Adding upstream version 9.1.upstream/9.1upstream

Signed-off-by: Daniel Baumann <daniel.baumann@progress-linux.org>

1 files changed, 8058 insertions, 0 deletions

diff --git a/ChangeLog b/ChangeLog
new file mode 100644
index 0000000..20767ae
--- /dev/null
+++ b/ChangeLog
@@ -0,0 +1,8058 @@
+2022-04-15  Pádraig Brady  <P@draigBrady.com>
+
+	version 9.1
+	* NEWS: Record release date.
+
+2022-04-15  Pádraig Brady  <P@draigBrady.com>
+
+	doc: avoid unicode errors in texi conversion
+	Avoid "Unicode character U+#1 not supported, sorry" error
+	when converting from texi to dvi or pdf.
+
+	* doc/coreutils.texi (tr invocation): Avoid the @U{XXXX}
+	texi representation, as even though info and html can represent
+	these characters directly, there are conversion errors
+	for pdf and dvi.  Instead use the more abstract shell
+	$'\uXXXX' representation.
+
+2022-04-14  Pádraig Brady  <P@draigBrady.com>
+
+	build: copy: fix build on macos 10.12
+	* src/copy.c (copy_reg): Handle the case where CLONE_NOOWNERCOPY
+	is not defined.
+	Reported by Jeffrey Walton
+
+2022-04-13  Pádraig Brady  <P@draigBrady.com>
+
+	tail: detect closed stdout on Solaris
+	* src/tail.c (check_output_alive): Use poll() on Solaris.
+	Also handle POLLHUP, which Solaris returns in this case.
+	* tests/tail-2/pipe-f.sh: Use `head -n2` rather than `sed 2q`
+	as Solaris sed does not exit in this case.
+	* NEWS: Mention the improvement.
+	Reported by Bruno Haible.
+
+	maint: syntax-check: fix preprocessor indentation
+	* gl/lib/targetdir.h: Keep '#' at start of line.
+
+2022-04-13  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp,mv,install: omit an ‘inline’
+	* gl/lib/targetdir.c (target_directory_operand):
+	Omit unnecessary ‘inline’.
+
+	cp,mv,install: improve EACCES targetdir messages
+	This improves on the fix for --target-directory diagnostics bugs on
+	Solaris 11.  Problem reported by Bruno Haible and Pádraig Brady; see:
+	https://lists.gnu.org/r/coreutils/2022-04/msg00044.html
+	Also, omit some unnecessary stat calls.
+	* gl/lib/targetdir.c (target_directory_operand): If !O_DIRECTORY,
+	do not bother calling open if stat failed with errno != EOVERFLOW.
+	Rename is_a_dir to try_to_open since that’s closer to what it means.
+	If the open failed with EACCES and we used O_SEARCH, look at stat
+	results to see whether errno should be ENOTDIR for better diagnostics.
+	Treat EOVERFLOW as an “I don’t know whether it’s a directory and
+	there’s no easy way to find out” rather than as an error.
+
+	cp,mv,install: avoid excess stat calls on non-GNU
+	* gl/lib/targetdir.c (target_directory_operand): New arg ST.
+	All callers changed.
+	* src/cp.c (do_copy):
+	* src/mv.c (main):
+	Avoid unnecessary stat call if target_directory_operand already
+	got the status.
+
+	cp,mv,install: modularize targetdir
+	Move target directory code out of system.h to a new targetdir module.
+	This doesn’t change functionality.
+	* bootstrap.conf (gnulib_modules): Add targetdir.
+	* src/cp.c, src/install.c, src/mv.c: Include targetdir.h.
+	* src/system.h (must_be_working_directory, target_directory_operand)
+	(targetdir_dirfd_valid): Move from here ...
+	* gl/lib/targetdir.c, gl/lib/targetdir.h, gl/modules/targetdir:
+	... to these new files.
+
+2022-04-13  Pádraig Brady  <P@draigBrady.com>
+
+	cp,mv,install: avoid EACCES with non directory destination
+	* src/system.h (target_directory_operand): Also check with stat()
+	on systems with O_SEARCH, to avoid open("file", O_SEARCH|O_DIRECTORY)
+	returning EACCES rather than ENOTDIR, which was seen on Solaris 11.4
+	when operating on non dirs without execute bit set.
+	* NEWS: Remove related bug entry, as that issue was only introduced
+	after coreutils v9.0 was released.
+	Reported by Bruno Haible.
+
+	sync: support syncing files on cygwin
+	* src/sync.c (sync_arg): Similarly to AIX, Cygwin 2.9.0
+	was seen to need write access to have permission to sync a file.
+
+	tests: cygwin: handle ENOENT from execvp(".")
+	* tests/misc/env.sh: Verify with another command that
+	execvp() doesn not return ENOENT, before testing the
+	exit code from the command in question.
+	* tests/misc/nice-fail.sh: Likewise.
+	* tests/misc/stdbuf.sh: Likewise.
+	* tests/misc/timeout-parameters.sh: Likewise.
+
+	tests: env-S.pl: unset cygwin hardwired env vars
+	* tests/misc/env-S.pl: Unset SYSTEMROOT and WINDIR.
+
+2022-04-12  Pádraig Brady  <P@draigBrady.com>
+
+	tests: md5sum: fix false failures on cygwin
+	* tests/misc/md5sum-newline.pl: Avoid binary '*' tags when
+	comparing checksums.
+	* tests/misc/md5sum-bsd.sh: Avoid binary '*' tags so that we correctly
+	trigger the ambiguity test.
+	Reported by Bruno Haible
+
+2022-04-11  Pádraig Brady  <P@draigBrady.com>
+
+	tests: b2sum.sh: fix false failure on cygwin
+	* tests/misc/b2sum.sh: Avoid binary '*' tags when comparing checksums.
+	Reported by Bruno Haible
+
+	tests: dircolors.pl: avoid false failure with TERM=dumb
+	* tests/Coreutils.pm: Ensure an unset $TERM env var,
+	which is required on perl 5.22.2 on Solaris 11 OpenIndiana at least,
+	where TERM was being reset to 'dumb'.
+	Reported By Bruno Haible.
+
+	tests: printf-mb.sh: fix false failure with french translations
+	* tests/misc/printf-mb.sh: As per commit 04148c99c,
+	adjust non C warnings before comparison, to those of LC_MESSAGES=C.
+	Reported by Adam Sampson
+
+2022-04-10  Pádraig Brady  <P@draigBrady.com>
+
+	tests: stty.sh: skip on systems without perl
+	* init.cfg (stty_reversible_init_): Add require_perl_
+	to ensure we skip rather than error, without perl.
+
+2022-04-09  Pádraig Brady  <P@draigBrady.com>
+
+	cp,mv,install: avoid opening non directory destination
+	commit v9.0-66-ge2daa8f79 introduced an issue, for example
+	where cp could hang when overwriting a destination fifo,
+	when it would try to open() the fifo on systems
+	like Solaris 10 that didn't support the O_DIRECTORY flag.
+
+	This is still racy on such systems, but only in the
+	case where a directory is replaced by a fifo in
+	the small window between stat() and open().
+
+	* src/system.h (target_directory_operand): On systems without
+	O_DIRECTORY, ensure the file is a directory before attempting to open().
+	* tests/cp/special-f.sh: Protect cp with timeout(1),
+	as cp was seen to hang when trying to overwrite an existing fifo.
+	* NEWS: Mention the bug fix.
+
+2022-04-09  Pádraig Brady  <P@draigBrady.com>
+
+	doc: install --compare: clarify mode of operation
+	* doc/coreutils.texi (install invocation): For the --compare option,
+	clarify that the ownership or permissions of the source files don't
+	matter.  Also don't imply --owner or --group need to be specified
+	for --compare to be effective.
+	* src/install.c (usage): Add more detail on what's being compared.
+	Fixes https://bugs.gnu.org/50889
+
+2022-04-08  Pádraig Brady  <P@draigBrady.com>
+
+	doc: remove older ChangeLog items
+	* Makefile.am: Update the oldest documented version
+	to 8.27 which is now about 5 years old.
+
+2022-04-08  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: remove obsolete statat gnulib module
+	* bootstrap.conf (gnulib_modules): Remove statat.
+
+2022-04-07  Pádraig Brady  <P@draigBrady.com>
+
+	build: update gnulib submodule to latest
+	* gnulib: Update to latest
+	* src/copy.c: Replace deprecated {l,}statat(), with fstatat().
+	* src/cp.c: Likewise.
+	* src/install.c: Likewise.
+	* src/remove.c: Likewise.
+
+2022-04-04  Pádraig Brady  <P@draigBrady.com>
+
+	factor: improve support on RISCV and loongson
+	* src/longlong.h: Pull in RISCV fix and loongarch64 support from
+	https://gmplib.org/repo/gmp/log/tip/longlong.h
+
+2022-04-03  Pádraig Brady  <P@draigBrady.com>
+
+	doc: describe `dd iseek` as a feature not a change
+	* NEWS: Move description from "Changes in behavior"
+	to "New features".
+
+2022-04-03  Pádraig Brady  <P@draigBrady.com>
+
+	ls: avoid expensive capability lookup by default
+	Lookup of file-based capabilities adds 30% overhead to the common
+	case of ls --color usage.  Since the use of file capabilities is
+	very rare, it doesn't make sense to pay this cost in the common
+	case.  It's better to use getcap to inspect capabilities, and the
+	following run shows only 8 files using capabilities on my fedora
+	35 distro (14 years after the feature was introduced to the linux
+	kernel).
+
+	  $ getcap -r /
+	  /usr/bin/arping = cap_net_raw+p
+	  /usr/bin/clockdiff = cap_net_raw+p
+	  /usr/bin/gnome-keyring-daemon = cap_ipc_lock+ep
+	  /usr/bin/gnome-shell = cap_sys_nice+ep
+	  /usr/bin/newgidmap = cap_setgid+ep
+	  /usr/bin/newuidmap = cap_setuid+ep
+	  /usr/sbin/mtr-packet = cap_net_raw+ep
+	  /usr/sbin/suexec = cap_setgid,cap_setuid+ep
+
+	* src/dircolors.hin: Set "CAPABILITY" to "00", to indicate unused.
+	* src/ls.c: Set the default C_CAP color to not colored.
+	* NEWS: Mention the change in behavior.
+
+2022-04-03  Ville Skyttä  <ville.skytta@iki.fi>
+
+	dircolors: colorize backup files with bright black
+	* src/dircolors.hin: Add patterns for suffixes for "backup files".
+	The color used is so they stand out less than non-backup files,
+	and bright black works well on both light and dark backgrounds.
+	* THANKS.in: Remove duplicate.
+	Fixes https://bugs.gnu.org/54521
+
+2022-03-29  Pádraig Brady  <P@draigBrady.com>
+
+	doc: join: clarify that -e only effective for -12jo fields
+	* src/join.c (usage): Clarify that -e is not sufficient
+	to enable output of missing fields from one of the inputs.
+	Rather the -12jo options are required to explicitly
+	enable output of those fields.
+	Fixes https://bugs.gnu.org/54625
+
+2022-03-25  Pádraig Brady  <P@draigBrady.com>
+
+	maint: sync latest bootstrap from gnulib
+	* bootstrap: Should have updated this with the last gnulib update.
+
+2022-03-20  Pádraig Brady  <P@draigBrady.com>
+
+	tests: improve recent printf test
+	* tests/misc/printf-mb.sh: Given we shortcut the single char
+	(invalid multi-byte) case, add a case to ensure we're correctly
+	checking the return from mbrtowc().
+
+2022-03-19  Pádraig Brady  <P@draigBrady.com>
+
+	printf: support printing the numeric value of multi-byte chars
+	* src/printf.c (STRTOX): Update to support multi-byte chars.
+	* tests/misc/printf-mb.sh: Add a new test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the improvement.
+	Fixes https://bugs.gnu.org/54388
+
+2022-03-18  Pádraig Brady  <P@draigBrady.com>
+
+	maint: move build-related NEWS item to its own section
+	* NEWS: Follow other Build-related patterns in NEWS.
+
+2022-03-12  Pádraig Brady  <P@draigBrady.com>
+
+	doc: test: clarify that -rwx don't just check perm bits
+	* src/test.c (usage): State that -rwx is determined by
+	user access, rather than permission bits.
+	* doc/coreutils.texi (Access permission tests): Likewise.
+	* man/test.x [SEE ALSO]: access(2).
+	Fixes https://bugs.gnu.org/54338
+
+2022-03-07  Pádraig Brady  <P@draigBrady.com>
+
+	maint: address syntax-check issues in recent commit
+	* cfg.mk (sc_die_EXIT_FAILURE): Generalize to match any EXIT_ define,
+	and also relax to ignore error() usage with ternary operator.
+	* src/chroot.c (main): Use () to avoid the sc_error_quotes check.
+
+2022-03-07  Pádraig Brady  <P@draigBrady.com>
+
+	stat: only automount with --cached=never
+	Revert to the default behavior before the introduction of statx().
+
+	* src/stat.c (do_stat): Set AT_NO_AUTOMOUNT without --cached=never.
+	* doc/coreutils.texi (stat invocation): Mention the automount
+	behavior with --cached=never.
+	* NEWS: Mention the change in behavior.
+
+	Fixes https://bugs.gnu.org/54287
+
+2022-03-07  Rohan Sable  <rsable@redhat.com>
+
+	ls: avoid triggering automounts
+	statx() has different defaults wrt automounting
+	compared to stat() or lstat(), so explicitly
+	set the AT_NO_AUTOMOUNT flag to suppress that behavior,
+	and avoid unintended operations or potential errors.
+
+	* src/ls.c (do_statx): Pass AT_NO_AUTOMOUNT to avoid this behavior.
+	* NEWS: Mention the change in behavior.
+	Fixes https://bugs.gnu.org/54286
+
+2022-03-07  Pádraig Brady  <P@draigBrady.com>
+
+	build: ensure AT_NO_AUTOMOUNT is defined
+	update gnulib submodule to latest,
+	where this is the only change
+
+2022-03-05  Paul Eggert  <eggert@cs.ucla.edu>
+
+	date: fix newly-introduced %%-N bug
+	* src/date.c (adjust_resolution): Don’t mishandle %%-N.
+	* tests/misc/date.pl (pct-pct): New test.
+
+2022-02-25  Paul Eggert  <eggert@cs.ucla.edu>
+
+	chown: warn about USER.GROUP
+	Suggested by Dan Jacobson (Bug#44770).
+	* src/chown.c, src/chroot.c (main):
+	Issue warnings if obsolete USER.GROUP notation is present.
+
+	build: update gnulib submodule to latest
+
+2022-02-24  Pádraig Brady  <P@draigBrady.com>
+
+	fmt: fix invalid multi-byte splitting on macOS
+	On macOS, isspace(0x85) returns true,
+	which results in splitting within multi-byte characters.
+
+	* src/fmt.c (get_line): s/isspace/c_isspace/.
+	* tests/fmt/non-space.sh: Add a new test.
+	* tests/local.mk: Reference new test.
+	* NEWS: Mention the fix.
+	Addresses https://bugs.gnu.org/54124
+
+2022-02-24  Pádraig Brady  <P@draigBrady.com>
+
+	tests: improve compat with macOS
+	* tests/misc/wc-nbsp.sh: Only the en_US.iso8859-1 form
+	is accepted on macOS 10.15.7 at least.  GNU/Linux also
+	accepts ISO-8859-1 (and canonicalizes the charmap to this).
+
+2022-02-23  Paul Eggert  <eggert@cs.ucla.edu>
+
+	dd: counts ending in "B" now count bytes
+	This implements my suggestion in Bug#54112.
+	* src/dd.c (usage): Document the change.
+	(parse_integer, scanargs): Implement the change.
+	Omit some now-obsolete checks for invalid flags.
+	* tests/dd/bytes.sh: Test the new behavior, while retaining
+	checks for the now-obsolete usage.
+	* tests/dd/nocache_eof.sh: Avoid now-obsolete usage.
+
+2022-02-22  Paul Eggert  <eggert@cs.ucla.edu>
+
+	dd: improve doc relative to POSIX
+	* doc/coreutils.texi (dd invocation): Improve documentation,
+	clarifying whether features are extensions to POSIX.
+
+	dd: support iseek= and oseek=
+	Alias iseek=N to skip=N, oseek=N to seek=N (Bug#45648).
+	* src/dd.c (scanargs): Parse iseek= and oseek=.
+	* tests/dd/skip-seek.pl (sk-seek5): New test case.
+
+2022-02-21  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp: avoid unnecessary buffer allocation
+	Do not allocate I/O buffer if copy_file_range suffices.
+	* src/copy.c (sparse_copy, lseek_copy): Buffer arg is now char **
+	instead of char *, and buffer is now allocated only if needed.
+	All uses changed.
+
+2022-02-19  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+2022-02-15  Pádraig Brady  <P@draigBrady.com>
+
+	doc: env: fix man page reference of exec(2) to exec(3p)
+	* man/env.x: Change exec() reference from section 2 to 3p.
+
+2022-02-15  Pádraig Brady  <P@draigBrady.com>
+
+	doc: use bold style for man page references
+	It's more common to use bold style than not,
+	for references to other man pages.
+	Ideally each man page renderer would highlight references,
+	but currently some rely on styles in the page itself.
+
+	* man/help2man: Implement a --bold-refs option that
+	will mark up references like "name(1)" with bold
+	style around the "name" component.
+	* man/local.mk: Pass --bold-refs to our help2man unless disabled.
+	* configure.ac: Add a --disable-bold-man-page-references option.
+	Addresses https://bugs.gnu.org/53977
+
+2022-02-15  Pádraig Brady  <P@draigBrady.com>
+
+	dircolors: speed up processing of TERM entries
+	* src/dircolors.c (main): Avoid glob matching
+	when we've already matched in a group of {COLOR,}TERM entries.
+
+2022-02-15  Pádraig Brady  <P@draigBrady.com>
+
+	dircolors: consider COLORTERM as well as TERM env vars
+	COLORTERM is an environment used usually to expose truecolor support in
+	terminal emulators.  Therefore support matches on that in addition
+	to TERM.  Also set the default COLORTERM match pattern so that
+	we apply colors if COLORTERM is any value.
+
+	This implicitly supports a terminal like "foot"
+	without a need for an explicit TERM entry.
+
+	* NEWS: Mention the new feature.
+	* src/dircolors.c (main): Match COLORTERM like we do for TERM.
+	* src/dircolors.hin: Add default config to match any COLORTERM.
+	* tests/misc/dircolors.pl: Add test cases.
+
+2022-02-14  Paul Eggert  <eggert@cs.ucla.edu>
+
+	tr: mention multibyte problem in man page
+	* man/tr.x: Document tr problem.
+
+	tr: improve multibyte etc. doc
+	Problem reported by Dan Jacobson (Bug#48248).
+	* doc/coreutils.texi (tr invocation): Improve documentation for
+	tr's failure to support multibyte characters POSIX-style.
+	* doc/coreutils.texi (tr invocation), src/tr.c (usage):
+	Use terminology closer to POSIX's.
+
+2022-02-13  Pádraig Brady  <P@draigBrady.com>
+
+	dircolors: add --print-ls-colors to display colored entries
+	* NEWS: Mention the new feature.
+	* doc/coreutils.texi (dircolors invocation): Describe the new
+	--print-ls-colors option.
+	* src/dircolors.c (print_ls_colors): A new global to select
+	between shell or terminal output.
+	(append_entry): A new function refactored from dc_parse_stream()
+	to append the entry in the appropriate format.
+	(dc_parse_stream): Adjust to call append_entry().
+	* tests/misc/dircolors.pl: Add test cases.
+
+2022-02-13  Pádraig Brady  <P@draigBrady.com>
+
+	chown,chgrp: reinstate numeric id output in -v messages
+	since gnulib commit ff208d546a,
+	related to coreutils commit v9.0-143-gabde15969
+	we no longer maintain numeric IDs through chopt->{user,group}_name.
+	Therefore we need to adjust to ensure tests/chown/basic.sh passes.
+
+	* src/chown-core.c (uid_to_str, gid_to_str): New helper functions
+	to convert numeric id to string.
+	(change_file_owner): Use the above new functions to pass
+	numeric ids to describe_change().
+
+2022-02-13  Paul Eggert  <eggert@cs.ucla.edu>
+
+	sort: fix several version-sort problems
+	This also affects ls -v in some corner cases.
+	Problems reported by Michael Debertol <https://bugs.gnu.org/49239>.
+	While looking into this, I spotted some more areas where the
+	code and documentation did not agree, or where the documentation
+	was unclear.  In some cases I changed the code; in others
+	the documentation.  I hope things are nailed down better now.
+	* doc/sort-version.texi: Distinguish more carefully between
+	characters and bytes.  Say that non-identical strings can
+	compare equal, since they now can.  Improve readability in
+	various ways.  Make it clearer that a suffix can be the
+	entire string.
+	* src/ls.c (cmp_version): Fall back on strcmp if filevercmp
+	reports equality, since filevercmp is no longer a total order.
+	* src/sort.c (keycompare): Use filenvercmp, to treat NULs correctly.
+	* tests/misc/ls-misc.pl (v_files):
+	Adjust test to match new behavior.
+	* tests/misc/sort-version.sh: Add tests for stability,
+	and for sorting with NUL bytes.
+
+	build: update gnulib submodule to latest
+
+2022-02-12  Pádraig Brady  <P@draigBrady.com>
+
+	doc: avoid using "[" is URLS in --help output
+	* src/system.h (emit_ancillary_info): While supported if entered
+	  manually, the "[" character is not highlighted as part of a
+	  URL by default in terminals, so avoid using it.
+	  Addresses https://bugs.gnu.org/53946
+
+	doc: adust --help, --version alignment
+	* src/system.h: Adjust the alignment of the --help
+	and --version option descriptions, to start at column 21.
+	This better aligns with the descriptions of most commands,
+	and also aligns with the minimum column a description must
+	start at to ensure a blank line is not output when a description
+	follows an option on a line by itself.
+
+	doc: rmdir: improve --help formatting
+	* src/rmdir.c (usage): Move description to column 21,
+	so that a --long-option on its own line without a
+	trailing description, doesn't have an erroneous blank
+	line inserted between the option and description.
+	Also group descriptions with blank lines rather than indents,
+	so that man pages don't have erroneous blank lines
+	added within the description.
+	Addresses https://bugs.gnu.org/53946
+
+	doc: ls: reference dircolors(1) from --help
+	* src/ls.c (usage): s/dircolors/dircolors(1)/.
+	* man/ls.x [SEE ALSO]: Reference dircolors(1).
+	Addresses https://bugs.gnu.org/53946
+
+	doc: ls: improve --help formatting
+	* src/ls.c (usage): Use blank lines to group multi-line
+	option descriptions, rather than indenting.
+	This results in more consistent alignment of descriptions,
+	and also avoids erroneous new lines in generated in man pages.
+	Addresses https://bugs.gnu.org/53946
+
+2022-02-08  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: improve version-sort doc
+	* doc/coreutils.texi, doc/sort-version.texi:
+	Capitalize “Coreutils”.
+	* doc/sort-version.texi: Don’t emphasize natural sort so much,
+	since Coreutils has just version sort.
+	Use the term “lexicographic” instead of “alphabetic” or “standard”.
+	Suggest combining ‘V’ with ‘b’, and show why ‘b’ is needed.
+	Use shorter titles for sections, as GNU Emacs displays info poorly
+	when titles are too long to fit in a line.
+	Use @samp instead of @code for samples of data.
+	Do not use @samp{@code{...}}; @samp{...} should suffice and
+	double-nesting looks bad with Emacs.
+	Omit blank lines in examples that would not be present
+	in actual shell sessions.
+	Quote with `` and '', not with " or with '.
+	Mention dpkg --compare-versions more prominently.
+	Don’t rely on "\n" being equivalent to "\\n" in shell args.
+	Prefer Unicode name for hyphen-minus.
+
+2022-02-07  Christian Hesse  <mail@eworm.de>
+
+	dircolors: highlight .avif as image
+	This add highlighting for AV1 Image File Format (AVIF):
+	https://aomediacodec.github.io/av1-avif/
+
+	* src/dircolors.hin: Highlight .avif as image.
+
+2022-02-05  Paul Eggert  <eggert@cs.ucla.edu>
+
+	date: test against bug#50115
+	* tests/misc/date.pl: Add test.
+
+	build: update gnulib submodule to latest
+
+2022-02-05  Pádraig Brady  <P@draigBrady.com>
+
+	doc: fix somewhat ambiguous date format representation
+	* doc/coreutils.texi (date invocation): Remove @var{...} usage,
+	as that capitalizes in the representation and thus somewhat
+	ambiguates the format wrt Month and Minute.  This also avoids
+	a syntax check failure about redundant capitalization in @var{}.
+
+2022-02-05  Paul Eggert  <eggert@cs.ucla.edu>
+
+	date: improve doc
+	Problem reported by Dan Jacobson (Bug#51288).
+	* doc/coreutils.texi (date invocation, Setting the time)
+	(Options for date):
+	* src/date.c (usage): Improve doc.
+
+	build: update gnulib submodule to latest
+
+2022-02-04  Paul Eggert  <eggert@cs.ucla.edu>
+
+	id: print groups of listed name
+	Problem reported by Vladimir D. Seleznev (Bug#53631).
+	* src/id.c (main): Do not canonicalize user name before
+	deciding what groups the user belongs to.
+
+2022-02-01  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: add NEWS entry for recent cksum change
+	* NEWS (Changes in behavior): Add entry for commit v9.0-92-ga42a03913.
+
+2022-02-01  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: suppress bogus noreturn warnings
+	* configure.ac: Move the single-binary code before the
+	gcc-warnings code, so that the latter can depend on the former.
+	Suppress -Wsuggest-attribute=noreturn with single binaries,
+	to avoid diagnostics like the following:
+	  src/expr.c: In function 'single_binary_main_expr':
+	  error: function might be candidate for attribute 'noreturn'
+	Problem reported by Pádraig Brady in:
+	https://lists.gnu.org/r/coreutils/2022-01/msg00061.html
+
+	tr: pacify -fsanitizer=leak
+	* src/tr.c (main): Use main_exit, not return, in a couple of
+	places missed last time.
+
+	chgrp: fix typo in previous change
+	* src/chgrp.c (main): Use main_exit, not exit.
+
+	maint: mark some _Noreturn functions
+	* src/basenc.c (finish_and_exit, do_encode, do_decode):
+	* src/comm.c (compare_files):
+	* src/tsort.c (tsort):
+	* src/uptime.c (uptime):
+	Mark with _Noreturn.  Otherwise, unoptimized compilations may warn
+	that the calling renamed-main function doesn't return a value,
+	when !lint and when single-binary.
+
+	df: fix memory leak
+	* src/df.c (devlist_free): Remove.
+	(filter_mount_list): Free all of devlist, instead of merely
+	the entries in devlist_table.
+
+2022-01-31  Pádraig Brady  <P@draigBrady.com>
+
+	maint: cut: avoid exporting recently added variable
+	* src/cut.c: Make output_delimiter_default static,
+	as identified by `make syntax-check`.
+
+2022-01-31  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: pacify gcc -flto -Wmaybe-uninitialized
+	* gl/lib/xdectoint.c (__xnumtoint): Tell gcc that ‘error’
+	does not return here.
+	* gl/modules/xdectoint (Depends-on): Add stdbool, verify.
+
+	dd: do not access uninitialized
+	* src/dd.c (parse_integer): Avoid undefined behavior
+	that accesses an uninitialized ‘n’ when e == LONGINT_INVALID.
+	Return more-accurate error code when INTMAX_MAX < n.
+
+	uptime: simplify -fsanitize=leak pacification
+	* src/uptime.c (uptime): Exit here ...
+	(main): ... instead of here.
+
+	uniq: remove IF_LINT
+	* src/uniq.c (check_file): Remove a no-longer-needed IF_LINT.
+
+	unexpand: remove IF_LINT
+	* src/unexpand.c (unexpand): Remove a no-longer-needed IF_LINT.
+
+	pr: remove IF_LINT
+	* src/pr.c (read_line): Remove a no-longer-needed IF_LINT.
+
+	truncate: simplify
+	* src/truncate.c (do_ftruncate): Check != 0 instead of == -1.
+	Avoid a cast.
+	(main): Use C99 style decls after statements.
+	Simplify ‘open’ logic.
+
+2022-01-31  Paul Eggert  <eggert@cs.ucla.edu>
+
+	shred: remove IF_LINT
+	* src/shred.c (dopass): Remove a no-longer-needed IF_LINT.
+
+	(read_line): Remove an IF_LINT; no longer needed with
+	today’s GCC.
+
+2022-01-31  Paul Eggert  <eggert@cs.ucla.edu>
+
+	pr: simplify -fsanitize=leak pacification
+	* src/pr.c (main): Remove an IF_LINT.
+	Use main_exit rather than return.
+
+	pinky: simplify -fsanitize=leak pacification
+	* src/pinky.c (short_pinky): exit instead of freeing.
+
+	paste: remove IF_LINT
+	* src/paste.c (paste_parallel): Remove no-longer-needed IF_LINT.
+
+	hostname: simplify
+	* src/hostname.c (sethostname): Provide a substitute on all
+	platforms, to simplify the mainline code.
+	(main): Simplify.  Remove an IF_LINT.
+	Use main_exit rather than return.
+
+	factor: remove IF_LINT
+	* src/factor.c (factor_using_squfof) [USE_SQUFOF]:
+	Use plain assert (...), not IF_LINT (assert (...)).
+	This code is currently never compiled or executed,
+	so this is merely a symbolic cleanup.
+
+	expand: remove IF_LINT
+	* src/expand.c (expand): Remove no-longer-needed IF_LINT.
+
+	env: simplify -fsanitize=leak pacification
+	* src/env.c (unset_envvars): Remove IF_LINT code.
+	(main): Use main_exit, not return.
+
+	md5sum: remove IF_LINTs
+	* src/digest.c (digest_check): Remove IF_LINTs that are no longer
+	needed, as GCC has gotten smarter since 2008.
+
+	df: simplify -fsanitize=leak pacification
+	* src/df.c (print_table, main) [lint]: Omit unnecessary cleanup.
+	(main): Use main_exit, not return.
+
+	date: simplify -fsanitize=leak pacification
+	* src/date.c (main) [lint]: Omit unnecessary cleanup.
+	Use main_exit, not return.
+
+	cut: simplify and remove an IF_LINT
+	* src/cut.c (enum operating_mode, operating_mode)
+	(output_delimiter_specified, cut_stream):
+	Remove; no longer needed.
+	(output_delimiter_default): New static var.  Code can now
+	use ‘output_delimiter_string != output_delimiter_default’
+	instead of ‘output_delimiter_specified’.
+	(cut_file): New arg CUT_STREAM.  Caller changed.
+	(main): Simplify.  Coalesce duplicate code.  Redo to avoid need
+	for IF_LINT, or for the static var.  No need to xstrdup optarg.
+
+	cut: simplify -fsanitize=leak pacification
+	* src/set-fields.c (reset_fields): Remove, as it’s not needed for
+	-fsanitize=leak even when ‘lint’ is defined.  All uses removed.
+
+	cp: simplify GCC pacification
+	* src/cp.c (make_dir_parents_private): Remove IF_LINT code that is
+	no longer needed, as GCC has apparently gotten smarter since 2008.
+
+	chown: simplify -fsanitize=leak pacification
+	* src/chgrp.c, src/chown.c (main) [lint]: Omit unnecessary cleanup.
+	Use main_exit, not return.
+
+	basenc: simplify -fsanitize=leak pacification
+	* src/basenc.c (finish_and_exit): New function.
+	(do_encode, do_decode): Use it.  Accept new INFILE arg.  Remove
+	no-longer-needed IF_LINT code.  Exit when done.  Caller changed.
+
+	test: simplify gcc pacification
+	* src/test.c (get_mtime) [lint]: Omit ifdef lint code that is no
+	longer needed, as GCC has gotten smarter since 2005.
+
+	tail: simplify -fsanitize=leak pacification
+	Also, close a no-longer-needed file descriptor when falling
+	back from inotify.
+	* src/tail.c (tail_forever_inotify): Return void, not bool.  Exit
+	on fatal error, or on successful completion.  Accept an extra
+	argument pointing to a hash table that the caller should free on
+	non-fatal error; this simplifies cleanup.  Don’t bother setting
+	errno when returning.  Caller changed.
+	(main): Omit no-longer-needed IF_LINT code.  Close inotify
+	descriptor if inotify fails; this fixes a file descriptor leak and
+	means we needn’t call inotify_rm_watch.  Use main_exit, not return.
+
+	tac: simplify -fsanitize=leak pacification
+	* src/tac.c (main) [lint]: Omit unnecessary cleanup.
+	Use main_exit, not return.
+
+	shuf: simplify -fsanitize=leak pacification
+	* src/shuf.c (main) [lint]: Omit unnecessary cleanup.
+	Use main_exit, not return.
+
+	numfmt: simplify -fsanitize=leak pacification
+	* src/numfmt.c (main) [lint]: Omit unnecessary cleanup.
+	Use main_exit, not return.
+
+	mktemp: simplify -fsanitize=leak pacification
+	* src/mktemp.c (main) [lint]: Omit unnecessary cleanup.
+	Use main_exit, not return.
+
+	dd: simplify -fsanitize=leak pacification
+	* src/dd.c (cleanup) [lint]: Omit unnecessary cleanup.
+	(main): Use main_exit, not return.
+
+	cp: simplify cp/install/ln/mv pacification
+	* src/copy.c (dest_info_free, src_info_free) [lint]:
+	Remove.  All uses removed.
+	(copy_internal): Pacify only Clang and Coverity; GCC doesn’t need it.
+	* src/cp-hash.c (forget_all) [lint]: Remove.  All uses removed.
+	* src/cp.c, src/install.c, src/ln.c, src/mv.c (main):
+	Use main_exit, not return.
+
+	chmod: pacify -fsanitizer=leak
+	* src/chmod.c (main): Use main_exit, not return.
+
+	yes: pacify -fsanitizer=leak
+	* src/yes.c (main): Use main_exit, not return.
+
+	tsort: pacify -fsanitizer=leak
+	* src/tsort.c (detect_loop): Free removed successor.
+
+	sort: pacify -fsanitizer=leak
+	* src/sort.c (pipe_fork, keycompare, sort, main):
+	Remove lint code that no longer seems to be needed.
+	(sort): Unconditionally compile ifdef lint code that is needed
+	to free storage even when not linting.
+	(main): Use main_exit, not return.
+
+	split: pacify -fsanitizer=leak
+	* src/split.c (lines_rr): New arg FILESP.  All uses changed.
+	(main): Use main_exit, not return.  Omit unnecessary alignfree.
+
+	ptx: pacify -fsanitizer=leak
+	* src/ptx.c (unescape_string): Rename from copy_unescaped_string,
+	and unescape the string in place.  Callers changed.  This way,
+	we needn’t allocate storage and thus needn’t worry about
+	-fsanitizer=leak.
+
+	seq: pacify -fsanitizer=leak
+	* src/seq.c (seq_fast): If successful, exit rather than returning true.
+	Callers changed.
+	(main): Use main_exit, not return.
+
+	tsort: pacify -fsanitizer=leak
+	* src/tsort.c (struct item.balance): Now signed char to save space.
+	(struct item.printed): New member.
+	(new_item): Initialize k->printed to false.  Simplify via xzalloc.
+	(scan_zeros): Use k->printed rather than nulling out string.
+	(tsort): Move exiting code here ...
+	(main): ... from here.
+	(tsort) [lint]: Omit no-longer-needed code.  Instead, set head->printed.
+
+	tr: pacify -fsanitizer=leak
+	* src/tr.c (main): Use main_exit, not return.
+
+	stat: pacify -fsanitizer=leak
+	* src/stat.c (main):  Use main_exit, not return.
+
+	comm: pacify -fsanitizer=leak
+	* src/comm.c (compare_files): Move exiting code here ...
+	(main): ... from here, to pacify gcc -fsanitize=leak.
+
+	expr: lint cleanup, and introducing main_exit
+	This introduces a new macro main_exit, which is useful
+	for pacifying gcc -fsanitizer=lint and in some cases
+	means we can remove some ‘IF_LINT’ and ‘ifdef lint’ code.
+	* src/expr.c (main): Use main_exit, not return.
+	(docolon): Omit an IF_LINT that GCC no longer needs.
+	* src/system.h (main_exit): New macro.
+
+2022-01-30  Pádraig Brady  <P@draigBrady.com>
+
+	cksum: use more exact selection of digest algorithms
+	Use more constrained argument matching
+	to improve forward compatibility and robustness.
+
+	For example it's better that `cksum -a sha3` is _not_
+	equivalent to `cksum -a sha386`, so that a user
+	specifying `-a sha3` on an older cksum would not be surprised.
+
+	Also argmatch() is used when parsing tags from lines like:
+	SHA3 (filename) = abcedf....
