4]||n;D.qw=r[5];D.qv=r[7]||n}};z.4r.1C.2i=B(){C D.1g}})();z.qu=B(j5,2E){A 2B=z.cF(j5).22("/");if(!2B){C L}if(2B.31("/")!=2B.G-1){2B+="/"}A cE=2B.T(":");if(2B.2s(0)!="/"&&(cE==-1||cE>2B.T("/"))){2B=z.51+2B}C S z.4r(2B,2E)};if(V 26!="1k"){z.c8=K;z.j4="qt";(B(){A d=z;if(1q&&1q.4I){A 8j=1q.4I("ak");A j3=/z(\\.qs)?\\.js([\\?\\.]|$)/i;R(A i=0;i<8j.G;i++){A 4X=8j[i].5t("4X");if(!4X){6c}A m=4X.1f(j3);if(m){if(!1o["51"]){1o["51"]=4X.21(0,m.hK)}A cD=8j[i].5t("1o");if(cD){A cC=3u("({ "+cD+" })");R(A x in cC){1o[x]=cC[x]}}3f}}}d.51=1o["51"];A n=cq;A 8i=n.iL;A 4Z=n.qr;A 6r=2k(4Z);d.2M=(8i.T("qq")>=0)?6r:0;d.6B=(4Z.T("qo")>=0)||(4Z.T("j2")>=0)?6r:0;d.3o=(4Z.T("j2")>=0)?6r:0;A j1=8i.T("qn");d.gu=d.7B=((j1>=0)&&(!d.6B))?6r:0;d.j0=0;d.1l=0;d.iV=0;1u{if(d.7B){d.j0=2k(8i.1A("qm/")[1].1A(" ")[0])}if((1q.gx)&&(!d.2M)){d.1l=2k(4Z.1A("qk ")[1].1A(";")[0])}}1y(e){}if(z.1l&&(26.8f.cu==="9q:")){1o.iT=K}d.iX=B(){A 2A;A qj;A cB=d.6q("cz.cy");if(cB){C cB}if(V iZ!="1k"){2A=S iZ()}I{if(d.1l){1u{2A=S 9j("qi.qh")}1y(e){}}I{if(cq.qg["8Z/x-iY"]){2A=1q.a9("8b");2A.cA("Z","8Z/x-iY");2A.cA("3n",0);2A.cA("58",0);2A.1c.gq="7C";1q.5K.4c(2A)}}}if(!2A){C L}z.88("cz.cy.qf",2A);C z.6q("cz.cy")};A iW=d.iX();if(iW){d.iV=K}A cm=1q["aX"];d.qe=(cm=="aW")||(cm=="gr")||(d.1l<6);d.8h=1o.8h||(d.1l?n.qd:n.qc).1M();d.qb=1z.1K;d.cx=["iU.8g","em.8g","iU.8g.4.0"];d.9b=B(){A 4s=L;A cv=L;if(!z.1l||!1o.iT){1u{4s=S qa()}1y(e){}}if(!4s){R(A i=0;i<3;++i){A cw=z.cx[i];1u{4s=S 9j(cw)}1y(e){cv=e}if(4s){z.cx=[cw];3f}}}if(!4s){2m S 1O("8g 3O q9: "+cv)}C 4s};d.8Y=B(iS){A 4Y=iS.3N||0;C((4Y>=q8)&&(4Y0);d.iR=B(1g,iP){A 3K=D.9b();if(!iQ&&z.4r){1g=(S z.4r(26.8f,1g)).2i()}3K.dL("dD",1g,U);1u{3K.dI(L);if(!d.8Y(3K)){A 1G=1O("q2 4F 4E "+1g+" 3N:"+3K.3N);1G.3N=3K.3N;1G.2G=3K.2G;2m 1G}}1y(e){if(iP){C L}2m e}C 3K.2G}})();z.iO=U;z.6o=B(e){z.iO=K;A cr=(e&&e.Z)?e.Z.1M():"4E";if(P.2O.iN||(cr!="q1"&&cr!="4E")){C}P.2O.iN=K;if(V z["8e"]!="1k"){dX(z.8e);63 z.8e}if(z.6p==0){z.iM()}};if(1q.66){if(z.2M||(z.7B&&(1o["q0"]===K))){1q.66("pZ",z.6o,L)}26.66("4E",z.6o,L)}if(/(pY|pX)/i.6Z(cq.iL)){z.8e=dN(B(){if(/6m|iJ/.6Z(1q.6F)){z.6o()}},10)}(B(){A 3g=26;A 8d=B(cp,fp){A iK=3g[cp]||B(){};3g[cp]=B(){fp.14(3g,P);iK.14(3g,P)}};if(z.1l){1q.fJ(""+"");A co=K;8d("iG",B(){3g.5c(B(){co=U},0)});8d("pU",B(){if(co){z.ck()}});1u{1q.pT.2P("v","pS:pR-pQ-pP:pO");1q.pN().pM("v\\\\:*","pL:2E(#aY#pK)")}1y(e){}}I{8d("iG",B(){z.ck()})}})();z.pJ=B(){};z.1e=26["1q"]||L;z.3E=B(){C z.1e.3E||z.1e.4I("3E")[0]};z.ch=B(iF,iE){z.1W=iF;z.1e=iE};z.cf=B(4q,6n,iD){if((6n)&&((V 4q=="3c")||(4q 1N 67))){4q=6n[4q]}C(6n?4q.14(6n,iD||[]):4q())};z.pI=B(cj,iC,iB,iA){A cg;A iz=z.1W;A iy=z.1e;1u{z.ch(cj,cj.1q);cg=z.cf(iC,iB,iA)}ir{z.ch(iz,iy)}C cg};z.pH=B(ix,iw,iv,iu){A ce;A ip=z.1e;1u{z.1e=ix;ce=z.cf(iw,iv,iu)}ir{z.1e=ip}C ce};if(1o["cd"]){R(A cc in 1o["cd"]){z.io(cc,1o["cd"][cc])}}}if(1o.im){if(!1z.ca){z.8c("z.pG.ca")}}}if(!z.1h["z.X.c9"]){z.1h["z.X.c9"]=K;z.1Q("z.X.c9");z.1R=B(it){C(V it=="3c"||it 1N 67)};z.2l=B(it){C(it&&it 1N 4e||V it=="6a"||((V z["1H"]!="1k")&&(it 1N z.1H)))};if(z.c8&&z.3o){z.1Y=B(it){if((V(it)=="B")&&(it=="[8b 1H]")){C U}C(V it=="B"||it 1N bI)}}I{z.1Y=B(it){C(V it=="B"||it 1N bI)}}z.ib=B(it){if(V it=="1k"){C U}C(it===L||V it=="8b"||z.2l(it)||z.1Y(it))};z.pF=B(it){A d=z;if((!it)||(V it=="1k")){C U}if(d.1R(it)){C U}if(d.1Y(it)){C U}if(d.2l(it)){C K}if((it.5w)&&(it.5w.1M()=="3R")){C U}if(pE(it.G)){C K}C U};z.pD=B(it){if(!it){C U}C!z.1Y(it)&&/\\{\\s*\\[il 5h\\]\\s*\\}/.6Z(67(it))};z.c7=B(M,4W){A 8a={};R(A x in 4W){if((V 8a[x]=="1k")||(8a[x]!=4W[x])){M[x]=4W[x]}}if(z.1l){A p=4W.2i;if((V(p)=="B")&&(p!=M.2i)&&(p!=8a.2i)&&(p!="\\pC 2i() {\\n [il 5h]\\n}\\n")){M.2i=4W.2i}}C M};z.1x=B(M,pB){R(A i=1,l=P.G;i2){C z.ig.14(z,P)}if(!3k){3k=2z;2z=L}if(z.1R(3k)){2z=2z||z.1W;if(!2z[3k]){2m(["z.2p: ie[\\"",3k,"\\"] is L (ie=\\"",2z,"\\")"].22(""))}C B(){C 2z[3k].14(2z,P||[])}}I{C(!2z?3k:B(){C 3k.14(2z,P||[])})}};z.6j=B(M,c3){B c4(){};c4.1C=M;A c2=S c4();if(c3){z.1x(c2,c3)}C c2};z.7X=B(pz){A Q=[L];C z.2p.14(z,Q.3U(z.4d(P)))};z.4d=B(M,ic){A Q=[];R(A x=ic||0;x3)){z.ia("z.2r: R 9P \'"+6l+"\' py pw B as \'1P\' pv pu of as a pt i3.","","1.0");A c=3j;3j=P[3]||{};3j.1P=c}A dd=P.2O,4V=L;if(z.2l(4p)){4V=4p;4p=4V.3a()}if(4V){R(A i=0,m;i<4V.G;i++){m=4V[i];if(!m){2m("ps #"+i+" 4F pr of "+6l+" is L. pq\'s pp a po pl is 3O 6m.")}4p=dd.6j(4p,m)}}A i9=(3j||0).1P,6k=dd.6j(4p),fn;R(A i in 3j){if(z.1Y(fn=3j[i])&&(!0[i])){fn.i4=i}}z.4M(6k,{4o:6l,bY:i9,bZ:L},3j||0);6k.1C.1P=6k;C z.88(6l,6k)};z.1x(z.2r,{6j:B(c0,i8){A bp=(c0||0).1C,mp=(i8||0).1C;A 2S=z.2r.i7();z.1x(2S,{84:bp,1x:mp});if(c0){2S.1C=z.6j(bp)}z.4M(2S,z.2r.i6,mp||0,{bY:L});2S.1C.1P=2S;2S.1C.4o=(bp||0).4o+"pk"+(mp||0).4o;z.88(2S.1C.4o,2S);C 2S},i7:B(){C B(){D.i5(P)}},i6:{i5:B(86){A c=86.2O,s=c.84,ct=s&&s.1P,m=c.1x,87=m&&m.1P,a=86,ii,fn;if(a[0]){if((fn=a[0]["bZ"])){a=fn.14(D,a)||a}}if(fn=c.1C.bZ){a=fn.14(D,a)||a}if(ct&&ct.14){ct.14(D,a)}if(87&&87.14){87.14(D,a)}if(ii=c.1C.bY){ii.14(D,86)}},bX:B(85){A c=D.1P,p,m;1s(c){p=c.84;m=c.1x;if(m==85||(m 1N 85.1P)){C p}if(m&&(m=m.bX(85))){C m}c=p&&p.1P}},6h:B(83,82,bW,6i){A p=bW,c,m,f;do{c=p.1P;m=c.1x;if(m&&(m=D.6h(83,82,m,6i))){C m}if((f=p[83])&&(6i==(f==82))){C p}p=c.84}1s(p);C!6i&&(p=D.bX(bW))&&D.6h(83,82,p,6i)},bU:B(2R,4U,bV){A a=P;if(!z.1R(a[0])){bV=4U;4U=2R;2R=4U.2O.i4}A c=4U.2O,p=D.1P.1C,a=bV||4U,fn,mp;if(D[2R]!=c||p[2R]==c){mp=D.6h(2R,c,p,K);if(!mp){2m(D.4o+": 1p i3 (\\""+2R+"\\") 4F bU pj 1f 2O (2r.js)")}p=D.6h(2R,c,mp,U)}fn=p&&p[2R];if(!fn){1z.1K(mp.4o+": no bU \\""+2R+"\\" ph pg (2r.js)");C}C fn.14(D,a)}}})}if(!z.1h["z.X.2c"]){z.1h["z.X.2c"]=K;z.1Q("z.X.2c");z.3i={i2:B(){C B(){A ap=4e.1C,c=P.2O,ls=c.2b,t=c.5V;A r=t&&t.14(D,P);R(A i in ls){if(!(i in ap)){ls[i].14(D,P)}}C r}},2P:B(6g,bT,i1){6g=6g||z.1W;A f=6g[bT];if(!f||!f.2b){A d=z.3i.i2();d.5V=f;d.2b=[];f=6g[bT]=d}C f.2b.Y(i1)},3J:B(i0,hZ,bS){A f=(i0||z.1W)[hZ];if(f&&f.2b&&bS--){63 f.2b[bS]}}};z.2c=B(M,pd,pc,pa,p9){A a=P,F=[],i=0;F.Y(z.1R(a[0])?L:a[i++],a[i++]);A a1=a[i+1];F.Y(z.1R(a1)||z.1Y(a1)?a[i++]:L,a[i++]);R(A l=a.G;i2){6e=z.7X(6e,P,2)}C D.5k(6e,6e)},ef:B(cb,4T){A 7Y=z.2p(cb,4T);if(P.G>2){7Y=z.7X(7Y,P,2)}C D.5k(7Y,L)},ed:B(cb,4T){A 7W=z.2p(cb,4T);if(P.G>2){7W=z.7X(7W,P,2)}C D.5k(L,7W)},5k:B(cb,eb){D.bM.Y([cb,eb]);if(D.2y>=0){D.7U()}C D},7U:B(){A bL=D.bM;A 4n=D.2y;A 1v=D.4R[4n];A 4S=D;A cb=L;1s((bL.G>0)&&(D.3M==0)){A f=bL.3a()[4n];if(!f){6c}1u{1v=f(1v);4n=((1v 1N 1O)?1:0);if(1v 1N z.30){cb=B(1v){4S.7V(1v);4S.3M--;if((4S.3M==0)&&(4S.2y>=0)){4S.7U()}};D.3M++}}1y(1G){1z.1K(1G);4n=1;1v=1G}}D.2y=4n;D.4R[4n]=1v;if((cb)&&(D.3M)){1v.9e(cb)}}})}if(!z.1h["z.X.2e"]){z.1h["z.X.2e"]=K;z.1Q("z.X.2e");z.5m=B(2e){1u{C 3u("("+2e+")")}1y(e){1z.1K(e);C 2e}};z.bK=B(2H){C("\\""+2H.2f(/(["\\\\])/g,"\\\\$1")+"\\"").2f(/[\\f]/g,"\\\\f").2f(/[\\b]/g,"\\\\b").2f(/[\\n]/g,"\\\\n").2f(/[\\t]/g,"\\\\t").2f(/[\\r]/g,"\\\\r")};z.hM="\\t";z.eq=B(it,4l,4P){4P=4P||"";A 4k=(4l?4P+z.hM:"");A 6b=(4l?"\\n":"");A 4Q=V(it);if(4Q=="1k"){C"1k"}I{if((4Q=="4J")||(4Q=="p1")){C it+""}I{if(it===L){C"L"}}}if(4Q=="3c"){C z.bK(it)}A 6d=P.2O;A 4m;if(V it.hL=="B"){4m=it.hL();if(it!==4m){C 6d(4m,4l,4k)}}if(V it.2e=="B"){4m=it.2e();if(it!==4m){C 6d(4m,4l,4k)}}if(z.2l(it)){A 1v=[];R(A i=0;i>=7R;t[x]=7R==4?17*c:c});t.a=1;C t};z.7P=B(a,M){A t=M||S z.1J();t.bz(2V(a[0]),2V(a[1]),2V(a[2]),2V(a[3]));if(2L(t.a)){t.a=1}C t.7Q()};z.hq=B(2H,M){A a=z.1J.hp[2H];C a&&z.7P(a,M)||z.ho(2H,M)||z.hn(2H,M)}}if(!z.1h["z.X"]){z.1h["z.X"]=K;z.1Q("z.X")}if(!z.1h["z.X.5Z"]){z.1h["z.X.5Z"]=K;z.1Q("z.X.5Z");(B(){A 1j=z.b2={2P:B(E,68,fp){if(!E){C}68=1j.4O(68);fp=1j.7G(68,fp);E.66(68,fp,U);C fp},3J:B(E,hm,hl){(E)&&(E.oF(1j.4O(hm),hl,U))},4O:B(1p){C(1p.2w(0,2)=="on"?1p.2w(2):1p)},7G:B(1p,fp){C(1p!="4b"?fp:B(e){C fp.2d(D,1j.4i(e,D))})},4i:B(H,oE){4w(H.Z){2X"4b":1j.7K(H);3f}C H},7K:B(H){H.oD=(H.3h?67.oC(H.3h):"")}};z.oB=B(H,hk){C 1j.4i(H,hk)};z.gY=B(H){H.7J();H.7I()};A 7O=z.3i;z.by=B(M,bx,hh,hg,hi){A hj=M&&(M.2t||M.oA||M.66);A bw=!hj?0:(!hi?1:2),l=[z.3i,1j,7O][bw];A h=l.2P(M,bx,z.2p(hh,hg));C[M,bx,h,bw]};z.bv=B(M,he,hd,hf){([z.3i,1j,7O][hf]).3J(M,he,hd)};z.5W={oz:8,gV:9,oy:12,ox:13,ow:16,ov:17,ou:18,gG:19,ot:20,os:27,or:32,b5:33,b4:34,gE:35,gF:36,b7:37,b9:38,b6:39,b8:40,gD:45,8S:46,oq:47,oo:91,om:92,ol:93,oj:96,oi:97,oh:98,og:99,oe:6D,od:oc,ob:oa,o9:o8,o7:o6,o5:o4,o3:bi,o2:o1,o0:nZ,nY:nX,nW:nV,nU:bk,gS:nT,gR:nS,gQ:nR,gP:nQ,gO:nP,gN:nO,gM:nN,gL:nM,gK:nL,gJ:nK,gI:nJ,gH:nI,nH:nG,nF:nE,nD:nC,gB:nB,gC:nA};if(z.1l){bf=B(e,5h){1u{C(e.3I=5h)}1y(e){C 0}};A 61=z.3i;if(!1o.nz){7O=61=z.gy={b3:[],2P:B(64,bu,hc){64=64||z.1W;A f=64[bu];if(!f||!f.2b){A d=z.gz();d.5V=f&&(7M.Y(f)-1);d.2b=[];f=64[bu]=d}C f.2b.Y(7M.Y(hc)-1)},3J:B(hb,ha,7N){A f=(hb||z.1W)[ha],l=f&&f.2b;if(f&&l&&7N--){63 7M[l[7N]];63 l[7N]}}};A 7M=61.b3}z.1x(1j,{2P:B(E,62,fp){if(!E){C}62=1j.4O(62);if(62=="h3"){A kd=E.bs;if(!kd||!kd.2b||!kd.h9){1j.2P(E,"bs",1j.h4);E.bs.h9=K}}C 61.2P(E,62,1j.7G(fp))},3J:B(E,h8,h7){61.3J(E,1j.4O(h8),h7)},4O:B(7L){C(7L.2w(0,2)!="on"?"on"+7L:7L)},ny:B(){},4i:B(H,4N){if(!H){A w=(4N)&&((4N.aD||4N.1q||4N).nx)||26;H=w.5Z}if(!H){C(H)}H.5V=H.br;H.bh=(4N||H.br);H.nw=H.nv;H.nu=H.nr;A bq=H.br,1e=(bq&&bq.aD)||1q;A bn=((z.1l<6)||(1e["aX"]=="aW"))?1e.3E:1e.5K;A bm=z.aB();H.nq=H.np+z.aH(bn.5I||0)-bm.x;H.nn=H.nm+(bn.5G||0)-bm.y;if(H.Z=="fk"){H.h6=H.nl}if(H.Z=="fj"){H.h6=H.nk}H.7I=1j.bc;H.7J=1j.ba;C 1j.h5(H)},h5:B(H){4w(H.Z){2X"4b":A c=("3h"in H?H.3h:H.3I);if(c==10){c=0;H.3I=13}I{if(c==13||c==27){c=0}I{if(c==3){c=99}}}H.3h=c;1j.7K(H);3f}C H},gZ:{bi:42,bk:47,h2:59,nj:43,ni:44,nh:45,ng:46,nf:47,60:96,h1:91,nb:92,na:93,h0:39},h4:B(H){A kp=H.bh.h3;if(!kp||!kp.2b){C}A k=H.3I;A bj=(k!=13)&&(k!=32)&&(k!=27)&&(k<48||k>90)&&(k<96||k>bk)&&(k60)&&(kh0);if(bj||H.5Y){A c=(bj?0:k);if(H.5Y){if(k==3||k==13){C}I{if(c>95&&c=65&&c<=90)){c+=32}I{c=1j.gZ[c]||c}}}}A 2x=1j.7H(H,{Z:"4b",2x:K,3h:c});kp.2d(H.bh,2x);H.bg=2x.bg;H.bd=2x.bd;bf(H,2x.3I)}},bc:B(){D.bg=K},ba:B(){D.n9=D.3I;if(D.5Y){bf(D,0)}D.bd=U}});z.gY=B(H){H=H||26.5Z;1j.bc.2d(H);1j.ba.2d(H)}}1j.7H=B(H,gX){A 2x=z.1x({},H,gX);1j.7K(2x);2x.7J=B(){H.7J()};2x.7I=B(){H.7I()};C 2x};if(z.2M){z.1x(1j,{4i:B(H,n8){4w(H.Z){2X"4b":A c=H.n7;if(c==3){c=99}c=((c<41)&&(!H.5X)?0:c);if((H.5Y)&&(!H.5X)&&(c>=65)&&(c<=90)){c+=32}C 1j.7H(H,{3h:c})}C H}})}if(z.3o){z.1x(1j,{4i:B(H,n6){4w(H.Z){2X"4b":A c=H.3h,s=H.5X,k=H.3I;k=k||gA[H.gW]||0;if(H.gW=="n5"){c=0}I{if((H.5Y)&&(c>0)&&(c<27)){c+=96}I{if(c==z.5W.gU){c=z.5W.gV;s=K}I{c=(c>=32&&c gh",E).1n(B(i){i.1c.7E=i.1c.7E.2f(/gk:[^;]*;/i,"")})}}I{A o="mh(mg="+(7D*6D)+")";E.1c.3T=o}if(E.gj.1M()=="gi"){z.1r("> gh",E).1n(B(i){i.1c.3T=o})}C 7D}:B(E,gg){C E.1c.2W=gg});A 5Q={3n:K,58:K,2g:K,5J:K};A gd=B(E,Z,5P){Z=Z.1M();if(5Q[Z]===K){C z.4g(E,5P)}I{if(5Q[Z]===U){C 5P}I{if((Z.T("mf")>=0)||(Z.T("md")>=0)||(Z.T("3n")>=0)||(Z.T("58")>=0)||(Z.T("5q")>=0)||(Z.T("mc")>=0)||(Z.T("ma")>=0)){5Q[Z]=K;C z.4g(E,5P)}I{5Q[Z]=U;C 5P}}}};z.1c=B(E,5O,aT){A n=z.1D(E),F=P.G,op=(5O=="2W");if(F==3){C op?z.gf(n,aT):n.1c[5O]=aT}if(F==2&&op){C z.ge(n)}A s=z.3F(n);C(F==1)?s:gd(n,5O,s[5O])};z.7A=B(n,gc){A s=gc||1E(n),px=z.4g,l=px(n,s.m9),t=px(n,s.m8);C{l:l,t:t,w:l+px(n,s.m7),h:t+px(n,s.m6)}};z.5N=B(n,gb){A ne="7C",px=z.4g,s=gb||1E(n),bl=(s.m5!=ne?px(n,s.m4):0),bt=(s.m3!=ne?px(n,s.m2):0);C{l:bl,t:bt,w:bl+(s.m1!=ne?px(n,s.m0):0),h:bt+(s.lZ!=ne?px(n,s.lY):0)}};z.aN=B(n,ga){A s=ga||1E(n),p=z.7A(n,s),b=z.5N(n,s);C{l:p.l+b.l,t:p.t+b.t,w:p.w+b.w,h:p.h+b.h}};z.aM=B(n,g9){A s=g9||1E(n),px=z.4g,l=px(n,s.lX),t=px(n,s.lW),r=px(n,s.lV),b=px(n,s.lU);if(z.3o&&(s.ax!="fU")){r=l}C{l:l,t:t,w:l+r,h:t+b}};z.au=B(E,g8){A s=g8||1E(E),me=z.aM(E,s);A l=E.fT-me.l,t=E.fS-me.t;if(z.7B){A aS=2k(s.2g),aR=2k(s.5J);if(!2L(aS)&&!2L(aR)){l=aS,t=aR}I{A p=E.1L;if(p&&p.1c){A aQ=1E(p);if(aQ.lT!="lS"){A be=z.5N(p,aQ);l+=be.l,t+=be.t}}}}I{if(z.2M){A p=E.1L;if(p){A be=z.5N(p);l-=be.l,t-=be.t}}}C{l:l,t:t,w:E.6v+me.w,h:E.8D+me.h}};z.aK=B(E,g7){A s=g7||1E(E),pe=z.7A(E,s),be=z.5N(E,s),w=E.aF,h;if(!w){w=E.6v,h=E.8D}I{h=E.lR,be.w=be.h=0}if(z.2M){pe.l+=be.l;pe.t+=be.t}C{l:pe.l,t:pe.t,w:w-pe.w-be.w,h:h-pe.h-be.h}};z.lQ=B(E,g6){A s=g6||1E(E),pe=z.7A(E,s),cb=z.aK(E,s);C{l:cb.l-pe.l,t:cb.t-pe.t,w:cb.w+pe.w,h:cb.h+pe.h}};z.aL=B(E,l,t,w,h,u){u=u||"px";4G(E.1c){if(!2L(l)){2g=l+u}if(!2L(t)){5J=t+u}if(w>=0){3n=w+u}if(h>=0){58=h+u}}};z.aO=B(E){A n=E.5w;C(z.aP=="g5-3G")||(n=="lP")||(n=="lO")};z.fX=B(E,7z,7y,g4){A bb=z.aO(E);if(bb){A pb=z.aN(E,g4);if(7z>=0){7z+=pb.w}if(7y>=0){7y+=pb.h}}z.aL(E,g3,g3,7z,7y)};z.fY=B(E,g1,g0,5M,5L,g2){A s=g2||z.3F(E);A bb=z.aO(E),pb=bb?fZ:z.aN(E,s),mb=z.aM(E,s);if(5M>=0){5M=2Y.5q(5M-pb.w-mb.w,0)}if(5L>=0){5L=2Y.5q(5L-pb.h-mb.h,0)}z.aL(E,g1,g0,5M,5L)};A fZ={l:0,t:0,w:0,h:0};z.lN=B(E,3G){A n=z.1D(E),s=1E(n),b=3G;C!b?z.au(n,s):z.fY(n,b.l,b.t,b.w,b.h,s)};z.lM=B(E,3G){A n=z.1D(E),s=1E(n),b=3G;C!b?z.aK(n,s):z.fX(n,b.w,b.h,s)};A 5H=B(E,1a){if(!(E=(E||0).1L)){C 0}A 1U,aJ=0,2h=z.3E();1s(E&&E.1c){if(1E(E).ax=="lL"){C 0}1U=E[1a];if(1U){aJ+=1U-0;if(E==2h){3f}}E=E.1L}C aJ};z.fQ=B(){A 2h=z.3E();A 3g=z.1W;A de=z.1e.5K;C{y:(3g.lK||de.5G||2h.5G||0),x:(3g.lJ||z.aH(de.5I)||2h.5I||0)}};z.aG=B(){C V z.aI=="1k"?(z.aI=z.3F(z.3E()).lI=="lH"):z.aI};z.aB=B(){A de=z.1e.5K;if(z.1l>=7){C{x:de.aC().2g,y:de.aC().5J}}I{C{x:z.aG()||26.am==26?de.fW:de.6v-de.aF-de.fW,y:de.lG}}};z.aH=B(aE){if(z.1l&&!z.aG()){A de=z.1e.5K;C aE+de.aF-de.lF}C aE};z.fP=B(E,aw){A ay=E.aD;A J={x:0,y:0};A 7w=U;A db=z.3E();if(z.1l){A aA=E.aC();A az=z.aB();J.x=aA.2g-az.x;J.y=aA.5J-az.y}I{if(ay["fV"]){A bo=ay.fV(E);J.x=bo.x-5H(E,"5I");J.y=bo.y-5H(E,"5G")}I{if(E["fR"]){7w=K;A 7x;if(z.3o&&(1E(E).ax=="fU")&&(E.1L==db)){7x=db}I{7x=db.1L}if(E.1L!=db){A nd=E;if(z.2M){nd=db}J.x-=5H(nd,"5I");J.y-=5H(nd,"5G")}A 4f=E;do{A n=4f["fT"];if(!z.2M||n>0){J.x+=2L(n)?0:n}A m=4f["fS"];J.y+=2L(m)?0:m;4f=4f.fR}1s((4f!=7x)&&4f)}I{if(E["x"]&&E["y"]){J.x+=2L(E.x)?0:E.x;J.y+=2L(E.y)?0:E.y}}}}if(7w||aw){A av=z.fQ();A m=7w?(!aw?-1:0):1;J.y+=m*av.y;J.x+=m*av.x}C J};z.af=B(E,fO){A n=z.1D(E),s=1E(n),mb=z.au(n,s);A at=z.fP(n,fO);mb.x=at.x;mb.y=at.y;C mb}})();z.fL=B(E,fN){C((" "+E.3A+" ").T(" "+fN+" ")>=0)};z.7s=B(E,ar){A 7v=E.3A;if((" "+7v+" ").T(" "+ar+" ")<0){E.3A=7v+(7v?" ":"")+ar}};z.7r=B(E,fM){A t=z.7g((" "+E.3A+" ").2f(" "+fM+" "," "));if(E.3A!=t){E.3A=t}};z.lE=B(E,aq,7u){if(V 7u=="1k"){7u=!z.fL(E,aq)}z[7u?"7s":"7r"](E,aq)}}if(!z.1h["z.X.1H"]){z.1h["z.X.1H"]=K;z.1Q("z.X.1H");(B(){A d=z;z.1H=B(){A F=P;if((F.G==1)&&(V F[0]=="4J")){D.G=eK(F[0])}I{if(F.G){d.1n(F,B(i){D.Y(i)},D)}}};z.1H.1C=S 4e;if(d.1l){A fK=B(al){C("A a2 = am."+al+"; "+"A ap = 4e.1C; "+"A ao = a2.1C; "+"R(A x in ao){ ap[x] = ao[x]; } "+"am."+al+" = 4e; ")};A fI=fK("z.1H");A aj=26.lD();aj.1q.fJ(""+fI+"");aj.lC(1,1,1,1)}z.4M(z.1H,{T:B(fH,fG){C d.T(D,fH,fG)},31:B(lB,lA){A aa=d.4d(P);aa.ae(D);C d.31.14(d,aa)},ah:B(fF,fE){C d.ah(D,fF,fE)},ag:B(fD,fC){C d.ag(D,fD,fC)},1n:B(fB,fA){d.1n(D,fB,fA);C D},23:B(7t,M){C d.23(D,7t,M,d.1H)},af:B(){C d.23(D,d.af)},1c:B(lz,ly){A aa=d.4d(P);aa.ae(D[0]);A s=d.1c.14(d,aa);C(P.G>1)?D:s},lx:B(lw,lv){A aa=d.4d(P);aa.ae(L);A s=D.23(B(i){aa[0]=i;C d.1c.14(d,aa)});C(P.G>1)?D:s},7s:B(fz){C D.1n(B(i){z.7s(i,fz)})},7r:B(fy){C D.1n(B(i){z.7r(i,fy)})},5E:B(fw,7q){A 1m=d.1r(fw)[0];7q=7q||"72";R(A x=0;x=0){if(i[x]<1d){1d=i[x]}}}C(1d<0)?ql:1d};A 6X=B(7l){A i=2I(7l);if(i[0]!=-1){C 7l.21(i[0]+1,a0(7l,1))}I{C""}};A 5r=B(7k){A 5D;A i=2I(7k);if((i[0]==0)||(i[1]==0)){5D=0}I{5D=a0(7k,0)}C((5D>0)?7k.3b(0,5D).1M():"*")};A fg=B(Q){A J=-1;R(A x=0;x=0){if((1S>J)||(J==-1)){J=1S}}}C J};A 9H=B(7i){A i=2I(7i);if(-1==i[1]){C""}A di=i[1]+1;A 7j=fg(i.2w(2));if(di<7j){C 7i.21(di,7j)}I{if(-1==7j){C 7i.3b(di)}I{C""}}};A f3=[{1i:"|=",1f:B(15,fe){C"[5z(3U(\' \',@"+15+",\' \'), \' "+fe+"-\')]"}},{1i:"~=",1f:B(15,fd){C"[5z(3U(\' \',@"+15+",\' \'), \' "+fd+" \')]"}},{1i:"^=",1f:B(15,fb){C"[li-4G(@"+15+", \'"+fb+"\')]"}},{1i:"*=",1f:B(15,fa){C"[5z(@"+15+", \'"+fa+"\')]"}},{1i:"$=",1f:B(15,9Z){C"[21(@"+15+", 3c-G(@"+15+")-"+(9Z.G-1)+")=\'"+9Z+"\']"}},{1i:"!=",1f:B(15,f9){C"[3O(@"+15+"=\'"+f9+"\')]"}},{1i:"=",1f:B(15,f8){C"[@"+15+"=\'"+f8+"\']"}}];A 9C=B(9Y,3Z,f7,f6){A 49;A i=2I(3Z);if(i[2]>=0){A 4L=3Z.T("]",i[2]);A 29=3Z.21(i[2]+1,4L);1s(29&&29.G){if(29.2s(0)=="@"){29=29.2w(1)}49=L;R(A x=0;x<9Y.G;x++){A 1S=9Y[x];A 7h=29.T(1S.1i);if(7h>=0){A 15=29.21(0,7h);A 4a=29.21(7h+1S.1i.G);if((4a.2s(0)=="\\"")||(4a.2s(0)=="\'")){4a=4a.21(1,4a.G-1)}49=1S.1f(d.7g(15),d.7g(4a));3f}}if((!49)&&(29.G)){49=f7(29)}if(49){f6(49)}29=L;A 7f=3Z.T("[",4L);if(0<=7f){4L=3Z.T("]",7f);if(0<=4L){29=3Z.21(7f+1,4L)}}}}};A f0=B(f5){A 4K=".";A 7e=f5.1A(" ");1s(7e.G){A 2K=7e.3a();A 7d;if(2K==">"){7d="/";2K=7e.3a()}I{7d="//"}A f4=5r(2K);4K+=7d+f4;A id=6X(2K);if(id.G){4K+="[@id=\'"+id+"\'][1]"}A cn=9H(2K);if(cn.G){A 9X=" ";if(cn.2s(cn.G-1)=="*"){9X="";cn=cn.3b(0,cn.G-1)}4K+="[5z(3U(\' \',@9P,\' \'), \' "+cn+9X+"\')]"}9C(f3,2K,B(f2){C"[@"+f2+"]"},B(f1){4K+=f1})}C 4K};A 7a={};A eC=B(28){if(7a[28]){C 7a[28]}A 1e=d.1e;A 9W=f0(28);A 4H=B(9V){A J=[];A 7b;1u{7b=1e.9x(9W,9V,L,lh.lg,L)}1y(e){1z.1K("lf in le:",9W,"lc:",9V);1z.1K(e)}A 7c=7b.eZ();1s(7c){J.Y(7c);7c=7b.eZ()}C J};C 7a[28]=4H};A 5x={};A 9B={};A 3y=B(79,78){if(!79){C 78}if(!78){C 79}C B(){C 79.14(26,P)&&78.14(26,P)}};A 75=B(9U,3Y,5B,2J){A 2v=2J+1;A 76=(3Y.G==2v);A 2K=3Y[2J];if(2K==">"){A 77=9U.3W;if(!77.G){C}2v++;76=(3Y.G==2v);A 4H=6O(3Y[2J+1]);R(A x=0,11;x<77.G,11=77[x];x++){if(4H(11)){if(76){5B.Y(11)}I{75(11,3Y,5B,2v)}}}}A 5C=6U(2K)(9U);if(76){1s(5C.G){5B.Y(5C.3a())}}I{1s(5C.G){75(5C.3a(),3Y,5B,2v)}}};A eE=B(9T,eY){A J=[];A x=9T.G-1,11;1s(11=9T[x--]){75(11,eY,J,0)}C J};A 6O=B(3D){if(5x[3D]){C 5x[3D]}A ff=L;A 9S=5r(3D);if(9S!="*"){ff=3y(ff,B(N){C((N.2t==1)&&(9S==N.5w.1M()))})}A 9R=6X(3D);if(9R.G){ff=3y(ff,B(N){C((N.2t==1)&&(N.id==9R))})}if(2Y.5q.14(D,2I(3D).2w(1))>=0){ff=3y(ff,9z(3D))}C 5x[3D]=ff};A 5y=B(E){A pn=E.1L;A 9Q=pn.3W;A 2v=-1;A 3C=pn.5A;if(!3C){C 2v}A ci=E["eW"];A cl=pn["eX"];if(((V cl=="4J")&&(cl!=9Q.G))||(V ci!="4J")){pn["eX"]=9Q.G;A 2J=1;do{if(3C===E){2v=2J}if(3C.2t==1){3C["eW"]=2J;2J++}3C=3C.71}1s(3C)}I{2v=ci}C 2v};A lb=0;A 3X=B(N,15){A 74="";if(15=="9P"){C N.3A||74}if(15=="R"){C N.la||74}C N.5t(15,2)||74};A eH=[{1i:"|=",1f:B(15,9O){A eV=" "+9O+"-";C B(N){A ea=" "+(N.5t(15,2)||"");C((ea==9O)||(ea.T(eV)==0))}}},{1i:"^=",1f:B(15,eU){C B(N){C(3X(N,15).T(eU)==0)}}},{1i:"*=",1f:B(15,eT){C B(N){C(3X(N,15).T(eT)>=0)}}},{1i:"~=",1f:B(15,eS){A 9N=" "+eS+" ";C B(N){A ea=" "+3X(N,15)+" ";C(ea.T(9N)>=0)}}},{1i:"$=",1f:B(15,73){A 9N=" "+73;C B(N){A ea=" "+3X(N,15);C(ea.31(73)==(ea.G-73.G))}}},{1i:"!=",1f:B(15,eR){C B(N){C(3X(N,15)!=eR)}}},{1i:"=",1f:B(15,eQ){C B(N){C(3X(N,15)==eQ)}}}];A 9E=[{1i:"9M-9K",1f:B(1p,l9){C B(N){if(N.2t!=1){C U}A fc=N.eP;1s(fc&&(fc.2t!=1)){fc=fc.eP}C(!fc)}}},{1i:"72-9K",1f:B(1p,l8){C B(N){if(N.2t!=1){C U}A nc=N.71;1s(nc&&(nc.2t!=1)){nc=nc.71}C(!nc)}}},{1i:"l7",1f:B(1p,l6){C B(N){A cn=N.3W;A eO=N.3W.G;R(A x=eO-1;x>=0;x--){A nt=cn[x].2t;if((nt==1)||(nt==3)){C U}}C K}}},{1i:"5z",1f:B(1p,eN){C B(N){C(N.9L.T(eN)>=0)}}},{1i:"3O",1f:B(1p,eM){A eL=6O(eM);C B(N){C(!eL(N))}}},{1i:"l5-9K",1f:B(1p,2u){A pi=eK;if(2u=="l4"){C B(N){C(((5y(N))%2)==1)}}I{if((2u=="2n")||(2u=="l3")){C B(N){C((5y(N)%2)==0)}}I{if(2u.T("l2+")==0){A 70=pi(2u.3b(3));C B(N){C(N.1L.3W[70-1]===N)}}I{if((2u.T("n+")>0)&&(2u.G>3)){A 9J=2u.1A("n+",2);A eJ=pi(9J[0]);A 2J=pi(9J[1]);C B(N){C((5y(N)%eJ)==2J)}}I{if(2u.T("n")==-1){A 70=pi(2u);C B(N){C(5y(N)==70)}}}}}}}}];A 9z=B(3e){A 9I=(9B[3e]||5x[3e]);if(9I){C 9I}A ff=L;A i=2I(3e);if(i[0]>=0){A 24=5r(3e);if(24!="*"){ff=3y(ff,B(N){C(N.5w.1M()==24)})}}A 5u;A 3B=9H(3e);if(3B.G){A 9F=3B.2s(3B.G-1)=="*";if(9F){3B=3B.3b(0,3B.G-1)}A re=S 9G("(?:^|\\\\s)"+3B+(9F?".*":"")+"(?:\\\\s|$)");ff=3y(ff,B(N){C re.6Z(N.3A)})}if(i[3]>=0){A 3z=3e.3b(i[3]+1);A 9D="";A 5v=3z.T("(");A 6Y=3z.31(")");if((0<=5v)&&(0<=6Y)&&(6Y>5v)){9D=3z.21(5v+1,6Y);3z=3z.3b(0,5v)}5u=L;R(A x=0;x<9E.G;x++){A 1S=9E[x];if(1S.1i==3z){5u=1S.1f(3z,9D);3f}}if(5u){ff=3y(ff,5u)}}A eG=(d.1l)?B(5s){A eI=5s.1M();C B(N){C N[5s]||N[eI]}}:B(5s){C B(N){C(N&&N.5t&&N.l1(5s))}};9C(eH,3e,eG,B(eF){ff=3y(ff,eF)});if(!ff){ff=B(){C K}}C 9B[3e]=ff};A 6W={};A 6U=B(3d,1B){A 9A=6W[3d];if(9A){C 9A}A i=2I(3d);A id=6X(3d);if(i[0]==0){C 6W[3d]=B(1B){C[d.1D(id)]}}A 9y=9z(3d);A 5p;if(i[0]>=0){5p=B(1B){A 11=d.1D(id);if(9y(11)){C[11]}}}I{A 3V;A 24=5r(3d);if(2Y.5q.14(D,2I(3d))==-1){5p=B(1B){A J=[];A 11,x=0,3V=1B.4I(24);1s(11=3V[x++]){J.Y(11)}C J}}I{5p=B(1B){A J=[];A 11,x=0,3V=1B.4I(24);1s(11=3V[x++]){if(9y(11)){J.Y(11)}}C J}}}C 6W[3d]=5p};A l0={};A 5o={">":B(1B){A J=[];A 11,x=0,3V=1B.3W;1s(11=3V[x++]){if(11.2t==1){J.Y(11)}}C J}};A 9w=B(6V){if(0>6V.T(" ")){C 6U(6V)}A eD=B(1B){A 6S=6V.1A(" ");A 6T;if(6S[0]==">"){6T=[1B]}I{6T=6U(6S.3a())(1B)}C eE(6T,6S)};C eD};A 9v=((1q["9x"]&&!d.3o)?B(3x){A 6R=3x.1A(" ");if((1q["9x"])&&(3x.T(":")==-1)&&((K))){if(((6R.G>2)&&(3x.T(">")==-1))||(6R.G>3)||(3x.T("[")>=0)||((1==6R.G)&&(0<=3x.T(".")))){C eC(3x)}}C 9w(3x)}:9w);A ey=B(3w){if(5o[3w]){C 5o[3w]}if(0>3w.T(",")){C 5o[3w]=9v(3w)}I{A eB=3w.1A(/\\s*,\\s*/);A 4H=B(1B){A eA=0;A J=[];A 6Q;1s(6Q=eB[eA++]){J=J.3U(9v(6Q,6Q.T(" "))(1B))}C J};C 5o[3w]=4H}};A 5n=0;A ez=B(Q){A J=S d.1H();if(!Q){C J}if(Q[0]){J.Y(Q[0])}if(Q.G<2){C J}5n++;Q[0]["9u"]=5n;R(A x=1,11;11=Q[x];x++){if(Q[x]["9u"]!=5n){J.Y(11)}11["9u"]=5n}C J};d.1r=B(6P,1B){if(V 6P!="3c"){C S d.1H(6P)}if(V 1B=="3c"){1B=d.1D(1B)}C ez(ey(6P)(1B||d.1e))};d.9t=B(ex,9s){A 9r=S d.1H();A ff=(9s)?6O(9s):B(){C K};R(A x=0,11;11=ex[x];x++){if(ff(11)){9r.Y(11)}}C 9r}})()}if(!z.1h["z.X.1b"]){z.1h["z.X.1b"]=K;z.1Q("z.X.1b");z.6K=B(ew){A J={};A iq="kZ[Z!=9q][Z!=kY][Z!=et][Z!=kX][Z!=kW], kV, kU";z.1r(iq,ew).3T(B(E){C(!E.kT)}).1n(B(1m){A 3v=1m.1p;A Z=(1m.Z||"").1M();if((Z=="kS")||(Z=="kR")){if(1m.kQ){J[3v]=1m.1Z}}I{if(1m.kP){A ev=J[3v]=[];z.1r("kO[kN]",1m).1n(B(eu){ev.Y(eu.1Z)})}I{J[3v]=1m.1Z;if(Z=="et"){J[3v+".x"]=J[3v+".y"]=J[3v].x=J[3v].y=0}}}});C J};z.9h=B(23){A ec=kM;A J="";A es={};R(A x in 23){if(23[x]!=es[x]){if(z.2l(23[x])){R(A y=0;y<23[x].G;y++){J+=ec(x)+"="+ec(23[x][y])+"&"}}I{J+=ec(x)+"="+ec(23[x])+"&"}}}if((J.G)&&(J.2s(J.G-1)=="&")){J=J.3b(0,J.G-1)}C J};z.kL=B(er){C z.9h(z.6K(er))};z.kK=B(ep){C z.eq(z.6K(ep))};z.kJ=B(2H){A J={};A qp=2H.1A("&");A dc=kI;z.1n(qp,B(1m){if(1m.G){A 9p=1m.1A("=");A 1p=dc(9p.3a());A 1U=dc(9p.22("="));if(z.1R(J[1p])){J[1p]=[J[1p]]}if(z.2l(J[1p])){J[1p].Y(1U)}I{J[1p]=1U}}});C J};z.e1=U;z.e6={"9g":B(1b){C 1b.2G},"2e":B(1b){if(!1o.eo){1z.1K("kH kG kF a kE of 9g/2e-6M-9m"+" 4F kD kC kB kA 4G en kz"+" (ky 1o.eo=K 4F kx kw D kv)")}C z.5m(1b.2G)},"2e-6M-ku":B(1b){A 6N=1b.2G;A 9o=6N.T("/*");A 9n=6N.31("*/");if((9o==-1)||(9n==-1)){C z.5m(1b.2G)}C z.5m(6N.21(9o+2,9n))},"2e-6M-9m":B(1b){A 6L=1b.2G;A 9l=6L.T("/*");A 9k=6L.31("*/");if((9l==-1)||(9k==-1)){1z.1K("kt en ks\'t 6M 9m!");C""}C z.5m(6L.21(9l+2,9k))},"kr":B(1b){C z.3u(1b.2G)},"kq":B(1b){if(z.1l&&!1b.el){z.1n(["ko","em","kn","km"],B(i){1u{A 1e=S 9j(kl[i]+".kk");1e.kj=U;1e.ki(1b.2G);C 1e}1y(e){}})}I{C 1b.el}}};(B(){z.e5=B(F,ej,ei,eh){A 2F={};2F.F=F;A 6J=L;if(F.3R){A 3R=z.1D(F.3R);A 9i=3R.kh("kg");2F.2E=F.2E||(9i?9i.1Z:L);6J=z.6K(3R)}I{2F.2E=F.2E}A 5l=[{}];if(6J){5l.Y(6J)}if(F.5g){5l.Y(F.5g)}if(F.ek){5l.Y({"z.ek":S 5d().8O()})}2F.1r=z.9h(z.1x.14(L,5l));2F.9d=F.9d||"9g";A d=S z.30(ej);d.5k(ei,B(eg){C eh(eg,d)});A ld=F.4E;if(ld&&z.1Y(ld)){d.ef(B(ee){C ld.2d(F,ee,2F)})}A 1G=F.9f;if(1G&&z.1Y(1G)){d.ed(B(e9){C 1G.2d(F,e9,2F)})}A 6I=F.kf;if(6I&&z.1Y(6I)){d.9e(B(e8){C 6I.2d(F,e8,2F)})}d.1F=2F;C d};A e4=B(O){O.e0=K;A 1b=O.1F.1b;if(V 1b.e7=="B"){1b.e7()}};A e3=B(O){C z.e6[O.1F.9d](O.1F.1b)};A e2=B(9c,O){1z.1K(9c);C 9c};A 3Q=B(F){A O=z.e5(F,e4,e3,e2);O.1F.1b=z.9b(O.1F.F);C O};A 5j=L;A 3t=[];A 94=B(){A dZ=(S 5d()).dU();if(!z.e1){z.1n(3t,B(4D,6H){if(!4D){C}A O=4D.O;1u{if(!O||O.e0||!4D.dT(O)){3t.3S(6H,1);C}if(4D.dR(O)){3t.3S(6H,1);4D.dP(O)}I{if(O.9a){if(O.9a+(O.1F.F.6G||0)0){5c(z.2p(D,B(){D.5b(L,8R)}),d);C D}D.4A=S 5d().8O();if(D.2Z){D.4A-=D.8Q*D.2o}D.8N=D.4A+D.8Q;D.2D=K;D.2Z=U;A 8P=D.2C.4x(D.2o);if(!D.2o){if(!D.4y){D.4y=D.4z}D.3q("dt",[8P])}D.3q("ds",[8P]);D.8M();C D},jS:B(){5e(D.3r);if(!D.2D){C D}D.2Z=K;D.3q("dr",[D.2C.4x(D.2o)]);C D},jR:B(dq,dp){5e(D.3r);D.2D=D.2Z=K;D.2o=dq*6D;if(dp){D.5b()}C D},jQ:B(dn){if(!D.3r){C}5e(D.3r);if(dn){D.2o=1}D.3q("dm",[D.2C.4x(D.2o)]);D.2D=D.2Z=U;C D},3N:B(){if(D.2D){C D.2Z?"3M":"jP"}C"jO"},8M:B(){5e(D.3r);if(D.2D){A dl=S 5d().8O();A 2q=(dl-D.4A)/(D.8N-D.4A);if(2q>=1){2q=1}D.2o=2q;if(D.5a){2q=D.5a(2q)}D.3q("8B",[D.2C.4x(2q)]);if(2q<1){D.3r=5c(z.2p(D,"8M"),D.dj)}I{D.2D=U;if(D.4z>0){D.4z--;D.5b(L,K)}I{if(D.4z==-1){D.5b(L,K)}I{if(D.4y){D.4z=D.4y;D.4y=0}}}D.2o=0;D.3q("dh")}}C D}});(B(){A df=B(E){if(z.1l){A ns=E.1c;if(!ns.8L.G&&z.1c(E,"8L")=="dg"){ns.8L="1"}if(!ns.3n.G&&z.1c(E,"3n")=="8K"){ns.3n="8K"}}};z.6C=B(F){if(V F.1d=="1k"){2m S 1O("z.6C jN an 1d 1Z")}F.E=z.1D(F.E);A 3p=z.1x({6w:{}},F);A 8J=(3p.6w.2W={});8J.1w=(V 3p.1w=="1k")?B(){C 2V(z.1c(3p.E,"2W"))}:3p.1w;8J.1d=3p.1d;A 2U=z.6y(3p);z.2c(2U,"6x",L,B(){df(3p.E)});C 2U};z.8I=B(F){C z.6C(z.1x({1d:1},F))};z.8H=B(F){C z.6C(z.1x({1d:0},F))};if(z.6B&&!z.3o){z.8E=B(n){C 2k("0.5")+((2Y.da((n+2k("1.5"))*2Y.d9))/2)}}I{z.8E=B(n){C 0.5+((2Y.da((n+1.5)*2Y.d9))/2)}}A d4=B(6A){D.8G=6A;R(A p in 6A){A 1a=6A[p];if(1a.1w 1N z.1J){1a.d7=S z.1J()}}D.4x=B(r){A J={};R(A p in D.8G){A 1a=D.8G[p];A 6z=L;if(1a.1w 1N z.1J){6z=z.d8(1a.1w,1a.1d,r,1a.d7).8F()}I{if(!z.2l(1a.1w)){6z=((1a.1d-1a.1w)*r)+1a.1w+(p!="2W"?1a.jM||"px":"")}}J[p]=6z}C J}};z.6y=B(F){F.E=z.1D(F.E);if(!F.5a){F.5a=z.8E}A 2U=S z.d6(F);z.2c(2U,"6x",2U,B(){A pm={};R(A p in D.6w){A 1a=pm[p]=z.1x({},D.6w[p]);if(z.1Y(1a.1w)){1a.1w=1a.1w()}if(z.1Y(1a.1d)){1a.1d=1a.1d()}A d5=(p.1M().T("jL")>=0);B 8C(E,p){4w(p){2X"58":C E.8D;2X"3n":C E.6v}A v=z.1c(E,p);C(p=="2W")?2V(v):2k(v)};if(V 1a.1d=="1k"){1a.1d=8C(D.E,p)}I{if(V 1a.1w=="1k"){1a.1w=8C(D.E,p)}}if(d5){1a.1w=S z.1J(1a.1w);1a.1d=S z.1J(1a.1d)}I{1a.1w=(p=="2W")?2V(1a.1w):2k(1a.1w)}}D.2C=S d4(pm)});z.2c(2U,"8B",2U,B(8A){R(A s in 8A){z.1c(D.E,s,8A[s])}});C 2U}})()}',62,1711,'|||||||||||||||||||||||||||||||||||dojo|var|function|return|this|node|args|length|evt|else|ret|true|null|obj|elem|dfd|arguments|arr|for|new|indexOf|false|typeof||_base|push|type||te|||apply|attr|||||prop|xhr|style|end|doc|match|uri|_hasResource|key|del|undefined|isIE|item|forEach|djConfig|name|document|query|while|_66|try|res|start|mixin|catch|console|split|root|prototype|byId|gcs|ioArgs|err|NodeList|_p|Color|debug|parentNode|toLowerCase|instanceof|Error|constructor|provide|isString|ta|255|val|_a|global|_69|isFunction|value||substring|join|map|tn||window||path|_343|_220|_listeners|connect|call|json|replace|left|_b|toString|128|parseFloat|isArray|throw||_percent|hitch|step|declare|charAt|nodeType|_3c3|nidx|slice|faux|fired|_c4|_7e|loc|curve|_active|url|_44c|responseText|str|_312|idx|tqp|isNaN|isOpera|_22d|callee|add|_18b|_f8|_e2|_41|anim|Number|opacity|case|Math|_paused|Deferred|lastIndexOf|||||||||shift|substr|string|_3e7|_3ce|break|_w|charCode|_listener|_d5|_c5|authority|_49|width|isSafari|_49e|fire|_timer|_47b|_465|eval|_in|_40c|_409|_362|_3d9|className|_3d5|_386|_37a|body|getComputedStyle|box|_221|keyCode|remove|_8d|_46|paused|status|not|_478|_461|form|splice|filter|concat|tret|childNodes|_38b|_367|_33d||||||||||_340|_348|keypress|appendChild|_toArray|Array|_2b0|_toPixelValue|ref|_fixEvent|_19f|_14c|_14a|_150|_141|declaredClass|_d4|_99|_Url|_83|scheme|_67|_3d|switch|getValue|_startRepeatCount|repeat|_startTime|_47e|cancel|tif|load|to|with|tf|getElementsByTagName|number|_34c|_342|extend|_1e3|_normalizeEventName|_14b|_14e|results|self|cbfn|_f9|_d8|_b2|src|_88|dav||baseUrl|fragment|_loadedModules|_44|_43|_loaders|mll|height||easing|play|setTimeout|Date|clearTimeout|hdr|content|code|errback|_464|addCallbacks|_450|fromJson|_413|_3fc|_3ee|max|_31e|cond|getAttribute|_3d4|obi|tagName|_360|_381|contains|firstChild|_368|_372|_320|place|_2fa|scrollTop|_299|scrollLeft|top|documentElement|_288|_287|_getBorderExtents|_23f|_23d|_239|_218|_216|_211|eles|target|keys|shiftKey|ctrlKey|event|192|iel|_1db|delete|_1cf||addEventListener|String|_1af|_157|array|_14d|continue|_14f|_137|_11f|_106|_findMethod|has|_delegate|_dc|_d3|loaded|_9a|_loadInit|_inFlightCount|getObject|tv|_4f|_postLoad|_2d|offsetWidth|properties|beforeBegin|animateProperty|_4ad|_4a6|isKhtml|_fade|100|headers|readyState|timeout|_469|_457|_44d|formToObject|_441|comment|_43d|_36f|_419|tp|_40a|_406|_407|_373|_403|_3e6|_31b|cbi|test|_3c7|nextSibling|last|_3a1|_38e|_365|_36b|ecn|_364|_363|_356|_35e|_35f|_34f|_34d|_349|trim|tci|_328|_32b|_31f|_31c|_anim|_300|_2ff|_2f5|_2e7|removeClass|addClass|func|_2c4|cls|_2a9|_2ae|_280|_27f|_getPadExtents|isMoz|none|_233|cssText|_214|_fixCallback|_synthesizeEvent|stopPropagation|preventDefault|_setKeyChar|_1e1|ieh|_1d7|_1be|colorFromArray|sanitize|bits|rgb|_156|_fire|_resback|_13d|partial|_13a|silentlyCancelled|_topics|_127|_f1|_f0|superclass|_ec|_e3|mct|setObject|_bf|_b3|object|require|_92|_khtmlTimer|location|XMLHTTP|locale|dua|_71|_modulePrefixes|_55|_loadModule|_51|_50|_4e|pop|_3f|_callLoaded|_unloaders|_loadNotifying|_loadedUrls|_27|_24|_1d|_5|_4b7|onAnimate|getStyle|offsetHeight|_defaultEasing|toCss|_properties|fadeOut|fadeIn|_49f|auto|zoom|_cycle|_endTime|valueOf|_494|duration|_492|DELETE|_ioAddQueryToUrl|putData|contentType|password|user|_isDocumentOk|application|||||_466||||||startTime|_xhrObj|_45f|handleAs|addBoth|error|text|objectToQuery|_44f|ActiveXObject|_443|_442|filtered|_43f|_43e|_437|file|tnl|_41c|_filterQueryResult|_zipIdx|_408|_402|evaluate|_3ed|_380|fHit|_361|_33b|_3da|_3ab|_3d6|RegExp|_327|_3cf|_3c9|child|innerHTML|first|tval|_391|class|pnc|_37e|_37c|_375|_366|_35c|_35a|_353|_33c|_336|_314|||_315|_oe|_307|_309|cloneNode|after|createElement||_2f8|_2ef|_2ee|unshift|coords|some|every||_2cb|script|_2c9|parent||a2p||_2c3|_2bd||abs|_getMarginBox|_2b3|_2a6|position|_2a7|_2ac|_2ab|_getIeDocumentElementOffset|getBoundingClientRect|ownerDocument|_2a3|clientWidth|_isBodyLtr|_fixIeBiDiScrollLeft|_bodyLtr|_29d|_getContentBox|_setBox|_getMarginExtents|_getPadBorderExtents|_usesBorderBox|boxModel|pcs|st|sl|_240|runtimeStyle|_dcm|BackCompat|compatMode|default|_21b|_d|html|_event_listener|handlers|PAGE_DOWN|PAGE_UP|RIGHT_ARROW|LEFT_ARROW|DOWN_ARROW|UP_ARROW|_preventDefault||_stopPropagation|returnValue||_trySetKeyCode|cancelBubble|currentTarget|106|_1ee|111||_1e8|_1e7|||se|srcElement|onkeydown||_1d0|_disconnect|lid|_1c0|_connect|_set|_195|_185|_183|_17d|_everyOrSome|_16b|_172|_15b|Function|_154|_escapeString|_140|chain|_check|canceller|_12d|_124|_11a|_10d|_107|inherited|_fa|_f2|_findMixin|_constructor|preamble|_de|clone|tmp|_c7|TMP|_be|_ba|_mixin|isBrowser|lang|firebug||param|modulePaths|_a7|_fireCallback|_a0|setContext||_9c|unloaded||||_96|_93|navigator|_90|_89||protocol|_84|_86|_XMLHTTP_PROGIDS|gears|google|setAttribute|_80|_77|cfg|_6f|_getModuleSymbols|_5a|_58|_53|_4d|_4c|_45|_40|_moduleHasPrefix|_loadUri|_28|_26|_21|_22|tests|doh|_20|_1f|_1c|version|_1b|_19|_getProp|_11|_4|_4a5|_4b3|_Animation|tempColor|blendColors|PI|sin|||||_49a|normal|onEnd||rate||curr|onStop|_497||_496|pct|onPause|onPlay|onBegin|delay||_491|_Line|_48b|wrapForm|PUT|_487|POST|GET|_476|_474|_472|_ioWatch|send|_471|setRequestHeader|open|callback|setInterval|_470|resHandle|_46f|ioCheck|_46e|validCheck|getTime|_ioCancelAll|addOnUnload|clearInterval|dojoType|now|canceled|_blockAsync|_45e|_45c|_459|_ioSetArgs|_contentHandlers|abort|_458|_456||||addErrback|_454|addCallback|_452|_44b|_44a|_449|preventCache|responseXML|Microsoft|JSON|usePlainJson|_431|toJson|_430|_42d|image|opt|ria|_421|_41b|_40b|_zip|_410|_40d|_357|sqf|_374|_3e5|_3df|_38f|clc|pred|parseInt|ntf|_3bf|_3bc|cnl|previousSibling|_3a9|_3a6|_39c|_399|_396|_392|__cachedIndex|__cachedLength|_376|iterateNext|_34a|_355|_354|_32c|_350|_34b|_33f|_33e|_33a|_338|_334|_332||_330|_32e||_322|_316|mousemove|mouseout|mouseover|_305|lastChild||_2f9||_2f2|_2f1|removeChild|_2ec|_2eb|_2ea|_2e6||_2e4|_2e2|_2d6|_2d5|_2d4|_2d3|_2d2|_2d1|_2cd|_2cc|scs|write|_2c8|hasClass|_2c0|_2bb|_2b5|_abs|_docScroll|offsetParent|offsetTop|offsetLeft|absolute|getBoxObjectFor|clientLeft|_setContentSize|_setMarginBox|_28d|_286|_285|_289|NaN|_281|border|_272|_26b|_260|_258|_253|_24c|_246|_23a|_getOpacity|_setOpacity|_238|td|tr|nodeName|FILTER|_22f|_22e|currentStyle|_22c|_22b|display|QuirksMode|unselectable|_217|isMozilla|getElementById|attributes|all|_ie_listener|_getIeDispatcher|_1fd|NUM_LOCK|SCROLL_LOCK|INSERT|END|HOME|PAUSE|F12|F11|F10|F9|F8|F7|F6|F5|F4|F3|F2|F1|63232|SHIFT_TAB|TAB|keyIdentifier|_1f3|stopEvent|_punctMap|222|219|186|onkeypress|_stealthKeyDown|_fixKeys|relatedTarget|_1e0|_1df|_stealthKeydown|_1d6|_1d5|_1d1|_1ca|_1c9|_1cb|_1c2|_1c1|_1c3|_1c4|_1bc|_1b3|_1b2|colorFromHex|colorFromRgb|named|colorFromString|mask|rgba|_19c|_197|_192|setColor|_180|_178|_177|_175|_174|_16d|_166|_164|_163|_162|_15c|_15d|_15e|index|__json__|toJsonIndentStr|_nextId|_12f|_12b|publish|_128|_126|_125|_122|_121|_123|_11c|_11b|_10c|_10b|_108|getDispatcher|argument|nom|_construct|_core|_makeCtor|_df|_db|deprecated|isObject|_cc||scope||_hitchArgs|_c2||pre|_c1|native|isDebug||registerModulePath|_a8||finally|||_a6|_a5|_a4|_a3|_a2|_a1|_9f|_9e|_9d|_9b|_98|_97|onbeforeunload|ipt|scr|complete|_95|userAgent|_modulesLoaded|initialized|_initFired|_8c|_8a|_getText|_87|ieForceActiveXXhr|Msxml2|isGears|_81|_gearsObject|googlegears|GearsFactory|isFF|_7d|Safari|_72|_name|_6c|ire|ore|_68|i18n|_5b|requireIf|_56|_52|loading|_4a|_loadPath|_47|_48|_global_omit_module_check|_getModulePrefix|_3c|_3a|_37|_30|Boolean|_loadUriAndCheck|_2e||cacheBust|_1e|_1a|_17|_16|_15|_14|_f|_10|_e|_9|_8|revision|flag|patch|minor|major|_6|color|units|needs|stopped|playing|stop|gotoPercent|pause|1000|implemented|yet|_48a|xhrDelete|rawXhrPut|xhrPut|postData|rawXhrPost|xhrPost|xhrGet|Type|Content|sync|response|http|bad|urlencoded|www|_watchInFlightError||exceeded|handle|action|getAttributeNode|loadXML|async|XMLDOM|prefixes|MSXML3|MSXML|MSXML2||xml|javascript|wasn|your|optional|message|off|turn|use|endpoints|issues|security|potential|avoid|mimetype|using|consider|please|decodeURIComponent|queryToObject|formToJson|formToQuery|encodeURIComponent|selected|option|multiple|checked|checkbox|radio|disabled|textarea|select|button|reset|submit|input|_3fb|hasAttribute|0n|even|odd|nth|_3b5|empty|_3b1|_3ad|htmlFor|_38a|under||exprssion|failure|ANY_TYPE|XPathResult|starts|keyup|keydown|mouseup|mousedown|blur|click|combine|span|addContent||adopt|orphan|_2de|_2dd|styles|_2da|_2d9|_2cf|_2ce|show|createPopup|toggleClass|scrollWidth|clientTop|ltr|direction|pageXOffset|pageYOffset|fixed|contentBox|marginBox|BUTTON|TABLE|_getBorderBox|clientHeight|visible|overflow|marginBottom|marginRight|marginTop|marginLeft|borderBottomWidth|borderBottomStyle|borderRightWidth|borderRightStyle|borderTopWidth|borderTopStyle|borderLeftWidth|borderLeftStyle|paddingBottom|paddingRight|paddingTop|paddingLeft|offset||min|padding||margin|Opacity|Alpha|alpha|filters|pixelLeft|medium|_22a|defaultView|before||insertBefore|KhtmlUserSelect|MozUserSelect|setSelectable|isDescendant|div|_destroyElement|BackgroundImageCache|execCommand|PageDown|PageUp|Right|Left|Down|Up|63289|63249|63248|PRINT_SCREEN|63302|63277|63276|63275|63273|63272|63250|63247|63246|63245|63244|63243|63242|63241|63240|63239|63238|63237|63236|63235|63234|63233|Enter|_1f9|which|_1f6|bubbledKeyCode|221|220||||191|190|189|188|187|toElement|fromElement|clientY|pageY||clientX|pageX|offsetY|||layerY|offsetX|layerX|parentWindow|_nop|_allow_leaks|145|144|126|F15|125|F14|124|F13|123|122|121|120|119|118|117|116|115|114|113|112|NUMPAD_DIVIDE|110|NUMPAD_PERIOD|109|NUMPAD_MINUS|108|NUMPAD_ENTER|107|NUMPAD_PLUS|NUMPAD_MULTIPLY|105|NUMPAD_9|104|NUMPAD_8|103|NUMPAD_7|102|NUMPAD_6|101|NUMPAD_5|NUMPAD_4||NUMPAD_3|NUMPAD_2|NUMPAD_1|NUMPAD_0||SELECT|RIGHT_WINDOW||LEFT_WINDOW||HELP|SPACE|ESCAPE|CAPS_LOCK|ALT|CTRL|SHIFT|ENTER|CLEAR|BACKSPACE|attachEvent|fixEvent|fromCharCode|keyChar|_1b9|removeEventListener|0x|round|toHex|toRgba|toRgb|aqua|teal|blue|navy|yellow|olive|lime|green|fuchsia|purple|red|maroon|white|gray|silver|black|boolean|called|already|Cancelled|connectPublisher|unsubscribe|subscribe|disconnect|_113|_112||_111|_110|||found|was||must|_|module|||required|likely|It|declaration|Mixin|separate|instead|property|initializer||pass|_c9|_bb|_b7|nfunction|isAlien|isFinite|isArrayLike|_firebug|withDoc|withGlobal|_writeIncludes|VML|behavior|addRule|createStyleSheet|vml|com|microsoft|schemas|urn|namespaces|onunload|onreadystatechange|defer|khtml|WebKit|DOMContentLoaded|enableMozDomContentLoaded|domcontentloaded|Unable|base|chrome|1223|304|300|200|available|XMLHttpRequest|_println|language|userLanguage|isQuirks|factory|mimeTypes|Factory|Gears|_7f|MSIE||Firefox|Gecko|Konqueror||Opera|appVersion|xd|browser|moduleUrl|port|host|hostenv|_requireLocalization|_5f|_5e|_5d|_5c|requireLocalization|requireAfterIf|_57|common|platformRequire|defined|symbol|_isXDomain|tried|Could|__package__|packageFileName|_42|useXDomain|flight|still|files|addOnLoad|failed|sourceURL|util|notice|without|change|subject|APIs|EXPERIMENTAL|experimental|removed|will|DEPRECATED|exists|10315|Rev|Mobile|Spidermonkey|Rhino||Browser|delayMozLoadingFix|preventBackButtonFix|libraryScriptUri|baseRelativePath|baseScriptUri|allowQueryConfig|warn|trace|timeEnd||time|profileEnd|profile|log|info|groupEnd|group|dirxml|dir|count|assert'.split('|'),0,{}); + + +/* + +Prototype 1.5 rc0 + - Adapted from Ruby on Rails - http://dev.rubyonrails.org/browser/spinoffs/prototype/src + - By Lunarmedia, 06 August, 2006 + - Available at (and packed with) JavascriptCompressor.com + +Please note this version is missing the selector.js component of the full Prototype library. +You can get the compressed version of selector at JavascriptCompressor.com + +*/ + +var decompressedPrototype = function(p,a,c,k,e,d){e=function(c){return(c35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--){d[e(c)]=k[c]||e(c)}k=[(function(e){return d[e]})];e=(function(){return'\\w+'});c=1};while(c--){if(k[c]){p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c])}}return p}('d T={4l:\'1.5.8P\',3E:\'(?:<3G.*?>)((\\n|\\r|.)*?)(?:<\\/3G>)\',2v:7(){},K:7(x){c x}};d 1b={17:7(){c 7(){6.1I.2n(6,N)}}};d 1e=z q();q.u=7(5d,O){G(d 1G 2M O){5d[1G]=O[1G]}c 5d};q.1U=7(U){1j{f(U==1v)c\'1v\';f(U==1L)c\'1L\';c U.1U?U.1U():U.2C()}1s(e){f(e 8R 9l)c\'...\';25 e}};7j.v.1d=7(){d 43=6,23=$A(N),U=23.8S();c 7(){c 43.2n(U,23.3s($A(N)))}};7j.v.8U=7(U){d 43=6;c 7(C){c 43.8V(U,C||1W.C)}};q.u(8Q.v,{8W:7(){d 4Z=6.2C(16);f(6<16)c\'0\'+4Z;c 4Z},5j:7(){c 6+1},8Y:7(o){$R(0,6,11).V(o);c 6}});d 6s={6j:7(){d 48;G(d i=0;i0){f(I=O.I(1A)){L+=O.47(0,I.w);L+=(1z(I)||\'\').2C();O=O.47(I.w+I[0].t)}1D{L+=O,O=\'\'}}c L},92:7(1A,1z,3i){1z=6.2T.52(1z);3i=3i===1v?1:3i;c 6.2T(1A,7(I){f(--3i<0)c I[0];c 1z(I)})},93:7(1A,o){6.2T(1A,o);c 6},94:7(t,2S){t=t||30;2S=2S===1v?\'...\':2S;c 6.t>t?6.47(0,t-2S.t)+2S:6},9F:7(){c 6.2y(/^\\s+/,\'\').2y(/\\s+$/,\'\')},71:7(){c 6.2y(/<\\/?[^>]+>/7Y,\'\')},2Q:7(){c 6.2y(z 3O(T.3E,\'5P\'),\'\')},70:7(){d 6Y=z 3O(T.3E,\'5P\');d 5p=z 3O(T.3E,\'98\');c(6.I(6Y)||[]).1C(7(5o){c(5o.I(5p)||[\'\',\'\'])[1]})},3q:7(){c 6.70().1C(7(3G){c 4q(3G)})},9E:7(){d 1q=J.4Y(\'1q\');d 1Y=J.9D(6);1q.75(1Y);c 1q.3h},9c:7(){d 1q=J.4Y(\'1q\');1q.3h=6.71();c 1q.2z[0]?1q.2z[0].6q:\'\'},78:7(){d 7i=6.I(/^\\??(.*)$/)[1].3j(\'&\');c 7i.36({},7(5b,72){d 1i=72.3j(\'=\');5b[1i[0]]=1i[1];c 5b})},1Z:7(){c 6.3j(\'\')},3P:7(){d 2l=6.3j(\'-\');f(2l.t==1)c 2l[0];d 54=6.5g(\'-\')==0?2l[0].7e(0).3Y()+2l[0].7g(1):2l[0];G(d i=1,73=2l.t;i<73;i++){d s=2l[i];54+=s.7e(0).3Y()+s.7g(1)}c 54},1U:7(){c"\'"+6.2y(/\\\\/g,\'\\\\\\\\\').2y(/\'/g,\'\\\\\\\'\')+"\'"}});4b.v.2T.52=7(1z){f(2i 1z==\'7\')c 1z;d 2U=z 3n(1z);c 7(I){c 2U.7a(I)}};4b.v.9h=4b.v.78;d 3n=1b.17();3n.79=/(^|.|\\r|\\n)(#\\{(.*?)\\})/;3n.v={1I:7(2U,1A){6.2U=2U.2C();6.1A=1A||3n.79},7a:7(U){c 6.2U.2T(6.1A,7(I){d 53=I[1];f(53==\'\\\\\')c I[2];c 53+(U[I[3]]||\'\').2C()})}};d $1y=z q();d $49=z q();d 1p={V:7(o){d w=0;1j{6.2m(7(h){1j{o(h,w++)}1s(e){f(e!=$49)25 e}})}1s(e){f(e!=$1y)25 e}},9n:7(o){d L=11;6.V(7(h,w){L=L&&!!(o||T.K)(h,w);f(!L)25 $1y});c L},9o:7(o){d L=11;6.V(7(h,w){f(L=!!(o||T.K)(h,w))25 $1y});c L},3e:7(o){d P=[];6.V(7(h,w){P.W(o(h,w))});c P},7n:7(o){d L;6.V(7(h,w){f(o(h,w)){L=h;25 $1y}});c L},7o:7(o){d P=[];6.V(7(h,w){f(o(h,w))P.W(h)});c P},9p:7(1A,o){d P=[];6.V(7(h,w){d 7c=h.2C();f(7c.I(1A))P.W((o||T.K)(h,w))});c P},1M:7(U){d 51=Y;6.V(7(h){f(h==U){51=11;25 $1y}});c 51},36:7(45,o){6.V(7(h,w){45=o(45,h,w)});c 45},9q:7(1F){d 23=$A(N).47(1);c 6.3e(7(h){c h[1F].2n(h,23)})},9s:7(o){d L;6.V(7(h,w){h=(o||T.K)(h,w);f(L==1v||h>=L)L=h});c L},9u:7(o){d L;6.V(7(h,w){h=(o||T.K)(h,w);f(L==1v||hb?1:0}).3r(\'h\')},1Z:7(){c 6.3e(T.K)},9B:7(){d o=T.K,23=$A(N);f(2i 23.5e()==\'7\')o=23.9C();d 7l=[6].3s(23).1C($A);c 6.1C(7(h,w){c o(7l.3r(w))})},1U:7(){c\'#<1p:\'+6.1Z().1U()+\'>\'}};q.u(1p,{1C:1p.3e,5v:1p.7n,1k:1p.7o,8M:1p.1M,7p:1p.1Z});d $A=1E.7q=7(2R){f(!2R)c[];f(2R.1Z){c 2R.1Z()}1D{d P=[];G(d i=0;i<2R.t;i++)P.W(2R[i]);c P}};q.u(1E.v,1p);f(!1E.v.4d)1E.v.4d=1E.v.4m;q.u(1E.v,{2m:7(o){G(d i=0;i<6.t;i++)o(6[i])},5i:7(){6.t=0;c 6},7r:7(){c 6[0]},5e:7(){c 6[6.t-1]},7s:7(){c 6.1k(7(h){c h!=1v||h!=1L})},6J:7(){c 6.36([],7(6H,h){c 6H.3s(h&&h.5D==1E?h.6J():[h])})},5s:7(){d 4N=$A(N);c 6.1k(7(h){c!4N.1M(h)})},5g:7(U){G(d i=0;i<6.t;i++)f(6[i]==U)c i;c-1},4m:7(5h){c(5h!==Y?6:6.1Z()).4d()},1U:7(){c\'[\'+6.1C(q.1U).1N(\', \')+\']\'}});d 4h={2m:7(o){G(d 1O 2M 6){d h=6[1O];f(2i h==\'7\')49;d 1i=[1O,h];1i.1O=1O;1i.h=h;o(1i)}},7t:7(){c 6.3r(\'1O\')},4N:7(){c 6.3r(\'h\')},7u:7(2N){c $H(2N).36($H(6),7(4Q,1i){4Q[1i.1O]=1i.h;c 4Q})},7w:7(){c 6.1C(7(1i){c 1i.1C(4n).1N(\'=\')}).1N(\'&\')},1U:7(){c\'#<4h:{\'+6.1C(7(1i){c 1i.1C(q.1U).1N(\': \')}).1N(\', \')+\'}>\'}};7 $H(U){d 2N=q.u({},U||{});q.u(2N,1p);q.u(2N,4h);c 2N};3L=1b.17();q.u(3L.v,1p);q.u(3L.v,{1I:7(22,2x,2H){6.22=22;6.2x=2x;6.2H=2H},2m:7(o){d h=6.22;2q{o(h);h=h.5j()}1H(6.1M(h))},1M:7(h){f(h<6.22)c Y;f(6.2H)c h<6.2x;c h<=6.2x}});d $R=7(22,2x,2H){c z 3L(22,2x,2H)};d M={4w:7(){c 6s.6j(7(){c z 5C()},7(){c z 5n(\'7y.6d\')},7(){c z 5n(\'7z.6d\')})||Y},4s:0};M.2W={3b:[],2m:7(o){6.3b.2m(o)},69:7(4F){f(!6.1M(4F))6.3b.W(4F)},7A:7(5t){6.3b=6.3b.5s(5t)},3y:7(1a,26,E,2Z){6.V(7(3o){f(3o[1a]&&2i 3o[1a]==\'7\'){1j{3o[1a].2n(3o,[26,E,2Z])}1s(e){}}})}};q.u(M.2W,1p);M.2W.69({5G:7(){M.4s++},1B:7(){M.4s--}});M.44=7(){};M.44.v={4a:7(m){6.m={1F:\'4j\',4p:11,5H:\'5E/x-86-Q-7C\',28:\'\'};q.u(6.m,m||{})},3l:7(){c 6.E.32==1v||6.E.32==0||(6.E.32>=84&&6.E.32<7E)},7G:7(){c!6.3l()}};M.3t=1b.17();M.3t.5L=[\'7H\',\'80\',\'7I\',\'7J\',\'4t\'];M.3t.v=q.u(z M.44(),{1I:7(1l,m){6.E=M.4w();6.4a(m);6.26(1l)},26:7(1l){d 28=6.m.28||\'\';f(28.t>0)28+=\'&7K=\';1j{6.1l=1l;f(6.m.1F==\'7L\'&&28.t>0)6.1l+=(6.1l.I(/\\?/)?\'&\':\'?\')+28;M.2W.3y(\'5G\',6,6.E);6.E.7N(6.m.1F,6.1l,6.m.4p);f(6.m.4p){6.E.5T=6.5J.1d(6);2Y((7(){6.4r(1)}).1d(6),10)}6.5A();d 1c=6.m.5V?6.m.5V:28;6.E.7O(6.m.1F==\'4j\'?1c:1L)}1s(e){6.3p(e)}},5A:7(){d 1P=[\'X-7P-7Q\',\'5C\',\'X-T-4l\',T.4l,\'7R\',\'1Y/7m, 1Y/2e, 5E/5F, 1Y/5F, */*\'];f(6.m.1F==\'4j\'){1P.W(\'5Q-2g\',6.m.5H);f(6.E.7S)1P.W(\'7T\',\'7U\')}f(6.m.1P)1P.W.2n(1P,6.m.1P);G(d i=0;i<1P.t;i+=2)6.E.7V(1P[i],1P[i+1])},5J:7(){d 2F=6.E.2F;f(2F!=1)6.4r(6.E.2F)},4A:7(B){1j{c 6.E.7W(B)}1s(e){}},5M:7(){1j{c 4q(\'(\'+6.4A(\'X-7X\')+\')\')}1s(e){}},5R:7(){1j{c 4q(6.E.3F)}1s(e){6.3p(e)}},4r:7(2F){d C=M.3t.5L[2F];d E=6.E,2Z=6.5M();f(C==\'4t\'){1j{(6.m[\'2I\'+6.E.32]||6.m[\'2I\'+(6.3l()?\'81\':\'82\')]||T.2v)(E,2Z)}1s(e){6.3p(e)}f((6.4A(\'5Q-2g\')||\'\').I(/^1Y\\/7m/i))6.5R()}1j{(6.m[\'2I\'+C]||T.2v)(E,2Z);M.2W.3y(\'2I\'+C,6,E,2Z)}1s(e){6.3p(e)}f(C==\'4t\')6.E.5T=T.2v},3p:7(57){(6.m.5W||T.2v)(6,57);M.2W.3y(\'5W\',6,57)}});M.4C=1b.17();q.u(q.u(M.4C.v,M.3t.v),{1I:7(1w,1l,m){6.4x={3m:1w.3m?$(1w.3m):$(1w),3z:1w.3z?$(1w.3z):(1w.3m?1L:$(1w))};6.E=M.4w();6.4a(m);d 1B=6.m.1B||T.2v;6.m.1B=(7(E,U){6.5Y();1B(E,U)}).1d(6);6.26(1l)},5Y:7(){d 3A=6.3l()?6.4x.3m:6.4x.3z;d 3k=6.E.3F;f(!6.m.3q)3k=3k.2Q();f(3A){f(6.m.60){z 6.m.60(3A,3k)}1D{k.6h(3A,3k)}}f(6.3l()){f(6.1B)2Y(6.1B.1d(6),10)}}});M.61=1b.17();M.61.v=q.u(z M.44(),{1I:7(1w,1l,m){6.4a(m);6.1B=6.m.1B;6.1J=(6.m.1J||2);6.2s=(6.m.2s||1);6.4B={};6.1w=1w;6.1l=1l;6.22()},22:7(){6.m.1B=6.63.1d(6);6.2D()},7b:7(){6.4B.1B=1v;89(6.65);(6.1B||T.2v).2n(6,N)},63:7(26){f(6.m.2s){6.2s=(26.3F==6.64?6.2s*6.m.2s:1);6.64=26.3F}6.65=2Y(6.2D.1d(6),6.2s*6.1J*4z)},2D:7(){6.4B=z M.4C(6.1w,6.1l,6.m)}});7 $(){d P=[],4;G(d i=0;i<4V>\'+6.2t+\'\';c $A(1q.2z[0].2z[0].2z)}};d 1g=z q();1g.6W=1b.17();1g.6W.v=q.u(z 1e.1g(\'96\'),{2V:7(){6.1K.97(6.4)},2X:7(2h){2h.V((7(2j){6.4.1X.55(2j,6.4)}).1d(6))}});1g.5m=1b.17();1g.5m.v=q.u(z 1e.1g(\'99\'),{2V:7(){6.1K.56(6.4);6.1K.74(11)},2X:7(2h){2h.4m(Y).V((7(2j){6.4.55(2j,6.4.9a)}).1d(6))}});1g.7h=1b.17();1g.7h.v=q.u(z 1e.1g(\'9d\'),{2V:7(){6.1K.56(6.4);6.1K.74(6.4)},2X:7(2h){2h.V((7(2j){6.4.75(2j)}).1d(6))}});1g.76=1b.17();1g.76.v=q.u(z 1e.1g(\'9i\'),{2V:7(){6.1K.9m(6.4)},2X:7(2h){2h.V((7(2j){6.4.1X.55(2j,6.4.9t)}).1d(6))}});k.3S=1b.17();k.3S.v={1I:7(4){6.4=$(4)},2m:7(o){6.4.1f.3j(/\\s+/).1k(7(B){c B.t>0}).2m(o)},5c:7(1f){6.4.1f=1f},7k:7(5a){f(6.1M(5a))c;6.5c(6.1Z().3s(5a).1N(\' \'))},42:7(4c){f(!6.1M(4c))c;6.5c(6.1k(7(1f){c 1f!=4c}).1N(\' \'))},2C:7(){c 6.1Z().1N(\' \')}};q.u(k.3S.v,1p);d 5I={5i:7(){G(d i=0;i=0){2b=4.m[w];h=2b.h||2b.1Y}c[4.B,h]},5X:7(4){d h=[];G(d i=0;i<4.t;i++){d 2b=4.m[i];f(2b.87)h.W(2b.h||2b.1Y)}c[4.B,h]}};d $F=D.k.1x;1e.3D=7(){};1e.3D.v={1I:7(4,1J,1a){6.1J=1J;6.4=$(4);6.1a=1a;6.2K=6.1x();6.2A()},2A:7(){5Z(6.2D.1d(6),6.1J*4z)},2D:7(){d h=6.1x();f(6.2K!=h){6.1a(6.4,h);6.2K=h}}};D.k.3C=1b.17();D.k.3C.v=q.u(z 1e.3D(),{1x:7(){c D.k.1x(6.4)}});D.3C=1b.17();D.3C.v=q.u(z 1e.3D(),{1x:7(){c D.3a(6.4)}});1e.2c=7(){};1e.2c.v={1I:7(4,1a){6.4=$(4);6.1a=1a;6.2K=6.1x();f(6.4.1h.2w()==\'Q\')6.67();1D 6.2A(6.4)},4K:7(){d h=6.1x();f(6.2K!=h){6.1a(6.4,h);6.2K=h}},67:7(){d 12=D.2L(6.4);G(d i=0;i<12.t;i++)6.2A(12[i])},2A:7(4){f(4.2g){6c(4.2g.2w()){1r\'6g\':1r\'6i\':1o.3B(4,\'8j\',6.4K.1d(6));1y;1r\'6l\':1r\'1Y\':1r\'3J\':1r\'1k-6n\':1r\'1k-8t\':1o.3B(4,\'8u\',6.4K.1d(6));1y}}}};D.k.2c=1b.17();D.k.2c.v=q.u(z 1e.2c(),{1x:7(){c D.k.1x(6.4)}});D.2c=1b.17();D.2c.v=q.u(z 1e.2c(),{1x:7(){c D.3a(6.4)}});f(!1W.1o){d 1o=z q()}q.u(1o,{8C:8,8F:9,8H:13,8I:27,8J:37,8L:38,8O:39,8T:40,8X:46,4:7(C){c C.Z||C.91},95:7(C){c(((C.6X)&&(C.6X==1))||((C.6Z)&&(C.6Z==1)))},9b:7(C){c C.9e||(C.9f+(J.3R.2G||J.1c.2G))},9g:7(C){c C.9j||(C.9k+(J.3R.2O||J.1c.2O))},7b:7(C){f(C.7d){C.7d();C.9r()}1D{C.48=Y;C.9w=11}},9A:7(C,1h){d 4=1o.4(C);1H(4.1X&&(!4.1h||(4.1h.3Y()!=1h.3Y())))4=4.1X;c 4},1T:Y,5u:7(4,B,1V,1u){f(!6.1T)6.1T=[];f(4.5f){6.1T.W([4,B,1V,1u]);4.5f(B,1V,1u)}1D f(4.4i){6.1T.W([4,B,1V,1u]);4.4i(\'2I\'+B,1V)}},66:7(){f(!1o.1T)c;G(d i=0;i<1o.1T.t;i++){1o.5N.2n(6,1o.1T[i]);1o.1T[i][0]=1L}1o.1T=Y},3B:7(4,B,1V,1u){d 4=$(4);1u=1u||Y;f(B==\'5U\'&&(33.4u.I(/3x|3w|3u/)||4.4i))B=\'5K\';6.5u(4,B,1V,1u)},5N:7(4,B,1V,1u){d 4=$(4);1u=1u||Y;f(B==\'5U\'&&(33.4u.I(/3x|3w|3u/)||4.4k))B=\'5K\';f(4.5x){4.5x(B,1V,1u)}1D f(4.4k){1j{4.4k(\'2I\'+B,1V)}1s(e){}}}});f(33.4u.I(/\\88\\b/))1o.3B(1W,\'8a\',1o.66,Y);d 2d={6o:Y,4P:7(){6.6z=1W.8e||J.3R.2G||J.1c.2G||0;6.6F=1W.8g||J.3R.2O||J.1c.2O||0},6u:7(4){d 19=0,15=0;2q{19+=4.2O||0;15+=4.2G||0;4=4.1X}1H(4);c[15,19]},35:7(4){d 19=0,15=0;2q{19+=4.29||0;15+=4.2f||0;4=4.1Q}1H(4);c[15,19]},68:7(4){d 19=0,15=0;2q{19+=4.29||0;15+=4.2f||0;4=4.1Q;f(4){p=k.1R(4,\'14\');f(p==\'3T\'||p==\'2o\')1y}}1H(4);c[15,19]},1Q:7(4){f(4.1Q)c 4.1Q;f(4==J.1c)c 4;1H((4=4.1X)&&4!=J.1c)f(k.1R(4,\'14\')!=\'4G\')c 4;c J.1c},8o:7(4,x,y){f(6.6o)c 6.6r(4,x,y);6.3g=x;6.34=y;6.1t=6.35(4);c(y>=6.1t[1]&&y<6.1t[1]+4.2k&&x>=6.1t[0]&&x<6.1t[0]+4.2p)},6r:7(4,x,y){d 4S=6.6u(4);6.3g=x+4S[0]-6.6z;6.34=y+4S[1]-6.6F;6.1t=6.35(4);c(6.34>=6.1t[1]&&6.34<6.1t[1]+4.2k&&6.3g>=6.1t[0]&&6.3g<6.1t[0]+4.2p)},8E:7(3Z,4){f(!3Z)c 0;f(3Z==\'8G\')c((6.1t[1]+4.2k)-6.34)/4.2k;f(3Z==\'8K\')c((6.1t[0]+4.2p)-6.3g)/4.2p},77:7(O,Z){O=$(O);Z=$(Z);Z.l.14=\'2o\';d 2P=6.35(O);Z.l.1n=2P[1]+\'1m\';Z.l.18=2P[0]+\'1m\';Z.l.21=O.2p+\'1m\';Z.l.24=O.2k+\'1m\'},4e:7(4M){d 19=0,15=0;d 4=4M;2q{19+=4.29||0;15+=4.2f||0;f(4.1Q==J.1c)f(k.1R(4,\'14\')==\'2o\')1y}1H(4=4.1Q);4=4M;2q{19-=4.2O||0;15-=4.2G||0}1H(4=4.1X);c[15,19]},77:7(O,Z){d m=q.u({5l:11,5r:11,5B:11,5q:11,29:0,2f:0},N[2]||{});O=$(O);d p=2d.4e(O);Z=$(Z);d 2J=[0,0];d 3v=1L;f(k.1R(Z,\'14\')==\'2o\'){3v=2d.1Q(Z);2J=2d.4e(3v)}f(3v==J.1c){2J[0]-=J.1c.2f;2J[1]-=J.1c.29}f(m.5l)Z.l.18=(p[0]-2J[0]+m.2f)+\'1m\';f(m.5r)Z.l.1n=(p[1]-2J[1]+m.29)+\'1m\';f(m.5B)Z.l.21=O.2p+\'1m\';f(m.5q)Z.l.24=O.2k+\'1m\'},8b:7(4){4=$(4);f(4.l.14==\'2o\')c;2d.4P();d 2P=2d.68(4);d 1n=2P[1];d 18=2P[0];d 21=4.6m;d 24=4.6p;4.6P=18-3X(4.l.18||0);4.6I=1n-3X(4.l.1n||0);4.5k=4.l.21;4.7f=4.l.24;4.l.14=\'2o\';4.l.1n=1n+\'1m\';4.l.18=18+\'1m\';4.l.21=21+\'1m\';4.l.24=24+\'1m\'},8w:7(4){4=$(4);f(4.l.14==\'3T\')c;2d.4P();4.l.14=\'3T\';d 1n=3X(4.l.1n||0)-(4.6I||0);d 18=3X(4.l.18||0)-(4.6P||0);4.l.1n=1n+\'1m\';4.l.18=18+\'1m\';4.l.24=4.7f;4.l.21=4.5k}};f(/3x|3w|3u/.4v(33.62)){2d.35=7(4){d 19=0,15=0;2q{19+=4.29||0;15+=4.2f||0;f(4.1Q==J.1c)f(k.1R(4,\'14\')==\'2o\')1y;4=4.1Q}1H(4);c[15,19]}};',62,600,'||||element||this|function|||||return|var||if||value|||Element|style|options||iterator||Object|||length|extend|prototype|index|||new||name|event|Form|transport||for||match|document||result|Ajax|arguments|source|results|form|||Prototype|object|each|push||false|target||true|elements||position|valueL||create|left|valueT|callback|Class|body|bind|Abstract|className|Insertion|tagName|pair|try|select|url|px|top|Event|Enumerable|div|case|catch|offset|useCapture|undefined|container|getValue|break|replacement|pattern|onComplete|map|else|Array|method|property|while|initialize|frequency|range|null|include|join|key|requestHeaders|offsetParent|getStyle|parameter|observers|inspect|observer|window|parentNode|text|toArray|els|width|start|args|height|throw|request||parameters|offsetTop|methods|opt|EventObserver|Position|html|offsetLeft|type|fragments|typeof|fragment|offsetHeight|oStringList|_each|apply|absolute|offsetWidth|do|cache|decay|content|input|emptyFunction|toLowerCase|end|replace|childNodes|registerCallback|display|toString|onTimerEvent|Serializers|readyState|scrollLeft|exclusive|on|delta|lastValue|getElements|in|hash|scrollTop|offsets|stripScripts|iterable|truncation|gsub|template|initializeRange|Responders|insertContent|setTimeout|json||hidden|status|navigator|ycomp|cumulativeOffset|inject||||serialize|responders|_overflow|Methods|collect|adjacency|xcomp|innerHTML|count|split|response|responseIsSuccess|success|Template|responder|dispatchException|evalScripts|pluck|concat|Request|KHTML|parent|Safari|Konqueror|dispatch|failure|receiver|observe|Observer|TimedObserver|ScriptFragment|responseText|script|inputs|ancestor|textarea|classNames|ObjectRange|node|typeName|RegExp|camelize|none|documentElement|ClassNames|relative|right|overflow|HTMLElement|parseFloat|toUpperCase|mode||currentlyExecuting|remove|__method|Base|memo||slice|returnValue|continue|setOptions|String|classNameToRemove|_reverse|page|focus|queryComponent|Hash|attachEvent|post|detachEvent|Version|reverse|encodeURIComponent|disabled|asynchronous|eval|respondToReadyState|activeRequestCount|Complete|appVersion|test|getTransport|containers|matchingInputs|1000|header|updater|Updater|getElementsByTagName|child|responderToAdd|static|tagElements|queryComponents|defaultView|onElementEvent|css|forElement|values|visibility|prepare|mergedHash|pos|offsetcache|_madePositioned|visible|tbody|findOrStore|_nativeExtensions|createElement|digits|trues|found|prepareReplacement|before|camelizedString|insertBefore|selectNodeContents|exception|falses|criteria|classNameToAdd|params|set|destination|last|addEventListener|indexOf|inline|clear|succ|_originalWidth|setLeft|Top|ActiveXObject|scriptTag|matchOne|setHeight|setTop|without|responderToRemove|_observeAndCache|find|reset|removeEventListener|activate|findFirstElement|setRequestHeaders|setWidth|XMLHttpRequest|constructor|application|xml|onCreate|contentType|Field|onStateChange|keydown|Events|evalJSON|stopObserving|inputSelector|img|Content|evalResponse|selectOne|onreadystatechange|keypress|postBody|onException|selectMany|updateContent|setInterval|insertion|PeriodicalUpdater|userAgent|updateComplete|lastText|timer|unloadCache|registerFormCallbacks|positionedOffset|register|parentElement|children|switch|XMLHTTP|_extended|hide|checkbox|update|radio|these|outerHTML|password|clientWidth|one|includeScrollOffsets|clientHeight|nodeValue|withinIncludingScrolloffsets|Try|scrollTo|realOffset|getComputedStyle|show|currentStyle|auto|deltaX|originalPosition|originalVisibility|originalWidth|originalHeight|opera|deltaY|bottom|array|_originalTop|flatten|addMethods|lambda|Toggle|toggle|insertAdjacentHTML|_originalLeft|PeriodicalExecuter|ownerDocument|createRange|createContextualFragment|contentFromAnonymousTable|table|Before|which|matchAll|button|extractScripts|stripTags|pairString|len|collapse|appendChild|After|clone|toQueryParams|Pattern|evaluate|stop|stringValue|preventDefault|charAt|_originalHeight|substring|Bottom|pairs|Function|add|collections|javascript|detect|findAll|entries|from|first|compact|keys|merge|present|toQueryString|getInputs|Msxml2|Microsoft|unregister|disable|urlencoded|blur|300|enable|responseIsFailure|Uninitialized|Loaded|Interactive|_|get|focusFirstElement|open|send|Requested|With|Accept|overrideMimeType|Connection|close|setRequestHeader|getResponseHeader|JSON|gi|submit|Loading|Success|Failure|checked|200|selectedIndex|www|selected|bMSIE|clearTimeout|unload|absolutize|string|getElementById|pageXOffset|getElementsByClassName|pageYOffset|removeChild|replaceChild|click|getHeight|hasClassName|addClassName|removeClassName|within|cleanWhitespace|nodeType|empty|childOf|multiple|change|getPropertyValue|relativize|setStyle|getDimensions|makePositioned|undoPositioned|makeClipping|KEY_BACKSPACE|undoClipping|overlap|KEY_TAB|vertical|KEY_RETURN|KEY_ESC|KEY_LEFT|horizontal|KEY_UP|member|tr|KEY_RIGHT|0_RC_0|Number|instanceof|shift|KEY_DOWN|bindAsEventListener|call|toColorPart|KEY_DELETE|times|finally|callee|srcElement|sub|scan|truncate|isLeftClick|beforeBegin|setStartBefore|im|afterBegin|firstChild|pointerX|unescapeHTML|beforeEnd|pageX|clientX|pointerY|parseQuery|afterEnd|pageY|clientY|RangeError|setStartAfter|all|any|grep|invoke|stopPropagation|max|nextSibling|min|partition|cancelBubble|reject|sortBy|sort|findElement|zip|pop|createTextNode|escapeHTML|strip'.split('|'),0,{}) + +} \ No newline at end of file diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-validate-input.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-validate-input.js new file mode 100644 index 0000000000..a52d737bef --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-0.9.1/string-validate-input.js @@ -0,0 +1,89 @@ +letters = new Array("a","b","c","d","e","f","g","h","i","j","k","l","m","n","o","p","q","r","s","t","u","v","w","x","y","z"); +numbers = new Array(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26); +colors = new Array("FF","CC","99","66","33","00"); + +var endResult; + +function doTest() +{ + endResult = ""; + + // make up email address + for (var k=0;k<4000;k++) + { + name = makeName(6); + (k%2)?email=name+"@mac.com":email=name+"(at)mac.com"; + + // validate the email address + var pattern = /^[a-zA-Z0-9\-\._]+@[a-zA-Z0-9\-_]+(\.?[a-zA-Z0-9\-_]*)\.[a-zA-Z]{2,3}$/; + + if(pattern.test(email)) + { + var r = email + " appears to be a valid email address."; + addResult(r); + } + else + { + r = email + " does NOT appear to be a valid email address."; + addResult(r); + } + } + + // make up ZIP codes + for (var s=0;s<4000;s++) + { + var zipGood = true; + var zip = makeNumber(4); + (s%2)?zip=zip+"xyz":zip=zip.concat("7"); + + // validate the zip code + for (var i = 0; i < zip.length; i++) { + var ch = zip.charAt(i); + if (ch < "0" || ch > "9") { + zipGood = false; + r = zip + " contains letters."; + addResult(r); + } + } + if (zipGood && zip.length>5) + { + zipGood = false; + r = zip + " is longer than five characters."; + addResult(r); + } + if (zipGood) + { + r = zip + " appears to be a valid ZIP code."; + addResult(r); + } + } +} + +function makeName(n) +{ + var tmp = ""; + for (var i=0;i= 0) + checkSyntax(testScript); + else + load(testScript); + let duration = new Date() - startTime; + gc(); + + print(testName+":", duration); +} + +})(); + diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/json2.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/json2.js new file mode 100644 index 0000000000..39d8f3706a --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/json2.js @@ -0,0 +1,481 @@ +/* + http://www.JSON.org/json2.js + 2009-09-29 + + Public Domain. + + NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK. + + See http://www.JSON.org/js.html + + + This code should be minified before deployment. + See http://javascript.crockford.com/jsmin.html + + USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO + NOT CONTROL. + + + This file creates a global JSON object containing two methods: stringify + and parse. + + JSON.stringify(value, replacer, space) + value any JavaScript value, usually an object or array. + + replacer an optional parameter that determines how object + values are stringified for objects. It can be a + function or an array of strings. + + space an optional parameter that specifies the indentation + of nested structures. If it is omitted, the text will + be packed without extra whitespace. If it is a number, + it will specify the number of spaces to indent at each + level. If it is a string (such as '\t' or ' '), + it contains the characters used to indent at each level. + + This method produces a JSON text from a JavaScript value. + + When an object value is found, if the object contains a toJSON + method, its toJSON method will be called and the result will be + stringified. A toJSON method does not serialize: it returns the + value represented by the name/value pair that should be serialized, + or undefined if nothing should be serialized. The toJSON method + will be passed the key associated with the value, and this will be + bound to the value + + For example, this would serialize Dates as ISO strings. + + Date.prototype.toJSON = function (key) { + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + return this.getUTCFullYear() + '-' + + f(this.getUTCMonth() + 1) + '-' + + f(this.getUTCDate()) + 'T' + + f(this.getUTCHours()) + ':' + + f(this.getUTCMinutes()) + ':' + + f(this.getUTCSeconds()) + 'Z'; + }; + + You can provide an optional replacer method. It will be passed the + key and value of each member, with this bound to the containing + object. The value that is returned from your method will be + serialized. If your method returns undefined, then the member will + be excluded from the serialization. + + If the replacer parameter is an array of strings, then it will be + used to select the members to be serialized. It filters the results + such that only members with keys listed in the replacer array are + stringified. + + Values that do not have JSON representations, such as undefined or + functions, will not be serialized. Such values in objects will be + dropped; in arrays they will be replaced with null. You can use + a replacer function to replace those with JSON values. + JSON.stringify(undefined) returns undefined. + + The optional space parameter produces a stringification of the + value that is filled with line breaks and indentation to make it + easier to read. + + If the space parameter is a non-empty string, then that string will + be used for indentation. If the space parameter is a number, then + the indentation will be that many spaces. + + Example: + + text = JSON.stringify(['e', {pluribus: 'unum'}]); + // text is '["e",{"pluribus":"unum"}]' + + + text = JSON.stringify(['e', {pluribus: 'unum'}], null, '\t'); + // text is '[\n\t"e",\n\t{\n\t\t"pluribus": "unum"\n\t}\n]' + + text = JSON.stringify([new Date()], function (key, value) { + return this[key] instanceof Date ? + 'Date(' + this[key] + ')' : value; + }); + // text is '["Date(---current time---)"]' + + + JSON.parse(text, reviver) + This method parses a JSON text to produce an object or array. + It can throw a SyntaxError exception. + + The optional reviver parameter is a function that can filter and + transform the results. It receives each of the keys and values, + and its return value is used instead of the original value. + If it returns what it received, then the structure is not modified. + If it returns undefined then the member is deleted. + + Example: + + // Parse the text. Values that look like ISO date strings will + // be converted to Date objects. + + myData = JSON.parse(text, function (key, value) { + var a; + if (typeof value === 'string') { + a = +/^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value); + if (a) { + return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4], + +a[5], +a[6])); + } + } + return value; + }); + + myData = JSON.parse('["Date(09/09/2001)"]', function (key, value) { + var d; + if (typeof value === 'string' && + value.slice(0, 5) === 'Date(' && + value.slice(-1) === ')') { + d = new Date(value.slice(5, -1)); + if (d) { + return d; + } + } + return value; + }); + + + This is a reference implementation. You are free to copy, modify, or + redistribute. +*/ + +/*jslint evil: true, strict: false */ + +/*members "", "\b", "\t", "\n", "\f", "\r", "\"", JSON, "\\", apply, + call, charCodeAt, getUTCDate, getUTCFullYear, getUTCHours, + getUTCMinutes, getUTCMonth, getUTCSeconds, hasOwnProperty, join, + lastIndex, length, parse, prototype, push, replace, slice, stringify, + test, toJSON, toString, valueOf +*/ + + +// Create a JSON object only if one does not already exist. We create the +// methods in a closure to avoid creating global variables. + +if (!this.JSON) { + this.JSON = {}; +} + +(function () { + + function f(n) { + // Format integers to have at least two digits. + return n < 10 ? '0' + n : n; + } + + if (typeof Date.prototype.toJSON !== 'function') { + + Date.prototype.toJSON = function (key) { + + return isFinite(this.valueOf()) ? + this.getUTCFullYear() + '-' + + f(this.getUTCMonth() + 1) + '-' + + f(this.getUTCDate()) + 'T' + + f(this.getUTCHours()) + ':' + + f(this.getUTCMinutes()) + ':' + + f(this.getUTCSeconds()) + 'Z' : null; + }; + + String.prototype.toJSON = + Number.prototype.toJSON = + Boolean.prototype.toJSON = function (key) { + return this.valueOf(); + }; + } + + var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + gap, + indent, + meta = { // table of character substitutions + '\b': '\\b', + '\t': '\\t', + '\n': '\\n', + '\f': '\\f', + '\r': '\\r', + '"' : '\\"', + '\\': '\\\\' + }, + rep; + + + function quote(string) { + +// If the string contains no control characters, no quote characters, and no +// backslash characters, then we can safely slap some quotes around it. +// Otherwise we must also replace the offending characters with safe escape +// sequences. + + escapable.lastIndex = 0; + return escapable.test(string) ? + '"' + string.replace(escapable, function (a) { + var c = meta[a]; + return typeof c === 'string' ? c : + '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }) + '"' : + '"' + string + '"'; + } + + + function str(key, holder) { + +// Produce a string from holder[key]. + + var i, // The loop counter. + k, // The member key. + v, // The member value. + length, + mind = gap, + partial, + value = holder[key]; + +// If the value has a toJSON method, call it to obtain a replacement value. + + if (value && typeof value === 'object' && + typeof value.toJSON === 'function') { + value = value.toJSON(key); + } + +// If we were called with a replacer function, then call the replacer to +// obtain a replacement value. + + if (typeof rep === 'function') { + value = rep.call(holder, key, value); + } + +// What happens next depends on the value's type. + + switch (typeof value) { + case 'string': + return quote(value); + + case 'number': + +// JSON numbers must be finite. Encode non-finite numbers as null. + + return isFinite(value) ? String(value) : 'null'; + + case 'boolean': + case 'null': + +// If the value is a boolean or null, convert it to a string. Note: +// typeof null does not produce 'null'. The case is included here in +// the remote chance that this gets fixed someday. + + return String(value); + +// If the type is 'object', we might be dealing with an object or an array or +// null. + + case 'object': + +// Due to a specification blunder in ECMAScript, typeof null is 'object', +// so watch out for that case. + + if (!value) { + return 'null'; + } + +// Make an array to hold the partial results of stringifying this object value. + + gap += indent; + partial = []; + +// Is the value an array? + + if (Object.prototype.toString.apply(value) === '[object Array]') { + +// The value is an array. Stringify every element. Use null as a placeholder +// for non-JSON values. + + length = value.length; + for (i = 0; i < length; i += 1) { + partial[i] = str(i, value) || 'null'; + } + +// Join all of the elements together, separated with commas, and wrap them in +// brackets. + + v = partial.length === 0 ? '[]' : + gap ? '[\n' + gap + + partial.join(',\n' + gap) + '\n' + + mind + ']' : + '[' + partial.join(',') + ']'; + gap = mind; + return v; + } + +// If the replacer is an array, use it to select the members to be stringified. + + if (rep && typeof rep === 'object') { + length = rep.length; + for (i = 0; i < length; i += 1) { + k = rep[i]; + if (typeof k === 'string') { + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } else { + +// Otherwise, iterate through all of the keys in the object. + + for (k in value) { + if (Object.hasOwnProperty.call(value, k)) { + v = str(k, value); + if (v) { + partial.push(quote(k) + (gap ? ': ' : ':') + v); + } + } + } + } + +// Join all of the member texts together, separated with commas, +// and wrap them in braces. + + v = partial.length === 0 ? '{}' : + gap ? '{\n' + gap + partial.join(',\n' + gap) + '\n' + + mind + '}' : '{' + partial.join(',') + '}'; + gap = mind; + return v; + } + } + +// If the JSON object does not yet have a stringify method, give it one. + + if (typeof JSON.stringify !== 'function') { + JSON.stringify = function (value, replacer, space) { + +// The stringify method takes a value and an optional replacer, and an optional +// space parameter, and returns a JSON text. The replacer can be a function +// that can replace values, or an array of strings that will select the keys. +// A default replacer method can be provided. Use of the space parameter can +// produce text that is more easily readable. + + var i; + gap = ''; + indent = ''; + +// If the space parameter is a number, make an indent string containing that +// many spaces. + + if (typeof space === 'number') { + for (i = 0; i < space; i += 1) { + indent += ' '; + } + +// If the space parameter is a string, it will be used as the indent string. + + } else if (typeof space === 'string') { + indent = space; + } + +// If there is a replacer, it must be a function or an array. +// Otherwise, throw an error. + + rep = replacer; + if (replacer && typeof replacer !== 'function' && + (typeof replacer !== 'object' || + typeof replacer.length !== 'number')) { + throw new Error('JSON.stringify'); + } + +// Make a fake root object containing our value under the key of ''. +// Return the result of stringifying the value. + + return str('', {'': value}); + }; + } + + +// If the JSON object does not yet have a parse method, give it one. + + if (typeof JSON.parse !== 'function') { + JSON.parse = function (text, reviver) { + +// The parse method takes a text and an optional reviver function, and returns +// a JavaScript value if the text is a valid JSON text. + + var j; + + function walk(holder, key) { + +// The walk method is used to recursively walk the resulting structure so +// that modifications can be made. + + var k, v, value = holder[key]; + if (value && typeof value === 'object') { + for (k in value) { + if (Object.hasOwnProperty.call(value, k)) { + v = walk(value, k); + if (v !== undefined) { + value[k] = v; + } else { + delete value[k]; + } + } + } + } + return reviver.call(holder, key, value); + } + + +// Parsing happens in four stages. In the first stage, we replace certain +// Unicode characters with escape sequences. JavaScript handles many characters +// incorrectly, either silently deleting them, or treating them as line endings. + + cx.lastIndex = 0; + if (cx.test(text)) { + text = text.replace(cx, function (a) { + return '\\u' + + ('0000' + a.charCodeAt(0).toString(16)).slice(-4); + }); + } + +// In the second stage, we run the text against regular expressions that look +// for non-JSON patterns. We are especially concerned with '()' and 'new' +// because they can cause invocation, and '=' because it can cause mutation. +// But just to be safe, we want to reject all unexpected forms. + +// We split the second stage into 4 regexp operations in order to work around +// crippling inefficiencies in IE's and Safari's regexp engines. First we +// replace the JSON backslash pairs with '@' (a non-JSON character). Second, we +// replace all simple value tokens with ']' characters. Third, we delete all +// open brackets that follow a colon or comma or that begin the text. Finally, +// we look to see that the remaining characters are only whitespace or ']' or +// ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval. + + if (/^[\],:{}\s]*$/. +test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@'). +replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']'). +replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) { + +// In the third stage we use the eval function to compile the text into a +// JavaScript structure. The '{' operator is subject to a syntactic ambiguity +// in JavaScript: it can begin a block or an object literal. We wrap the text +// in parens to eliminate the ambiguity. + + j = eval('(' + text + ')'); + +// In the optional fourth stage, we recursively walk the new structure, passing +// each name/value pair to a reviver function for possible transformation. + + return typeof reviver === 'function' ? + walk({'': j}, '') : j; + } + +// If the text is not JSON parseable, then a SyntaxError is thrown. + + throw new SyntaxError('JSON.parse'); + }; + } +}()); diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/driver.html b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/driver.html new file mode 100644 index 0000000000..4c341fadd8 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/driver.html @@ -0,0 +1,132 @@ + + + + + + + + +SunSpider 1.0.1 JavaScript Benchmark (sunspider-1.0.1 test suite - In Progress...) + + + + + +