+	so it's more robust that older cksum instances to fail
+	earlier in the parsing process, when parsing output from
+	possible future cksum implementations that might support SHA3.
+
+	* src/digest.c (algorithm_from_tag): Use argmatch_exact()
+	to ensure we don't match abbreviated algorithms.
+	(main): Likewise.
+	* tests/misc/cksum-a.sh: Add a test case.
+
+2022-01-30  Pádraig Brady  <P@draigBrady.com>
+
+	build: update gnulib submodule to latest
+	To provide argmatch_exact() that does not
+	use abbreviated matching, to be used by cksum.
+
+2022-01-30  Paul Eggert  <eggert@cs.ucla.edu>
+
+	mv: when installing to dir use dir-relative names
+	When the destination for mv is a directory, use functions like openat
+	to access the destination files, when such functions are available.
+	This should be more efficient and should avoid some race conditions.
+	Likewise for 'install'.
+	* src/cp.c (must_be_working_directory, target_directory_operand)
+	(target_dirfd_valid): Move from here ...
+	* src/system.h: ... to here, so that install and mv can use them.
+	Make them inline so GCC doesn’t complain.
+	* src/install.c (lchown) [HAVE_LCHOWN]: Remove; no longer needed.
+	(need_copy, copy_file, change_attributes, change_timestamps)
+	(install_file_in_file, install_file_in_dir):
+	New args for directory-relative names.  All uses changed.
+	Continue to pass full names as needed, for diagnostics and for
+	lower-level functions that do not support directory-relative names.
+	(install_file_in_dir): Update *TARGET_DIRFD as needed.
+	(main): Handle target-directory in the new, cp-like way.
+	* src/mv.c (remove_trailing_slashes): Remove static var; now local.
+	(do_move): New args for directory-relative names.  All uses changed.
+	Continue to pass full names as needed, for diagnostics and for
+	lower-level functions that do not support directory-relative names.
+	(movefile): Remove; no longer needed.
+	(main): Handle target-directory in the new, cp-like way.
+	* tests/install/basic-1.sh:
+	* tests/mv/diag.sh: Adjust to match new diagnostic wording.
+
+	cp: fix comment typo
+
+2022-01-28  Pádraig Brady  <P@draigBrady.com>
+
+	doc: NEWS: explain _why_ copy_file_range() is used
+	* NEWS: Mention why we're making the change in behavior in cat(1).
+
+	build: update gnulib submodule to latest
+	To fix a syntax-check false failure
+
+2022-01-28  Paul Eggert  <eggert@cs.ucla.edu>
+
+	dd: synchronize output after write errors
+	Problem reported by Sworddragon (Bug#51345).
+	* src/dd.c (cleanup): Synchronize output unless dd has been interrupted.
+	(synchronize_output): New function, split out from dd_copy.
+	Update conversions_mask so synchronization is done at most once.
+	(main): Do not die with the output file open, since we want to be
+	able to synchronize it before exiting.  Synchronize output before
+	exiting.
+
+	dd: output final progress before syncing
+	Problem reported by Sworddragon (Bug#51482).
+	* src/dd.c (reported_w_bytes): New var.
+	(print_xfer_stats): Set it.
+	(dd_copy): Print a final progress report if useful before
+	synchronizing output data.
+
+2022-01-27  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cat: prefer copy_file_range to read+write
+	* src/cat.c (copy_cat): New function.
+	(main): Use it.
+
+	csplit: improve integer overflow checking
+	* src/csplit.c: Prefer signed integers to unsigned for sizes
+	when either will do.  Check for some unlikely overflows.
+	(INCR_SIZE): Remove; no longer used.
+	(free_buffer): Also free the arg, simplifying callers.
+	(get_new_buffer): Use xpalloc instead of computing new
+	size by hand.  Add ATTRIBUTE_DEALLOC.
+	(delete_all_files, close_output_file):
+	If unlink fails with ENOENT, treat it as success.
+	(close_output_file): If unlink fails, decrement count anyway.
+	(parse_repeat_count, parse_patterns): Check for int overflow.
+	(check_format_conv_type): Use signed format.
+
+	maint: simplify memory alignment
+	Use the new Gnulib modules alignalloc and xalignalloc
+	to simplify some memory allocation.
+	Also, fix some unlikely integer overflow problems.
+	* bootstrap.conf (gnulib_modules): Add alignalloc, xalignalloc.
+	* src/cat.c, src/copy.c, src/dd.c, src/shred.c, src/split.c:
+	Include alignalloc.h.
+	* src/cat.c (main):
+	* src/copy.c (copy_reg):
+	* src/dd.c (alloc_ibuf, alloc_obuf):
+	* src/shred.c (dopass):
+	* src/split.c (main):
+	Use alignalloc/xalignalloc/alignfree instead of doing page
+	alignment by hand.
+	* src/cat.c (main):
+	Check for integer overflow in page size calculations.
+	* src/dd.c (INPUT_BLOCK_SLOP, OUTPUT_BLOCK_SLOP, MAX_BLOCKSIZE):
+	(real_ibuf, real_obuf) [lint]:
+	Remove; no longer needed.
+	(cleanup) [lint]:
+	(scanargs): Simplify.
+	* src/ioblksize.h (io_blksize): Do not allow blocksizes largest
+	than the largest power of two that fits in idx_t and size_t.
+	* src/shred.c (PAGE_ALIGN_SLOP, PATTERNBUF_SIZE): Remove.
+
+	build: update gnulib submodule to latest
+
+	copy: remove unnecessary ‘free’
+	* src/copy.c (copy_reg): Remove a ‘free’ call that does nothing
+	because its argument is always a null pointer, starting with
+	2007-11-1608:31:15Z!jim@meyering.net.
+
+	dd: simplify conv=swab code
+	Simplify byte-swapping, so that the code no longer needs to
+	allocate a page before the input buffer.
+	* src/dd.c (SWAB_ALIGN_OFFSET, char_is_saved, saved_char): Remove.
+	All uses removed.
+	(INPUT_BLOCK_SLOP): Simplify to just page_size.
+	(alloc_ibuf, dd_copy): Adjust to new swab_buffer API.
+	(swab_buffer): New arg SAVED_BYTE, taking the place of the old
+	global variables.  Do not access BUF[-1].
+
+	dd: improve integer overflow checking
+	* src/dd.c: Prefer signed to unsigned types where either will do,
+	as this helps improve checking with gcc -fsanitize=undefined.
+	Limit the signed types to their intended ranges.
+	(MAX_BLOCKSIZE): Don’t exceed IDX_MAX - slop either.
+	(input_offset_overflow): Remove; overflow now denoted by negative.
+	(parse_integer): Return INTMAX_MAX on overflow, instead of unspecified.
+	Do not falsely report overflow for ‘00x99999999999999999999999999999’.
+	* tests/dd/misc.sh: New test for 00xBIG.
+	* tests/dd/skip-seek-past-file.sh: Adjust to new diagnostic wording.
+	New test for BIGxBIG.
+
+	shred: fix declaration typo
+	* gl/lib/randint.h (randint_all_new):
+	Do not declare with _GL_ATTRIBUTE_NONNULL (), as
+	the arg can be a null pointer.  This fixes a typo added in
+	2021-11-01T05:30:28Z!eggert@cs.ucla.edu.
+
+	cat: prefer signed to unsigned
+	* src/cat.c: Prefer signed to unsigned types
+	where either will do, as they allow for better
+	overflow checking at runtime.
+
+	cat: improve style
+	* cat.c: Improve style a bit, mostly by assuming C99-style
+	declarations after statements
+
+2022-01-27  Pádraig Brady  <P@draigBrady.com>
+
+	doc: csplit: clarify [OFFSET] syntax
+	* src/csplit.c (usage): Clarify that '+' prefix is optional on OFFSET.
+	* doc/coreutils.texi (csplit invocation): Likewise.
+	Fixes https://bugs.gnu.org/53574
+
+2022-01-15  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: allow readlinkat calls
+	Problem reported by Bernhard Voelker in:
+	https://lists.gnu.org/r/coreutils/2022-01/msg00026.html
+	* cfg.mk (sc_prohibit_readlink): Remove.  It’s OK to call
+	readlinkat to determine whether a file is a symbolic link.
+
+	cp: rely on Gnulib for copy_file_range workaround
+	Gnulib now replaces copy_file_range on buggy hosts
+	so there is no need for Coreutils to worry about the bug.
+	* src/copy.c: Do not include sys/utsname.h, xstrtol.h.
+	(functional_copy_file_range): Remove.  All uses now
+	simply call copy_file_range.
+
+	build: update gnulib submodule to latest
+
+2022-01-14  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: fix pluralization typo
+
+	cp: fix two typos in previous change
+	Somehow ‘make check’ didn’t catch these the first few times.
+	* src/copy.c (copy_dir): Don’t pass null pointer to
+	copy_internal where it now expects non-null if move mode.
+	* src/cp.c (make_dir_parents_private): Initialize *attr_list
+	before recentely-added quick return.
+
+	cp: omit unnecessary stat of destination
+	'cp A B' attempts to open B as a directory, to see whether to
+	write to B/A instead of to B.  In the common case where the
+	open fails with ENOENT, do not bother to stat B afterwards
+	since the stat should also fail with ENOENT.
+	* src/copy.c (copy_internal, copy): Change bool arg about
+	nonexistent destination to a 3-way int argument.  All callers changed.
+	(copy_internal): Do not bother to stat a destination already known
+	to not exist when following symlinks.
+
+2022-01-13  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+	cp: when copying to dir use dir-relative names
+	When copying to a directory, use functions like openat to access
+	the destination files, when such functions are available.  This
+	should be more efficient and should avoid some race conditions.
+	* bootstrap.conf (gnulib_modules): Add areadlinkat-with-size,
+	fchmodat, fchownat, mkdirat, mkfifoat, utimensat.
+	* src/copy.c (lchown) [!HAVE_LCHOWN]:
+	* src/copy.c, src/system.h (rpl_mkfifo, mkfifo) [!HAVE_MKFIFO]:
+	Remove.  All uses removed.
+	(utimens_symlink): Remove; we shouldn’t have to worry about
+	those obsolete systems any more.  All uses replaced by utimensat.
+	* src/copy.c (copy_dir, set_owner, fchmod_or_lchmod, copy_reg)
+	(same_file_ok, writable_destination, overwrite_ok, abandon_move)
+	(create_hard_link, src_is_dst_backup, copy_internal, copy):
+	* src/cp.c (make_dir_parents_private, re_protect):
+	New args for directory-relative names.  All uses changed.
+	Continue to pass full names as needed, for diagnostics and for
+	lower-level functions like qset_acl that do not support
+	directory-relative names.
+	* src/copy.c (copy_reg): Prefer readlinkat to lstatat for merely
+	checking whether a file is a symlink, to avoid EOVERFLOW issues.
+	(subst_suffix): New function.
+	(create_hard_link): Accept a null SRC_NAME as meaning that if it
+	is needed it needs to be constructed from SRC_RELNAME, DST_NAME,
+	and DST_RELNAME.
+	(source_is_dst_backup): Use subst_suffix instead of doing it by hand.
+	(copy_internal): Remember and use directory-relative names instead
+	of full names.
+	* src/cp.c (lchown) [!HAVE_LCHOWN]: Remove.  All uses removed.
+	(must_be_working_directory): New function.
+	(target_directory_operand): Simply take file name as arg,
+	and return a file descriptor or negative number on failure;
+	open with O_DIRECTORY to obtain any file descriptor.
+	All uses changed.
+	(target_dirfd_valid): New function.
+	(do_copy): Use these new functions to obtain a file descriptor
+	for any target directory, and use directory-relative names
+	for that directory.
+	(main): Omit no-longer-needed stat when --target-directory,
+	as do_copy now does this.
+	* src/ln.c (O_PATHSEARCH): Move from here ...
+	* src/system.h: ... to here.
+	* tests/cp/fail-perm.sh: Adjust to change in diagnostic wording,
+	and add a test for --no-target-directory.
+
+	cp: tweak internal name
+	* src/cp.c (do_copy): Omit confusingly-named local new_dest, since
+	there’s another var new_dst that means something quite different.
+
+2022-01-12  Daniel Knittl-Frank  <knittl89@googlemail.com>
+
+	scripts: fix typo in commit-msg git-hook script
+	Commit 2f438fa9f53250fb3c8b39a95eedd627b5569ca4 (basenc: A new program
+	complementary to base64/base32) introduced a typo in the list of allowed
+	commit message prefixes, accidentally changing "basename" to
+	"nbasename".  Revert it back to the correct "basename".
+
+2022-01-07  Paul Eggert  <eggert@cs.ucla.edu>
+
+	df: tiny simplification
+	* src/df.c (LOG_EQ): Remove.  All callers replaced by ==.
+
+2022-01-02  Pádraig Brady  <P@draigBrady.com>
+
+	maint: update all copyright year number ranges
+	Run "make update-copyright" and then...
+
+	* gnulib: Update to latest with copyright year adjusted.
+	* tests/init.sh: Sync with gnulib to pick up copyright year.
+	* bootstrap: Likewise.
+	* tests/sample-test: Adjust to use the single most recent year.
+
+2022-01-02  Pádraig Brady  <P@draigBrady.com>
+
+	build: update gnulib submodule to latest
+	mainly to get updated copyright year
+
+	* doc/fdl.texi: Sync from gnulib.
+	* .gitignore: Add lib/unictype, as bitmap.h therein is depended on
+	since gnulib commit f698ea71
+
+2021-12-31  Paul Eggert  <eggert@cs.ucla.edu>
+
+	date: new option --resolution
+	* NEWS, doc/coreutils.texi (Options for date): Mention this.
+	* src/date.c (RESOLUTION_OPTION): New constant.
+	(DEBUG_DATE_PARSING_OPTION): Rename from DEBUG_DATE_PARSING.
+	All uses changed.
+	(long_options, usage, main): Support --resolution.
+
+	date: %-N now means suppress extra digits
+	* NEWS, doc/coreutils.texi: Mention this.
+	* bootstrap.conf (gnulib_modules): Add gettime-res.
+	* src/date.c (res_width, adjust_resolution): New functions.
+	(main): Adjust %-N to be %9N, or whatever, before using it.
+
+	build: update gnulib submodule to latest
+
+	doc: Document , vs . in date --rfc-3339=ns
+
+	build: port to AIX 7.1
+	This fixes a porting bug introduced in
+	2019-08-12T03:29:00Z!bruno@clisp.org.
+	Problem discovered on AIX 7.1.
+	* src/local.mk (LDADD): Add $(LIB_MBRTOWC), since pretty much
+	every command uses quotearg or mbrtowc or whatever.
+	(src_sort_LDADD): Add $(LIBPMULTITHREAD) and
+	$(LIB_PTHREAD_SIGMASK) instead of $(LIBTHREAD).
+
+2021-12-28  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: be more careful about Perl
+	Problem reported by Serge Belyshev (Bug#52844).
+	* configure.ac (HAVE_PERL): Rely on latest Gnulib gl_PERL, which
+	sets gl_cv_prog_perl.
+
+	build: update gnulib submodule to latest
+
+2021-12-27  Max Filippov  <jcmvbkbc@gmail.com>
+
+	all: fix adjustment of /proc/$pid/cmdline by single binary
+	When configured with --enable-single-binary tools issue incorrect prctl:
+
+	  prctl(PR_SET_KEEPCAPS, ...)      = -1 EINVAL (Invalid argument)
+
+	PR_SET_MM_ARG_START is not a prctl 'option' parameter, it's 'arg2'
+	parameter for the option PR_SET_MM.  It also has to have 'arg4' and
+	'arg5' set to 0 explicitly, otherwise the kernel also returns -EINVAL.
+
+	* src/coreutils.c (launch_program): Fix prctl arguments.
+	* NEWS: Mention the improvement.
+	Fixes https://bugs.gnu.org/52800
+
+2021-12-24  Paul Eggert  <eggert@cs.ucla.edu>
+
+	ls: improve doc for =WHEN
+	* src/ls.c (usage): Improve clarity of =WHEN args (Bug#52782).
+
+	doc: colorize -> color
+	Living so close to Hollywood I know that "colorize"
+	means adding color to something that was already monochrome,
+	whereas "color" means to give color to something.
+	Coreutils apps color text instead of colorizing it.
+
+2021-12-20  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: update tests/init.sh from gnulib
+	* tests/init.sh: Sync from gnulib/tests/init.sh.
+	A recent gnulib update (4f497bf3c) missed this.
+
+2021-12-20  Jim Meyering  <meyering@fb.com>
+
+	maint: syntax-check requires "char const *", not "const char *"
+	* gl/lib/mbsalign.c (mbs_align_pad): Adjust.
+	* src/chroot.c (is_root): Adjust.
+	* src/digest.c (main): Adjust.
+	* src/relpath.c (buffer_or_output) Adjust.
+	* src/ls.c (print_name_with_quoting, get_color_indicator): Adjust.
+
+	maint: split a long line
+	* src/test.c (three_arguments): Split long line.
+
+	maint: commit-msg: compute UTF-8-aware line-length
+	* scripts/git-hooks/commit-msg: Count UTF-8 characters rather
+	than bytes to avoid erroneously rejecting as "longer than 72" a
+	log message line like the UTF-8 one for id.c just prior.  It has
+	77 bytes but only 67 characters.
+	(check_msg): Read in "utf8" mode. Also include actual length
+	in the diagnostic.
+	(main): Don't loop when stdout is redirected, as it is when
+	invoked via vc-dwim.
+	Paul Eggert reported privately both the error of counting bytes
+	rather than chars and the re_edit loop when failing via vc-dwim.
+
+2021-12-19  Paul Eggert  <eggert@cs.ucla.edu>
+
+	id: improve doc for when USER is omitted
+	* src/id.c (usage): “current user” → “current process” (Bug#52656).
+
+2021-12-18  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: use GNU style for spacing
+
+2021-12-16  Bruno Haible  <bruno@clisp.org>
+
+	build: non-recursive Automake in a less hacky way
+	* bootstrap.conf (gnulib_modules): Remove
+	non-recursive-gnulib-prefix-hack.
+	(gnulib_tool_option_extras): Add --automake-subdir.
+	(bootstrap_post_import_hook): No need to massage lib/gnulib.mk.
+
+2021-12-16  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update bootstrap to latest
+
+	build: update gnulib submodule to latest
+
+2021-12-15  Jim Meyering  <meyering@fb.com>
+
+	maint: factor.c: avoid new GCC 12 warning
+	* src/factor.c (millerrabin2): Mark as ATTRIBUTE_PURE,
+	per advice from GCC 12.
+
+2021-12-14  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+	* NEWS: Mention the bugfix.
+
+2021-12-10  Paul Eggert  <eggert@cs.ucla.edu>
+
+	mv: Bug#52410 fix
+	The recent Gnulib update fixed this bug reported by Vincent Vermilya.
+	* tests/mv/backup-dir.sh: Test for Bug#52410.
+
+	build: update gnulib submodule to latest
+
+2021-12-07  Paul Eggert  <eggert@cs.ucla.edu>
+
+	uname: port to recent macOS
+	Problem reported by Jakub Sokołowski (bug #52330).
+	* src/uname.c [__APPLE__]: Don’t include sys/syctl.h,
+	mach/machine.h, mach-o/arch.h.
+	(print_element_env): New function.  With __APPLE__, it defers to the
+	env var UNAME_MACHINE (if given) for uname -m, and similarly for -nrsv.
+	(main): Use it.  For -p with __APPLE__, rely on predefined macros
+	and omit any 64-bit indication, for compatibility with macOS uname.
+
+2021-11-22  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp: clone on macOS
+	* configure.ac: Check for fclonefileat.
+	* src/copy.c [HAVE_FCLONEFILEAT && !USE_XATTR]:
+	Include <sys/clonefile.h>.
+	(copy_reg): If possible, use fclonefileat to clone.
+
+2021-11-21  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp: streamline cloning by skipping fstat
+	* src/copy.c (copy_reg): Attempt clone_file before fstat of dest,
+	so that if clone_file succeeds we can skip the fstat.
+
+2021-11-20  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp: fix --preserve=ownership permissions bug
+	This fixes a bug that I introduced in
+	2006-12-06T19:44:08Z!eggert@cs.ucla.edu.
+	* src/copy.c (USE_XATTR): New macro.
+	(copy_reg): Use it to help the compiler.  Prefer open u+w to a
+	later chmod u=rw; u+r isn’t needed for xattr.  For the later u-r,
+	do only one (or zero) chmod calls instead of two (or one).
+	In the last chmod, respect the umask instead of ignoring it.
+	* tests/cp/preserve-mode.sh: Test for the bug.
+
+2021-11-19  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: prefer MAYBE_UNUSED
+	Prefer MAYBE_UNUSED to _GL_UNUSED, since the C2x syntax
+	will be [[maybe_unused]] at the start of the declaration,
+	and we want to look forward to that.  All uses of _GL_UNUSED
+	either changed to MAYBE_UNUSED, or (when not needed) removed.
+
+2021-11-18  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp: fix security context race
+	This fixes an issue introduced in the fix for Bug#11100.
+	* NEWS: Mention this.
+	* src/copy.c (copy_reg): Fix obscure bug where open-without-CREAT
+	failed with ENOENT and we forget to call set_process_security_ctx
+	before calling open-with-CREAT. Also, don’t bother to unlink
+	DST_NAME if open failed with ENOENT; and if unlink fails with
+	ENOENT, don’t consider that to be an error (someone else could
+	have removed the file for us, and that’s OK).  Also, don’t worry
+	about move mode, since we use O_EXCL|O_CREAT and so won’t open
+	an existing file.
+
+2021-11-17  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: update NEWS for macOS fix
+
+	cp: minor clarity tweak
+	* src/copy.c (copy_reg): Use cached data_copy_required.
+
+	cp: fix ptrdiff_t/ssize_t theoretical glitches
+	* src/copy.c (sparse_copy): Use system.h’s SSIZE_MAX.
+	Don’t assume SSIZE_MAX <= PTRDIFF_MAX.
+
+2021-11-16  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+	maint: fix nonnull decl
+	* gl/lib/randread.h (randread_new): Do not mark with
+	_GL_ATTRIBUTE_RETURNS_NONNULL, since it can return NULL.
+
+2021-11-15  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+2021-11-13  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid false failure in env-signal-handler.sh
+	* tests/misc/env-signal-handler.sh: Use retry_delay_ to
+	avoid a false failure under load, where env hasn't setup
+	the SIGINT handling before timeout(1) sends the SIGINT.
+	Fixes https://bugs.gnu.org/51793
+
+2021-11-01  Pádraig Brady  <P@draigBrady.com>
+
+	maint: fix recent syntax-check failures
+	* cfg.mk (exclude_file_name_regexp--sc_system_h_headers):
+	Add chown-core.h to the regexp, to better decouple from system.h.
+	* src/env.c: Remove minmax.h include already included in system.h.
+	* src/libstdbuf.c: Likewise.
+	* src/prog-fprintf.h: Remove doubled semicolon.
+
+2021-11-01  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: use minmax.h instead of rolling our own
+	* gl/lib/mbsalign.c, gl/lib/randread.c, src/system.h (MAX, MIN):
+	Remove; include minmax.h instead.
+	* gl/modules/mbsalign, gl/modules/randread (Depends-on): Add minmax.
+	* src/factor.c (MIN): Remove.
+
+	maint: add function attributes to .h files
+	Add _GL_ATTRIBUTE_NONNULL, _GL_ATTRIBUTE_MALLOC,
+	_GL_ATTRIBUTE_DEALLOC, _GL_ATTRIBUTE_DALLOC_FREE,
+	_GL_ATTRIBUTE_RETURNS_NONNULL to .h files when appropriate.
+	* gl/lib/mbsalign.h, gl/lib/randperm.h, src/chown-core.h:
+	Include stdlib.h, for the benefit of _GL_ATTRIBUTE_DALLOC_FREE.
+	* gl/lib/randread.c (randread_free_body): New static function.
+	(randread_new, randread_free): Use it.
+	* src/copy.c (valid_options): Remove assert that is no longer
+	needed because it is now checked statically.
+
+	maint: enable -Wsuggest-attribute=format
+	* configure.ac (WERROR_CFLAGS): Enable -Wsuggest-attribute=format
+	for lib/ and src/.
+	* src/copy.c (copy_attr_error, copy_attr_allerror):
+	Add ATTRIBUTE_FORMAT.
+	(copy_attr): Ignore -Wsuggest-attribute=format in the
+	small section of code that needs it ignored.
+	* src/test.c (test_syntax_error): Mark with ATTRIBUTE_FORMAT.
+	(binary_operator): Omit unnecessary NULL args, pacifying
+	-Wsuggest-attribute=format.
+
+	maint: modernize attribute usage
+	* src/system.h (__attribute__): Remove.  Replace all uses that
+	rely on this by _GL_ATTRIBUTE_xxx or ATTRIBUTE_xxx.
+	(ATTRIBUTE_WARN_UNUSED_RESULT): Remove.  Replace all uses by
+	NODISCARD.
+
+	maint: remove unused __attribute__ defn
+	* gl/lib/randread.c (__attribute__): Remove; no longer
+	used after the recent _Noreturn change.
+
+	b2sum: simplify attribute usage
+	* src/blake2/blake2.h (BLAKE2_PACKED): Simplify, and port better
+	to older GCC, by using _GL_ATTRIBUTE_PACKED.
+
+	maint: prefer attribute.h in .c files
+	This will help us make the transition to C2x, where some
+	attributes must come at the start of function decls.
+	Leave the attributes alone in .h files for now,
+	as the Gnulib tradition is to not expose attribute.h to users.
+	* bootstrap.conf (gnulib_modules): Add ‘attribute’.
+	* gl/lib/randperm.c, src/make-prime-list.c, src/system.h:
+	Include attribute.h.
+	* gl/lib/strnumcmp.c (strnumcmp): Remove _GL_ATTRIBUTE_PURE here,
+	as this belongs in the .h file.
+	* gl/lib/strnumcmp.h (strnumcmp): Add _GL_ATTRIBUTE_PURE here.
+	* src/sort.c (human_numcompare, numcompare): Now ATTRIBUTE_PURE;
+	discovered due to strnumcmp.h change.
+	* gl/lib/randperm.c, src/copy.c, src/dd.c, src/df.c, src/digest.c:
+	* src/env.c, src/expr.c, src/factor.c, src/ls.c:
+	* src/make-prime-list.c, src/numfmt.c, src/od.c, src/pathchk.c:
+	* src/pinky.c, src/pr.c, src/ptx.c, src/realpath.c, src/relpath.c:
+	* src/seq.c, src/sort.c, src/stat.c, src/stty.c, src/system.h:
+	* src/tr.c, src/uniq.c, src/wc.c:
+	In .c files, crefer ATTRIBUTE_CONST to _GL_ATTRIBUTE_CONST, and
+	similarly for ATTRIBUTE_FORMAT and ATTRIBUTE_PURE.
+	* src/system.h (FALLTHROUGH): Remove; attribute.h defines it.
+
+2021-10-31  Pádraig Brady  <P@draigBrady.com>
+
+	sort: --debug: add warnings about sign, radix, and grouping chars
+	New warnings are added related to the handling
+	of thousands grouping characters, decimal points, and sign characters.
+	Examples now diagnosed are:
+
+	$ printf '0,9\n1,a\n' | sort -nk1 --debug -t, -s
+	sort: key 1 is numeric and spans multiple fields
+	sort: field separator ‘,’ is treated as a group separator in numbers
+	1,a
+	_
+	0,9
+	___
+
+	$ printf '1,a\n0,9\n' | LC_ALL=fr_FR.utf8 sort -gk1 --debug -t, -s
+	sort: key 1 is numeric and spans multiple fields
+	sort: field separator ‘,’ is treated as a decimal point in numbers
+	0,9
+	___
+	1,a
+	__
+
+	$ printf '1.0\n0.9\n' | LC_ALL=fr_FR.utf8 sort -s -k1,1g --debug
+	sort: note numbers use ‘,’ as a decimal point in this locale
+	0.9
+	_
+	1.0
+	_
+
+	$ LC_ALL=fr_FR.utf8 sort -n --debug /dev/null
+	sort: text ordering performed using ‘fr_FR.utf8’ sorting rules
+	sort: note numbers use ‘,’ as a decimal point in this locale
+	sort: the multi-byte number group separator in this locale \
+	      is not supported
+
+	$ sort --debug -t- -k1n /dev/null
+	sort: key 1 is numeric and spans multiple fields
+	sort: field separator ‘-’ is treated as a minus sign in numbers
+	sort: note numbers use ‘.’ as a decimal point in this locale
+
+	$ sort --debug -t+ -k1g /dev/null
+	sort: key 1 is numeric and spans multiple fields
+	sort: field separator ‘+’ is treated as a plus sign in numbers
+	sort: note numbers use ‘.’ as a decimal point in this locale
+
+	* src/sort.c (key_warnings): Add the warnings above.
+	* tests/misc/sort-debug-warn.sh: Add test cases.
+	Also check that all sort invocations succeed.
+	* NEWS: Mention the improvement.
+	Addresses https://bugs.gnu.org/51011
+
+2021-10-31  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: modernize README-{hacking,prereq}
+
+2021-10-30  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp: revert unnecessary FreeBSD workaround
+	That was a false alarm due to a bug in FreeBSD 9.1 truss;
+	see Pádraig Brady’s report (Bug#51433#29).
+	* src/copy.c (lseek_copy, infer_scantype): Don’t bother checking
+	whether lseek returned -1.  This doesn’t entirely revert the
+	previous change, as it keeps the code simplification of the
+	previous change while reverting the check for -1.
+
+	cp: defend better against FreeBSD 9.1 zfs bug
+	Problem reported by Pádraig Brady (Bug#51433#14).
+	* src/copy.c (lseek_copy, infer_scantype): Report an error if
+	lseek with SEEK_DATA or SEEK_HOLE returns less than -1,
+	as this is an lseek bug.
+
+2021-10-22  Pádraig Brady  <P@draigBrady.com>
+
+	doc: say that printf(1) is preferred over echo(1)
+	* src/echo.c (usage): Say printf(1) is preferred
+	due to being more standard and robust.
+	* man/echo.x [SEE ALSO]: Reference printf(1).
+	* doc/coreutils.texi (echo invocation): Mention in the
+	summary that echo is not robust when outputting
+	any string, and that printf is preferred.
+	Also expand on the examples showing how to
+	output a single '-n' string.
+	Addresses https://bugs.gnu.org/51311
+
+2021-10-12  Pádraig Brady  <P@draigBrady.com>
+
+	doc: timeout --kill-after: clarify disabled timeouts
+	* doc/coreutils.texi (timeout invocation): Clarify
+	that -k is ignored if either its duration or the
+	main timeout duration is 0.
+	Addresses https://bugs.gnu.org/51128
+
+	timeout: ensure --foreground -k exits with status 137
+	* src/timeout.c (main): Propagate the killed status from the child.
+	* doc/coreutils.texi (timeout invocation): Remove the
+	description of the --foreground specific handling of SIGKILL,
+	now that it's consistent with the default mode of operation.
+	* tests/misc/timeout.sh: Add a test case.
+	* NEWS: Mention the change in behavior.
+	Fixes https://bugs.gnu.org/51135
+
+2021-10-11  Pádraig Brady  <P@draigBrady.com>
+
+	doc: timeout --foreground: add clarification on exit status
+	* doc/coreutils.texi (timeout invocation): Add detail on
+	how --foreground allows timeout(1) to use more standard
+	exit status as the uncatchable SIGKILL is not sent to itself.
+	Fixes https://bugs.gnu.org/51135
+
+2021-10-11  Paul Eggert  <eggert@cs.ucla.edu>
+
+	sort: fix unlikely bug when '\377' < 0
+	* gl/lib/strintcmp.c (strintcmp): Don’t assume that the input
+	cannot contain ((char) -1), as this equals '\377' when char is
+	signed (assuming 8-bit char).
+	* src/sort.c (decimal_point): Now char, to make it clear
+	that it’s always in char range now.
+	(NON_CHAR): New constant.
+	(traverse_raw_number): Return char not unsigned char;
+	this is simpler and could be faster.  All callers changed.
+	(main): Do not convert decimal_point and thousands_sep to
+	unsigned char, as this can mishandle comparisons on
+	machines where char is signed and the input data contains
+	((char) -1).  Use NON_CHAR, not -1, as an out-of-range value for
+	thousands_sep.
+
+2021-10-03  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+	maint: switch to C11-style _Noreturn
+	Use C11-style _Noreturn instead of the old ATTRIBUTE_NORETURN
+	macro.  This pacifies clang on OpenBSD 6.9, which otherwise
+	complains "'noreturn' function does return" in some places.
+	* gl/lib/randread.c, src/system.h (ATTRIBUTE_NORETURN):
+	Remove.  All uses either removed as GCC no longer needs them, or
+	changed to C11-style _Noreturn since Gnulib arranges for _Noreturn
+	globally nowadays.
+
+	ls: port to OpenBSD
+	Problem reported by Brian Callahan (Bug#50972).
+	* src/ls.c (decode_switches): Don’t assume __GNUC_PREREQ.
+
+2021-09-26  Pádraig Brady  <P@draigBrady.com>
+
+	doc: adjust ls --zero option order in texinfo
+	* doc/coreutils.texi (ls invocation - general output formatting):
+	The option ordering was not changed when the option was renamed
+	from --null to --zero.
+
+2021-09-25  Pádraig Brady  <P@draigBrady.com>
+
+	tests: cp/sparse-perf: make more robust and add zfs comments
+	* init.cfg (seek_data_capable_): Add a timeout to ensure failure for
+	slow lseek(...SEEK_DATA) calls (even if that syscall isn't interrupted).
+	* tests/cp/sparse-perf.sh: Run the SEEK_DATA check on the
+	1TiB empty file to exclude both FreeBSD 9.1 which takes 35s,
+	and ZFS which requires a delay of about 5s between file creation
+	and use of SEEK_DATA to correctly determine it's empty (return ENXIO).
+	Also remove the stat size checks as they invalidate the test
+	due to cp never writing data due to it being always zeros,
+	and thus converted to holes in the output.
+
+2021-09-24  Pádraig Brady  <P@draigBrady.com>
+
+	chmod: fix exit status when ignoring symlinks
+	* src/chmod.c: Reorder enum so CH_NOT_APPLIED
+	can be treated as a non error.
+	* tests/chmod/ignore-symlink.sh: A new test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the bug fix.
+	Fixes https://bugs.gnu.org/50784
+
+	maint: post-release administrivia
+	* NEWS: Add header line for next release.
+	* .prev-version: Record previous version.
+	* cfg.mk (old_NEWS_hash): Auto-update.
+
+	version 9.0
+	* NEWS: Record release date.
+
+	tests: sparse-perf: avoid false failure
+	* tests/cp/sparse-perf.sh: Avoid the case where
+	we saw SEEK_DATA take 35s to return a result
+	against a 1TB sparse file.  This happened on
+	a FreeBSD 9.1 VM at least.
+	Reported by Nelson H. F. Beebe.
+
+	cksum: fix -a crc on 64 bit big endian systems
+	* src/cksum.c (crc_sum_stream): On sparc64 for example,
+	a crc of 0 was printed due to mismatch in size of
+	variable copied between generator and output functions.
+	uint_fast32_t is generally 64 bits on 64 bit systems,
+	so we copy through an int to ensure we don't use the wrong
+	end of a 64 bit variable.
+	Reported by Nelson H. F. Beebe
+
+2021-09-21  Pádraig Brady  <P@draigBrady.com>
+
+	tail: fix detection of closed stdout on macOS
+	* bootstrap.conf: We only need poll on Linux and AIX
+	where poll is not replaced.  Also resinstate dependence
+	on select so we can use it unconditionally.
+	* src/tail.c (check_output_alive): Reinstate use of select()
+	by default as poll was seen to be ineffective for this
+	application on macOS.
+	Fixes https://bugs.gnu.org/50714
+
+	maint: clean up c++ style comments
+	* src/expand-common.h: Remove commented variables.
+	* src/remove.h: Change to C style comment.
+	* src/tail.c: Likewise.
+
+2021-09-20  Pádraig Brady  <P@draigBrady.com>
+
+	tests: date-debug: avoid a false failure on solaris
+	* tests/misc/date-debug.sh: Use a dynamic time format,
+	as the C locale on solaris uses %T rather than %H:%M:%S
+	for the time component.
+
+2021-09-20  Jim Meyering  <meyering@fb.com>
+
+	doc: drop extraneous single quotes in help
+	* src/digest.c (usage) [cksum --help]: Drop single quotes
+	around each checksum name.
+	* src/tee.c (usage) [tee --help]: Likewise.
+
+	cksum: list Pádraig as coauthor
+	* src/digest.c (AUTHORS) [HASH_ALGO_CKSUM]: Add Pádraig as
+	cksum coauthor.
+	* AUTHORS: Likewise.