        SunSpider JavaScript Benchmark (In Progress...)

        +

        Content Version: sunspider-1.0.1

        + + + + + +
        +
        + + + diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/results.html b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/results.html new file mode 100644 index 0000000000..4caaeacd48 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/results.html @@ -0,0 +1,108 @@ + + + + + + + + +SunSpider 1.0.1 JavaScript Benchmark Results (sunspider-1.0.1 test suite) + + + + +

        SunSpider 1.0.1 JavaScript Benchmark Results

        + +

        Content Version: sunspider-1.0.1

        + +

        Run Again

        + +


        +(You can bookmark this results URL for later comparison.)

        + +
        To compare to another run, paste a saved result URL in the text field below and press enter:
        +
        +
        + +
        +
        + + + + + + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/sunspider-test-contents.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/sunspider-test-contents.js new file mode 100644 index 0000000000..cd11a5628e --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/sunspider-test-contents.js @@ -0,0 +1,7295 @@ +var testContents = [ "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider 3d-cube\n\ +\n\ +\n\ +\n\ +\n\ +

        3d-cube

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider 3d-morph\n\ +\n\ +\n\ +\n\ +\n\ +

        3d-morph

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider 3d-raytrace\n\ +\n\ +\n\ +\n\ +\n\ +

        3d-raytrace

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider access-binary-trees\n\ +\n\ +\n\ +\n\ +\n\ +

        access-binary-trees

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider access-fannkuch\n\ +\n\ +\n\ +\n\ +\n\ +

        access-fannkuch

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider access-nbody\n\ +\n\ +\n\ +\n\ +\n\ +

        access-nbody

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider access-nsieve\n\ +\n\ +\n\ +\n\ +\n\ +

        access-nsieve

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider bitops-3bit-bits-in-byte\n\ +\n\ +\n\ +\n\ +\n\ +

        bitops-3bit-bits-in-byte

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider bitops-bits-in-byte\n\ +\n\ +\n\ +\n\ +\n\ +

        bitops-bits-in-byte

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider bitops-bitwise-and\n\ +\n\ +\n\ +\n\ +\n\ +

        bitops-bitwise-and

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider bitops-nsieve-bits\n\ +\n\ +\n\ +\n\ +\n\ +

        bitops-nsieve-bits

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider controlflow-recursive\n\ +\n\ +\n\ +\n\ +\n\ +

        controlflow-recursive

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider crypto-aes\n\ +\n\ +\n\ +\n\ +\n\ +

        crypto-aes

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider crypto-md5\n\ +\n\ +\n\ +\n\ +\n\ +

        crypto-md5

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider crypto-sha1\n\ +\n\ +\n\ +\n\ +\n\ +

        crypto-sha1

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider date-format-tofte\n\ +\n\ +\n\ +\n\ +\n\ +

        date-format-tofte

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider date-format-xparb\n\ +\n\ +\n\ +\n\ +\n\ +

        date-format-xparb

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider math-cordic\n\ +\n\ +\n\ +\n\ +\n\ +

        math-cordic

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider math-partial-sums\n\ +\n\ +\n\ +\n\ +\n\ +

        math-partial-sums

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider math-spectral-norm\n\ +\n\ +\n\ +\n\ +\n\ +

        math-spectral-norm

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider regexp-dna\n\ +\n\ +\n\ +\n\ +\n\ +

        regexp-dna

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider string-base64\n\ +\n\ +\n\ +\n\ +\n\ +

        string-base64

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider string-fasta\n\ +\n\ +\n\ +\n\ +\n\ +

        string-fasta

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider string-tagcloud\n\ +\n\ +\n\ +\n\ +\n\ +

        string-tagcloud

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider string-unpack-code\n\ +\n\ +\n\ +\n\ +\n\ +

        string-unpack-code

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +", "\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +\n\ +SunSpider string-validate-input\n\ +\n\ +\n\ +\n\ +\n\ +

        string-validate-input

        \n\ +
        \n\ +
        \n\ +\n\ +\n\ +\n\ +\n\ +\n\ +" ]; diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/sunspider-test-prefix.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/sunspider-test-prefix.js new file mode 100644 index 0000000000..61a4b4fe06 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-1.0.1/sunspider-test-prefix.js @@ -0,0 +1,2 @@ +var tests = [ "3d-cube", "3d-morph", "3d-raytrace", "access-binary-trees", "access-fannkuch", "access-nbody", "access-nsieve", "bitops-3bit-bits-in-byte", "bitops-bits-in-byte", "bitops-bitwise-and", "bitops-nsieve-bits", "controlflow-recursive", "crypto-aes", "crypto-md5", "crypto-sha1", "date-format-tofte", "date-format-xparb", "math-cordic", "math-partial-sums", "math-spectral-norm", "regexp-dna", "string-base64", "string-fasta", "string-tagcloud", "string-unpack-code", "string-validate-input" ]; +var categories = [ "3d", "access", "bitops", "controlflow", "crypto", "date", "math", "regexp", "string" ]; diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-analyze-results.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-analyze-results.js new file mode 100644 index 0000000000..029e193e97 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-analyze-results.js @@ -0,0 +1,280 @@ +/* + * Copyright (C) 2007 Apple Inc. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY APPLE INC. ``AS IS'' AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL APPLE INC. OR + * CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + * PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + * PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY + * OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +var count = output.length; + +var itemTotals = {}; +itemTotals.length = count; + +var total = 0; +var categoryTotals = {}; +var testTotalsByCategory = {}; + +var mean = 0; +var categoryMeans = {}; +var testMeansByCategory = {}; + +var stdDev = 0; +var categoryStdDevs = {}; +var testStdDevsByCategory = {}; + +var stdErr = 0; +var categoryStdErrs = {}; +var testStdErrsByCategory = {}; + +function initialize() +{ + itemTotals = {total: []}; + + for (var i = 0; i < categories.length; i++) { + var category = categories[i]; + itemTotals[category] = []; + categoryTotals[category] = 0; + testTotalsByCategory[category] = {}; + categoryMeans[category] = 0; + testMeansByCategory[category] = {}; + categoryStdDevs[category] = 0; + testStdDevsByCategory[category] = {}; + categoryStdErrs[category] = 0; + testStdErrsByCategory[category] = {}; + } + + for (var i = 0; i < tests.length; i++) { + var test = tests[i]; + itemTotals[test] = []; + var category = test.replace(/-.*/, ""); + testTotalsByCategory[category][test] = 0; + testMeansByCategory[category][test] = 0; + testStdDevsByCategory[category][test] = 0; + testStdErrsByCategory[category][test] = 0; + } + + for (var i = 0; i < count; i++) { + itemTotals["total"][i] = 0; + for (var category in categoryTotals) { + itemTotals[category][i] = 0; + for (var test in testTotalsByCategory[category]) { + itemTotals[test][i] = 0; + } + } + } +} + +function computeItemTotals() +{ + for (var i = 0; i < output.length; i++) { + var result = output[i]; + for (var test in result) { + var time = result[test]; + var category = test.replace(/-.*/, ""); + itemTotals["total"][i] += time; + itemTotals[category][i] += time; + itemTotals[test][i] += time; + } + } +} + +function computeTotals() +{ + for (var i = 0; i < output.length; i++) { + var result = output[i]; + for (var test in result) { + var time = result[test]; + var category = test.replace(/-.*/, ""); + total += time; + categoryTotals[category] += time; + testTotalsByCategory[category][test] += time; + } + } +} + +function computeMeans() +{ + mean = total / count; + for (var category in categoryTotals) { + categoryMeans[category] = categoryTotals[category] / count; + for (var test in testTotalsByCategory[category]) { + testMeansByCategory[category][test] = testTotalsByCategory[category][test] / count; + } + } +} + +function standardDeviation(mean, items) +{ + var deltaSquaredSum = 0; + for (var i = 0; i < items.length; i++) { + var delta = items[i] - mean; + deltaSquaredSum += delta * delta; + } + variance = deltaSquaredSum / (items.length - 1); + return Math.sqrt(variance); +} + +function computeStdDevs() +{ + stdDev = standardDeviation(mean, itemTotals["total"]); + for (var category in categoryStdDevs) { + categoryStdDevs[category] = standardDeviation(categoryMeans[category], itemTotals[category]); + } + for (var category in categoryStdDevs) { + for (var test in testStdDevsByCategory[category]) { + testStdDevsByCategory[category][test] = standardDeviation(testMeansByCategory[category][test], itemTotals[test]); + } + } +} + +function computeStdErrors() +{ + var sqrtCount = Math.sqrt(count); + + stdErr = stdDev / sqrtCount; + for (var category in categoryStdErrs) { + categoryStdErrs[category] = categoryStdDevs[category] / sqrtCount; + } + for (var category in categoryStdDevs) { + for (var test in testStdErrsByCategory[category]) { + testStdErrsByCategory[category][test] = testStdDevsByCategory[category][test] / sqrtCount; + } + } + +} + +var tDistribution = [NaN, NaN, 12.71, 4.30, 3.18, 2.78, 2.57, 2.45, 2.36, 2.31, 2.26, 2.23, 2.20, 2.18, 2.16, 2.14, 2.13, 2.12, 2.11, 2.10, 2.09, 2.09, 2.08, 2.07, 2.07, 2.06, 2.06, 2.06, 2.05, 2.05, 2.05, 2.04, 2.04, 2.04, 2.03, 2.03, 2.03, 2.03, 2.03, 2.02, 2.02, 2.02, 2.02, 2.02, 2.02, 2.02, 2.01, 2.01, 2.01, 2.01, 2.01, 2.01, 2.01, 2.01, 2.01, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.96]; +var tMax = tDistribution.length; +var tLimit = 1.96; + +function tDist(n) +{ + if (n > tMax) + return tLimit; + return tDistribution[n]; +} + + +function formatResult(meanWidth, mean, stdErr, n, mode) +{ + // NaN mean means that the test did not run correctly. + if (mean != mean) { + var result = ""; + for (var i = 0; i < meanWidth - 3; ++i) + result += " "; + if (mode == "test") + result += "ERROR: Invalid test run."; + else + result += "ERROR: Some tests failed."; + return result; + } + + var meanString = mean.toFixed(1).toString(); + while (meanString.length < meanWidth) { + meanString = " " + meanString; + } + + if (n == 1) + return meanString + "ms"; + + return meanString + "ms +/- " + ((tDist(n) * stdErr / mean) * 100).toFixed(1) + "%"; +} + +function computeLabelWidth() +{ + var width = "Total".length; + for (var category in categoryMeans) { + if (category.length + 2 > width) + width = category.length + 2; + } + for (var i = 0; i < tests.length; i++) { + var shortName = tests[i].replace(/^[^-]*-/, ""); + if (shortName.length + 4 > width) + width = shortName.length + 4; + } + + return width; +} + +function computeMeanWidth() +{ + var width = mean.toFixed(1).toString().length; + for (var category in categoryMeans) { + var candidate = categoryMeans[category].toFixed(2).toString().length; + if (candidate > width) + width = candidate; + for (var test in testMeansByCategory[category]) { + var candidate = testMeansByCategory[category][test].toFixed(2).toString().length; + if (candidate > width) + width = candidate; + } + } + + return width; +} + +function resultLine(labelWidth, indent, label, meanWidth, mean, stdErr, mode) +{ + var result = ""; + for (i = 0; i < indent; i++) { + result += " "; + } + + result += label + ": "; + + for (i = 0; i < (labelWidth - (label.length + indent)); i++) { + result += " "; + } + + return result + formatResult(meanWidth, mean, stdErr, count, mode); +} + +function printOutput() +{ + var labelWidth = computeLabelWidth(); + var meanWidth = computeMeanWidth(); + + print("\n"); + print("============================================"); + if (count == 1) + print("RESULTS"); + else + print("RESULTS (means and 95% confidence intervals)"); + print("--------------------------------------------"); + print(resultLine(labelWidth, 0, "Total", meanWidth, mean, stdErr, "total")); + print("--------------------------------------------"); + for (var category in categoryMeans) { + print(""); + print(resultLine(labelWidth, 2, category, meanWidth, categoryMeans[category], categoryStdErrs[category], "category")); + for (var test in testMeansByCategory[category]) { + var shortName = test.replace(/^[^-]*-/, ""); + print(resultLine(labelWidth, 4, shortName, meanWidth, testMeansByCategory[category][test], testStdErrsByCategory[category][test], "test")); + } + } +} + +initialize(); +computeItemTotals(); +computeTotals(); +computeMeans(); +computeStdDevs(); +computeStdErrors(); +printOutput(); diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-compare-results.js b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-compare-results.js new file mode 100644 index 0000000000..d9f2d7b244 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider-compare-results.js @@ -0,0 +1,396 @@ +/* + * Copyright (C) 2007 Apple Inc. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY APPLE INC. ``AS IS'' AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL APPLE INC. OR + * CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, + * PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR + * PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY + * OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +function sunspiderCompareResults(output1, output2) +{ + var count1 = output1.length; + var count2 = output2.length; + + var itemTotals1 = {}; + itemTotals1.length = count1; + + var total1 = 0; + var categoryTotals1 = {}; + var testTotalsByCategory1 = {}; + + var mean1 = 0; + var categoryMeans1 = {}; + var testMeansByCategory1 = {}; + + var stdDev1 = 0; + var categoryStdDevs1 = {}; + var testStdDevsByCategory1 = {}; + + var stdErr1 = 0; + var categoryStdErrs1 = {}; + var testStdErrsByCategory1 = {}; + + var itemTotals2 = {}; + itemTotals2.length = count2; + + var total2 = 0; + var categoryTotals2 = {}; + var testTotalsByCategory2 = {}; + + var mean2 = 0; + var categoryMeans2 = {}; + var testMeansByCategory2 = {}; + + var stdDev2 = 0; + var categoryStdDevs2 = {}; + var testStdDevsByCategory2 = {}; + + var stdErr2 = 0; + var categoryStdErrs2 = {}; + var testStdErrsByCategory2 = {}; + + function initialize() + { + itemTotals1 = {total: []}; + + for (var i = 0; i < categories.length; i++) { + var category = categories[i]; + itemTotals1[category] = []; + categoryTotals1[category] = 0; + testTotalsByCategory1[category] = {}; + categoryMeans1[category] = 0; + testMeansByCategory1[category] = {}; + categoryStdDevs1[category] = 0; + testStdDevsByCategory1[category] = {}; + categoryStdErrs1[category] = 0; + testStdErrsByCategory1[category] = {}; + } + + for (var i = 0; i < tests.length; i++) { + var test = tests[i]; + itemTotals1[test] = []; + var category = test.replace(/-.*/, ""); + testTotalsByCategory1[category][test] = 0; + testMeansByCategory1[category][test] = 0; + testStdDevsByCategory1[category][test] = 0; + testStdErrsByCategory1[category][test] = 0; + } + + for (var i = 0; i < count1; i++) { + itemTotals1["total"][i] = 0; + for (var category in categoryTotals1) { + itemTotals1[category][i] = 0; + for (var test in testTotalsByCategory1[category]) { + itemTotals1[test][i] = 0; + } + } + } + + itemTotals2 = {total: []}; + + for (var i = 0; i < categories.length; i++) { + var category = categories[i]; + itemTotals2[category] = []; + categoryTotals2[category] = 0; + testTotalsByCategory2[category] = {}; + categoryMeans2[category] = 0; + testMeansByCategory2[category] = {}; + categoryStdDevs2[category] = 0; + testStdDevsByCategory2[category] = {}; + categoryStdErrs2[category] = 0; + testStdErrsByCategory2[category] = {}; + } + + for (var i = 0; i < tests.length; i++) { + var test = tests[i]; + itemTotals2[test] = []; + var category = test.replace(/-.*/, ""); + testTotalsByCategory2[category][test] = 0; + testMeansByCategory2[category][test] = 0; + testStdDevsByCategory2[category][test] = 0; + testStdErrsByCategory2[category][test] = 0; + } + + for (var i = 0; i < count2; i++) { + itemTotals2["total"][i] = 0; + for (var category in categoryTotals2) { + itemTotals2[category][i] = 0; + for (var test in testTotalsByCategory2[category]) { + itemTotals2[test][i] = 0; + } + } + } + + } + + function computeItemTotals(output, itemTotals) + { + for (var i = 0; i < output.length; i++) { + var result = output[i]; + for (var test in result) { + var time = result[test]; + var category = test.replace(/-.*/, ""); + itemTotals["total"][i] += time; + itemTotals[category][i] += time; + itemTotals[test][i] += time; + } + } + } + + function computeTotals(output, categoryTotals, testTotalsByCategory) + { + var total = 0; + + for (var i = 0; i < output.length; i++) { + var result = output[i]; + for (var test in result) { + var time = result[test]; + var category = test.replace(/-.*/, ""); + total += time; + categoryTotals[category] += time; + testTotalsByCategory[category][test] += time; + } + } + + return total; + } + + function computeMeans(count, total, categoryTotals, categoryMeans, testTotalsByCategory, testMeansByCategory) + { + var mean = total / count; + for (var category in categoryTotals) { + categoryMeans[category] = categoryTotals[category] / count; + for (var test in testTotalsByCategory[category]) { + testMeansByCategory[category][test] = testTotalsByCategory[category][test] / count; + } + } + return mean; + } + + function standardDeviation(mean, items) + { + var deltaSquaredSum = 0; + for (var i = 0; i < items.length; i++) { + var delta = items[i] - mean; + deltaSquaredSum += delta * delta; + } + variance = deltaSquaredSum / (items.length - 1); + return Math.sqrt(variance); + } + + function computeStdDevs(mean, itemTotals, categoryStdDevs, categoryMeans, testStdDevsByCategory, testMeansByCategory) + { + var stdDev = standardDeviation(mean, itemTotals["total"]); + for (var category in categoryStdDevs) { + categoryStdDevs[category] = standardDeviation(categoryMeans[category], itemTotals[category]); + } + for (var category in categoryStdDevs) { + for (var test in testStdDevsByCategory[category]) { + testStdDevsByCategory[category][test] = standardDeviation(testMeansByCategory[category][test], itemTotals[test]); + } + } + return stdDev; + } + + function computeStdErrors(count, stdDev, categoryStdErrs, categoryStdDevs, testStdErrsByCategory, testStdDevsByCategory) + { + var sqrtCount = Math.sqrt(count); + + var stdErr = stdDev / sqrtCount; + for (var category in categoryStdErrs) { + categoryStdErrs[category] = categoryStdDevs[category] / sqrtCount; + } + for (var category in categoryStdDevs) { + for (var test in testStdErrsByCategory[category]) { + testStdErrsByCategory[category][test] = testStdDevsByCategory[category][test] / sqrtCount; + } + } + + return stdErr; + } + + var tDistribution = [NaN, NaN, 12.71, 4.30, 3.18, 2.78, 2.57, 2.45, 2.36, 2.31, 2.26, 2.23, 2.20, 2.18, 2.16, 2.14, 2.13, 2.12, 2.11, 2.10, 2.09, 2.09, 2.08, 2.07, 2.07, 2.06, 2.06, 2.06, 2.05, 2.05, 2.05, 2.04, 2.04, 2.04, 2.03, 2.03, 2.03, 2.03, 2.03, 2.02, 2.02, 2.02, 2.02, 2.02, 2.02, 2.02, 2.01, 2.01, 2.01, 2.01, 2.01, 2.01, 2.01, 2.01, 2.01, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 2.00, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.99, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.98, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.97, 1.96]; + var tMax = tDistribution.length; + var tLimit = 1.96; + + function tDist(n) + { + if (n > tMax) + return tLimit; + return tDistribution[n]; + } + + + function formatMean(meanWidth, mean, stdErr, count) + { + if (mean != mean) { + var result = " ERROR "; + for (var i = 0; i < meanWidth; ++i) + result = " " + result; + return result; + } + + var meanString = mean.toFixed(1).toString(); + while (meanString.length < meanWidth) { + meanString = " " + meanString; + } + + var errString = ((tDist(count) * stdErr / mean) * 100).toFixed(1) + "%"; + while (errString.length < "99.9%".length) + errString += " "; + + var error = "+/- " + errString + " "; + + return meanString + "ms " + error; + } + + function computeLabelWidth() + { + var width = "Total".length; + for (var category in categoryMeans1) { + if (category.length + 2 > width) + width = category.length + 2; + } + for (var i = 0; i < tests.length; i++) { + var shortName = tests[i].replace(/^[^-]*-/, ""); + if (shortName.length + 4 > width) + width = shortName.length + 4; + } + + return width; + } + + function computeMeanWidth(mean, categoryMeans, testMeansByCategory) + { + var width = mean.toFixed(1).toString().length; + for (var category in categoryMeans) { + var candidate = categoryMeans[category].toFixed(1).toString().length; + if (candidate > width) + width = candidate; + for (var test in testMeansByCategory[category]) { + var candidate = testMeansByCategory[category][test].toFixed(1).toString().length; + if (candidate > width) + width = candidate; + } + } + + return width; + } + + function pad(str, n) + { + while (str.length < n) { + str += " "; + } + return str; + } + + function resultLine(labelWidth, indent, label, meanWidth1, mean1, stdErr1, meanWidth2, mean2, stdErr2) + { + result = pad("", indent); + result += label + ": "; + result = pad(result, labelWidth + 2); + + var diffSummary; + var diffDetail; + + if (mean1 != mean1 || mean2 != mean2) { + diffSummary = "??"; + diffDetail = " invalid runs detected"; + } else { + var t = (mean1 - mean2) / (Math.sqrt((stdErr1 * stdErr1) + (stdErr2 * stdErr2))); + var df = count1 + count2 - 2; + + var statisticallySignificant = (Math.abs(t) > tDist(df+1)); + var diff = mean2 - mean1; + var percentage = 100 * diff / mean1; + var isFaster = diff < 0; + var probablySame = (percentage < 0.1) && !statisticallySignificant; + var ratio = isFaster ? (mean1 / mean2) : (mean2 / mean1); + var fixedRatio = (ratio < 1.2) ? ratio.toFixed(3).toString() : ((ratio < 10) ? ratio.toFixed(2).toString() : ratio.toFixed(1).toString()); + var formattedRatio = isFaster ? fixedRatio + "x as fast" : "*" + fixedRatio + "x as slow*"; + + if (probablySame) { + diffSummary = "-"; + diffDetail = ""; + } else if (!statisticallySignificant) { + diffSummary = "??"; + diffDetail = " not conclusive: might be " + formattedRatio; + } else { + diffSummary = formattedRatio; + diffDetail = " significant"; + } + } + + return result + pad(diffSummary, 18) + formatMean(meanWidth1, mean1, stdErr1, count1) + " " + formatMean(meanWidth2, mean2, stdErr2, count2) + diffDetail; + } + + function printOutput() + { + var labelWidth = computeLabelWidth(); + var meanWidth1 = computeMeanWidth(mean1, categoryMeans1, testMeansByCategory1); + var meanWidth2 = computeMeanWidth(mean2, categoryMeans2, testMeansByCategory2); + + print("\n"); + var header = "TEST"; + while (header.length < labelWidth) + header += " "; + header += " COMPARISON FROM TO DETAILS"; + print(header); + print(""); + print("==============================================================================="); + print(""); + print(resultLine(labelWidth, 0, "** TOTAL **", meanWidth1, mean1, stdErr1, meanWidth2, mean2, stdErr2)); + print(""); + print("==============================================================================="); + + for (var category in categoryMeans1) { + print(""); + print(resultLine(labelWidth, 2, category, + meanWidth1, categoryMeans1[category], categoryStdErrs1[category], + meanWidth2, categoryMeans2[category], categoryStdErrs2[category])); + for (var test in testMeansByCategory1[category]) { + var shortName = test.replace(/^[^-]*-/, ""); + print(resultLine(labelWidth, 4, shortName, + meanWidth1, testMeansByCategory1[category][test], testStdErrsByCategory1[category][test], + meanWidth2, testMeansByCategory2[category][test], testStdErrsByCategory2[category][test])); + } + } + } + + initialize(); + + computeItemTotals(output1, itemTotals1); + computeItemTotals(output2, itemTotals2); + + total1 = computeTotals(output1, categoryTotals1, testTotalsByCategory1); + total2 = computeTotals(output2, categoryTotals2, testTotalsByCategory2); + + mean1 = computeMeans(count1, total1, categoryTotals1, categoryMeans1, testTotalsByCategory1, testMeansByCategory1); + mean2 = computeMeans(count2, total2, categoryTotals2, categoryMeans2, testTotalsByCategory2, testMeansByCategory2); + + stdDev1 = computeStdDevs(mean1, itemTotals1, categoryStdDevs1, categoryMeans1, testStdDevsByCategory1, testMeansByCategory1); + stdDev2 = computeStdDevs(mean2, itemTotals2, categoryStdDevs2, categoryMeans2, testStdDevsByCategory2, testMeansByCategory2); + + stdErr1 = computeStdErrors(count1, stdDev1, categoryStdErrs1, categoryStdDevs1, testStdErrsByCategory1, testStdDevsByCategory1); + stdErr2 = computeStdErrors(count2, stdDev2, categoryStdErrs2, categoryStdDevs2, testStdErrsByCategory2, testStdDevsByCategory2); + + printOutput(); +} diff --git a/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider.css b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider.css new file mode 100644 index 0000000000..c91a1031b4 --- /dev/null +++ b/third_party/webkit/PerformanceTests/SunSpider/sunspider-1.0.1/sunspider.css @@ -0,0 +1,31 @@ + +body { font-family: sans-serif; + margin: 20px; + background-color: #D9D5A1; + color: #1B0636 } + +h2 { background-color: #4E8AB9; + margin: -20px -20px 0px -20px; + padding: 30px 20px 30px 20px; + color: yellow; + border-bottom: 2px solid #360D6B; + zoom: 1.0 /* I CAN HAS LAYOUT? (ie hack) */ } + +dt { font-weight: bold } + +dd { margin-bottom: 1em; margin-top: 0.5em } + +:link { color: #1363A1 } +:visited { color: #5113A1 } + +#testframe { margin-top: 20px; + width: 80%; + height: 500px; + border: 2px solid #360D6B } + +#logo { float: left; + position: relative; + bottom: 0.33em; + padding-right: 20px; + margin-bottom: -40px; + font-size: 3em } diff --git a/third_party/webkit/PerformanceTests/resources/statistics.js b/third_party/webkit/PerformanceTests/resources/statistics.js new file mode 100644 index 0000000000..6b795570fc --- /dev/null +++ b/third_party/webkit/PerformanceTests/resources/statistics.js @@ -0,0 +1,145 @@ +/* + * Copyright (C) 2012, 2013 Apple Inc. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY APPLE INC. AND ITS CONTRIBUTORS ``AS IS'' + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, + * THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL APPLE INC. OR ITS CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF + * THE POSSIBILITY OF SUCH DAMAGE. + */ + +var Statistics = new (function () { + + this.max = function (values) { + return Math.max.apply(Math, values); + } + + this.min = function (values) { + return Math.min.apply(Math, values); + } + + this.sum = function (values) { + return values.reduce(function (a, b) { return a + b; }, 0); + } + + this.squareSum = function (values) { + return values.reduce(function (sum, value) { return sum + value * value;}, 0); + } + + // With sum and sum of squares, we can compute the sample standard deviation in O(1). + // See https://rniwa.com/2012-11-10/sample-standard-deviation-in-terms-of-sum-and-square-sum-of-samples/ + this.sampleStandardDeviation = function (numberOfSamples, sum, squareSum) { + if (numberOfSamples < 2) + return 0; + return Math.sqrt(squareSum / (numberOfSamples - 1) + - sum * sum / (numberOfSamples - 1) / numberOfSamples); + } + + this.supportedConfidenceLevels = function () { + var supportedLevels = []; + for (var quantile in tDistributionInverseCDF) + supportedLevels.push((1 - (1 - quantile) * 2).toFixed(2)); + return supportedLevels; + } + + // Computes the delta d s.t. (mean - d, mean + d) is the confidence interval with the specified confidence level in O(1). + this.confidenceIntervalDelta = function (confidenceLevel, numberOfSamples, sum, squareSum) { + var probability = (1 - (1 - confidenceLevel) / 2); + if (!(probability in tDistributionInverseCDF)) { + throw 'We only support ' + this.supportedConfidenceLevels().map( + function (level) { return level * 100 + '%'; } ).join(', ') + ' confidence intervals.'; + } + if (numberOfSamples - 2 < 0) + return NaN; + + var cdfForProbability = tDistributionInverseCDF[probability]; + var degreesOfFreedom = numberOfSamples - 1; + if (degreesOfFreedom > cdfForProbability.length) + throw 'We only support up to ' + deltas.length + ' degrees of freedom'; + + // tDistributionQuantile(degreesOfFreedom, confidenceLevel) * sampleStandardDeviation / sqrt(numberOfSamples) * S/sqrt(numberOfSamples) + var quantile = cdfForProbability[degreesOfFreedom - 1]; // The first entry is for the one degree of freedom. + return quantile * this.sampleStandardDeviation(numberOfSamples, sum, squareSum) / Math.sqrt(numberOfSamples); + } + + this.confidenceInterval = function (values, probability) { + var sum = this.sum(values); + var mean = sum / values.length; + var delta = this.confidenceIntervalDelta(probability || 0.95, values.length, sum, this.squareSum(values)); + return [mean - delta, mean + delta]; + } + + // See http://en.wikipedia.org/wiki/Student's_t-distribution#Table_of_selected_values + // This table contains one sided (a.k.a. tail) values. + var tDistributionInverseCDF = { + 0.9: [ + 3.077684, 1.885618, 1.637744, 1.533206, 1.475884, 1.439756, 1.414924, 1.396815, 1.383029, 1.372184, + 1.363430, 1.356217, 1.350171, 1.345030, 1.340606, 1.336757, 1.333379, 1.330391, 1.327728, 1.325341, + 1.323188, 1.321237, 1.319460, 1.317836, 1.316345, 1.314972, 1.313703, 1.312527, 1.311434, 1.310415, + 1.309464, 1.308573, 1.307737, 1.306952, 1.306212, 1.305514, 1.304854, 1.304230, 1.303639, 1.303077, + 1.302543, 1.302035, 1.301552, 1.301090, 1.300649, 1.300228, 1.299825, 1.299439, 1.299069, 1.298714, + + 1.298373, 1.298045, 1.297730, 1.297426, 1.297134, 1.296853, 1.296581, 1.296319, 1.296066, 1.295821, + 1.295585, 1.295356, 1.295134, 1.294920, 1.294712, 1.294511, 1.294315, 1.294126, 1.293942, 1.293763, + 1.293589, 1.293421, 1.293256, 1.293097, 1.292941, 1.292790, 1.292643, 1.292500, 1.292360, 1.292224, + 1.292091, 1.291961, 1.291835, 1.291711, 1.291591, 1.291473, 1.291358, 1.291246, 1.291136, 1.291029, + 1.290924, 1.290821, 1.290721, 1.290623, 1.290527, 1.290432, 1.290340, 1.290250, 1.290161, 1.290075], + 0.95: [ + 6.313752, 2.919986, 2.353363, 2.131847, 2.015048, 1.943180, 1.894579, 1.859548, 1.833113, 1.812461, + 1.795885, 1.782288, 1.770933, 1.761310, 1.753050, 1.745884, 1.739607, 1.734064, 1.729133, 1.724718, + 1.720743, 1.717144, 1.713872, 1.710882, 1.708141, 1.705618, 1.703288, 1.701131, 1.699127, 1.697261, + 1.695519, 1.693889, 1.692360, 1.690924, 1.689572, 1.688298, 1.687094, 1.685954, 1.684875, 1.683851, + 1.682878, 1.681952, 1.681071, 1.680230, 1.679427, 1.678660, 1.677927, 1.677224, 1.676551, 1.675905, + + 1.675285, 1.674689, 1.674116, 1.673565, 1.673034, 1.672522, 1.672029, 1.671553, 1.671093, 1.670649, + 1.670219, 1.669804, 1.669402, 1.669013, 1.668636, 1.668271, 1.667916, 1.667572, 1.667239, 1.666914, + 1.666600, 1.666294, 1.665996, 1.665707, 1.665425, 1.665151, 1.664885, 1.664625, 1.664371, 1.664125, + 1.663884, 1.663649, 1.663420, 1.663197, 1.662978, 1.662765, 1.662557, 1.662354, 1.662155, 1.661961, + 1.661771, 1.661585, 1.661404, 1.661226, 1.661052, 1.660881, 1.660715, 1.660551, 1.660391, 1.660234], + 0.975: [ + 12.706205, 4.302653, 3.182446, 2.776445, 2.570582, 2.446912, 2.364624, 2.306004, 2.262157, 2.228139, + 2.200985, 2.178813, 2.160369, 2.144787, 2.131450, 2.119905, 2.109816, 2.100922, 2.093024, 2.085963, + 2.079614, 2.073873, 2.068658, 2.063899, 2.059539, 2.055529, 2.051831, 2.048407, 2.045230, 2.042272, + 2.039513, 2.036933, 2.034515, 2.032245, 2.030108, 2.028094, 2.026192, 2.024394, 2.022691, 2.021075, + 2.019541, 2.018082, 2.016692, 2.015368, 2.014103, 2.012896, 2.011741, 2.010635, 2.009575, 2.008559, + + 2.007584, 2.006647, 2.005746, 2.004879, 2.004045, 2.003241, 2.002465, 2.001717, 2.000995, 2.000298, + 1.999624, 1.998972, 1.998341, 1.997730, 1.997138, 1.996564, 1.996008, 1.995469, 1.994945, 1.994437, + 1.993943, 1.993464, 1.992997, 1.992543, 1.992102, 1.991673, 1.991254, 1.990847, 1.990450, 1.990063, + 1.989686, 1.989319, 1.988960, 1.988610, 1.988268, 1.987934, 1.987608, 1.987290, 1.986979, 1.986675, + 1.986377, 1.986086, 1.985802, 1.985523, 1.985251, 1.984984, 1.984723, 1.984467, 1.984217, 1.983972], + 0.99: [ + 31.820516, 6.964557, 4.540703, 3.746947, 3.364930, 3.142668, 2.997952, 2.896459, 2.821438, 2.763769, + 2.718079, 2.680998, 2.650309, 2.624494, 2.602480, 2.583487, 2.566934, 2.552380, 2.539483, 2.527977, + 2.517648, 2.508325, 2.499867, 2.492159, 2.485107, 2.478630, 2.472660, 2.467140, 2.462021, 2.457262, + 2.452824, 2.448678, 2.444794, 2.441150, 2.437723, 2.434494, 2.431447, 2.428568, 2.425841, 2.423257, + 2.420803, 2.418470, 2.416250, 2.414134, 2.412116, 2.410188, 2.408345, 2.406581, 2.404892, 2.403272, + + 2.401718, 2.400225, 2.398790, 2.397410, 2.396081, 2.394801, 2.393568, 2.392377, 2.391229, 2.390119, + 2.389047, 2.388011, 2.387008, 2.386037, 2.385097, 2.384186, 2.383302, 2.382446, 2.381615, 2.380807, + 2.380024, 2.379262, 2.378522, 2.377802, 2.377102, 2.376420, 2.375757, 2.375111, 2.374482, 2.373868, + 2.373270, 2.372687, 2.372119, 2.371564, 2.371022, 2.370493, 2.369977, 2.369472, 2.368979, 2.368497, + 2.368026, 2.367566, 2.367115, 2.366674, 2.366243, 2.365821, 2.365407, 2.365002, 2.364606, 2.364217] + }; + +})(); + +if (typeof module != 'undefined') { + for (var key in Statistics) + module.exports[key] = Statistics[key]; +} diff --git a/third_party/webkit/PerformanceTests/six-speed/VERSION b/third_party/webkit/PerformanceTests/six-speed/VERSION new file mode 100644 index 0000000000..49d59571fb --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/VERSION @@ -0,0 +1 @@ +0.1 diff --git a/third_party/webkit/PerformanceTests/six-speed/test.js b/third_party/webkit/PerformanceTests/six-speed/test.js new file mode 100644 index 0000000000..e50af51252 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/test.js @@ -0,0 +1,85 @@ + +function assertEqual() {} +function test(fn) { + var its = iterations; + var start = Date.now(); + for (var i = 0; i < its; i++) { + fn(); + } + timing = Date.now() - start; +} + +var tests = [ + "template_string", + "defaults", + "map-set-lookup", + "spread", + "object-assign", + "spread-literal", + "map-set", + "destructuring-simple", + "super", + "for-of-object", + "rest", + "regex-u", + "arrow", + "bindings-compound", + "classes", + "template_string_tag", + "map-string", + "arrow-declare", + "spread-generator", + "object-literal-ext", + "generator", + "arrow-args", + "for-of-array", + "bindings", + "destructuring", + "map-set-object" +] +var iteration_for_test = [ + 200000000, + 100000000, + 200000, + 1000000, + 600000, + 1000000, + 10000, + 20000000, + 3000000, + 1000000, + 500000, + 1000000, + 20000000, + 20000000, + 10000000, + 2000000, + 30000000, + 30000000, + 1000000, + 1000000, + 3000000, + 20000000, + 5000000, + 20000000, + 20000000, + 5000 +] + +for (var z = 0; z < tests.length; z++) { + var timing = 0; + var testname = tests[z]; + var iterations = iteration_for_test[z]; + + // ES5 + var content = read("tests/"+testname+".es5") + var func = new Function(content); + func(); + print(testname+"-es5:", timing); + + // ES6 + var content = read("tests/"+testname+".es6") + var func = new Function(content); + func(); + print(testname+"-es6:", timing); +} diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/arrow-args.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/arrow-args.es5 new file mode 100644 index 0000000000..252c02a7c8 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/arrow-args.es5 @@ -0,0 +1,16 @@ +var obj = { + value: 42, + fn: function() { + var args = arguments; + return function() { + return args[0]; + }; + } +}; + +var fn = obj.fn(1); +assertEqual(fn(), 1); + +test(function() { + fn(); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/arrow-args.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/arrow-args.es6 new file mode 100644 index 0000000000..1a82d36853 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/arrow-args.es6 @@ -0,0 +1,14 @@ + +var obj = { + value: 42, + fn: function() { + return () => arguments[0]; + } +}; + +var fn = obj.fn(1); +assertEqual(fn(), 1); + +test(function() { + fn(); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/arrow-declare.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/arrow-declare.es5 new file mode 100644 index 0000000000..735654624e --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/arrow-declare.es5 @@ -0,0 +1,14 @@ +var obj = { + value: 42, + fn: function() { + return function() { + return obj.value; + }; + } +}; + +assertEqual(obj.fn()(), 42); + +test(function() { + obj.fn(); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/arrow-declare.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/arrow-declare.es6 new file mode 100644 index 0000000000..9e37365b28 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/arrow-declare.es6 @@ -0,0 +1,13 @@ + +var obj = { + value: 42, + fn: function() { + return () => this.value; + } +}; + +assertEqual(obj.fn()(), 42); + +test(function() { + obj.fn(); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/arrow.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/arrow.es5 new file mode 100644 index 0000000000..f1f7ff9c1d --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/arrow.es5 @@ -0,0 +1,15 @@ +var obj = { + value: 42, + fn: function() { + return function() { + return obj.value; + }; + } +}; + +var fn = obj.fn(); +assertEqual(fn(), 42); + +test(function() { + fn(); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/arrow.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/arrow.es6 new file mode 100644 index 0000000000..f2c01493db --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/arrow.es6 @@ -0,0 +1,14 @@ + +var obj = { + value: 42, + fn: function() { + return () => this.value; + } +}; + +var fn = obj.fn(); +assertEqual(fn(), 42); + +test(function() { + fn(); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/bindings-compound.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/bindings-compound.es5 new file mode 100644 index 0000000000..789d586cac --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/bindings-compound.es5 @@ -0,0 +1,11 @@ +var b = 2; + +assertEqual(fn(), 3); + +function fn() { + var a = 1; + a += b; + + return a; +} +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/bindings-compound.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/bindings-compound.es6 new file mode 100644 index 0000000000..cea478f070 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/bindings-compound.es6 @@ -0,0 +1,14 @@ +"use strict"; + +const b = 2; + +function fn() { + + let a = 1; + a += b; + + return a; +} + +assertEqual(fn(), 3); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/bindings.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/bindings.es5 new file mode 100644 index 0000000000..4d4df8362d --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/bindings.es5 @@ -0,0 +1,8 @@ +var a = 1, + b = 2; + +assertEqual(a+b, 3); + +test(function() { + return a + b; +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/bindings.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/bindings.es6 new file mode 100644 index 0000000000..44e34bc8d5 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/bindings.es6 @@ -0,0 +1,10 @@ +"use strict"; + +const a = 1; +let b = 2; + +assertEqual(a+b, 3); + +test(function() { + return a + b; +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/classes.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/classes.es5 new file mode 100644 index 0000000000..ae5c7c11fb --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/classes.es5 @@ -0,0 +1,11 @@ +function C() { + this.foo = 'bar'; +} +C.prototype.bar = function() { +}; + +assertEqual(new C().foo, 'bar'); + +test(function() { + return new C(); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/classes.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/classes.es6 new file mode 100644 index 0000000000..9007b992f7 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/classes.es6 @@ -0,0 +1,13 @@ +class C { + constructor() { + this.foo = 'bar'; + } + bar() { + } +} + +assertEqual(new C().foo, 'bar'); + +test(function() { + return new C(); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/defaults.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/defaults.es5 new file mode 100644 index 0000000000..eec3f0d2e7 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/defaults.es5 @@ -0,0 +1,14 @@ +function fn(arg, other) { + arg = arg === undefined ? 1 : arg; + other = other === undefined ? 3 : other; + return other; +} + +assertEqual(fn(), 3); +assertEqual(fn(1, 2), 2); + +test(function() { + fn(); + fn(2); + fn(2, 4); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/defaults.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/defaults.es6 new file mode 100644 index 0000000000..1df8fdeb01 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/defaults.es6 @@ -0,0 +1,13 @@ +function fn(arg = 1, other = 3) { + return other; +} + + +assertEqual(fn(), 3); +assertEqual(fn(1, 2), 2); + +test(function() { + fn(); + fn(2); + fn(2, 4); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/destructuring-simple.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/destructuring-simple.es5 new file mode 100644 index 0000000000..1bd89387cf --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/destructuring-simple.es5 @@ -0,0 +1,14 @@ +var data = { + a: 'foo', + b: {c: 'd'}, + arr: [1, 2, 3] +}; + +function fn() { + var a = data.a, + b = data.b; + return a; +} + +assertEqual(fn(), 'foo'); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/destructuring-simple.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/destructuring-simple.es6 new file mode 100644 index 0000000000..60fd3c010e --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/destructuring-simple.es6 @@ -0,0 +1,14 @@ +var data = { + a: 'foo', + b: {c: 'd'}, + arr: [1, 2, 3] +}; + +function fn() { + var {a, b} = data; + return a; +} + +assertEqual(fn(), 'foo'); + +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/destructuring.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/destructuring.es5 new file mode 100644 index 0000000000..7be5e3cfc8 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/destructuring.es5 @@ -0,0 +1,15 @@ +var data = { + a: 'foo', + b: {c: 'd'}, + arr: [1, 2, 3] +}; + +function fn() { + var a = data.a, + b = data.b.c, + c = data.arr[1]; + return c; +} + +assertEqual(fn(), 2); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/destructuring.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/destructuring.es6 new file mode 100644 index 0000000000..50e9b75bb3 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/destructuring.es6 @@ -0,0 +1,13 @@ +var data = { + a: 'foo', + b: {c: 'd'}, + arr: [1, 2, 3] +}; + +function fn() { + var {a, b:{c:b}, arr:[, c]} = data; + return c; +} + +assertEqual(fn(), 2); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/for-of-array.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/for-of-array.es5 new file mode 100644 index 0000000000..d27543f84a --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/for-of-array.es5 @@ -0,0 +1,13 @@ +var data = [1,2,3]; + +function fn() { + var ret = ''; + for (var i = 0; i < data.length; i++) { + ret += data[i]; + } + return ret; +} + +assertEqual(fn(), '123'); + +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/for-of-array.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/for-of-array.es6 new file mode 100644 index 0000000000..b64378948b --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/for-of-array.es6 @@ -0,0 +1,13 @@ +var data = [1,2,3]; + +function fn() { + var ret = ''; + for (var value of data) { + ret += value; + } + return ret; +} + +assertEqual(fn(), '123'); + +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/for-of-object.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/for-of-object.es5 new file mode 100644 index 0000000000..3dc1da1929 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/for-of-object.es5 @@ -0,0 +1,13 @@ +var data = {'a': 'b', 'c': 'd'}; +function fn() { + var ret = ''; + for (var name in data) { + if (data.hasOwnProperty(name)) { + ret += data[name]; + } + } + return ret; +} + +assertEqual(fn(), 'bd'); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/for-of-object.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/for-of-object.es6 new file mode 100644 index 0000000000..55b5fb6dd0 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/for-of-object.es6 @@ -0,0 +1,24 @@ +var data = {'a': 'b', 'c': 'd'}; +data[Symbol.iterator] = function() { + var array = Object.keys(data), + nextIndex = 0; + + return { + next: function() { + return nextIndex < array.length ? + {value: data[array[nextIndex++]], done: false} : + {done: true}; + } + }; +}; + +function fn() { + var ret = ''; + for (var value of data) { + ret += value; + } + return ret; +} + +assertEqual(fn(), 'bd'); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/generator.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/generator.es5 new file mode 100644 index 0000000000..d1b441c1da --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/generator.es5 @@ -0,0 +1,26 @@ +function generator() { + var i = 0; + return { + next: function() { + i++; + if (i >= 3) { + return {done: true}; + } else { + return { + value: i, + done: false + }; + } + } + }; +} + +function fn() { + var iterator = generator(); + iterator.next(); + iterator.next(); + return iterator.next().done; +} + +assertEqual(fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/generator.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/generator.es6 new file mode 100644 index 0000000000..431fd76f22 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/generator.es6 @@ -0,0 +1,14 @@ +function * generator() { + yield 1; + yield 2; +} + +function fn() { + var iterator = generator(); + iterator.next(); + iterator.next(); + return iterator.next().done; +} + +assertEqual(fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/map-set-lookup.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/map-set-lookup.es5 new file mode 100644 index 0000000000..e0fa70d97a --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/map-set-lookup.es5 @@ -0,0 +1,21 @@ +var keys = [], + values = [], + set = [], + key = {}; + +for (var i = 0; i < 500; i++) { + keys.push(i); + values.push(i); + set.push(i); +} + +keys.push(key); +values.push('bar'); +set.push(key); + +function fn() { + return set.indexOf(key) >= 0 && keys.indexOf(key) >= 0; +} + +assertEqual(fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/map-set-lookup.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/map-set-lookup.es6 new file mode 100644 index 0000000000..2fc9c503e2 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/map-set-lookup.es6 @@ -0,0 +1,18 @@ +var map = new Map(), + set = new Set(), + key = {}; + +for (var i = 0; i < 500; i++) { + map.set(i, i); + set.add(i); +} + +map.set(key, 'bar'); +set.add(key); + +function fn() { + return map.has(key) && set.has(key); +} + +assertEqual(fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/map-set-object.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/map-set-object.es5 new file mode 100644 index 0000000000..61dfcc5b21 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/map-set-object.es5 @@ -0,0 +1,21 @@ +function fn() { + var keys = [], + values = [], + set = [], + key = {}; + + for (var i = 0; i < 500; i++) { + keys.push(i); + values.push(i); + set.push(i); + } + + keys.push(key); + values.push('bar'); + set.push(key); + + return set.indexOf(key) >= 0 && keys.indexOf(key) >= 0; +} + +assertEqual(fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/map-set-object.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/map-set-object.es6 new file mode 100644 index 0000000000..8624a0bb27 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/map-set-object.es6 @@ -0,0 +1,18 @@ +function fn() { + var map = new Map(), + set = new Set(), + key = {}; + + for (var i = 0; i < 500; i++) { + map.set(i, i); + set.add(i); + } + + map.set(key, 'bar'); + set.add(key); + + return map.has(key) && set.has(key); +} + +assertEqual(fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/map-set.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/map-set.es5 new file mode 100644 index 0000000000..b99ec7ad04 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/map-set.es5 @@ -0,0 +1,16 @@ +function fn() { + var map = {}, + set = []; + + for (var i = 0; i < 250; i++) { + map[i] = i; + set.push(i); + } + + map.foo = 'bar'; + set.push('bar'); + return ('foo' in map) && set.indexOf('bar') >= 0; +} + +assertEqual(fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/map-set.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/map-set.es6 new file mode 100644 index 0000000000..583450d1db --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/map-set.es6 @@ -0,0 +1,17 @@ +function fn() { + var map = new Map(), + set = new Set(); + + for (var i = 0; i < 250; i++) { + map.set(i, i); + set.add(i); + } + + map.set('foo', 'bar'); + set.add('bar'); + + return map.has('foo') && set.has('bar'); +} + +assertEqual(fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/map-string.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/map-string.es5 new file mode 100644 index 0000000000..147547e6b4 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/map-string.es5 @@ -0,0 +1,12 @@ +var map = {}; + +for (var i = 0; i < 500; i++) { + map[i] = i; +} + +function fn() { + return map['499'] === 499; +} + +assertEqual(fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/map-string.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/map-string.es6 new file mode 100644 index 0000000000..43b7811025 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/map-string.es6 @@ -0,0 +1,12 @@ +var map = new Map(); + +for (var i = 0; i < 500; i++) { + map.set(i + '', i); +} + +function fn() { + return map.get('499') === 499; +} + +assertEqual(fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/object-assign.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/object-assign.es5 new file mode 100644 index 0000000000..33d1571d27 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/object-assign.es5 @@ -0,0 +1,28 @@ +var obj = { + a: 1, + b: true, + c: function () {}, + d: null, + e: 'e' +}; + +var fn = function (src) { + var o = {}; + var keys = Object.keys(src); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + o[key] = src[key]; + } + return o; +}; + +var r = fn(obj); +assertEqual(r.a, obj.a); +assertEqual(r.b, obj.b); +assertEqual(r.c, obj.c); +assertEqual(r.d, obj.d); +assertEqual(r.e, obj.e); + +test(function () { + fn(obj); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/object-assign.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/object-assign.es6 new file mode 100644 index 0000000000..bdce0b20fc --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/object-assign.es6 @@ -0,0 +1,22 @@ +const obj = { + a: 1, + b: true, + c: function () {}, + d: null, + e: 'e' +}; + +const fn = function (src) { + return Object.assign({}, src); +}; + +const r = fn(obj); +assertEqual(r.a, obj.a); +assertEqual(r.b, obj.b); +assertEqual(r.c, obj.c); +assertEqual(r.d, obj.d); +assertEqual(r.e, obj.e); + +test(function () { + fn(obj); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/object-literal-ext.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/object-literal-ext.es5 new file mode 100644 index 0000000000..5ea31687db --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/object-literal-ext.es5 @@ -0,0 +1,15 @@ +function fn() { + var name = 'foo'; + var ret = { + 'bizz buzz': function() { + return 1; + }, + name: name + }; + ret[name] = 'bar'; + ret[name + 'foo'] = 'foo'; + return ret; +} + +assertEqual(fn().foofoo, 'foo'); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/object-literal-ext.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/object-literal-ext.es6 new file mode 100644 index 0000000000..8b2052f990 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/object-literal-ext.es6 @@ -0,0 +1,14 @@ +function fn() { + var name = 'foo'; + return { + 'bizz buzz'() { + return 1; + }, + name, + [name]: 'bar', + [name + 'foo']: 'foo' + }; +} + +assertEqual(fn().foofoo, 'foo'); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/regex-u.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/regex-u.es5 new file mode 100644 index 0000000000..b91eadd1c5 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/regex-u.es5 @@ -0,0 +1,6 @@ +function fn() { + return '𠮷'.match(/^.$/); +} + +// Not asserting as this isn't quite an accurate test under es5 +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/regex-u.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/regex-u.es6 new file mode 100644 index 0000000000..828cbbcac7 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/regex-u.es6 @@ -0,0 +1,6 @@ +function fn() { + return '𠮷'.match(/^.$/u); +} + +assertEqual(!!fn(), true); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/rest.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/rest.es5 new file mode 100644 index 0000000000..6c9b56a09a --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/rest.es5 @@ -0,0 +1,13 @@ +function fn() { + return arguments[1]; +} + +assertEqual(fn(), undefined); +assertEqual(fn(2), undefined); +assertEqual(fn(2, 4), 4); + +test(function() { + fn(); + fn(2); + fn(2, 4); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/rest.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/rest.es6 new file mode 100644 index 0000000000..41e4d91611 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/rest.es6 @@ -0,0 +1,13 @@ +function fn(foo, ...args) { + return args[0]; +} + +assertEqual(fn(), undefined); +assertEqual(fn(2), undefined); +assertEqual(fn(2, 4), 4); + +test(function() { + fn(); + fn(2); + fn(2, 4); +}); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/spread-generator.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/spread-generator.es5 new file mode 100644 index 0000000000..2a0305b349 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/spread-generator.es5 @@ -0,0 +1,27 @@ +function generator() { + var i = 0; + return { + next: function() { + i++; + if (i >= 4) { + return {done: true}; + } else { + return { + value: i, + done: false + }; + } + } + }; +} + +function fn() { + var iterator = generator(); + var args = [iterator.next().value, iterator.next().value, iterator.next().value]; + iterator.next(); + + return Math.max.apply(Math, args); +} + +assertEqual(fn(), 3); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/spread-generator.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/spread-generator.es6 new file mode 100644 index 0000000000..a7831295a9 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/spread-generator.es6 @@ -0,0 +1,11 @@ +function *generate() { + yield 1; + yield 2; + yield 3; +} + +function fn() { + return Math.max(... generate()); +} +assertEqual(fn(), 3); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/spread-literal.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/spread-literal.es5 new file mode 100644 index 0000000000..d76d88edf9 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/spread-literal.es5 @@ -0,0 +1,8 @@ +function fn() { + var ret = [1]; + ret.push(1, 2, 3); + return ret; +} + +assertEqual(fn()[3], 3); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/spread-literal.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/spread-literal.es6 new file mode 100644 index 0000000000..b180fb5587 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/spread-literal.es6 @@ -0,0 +1,5 @@ +function fn() { + return [1, ... [1, 2, 3]]; +} +assertEqual(fn()[3], 3); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/spread.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/spread.es5 new file mode 100644 index 0000000000..bd13f44c6f --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/spread.es5 @@ -0,0 +1,6 @@ +function fn() { + return Math.max.apply(Math, [1,2,3]); +} + +assertEqual(fn(), 3); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/spread.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/spread.es6 new file mode 100644 index 0000000000..95ee937d24 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/spread.es6 @@ -0,0 +1,6 @@ +function fn() { + return Math.max(...[1,2,3]); +} + +assertEqual(fn(), 3); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/super.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/super.es5 new file mode 100644 index 0000000000..8edc527127 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/super.es5 @@ -0,0 +1,23 @@ +function C() { + this.foo = 'bar'; +} +C.prototype.bar = function() { + return 41; +}; + + +function D() { + C.call(this); + this.baz = 'bat'; +} +D.prototype = Object.create(C.prototype); +D.prototype.bar = function() { + return C.prototype.bar.call(this) + 1; +}; +function fn() { + var d = new D(); + return d.bar(); +} + +assertEqual(fn(), 42); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/super.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/super.es6 new file mode 100644 index 0000000000..29386be524 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/super.es6 @@ -0,0 +1,25 @@ + +class C { + constructor() { + this.foo = 'bar'; + } + bar() { + return 41; + } +} +class D extends C { + constructor() { + super(); + this.baz = 'bat'; + } + bar() { + return super.bar() + 1; + } +} +function fn() { + var d = new D(); + return d.bar(); +} + +assertEqual(fn(), 42); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/template_string.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/template_string.es5 new file mode 100644 index 0000000000..6296ad3625 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/template_string.es5 @@ -0,0 +1,7 @@ +var data = [1,2,3]; +function fn() { + return data[0] + ' ' + (data[1] + data[2]); +} + +assertEqual(fn(), '1 5'); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/template_string.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/template_string.es6 new file mode 100644 index 0000000000..3e891237b9 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/template_string.es6 @@ -0,0 +1,7 @@ +var data = [1,2,3]; +function fn() { + return `${data[0]} ${data[1] + data[2]}`; +} + +assertEqual(fn(), '1 5'); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/template_string_tag.es5 b/third_party/webkit/PerformanceTests/six-speed/tests/template_string_tag.es5 new file mode 100644 index 0000000000..a0e5db0507 --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/template_string_tag.es5 @@ -0,0 +1,11 @@ +var data = [1, 2, 3]; +function tag(strings, value1, value2) { + return strings[0] + value1 + strings[1] + value2 + strings[2]; +} + +function fn() { + return tag(['', ' ', ''], data[0], data[1] + data[2]); +} + +assertEqual(fn(), '1 5'); +test(fn); diff --git a/third_party/webkit/PerformanceTests/six-speed/tests/template_string_tag.es6 b/third_party/webkit/PerformanceTests/six-speed/tests/template_string_tag.es6 new file mode 100644 index 0000000000..dec6501bce --- /dev/null +++ b/third_party/webkit/PerformanceTests/six-speed/tests/template_string_tag.es6 @@ -0,0 +1,11 @@ +var data = [1, 2, 3]; +function tag(strings, value1, value2) { + return strings[0] + value1 + strings[1] + value2 + strings[2]; +} + +function fn() { + return tag`${data[0]} ${data[1] + data[2]}`; +} + +assertEqual(fn(), '1 5'); +test(fn); diff --git a/third_party/webkit/PerformanceTests/wasm-godot/godot.js b/third_party/webkit/PerformanceTests/wasm-godot/godot.js new file mode 100644 index 0000000000..608fb3fb5e --- /dev/null +++ b/third_party/webkit/PerformanceTests/wasm-godot/godot.js @@ -0,0 +1,4 @@ +var Benchmark={};Benchmark["script-start"]=performance.now();var Engine={USING_WASM:true,RuntimeEnvironment:(function(Module){var Module;if(!Module)Module=(typeof Module!=="undefined"?Module:null)||{};var moduleOverrides={};for(var key in Module){if(Module.hasOwnProperty(key)){moduleOverrides[key]=Module[key]}}var ENVIRONMENT_IS_WEB=false;var ENVIRONMENT_IS_WORKER=false;var ENVIRONMENT_IS_NODE=false;var ENVIRONMENT_IS_SHELL=false;if(Module["ENVIRONMENT"]){if(Module["ENVIRONMENT"]==="WEB"){ENVIRONMENT_IS_WEB=true}else if(Module["ENVIRONMENT"]==="WORKER"){ENVIRONMENT_IS_WORKER=true}else if(Module["ENVIRONMENT"]==="NODE"){ENVIRONMENT_IS_NODE=true}else if(Module["ENVIRONMENT"]==="SHELL"){ENVIRONMENT_IS_SHELL=true}else{throw new Error("The provided Module['ENVIRONMENT'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.")}}else{ENVIRONMENT_IS_WEB=typeof window==="object";ENVIRONMENT_IS_WORKER=typeof importScripts==="function";ENVIRONMENT_IS_NODE=typeof process==="object"&&typeof require==="function"&&!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_WORKER;ENVIRONMENT_IS_SHELL=!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_NODE&&!ENVIRONMENT_IS_WORKER}if(ENVIRONMENT_IS_NODE){if(!Module["print"])Module["print"]=console.log;if(!Module["printErr"])Module["printErr"]=console.warn;var nodeFS;var nodePath;Module["read"]=function shell_read(filename,binary){if(!nodeFS)nodeFS=require("fs");if(!nodePath)nodePath=require("path");filename=nodePath["normalize"](filename);var ret=nodeFS["readFileSync"](filename);return binary?ret:ret.toString()};Module["readBinary"]=function readBinary(filename){var ret=Module["read"](filename,true);if(!ret.buffer){ret=new Uint8Array(ret)}assert(ret.buffer);return ret};Module["load"]=function load(f){globalEval(read(f))};if(!Module["thisProgram"]){if(process["argv"].length>1){Module["thisProgram"]=process["argv"][1].replace(/\\/g,"/")}else{Module["thisProgram"]="unknown-program"}}Module["arguments"]=process["argv"].slice(2);if(typeof module!