+
+	tests: env-s.pl: avoid spurious failure on OS X
+	* tests/misc/env-S.pl: The __CF_USER_TEXT_ENCODING envvar
+	would cause many of these sub-tests to fail. Ignore it.
+
+2021-09-20  Pádraig Brady  <P@draigBrady.com>
+
+	build: update gnulib submodule to latest
+	* gnulib: Update to latest.
+	Fixes "extern inline" and "rpl_free" issues.
+
+	doc: fix --help formatting for checksum utils
+	* src/digest.c (usage): Indicate that --length and --algorithm
+	require arguments.  Emit corresponding emit_mandatory_arg_note().
+	Use consistent alignment.
+
+	cksum: support more transparent emulation of older utils
+	* src/digest.c: Allow using the --untagged option with --check,
+	so that `cksum -a md5 --untagged` used to emulate md5sum for example,
+	may be augmented with the --check option.  Also support the --tag
+	option with cksum, to allow overriding a previous --untagged setting.
+	* doc/coreutils.texi: Adjust accordingly.
+	* tests/misc/cksum-a.sh: Likewise.
+
+	tests: avoid rare race in tail-2/F-vs-rename.sh
+	* tests/tail-2/F-vs-rename.sh: Keep stdout and stderr separate,
+	so that interspersion doesn't impact regex checks.  Also wait
+	for each file's data to be printed to avoid multiple writes
+	to a file to be printed in a single iteration, which would
+	impact the regex checks.  Also we refactor the check function,
+	rather than repeatedly redefining variations.
+
+2021-09-17  Pádraig Brady  <P@draigBrady.com>
+
+	maint: remove duplicate from THANKS.in
+	* THANKS.in: Now that Tianjia Zhang has a commit in the repo.
+
+2021-09-17  Tianjia Zhang  <tianjia.zhang@linux.alibaba.com>
+
+	tests: fix typo in cksum-a.sh
+	* tests/misc/cksum-a.sh: fix typo md5um to md5sum.
+
+2021-09-17  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix rare false failure in tail-2/F-vs-rename
+	This is wrong fix really, as only introducing delay I think.
+
+	* tests/tail-2/F-vs-rename.sh: Avoid a rare false failure
+	due to a race in the test.  Now wait until tail has noticed
+	that b is replaced before writing to a, so that the subsequent
+	write of "y" to b will be displayed independently from
+	current contents of b ("x").
+
+2021-09-17  Pádraig Brady  <P@draigBrady.com>
+
+	tests: port removed-directory test to FreeBSD
+	* tests/ls/removed-directory.sh: On FreeBSD 9.1 at least,
+	one gets ENOENT when trying to traverse the current removed dir
+	with ../, so instead reference the parent dir directly.
+
+2021-09-16  Pádraig Brady  <P@draigBrady.com>
+
+	rmdir: fix uninitialized memory causing incorrect error
+	* src/rmdir.c (main): Only inspect the returned stat structure,
+	when stat(2) returns success.
+
+2021-09-16  Jim Meyering  <meyering@fb.com>
+
+	build: avoid new chmod.c warnings from upcoming GCC12
+	Here are the warnings:
+	src/chmod.c:175:3: error: 'ch.new_mode' may be used uninitialized in\
+	    this function [-Werror=maybe-uninitialized]
+	  175 |   strmode (ch->new_mode, perms);
+	src/chmod.c:178:3: error: 'ch.old_mode' may be used uninitialized in\
+	    this function [-Werror=maybe-uninitialized]
+	  178 |   strmode (ch->old_mode, old_perms);
+
+	* src/chmod.c (process_file): Initialize ch.  Its new_mode and
+	old_mode fields could indeed be used uninitialized to form mode
+	strings, but those are used only when built from initialized members.
+
+2021-09-16  Pádraig Brady  <P@draigBrady.com>
+
+	digest: ignore empty lines when checking
+	* src/digest.c (digest_check): Treat empty lines like comments,
+	as commented checksum files very often have empty lines.
+	* tests/misc/md5sum.pl: Adjust accordingly.
+
+	factor: sync longlong.h adjustments from upstream
+	* src/longlong.h: Sync changes from:
+	https://gmplib.org/repo/gmp/log/tip/longlong.h
+
+	stat,tail: add support for the secretmem file system
+	* src/stat.c (human_fstype): Add case for the 'secretmem'
+	file system type.
+	* NEWS: Mention the Improvement.
+
+	maint: sync help2man to latest version
+	* man/help2man: sync to changes from version 1.48.5.
+	Note this doesn't materially change the generated man pages.
+
+	doc: remove older ChangeLog items
+	* Makefile.am: Update the oldest documented version
+	to 8.25 which is now about 5 years old.
+
+	tests: ensure returns_ check failures are propagated
+	* tests/misc/cksum-a.sh: Set fail=1 if returns_ check fails.
+	* tests/misc/sync.sh: Likewise.
+	* tests/misc/yes.sh: Likewise.
+
+	cksum: fix --check with non tagged format checksums
+	* src/digest.c: Always set the digest_length, so that
+	we check the correct number of hex digits when parsing
+	non tagged format checksums.
+	* tests/misc/cksum-a.sh: Add a test case.  Also fix
+	up this test which was ineffective due to fail=1
+	being set in a subshell and ignored.
+
+2021-09-16  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cksum: fix off-by-1 bug with \r stripping
+	Problem reported by Jim Meyering (Bug#50611).
+	* src/digest.c (digest_check): When stripping trailing \r,
+	avoid subscript error before start of line.
+
+2021-09-15  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: prefer rawmemchr to memchr when easy
+	* bootstrap.conf (gnulib_modules): Add rawmemchr.
+	* src/csplit.c: Include idx.h.
+	* src/csplit.c (record_line_starts):
+	* src/head.c (elide_tail_lines_pipe):
+	* src/shuf.c (next_line):
+	* src/split.c (lines_split):
+	* src/tail.c (pipe_lines):
+	* src/wc.c (wc_lines):
+	Prefer rawmemchr to memchr when rawmemchr is easy.
+	* src/csplit.c (load_buffer):
+	* src/head.c (struct linebuffer):
+	Make room for a 1-byte sentinel.
+
+	split: avoid NULL + 1
+	* src/split.c (lines_chunk_split): Don’t add to a null pointer.
+	It’s undefined behavior, and it’s unnecessarily confusing
+	regardless.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	digest: support windows format checksum files
+	Support checksum files with CRLF line endings,
+	which is a common gotcha for using --check on windows,
+	or with checksum files generated on windows.
+	Note we escape \r here to support the original coreutils format
+	(with file name at EOL), and file names with literal
+	\r characters as the last character of their name.
+
+	* src/digest.c (filename_unescape): Convert \\r -> \r.
+	(print_filename): Escape \r -> \\r.
+	(output_file): Detect \r chars in file names.
+	(digest_check): Ignore literal \r char at EOL.
+	* tests/misc/md5sum.pl: Add a test case.
+	* tests/misc/sha1sum.pl: Likewise.
+	* NEWS: Mention the improvement.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	doc: improve --help indenting in checksum utils
+	* src/digest.c (usage): Indent multi-line descriptions for clarity.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	cksum: operate in binary mode only
+	This only practically matters on windows.
+	But given there are separate text handling options in cygwin,
+	keep the interface simple, and avoid exposing the
+	confusing binary/text difference here.
+
+	* doc/coreutils.texi (md5sum invocation): Mention that
+	--binary and --text are not supported by the cksum command.
+	* src/digest.c: Set flag to use binary mode by default.
+	(output_file): Don't distinguish text and binary modes with
+	' ' and '*', and just use ' ' always.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	cksum: use --tag format by default
+	This format is a better default, since it results in simpler usage,
+	as you don't need to specify --tag on generation or -a on
+	checking invocations.  Also it's a more general format supporting
+	mixed and length adjusted digests.
+
+	* doc/coreutils.texi (cksum invocation): Document a new --untagged
+	option, to use the older coreutils format.
+	(md5sum invocation): Mention that cksum doesn't support --tag.
+	* src/digest.c: Adjust cksum(1) to default to --tag,
+	and accept the new --untagged option.
+	* tests/misc/b2sum.sh: Adjust accordingly.
+	* tests/misc/cksum-a.sh: Likewise.
+	* tests/misc/cksum-c.sh: Likewise.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	cksum: support --zero in default mode
+	* src/cksum.h: Thread DELIM through the output functions.
+	* src/digest.c: Likewise.
+	* src/sum.c: Likewise.
+	* src/sum.h: Likewise.
+	* src/cksum.c: Likewise. Also adjust check to allow -z
+	with traditional output modes.  Also ajust the global variable
+	name to avoid shadowing warnings.
+	* tests/misc/cksum-a.sh: Adjust accordingly.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	digest: support -length specifiers on all digest tags
+	This will be generally useful going forward, for sha3-256 etc.
+
+	* src/digest.c: Rename b2_length to digest_length, and
+	adjust/simplify the code to operate on this for both
+	b2sum and cksum -a blake2b.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	cksum: support digest detection for tagged format
+	Support `cksum --check FILE` without having to specify a digest
+	algorithm, allowing for more generic file check instructions.
+	This also supports mixed digest checksum files, supporting
+	more robust multi digest checks.
+
+	* src/digest.c (algorithm_from_tag): A new function to
+	identify the digest algorithm from a tagged format line.
+	(split3): Set the algorithm depending on tag, and update
+	the expected digest length accordingly.
+	* tests/misc/cksum-c.sh: Add a new test.
+	* tests/local.mk: Reference the new test.
+	* tests/misc/md5sum.pl: Adjust to more generic error.
+	* tests/misc/sha1sum.pl: Likewise.
+	* doc/coreutils.texi (md5sum invocation): Mention the new -c feature.
+	* NEWS: Mention the new feature.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	maint: simplify b2sum to only handle BLAKE2b
+	Any further variants will use the cksum -a table driven mechanism.
+
+	* src/digest.c: Remove BLAKE2 specific table driven code.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	digest: add support for sm3
+	Add message digest sm3, which uses the OSCCA SM3 secure
+	hash (OSCCA GM/T 0004-2012 SM3) generic hash transformation.
+
+	* bootstrap.conf: Add the sm3 module.
+	* doc/coreutils.texi: Mention the cksum -a option.
+	* src/digest.c: Provide support for --algorithm='sm3'.
+	* tests/misc/sm3sum.pl: Add a new test (from Tianjia Zhang)
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the new feature.
+
+	Tested-by: Tianjia Zhang <tianjia.zhang@linux.alibaba.com>
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	cksum: add --algorithm option to select digest mode
+	* src/digest.c: Organize HASH_ALGO_CKSUM to be table driven,
+	and amalgamate all digest algorithms.
+	(main): Parse all options if HASH_ALGO_CKSUM, and disallow
+	--tag, --zero, and --check with the traditional bsd, sysv, and crc
+	checksums for now.
+	* src/local.mk: Reorganize to include all digest modules in cksum.
+	* tests/misc/cksum-a.sh: Add a new test.
+	* tests/misc/b2sum.sh: Update to default to checking with cksum,
+	as b2sum's implementation diverges a bit from the others.
+	* tests/local.mk: Reference the new test.
+	* doc/coreutils.texi (cksum invocation): Adjust the summary to
+	identify the new mode, and document the new --algorithm option.
+	* man/cksum.x: Adjust description to be more general.
+	* man/*sum.x: Add [See Also] section referencing cksum(1).
+	* NEWS: Mention the new feature.
+
+	digest: refactor cksum(1) into digest.c
+	* cfg.mk: Adjust cksum.c to not require config.h
+	and support a main (for crctab) without calling bindtextdomain().
+	* po/POTFILES.in: Remove cksum_pclmul.c since it no longer
+	concerns itself with diagnostics.
+	* src/cksum.c: Refactor to just providing stream digest,
+	and digest printing functionality.
+	* src/cksum.h: Adjust to the new interface.
+	* src/cksum_pclmul.c: Remove diagnostics, and determine errors
+	internally.
+	* src/crctab.c: Separate from cksum.h since that's now included
+	multiple times.
+	* src/digest.c: Provide cksum(1) functionality if -DHASH_ALGO_CKSUM
+	* src/local.mk: Adjust to new crctab.c and HASH_ALGO_CKSUM define.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	cksum: document the --debug option
+	This should have been part of commit v8.32-113-gb73b9fcb1
+
+	* doc/coreutils.texi (cksum invocation): Add the --debug description.
+	* src/cksum.c (usage): Likewise.
+	(main): Also give explicit indication when using generic hardware.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	sum: handle EOVERFLOW for too large inputs
+	* src/sum.c (bsd_sum_stream): Detect overflow when updating length.
+	(sysv_sum_stream): Likewise.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	digest: refactor sum(1) into digest.c
+	Since digest will be providing all digest functionality,
+	refactor sum.c into it.
+
+	* po/POTFILES.in: sum.c no longer has translatable strings so remove.
+	* src/digest.c: Call out to new stream interfaces in sum.c
+	* src/local.mk: Adjust sources for the sum binary.
+	* src/sum.c: Provide a stream interface for BSD and SYSV digests.
+	* src/sum.h: A new file to declare the exported functions in sum.c
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	digest: add LENGTH parameter to digest to support cksum
+	* src/digest.c (digest_file): Add a LENGTH param,
+	to support cksum(1), and sum(1) which output the
+	length as part of their output.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	maint: rename md5sum.c to more general digest.c
+	md5sum.c will be the base for all digest functions,
+	so rename accordingly.
+
+	* src/md5sum.c: Rename to ...
+	* src/digest.c: ... renamed from md5sum.c
+	* scripts/git-hooks/commit-msg: Allow digest: commit prefix.
+	* po.POTFILES.in: Adjust to new name.
+	* src/local.mk: Likewise.
+
+2021-09-15  Pádraig Brady  <P@draigBrady.com>
+
+	doc: fix ambiguities in logname(1) and whoami(1)
+	* doc/coreutils.texi (whoami invocation): Clarify it prints names,
+	not numeric IDs.
+	* man/whoami.x: Likewise.
+	* man/logname.x: Reference getlogin(3).
+	* src/logname.c: Clarify that it prints the login name,
+	rather than the name of the effective user ID.
+
+	Fixes https://bugs.gnu.org/48894
+
+2021-09-15  nl6720  <nl6720@gmail.com>
+
+	dircolors: add *direct* to TERM matching
+	Search for "direct color" at:
+	https://invisible-island.net/xterm/terminfo.html
+
+	* src/dircolors.hin: Add *direct* to match terminals that
+	support direct colors (24-bit color / TrueColor).
+	The trailing * will match entries like xterm-direct2.
+
+	Addresses https://bugs.gnu.org/39827
+
+2021-09-12  Pádraig Brady  <P@draigBrady.com>
+
+	tests: stat-vs-dirent.sh: avoid a false failure
+	* tests/ls/stat-vs-dirent.sh: Skip the test if we can't stat(1),
+	as the file may have been removed, or have a malformed name
+	due to '\n' etc. in the file name.
+
+2021-09-09  Pádraig Brady  <P@draigBrady.com>
+
+	tests: add new stdin reading programs to tty-eof test
+	* tests/misc/tty-eof.pl: Add b2sum and basenc.
+
+	build: update gnulib submodule to latest
+	* gnulib: Update to latest. This fixes a gnulib test failure in base64,
+	among other fixes.
+	* cfg.mk: Disable sc_indent as auto indent is too invasive for now.
+
+2021-09-09  Pádraig Brady  <P@draigBrady.com>
+
+	doc: fix repeated word
+	A proposed change to gnulib's sc_prohibit_doubled_word
+	was made to detect this in future.
+
+	* README: s/can can/can/.
+	Fixes https://bugs.gnu.org/50484
+
+2021-09-09  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: can “can can”
+	Problem reported by Akbarkhon Variskhanov (Bug#50484).
+
+2021-09-08  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: add missing "as" (thanks to Nelson H.F. Beebe)
+
+2021-09-05  Justin Tracey  <j2tracey@gmail.com>
+
+	tests: narrow scope of faulty join args
+	* tests/misc/join.pl: Only test invalid-j with an invalid -j field,
+	not with missing operands as well.
+
+2021-08-31  Pádraig Brady  <P@draigBrady.com>
+
+	doc: indicate the default algorithm in the sum(1) man page
+	* src/sum.c (usage): Indicate that -r (BSD algorithm) is the default.
+
+2021-08-31  Pádraig Brady  <P@draigBrady.com>
+
+	sum: always output a file name if one passed
+	Adjust to output the file name if any name parameter is passed.
+	This is consistent with sum -s, cksum, and sum implementations
+	on other platforms.  This should not cause significant compat
+	issues, as multiple fields are already output, and so already
+	need to be parsed.
+
+	* src/sum.c (bsd_sum_file): Output the file name
+	if any name parameter is passed.
+	* tests/misc/sum.pl: Adjust accordingly.
+	* doc/coreutils.texi (sum invocation): Likewise.
+	* NEWS: Mention the change in behavior.
+
+2021-08-31  Paul Eggert  <eggert@cs.ucla.edu>
+
+	tests: port better to NetBSD
+	* tests/misc/help-version.sh: Test that /dev/full causes
+	shell printf to fail.  This ports better to NetBSD 9.88.46,
+	where it doesn’t.  Problem reported by Nelson H. F. Beebe.
+
+	tests: merge help-version changes back from gzip
+	* tests/misc/help-version.sh: Merge gzip-related changes
+	back from gzip/tests/help-version.  This fixes problems
+	when TERM is not 'dumb', and should simplify maintenance.
+
+2021-08-30  Assaf Gordon  <assafgordon@gmail.com>
+
+	basenc: fix bug49741: using wrong decoding buffer length
+	Emil Lundberg <lundberg.emil@gmail.com> reports in
+	https://bugs.gnu.org/49741 about a 'basenc --base64 -d' decoding bug.
+	The input buffer length was not divisible by 3, resulting in
+	decoding errors.
+
+	* NEWS: Mention fix.
+	* src/basenc.c (DEC_BLOCKSIZE): Change from 1024*5 to 4200 (35*3*5*8)
+	which is divisible by 3,4,5,8 - satisfying both base32 and base64;
+	Use compile-time verify() macro to enforce the above.
+	* tests/misc/basenc.pl: Add test.
+
+2021-08-28  Paul Eggert  <eggert@cs.ucla.edu>
+
+	basenc: prefer signed to unsigned integers
+	This patch modifies basenc to prefer signed integers to
+	unsigned, as signed are less error-prone.
+	This patch also updates Gnulib to to latest, which updates Gnulib’s
+	base32 and base64 modules to prefer signed to unsigned integers.
+	* src/basenc.c: Include idx.h.
+	(struct base2_decode_context): Use unsigned char, not unsigned
+	for an octet that must fit in an unsigned char.
+	(base_encode, struct base_decode_context)
+	(base64_decode_ctx_wrapper, prepare_inbuf, base64url_encode)
+	(base64url_decode_ctx_wrapper, base32_decode_ctx_wrapper)
+	(base32hex_encode, base32hex_decode_ctx_wrapper, base16_encode)
+	(base16_decode_ctx, z85_encode, Z85_HI_CTX_TO_32BIT_VAL)
+	(z85_decoding, z85_decode_ctx, base2msbf_encode)
+	(base2lsbf_encode, base2lsbf_decode_ctx, base2msbf_decode_ctx)
+	(wrap_write, do_encode, do_decode, main):
+	Prefer signed integers to unsigned.
+	(main): Treat extremely large wrap columns as if they were
+	infinite; that’s good enough.  Since we’re now using xstrtoimax,
+	this allows ‘-w -0’ (same as ‘-w 0’).
+	* tests/misc/base64.pl (gen_tests): -w-0 is no longer an error.
+
+2021-08-25  Jim Meyering  <meyering@fb.com>
+
+	maint: avoid new syntax-check failure
+	find-mount-point.h rightly includes <stdlib.h> for its use
+	of _GL_ATTRIBUTE_DEALLOC_FREE, which uses free, yet that new
+	inclusion provoked a syntax-check failure. Exempt this header
+	file as we've done for others.
+	* cfg.mk (exclude_file_name_regexp--sc_system_h_headers):
+	Add find-mount-point.h to the regexp.
+	(sc_system_h_headers): Use grep -E, for a more readable regexp.
+
+2021-08-25  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid reflinks when testing SEEK_DATA logic
+	This better tests the SEEK_HOLE logic which
+	replaced the original fiemap hole identification logic.
+	Also it avoids a false failure in sparse-2.sh
+	on reflink supporting file systems, where we
+	try to correlate the file sizes produced by cp and dd.
+
+	* tests/cp/sparse-2.sh: s/cp/cp --reflink=never/
+	* tests/cp/sparse-extents-2.sh: Likewise.
+	* tests/cp/sparse-extents.sh: Likewise.
+	* tests/cp/sparse-perf.sh: Likewise.
+	* tests/cp/sparse.sh: Likewise.
+
+	Fixes https://github.com/coreutils/coreutils/issues/54
+
+2021-08-22  Paul Eggert  <eggert@cs.ucla.edu>
+
+	df: pacify -Wsuggest-attribute=malloc
+	Problem found with latest Gnulib and GCC 11.2.1.
+	* src/find-mount-point.h (find_mount_point):
+	Add _GL_ATTRIBUTE_MALLOC and _GL_ATTRIBUTE_DEALLOC_FREE.
+
+	build: update gnulib submodule to latest
+
+	maint: use clearerr on stdin when appropriate
+	This is so that commands like ‘fmt - -’ read from stdin
+	both times, even when it is a tty.  Fix some other minor
+	issues that are related.
+	* src/blake2/b2sum.c (main):
+	* src/cksum.c (cksum):
+	* src/cut.c (cut_file):
+	* src/expand-common.c (next_file):
+	* src/fmt.c (fmt):
+	* src/fold.c (fold_file):
+	* src/md5sum.c (digest_file, digest_check):
+	* src/nl.c (nl_file):
+	* src/od.c (check_and_close):
+	* src/paste.c (paste_parallel, paste_serial):
+	* src/pr.c (close_file):
+	* src/sum.c (bsd_sum_file):
+	Use clearerr on stdin so that stdin can be read multiple times
+	even if it is a tty.  Do not assume that ferror preserves errno as
+	POSIX does not guarantee this.  Coalesce duplicate diagnostic
+	calls.
+	* src/blake2/b2sum.c (main):
+	* src/fmt.c (main, fmt):
+	Report read error, even if it's merely fclose failure.
+	* src/fmt.c: Include die.h.
+	(fmt): New arg FILE.  Close input (reporting error) if not stdin.
+	All callers changed.
+	* src/ptx.c (swallow_file_in_memory): Clear stdin's EOF flag.
+	* src/sort.c (xfclose): Remove unnecessary feof call.
+
+	doc: spell out stdin, stdout, stderr
+	* doc/coreutils.texi: Spell out words like “stdin” in
+	English prose.
+
+2021-08-16  Paul Eggert  <eggert@cs.ucla.edu>
+
+	chmod: fix use of uninitialized var if -v
+	Problem reported by Michael Debertol (Bug#50070).
+	* NEWS: Mention the fix.
+	* src/chmod.c (struct change_status): New struct, replacing the
+	old enum Change_status.  All uses changed.
+	(describe_change): Distinguish between cases depending on
+	whether 'stat' or its equivalent succeeded.  Report a line
+	of output even if 'stat' failed, as that matches the documentation.
+	Rework to avoid casts.
+	(process_file): Do not output nonsense modes computed from
+	uninitialized storage, removing a couple of IF_LINTs.  Simplify by
+	defaulting to CH_NO_STAT.
+
+2021-08-14  Pádraig Brady  <P@draigBrady.com>
+
+	maint: update .gitignore
+	* .gitignore: ignore new lib/malloc gnulib directory.
+
+	maint: allow hook script accept "Signed-off-by:"
+	* scripts/git-hooks/commit-msg: Relax this constraint.
+
+2021-08-11  Paul Eggert  <eggert@cs.ucla.edu>
+
+	df: fix bug with automounted
+	If the command-line argument is automounted, df would use
+	stat info that became wrong after the following open.
+	* NEWS: Mention the fix (bug#50012).
+	* src/df.c (automount_stat_err): New function.
+	This fixes the hang on fifos in a better way, by using O_NONBLOCK.
+	(main): Use it.
+
+2021-08-08  Pádraig Brady  <P@draigBrady.com>
+
+	cat: with -E fix handling of \r\n spanning buffers
+	We must delay handling when \r is the last character
+	of the buffer being processed, as the next character
+	may or may not be \n.
+
+	* src/cat.c (pending_cr): A new global to record whether
+	the last character processed (in -E mode) is '\r'.
+	(cat): Honor pending_cr when processing the start of the buffer.
+	(main): Honor pending_cr if no more files to process.
+	* tests/misc/cat-E.sh: Add test cases.
+	Fixes https://bugs.gnu.org/49925
+
+2021-07-31  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: update .gitignore
+
+	build: update gnulib submodule to latest
+
+	uniq: pacify GCC -fanalyzer
+	Pacify GCC 11.1 -fanalyzer.
+	* src/uniq.c (check_file): Use simpler test to check whether this
+	is the first time through the loop.  Although the old test was
+	correct, the new one is easier to understand and perhaps a tiny
+	bit more efficient.
+
+	numfmt: omit unnecessary pointer test
+	Caught by GCC 11.1 -fanalyzer.
+	* src/numfmt.c (simple_strtod_int): Remove unnecessary test of
+	*endptr vs NULL.  Presumably this was a typo and **endptr was
+	intended instead of *endptr, but an **endptr test is also
+	unnecessary since c_isdigit (0) returns false.
+
+2021-07-29  Pádraig Brady  <P@draigBrady.com>
+
+	doc: add options summary list to tr texinfo
+	* doc/coreutils.texi (tr invocation): Provide a summary
+	list of the available options, which is useful to
+	provide a quick reminder for those already familiar
+	with the functionality of tr.
+	Fixes https://bugs.gnu.org/49764
+
+2021-07-28  Pádraig Brady  <P@draigBrady.com>
+
+	tests: augment new ls --zero test cases
+	* tests/ls/zero-option.sh: Check for the disabled, disallowed,
+	and allowed option combinations.
+
+	maint: avoid syntax-check failures in recent ls changes
+	* src/ls.c: Fix ifdef indenting and long line.
+
+2021-07-28  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: modernize usage of “disk” and “core”
+	In documentation and comments, don’t assume that secondary storage
+	devices are disk devices.  Similarly, don’t assume that main memory
+	uses magnetic cores, which became obsolete in the 1970s.
+	* src/du.c (usage):
+	* src/ls.c (usage):
+	* src/shred.c (usage): Reword to avoid “disk” in usage messages.
+
+	doc: improve ls documentation
+	* doc/coreutils.texi (ls invocation): Document implementation more
+	closely.  Be more consistent about style.  Omit some needless words.
+	* src/ls.c (usage): Don’t overdocument -f, as the details were wrong.
+	Omit -1 advice as it’s a bit obsolete now that we have --zero and
+	is a bit much for --usage output anyway.
+
+	ls: rename --null to --zero (Bug#49716)
+	* NEWS, doc/coreutils.texi (General output formatting):
+	* src/ls.c (usage):
+	Document this.
+	* src/ls.c (ZERO_OPTION): Rename from NULL_OPTION.
+	All uses changed.
+	(long_options): Rename --null to --zero.
+	(dired_dump_obstack, main, print_dir): Use '\n' instead of
+	eolbyte where eolbyte must equal '\n'.
+	(decode_switches): Decode --zero instead of --null.
+	--zero also implies -1, -N, --color=none, --show-control-chars.
+	Use easier-to-decipher code to set ‘format’ and ‘dired’.
+	Reject attempts to combine --dired and --zero.
+	* tests/local.mk: Adjust to test script renaming.
+	* tests/ls/zero-option.sh: Rename from tests/ls/null-option.sh,
+	and test --zero instead of --null.
+
+	ls: compute defaults more lazily
+	* src/ls.c (enum time_type, enum sort_type, enum indicator_style)
+	(enum Dereference_symlink, ignore_mode):
+	Put ‘= 0’ after default values, since the code relies
+	on static storage defaulting to zero.
+	(enum sort_type): Reorder so that -1 can be used to represent unset.
+	(main): Test print_with_color after parse_ls_color may have reset it.
+	(decode_line_length): Return the line length instead of setting
+	static storage.  All uses changed.  Treat line lengths exceeding
+	PTRDIFF_MAX as infinite, to avoid pointer-subtraction glitches.
+	(stdout_isatty): New function, to avoid calling isatty twice.
+	(decode_switches): Calculate defaults more lazily, to avoid using
+	syscalls or getenv during startup unless the results are more
+	likely to be needed.  Use -1 to indicate options that haven’t been
+	set on the command line yet.  Move print_with_color test from
+	here to ‘main’.  Suppress bogus GCC warning.
+	(getenv_quoting_style): Return the quoting style instead of
+	setting static storage.
+	(init_column_info): New arg MAX_COLS, to avoid recalculating it.
+	Caller changed.
+
+2021-07-26  Pádraig Brady  <P@draigBrady.com>
+
+	maint: avoid recent syntax-check issues
+	* .gitignore: Cater for recently added poll module.
+	* src/stdbuf.c: Avoid false positive from sc_prohibit_readlink.
+
+2021-07-26  Paul Eggert  <eggert@cs.ucla.edu>
+
+	ls: add --null option (Bug#49716)
+	* NEWS, doc/coreutils.texi (General output formatting):
+	* src/ls.c (usage): Document this.
+	* src/ls.c (NULL_OPTION): New constant.
+	(long_options): Add --null.
+	(eolbyte): New static var.
+	(dired_dump_obstack, main, print_dir, print_current_files)
+	(print_many_per_line, print_horizontal, print_with_separator):
+	Output eolbyte instead of '\n'.
+	(decode_switches): Decode --null.
+	* tests/ls/null-option.sh: New file.
+	* tests/local.mk (all_tests): Add it.
+
+	ls: port to wider off_t, uid_t, gid_t
+	* src/ls.c (dired_pos): Now off_t, not size_t, since it counts
+	output file offsets.
+	(dired_dump_obstack): This obstack's file offsets are now
+	off_t, not size_t.
+	(format_user_or_group, format_user_or_group_width):
+	ID arg is now uintmax_t, not unsigned long, since uid_t and
+	gid_t values might exceed ULONG_MAX.
+	(format_user_or_group_width): Use snprintf with NULL instead of
+	sprintf with a discarded buffer.  This avoids a stack buffer,
+	and so should be safer.
+
+	ls: demacroize
+	Prefer functions or constants to macros where either will do.
+	That’s cleaner, and nowadays there’s no performance reason to
+	prefer macros.  All uses changed.
+	* src/ls.c (INITIAL_TABLE_SIZE, MIN_COLUMN_WIDTH):
+	Now constants instead of macros.
+	(file_or_link_mode): New function, replacing the old macro
+	FILE_OR_LINK_MODE.
+	(dired_outbyte): New function, replacing the old macro DIRED_PUTCHAR.
+	(dired_outbuf): New function, replacing the old macro DIRED_FPUTS.
+	(dired_outstring): New function, replacing the old macro
+	DIRED_FPUTS_LITERAL.
+	(dired_indent): New function, replacing the old macro DIRED_INDENT.
+	(push_current_dired_pos): New function, replacing the old macro
+	PUSH_CURRENT_DIRED_POS.
+	(assert_matching_dev_ino): New function, replacing the old macro
+	ASSERT_MATCHING_DEV_INO.
+	(do_stat, do_lstat, stat_for_mode, stat_for_ino, fstat_for_ino)
+	(signal_init, signal_restore, cmp_ctime, cmp_mtime, cmp_atime)
+	(cmp_btime, cmp_size, cmp_name, cmp_extension)
+	(fileinfo_name_width, cmp_width, cmp_version):
+	No longer inline; compilers can deduce this well enough nowadays.
+	(main): Protect unused assert with ‘if (false)’ rather than
+	commenting it out, so that the compiler checks the code.
+	(print_dir): Output the space and newline in the same buffer
+	as the human-readable number they surround.
+	(dirfirst_check): New function, replacing the old macro
+	DIRFIRST_CHECK.  Simplify by using subtraction.
+	(off_cmp): New function, replacing the old macro longdiff.
+	(print_long_format): No need to null-terminate the string now.
+	(format_user_or_group): Let printf count the bytes.
+
+	ls: simplify sprintf usage
+	* src/ls.c (format_user_or_group_width, print_long_format):
+	Use return value from sprintf instead of calling strlen on
+	the resulting buffer, or inferring the length some other way.
+
+	build: update gnulib submodule to latest
+
+	maint: fix white space
+
+	env: fix usage typo
+	* src/env.c (usage): Fix pluralization typo.
+
+2021-07-02  Kamil Dudka  <kdudka@redhat.com>
+
+	df: fix duplicated remote entries due to bind mounts
+	As originally reported in <https://bugzilla.redhat.com/1962515>,
+	df invoked without -a printed duplicated entries for NFS mounts
+	of bind mounts.  This is a regression from commit v8.25-54-g1c17f61ef99,
+	which introduced the use of a hash table.
+
+	The proposed patch makes sure that the devlist entry seen the last time
+	is used for comparison when eliminating duplicated mount entries.  This
+	way it worked before introducing the hash table.
+
+	Patch co-authored by Roberto Bergantinos.
+
+	* src/ls.c (struct devlist): Introduce the seen_last pointer.
+	(devlist_for_dev): Return the devlist entry seen the last time if found.
+	(filter_mount_list): Remember the devlist entry seen the last time for
+	each hashed item.
+	* NEWS: Mention the bug fix.
+	Fixes https://bugs.gnu.org/49298
+
+2021-06-27  Paul Eggert  <eggert@cs.ucla.edu>
+
+	tail: use poll, not select
+	This fixes an unlikely stack out-of-bounds write reported by
+	Stepan Broz via Kamil Dudka (Bug#49209).
+	* bootstrap.conf (gnulib_modules): Replace select with poll.
+	* src/tail.c: Do not include <sys/select.h>.
+	[!_AIX]: Include poll.h.
+	(check_output_alive) [!_AIX]: Use poll instead of select.
+	(tail_forever_inotify): Likewise.  Simplify logic, as there is no
+	need for a ‘while (len <= evbuf_off)’ loop.
+
+	tail: fix abuse2 test race
+	* tests/tail-2/inotify-hash-abuse2.sh (fastpoll):
+	Fix race where tailed file ‘f’ temporarily did not exist.
+
+	maint: while (1) → while (true)
+
+2021-06-21  Nikolay Nechaev  <Nikolay_Nechaev@mail.ru>
+
+	maint: remove redundant checks on buffer sizes in tail
+	* src/tail.c: remove redundant size checks before calls to
+	`xwrite_stdout`
+
+2021-06-21  Pádraig Brady  <P@draigBrady.com>
+
+	stat: use decomposed decimal device numbers by default
+	* src/stat.c (default_format): Use decomposed decimal
+	representation (major,minor) in the default format.
+	This is least ambiguous for human interpretation,
+	and more consistent with ls for example.
+	Fixes https://bugs.gnu.org/48960
+
+2021-06-21  Pádraig Brady  <P@draigBrady.com>
+
+	stat: support more device number representations
+	In preparation for changing the default device number
+	representation (to decomposed decimal), provide more
+	formatting options for device numbers.
+
+	These new (FreeBSD compat) formatting options are added:
+
+	   %Hd  major device number in decimal (st_dev)
+	   %Ld  minor device number in decimal (st_dev)
+	   %Hr  major device type in decimal (st_rdev)
+	   %Lr  minor device type in decimal (st_rdev)
+	   %r   (composed) device type in decimal (st_rdev)
+	   %R   (composed) device type in hex (st_rdev)
+
+	* doc/coreutils.texi (stat invocation): Document new formats.
+	* src/stat.c (print_it): Handle the new %H and %L modifiers.
+	(print_statfs): Adjust to passing the format as two chars
+	rather than an int.  Using an int was introduced in commit db42ae78,
+	but using separate chars is cleaner and more extensible.
+	(print_stat): Likewise.  Handle any modifiers and the new 'r' format.
+	(usage): Document the new formats.
+	* tests/misc/stat-fmt.sh: Add a test case for new modifiers.
+	Addresses https://bugs.gnu.org/48960
+
+2021-06-12  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+	Coreutils mistakenly did not list xstrndup as a module
+	that it depends on directly.  When the latest Gnulib removed
+	the dirname module's dependency on xstrndup, this mistake
+	caused coreutils to not build.  Since all of Coreutils's
+	uses of xstrndup know the string length, xmemdup0 is a better
+	match for what's needed.  Since the size args are typically
+	signed or derived from subtracting pointers, the new Gnulib
+	ximemdup0 function is a better match yet.
+	So, use ximemdup0 instead of xstrndup.
+	* src/cut.c, src/dircolors.c, src/expand-common.c, src/expand.c:
+	* src/numfmt.c, src/set-fields.c, src/unexpand.c:
+	Do not include xstrndup.h; no longer needed.