=="undefined"){module["exports"]=Module}process["on"]("uncaughtException",(function(ex){if(!(ex instanceof ExitStatus)){throw ex}}));Module["inspect"]=(function(){return"[Emscripten Module object]"})}else if(ENVIRONMENT_IS_SHELL){if(!Module["print"])Module["print"]=print;if(typeof printErr!="undefined")Module["printErr"]=printErr;if(typeof read!="undefined"){Module["read"]=read}else{Module["read"]=function shell_read(){throw"no read() available"}}Module["readBinary"]=function readBinary(f){if(typeof readbuffer==="function"){return new Uint8Array(readbuffer(f))}var data=read(f,"binary");assert(typeof data==="object");return data};if(typeof scriptArgs!="undefined"){Module["arguments"]=scriptArgs}else if(typeof arguments!="undefined"){Module["arguments"]=arguments}if(typeof quit==="function"){Module["quit"]=(function(status,toThrow){quit(status)})}}else if(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER){Module["read"]=function shell_read(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.send(null);return xhr.responseText};if(ENVIRONMENT_IS_WORKER){Module["readBinary"]=function readBinary(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.responseType="arraybuffer";xhr.send(null);return new Uint8Array(xhr.response)}}Module["readAsync"]=function readAsync(url,onload,onerror){var xhr=new XMLHttpRequest;xhr.open("GET",url,true);xhr.responseType="arraybuffer";xhr.onload=function xhr_onload(){if(xhr.status==200||xhr.status==0&&xhr.response){onload(xhr.response)}else{onerror()}};xhr.onerror=onerror;xhr.send(null)};if(typeof arguments!="undefined"){Module["arguments"]=arguments}if(typeof console!=="undefined"){if(!Module["print"])Module["print"]=function shell_print(x){console.log(x)};if(!Module["printErr"])Module["printErr"]=function shell_printErr(x){console.warn(x)}}else{var TRY_USE_DUMP=false;if(!Module["print"])Module["print"]=TRY_USE_DUMP&&typeof dump!=="undefined"?(function(x){dump(x)}):(function(x){})}if(ENVIRONMENT_IS_WORKER){Module["load"]=importScripts}if(typeof Module["setWindowTitle"]==="undefined"){Module["setWindowTitle"]=(function(title){document.title=title})}}else{throw"Unknown runtime environment. Where are we?"}function globalEval(x){eval.call(null,x)}if(!Module["load"]&&Module["read"]){Module["load"]=function load(f){globalEval(Module["read"](f))}}if(!Module["print"]){Module["print"]=(function(){})}if(!Module["printErr"]){Module["printErr"]=Module["print"]}if(!Module["arguments"]){Module["arguments"]=[]}if(!Module["thisProgram"]){Module["thisProgram"]="./this.program"}if(!Module["quit"]){Module["quit"]=(function(status,toThrow){throw toThrow})}Module.print=Module["print"];Module.printErr=Module["printErr"];Module["preRun"]=[];Module["postRun"]=[];for(var key in moduleOverrides){if(moduleOverrides.hasOwnProperty(key)){Module[key]=moduleOverrides[key]}}moduleOverrides=undefined;var Runtime={setTempRet0:(function(value){tempRet0=value;return value}),getTempRet0:(function(){return tempRet0}),stackSave:(function(){return STACKTOP}),stackRestore:(function(stackTop){STACKTOP=stackTop}),getNativeTypeSize:(function(type){switch(type){case"i1":case"i8":return 1;case"i16":return 2;case"i32":return 4;case"i64":return 8;case"float":return 4;case"double":return 8;default:{if(type[type.length-1]==="*"){return Runtime.QUANTUM_SIZE}else if(type[0]==="i"){var bits=parseInt(type.substr(1));assert(bits%8===0);return bits/8}else{return 0}}}}),getNativeFieldSize:(function(type){return Math.max(Runtime.getNativeTypeSize(type),Runtime.QUANTUM_SIZE)}),STACK_ALIGN:16,prepVararg:(function(ptr,type){if(type==="double"||type==="i64"){if(ptr&7){assert((ptr&7)===4);ptr+=4}}else{assert((ptr&3)===0)}return ptr}),getAlignSize:(function(type,size,vararg){if(!vararg&&(type=="i64"||type=="double"))return 8;if(!type)return Math.min(size,8);return Math.min(size||(type?Runtime.getNativeFieldSize(type):0),Runtime.QUANTUM_SIZE)}),dynCall:(function(sig,ptr,args){if(args&&args.length){return Module["dynCall_"+sig].apply(null,[ptr].concat(args))}else{return Module["dynCall_"+sig].call(null,ptr)}}),functionPointers:[],addFunction:(function(func){for(var i=0;i>2];var end=(ret+size+15|0)&-16;HEAP32[DYNAMICTOP_PTR>>2]=end;if(end>=TOTAL_MEMORY){var success=enlargeMemory();if(!success){HEAP32[DYNAMICTOP_PTR>>2]=ret;return 0}}return ret}),alignMemory:(function(size,quantum){var ret=size=Math.ceil(size/(quantum?quantum:16))*(quantum?quantum:16);return ret}),makeBigInt:(function(low,high,unsigned){var ret=unsigned?+(low>>>0)+ +(high>>>0)*4294967296:+(low>>>0)+ +(high|0)*4294967296;return ret}),GLOBAL_BASE:1024,QUANTUM_SIZE:4,__dummy__:0};Module["Runtime"]=Runtime;var ABORT=0;var EXITSTATUS=0;function assert(condition,text){if(!condition){abort("Assertion failed: "+text)}}function getCFunc(ident){var func=Module["_"+ident];if(!func){try{func=eval("_"+ident)}catch(e){}}assert(func,"Cannot call unknown function "+ident+" (perhaps LLVM optimizations or closure removed it?)");return func}var cwrap,ccall;((function(){var JSfuncs={"stackSave":(function(){Runtime.stackSave()}),"stackRestore":(function(){Runtime.stackRestore()}),"arrayToC":(function(arr){var ret=Runtime.stackAlloc(arr.length);writeArrayToMemory(arr,ret);return ret}),"stringToC":(function(str){var ret=0;if(str!==null&&str!==undefined&&str!==0){var len=(str.length<<2)+1;ret=Runtime.stackAlloc(len);stringToUTF8(str,ret,len)}return ret})};var toC={"string":JSfuncs["stringToC"],"array":JSfuncs["arrayToC"]};ccall=function ccallFunc(ident,returnType,argTypes,args,opts){var func=getCFunc(ident);var cArgs=[];var stack=0;if(args){for(var i=0;i>0]=value;break;case"i8":HEAP8[ptr>>0]=value;break;case"i16":HEAP16[ptr>>1]=value;break;case"i32":HEAP32[ptr>>2]=value;break;case"i64":tempI64=[value>>>0,(tempDouble=value,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble- +(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[ptr>>2]=tempI64[0],HEAP32[ptr+4>>2]=tempI64[1];break;case"float":HEAPF32[ptr>>2]=value;break;case"double":HEAPF64[ptr>>3]=value;break;default:abort("invalid type for setValue: "+type)}}Module["setValue"]=setValue;function getValue(ptr,type,noSafe){type=type||"i8";if(type.charAt(type.length-1)==="*")type="i32";switch(type){case"i1":return HEAP8[ptr>>0];case"i8":return HEAP8[ptr>>0];case"i16":return HEAP16[ptr>>1];case"i32":return HEAP32[ptr>>2];case"i64":return HEAP32[ptr>>2];case"float":return HEAPF32[ptr>>2];case"double":return HEAPF64[ptr>>3];default:abort("invalid type for setValue: "+type)}return null}Module["getValue"]=getValue;var ALLOC_NORMAL=0;var ALLOC_STACK=1;var ALLOC_STATIC=2;var ALLOC_DYNAMIC=3;var ALLOC_NONE=4;Module["ALLOC_NORMAL"]=ALLOC_NORMAL;Module["ALLOC_STACK"]=ALLOC_STACK;Module["ALLOC_STATIC"]=ALLOC_STATIC;Module["ALLOC_DYNAMIC"]=ALLOC_DYNAMIC;Module["ALLOC_NONE"]=ALLOC_NONE;function allocate(slab,types,allocator,ptr){var zeroinit,size;if(typeof slab==="number"){zeroinit=true;size=slab}else{zeroinit=false;size=slab.length}var singleType=typeof types==="string"?types:null;var ret;if(allocator==ALLOC_NONE){ret=ptr}else{ret=[typeof _malloc==="function"?_malloc:Runtime.staticAlloc,Runtime.stackAlloc,Runtime.staticAlloc,Runtime.dynamicAlloc][allocator===undefined?ALLOC_STATIC:allocator](Math.max(size,singleType?1:types.length))}if(zeroinit){var ptr=ret,stop;assert((ret&3)==0);stop=ret+(size&~3);for(;ptr>2]=0}stop=ret+size;while(ptr>0]=0}return ret}if(singleType==="i8"){if(slab.subarray||slab.slice){HEAPU8.set(slab,ret)}else{HEAPU8.set(new Uint8Array(slab),ret)}return ret}var i=0,type,typeSize,previousType;while(i>0];hasUtf|=t;if(t==0&&!length)break;i++;if(length&&i==length)break}if(!length)length=i;var ret="";if(hasUtf<128){var MAX_CHUNK=1024;var curr;while(length>0){curr=String.fromCharCode.apply(String,HEAPU8.subarray(ptr,ptr+Math.min(length,MAX_CHUNK)));ret=ret?ret+curr:curr;ptr+=MAX_CHUNK;length-=MAX_CHUNK}return ret}return Module["UTF8ToString"](ptr)}Module["Pointer_stringify"]=Pointer_stringify;function AsciiToString(ptr){var str="";while(1){var ch=HEAP8[ptr++>>0];if(!ch)return str;str+=String.fromCharCode(ch)}}Module["AsciiToString"]=AsciiToString;function stringToAscii(str,outPtr){return writeAsciiToMemory(str,outPtr,false)}Module["stringToAscii"]=stringToAscii;var UTF8Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf8"):undefined;function UTF8ArrayToString(u8Array,idx){var endPtr=idx;while(u8Array[endPtr])++endPtr;if(endPtr-idx>16&&u8Array.subarray&&UTF8Decoder){return UTF8Decoder.decode(u8Array.subarray(idx,endPtr))}else{var u0,u1,u2,u3,u4,u5;var str="";while(1){u0=u8Array[idx++];if(!u0)return str;if(!(u0&128)){str+=String.fromCharCode(u0);continue}u1=u8Array[idx++]&63;if((u0&224)==192){str+=String.fromCharCode((u0&31)<<6|u1);continue}u2=u8Array[idx++]&63;if((u0&240)==224){u0=(u0&15)<<12|u1<<6|u2}else{u3=u8Array[idx++]&63;if((u0&248)==240){u0=(u0&7)<<18|u1<<12|u2<<6|u3}else{u4=u8Array[idx++]&63;if((u0&252)==248){u0=(u0&3)<<24|u1<<18|u2<<12|u3<<6|u4}else{u5=u8Array[idx++]&63;u0=(u0&1)<<30|u1<<24|u2<<18|u3<<12|u4<<6|u5}}}if(u0<65536){str+=String.fromCharCode(u0)}else{var ch=u0-65536;str+=String.fromCharCode(55296|ch>>10,56320|ch&1023)}}}}Module["UTF8ArrayToString"]=UTF8ArrayToString;function UTF8ToString(ptr){return UTF8ArrayToString(HEAPU8,ptr)}Module["UTF8ToString"]=UTF8ToString;function stringToUTF8Array(str,outU8Array,outIdx,maxBytesToWrite){if(!(maxBytesToWrite>0))return 0;var startIdx=outIdx;var endIdx=outIdx+maxBytesToWrite-1;for(var i=0;i=55296&&u<=57343)u=65536+((u&1023)<<10)|str.charCodeAt(++i)&1023;if(u<=127){if(outIdx>=endIdx)break;outU8Array[outIdx++]=u}else if(u<=2047){if(outIdx+1>=endIdx)break;outU8Array[outIdx++]=192|u>>6;outU8Array[outIdx++]=128|u&63}else if(u<=65535){if(outIdx+2>=endIdx)break;outU8Array[outIdx++]=224|u>>12;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else if(u<=2097151){if(outIdx+3>=endIdx)break;outU8Array[outIdx++]=240|u>>18;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else if(u<=67108863){if(outIdx+4>=endIdx)break;outU8Array[outIdx++]=248|u>>24;outU8Array[outIdx++]=128|u>>18&63;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else{if(outIdx+5>=endIdx)break;outU8Array[outIdx++]=252|u>>30;outU8Array[outIdx++]=128|u>>24&63;outU8Array[outIdx++]=128|u>>18&63;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}}outU8Array[outIdx]=0;return outIdx-startIdx}Module["stringToUTF8Array"]=stringToUTF8Array;function stringToUTF8(str,outPtr,maxBytesToWrite){return stringToUTF8Array(str,HEAPU8,outPtr,maxBytesToWrite)}Module["stringToUTF8"]=stringToUTF8;function lengthBytesUTF8(str){var len=0;for(var i=0;i=55296&&u<=57343)u=65536+((u&1023)<<10)|str.charCodeAt(++i)&1023;if(u<=127){++len}else if(u<=2047){len+=2}else if(u<=65535){len+=3}else if(u<=2097151){len+=4}else if(u<=67108863){len+=5}else{len+=6}}return len}Module["lengthBytesUTF8"]=lengthBytesUTF8;var UTF16Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf-16le"):undefined;function demangle(func){var __cxa_demangle_func=Module["___cxa_demangle"]||Module["__cxa_demangle"];if(__cxa_demangle_func){try{var s=func.substr(1);var len=lengthBytesUTF8(s)+1;var buf=_malloc(len);stringToUTF8(s,buf,len);var status=_malloc(4);var ret=__cxa_demangle_func(buf,0,0,status);if(getValue(status,"i32")===0&&ret){return Pointer_stringify(ret)}}catch(e){}finally{if(buf)_free(buf);if(status)_free(status);if(ret)_free(ret)}return func}Runtime.warnOnce("warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling");return func}function demangleAll(text){var regex=/__Z[\w\d_]+/g;return text.replace(regex,(function(x){var y=demangle(x);return x===y?x:x+" ["+y+"]"}))}function jsStackTrace(){var err=new Error;if(!err.stack){try{throw new Error(0)}catch(e){err=e}if(!err.stack){return"(no stack trace available)"}}return err.stack.toString()}function stackTrace(){var js=jsStackTrace();if(Module["extraStackTrace"])js+="\n"+Module["extraStackTrace"]();return demangleAll(js)}Module["stackTrace"]=stackTrace;var PAGE_SIZE=16384;var WASM_PAGE_SIZE=65536;var ASMJS_PAGE_SIZE=16777216;var MIN_TOTAL_MEMORY=16777216;function alignUp(x,multiple){if(x%multiple>0){x+=multiple-x%multiple}return x}var HEAP,buffer,HEAP8,HEAPU8,HEAP16,HEAPU16,HEAP32,HEAPU32,HEAPF32,HEAPF64;function updateGlobalBuffer(buf){Module["buffer"]=buffer=buf}function updateGlobalBufferViews(){Module["HEAP8"]=HEAP8=new Int8Array(buffer);Module["HEAP16"]=HEAP16=new Int16Array(buffer);Module["HEAP32"]=HEAP32=new Int32Array(buffer);Module["HEAPU8"]=HEAPU8=new Uint8Array(buffer);Module["HEAPU16"]=HEAPU16=new Uint16Array(buffer);Module["HEAPU32"]=HEAPU32=new Uint32Array(buffer);Module["HEAPF32"]=HEAPF32=new Float32Array(buffer);Module["HEAPF64"]=HEAPF64=new Float64Array(buffer)}var STATIC_BASE,STATICTOP,staticSealed;var STACK_BASE,STACKTOP,STACK_MAX;var DYNAMIC_BASE,DYNAMICTOP_PTR;STATIC_BASE=STATICTOP=STACK_BASE=STACKTOP=STACK_MAX=DYNAMIC_BASE=DYNAMICTOP_PTR=0;staticSealed=false;function abortOnCannotGrowMemory(){abort("Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value "+TOTAL_MEMORY+", (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ")}if(!Module["reallocBuffer"])Module["reallocBuffer"]=(function(size){var ret;try{if(ArrayBuffer.transfer){ret=ArrayBuffer.transfer(buffer,size)}else{var oldHEAP8=HEAP8;ret=new ArrayBuffer(size);var temp=new Int8Array(ret);temp.set(oldHEAP8)}}catch(e){return false}var success=_emscripten_replace_memory(ret);if(!success)return false;return ret});function enlargeMemory(){var PAGE_MULTIPLE=Module["usingWasm"]?WASM_PAGE_SIZE:ASMJS_PAGE_SIZE;var LIMIT=2147483648-PAGE_MULTIPLE;if(HEAP32[DYNAMICTOP_PTR>>2]>LIMIT){return false}var OLD_TOTAL_MEMORY=TOTAL_MEMORY;TOTAL_MEMORY=Math.max(TOTAL_MEMORY,MIN_TOTAL_MEMORY);while(TOTAL_MEMORY>2]){if(TOTAL_MEMORY<=536870912){TOTAL_MEMORY=alignUp(2*TOTAL_MEMORY,PAGE_MULTIPLE)}else{TOTAL_MEMORY=Math.min(alignUp((3*TOTAL_MEMORY+2147483648)/4,PAGE_MULTIPLE),LIMIT)}}var replacement=Module["reallocBuffer"](TOTAL_MEMORY);if(!replacement||replacement.byteLength!=TOTAL_MEMORY){TOTAL_MEMORY=OLD_TOTAL_MEMORY;return false}updateGlobalBuffer(replacement);updateGlobalBufferViews();return true}var byteLength;try{byteLength=Function.prototype.call.bind(Object.getOwnPropertyDescriptor(ArrayBuffer.prototype,"byteLength").get);byteLength(new ArrayBuffer(4))}catch(e){byteLength=(function(buffer){return buffer.byteLength})}var TOTAL_STACK=Module["TOTAL_STACK"]||5242880;var TOTAL_MEMORY=Module["TOTAL_MEMORY"]||16777216;if(TOTAL_MEMORY0){var callback=callbacks.shift();if(typeof callback=="function"){callback();continue}var func=callback.func;if(typeof func==="number"){if(callback.arg===undefined){Module["dynCall_v"](func)}else{Module["dynCall_vi"](func,callback.arg)}}else{func(callback.arg===undefined?null:callback.arg)}}}var __ATPRERUN__=[];var __ATINIT__=[];var __ATMAIN__=[];var __ATEXIT__=[];var __ATPOSTRUN__=[];var runtimeInitialized=false;var runtimeExited=false;function preRun(){if(Module["preRun"]){if(typeof Module["preRun"]=="function")Module["preRun"]=[Module["preRun"]];while(Module["preRun"].length){addOnPreRun(Module["preRun"].shift())}}callRuntimeCallbacks(__ATPRERUN__)}function ensureInitRuntime(){if(runtimeInitialized)return;runtimeInitialized=true;callRuntimeCallbacks(__ATINIT__)}function preMain(){callRuntimeCallbacks(__ATMAIN__)}function exitRuntime(){callRuntimeCallbacks(__ATEXIT__);runtimeExited=true}function postRun(){if(Module["postRun"]){if(typeof Module["postRun"]=="function")Module["postRun"]=[Module["postRun"]];while(Module["postRun"].length){addOnPostRun(Module["postRun"].shift())}}callRuntimeCallbacks(__ATPOSTRUN__)}function addOnPreRun(cb){__ATPRERUN__.unshift(cb)}Module["addOnPreRun"]=addOnPreRun;function addOnInit(cb){__ATINIT__.unshift(cb)}Module["addOnInit"]=addOnInit;function addOnPreMain(cb){__ATMAIN__.unshift(cb)}Module["addOnPreMain"]=addOnPreMain;function addOnExit(cb){__ATEXIT__.unshift(cb)}Module["addOnExit"]=addOnExit;function addOnPostRun(cb){__ATPOSTRUN__.unshift(cb)}Module["addOnPostRun"]=addOnPostRun;function intArrayFromString(stringy,dontAddNull,length){var len=length>0?length:lengthBytesUTF8(stringy)+1;var u8array=new Array(len);var numBytesWritten=stringToUTF8Array(stringy,u8array,0,u8array.length);if(dontAddNull)u8array.length=numBytesWritten;return u8array}Module["intArrayFromString"]=intArrayFromString;function intArrayToString(array){var ret=[];for(var i=0;i255){chr&=255}ret.push(String.fromCharCode(chr))}return ret.join("")}Module["intArrayToString"]=intArrayToString;function writeStringToMemory(string,buffer,dontAddNull){Runtime.warnOnce("writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!");var lastChar,end;if(dontAddNull){end=buffer+lengthBytesUTF8(string);lastChar=HEAP8[end]}stringToUTF8(string,buffer,Infinity);if(dontAddNull)HEAP8[end]=lastChar}Module["writeStringToMemory"]=writeStringToMemory;function writeArrayToMemory(array,buffer){HEAP8.set(array,buffer)}Module["writeArrayToMemory"]=writeArrayToMemory;function writeAsciiToMemory(str,buffer,dontAddNull){for(var i=0;i>0]=str.charCodeAt(i)}if(!dontAddNull)HEAP8[buffer>>0]=0}Module["writeAsciiToMemory"]=writeAsciiToMemory;if(!Math["imul"]||Math["imul"](4294967295,5)!==-5)Math["imul"]=function imul(a,b){var ah=a>>>16;var al=a&65535;var bh=b>>>16;var bl=b&65535;return al*bl+(ah*bl+al*bh<<16)|0};Math.imul=Math["imul"];if(!Math["fround"]){var froundBuffer=new Float32Array(1);Math["fround"]=(function(x){froundBuffer[0]=x;return froundBuffer[0]})}Math.fround=Math["fround"];if(!Math["clz32"])Math["clz32"]=(function(x){x=x>>>0;for(var i=0;i<32;i++){if(x&1<<31-i)return i}return 32});Math.clz32=Math["clz32"];if(!Math["trunc"])Math["trunc"]=(function(x){return x<0?Math.ceil(x):Math.floor(x)});Math.trunc=Math["trunc"];var Math_abs=Math.abs;var Math_cos=Math.cos;var Math_sin=Math.sin;var Math_tan=Math.tan;var Math_acos=Math.acos;var Math_asin=Math.asin;var Math_atan=Math.atan;var Math_atan2=Math.atan2;var Math_exp=Math.exp;var Math_log=Math.log;var Math_sqrt=Math.sqrt;var Math_ceil=Math.ceil;var Math_floor=Math.floor;var Math_pow=Math.pow;var Math_imul=Math.imul;var Math_fround=Math.fround;var Math_round=Math.round;var Math_min=Math.min;var Math_clz32=Math.clz32;var Math_trunc=Math.trunc;var runDependencies=0;var runDependencyWatcher=null;var dependenciesFulfilled=null;function getUniqueRunDependency(id){return id}function addRunDependency(id){runDependencies++;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}}Module["addRunDependency"]=addRunDependency;function removeRunDependency(id){runDependencies--;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}if(runDependencies==0){if(runDependencyWatcher!==null){clearInterval(runDependencyWatcher);runDependencyWatcher=null}if(dependenciesFulfilled){var callback=dependenciesFulfilled;dependenciesFulfilled=null;callback()}}}Module["removeRunDependency"]=removeRunDependency;Module["preloadedImages"]={};Module["preloadedAudios"]={};var memoryInitializer=null;function integrateWasmJS(Module){var method=Module["wasmJSMethod"]||"native-wasm";Module["wasmJSMethod"]=method;var wasmTextFile=Module["wasmTextFile"]||"godot.javascript.opt.webassembly.wast";var wasmBinaryFile=Module["wasmBinaryFile"]||"godot.javascript.opt.webassembly.wasm";var asmjsCodeFile=Module["asmjsCodeFile"]||"godot.javascript.opt.webassembly.temp.asm.js";if(typeof Module["locateFile"]==="function"){wasmTextFile=Module["locateFile"](wasmTextFile);wasmBinaryFile=Module["locateFile"](wasmBinaryFile);asmjsCodeFile=Module["locateFile"](asmjsCodeFile)}var wasmPageSize=64*1024;var asm2wasmImports={"f64-rem":(function(x,y){return x%y}),"f64-to-int":(function(x){return x|0}),"i32s-div":(function(x,y){return(x|0)/(y|0)|0}),"i32u-div":(function(x,y){return(x>>>0)/(y>>>0)>>>0}),"i32s-rem":(function(x,y){return(x|0)%(y|0)|0}),"i32u-rem":(function(x,y){return(x>>>0)%(y>>>0)>>>0}),"debugger":(function(){debugger})};var info={"global":null,"env":null,"asm2wasm":asm2wasmImports,"parent":Module};var exports=null;function lookupImport(mod,base){var lookup=info;if(mod.indexOf(".")<0){lookup=(lookup||{})[mod]}else{var parts=mod.split(".");lookup=(lookup||{})[parts[0]];lookup=(lookup||{})[parts[1]]}if(base){lookup=(lookup||{})[base]}if(lookup===undefined){abort("bad lookupImport to ("+mod+")."+base)}return lookup}function mergeMemory(newBuffer){var oldBuffer=Module["buffer"];if(newBuffer.byteLength=0||Module["wasmJSMethod"].indexOf("interpret-asm2wasm")>=0?"godot.javascript.opt.webassembly.js.mem":null;var STATIC_BUMP=1032944;Module["STATIC_BASE"]=STATIC_BASE;Module["STATIC_BUMP"]=STATIC_BUMP;var tempDoublePtr=STATICTOP;STATICTOP+=16;function ___setErrNo(value){if(Module["___errno_location"])HEAP32[Module["___errno_location"]()>>2]=value;return value}var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};var Sockets={BUFFER_SIZE:10240,MAX_BUFFER_SIZE:10485760,nextFd:1,fds:{},nextport:1,maxport:65535,peer:null,connections:{},portmap:{},localAddr:4261412874,addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034]};function __inet_pton4_raw(str){var b=str.split(".");for(var i=0;i<4;i++){var tmp=Number(b[i]);if(isNaN(tmp))return null;b[i]=tmp}return(b[0]|b[1]<<8|b[2]<<16|b[3]<<24)>>>0}function __inet_pton6_raw(str){var words;var w,offset,z;var valid6regx=/^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i;var parts=[];if(!valid6regx.test(str)){return null}if(str==="::"){return[0,0,0,0,0,0,0,0]}if(str.indexOf("::")===0){str=str.replace("::","Z:")}else{str=str.replace("::",":Z:")}if(str.indexOf(".")>0){str=str.replace(new RegExp("[.]","g"),":");words=str.split(":");words[words.length-4]=parseInt(words[words.length-4])+parseInt(words[words.length-3])*256;words[words.length-3]=parseInt(words[words.length-2])+parseInt(words[words.length-1])*256;words=words.slice(0,words.length-2)}else{words=str.split(":")}offset=0;z=0;for(w=0;w>8&255)+"."+(addr>>16&255)+"."+(addr>>24&255)}function __inet_ntop6_raw(ints){var str="";var word=0;var longest=0;var lastzero=0;var zstart=0;var len=0;var i=0;var parts=[ints[0]&65535,ints[0]>>16,ints[1]&65535,ints[1]>>16,ints[2]&65535,ints[2]>>16,ints[3]&65535,ints[3]>>16];var hasipv4=true;var v4part="";for(i=0;i<5;i++){if(parts[i]!==0){hasipv4=false;break}}if(hasipv4){v4part=__inet_ntop4_raw(parts[6]|parts[7]<<16);if(parts[5]===-1){str="::ffff:";str+=v4part;return str}if(parts[5]===0){str="::";if(v4part==="0.0.0.0")v4part="";if(v4part==="0.0.0.1")v4part="1";str+=v4part;return str}}for(word=0;word<8;word++){if(parts[word]===0){if(word-lastzero>1){len=0}lastzero=word;len++}if(len>longest){longest=len;zstart=word-longest+1}}for(word=0;word<8;word++){if(longest>1){if(parts[word]===0&&word>=zstart&&word>1]=family;HEAP32[sa+4>>2]=addr;HEAP16[sa+2>>1]=_htons(port);break;case 10:addr=__inet_pton6_raw(addr);HEAP32[sa>>2]=family;HEAP32[sa+8>>2]=addr[0];HEAP32[sa+12>>2]=addr[1];HEAP32[sa+16>>2]=addr[2];HEAP32[sa+20>>2]=addr[3];HEAP16[sa+2>>1]=_htons(port);HEAP32[sa+4>>2]=0;HEAP32[sa+24>>2]=0;break;default:return{errno:ERRNO_CODES.EAFNOSUPPORT}}return{}}function _getaddrinfo(node,service,hint,out){var addrs=[];var addr=0;var port=0;var flags=0;var family=0;var type=0;var proto=0;var ai;function allocaddrinfo(family,type,proto,canon,addr,port){var sa,salen,ai;var res;salen=family===10?28:16;addr=family===10?__inet_ntop6_raw(addr):__inet_ntop4_raw(addr);sa=_malloc(salen);res=__write_sockaddr(sa,family,addr,port);assert(!res.errno);ai=_malloc(32);HEAP32[ai+4>>2]=family;HEAP32[ai+8>>2]=type;HEAP32[ai+12>>2]=proto;HEAP32[ai+24>>2]=canon;HEAP32[ai+20>>2]=sa;if(family===10){HEAP32[ai+16>>2]=28}else{HEAP32[ai+16>>2]=16}HEAP32[ai+28>>2]=0;return ai}if(hint){flags=HEAP32[hint>>2];family=HEAP32[hint+4>>2];type=HEAP32[hint+8>>2];proto=HEAP32[hint+12>>2]}if(type&&!proto){proto=type===2?17:6}if(!type&&proto){type=proto===17?2:1}if(proto===0){proto=6}if(type===0){type=1}if(!node&&!service){return-2}if(flags&~(1|2|4|1024|8|16|32)){return-1}if(hint!==0&&HEAP32[hint>>2]&2&&!node){return-1}if(flags&32){return-2}if(type!==0&&type!==1&&type!==2){return-7}if(family!==0&&family!==2&&family!==10){return-6}if(service){service=Pointer_stringify(service);port=parseInt(service,10);if(isNaN(port)){if(flags&1024){return-2}return-8}}if(!node){if(family===0){family=2}if((flags&1)===0){if(family===2){addr=_htonl(2130706433)}else{addr=[0,0,0,1]}}ai=allocaddrinfo(family,type,proto,null,addr,port);HEAP32[out>>2]=ai;return 0}node=Pointer_stringify(node);addr=__inet_pton4_raw(node);if(addr!==null){if(family===0||family===2){family=2}else if(family===10&&flags&8){addr=[0,0,_htonl(65535),addr];family=10}else{return-2}}else{addr=__inet_pton6_raw(node);if(addr!==null){if(family===0||family===10){family=10}else{return-2}}}if(addr!=null){ai=allocaddrinfo(family,type,proto,node,addr,port);HEAP32[out>>2]=ai;return 0}if(flags&4){return-2}node=DNS.lookup_name(node);addr=__inet_pton4_raw(node);if(family===0){family=2}else if(family===10){addr=[0,0,_htonl(65535),addr]}ai=allocaddrinfo(family,type,proto,null,addr,port);HEAP32[out>>2]=ai;return 0}function _sem_wait(){}function _fork(){___setErrNo(ERRNO_CODES.EAGAIN);return-1}function _posix_spawn(){return _fork.apply(null,arguments)}var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],queries:[],samplers:[],transformFeedbacks:[],syncs:[],byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},stringiCache:{},tempFixedLengthArray:[],packAlignment:4,unpackAlignment:4,init:(function(){GL.miniTempBuffer=new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);for(var i=0;i>2];if(len<0){frag=Pointer_stringify(HEAP32[string+i*4>>2])}else{frag=Pointer_stringify(HEAP32[string+i*4>>2],len)}}else{frag=Pointer_stringify(HEAP32[string+i*4>>2])}source+=frag}return source}),createContext:(function(canvas,webGLContextAttributes){if(typeof webGLContextAttributes["majorVersion"]==="undefined"&&typeof webGLContextAttributes["minorVersion"]==="undefined"){if(typeof WebGL2RenderingContext!=="undefined")webGLContextAttributes["majorVersion"]=2;else webGLContextAttributes["majorVersion"]=1;webGLContextAttributes["minorVersion"]=0}var ctx;var errorInfo="?";function onContextCreationError(event){errorInfo=event.statusMessage||errorInfo}try{canvas.addEventListener("webglcontextcreationerror",onContextCreationError,false);try{if(webGLContextAttributes["majorVersion"]==1&&webGLContextAttributes["minorVersion"]==0){ctx=canvas.getContext("webgl",webGLContextAttributes)||canvas.getContext("experimental-webgl",webGLContextAttributes)}else if(webGLContextAttributes["majorVersion"]==2&&webGLContextAttributes["minorVersion"]==0){ctx=canvas.getContext("webgl2",webGLContextAttributes)}else{throw"Unsupported WebGL context version "+majorVersion+"."+minorVersion+"!"}}finally{canvas.removeEventListener("webglcontextcreationerror",onContextCreationError,false)}if(!ctx)throw":("}catch(e){Module.print("Could not create canvas: "+[errorInfo,e,JSON.stringify(webGLContextAttributes)]);return 0}if(!ctx)return 0;return GL.registerContext(ctx,webGLContextAttributes)}),registerContext:(function(ctx,webGLContextAttributes){var handle=GL.getNewId(GL.contexts);var context={handle:handle,attributes:webGLContextAttributes,version:webGLContextAttributes["majorVersion"],GLctx:ctx};function getChromeVersion(){var raw=navigator.userAgent.match(/Chrom(e|ium)\/([0-9]+)\./);return raw?parseInt(raw[2],10):false}context.supportsWebGL2EntryPoints=context.version>=2&&(getChromeVersion()===false||getChromeVersion()>=58);if(ctx.canvas)ctx.canvas.GLctxObject=context;GL.contexts[handle]=context;if(typeof webGLContextAttributes["enableExtensionsByDefault"]==="undefined"||webGLContextAttributes["enableExtensionsByDefault"]){GL.initExtensions(context)}return handle}),makeContextCurrent:(function(contextHandle){var context=GL.contexts[contextHandle];if(!context)return false;GLctx=Module.ctx=context.GLctx;GL.currentContext=context;return true}),getContext:(function(contextHandle){return GL.contexts[contextHandle]}),deleteContext:(function(contextHandle){if(GL.currentContext===GL.contexts[contextHandle])GL.currentContext=null;if(typeof JSEvents==="object")JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas);if(GL.contexts[contextHandle]&&GL.contexts[contextHandle].GLctx.canvas)GL.contexts[contextHandle].GLctx.canvas.GLctxObject=undefined;GL.contexts[contextHandle]=null}),initExtensions:(function(context){if(!context)context=GL.currentContext;if(context.initExtensionsDone)return;context.initExtensionsDone=true;var GLctx=context.GLctx;context.maxVertexAttribs=GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS);if(context.version<2){var instancedArraysExt=GLctx.getExtension("ANGLE_instanced_arrays");if(instancedArraysExt){GLctx["vertexAttribDivisor"]=(function(index,divisor){instancedArraysExt["vertexAttribDivisorANGLE"](index,divisor)});GLctx["drawArraysInstanced"]=(function(mode,first,count,primcount){instancedArraysExt["drawArraysInstancedANGLE"](mode,first,count,primcount)});GLctx["drawElementsInstanced"]=(function(mode,count,type,indices,primcount){instancedArraysExt["drawElementsInstancedANGLE"](mode,count,type,indices,primcount)})}var vaoExt=GLctx.getExtension("OES_vertex_array_object");if(vaoExt){GLctx["createVertexArray"]=(function(){return vaoExt["createVertexArrayOES"]()});GLctx["deleteVertexArray"]=(function(vao){vaoExt["deleteVertexArrayOES"](vao)});GLctx["bindVertexArray"]=(function(vao){vaoExt["bindVertexArrayOES"](vao)});GLctx["isVertexArray"]=(function(vao){return vaoExt["isVertexArrayOES"](vao)})}var drawBuffersExt=GLctx.getExtension("WEBGL_draw_buffers");if(drawBuffersExt){GLctx["drawBuffers"]=(function(n,bufs){drawBuffersExt["drawBuffersWEBGL"](n,bufs)})}}GLctx.disjointTimerQueryExt=GLctx.getExtension("EXT_disjoint_timer_query");var automaticallyEnabledExtensions=["OES_texture_float","OES_texture_half_float","OES_standard_derivatives","OES_vertex_array_object","WEBGL_compressed_texture_s3tc","WEBGL_depth_texture","OES_element_index_uint","EXT_texture_filter_anisotropic","ANGLE_instanced_arrays","OES_texture_float_linear","OES_texture_half_float_linear","WEBGL_compressed_texture_atc","WEBGL_compressed_texture_pvrtc","EXT_color_buffer_half_float","WEBGL_color_buffer_float","EXT_frag_depth","EXT_sRGB","WEBGL_draw_buffers","WEBGL_shared_resources","EXT_shader_texture_lod","EXT_color_buffer_float"];var exts=GLctx.getSupportedExtensions();if(exts&&exts.length>0){GLctx.getSupportedExtensions().forEach((function(ext){if(automaticallyEnabledExtensions.indexOf(ext)!=-1){GLctx.getExtension(ext)}}))}}),populateUniformTable:(function(program){var p=GL.programs[program];GL.programInfos[program]={uniforms:{},maxUniformLength:0,maxAttributeLength:-1,maxUniformBlockNameLength:-1};var ptable=GL.programInfos[program];var utable=ptable.uniforms;var numUniforms=GLctx.getProgramParameter(p,GLctx.ACTIVE_UNIFORMS);for(var i=0;i=2)glVersion="OpenGL ES 3.0 ("+glVersion+")";else{glVersion="OpenGL ES 2.0 ("+glVersion+")"}ret=allocate(intArrayFromString(glVersion),"i8",ALLOC_NORMAL);break;case 7939:var exts=GLctx.getSupportedExtensions();var gl_exts=[];for(var i=0;i=0;i--){var last=parts[i];if(last==="."){parts.splice(i,1)}else if(last===".."){parts.splice(i,1);up++}else if(up){parts.splice(i,1);up--}}if(allowAboveRoot){for(;up;up--){parts.unshift("..")}}return parts}),normalize:(function(path){var isAbsolute=path.charAt(0)==="/",trailingSlash=path.substr(-1)==="/";path=PATH.normalizeArray(path.split("/").filter((function(p){return!!p})),!isAbsolute).join("/");if(!path&&!isAbsolute){path="."}if(path&&trailingSlash){path+="/"}return(isAbsolute?"/":"")+path}),dirname:(function(path){var result=PATH.splitPath(path),root=result[0],dir=result[1];if(!root&&!dir){return"."}if(dir){dir=dir.substr(0,dir.length-1)}return root+dir}),basename:(function(path){if(path==="/")return"/";var lastSlash=path.lastIndexOf("/");if(lastSlash===-1)return path;return path.substr(lastSlash+1)}),extname:(function(path){return PATH.splitPath(path)[3]}),join:(function(){var paths=Array.prototype.slice.call(arguments,0);return PATH.normalize(paths.join("/"))}),join2:(function(l,r){return PATH.normalize(l+"/"+r)}),resolve:(function(){var resolvedPath="",resolvedAbsolute=false;for(var i=arguments.length-1;i>=-1&&!resolvedAbsolute;i--){var path=i>=0?arguments[i]:FS.cwd();if(typeof path!=="string"){throw new TypeError("Arguments to path.resolve must be strings")}else if(!path){return""}resolvedPath=path+"/"+resolvedPath;resolvedAbsolute=path.charAt(0)==="/"}resolvedPath=PATH.normalizeArray(resolvedPath.split("/").filter((function(p){return!!p})),!resolvedAbsolute).join("/");return(resolvedAbsolute?"/":"")+resolvedPath||"."}),relative:(function(from,to){from=PATH.resolve(from).substr(1);to=PATH.resolve(to).substr(1);function trim(arr){var start=0;for(;start=0;end--){if(arr[end]!=="")break}if(start>end)return[];return arr.slice(start,end-start+1)}var fromParts=trim(from.split("/"));var toParts=trim(to.split("/"));var length=Math.min(fromParts.length,toParts.length);var samePartsLength=length;for(var i=0;i0){result=buf.slice(0,bytesRead).toString("utf-8")}else{result=null}}else if(typeof window!="undefined"&&typeof window.prompt=="function"){result=window.prompt("Input: ");if(result!==null){result+="\n"}}else if(typeof readline=="function"){result=readline();if(result!==null){result+="\n"}}if(!result){return null}tty.input=intArrayFromString(result,true)}return tty.input.shift()}),put_char:(function(tty,val){if(val===null||val===10){Module["print"](UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}}),flush:(function(tty){if(tty.output&&tty.output.length>0){Module["print"](UTF8ArrayToString(tty.output,0));tty.output=[]}})},default_tty1_ops:{put_char:(function(tty,val){if(val===null||val===10){Module["printErr"](UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}}),flush:(function(tty){if(tty.output&&tty.output.length>0){Module["printErr"](UTF8ArrayToString(tty.output,0));tty.output=[]}})}};var MEMFS={ops_table:null,mount:(function(mount){return MEMFS.createNode(null,"/",16384|511,0)}),createNode:(function(parent,name,mode,dev){if(FS.isBlkdev(mode)||FS.isFIFO(mode)){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}if(!MEMFS.ops_table){MEMFS.ops_table={dir:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,lookup:MEMFS.node_ops.lookup,mknod:MEMFS.node_ops.mknod,rename:MEMFS.node_ops.rename,unlink:MEMFS.node_ops.unlink,rmdir:MEMFS.node_ops.rmdir,readdir:MEMFS.node_ops.readdir,symlink:MEMFS.node_ops.symlink},stream:{llseek:MEMFS.stream_ops.llseek}},file:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:{llseek:MEMFS.stream_ops.llseek,read:MEMFS.stream_ops.read,write:MEMFS.stream_ops.write,allocate:MEMFS.stream_ops.allocate,mmap:MEMFS.stream_ops.mmap,msync:MEMFS.stream_ops.msync}},link:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,readlink:MEMFS.node_ops.readlink},stream:{}},chrdev:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:FS.chrdev_stream_ops}}}var node=FS.createNode(parent,name,mode,dev);if(FS.isDir(node.mode)){node.node_ops=MEMFS.ops_table.dir.node;node.stream_ops=MEMFS.ops_table.dir.stream;node.contents={}}else if(FS.isFile(node.mode)){node.node_ops=MEMFS.ops_table.file.node;node.stream_ops=MEMFS.ops_table.file.stream;node.usedBytes=0;node.contents=null}else if(FS.isLink(node.mode)){node.node_ops=MEMFS.ops_table.link.node;node.stream_ops=MEMFS.ops_table.link.stream}else if(FS.isChrdev(node.mode)){node.node_ops=MEMFS.ops_table.chrdev.node;node.stream_ops=MEMFS.ops_table.chrdev.stream}node.timestamp=Date.now();if(parent){parent.contents[name]=node}return node}),getFileDataAsRegularArray:(function(node){if(node.contents&&node.contents.subarray){var arr=[];for(var i=0;inode.contents.length){node.contents=MEMFS.getFileDataAsRegularArray(node);node.usedBytes=node.contents.length}if(!node.contents||node.contents.subarray){var prevCapacity=node.contents?node.contents.length:0;if(prevCapacity>=newCapacity)return;var CAPACITY_DOUBLING_MAX=1024*1024;newCapacity=Math.max(newCapacity,prevCapacity*(prevCapacity0)node.contents.set(oldContents.subarray(0,node.usedBytes),0);return}if(!node.contents&&newCapacity>0)node.contents=[];while(node.contents.lengthnewSize)node.contents.length=newSize;else while(node.contents.length=stream.node.usedBytes)return 0;var size=Math.min(stream.node.usedBytes-position,length);assert(size>=0);if(size>8&&contents.subarray){buffer.set(contents.subarray(position,position+size),offset)}else{for(var i=0;i0||position+lengthe2.timestamp){create.push(key);total++}}));var remove=[];Object.keys(dst.entries).forEach((function(key){var e=dst.entries[key];var e2=src.entries[key];if(!e2){remove.push(key);total++}}));if(!total){return callback(null)}var completed=0;var db=src.type==="remote"?src.db:dst.db;var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readwrite");var store=transaction.objectStore(IDBFS.DB_STORE_NAME);function done(err){if(err){if(!done.errored){done.errored=true;return callback(err)}return}if(++completed>=total){return callback(null)}}transaction.onerror=(function(e){done(this.error);e.preventDefault()});create.sort().forEach((function(path){if(dst.type==="local"){IDBFS.loadRemoteEntry(store,path,(function(err,entry){if(err)return done(err);IDBFS.storeLocalEntry(path,entry,done)}))}else{IDBFS.loadLocalEntry(path,(function(err,entry){if(err)return done(err);IDBFS.storeRemoteEntry(store,path,entry,done)}))}}));remove.sort().reverse().forEach((function(path){if(dst.type==="local"){IDBFS.removeLocalEntry(path,done)}else{IDBFS.removeRemoteEntry(store,path,done)}}))})};var NODEFS={isWindows:false,staticInit:(function(){NODEFS.isWindows=!!process.platform.match(/^win/)}),mount:(function(mount){assert(ENVIRONMENT_IS_NODE);return NODEFS.createNode(null,"/",NODEFS.getMode(mount.opts.root),0)}),createNode:(function(parent,name,mode,dev){if(!FS.isDir(mode)&&!FS.isFile(mode)&&!FS.isLink(mode)){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var node=FS.createNode(parent,name,mode);node.node_ops=NODEFS.node_ops;node.stream_ops=NODEFS.stream_ops;return node}),getMode:(function(path){var stat;try{stat=fs.lstatSync(path);if(NODEFS.isWindows){stat.mode=stat.mode|(stat.mode&146)>>1}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}return stat.mode}),realPath:(function(node){var parts=[];while(node.parent!==node){parts.push(node.name);node=node.parent}parts.push(node.mount.opts.root);parts.reverse();return PATH.join.apply(null,parts)}),flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:(function(flags){flags&=~2097152;flags&=~2048;flags&=~32768;flags&=~524288;if(flags in NODEFS.flagsToPermissionStringMap){return NODEFS.flagsToPermissionStringMap[flags]}else{throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}}),node_ops:{getattr:(function(node){var path=NODEFS.realPath(node);var stat;try{stat=fs.lstatSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}if(NODEFS.isWindows&&!stat.blksize){stat.blksize=4096}if(NODEFS.isWindows&&!stat.blocks){stat.blocks=(stat.size+stat.blksize-1)/stat.blksize|0}return{dev:stat.dev,ino:stat.ino,mode:stat.mode,nlink:stat.nlink,uid:stat.uid,gid:stat.gid,rdev:stat.rdev,size:stat.size,atime:stat.atime,mtime:stat.mtime,ctime:stat.ctime,blksize:stat.blksize,blocks:stat.blocks}}),setattr:(function(node,attr){var path=NODEFS.realPath(node);try{if(attr.mode!==undefined){fs.chmodSync(path,attr.mode);node.mode=attr.mode}if(attr.timestamp!==undefined){var date=new Date(attr.timestamp);fs.utimesSync(path,date,date)}if(attr.size!==undefined){fs.truncateSync(path,attr.size)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),lookup:(function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);var mode=NODEFS.getMode(path);return NODEFS.createNode(parent,name,mode)}),mknod:(function(parent,name,mode,dev){var node=NODEFS.createNode(parent,name,mode,dev);var path=NODEFS.realPath(node);try{if(FS.isDir(node.mode)){fs.mkdirSync(path,node.mode)}else{fs.writeFileSync(path,"",{mode:node.mode})}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}return node}),rename:(function(oldNode,newDir,newName){var oldPath=NODEFS.realPath(oldNode);var newPath=PATH.join2(NODEFS.realPath(newDir),newName);try{fs.renameSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),unlink:(function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.unlinkSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),rmdir:(function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.rmdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),readdir:(function(node){var path=NODEFS.realPath(node);try{return fs.readdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),symlink:(function(parent,newName,oldPath){var newPath=PATH.join2(NODEFS.realPath(parent),newName);try{fs.symlinkSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),readlink:(function(node){var path=NODEFS.realPath(node);try{path=fs.readlinkSync(path);path=NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root),path);return path}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}})},stream_ops:{open:(function(stream){var path=NODEFS.realPath(stream.node);try{if(FS.isFile(stream.node.mode)){stream.nfd=fs.openSync(path,NODEFS.flagsToPermissionString(stream.flags))}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),close:(function(stream){try{if(FS.isFile(stream.node.mode)&&stream.nfd){fs.closeSync(stream.nfd)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(ERRNO_CODES[e.code])}}),read:(function(stream,buffer,offset,length,position){if(length===0)return 0;var nbuffer=new Buffer(length);var res;try{res=fs.readSync(stream.nfd,nbuffer,0,length,position)}catch(e){throw new FS.ErrnoError(ERRNO_CODES[e.code])}if(res>0){for(var i=0;i=stream.node.size)return 0;var chunk=stream.node.contents.slice(position,position+length);var ab=WORKERFS.reader.readAsArrayBuffer(chunk);buffer.set(new Uint8Array(ab),offset);return chunk.size}),write:(function(stream,buffer,offset,length,position){throw new FS.ErrnoError(ERRNO_CODES.EIO)}),llseek:(function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){position+=stream.node.size}}if(position<0){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}return position})}};STATICTOP+=16;STATICTOP+=16;STATICTOP+=16;var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:(function(e){if(!(e instanceof FS.ErrnoError))throw e+" : "+stackTrace();return ___setErrNo(e.errno)}),lookupPath:(function(path,opts){path=PATH.resolve(FS.cwd(),path);opts=opts||{};if(!path)return{path:"",node:null};var defaults={follow_mount:true,recurse_count:0};for(var key in defaults){if(opts[key]===undefined){opts[key]=defaults[key]}}if(opts.recurse_count>8){throw new FS.ErrnoError(ERRNO_CODES.ELOOP)}var parts=PATH.normalizeArray(path.split("/").filter((function(p){return!!p})),false);var current=FS.root;var current_path="/";for(var i=0;i40){throw new FS.ErrnoError(ERRNO_CODES.ELOOP)}}}}return{path:current_path,node:current}}),getPath:(function(node){var path;while(true){if(FS.isRoot(node)){var mount=node.mount.mountpoint;if(!path)return mount;return mount[mount.length-1]!=="/"?mount+"/"+path:mount+path}path=path?node.name+"/"+path:node.name;node=node.parent}}),hashName:(function(parentid,name){var hash=0;for(var i=0;i>>0)%FS.nameTable.length}),hashAddNode:(function(node){var hash=FS.hashName(node.parent.id,node.name);node.name_next=FS.nameTable[hash];FS.nameTable[hash]=node}),hashRemoveNode:(function(node){var hash=FS.hashName(node.parent.id,node.name);if(FS.nameTable[hash]===node){FS.nameTable[hash]=node.name_next}else{var current=FS.nameTable[hash];while(current){if(current.name_next===node){current.name_next=node.name_next;break}current=current.name_next}}}),lookupNode:(function(parent,name){var err=FS.mayLookup(parent);if(err){throw new FS.ErrnoError(err,parent)}var hash=FS.hashName(parent.id,name);for(var node=FS.nameTable[hash];node;node=node.name_next){var nodeName=node.name;if(node.parent.id===parent.id&&nodeName===name){return node}}return FS.lookup(parent,name)}),createNode:(function(parent,name,mode,rdev){if(!FS.FSNode){FS.FSNode=(function(parent,name,mode,rdev){if(!parent){parent=this}this.parent=parent;this.mount=parent.mount;this.mounted=null;this.id=FS.nextInode++;this.name=name;this.mode=mode;this.node_ops={};this.stream_ops={};this.rdev=rdev});FS.FSNode.prototype={};var readMode=292|73;var writeMode=146;Object.defineProperties(FS.FSNode.prototype,{read:{get:(function(){return(this.mode&readMode)===readMode}),set:(function(val){val?this.mode|=readMode:this.mode&=~readMode})},write:{get:(function(){return(this.mode&writeMode)===writeMode}),set:(function(val){val?this.mode|=writeMode:this.mode&=~writeMode})},isFolder:{get:(function(){return FS.isDir(this.mode)})},isDevice:{get:(function(){return FS.isChrdev(this.mode)})}})}var node=new FS.FSNode(parent,name,mode,rdev);FS.hashAddNode(node);return node}),destroyNode:(function(node){FS.hashRemoveNode(node)}),isRoot:(function(node){return node===node.parent}),isMountpoint:(function(node){return!!node.mounted}),isFile:(function(mode){return(mode&61440)===32768}),isDir:(function(mode){return(mode&61440)===16384}),isLink:(function(mode){return(mode&61440)===40960}),isChrdev:(function(mode){return(mode&61440)===8192}),isBlkdev:(function(mode){return(mode&61440)===24576}),isFIFO:(function(mode){return(mode&61440)===4096}),isSocket:(function(mode){return(mode&49152)===49152}),flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:(function(str){var flags=FS.flagModes[str];if(typeof flags==="undefined"){throw new Error("Unknown file open mode: "+str)}return flags}),flagsToPermissionString:(function(flag){var perms=["r","w","rw"][flag&3];if(flag&512){perms+="w"}return perms}),nodePermissions:(function(node,perms){if(FS.ignorePermissions){return 0}if(perms.indexOf("r")!==-1&&!(node.mode&292)){return ERRNO_CODES.EACCES}else if(perms.indexOf("w")!==-1&&!(node.mode&146)){return ERRNO_CODES.EACCES}else if(perms.indexOf("x")!==-1&&!(node.mode&73)){return ERRNO_CODES.EACCES}return 0}),mayLookup:(function(dir){var err=FS.nodePermissions(dir,"x");if(err)return err;if(!dir.node_ops.lookup)return ERRNO_CODES.EACCES;return 0}),mayCreate:(function(dir,name){try{var node=FS.lookupNode(dir,name);return ERRNO_CODES.EEXIST}catch(e){}return FS.nodePermissions(dir,"wx")}),mayDelete:(function(dir,name,isdir){var node;try{node=FS.lookupNode(dir,name)}catch(e){return e.errno}var err=FS.nodePermissions(dir,"wx");if(err){return err}if(isdir){if(!FS.isDir(node.mode)){return ERRNO_CODES.ENOTDIR}if(FS.isRoot(node)||FS.getPath(node)===FS.cwd()){return ERRNO_CODES.EBUSY}}else{if(FS.isDir(node.mode)){return ERRNO_CODES.EISDIR}}return 0}),mayOpen:(function(node,flags){if(!node){return ERRNO_CODES.ENOENT}if(FS.isLink(node.mode)){return ERRNO_CODES.ELOOP}else if(FS.isDir(node.mode)){if(FS.flagsToPermissionString(flags)!=="r"||flags&512){return ERRNO_CODES.EISDIR}}return FS.nodePermissions(node,FS.flagsToPermissionString(flags))}),MAX_OPEN_FDS:4096,nextfd:(function(fd_start,fd_end){fd_start=fd_start||0;fd_end=fd_end||FS.MAX_OPEN_FDS;for(var fd=fd_start;fd<=fd_end;fd++){if(!FS.streams[fd]){return fd}}throw new FS.ErrnoError(ERRNO_CODES.EMFILE)}),getStream:(function(fd){return FS.streams[fd]}),createStream:(function(stream,fd_start,fd_end){if(!FS.FSStream){FS.FSStream=(function(){});FS.FSStream.prototype={};Object.defineProperties(FS.FSStream.prototype,{object:{get:(function(){return this.node}),set:(function(val){this.node=val})},isRead:{get:(function(){return(this.flags&2097155)!==1})},isWrite:{get:(function(){return(this.flags&2097155)!==0})},isAppend:{get:(function(){return this.flags&1024})}})}var newStream=new FS.FSStream;for(var p in stream){newStream[p]=stream[p]}stream=newStream;var fd=FS.nextfd(fd_start,fd_end);stream.fd=fd;FS.streams[fd]=stream;return stream}),closeStream:(function(fd){FS.streams[fd]=null}),chrdev_stream_ops:{open:(function(stream){var device=FS.getDevice(stream.node.rdev);stream.stream_ops=device.stream_ops;if(stream.stream_ops.open){stream.stream_ops.open(stream)}}),llseek:(function(){throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)})},major:(function(dev){return dev>>8}),minor:(function(dev){return dev&255}),makedev:(function(ma,mi){return ma<<8|mi}),registerDevice:(function(dev,ops){FS.devices[dev]={stream_ops:ops}}),getDevice:(function(dev){return FS.devices[dev]}),getMounts:(function(mount){var mounts=[];var check=[mount];while(check.length){var m=check.pop();mounts.push(m);check.push.apply(check,m.mounts)}return mounts}),syncfs:(function(populate,callback){if(typeof populate==="function"){callback=populate;populate=false}FS.syncFSRequests++;if(FS.syncFSRequests>1){console.log("warning: "+FS.syncFSRequests+" FS.syncfs operations in flight at once, probably just doing extra work")}var mounts=FS.getMounts(FS.root.mount);var completed=0;function doCallback(err){assert(FS.syncFSRequests>0);FS.syncFSRequests--;return callback(err)}function done(err){if(err){if(!done.errored){done.errored=true;return doCallback(err)}return}if(++completed>=mounts.length){doCallback(null)}}mounts.forEach((function(mount){if(!mount.type.syncfs){return done(null)}mount.type.syncfs(mount,populate,done)}))}),mount:(function(type,opts,mountpoint){var root=mountpoint==="/";var pseudo=!mountpoint;var node;if(root&&FS.root){throw new FS.ErrnoError(ERRNO_CODES.EBUSY)}else if(!root&&!pseudo){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});mountpoint=lookup.path;node=lookup.node;if(FS.isMountpoint(node)){throw new FS.ErrnoError(ERRNO_CODES.EBUSY)}if(!FS.isDir(node.mode)){throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)}}var mount={type:type,opts:opts,mountpoint:mountpoint,mounts:[]};var mountRoot=type.mount(mount);mountRoot.mount=mount;mount.root=mountRoot;if(root){FS.root=mountRoot}else if(node){node.mounted=mount;if(node.mount){node.mount.mounts.push(mount)}}return mountRoot}),unmount:(function(mountpoint){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});if(!FS.isMountpoint(lookup.node)){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var node=lookup.node;var mount=node.mounted;var mounts=FS.getMounts(mount);Object.keys(FS.nameTable).forEach((function(hash){var current=FS.nameTable[hash];while(current){var next=current.name_next;if(mounts.indexOf(current.mount)!==-1){FS.destroyNode(current)}current=next}}));node.mounted=null;var idx=node.mount.mounts.indexOf(mount);assert(idx!==-1);node.mount.mounts.splice(idx,1)}),lookup:(function(parent,name){return parent.node_ops.lookup(parent,name)}),mknod:(function(path,mode,dev){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);if(!name||name==="."||name===".."){throw new FS.ErrnoError(ERRNO_CODES.EINVAL)}var err=FS.mayCreate(parent,name);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.mknod){throw new FS.ErrnoError(ERRNO_CODES.EPERM)}return parent.node_ops.mknod(parent,name,mode,dev)}),create:(function(path,mode){mode=mode!==undefined?mode:438;mode&=4095;mode|=32768;return FS.mknod(path,mode,0)}),mkdir:(function(path,mode){mode=mode!==undefined?mode:511;mode&=511|512;mode|=16384;return FS.mknod(path,mode,0)}),mkdirTree:(function(path,mode){var dirs=path.split("/");var d="";for(var i=0;ithis.length-1||idx<0){return undefined}var chunkOffset=idx%this.chunkSize;var chunkNum=idx/this.chunkSize|0;return this.getter(chunkNum)[chunkOffset]};LazyUint8Array.prototype.setDataGetter=function LazyUint8Array_setDataGetter(getter){this.getter=getter};LazyUint8Array.prototype.cacheLength=function LazyUint8Array_cacheLength(){var xhr=new XMLHttpRequest;xhr.open("HEAD",url,false);xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);var datalength=Number(xhr.getResponseHeader("Content-length"));var header;var hasByteServing=(header=xhr.getResponseHeader("Accept-Ranges"))&&header==="bytes";var usesGzip=(header=xhr.getResponseHeader("Content-Encoding"))&&header==="gzip";var chunkSize=1024*1024;if(!hasByteServing)chunkSize=datalength;var doXHR=(function(from,to){if(from>to)throw new Error("invalid range ("+from+", "+to+") or no bytes requested!");if(to>datalength-1)throw new Error("only "+datalength+" bytes available! programmer error!");var xhr=new XMLHttpRequest;xhr.open("GET",url,false);if(datalength!==chunkSize)xhr.setRequestHeader("Range","bytes="+from+"-"+to);if(typeof Uint8Array!="undefined")xhr.responseType="arraybuffer";if(xhr.overrideMimeType){xhr.overrideMimeType("text/plain; charset=x-user-defined")}xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);if(xhr.response!==undefined){return new Uint8Array(xhr.response||[])}else{return intArrayFromString(xhr.responseText||"",true)}});var lazyArray=this;lazyArray.setDataGetter((function(chunkNum){var start=chunkNum*chunkSize;var end=(chunkNum+1)*chunkSize-1;end=Math.min(end,datalength-1);if(typeof lazyArray.chunks[chunkNum]==="undefined"){lazyArray.chunks[chunkNum]=doXHR(start,end)}if(typeof lazyArray.chunks[chunkNum]==="undefined")throw new Error("doXHR failed!");return lazyArray.chunks[chunkNum]}));if(usesGzip||!datalength){chunkSize=datalength=1;datalength=this.getter(0).length;chunkSize=datalength;console.log("LazyFiles on gzip forces download of the whole file when length is accessed")}this._length=datalength;this._chunkSize=chunkSize;this.lengthKnown=true};if(typeof XMLHttpRequest!=="undefined"){if(!ENVIRONMENT_IS_WORKER)throw"Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";var lazyArray=new LazyUint8Array;Object.defineProperties(lazyArray,{length:{get:(function(){if(!this.lengthKnown){this.cacheLength()}return this._length})},chunkSize:{get:(function(){if(!this.lengthKnown){this.cacheLength()}return this._chunkSize})}});var properties={isDevice:false,contents:lazyArray}}else{var properties={isDevice:false,url:url}}var node=FS.createFile(parent,name,properties,canRead,canWrite);if(properties.contents){node.contents=properties.contents}else if(properties.url){node.contents=null;node.url=properties.url}Object.defineProperties(node,{usedBytes:{get:(function(){return this.contents.length})}});var stream_ops={};var keys=Object.keys(node.stream_ops);keys.forEach((function(key){var fn=node.stream_ops[key];stream_ops[key]=function forceLoadLazyFile(){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(ERRNO_CODES.EIO)}return fn.apply(null,arguments)}}));stream_ops.read=function stream_ops_read(stream,buffer,offset,length,position){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(ERRNO_CODES.EIO)}var contents=stream.node.contents;if(position>=contents.length)return 0;var size=Math.min(contents.length-position,length);assert(size>=0);if(contents.slice){for(var i=0;i>2]=stat.dev;HEAP32[buf+4>>2]=0;HEAP32[buf+8>>2]=stat.ino;HEAP32[buf+12>>2]=stat.mode;HEAP32[buf+16>>2]=stat.nlink;HEAP32[buf+20>>2]=stat.uid;HEAP32[buf+24>>2]=stat.gid;HEAP32[buf+28>>2]=stat.rdev;HEAP32[buf+32>>2]=0;HEAP32[buf+36>>2]=stat.size;HEAP32[buf+40>>2]=4096;HEAP32[buf+44>>2]=stat.blocks;HEAP32[buf+48>>2]=stat.atime.getTime()/1e3|0;HEAP32[buf+52>>2]=0;HEAP32[buf+56>>2]=stat.mtime.getTime()/1e3|0;HEAP32[buf+60>>2]=0;HEAP32[buf+64>>2]=stat.ctime.getTime()/1e3|0;HEAP32[buf+68>>2]=0;HEAP32[buf+72>>2]=stat.ino;return 0}),doMsync:(function(addr,stream,len,flags){var buffer=new Uint8Array(HEAPU8.subarray(addr,addr+len));FS.msync(stream,buffer,0,len,flags)}),doMkdir:(function(path,mode){path=PATH.normalize(path);if(path[path.length-1]==="/")path=path.substr(0,path.length-1);FS.mkdir(path,mode,0);return 0}),doMknod:(function(path,mode,dev){switch(mode&61440){case 32768:case 8192:case 24576:case 4096:case 49152:break;default:return-ERRNO_CODES.EINVAL}FS.mknod(path,mode,dev);return 0}),doReadlink:(function(path,buf,bufsize){if(bufsize<=0)return-ERRNO_CODES.EINVAL;var ret=FS.readlink(path);var len=Math.min(bufsize,lengthBytesUTF8(ret));var endChar=HEAP8[buf+len];stringToUTF8(ret,buf,bufsize+1);HEAP8[buf+len]=endChar;return len}),doAccess:(function(path,amode){if(amode&~7){return-ERRNO_CODES.EINVAL}var node;var lookup=FS.lookupPath(path,{follow:true});node=lookup.node;var perms="";if(amode&4)perms+="r";if(amode&2)perms+="w";if(amode&1)perms+="x";if(perms&&FS.nodePermissions(node,perms)){return-ERRNO_CODES.EACCES}return 0}),doDup:(function(path,flags,suggestFD){var suggest=FS.getStream(suggestFD);if(suggest)FS.close(suggest);return FS.open(path,flags,0,suggestFD,suggestFD).fd}),doReadv:(function(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.read(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr;if(curr>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.write(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr}return ret}),varargs:0,get:(function(varargs){SYSCALLS.varargs+=4;var ret=HEAP32[SYSCALLS.varargs-4>>2];return ret}),getStr:(function(){var ret=Pointer_stringify(SYSCALLS.get());return ret}),getStreamFromFD:(function(){var stream=FS.getStream(SYSCALLS.get());if(!stream)throw new FS.ErrnoError(ERRNO_CODES.EBADF);return stream}),getSocketFromFD:(function(){var socket=SOCKFS.getSocket(SYSCALLS.get());if(!socket)throw new FS.ErrnoError(ERRNO_CODES.EBADF);return socket}),getSocketAddress:(function(allowNull){var addrp=SYSCALLS.get(),addrlen=SYSCALLS.get();if(allowNull&&addrp===0)return null;var info=__read_sockaddr(addrp,addrlen);if(info.errno)throw new FS.ErrnoError(info.errno);info.addr=DNS.lookup_addr(info.addr)||info.addr;return info}),get64:(function(){var low=SYSCALLS.get(),high=SYSCALLS.get();if(low>=0)assert(high===0);else assert(high===-1);return low}),getZero:(function(){assert(SYSCALLS.get()===0)})};function ___syscall114(which,varargs){SYSCALLS.varargs=varargs;try{abort("cannot wait on child processes")}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _pthread_mutex_init(){}var _llvm_pow_f32=Math_pow;var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,lastGamepadState:null,lastGamepadStateFrame:null,numGamepadsConnected:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,staticInit:(function(){if(typeof window!=="undefined"){window.addEventListener("gamepadconnected",(function(){++JSEvents.numGamepadsConnected}));window.addEventListener("gamepaddisconnected",(function(){--JSEvents.numGamepadsConnected}));var firstState=navigator.getGamepads?navigator.getGamepads():navigator.webkitGetGamepads?navigator.webkitGetGamepads():null;if(firstState){JSEvents.numGamepadsConnected=firstState.length}}}),registerRemoveEventListeners:(function(){if(!JSEvents.removeEventListenersRegistered){__ATEXIT__.push((function(){for(var i=JSEvents.eventHandlers.length-1;i>=0;--i){JSEvents._removeHandler(i)}}));JSEvents.removeEventListenersRegistered=true}}),findEventTarget:(function(target){if(target){if(typeof target=="number"){target=Pointer_stringify(target)}if(target=="#window")return window;else if(target=="#document")return document;else if(target=="#screen")return window.screen;else if(target=="#canvas")return Module["canvas"];if(typeof target=="string")return document.getElementById(target);else return target}else{return window}}),deferredCalls:[],deferCall:(function(targetFunction,precedence,argsList){function arraysHaveEqualContent(arrA,arrB){if(arrA.length!=arrB.length)return false;for(var i in arrA){if(arrA[i]!=arrB[i])return false}return true}for(var i in JSEvents.deferredCalls){var call=JSEvents.deferredCalls[i];if(call.targetFunction==targetFunction&&arraysHaveEqualContent(call.argsList,argsList)){return}}JSEvents.deferredCalls.push({targetFunction:targetFunction,precedence:precedence,argsList:argsList});JSEvents.deferredCalls.sort((function(x,y){return x.precedence0}),removeAllHandlersOnTarget:(function(target,eventTypeString){for(var i=0;i>2]=e.location;HEAP32[JSEvents.keyEvent+68>>2]=e.ctrlKey;HEAP32[JSEvents.keyEvent+72>>2]=e.shiftKey;HEAP32[JSEvents.keyEvent+76>>2]=e.altKey;HEAP32[JSEvents.keyEvent+80>>2]=e.metaKey;HEAP32[JSEvents.keyEvent+84>>2]=e.repeat;stringToUTF8(e.locale?e.locale:"",JSEvents.keyEvent+88,32);stringToUTF8(e.char?e.char:"",JSEvents.keyEvent+120,32);HEAP32[JSEvents.keyEvent+152>>2]=e.charCode;HEAP32[JSEvents.keyEvent+156>>2]=e.keyCode;HEAP32[JSEvents.keyEvent+160>>2]=e.which;var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.keyEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:JSEvents.findEventTarget(target),allowsDeferredCalls:JSEvents.isInternetExplorer()?false:true,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),getBoundingClientRectOrZeros:(function(target){return target.getBoundingClientRect?target.getBoundingClientRect():{left:0,top:0}}),fillMouseEventData:(function(eventStruct,e,target){HEAPF64[eventStruct>>3]=JSEvents.tick();HEAP32[eventStruct+8>>2]=e.screenX;HEAP32[eventStruct+12>>2]=e.screenY;HEAP32[eventStruct+16>>2]=e.clientX;HEAP32[eventStruct+20>>2]=e.clientY;HEAP32[eventStruct+24>>2]=e.ctrlKey;HEAP32[eventStruct+28>>2]=e.shiftKey;HEAP32[eventStruct+32>>2]=e.altKey;HEAP32[eventStruct+36>>2]=e.metaKey;HEAP16[eventStruct+40>>1]=e.button;HEAP16[eventStruct+42>>1]=e.buttons;HEAP32[eventStruct+44>>2]=e["movementX"]||e["mozMovementX"]||e["webkitMovementX"]||e.screenX-JSEvents.previousScreenX;HEAP32[eventStruct+48>>2]=e["movementY"]||e["mozMovementY"]||e["webkitMovementY"]||e.screenY-JSEvents.previousScreenY;if(Module["canvas"]){var rect=Module["canvas"].getBoundingClientRect();HEAP32[eventStruct+60>>2]=e.clientX-rect.left;HEAP32[eventStruct+64>>2]=e.clientY-rect.top}else{HEAP32[eventStruct+60>>2]=0;HEAP32[eventStruct+64>>2]=0}if(target){var rect=JSEvents.getBoundingClientRectOrZeros(target);HEAP32[eventStruct+52>>2]=e.clientX-rect.left;HEAP32[eventStruct+56>>2]=e.clientY-rect.top}else{HEAP32[eventStruct+52>>2]=0;HEAP32[eventStruct+56>>2]=0}if(e.type!=="wheel"&&e.type!=="mousewheel"){JSEvents.previousScreenX=e.screenX;JSEvents.previousScreenY=e.screenY}}),registerMouseEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.mouseEvent){JSEvents.mouseEvent=_malloc(72)}target=JSEvents.findEventTarget(target);var handlerFunc=(function(event){var e=event||window.event;JSEvents.fillMouseEventData(JSEvents.mouseEvent,e,target);var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.mouseEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:target,allowsDeferredCalls:eventTypeString!="mousemove"&&eventTypeString!="mouseenter"&&eventTypeString!="mouseleave",eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};if(JSEvents.isInternetExplorer()&&eventTypeString=="mousedown")eventHandler.allowsDeferredCalls=false;JSEvents.registerOrRemoveHandler(eventHandler)}),registerWheelEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.wheelEvent){JSEvents.wheelEvent=_malloc(104)}target=JSEvents.findEventTarget(target);var wheelHandlerFunc=(function(event){var e=event||window.event;JSEvents.fillMouseEventData(JSEvents.wheelEvent,e,target);HEAPF64[JSEvents.wheelEvent+72>>3]=e["deltaX"];HEAPF64[JSEvents.wheelEvent+80>>3]=e["deltaY"];HEAPF64[JSEvents.wheelEvent+88>>3]=e["deltaZ"];HEAP32[JSEvents.wheelEvent+96>>2]=e["deltaMode"];var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.wheelEvent,userData);if(shouldCancel){e.preventDefault()}});var mouseWheelHandlerFunc=(function(event){var e=event||window.event;JSEvents.fillMouseEventData(JSEvents.wheelEvent,e,target);HEAPF64[JSEvents.wheelEvent+72>>3]=e["wheelDeltaX"]||0;HEAPF64[JSEvents.wheelEvent+80>>3]=-(e["wheelDeltaY"]?e["wheelDeltaY"]:e["wheelDelta"]);HEAPF64[JSEvents.wheelEvent+88>>3]=0;HEAP32[JSEvents.wheelEvent+96>>2]=0;var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.wheelEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:target,allowsDeferredCalls:true,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:eventTypeString=="wheel"?wheelHandlerFunc:mouseWheelHandlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),pageScrollPos:(function(){if(window.pageXOffset>0||window.pageYOffset>0){return[window.pageXOffset,window.pageYOffset]}if(typeof document.documentElement.scrollLeft!=="undefined"||typeof document.documentElement.scrollTop!=="undefined"){return[document.documentElement.scrollLeft,document.documentElement.scrollTop]}return[document.body.scrollLeft|0,document.body.scrollTop|0]}),registerUiEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.uiEvent){JSEvents.uiEvent=_malloc(36)}if(eventTypeString=="scroll"&&!target){target=document}else{target=JSEvents.findEventTarget(target)}var handlerFunc=(function(event){var e=event||window.event;if(e.target!=target){return}var scrollPos=JSEvents.pageScrollPos();HEAP32[JSEvents.uiEvent>>2]=e.detail;HEAP32[JSEvents.uiEvent+4>>2]=document.body.clientWidth;HEAP32[JSEvents.uiEvent+8>>2]=document.body.clientHeight;HEAP32[JSEvents.uiEvent+12>>2]=window.innerWidth;HEAP32[JSEvents.uiEvent+16>>2]=window.innerHeight;HEAP32[JSEvents.uiEvent+20>>2]=window.outerWidth;HEAP32[JSEvents.uiEvent+24>>2]=window.outerHeight;HEAP32[JSEvents.uiEvent+28>>2]=scrollPos[0];HEAP32[JSEvents.uiEvent+32>>2]=scrollPos[1];var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.uiEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:target,allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),getNodeNameForTarget:(function(target){if(!target)return"";if(target==window)return"#window";if(target==window.screen)return"#screen";return target&&target.nodeName?target.nodeName:""}),registerFocusEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.focusEvent){JSEvents.focusEvent=_malloc(256)}var handlerFunc=(function(event){var e=event||window.event;var nodeName=JSEvents.getNodeNameForTarget(e.target);var id=e.target.id?e.target.id:"";stringToUTF8(nodeName,JSEvents.focusEvent+0,128);stringToUTF8(id,JSEvents.focusEvent+128,128);var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.focusEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:JSEvents.findEventTarget(target),allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),tick:(function(){if(window["performance"]&&window["performance"]["now"])return window["performance"]["now"]();else return Date.now()}),registerDeviceOrientationEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.deviceOrientationEvent){JSEvents.deviceOrientationEvent=_malloc(40)}var handlerFunc=(function(event){var e=event||window.event;HEAPF64[JSEvents.deviceOrientationEvent>>3]=JSEvents.tick();HEAPF64[JSEvents.deviceOrientationEvent+8>>3]=e.alpha;HEAPF64[JSEvents.deviceOrientationEvent+16>>3]=e.beta;HEAPF64[JSEvents.deviceOrientationEvent+24>>3]=e.gamma;HEAP32[JSEvents.deviceOrientationEvent+32>>2]=e.absolute;var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.deviceOrientationEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:JSEvents.findEventTarget(target),allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),registerDeviceMotionEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.deviceMotionEvent){JSEvents.deviceMotionEvent=_malloc(80)}var handlerFunc=(function(event){var e=event||window.event;HEAPF64[JSEvents.deviceMotionEvent>>3]=JSEvents.tick();HEAPF64[JSEvents.deviceMotionEvent+8>>3]=e.acceleration.x;HEAPF64[JSEvents.deviceMotionEvent+16>>3]=e.acceleration.y;HEAPF64[JSEvents.deviceMotionEvent+24>>3]=e.acceleration.z;HEAPF64[JSEvents.deviceMotionEvent+32>>3]=e.accelerationIncludingGravity.x;HEAPF64[JSEvents.deviceMotionEvent+40>>3]=e.accelerationIncludingGravity.y;HEAPF64[JSEvents.deviceMotionEvent+48>>3]=e.accelerationIncludingGravity.z;HEAPF64[JSEvents.deviceMotionEvent+56>>3]=e.rotationRate.alpha;HEAPF64[JSEvents.deviceMotionEvent+64>>3]=e.rotationRate.beta;HEAPF64[JSEvents.deviceMotionEvent+72>>3]=e.rotationRate.gamma;var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.deviceMotionEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:JSEvents.findEventTarget(target),allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),screenOrientation:(function(){if(!window.screen)return undefined;return window.screen.orientation||window.screen.mozOrientation||window.screen.webkitOrientation||window.screen.msOrientation}),fillOrientationChangeEventData:(function(eventStruct,e){var orientations=["portrait-primary","portrait-secondary","landscape-primary","landscape-secondary"];var orientations2=["portrait","portrait","landscape","landscape"];var orientationString=JSEvents.screenOrientation();var orientation=orientations.indexOf(orientationString);if(orientation==-1){orientation=orientations2.indexOf(orientationString)}HEAP32[eventStruct>>2]=1<>2]=window.orientation}),registerOrientationChangeEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.orientationChangeEvent){JSEvents.orientationChangeEvent=_malloc(8)}if(!target){target=window.screen}else{target=JSEvents.findEventTarget(target)}var handlerFunc=(function(event){var e=event||window.event;JSEvents.fillOrientationChangeEventData(JSEvents.orientationChangeEvent,e);var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.orientationChangeEvent,userData);if(shouldCancel){e.preventDefault()}});if(eventTypeString=="orientationchange"&&window.screen.mozOrientation!==undefined){eventTypeString="mozorientationchange"}var eventHandler={target:target,allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),fullscreenEnabled:(function(){return document.fullscreenEnabled||document.mozFullScreenEnabled||document.webkitFullscreenEnabled||document.msFullscreenEnabled}),fillFullscreenChangeEventData:(function(eventStruct,e){var fullscreenElement=document.fullscreenElement||document.mozFullScreenElement||document.webkitFullscreenElement||document.msFullscreenElement;var isFullscreen=!!fullscreenElement;HEAP32[eventStruct>>2]=isFullscreen;HEAP32[eventStruct+4>>2]=JSEvents.fullscreenEnabled();var reportedElement=isFullscreen?fullscreenElement:JSEvents.previousFullscreenElement;var nodeName=JSEvents.getNodeNameForTarget(reportedElement);var id=reportedElement&&reportedElement.id?reportedElement.id:"";stringToUTF8(nodeName,eventStruct+8,128);stringToUTF8(id,eventStruct+136,128);HEAP32[eventStruct+264>>2]=reportedElement?reportedElement.clientWidth:0;HEAP32[eventStruct+268>>2]=reportedElement?reportedElement.clientHeight:0;HEAP32[eventStruct+272>>2]=screen.width;HEAP32[eventStruct+276>>2]=screen.height;if(isFullscreen){JSEvents.previousFullscreenElement=fullscreenElement}}),registerFullscreenChangeEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.fullscreenChangeEvent){JSEvents.fullscreenChangeEvent=_malloc(280)}if(!target){target=document}else{target=JSEvents.findEventTarget(target)}var handlerFunc=(function(event){var e=event||window.event;JSEvents.fillFullscreenChangeEventData(JSEvents.fullscreenChangeEvent,e);var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.fullscreenChangeEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:target,allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),resizeCanvasForFullscreen:(function(target,strategy){var restoreOldStyle=__registerRestoreOldStyle(target);var cssWidth=strategy.softFullscreen?window.innerWidth:screen.width;var cssHeight=strategy.softFullscreen?window.innerHeight:screen.height;var rect=target.getBoundingClientRect();var windowedCssWidth=rect.right-rect.left;var windowedCssHeight=rect.bottom-rect.top;var windowedRttWidth=target.width;var windowedRttHeight=target.height;if(strategy.scaleMode==3){__setLetterbox(target,(cssHeight-windowedCssHeight)/2,(cssWidth-windowedCssWidth)/2);cssWidth=windowedCssWidth;cssHeight=windowedCssHeight}else if(strategy.scaleMode==2){if(cssWidth*windowedRttHeight>2]=isPointerlocked;var nodeName=JSEvents.getNodeNameForTarget(pointerLockElement);var id=pointerLockElement&&pointerLockElement.id?pointerLockElement.id:"";stringToUTF8(nodeName,eventStruct+4,128);stringToUTF8(id,eventStruct+132,128)}),registerPointerlockChangeEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.pointerlockChangeEvent){JSEvents.pointerlockChangeEvent=_malloc(260)}if(!target){target=document}else{target=JSEvents.findEventTarget(target)}var handlerFunc=(function(event){var e=event||window.event;JSEvents.fillPointerlockChangeEventData(JSEvents.pointerlockChangeEvent,e);var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.pointerlockChangeEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:target,allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),registerPointerlockErrorEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!target){target=document}else{target=JSEvents.findEventTarget(target)}var handlerFunc=(function(event){var e=event||window.event;var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,0,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:target,allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),requestPointerLock:(function(target){if(target.requestPointerLock){target.requestPointerLock()}else if(target.mozRequestPointerLock){target.mozRequestPointerLock()}else if(target.webkitRequestPointerLock){target.webkitRequestPointerLock()}else if(target.msRequestPointerLock){target.msRequestPointerLock()}else{if(document.body.requestPointerLock||document.body.mozRequestPointerLock||document.body.webkitRequestPointerLock||document.body.msRequestPointerLock){return-3}else{return-1}}return 0}),fillVisibilityChangeEventData:(function(eventStruct,e){var visibilityStates=["hidden","visible","prerender","unloaded"];var visibilityState=visibilityStates.indexOf(document.visibilityState);HEAP32[eventStruct>>2]=document.hidden;HEAP32[eventStruct+4>>2]=visibilityState}),registerVisibilityChangeEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.visibilityChangeEvent){JSEvents.visibilityChangeEvent=_malloc(8)}if(!target){target=document}else{target=JSEvents.findEventTarget(target)}var handlerFunc=(function(event){var e=event||window.event;JSEvents.fillVisibilityChangeEventData(JSEvents.visibilityChangeEvent,e);var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.visibilityChangeEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:target,allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),registerTouchEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.touchEvent){JSEvents.touchEvent=_malloc(1684)}target=JSEvents.findEventTarget(target);var handlerFunc=(function(event){var e=event||window.event;var touches={};for(var i=0;i>2]=e.ctrlKey;HEAP32[ptr+8>>2]=e.shiftKey;HEAP32[ptr+12>>2]=e.altKey;HEAP32[ptr+16>>2]=e.metaKey;ptr+=20;var canvasRect=Module["canvas"]?Module["canvas"].getBoundingClientRect():undefined;var targetRect=JSEvents.getBoundingClientRectOrZeros(target);var numTouches=0;for(var i in touches){var t=touches[i];HEAP32[ptr>>2]=t.identifier;HEAP32[ptr+4>>2]=t.screenX;HEAP32[ptr+8>>2]=t.screenY;HEAP32[ptr+12>>2]=t.clientX;HEAP32[ptr+16>>2]=t.clientY;HEAP32[ptr+20>>2]=t.pageX;HEAP32[ptr+24>>2]=t.pageY;HEAP32[ptr+28>>2]=t.changed;HEAP32[ptr+32>>2]=t.onTarget;if(canvasRect){HEAP32[ptr+44>>2]=t.clientX-canvasRect.left;HEAP32[ptr+48>>2]=t.clientY-canvasRect.top}else{HEAP32[ptr+44>>2]=0;HEAP32[ptr+48>>2]=0}HEAP32[ptr+36>>2]=t.clientX-targetRect.left;HEAP32[ptr+40>>2]=t.clientY-targetRect.top;ptr+=52;if(++numTouches>=32){break}}HEAP32[JSEvents.touchEvent>>2]=numTouches;var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.touchEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:target,allowsDeferredCalls:eventTypeString=="touchstart"||eventTypeString=="touchend",eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),fillGamepadEventData:(function(eventStruct,e){HEAPF64[eventStruct>>3]=e.timestamp;for(var i=0;i>3]=e.axes[i]}for(var i=0;i>3]=e.buttons[i].value}else{HEAPF64[eventStruct+i*8+528>>3]=e.buttons[i]}}for(var i=0;i>2]=e.buttons[i].pressed}else{HEAP32[eventStruct+i*4+1040>>2]=e.buttons[i]==1}}HEAP32[eventStruct+1296>>2]=e.connected;HEAP32[eventStruct+1300>>2]=e.index;HEAP32[eventStruct+8>>2]=e.axes.length;HEAP32[eventStruct+12>>2]=e.buttons.length;stringToUTF8(e.id,eventStruct+1304,64);stringToUTF8(e.mapping,eventStruct+1368,64)}),registerGamepadEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.gamepadEvent){JSEvents.gamepadEvent=_malloc(1432)}var handlerFunc=(function(event){var e=event||window.event;JSEvents.fillGamepadEventData(JSEvents.gamepadEvent,e.gamepad);var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.gamepadEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:JSEvents.findEventTarget(target),allowsDeferredCalls:true,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),registerBeforeUnloadEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){var handlerFunc=(function(event){var e=event||window.event;var confirmationMessage=Module["dynCall_iiii"](callbackfunc,eventTypeId,0,userData);if(confirmationMessage){confirmationMessage=Pointer_stringify(confirmationMessage)}if(confirmationMessage){e.preventDefault();e.returnValue=confirmationMessage;return confirmationMessage}});var eventHandler={target:JSEvents.findEventTarget(target),allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),battery:(function(){return navigator.battery||navigator.mozBattery||navigator.webkitBattery}),fillBatteryEventData:(function(eventStruct,e){HEAPF64[eventStruct>>3]=e.chargingTime;HEAPF64[eventStruct+8>>3]=e.dischargingTime;HEAPF64[eventStruct+16>>3]=e.level;HEAP32[eventStruct+24>>2]=e.charging}),registerBatteryEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!JSEvents.batteryEvent){JSEvents.batteryEvent=_malloc(32)}var handlerFunc=(function(event){var e=event||window.event;JSEvents.fillBatteryEventData(JSEvents.batteryEvent,JSEvents.battery());var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,JSEvents.batteryEvent,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:JSEvents.findEventTarget(target),allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}),registerWebGlEventCallback:(function(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString){if(!target){target=Module["canvas"]}var handlerFunc=(function(event){var e=event||window.event;var shouldCancel=Module["dynCall_iiii"](callbackfunc,eventTypeId,0,userData);if(shouldCancel){e.preventDefault()}});var eventHandler={target:JSEvents.findEventTarget(target),allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:handlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)})};function _emscripten_set_fullscreenchange_callback(target,userData,useCapture,callbackfunc){if(typeof JSEvents.fullscreenEnabled()==="undefined")return-1;if(!target)target=document;else{target=JSEvents.findEventTarget(target);if(!target)return-4}JSEvents.registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"fullscreenchange");JSEvents.registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"mozfullscreenchange");JSEvents.registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"webkitfullscreenchange");JSEvents.registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"msfullscreenchange");return 0}var DLFCN={error:null,errorMsg:null,loadedLibs:{},loadedLibNames:{}};function _dlerror(){if(DLFCN.errorMsg===null){return 0}else{if(DLFCN.error)_free(DLFCN.error);var msgArr=intArrayFromString(DLFCN.errorMsg);DLFCN.error=allocate(msgArr,"i8",ALLOC_NORMAL);DLFCN.errorMsg=null;return DLFCN.error}}function _glCompileShader(shader){GLctx.compileShader(GL.shaders[shader])}function ___syscall54(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),op=SYSCALLS.get();switch(op){case 21505:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0};case 21506:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0};case 21519:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;var argp=SYSCALLS.get();HEAP32[argp>>2]=0;return 0};case 21520:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return-ERRNO_CODES.EINVAL};case 21531:{var argp=SYSCALLS.get();return FS.ioctl(stream,op,argp)};case 21523:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0};default:abort("bad ioctl syscall "+op)}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}var ___tm_current=STATICTOP;STATICTOP+=48;var ___tm_timezone=allocate(intArrayFromString("GMT"),"i8",ALLOC_STATIC);var _tzname=STATICTOP;STATICTOP+=16;var _daylight=STATICTOP;STATICTOP+=16;var _timezone=STATICTOP;STATICTOP+=16;function _tzset(){if(_tzset.called)return;_tzset.called=true;HEAP32[_timezone>>2]=-(new Date).getTimezoneOffset()*60;var winter=new Date(2e3,0,1);var summer=new Date(2e3,6,1);HEAP32[_daylight>>2]=Number(winter.getTimezoneOffset()!=summer.getTimezoneOffset());function extractZone(date){var match=date.toTimeString().match(/\(([A-Za-z ]+)\)$/);return match?match[1]:"GMT"}var winterName=extractZone(winter);var summerName=extractZone(summer);var winterNamePtr=allocate(intArrayFromString(winterName),"i8",ALLOC_NORMAL);var summerNamePtr=allocate(intArrayFromString(summerName),"i8",ALLOC_NORMAL);if(summer.getTimezoneOffset()>2]=winterNamePtr;HEAP32[_tzname+4>>2]=summerNamePtr}else{HEAP32[_tzname>>2]=summerNamePtr;HEAP32[_tzname+4>>2]=winterNamePtr}}function _localtime_r(time,tmPtr){_tzset();var date=new Date(HEAP32[time>>2]*1e3);HEAP32[tmPtr>>2]=date.getSeconds();HEAP32[tmPtr+4>>2]=date.getMinutes();HEAP32[tmPtr+8>>2]=date.getHours();HEAP32[tmPtr+12>>2]=date.getDate();HEAP32[tmPtr+16>>2]=date.getMonth();HEAP32[tmPtr+20>>2]=date.getFullYear()-1900;HEAP32[tmPtr+24>>2]=date.getDay();var start=new Date(date.getFullYear(),0,1);var yday=(date.getTime()-start.getTime())/(1e3*60*60*24)|0;HEAP32[tmPtr+28>>2]=yday;HEAP32[tmPtr+36>>2]=-(date.getTimezoneOffset()*60);var summerOffset=(new Date(2e3,6,1)).getTimezoneOffset();var winterOffset=start.getTimezoneOffset();var dst=date.getTimezoneOffset()==Math.min(winterOffset,summerOffset)|0;HEAP32[tmPtr+32>>2]=dst;var zonePtr=HEAP32[_tzname+(dst?Runtime.QUANTUM_SIZE:0)>>2];HEAP32[tmPtr+40>>2]=zonePtr;return tmPtr}function _localtime(time){return _localtime_r(time,___tm_current)}function _glDeleteTextures(n,textures){for(var i=0;i>2];var texture=GL.textures[id];if(!texture)continue;GLctx.deleteTexture(texture);texture.name=0;GL.textures[id]=null}}var PTHREAD_SPECIFIC={};function _pthread_setspecific(key,value){if(!(key in PTHREAD_SPECIFIC)){return ERRNO_CODES.EINVAL}PTHREAD_SPECIFIC[key]=value;return 0}function _glVertexAttrib4f(x0,x1,x2,x3,x4){GLctx["vertexAttrib4f"](x0,x1,x2,x3,x4)}function _glVertexAttribIPointer(index,size,type,stride,ptr){GLctx.vertexAttribIPointer(index,size,type,stride,ptr)}function _dlclose(handle){if(!DLFCN.loadedLibs[handle]){DLFCN.errorMsg="Tried to dlclose() unopened handle: "+handle;return 1}else{var lib_record=DLFCN.loadedLibs[handle];if(--lib_record.refcount==0){if(lib_record.module.cleanups){lib_record.module.cleanups.forEach((function(cleanup){cleanup()}))}delete DLFCN.loadedLibNames[lib_record.name];delete DLFCN.loadedLibs[handle]}return 0}}function _emscripten_memcpy_big(dest,src,num){HEAPU8.set(HEAPU8.subarray(src,src+num),dest);return dest}function _pthread_mutexattr_init(){}function _glUniform1f(location,v0){GLctx.uniform1f(GL.uniforms[location],v0)}function ___syscall168(which,varargs){SYSCALLS.varargs=varargs;try{var fds=SYSCALLS.get(),nfds=SYSCALLS.get(),timeout=SYSCALLS.get();var nonzero=0;for(var i=0;i>2];var events=HEAP16[pollfd+4>>1];var mask=32;var stream=FS.getStream(fd);if(stream){mask=SYSCALLS.DEFAULT_POLLMASK;if(stream.stream_ops.poll){mask=stream.stream_ops.poll(stream)}}mask&=events|8|16;if(mask)nonzero++;HEAP16[pollfd+6>>1]=mask}return nonzero}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall195(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),buf=SYSCALLS.get();return SYSCALLS.doStat(FS.stat,path,buf)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _glCreateShader(shaderType){var id=GL.getNewId(GL.shaders);GL.shaders[id]=GLctx.createShader(shaderType);return id}function _glUniform1i(location,v0){GLctx.uniform1i(GL.uniforms[location],v0)}function _glInvalidateFramebuffer(target,numAttachments,attachments){var list=GL.tempFixedLengthArray[numAttachments];for(var i=0;i>2]}GLctx["invalidateFramebuffer"](target,list)}function _glCompressedTexImage2D(target,level,internalFormat,width,height,border,imageSize,data){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,HEAPU8,data,imageSize);return}GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,data?HEAPU8.subarray(data,data+imageSize):null)}function _glDisable(x0){GLctx["disable"](x0)}function _glBlendFuncSeparate(x0,x1,x2,x3){GLctx["blendFuncSeparate"](x0,x1,x2,x3)}function _glDrawBuffers(n,bufs){var bufArray=GL.tempFixedLengthArray[n];for(var i=0;i>2]}GLctx["drawBuffers"](bufArray)}function _emscripten_set_touchcancel_callback(target,userData,useCapture,callbackfunc){JSEvents.registerTouchEventCallback(target,userData,useCapture,callbackfunc,25,"touchcancel");return 0}function _glBindFramebuffer(target,framebuffer){GLctx.bindFramebuffer(target,framebuffer?GL.framebuffers[framebuffer]:null)}function ___lock(){}function _glCullFace(x0){GLctx["cullFace"](x0)}function _emscripten_set_keyup_callback(target,userData,useCapture,callbackfunc){JSEvents.registerKeyEventCallback(target,userData,useCapture,callbackfunc,3,"keyup");return 0}function _emscripten_webgl_make_context_current(contextHandle){var success=GL.makeContextCurrent(contextHandle);return success?0:-5}function _glDeleteProgram(id){if(!id)return;var program=GL.programs[id];if(!program){GL.recordError(1281);return}GLctx.deleteProgram(program);program.name=0;GL.programs[id]=null;GL.programInfos[id]=null}function _glRenderbufferStorage(x0,x1,x2,x3){GLctx["renderbufferStorage"](x0,x1,x2,x3)}function _emscripten_get_pointerlock_status(pointerlockStatus){if(pointerlockStatus)JSEvents.fillPointerlockChangeEventData(pointerlockStatus);if(!document.body||!document.body.requestPointerLock&&!document.body.mozRequestPointerLock&&!document.body.webkitRequestPointerLock&&!document.body.msRequestPointerLock){return-1}return 0}function _glAttachShader(program,shader){GLctx.attachShader(GL.programs[program],GL.shaders[shader])}function _glClearBufferfv(buffer,drawbuffer,value){GLctx["clearBufferfv"](buffer,drawbuffer,HEAPF32,value>>2)}function _pthread_attr_setdetachstate(){}function _emscripten_set_touchstart_callback(target,userData,useCapture,callbackfunc){JSEvents.registerTouchEventCallback(target,userData,useCapture,callbackfunc,22,"touchstart");return 0}function ___syscall10(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr();FS.unlink(path);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _glClearBufferfi(x0,x1,x2,x3){GLctx["clearBufferfi"](x0,x1,x2,x3)}function _pthread_attr_init(attr){return 0}function _emscripten_set_main_loop_timing(mode,value){Browser.mainLoop.timingMode=mode;Browser.mainLoop.timingValue=value;if(!Browser.mainLoop.func){return 1}if(mode==0){Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_setTimeout(){var timeUntilNextTick=Math.max(0,Browser.mainLoop.tickStartTime+value-_emscripten_get_now())|0;setTimeout(Browser.mainLoop.runner,timeUntilNextTick)};Browser.mainLoop.method="timeout"}else if(mode==1){Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_rAF(){Browser.requestAnimationFrame(Browser.mainLoop.runner)};Browser.mainLoop.method="rAF"}else if(mode==2){if(!window["setImmediate"]){var setImmediates=[];var emscriptenMainLoopMessageId="setimmediate";function Browser_setImmediate_messageHandler(event){if(event.source===window&&event.data===emscriptenMainLoopMessageId){event.stopPropagation();setImmediates.shift()()}}window.addEventListener("message",Browser_setImmediate_messageHandler,true);window["setImmediate"]=function Browser_emulated_setImmediate(func){setImmediates.push(func);if(ENVIRONMENT_IS_WORKER){if(Module["setImmediates"]===undefined)Module["setImmediates"]=[];Module["setImmediates"].push(func);window.postMessage({target:emscriptenMainLoopMessageId})}else window.postMessage(emscriptenMainLoopMessageId,"*")}}Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_setImmediate(){window["setImmediate"](Browser.mainLoop.runner)};Browser.mainLoop.method="immediate"}return 0}function _emscripten_get_now(){abort()}function _emscripten_set_main_loop(func,fps,simulateInfiniteLoop,arg,noSetTiming){Module["noExitRuntime"]=true;assert(!Browser.mainLoop.func,"emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.");Browser.mainLoop.func=func;Browser.mainLoop.arg=arg;var browserIterationFunc;if(typeof arg!=="undefined"){browserIterationFunc=(function(){Module["dynCall_vi"](func,arg)})}else{browserIterationFunc=(function(){Module["dynCall_v"](func)})}var thisMainLoopId=Browser.mainLoop.currentlyRunningMainloop;Browser.mainLoop.runner=function Browser_mainLoop_runner(){if(ABORT)return;if(Browser.mainLoop.queue.length>0){var start=Date.now();var blocker=Browser.mainLoop.queue.shift();blocker.func(blocker.arg);if(Browser.mainLoop.remainingBlockers){var remaining=Browser.mainLoop.remainingBlockers;var next=remaining%1==0?remaining-1:Math.floor(remaining);if(blocker.counted){Browser.mainLoop.remainingBlockers=next}else{next=next+.5;Browser.mainLoop.remainingBlockers=(8*remaining+next)/9}}console.log('main loop blocker "'+blocker.name+'" took '+(Date.now()-start)+" ms");Browser.mainLoop.updateStatus();if(thisMainLoopId1&&Browser.mainLoop.currentFrameNumber%Browser.mainLoop.timingValue!=0){Browser.mainLoop.scheduler();return}else if(Browser.mainLoop.timingMode==0){Browser.mainLoop.tickStartTime=_emscripten_get_now()}if(Browser.mainLoop.method==="timeout"&&Module.ctx){Module.printErr("Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!");Browser.mainLoop.method=""}Browser.mainLoop.runIter(browserIterationFunc);if(thisMainLoopId0)_emscripten_set_main_loop_timing(0,1e3/fps);else _emscripten_set_main_loop_timing(1,1);Browser.mainLoop.scheduler()}if(simulateInfiniteLoop){throw"SimulateInfiniteLoop"}}var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:(function(){Browser.mainLoop.scheduler=null;Browser.mainLoop.currentlyRunningMainloop++}),resume:(function(){Browser.mainLoop.currentlyRunningMainloop++;var timingMode=Browser.mainLoop.timingMode;var timingValue=Browser.mainLoop.timingValue;var func=Browser.mainLoop.func;Browser.mainLoop.func=null;_emscripten_set_main_loop(func,0,false,Browser.mainLoop.arg,true);_emscripten_set_main_loop_timing(timingMode,timingValue);Browser.mainLoop.scheduler()}),updateStatus:(function(){if(Module["setStatus"]){var message=Module["statusMessage"]||"Please wait...";var remaining=Browser.mainLoop.remainingBlockers;var expected=Browser.mainLoop.expectedBlockers;if(remaining){if(remaining=6){var curr=leftchar>>leftbits-6&63;leftbits-=6;ret+=BASE[curr]}}if(leftbits==2){ret+=BASE[(leftchar&3)<<4];ret+=PAD+PAD}else if(leftbits==4){ret+=BASE[(leftchar&15)<<2];ret+=PAD}return ret}audio.src="data:audio/x-"+name.substr(-3)+";base64,"+encode64(byteArray);finish(audio)};audio.src=url;Browser.safeSetTimeout((function(){finish(audio)}),1e4)}else{return fail()}};Module["preloadPlugins"].push(audioPlugin);function pointerLockChange(){Browser.pointerLock=document["pointerLockElement"]===Module["canvas"]||document["mozPointerLockElement"]===Module["canvas"]||document["webkitPointerLockElement"]===Module["canvas"]||document["msPointerLockElement"]===Module["canvas"]}var canvas=Module["canvas"];if(canvas){canvas.requestPointerLock=canvas["requestPointerLock"]||canvas["mozRequestPointerLock"]||canvas["webkitRequestPointerLock"]||canvas["msRequestPointerLock"]||(function(){});canvas.exitPointerLock=document["exitPointerLock"]||document["mozExitPointerLock"]||document["webkitExitPointerLock"]||document["msExitPointerLock"]||(function(){});canvas.exitPointerLock=canvas.exitPointerLock.bind(document);document.addEventListener("pointerlockchange",pointerLockChange,false);document.addEventListener("mozpointerlockchange",pointerLockChange,false);document.addEventListener("webkitpointerlockchange",pointerLockChange,false);document.addEventListener("mspointerlockchange",pointerLockChange,false);if(Module["elementPointerLock"]){canvas.addEventListener("click",(function(ev){if(!Browser.pointerLock&&Module["canvas"].requestPointerLock){Module["canvas"].requestPointerLock();ev.preventDefault()}}),false)}}}),createContext:(function(canvas,useWebGL,setInModule,webGLContextAttributes){if(useWebGL&&Module.ctx&&canvas==Module.canvas)return Module.ctx;var ctx;var contextHandle;if(useWebGL){var contextAttributes={antialias:false,alpha:false};if(webGLContextAttributes){for(var attribute in webGLContextAttributes){contextAttributes[attribute]=webGLContextAttributes[attribute]}}contextHandle=GL.createContext(canvas,contextAttributes);if(contextHandle){ctx=GL.getContext(contextHandle).GLctx}}else{ctx=canvas.getContext("2d")}if(!ctx)return null;if(setInModule){if(!useWebGL)assert(typeof GLctx==="undefined","cannot set in module if GLctx is used, but we are a non-GL context that would replace it");Module.ctx=ctx;if(useWebGL)GL.makeContextCurrent(contextHandle);Module.useWebGL=useWebGL;Browser.moduleContextCreatedCallbacks.forEach((function(callback){callback()}));Browser.init()}return ctx}),destroyContext:(function(canvas,useWebGL,setInModule){}),fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:(function(lockPointer,resizeCanvas,vrDevice){Browser.lockPointer=lockPointer;Browser.resizeCanvas=resizeCanvas;Browser.vrDevice=vrDevice;if(typeof Browser.lockPointer==="undefined")Browser.lockPointer=true;if(typeof Browser.resizeCanvas==="undefined")Browser.resizeCanvas=false;if(typeof Browser.vrDevice==="undefined")Browser.vrDevice=null;var canvas=Module["canvas"];function fullscreenChange(){Browser.isFullscreen=false;var canvasContainer=canvas.parentNode;if((document["fullscreenElement"]||document["mozFullScreenElement"]||document["msFullscreenElement"]||document["webkitFullscreenElement"]||document["webkitCurrentFullScreenElement"])===canvasContainer){canvas.exitFullscreen=document["exitFullscreen"]||document["cancelFullScreen"]||document["mozCancelFullScreen"]||document["msExitFullscreen"]||document["webkitCancelFullScreen"]||(function(){});canvas.exitFullscreen=canvas.exitFullscreen.bind(document);if(Browser.lockPointer)canvas.requestPointerLock();Browser.isFullscreen=true;if(Browser.resizeCanvas)Browser.setFullscreenCanvasSize()}else{canvasContainer.parentNode.insertBefore(canvas,canvasContainer);canvasContainer.parentNode.removeChild(canvasContainer);if(Browser.resizeCanvas)Browser.setWindowedCanvasSize()}if(Module["onFullScreen"])Module["onFullScreen"](Browser.isFullscreen);if(Module["onFullscreen"])Module["onFullscreen"](Browser.isFullscreen);Browser.updateCanvasDimensions(canvas)}if(!Browser.fullscreenHandlersInstalled){Browser.fullscreenHandlersInstalled=true;document.addEventListener("fullscreenchange",fullscreenChange,false);document.addEventListener("mozfullscreenchange",fullscreenChange,false);document.addEventListener("webkitfullscreenchange",fullscreenChange,false);document.addEventListener("MSFullscreenChange",fullscreenChange,false)}var canvasContainer=document.createElement("div");canvas.parentNode.insertBefore(canvasContainer,canvas);canvasContainer.appendChild(canvas);canvasContainer.requestFullscreen=canvasContainer["requestFullscreen"]||canvasContainer["mozRequestFullScreen"]||canvasContainer["msRequestFullscreen"]||(canvasContainer["webkitRequestFullscreen"]?(function(){canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"])}):null)||(canvasContainer["webkitRequestFullScreen"]?(function(){canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"])}):null);if(vrDevice){canvasContainer.requestFullscreen({vrDisplay:vrDevice})}else{canvasContainer.requestFullscreen()}}),requestFullScreen:(function(lockPointer,resizeCanvas,vrDevice){Module.printErr("Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.");Browser.requestFullScreen=(function(lockPointer,resizeCanvas,vrDevice){return Browser.requestFullscreen(lockPointer,resizeCanvas,vrDevice)});return Browser.requestFullscreen(lockPointer,resizeCanvas,vrDevice)}),nextRAF:0,fakeRequestAnimationFrame:(function(func){var now=Date.now();if(Browser.nextRAF===0){Browser.nextRAF=now+1e3/60}else{while(now+2>=Browser.nextRAF){Browser.nextRAF+=1e3/60}}var delay=Math.max(Browser.nextRAF-now,0);setTimeout(func,delay)}),requestAnimationFrame:function requestAnimationFrame(func){if(typeof window==="undefined"){Browser.fakeRequestAnimationFrame(func)}else{if(!window.requestAnimationFrame){window.requestAnimationFrame=window["requestAnimationFrame"]||window["mozRequestAnimationFrame"]||window["webkitRequestAnimationFrame"]||window["msRequestAnimationFrame"]||window["oRequestAnimationFrame"]||Browser.fakeRequestAnimationFrame}window.requestAnimationFrame(func)}},safeCallback:(function(func){return(function(){if(!ABORT)return func.apply(null,arguments)})}),allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:(function(){Browser.allowAsyncCallbacks=false}),resumeAsyncCallbacks:(function(){Browser.allowAsyncCallbacks=true;if(Browser.queuedAsyncCallbacks.length>0){var callbacks=Browser.queuedAsyncCallbacks;Browser.queuedAsyncCallbacks=[];callbacks.forEach((function(func){func()}))}}),safeRequestAnimationFrame:(function(func){return Browser.requestAnimationFrame((function(){if(ABORT)return;if(Browser.allowAsyncCallbacks){func()}else{Browser.queuedAsyncCallbacks.push(func)}}))}),safeSetTimeout:(function(func,timeout){Module["noExitRuntime"]=true;return setTimeout((function(){if(ABORT)return;if(Browser.allowAsyncCallbacks){func()}else{Browser.queuedAsyncCallbacks.push(func)}}),timeout)}),safeSetInterval:(function(func,timeout){Module["noExitRuntime"]=true;return setInterval((function(){if(ABORT)return;if(Browser.allowAsyncCallbacks){func()}}),timeout)}),getMimetype:(function(name){return{"jpg":"image/jpeg","jpeg":"image/jpeg","png":"image/png","bmp":"image/bmp","ogg":"audio/ogg","wav":"audio/wav","mp3":"audio/mpeg"}[name.substr(name.lastIndexOf(".")+1)]}),getUserMedia:(function(func){if(!window.getUserMedia){window.getUserMedia=navigator["getUserMedia"]||navigator["mozGetUserMedia"]}window.getUserMedia(func)}),getMovementX:(function(event){return event["movementX"]||event["mozMovementX"]||event["webkitMovementX"]||0}),getMovementY:(function(event){return event["movementY"]||event["mozMovementY"]||event["webkitMovementY"]||0}),getMouseWheelDelta:(function(event){var delta=0;switch(event.type){case"DOMMouseScroll":delta=event.detail;break;case"mousewheel":delta=event.wheelDelta;break;case"wheel":delta=event["deltaY"];break;default:throw"unrecognized mouse wheel event: "+event.type}return delta}),mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:(function(event){if(Browser.pointerLock){if(event.type!="mousemove"&&"mozMovementX"in event){Browser.mouseMovementX=Browser.mouseMovementY=0}else{Browser.mouseMovementX=Browser.getMovementX(event);Browser.mouseMovementY=Browser.getMovementY(event)}if(typeof SDL!="undefined"){Browser.mouseX=SDL.mouseX+Browser.mouseMovementX;Browser.mouseY=SDL.mouseY+Browser.mouseMovementY}else{Browser.mouseX+=Browser.mouseMovementX;Browser.mouseY+=Browser.mouseMovementY}}else{var rect=Module["canvas"].getBoundingClientRect();var cw=Module["canvas"].width;var ch=Module["canvas"].height;var scrollX=typeof window.scrollX!=="undefined"?window.scrollX:window.pageXOffset;var scrollY=typeof window.scrollY!=="undefined"?window.scrollY:window.pageYOffset;if(event.type==="touchstart"||event.type==="touchend"||event.type==="touchmove"){var touch=event.touch;if(touch===undefined){return}var adjustedX=touch.pageX-(scrollX+rect.left);var adjustedY=touch.pageY-(scrollY+rect.top);adjustedX=adjustedX*(cw/rect.width);adjustedY=adjustedY*(ch/rect.height);var coords={x:adjustedX,y:adjustedY};if(event.type==="touchstart"){Browser.lastTouches[touch.identifier]=coords;Browser.touches[touch.identifier]=coords}else if(event.type==="touchend"||event.type==="touchmove"){var last=Browser.touches[touch.identifier];if(!last)last=coords;Browser.lastTouches[touch.identifier]=last;Browser.touches[touch.identifier]=coords}return}var x=event.pageX-(scrollX+rect.left);var y=event.pageY-(scrollY+rect.top);x=x*(cw/rect.width);y=y*(ch/rect.height);Browser.mouseMovementX=x-Browser.mouseX;Browser.mouseMovementY=y-Browser.mouseY;Browser.mouseX=x;Browser.mouseY=y}}),asyncLoad:(function(url,onload,onerror,noRunDep){var dep=!noRunDep?getUniqueRunDependency("al "+url):"";Module["readAsync"](url,(function(arrayBuffer){assert(arrayBuffer,'Loading data file "'+url+'" failed (no arrayBuffer).');onload(new Uint8Array(arrayBuffer));if(dep)removeRunDependency(dep)}),(function(event){if(onerror){onerror()}else{throw'Loading data file "'+url+'" failed.'}}));if(dep)addRunDependency(dep)}),resizeListeners:[],updateResizeListeners:(function(){var canvas=Module["canvas"];Browser.resizeListeners.forEach((function(listener){listener(canvas.width,canvas.height)}))}),setCanvasSize:(function(width,height,noUpdates){var canvas=Module["canvas"];Browser.updateCanvasDimensions(canvas,width,height);if(!noUpdates)Browser.updateResizeListeners()}),windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:(function(){if(typeof SDL!="undefined"){var flags=HEAPU32[SDL.screen+Runtime.QUANTUM_SIZE*0>>2];flags=flags|8388608;HEAP32[SDL.screen+Runtime.QUANTUM_SIZE*0>>2]=flags}Browser.updateResizeListeners()}),setWindowedCanvasSize:(function(){if(typeof SDL!="undefined"){var flags=HEAPU32[SDL.screen+Runtime.QUANTUM_SIZE*0>>2];flags=flags&~8388608;HEAP32[SDL.screen+Runtime.QUANTUM_SIZE*0>>2]=flags}Browser.updateResizeListeners()}),updateCanvasDimensions:(function(canvas,wNative,hNative){if(wNative&&hNative){canvas.widthNative=wNative;canvas.heightNative=hNative}else{wNative=canvas.widthNative;hNative=canvas.heightNative}var w=wNative;var h=hNative;if(Module["forcedAspectRatio"]&&Module["forcedAspectRatio"]>0){if(w/h>2]=canvas.width;HEAP32[height>>2]=canvas.height;HEAP32[isFullscreen>>2]=Browser.isFullscreen?1:0}function _glDrawElements(mode,count,type,indices){GLctx.drawElements(mode,count,type,indices)}function ___syscall5(which,varargs){SYSCALLS.varargs=varargs;try{var pathname=SYSCALLS.getStr(),flags=SYSCALLS.get(),mode=SYSCALLS.get();var stream=FS.open(pathname,flags,mode);return stream.fd}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}var _environ=STATICTOP;STATICTOP+=16;var ___environ=_environ;function ___buildEnvironment(env){var MAX_ENV_VALUES=64;var TOTAL_ENV_SIZE=1024;var poolPtr;var envPtr;if(!___buildEnvironment.called){___buildEnvironment.called=true;ENV["USER"]=ENV["LOGNAME"]="web_user";ENV["PATH"]="/";ENV["PWD"]="/";ENV["HOME"]="/home/web_user";ENV["LANG"]="C";ENV["_"]=Module["thisProgram"];poolPtr=allocate(TOTAL_ENV_SIZE,"i8",ALLOC_STATIC);envPtr=allocate(MAX_ENV_VALUES*4,"i8*",ALLOC_STATIC);HEAP32[envPtr>>2]=poolPtr;HEAP32[_environ>>2]=envPtr}else{envPtr=HEAP32[_environ>>2];poolPtr=HEAP32[envPtr>>2]}var strings=[];var totalSize=0;for(var key in env){if(typeof env[key]==="string"){var line=key+"="+env[key];strings.push(line);totalSize+=line.length}}if(totalSize>TOTAL_ENV_SIZE){throw new Error("Environment size exceeded TOTAL_ENV_SIZE!")}var ptrSize=4;for(var i=0;i>2]=poolPtr;poolPtr+=line.length+1}HEAP32[envPtr+strings.length*ptrSize>>2]=0}var ENV={};function _dlopen(filename,flag){abort("To use dlopen, you need to use Emscripten's linking support, see https://github.com/kripken/emscripten/wiki/Linking");var searchpaths=[];if(filename===0){filename="__self__"}else{var strfilename=Pointer_stringify(filename);var isValidFile=(function(filename){var target=FS.findObject(filename);return target&&!target.isFolder&&!target.isDevice});if(isValidFile(strfilename)){filename=strfilename}else{if(ENV["LD_LIBRARY_PATH"]){searchpaths=ENV["LD_LIBRARY_PATH"].split(":")}for(var ident in searchpaths){var searchfile=PATH.join2(searchpaths[ident],strfilename);if(isValidFile(searchfile)){filename=searchfile;break}}}}if(DLFCN.loadedLibNames[filename]){var handle=DLFCN.loadedLibNames[filename];DLFCN.loadedLibs[handle].refcount++;return handle}if(filename==="__self__"){var handle=-1;var lib_module=Module;var cached_functions={}}else{var target=FS.findObject(filename);if(!target||target.isFolder||target.isDevice){DLFCN.errorMsg="Could not find dynamic lib: "+filename;return 0}FS.forceLoadFile(target);var lib_module;try{var lib_data=FS.readFile(filename,{encoding:"binary"});if(!(lib_data instanceof Uint8Array))lib_data=new Uint8Array(lib_data);lib_module=Runtime.loadWebAssemblyModule(lib_data)}catch(e){DLFCN.errorMsg="Could not evaluate dynamic lib: "+filename+"\n"+e;return 0}var handle=1;for(var key in DLFCN.loadedLibs){if(DLFCN.loadedLibs.hasOwnProperty(key))handle++}if(flag&256){for(var ident in lib_module){if(lib_module.hasOwnProperty(ident)){if(ident[0]=="_"){Module[ident]=lib_module[ident]}}}}var cached_functions={}}DLFCN.loadedLibs[handle]={refcount:1,name:filename,module:lib_module,cached_functions:cached_functions};DLFCN.loadedLibNames[filename]=handle;return handle}function ___syscall6(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD();FS.close(stream);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _glGenVertexArrays(n,arrays){for(var i=0;i>2]=0;return}var id=GL.getNewId(GL.vaos);vao.name=id;GL.vaos[id]=vao;HEAP32[arrays+i*4>>2]=id}}function _pthread_rwlock_init(){return 0}function _glUniform1iv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform1iv(GL.uniforms[location],HEAP32,value>>2,count);return}GLctx.uniform1iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*4>>2))}function _glReadBuffer(x0){GLctx["readBuffer"](x0)}function _sigemptyset(set){HEAP32[set>>2]=0;return 0}function emscriptenWebGLComputeImageSize(width,height,sizePerPixel,alignment){function roundedToNextMultipleOf(x,y){return Math.floor((x+y-1)/y)*y}var plainRowSize=width*sizePerPixel;var alignedRowSize=roundedToNextMultipleOf(plainRowSize,alignment);return height<=0?0:(height-1)*alignedRowSize+plainRowSize}function emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat){var sizePerPixel;var numChannels;switch(format){case 6406:case 6409:case 6402:case 6403:case 36244:numChannels=1;break;case 6410:case 33319:case 33320:numChannels=2;break;case 6407:case 35904:case 36248:numChannels=3;break;case 6408:case 35906:case 36249:numChannels=4;break;default:GL.recordError(1280);return null}switch(type){case 5121:case 5120:sizePerPixel=numChannels*1;break;case 5123:case 36193:case 5131:case 5122:sizePerPixel=numChannels*2;break;case 5125:case 5126:case 5124:sizePerPixel=numChannels*4;break;case 34042:case 35902:case 33640:case 35899:case 34042:sizePerPixel=4;break;case 33635:case 32819:case 32820:sizePerPixel=2;break;default:GL.recordError(1280);return null}var bytes=emscriptenWebGLComputeImageSize(width,height,sizePerPixel,GL.unpackAlignment);switch(type){case 5120:return HEAP8.subarray(pixels,pixels+bytes);case 5121:return HEAPU8.subarray(pixels,pixels+bytes);case 5122:return HEAP16.subarray(pixels>>1,pixels+bytes>>1);case 5124:return HEAP32.subarray(pixels>>2,pixels+bytes>>2);case 5126:return HEAPF32.subarray(pixels>>2,pixels+bytes>>2);case 5125:case 34042:case 35902:case 33640:case 35899:case 34042:return HEAPU32.subarray(pixels>>2,pixels+bytes>>2);case 5123:case 33635:case 32819:case 32820:case 36193:case 5131:return HEAPU16.subarray(pixels>>1,pixels+bytes>>1);default:GL.recordError(1280);return null}}function emscriptenWebGLGetHeapForType(type){switch(type){case 5120:return HEAP8;case 5121:return HEAPU8;case 5122:return HEAP16;case 5123:case 33635:case 32819:case 32820:case 36193:case 5131:return HEAPU16;case 5124:return HEAP32;case 5125:case 34042:case 35902:case 33640:case 35899:case 34042:return HEAPU32;case 5126:return HEAPF32;default:return null}}function emscriptenWebGLGetShiftForType(type){switch(type){case 5120:case 5121:return 0;case 5122:case 5123:case 33635:case 32819:case 32820:case 36193:case 5131:return 1;case 5124:case 5126:case 5125:case 34042:case 35902:case 33640:case 35899:case 34042:return 2;default:return 0}}function _glTexSubImage3D(target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,pixels){if(GLctx.currentPixelUnpackBufferBinding){GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,pixels)}else if(pixels!=0){GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,emscriptenWebGLGetHeapForType(type),pixels>>emscriptenWebGLGetShiftForType(type))}else{GLctx["texSubImage3D"](target,level,xoffset,yoffset,zoffset,width,height,depth,format,type,null)}}function _glDrawArraysInstanced(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}function _glGenerateMipmap(x0){GLctx["generateMipmap"](x0)}function ___syscall140(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),offset_high=SYSCALLS.get(),offset_low=SYSCALLS.get(),result=SYSCALLS.get(),whence=SYSCALLS.get();var offset=offset_low;FS.llseek(stream,offset,whence);HEAP32[result>>2]=stream.position;if(stream.getdents&&offset===0&&whence===0)stream.getdents=null;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall268(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),size=SYSCALLS.get(),buf=SYSCALLS.get();assert(size===64);HEAP32[buf+4>>2]=4096;HEAP32[buf+40>>2]=4096;HEAP32[buf+8>>2]=1e6;HEAP32[buf+12>>2]=5e5;HEAP32[buf+16>>2]=5e5;HEAP32[buf+20>>2]=FS.nextInode;HEAP32[buf+24>>2]=1e6;HEAP32[buf+28>>2]=42;HEAP32[buf+44>>2]=2;HEAP32[buf+36>>2]=255;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall146(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doWritev(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function __isLeapYear(year){return year%4===0&&(year%100!==0||year%400===0)}function __arraySum(array,index){var sum=0;for(var i=0;i<=index;sum+=array[i++]);return sum}var __MONTH_DAYS_LEAP=[31,29,31,30,31,30,31,31,30,31,30,31];var __MONTH_DAYS_REGULAR=[31,28,31,30,31,30,31,31,30,31,30,31];function __addDays(date,days){var newDate=new Date(date.getTime());while(days>0){var leap=__isLeapYear(newDate.getFullYear());var currentMonth=newDate.getMonth();var daysInCurrentMonth=(leap?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR)[currentMonth];if(days>daysInCurrentMonth-newDate.getDate()){days-=daysInCurrentMonth-newDate.getDate()+1;newDate.setDate(1);if(currentMonth<11){newDate.setMonth(currentMonth+1)}else{newDate.setMonth(0);newDate.setFullYear(newDate.getFullYear()+1)}}else{newDate.setDate(newDate.getDate()+days);return newDate}}return newDate}function _strftime(s,maxsize,format,tm){var tm_zone=HEAP32[tm+40>>2];var date={tm_sec:HEAP32[tm>>2],tm_min:HEAP32[tm+4>>2],tm_hour:HEAP32[tm+8>>2],tm_mday:HEAP32[tm+12>>2],tm_mon:HEAP32[tm+16>>2],tm_year:HEAP32[tm+20>>2],tm_wday:HEAP32[tm+24>>2],tm_yday:HEAP32[tm+28>>2],tm_isdst:HEAP32[tm+32>>2],tm_gmtoff:HEAP32[tm+36>>2],tm_zone:tm_zone?Pointer_stringify(tm_zone):""};var pattern=Pointer_stringify(format);var EXPANSION_RULES_1={"%c":"%a %b %d %H:%M:%S %Y","%D":"%m/%d/%y","%F":"%Y-%m-%d","%h":"%b","%r":"%I:%M:%S %p","%R":"%H:%M","%T":"%H:%M:%S","%x":"%m/%d/%y","%X":"%H:%M:%S"};for(var rule in EXPANSION_RULES_1){pattern=pattern.replace(new RegExp(rule,"g"),EXPANSION_RULES_1[rule])}var WEEKDAYS=["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"];var MONTHS=["January","February","March","April","May","June","July","August","September","October","November","December"];function leadingSomething(value,digits,character){var str=typeof value==="number"?value.toString():value||"";while(str.length0?1:0}var compare;if((compare=sgn(date1.getFullYear()-date2.getFullYear()))===0){if((compare=sgn(date1.getMonth()-date2.getMonth()))===0){compare=sgn(date1.getDate()-date2.getDate())}}return compare}function getFirstWeekStartDate(janFourth){switch(janFourth.getDay()){case 0:return new Date(janFourth.getFullYear()-1,11,29);case 1:return janFourth;case 2:return new Date(janFourth.getFullYear(),0,3);case 3:return new Date(janFourth.getFullYear(),0,2);case 4:return new Date(janFourth.getFullYear(),0,1);case 5:return new Date(janFourth.getFullYear()-1,11,31);case 6:return new Date(janFourth.getFullYear()-1,11,30)}}function getWeekBasedYear(date){var thisDate=__addDays(new Date(date.tm_year+1900,0,1),date.tm_yday);var janFourthThisYear=new Date(thisDate.getFullYear(),0,4);var janFourthNextYear=new Date(thisDate.getFullYear()+1,0,4);var firstWeekStartThisYear=getFirstWeekStartDate(janFourthThisYear);var firstWeekStartNextYear=getFirstWeekStartDate(janFourthNextYear);if(compareByDay(firstWeekStartThisYear,thisDate)<=0){if(compareByDay(firstWeekStartNextYear,thisDate)<=0){return thisDate.getFullYear()+1}else{return thisDate.getFullYear()}}else{return thisDate.getFullYear()-1}}var EXPANSION_RULES_2={"%a":(function(date){return WEEKDAYS[date.tm_wday].substring(0,3)}),"%A":(function(date){return WEEKDAYS[date.tm_wday]}),"%b":(function(date){return MONTHS[date.tm_mon].substring(0,3)}),"%B":(function(date){return MONTHS[date.tm_mon]}),"%C":(function(date){var year=date.tm_year+1900;return leadingNulls(year/100|0,2)}),"%d":(function(date){return leadingNulls(date.tm_mday,2)}),"%e":(function(date){return leadingSomething(date.tm_mday,2," ")}),"%g":(function(date){return getWeekBasedYear(date).toString().substring(2)}),"%G":(function(date){return getWeekBasedYear(date)}),"%H":(function(date){return leadingNulls(date.tm_hour,2)}),"%I":(function(date){var twelveHour=date.tm_hour;if(twelveHour==0)twelveHour=12;else if(twelveHour>12)twelveHour-=12;return leadingNulls(twelveHour,2)}),"%j":(function(date){return leadingNulls(date.tm_mday+__arraySum(__isLeapYear(date.tm_year+1900)?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,date.tm_mon-1),3)}),"%m":(function(date){return leadingNulls(date.tm_mon+1,2)}),"%M":(function(date){return leadingNulls(date.tm_min,2)}),"%n":(function(){return"\n"}),"%p":(function(date){if(date.tm_hour>=0&&date.tm_hour<12){return"AM"}else{return"PM"}}),"%S":(function(date){return leadingNulls(date.tm_sec,2)}),"%t":(function(){return"\t"}),"%u":(function(date){var day=new Date(date.tm_year+1900,date.tm_mon+1,date.tm_mday,0,0,0,0);return day.getDay()||7}),"%U":(function(date){var janFirst=new Date(date.tm_year+1900,0,1);var firstSunday=janFirst.getDay()===0?janFirst:__addDays(janFirst,7-janFirst.getDay());var endDate=new Date(date.tm_year+1900,date.tm_mon,date.tm_mday);if(compareByDay(firstSunday,endDate)<0){var februaryFirstUntilEndMonth=__arraySum(__isLeapYear(endDate.getFullYear())?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,endDate.getMonth()-1)-31;var firstSundayUntilEndJanuary=31-firstSunday.getDate();var days=firstSundayUntilEndJanuary+februaryFirstUntilEndMonth+endDate.getDate();return leadingNulls(Math.ceil(days/7),2)}return compareByDay(firstSunday,janFirst)===0?"01":"00"}),"%V":(function(date){var janFourthThisYear=new Date(date.tm_year+1900,0,4);var janFourthNextYear=new Date(date.tm_year+1901,0,4);var firstWeekStartThisYear=getFirstWeekStartDate(janFourthThisYear);var firstWeekStartNextYear=getFirstWeekStartDate(janFourthNextYear);var endDate=__addDays(new Date(date.tm_year+1900,0,1),date.tm_yday);if(compareByDay(endDate,firstWeekStartThisYear)<0){return"53"}if(compareByDay(firstWeekStartNextYear,endDate)<=0){return"01"}var daysDifference;if(firstWeekStartThisYear.getFullYear()=0;off=Math.abs(off)/60;off=off/60*100+off%60;return(ahead?"