+	* src/dircolors.c (parse_line):
+	* src/expand-common.c (parse_tab_stops):
+	* src/numfmt.c (parse_format_string):
+	* src/set-fields.c (set_fields):
+	Use ximemdup0 instead of xstrndup.
+
+2021-05-28  Jim Meyering  <meyering@fb.com>
+
+	maint: bootstrap: remove reference to unused hash-pjw module
+	* bootstrap.conf (gnulib_modules): Remove hash-pjw. No longer used.
+
+2021-05-15  Pádraig Brady  <P@draigBrady.com>
+
+	build: update gnulib submodule to latest
+	Fixes a false test failure with MALLOC_CHECK_ set.
+
+	* gnulib: Update to latest.
+
+2021-05-15  Pádraig Brady  <P@draigBrady.com>
+
+	copy: remove fiemap logic
+	This is now only used on 10 year old linux kernels,
+	and performs a sync before each copy.
+
+	* src/copy.c (extent_copy): Remove function and all callers.
+	* src/extent-scan.c: Remove.
+	* src/extent-scan.h: Remove.
+	* src/fiemap.h: Remove.
+	* src/local.mk: Adjust for removed files.
+	* NEWS: Adjust to say fiemap is removed.
+
+2021-05-13  Pádraig Brady  <P@draigBrady.com>
+
+	copy: disallow copy_file_range() on Linux kernels before 5.3
+	copy_file_range() before Linux kernel release 5.3 had many issues,
+	as described at https://lwn.net/Articles/789527/, which was
+	referenced from https://lwn.net/Articles/846403/; a more general
+	article discussing the generality of copy_file_range().
+	Linux kernel 5.3 was released in September 2019, which is new enough
+	that we need to actively avoid older kernels.
+
+	* src/copy.c (functional_copy_file_range): A new function
+	that returns false for Linux kernels before version 5.3.
+	(sparse_copy): Call this new function to gate use of
+	copy_file_range().
+
+2021-05-12  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix tests/cp/sparse-2.sh false failure on some systems
+	* tests/cp/sparse-2.sh: Double check cp --sparse=always,
+	with dd conv=sparse, in the case where the former didn't
+	create a sparse file.  Now that this test is being newly run
+	on macos, we're seeing a failure due to seek() not creating
+	holes on apfs unless the size is >= 16MiB.
+
+2021-05-12  Pádraig Brady  <P@draigBrady.com>
+
+	tests: ensure we test SEEK_DATA where used
+	fiemap is no longer the default copy implementation,
+	so check for SEEK_DATA support instead as that's preferred.
+	This will ensure better test coverage on systems without fiemap.
+
+	* init.cfg: Replace fiemap_capable_ with seek_data_capable_.
+	This is best supported with python 3 so prefer that.
+	* tests/seek-data-capable: A new test script checking for
+	SEEK_DATA support on the passed file name,
+	called from seek_data_capable_.
+	* tests/fiemap-capable: Remove no longer used probing script.
+	* tests/cp/fiemap-perf.sh: Renamed to tests/cp/sparse-perf.sh
+	* tests/cp/fiemap-2.sh: Renamed to tests/cp/sparse-2.sh
+	* tests/cp/fiemap-extents.sh: Renamed to tests/cp/sparse-extents.sh
+	* tests/cp/sparse-fiemap.sh: Renamed to tests/cp/sparse-extents-2.sh
+	* tests/cp/fiemap-FMR.sh: Renamed to tests/cp/copy-FMR.sh
+	* tests/local.mk: Reference the renamed tests.
+
+2021-05-12  Pádraig Brady  <P@draigBrady.com>
+
+	copy: handle system security config issues with copy_file_range()
+	* src/copy.c (sparse_copy): Upon EPERM from copy_file_range(),
+	fall back to a standard copy, which will give a more accurate
+	error as to whether the issue is with the source or destination.
+	Also this will avoid the issue where seccomp or apparmor are
+	not configured to handle copy_file_range(), in which case
+	the fall back standard copy would succeed without issue.
+	This specific issue with seccomp was noticed for example in:
+	https://github.com/golang/go/issues/40900
+
+	copy: handle EOPNOTSUPP from SEEK_DATA
+	* src/copy.c (infer_scantype): Ensure we don't error out
+	if SEEK_DATA returns EOPNOTSUPP, on systems where this value
+	is distinct from ENOTSUP.  Generally both of these should be checked.
+
+	copy: handle ENOTSUP from copy_file_range()
+	* src/copy.c (sparse_copy): Ensure we fall back to
+	a standard copy if copy_file_range() returns ENOTSUP.
+	This generally is best checked when checking ENOSYS,
+	but it also seems to be a practical concern on Centos 7,
+	as a quick search gave https://bugzilla.redhat.com/1840284
+
+2021-05-10  Pádraig Brady  <P@draigBrady.com>
+
+	build: update gnulib submodule to latest
+	Fixes a bits/long-double.h include build issue on some systems.
+
+	* bootstrap: Sync new --version option from gnulib.
+	* gnulib: Update to lastest.
+	Reported by Carl Edquist
+
+2021-05-10  Carl Edquist  <edquist@cs.wisc.edu>
+
+	build: fix __get_cpuid_count check to catch link failure
+	The test program will compile successfully even if __get_cpuid_count
+	is not declared.  The error for the missing symbol will only show up
+	at link time.  Thus, use AC_LINK_IFELSE instead of AC_COMPILE_IFELSE.
+
+	* configure.ac (__get_cpuid_count check): Use C_LINK_IFELSE instead
+	of AC_COMPILE_IFELSE.
+	(__get_cpuid check): Likewise.
+
+2021-05-08  Pádraig Brady  <P@draigBrady.com>
+
+	maint: consistently free hash structures in dev mode
+	Ensure we call hash_free() to avoid valgrind and leak_sanitizer
+	"definitely lost" warnings.  These were not real leaks as
+	we terminate immediately after, but we should avoid these
+	"definitely lost" warnings where possible.
+
+	* src/copy.c: Add dest_info_free() and src_info_free().
+	* src/copy.h: Declare the above.
+	* src/cp-hash.c: Don't define unless "lint" is defined.
+	* src/install.c: Call dest_info_free() in dev mode.
+	* src/mv.c: Likewise.
+	* src/cp.c: Likewise. Also call src_info_free().
+	* src/ln.c: Call hash_free() in dev mode.
+	* src/tail.c: Call hash_free() even if about to exit, in dev mode.
+
+	Fixes https://bugs.gnu.org/48189
+
+2021-05-06  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: fix sc_space_before_open_paren failure
+	* src/copy.c (dest_info_init): Add space before parens.
+	(src_info_init): Likewise.
+	Syntax-check failure introduced in the previous commit.
+
+2021-05-03  Pádraig Brady  <P@draigBrady.com>
+
+	copy: exit immediately upon failure to allocate hash memory
+	* src/copy.c (dest_info_init, src_info_init): Terminate immediately
+	upon memory exhaustion.
+
+2021-05-02  Pádraig Brady  <P@draigBrady.com>
+
+	copy: ensure we enforce --reflink=never
+	* src/copy.c (sparse_copy): Don't use copy_file_range()
+	with --reflink=never as copy_file_range() may implicitly
+	use acceleration techniques like reflinking.
+	(extent_copy): Pass through whether we allow reflinking.
+	(lseek_copy): Likewise.
+	Fixes https://bugs.gnu.org/48164
+
+	wc: add --debug to diagnose which implementation used
+	* src/wc.c: (main): Handle the new --debug option.
+	Only call avx2_supported if needed.
+	(avx2_supported): Diagnose various failures and attempts.
+	* NEWS: Mention the new wc improvement and --debug option.
+
+2021-05-02  Kristoffer Brånemyr  <ztion1@yahoo.se>
+
+	wc: use avx2 optimization when counting only lines
+	Use cpuid to detect CPU support for avx2 instructions.
+	Performance was seen to improve by 5x for a file with only newlines,
+	while the performance for a file with no such characters is unchanged.
+
+	* configure.ac [USE_AVX2_WC_LINECOUNT]: A new conditional,
+	set when __get_cpuid_count() and avx2 compiler intrinsics are supported.
+	* src/wc.c (avx2_supported): A new function using __get_cpuid_count()
+	to determine if avx2 instructions are supported.
+	(wc_lines): A new function refactored from wc(),
+	which implements the standard line counting logic,
+	and provides the fallback implementation for when avx2 is not supported.
+	* src/wc_avx2.c: A new module to implement using avx2 intrinsics.
+	* src/local.mk: Reference the new module.  Note we build as a separate
+	lib so that it can be portably built with separate -mavx2 etc. flags.
+
+2021-05-01  Paul Eggert  <eggert@cs.ucla.edu>
+
+	touch: fix wrong diagnostic (Bug#48106)
+	Problem reported by Roland (Bug#48106).
+	* src/touch.c (touch): Take more care when deciding whether
+	to use open_errno or utime_errno in the diagnostic.
+	Stop worrying about SunOS 4 (which as part of the problem),
+	as it’s long obsolete.  For Solaris 10, verify that EINVAL
+	really means the file was a directory.
+
+2021-04-27  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: port to Autoconf 2.71
+	* configure.ac: Use AC_PROG_CC, not AC_PROG_CC_STDC.
+	* gl/modules/smack (configure.ac):
+	* m4/jm-macros.m4 (coreutils_MACROS):
+	* m4/xattr.m4 (gl_FUNC_XATTR):
+	Use AS_HELP_STRING, not AC_HELP_STRING.
+	* m4/check-decl.m4 (gl_CHECK_DECLS):
+	Do not require AC_HEADER_TIME; we no longer care about it directly.
+	* m4/jm-macros.m4 (coreutils_MACROS):
+	Do not require AC_ISC_POSIX, which became obsolete in 2006.
+	Use AC_LINK_IFELSE instead of AC_TRY_LINK.
+
+	csplit: size_t overflow check
+	* src/csplit.c (get_new_buffer): Fix unlikely size_t overflow.
+
+	build: update gnulib submodule to latest
+	* src/csplit.c (load_buffer):
+	* src/pinky.c (create_fullname):
+	Use intprops-based checks rather than xalloc_oversized,
+	since Gnulib xalloc.h no longer includes xalloc-oversized.h.
+
+2021-04-27  Zorro Lang  <zlang@redhat.com>
+
+	copy: do not refuse to copy a swap file
+	* src/copy.c (sparse_copy): Fallback to read() if copy_file_range()
+	fails with ETXTBSY.  Otherwise it would be impossible to copy files
+	that are being used as swap.  This used to work before introducing
+	the support for copy_file_range() in coreutils.  (Bug#48036)
+
+2021-04-22  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	tests: fix FP in ls/stat-free-color.sh
+	On newer systems like Fedora 34 and openSUSE Tumbleweed, ls(1) calls
+	newfstatat(STDOUT_FILENO, ...), but only when there is something to
+	output.
+
+	* tests/ls/stat-free-color.sh: Add -a option to the reference invocation
+	of ls, thus enforcing something gets output.
+
+2021-04-11  Pádraig Brady  <P@draigBrady.com>
+
+	doc: clarify that ln --relative requires --symbolic to be specified
+	* doc/coreutils.texi (ln invocation): State --symbolic is required.
+	* src/ln.c (usage): Explicitly state -s is not implied.
+	Fixes https://bugs.gnu.org/47703
+
+	doc: clarify what's counted by wc
+	* src/wc.c (usage): State that only printable characters are considered
+	when counting words.  This also disambiguates wether we're talking
+	about bytes or characters in this context.
+	* doc/coreutils.texi (wc invocation): Likewise.  Also clarify
+	that --characters counts valid locale aware characters,
+	and that --lines does not count a trailing "line" unless
+	it ends with a newline character.
+	Fixes https://bugs.gnu.org/47702
+
+	maint: use "char const *" rather than "const char *"
+	* cfg.mk (sc_prohibit-const-char): Add a new syntax-check to
+	enforce this style.
+	* *.[ch]: sed -i 's/const char \*/char const */g'
+
+2021-04-11  Pádraig Brady  <P@draigBrady.com>
+
+	ls: cache name width determination
+	This is especially important now for --sort=width,
+	as that can greatly increase how often this
+	expensive quote_name_width() function is called per file.
+
+	This also helps the default invocation of ls,
+	or specifically the --format={across,vertical} cases
+	(when --width is not set to 0),
+	to avoid two calls to this function per file.
+
+	Note the only case where we later compute the width,
+	is for --format=commas.  That's only done once though,
+	so we leave the computation close to use to
+	maximize hardware caching.
+
+	* src/ls.c (struct fileinfo): Add a WIDTH member to cache
+	the screen width of the file name.
+	(update_current_files_info): Set the WIDTH members for cases
+	they're needed multiple times.  Note we do this explicitly here,
+	rather than caching at use, so that the fileinfo
+	structures can remain const in the sorting and presentation functions.
+	(sort_files): Call the new update_current_files_info() in this
+	initialization function.
+	(fileinfo_name_width): Renamed from fileinfo_width,
+	and adjusted to return the cached value if available.
+
+2021-04-11  Carl Edquist  <edquist@cs.wisc.edu>
+
+	ls: add --sort=width option to sort by file name width
+	This helps identify the outliers for long filenames, and also produces
+	a more compact display of columns when listing a directory with many
+	entries of various widths.
+
+	* src/ls.c (sort_type, sort_types, sort_width): New sort_width sort
+	type.
+	(sort_args): Add "width" sort arg.
+	(cmp_width, fileinfo_width): New sort function and helper for file name
+	width.
+	(quote_name_width): Add function prototype declaration.
+	(usage): Document --sort=width option.
+	* doc/coreutils.texi: Document --sort=width option.
+	* tests/ls/sort-width-option.sh: New test for --sort=width option.
+	* tests/local.mk: Reference new test.
+	* NEWS: Mention the new feature.
+
+2021-03-30  Paul Eggert  <eggert@cs.ucla.edu>
+
+	env: simplify --split-string memory management
+	* bootstrap.conf (gnulib_modules): Add idx.
+	* src/env.c: Include idx.h, minmax.h.
+	Prefer idx_t to ptrdiff_t when values are nonnegative.
+	(valid_escape_sequence, escape_char, validate_split_str)
+	(CHECK_START_NEW_ARG):
+	Remove; no longer needed now that we validate as we go.
+	(struct splitbuf): New type.
+	(splitbuf_grow, splitbuf_append_byte, check_start_new_arg)
+	(splitbuf_finishup): New functions.
+	(build_argv): New arg ARGC.  Validate and process in one go, using
+	the new functions; this is simpler and more reliable than the old
+	approach (as witness the recent bug).  Avoid integer overflow in
+	the unlikely case where the string contains more than INT_MAX
+	arguments.
+	(parse_split_string): Simplify by exploiting the new build_argv.
+
+	build: update gnulib submodule to latest
+
+2021-03-29  Pádraig Brady  <P@draigBrady.com>
+
+	tests: add a test case for recent env fix
+	* tests/misc/env-S.pl: Add a test case for recent commit ec6904f0.
+
+	maint: ignore all .a files in .gitignore
+	* .gitignore: Rather than add the new src/libcksum_pclmul.a,
+	just ignore any such libs.
+	* src/.gitignore: Likewise.
+	Reported by Kristoffer Brånemyr.
+
+2021-03-26  Paul Eggert  <eggert@cs.ucla.edu>
+
+	env: prefer ptrdiff_t
+	* src/env.c (usvars_used, vnlen, unset_envvars, expansion)
+	(build_argv): Prefer ptrdiff_t to size_t when either will do.
+
+	env: improve whitespace warning
+	* src/env.c (main): Issue -S warning for any whitespace,
+	not just space.
+
+	env: use GNU coding style
+	* src/env.c: Use GNU coding style for recentish changes.
+
+	env: remove asserts
+	The assertions didn’t help catch the most recent bug which
+	was in their area, and kind of get in the way.
+	* src/env.c: Do not include <assert.h>, and remove all assertions.
+	These seem to have been put in to pacify gcov, but surely there’s
+	a better way.
+	(escape_char): Pacify GCC with 'assume' instead.
+
+	doc: document env fix
+	* NEWS, doc/coreutils.texi (env invocation): Document recent change.
+
+	env: fix address violation with '\v' in -S
+	Problem reported by Frank Busse (Bug#47412).
+	* src/env.c (C_ISSPACE_CHARS): New macro.
+	(shortopts, build_argv, main): Treate all C-locale space
+	characters like space and tab, for compatibility with FreeBSD.
+	(validate_split_str, build_argv, parse_split_string):
+	Use the C locale, not the current locale, to determine whether a
+	byte is a space character.
+
+2021-03-25  Paul Eggert  <eggert@cs.ucla.edu>
+
+	hostname: pacify valgrind
+	* src/hostname.c (main) [IF_LINT]: Free hostname (Bug#47384).
+
+	hostname: use puts
+	* src/hostname.c (main): Prefer puts to printf "%s\n".
+
+	maint: indenting
+	* src/ln.c: Fix indenting.
+
+2021-03-25  Kamil Dudka  <kdudka@redhat.com>
+
+	ln: fix memory leaks in do_link
+	* src/ln.c (do_link): Free memory allocated by convert_abs_rel
+	on all code paths (Bug#47373).
+
+2021-03-25  Paul Eggert  <eggert@cs.ucla.edu>
+
+	stdbuf: port lib to macOS
+	* src/libstdbuf.c (fprintf, free, strtoumax): Undef these too,
+	since Gnulib might replace them.
+
+2021-03-24  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cksum: port recent changes to macOS
+	* src/cksum.c (cksum_slice8): Fix bug on little-endian
+	platforms lacking __bswap_32: the SWAP macro evaluates
+	its argument multiple times, but the macro has a side effect.
+
+2021-03-22  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: update bootstrap from gnulib
+	* bootstrap: Sync from gnulib/build-aux/bootstrap; the previous gnulib
+	update (commit 1a3eb6c30) missed to update that file.
+
+2021-03-21  Paul Eggert  <eggert@cs.ucla.edu>
+
+	ptx: remove use of diacrit module
+	The diacrit module is obsolete, and ptx’s use of it is obsolete
+	too; it assumes an 8-bit locale (not that common these days) and
+	that TeX cannot process the 8-bit characters (nowadays, it can).
+	* NEWS, doc/coreutils.texi (Charset selection in ptx): Document this.
+	* bootstrap.conf (gnulib_modules): Remove diacrit.
+	* src/ptx.c: Do not include diacrit.h.
+	(print_field, fix_output_parameters): Remove obsolete support
+	for 8-bit diacritics.
+
+	build: update gnulib submodule to latest
+
+2021-03-15  Pádraig Brady  <P@draigBrady.com>
+
+	cksum: don't exit immediately if a single file overflows
+	This behavior was introduced in commit FILEUTILS-4_0_44-4-g519b707b4.
+
+	* src/cksum.c (cksum_slice8): Only report the overflow, and continue.
+	* src/cksum_pclmul.c (cksum_pclmul): Likewise.
+
+2021-03-15  Pádraig Brady  <P@draigBrady.com>
+
+	cksum: add --debug to diagnose which implementation used
+	* src/cksum.c: (main): Use getopt_long to parse options,
+	and handle the new --debug option.
+	(pclmul_supported): Diagnose various failures and attempts.
+	* NEWS: Mention the new option.
+
+2021-03-15  Kristoffer Brånemyr  <ztion1@yahoo.se>
+
+	cksum: use pclmul hardware instruction for CRC32 calculation
+	Use cpuid to detect CPU support for hardware instruction.
+	Fall back to slice by 8 algorithm if not supported.
+	A 500MiB file improves from 1.40s to 0.67s on an i3-2310M
+
+	* configure.ac [USE_PCLMUL_CRC32]: A new conditional,
+	set when __get_cpuid() and clmul compiler intrinsics are supported.
+	* src/cksum.c (pclmul_supported): A new function using __get_cpuid()
+	to determine if pclmul instructions are supported.
+	(cksum): A new function refactored from cksum_slice8(),
+	which calls pclmul_supported() and then cksum_slice8()
+	or cksum_pclmul() as appropriate.
+	* src/cksum.h: Export the crctab array for use in the new module.
+	* src/cksum_pclmul.c: A new module to implement using pclmul intrinsics.
+	* po/POTFILES.in: Reference the new cksum_pclmul module.
+	* src/local.mk: Likewise.  Note we build it as a separate library
+	so that it can be portably built with separate -mavx etc. flags.
+	* tests/misc/cksum.sh: Add new test modes for pertinent buffer sizes.
+
+2021-03-14  Pádraig Brady  <P@draigBrady.com>
+
+	maint: propagate DEPENDENCIES to libs in single binary mode
+	build-aux/gen-single-binary.sh (override_single): A new function
+	to refactor the existing mappings for dir, vdir, and arch.
+	This function now also sets the DEPENDENCIES variable so that these
+	dependencies can be maintained later in the script, where
+	we now propagate the automake generated $(src_$cmd_DEPENDENCIES)
+	to our equivalent src_libsinglebin_$cmd_a_DEPENDENCIES.
+	This will ensure that any required libs are built,
+	which we require in a following change to cksum that
+	builds part of it as a separate library.
+
+2021-02-19  Pádraig Brady  <P@draigBrady.com>
+
+	rmdir: diagnose non following of symlinks with trailing slash
+	GNU/Linux is unusual here in that rmdir("symlink/") returns ENOTDIR,
+	whereas Solaris and FreeBSD at least, will follow the symlink
+	and remove the target directory.  We don't make the behavior
+	on Linux kernels consistent, but at least clarify
+	the confusing error message.
+
+	* src/rmdir (main): Output a specific error message for the above case.
+	(remove_parents): In the error message, don't assume intermediate paths
+	are directories, as they could be symlinks.
+	* tests/rmdir/symlink-errors.sh: Add a new test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the improvement.
+
+2021-02-18  Kamil Dudka  <kdudka@redhat.com>
+
+	stat,tail: add support for the exfat file system
+	Bug: https://bugzilla.redhat.com/1921427
+
+	* src/stat.c (human_fstype): Add case for the 'exfat' file system type.
+	* NEWS: Mention the Improvement.
+	Fixes https://bugs.gnu.org/46613
+
+2021-02-15  Erik Auerswald  <auerswal@unix-ag.uni-kl.de>
+
+	pr: fix alignment of input tabs to multiple columns
+	This regression was introduced in commit COREUTILS-6_8-58-g553d347d3
+
+	* src/pr.c (init_parameters): Process tabs for multiple columns.
+	* tests/pr/pr-tests.pl: Add test cases.
+	* NEWS: Mention the bug fix.
+	Fixes https://bugs.gnu.org/46422
+
+2021-02-10  Pádraig Brady  <P@draigBrady.com>
+
+	cat: extend --show-ends to show \r\n as ^M$
+	  - \r\n is common a line end combination
+	  - catting such a file without options causes it to display normally
+	  - overwriting the first char with $, loses info
+
+	* src/cat.c (cat): Convert \r preceeding a \n to ^M.
+	* tests/misc/cat-E.sh: New test.
+	* tests/local.mk: Reference new test.
+	* tests/misc/cat-proc.sh: Fix typo.
+	* doc/coreutils.texi (cat invocation): Mention the new behavior.
+	* NEWS: Mention the improvement.
+
+2021-01-26  Paul Eggert  <eggert@cs.ucla.edu>
+
+	expr: fix bug with unmatched \(...\)
+	Problem reported by Qiuhao Li.
+	* NEWS: Mention this.
+	* doc/coreutils.texi (String expressions):
+	Document the correct behavior, which POSIX requires.
+	* src/expr.c (docolon): Treat unmatched \(...\) as empty.
+	* tests/misc/expr.pl: New test.
+
+2021-01-25  Pádraig Brady  <P@draigBrady.com>
+
+	split: fix --number=K/N to output correct part of file
+	This functionality regressed with the adjustments
+	in commit v8.25-4-g62e7af032
+
+	* src/split.c (bytes_chunk_extract): Account for already read data
+	when seeking into the file.
+	* tests/split/b-chunk.sh: Use the hidden ---io-blksize option,
+	to test this functionality.
+	* NEWS: Mention the bug fix.
+	Fixes https://bugs.gnu.org/46048
+
+2021-01-19  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: rmdir --recursive substitutes
+	* doc/coreutils.texi (rmdir invocation): Add note on how to remove
+	empty subdirectories recursively.
+
+2021-01-15  Paul Eggert  <eggert@cs.ucla.edu>
+
+	mkdir: fix bug when -m's more generous than umask
+	Problem reported by David McCall (Bug#45886).
+	I introduced this problem when fixing Bug#14371.
+	* NEWS: Mention the fix.
+	* src/mkdir.c (struct mkdir_options): New members umask_ancestor,
+	umask_self, replacing umask_value.
+	(make_ancestor): Use them when temporarily adjusting umask.
+	(main): Set them, and set the umask to umask_self instead
+	of leaving it alone.
+	* tests/mkdir/perm.sh (tests): Add test case for bug.
+
+2021-01-09  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: modernize and fix regexp xref
+	* doc/coreutils.texi: Fix regexp cross-reference that had become
+	out-of-date (Bug#45749).  Also, fix some obsolete references to
+	SunOS and to /usr/dict/words, and change “Linux” to “GNU/Linux”
+	where appropriate.  Unfortunately the pipeline example gets more
+	complicated since /usr/share/dict/words is not sorted the way that
+	‘comm’ wants.
+
+2021-01-03  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: make formatting of SEE ALSO in cat.1 and tac.1 consistent
+	None of the coreutils man pages - but the two above - are using bold
+	setting for the references to other man pages in the SEE ALSO section.
+
+	* man/cat.x (SEE ALSO): Remove '\fB...\fP' setting.
+	* man/tac.x: Likewise, and add a reference to cat(1).
+
+2021-01-02  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: exempt 'doc/fdl.texi' from 'make update-copyright'
+	This file is a copy from gnulib and therefore should not get changed
+	by the yearly update.
+
+	* .x-update-copyright: Add pattern for the above file.
+	* doc/fdl.texi: Revert the previous change.
+
+2021-01-01  Pádraig Brady  <P@draigBrady.com>
+
+	maint: update all copyright year number ranges
+	Run "make update-copyright" and then...
+
+	* gnulib: Update to latest with copyright year adjusted.
+	* tests/init.sh: Sync with gnulib to pick up copyright year.
+	* bootstrap: Likewise.
+	* tests/sample-test: Adjust to use the single most recent year.
+
+2020-12-28  Pádraig Brady  <P@draigBrady.com>
+
+	tests: add a test for cksum
+	* tests/misc/cksum.sh: Test basic operation.
+	* tests/local.mk: Reference the new test.
+
+2020-12-28  Kristoffer Brånemyr  <ztion1@yahoo.se>
+
+	cksum: use more efficient slice by 8 algorithm
+	A 100MB file improves from 2.50s to 1.80s on a Sparc T5220
+	A 100MB file improves from 0.54s to 0.13s on an i3-2310M
+
+	* bootstrap.conf: Explicitly depend on byteswap,
+	since now used directly by coreutils.
+	* src/cksum.c (cksum): Process in multiples of 8 bytes.
+	(main): Adjust for generation of expanded crctab.
+	* src/cksum.h: Split now larger crctab to separate header.
+	* src/local.mk: Reference the new header.
+	* NEWS: Mention the improvement.
+
+2020-12-25  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+	* src/make-prime-list.c (free): Undef, since Gnulib's free-posix
+	module now defines this to rpl_free on some platforms.
+
+2020-12-18  Pádraig Brady  <P@draigBrady.com>
+
+	doc: remove extraneous ./src/ prefix from examples
+	* doc/coreutils.texi (numfmt invocation): s|./src/numfmt|numfmt|
+
+	doc: add `seq inf` and `sleep inf` examples to texinfo
+	* doc/coreutils.texi (seq invocation): Mention "inf" is supported,
+	and describe that it's handled specially to generate infinite
+	whole integer sequences.  Also mention that such infinite generation
+	is supported for integer steps up to 200.
+	(sleep invocation): Give `sleep inf` as an example to sleep forever.
+	* src/seq.c: Add a comment on SEQ_FAST_STEP_LIMIT, to say it's
+	reflected in the texinfo description.
+
+2020-12-15  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: document mkdir -m -p better
+	Chris Colohan wrote that the man page did not do enough to dispel
+	a common misunderstanding that “contributed to one of the scariest
+	outages Google has ever seen” (Bug#45258).
+	* doc/coreutils.texi (mkdir invocation):
+	* src/mkdir.c (usage): Document -m vs -p better.
+
+2020-12-15  KOBAYASHI Takashi  <a1415tk@aiit.ac.jp>
+
+	nl: fix --section-delimiter handling of single characters
+	* src/nl.c (main): Enforce the POSIX specified
+	behavior of assuming ':' is specified after a single
+	character argument to -d.
+	* tests/misc/nl.sh: Add a test case.
+	* NEWS: Mention the bug fix.
+
+2020-12-15  Pádraig Brady  <P@draigBrady.com>
+
+	doc: mention the GNU extensions to nl --section-delimiter
+	* doc/coreutils.texi (nl invocation): Mention the GNU extensions
+	of allowing arbitrary length and empty delimiter strings.
+	* src/nl.c (usage): Likewise.
+	* tests/misc/nl.sh: Add test cases for the GNU extensions.
+
+	maint: refactor nl section delimiter handling
+	* src/nl.c (main): Update the default delimiter characters
+	when passed two characters with --section-delimiter.
+	Avoid redundant copies for the body and footer delimiter strings,
+	and instead, just offset into the header string.
+	(check_section): Avoid redundant comparing of 2 bytes of memory
+	for an empty delimiter.
+
+2020-12-12  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+2020-12-08  Arman Absalan  <armanaxh@gmail.com>
+
+	chroot,comm,join: fix usage options style
+	* src/chroot.c (usage): Fix indentation of options.
+	* src/comm.c: Likewise.
+	* src/join.c: Likewise.
+
+2020-12-01  Pádraig Brady  <P@draigBrady.com>
+
+	date: with --debug, show the output format
+	The format can be determined from --options or the locale,
+	so it's useful to output the format string being used.
+
+	* src/date.c (show_date): Show the output format
+	along with the date being shown.
+	* tests/misc/date-debug.sh: Adjust accordingly.
+	Addresses https://bugs.gnu.org/44960
+
+2020-11-27  Tim Gates  <tim.gates@iress.com>
+
+	maint: fix typo, characteres -> characters
+	* src/expr.c: Fix typo in comment.
+
+2020-11-26  Nishant Nayan  <nishant.nayan@oracle.com>
+
+	rm: do not skip files upon failure to remove an empty dir
+	When removing a directory fails for some reason, and that directory
+	is empty, the rm_fts code gets the return value of the excise call
+	confused with the return value of its earlier call to prompt,
+	causing fts_skip_tree to be called again and the next file
+	that rm would otherwise have deleted to survive.
+
+	* src/remove.c (rm_fts): Ensure we only skip a single fts entry,
+	when processing empty dirs.  I.e. only skip the entry
+	having successfully removed it.
+	* tests/rm/empty-immutable-skip.sh: New root-only test.
+	* tests/local.mk: Add it.
+	* NEWS: Mention the bug fix.
+	Fixes https://bugs.gnu.org/44883
+
+2020-11-26  Pádraig Brady  <P@draigBrady.com>
+
+	maint: mention in NEWS about new df remote fs types
+	* NEWS: Mention new remote file system types
+	recognized since gnulib commit dd1fc46b.
+
+2020-11-23  Pádraig Brady  <P@draigBrady.com>
+
+	maint: remove no longer needed se_const helper
+	This was needed before libselinux-2.3 (May 2014),
+	but modern releases have the correct const declarations.
+
+	* src/chcon.c: Remove se_const() wrapper.
+	* src/cp.c: Likewise.
+	* src/install.c: Likewise.
+	* src/mkdir.c: Likewise.
+	* src/mkfifo.c: Likewise.
+	* src/mknod.c: Likewise.
+	* src/system.h: Likewise.
+	* gnulib: update to pick up const correctness fixes in selinux stubs.
+
+2020-11-23  Pádraig Brady  <P@draigBrady.com>
+
+	maint: fix syntax-check failure
+	* po/POTFILES.in (src/selinux.c): Remove entry as this source doesn't
+	contain any translatable strings anymore; avoids a sc_po_check failure.
+
+2020-11-23  Paul Eggert  <eggert@cs.ucla.edu>
+
+	install: suppress "Operation not supported" false alarms
+	At least, I *think* they are false alarms.  An SELinux expert eye
+	would be welcome.
+	* src/install.c (setdefaultfilecon): If selabel_lookup fails
+	due to either ENOTSUP or ENODATA, don’t diagnose the issue.
+	Problem reported by Kamil Dudka in:
+	https://lists.gnu.org/r/coreutils/2020-11/msg00050.html
+
+	maint: propagate errno better in selinux.c
+	* src/selinux.c: Don’t include die.h; no longer needed.
+	(computecon, defaultcon, restorecon): Propagate errno.
+	(defaultcon, restorecon): Don’t diagnose errors or exit, as that’s
+	the caller’s responsibility.
+
+2020-11-23  Pádraig Brady  <P@draigBrady.com>
+
+	maint: use absolute paths with selabel_lookup
+	* src/selinux.c: selabel_lookup requires absolute paths
+	(while only older matchpathcon before libselinux < 2.1.5 2011-0826 did).
+	* po/POTFILES.in: Readd src/selinux.c since we now have
+	a translatable error message.
+
+2020-11-22  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: minor cleanup
+	The previous commit introduced a couple of syntax-check failures.
+
+	* .gitignore (/lib/se-label.h): Add entry to silence the
+	sc_gitignore_missing check.  Sort entries in C locale.
+	* po/POTFILES.in (src/selinux.c): Remove entry as this source doesn't
+	contain any translatable strings anymore; avoids a sc_po_check failure.
+	* src/mv.c: Replace tabs by spaces to avoid complaints by
+	sc_prohibit_tab_based_indentation.
+
+2020-11-22  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+	maint: port from matchpathcon to selabel_lookup
+	Ubuntu 20.10 is using a newer version of libselinux that
+	complains that matchpathcon is obsolete.  Rewrite the code
+	that it uses the recommended selabel_lookup instead.
+	* m4/jm-macros.m4 (coreutils_MACROS): Do not check for
+	matchpathcon_init_prefix, as it is no longer used.
+	* src/copy.c (set_file_security_ctx): Omit process_local arg,
+	as it is equivalent to !x->set_security_context.  All callers changed.
+	* src/copy.h (struct cp_options): set_security_context is now of
+	type struct selabel_handle *, not bool.  All uses changed.
+	* src/cp.c, src/install.c, src/mkdir.c, src/mkfifo.c, src/mknod.c:
+	* src/mv.c: Include selinux/label.h.
+	(main): Use selabel_open for set_security context.
+	* src/install.c (matchpathcon_init_prefix): Remove; now unused.
+	(get_labeling_handle): New static function.
+	(setdefaultfilecon, main): Use it.
+	(setdefaultfilecon): Do something regardless of
+	ENABLE_MATCHPATHCON, which seems to be a revenant macro.
+	(setdefaultfilecon): Use selabel_lookup instead of the obsolescent
+	matchpathcon.  Report an error unless it fails due to ENOENT.
+	* src/local.mk (src_ginstall_CPPFLAGS): Remove.
+	* src/selinux.c: Include selinux/label.h
+	Do not include die.h, error.h, canonicalize.h.
+	(defaultcon, restorecon_private, restorecon):
+	New arg HANDLE.  All callers changed.
+	Use selabel_lookup rather than matchpathcon.
+	(restorecon_private, restorecon): Don’t lose track of errno.
+	* src/selinux.c, src/selinux.h:
+	(restorecon): Don’t call ‘error’; that’s the caller’s job.
+	Use HAVE_SELINUX_LABEL_H, not HAVE_SELINUX_SELINUX_H,
+	in case there is some weird system with the former but not the latter.
+	* src/selinux.h (struct selinux_handle): Add forward decl.
+
+	build: port to Solaris 10
+	* src/local.mk (src_ln_LDADD, src_mktemp_LDADD, src_tac_LDADD):
+	Add $(LIB_CLOCK_GETTIME), since these use tempname which uses
+	clock_gettime if getrandom fails.  On platforms like Solaris 10,
+	clock_gettime is not in the standard C library.
+
+	build: update gnulib submodule to latest
+
+2020-11-18  Pádraig Brady  <P@draigBrady.com>
+
+	doc: mention that sort -g supports hex numbers
+	* doc/coreutils.texi (sort invocation): Mention explicitly
+	that --general-numeric-sort supports arbitrary format hex numbers,
+	but also mention that consistent case/width hex numbers can
+	be sorted faster with a standard sort.
+
+2020-11-14  Pádraig Brady  <P@draigBrady.com>
+
+	tr: fix crash validating -c with some case char classes
+	This crash was identified by Cyber Independent Testing Lab:
+	https://cyber-itl.org/2020/10/28/citl-7000-defects.html
+	and was introduced with commit v8.5-163-g3f48829c2
+
+	* src/tr.c (validate_case_classes): Don't apply these
+	extra case alignment checks in the --complement case,
+	which is even more restrictive as to the contents of SET2.