+":"-")+String("0000"+off).slice(-4)}),"%Z":(function(date){return date.tm_zone}),"%%":(function(){return"%"})};for(var rule in EXPANSION_RULES_2){if(pattern.indexOf(rule)>=0){pattern=pattern.replace(new RegExp(rule,"g"),EXPANSION_RULES_2[rule](date))}}var bytes=intArrayFromString(pattern,false);if(bytes.length>maxsize){return 0}writeArrayToMemory(bytes,s);return bytes.length-1}function ___syscall145(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doReadv(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _atexit(func,arg){__ATEXIT__.unshift({func:func,arg:arg})}function ___cxa_atexit(){return _atexit.apply(null,arguments)}function _glUnmapBuffer(){Module["printErr"]("missing function: glUnmapBuffer");abort(-1)}function _emscripten_set_touchend_callback(target,userData,useCapture,callbackfunc){JSEvents.registerTouchEventCallback(target,userData,useCapture,callbackfunc,23,"touchend");return 0}function __setLetterbox(element,topBottom,leftRight){if(JSEvents.isInternetExplorer()){element.style.marginLeft=element.style.marginRight=leftRight+"px";element.style.marginTop=element.style.marginBottom=topBottom+"px"}else{element.style.paddingLeft=element.style.paddingRight=leftRight+"px";element.style.paddingTop=element.style.paddingBottom=topBottom+"px"}}function _emscripten_do_request_fullscreen(target,strategy){if(typeof JSEvents.fullscreenEnabled()==="undefined")return-1;if(!JSEvents.fullscreenEnabled())return-3;if(!target)target="#canvas";target=JSEvents.findEventTarget(target);if(!target)return-4;if(!target.requestFullscreen&&!target.msRequestFullscreen&&!target.mozRequestFullScreen&&!target.mozRequestFullscreen&&!target.webkitRequestFullscreen){return-3}var canPerformRequests=JSEvents.canPerformEventHandlerRequests();if(!canPerformRequests){if(strategy.deferUntilInEventHandler){JSEvents.deferCall(JSEvents.requestFullscreen,1,[target,strategy]);return 1}else{return-2}}return JSEvents.requestFullscreen(target,strategy)}var __currentFullscreenStrategy={};function __registerRestoreOldStyle(canvas){var oldWidth=canvas.width;var oldHeight=canvas.height;var oldCssWidth=canvas.style.width;var oldCssHeight=canvas.style.height;var oldBackgroundColor=canvas.style.backgroundColor;var oldDocumentBackgroundColor=document.body.style.backgroundColor;var oldPaddingLeft=canvas.style.paddingLeft;var oldPaddingRight=canvas.style.paddingRight;var oldPaddingTop=canvas.style.paddingTop;var oldPaddingBottom=canvas.style.paddingBottom;var oldMarginLeft=canvas.style.marginLeft;var oldMarginRight=canvas.style.marginRight;var oldMarginTop=canvas.style.marginTop;var oldMarginBottom=canvas.style.marginBottom;var oldDocumentBodyMargin=document.body.style.margin;var oldDocumentOverflow=document.documentElement.style.overflow;var oldDocumentScroll=document.body.scroll;var oldImageRendering=canvas.style.imageRendering;function restoreOldStyle(){var fullscreenElement=document.fullscreenElement||document.mozFullScreenElement||document.webkitFullscreenElement||document.msFullscreenElement;if(!fullscreenElement){document.removeEventListener("fullscreenchange",restoreOldStyle);document.removeEventListener("mozfullscreenchange",restoreOldStyle);document.removeEventListener("webkitfullscreenchange",restoreOldStyle);document.removeEventListener("MSFullscreenChange",restoreOldStyle);canvas.width=oldWidth;canvas.height=oldHeight;canvas.style.width=oldCssWidth;canvas.style.height=oldCssHeight;canvas.style.backgroundColor=oldBackgroundColor;if(!oldDocumentBackgroundColor)document.body.style.backgroundColor="white";document.body.style.backgroundColor=oldDocumentBackgroundColor;canvas.style.paddingLeft=oldPaddingLeft;canvas.style.paddingRight=oldPaddingRight;canvas.style.paddingTop=oldPaddingTop;canvas.style.paddingBottom=oldPaddingBottom;canvas.style.marginLeft=oldMarginLeft;canvas.style.marginRight=oldMarginRight;canvas.style.marginTop=oldMarginTop;canvas.style.marginBottom=oldMarginBottom;document.body.style.margin=oldDocumentBodyMargin;document.documentElement.style.overflow=oldDocumentOverflow;document.body.scroll=oldDocumentScroll;canvas.style.imageRendering=oldImageRendering;if(canvas.GLctxObject)canvas.GLctxObject.GLctx.viewport(0,0,oldWidth,oldHeight);if(__currentFullscreenStrategy.canvasResizedCallback){Module["dynCall_iiii"](__currentFullscreenStrategy.canvasResizedCallback,37,0,__currentFullscreenStrategy.canvasResizedCallbackUserData)}}}document.addEventListener("fullscreenchange",restoreOldStyle);document.addEventListener("mozfullscreenchange",restoreOldStyle);document.addEventListener("webkitfullscreenchange",restoreOldStyle);document.addEventListener("MSFullscreenChange",restoreOldStyle);return restoreOldStyle}function _emscripten_request_fullscreen_strategy(target,deferUntilInEventHandler,fullscreenStrategy){var strategy={};strategy.scaleMode=HEAP32[fullscreenStrategy>>2];strategy.canvasResolutionScaleMode=HEAP32[fullscreenStrategy+4>>2];strategy.filteringMode=HEAP32[fullscreenStrategy+8>>2];strategy.deferUntilInEventHandler=deferUntilInEventHandler;strategy.canvasResizedCallback=HEAP32[fullscreenStrategy+12>>2];strategy.canvasResizedCallbackUserData=HEAP32[fullscreenStrategy+16>>2];__currentFullscreenStrategy=strategy;return _emscripten_do_request_fullscreen(target,strategy)}function _glBindRenderbuffer(target,renderbuffer){GLctx.bindRenderbuffer(target,renderbuffer?GL.renderbuffers[renderbuffer]:null)}function _pthread_rwlock_tryrdlock(){return 0}function _glDeleteFramebuffers(n,framebuffers){for(var i=0;i>2];var framebuffer=GL.framebuffers[id];if(!framebuffer)continue;GLctx.deleteFramebuffer(framebuffer);framebuffer.name=0;GL.framebuffers[id]=null}}function _glDrawArrays(mode,first,count){GLctx.drawArrays(mode,first,count)}function _glUniform1ui(location,v0){GLctx.uniform1ui(GL.uniforms[location],v0)}function __emscripten_sample_gamepad_data(){if(!JSEvents.numGamepadsConnected)return;if(Browser.mainLoop.currentFrameNumber!==JSEvents.lastGamepadStateFrame||!Browser.mainLoop.currentFrameNumber){JSEvents.lastGamepadState=navigator.getGamepads?navigator.getGamepads():navigator.webkitGetGamepads?navigator.webkitGetGamepads:null;JSEvents.lastGamepadStateFrame=Browser.mainLoop.currentFrameNumber}}function _emscripten_get_num_gamepads(){if(!JSEvents.numGamepadsConnected)return 0;__emscripten_sample_gamepad_data();if(!JSEvents.lastGamepadState)return-1;return JSEvents.lastGamepadState.length}function _sigaction(signum,act,oldact){return 0}function _usleep(useconds){var msec=useconds/1e3;if((ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER)&&self["performance"]&&self["performance"]["now"]){var start=self["performance"]["now"]();while(self["performance"]["now"]()-start>2];var nanoseconds=HEAP32[rqtp+4>>2];if(rmtp!==0){HEAP32[rmtp>>2]=0;HEAP32[rmtp+4>>2]=0}return _usleep(seconds*1e6+nanoseconds/1e3)}function _glClear(x0){GLctx["clear"](x0)}function _emscripten_set_resize_callback(target,userData,useCapture,callbackfunc){JSEvents.registerUiEventCallback(target,userData,useCapture,callbackfunc,10,"resize");return 0}function _glActiveTexture(x0){GLctx["activeTexture"](x0)}function _glEnableVertexAttribArray(index){GLctx.enableVertexAttribArray(index)}function _emscripten_get_fullscreen_status(fullscreenStatus){if(typeof JSEvents.fullscreenEnabled()==="undefined")return-1;JSEvents.fillFullscreenChangeEventData(fullscreenStatus);return 0}function _posix_spawn_file_actions_destroy(){Module["printErr"]("missing function: posix_spawn_file_actions_destroy");abort(-1)}function _glUniform4f(location,v0,v1,v2,v3){GLctx.uniform4f(GL.uniforms[location],v0,v1,v2,v3)}function _glRenderbufferStorageMultisample(x0,x1,x2,x3,x4){GLctx["renderbufferStorageMultisample"](x0,x1,x2,x3,x4)}function _emscripten_request_pointerlock(target,deferUntilInEventHandler){if(!target)target="#canvas";target=JSEvents.findEventTarget(target);if(!target)return-4;if(!target.requestPointerLock&&!target.mozRequestPointerLock&&!target.webkitRequestPointerLock&&!target.msRequestPointerLock){return-1}var canPerformRequests=JSEvents.canPerformEventHandlerRequests();if(!canPerformRequests){if(deferUntilInEventHandler){JSEvents.deferCall(JSEvents.requestPointerLock,2,[target]);return 1}else{return-2}}return JSEvents.requestPointerLock(target)}function _execl(){___setErrNo(ERRNO_CODES.ENOEXEC);return-1}function _execvp(){return _execl.apply(null,arguments)}function _emscripten_webgl_create_context(target,attributes){var contextAttributes={};contextAttributes["alpha"]=!!HEAP32[attributes>>2];contextAttributes["depth"]=!!HEAP32[attributes+4>>2];contextAttributes["stencil"]=!!HEAP32[attributes+8>>2];contextAttributes["antialias"]=!!HEAP32[attributes+12>>2];contextAttributes["premultipliedAlpha"]=!!HEAP32[attributes+16>>2];contextAttributes["preserveDrawingBuffer"]=!!HEAP32[attributes+20>>2];contextAttributes["preferLowPowerToHighPerformance"]=!!HEAP32[attributes+24>>2];contextAttributes["failIfMajorPerformanceCaveat"]=!!HEAP32[attributes+28>>2];contextAttributes["majorVersion"]=HEAP32[attributes+32>>2];contextAttributes["minorVersion"]=HEAP32[attributes+36>>2];contextAttributes["explicitSwapControl"]=HEAP32[attributes+44>>2];target=Pointer_stringify(target);var canvas;if((!target||target==="#canvas")&&Module["canvas"]){canvas=Module["canvas"].id?GL.offscreenCanvases[Module["canvas"].id]||JSEvents.findEventTarget(Module["canvas"].id):Module["canvas"]}else{canvas=GL.offscreenCanvases[target]||JSEvents.findEventTarget(target)}if(!canvas){return 0}if(contextAttributes["explicitSwapControl"]){console.error("emscripten_webgl_create_context failed: explicitSwapControl is not supported, please rebuild with -s OFFSCREENCANVAS_SUPPORT=1 to enable targeting the experimental OffscreenCanvas specification!");return 0}var contextHandle=GL.createContext(canvas,contextAttributes);return contextHandle}function _gettimeofday(ptr){var now=Date.now();HEAP32[ptr>>2]=now/1e3|0;HEAP32[ptr+4>>2]=now%1e3*1e3|0;return 0}function _glGenFramebuffers(n,ids){for(var i=0;i>2]=0;return}var id=GL.getNewId(GL.framebuffers);framebuffer.name=id;GL.framebuffers[id]=framebuffer;HEAP32[ids+i*4>>2]=id}}function _pthread_mutex_destroy(){}function _glUniformBlockBinding(program,uniformBlockIndex,uniformBlockBinding){program=GL.programs[program];GLctx["uniformBlockBinding"](program,uniformBlockIndex,uniformBlockBinding)}function _glDeleteVertexArrays(n,vaos){for(var i=0;i>2];GLctx["deleteVertexArray"](GL.vaos[id]);GL.vaos[id]=null}}function _llvm_trap(){abort("trap!")}function _pthread_rwlock_unlock(){return 0}function _glDisableVertexAttribArray(index){GLctx.disableVertexAttribArray(index)}function _sysconf(name){switch(name){case 30:return PAGE_SIZE;case 85:var maxHeapSize=2*1024*1024*1024-65536;return maxHeapSize/PAGE_SIZE;case 132:case 133:case 12:case 137:case 138:case 15:case 235:case 16:case 17:case 18:case 19:case 20:case 149:case 13:case 10:case 236:case 153:case 9:case 21:case 22:case 159:case 154:case 14:case 77:case 78:case 139:case 80:case 81:case 82:case 68:case 67:case 164:case 11:case 29:case 47:case 48:case 95:case 52:case 51:case 46:return 200809;case 79:return 0;case 27:case 246:case 127:case 128:case 23:case 24:case 160:case 161:case 181:case 182:case 242:case 183:case 184:case 243:case 244:case 245:case 165:case 178:case 179:case 49:case 50:case 168:case 169:case 175:case 170:case 171:case 172:case 97:case 76:case 32:case 173:case 35:return-1;case 176:case 177:case 7:case 155:case 8:case 157:case 125:case 126:case 92:case 93:case 129:case 130:case 131:case 94:case 91:return 1;case 74:case 60:case 69:case 70:case 4:return 1024;case 31:case 42:case 72:return 32;case 87:case 26:case 33:return 2147483647;case 34:case 1:return 47839;case 38:case 36:return 99;case 43:case 37:return 2048;case 0:return 2097152;case 3:return 65536;case 28:return 32768;case 44:return 32767;case 75:return 16384;case 39:return 1e3;case 89:return 700;case 71:return 256;case 40:return 255;case 2:return 100;case 180:return 64;case 25:return 20;case 5:return 16;case 6:return 6;case 73:return 4;case 84:{if(typeof navigator==="object")return navigator["hardwareConcurrency"]||1;return 1}}___setErrNo(ERRNO_CODES.EINVAL);return-1}function _dlsym(handle,symbol){symbol=Pointer_stringify(symbol);if(!DLFCN.loadedLibs[handle]){DLFCN.errorMsg="Tried to dlsym() from an unopened handle: "+handle;return 0}else{var lib=DLFCN.loadedLibs[handle];symbol="_"+symbol;if(lib.cached_functions.hasOwnProperty(symbol)){return lib.cached_functions[symbol]}if(!lib.module.hasOwnProperty(symbol)){DLFCN.errorMsg='Tried to lookup unknown symbol "'+symbol+'" in dynamic lib: '+lib.name;return 0}else{var result=lib.module[symbol];if(typeof result=="function"){result=Runtime.addFunction(result);lib.cached_functions=result}return result}}}function _glGetShaderInfoLog(shader,maxLength,length,infoLog){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";if(maxLength>0&&infoLog){var numBytesWrittenExclNull=stringToUTF8(log,infoLog,maxLength);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _abort(){Module["abort"]()}function _glDepthFunc(x0){GLctx["depthFunc"](x0)}function _pthread_getspecific(key){return PTHREAD_SPECIFIC[key]||0}function _glEnable(x0){GLctx["enable"](x0)}var cttz_i8=allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0],"i8",ALLOC_STATIC);function _llvm_cttz_i32(x){x=x|0;var ret=0;ret=HEAP8[cttz_i8+(x&255)>>0]|0;if((ret|0)<8)return ret|0;ret=HEAP8[cttz_i8+(x>>8&255)>>0]|0;if((ret|0)<8)return ret+8|0;ret=HEAP8[cttz_i8+(x>>16&255)>>0]|0;if((ret|0)<8)return ret+16|0;return(HEAP8[cttz_i8+(x>>>24)>>0]|0)+24|0}function _glGenBuffers(n,buffers){for(var i=0;i>2]=0;return}var id=GL.getNewId(GL.buffers);buffer.name=id;GL.buffers[id]=buffer;HEAP32[buffers+i*4>>2]=id}}function ___syscall331(which,varargs){SYSCALLS.varargs=varargs;try{return-ERRNO_CODES.ENOSYS}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _wait(stat_loc){___setErrNo(ERRNO_CODES.ECHILD);return-1}function _waitpid(){return _wait.apply(null,arguments)}function _glBlendFunc(x0,x1){GLctx["blendFunc"](x0,x1)}function _glCreateProgram(){var id=GL.getNewId(GL.programs);var program=GLctx.createProgram();program.name=id;GL.programs[id]=program;return id}function _glTexImage3D(target,level,internalFormat,width,height,depth,border,format,type,pixels){if(GLctx.currentPixelUnpackBufferBinding){GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,pixels)}else if(pixels!=0){GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,emscriptenWebGLGetHeapForType(type),pixels>>emscriptenWebGLGetShiftForType(type))}else{GLctx["texImage3D"](target,level,internalFormat,width,height,depth,border,format,type,null)}}function ___cxa_pure_virtual(){ABORT=true;throw"Pure virtual function called!"}function _longjmp(env,value){Module["setThrew"](env,value||1);throw"longjmp"}function _emscripten_set_mousedown_callback(target,userData,useCapture,callbackfunc){JSEvents.registerMouseEventCallback(target,userData,useCapture,callbackfunc,5,"mousedown");return 0}function __hideEverythingExceptGivenElement(onlyVisibleElement){var child=onlyVisibleElement;var parent=child.parentNode;var hiddenElements=[];while(child!=document.body){var children=parent.children;for(var i=0;ix*h)w=h*x/y|0;topMargin=(screenHeight-h)/2|0}if(inPixelPerfectFullscreenMode){canvas.width=w;canvas.height=h;if(canvas.GLctxObject)canvas.GLctxObject.GLctx.viewport(0,0,canvas.width,canvas.height)}if(inHiDPIFullscreenMode){topMargin/=window.devicePixelRatio;w/=window.devicePixelRatio;h/=window.devicePixelRatio;w=Math.round(w*1e4)/1e4;h=Math.round(h*1e4)/1e4;topMargin=Math.round(topMargin*1e4)/1e4}if(inCenteredWithoutScalingFullscreenMode){var t=(window.innerHeight-parseInt(canvas.style.height))/2;var b=(window.innerWidth-parseInt(canvas.style.width))/2;__setLetterbox(canvas,t,b)}else{canvas.style.width=w+"px";canvas.style.height=h+"px";var b=(window.innerWidth-w)/2;__setLetterbox(canvas,topMargin,b)}if(!inCenteredWithoutScalingFullscreenMode&&__currentFullscreenStrategy.canvasResizedCallback){Module["dynCall_iiii"](__currentFullscreenStrategy.canvasResizedCallback,37,0,__currentFullscreenStrategy.canvasResizedCallbackUserData)}}function _emscripten_enter_soft_fullscreen(target,fullscreenStrategy){if(!target)target="#canvas";target=JSEvents.findEventTarget(target);if(!target)return-4;var strategy={};strategy.scaleMode=HEAP32[fullscreenStrategy>>2];strategy.canvasResolutionScaleMode=HEAP32[fullscreenStrategy+4>>2];strategy.filteringMode=HEAP32[fullscreenStrategy+8>>2];strategy.canvasResizedCallback=HEAP32[fullscreenStrategy+12>>2];strategy.canvasResizedCallbackUserData=HEAP32[fullscreenStrategy+16>>2];strategy.target=target;strategy.softFullscreen=true;var restoreOldStyle=JSEvents.resizeCanvasForFullscreen(target,strategy);document.documentElement.style.overflow="hidden";document.body.scroll="no";document.body.style.margin="0px";var hiddenElements=__hideEverythingExceptGivenElement(target);function restoreWindowedState(){restoreOldStyle();__restoreHiddenElements(hiddenElements);window.removeEventListener("resize",__softFullscreenResizeWebGLRenderTarget);if(strategy.canvasResizedCallback){Module["dynCall_iiii"](strategy.canvasResizedCallback,37,0,strategy.canvasResizedCallbackUserData)}}__restoreOldWindowedStyle=restoreWindowedState;__currentFullscreenStrategy=strategy;window.addEventListener("resize",__softFullscreenResizeWebGLRenderTarget);if(strategy.canvasResizedCallback){Module["dynCall_iiii"](strategy.canvasResizedCallback,37,0,strategy.canvasResizedCallbackUserData)}return 0}function _emscripten_exit_fullscreen(){if(typeof JSEvents.fullscreenEnabled()==="undefined")return-1;JSEvents.removeDeferredCalls(JSEvents.requestFullscreen);if(document.exitFullscreen){document.exitFullscreen()}else if(document.msExitFullscreen){document.msExitFullscreen()}else if(document.mozCancelFullScreen){document.mozCancelFullScreen()}else if(document.webkitExitFullscreen){document.webkitExitFullscreen()}else{return-1}if(__currentFullscreenStrategy.canvasResizedCallback){Module["dynCall_iiii"](__currentFullscreenStrategy.canvasResizedCallback,37,0,__currentFullscreenStrategy.canvasResizedCallbackUserData)}return 0}function _pthread_rwlock_rdlock(){return 0}function _pthread_rwlock_wrlock(){return 0}function _pthread_join(){}var SOCKFS={mount:(function(mount){Module["websocket"]=Module["websocket"]&&"object"===typeof Module["websocket"]?Module["websocket"]:{};Module["websocket"]._callbacks={};Module["websocket"]["on"]=(function(event,callback){if("function"===typeof callback){this._callbacks[event]=callback}return this});Module["websocket"].emit=(function(event,param){if("function"===typeof this._callbacks[event]){this._callbacks[event].call(this,param)}});return FS.createNode(null,"/",16384|511,0)}),createSocket:(function(family,type,protocol){var streaming=type==1;if(protocol){assert(streaming==(protocol==6))}var sock={family:family,type:type,protocol:protocol,server:null,error:null,peers:{},pending:[],recv_queue:[],sock_ops:SOCKFS.websocket_sock_ops};var name=SOCKFS.nextname();var node=FS.createNode(SOCKFS.root,name,49152,0);node.sock=sock;var stream=FS.createStream({path:name,node:node,flags:FS.modeStringToFlags("r+"),seekable:false,stream_ops:SOCKFS.stream_ops});sock.stream=stream;return sock}),getSocket:(function(fd){var stream=FS.getStream(fd);if(!stream||!FS.isSocket(stream.node.mode)){return null}return stream.node.sock}),stream_ops:{poll:(function(stream){var sock=stream.node.sock;return sock.sock_ops.poll(sock)}),ioctl:(function(stream,request,varargs){var sock=stream.node.sock;return sock.sock_ops.ioctl(sock,request,varargs)}),read:(function(stream,buffer,offset,length,position){var sock=stream.node.sock;var msg=sock.sock_ops.recvmsg(sock,length);if(!msg){return 0}buffer.set(msg.buffer,offset);return msg.buffer.length}),write:(function(stream,buffer,offset,length,position){var sock=stream.node.sock;return sock.sock_ops.sendmsg(sock,buffer,offset,length)}),close:(function(stream){var sock=stream.node.sock;sock.sock_ops.close(sock)})},nextname:(function(){if(!SOCKFS.nextname.current){SOCKFS.nextname.current=0}return"socket["+SOCKFS.nextname.current++ +"]"}),websocket_sock_ops:{createPeer:(function(sock,addr,port){var ws;if(typeof addr==="object"){ws=addr;addr=null;port=null}if(ws){if(ws._socket){addr=ws._socket.remoteAddress;port=ws._socket.remotePort}else{var result=/ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);if(!result){throw new Error("WebSocket URL must be in the format ws(s)://address:port")}addr=result[1];port=parseInt(result[2],10)}}else{try{var runtimeConfig=Module["websocket"]&&"object"===typeof Module["websocket"];var url="ws:#".replace("#","//");if(runtimeConfig){if("string"===typeof Module["websocket"]["url"]){url=Module["websocket"]["url"]}}if(url==="ws://"||url==="wss://"){var parts=addr.split("/");url=url+parts[0]+":"+port+"/"+parts.slice(1).join("/")}var subProtocols="binary";if(runtimeConfig){if("string"===typeof Module["websocket"]["subprotocol"]){subProtocols=Module["websocket"]["subprotocol"]}}subProtocols=subProtocols.replace(/^ +| +$/g,"").split(/ *, */);var opts=ENVIRONMENT_IS_NODE?{"protocol":subProtocols.toString()}:subProtocols;var WebSocketConstructor;if(ENVIRONMENT_IS_NODE){WebSocketConstructor=require("ws")}else if(ENVIRONMENT_IS_WEB){WebSocketConstructor=window["WebSocket"]}else{WebSocketConstructor=WebSocket}ws=new WebSocketConstructor(url,opts);ws.binaryType="arraybuffer"}catch(e){throw new FS.ErrnoError(ERRNO_CODES.EHOSTUNREACH)}}var peer={addr:addr,port:port,socket:ws,dgram_send_queue:[]};SOCKFS.websocket_sock_ops.addPeer(sock,peer);SOCKFS.websocket_sock_ops.handlePeerEvents(sock,peer);if(sock.type===2&&typeof sock.sport!=="undefined"){peer.dgram_send_queue.push(new Uint8Array([255,255,255,255,"p".charCodeAt(0),"o".charCodeAt(0),"r".charCodeAt(0),"t".charCodeAt(0),(sock.sport&65280)>>8,sock.sport&255]))}return peer}),getPeer:(function(sock,addr,port){return sock.peers[addr+":"+port]}),addPeer:(function(sock,peer){sock.peers[peer.addr+":"+peer.port]=peer}),removePeer:(function(sock,peer){delete sock.peers[peer.addr+":"+peer.port]}),handlePeerEvents:(function(sock,peer){var first=true;var handleOpen=(function(){Module["websocket"].emit("open",sock.stream.fd);try{var queued=peer.dgram_send_queue.shift();while(queued){peer.socket.send(queued);queued=peer.dgram_send_queue.shift()}}catch(e){peer.socket.close()}});function handleMessage(data){assert(typeof data!=="string"&&data.byteLength!==undefined);if(data.byteLength==0){return}data=new Uint8Array(data);var wasfirst=first;first=false;if(wasfirst&&data.length===10&&data[0]===255&&data[1]===255&&data[2]===255&&data[3]===255&&data[4]==="p".charCodeAt(0)&&data[5]==="o".charCodeAt(0)&&data[6]==="r".charCodeAt(0)&&data[7]==="t".charCodeAt(0)){var newport=data[8]<<8|data[9];SOCKFS.websocket_sock_ops.removePeer(sock,peer);peer.port=newport;SOCKFS.websocket_sock_ops.addPeer(sock,peer);return}sock.recv_queue.push({addr:peer.addr,port:peer.port,data:data});Module["websocket"].emit("message",sock.stream.fd)}if(ENVIRONMENT_IS_NODE){peer.socket.on("open",handleOpen);peer.socket.on("message",(function(data,flags){if(!flags.binary){return}handleMessage((new Uint8Array(data)).buffer)}));peer.socket.on("close",(function(){Module["websocket"].emit("close",sock.stream.fd)}));peer.socket.on("error",(function(error){sock.error=ERRNO_CODES.ECONNREFUSED;Module["websocket"].emit("error",[sock.stream.fd,sock.error,"ECONNREFUSED: Connection refused"])}))}else{peer.socket.onopen=handleOpen;peer.socket.onclose=(function(){Module["websocket"].emit("close",sock.stream.fd)});peer.socket.onmessage=function peer_socket_onmessage(event){handleMessage(event.data)};peer.socket.onerror=(function(error){sock.error=ERRNO_CODES.ECONNREFUSED;Module["websocket"].emit("error",[sock.stream.fd,sock.error,"ECONNREFUSED: Connection refused"])})}}),poll:(function(sock){if(sock.type===1&&sock.server){return sock.pending.length?64|1:0}var mask=0;var dest=sock.type===1?SOCKFS.websocket_sock_ops.getPeer(sock,sock.daddr,sock.dport):null;if(sock.recv_queue.length||!dest||dest&&dest.socket.readyState===dest.socket.CLOSING||dest&&dest.socket.readyState===dest.socket.CLOSED){mask|=64|1}if(!dest||dest&&dest.socket.readyState===dest.socket.OPEN){mask|=4}if(dest&&dest.socket.readyState===dest.socket.CLOSING||dest&&dest.socket.readyState===dest.socket.CLOSED){mask|=16}return mask}),ioctl:(function(sock,request,arg){switch(request){case 21531:var bytes=0;if(sock.recv_queue.length){bytes=sock.recv_queue[0].data.length}HEAP32[arg>>2]=bytes;return 0;default:return ERRNO_CODES.EINVAL}}),close:(function(sock){if(sock.server){try{sock.server.close()}catch(e){}sock.server=null}var peers=Object.keys(sock.peers);for(var i=0;i>1];var port=_ntohs(HEAP16[sa+2>>1]);var addr;switch(family){case 2:if(salen!==16){return{errno:ERRNO_CODES.EINVAL}}addr=HEAP32[sa+4>>2];addr=__inet_ntop4_raw(addr);break;case 10:if(salen!==28){return{errno:ERRNO_CODES.EINVAL}}addr=[HEAP32[sa+8>>2],HEAP32[sa+12>>2],HEAP32[sa+16>>2],HEAP32[sa+20>>2]];addr=__inet_ntop6_raw(addr);break;default:return{errno:ERRNO_CODES.EAFNOSUPPORT}}return{family:family,addr:addr,port:port}}function ___syscall102(which,varargs){SYSCALLS.varargs=varargs;try{var call=SYSCALLS.get(),socketvararg=SYSCALLS.get();SYSCALLS.varargs=socketvararg;switch(call){case 1:{var domain=SYSCALLS.get(),type=SYSCALLS.get(),protocol=SYSCALLS.get();var sock=SOCKFS.createSocket(domain,type,protocol);assert(sock.stream.fd<64);return sock.stream.fd};case 2:{var sock=SYSCALLS.getSocketFromFD(),info=SYSCALLS.getSocketAddress();sock.sock_ops.bind(sock,info.addr,info.port);return 0};case 3:{var sock=SYSCALLS.getSocketFromFD(),info=SYSCALLS.getSocketAddress();sock.sock_ops.connect(sock,info.addr,info.port);return 0};case 4:{var sock=SYSCALLS.getSocketFromFD(),backlog=SYSCALLS.get();sock.sock_ops.listen(sock,backlog);return 0};case 5:{var sock=SYSCALLS.getSocketFromFD(),addr=SYSCALLS.get(),addrlen=SYSCALLS.get();var newsock=sock.sock_ops.accept(sock);if(addr){var res=__write_sockaddr(addr,newsock.family,DNS.lookup_name(newsock.daddr),newsock.dport);assert(!res.errno)}return newsock.stream.fd};case 6:{var sock=SYSCALLS.getSocketFromFD(),addr=SYSCALLS.get(),addrlen=SYSCALLS.get();var res=__write_sockaddr(addr,sock.family,DNS.lookup_name(sock.saddr||"0.0.0.0"),sock.sport);assert(!res.errno);return 0};case 7:{var sock=SYSCALLS.getSocketFromFD(),addr=SYSCALLS.get(),addrlen=SYSCALLS.get();if(!sock.daddr){return-ERRNO_CODES.ENOTCONN}var res=__write_sockaddr(addr,sock.family,DNS.lookup_name(sock.daddr),sock.dport);assert(!res.errno);return 0};case 11:{var sock=SYSCALLS.getSocketFromFD(),message=SYSCALLS.get(),length=SYSCALLS.get(),flags=SYSCALLS.get(),dest=SYSCALLS.getSocketAddress(true);if(!dest){return FS.write(sock.stream,HEAP8,message,length)}else{return sock.sock_ops.sendmsg(sock,HEAP8,message,length,dest.addr,dest.port)}};case 12:{var sock=SYSCALLS.getSocketFromFD(),buf=SYSCALLS.get(),len=SYSCALLS.get(),flags=SYSCALLS.get(),addr=SYSCALLS.get(),addrlen=SYSCALLS.get();var msg=sock.sock_ops.recvmsg(sock,len);if(!msg)return 0;if(addr){var res=__write_sockaddr(addr,sock.family,DNS.lookup_name(msg.addr),msg.port);assert(!res.errno)}HEAPU8.set(msg.buffer,buf);return msg.buffer.byteLength};case 14:{return-ERRNO_CODES.ENOPROTOOPT};case 15:{var sock=SYSCALLS.getSocketFromFD(),level=SYSCALLS.get(),optname=SYSCALLS.get(),optval=SYSCALLS.get(),optlen=SYSCALLS.get();if(level===1){if(optname===4){HEAP32[optval>>2]=sock.error;HEAP32[optlen>>2]=4;sock.error=null;return 0}}return-ERRNO_CODES.ENOPROTOOPT};case 16:{var sock=SYSCALLS.getSocketFromFD(),message=SYSCALLS.get(),flags=SYSCALLS.get();var iov=HEAP32[message+8>>2];var num=HEAP32[message+12>>2];var addr,port;var name=HEAP32[message>>2];var namelen=HEAP32[message+4>>2];if(name){var info=__read_sockaddr(name,namelen);if(info.errno)return-info.errno;port=info.port;addr=DNS.lookup_addr(info.addr)||info.addr}var total=0;for(var i=0;i>2]}var view=new Uint8Array(total);var offset=0;for(var i=0;i>2];var iovlen=HEAP32[iov+(8*i+4)>>2];for(var j=0;j>0]}}return sock.sock_ops.sendmsg(sock,view,0,total,addr,port)};case 17:{var sock=SYSCALLS.getSocketFromFD(),message=SYSCALLS.get(),flags=SYSCALLS.get();var iov=HEAP32[message+8>>2];var num=HEAP32[message+12>>2];var total=0;for(var i=0;i>2]}var msg=sock.sock_ops.recvmsg(sock,total);if(!msg)return 0;var name=HEAP32[message>>2];if(name){var res=__write_sockaddr(name,sock.family,DNS.lookup_name(msg.addr),msg.port);assert(!res.errno)}var bytesRead=0;var bytesRemaining=msg.buffer.byteLength;for(var i=0;bytesRemaining>0&&i>2];var iovlen=HEAP32[iov+(8*i+4)>>2];if(!iovlen){continue}var length=Math.min(iovlen,bytesRemaining);var buf=msg.buffer.subarray(bytesRead,bytesRead+length);HEAPU8.set(buf,iovbase+bytesRead);bytesRead+=length;bytesRemaining-=length}return bytesRead};default:abort("unsupported socketcall syscall "+call)}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _glDeleteBuffers(n,buffers){for(var i=0;i>2];var buffer=GL.buffers[id];if(!buffer)continue;GLctx.deleteBuffer(buffer);buffer.name=0;GL.buffers[id]=null;if(id==GL.currArrayBuffer)GL.currArrayBuffer=0;if(id==GL.currElementArrayBuffer)GL.currElementArrayBuffer=0}}function _emscripten_set_gamepaddisconnected_callback(userData,useCapture,callbackfunc){if(!navigator.getGamepads&&!navigator.webkitGetGamepads)return-1;JSEvents.registerGamepadEventCallback(window,userData,useCapture,callbackfunc,27,"gamepaddisconnected");return 0}function _glDrawElementsInstanced(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _glClearColor(x0,x1,x2,x3){GLctx["clearColor"](x0,x1,x2,x3)}function _kill(pid,sig){___setErrNo(ERRNO_CODES.EPERM);return-1}function _glGetStringi(name,index){if(GLctx.canvas.GLctxObject.version<2){GL.recordError(1282);return 0}var stringiCache=GL.stringiCache[name];if(stringiCache){if(index<0||index>=stringiCache.length){GL.recordError(1281);return 0}return stringiCache[index]}switch(name){case 7939:var exts=GLctx.getSupportedExtensions();var gl_exts=[];for(var i=0;i=stringiCache.length){GL.recordError(1281);return 0}return stringiCache[index];default:GL.recordError(1280);return 0}}function _sem_destroy(){}function _emscripten_exit_soft_fullscreen(){if(__restoreOldWindowedStyle)__restoreOldWindowedStyle();__restoreOldWindowedStyle=null;return 0}function _emscripten_get_gamepad_status(index,gamepadState){__emscripten_sample_gamepad_data();if(!JSEvents.lastGamepadState)return-1;if(index<0||index>=JSEvents.lastGamepadState.length)return-5;if(!JSEvents.lastGamepadState[index])return-7;JSEvents.fillGamepadEventData(gamepadState,JSEvents.lastGamepadState[index]);return 0}function _sem_init(){}function _glUniform2fv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform2fv(GL.uniforms[location],HEAPF32,value>>2,count*2);return}var view;if(2*count<=GL.MINI_TEMP_BUFFER_SIZE){view=GL.miniTempBufferViews[2*count-1];for(var i=0;i<2*count;i+=2){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2]}}else{view=HEAPF32.subarray(value>>2,value+count*8>>2)}GLctx.uniform2fv(GL.uniforms[location],view)}function _emscripten_set_mouseup_callback(target,userData,useCapture,callbackfunc){JSEvents.registerMouseEventCallback(target,userData,useCapture,callbackfunc,6,"mouseup");return 0}function ___syscall39(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),mode=SYSCALLS.get();return SYSCALLS.doMkdir(path,mode)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall38(which,varargs){SYSCALLS.varargs=varargs;try{var old_path=SYSCALLS.getStr(),new_path=SYSCALLS.getStr();FS.rename(old_path,new_path);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall33(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),amode=SYSCALLS.get();return SYSCALLS.doAccess(path,amode)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _glClearDepthf(x0){GLctx["clearDepth"](x0)}function _glGenTextures(n,textures){for(var i=0;i>2]=0;return}var id=GL.getNewId(GL.textures);texture.name=id;GL.textures[id]=texture;HEAP32[textures+i*4>>2]=id}}function _glColorMask(red,green,blue,alpha){GLctx.colorMask(!!red,!!green,!!blue,!!alpha)}var PIPEFS={BUCKET_BUFFER_SIZE:8192,mount:(function(mount){return FS.createNode(null,"/",16384|511,0)}),createPipe:(function(){var pipe={buckets:[]};pipe.buckets.push({buffer:new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),offset:0,roffset:0});var rName=PIPEFS.nextname();var wName=PIPEFS.nextname();var rNode=FS.createNode(PIPEFS.root,rName,4096,0);var wNode=FS.createNode(PIPEFS.root,wName,4096,0);rNode.pipe=pipe;wNode.pipe=pipe;var readableStream=FS.createStream({path:rName,node:rNode,flags:FS.modeStringToFlags("r"),seekable:false,stream_ops:PIPEFS.stream_ops});rNode.stream=readableStream;var writableStream=FS.createStream({path:wName,node:wNode,flags:FS.modeStringToFlags("w"),seekable:false,stream_ops:PIPEFS.stream_ops});wNode.stream=writableStream;return{readable_fd:readableStream.fd,writable_fd:writableStream.fd}}),stream_ops:{poll:(function(stream){var pipe=stream.node.pipe;if((stream.flags&2097155)===1){return 256|4}else{if(pipe.buckets.length>0){for(var i=0;i0){return 64|1}}}}return 0}),ioctl:(function(stream,request,varargs){return ERRNO_CODES.EINVAL}),read:(function(stream,buffer,offset,length,position){var pipe=stream.node.pipe;var currentLength=0;for(var i=0;i=dataLen){currBucket.buffer.set(data,currBucket.offset);currBucket.offset+=dataLen;return dataLen}else if(freeBytesInCurrBuffer>0){currBucket.buffer.set(data.subarray(0,freeBytesInCurrBuffer),currBucket.offset);currBucket.offset+=freeBytesInCurrBuffer;data=data.subarray(freeBytesInCurrBuffer,data.byteLength)}var numBuckets=data.byteLength/PIPEFS.BUCKET_BUFFER_SIZE|0;var remElements=data.byteLength%PIPEFS.BUCKET_BUFFER_SIZE;for(var i=0;i0){var newBucket={buffer:new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),offset:data.byteLength,roffset:0};pipe.buckets.push(newBucket);newBucket.buffer.set(data)}return dataLen}),close:(function(stream){var pipe=stream.node.pipe;pipe.buckets=null})},nextname:(function(){if(!PIPEFS.nextname.current){PIPEFS.nextname.current=0}return"pipe["+PIPEFS.nextname.current++ +"]"})};function ___syscall42(which,varargs){SYSCALLS.varargs=varargs;try{var fdPtr=SYSCALLS.get();if(fdPtr==0){throw new FS.ErrnoError(ERRNO_CODES.EFAULT)}var res=PIPEFS.createPipe();HEAP32[fdPtr>>2]=res.readable_fd;HEAP32[fdPtr+4>>2]=res.writable_fd;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall40(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr();FS.rmdir(path);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _glDeleteRenderbuffers(n,renderbuffers){for(var i=0;i>2];var renderbuffer=GL.renderbuffers[id];if(!renderbuffer)continue;GLctx.deleteRenderbuffer(renderbuffer);renderbuffer.name=0;GL.renderbuffers[id]=null}}function _glGetProgramiv(program,pname,p){if(!p){GL.recordError(1281);return}if(program>=GL.counter){GL.recordError(1281);return}var ptable=GL.programInfos[program];if(!ptable){GL.recordError(1282);return}if(pname==35716){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35719){HEAP32[p>>2]=ptable.maxUniformLength}else if(pname==35722){if(ptable.maxAttributeLength==-1){var program=GL.programs[program];var numAttribs=GLctx.getProgramParameter(program,GLctx.ACTIVE_ATTRIBUTES);ptable.maxAttributeLength=0;for(var i=0;i>2]=ptable.maxAttributeLength}else if(pname==35381){if(ptable.maxUniformBlockNameLength==-1){var program=GL.programs[program];var numBlocks=GLctx.getProgramParameter(program,GLctx.ACTIVE_UNIFORM_BLOCKS);ptable.maxUniformBlockNameLength=0;for(var i=0;i>2]=ptable.maxUniformBlockNameLength}else{HEAP32[p>>2]=GLctx.getProgramParameter(GL.programs[program],pname)}}function _glVertexAttribPointer(index,size,type,normalized,stride,ptr){GLctx.vertexAttribPointer(index,size,type,!!normalized,stride,ptr)}function _emscripten_exit_pointerlock(){JSEvents.removeDeferredCalls(JSEvents.requestPointerLock);if(document.exitPointerLock){document.exitPointerLock()}else if(document.msExitPointerLock){document.msExitPointerLock()}else if(document.mozExitPointerLock){document.mozExitPointerLock()}else if(document.webkitExitPointerLock){document.webkitExitPointerLock()}else{return-1}return 0}function _glFramebufferTextureLayer(target,attachment,texture,level,layer){GLctx.framebufferTextureLayer(target,attachment,GL.textures[texture],level,layer)}function _pthread_create(){return 11}function _glGetUniformLocation(program,name){name=Pointer_stringify(name);var arrayOffset=0;if(name.indexOf("]",name.length-1)!==-1){var ls=name.lastIndexOf("[");var arrayIndex=name.slice(ls+1,-1);if(arrayIndex.length>0){arrayOffset=parseInt(arrayIndex);if(arrayOffset<0){return-1}}name=name.slice(0,ls)}var ptable=GL.programInfos[program];if(!ptable){return-1}var utable=ptable.uniforms;var uniformInfo=utable[name];if(uniformInfo&&arrayOffset>2,count*4);return}var view;if(4*count<=GL.MINI_TEMP_BUFFER_SIZE){view=GL.miniTempBufferViews[4*count-1];for(var i=0;i<4*count;i+=4){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2]}}else{view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniform4fv(GL.uniforms[location],view)}function _llvm_bswap_i64(l,h){var retl=_llvm_bswap_i32(h)>>>0;var reth=_llvm_bswap_i32(l)>>>0;return(Runtime.setTempRet0(reth),retl)|0}function _glVertexAttribDivisor(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _glViewport(x0,x1,x2,x3){GLctx["viewport"](x0,x1,x2,x3)}function _pthread_attr_setstacksize(){}function _pthread_rwlock_destroy(){return 0}function _glCheckFramebufferStatus(x0){return GLctx["checkFramebufferStatus"](x0)}function _pthread_rwlock_trywrlock(){return 0}function ___syscall15(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),mode=SYSCALLS.get();FS.chmod(path,mode);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _gmtime_r(time,tmPtr){var date=new Date(HEAP32[time>>2]*1e3);HEAP32[tmPtr>>2]=date.getUTCSeconds();HEAP32[tmPtr+4>>2]=date.getUTCMinutes();HEAP32[tmPtr+8>>2]=date.getUTCHours();HEAP32[tmPtr+12>>2]=date.getUTCDate();HEAP32[tmPtr+16>>2]=date.getUTCMonth();HEAP32[tmPtr+20>>2]=date.getUTCFullYear()-1900;HEAP32[tmPtr+24>>2]=date.getUTCDay();HEAP32[tmPtr+36>>2]=0;HEAP32[tmPtr+32>>2]=0;var start=Date.UTC(date.getUTCFullYear(),0,1,0,0,0,0);var yday=(date.getTime()-start)/(1e3*60*60*24)|0;HEAP32[tmPtr+28>>2]=yday;HEAP32[tmPtr+40>>2]=___tm_timezone;return tmPtr}function _gmtime(time){return _gmtime_r(time,___tm_current)}function ___syscall12(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr();FS.chdir(path);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _glBlitFramebuffer(x0,x1,x2,x3,x4,x5,x6,x7,x8,x9){GLctx["blitFramebuffer"](x0,x1,x2,x3,x4,x5,x6,x7,x8,x9)}function _glBindAttribLocation(program,index,name){name=Pointer_stringify(name);GLctx.bindAttribLocation(GL.programs[program],index,name)}function _emscripten_webgl_init_context_attributes(attributes){HEAP32[attributes>>2]=1;HEAP32[attributes+4>>2]=1;HEAP32[attributes+8>>2]=0;HEAP32[attributes+12>>2]=1;HEAP32[attributes+16>>2]=1;HEAP32[attributes+20>>2]=0;HEAP32[attributes+24>>2]=0;HEAP32[attributes+28>>2]=0;HEAP32[attributes+32>>2]=1;HEAP32[attributes+36>>2]=0;HEAP32[attributes+40>>2]=1;HEAP32[attributes+44>>2]=0}function _glUniform2iv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform2iv(GL.uniforms[location],HEAP32,value>>2,count*2);return}GLctx.uniform2iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*8>>2))}function _glBindBufferBase(target,index,buffer){var bufferObj=buffer?GL.buffers[buffer]:null;GLctx["bindBufferBase"](target,index,bufferObj)}function _glBufferSubData(target,offset,size,data){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.bufferSubData(target,offset,HEAPU8,data,size);return}GLctx.bufferSubData(target,offset,HEAPU8.subarray(data,data+size))}function _glMapBufferRange(){Module["printErr"]("missing function: glMapBufferRange");abort(-1)}function _llvm_exp2_f32(x){return Math.pow(2,x)}function _glGetShaderiv(shader,pname,p){if(!p){GL.recordError(1281);return}if(pname==35716){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35720){var source=GLctx.getShaderSource(GL.shaders[shader]);var sourceLength=source===null||source.length==0?0:source.length+1;HEAP32[p>>2]=sourceLength}else{HEAP32[p>>2]=GLctx.getShaderParameter(GL.shaders[shader],pname)}}function _glGenRenderbuffers(n,renderbuffers){for(var i=0;i>2]=0;return}var id=GL.getNewId(GL.renderbuffers);renderbuffer.name=id;GL.renderbuffers[id]=renderbuffer;HEAP32[renderbuffers+i*4>>2]=id}}function _sem_post(){}function _emscripten_set_touchmove_callback(target,userData,useCapture,callbackfunc){JSEvents.registerTouchEventCallback(target,userData,useCapture,callbackfunc,24,"touchmove");return 0}function _glShaderSource(shader,count,string,length){var source=GL.getSource(shader,count,string,length);GLctx.shaderSource(GL.shaders[shader],source)}function _glTexSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixels){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx.texSubImage2D(target,level,internalFormat,width,height,border,format,type,pixels)}else if(pixels!=0){GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,emscriptenWebGLGetHeapForType(type),pixels>>emscriptenWebGLGetShiftForType(type))}else{GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,null)}return}var pixelData=null;if(pixels)pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,0);GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixelData)}function _emscripten_set_keypress_callback(target,userData,useCapture,callbackfunc){JSEvents.registerKeyEventCallback(target,userData,useCapture,callbackfunc,1,"keypress");return 0}var PTHREAD_SPECIFIC_NEXT_KEY=1;function _pthread_key_create(key,destructor){if(key==0){return ERRNO_CODES.EINVAL}HEAP32[key>>2]=PTHREAD_SPECIFIC_NEXT_KEY;PTHREAD_SPECIFIC[PTHREAD_SPECIFIC_NEXT_KEY]=0;PTHREAD_SPECIFIC_NEXT_KEY++;return 0}var PROCINFO={ppid:1,pid:42,sid:42,pgid:42};function ___syscall20(which,varargs){SYSCALLS.varargs=varargs;try{return PROCINFO.pid}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function _glUniformMatrix4fv(location,count,transpose,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniformMatrix4fv(GL.uniforms[location],!!transpose,HEAPF32,value>>2,count*16);return}var view;if(16*count<=GL.MINI_TEMP_BUFFER_SIZE){view=GL.miniTempBufferViews[16*count-1];for(var i=0;i<16*count;i+=16){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2];view[i+4]=HEAPF32[value+(4*i+16)>>2];view[i+5]=HEAPF32[value+(4*i+20)>>2];view[i+6]=HEAPF32[value+(4*i+24)>>2];view[i+7]=HEAPF32[value+(4*i+28)>>2];view[i+8]=HEAPF32[value+(4*i+32)>>2];view[i+9]=HEAPF32[value+(4*i+36)>>2];view[i+10]=HEAPF32[value+(4*i+40)>>2];view[i+11]=HEAPF32[value+(4*i+44)>>2];view[i+12]=HEAPF32[value+(4*i+48)>>2];view[i+13]=HEAPF32[value+(4*i+52)>>2];view[i+14]=HEAPF32[value+(4*i+56)>>2];view[i+15]=HEAPF32[value+(4*i+60)>>2]}}else{view=HEAPF32.subarray(value>>2,value+count*64>>2)}GLctx.uniformMatrix4fv(GL.uniforms[location],!!transpose,view)}function _glBindBuffer(target,buffer){var bufferObj=buffer?GL.buffers[buffer]:null;if(target==35051){GLctx.currentPixelPackBufferBinding=buffer}else if(target==35052){GLctx.currentPixelUnpackBufferBinding=buffer}GLctx.bindBuffer(target,bufferObj)}function _glUniform3fv(location,count,value){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.uniform3fv(GL.uniforms[location],HEAPF32,value>>2,count*3);return}var view;if(3*count<=GL.MINI_TEMP_BUFFER_SIZE){view=GL.miniTempBufferViews[3*count-1];for(var i=0;i<3*count;i+=3){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2]}}else{view=HEAPF32.subarray(value>>2,value+count*12>>2)}GLctx.uniform3fv(GL.uniforms[location],view)}function _glBufferData(target,size,data,usage){if(!data){GLctx.bufferData(target,size,usage)}else{if(GL.currentContext.supportsWebGL2EntryPoints){GLctx.bufferData(target,HEAPU8,usage,data,size);return}GLctx.bufferData(target,HEAPU8.subarray(data,data+size),usage)}}function _glCompressedTexImage3D(target,level,internalFormat,width,height,depth,border,imageSize,data){if(GL.currentContext.supportsWebGL2EntryPoints){GLctx["compressedTexImage3D"](target,level,internalFormat,width,height,depth,border,HEAPU8,data,imageSize)}else{GLctx["compressedTexImage3D"](target,level,internalFormat,width,height,depth,border,data?HEAPU8.subarray(data,data+imageSize):null)}}function _emscripten_longjmp(env,value){_longjmp(env,value)}function _getenv(name){if(name===0)return 0;name=Pointer_stringify(name);if(!ENV.hasOwnProperty(name))return 0;if(_getenv.ret)_free(_getenv.ret);_getenv.ret=allocate(intArrayFromString(ENV[name]),"i8",ALLOC_NORMAL);return _getenv.ret}function emscriptenWebGLGet(name_,p,type){if(!p){GL.recordError(1281);return}var ret=undefined;switch(name_){case 36346:ret=1;break;case 36344:if(type!=="Integer"&&type!=="Integer64"){GL.recordError(1280)}return;case 34814:case 36345:ret=0;break;case 34466:var formats=GLctx.getParameter(34467);ret=formats.length;break;case 33309:if(GLctx.canvas.GLctxObject.version<2){GL.recordError(1282);return}var exts=GLctx.getSupportedExtensions();ret=2*exts.length;break;case 33307:case 33308:if(GLctx.canvas.GLctxObject.version<2){GL.recordError(1280);return}ret=name_==33307?3:0;break}if(ret===undefined){var result=GLctx.getParameter(name_);switch(typeof result){case"number":ret=result;break;case"boolean":ret=result?1:0;break;case"string":GL.recordError(1280);return;case"object":if(result===null){switch(name_){case 34964:case 35725:case 34965:case 36006:case 36007:case 32873:case 34229:case 35097:case 36389:case 34068:{ret=0;break};default:{GL.recordError(1280);return}}}else if(result instanceof Float32Array||result instanceof Uint32Array||result instanceof Int32Array||result instanceof Array){for(var i=0;i>2]=result[i];break;case"Float":HEAPF32[p+i*4>>2]=result[i];break;case"Boolean":HEAP8[p+i>>0]=result[i]?1:0;break;default:throw"internal glGet error, bad type: "+type}}return}else if(result instanceof WebGLBuffer||result instanceof WebGLProgram||result instanceof WebGLFramebuffer||result instanceof WebGLRenderbuffer||result instanceof WebGLQuery||result instanceof WebGLSampler||result instanceof WebGLSync||result instanceof WebGLTransformFeedback||result instanceof WebGLVertexArrayObject||result instanceof WebGLTexture){ret=result.name|0}else{GL.recordError(1280);return}break;default:GL.recordError(1280);return}}switch(type){case"Integer64":tempI64=[ret>>>0,(tempDouble=ret,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble- +(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[p>>2]=tempI64[0],HEAP32[p+4>>2]=tempI64[1];break;case"Integer":HEAP32[p>>2]=ret;break;case"Float":HEAPF32[p>>2]=ret;break;case"Boolean":HEAP8[p>>0]=ret?1:0;break;default:throw"internal glGet error, bad type: "+type}}function _glGetFloatv(name_,p){emscriptenWebGLGet(name_,p,"Float")}function _emscripten_set_keydown_callback(target,userData,useCapture,callbackfunc){JSEvents.registerKeyEventCallback(target,userData,useCapture,callbackfunc,2,"keydown");return 0}var _llvm_pow_f64=Math_pow;function _glGetIntegerv(name_,p){emscriptenWebGLGet(name_,p,"Integer")}function _glFramebufferTexture2D(target,attachment,textarget,texture,level){GLctx.framebufferTexture2D(target,attachment,textarget,GL.textures[texture],level)}function _emscripten_set_gamepadconnected_callback(userData,useCapture,callbackfunc){if(!navigator.getGamepads&&!navigator.webkitGetGamepads)return-1;JSEvents.registerGamepadEventCallback(window,userData,useCapture,callbackfunc,26,"gamepadconnected");return 0}function _glUseProgram(program){GLctx.useProgram(program?GL.programs[program]:null)}function _glTexImage2D(target,level,internalFormat,width,height,border,format,type,pixels){if(GL.currentContext.supportsWebGL2EntryPoints){if(GLctx.currentPixelUnpackBufferBinding){GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels)}else if(pixels!=0){GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,emscriptenWebGLGetHeapForType(type),pixels>>emscriptenWebGLGetShiftForType(type))}else{GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,null)}return}var pixelData=null;if(pixels)pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat);GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixelData)}function _glGetProgramInfoLog(program,maxLength,length,infoLog){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";if(maxLength>0&&infoLog){var numBytesWrittenExclNull=stringToUTF8(log,infoLog,maxLength);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _glBlendEquation(x0){GLctx["blendEquation"](x0)}function _glBindVertexArray(vao){GLctx["bindVertexArray"](GL.vaos[vao])}function _pthread_mutexattr_settype(){}function _emscripten_set_wheel_callback(target,userData,useCapture,callbackfunc){target=JSEvents.findEventTarget(target);if(typeof target.onwheel!=="undefined"){JSEvents.registerWheelEventCallback(target,userData,useCapture,callbackfunc,9,"wheel");return 0}else if(typeof target.onmousewheel!=="undefined"){JSEvents.registerWheelEventCallback(target,userData,useCapture,callbackfunc,9,"mousewheel");return 0}else{return-1}}function ___unlock(){}function _glScissor(x0,x1,x2,x3){GLctx["scissor"](x0,x1,x2,x3)}function _llvm_exp2_f64(){return _llvm_exp2_f32.apply(null,arguments)}function _posix_spawn_file_actions_adddup2(){Module["printErr"]("missing function: posix_spawn_file_actions_adddup2");abort(-1)}function _setenv(envname,envval,overwrite){if(envname===0){___setErrNo(ERRNO_CODES.EINVAL);return-1}var name=Pointer_stringify(envname);var val=Pointer_stringify(envval);if(name===""||name.indexOf("=")!==-1){___setErrNo(ERRNO_CODES.EINVAL);return-1}if(ENV.hasOwnProperty(name)&&!overwrite)return 0;ENV[name]=val;___buildEnvironment(ENV);return 0}function _glEndTransformFeedback(){GLctx["endTransformFeedback"]()}function _glDeleteShader(id){if(!id)return;var shader=GL.shaders[id];if(!shader){GL.recordError(1281);return}GLctx.deleteShader(shader);GL.shaders[id]=null}function _glCopyBufferSubData(x0,x1,x2,x3,x4){GLctx["copyBufferSubData"](x0,x1,x2,x3,x4)}function _glTransformFeedbackVaryings(program,count,varyings,bufferMode){program=GL.programs[program];var vars=[];for(var i=0;i>2]));GLctx["transformFeedbackVaryings"](program,vars,bufferMode)}function ___syscall183(which,varargs){SYSCALLS.varargs=varargs;try{var buf=SYSCALLS.get(),size=SYSCALLS.get();if(size===0)return-ERRNO_CODES.EINVAL;var cwd=FS.cwd();if(size>2]=ret}return ret}function ___syscall221(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),cmd=SYSCALLS.get();switch(cmd){case 0:{var arg=SYSCALLS.get();if(arg<0){return-ERRNO_CODES.EINVAL}var newStream;newStream=FS.open(stream.path,stream.flags,0,arg);return newStream.fd};case 1:case 2:return 0;case 3:return stream.flags;case 4:{var arg=SYSCALLS.get();stream.flags|=arg;return 0};case 12:case 12:{var arg=SYSCALLS.get();var offset=0;HEAP16[arg+offset>>1]=2;return 0};case 13:case 14:case 13:case 14:return 0;case 16:case 8:return-ERRNO_CODES.EINVAL;case 9:___setErrNo(ERRNO_CODES.EINVAL);return-1;default:{return-ERRNO_CODES.EINVAL}}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall220(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),dirp=SYSCALLS.get(),count=SYSCALLS.get();if(!stream.getdents){stream.getdents=FS.readdir(stream.path)}var pos=0;while(stream.getdents.length>0&&pos+268<=count){var id;var type;var name=stream.getdents.pop();assert(name.length<256);if(name[0]==="."){id=1;type=4}else{var child=FS.lookupNode(stream.node,name);id=child.id;type=FS.isChrdev(child.mode)?2:FS.isDir(child.mode)?4:FS.isLink(child.mode)?10:8}HEAP32[dirp+pos>>2]=id;HEAP32[dirp+pos+4>>2]=stream.position;HEAP16[dirp+pos+8>>1]=268;HEAP8[dirp+pos+10>>0]=type;for(var i=0;i>0]=name.charCodeAt(i)}HEAP8[dirp+pos+(11+i)>>0]=0;pos+=268}return pos}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}var ___dso_handle=STATICTOP;STATICTOP+=16;var GLctx;GL.init();FS.staticInit();__ATINIT__.unshift((function(){if(!Module["noFSInit"]&&!FS.init.initialized)FS.init()}));__ATMAIN__.push((function(){FS.ignorePermissions=false}));__ATEXIT__.push((function(){FS.quit()}));Module["FS_createFolder"]=FS.createFolder;Module["FS_createPath"]=FS.createPath;Module["FS_createDataFile"]=FS.createDataFile;Module["FS_createPreloadedFile"]=FS.createPreloadedFile;Module["FS_createLazyFile"]=FS.createLazyFile;Module["FS_createLink"]=FS.createLink;Module["FS_createDevice"]=FS.createDevice;Module["FS_unlink"]=FS.unlink;__ATINIT__.unshift((function(){TTY.init()}));__ATEXIT__.push((function(){TTY.shutdown()}));if(ENVIRONMENT_IS_NODE){var fs=require("fs");var NODEJS_PATH=require("path");NODEFS.staticInit()}JSEvents.staticInit();Module["requestFullScreen"]=function Module_requestFullScreen(lockPointer,resizeCanvas,vrDevice){Module.printErr("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead.");Module["requestFullScreen"]=Module["requestFullscreen"];Browser.requestFullScreen(lockPointer,resizeCanvas,vrDevice)};Module["requestFullscreen"]=function Module_requestFullscreen(lockPointer,resizeCanvas,vrDevice){Browser.requestFullscreen(lockPointer,resizeCanvas,vrDevice)};Module["requestAnimationFrame"]=function Module_requestAnimationFrame(func){Browser.requestAnimationFrame(func)};Module["setCanvasSize"]=function Module_setCanvasSize(width,height,noUpdates){Browser.setCanvasSize(width,height,noUpdates)};Module["pauseMainLoop"]=function Module_pauseMainLoop(){Browser.mainLoop.pause()};Module["resumeMainLoop"]=function Module_resumeMainLoop(){Browser.mainLoop.resume()};Module["getUserMedia"]=function Module_getUserMedia(){Browser.getUserMedia()};Module["createContext"]=function Module_createContext(canvas,useWebGL,setInModule,webGLContextAttributes){return Browser.createContext(canvas,useWebGL,setInModule,webGLContextAttributes)};if(ENVIRONMENT_IS_NODE){_emscripten_get_now=function _emscripten_get_now_actual(){var t=process["hrtime"]();return t[0]*1e3+t[1]/1e6}}else if(typeof dateNow!