+	* tests/misc/tr-case-class.sh: Add a test case,
+	for a large SET1, which caused the length adjustment
+	in validate_case_classes to underflow and trigger the assert.
+	* NEWS: Mention the bug fix.
+
+2020-11-12  Ben Pfaff  <blp@cs.stanford.edu>
+
+	doc: clarify in texinfo that `test == ...` is non portable
+	* doc/coreutils.texi (test invocation): Mention non portability
+	of the double equals form.
+
+2020-11-11  Pádraig Brady  <P@draigBrady.com>
+
+	ls: fix crash printing SELinux context for unstatable files
+	This crash was identified by Cyber Independent Testing Lab:
+	https://cyber-itl.org/2020/10/28/citl-7000-defects.html
+	and was introduced with commit v6.9.90-11-g4245876e2
+
+	* src/ls.c (gobble_file): Ensure scontext is initialized
+	in the case where files are not statable.
+	* tests/ls/selinux-segfault.sh: Renamed from proc-selinux-segfault.sh,
+	and added test case for broken symlinks.
+	* tests/local.mk: Adjust for the renamed test.
+	* NEWS: Mention the bug fix.
+
+2020-11-07  Pádraig Brady  <P@draigBrady.com>
+
+	timeout: support sub-second timeouts on macOS
+	* m4/jm-macros.m4: Check for setitimer.
+	* src/timeout.c: Use setitimer if timer_settime is not available.
+	* NEWS: Mention the improvement.
+
+2020-11-07  Pádraig Brady  <P@draigBrady.com>
+
+	maint: avoid strncat warning on GCC
+	GCC 10.1.1 without optimization gives:
+
+	  error: ‘strncat’ argument 2 declared attribute ‘nonstring’
+	    [-Werror=stringop-overflow=]
+	    strncat (comment, UT_ID (utmp_ent), utmpsize);
+
+	Note the strncat man page says that:
+	  "src does not need to be null-terminated
+	   if it contains n or more bytes."
+	And the POSIX spec says that the second (source) parameter
+	is an array not a string.
+	So I think it's incorrect for strncat to require src be a string type.
+	This constraint seems to be being added to the gcc builtin strncat,
+	as specifiying -fno-builtin also avoids the warning.
+	Note specifying any optimization level also avoids the warning.
+
+	* src/who.c (make_id_equals_comment): Avoid the issue by using
+	stpcpy + stzncpy, instead of strcpy + strncat.
+	This pattern is used elsewhere in who.c
+
+2020-10-28  Pádraig Brady  <P@draigBrady.com>
+
+	stat,tail: sync file system constants from the linux kernel
+	* src/stat.c: Add magic constants for "devmem", and
+	"zonefs" file systems.
+	* NEWS: Mention the improvement.
+
+	maint: cleanup operation of fs-magic-compare
+	* src/local.mk: Ensure we map 2 hex digits to 4,
+	so that we don't output already handled Z3FOLD file system (0x33).
+	Also hide the generation command for src/fs.h.
+
+2020-10-27  Pádraig Brady  <P@draigBrady.com>
+
+	doc: make blank lines before --help consistent
+	* src/basenc.c (usage): Remove extraneous blank line,
+	to be consistent with other utilities that have options.
+	* src/realpath.c: Likewise.
+	* src/runcon.c: Likewise.
+	Addresses https://bugs.gnu.org/44248
+
+2020-10-26  Jim Meyering  <meyering@fb.com>
+
+	maint: avoid new sort.c warning from upcoming GCC11
+	gcc version 11.0.0 20201025 (experimental) warns that
+	src/sort.c:1655:1: warning: function might be candidate for attribute \
+	  'pure' if it is known to return normally [-Wsuggest-attribute=pure]
+	* src/sort.c (limfield): Mark as pure.
+
+2020-10-26  Kamil Dudka  <kdudka@redhat.com>
+
+	dd: drop old workaround for lseek() bug in Linux kernel
+	The workaround triggers warnings from newer kernel versions in case
+	a user does not have sufficient privileges for the MTIOCGET ioctl.
+
+	* src/dd.c (skip_via_lseek): Drop wrapper function no longer needed.
+	(skip): Use lseek() directly.
+	(advance_input_after_read_error): Likewise.
+
+	Reported-by: Nir Soffer at https://bugzilla.redhat.com/1876840
+	Fixes https://bugs.gnu.org/44235
+
+2020-10-26  KOBAYASHI Takashi  <a1415tk@aiit.ac.jp>
+
+	nl: support a negative --line-increment
+	* src/nl.c (main): Allow -i to accept down to INTMAX_MIN.
+	* tests/misc/nl.sh: Add test cases.
+	* NEWS: Mention the new feature.
+
+2020-10-25  Pádraig Brady  <P@draigBrady.com>
+
+	nl: only fail if need to output overflowed numbers
+	Previously we would have failed immediately upon internal overflow,
+	which didn't output the full line being processed, and assumed
+	there would be another numbered line.
+
+	* src/nl.c (line_no_overflow): A new global to track overflow.
+	(print_lineno): Only fail if about to output an overflowed number.
+	(reset_lineno): A new function to refactor resetting of the number,
+	and which also clears line_no_overflow.
+	* tests/misc/nl.sh: Add a test case.
+
+2020-10-25  Pádraig Brady  <P@draigBrady.com>
+
+	maint: add lib/parse-datetime-gen.h to .gitignore
+	* .gitignore: update to ignore new file
+	generated by the latest gnulib update.
+
+	maint: sync help2man to latest version
+	* man/help2man: sync to changes from version 1.47.16.
+	Note this doesn't materially change the generated man pages.
+	Addresses https://bugs.gnu.org/44105
+
+2020-10-19  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+	* gl/lib/randperm.c, src/cp-hash.c, src/ls.c, src/sort.c, src/tail.c:
+	Change all instaces of hash_delete to hash_remove to accommodate
+	change to Gnulib API.
+
+2020-10-17  Grigorii Sokolik  <g.sokol99@g-sokol.info>
+
+	maint: remove already handled FIXME in tail.c
+	* src/tail.c: Remove FIXME to follow a file name in a recreated
+	directory. The comment was added in commit v8.5-191-g61b77891c
+	while the fix (albeit not using inotify) was added in
+	commit v8.27-21-gba5fe2d4b
+
+	maint: update docs for build prerequisites
+	* README-prereq: Explicitly pull tags,
+	and update the xz git repo url.
+
+2020-09-29  Benno Schulenberg  <bensberg@telfort.nl>
+
+	doc: fix punctuation in stat --help
+	* src/stat.c (usage): Replace a mistaken semicolon with a colon,
+	and replace mistaken backticks with single quotes.  Also reorder
+	some words, for clarity.
+	Fixes https://bugs.gnu.org/43707
+
+2020-08-12  Pádraig Brady  <P@draigBrady.com>
+
+	doc: clarify timeout --foreground description
+	* doc/coreutils.texi (timeout invocation): Avoid any implication
+	that `timeout --foreground` could be used to retroactively
+	timeout commands not already invoked by timeout(1).
+	Fixes bug https://bugs.gnu.org/42831
+
+2020-08-08  Emanuele Giacomelli  <vpooldyn-linux@yahoo.it>
+
+	csplit: fix regex suppression with specific match count
+	* src/csplit.c (process_regexp): Process the line suppression
+	in all invocations so that the last match is suppressed.
+	Previously with a non infinite match count,
+	the last regex pattern was not suppressed.
+	* NEWS: Mention the bug fix.
+	* tests/misc/csplit-suppress-matched.pl: Add a test case.
+	Fixes https://bugs.gnu.org/42764
+
+2020-07-31  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	tests: skip some parts of 'tests/rmdir/ignore.sh' if run as root
+	Parts of this test expect that the rmdir syscall returns with EPERM,
+	but the root user does not see that.
+
+	* tests/rmdir/ignore.sh: Add uid_is_privileged_ guards around parts
+	of the test which expect rmdir() to fail with EPERM.
+
+	Reported by Nick Alcock <nix@esperi.org.uk> in
+	https://bugs.gnu.org/42633
+
+2020-07-28  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: show version in title of HTML manual
+	* doc/coreutils.texi (@include version.texi): Move before ...
+	(@settitle): ... this.  Add the version after the package name.
+
+	Suggested by Jonny Grant <jg@jguk.org> in
+	https://lists.gnu.org/r/bug-coreutils/2020-07/msg00021.html
+
+2020-07-28  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+	* src/local.mk (src_expr_LDADD, src_factor_LDADD):
+	Adjust to Gnulib renaming of LIB_GMP to LIBGMP.
+
+2020-07-27  Pádraig Brady  <P@draigBrady.com>
+
+	doc: fix typo in env --split-string documentation
+	* doc/coreutils.texi: Fix grammar.
+
+2020-07-24  Paul Eggert  <eggert@cs.ucla.edu>
+
+	date: clarify the Epoch
+	* src/date.c (usage): Mention the Epoch under %s for clarity,
+	and capitalize.
+
+	doc: modernize date examples
+	* doc/coreutils.texi: Use more-modern date examples.
+	Capitalize “Epoch” to be consistent with POSIX.
+
+	build: update gnulib submodule to latest
+	* bootstrap.conf (gnulib_modules): Add hash-triple.
+
+2020-07-20  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: clarify 'timeout -k' behavior
+	* doc/coreutils.texi (timeout invocation): Document that the the
+	duration of --kill-after=DURATION begins when sending the initial
+	signal.  Also mention that -k does not have any effect if timeout's
+	duration is 0.
+
+	Suggested by Jonny Grant <jg@jguk.org>.
+
+2020-07-19  Paul Eggert  <eggert@cs.ucla.edu>
+
+	factor: port to --without-libgmp
+	* src/factor.c (mp_factor_using_division): Use mpz_fdiv_q_2exp
+	instead of its no-longer-documented mpz_div_2exp alias.
+	(print_factors): Use mpz_out_str instead of gmp_printf.
+
+2020-07-11  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: be less aggressive about -fanalyzer
+	* configure.ac: Don’t enable -fanalyzer unless configured with the
+	new --enable-gcc-warnings=expensive option.  See thread at:
+	https://lists.gnu.org/r/coreutils/2020-07/msg00011.html
+
+2020-07-09  Paul Eggert  <eggert@cs.ucla.edu>
+
+	factor: explain why non-GMP code (Bug#42269)
+	* doc/coreutils.texi (factor invocation):
+	* src/factor.c: Explain why the two-word algorithm is useful.
+
+2020-07-08  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: mention expr and factor bignums
+	* NEWS:
+	* doc/coreutils.texi (expr invocation, factor invocation):
+	Mention bignum support on all platforms.  Modernize timings.
+
+	factor: treat ' +bignum' like non-bignum
+	* src/factor.c (strto2uintmax): Instead of here ...
+	(print_factors): ... skip spaces and '+' here, so that
+	bignums are treated like non-bignums.
+	* tests/misc/factor.pl (bug-gmp-plus_2_sup_128_plus_1): New test.
+
+	tests: simplify since expr now works on bignums
+	* cfg.mk (sc_prohibit_expr_unsigned): Remove.
+	* tests/dd/skip-seek-past-dev.sh (DEV_OFLOW):
+	* tests/id/setgid.sh (gp1):
+	* tests/misc/cut-huge-range.sh (CUT_MAX):
+	* tests/misc/expr.pl:
+	* tests/misc/sort-discrim.sh:
+	Assume expr works on bignums.
+	* tests/misc/cut-huge-range.sh (subtract_one):
+	Remove; no longer needed.
+
+	factor: simplify tests by assuming libgmp
+	* tests/misc/factor.pl: Test bignums even if !HAVE_GMP.
+
+2020-07-07  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: use Gnulib libgmp module
+	This lets use assume multiple-precision arithmetic on all
+	platforms, simplifying the code.
+	* bootstrap.conf (gnulib_modules): Add libgmp.
+	* configure.ac: Don’t call cu_GMP, as this is now done by Gnulib.
+	* m4/gmp.m4: Remove.
+	* src/expr.c, src/factor.c: Use gmp.h unconditionally.
+	* src/factor.c: Use the simpler ‘#ifndef mpz_inits’ to
+	determine whether there is an mpz_inits macro.
+
+	build: update gnulib submodule to latest
+
+2020-07-03  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: add timeout examples
+	* doc/coreutils.texi (timeout invocation): Add examples.
+
+	Suggested by Jonny Grant <jg@jguk.org> in
+	https://lists.gnu.org/r/bug-coreutils/2020-06/msg00018.html
+
+2020-06-30  Andreas Schwab  <schwab@linux-m68k.org>
+
+	tests: avoid spurious testsuite failure
+	* tests/dd/stats.sh: Increase timeout.
+	Fixes https://bugs.gnu.org/42135
+
+2020-06-26  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix false failure with valgrind and reflink
+	* tests/cp/fiemap-FMR.sh: Avoid FICLONE ioctl,
+	which would avoid the point of the test (fiemap testing).
+	Also it avoids a valgrind bug with this ioctl:
+	https://bugs.kde.org/show_bug.cgi?id=397605
+
+2020-06-26  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp: use copy_file_range if available
+	* NEWS: Mention this.
+	* bootstrap.conf (gnulib_modules): Add copy-file-range.
+	* src/copy.c (sparse_copy): Try copy_file_range if not
+	looking for holes.
+
+	cp: use SEEK_DATA/SEEK_HOLE if available
+	If it works, prefer lseek with SEEK_DATA and SEEK_HOLE to FIEMAP,
+	as lseek is simpler and more portable (will be in next POSIX).
+	Problem reported in 2011 by Jeff Liu (Bug#8061).
+	* NEWS: Mention this.
+	* src/copy.c (lseek_copy) [SEEK_HOLE]: New function.
+	(enum scantype): New constants ERROR_SCANTYPE, LSEEK_SCANTYPE.
+	(union scan_inference): New type.
+	(infer_scantype): Last arg is now union scan_inference *,
+	not struct extent_scan *.  All callers changed.
+	Prefer SEEK_HOLE to FIEMAP if both work, since
+	SEEK_HOLE is simpler and more portable.
+	(copy_reg): Do the fdadvise after initial scan, in case the scan
+	fails.  Report an error if the initial scan fails.
+	(copy_reg) [SEEK_HOLE]: Use lseek_copy if scantype says so.
+
+	cp: avoid copy_reg goto
+	* src/copy.c (copy_reg): Redo to avoid label and goto.
+
+	cp: refactor extent_copy
+	* src/copy.c (extent_copy): New arg SCAN, replacing
+	REQUIRE_NORMAL_COPY.  All callers changed.
+	(enum scantype): New type.
+	(infer_scantype): Rename from is_probably_sparse and return
+	the new type.  Add args FD and SCAN.  All callers changed.
+
+	maint: typo fix
+	* NEWS: Fix typo.
+
+2020-06-23  Paul Eggert  <eggert@cs.ucla.edu>
+
+	chmod: man page fixes
+	* man/chmod.x: Mention -6000 too.  Use .BR to fix trailing period.
+
+2020-06-21  Pádraig Brady  <P@draigBrady.com>
+
+	doc: fix punctuation in man pages
+	* man/chmod.x: Add missing punctuation.
+	* src/expand-common.c: Likewise.
+	* src/numfmt.c: Likewise.
+	* src/rm.c: Likewise.
+
+	Fixes https://bugs.gnu.org/41962
+
+2020-06-20  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	stat,tail: add support for the VBOXSF file system
+	* src/stat.c (human_fstype): Add case for the 'vboxsf' file system type
+	which is used for VirtualBox Shared Folders mounted in VirtualBox guest
+	VMs.
+	* NEWS: Mention the Improvement.
+	Fixes https://bugs.gnu.org/41935
+
+2020-06-19  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp: default to COW
+	Likewise for ‘install’.  Proposed in Bug#24400, and long past due.
+	* NEWS:
+	* doc/coreutils.texi (cp invocation):
+	* src/copy.h (enum Reflink_type): Document this.
+	* src/cp.c (cp_option_init):
+	* src/install.c (cp_option_init): Implement this.
+
+2020-06-15  Tobias Stoeckmann  <tobias@stoeckmann.org>
+
+	maint: avoid signed integer overflows
+	Since -LONG_MIN results in LONG_MIN again, the operation itself is
+	a signed integer overflow.
+
+	This can be observed with the following calls (best if compiled
+	with -ftrapv or -fsanitize=undefined):
+
+	  $ numfmt --padding=-9223372036854775808
+	  $ seq 1e-9223372036854775808
+
+	Technically, the change in seq "reduces" the precision, but a double
+	or long double that small would be represented as 0 anyway.
+
+	* src/numfmt.c: Explicitly disallow --padding=LONG_MIN.
+	* src/seq.c: Treat 1e$LONG_MIN as 1e-$LONG_MAX.
+	* tests/misc/numfmt.pl: Add a test case.
+	* tests/misc/seq-precision.sh: Likewise.
+
+	Fixes https://bugs.gnu.org/41850
+
+2020-06-07  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: timeout: improve documentation of the exit status
+	* doc/coreutils.texi (timeout invocation): Document that the exit
+	status is 137 when the KILL signal is used, regardless of whether that
+	signal is sent to COMMAND or timeout.
+	* src/timeout.c (usage): Likewise. Also split out and expand
+	on the possible exit status values to a separate table.
+
+	Discussed at https://bugs.gnu.org/41634
+
+2020-06-01  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: use getrandom, not getentropy
+	This makes for one Gnulib module less, and at runtime there’s
+	typically just one getrandom syscall instead of several for large
+	nonces.
+	* gl/lib/randread.c: Include sys/random.h instead of sys/time.h
+	and unistd.h.
+	(get_nonce): Use getrandom, not getentropy.
+	* gl/modules/randread (Depends-on):
+	Depend on getrandom, not getentropy.
+	* src/shred.c (main):
+	* src/shuf.c (main):
+	* src/sort.c (random_md5_state_init):
+	Say "getrandom" rather than "getentropy" in (unlikely) diagnostic.
+
+	maint: use getentropy and new tempname modules
+	Update gnulib submodule to latest and use its new features.
+	Gnulib’s new getentropy module means coreutils can now assume
+	getentropy instead of approximating it, badly in some cases.
+	Gnulib’s improvements to the tempname module mean coreutils no
+	longer needs to maintain private patches.
+	* bootstrap.conf (gnulib_modules): Remove gettimeofday.
+	* gl/lib/randread.c (NAME_OF_NONCE_DEVICE): Remove.
+	(get_nonce): Return success indicator.  Remove bytes_bound arg.
+	All callers changed.  Rewrite by using getentropy instead of
+	reading the nonce device and falling back on gettimeofday.
+	Fail if getentropy fails.
+	(randread_new): Return NULL (setting errno) if get_nonce fails.
+	All callers changed.
+	* gl/lib/tempname.c.diff, gl/lib/tempname.h.diff:
+	* gl/modules/tempname.diff: Remove.
+	* gl/modules/randread (Depends-on):
+	Depend on getentropy, not gettimeofday.
+	* src/ptx.c (swallow_file_in_memory):
+	* src/shuf.c (read_input):
+	Adjust to read_file changes in Gnulib.
+	* src/shred.c (main):
+	* src/shuf.c (main):
+	* src/sort.c (random_md5_state_init):
+	Diagnose the new form of randread_new failures: randread_new can
+	fail now when !random_source, meaning getentropy failed.
+
+	echo: pacify Oracle Studio 12.6
+	* src/echo.c (main): Don’t assign pointer to bool.
+	This is well-defined in C99, but is arguably bad style
+	and Oracle Studio 12.6 complains.
+
+2020-05-25  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: copy FDL from gnulib instead of using it as module
+	Since the previous gnulib update, bootstrap outputs this warning:
+
+	  Notice from module fdl:
+	    Don't use this module! Instead, copy the referenced license file \
+	    into your version control repository.
+
+	See gnulib commit:
+	  https://git.sv.gnu.org/cgit/gnulib.git/commit/?id=88fc5afbccc9
+
+	* bootstrap.conf (gnulib_modules): Remove 'fdl'.
+	* doc/fdl.texi: Add file as a copy of 'gnulib/doc/fdl.texi'.
+	* doc/.gitignore (/fdl.texi): Remove entry.
+	* cfg.mk (FILTER_LONG_LINES): Add pattern for the 'fdl.texi' file.
+
+2020-05-23  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: fix syntax-check failure from recent adjustment
+	* cfg.mk (old_NEWS_hash): Regenerate after commit v8.32-15-g6d0107a37
+
+2020-05-23  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	tests: fix removed-directory test
+	The previous attempt to skip that test on NFS (commit 4181fc518362)
+	made the test fail; it introduced two problems:
+	a) In the good case, i.e., when the subshell returns with exit status 0,
+	the test ran into framework_failure_.
+	b) As the subshell also runs with 'set -x', the later comparison of
+	/dev/null with 'err' would fail.
+
+	* tests/ls/removed-directory.sh: Revert to the style without subshell,
+	and add 'test -d .' to verify that 'ls' can read the removed dir.
+
+2020-05-21  Paul Eggert  <eggert@cs.ucla.edu>
+
+	date: document +%-N change
+	Suggested by Kamil Dudka in:
+	https://lists.gnu.org/r/bug-gnulib/2020-05/msg00205.html
+	* NEWS: Mention the change for coreutils 8.23.
+	* doc/coreutils.texi (Padding and other flags):
+	Document it.
+
+	ls: port removed-directory test to NFS
+	* tests/ls/removed-directory.sh:
+	Port test to NFS, where one gets a stale file handle
+	when looking at a removed directory.
+
+	dd: omit unnecessary vars when !lint
+	* src/dd.c (real_ibuf, real_obuf) [!lint]:
+	Remove, as they're needed only when lint checking.
+	All uses removed when 'lint' is not defined.
+
+	maint: omit unnecessary pragmas and fix tsort.c
+	* src/chown-core.c, src/comm.c:
+	* src/tsort.c (record_relation):
+	Remove GCC 10 pragmas that are not needed in GCC 10.1.0 (the first
+	public GCC 10 release) and that in some cases cause diagnostics
+	with GCC 10.1.0.  The tsort.c change fixes a bug that was
+	inadvertantly introduced when these pragmas were added.
+
+	build: update gnulib submodule to latest
+
+2020-05-11  Pádraig Brady  <P@draigBrady.com>
+
+	maint: avoid warnings from GCC's -fanalyzer
+	* src/env.c (build_argv): Add an assert() to avoid:
+	  warning: use of NULL 'n' where non-null expected
+	  [CWE-690] [-Wanalyzer-null-argument]
+	  note: argument 1 of 'getenv' must be non-null
+	* src/dd.c (alloc_ibuf): Don't discard the allocated pointer, to avoid:
+	  [CWE-401] [-Wanalyzer-malloc-leak]
+	(alloc_obuf): Likewise.
+	(cleanup): Deallocate the now tracked buffers which
+	also avoids "possibly lost" warnings from valgrind.
+	* src/tsort.c (search_item): Add asserts to avoid:
+	  [CWE-690] [-Wanalyzer-null-dereference]
+	(record_relation): An assert doesn't suffice here,
+	so disable the warning for this function.
+	* src/comm.c: Suppress the following false positive for the whole file:
+	  [CWE-457] [-Wanalyzer-use-of-uninitialized-value]
+	* src/chown-core.c: Suppress the following false positive for the file:
+	  [CWE-415] [-Wanalyzer-double-free]
+
+2020-04-27  Jason Kim  <git@jasonk.me>
+
+	ls: allow --classify to be ignored for non tty output
+	Have the `ls` `--classify` option take an optional argument for when to
+	classify ("always", "auto", "never"), just like the optional argument
+	for `--color`.  When the optional argument is not specified, default to
+	"always" for backwards compatibility.
+
+	* src/ls.c (usage): Update help text.
+	(decode_switches): Support an optional argument for --classify.
+	* tests/ls/classify.sh: Add a new test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the new feature.
+
+2020-04-22  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	build: update gnulib to latest - to avoid du(1) crash on XFS
+	Pull in a fix for FTS to avoid a crash when traversing a heavily
+	changed XFS file system:
+
+	> fts: remove NOSTAT_LEAF_OPTIMIZATION
+
+	* NEWS (Bug fixes): Mention the fix.
+	* gnulib: Update to latest.
+	* bootstrap: Sync from gnulib/build-aux/bootstrap.
+
+	Discussed at:
+	<https://lists.gnu.org/r/bug-gnulib/2020-04/msg00068.html>
+
+2020-04-02  Pádraig Brady  <P@draigBrady.com>
+
+	maint: clean up recently added test
+	* tests/misc/uniq-collate.sh: Remove logic that
+	was already refactored into gen_input().
+
+	cp: ensure --attributes-only doesn't remove files
+	* src/copy.c (copy_internal): Ensure we don't unlink the destination
+	unless explicitly requested.
+	* tests/cp/attr-existing.sh: Add test cases.
+	* NEWS: Mention the bug fix.
+	Fixes https://bugs.gnu.org/40352
+
+2020-03-28  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+	* src/selinux.c: Do not include dosname.h; not needed, since
+	system.h does that for us via dirname.h.
+
+2020-03-15  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: add texi2dvi build directory to doc/.gitignore
+	* doc/.gitignore (/coreutils.t2p/): Add entry for the build directory
+	left behind after 'make pdf'.
+	While at it, sort the file.
+
+2020-03-07  Paul Eggert  <eggert@cs.ucla.edu>
+
+	ls: improve removed-directory test
+	* tests/ls/removed-directory.sh: Remove host_triplet test.
+	Skip this test if one cannot remove the working directory.
+	From a suggestion by Bernhard Voelker (Bug#39929).
+
+	ls: restore 8.31 behavior on removed directories
+	* NEWS: Mention this.
+	* src/ls.c: Do not include <sys/sycall.h>
+	(print_dir): Don't worry about whether the directory is removed.
+	* tests/ls/removed-directory.sh: Adjust to match new (i.e., old)
+	behavior.
+
+2020-03-05  Pádraig Brady  <P@draigBrady.com>
+
+	maint: post-release administrivia
+	* NEWS: Add header line for next release.
+	* .prev-version: Record previous version.
+	* cfg.mk (old_NEWS_hash): Auto-update.
+
+	version 8.32
+	* NEWS: Record release date.
+
+2020-03-04  Pádraig Brady  <P@draigBrady.com>
+
+	tests: don't rely on system env(1) being present
+	* tests/misc/env-S.pl: `env -i env` will call the system env
+	due to the path being cleared, so pass the absolute path
+	of our env binary under test to avoid that.  This was seen
+	to be an issue on Guix where /usr/bin/env was not available.
+
+	basenc: avoid undefined behaviour in z85 processing
+	* src/basenc.c (z85_decode_ctx_init): Ensure we're working
+	with unsigned, as otherwise ubsan triggers with:
+	  src/basenc.c:767:18: runtime error: signed integer overflow:
+	  43 * 52200625 cannot be represented in type 'int'
+	(z85_encode): Likewise to avoid the usban error:
+	  src/basenc.c:630:26: runtime error:
+	  left shift of 134 by 24 places cannot be represented in type 'int'
+
+2020-03-01  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid a false failure on OpenIndiana 11
+	* tests/misc/timeout-parameters.sh: Split the large timeout
+	handling to ...
+	* tests/misc/timeout-large-parameters.sh: ... here, so that
+	the 3 second delay is contained in its own test, and if
+	the test is skipped due invalid handling within timeout(1),
+	it will be more apparent.
+	Also adjust the check so we skip whenever the kernel timer
+	fires immediately, to handle the buggy OpenIndiana 11 kernel also.
+	Reported by Bruno Haible.
+
+	tests: avoid a hang on GNU/Hurd from 2019
+	* tests/du/8gb.sh: Add a timeout around:
+	`dd bs=1 seek=8G of=big < /dev/null`
+
+	tests: use bash in some scripts to avoid false failures
+	* init.cfg (require_bash_as_SHELL_): A new function to replace
+	SHELL for the current test, with bash if available.
+	This is useful on OpenIndiana 11 where /bin/sh was seen
+	to have races in handling of SIGPIPE.
+	* tests/misc/seq-epipe.sh: Use the new function to enforce bash.
+	* tests/misc/env-signal-handler.sh: Likewise.
+	Reported by Bruno Haible
+
+	tests: improve test coverage for ls stat checks
+	* tests/ls/stat-free-color.sh: Check for the availability
+	of various stat calls individually, and add statx() and fstatat64()
+	to the list to check.  Fix the stat counting logic to
+	ignore lines like "+++ exited with 0 +++".
+	* tests/ls/stat-free-symlinks.sh: Check syscalls other than stat().
+
+2020-03-01  Bruno Haible  <bruno@clisp.org>
+
+	tests: enable 4 more tests to be executed on FreeBSD
+	* init.cfg (gcc_shared_libs_): New variable.
+	(gcc_shared_): Use it, instead of hardcoding -ldl.
+	(require_gcc_shared_): Determine the suitable value
+	for gcc_shared_libs_.
+
+2020-02-29  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix incorrect `|| fail` pattern in tests
+	* tests/ls/stat-free-symlinks.sh: s/|| fail/|| fail=1/.
+	* tests/misc/tee.sh: Likewise.
+	* tests/touch/relative.sh: Likewise.
+	* cfg.mk (sc_prohibit_or_fail): A new syntax-check to avoid this.
+
+2020-02-29  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid false failures on darwin 19.2.0
+	With these adjustments, all tests pass on macOS Catalina.
+
+	* tests/dd/sparse.sh: Adjust so that systems like apfs that
+	don't create holes < 16 MiB do not fail erroneously.
+	* tests/touch/trailing-slash.sh: Darwin was seen to dereference
+	symlinks to files when given a trailing slash, so avoid
+	that particular case.
+
+2020-02-29  Bruno Haible  <bruno@clisp.org>
+
+	tests: fix test failure on FreeBSD 12
+	* tests/misc/csplit-io-err.sh: Limit the effect of the fwrite
+	override to streams != stderr, as fwrite is in the error() path there.
+
+2020-02-27  Jan Nieuwenhuizen  <janneke@gnu.org>
+
+	build: once again distribute .tar.gz files
+	* configure.ac: Reenable distribution of gzip-compressed
+	tarballs, for Guix bootstrapping reasons as discussed at:
+	https://lists.gnu.org/r/coreutils/2020-02/msg00042.html
+	* THANKS.in: Remove me, as now a committer.
+	* NEWS (Build-related): Mention this.
+
+2020-02-27  Pádraig Brady  <P@draigBrady.com>
+
+	maint: ensure .deps/ in the project root is ignored by git
+	* .gitignore: s|*/.deps/|.deps|
+
+	doc: remove older ChangeLog items
+	* Makefile.am: Update the oldest documented version
+	to 8.23 which is now about 5 years old.
+
+2020-02-27  Colin Watson  <cjwatson@debian.org>
+
+	ls: issue error message on removed directory
+	If the current directory has been removed, then "ls" confusingly
+	produced no output and no error message, indistinguishable from
+	running on an empty directory.
+
+	* src/ls.c (print_dir): Report ENOENT on GNU/Linux if readdir
+	finds no directory entries at all, not even "." or "..",
+	and a recheck with the getdents syscall returns ENOENT.
+	We recheck with getdents() as POSIX states that
+	"The directory entries for dot and dot-dot are optional".
+	* tests/ls/removed-directory.sh: New file.
+	* tests/local.mk (all_tests): Add new test.
+	* NEWS: Mention the change in behavior.
+	Reported by Owen Thomas.
+
+2020-02-25  Pádraig Brady  <P@draigBrady.com>
+
+	build: update to latest gnulib
+	* bootstrap.conf: Adjust for changes to fchmodat and fchownat,
+	which are now separated from chmodat and chownat respectively.
+
+	b2sum: sync better with upstream
+	* src/blake2/blake2-impl.h: Sync load16() implementation,
+	which doesn't change code generation.
+	Also leverage (builtin) memcpy to more efficiently
+	move data on little endian systems,
+	giving a 2% win with GCC 9.2.1 on an i3-2310M.
+
+	factor: sync longlong.h adjustments from upstream
+	* src/longlong.h: Sync changes from:
+	https://gmplib.org/repo/gmp/log/tip/longlong.h
+	mips64: Provide r6 asm code as default expression yields.
+	arm32: Define sub_ddmmss separately for non-thumb (no rsc instruction).
+	powerpc: Add "CLOBBER" descriptions for some registers.
+	x86: Fix criterion for when to use mulx in umul_ppmm.
+
+	stat,tail: sync file system constants from the linux kernel
+	* src/stat.c: Add magic constants for "binderfs", "dma-buf-fs",
+	"erofs", "ppc-cmm-fs", and "z3fold".
+	* NEWS: Mention the improvement.
+
+2020-02-24  Pádraig Brady  <P@draigBrady.com>
+
+	uniq: avoid strcoll() to improve performance and consistency
+	strcoll() is only significant to uniq(1) if it returns 0,
+	and it generally only does so with buggy locales or mismatched
+	locales and data.  Some systems may have strcoll()
+	return 0 for equivalent normalized unicode forms,
+	but for consistency across platforms strcoll() is avoided.
+	The various cases are defined in the new test.
+	This is consistent with newer POSIX standards as discussed at:
+	https://www.austingroupbugs.net/view.php?id=963
+
+	* src/uniq.c: s/xstrcoll/memcmp/.
+	* tests/local.mk: Reference the new test.
+	* tests/misc/uniq-collate.sh: Add a new test.
+	* NEWS: Mention the change in behavior.
+	Fixes https://bugs.gnu.org/38627
+
+2020-02-15  Pádraig Brady  <P@draigBrady.com>
+
+	doc: clarify that '%a' stat format outputs mode bits
+	* src/stat.c (usage): Mention permission bits rather than
+	"access" so there is no confusion with ACLs etc.
+	Also indicate we output the file type with '%A'.
+	* doc/coreutils.texi (stat invocation): Likewise.
+	Also indicate '%A' is similar to `ls -ld` output.
+	Addresses https://bugs.gnu.org/39613
+
+2020-02-10  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix test for symlink
+	* tests/cp/preserve-gid.sh: s/-l/-L/.
+	Reported by Kamil Dudka
+
+2020-02-09  Kamil Dudka  <kdudka@redhat.com>
+
+	tests: ensure tests/cp/preserve-gid.sh works with single binary
+	* tests/cp/preserve-gid.sh: If configured with --enable-single-binary
+	copy the coreutils single binary, instead of the cp one-line launcher.
+
+	Discussed at https://bugzilla.redhat.com/1800597
+	Fixes https://bugs.gnu.org/39485
+
+2020-02-09  Pádraig Brady  <P@draigBrady.com>
+
+	maint: avoid syntax-check failure in previous commit
+	* configure.ac: Restrict lines to 80 chars.
+
+2020-02-09  Jim Meyering  <meyering@fb.com>
+
+	build: suppress new FP warning from gcc-10.0.1
+	* configure.ac (GNULIB_WARN_CFLAGS): Add -Wno-return-local-addr
+	to avoid FP warning about careadlinkat.c. Discussed starting in
+	https://lists.gnu.org/r/coreutils/2020-02/msg00006.html
+
+2020-02-04  Pádraig Brady  <P@draigBrady.com>
+
+	build: update to latest gnulib
+	Pick up recent build fixes to avoid sysctl.h inclusion on glibc systems,
+	restrict the max file size supported by read-file to PTRDIFF_MAX,
+	and to avoid a -Werror=unused failure in test-canonicalize.
+
+	tests: avoid false failure due to varying /proc/kallsyms
+	* tests/cp/proc-short-read.sh: Switch to using /proc/cpuinfo,
+	rather than /proc/kallsyms which was seen to vary in some cases.
+	Fixes https://bugs.gnu.org/39357
+
+2020-02-04  Pádraig Brady  <P@draigBrady.com>
+
+	rmdir: fix --ignore-fail-on-non-empty with permissions errors
+	Since v6.10-21-ged5c4e7 `rmdir --ignore-fail-on-non-empty`
+	had reversed the failure status for directories that failed
+	to be removed for permissions reasons.  I.E. it would have
+	returned a failure status for such non empty dirs, and vice versa.
+
+	* src/rmdir.c (errno_may_be_non_empty): Rename from the
+	more confusing errno_may_be_empty(), and remove the EEXIST
+	case (specific to Solaris), which is moot here since
+	handled in errno_rmdir_non_empty().
+	(ignorable_failure): Fix the logic error so that
+	_non_ empty dirs are deemed to have ignorable failures.
+	(main): Fix clobbering of errno by is_empty_dir().
+	(remove_parents): Likewise.
+	* tests/rmdir/ignore.sh: Add a test case.
+	* THANKS.in: Add reporter who fixed the errno handling.
+	* NEWS: Mention the bug fix.
+	Fixes https://bugs.gnu.org/39364
+
+2020-02-03  Pádraig Brady  <P@draigBrady.com>
+
+	build: avoid vector performance warnings in randperm
+	* configure.ac: Add -Wno-vector-operation-performance to suppress the
+	following gcc-9.2 error in gl/lib/randperm.c:
+	  error: vector operation will be expanded piecewise
+
+	build: avoid including sysctl.h on glibc
+	* src/uname.c: Avoid unneeded header with GLIBC,
+	which has been deprecated since glibc-2.30.
+	* src/uptime.c: Likewise.
+
+	ls: support --time=creation to show/sort birth time
+	* src/ls.c (usage): Reorganize help for --time,
+	and add description for --time=birth.
+	(do_statx): Store btime in mtime if available.
+	(get_stat_btime): A new function to read the creation time
+	from the appropriate stat structure member.
+	(cmp_btime): A new function to compare birth time.
+	(print_long_format): Output '?' when birth time unavailable.
+	* doc/coreutils.texi: Document --time={birth,creation}.
+	* tests/local.mk: Reference the new test.
+	* tests/ls/birthtime.sh: Add a new test.
+	* NEWS: Mention the new feature.
+
+2020-01-30  Chris Meyering  <christophe.meyering@gmail.com>
+
+	build: rearrange yes(1) code to prevent GCC 10 warning
+	* src/yes.c (main): Convert for loop to do-while in order to indicate
+	that the loop will be run at least once.
+	This avoids the following warning after the second loop:
+	src/yes.c:110:20: error: writing 1 byte into a region of size 0
+
+2020-01-01  Emil Engler  <me@emilengler.com>
+
+	maint: add lib/iconv_open-zos.h to .gitignore
+	* .gitignore: Add file newly generated by gnulib commit 49e78fc
+
+2020-01-01  Pádraig Brady  <P@draigBrady.com>
+
+	build: auto enable use of openssl with >= version 3
+	* configure.ac: Set --with-openssl=auto-gpl-compat as the default,
+	so that openssl is used for md5sum etc., with openssl >= 3,
+	which is newly licensed under ASL v2.
+	* gnulib: Update to include "auto-gpl-compat" support.
+
+	maint: adjust to split out xstrtol-error gnulib module
+	* bootstrap.conf: Depend on the new module split from xstrtol.
+	* src/df.c: Include "xstrtol-error.h" for xstrtol_fatal.
+	* src/du.c: Likewise.
+	* src/ls.c: Likewise.
+	* src/od.c: Likewise.
+	* src/pr.c: Likewise.
+	* src/sort.c: Likewise.
+
+2020-01-01  Pádraig Brady  <P@draigBrady.com>
+
+	maint: update all copyright year number ranges
+	Run "make update-copyright" and then...
+
+	* gnulib: Update to latest with copyright year adjusted.
+	* tests/init.sh: Sync with gnulib to pick up copyright year.
+	* bootstrap: Likewise.
+	* tests/sample-test: Adjust to use the single most recent year.
+
+2019-12-08  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: add example to demonstrate sub-second sleep times
+	* doc/coreutils.texi (sleep invocation): Add an example to demonstrate
+	how to use the floating-point and the scientific notation to sleep
+	for sub-second times, e.g. milli-, micro- and nanoseconds.
+
+	Inspired by Stephane Chazelas in:
+	  https://lists.gnu.org/r/coreutils/2019-12/msg00005.html
+
+2019-12-02  Pádraig Brady  <P@draigBrady.com>
+
+	maint: fix syntax-check failure from recent adjustment
+	* cfg.mk (old_NEWS_hash): Regenerate after commit v8.31-56-gc1e1965.
+
+2019-12-02  Kamil Dudka  <kdudka@redhat.com>
+
+	chcon: do not validate security context if SELinux is disabled
+	* src/chcon.c (main): Skip call of security_check_context()
+	in case SELinux is disabled to avoid unnecessary failure.
+
+	Bug: https://bugzilla.redhat.com/1777831
+
+2019-11-12  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: remove colon from node name
+	* doc/sort-version.texi (Minus/Hyphen and Colon characters):
+	Rename from “Minus/Hyphen @samp{-} and Colon @samp{:} characters”,
+	as texi2any 6.6 complains about colons in node names.
+
+	shred: modernize documentation
+	* doc/coreutils.texi (shred invocation):
+	Modernize discussion to today’s technology (Bug#38168).
+	* src/shred.c (usage): Omit lengthy duplication of the manual’s
+	discussion of file systems and storage devices, as that became out
+	of sync with the manual.  Instead, just cite the manual.
+
+2019-10-22  Paul Eggert  <eggert@cs.ucla.edu>
+
+	all: improve parsing of numeric arguments
+	This addresses a longstanding "update all callers" FIXME in
+	lib/xstrtol.c, by having programs check that numbers do not
+	have unknown suffixes.  The problem was also reported for
+	'shuf' by my student Maggie Huang while reimplementing a shuf
+	subset in Python as an exercise in UCLA Computer Science 35L:
+	https://web.cs.ucla.edu/classes/fall19/cs35L/assign/assign3.html
+	This patch also improves the portability of the code to unusual
+	platforms where ULONG_MAX < SIZE_MAX.
+	* NEWS: Mention user-visible changes.
+	* src/chgrp.c (parse_group):
+	* src/chroot.c (parse_additional_groups):
+	* src/du.c (main):
+	* src/install.c (get_ids):
+	* src/join.c (string_to_join_field):
+	* src/ls.c (decode_switches):
+	* src/md5sum.c (split_3):
+	* src/shuf.c (main):
+	* src/sort.c (specify_nthreads):
+	* src/uniq.c (size_opt, main):
+	Use uintmax_t instead of unsigned long, for portability
+	to oddball platforms where unsigned long is not wide enough.
+	* src/du.c (main):
+	* src/expr.c (mpz_init_set_str) [!HAVE_GMP]:
+	* src/install.c (get_ids):
+	* src/ls.c (decode_switches):
+	* src/mknod.c (main):
+	* src/ptx.c (main):
+	* src/shuf.c (main):
+	* src/sort.c (specify_nmerge, specify_nthreads):
+	Reject numbers with suffixes.
+	* src/md5sum.c (split_3): Simplify.
+
+	stdbuf: improve size checking
+	* bootstrap.conf (gnulib_modules): Add minmax.
+	* src/libstdbuf.c: Include stdint.h, minmax.h.
+	(apply_mode): Don’t assume SIZE_MAX <= ULONG_MAX.
+	Improve checking for invalid sizes.
+
+	shuf: improve randperm overflow checking
+	* gl/lib/randperm.c: Include randperm.h first, since it’s the API.
+	Include stdint.h, count-leading-zeros.h, verify.h.
+	(floor_lg): Rename from ceil_log (which was not actually
+	implementing the ceiling!) and implement the floor using
+	count_leading_zeros.
+	(randperm_bound): Use floor_lg, not ceil_log.  Use uintmax_t
+	instead of size_t in case the size gets large on a 32-bit host.
+	* gl/modules/randperm (Depends-on): Add count-leading-zeros, stdint.
+
+	build: don’t worry about logical-op checking
+	* configure.ac: Remove code tailoring --enable-gcc-warnings
+	to GCC 4.7 and earlier, as developers no longer need to worry
+	about GCCs that old.
+
+	build: re-enable type-limits checking
+	* configure.ac: When --enable-gcc-warnings is used, omit
+	-Wno-type-limits.  The need for -Wno-type-limits has passed, now
+	that intprops.h uses builtin primitives for GCC 5 and later, given
+	that recent GCCs issue type-limits warnings only for non-constant
+	expressions.  --enable-gcc-warnings is not intended for use with
+	old compilers, so we can drop -Wno-type-limits now.
+
+2019-10-21  Paul Eggert  <eggert@cs.ucla.edu>
+
+	shuf: fix bug with ‘-r -n 0’
+	‘shuf -r -n 0 file’ would mistakenly read from standard input.
+	Problem reported by my student Jingnong Qu while reimplementing a
+	shuf subset in Python as an exercise in UCLA Computer Science 35L:
+	https://web.cs.ucla.edu/classes/fall19/cs35L/assign/assign3.html
+	* NEWS: Mention the fix.  Also, ASCIIfy a previous item.
+	* src/shuf.c (main): Fix bug.
+	* tests/misc/shuf.sh: Add a test case for the bug.
+
+2019-10-09  Jeff Layton  <jlayton@kernel.org>
+
+	ls: use statx instead of stat when available
+	statx allows ls to indicate interest in only certain inode metadata.
+	This is potentially a win on networked/clustered/distributed
+	file systems. In cases where we'd have to do a full, heavyweight stat()
+	call we can now do a much lighter statx() call.
+
+	As a real-world example, consider a file system like CephFS where one
+	client is actively writing to a file and another client does an
+	ls --color in the same directory. --color means that we need to fetch
+	the mode of the file.
+
+	Doing that with a stat() call means that we have to fetch the size and
+	mtime in addition to the mode. The MDS in that situation will have to
+	revoke caps in order to ensure that it has up-to-date values to report,
+	which disrupts the writer.
+
+	This has a measurable affect on performance. I ran a fio sequential
+	write test on one cephfs client and had a second client do "ls --color"
+	in a tight loop on the directory that held the file:
+
+	Baseline -- no activity on the second client:
+
+	WRITE: bw=76.7MiB/s (80.4MB/s), 76.7MiB/s-76.7MiB/s (80.4MB/s-80.4MB/s),
+	       io=4600MiB (4824MB), run=60016-60016msec
+
+	Without this patch series, we see a noticable performance hit:
+
+	WRITE: bw=70.4MiB/s (73.9MB/s), 70.4MiB/s-70.4MiB/s (73.9MB/s-73.9MB/s),
+	       io=4228MiB (4433MB), run=60012-60012msec
+
+	With this patch series, we gain most of that ground back:
+
+	WRITE: bw=75.9MiB/s (79.6MB/s), 75.9MiB/s-75.9MiB/s (79.6MB/s-79.6MB/s),
+	       io=4555MiB (4776MB), run=60019-60019msec
+
+	* src/stat.c: move statx to stat struct conversion to new header...
+	* src/statx.h: ...here.
+	* src/ls.c: Add wrapper functions for stat/lstat/fstat calls,
+	and add variants for when we are only interested in specific info.
+	Add statx-enabled functions and set the request mask based on the
+	output format and what values are needed.
+	* NEWS: Mention the Improvement.
+
+2019-10-03  Paul Eggert  <eggert@cs.ucla.edu>
+
+	truncate: avoid integer-overflow assumptions
+	* src/truncate.c (do_ftruncate): Simplify overflow checking,
+	and don’t rely on theoretically-nonportable assumptions
+	like assuming that OFF_MAX < UINTMAX_MAX.
+
+	numfmt: avoid unlikely integer overflow
+	* src/numfmt.c (parse_format_string): Report overflow if
+	pad < -LONG_MAX, since that can’t be negated.
+
+	nl: fix integer-overflow bug
+	Problem reported by Roland Illig (Bug#37585)
+	* src/nl.c (print_lineno): Don’t rely on undefined behavior when
+	checking for integer overflow.
+
+	cp: simplify integer overflow checking
+	* src/copy.c (sparse_copy): Use INT_ADD_WRAPV instead
+	of doing overflow checking by hand.
+
+2019-09-08  Pádraig Brady  <pbrady@fb.com>
+
+	seq: use faster processing for integer steps from 2 to 200
+	* src/seq.c: (seq_fast): Accept STEP as a parameter and use that
+	to skip the output of generated numbers.
+	(main): Relax to using seq_fast for integer steps between 1 and 200.
+	For larger steps the throughput was faster using the standard
+	incrementing procedure.
+	(cmp): Use the equivalent but faster memcmp for equal len strings.
+	* tests/misc/seq.pl: Update fast path cases.
+	Addresses https://bugs.gnu.org/37241
+
+2019-09-08  Pádraig Brady  <P@draigBrady.com>
+
+	maint: use consistent header ordering and spacing in NEWS
+	* NEWS: Move "Changes in behavior" before "New features",
+	and ensure there is only a single blank line between sections.
+
+2019-08-15  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+2019-08-15  Assaf Gordon  <assafgordon@gmail.com>
+
+	scripts: document how to build older versions on newer systems
+	Based on https://lists.gnu.org/r/coreutils/2019-08/msg00011.html .
+
+	* scripts/build-older-versions/README.older-versions: Documentation
+	* scripts/build-older-versions/build-older-versions.sh: Helper script.
+	* scripts/build-older-versions/.gitignore: Ignore build directory.
+	* scripts/build-older-versions/coreutils-5.0-on-glibc-2.28.diff,
+	scripts/build-older-versions/coreutils-5.97-on-glibc-2.28.diff,
+	scripts/build-older-versions/coreutils-6.10-on-glibc-2.28.diff,
+	scripts/build-older-versions/coreutils-6.11-on-glibc-2.28.diff,
+	scripts/build-older-versions/coreutils-6.12-on-glibc-2.28.diff,
+	scripts/build-older-versions/coreutils-7.2-on-glibc-2.28.diff,
+	scripts/build-older-versions/coreutils-8.13-on-glibc-2.28.diff,
+	scripts/build-older-versions/coreutils-8.17-on-glibc-2.28.diff,
+	scripts/build-older-versions/coreutils-8.18-on-glibc-2.28.diff,
+	scripts/build-older-versions/coreutils-8.24-on-glibc-2.28.diff,
+	scripts/build-older-versions/coreutils-8.4-on-glibc-2.28.diff: Patches.
+
+2019-08-12  Bruno Haible  <bruno@clisp.org>
+
+	build: adjust for recent gnulib pthread changes
+	Discussed in https://lists.gnu.org/r/coreutils/2019-08/msg00030.html .
+
+	* bootstrap.conf (gnulib_modules): Replace 'pthread' with
+	pthread-* modules.
+	* src/sort.c: Remove GNULIB_defined_pthread_functions conditional.
+
+2019-08-11  Assaf Gordon  <assafgordon@gmail.com>
+
+	date: mention military timezone changes from gnulib
+	Gnulib commits f1f10d47be8762e4ca17c8957a0520b08d28abfb and
+	0673d8ab42c9bb0cf618a21b537cdd8fb976fb73 negated the meaning of
+	military timezones parsed in gnu date.
+	See https://lists.gnu.org/r/bug-gnulib/2019-08/msg00005.html and
+	https://lists.gnu.org/r/coreutils/2019-08/msg00021.html
+
+	* NEWS: Mention this user-visible change.
+	* tests/misc/date.pl: Add tests for the new behavior.
+
+2019-08-11  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: add lib/argmatch.h to po/POTFILES.in
+	* po/POTFILES.in (lib/argmatch.h): Add to avoid sc_po_check error:
+	    "maint.mk: you have changed the set of files with translatable \
+	     diagnostics;"
+
+2019-08-11  Assaf Gordon  <assafgordon@gmail.com>
+
+	gnulib: update to latest
+
+2019-08-08  Pádraig Brady  <P@draigBrady.com>
+
+	doc: clarify that truncate creates sparse files
+	* src/truncate.c (usage): Explicitly mention "sparse".
+	* doc/coreutils.texi (truncate invocation): Likewise.
+	Addresses https://bugs.gnu.org/36963
+
+2019-08-07  Mike Swanson  <mikeonthecomputer@gmail.com>
+
+	dircolors: recognize the WebP image format
+	* src/dircolors.hin: Add .webp for the WebP image format.
+	Fixes https://bugs.gnu.org/36899
+
+2019-08-07  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: fix error in syntax-check checking
+	The previous commit introduced a bug into the following syntax-check,
+	and thus effectively turned it off:
+
+	  $ make sc_prohibit_test_calls_print_ver_with_irrelevant_argument; \
+	      echo $?
+	  prohibit_test_calls_print_ver_with_irrelevant_argument
+	  fatal: cannot change to 'grep': No such file or directory
+	  0
+
+	* cfg.mk (sc_prohibit_test_calls_print_ver_with_irrelevant_argument):
+	Remove changing directory, and pass $(srcdir) as argument to 'git -C'.
+
+2019-08-04  Akim Demaille  <akim.demaille@gmail.com>
+
+	maint: fix issues in syntax-check
+	* cfg.mk (sc_prohibit_colon_redirection): Don't expect `|` to denote
+	the pipe character in git grep.
+	(sc_tests_executable)
+	(sc_case_insensitive_file_names)
+	(sc_some_programs_must_avoid_exit_failure)
+	(sc_prohibit_test_background_without_cleanup_)
+	(sc_prohibit_test_calls_print_ver_with_irrelevant_argument)
+	(sc_prohibit_test_ulimit_without_require_)
+	(sc_prohibit_test_background_without_cleanup_)
+	(sc_THANKS_in_duplicates)
+	*sc_prohibit_test_calls_print_ver_with_irrelevant_argument):
+	Don't expect builddir to be a descendant of srcdir.
+	(sc_strftime_check): Don't check file size against 0 when "N\nq\n" was
+	already put in the file.
+	* THANKS.in: Remove me.
+
+2019-08-03  Assaf Gordon  <assafgordon@gmail.com>
+
+	seq: fix superfluous output line
+	Under certain circumstances seq prints an extra line when the output
+	format has custom format with characters following the printed numbers:
+
+	    $ seq -f "%g " 1000000 1000000
+	     1e+06
+	     1e+06
+
+	This is due to the "print_extra_number" logic using strings to determine
+	whether a 'extra number' is needed, but only one string was trimmed
+	when using a custom printf format.
+
+	Prompted by https://lists.gnu.org/r/coreutils/2019-08/msg00001.html
+
+	* NEWS: Mention fix.
+	* src/seq.c (print_numbers): Trim the 'x0_str' string before comparing
+	it to the previous 'x_str' string.
+	* tests/misc/seq-extra-number.sh: Add this scenario.
+	* tests/local.mk (all_tests): Add new test.
+
+2019-07-22  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: improve new version sort chapter
+	* doc/sort-version.texi: Fix some typos, avoid overly long lines in
+	the generated PDF, enclose some sample strings in @samp{...} for better
+	readability, etc.  This also avoids an sc-avoid-builtin error:
+	s/builtin/built-in/
+
+2019-07-15  Assaf Gordon  <assafgordon@gmail.com>
+
+	doc: add "version sort ordering" chapter
+	* doc/sort-version.texi: New file.
+	* doc/local.mk (doc_coreutils_TEXINFOS): Add new file.
+	* doc/coreutils.texi: @include new file, replace previous "Details about
+	version sort" section.
+
+2019-07-12  Andreas Dilger  <adilger@whamcloud.com>
+
+	stat: don't explicitly request file size for filenames
+	When calling 'stat -c %N' to print the filename, don't explicitly
+	request the size of the file via statx(), as it may add overhead on
+	some filesystems.  The size is only needed to optimize an allocation
+	for the relatively rare case of reading a symlink name, and the worst
+	effect is a somewhat-too-large temporary buffer may be allocated for
+	areadlink_with_size(), or internal retries if buffer is too small.
+
+	The file size will be returned by statx() on most filesystems, even
+	if not requested, unless the filesystem considers this to be too
+	expensive for that file, in which case the tradeoff is worthwhile.
+
+	* src/stat.c: Don't explicitly request STATX_SIZE for filenames.
+
+2019-06-20  Paul Eggert  <eggert@cs.ucla.edu>
+
+	od: use fseek on non-regular files
+	Problem reported by Szőts Ákos (Bug#36291).
+	* NEWS: Mention this.
+	* src/od.c (skip): Try fseek even on files that do not have usable
+	sizes, falling back on fread if fseek fails.
+
+2019-06-18  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: mention ls -l user/group justification
+	* doc/coreutils.texi (What information is listed):
+	Document justification of user and group columns in ls -l output
+	(Bug#36220).
+
+2019-06-14  Jeff Layton  <jlayton@kernel.org>
+
+	stat: fix enabling of statx logic
+	* src/stat.c: STATX_INO isn't defined until stat.h is included.
+	Move the test down so it works properly.
+
+2019-06-13  Assaf Gordon  <assafgordon@gmail.com>
+
+	tests: avoid false-positive in date-debug test
+	When debugging an invalid date due to DST switching, the intermediate
+	'normalized time' should not be checked - its value can differ between
+	systems (e.g. glibc vs musl).
+
+	Reported by Niklas Hambüchen in
+	https://lists.gnu.org/r/coreutils/2019-05/msg00031.html
+	Analyzed by Rich Felker in
+	https://lists.gnu.org/r/coreutils/2019-05/msg00039.html
+
+	* tests/misc/date-debug.sh: Replace the exact normalized time
+	with 'XX:XX:XX' so different values would not trigger test failure.
+
+2019-06-10  Jeff Layton  <jlayton@kernel.org>
+
+	stat: Use statx where available and support --cached
+	* src/stat.c: Drop statbuf argument from out_epoch_sec().
+	Use statx() rather than [lf]stat() where available,
+	so a separate call is not required to get birth time.
+	Set STATX_* mask bits only for things we want to print,
+	which can be more efficient on some file systems.
+	Add a new --cache= command-line option that sets the appropriate hint
+	flags in the statx call.  These are primarily used with network
+	file systems to indicate what level of cache coherency is desired.
+	The new option is available unconditionally for better portability,
+	and ignored where not implemented.
+	* doc/coreutils.texi: Add documention for --cached.
+	* man/stat.x (SEE ALSO): Mention statx().
+	* NEWS: Mention the new feature.
+
+2019-06-09  Pádraig Brady  <P@draigBrady.com>
+
+	doc: fix description of tail -f on truncated files
+	* doc/coreutils.texi (tail invocation): Update to match
+	the new behavior following commit v8.23-189-gb28ff6a
+
+2019-06-08  Pádraig Brady  <P@draigBrady.com>
+
+	split: fix failure for certain number of specified files
+	* src/split.c (set_suffix_length): Use a more standard
+	zero based logN calculation for the number of units.
+	* tests/split/suffix-auto-length.sh: Add a test case.
+	* THANKS.in: Mention the reporter.
+	* NEWS: Mention the fix.
+	Fixes https://bugs.gnu.org/35291
+
+2019-05-30  Paul Eggert  <eggert@cs.ucla.edu>
+
+	dd: be more careful about signal handling
+	Problem reported by Hans Henrik Bergan (Bug#36007).
+	* NEWS: Mention this.
+	* src/dd.c (iclose, ifdatasync, ifstat, ifsync):
+	New functions, which are more careful about SIGINT.
+	(cleanup): Use iclose instead of close.
+	(finish_up): Process signals first.
+	(skip, dd_copy, main): Use ifstat instead of fstat.
+	(dd_copy): Use ifdatasync and ifsync instead of fdatasync and fsync.
+
+	maint: fix version number in NEWS
+
+2019-05-28  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp: fix /dev/stdin problem on Solaris
+	Problem reported by Jakub Kulik (Bug#35713).
+	* NEWS: Mention this.
+	* configure.ac (DEV_FD_MIGHT_BE_CHR): New macro.
+	* src/copy.c (DEV_FD_MIGHT_BE_CHR): Default to false.
+	(follow_fstatat): New function.
+	(copy_internal): Use it.
+	* src/copy.h (XSTAT): Remove; no longer used.
+
+2019-05-26  Kevin Locke  <kevin@kevinlocke.name>
+
+	doc: clarify dd sparse detection is by *output* block
+	The wording of the dd --help text suggests that output will be skipped
+	for sparse *input* blocks (i.e. that NUL-checking is done on input
+	blocks) while the code actually checks/skips all-NUL *output* blocks.[1]
+
+	* src/dd.c (usage): Update the --help text to clarify the above.
+	* tests/dd/sparse.sh: Ensure sparseness is controlled with obs.
+
+	[1]: https://superuser.com/a/1136358
+
+2019-05-22  Martin Castillo  <castilma@uni-bremen.de>
+
+	doc: fix typo in sort set operations example
+	* doc/coreutils.texi (sort invocation): Add a missing -u
+	option to uniq.
+	Addresses https://bugs.gnu.org/35849
+
+2019-05-17  Paul Eggert  <eggert@cs.ucla.edu>
+
+	b2sum: port blake2b-ref.c to HP-UX aCC
+	Continue the fix for Bug#35650.
+	* src/blake2/blake2b-ref.c [HAVE_CONFIG_H]: Include <config.h>.
+
+2019-05-15  Paul Eggert  <eggert@cs.ucla.edu>
+
+	b2sum: sync better with upstream
+	* src/blake2/b2sum.c: Reorder source code to minimize diffs from:
+	https://github.com/BLAKE2/BLAKE2/blob/master/b2sum/b2sum.c
+
+	b2sum: port to HP-UX aCC
+	Its support for the -include option is flaky.  Problem reported by
+	Michael Osipov (Bug#35650).  Plus, we could run into other
+	compilers that don’t support any option like -include.  Change the
+	code so that -include is not needed.  Although this causes us to
+	depart from the upstream version, we’re already doing that for
+	other reasons.
+	* configure.ac (USE_XLC_INCLUDE): Remove, as there’s no
+	guarantee a compiler will support something like -include.
+	* src/blake2/b2sum.c [HAVE_CONFIG_H]: Include <config.h>.
+	* src/local.mk (src_b2sum_CPPFLAGS): Add -DHAVE_CONFIG_H.
+	Do not use -include or a substitute.
+
+2019-05-14  Paul Eggert  <eggert@cs.ucla.edu>
+
+	stdbuf: port configure-time checking to HP-UX aCC
+	Problem reported by Michael Osipov (Bug#35650).
+	* configure.ac: Use AC_LANG_WERROR to pay attention to compiler
+	and linker warnings when testing whether stdbuf will work.
+
+2019-05-11  Paul Eggert  <eggert@cs.ucla.edu>
+
+	b2sum: port to HP-UX C
+	* src/blake2/blake2.h (BLAKE2_PACKED):
+	Don’t assume __attribute__ ((packed)) works on non-Microsoft
+	compilers.  Instead, assume it works only if we have good
+	reason to assume so, and fall back on Microsoft (or not packing)
+	otherwise.  In practice, not packing is good enough and the
+	BLAKE2_PACKED macro is mostly just for documentation.
+
+	cp: port fiemap.h to C99
+	* src/extent-scan.c (extent_scan_read): Adjust to change in
+	struct fiemap.
+	* src/fiemap.h (struct fiemap): Use FLEXIBLE_ARRAY_MEMBER
+	to port to C99.
+
+	basenc: port to C99
+	* src/basenc.c: Various minor style cleanups.
+	(struct base_decode_context): Do not use anonymous unions, as
+	they’re not in C99.  Use a named union instead.  All uses changed.
+
+	maint: adjust to recent verify_true removal
+	* src/system.h (X2NREALLOC, X2REALLOC, DECIMAL_DIGIT_ACCUMULATE):
+	Use verify_expr instead of verify_true, which has been removed.
+	(DECIMAL_DIGIT_ACCUMULATE): Remove unnecessary size check.
+
+	build: update gnulib submodule to latest
+
+2019-04-19  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	gnulib: update to the latest
+	* gnulib: Update to latest, mainly for:
+	  > mountlist: make parsing /proc/self/mountinfo more robust
+	* NEWS: Mention the fix.
+
+	Fixes https://bugs.gnu.org/33468
+
+2019-03-31  Shugo Maeda  <shugo@ruby-lang.org>
+
+	factor: output immediately if stdout is a tty but stdin is not
+	* src/factor.c (lbuf_putc): Use line buffered mode if the standard
+	output is a terminal in the same way as the stdio library.
+	User programs might use pty only for the standard out
+	like the example of Ruby's PTY module:
+	https://docs.ruby-lang.org/en/2.6.0/PTY.html#module-PTY-label-Example
+	* NEWS: Mention the fix.
+	Fixes https://bugs.gnu.orv/35046
+
+2019-03-30  Pádraig Brady  <P@draigBrady.com>
+
+	maint: fix syntax check failure
+	* src/ln.c: Remove leading TAB.
+
+2019-03-30  Martin Castillo  <castilma@uni-bremen.de>
+
+	maint: tee: use STDIN_FILENO rather than 0
+	* src/tee.c (tee_files): Use the name rather than the value.
+	Addresses https://bugs.gnu.org/35041
+
+2019-03-20  Paul Eggert  <eggert@cs.ucla.edu>
+
+	dd: improve doc of stderr output
+	* doc/coreutils.texi (dd invocation):
+	Document stderr output more carefully.
+	Say that conv=block can lose input data.
+
+2019-03-18  Kamil Dudka  <kdudka@redhat.com>
+
+	md5sum,b2sum,sha*sum: --help: add note about binary/text mode
+	* src/md5sum.c (usage): Make it clear that there is no difference
+	between binary mode and text mode on GNU systems.
+
+	Bug: https://bugzilla.redhat.com/406981
+	Bug: https://bugzilla.redhat.com/1688740
+
+2019-03-17  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: add NEWS item for Solaris symlink fix
+
+	ln: port to symlink ("x", ".") failing with EINVAL
+	Problem reported by John Marino (Bug#34894).
+	* src/ln.c (main): Port ln -s to Solaris symlink function,
+	where symlink ("x", ".") fails with errno == EINVAL.
+
+2019-03-16  Pádraig Brady  <P@draigBrady.com>
+
+	doc: add a NEWS entry for the ln O_DIRECTORY fix
+	* NEWS: Mention the bugfix.
+
+2019-03-16  Paul Eggert  <eggert@cs.ucla.edu>
+
+	ln: port to platforms lacking O_DIRECTORY
+	* src/ln.c (main): Port to older platforms lacking
+	support for POSIX.1-2008’s O_DIRECTORY flag (Bug#34876).
+
+2019-03-15  Kamil Dudka  <kdudka@redhat.com>
+
+	doc: improve wording of the --kibibytes option description
+	Bug: https://bugzilla.redhat.com/1527391 , https://bugs.gnu.org/33646
+
+	* doc/coreutils.texi (General output formatting): Improve wording of
+	'--kibibytes' option.
+
+2019-03-11  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: sync extra files from gnulib
+	Some files are physically copied from gnulib, and should get sync'ed
+	after each update to latest gnulib.  This was forgotten during recent
+	updates.
+
+	* COPYING: Merge from gnulib/doc/COPYINGv3.
+	* tests/init.sh: Merge from gnulib/tests/init.sh.
+
+2019-03-11  Pádraig Brady  <P@draigBrady.com>
+
+	maint: post-release administrivia
+	* NEWS: Add header line for next release.
+	* .prev-version: Record previous version.
+	* cfg.mk (old_NEWS_hash): Auto-update.
+
+2019-03-10  Pádraig Brady  <P@draigBrady.com>
+
+	version 8.31
+	* NEWS: Record release date.
+
+	tests: test-N: include subsecond values in gating check
+	* tests/misc/test-N.sh: The subsecond values for atime and mtime
+	were potentially seen to differ on newlyl created files.
+	So we include the subsecond portion when comparing stat values.
+
+	tests: wc-nbsp: fix false failures on various systems
+	* tests/misc/wc-nbsp.sh: Add gating checks for all characters,
+	as there are disparate classifications on various systems:
+	SunOS 5.10 treats \u202F, \u2060 as !iswprint()
+	SunOS 5.10 treats \u00A0, \u2007 as iswspace()
+	AIX 7.2, Darwin 17.4.0, NetBSD 7.1 treat \u2060 as !iswprint()
+
+2019-03-07  Pádraig Brady  <P@draigBrady.com>
+
+	tests: tail-2/pipe-f: avoid false failure closing stdout
+	* tests/tail-2/pipe-f.sh: Check closing stdout with >&-
+	is effective, which avoids a false failure on NetBSD 7.1
+	Reported by Assaf Gordon
+
+	tests: tac-2-nonseekable: ensure we don't block indefinitely
+	* tests/misc/tac-2-nonseekable.sh: Add a timeout to both
+	protect and check whether we can close stdin correctly.
+
+	tests: id/zero: avoid false failure due to sed differences
+	* tests/id/zero.sh: sed on OSX will output a \n even
+	if the input doesn't have a \n on the last "line".
+	So ensure we always have a trailing '\n' to avoid the disparity.
+
+2019-03-07  Pádraig Brady  <P@draigBrady.com>
+
+	tests: test-N: fix false positives on some systems
+	Testing by Assaf Gordon on OSX showed the atime wasn't
+	being updated when explicitly set back in time.
+	Also Debian 8.11 / mips64 was seen to not update the
+	mtime when truncating an empty file.
+
+	* tests/misc/test-N.sh: Isolate from different timestamping
+	behaviors of various (file) systems, by correlating
+	the timestamps with stat(1) before using `test -N`.
+
+2019-03-07  Assaf Gordon  <assafgordon@gmail.com>
+
+	doc: replace @hashchar{} with actual hash character
+	Very old makeinfo-4.13 fails with:
+	  ./doc/coreutils.texi:2286: Unknown command `hashchar'.
+	  ./doc/coreutils.texi:2286: Misplaced {.
+	  ./doc/coreutils.texi:2286: Misplaced }.
+
+	Reported Bernhard Voelker in
+	https://lists.gnu.org/r/coreutils/2019-03/msg00016.html .
+
+	* doc/coreutils.texi (basenc invocation): Replace @hashchar{} with
+	actual hash character.  The special syntax is only required
+	when referring to #line directives.
+
+2019-03-06  Pádraig Brady  <P@draigBrady.com>
+
+	build: avoid statx related build failure on AIX
+	* src/stat.c (get_birthtime): Check also for STATX_BTIME define,
+	as a different statx is available on AIX 7.2.
+
+	tests: wc-nbsp.sh: avoid failure on FreeBSD
+	* tests/misc/wc-nbsp.sh: FreeBSD and OS X don't
+	treat non breaking space as printable characters.
+	So use wc -L to determine printability before
+	testing non breaking space functionality.
+
+	build: fix env build where SIGNUM_BOUND is not constant
+	* src/env.c (initialize_signals): A new function to initialize
+	the signals array on the heap, to avoid a build failure on
+	opensolaris, where SIGNUM_BOUND is not a constant.
+
+2019-03-04  Pádraig Brady  <P@draigBrady.com>
+
+	doc: remove older ChangeLog items
+	* Makefile.am: Update the oldest documented version
+	to 8.22 which is now about 5 years old.
+
+	build: revert recent change with distributed man page handling
+	* man/local.mk: commit f114495e added an extra check to ensure
+	a binary was working before using it to generate the man page.
+	However this was not working for the false(1) command,
+	and also one can generally specify that one should not
+	be using generated commands on the current system by passing
+	'cross_compiling=yes' to the configure invocation.
+
+	env: add --list-signal-handling to output non default handling
+	* src/env.c (main): Output blocked or ignored signals
+	before a command is executed.
+	* doc/coreutils.texi (env invocation): Add the option.
+	* tests/misc/env-signal-handler.sh: Add a test case.
+	* NEWS: Mention the new feature.
+
+2019-03-04  Assaf Gordon  <assafgordon@gmail.com>
+
+	env: new options --{default,ignore,block}-signal[=SIG]
+	New options to set signal handlers for the command being executed.
+	--block-signal suggested by Paul Eggert in http://bugs.gnu.org/34488#71
+	--default-signal is useful to overcome the POSIX limitation that shell
+	must not override inherited signal state, e.g. the second 'trap' here is
+	a no-op:
+
+	   trap '' PIPE && sh -c 'trap - PIPE ; seq inf | head -n1'
+
+	Instead use:
+
+	   trap '' PIPE && sh -c 'env --default-signal=PIPE seq inf | head -n1'
+
+	Similarly, the following will prevent CTRL-C from terminating the
+	program:
+
+	   env --ignore-signal=INT seq inf > /dev/null
+
+	See https://bugs.gnu.org/34488#8
+
+	* NEWS: Mention new options.
+	* doc/coreutils.texi (env invocation): Document new options.
+	* man/env.x: Add example of --default-signal=SIG usage.
+	(SEE ALSO): Mention sigprocmask.
+	* src/env.c (signals): New global variable.
+	(longopts): Add new options.
+	(usage): Print new options.
+	(parse_signal_params): Parse comma-separated list of signals, store in
+	signals variable.
+	(reset_signal_handlers): Set each signal to SIG_DFL/SIG_IGN.
+	(parse_block_signal_params): Parse command-line options.
+	(set_signal_proc_mask): Call sigprocmask to block/unblock signals.
+	(main): Process new options.
+	* src/local.mk (src_env_SOURCES): Add operand2sig.c.
+	* tests/misc/env-signal-handler.sh: New test.
+	* tests/local.mk (all_tests): Add new test.
+
+2019-03-04  Martin Bukatovic  <martin.bukatovic@gmail.com>
+
+	stat: print birth time on systems supporting statx
+	* configure.ac: Check for statx(), available on glibc >= 2.28.
+	* src/stat.c (get_birthtime): Call statx() when available.
+	* NEWS: Mention the improvement.
+
+2019-03-04  Pádraig Brady  <P@draigBrady.com>
+
+	df: support different file system encodings when not using tty
+	* src/df.c (replace_problematic_chars): A new wrapper to be
+	more conservative in our replacement when not connected to a tty.