=="undefined"){_emscripten_get_now=dateNow}else if(typeof self==="object"&&self["performance"]&&typeof self["performance"]["now"]==="function"){_emscripten_get_now=(function(){return self["performance"]["now"]()})}else if(typeof performance==="object"&&typeof performance["now"]==="function"){_emscripten_get_now=(function(){return performance["now"]()})}else{_emscripten_get_now=Date.now}___buildEnvironment(ENV);__ATINIT__.push((function(){SOCKFS.root=FS.mount(SOCKFS,{},null)}));__ATINIT__.push((function(){PIPEFS.root=FS.mount(PIPEFS,{},null)}));DYNAMICTOP_PTR=allocate(1,"i32",ALLOC_STATIC);STACK_BASE=STACKTOP=Runtime.alignMemory(STATICTOP);STACK_MAX=STACK_BASE+TOTAL_STACK;DYNAMIC_BASE=Runtime.alignMemory(STACK_MAX);HEAP32[DYNAMICTOP_PTR>>2]=DYNAMIC_BASE;staticSealed=true;Module["wasmTableSize"]=38095;Module["wasmMaxTableSize"]=38095;function invoke_viij(index,a1,a2,a3,a4){try{Module["dynCall_viij"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_fifi(index,a1,a2,a3){try{return Module["dynCall_fifi"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6){try{return Module["dynCall_iiiiiii"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11){try{Module["dynCall_viiiiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiifi(index,a1,a2,a3,a4,a5,a6,a7,a8){try{Module["dynCall_viiiiiifi"](index,a1,a2,a3,a4,a5,a6,a7,a8)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiffii(index,a1,a2,a3,a4,a5,a6){try{Module["dynCall_viiffii"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vidi(index,a1,a2,a3){try{Module["dynCall_vidi"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiifiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10){try{return Module["dynCall_iiiiifiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_jii(index,a1,a2){try{return Module["dynCall_jii"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_fif(index,a1,a2){try{return Module["dynCall_fif"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15){try{Module["dynCall_viiiiiiiiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiifffi(index,a1,a2,a3,a4,a5,a6,a7,a8){try{Module["dynCall_viiiifffi"](index,a1,a2,a3,a4,a5,a6,a7,a8)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_fii(index,a1,a2){try{return Module["dynCall_fii"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiff(index,a1,a2,a3,a4,a5,a6,a7){try{Module["dynCall_viiiiiff"](index,a1,a2,a3,a4,a5,a6,a7)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_di(index,a1){try{return Module["dynCall_di"](index,a1)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viff(index,a1,a2,a3){try{Module["dynCall_viff"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiifiii(index,a1,a2,a3,a4,a5,a6){try{return Module["dynCall_iiifiii"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiifi(index,a1,a2,a3,a4,a5,a6,a7){try{Module["dynCall_viiiiifi"](index,a1,a2,a3,a4,a5,a6,a7)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiifiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10){try{return Module["dynCall_iiiifiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiffi(index,a1,a2,a3,a4,a5){try{Module["dynCall_viiffi"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_dii(index,a1,a2){try{return Module["dynCall_dii"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9){try{return Module["dynCall_iiiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiiiff(index,a1,a2,a3,a4,a5,a6,a7,a8,a9){try{Module["dynCall_viiiiiiiff"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiff(index,a1,a2,a3,a4,a5){try{Module["dynCall_viiiff"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7){try{return Module["dynCall_iiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_j(index){try{return Module["dynCall_j"](index)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiffif(index,a1,a2,a3,a4,a5,a6,a7,a8){try{Module["dynCall_viiiiffif"](index,a1,a2,a3,a4,a5,a6,a7,a8)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiji(index,a1,a2,a3,a4,a5){try{return Module["dynCall_iiiji"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viidddi(index,a1,a2,a3,a4,a5,a6){try{Module["dynCall_viidddi"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiffii(index,a1,a2,a3,a4,a5,a6,a7,a8){try{Module["dynCall_viiiiffii"](index,a1,a2,a3,a4,a5,a6,a7,a8)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiifi(index,a1,a2,a3,a4,a5){try{Module["dynCall_viiifi"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_diiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8){try{return Module["dynCall_diiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiifii(index,a1,a2,a3,a4,a5){try{return Module["dynCall_iiifii"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiffiii(index,a1,a2,a3,a4,a5,a6,a7,a8){try{Module["dynCall_viiiffiii"](index,a1,a2,a3,a4,a5,a6,a7,a8)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiif(index,a1,a2,a3,a4,a5,a6){try{Module["dynCall_viiiiif"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiifiiii(index,a1,a2,a3,a4,a5,a6,a7,a8){try{return Module["dynCall_iiiifiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vifi(index,a1,a2,a3){try{Module["dynCall_vifi"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vifff(index,a1,a2,a3,a4){try{Module["dynCall_vifff"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6){try{Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_fiii(index,a1,a2,a3){try{return Module["dynCall_fiii"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiifffi(index,a1,a2,a3,a4,a5,a6,a7){try{Module["dynCall_viiifffi"](index,a1,a2,a3,a4,a5,a6,a7)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_ji(index,a1){try{return Module["dynCall_ji"](index,a1)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10){try{Module["dynCall_viiiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viif(index,a1,a2,a3){try{Module["dynCall_viif"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_diii(index,a1,a2,a3){try{return Module["dynCall_diii"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_fiiii(index,a1,a2,a3,a4){try{return Module["dynCall_fiiii"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiii(index,a1,a2,a3,a4,a5){try{return Module["dynCall_iiiiii"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiffffffii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11){try{Module["dynCall_viiiffffffii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vijii(index,a1,a2,a3,a4,a5){try{Module["dynCall_vijii"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiii(index,a1,a2,a3,a4){try{return Module["dynCall_iiiii"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiif(index,a1,a2,a3,a4){try{return Module["dynCall_iiiif"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiifif(index,a1,a2,a3,a4,a5,a6,a7){try{Module["dynCall_viiiifif"](index,a1,a2,a3,a4,a5,a6,a7)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiiifiif(index,a1,a2,a3,a4,a5,a6,a7,a8,a9){try{return Module["dynCall_iiiiiifiif"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiii(index,a1,a2,a3,a4){try{Module["dynCall_viiii"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiii(index,a1,a2,a3,a4,a5){try{Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vif(index,a1,a2){try{Module["dynCall_vif"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vid(index,a1,a2){try{Module["dynCall_vid"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vij(index,a1,a2,a3){try{Module["dynCall_vij"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vii(index,a1,a2){try{Module["dynCall_vii"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiif(index,a1,a2,a3,a4,a5){try{Module["dynCall_viiiif"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiifiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9){try{return Module["dynCall_iiiiifiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viifii(index,a1,a2,a3,a4,a5){try{Module["dynCall_viifii"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_fi(index,a1){try{return Module["dynCall_fi"](index,a1)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viifif(index,a1,a2,a3,a4,a5){try{Module["dynCall_viifif"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiifffiffi(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11){try{Module["dynCall_viiiifffiffi"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiffiffff(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10){try{Module["dynCall_viiiffiffff"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8){try{Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_diiii(index,a1,a2,a3,a4){try{return Module["dynCall_diiii"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiifi(index,a1,a2,a3,a4,a5,a6){try{return Module["dynCall_iiiiifi"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viji(index,a1,a2,a3,a4){try{Module["dynCall_viji"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iif(index,a1,a2){try{return Module["dynCall_iif"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7){try{Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9){try{Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iii(index,a1,a2){try{return Module["dynCall_iii"](index,a1,a2)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_fiiiif(index,a1,a2,a3,a4,a5){try{return Module["dynCall_fiiiif"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iij(index,a1,a2,a3){try{return Module["dynCall_iij"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_f(index){try{return Module["dynCall_f"](index)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_jiiii(index,a1,a2,a3,a4){try{return Module["dynCall_jiiii"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viii(index,a1,a2,a3){try{Module["dynCall_viii"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiifi(index,a1,a2,a3,a4,a5,a6){try{Module["dynCall_viiiifi"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_v(index){try{Module["dynCall_v"](index)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viid(index,a1,a2,a3){try{Module["dynCall_viid"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiff(index,a1,a2,a3,a4,a5,a6){try{Module["dynCall_viiiiff"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiifiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9){try{return Module["dynCall_iiifiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiifj(index,a1,a2,a3,a4,a5,a6){try{return Module["dynCall_iiiifj"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_vi(index,a1){try{Module["dynCall_vi"](index,a1)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10){try{return Module["dynCall_iiiiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_ii(index,a1){try{return Module["dynCall_ii"](index,a1)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viifi(index,a1,a2,a3,a4){try{Module["dynCall_viifi"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiifiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11){try{return Module["dynCall_iiiiifiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_fffff(index,a1,a2,a3,a4){try{return Module["dynCall_fffff"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiifi(index,a1,a2,a3,a4){try{return Module["dynCall_iiifi"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiif(index,a1,a2,a3,a4){try{Module["dynCall_viiif"](index,a1,a2,a3,a4)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiffif(index,a1,a2,a3,a4,a5,a6,a7){try{Module["dynCall_viiiffif"](index,a1,a2,a3,a4,a5,a6,a7)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiffii(index,a1,a2,a3,a4,a5,a6){try{return Module["dynCall_iiiffii"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_fiiiiii(index,a1,a2,a3,a4,a5,a6){try{return Module["dynCall_fiiiiii"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viffff(index,a1,a2,a3,a4,a5){try{Module["dynCall_viffff"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiii(index,a1,a2,a3){try{return Module["dynCall_iiii"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viifff(index,a1,a2,a3,a4,a5){try{Module["dynCall_viifff"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiiiifiif(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10){try{return Module["dynCall_iiiiiiifiif"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiffiii(index,a1,a2,a3,a4,a5,a6,a7){try{Module["dynCall_viiffiii"](index,a1,a2,a3,a4,a5,a6,a7)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiif(index,a1,a2,a3){try{return Module["dynCall_iiif"](index,a1,a2,a3)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiffi(index,a1,a2,a3,a4,a5,a6){try{Module["dynCall_viiiffi"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiifff(index,a1,a2,a3,a4,a5,a6){try{Module["dynCall_viiifff"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiifiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9){try{return Module["dynCall_iiiifiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12){try{Module["dynCall_viiiiiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_i(index){try{return Module["dynCall_i"](index)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_viiffff(index,a1,a2,a3,a4,a5,a6){try{Module["dynCall_viiffff"](index,a1,a2,a3,a4,a5,a6)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8){try{return Module["dynCall_iiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}function invoke_iiiiif(index,a1,a2,a3,a4,a5){try{return Module["dynCall_iiiiif"](index,a1,a2,a3,a4,a5)}catch(e){if(typeof e!=="number"&&e!=="longjmp")throw e;Module["setThrew"](1,0)}}Module.asmGlobalArg={"Math":Math,"Int8Array":Int8Array,"Int16Array":Int16Array,"Int32Array":Int32Array,"Uint8Array":Uint8Array,"Uint16Array":Uint16Array,"Uint32Array":Uint32Array,"Float32Array":Float32Array,"Float64Array":Float64Array,"NaN":NaN,"Infinity":Infinity,"byteLength":byteLength};Module.asmLibraryArg={"abort":abort,"assert":assert,"enlargeMemory":enlargeMemory,"getTotalMemory":getTotalMemory,"abortOnCannotGrowMemory":abortOnCannotGrowMemory,"invoke_viij":invoke_viij,"invoke_fifi":invoke_fifi,"invoke_iiiiiii":invoke_iiiiiii,"invoke_viiiiiiiiiii":invoke_viiiiiiiiiii,"invoke_viiiiiifi":invoke_viiiiiifi,"invoke_viiffii":invoke_viiffii,"invoke_vidi":invoke_vidi,"invoke_iiiiifiiiii":invoke_iiiiifiiiii,"invoke_jii":invoke_jii,"invoke_fif":invoke_fif,"invoke_viiiiiiiiiiiiiii":invoke_viiiiiiiiiiiiiii,"invoke_viiiifffi":invoke_viiiifffi,"invoke_fii":invoke_fii,"invoke_viiiiiff":invoke_viiiiiff,"invoke_di":invoke_di,"invoke_viff":invoke_viff,"invoke_iiifiii":invoke_iiifiii,"invoke_viiiiifi":invoke_viiiiifi,"invoke_iiiifiiiiii":invoke_iiiifiiiiii,"invoke_viiffi":invoke_viiffi,"invoke_dii":invoke_dii,"invoke_iiiiiiiiii":invoke_iiiiiiiiii,"invoke_viiiiiiiff":invoke_viiiiiiiff,"invoke_viiiff":invoke_viiiff,"invoke_iiiiiiii":invoke_iiiiiiii,"invoke_j":invoke_j,"invoke_viiiiffif":invoke_viiiiffif,"invoke_iiiji":invoke_iiiji,"invoke_viidddi":invoke_viidddi,"invoke_viiiiffii":invoke_viiiiffii,"invoke_viiifi":invoke_viiifi,"invoke_diiiiiiii":invoke_diiiiiiii,"invoke_iiifii":invoke_iiifii,"invoke_viiiffiii":invoke_viiiffiii,"invoke_viiiiif":invoke_viiiiif,"invoke_iiiifiiii":invoke_iiiifiiii,"invoke_vifi":invoke_vifi,"invoke_vifff":invoke_vifff,"invoke_viiiiii":invoke_viiiiii,"invoke_fiii":invoke_fiii,"invoke_viiifffi":invoke_viiifffi,"invoke_ji":invoke_ji,"invoke_viiiiiiiiii":invoke_viiiiiiiiii,"invoke_viif":invoke_viif,"invoke_diii":invoke_diii,"invoke_fiiii":invoke_fiiii,"invoke_iiiiii":invoke_iiiiii,"invoke_viiiffffffii":invoke_viiiffffffii,"invoke_vijii":invoke_vijii,"invoke_iiiii":invoke_iiiii,"invoke_iiiif":invoke_iiiif,"invoke_viiiifif":invoke_viiiifif,"invoke_iiiiiifiif":invoke_iiiiiifiif,"invoke_viiii":invoke_viiii,"invoke_viiiii":invoke_viiiii,"invoke_vif":invoke_vif,"invoke_vid":invoke_vid,"invoke_vij":invoke_vij,"invoke_vii":invoke_vii,"invoke_viiiif":invoke_viiiif,"invoke_iiiiifiiii":invoke_iiiiifiiii,"invoke_viifii":invoke_viifii,"invoke_fi":invoke_fi,"invoke_viifif":invoke_viifif,"invoke_viiiifffiffi":invoke_viiiifffiffi,"invoke_viiiffiffff":invoke_viiiffiffff,"invoke_viiiiiiii":invoke_viiiiiiii,"invoke_diiii":invoke_diiii,"invoke_iiiiifi":invoke_iiiiifi,"invoke_viji":invoke_viji,"invoke_iif":invoke_iif,"invoke_viiiiiii":invoke_viiiiiii,"invoke_viiiiiiiii":invoke_viiiiiiiii,"invoke_iii":invoke_iii,"invoke_fiiiif":invoke_fiiiif,"invoke_iij":invoke_iij,"invoke_f":invoke_f,"invoke_jiiii":invoke_jiiii,"invoke_viii":invoke_viii,"invoke_viiiifi":invoke_viiiifi,"invoke_v":invoke_v,"invoke_viid":invoke_viid,"invoke_viiiiff":invoke_viiiiff,"invoke_iiifiiiiii":invoke_iiifiiiiii,"invoke_iiiifj":invoke_iiiifj,"invoke_vi":invoke_vi,"invoke_iiiiiiiiiii":invoke_iiiiiiiiiii,"invoke_ii":invoke_ii,"invoke_viifi":invoke_viifi,"invoke_iiiiifiiiiii":invoke_iiiiifiiiiii,"invoke_fffff":invoke_fffff,"invoke_iiifi":invoke_iiifi,"invoke_viiif":invoke_viiif,"invoke_viiiffif":invoke_viiiffif,"invoke_iiiffii":invoke_iiiffii,"invoke_fiiiiii":invoke_fiiiiii,"invoke_viffff":invoke_viffff,"invoke_iiii":invoke_iiii,"invoke_viifff":invoke_viifff,"invoke_iiiiiiifiif":invoke_iiiiiiifiif,"invoke_viiffiii":invoke_viiffiii,"invoke_iiif":invoke_iiif,"invoke_viiiffi":invoke_viiiffi,"invoke_viiifff":invoke_viiifff,"invoke_iiiifiiiii":invoke_iiiifiiiii,"invoke_viiiiiiiiiiii":invoke_viiiiiiiiiiii,"invoke_i":invoke_i,"invoke_viiffff":invoke_viiffff,"invoke_iiiiiiiii":invoke_iiiiiiiii,"invoke_iiiiif":invoke_iiiiif,"__softFullscreenResizeWebGLRenderTarget":__softFullscreenResizeWebGLRenderTarget,"___syscall221":___syscall221,"_glCullFace":_glCullFace,"__inet_ntop6_raw":__inet_ntop6_raw,"_emscripten_set_fullscreenchange_callback":_emscripten_set_fullscreenchange_callback,"_dlsym":_dlsym,"_pthread_rwlock_wrlock":_pthread_rwlock_wrlock,"_llvm_cttz_i32":_llvm_cttz_i32,"_glUniformMatrix4fv":_glUniformMatrix4fv,"__inet_pton4_raw":__inet_pton4_raw,"___setErrNo":___setErrNo,"_glUniform2fv":_glUniform2fv,"_glDeleteProgram":_glDeleteProgram,"___syscall268":___syscall268,"_pthread_attr_setdetachstate":_pthread_attr_setdetachstate,"_glBlendEquation":_glBlendEquation,"_longjmp":_longjmp,"_glVertexAttrib4f":_glVertexAttrib4f,"_pthread_rwlock_destroy":_pthread_rwlock_destroy,"_llvm_exp2_f64":_llvm_exp2_f64,"_glGetShaderInfoLog":_glGetShaderInfoLog,"__addDays":__addDays,"_emscripten_request_fullscreen_strategy":_emscripten_request_fullscreen_strategy,"emscriptenWebGLGetShiftForType":emscriptenWebGLGetShiftForType,"_emscripten_set_touchmove_callback":_emscripten_set_touchmove_callback,"_emscripten_set_main_loop_timing":_emscripten_set_main_loop_timing,"_emscripten_set_gamepaddisconnected_callback":_emscripten_set_gamepaddisconnected_callback,"_glBlendFunc":_glBlendFunc,"_glDisableVertexAttribArray":_glDisableVertexAttribArray,"_emscripten_memcpy_big":_emscripten_memcpy_big,"_pthread_attr_init":_pthread_attr_init,"_sysconf":_sysconf,"_execl":_execl,"_emscripten_set_touchstart_callback":_emscripten_set_touchstart_callback,"emscriptenWebGLComputeImageSize":emscriptenWebGLComputeImageSize,"_pthread_rwlock_rdlock":_pthread_rwlock_rdlock,"_glShaderSource":_glShaderSource,"_glUniform4f":_glUniform4f,"_glInvalidateFramebuffer":_glInvalidateFramebuffer,"_glBeginTransformFeedback":_glBeginTransformFeedback,"_pthread_mutexattr_settype":_pthread_mutexattr_settype,"_glDrawElementsInstanced":_glDrawElementsInstanced,"emscriptenWebGLGetHeapForType":emscriptenWebGLGetHeapForType,"_glUseProgram":_glUseProgram,"_glRenderbufferStorage":_glRenderbufferStorage,"_emscripten_get_canvas_size":_emscripten_get_canvas_size,"__write_sockaddr":__write_sockaddr,"_emscripten_webgl_make_context_current":_emscripten_webgl_make_context_current,"_glTexStorage2D":_glTexStorage2D,"_glGenBuffers":_glGenBuffers,"_glEndTransformFeedback":_glEndTransformFeedback,"_glFramebufferRenderbuffer":_glFramebufferRenderbuffer,"___syscall220":___syscall220,"_gmtime_r":_gmtime_r,"___cxa_atexit":___cxa_atexit,"_emscripten_exit_pointerlock":_emscripten_exit_pointerlock,"_getaddrinfo":_getaddrinfo,"___syscall140":___syscall140,"_emscripten_do_request_fullscreen":_emscripten_do_request_fullscreen,"_posix_spawn_file_actions_adddup2":_posix_spawn_file_actions_adddup2,"___syscall145":___syscall145,"___syscall146":___syscall146,"_glGenerateMipmap":_glGenerateMipmap,"_emscripten_set_keyup_callback":_emscripten_set_keyup_callback,"_emscripten_asm_const_iiiii":_emscripten_asm_const_iiiii,"__inet_ntop4_raw":__inet_ntop4_raw,"_sem_getvalue":_sem_getvalue,"__restoreHiddenElements":__restoreHiddenElements,"__arraySum":__arraySum,"_glVertexAttribIPointer":_glVertexAttribIPointer,"_sem_init":_sem_init,"___syscall42":___syscall42,"_glBindRenderbuffer":_glBindRenderbuffer,"_glDrawElements":_glDrawElements,"_glDepthMask":_glDepthMask,"_glBufferSubData":_glBufferSubData,"_glReadBuffer":_glReadBuffer,"_glClearBufferfi":_glClearBufferfi,"_glViewport":_glViewport,"_wait":_wait,"_glDeleteVertexArrays":_glDeleteVertexArrays,"_glGetStringi":_glGetStringi,"_llvm_pow_f32":_llvm_pow_f32,"_glDepthFunc":_glDepthFunc,"_emscripten_set_mousedown_callback":_emscripten_set_mousedown_callback,"_emscripten_set_canvas_size":_emscripten_set_canvas_size,"_glClearBufferfv":_glClearBufferfv,"___syscall331":___syscall331,"_dlclose":_dlclose,"_nanosleep":_nanosleep,"_gmtime":_gmtime,"_posix_spawn":_posix_spawn,"_glDrawBuffers":_glDrawBuffers,"_glCompressedTexImage2D":_glCompressedTexImage2D,"_kill":_kill,"___syscall114":___syscall114,"_llvm_trap":_llvm_trap,"_glGenTextures":_glGenTextures,"_glUnmapBuffer":_glUnmapBuffer,"_dlopen":_dlopen,"_glEnable":_glEnable,"_glDrawArraysInstanced":_glDrawArraysInstanced,"emscriptenWebGLGet":emscriptenWebGLGet,"___syscall15":___syscall15,"_emscripten_set_mouseup_callback":_emscripten_set_mouseup_callback,"___syscall12":___syscall12,"_emscripten_get_now":_emscripten_get_now,"___syscall10":___syscall10,"_glUniform1ui":_glUniform1ui,"_glAttachShader":_glAttachShader,"_glCreateProgram":_glCreateProgram,"__registerRestoreOldStyle":__registerRestoreOldStyle,"_pthread_rwlock_trywrlock":_pthread_rwlock_trywrlock,"___lock":___lock,"emscriptenWebGLGetTexPixelData":emscriptenWebGLGetTexPixelData,"___syscall6":___syscall6,"_glBindBuffer":_glBindBuffer,"___cxa_pure_virtual":___cxa_pure_virtual,"_time":_time,"_glBindFramebuffer":_glBindFramebuffer,"_gettimeofday":_gettimeofday,"_glDeleteTextures":_glDeleteTextures,"_glGenFramebuffers":_glGenFramebuffers,"_glGetIntegerv":_glGetIntegerv,"_emscripten_set_resize_callback":_emscripten_set_resize_callback,"_glGetString":_glGetString,"_dlerror":_dlerror,"_pthread_join":_pthread_join,"___syscall102":___syscall102,"_llvm_pow_f64":_llvm_pow_f64,"_emscripten_set_keypress_callback":_emscripten_set_keypress_callback,"_localtime_r":_localtime_r,"_glDeleteFramebuffers":_glDeleteFramebuffers,"_emscripten_get_gamepad_status":_emscripten_get_gamepad_status,"_glMapBufferRange":_glMapBufferRange,"__isLeapYear":__isLeapYear,"_glCheckFramebufferStatus":_glCheckFramebufferStatus,"_emscripten_webgl_create_context":_emscripten_webgl_create_context,"_glFramebufferTextureLayer":_glFramebufferTextureLayer,"___syscall20":___syscall20,"_pthread_rwlock_unlock":_pthread_rwlock_unlock,"_glVertexAttribPointer":_glVertexAttribPointer,"_emscripten_get_num_gamepads":_emscripten_get_num_gamepads,"___buildEnvironment":___buildEnvironment,"_glBlendFuncSeparate":_glBlendFuncSeparate,"_glUniform3fv":_glUniform3fv,"_glClearDepthf":_glClearDepthf,"__emscripten_sample_gamepad_data":__emscripten_sample_gamepad_data,"_tzset":_tzset,"_glClearColor":_glClearColor,"_glBindTexture":_glBindTexture,"_glUniform1f":_glUniform1f,"___syscall195":___syscall195,"_glGetFloatv":_glGetFloatv,"_sigemptyset":_sigemptyset,"_glUniform1i":_glUniform1i,"_strftime":_strftime,"_sem_wait":_sem_wait,"_glDrawArrays":_glDrawArrays,"_glCreateShader":_glCreateShader,"_pthread_mutex_destroy":_pthread_mutex_destroy,"_glCopyBufferSubData":_glCopyBufferSubData,"_glUniform2iv":_glUniform2iv,"_getenv":_getenv,"_glTransformFeedbackVaryings":_glTransformFeedbackVaryings,"_emscripten_asm_const_iiiiiii":_emscripten_asm_const_iiiiiii,"___syscall33":___syscall33,"_pthread_key_create":_pthread_key_create,"_glActiveTexture":_glActiveTexture,"__setLetterbox":__setLetterbox,"___syscall39":___syscall39,"___syscall38":___syscall38,"_glGenVertexArrays":_glGenVertexArrays,"_pthread_rwlock_init":_pthread_rwlock_init,"_glFrontFace":_glFrontFace,"_glCompileShader":_glCompileShader,"_execvp":_execvp,"_emscripten_set_gamepadconnected_callback":_emscripten_set_gamepadconnected_callback,"_glEnableVertexAttribArray":_glEnableVertexAttribArray,"_abort":_abort,"_glBindVertexArray":_glBindVertexArray,"___syscall183":___syscall183,"_glDeleteBuffers":_glDeleteBuffers,"_glBufferData":_glBufferData,"_glTexImage2D":_glTexImage2D,"_glGetProgramInfoLog":_glGetProgramInfoLog,"_glGetUniformBlockIndex":_glGetUniformBlockIndex,"_glCompressedTexImage3D":_glCompressedTexImage3D,"_waitpid":_waitpid,"_pthread_getspecific":_pthread_getspecific,"_glDeleteShader":_glDeleteShader,"_fork":_fork,"_glRenderbufferStorageMultisample":_glRenderbufferStorageMultisample,"_glGetProgramiv":_glGetProgramiv,"_llvm_exp2_f32":_llvm_exp2_f32,"___syscall168":___syscall168,"_glScissor":_glScissor,"_emscripten_request_pointerlock":_emscripten_request_pointerlock,"___syscall40":___syscall40,"_sigaction":_sigaction,"_sem_destroy":_sem_destroy,"___syscall5":___syscall5,"_emscripten_set_keydown_callback":_emscripten_set_keydown_callback,"_llvm_bswap_i64":_llvm_bswap_i64,"_emscripten_set_touchcancel_callback":_emscripten_set_touchcancel_callback,"_emscripten_set_mousemove_callback":_emscripten_set_mousemove_callback,"_glDeleteRenderbuffers":_glDeleteRenderbuffers,"__read_sockaddr":__read_sockaddr,"_glBlitFramebuffer":_glBlitFramebuffer,"_usleep":_usleep,"_glDisable":_glDisable,"_glLinkProgram":_glLinkProgram,"_emscripten_set_touchend_callback":_emscripten_set_touchend_callback,"_emscripten_exit_fullscreen":_emscripten_exit_fullscreen,"_glGenRenderbuffers":_glGenRenderbuffers,"_glGetUniformLocation":_glGetUniformLocation,"_glBindBufferBase":_glBindBufferBase,"_glClear":_glClear,"_glUniform4fv":_glUniform4fv,"_glTexSubImage3D":_glTexSubImage3D,"_sem_post":_sem_post,"_localtime":_localtime,"_posix_spawn_file_actions_init":_posix_spawn_file_actions_init,"_glBindAttribLocation":_glBindAttribLocation,"_glPixelStorei":_glPixelStorei,"_glUniform1iv":_glUniform1iv,"_glGetShaderiv":_glGetShaderiv,"_glTexImage3D":_glTexImage3D,"_glVertexAttribDivisor":_glVertexAttribDivisor,"_pthread_attr_setstacksize":_pthread_attr_setstacksize,"_emscripten_enter_soft_fullscreen":_emscripten_enter_soft_fullscreen,"_emscripten_get_pointerlock_status":_emscripten_get_pointerlock_status,"_emscripten_asm_const_ii":_emscripten_asm_const_ii,"_emscripten_set_wheel_callback":_emscripten_set_wheel_callback,"_emscripten_exit_soft_fullscreen":_emscripten_exit_soft_fullscreen,"___syscall54":___syscall54,"___unlock":___unlock,"_glFramebufferTexture2D":_glFramebufferTexture2D,"_pthread_create":_pthread_create,"_emscripten_set_main_loop":_emscripten_set_main_loop,"_glUniformBlockBinding":_glUniformBlockBinding,"_pthread_mutexattr_init":_pthread_mutexattr_init,"_pthread_setspecific":_pthread_setspecific,"_emscripten_asm_const_i":_emscripten_asm_const_i,"_emscripten_webgl_init_context_attributes":_emscripten_webgl_init_context_attributes,"_glCompressedTexSubImage3D":_glCompressedTexSubImage3D,"__inet_pton6_raw":__inet_pton6_raw,"_glColorMask":_glColorMask,"__hideEverythingExceptGivenElement":__hideEverythingExceptGivenElement,"_pthread_rwlock_tryrdlock":_pthread_rwlock_tryrdlock,"_glTexParameteri":_glTexParameteri,"_emscripten_longjmp":_emscripten_longjmp,"_posix_spawn_file_actions_destroy":_posix_spawn_file_actions_destroy,"_atexit":_atexit,"_pthread_mutex_init":_pthread_mutex_init,"_emscripten_get_fullscreen_status":_emscripten_get_fullscreen_status,"_glTexParameterf":_glTexParameterf,"_setenv":_setenv,"_glTexSubImage2D":_glTexSubImage2D,"DYNAMICTOP_PTR":DYNAMICTOP_PTR,"tempDoublePtr":tempDoublePtr,"ABORT":ABORT,"STACKTOP":STACKTOP,"STACK_MAX":STACK_MAX,"cttz_i8":cttz_i8,"___dso_handle":___dso_handle,"___environ":___environ};var asm=Module["asm"](Module.asmGlobalArg,Module.asmLibraryArg,buffer);Module["asm"]=asm;var stackSave=Module["stackSave"]=(function(){return Module["asm"]["stackSave"].apply(null,arguments)});var __GLOBAL__sub_I_global_constants_cpp=Module["__GLOBAL__sub_I_global_constants_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_global_constants_cpp"].apply(null,arguments)});var _main=Module["_main"]=(function(){return Module["asm"]["_main"].apply(null,arguments)});var __GLOBAL__sub_I_image_loader_svg_cpp=Module["__GLOBAL__sub_I_image_loader_svg_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_image_loader_svg_cpp"].apply(null,arguments)});var __GLOBAL__sub_I_color_cpp=Module["__GLOBAL__sub_I_color_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_color_cpp"].apply(null,arguments)});var __GLOBAL__sub_I_main_cpp=Module["__GLOBAL__sub_I_main_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_main_cpp"].apply(null,arguments)});var _resize_poolbytearray_and_open_write=Module["_resize_poolbytearray_and_open_write"]=(function(){return Module["asm"]["_resize_poolbytearray_and_open_write"].apply(null,arguments)});var __GLOBAL__sub_I_material_cpp=Module["__GLOBAL__sub_I_material_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_material_cpp"].apply(null,arguments)});var getTempRet0=Module["getTempRet0"]=(function(){return Module["asm"]["getTempRet0"].apply(null,arguments)});var __GLOBAL__sub_I_matrix3_cpp=Module["__GLOBAL__sub_I_matrix3_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_matrix3_cpp"].apply(null,arguments)});var __GLOBAL__sub_I_thread_posix_cpp=Module["__GLOBAL__sub_I_thread_posix_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_thread_posix_cpp"].apply(null,arguments)});var _pthread_mutex_trylock=Module["_pthread_mutex_trylock"]=(function(){return Module["asm"]["_pthread_mutex_trylock"].apply(null,arguments)});var _fflush=Module["_fflush"]=(function(){return Module["asm"]["_fflush"].apply(null,arguments)});var setTempRet0=Module["setTempRet0"]=(function(){return Module["asm"]["setTempRet0"].apply(null,arguments)});var _memset=Module["_memset"]=(function(){return Module["asm"]["_memset"].apply(null,arguments)});var __GLOBAL__sub_I_theme_cpp=Module["__GLOBAL__sub_I_theme_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_theme_cpp"].apply(null,arguments)});var _sbrk=Module["_sbrk"]=(function(){return Module["asm"]["_sbrk"].apply(null,arguments)});var _memcpy=Module["_memcpy"]=(function(){return Module["asm"]["_memcpy"].apply(null,arguments)});var _llvm_bswap_i32=Module["_llvm_bswap_i32"]=(function(){return Module["asm"]["_llvm_bswap_i32"].apply(null,arguments)});var __GLOBAL__sub_I_audio_server_cpp=Module["__GLOBAL__sub_I_audio_server_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_audio_server_cpp"].apply(null,arguments)});var _main_after_fs_sync=Module["_main_after_fs_sync"]=(function(){return Module["asm"]["_main_after_fs_sync"].apply(null,arguments)});var _send_notification=Module["_send_notification"]=(function(){return Module["asm"]["_send_notification"].apply(null,arguments)});var stackAlloc=Module["stackAlloc"]=(function(){return Module["asm"]["stackAlloc"].apply(null,arguments)});var __GLOBAL__sub_I_particles_cpp=Module["__GLOBAL__sub_I_particles_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_particles_cpp"].apply(null,arguments)});var _ntohs=Module["_ntohs"]=(function(){return Module["asm"]["_ntohs"].apply(null,arguments)});var _htonl=Module["_htonl"]=(function(){return Module["asm"]["_htonl"].apply(null,arguments)});var _realloc=Module["_realloc"]=(function(){return Module["asm"]["_realloc"].apply(null,arguments)});var _pthread_mutex_unlock=Module["_pthread_mutex_unlock"]=(function(){return Module["asm"]["_pthread_mutex_unlock"].apply(null,arguments)});var __GLOBAL__sub_I_resource_loader_cpp=Module["__GLOBAL__sub_I_resource_loader_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_resource_loader_cpp"].apply(null,arguments)});var _llvm_bswap_i16=Module["_llvm_bswap_i16"]=(function(){return Module["asm"]["_llvm_bswap_i16"].apply(null,arguments)});var _emscripten_get_global_libc=Module["_emscripten_get_global_libc"]=(function(){return Module["asm"]["_emscripten_get_global_libc"].apply(null,arguments)});var __GLOBAL__sub_I_resource_cpp=Module["__GLOBAL__sub_I_resource_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_resource_cpp"].apply(null,arguments)});var _htons=Module["_htons"]=(function(){return Module["asm"]["_htons"].apply(null,arguments)});var __GLOBAL__sub_I_class_db_cpp=Module["__GLOBAL__sub_I_class_db_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_class_db_cpp"].apply(null,arguments)});var ___errno_location=Module["___errno_location"]=(function(){return Module["asm"]["___errno_location"].apply(null,arguments)});var _testSetjmp=Module["_testSetjmp"]=(function(){return Module["asm"]["_testSetjmp"].apply(null,arguments)});var _saveSetjmp=Module["_saveSetjmp"]=(function(){return Module["asm"]["_saveSetjmp"].apply(null,arguments)});var __GLOBAL__sub_I_canvas_item_cpp=Module["__GLOBAL__sub_I_canvas_item_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_canvas_item_cpp"].apply(null,arguments)});var _free=Module["_free"]=(function(){return Module["asm"]["_free"].apply(null,arguments)});var runPostSets=Module["runPostSets"]=(function(){return Module["asm"]["runPostSets"].apply(null,arguments)});var setThrew=Module["setThrew"]=(function(){return Module["asm"]["setThrew"].apply(null,arguments)});var _round=Module["_round"]=(function(){return Module["asm"]["_round"].apply(null,arguments)});var establishStackSpace=Module["establishStackSpace"]=(function(){return Module["asm"]["establishStackSpace"].apply(null,arguments)});var _memmove=Module["_memmove"]=(function(){return Module["asm"]["_memmove"].apply(null,arguments)});var stackRestore=Module["stackRestore"]=(function(){return Module["asm"]["stackRestore"].apply(null,arguments)});var __GLOBAL__sub_I_dynamic_font_cpp=Module["__GLOBAL__sub_I_dynamic_font_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_dynamic_font_cpp"].apply(null,arguments)});var _malloc=Module["_malloc"]=(function(){return Module["asm"]["_malloc"].apply(null,arguments)});var __GLOBAL__sub_I_object_cpp=Module["__GLOBAL__sub_I_object_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_object_cpp"].apply(null,arguments)});var _pthread_mutex_lock=Module["_pthread_mutex_lock"]=(function(){return Module["asm"]["_pthread_mutex_lock"].apply(null,arguments)});var _emscripten_replace_memory=Module["_emscripten_replace_memory"]=(function(){return Module["asm"]["_emscripten_replace_memory"].apply(null,arguments)});var __GLOBAL__sub_I_register_types_cpp=Module["__GLOBAL__sub_I_register_types_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_register_types_cpp"].apply(null,arguments)});var __GLOBAL__sub_I_visual_script_nodes_cpp=Module["__GLOBAL__sub_I_visual_script_nodes_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_visual_script_nodes_cpp"].apply(null,arguments)});var __GLOBAL__sub_I_gdnative_cpp=Module["__GLOBAL__sub_I_gdnative_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_gdnative_cpp"].apply(null,arguments)});var __GLOBAL__sub_I_os_javascript_cpp=Module["__GLOBAL__sub_I_os_javascript_cpp"]=(function(){return Module["asm"]["__GLOBAL__sub_I_os_javascript_cpp"].apply(null,arguments)});var dynCall_viij=Module["dynCall_viij"]=(function(){return Module["asm"]["dynCall_viij"].apply(null,arguments)});var dynCall_fifi=Module["dynCall_fifi"]=(function(){return Module["asm"]["dynCall_fifi"].apply(null,arguments)});var dynCall_iiiiiii=Module["dynCall_iiiiiii"]=(function(){return Module["asm"]["dynCall_iiiiiii"].apply(null,arguments)});var dynCall_viiiiiiiiiii=Module["dynCall_viiiiiiiiiii"]=(function(){return Module["asm"]["dynCall_viiiiiiiiiii"].apply(null,arguments)});var dynCall_viiiiiifi=Module["dynCall_viiiiiifi"]=(function(){return Module["asm"]["dynCall_viiiiiifi"].apply(null,arguments)});var dynCall_viiffii=Module["dynCall_viiffii"]=(function(){return Module["asm"]["dynCall_viiffii"].apply(null,arguments)});var dynCall_vidi=Module["dynCall_vidi"]=(function(){return Module["asm"]["dynCall_vidi"].apply(null,arguments)});var dynCall_iiiiifiiiii=Module["dynCall_iiiiifiiiii"]=(function(){return Module["asm"]["dynCall_iiiiifiiiii"].apply(null,arguments)});var dynCall_jii=Module["dynCall_jii"]=(function(){return Module["asm"]["dynCall_jii"].apply(null,arguments)});var dynCall_fif=Module["dynCall_fif"]=(function(){return Module["asm"]["dynCall_fif"].apply(null,arguments)});var dynCall_viiiiiiiiiiiiiii=Module["dynCall_viiiiiiiiiiiiiii"]=(function(){return Module["asm"]["dynCall_viiiiiiiiiiiiiii"].apply(null,arguments)});var dynCall_viiiifffi=Module["dynCall_viiiifffi"]=(function(){return Module["asm"]["dynCall_viiiifffi"].apply(null,arguments)});var dynCall_fii=Module["dynCall_fii"]=(function(){return Module["asm"]["dynCall_fii"].apply(null,arguments)});var dynCall_viiiiiff=Module["dynCall_viiiiiff"]=(function(){return Module["asm"]["dynCall_viiiiiff"].apply(null,arguments)});var dynCall_di=Module["dynCall_di"]=(function(){return Module["asm"]["dynCall_di"].apply(null,arguments)});var dynCall_viff=Module["dynCall_viff"]=(function(){return Module["asm"]["dynCall_viff"].apply(null,arguments)});var dynCall_iiifiii=Module["dynCall_iiifiii"]=(function(){return Module["asm"]["dynCall_iiifiii"].apply(null,arguments)});var dynCall_viiiiifi=Module["dynCall_viiiiifi"]=(function(){return Module["asm"]["dynCall_viiiiifi"].apply(null,arguments)});var dynCall_iiiifiiiiii=Module["dynCall_iiiifiiiiii"]=(function(){return Module["asm"]["dynCall_iiiifiiiiii"].apply(null,arguments)});var dynCall_viiffi=Module["dynCall_viiffi"]=(function(){return Module["asm"]["dynCall_viiffi"].apply(null,arguments)});var dynCall_dii=Module["dynCall_dii"]=(function(){return Module["asm"]["dynCall_dii"].apply(null,arguments)});var dynCall_iiiiiiiiii=Module["dynCall_iiiiiiiiii"]=(function(){return Module["asm"]["dynCall_iiiiiiiiii"].apply(null,arguments)});var dynCall_viiiiiiiff=Module["dynCall_viiiiiiiff"]=(function(){return Module["asm"]["dynCall_viiiiiiiff"].apply(null,arguments)});var dynCall_viiiff=Module["dynCall_viiiff"]=(function(){return Module["asm"]["dynCall_viiiff"].apply(null,arguments)});var dynCall_iiiiiiii=Module["dynCall_iiiiiiii"]=(function(){return Module["asm"]["dynCall_iiiiiiii"].apply(null,arguments)});var dynCall_j=Module["dynCall_j"]=(function(){return Module["asm"]["dynCall_j"].apply(null,arguments)});var dynCall_viiiiffif=Module["dynCall_viiiiffif"]=(function(){return Module["asm"]["dynCall_viiiiffif"].apply(null,arguments)});var dynCall_iiiji=Module["dynCall_iiiji"]=(function(){return Module["asm"]["dynCall_iiiji"].apply(null,arguments)});var dynCall_viidddi=Module["dynCall_viidddi"]=(function(){return Module["asm"]["dynCall_viidddi"].apply(null,arguments)});var dynCall_viiiiffii=Module["dynCall_viiiiffii"]=(function(){return Module["asm"]["dynCall_viiiiffii"].apply(null,arguments)});var dynCall_viiifi=Module["dynCall_viiifi"]=(function(){return Module["asm"]["dynCall_viiifi"].apply(null,arguments)});var dynCall_diiiiiiii=Module["dynCall_diiiiiiii"]=(function(){return Module["asm"]["dynCall_diiiiiiii"].apply(null,arguments)});var dynCall_iiifii=Module["dynCall_iiifii"]=(function(){return Module["asm"]["dynCall_iiifii"].apply(null,arguments)});var dynCall_viiiffiii=Module["dynCall_viiiffiii"]=(function(){return Module["asm"]["dynCall_viiiffiii"].apply(null,arguments)});var dynCall_viiiiif=Module["dynCall_viiiiif"]=(function(){return Module["asm"]["dynCall_viiiiif"].apply(null,arguments)});var dynCall_iiiifiiii=Module["dynCall_iiiifiiii"]=(function(){return Module["asm"]["dynCall_iiiifiiii"].apply(null,arguments)});var dynCall_vifi=Module["dynCall_vifi"]=(function(){return Module["asm"]["dynCall_vifi"].apply(null,arguments)});var dynCall_vifff=Module["dynCall_vifff"]=(function(){return Module["asm"]["dynCall_vifff"].apply(null,arguments)});var dynCall_viiiiii=Module["dynCall_viiiiii"]=(function(){return Module["asm"]["dynCall_viiiiii"].apply(null,arguments)});var dynCall_fiii=Module["dynCall_fiii"]=(function(){return Module["asm"]["dynCall_fiii"].apply(null,arguments)});var dynCall_viiifffi=Module["dynCall_viiifffi"]=(function(){return Module["asm"]["dynCall_viiifffi"].apply(null,arguments)});var dynCall_ji=Module["dynCall_ji"]=(function(){return Module["asm"]["dynCall_ji"].apply(null,arguments)});var dynCall_viiiiiiiiii=Module["dynCall_viiiiiiiiii"]=(function(){return Module["asm"]["dynCall_viiiiiiiiii"].apply(null,arguments)});var dynCall_viif=Module["dynCall_viif"]=(function(){return Module["asm"]["dynCall_viif"].apply(null,arguments)});var dynCall_diii=Module["dynCall_diii"]=(function(){return Module["asm"]["dynCall_diii"].apply(null,arguments)});var dynCall_fiiii=Module["dynCall_fiiii"]=(function(){return Module["asm"]["dynCall_fiiii"].apply(null,arguments)});var dynCall_iiiiii=Module["dynCall_iiiiii"]=(function(){return Module["asm"]["dynCall_iiiiii"].apply(null,arguments)});var dynCall_viiiffffffii=Module["dynCall_viiiffffffii"]=(function(){return Module["asm"]["dynCall_viiiffffffii"].apply(null,arguments)});var dynCall_vijii=Module["dynCall_vijii"]=(function(){return Module["asm"]["dynCall_vijii"].apply(null,arguments)});var dynCall_iiiii=Module["dynCall_iiiii"]=(function(){return Module["asm"]["dynCall_iiiii"].apply(null,arguments)});var dynCall_iiiif=Module["dynCall_iiiif"]=(function(){return Module["asm"]["dynCall_iiiif"].apply(null,arguments)});var dynCall_viiiifif=Module["dynCall_viiiifif"]=(function(){return Module["asm"]["dynCall_viiiifif"].apply(null,arguments)});var dynCall_iiiiiifiif=Module["dynCall_iiiiiifiif"]=(function(){return Module["asm"]["dynCall_iiiiiifiif"].apply(null,arguments)});var dynCall_viiii=Module["dynCall_viiii"]=(function(){return Module["asm"]["dynCall_viiii"].apply(null,arguments)});var dynCall_viiiii=Module["dynCall_viiiii"]=(function(){return Module["asm"]["dynCall_viiiii"].apply(null,arguments)});var dynCall_vif=Module["dynCall_vif"]=(function(){return Module["asm"]["dynCall_vif"].apply(null,arguments)});var dynCall_vid=Module["dynCall_vid"]=(function(){return Module["asm"]["dynCall_vid"].apply(null,arguments)});var dynCall_vij=Module["dynCall_vij"]=(function(){return Module["asm"]["dynCall_vij"].apply(null,arguments)});var dynCall_vii=Module["dynCall_vii"]=(function(){return Module["asm"]["dynCall_vii"].apply(null,arguments)});var dynCall_viiiif=Module["dynCall_viiiif"]=(function(){return Module["asm"]["dynCall_viiiif"].apply(null,arguments)});var dynCall_iiiiifiiii=Module["dynCall_iiiiifiiii"]=(function(){return Module["asm"]["dynCall_iiiiifiiii"].apply(null,arguments)});var dynCall_viifii=Module["dynCall_viifii"]=(function(){return Module["asm"]["dynCall_viifii"].apply(null,arguments)});var dynCall_fi=Module["dynCall_fi"]=(function(){return Module["asm"]["dynCall_fi"].apply(null,arguments)});var dynCall_viifif=Module["dynCall_viifif"]=(function(){return Module["asm"]["dynCall_viifif"].apply(null,arguments)});var dynCall_viiiifffiffi=Module["dynCall_viiiifffiffi"]=(function(){return Module["asm"]["dynCall_viiiifffiffi"].apply(null,arguments)});var dynCall_viiiffiffff=Module["dynCall_viiiffiffff"]=(function(){return Module["asm"]["dynCall_viiiffiffff"].apply(null,arguments)});var dynCall_viiiiiiii=Module["dynCall_viiiiiiii"]=(function(){return Module["asm"]["dynCall_viiiiiiii"].apply(null,arguments)});var dynCall_diiii=Module["dynCall_diiii"]=(function(){return Module["asm"]["dynCall_diiii"].apply(null,arguments)});var dynCall_iiiiifi=Module["dynCall_iiiiifi"]=(function(){return Module["asm"]["dynCall_iiiiifi"].apply(null,arguments)});var dynCall_viji=Module["dynCall_viji"]=(function(){return Module["asm"]["dynCall_viji"].apply(null,arguments)});var dynCall_iif=Module["dynCall_iif"]=(function(){return Module["asm"]["dynCall_iif"].apply(null,arguments)});var dynCall_viiiiiii=Module["dynCall_viiiiiii"]=(function(){return Module["asm"]["dynCall_viiiiiii"].apply(null,arguments)});var dynCall_viiiiiiiii=Module["dynCall_viiiiiiiii"]=(function(){return Module["asm"]["dynCall_viiiiiiiii"].apply(null,arguments)});var dynCall_iii=Module["dynCall_iii"]=(function(){return Module["asm"]["dynCall_iii"].apply(null,arguments)});var dynCall_fiiiif=Module["dynCall_fiiiif"]=(function(){return Module["asm"]["dynCall_fiiiif"].apply(null,arguments)});var dynCall_iij=Module["dynCall_iij"]=(function(){return Module["asm"]["dynCall_iij"].apply(null,arguments)});var dynCall_f=Module["dynCall_f"]=(function(){return Module["asm"]["dynCall_f"].apply(null,arguments)});var dynCall_jiiii=Module["dynCall_jiiii"]=(function(){return Module["asm"]["dynCall_jiiii"].apply(null,arguments)});var dynCall_viii=Module["dynCall_viii"]=(function(){return Module["asm"]["dynCall_viii"].apply(null,arguments)});var dynCall_viiiifi=Module["dynCall_viiiifi"]=(function(){return Module["asm"]["dynCall_viiiifi"].apply(null,arguments)});var dynCall_v=Module["dynCall_v"]=(function(){return Module["asm"]["dynCall_v"].apply(null,arguments)});var dynCall_viid=Module["dynCall_viid"]=(function(){return Module["asm"]["dynCall_viid"].apply(null,arguments)});var dynCall_viiiiff=Module["dynCall_viiiiff"]=(function(){return Module["asm"]["dynCall_viiiiff"].apply(null,arguments)});var dynCall_iiifiiiiii=Module["dynCall_iiifiiiiii"]=(function(){return Module["asm"]["dynCall_iiifiiiiii"].apply(null,arguments)});var dynCall_iiiifj=Module["dynCall_iiiifj"]=(function(){return Module["asm"]["dynCall_iiiifj"].apply(null,arguments)});var dynCall_vi=Module["dynCall_vi"]=(function(){return Module["asm"]["dynCall_vi"].apply(null,arguments)});var dynCall_iiiiiiiiiii=Module["dynCall_iiiiiiiiiii"]=(function(){return Module["asm"]["dynCall_iiiiiiiiiii"].apply(null,arguments)});var dynCall_ii=Module["dynCall_ii"]=(function(){return Module["asm"]["dynCall_ii"].apply(null,arguments)});var dynCall_viifi=Module["dynCall_viifi"]=(function(){return Module["asm"]["dynCall_viifi"].apply(null,arguments)});var dynCall_iiiiifiiiiii=Module["dynCall_iiiiifiiiiii"]=(function(){return Module["asm"]["dynCall_iiiiifiiiiii"].apply(null,arguments)});var dynCall_fffff=Module["dynCall_fffff"]=(function(){return Module["asm"]["dynCall_fffff"].apply(null,arguments)});var dynCall_iiifi=Module["dynCall_iiifi"]=(function(){return Module["asm"]["dynCall_iiifi"].apply(null,arguments)});var dynCall_viiif=Module["dynCall_viiif"]=(function(){return Module["asm"]["dynCall_viiif"].apply(null,arguments)});var dynCall_viiiffif=Module["dynCall_viiiffif"]=(function(){return Module["asm"]["dynCall_viiiffif"].apply(null,arguments)});var dynCall_iiiffii=Module["dynCall_iiiffii"]=(function(){return Module["asm"]["dynCall_iiiffii"].apply(null,arguments)});var dynCall_fiiiiii=Module["dynCall_fiiiiii"]=(function(){return Module["asm"]["dynCall_fiiiiii"].apply(null,arguments)});var dynCall_viffff=Module["dynCall_viffff"]=(function(){return Module["asm"]["dynCall_viffff"].apply(null,arguments)});var dynCall_iiii=Module["dynCall_iiii"]=(function(){return Module["asm"]["dynCall_iiii"].apply(null,arguments)});var dynCall_viifff=Module["dynCall_viifff"]=(function(){return Module["asm"]["dynCall_viifff"].apply(null,arguments)});var dynCall_iiiiiiifiif=Module["dynCall_iiiiiiifiif"]=(function(){return Module["asm"]["dynCall_iiiiiiifiif"].apply(null,arguments)});var dynCall_viiffiii=Module["dynCall_viiffiii"]=(function(){return Module["asm"]["dynCall_viiffiii"].apply(null,arguments)});var dynCall_iiif=Module["dynCall_iiif"]=(function(){return Module["asm"]["dynCall_iiif"].apply(null,arguments)});var dynCall_viiiffi=Module["dynCall_viiiffi"]=(function(){return Module["asm"]["dynCall_viiiffi"].apply(null,arguments)});var dynCall_viiifff=Module["dynCall_viiifff"]=(function(){return Module["asm"]["dynCall_viiifff"].apply(null,arguments)});var dynCall_iiiifiiiii=Module["dynCall_iiiifiiiii"]=(function(){return Module["asm"]["dynCall_iiiifiiiii"].apply(null,arguments)});var dynCall_viiiiiiiiiiii=Module["dynCall_viiiiiiiiiiii"]=(function(){return Module["asm"]["dynCall_viiiiiiiiiiii"].apply(null,arguments)});var dynCall_i=Module["dynCall_i"]=(function(){return Module["asm"]["dynCall_i"].apply(null,arguments)});var dynCall_viiffff=Module["dynCall_viiffff"]=(function(){return Module["asm"]["dynCall_viiffff"].apply(null,arguments)});var dynCall_iiiiiiiii=Module["dynCall_iiiiiiiii"]=(function(){return Module["asm"]["dynCall_iiiiiiiii"].apply(null,arguments)});var dynCall_iiiiif=Module["dynCall_iiiiif"]=(function(){return Module["asm"]["dynCall_iiiiif"].apply(null,arguments)});Runtime.stackAlloc=Module["stackAlloc"];Runtime.stackSave=Module["stackSave"];Runtime.stackRestore=Module["stackRestore"];Runtime.establishStackSpace=Module["establishStackSpace"];Runtime.setTempRet0=Module["setTempRet0"];Runtime.getTempRet0=Module["getTempRet0"];Module["asm"]=asm;Module["FS"]=FS;if(memoryInitializer){if(typeof Module["locateFile"]==="function"){memoryInitializer=Module["locateFile"](memoryInitializer)}else if(Module["memoryInitializerPrefixURL"]){memoryInitializer=Module["memoryInitializerPrefixURL"]+memoryInitializer}if(ENVIRONMENT_IS_NODE||ENVIRONMENT_IS_SHELL){var data=Module["readBinary"](memoryInitializer);HEAPU8.set(data,Runtime.GLOBAL_BASE)}else{addRunDependency("memory initializer");var applyMemoryInitializer=(function(data){if(data.byteLength)data=new Uint8Array(data);HEAPU8.set(data,Runtime.GLOBAL_BASE);if(Module["memoryInitializerRequest"])delete Module["memoryInitializerRequest"].response;removeRunDependency("memory initializer")});function doBrowserLoad(){Module["readAsync"](memoryInitializer,applyMemoryInitializer,(function(){throw"could not load memory initializer "+memoryInitializer}))}if(Module["memoryInitializerRequest"]){function useRequest(){var request=Module["memoryInitializerRequest"];if(request.status!==200&&request.status!==0){console.warn("a problem seems to have happened with Module.memoryInitializerRequest, status: "+request.status+", retrying "+memoryInitializer);doBrowserLoad();return}applyMemoryInitializer(request.response)}if(Module["memoryInitializerRequest"].response){setTimeout(useRequest,0)}else{Module["memoryInitializerRequest"].addEventListener("load",useRequest)}}else{doBrowserLoad()}}}function ExitStatus(status){this.name="ExitStatus";this.message="Program terminated with exit("+status+")";this.status=status}ExitStatus.prototype=new Error;ExitStatus.prototype.constructor=ExitStatus;var initialStackTop;var preloadStartTime=null;var calledMain=false;dependenciesFulfilled=function runCaller(){if(!Module["calledRun"])run();if(!Module["calledRun"])dependenciesFulfilled=runCaller};Module["callMain"]=Module.callMain=function callMain(args){args=args||[];ensureInitRuntime();var argc=args.length+1;function pad(){for(var i=0;i<4-1;i++){argv.push(0)}}var argv=[allocate(intArrayFromString(Module["thisProgram"]),"i8",ALLOC_NORMAL)];pad();for(var i=0;i0){return}preRun();if(runDependencies>0)return;if(Module["calledRun"])return;function doRun(){if(Module["calledRun"])return;Module["calledRun"]=true;if(ABORT)return;ensureInitRuntime();preMain();if(Module["onRuntimeInitialized"])Module["onRuntimeInitialized"]();if(Module["_main"]&&shouldRunNow)Module["callMain"](args);postRun()}if(Module["setStatus"]){Module["setStatus"]("Running...");setTimeout((function(){setTimeout((function(){Module["setStatus"]("")}),1);doRun()}),1)}else{doRun()}}Module["run"]=Module.run=run;function exit(status,implicit){if(implicit&&Module["noExitRuntime"]){return}if(Module["noExitRuntime"]){}else{ABORT=true;EXITSTATUS=status;STACKTOP=initialStackTop;exitRuntime();if(Module["onExit"])Module["onExit"](status)}if(ENVIRONMENT_IS_NODE){process["exit"](status)}Module["quit"](status,new ExitStatus(status))}Module["exit"]=Module.exit=exit;var abortDecorators=[];function abort(what){if(Module["onAbort"]){Module["onAbort"](what)}if(what!==undefined){Module.print(what);Module.printErr(what);what=JSON.stringify(what)}else{what=""}ABORT=true;EXITSTATUS=1;var extra="\nIf this abort() is unexpected, build with -s ASSERTIONS=1 which can give more information.";var output="abort("+what+") at "+stackTrace()+extra;if(abortDecorators){abortDecorators.forEach((function(decorator){output=decorator(output,what)}))}throw output}Module["abort"]=Module.abort=abort;if(Module["preInit"]){if(typeof Module["preInit"]=="function")Module["preInit"]=[Module["preInit"]];while(Module["preInit"].length>0){Module["preInit"].pop()()}}var shouldRunNow=true;if(Module["noInitialRun"]){shouldRunNow=false}run();return Module})};((function(){var engine=Engine;var USING_WASM=engine.USING_WASM;var DOWNLOAD_ATTEMPTS_MAX=4;var basePath=null;var engineLoadPromise=null;var loadingFiles={};function getBasePath(path){if(path.endsWith("/"))path=path.slice(0,-1);if(path.lastIndexOf(".")>path.lastIndexOf("/"))path=path.slice(0,path.lastIndexOf("."));return path}function getBaseName(path){path=getBasePath(path);return path.slice(path.lastIndexOf("/")+1)}Engine=function Engine(){this.rtenv=null;var gameInitPromise=null;var unloadAfterInit=true;var memorySize=268435456;var progressFunc=null;var pckProgressTracker={};var lastProgress={loaded:0,total:0};var canvas=null;var stdout=null;var stderr=null;this.initGame=(function(mainPack){if(!gameInitPromise){if(mainPack===undefined){if(basePath!==null){mainPack=basePath+".pck"}else{return Promise.reject(new Error("No main pack to load specified"))}}if(basePath===null)basePath=getBasePath(mainPack);gameInitPromise=Engine.initEngine().then(instantiate.bind(this)).then((function(){Benchmark["game-instantiated"]=performance.now()}));var gameLoadPromise=loadPromise(mainPack,pckProgressTracker).then((function(xhr){return xhr.response}));gameInitPromise=Promise.all([gameLoadPromise,gameInitPromise]).then((function(values){return new Uint8Array(values[0])}));if(unloadAfterInit)gameInitPromise.then(Engine.unloadEngine);requestAnimationFrame(animateProgress)}return gameInitPromise});function instantiate(initializer){Benchmark["engine-loaded"]=performance.now();var rtenvOpts={noInitialRun:true,thisProgram:getBaseName(basePath),engine:this};if(typeof stdout==="function")rtenvOpts.print=stdout;if(typeof stderr==="function")rtenvOpts.printErr=stderr;if(typeof WebAssembly==="object"&&initializer instanceof ArrayBuffer){rtenvOpts.instantiateWasm=(function(imports,onSuccess){Benchmark["wasm-instantiate-Start"]=performance.now();WebAssembly.instantiate(initializer,imports).then((function(result){Benchmark["wasm-instantiate-Finish"]=performance.now();onSuccess(result.instance)}));return{}})}else if(initializer.asm&&initializer.mem){rtenvOpts.asm=initializer.asm;rtenvOpts.memoryInitializerRequest=initializer.mem;rtenvOpts.TOTAL_MEMORY=memorySize}else{throw new Error("Invalid initializer")}return new Promise((function(resolve,reject){rtenvOpts.onRuntimeInitialized=resolve;rtenvOpts.onAbort=reject;rtenvOpts.engine.rtenv=Engine.RuntimeEnvironment(rtenvOpts)}))}this.start=(function(mainPack){var p=this.initGame(mainPack).then(synchronousStart.bind(this));Benchmark["started-downloads"]=performance.now();return p});function synchronousStart(pckView){Benchmark["game-loaded"]=performance.now();if(canvas instanceof HTMLCanvasElement){this.rtenv.canvas=canvas}else{var firstCanvas=document.getElementsByTagName("canvas")[0];if(firstCanvas instanceof HTMLCanvasElement){this.rtenv.canvas=firstCanvas}else{throw new Error("No canvas found")}}var actualCanvas=this.rtenv.canvas;var context=false;try{context=actualCanvas.getContext("webgl2")||actualCanvas.getContext("experimental-webgl2")}catch(e){}if(!context){throw new Error("WebGL 2 not available")}if(actualCanvas.tabIndex<0){actualCanvas.tabIndex=0}actualCanvas.style.padding=0;actualCanvas.style.borderWidth=0;actualCanvas.style.borderStyle="none";actualCanvas.addEventListener("webglcontextlost",(function(ev){alert("WebGL context lost, please reload the page");ev.preventDefault()}),false);this.rtenv.FS.createDataFile("/",this.rtenv.thisProgram+".pck",pckView,true,true,true);gameInitPromise=null;this.rtenv.callMain()}this.setProgressFunc=(function(func){progressFunc=func});function animateProgress(){var loaded=0;var total=0;var totalIsValid=true;var progressIsFinal=true;[loadingFiles,pckProgressTracker].forEach((function(tracker){Object.keys(tracker).forEach((function(file){if(!tracker[file].final)progressIsFinal=false;if(!totalIsValid||tracker[file].total===0){totalIsValid=false;total=0}else{total+=tracker[file].total}loaded+=tracker[file].loaded}))}));if(loaded!==lastProgress.loaded||total!==lastProgress.total){lastProgress.loaded=loaded;lastProgress.total=total;if(typeof progressFunc==="function")progressFunc(loaded,total)}if(!progressIsFinal)requestAnimationFrame(animateProgress)}this.setCanvas=(function(elem){canvas=elem});this.setAsmjsMemorySize=(function(size){memorySize=size});this.setUnloadAfterInit=(function(enabled){if(enabled&&!unloadAfterInit&&gameInitPromise){gameInitPromise.then(Engine.unloadEngine)}unloadAfterInit=enabled});this.setStdoutFunc=(function(func){var print=(function(text){if(arguments.length>1){text=Array.prototype.slice.call(arguments).join(" ")}func(text)});if(this.rtenv)this.rtenv.print=print;stdout=print});this.setStderrFunc=(function(func){var printErr=(function(text){if(arguments.length>1)text=Array.prototype.slice.call(arguments).join(" ");func(text)});if(this.rtenv)this.rtenv.printErr=printErr;stderr=printErr})};Engine.RuntimeEnvironment=engine.RuntimeEnvironment;Engine.initEngine=(function(newBasePath){if(newBasePath!==undefined)basePath=getBasePath(newBasePath);if(engineLoadPromise===null){if(USING_WASM){if(typeof WebAssembly!=="object")return Promise.reject(new Error("Browser doesn't support WebAssembly"));engineLoadPromise=loadPromise(basePath+".wasm").then((function(xhr){return xhr.response}))}else{var asmjsPromise=loadPromise(basePath+".asm.js").then((function(xhr){return asmjsModulePromise(xhr.response)}));var memPromise=loadPromise(basePath+".mem");engineLoadPromise=Promise.all([asmjsPromise,memPromise]).then((function(values){return{asm:values[0],mem:values[1]}}))}engineLoadPromise=engineLoadPromise.catch((function(err){engineLoadPromise=null;throw err}))}return engineLoadPromise});function asmjsModulePromise(module){var elem=document.createElement("script");var script=new Blob(["Engine.asm = (function() { var Module = {};",module,"return Module.asm; })();"]);var url=URL.createObjectURL(script);elem.src=url;return new Promise((function(resolve,reject){elem.addEventListener("load",(function(){URL.revokeObjectURL(url);var asm=Engine.asm;Engine.asm=undefined;setTimeout((function(){resolve(asm)}),1)}));elem.addEventListener("error",(function(){URL.revokeObjectURL(url);reject("asm.js faiilure")}));document.body.appendChild(elem)}))}Engine.unloadEngine=(function(){engineLoadPromise=null});function loadPromise(file,tracker){if(tracker===undefined)tracker=loadingFiles;return new Promise((function(resolve,reject){loadXHR(resolve,reject,file,tracker)}))}function loadXHR(resolve,reject,file,tracker){var xhr=new XMLHttpRequest;xhr.open("GET",file);if(!file.endsWith(".js")){xhr.responseType="arraybuffer"}["loadstart","progress","load","error","timeout","abort"].forEach((function(ev){xhr.addEventListener(ev,onXHREvent.bind(xhr,resolve,reject,file,tracker))}));Benchmark["["+file+"]-load-Start"]=performance.now();xhr.send()}function onXHREvent(resolve,reject,file,tracker,ev){if(this.status>=400){if(this.status<500||++tracker[file].attempts>=DOWNLOAD_ATTEMPTS_MAX){reject(new Error("Failed loading file '"+file+"': "+this.statusText));this.abort();return}else{loadXHR(resolve,reject,file)}}switch(ev.type){case"loadstart":if(tracker[file]===undefined){tracker[file]={total:ev.total,loaded:ev.loaded,attempts:0,"final":false}}break;case"progress":tracker[file].loaded=ev.loaded;tracker[file].total=ev.total;break;case"load":Benchmark["["+file+"]-load-Finish"]=performance.now();tracker[file].final=true;resolve(this);break;case"error":case"timeout":if(++tracker[file].attempts>=DOWNLOAD_ATTEMPTS_MAX){tracker[file].final=true;reject(new Error("Failed loading file '"+file+"'"))}else{loadXHR(resolve,reject,file)}break;case"abort":tracker[file].final=true;reject(new Error("Loading file '"+file+"' was aborted."));break}}}))() + + + diff --git a/third_party/webkit/PerformanceTests/wasm-godot/godot.pck b/third_party/webkit/PerformanceTests/wasm-godot/godot.pck new file mode 100644 index 0000000000..2c890d5a48 Binary files /dev/null and b/third_party/webkit/PerformanceTests/wasm-godot/godot.pck differ diff --git a/third_party/webkit/PerformanceTests/wasm-godot/index.html b/third_party/webkit/PerformanceTests/wasm-godot/index.html new file mode 100644 index 0000000000..d43882eac2 --- /dev/null +++ b/third_party/webkit/PerformanceTests/wasm-godot/index.html @@ -0,0 +1,397 @@ + + + + + + + + + + + +
        + + HTML5 canvas appears to be unsupported in the current browser.
        + Please try updating or use a different browser. +         +
        + + + +
        +
        +
        +
        + Benchmark (all times in msec): +
        +
        +
        +
        +

        Interactive is defined as the end of the first frame faster than 55 frames per second.

        +

        CPU time excludes dead time caused by requestAnimationFrame.

        +
        + + + + + + + + diff --git a/third_party/webkit/PerformanceTests/webaudio/README.md b/third_party/webkit/PerformanceTests/webaudio/README.md new file mode 100644 index 0000000000..8fd378b573 --- /dev/null +++ b/third_party/webkit/PerformanceTests/webaudio/README.md @@ -0,0 +1,13 @@ +# webaudio-benchmark + +## Run + +Just open `index.html`. Time are in milliseconds, lower is better. + +## Adding new benchmarks + +Look into `benchmarks.js`, it's pretty straightforward. + +## License + +MPL 2.0 diff --git a/third_party/webkit/PerformanceTests/webaudio/benchmarks.js b/third_party/webkit/PerformanceTests/webaudio/benchmarks.js new file mode 100644 index 0000000000..1d8f0e78bb --- /dev/null +++ b/third_party/webkit/PerformanceTests/webaudio/benchmarks.js @@ -0,0 +1,377 @@ +if (typeof(window) == "undefined") { + benchmarks = [] + registerTestFile = function() {} + registerTestCase = function(o) { return benchmarks.push(o.name); } +} + +registerTestFile({ sampleRate: 48000, url: "think-mono-48000.wav" }); +registerTestFile({ sampleRate: 44100, url: "think-mono-44100.wav" }); +registerTestFile({ sampleRate: 38000, url: "think-mono-38000.wav" }); +registerTestFile({ sampleRate: 48000, url: "think-stereo-48000.wav" }); +registerTestFile({ sampleRate: 44100, url: "think-stereo-44100.wav" }); +registerTestFile({ sampleRate: 38000, url: "think-stereo-38000.wav" }); + +registerTestCase({ + func: function () { + var oac = new OfflineAudioContext(1, DURATION * sampleRate, sampleRate); + return oac; + }, + name: "Empty testcase" +}); + +registerTestCase({ + func: function () { + var oac = new OfflineAudioContext(1, DURATION * sampleRate, sampleRate); + var source0 = oac.createBufferSource(); + source0.buffer = getSpecificFile({ sampleRate: oac.sampleRate, numberOfChannels: 1 }); + source0.loop = true; + source0.connect(oac.destination); + source0.start(0); + return oac; + }, + name: "Simple source test without resampling" +}); + +registerTestCase({ + func: function() { + var oac = new OfflineAudioContext(2, DURATION * sampleRate, sampleRate); + var source0 = oac.createBufferSource(); + source0.buffer = getSpecificFile({ sampleRate: oac.sampleRate, numberOfChannels: 2 }); + source0.loop = true; + source0.connect(oac.destination); + source0.start(0); + return oac; + }, + name: "Simple source test without resampling (Stereo)" +}); + +registerTestCase({ + func: function () { + var oac = new OfflineAudioContext(2, DURATION * sampleRate, sampleRate); + var source0 = oac.createBufferSource(); + var panner = oac.createPanner(); + source0.buffer = getSpecificFile({ sampleRate: oac.sampleRate, numberOfChannels: 2 }); + source0.loop = true; + panner.setPosition(1, 2, 3); + panner.setOrientation(10, 10, 10); + source0.connect(panner); + panner.connect(oac.destination); + source0.start(0); + return oac; + }, + name: "Simple source test without resampling (Stereo and positional)" +}); + +registerTestCase({ + func: function() { + var oac = new OfflineAudioContext(1, DURATION * sampleRate, sampleRate); + var source0 = oac.createBufferSource(); + source0.buffer = getSpecificFile({ sampleRate: 38000, numberOfChannels: 1 }); + source0.loop = true; + source0.connect(oac.destination); + source0.start(0); + return oac; + }, + name: "Simple source test with resampling (Mono)" +}); + +registerTestCase({ + func: function() { + var oac = new OfflineAudioContext(2, DURATION * sampleRate, sampleRate); + var source0 = oac.createBufferSource(); + source0.buffer = getSpecificFile({ sampleRate: 38000, numberOfChannels: 2 }); + source0.loop = true; + source0.connect(oac.destination); + source0.start(0); + return oac; + }, + name: "Simple source test with resampling (Stereo)" +}); + +registerTestCase({ + func: function() { + var oac = new OfflineAudioContext(2, DURATION * sampleRate, sampleRate); + var source0 = oac.createBufferSource(); + var panner = oac.createPanner(); + source0.buffer = getSpecificFile({ sampleRate: 38000, numberOfChannels: 2 }); + source0.loop = true; + panner.setPosition(1, 2, 3); + panner.setOrientation(10, 10, 10); + source0.connect(panner); + panner.connect(oac.destination); + source0.start(0); + return oac; + }, + name: "Simple source test with resampling (Stereo and positional)" +}); + +registerTestCase({ + func: function() { + var oac = new OfflineAudioContext(2, DURATION * sampleRate, sampleRate); + var source0 = oac.createBufferSource(); + source0.buffer = getSpecificFile({ sampleRate: oac.sampleRate, numberOfChannels: 1 }); + source0.loop = true; + source0.connect(oac.destination); + source0.start(0); + return oac; + }, + name: "Upmix without resampling (Mono -> Stereo)" +}); + +registerTestCase({ + func: function() { + var oac = new OfflineAudioContext(1, DURATION * sampleRate, sampleRate); + var source0 = oac.createBufferSource(); + source0.buffer = getSpecificFile({ sampleRate: oac.sampleRate, numberOfChannels: 2 }); + source0.loop = true; + source0.connect(oac.destination); + source0.start(0); + return oac; + }, + name: "Downmix without resampling (Stereo -> Mono)" +}); + +registerTestCase({ + func: function() { + var duration_adjusted = DURATION / 4; + var oac = new OfflineAudioContext(2, duration_adjusted * sampleRate, sampleRate); + for (var i = 0; i < 100; i++) { + var source0 = oac.createBufferSource(); + source0.buffer = getSpecificFile({ sampleRate: 38000, numberOfChannels: 1 }); + source0.loop = true; + source0.connect(oac.destination); + source0.start(0); + } + return oac; + }, + name: "Simple mixing (100x same buffer)" +}); + +registerTestCase({ + func: function() { + var duration_adjusted = DURATION / 4; + var oac = new OfflineAudioContext(2, duration_adjusted * sampleRate, sampleRate); + var reference = getSpecificFile({ sampleRate: 38000, numberOfChannels: 1 }).getChannelData(0); + for (var i = 0; i < 100; i++) { + var source0 = oac.createBufferSource(); + // copy the buffer into the a new one, so we know the implementation is not + // sharing them. + var b = oac.createBuffer(1, reference.length, 38000); + var data = b.getChannelData(0); + for (var j = 0; j < b.length; j++) { + data[i] = reference[i]; + } + source0.buffer = b; + source0.loop = true; + source0.connect(oac.destination); + source0.start(0); + } + return oac; + }, + name: "Simple mixing (100 different buffers)" +}); + +registerTestCase({ + func: function() { + var oac = new OfflineAudioContext(2, DURATION * sampleRate, sampleRate); + var gain = oac.createGain(); + gain.gain.value = -1; + gain.connect(oac.destination); + var gainsi = []; + for (var i = 0; i < 4; i++) { + var gaini = oac.createGain(); + gaini.gain.value = 0.25; + gaini.connect(gain); + gainsi[i] = gaini + } + for (var j = 0; j < 2; j++) { + var sourcej = oac.createBufferSource(); + sourcej.buffer = getSpecificFile({ sampleRate: 38000, numberOfChannels: 1 }); + sourcej.loop = true; + sourcej.start(0); + for (var i = 0; i < 4; i++) { + var gainij = oac.createGain(); + gainij.gain.value = 0.5; + gainij.connect(gainsi[i]); + sourcej.connect(gainij); + } + } + return oac; + }, + name: "Simple mixing with gains" +}); + +registerTestCase({ + func: function() { + var duration_adjusted = DURATION / 8; + var oac = new OfflineAudioContext(1, duration_adjusted * sampleRate, sampleRate); + var i,l; + var decay = 10; + var duration = 4; + var len = sampleRate * duration; + var buffer = ac.createBuffer(2, len, oac.sampleRate) + var iL = buffer.getChannelData(0) + var iR = buffer.getChannelData(1) + // Simple exp decay loop + for(i=0,l=buffer.length;i + + + + + + + +
        +Loading assets + +
        +
        + +
        + + Benchmark in progress... +
        +
        +
        +
        + + diff --git a/third_party/webkit/PerformanceTests/webaudio/think-mono-38000.wav b/third_party/webkit/PerformanceTests/webaudio/think-mono-38000.wav new file mode 100644 index 0000000000..953127bde5 Binary files /dev/null and b/third_party/webkit/PerformanceTests/webaudio/think-mono-38000.wav differ diff --git a/third_party/webkit/PerformanceTests/webaudio/think-mono-44100.wav b/third_party/webkit/PerformanceTests/webaudio/think-mono-44100.wav new file mode 100644 index 0000000000..22c1ad6a04 Binary files /dev/null and b/third_party/webkit/PerformanceTests/webaudio/think-mono-44100.wav differ diff --git a/third_party/webkit/PerformanceTests/webaudio/think-mono-48000.wav b/third_party/webkit/PerformanceTests/webaudio/think-mono-48000.wav new file mode 100644 index 0000000000..87be7e5a18 Binary files /dev/null and b/third_party/webkit/PerformanceTests/webaudio/think-mono-48000.wav differ diff --git a/third_party/webkit/PerformanceTests/webaudio/think-mono.wav b/third_party/webkit/PerformanceTests/webaudio/think-mono.wav new file mode 100644 index 0000000000..553a1f3b2b Binary files /dev/null and b/third_party/webkit/PerformanceTests/webaudio/think-mono.wav differ diff --git a/third_party/webkit/PerformanceTests/webaudio/think-stereo-38000.wav b/third_party/webkit/PerformanceTests/webaudio/think-stereo-38000.wav new file mode 100644 index 0000000000..ab2a7c4271 Binary files /dev/null and b/third_party/webkit/PerformanceTests/webaudio/think-stereo-38000.wav differ diff --git a/third_party/webkit/PerformanceTests/webaudio/think-stereo-44100.wav b/third_party/webkit/PerformanceTests/webaudio/think-stereo-44100.wav new file mode 100644 index 0000000000..017e0cb241 Binary files /dev/null and b/third_party/webkit/PerformanceTests/webaudio/think-stereo-44100.wav differ diff --git a/third_party/webkit/PerformanceTests/webaudio/think-stereo-48000.wav b/third_party/webkit/PerformanceTests/webaudio/think-stereo-48000.wav new file mode 100644 index 0000000000..69175381f0 Binary files /dev/null and b/third_party/webkit/PerformanceTests/webaudio/think-stereo-48000.wav differ diff --git a/third_party/webkit/PerformanceTests/webaudio/update.sh b/third_party/webkit/PerformanceTests/webaudio/update.sh new file mode 100755 index 0000000000..773def3e34 --- /dev/null +++ b/third_party/webkit/PerformanceTests/webaudio/update.sh @@ -0,0 +1,14 @@ +#!/bin/sh + +usage() { + echo "Usage:" + echo "\t$0" /path/to/webaudio-benchmarks + exit 1 +} + +if [ $# != "1" ] +then + usage $0 +fi + +cp $1/* . diff --git a/third_party/webkit/PerformanceTests/webaudio/webaudio-bench.js b/third_party/webkit/PerformanceTests/webaudio/webaudio-bench.js new file mode 100644 index 0000000000..b4fb99612b --- /dev/null +++ b/third_party/webkit/PerformanceTests/webaudio/webaudio-bench.js @@ -0,0 +1,240 @@ +if (window.AudioContext == undefined) { + window.AudioContext = window.webkitAudioContext; + window.OfflineAudioContext = window.webkitOfflineAudioContext; +} + +$ = document.querySelectorAll.bind(document); + +let DURATION = null; +if (location.search) { + let duration = location.search.match(/rendering-buffer-length=(\d+)/); + if (duration) { + DURATION = duration[1]; + } else { + DURATION = 120; + } +} else { + DURATION = 120; +} + + +// Global sample rate at which we run the context. +var sampleRate = 48000; +// Array containing at first the url of the audio resources to fetch, and the +// the actual buffers audio buffer we have at our disposal to for tests. +var sources = []; +// Array containing the results, for each benchmark. +var results = []; +// Array containing the offline contexts used to run the testcases. +var testcases = []; +// Array containing the functions that can return a runnable testcase. +var testcases_registered = []; +// Array containing the audio buffers for each benchmark +var buffers = []; +var playingSource = null; +// audiocontext used to play back the result of the benchmarks +var ac = new AudioContext(); + +function getFile(source, callback) { + var request = new XMLHttpRequest(); + request.open("GET", source.url, true); + request.responseType = "arraybuffer"; + + request.onload = function() { + // decode buffer at its initial sample rate + var ctx = new OfflineAudioContext(1, 1, source.sampleRate); + + ctx.decodeAudioData(request.response, function(buffer) { + callback(buffer, undefined); + }, function() { + callback(undefined, "Error decoding the file " + source.url); + }); + } + request.send(); +} + +function recordResult(result) { + results.push(result); +} + +function benchmark(testcase, ended) { + var context = testcase.ctx; + var start; + + context.oncomplete = function(e) { + var end = Date.now(); + recordResult({ + name: testcase.name, + duration: end - start, + buffer: e.renderedBuffer + }); + ended(); + }; + + start = Date.now(); + context.startRendering(); +} + +function getMonoFile() { + return getSpecificFile({ numberOfChannels: 1 }); +} + +function getStereoFile() { + return getSpecificFile({ numberOfChannels: 2 }); +} + +function matchIfSpecified(a, b) { + if (b) { + return a == b; + } + return true; +} + +function getSpecificFile(spec) { + for (var i = 0 ; i < sources.length; i++) { + if (matchIfSpecified(sources[i].numberOfChannels, spec.numberOfChannels) && + matchIfSpecified(sources[i].sampleRate, spec.sampleRate)) { + return sources[i]; + } + } + + throw new Error("Could not find a file that matches the specs."); +} + +function allDone() { + document.getElementById("in-progress").style.display = "none"; + var result = document.getElementById("results"); + var str = ""; + var buffers_base = buffers.length; + var product_of_durations = 1.0; + + for (var i = 0 ; i < results.length; i++) { + var r = results[i]; + product_of_durations *= r.duration; + str += "" + + ""+ + ""+ + "" + +""; + buffers[buffers_base + i] = r.buffer; + } + recordResult({ + name: "Geometric Mean", + duration: Math.round(Math.pow(product_of_durations, 1.0/results.length)), + buffer: {} + }); + str += "
        Test nameTime in msSpeedup vs. realtimeSound
        " + r.name + "" + r.duration + "" + Math.round((r.buffer.duration * 1000) / r.duration) + "x ("+r.buffer.duration+"s)
        "; + result.innerHTML += str; + result.addEventListener("click", function(e) { + var t = e.target; + if (t.dataset.soundindex != undefined) { + if (playingSource != null) { + playingSource.button.innerHTML = "Play"; + playingSource.onended = undefined; + playingSource.stop(0); + if (playingSource.button == t) { + playingSource = null; + return; + } + } + playingSource = ac.createBufferSource(); + playingSource.connect(ac.destination); + playingSource.buffer = buffers[t.dataset.soundindex]; + playingSource.start(0); + playingSource.button = t; + t.innerHTML = "Pause"; + playingSource.onended = function () { + playingSource = null; + } + } + }); + + document.getElementById("run-all").disabled = false; + + if (location.search.includes("raptor")) { + var _data = ['raptor-benchmark', 'webaudio', JSON.stringify(results)]; + window.postMessage(_data, '*'); + window.sessionStorage.setItem('benchmark_results', JSON.stringify(_data)); + } else { + var xhr = new XMLHttpRequest(); + xhr.open("POST", "/results", true); + xhr.setRequestHeader("Content-type", "application/x-www-form-urlencoded"); + xhr.send("results=" + JSON.stringify(results)); + } +} + +function runOne(i) { + benchmark(testcases[i], function() { + i++; + $("#progress-bar")[0].value++; + if (i < testcases.length) { + runOne(i); + } else { + allDone(); + } + }); +} + +function runAll() { + $("#progress-bar")[0].max = testcases_registered.length; + $("#progress-bar")[0].value = 0; + initAll(); + results = []; + runOne(0); +} + +function initAll() { + for (var i = 0; i < testcases_registered.length; i++) { + testcases[i] = {}; + testcases[i].ctx = testcases_registered[i].func(); + testcases[i].name = testcases_registered[i].name; + } +} + +function loadOne(i, endCallback) { + getFile(sources[i], function(buffer, err) { + if (err) { + throw new Error(msg); + } + + sources[i] = buffer; + i++; + + if (i < sources.length) { + loadOne(i, endCallback); + } else { + endCallback(); + } + }); +} + +function loadAllSources(endCallback) { + loadOne(0, endCallback); +} + +document.addEventListener("DOMContentLoaded", function() { + document.getElementById("run-all").addEventListener("click", function() { + document.getElementById("run-all").disabled = true; + document.getElementById("in-progress").style.display = "inline"; + runAll(); + }); + loadAllSources(function() { + // auto-run when running in raptor + document.getElementById("loading").remove(); + document.getElementById("controls").style.display = "block"; + if (location.search.includes("raptor")) { + document.getElementById("run-all").disabled = true; + document.getElementById("in-progress").style.display = "inline"; + setTimeout(runAll, 100); + } + }); +}); + +/* Public API */ +function registerTestCase(testCase) { + testcases_registered.push(testCase); +} + +function registerTestFile(url) { + sources.push(url); +} -- cgit v1.2.3