+	* tests/df/problematic-chars.sh: Add a test case.
+
+	maint: tidy up recent additions to NEWS
+	* NEWS: Move date change to improvements and fix nohup grammar.
+
+2019-02-27  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: further clarify 'yes' alternative in seq invocation
+	* doc/coreutils.texi (node seq invocation): Clarify to use the tool
+	'yes'; otherwise the reader may interpret the sentence as if one
+	could pass 'yes' as the INCREMENT value.
+
+2019-02-26  Pádraig Brady  <P@draigBrady.com>
+
+	wc: treat non breaking space as a word separator
+	* src/wc.c (iswnbspace): A new function to match
+	characters in this class.
+	(isnbspace): Likewise for single byte charsets.
+	(main): Initialize posixly_correct from the environment,
+	to allow disabling honoring NBSP in non C locales.
+	(wc): Call is[w]nbspace() along with is[w]space.
+	* bootstrap.conf: Ensure btowc is available.
+	* tests/misc/wc-nbsp.sh: A new test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the change in behavior.
+
+2019-02-25  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: more date +%F clarifications
+	* doc/coreutils.texi (Date conversion specifiers):
+	Plain %F is actually like %+4Y-%m-%d.
+	(Padding and other flags): Mention POSIX restrictions.
+	* src/date.c (usage): Document recent changes.
+
+	doc: give date +%+F example
+	* doc/coreutils.texi (Padding and other flags):
+	Give example for + conversion specification.
+
+	doc: fix typo in previous patch
+
+	date: ‘+’ conversion specification flag
+	The recent Gnulib update fixed Bug#34608; document and test this.
+	* NEWS: Mention the change.
+	* doc/coreutils.texi (Padding and other flags):
+	Update doc to cover new flag and other POSIX.1-2017 changes.
+	* tests/misc/date.pl (date-century-plus): New test.
+
+	build: update gnulib submodule to latest
+
+2019-02-24  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	all: detect --help and --version more consistently
+	For select programs which accept only --help and --version options
+	(in addition to non-option arguments), process these options before
+	any other options.
+
+	Before:
+
+	  $ dd bs=1 --help
+	  dd: unrecognized option '--help'
+	  Try 'dd --help' for more information.
+
+	  $ yes me --help
+	  me --help
+	  me --help
+	  ...
+
+	After:
+	Any occurrence of '--help' in the arguments (prior to '--') will
+	show the help screen.
+
+	Discussed in https://bugs.gnu.org/33468 .
+
+	* NEWS: Mention change.
+	* src/cksum.c, src/dd.c, src/hostid.c, src/hostname.c, src/link.c,
+	src/logname.c, src/nohup.c, src/sleep.c, src/tsort.c, src/unlink.c,
+	src/uptime.c, src/users.c, src/whoami.c, src/yes.c (main): Replace
+	parse_long_options() + getopt_long() calls with
+	parse_gnu_standard_options_only(); Remove <getopt.h> inclusion;
+	Remove empty 'struct long_options' variable;
+	* tests/misc/help-version-getopt.sh: Add test.
+	* tests/local.mk (all_tests): Reference it.
+
+2019-02-24  Pádraig Brady  <P@draigBrady.com>
+
+	gnulib: update to the latest
+	update to a version with parse_gnu_standard_options_only()
+
+2019-02-20  Martin Castillo  <castilma@uni-bremen.de>
+
+	doc: fix join examples in texinfo
+	* doc/coreutils.texi (join invocation): Fix various errors.
+	Fixes https://bugs.gnu.org/34583
+	Fixes https://bugs.gnu.org/34584
+
+2019-02-19  Daming Yang  <lion@aosc.io>
+
+	ls: better align month abbreviations containing digits
+	* src/ls.c (abmon_init): Align numeric abbreviations right.
+	* NEWS: Mention the improvement.
+
+2019-02-18  Pádraig Brady  <P@draigBrady.com>
+
+	sort: clarify in --debug; only text comparisons affected
+	* src/sort.c (main): Adjust the debug info regarding locales,
+	to clarify that only textual comparisons are affected.
+	* tests/misc/sort-debug-warn.sh: Adjust accordingly.
+	Fixes https://bugs.gnu.org/34490
+
+2019-02-12  Pádraig Brady  <P@draigBrady.com>
+
+	comm,join: ensure warnings are apparent upon exit
+	* src/comm.c (main): Output a warning right before exit,
+	in case previous errors have scrolled from view.
+	* src/join.c (main): Likewise.
+	* tests/misc/comm.pl: Addjust accordingly.
+	* tests/misc/join.pl: Likewise.
+	Fixes https://bugs.gnu.org/34347
+
+2019-02-12  Filipp Gunbin  <fgunbin@fastmail.fm>
+
+	doc: fix typo referencing RFC 2822
+	* doc/coreutils.texi (date invocation): s/822/2822/.
+	Fixes https://bugs.gnu.org/34438
+
+2019-02-11  Pádraig Brady  <P@draigBrady.com>
+
+	gnulib: update to use new strtold module
+	* gnulib: Update to make the new strtold module available.
+	* bootstrap.conf: strtod is now a dependency of c-strtod,
+	which in turn is a dependency of cl-strtod.  This treats
+	strtold and strtod similarly.
+	* gl/lib/cl-strtod.c: Adjust to assume strtold is available.
+	* tests/misc/sort-float.sh: Likewise.
+	* src/sort.c: Likewise.
+	(nan_compare): Adjust comment to indicate
+	we still have to init padding bits as per
+	https://sourceware.org/bugzilla/show_bug.cgi?id=13246
+
+2019-02-04  Pádraig Brady  <P@draigBrady.com>
+
+	seq: output decimal points consistently with invalid locales
+	* src/seq.c (print_numbers): Only reset the locale if it
+	was successfully set originally.
+	* tests/misc/seq-locale.sh: Add a new test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the fix.
+
+	build: ensure sys/select.h is included
+	bootstrap.conf: Explicitly depend on select, rather than transitively.
+	* src/tail.c: Unconditionally include select.h as we use select()
+	outside inotify contexts now.
+
+	stat,tail: fix android build and support inotify
+	* src/extract-magic: Treat android like linux,
+	which fixes the build by ensuring the constants are defined.
+	* src/stat.c: Support all constants on android, including
+	the android specific "sdcardfs".
+	* src/tail.c: Fix inclusion of statfs headers to be independent
+	of inotify availability, as fremote() is used on linux even
+	if inotify has been disabled.  Also enable fremote() on android.
+	* NEWS: Mention the improvment.
+	Fixes https://bugs.gnu.org/34239
+
+2019-01-31  Pádraig Brady  <P@draigBrady.com>
+
+	tests: add test for locale decimal processing
+	* tests/misc/sleep.sh: Check locale processing of printf, sleep,
+	and timeout, when the french locale data is available.
+
+2019-01-31  Pádraig Brady  <P@draigBrady.com>
+
+	build: fix recent build failure on systems without strtold
+	Recently introduced in commit v8.30-50-geb73e23
+
+	* gl/lib/cl-strtod.c: Fall back to strtod() on systems
+	without strtold() (like we already do in sort).
+
+2019-01-28  Pádraig Brady  <P@draigBrady.com>
+
+	maint: fix new syntax-check failure from recent change
+	* cfg.mk: Exclude cl-strtold.c wrapper from requiring config.h
+
+2019-01-27  Paul Eggert  <eggert@cs.ucla.edu>
+
+	printf,seq: remove c-strtod dependency
+	* gl/modules/cl-strtold (Files): Add lib/cl-strtod.c, lib/cl-strtod.h.
+	(Depends-on): Remove cl-strtod.
+	(configure.ac): Redquire AC_C_RESTRICT.
+
+	printf,seq: improve long double accuracy
+	This fixes a thinko in the previous patch.
+	* gl/lib/cl-strtod.c (STRTOD): New macro.
+	(CL_STRTOD): Use it.
+
+	printf,seq,sleep,tail,timeout: accept current-locale floats
+	These commands now accept floating-point numbers in the
+	current locale, as well as in the C locale.
+	Compatibility problem reported by Robert Elz.
+	* NEWS: Document this.
+	* bootstrap.conf (gnulib_modules): Add cl-strtod, cl-strtold.
+	Remove c-strtold.
+	* doc/coreutils.texi (Floating point, tail invocation)
+	(printf invocation, timeout invocation, sleep invocation)
+	(seq invocation): Document this.
+	* gl/lib/cl-strtod.c, gl/lib/cl-strtod.h, gl/lib/cl-strtold.c:
+	* gl/modules/cl-strtod, gl/modules/cl-strtold: New files.
+	* src/printf.c, src/seq.c, src/sleep.c, src/tail.c, src/timeout.c:
+	Include cl-strtod.h instead of c-strtod.
+	* src/printf.c (vstrtold):
+	* src/seq.c (scan_arg, print_numbers):
+	* src/sleep.c (main):
+	* src/tail.c (parse_options):
+	* src/timeout.c (parse_duration):
+	Use cl_strtold instead of c_strtold.
+
+2019-01-25  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: update Goldberg URL
+	* doc/coreutils.texi (Floating point): Update URL.
+
+	sleep: improve doc
+	Problem reported by Robert Elz.
+	* doc/coreutils.texi (sleep invocation):
+	Say that arguments must be non-negative, which means they cannot
+	be arbitrary floating-point numbers.  Mention POSIX, not
+	“historical implementations” that are no longer of practical
+	interest.  List the extensions to POSIX.
+	* src/sleep.c (usage): Omit needless words, removing dubious
+	commentary about “most implementations” and incorrect commentary
+	about “arbitrary”.  Details about exactly which numbers are
+	allowed can be found in the documentation.
+
+2019-01-20  Pádraig Brady  <P@draigBrady.com>
+
+	tail: fix handling of broken pipes with SIGPIPE ignored
+	* init.cfg (trap_sigpipe_or_skip_): A new function refactored from...
+	* tests/misc/printf-surprise.sh: ...here.
+	* tests/misc/seq-epipe.sh. Likewise.
+	* src/tail.c (die_pipe): Ensure we exit upon sending SIGPIPE.
+	* tests/tail-2/pipe-f.sh: Ensure we exit even if SIGPIPE is ignored.
+	* NEWS: Mention the bug fix.
+
+2019-01-20  Ayappan  <ayappap2@in.ibm.com>
+
+	tail: fix recent ineffective AIX change
+	* src/tail.c: Fix commit v8.30-40-gd5ab4cb which was ineffective.
+	Fixes http://bugs.gnu.org/33946
+
+2019-01-20  Pádraig Brady  <P@draigBrady.com>
+
+	build: ensure VLAs are not used
+	Fail developer builds if VLAs are used,
+	as there are portability concerns to consider with them.
+
+	* configure.ac: Enable -Wvla which is implicit in the full list added.
+	* m4/jm-macros.m4: Define GNULIB_NO_VLA which disables use of
+	VLAs within gnulib code.
+
+2019-01-20  Pádraig Brady  <P@draigBrady.com>
+
+	gnulib: update to the latest
+	* gnulib: Update to a version supporting GNULIB_NO_VLA
+	* bootstrap: Sync with latest
+
+2019-01-16  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	build: use distributed man pages when running with --help fails
+	When building against an incompatible GLIBC version compared to that
+	on the build host, then running the just-built binary might fail
+	although it is the same platform - thus CROSS_COMPILING is false.
+	As a result, generating the man pages fails.
+
+	* man/local.mk (.x.1): Add a check to verify that running the utility
+	with --help succeeds, otherwise falling back to using 'dummy-man'.
+
+2019-01-13  Pádraig Brady  <P@draigBrady.com>
+
+	ls: with --group-directories-first, also group symlinked dirs
+	* src/ls.c (is_linked_directory): A new function to
+	also consider symlinked directories.
+	(main): Rename check_symlink_color to check_symlink_mode,
+	and enable that with --group-directories-first.
+	(DIRFIRST_CHECK): Adjust to use is_linked_directory,
+	rather than just is_directory.
+	(gobble_file): Simplify to always update f->linkmode
+	if the stat() succeeds.
+	* tests/ls/group-dirs.sh: A new test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the change in behavior.
+	Suggested by Amin Bandali in
+	https://lists.gnu.org/r/coreutils/2018-12/msg00017.html
+
+	tail: don't exit immediately with filters on AIX
+	* src/tail.c: Fix the check_output_available check on AIX.
+	Note we don't use poll for all systems as the overhead
+	of adding the gnulib poll module wouldn't be worth it
+	just for this single use.
+	* tests/tail-2/pipe-f.sh: Fix the test which always passed
+	due to only the exit code of sleep being checked.
+	* NEWS: Mention the bug fix and rearrange alphabetically.
+	Fixes http://bugs.gnu.org/33946
+
+2019-01-06  Assaf Gordon  <assafgordon@gmail.com>
+
+	basenc: allocate buffers on heap
+	Allocate the encoding/decoding buffers dynamically on the heap instead
+	of using variable-length-array (VLA) on the stack.
+	Discussed in https://lists.gnu.org/r/coreutils/2019-01/msg00004.html .
+
+	* src/basenc.c (do_encode,do_decode): Allocate inbuf/outbuf using
+	xmalloc, and free if using LINT.
+
+2019-01-04  Pádraig Brady  <P@draigBrady.com>
+
+	doc: adjust URLs in help to avoid wrapping
+	* src/system.h: Adjust lines containing URLs so that
+	they don't wrap on 80 column terminals.  One could also
+	use .UR macros, but these aren't universally available.
+	Note the adjustments here need to be compatible with
+	the pattern matching done in help2man.
+	Addresses https://bugs.gnu.org/33914
+
+2019-01-01  Assaf Gordon  <assafgordon@gmail.com>
+
+	maint: update all copyright year number ranges
+	Run "make update-copyright" and then...
+
+	* gnulib: Update to latest with copyright year adjusted.
+	* tests/init.sh: Sync with gnulib to pick up copyright year.
+	* bootstrap: Likewise.
+	* tests/sample-test: Adjust to use the single most recent year.
+
+2019-01-01  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: mention base32 in the title line of common basenc.c
+	* src/basenc.c: Do the above, and remove a redundant comment.
+
+2019-01-01  Assaf Gordon  <assafgordon@gmail.com>
+
+	base64,base32: fix 'extra operand' error message
+	In the following invocation, 'a' is the input file, and 'b' is the extra
+	operand:
+
+	  $ base64 a b
+
+	Report 'b' in the error message instead of 'a':
+
+	  $ base64 a b
+	  base64: extra operand 'b'
+
+	Discussed in https://lists.gnu.org/r/coreutils/2018-12/msg00008.html .
+
+	* src/basenc.c (main): If there is more than one non-option operand,
+	report the second one (assuming the first is a the input file name).
+	* tests/misc/base64.pl: Add tests.
+	* tests/misc/basenc.pl: Adjust expectedc error message in tests.
+	* NEWS: Mention bugfix.
+
+2018-12-31  Pádraig Brady  <P@draigBrady.com>
+
+	doc: mention that more than 8 colors are supported by ls
+	* src/dircolors.hin: Mention any codes supported by the terminal
+	are allowed.
+	Addresses https://bugs.gnu.org/33915
+
+2018-12-28  Assaf Gordon  <assafgordon@gmail.com>
+
+	basenc: A new program complementary to base64/base32
+	Encodes/decodes data in various common formats:
+	base64,base64url,base32,base32,base16,base2,z85.
+
+	Discussed here:
+	https://lists.gnu.org/r/coreutils/2018-11/msg00014.html
+	https://lists.gnu.org/r/coreutils/2018-12/msg00019.html
+
+	* AUTHORS: Add basenc.
+	* README: Reference the new program.
+	* NEWS: Mention the new program.
+	* build-aux/gen-lists-of-programs.sh: Add basenc.
+	* doc/coreutils.texi: (basenc invocation): Document the new command.
+	* man/.gitignore: Ignore the generated man page.
+	* man/basenc.x: A new template, with few examples.
+	* man/local.mk: Reference the new man page.
+	* scripts/git-hooks/commit-msg: Allow basenc as program prefix.
+	* src/.gitignore: Ignore the new binary.
+	* src/basenc.c:
+	(usage): Mention new options.
+	(main): Handle new options.
+	(isbase*, base*_length, base*_encode, base*_decode_ctx): Implement new
+	encoding/decoding formats.
+	* src/local.mk: Add new program.
+	* tests/local.mk: Add new test.
+	* tests/misc/basenc.pl: New tests.
+	* tests/misc/help-version.sh (basenc_setup): use '--version' for default
+	invocation (basenc errors with no parameters).
+
+2018-12-21  Assaf Gordon  <assafgordon@gmail.com>
+
+	maint: rename base64.c to basenc.c
+	In preparation for adding 'basenc' program.
+	Suggested in https://lists.gnu.org/r/coreutils/2018-11/msg00019.html .
+
+	* src/base64.c: Rename to src/basenc.c.
+	* src/local.mk: Update base*_SOURCES definitions.
+	* po/POTFILEs.in: Rename base64 to basenc.
+
+2018-12-15  Paul Eggert  <eggert@cs.ucla.edu>
+
+	shred,sort,split: add NEWS item
+
+	shred,sort,split: fix ftruncate error reporting
+	Problem reported for split by Scott Worley (Bug#33761):
+	* src/shred.c (do_wipefd):
+	Also report an error if ftruncate fails	on a shared memory object.
+	* src/sort.c (get_outstatus): New function.
+	(stream_open, avoid_trashing_input): Use it.
+	* src/sort.c (stream_open):
+	* src/split.c (create):
+	If ftruncate fails, do not report an error
+	unless it is a regular file or a shared memory object.
+
+2018-11-07  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	sync: add NEWS and test for the fix in the previous commit
+	* NEWS (Bug fixes): Mention the fix in commit 94d364f157f0.
+	While at it, remove duplicate "Changes in behavior" heading.
+	* tests/misc/sync.sh: Add a test with a write-only file for the fix.
+
+2018-11-06  Paul Eggert  <eggert@cs.ucla.edu>
+
+	sync: fix open fallback bug
+	Problem caught by Coverity Analysis
+	and reported by Kamil Dudka (Bug#33287).
+	* src/sync.c (sync_arg): Fix typo in fallback code.
+
+2018-10-28  Paul Eggert  <eggert@cs.ucla.edu>
+
+	ln: use linkat and symlinkat
+	Open a target directory and use its file descriptor in linkat,
+	symlinkat, etc. syscalls, instead of constructing long file names
+	by concatenating the target directory name to a basename.
+	This avoids O(N²) behavior with ‘ln F1 F2 ... Fn DIR’ when DIR is
+	a long file name with many slashes.  It also avoids some races if
+	DIR is renamed while ln is running.
+	* bootstrap.conf (gnulib_modules): Add openat-safer.
+	* src/ln.c: Include fcntl-safer.h.
+	(O_PATHSEARCH): New constant.
+	(errno_nonexisting, target_directory_operand): Remove; no longer used.
+	(atomic_link, do_link): New arg DESTDIR_FD.  All uses changed.
+	(do_link): New arg DEST_BASE.  All uses changed.
+	(main): Open target directory and use its file descriptor
+	as DESTDIR_FD.
+
+	build: update gnulib submodule to latest
+	* src/copy.c (copy_internal):
+	* src/cp.c (do_copy):
+	* src/ln.c (do_link):
+	Adjust to Gnulib API change.
+
+2018-10-27  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	tests: provide 100% coverage for echo
+	*  src/echo.c (usage): Assert that STATUS is always EXIT_SUCCESS.
+	* tests/misc/echo.sh: Add further tests for all hex and escape and
+	escape characters.
+
+	To get coverage statistics, run:
+	  make coverage -j 4 TESTS=tests/misc/echo.sh SUBDIRS=.
+	  xdg-open doc/coverage/src/echo.c.gcov.frameset.html
+
+2018-10-27  Pádraig Brady  <P@draigBrady.com>
+
+	echo: always process escapes when POSIXLY_CORRECT is set
+	* src/echo.c (main): Always enable backslash processing if
+	POSIXLY_CORRECT is set.
+	* tests/misc/echo.sh: Add (the first) test for the echo command.
+	* tests/local.mk: Reference the new test.
+	* tests/misc/printf.sh: Update a stale comment.
+	* doc/coreutils.texi (echo invocation). Mention that POSIXLY_CORRECT
+	now always enables backslash processing.
+	* NEWS: Mention the change in behavior.
+	Fixes https://bugs.gnu.org/32703
+	Issue identified by Eric Blake.
+
+2018-10-26  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	test: add -N unary operator
+	Bash knows 'test -N FILE'.  Add it to GNU 'test' as well.
+
+	* src/test.c (unary_operator): Add a case for 'N'.
+	(usage): Document it.
+	* doc/coreutils.texi (node File characteristic tests): Likewise.
+	* NEWS (New features): Likewise.
+	* tests/misc/test-N.sh: Add a test.
+	* tests/local.mk (all_tests): Reference it.
+
+2018-10-26  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	test: simplify redundant code
+	Remove the function 'test_unop', as the cases therein are redundant to
+	those handled by 'unary_operator'; exception: the cases 'o' and 'N':
+	they had been present in test_unop and handling the commands
+	  test -N STR
+	  test -o STR
+	and
+	  test x = x -a -N STR
+	  test x = x -a -o STR
+	which ran into an error later on anyway.
+	With this commit, the error diagnostic will change from ...
+	  $ /usr/bin/test -N STR
+	  /usr/bin/test: extra argument '-N'
+	  $ /usr/bin/test -o STR
+	  /usr/bin/test: extra argument '-o'
+	... to ...
+	  $ src/test -N STR
+	  src/test: '-N': unary operator expected
+	  $ src/test -o STR
+	  src/test: '-o': unary operator expected
+
+	* src/test.c (test_unop): Remove.
+	(unary_operator): Fail with test_syntax_error in the default case.
+	(term): Directly call unary_operator.
+	(two_arguments): Likewise.
+	* tests/misc/test-diag.pl: Adjust error diagnostic.
+
+2018-10-26  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	test: remove support for the ambigous -a unary operator
+	* src/test.c (unary_operator): Remove case 'a'.
+	(test_unop): Likewise.
+	* NEWS (Changes in behavior): Document the change.
+
+	Discussed at https://bugs.gnu.org/33097
+
+2018-10-21  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	test: avoid FP in chroot-credentials.sh for different group list order
+	On my openSUSE:Tumbleweed system, I get a false positive test failure
+	in the above 'check-root' test because the group lists inside and
+	outside the chroot have a different order:
+
+	  ++ chroot --userspec=berny / id -G
+	  ++ id -G berny
+	  + test '100 454 457 480 492' = '100 480 492 457 454'
+	  + fail=1
+
+	* tests/misc/chroot-credentials.sh (num_sort): Add function to sort
+	group lists, and use it in the test cases which test multiple groups.
+
+2018-10-20  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: tidy up setuid commentary
+	* doc/perm.texi (Mode Structure): Improve wording.
+	(Numeric Modes): Don’t say “on execution” (Bug#9594).
+
+2018-10-19  Paul Eggert  <eggert@cs.ucla.edu>
+
+	ln: avoid directory hard-link races
+	Previously, 'ln A B' did 'stat("B"), lstat("A"), link("A","B")'
+	where the stat and lstat were necessary to avoid hard-linking
+	directories on systems that can hard-link directories.
+	Now, in situations that prohibit hard links to directories,
+	'ln A B' merely does 'link("A","B")'.  The new behavior
+	avoids some races and should be more efficient.
+	This patch was inspired by Bug#10020, which was about 'ln'.
+	* bootstrap.conf (gnulib_modules): Add unlinkdir.
+	* src/force-link.c (force_linkat, force_symlinkat): New arg for
+	error number of previous try.  Return error number, 0, or -1 if
+	error, success, or success after removal.  All callers changed.
+	* src/ln.c: Include priv-set.h, unlinkdir.h.
+	(beware_hard_dir_link): New static var.
+	(errnoize, atomic_link): New functions.
+	(target_directory_operand): Use errnoize for simplicity.
+	(do_link): New arg for error number of previous try.  All callers
+	changed.  Do each link atomically if possible.
+	(main): Do -r check earlier.  Remove linkdir privileges so we can
+	use a single linkat/symlinkat instead of a racy substitute for the
+	common case of 'ln A B' and 'ln -s A B'.  Set beware_hard_dir_link
+	to disable this optimization.
+
+	cp: 'cp -il A B' no longer fails if user OKs it
+	* NEWS: Mention the change.
+	* src/copy.c (copy_internal): Replace the link if the
+	user has okayed it.
+
+	build: update gnulib submodule to latest
+	* gl/modules/tempname.diff: Update to match Gnulib.
+
+2018-10-17  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: add chmod examples
+	Discussed in https://bugs.gnu.org/11043 .
+
+	* doc/coreutils.texi (chmod invocation): Add examples.
+
+2018-10-02  Bjarni Ingi Gislason  <bjarniig@rhi.hi.is>
+
+	doc: fix minor mistakes in "env.x"
+	* man/env.x (OPTIONS): Fix a spelling mistake.  Protect a period at the
+	beginning of a line.
+
+2018-09-30  Achilles Gaikwad  <agaikwad@redhat.com>
+
+	id: support multiple specified users
+	  $ id root nobody
+	  uid=0(root) gid=0(root) groups=0(root)
+	  uid=99(nobody) gid=99(nobody) groups=99(nobody)
+
+	* src/id.c (main): Make variables opt_zero, just_group_list,
+	just_group, use_real, just_user global to be used in a new
+	function.
+	(print_stuff): New function that will print user and group
+	information for the specified USER.
+	When using -G option delimit each record with two NULs.
+	Restructure the code in the file to have global variables
+	followed by functions.
+	* tests/id/zero.sh: Add test cases to check the usage
+	of -z option with multiple users.
+	* tests/id/uid.sh: Add a test case to ensure all users
+	are queried in the presence of errors.
+	* doc/coreutils.texi: Document the interface changes.
+	* NEWS: Mention the new feature.
+
+2018-09-25  Stéphane Campinas  <stephane.campinas@gmail.com>
+
+	doc: csplit: clarify handling of regexps with negative offsets
+	* doc/coreutils.texi (csplit invocation): Detail the behavior
+	with regexp patterns and negative offsets, which differs from
+	line number patterns, to avoid looping on the input.  For example:
+	  $ seq 50 | csplit -s - /15/-5 /12/
+	  csplit: ‘/12/’: match not found
+
+2018-09-24  Pádraig Brady  <P@draigBrady.com>
+
+	doc: csplit: clarify input may not be reproducible from output
+	* doc/coreutils.texi (csplit invocation): Clarify that
+	portions of the input may be skipped and thus the input
+	may not be reproducible by just concatenating the output files.
+	Fixes https://bugs.gnu.org/32317
+
+2018-07-27  Paul Eggert  <eggert@cs.ucla.edu>
+
+	df: omit redundant comparison
+	Trivial inefficiency reported by Bruno Haible in:
+	http://lists.gnu.org/r/bug-gnulib/2018-07/msg00109.html
+	* src/df.c (hide_problematic_chars): Omit redundant test.
+
+	df: tune slightly
+	* src/df.c (get_header, get_dev):
+	Avoid calling mbswidth twice when once will do.
+
+	df: avoid multibyte character corruption on macOS
+	This improves on the earlier fix for the problem reported by
+	Chih-Hsuan Yen (Bug#32236), by also looking for other control
+	characters and for encoding errors.
+	* src/df.c: Include wchar.h and wctype.h instead of c-ctype.h.
+	(hide_problematic_chars): Process the string as multibyte.
+	Use iswcntrl, not c_iscntrl.
+
+2018-07-26  Chih-Hsuan Yen  <yan12125@gmail.com>
+
+	df: avoid multibyte character corruption on macOS
+	* src/df.c (hide_problematic_chars): Use c_iscntrl() as
+	passing 8 bit characters to iscntrl() is not supported on macOS.
+	* NEWS: Mention the bug fix.
+	Fixes https://bugs.gnu.org/32236
+
+2018-07-22  Wodry  <coreutils3422@runbox.com>  (tiny change)
+
+	doc: improve documentation of binary prefixes
+	* doc/coreutils.texi (Common options):
+	* src/dd.c, src/head.c, src/od.c, src/stdbuf.c, src/tail.c (usage):
+	* src/system.h (emit_size_note):
+	Mention binary prefixes (Bug#32242).
+
+2018-07-21  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid false failure on sparc 32 bit
+	* tests/rm/rm-readdir-fail.sh: Skip the test entirely on 32 bit,
+	so we avoid conflating the 32bit and 64 bit types, as that
+	triggers alignment issues (SIGBUS) on Gentoo sparc.
+	Fixes https://bugs.gnu.org/29886
+
+2018-07-05  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+	* bootstrap.conf, src/copy.c, src/mv.c, src/shred.c:
+	Adjust to renaming of renameat2 to renameatu.
+
+2018-07-05  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix skipping in some tests
+	* tests/cp/cp-a-selinux.sh: Use 'skip_' rather than the probably
+	undefined 'skip'.
+	* tests/du/2g.sh: Likewise.
+	* tests/install/install-Z-selinux.sh: Likewise.
+	* tests/misc/chcon.sh: Likewise.
+	* tests/misc/selinux.sh: Likewise.
+	* tests/mkdir/restorecon.sh: Likewise.
+	* cfg.mk (sc_prohibit-skip): A new syntax check to catch the issue.
+
+2018-07-02  Jim Meyering  <meyering@fb.com>
+
+	maint: init.cfg: fix a minor test-related quoting bug
+	* init.cfg (require_membership_in_two_groups_): This fixes a bug
+	introduced by me in v8.15-8-gdd0e4c562.  Luckily, the consequence
+	of low-probability triggering the bug was the mere added backslash
+	in the diagnostic: "...but running id -G\ either...".  It would be
+	triggered in a test failure for one who is a member of only one or
+	fewer groups.
+
+2018-07-02  Pádraig Brady  <P@draigBrady.com>
+
+	maint: post-release administrivia
+	* NEWS: Add header line for next release.
+	* .prev-version: Record previous version.
+	* cfg.mk (old_NEWS_hash): Auto-update.
+
+	version 8.30
+	* NEWS: Record release date.
+
+2018-07-01  Pádraig Brady  <P@draigBrady.com>
+
+	tests: standardize perl usage in tests
+	* tests/cp/fiemap-FMR.sh: Ensure perl is parameterized to $PERL,
+	and ensure require_perl_ is used, so tests are skipped appropriately.
+	* tests/cp/preserve-gid.sh: Likewise.
+	* tests/du/long-from-unreadable.sh: Likewise.
+	* tests/misc/env-S-script.sh: Likewise.
+	* tests/misc/sort-benchmark-random.sh: Likewise.
+	* tests/rm/deep-2.sh: Likewise.
+
+	maint: copy: avoid new static analyzer warnings
+	* src/copy.c (copy_internal): Use the lint protected src_mode,
+	rather than accessing the src_sb again.  Also unconditionally
+	populate src_sb when !x->move_mode and in lint mode.
+	Reported by Kamil Dudka with coverity and clang analyzer.
+
+	maint: fix recent stale comments and spelling mistakes
+	* doc/coreutils.texi: s/seperator/separator/.
+	* tests/misc/env-S.pl: Likewise.
+	* src/env.c: Fix stale comment.
+
+2018-06-27  Pádraig Brady  <P@draigBrady.com>
+
+	maint: disable overly agressive sc_gitignore_redundant
+	* cfg.mk (sc_gitignore_redundant): Disabled for now as too
+	aggressive flagging entries like /lib/arg-nonnull.h in
+	a newly checked out repo.
+
+	env: adjust diagnostics provided for shebang usage
+	* src/env.c (main): Don't process '-' specially since
+	that causes an issue on the openbsd getopt implementation
+	where a lone '-' is now processed as an option, and anyway
+	it doesn't particuarly help diagnosing common shebang
+	usage issues.  Also don't restrict the extra diagnostics
+	for shebang usage to the case with 3 arguments, as
+	further arguments can be passed to a script.
+	* tests/misc/env-S.pl: Adjust accordingly.
+
+2018-06-27  Assaf Gordon  <assafgordon@gmail.com>
+
+	tests: accept getopt errors without single-quotes
+	On OpenBSD 6.2, invalid single options produce error messages
+	without single quotes:
+
+	    $ ./src/chroot -/
+	    chroot: unknown option -- /
+
+	As opposed to other systems:
+
+	    ./src/chroot: invalid option -- '/'
+
+	Modify the grep search to accept this.
+
+	* tests/misc/usage_vs_getopt.sh (checkprg): Change the grep pattern
+	to accomodate no-single-quotes cases.
+
+2018-06-27  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix false failures when perl not available
+	* tests/local.mk: Reference the stub that skips perl tests,
+	with the correct path.
+
+	tests: fix false failure with limited shebang lines
+	* tests/misc/env-S-script.sh: Provide a wrapper to
+	emulate shebang processing, but without length limits,
+	which are 127 on Linux for example.
+
+	maint: update gnulib to latest
+	* gnulib: Update to latest, which incorporates
+	a thread linking fix from Bruno Haible,
+	which was seen on newer Ubuntu systems.
+
+2018-06-27  Assaf Gordon  <assafgordon@gmail.com>
+
+	tests: remove unused Data::Dumper perl module
+	The module is not needed anymore (was used during development).
+	Despite being a Perl core module, platforms like CentOS don't install
+	it by default.  Reported by Bruno Haible at
+	https://lists.gnu.org/r/coreutils/2018-06/msg00093.html.
+
+	* tests/misc/csplit-suppress-matched.pl: Remove Data::Dumper.
+
+2018-06-25  Carlos Santos  <casantos@datacom.com.br>
+
+	maint: fix -Werror=suggest-attribute=malloc in expr.c
+	Add attribute 'malloc' to mpz_get_str to prevent
+	the following on GCC 8.1.1
+
+	  src/expr.c:117:1: error: function might be candidate for attribute
+	    'malloc' if it is known to return normally
+	      [-Werror=suggest-attribute=malloc]
+	   mpz_get_str (char const *str, int base, mpz_t z)
+	   ^~~~~~~~~~~
+	  cc1: all warnings being treated as errors
+
+	* src/expr.c (mpz_get_str): Add _GL_ATTRIBUTE_MALLOC.
+
+2018-06-25  Pádraig Brady  <P@draigBrady.com>
+
+	maint: update gnulib to latest
+	* gnulib: Update to latest.
+	* .gitignore: Add new entries.
+	* bootstrap.conf: Enable wchar-single, which will enable more
+	efficient replacements of wcwidth and mbrtowc, as we indicate
+	that the charset will no change between invocations of these functions.
+
+	maint: sync longlong.h from gmp repo
+	* src/longlong.h: Sync changes.  No functional change.
+
+	maint: avoid false positive in src/fs-magic-compare
+	* src/local.mk (fs_normalize_perl_subst): `make src/fs-magic-compare`
+	was reporting incorrectly that AFS was not being handled.
+	Add a mapping to our KAFS identifier.
+	* .gitignore: Add intermediate files from `make src/fs-magic-compare`
+
+2018-06-23  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	tests: initialize fail=0 to avoid "unary operator expected" errors
+	With an uninitialized variable 'fail', the unquoted use like
+	  test $fail = 1
+	lead to the shell error
+	  "unary operator expected".
+
+	The uninitialized 'fail' variable was a side effect of
+	  https://git.sv.gnu.org/cgit/gnulib.git/commit/?id=e91c0d4f9
+	which was pulled into coreutils-v8.26 with
+	  https://git.sv.gnu.org/cgit/coreutils.git/commit/?id=ef9650170
+	Coreutils test code relied and relies on 'fail' to be initialized,
+	so initialize that variable here.
+
+	* tests/local.mk (TESTS_ENVIRONMENT): Initialize fail=0.
+
+2018-06-21  Jim Meyering  <meyering@fb.com>
+
+	maint: do not depend directly on gnulib's now-unused ftello module
+	* bootstrap.conf (gnulib_modules): Remove ftello, since it is
+	no longer used directly, since v8.9-11-geab97b307.
+
+2018-06-21  Pádraig Brady  <P@draigBrady.com>
+
+	tests: provide an option to relax the need for gdb
+	* tests/rm/r-root.sh: gdb provides extra protection,
+	but is not strictly necessary.  So provide an option
+	for maintainers to relax the requirements.
+
+	rm: add --preserve-root=all to protect mounts
+	* src/remove.c (rm_fts): With the --preserve-root=all extension,
+	reject command line arguments that are mount points.
+	* src/remove.h (rm_options): Add preserve_all_root to store config.
+	* src/mv.c (rm_option_init): Init preserve_all_root to false.
+	* src/rm.c (main): Init preserve_all_root as per option.
+	(usage): Describe the new option.
+	* src/remove.c (rm_fts): Lookup the parent device id,
+	and reject the cli argument if a separate file system.
+	* tests/rm/one-file-system.sh: Add a test case.
+	* NEWS: Mention the new feature.
+
+2018-06-21  Adam Borowski  <kilobyte@angband.pl>
+
+	cp: add --reflink=never to force standard copy mode
+	This mode is currently the default, but most if not all users of
+	reflink-capable filesystems want --reflink=auto, which is often
+	encapsulated into an alias.  Adding --reflink=never allows overriding
+	such an alias.
+
+	* doc/coreutils.texi (cp invocation): Describe the new option.
+	* src/cp.c: Support --reflink=never.
+	* tests/cp/reflink-auto.sh: Add a test case.
+	* NEWS: Mention the new feature.
+
+2018-06-21  Assaf Gordon  <assafgordon@gmail.com>
+
+	env: add -S/--split-string option
+	Adopted from FreeBSD's env(1), useful for specifing multiple
+	parameters on a shebang (#!) script line, e.g:
+
+	   #!/usr/bin/env -S perl -w -T
+
+	Discussed in https://lists.gnu.org/r/coreutils/2018-04/msg00011.html
+
+	* src/env.c (valid_escape_sequence,escape_char,scan_varname,
+	  extract_varname,validate_split_str,build_argv,
+	  parse_split_string): New functions.
+	  (main): Process new option and call parse_split_string.
+	  (usage): Mention new option.
+	* tests/misc/env-S.pl: Test new option from the command line.
+	* tests/misc/env-S-script.sh: Test new option from shebang scripts.
+	* tests/local.mk (all_tests): Add new tests.
+	* man/env.x (OPTIONS): Show a brief example of -S usage and point to
+	the full documentation for more information.
+	* doc/coreutils.texi (env invocation): Detail usage of -S/--split-string
+	option.
+	* NEWS: Mention new option.
+
+2018-06-21  Assaf Gordon  <assafgordon@gmail.com>
+
+	env: add -v/--debug option
+	Prints verbose information about each step:
+
+	  $ env -v -uFOO  -C /tmp BAR=BAZ date -u
+	  env: unset:    FOO
+	  env: setenv:   BAR=BAZ
+	  env: chdir:    '/tmp'
+	  env: executing: date
+	  env:    arg[0]= ‘date’
+	  env:    arg[1]= ‘-u’
+	  Sun Apr 22 08:52:30 UTC 2018
+
+	Inspired by FreeBSD's env(1).
+
+	* src/env.c (usage): Mention new option.
+	  (main): Print debug information if requested.
+	* NEWS: Mention new option.
+	* doc/coreutils.texi (env invocation): Mention -v/--debug.
+
+2018-06-21  Assaf Gordon  <assafgordon@gmail.com>
+
+	maint: refactor unsetenv call in env
+	Keep unset envvars (-uFOO) in an array for later deletion,
+	instead of reiterating over argv.  Done in preparation for
+	'-S string' feature. Related to '-u' discussion in
+	https://lists.gnu.org/r/coreutils/2018-04/msg00013.html
+
+	* src/env.c (append_unset_var,unset_envvars): New functions.
+	 (main): Use new functions.
+
+2018-06-21  Kaxandra Labat  <kaxandra.labat@gmail.com>
+
+	ls: ignore case when coloring file extensions
+	* src/ls.c (get_color_indicator): s/STREQ_LEN/c_strncasecmp/
+	* src/dircolors.hin: Remove a now redundant entry.
+	* tests/ls/color-ext.sh: Add a new test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the change in behavior.
+
+2018-06-21  Pádraig Brady  <P@draigBrady.com>
+
+	md5sum,b2sum,sha*sum: support -z,--zero option
+	* doc/coreutils.texi (md5sum invocation): Describe the new option,
+	and how it's not supported by --check, and how it disables escaping.
+	* src/md5sum.c (delim): A new global to parmeterize the out delimiter.
+	(main): Don't enable file name escaping with -z, and output '\0'.
+	* tests/misc/md5sum-newline.pl: Add a test case.
+	* NEWS: Mention the new feature.
+
+2018-06-21  Pádraig Brady  <P@draigBrady.com>
+
+	wc: optimize processing of ASCII in multi byte locales
+	===== Benchmark setup (on GNU/Linux) ====
+	$ yes áááááááááááááááááááá | head -n100000 > mbc.txt
+	$ yes 12345678901234567890 | head -n100000 > num.txt
+
+	===== Before ====
+	$ time src/wc -Lm < mbc.txt
+	real    0m0.186s
+	$ time src/wc -m < mbc.txt
+	real    0m0.186s
+	$ time src/wc -Lm < num.txt
+	real    0m0.055s
+	$ time src/wc -m < num.txt
+	real    0m0.056s
+
+	==== After ====
+	$ time src/wc -Lm < mbc.txt
+	real    0m0.196s
+	$ time src/wc -m < mbc.txt
+	real    0m0.173s
+	$ time src/wc -Lm < num.txt
+	real    0m0.031s
+	$ time src/wc -m < num.txt
+	real    0m0.028s
+
+	* src/wc.c (wc): Only call wide variant functions like
+	iswprint() and wcwidth() for non is_basic() characters.
+	I.E. non ISO C "basic character set" characters.
+	This is especially significant on OSX where wcwidth()
+	is very expensive (about 10x in tests).
+	* NEWS: Mention the improvement.
+	Suggested by Eric Fischer.
+
+2018-06-14  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: port test.1 to doclifter
+	* man/test.x: Use \& instead of quoting (Bug#31803).
+
+	doc: port man pages to doclifter
+	Problem reported by Eric S. Raymond (Bug#31803).
+	* man/test.x: Add SYNOPSIS section, since help2man
+	understandably gets confused by the square brackets.
+	* src/ln.c (usage): Omit parenthetical "(Nth form)" in usage,
+	as it confuses doclifter.
+
+2018-06-04  Pádraig Brady  <P@draigBrady.com>
+
+	cp: preserve existing permissions with --no-preserve=mode
+	This issue was introduced in commit v8.19-145-g24ebca6
+
+	* src/copy.c (copy_internal): With --no-preserve=mode,
+	only reset permissions for newly created files.
+	(copy_reg): Likewise.
+	* NEWS: Mention the fix.
+	* tests/cp/preserve-mode.sh: Add a test case.
+	Fixes https://bugs.gnu.org/31675
+
+2018-05-29  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix periodic false failure in month alignment
+	* tests/ls/abmon-align.sh: Base relative month adjustment
+	from the middle of the month, to avoid failures due
+	to months being repeated.
+	Fixes https://bugs.gnu.org/31644
+
+2018-05-26  Bjarni Ingi Gislason  <bjarniig@rhi.hi.is>
+
+	doc: formatting fixes in "du.x" and "rm.x"
+	Avoid warnings from: groff -b -e -mandoc -T utf8 -rF0 -t -w w -z
+
+	* man/du.x: Change ".BR" to ".B" if there is only one argument.
+	Protect an end-of-sentence indicator (.?!) with '\&'
+	if it does not mean an end of a sentence.
+	Change '--' to '\-\-' if it indicates an option.
+	* man/rm.x: Change '\=' to '='.
+
+2018-05-18  Pádraig Brady  <P@draigBrady.com>
+
+	cp: with --force; replace self referential symlinks
+	* src/copy.c (copy_internal): Don't fail immediately upon
+	getting ELOOP when running stat() on the destination,
+	rather proceeding if -f specified, allowing the link
+	to be removed.  If the loop is not in the final component
+	of the destination path, we still fail but at the
+	subsequent unlink() stage.
+	* doc/coreutils.texi (cp invocation): Adjust wording to say
+	that --force doesn't work with dangling links, rather than
+	all links that can't be traversed.
+	* tests/cp/thru-dangling.sh: Add a test case.
+	* NEWS: Mention the change in behavior.
+	Discussed in https://bugs.gnu.org/31335
+
+2018-05-15  Pádraig Brady  <P@draigBrady.com>
+
+	cp: fix symlink checks when overwriting files
+	Ensure this _does_ recreate the symlink
+	  Given "path1" and "path2" are on different devices.
+	  $ touch "path1/file"
+	  $ cd path2/; ln -s path1/file
+	  $ cp -dsf path1/file .
+
+	Ensure this does _not_ overwrite file
+	  $ touch file
+	  $ ln -s file l1
+	  $ cp -sf l1 file
+
+	* src/copy.c (same_file_ok): Remove device ids from consideration,
+	instead deferring to future EXDEV with --link or allowing
+	the first case above to work.
+	Also ensure that we do not exist this function too early,
+	when the destination file is not a symlink, which protects
+	against the second case.
+	* tests/cp/cross-dev-symlink.sh: Add a test for the first case.
+	* tests/cp/same-file.sh: Add a test for the second case above.
+	* NEWS: Mention the bug fixes.
+	* THANKS.in: Mention the reporters who also analyzed the code.
+	Fixes https://bugs.gnu.org/31364
+
+2018-05-15  Pádraig Brady  <P@draigBrady.com>
+
+	cp: ensure --remove-destination doesn't traverse symlinks
+	* src/cp.c (target_directory_operand): Allow through inaccessible
+	arguments with -f or --remove.
+	* doc/coreutils.texi (cp invocation): Clarify that -f doesn't directly
+	impact the removal of non-traversable symlinks.
+	* tests/cp/dir-rm-dest.sh: Test the new behavior.
+	* tests/cp/thru-dangling.sh: Enforce -f behavior wrt symlinks.
+	* NEWS: Mention the bug fix.
+	Fixes https://bugs.gnu.org/31335
+
+	maint: make chmod/chgrp/chown leak free under valgrind
+	* src/chmod.c: Deallocate the mode change array in dev mode.
+	* src/chown.c: Make chopt_free() actually deallocate, but
+	only call in dev mode.
+	* src/chgrp.c: Likewise.
+
+	doc: improve formatting of nl --help
+	* src/nl.c (usage): Better delineate the information.
+
+2018-05-14  Paul Eggert  <eggert@cs.ucla.edu>
+
+	who: simplify port to GCC 8
+	* src/who.c (make_id_equals_comment): Use simpler workaround
+	for GCC bug 85602.  Suggested by Martin Sebor in:
+	https://gcc.gnu.org/bugzilla/show_bug.cgi?id=85602#c3
+
+2018-05-04  Pádraig Brady  <P@draigBrady.com>
+
+	build: make GCC 8 adjustments more portable
+	* src/chown-core.h (chopt_free): Just define away this noop.
+	* src/chown-core.c (chopt_free): Remove the empty implementation.
+
+2018-05-04  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+2018-05-03  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: port to GCC 8
+	* src/chown-core.h (chopt_free, gid_to_name, uid_to_name):
+	No longer const.
+	* src/make-prime-list.c (xalloc): Add malloc attribute.
+	* src/who.c (make_id_equals_comment): Work around GCC bug 85602
+	by using mempcpy rather than strncat.  Although the old code
+	was correct, strncat raises so many hackles that it’s not
+	worth maintaining its use here.
+
+	maint: remove strpbrk module
+	* bootstrap.conf (gnulib_modules): Remove obsolete module strpbrk.
+
+	build: update gnulib submodule to latest
+
+2018-04-21  Pádraig Brady  <P@draigBrady.com>
+
+	doc: retroactively adjust info about tail and closed output
+	* NEWS: Expand on the 8.28 description of how tail more
+	responsively reacts to closed output, and move from "Improvements"
+	to "Changed behavior".
+	* cfg.mk (old_NEWS_hash): Regenerate.
+	Fixes https://bugs.gnu.org/31225
+
+2018-04-19  Pádraig Brady  <P@draigBrady.com>
+
+	doc: timeout --help: mention 0 DURATION disables timeout
+	* src/timeout.c (usage): Mention that a duration of 0 disables
+	the associated timeout, which is both concise info and useful
+	functionality as timeouts are frequently configured.
+
+2018-04-06  Eric Blake  <eblake@redhat.com>
+
+	doc: retroactively document -e/-u addition in NEWS
+	Prompted by https://bugs.gnu.org/31045
+
+	* NEWS: Update 8.8 blurb to mention other split additions.
+	* cfg.mk (old_NEWS_hash): Regenerate.
+
+2018-04-03  Paul Eggert  <eggert@cs.ucla.edu>
+
+	doc: Clarify octal bits in permissions
+	* doc/perm.texi (Numeric Modes): Briefly explain octal.
+	Reorder description to make it more intuitive (Bug#29069).
+
+2018-03-28  Tobias Stoeckmann  <tobias@stoeckmann.org>
+
+	cut: improve large file support on 32 bit
+	Increase max range from SIZE_MAX to UINTMAX_MAX, which will
+	allow cut to support line lengths up to the max file size
+	on all systems. The inherent SIZE_MAX limitation in cut was
+	removed with the enhancements in https://bugs.gnu.org/13127.
+	Also numfmt gets similarly increased --field ranges due to
+	shared code.
+
+	* src/cut.c: s/size_t/uintmax_t/.
+	* src/numfmt.c: Likewise.
+	* src/set-fields.c: Likewise.
+	* src/set-fields.h: Likewise.
+	* tests/misc/cut-huge-range.sh: Adjust accordingly.
+	* tests/misc/numfmt.pl: Likewise.
+	* NEWS: Mention the improvement.
+
+2018-03-28  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid a recent syntax-check failure
+	* tests/ls/a-option.sh: s/framework_failure/&_/.
+
+2018-03-27  Paul Eggert  <eggert@cs.ucla.edu>
+
+	ls: -A now overrides -a
+	Problem reported by Karl Berry (Bug#30963).
+	* NEWS: Mention this.
+	* src/ls.c (decode_switches): Implement this.
+	* tests/ls/a-option.sh: New file.
+	* tests/local.mk (all_tests): Add it.
+
+2018-03-24  Roland Hieber  <rohieb@rohieb.name>
+
+	doc: fix two typos in github templates
+	* .github/ISSUE_TEMPLATE.txt: Fix typo "coreitils" in the URL to the bug
+	tracker.
+	* .github/PULL_REQUEST_TEMPLATE.txt: Likewise.
+
+2018-03-16  Pádraig Brady  <P@draigBrady.com>
+
+	ls: increase the allowed abmon width from 5 to 12
+	This will impact relatively few languages,
+	and will make Arabic or Catalan etc.
+	output unambiguous abbreviated month names.
+
+	* src/ls.c (MAX_MON_WIDTH): Increase from 5 to 12.
+	* NEWS: Mention the bug fix.
+	* tests/ls/abmon-align.sh: Augment to check for ambiguous output.
+	Fixes https://bugs.gnu.org/30814
+
+2018-03-14  Brent Petit  <brent.petit@hpe.com>
+
+	stat,tail: add support for the EXFS file system
+	Enhanced XFS (EXFS) is a version of XFS maintained by HPE.
+	EXFS uses a unique magic number to allow the use of community
+	XFS, and EXFS filesystems at the same time.
+
+	* src/stat.c (human_fstype): Add file system ID definition,
+	and use "exfs" as the name.
+	* NEWS: Mention the Improvement.
+
+2018-03-06  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+2018-03-05  Paul Eggert  <eggert@cs.ucla.edu>
+
+	stat: work around IBM xlC bug
+	Problem reported by John Wiersba (Bug#30718)
+	* src/stat.c (human_time): Avoid giving an integer constant
+	expression a name, as it runs afoul of a bug in IBM XL C/C++ for
+	AIX 12.01.0000.0002.
+
+2018-03-04  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: adjust email address of Keith Thompson in THANKS.in
+	* THANKS.in (Keith Thompson): Update email address as requested by
+	himself at https://lists.gnu.org/r/coreutils/2018-03/msg00004.html
+
+2018-02-25  Pádraig Brady  <P@draigBrady.com>
+
+	cp: set appropriate default permissions for special files
+	This issue was introduced in commit v8.19-145-g24ebca6
+
+	* src/copy.c (copy_internal): When setting default permissions
+	to use with --no-preserve=mode, only set executable bits for
+	directories or sockets.
+	* NEWS: Mention the fix.
+	* tests/cp/preserve-mode.sh: Add a test case.
+	Fixes https://bugs.gnu.org/30534
+
+2018-01-21  Pádraig Brady  <P@draigBrady.com>
+
+	doc: use consistent example format in manual
+	* doc/coreutils.texi: Use @example consistently
+	as we don't need the smaller or fixed width representation.
+	This is especially true for the synopsis of commands.
+	@smallexample is rendered left aligned for HTML
+	which is awkward to read with the center aligned main content.
+
+2018-01-10  Paul Eggert  <eggert@cs.ucla.edu>
+
+	mv: clarify ‘mv -n A A’ change
+
+	mv: fewer syscalls for ‘mv a b’
+	This builds on a previous patch for mv atomicity (Bug#29961).
+	It merely improves performance; it does not fix bugs.
+	* src/copy.h (struct cp_options): New members last_file, rename_errno.
+	* src/copy.c (copy_internal): Support new rename_errno member
+	for the copy options.  Avoid calling stat when new members
+	suggest it’s not needed.
+	(cp_options_default): Initialize new members.
+	* src/mv.c: Include renameat2.h.
+	(main): With two arguments, first call ‘renamat2 (AT_FDCWD, "a",
+	AT_FDCWD, "b", RENAME_NOREPLACE)’.  Use its results to skip
+	remaining processing if possible; for example, if it succeeds
+	there is no need to stat either "a" or "b".  Also, set
+	x.last_file when it is the last file to rename.
+
+	mv: improve -n atomicity
+	Problem reported by Kamil Dudka (Bug#29961).
+	* NEWS: Mention this.
+	* src/copy.c: Include renameat2.h.
+	(copy_internal): If mv, try renameat2 first thing, with
+	RENAME_NOREPLACE.  If this works, skip most of the remaining code.
+	Also, fail quickly if it fails with EEXIST, and we are using -n.
+
+2018-01-10  Michael Orlitzky  <michael@orlitzky.com>
+
+	doc: warn about following symlinks recursively in chown/chgrp
+	In both chown and chgrp (which shares its code with chown), operating
+	on symlinks recursively has a window of vulnerability where the
+	destination user or group can change the target of the operation.
+	Warn about combining the --dereference, --recursive, and -L flags.
+
+	* doc/coreutils.texi (warnOptDerefWithRec): Add macro.
+	(node chown invocation): Add it to --dereference and -L.
+	(node chgrp invocation): Likewise.
+
+	See also: CVE-2017-18018
+
+2018-01-06  Paul Eggert  <eggert@cs.ucla.edu>
+
+	cp: remove ASSIGN_BASENAME_STRDUPA
+	* src/cp.c (do_copy): Just use ASSIGN_STRDUPA, as this simplifies
+	the code and uses less memory.
+
+2018-01-04  Paul Eggert  <eggert@cs.ucla.edu>
+
+	mv: -n overrides -u
+	* NEWS: Mention these fixes.
+	* doc/coreutils.texi (cp invocation, mv invocation):
+	Mention that -n is silent, and that it overrides -u.
+	* src/cp.c, src/mv.c (main): -n overrides -u.
+
+2018-01-03  Paul Eggert  <eggert@cs.ucla.edu>
+
+	tr: add -A, for compatibility with AIX tr
+	Problem reported by Michael (Bug#29946).
+	* src/tr.c (main): Add undocumented -A option.
+
+2018-01-03  Michael Orlitzky  <michael@orlitzky.com>
+
+	doc: clarify chown/chgrp --dereference defaults
+	* doc/coreutils.texi: the documentation for the --dereference
+	  flag of chown/chgrp states that it is the default mode of
+	  operation. Document that this is only the case when operating
+	  non-recursively.
+
+2018-01-02  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid false failure with xargs on AIX
+	* tests/misc/shred-remove.sh: AIX xargs defaults to using
+	'_' to indicate end of input, thus ignoring it.
+	Rather than specifying -E to avoid this behavior, simplify
+	by removing sed and xargs usage.
+
+2018-01-01  Pádraig Brady  <P@draigBrady.com>
+
+	maint: update all copyright year number ranges
+	Run "make update-copyright" and then...
+
+	* gnulib: Update to latest with copyright year adjusted.
+	* tests/init.sh: Sync with gnulib to pick up copyright year.
+	* bootstrap: Likewise.
+	* tests/sample-test: Adjust to use the single most recent year.
+
+2017-12-27  Pádraig Brady  <P@draigBrady.com>
+
+	maint: post-release administrivia
+	* NEWS: Add header line for next release.
+	* .prev-version: Record previous version.
+	* cfg.mk (old_NEWS_hash): Auto-update.
+
+	version 8.29
+	* NEWS: Record release date.
+
+2017-12-23  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid false failure on AIX 7.2
+	* tests/tail-2/pipe-f.sh: Close stdout in a subshell
+	to ensure the current shell isn't impacted.  Subsequent
+	piped commands like `echo foo | blah` were seen to fail
+	due to the previous closing of stdout.
+	Reported by Assaf Gordon.
+
+	doc: describe recent build checks for 32 bit time_t
+	* README: Document the new handling of 32 bit time_t,
+	with examples of how to build in 64 bit mode on AIX.
+	Also mention that GNU make is desired on AIX
+	due to its mishandling of the "[" target.
+	Suggested by Assaf Gordon.
+
+2017-12-21  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix recent portability issues on solaris 10
+	* tests/misc/ptx.pl: Escape the '^' character which is
+	otherwise considered as a line continuation character.
+	* tests/misc/shred-remove.sh: sed doesn't support \n.
+
+	maint: remove reference to excluded changelog item
+	* build-aux/git-log-fix: Remove old entry.
+
+2017-12-20  Pádraig Brady  <P@draigBrady.com>
+
+	maint: add doc/coverage to .gitignore
+	* .gitignore: Ignore the generated coverage report.
+
+	doc: remove older ChangeLog items
+	* Makefile.am: Update the oldest documented version
+	to 8.20 which is now about 5 years old.
+
+2017-12-18  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: mention which privileges are needed to chmod
+	POSIX specification for chmod(1):
+	https://pubs.opengroup.org/onlinepubs/9699919799/utilities/chmod.html
+
+	* doc/coreutils.texi (chmod invocation): Add a sentence about who can
+	change the file mode bits of a file - (almost) a copy from what POSIX
+	requires.
+
+	Fixes https://bugs.gnu.org/29207.
+
+2017-12-16  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix recent regressions with dash
+	* tests/misc/timeout.sh: dash outputs the "Killed"
+	message to stderr rather than the terminal.
+	* tests/misc/usage_vs_getopt.sh: dash doesn't yet
+	support the POSIX proposed $'...' shell quoting syntax.
+
+	build: avoid a signed overflow warning in ptx
+	* src/ptx.c (fix_output_parameters): GCC 6.3.1 with
+	./configure --enable-single-binary would give:
+	  error: assuming signed overflow does not occur
+	  when simplifying conditional to constant [-Werror=strict-overflow]
+	    if (file_index > 0)
+	So change the type of file_index to signed (size_t).
+
+2017-12-11  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: adjust for the renamed nstrfime gnulib module
+	* bootstrap.conf: s/strftime/nstrfrime/.
+
+2017-12-11  Pádraig Brady  <P@draigBrady.com>
+
+	build: update gnulib submodule to latest
+	* gnulib: Update with various build/test fixes.
+
+	tests: fix false failure in new dd/nocache_eof test
+	* test/dd/nocache_eof.sh: Also handle fadvise64_64 which is
+	used on 32 bit x86.  Note strace internally maps fadvise64_64
+	to {arm,xtensa}_fadvise64_64.
+
+	tail: fix tailing non seekable files on certain systems
+	* src/tail.c (tail_bytes): On systems were blksize_t is unsigned
+	and the same size or wider than off_t (android for example),
+	our initialized (off_t) -1 would be promoted to unsigned before
+	comparison, and thus fail to follow the appropriate path.
+	* tests/tail-2/tail-c.sh: Add a test case.
+	* NEWS: Mention the fix.
+	This issue was introduced in commit v8.23-47-g2662702
+	Reported at https://github.com/termux/termux-app/issues/233
+
+	build: avoid build failure without sys/mtio.h
+	* m4/jm-macros.m4: Check for the header.
+	* src/dd.c: Avoid the workaround where the header
+	is not available (on non glibc systems).
+	* src/shred.c: Likewise.
+
+	doc: reorganize ls -k and --time-style help
+	* src/ls.c (usage): Clarify -k only applies to -s usage
+	and directory 'total' lines.  Move the description
+	of TIME_STYLE out of the option section as it was awkward
+	to read and write there within 80 columns.
+
+2017-12-10  Pádraig Brady  <P@draigBrady.com>
+
+	doc: clarify numeric setuid handling in chmod man page
+	* man/chmod.x: Update the information to state one can
+	clear the setuid and setgid bits for directories numerically
+	using an additional leading '0' or a leading '='.
+	That has been supported since v8.15-64-g8931cdb.
+	Fixes https://bugs.gnu.org/29390
+
+	doc: shred: change 'truncate' to the more descriptive 'deallocate'
+	* doc/coreutils.texi (shred invocation): s/truncate/deallocate/.
+	* src/shred.c (usage): Likewise.
+	Fixes https://bugs.gnu.org/29317
+
+	doc: clarify that cp --force may recreate files
+	* doc/coreutils.texi (cp invocation): The language used
+	to describe recreating the file was a little confusing
+	as it mentioned opening a removed file.
+	Fixes https://bugs.gnu.org/29315
+
+2017-12-04  Kamil Dudka  <kdudka@redhat.com>
+
+	doc: fix default QUOTING_STYLE for %N format of stat(1)
+	* doc/coreutils.texi (stat invocation): The default value
+	of QUOTING_STYLE for the %N format of 'stat --printf' is
+	'shell-escape-always'.
+	Fixes https://bugs.gnu.org/29563
+	Reported by Christian Groessler at
+	https://bugzilla.redhat.com/1520399#c3
+
+2017-12-02  Jean Delvare  <jdelvare@suse.de>
+
+	tests: make ls/block-size more readable
+	* tests/ls/block-size.sh: The output of the test was hard to read. Add
+	comments saying what we are testing to make it easier to understand.
+
+2017-11-29  Bernhard Voelker  <mail@bernhard-voelker.de>
+	    Pádraig Brady  <P@draigBrady.com>
+
+	tests: verify usage vs. getopt
+	Verify that all options mentioned in usage are actually recognized
+	by the program.
+
+	* tests/misc/usage_vs_getopt.sh: Add test.
+	* tests/local.mk (all_tests): Reference it.
+
+2017-11-29  Pádraig Brady  <P@draigBrady.com>
+
+	readlink: remove superfluous comma from usage output
+	* src/readlink.c (usage): Remove ',' after --quiet option.
+
+2017-11-29  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	all: use consistent diagnostics for unknown long options
+	Previously, e.g. cksum failed to output the offending unknown long
+	option:
+	  $ cksum --unknown-opt
+	  cksum: invalid option -- '-'
+	  Try 'cksum --help' for more information.
+	i.e., it tried to diagnose '-' as short option.
+	Instead, it should diagnose the unknown long option:
+	  $ cksum --unknown-opt
+	  cksum: unrecognized option '--unknown-opt'
+	  Try 'cksum --help' for more information.
+
+	* src/cksum.c (long_options): Add struct with null entry only.
+	(main): Use it in the getopt_long call.
+	* src/dd.c: Likewise.
+	* src/hostid.c: Likewise.
+	* src/hostname.c: Likewise.
+	* src/link.c: Likewise.
+	* src/logname.c: Likewise.
+	* src/nohup.c: Likewise.
+	* src/sleep.c: Likewise.
+	* src/tsort.c: Likewise.
+	* src/unlink.c: Likewise.
+	* src/uptime.c: Likewise.
+	* src/users.c: Likewise.
+	* src/whoami.c: Likewise.
+	* src/yes.c: Likewise.
+	* NEWS (Improvements): Mention the fix.
+
+2017-11-29  Pádraig Brady  <P@draigBrady.com>
+
+	test: fix issues with tests/cp/preserve-mode.sh
+	* tests/cp/preserve-mode.sh: This was the only use of awk,
+	which may not be available on the system resulting
+	in an ineffective test.  Also the permissions bits for
+	directories were not being checked at all.
+
+	build: update gnulib submodule to latest
+	* gnulib: Update with various build/test fixes.
+
+2017-11-28  Pádraig Brady  <P@draigBrady.com>
+
+	build: update gnulib submodule to latest
+	* gnulib: Update including various build fixes.
+
+2017-11-27  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	timeout: also support short -v option
+	* src/timeout.c (main): Add short option character 'v' to getopt_long
+	call.
+	* tests/misc/timeout.sh: Run the test both for the long and the short
+	option.
+
+2017-11-25  Pádraig Brady  <P@draigBrady.com>
+
+	dd: support iflag=direct with arbitrary sized files
+	* src/dd.c (iread): Handle read error with a non-aligned
+	file offset in the O_DIRECT case.  This is not an issue
+	on XFS at least, but on EXT4 the final read will return
+	EINVAL rather than the expected 0 to indicate EOF.
+	* tests/dd/direct.sh: Test the iflag=direct case also.
+	* NEWS: Mention the improvement.
+
+2017-11-24  Pádraig Brady  <P@draigBrady.com>
+
+	timeout: add --verbose to diagnose timeouts
+	This is useful as handling in shell is complicated
+	with the varying exit status in the --kill-after case.
+
+	* src/timeout.c (main): Handle '-v' and store
+	COMMAND for the diagnostic.
+	(cleanup): Diagnose the signal name before sending.
+	(usage): Document -v, --verbose.
+	* doc/coreutils.texi (timeout invocation): Likewise.
+	* tests/misc/timeout.sh: Add a test case.
+	* NEWS: Mention the new feature
+	Fixes https://bugs.gnu.org/21760
+
+2017-11-19  Pádraig Brady  <P@draigBrady.com>
+
+	tail: seek to the end of block devices
+	* src/tail.c (tail_bytes): Try lseek(..., SEEK_END) when
+	we can't determine the file size.
+	* tests/tail-2/end-of-device.sh: Add a new root only test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the improvement.
+	Paul Eggert suggested using lseek() (rather than ioctl(BLKGETSIZE64)).
+	Fixes https://bugs.gnu.org/29259
+
+2017-11-14  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: include the module year2038 from gnulib
+	* bootstrap.conf (gnulib_modules): Add 'year2038' to ensure that time_t
+	is 64-bit (and thus works after 2038).
+
+	Suggested by Bruno Haible in
+	https://lists.gnu.org/r/bug-gnulib/2017-11/msg00022.html
+
+2017-11-14  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	maint: update gnulib to latest
+	* gnulib: Update - mainly for the recent year2038 changes.
+	* tests/init.sh: Update from gnulib/tests/init.sh.
+
+2017-11-09  Assaf Gordon  <assafgordon@gmail.com>
+
+	doc: add github issue/pull-request templates
+	These templates instruct contributors not to use github, and instead
+	use the upstream GNU development resources. Discussed in
+	http://lists.gnu.org/archive/html/coreutils/2017-11/msg00007.html .
+
+	* .github/ISSUE_TEMPLATE.txt,
+	  .github/PULL_REQUEST_TEMPLATE.txt: New files.
+
+2017-11-08  Jim Meyering  <meyering@fb.com>
+
+	maint: make hook script reject "/archive/html" in lists.gnu.org URLS
+	* scripts/git-hooks/commit-msg: Require the abbreviated "/r/"
+	form in any log message URL.
+
+	maint: shorten https://lists.gnu.org/archive/html/... links
+	Each /archive/html/ part can be replace with /r/.
+	Run this to induce the change:
+	git grep -l archive/html|xargs perl -pi -e 's,/archive/html/,/r/,g'
+	* TODO: Perform that substitution.
+	* bootstrap: Likewise.
+	* src/sort.c (sequential_sort): Likewise.
+	* src/tail.c (tail_file): Likewise.
+	* tests/misc/sort-merge-fdlimit.sh: Likewise.
+	* tests/misc/stty-row-col.sh: Likewise.
+	* tests/misc/unexpand.pl: Likewise.
+	* tests/rm/readdir-bug.sh: Likewise.
+	* tests/tail-2/inotify-rotate.sh: Likewise.
+
+2017-11-07  Thomas Deutschmann  <whissi@gentoo.org>
+
+	tests: avoid false failure with inaccessible mount points
+	* tests/ls/readdir-mountpoint-inode.sh: Skip the test
+	if any mount points are inaccessible by the current user.
+	Fixes https://bugs.gnu.org/29167
+	Reported at: https://bugs.gentoo.org/353164
+
+2017-11-06  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	doc: fix "Up" field of realpath usage examples
+	Older versions of 'makeinfo' choke on a missing reference:
+
+	  ./doc/coreutils.texi:14177: `Realpath usage examples' has no Up field\
+	  (perhaps incorrect sectioning?).
+	  makeinfo: Removing output file `doc/coreutils.info' due to errors; \
+	  use --force to preserve.
+
+	* doc/coreutils.texi (realpath invocation): Add a menu referencing
+	the usage examples - introduced in v8.27-91-g7449f0d.
+
+2017-11-06  Pádraig Brady  <P@draigBrady.com>
+
+	maint: ensure https:// URLs are used in --help and man pages
+	* configure.ac(AC_INIT): Specify the URL explicitly, so we're
+	not dependent on unreleased autoconf.
+
+2017-10-31  Assaf Gordon  <assafgordon@gmail.com>
+
+	stat: output default formats for --terse in usage
+	Suggested by L A Walsh in https://bugs.gnu.org/28763 .
+
+	* src/stat.c (fmt_terse_fs): Define format for --terse -f here.
+	(fmt_terse_regular): Define format for --terse here.
+	(fmt_terse_selinux): Likewise for when SELinux is enabled.
+	(default_format): Use the above constants.
+	(usage): Output the formats for the terse modes.
+
+2017-10-30  Pádraig Brady  <P@draigBrady.com>
+
+	df: fix hang with fifo argument
+	* src/df.c (main): stat() before open(), and avoid
+	the optional open when given a fifo argument.
+	* tests/df/unreadable.sh: Add a test case.
+	* NEWS: Mention the fix.
+	Fixes https://bugs.gnu.org/29038
+
+2017-10-28  Jim Meyering  <meyering@fb.com>
+
+	build: ls.c: apply _GL_ATTRIBUTE_PURE to more functions
+	* src/ls.c (DEFINE_SORT_FUNCTIONS): Apply _GL_ATTRIBUTE_PURE
+	to each strcmp-derived function definition, since GCC8 with
+	-Wsuggest-attribute=pure now warns it is needed.
+
+2017-10-26  Vincent Lefevre  <vincent@vinc17.net>
+
+	doc: reference statfs(2) in the stat(1) man page
+	* man/stat.x (SEE ALSO): Mention statfs(2) in addition to stat(2).
+	Note statfs() is generally used rather than statvfs(),
+	so we'll defer that reference to the SEE ALSO section of statfs(2).
+	Fixes https://bugs.gnu.org/28989
+
+2017-10-25  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid false failure when O_DIRECT isn't supported
+	* tests/dd/nocache_eof.sh: Only run the O_DIRECT tests
+	when 512 byte alignment is supported.  Otherwise with older
+	XFS on systems with > 1MiB pages, or on file systems not
+	supporting O_DIRECT, there would have been false failures.
+	* tests/dd/direct.sh: Clarify the skip message.
+
+2017-10-25  Pádraig Brady  <P@draigBrady.com>
+
+	dd: fix nocache regions passed to posix_fadvise()
+	Previously with oflag=direct the call to invalidate_cache()
+	was not passed to the kernel, as it was less than a page size,
+	and a subsequent call was not made to invalidate the pending space.
+	Similarly with oflag=nocache the pending space at EOF was
+	not invalidated.  Even though these amount to only a single page
+	in the page cache it can be significant.  For example on
+	XFS before kernel patch v4.9-rc1-4-g0ee7a3f, O_DIRECT files
+	would have been read inefficiently if any pages were cached,
+	even if they were already synced to storage.
+
+	* src/dd.c (i_nocache_eof, o_nocache_eof): New bools used
+	to control when we want invalidate_cache(,0) to clear to EOF.
+	(cache_round): Use IO_BUFSIZE (currently 132KiB) to minimize
+	calls to the relatively expensive advise function, rather
+	than page_size.  This also makes it clear that while the
+	kernel function operates on pages, this size is chosen for
+	performance reasons.
+	(invalidate_cache): Refactor to share more code between
+	input and output paths. Use i_nocache_eof and o_nocache_eof
+	rather than proxying off max_records.  Ensure we
+	invalidate full pages when clearing to EOF as the kernel
+	will ignore any non complete pages.  Fix the offset used
+	for the output path.
+	(dd_copy): Invalidate the cache of the input after the
+	offset is updated, for consistency and so we don't try to
+	invalidate before the start of the file.  When we read
+	EOF on input, set flags so that we invalidate to EOF.
+	(main): Invalidate to EOF in more cases, by depending
+	on the i_nocache_eof and o_nocache_eof flags.
+	* doc/coreutils.texi (dd invocation): Clarify the alignment
+	and persisted caveats on the example applying "nocache"
+	to part of a file.
+	* tests/dd/nocache_eof.sh: A new test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the bug fix.
+	Issue reported by Eric Bergen.
+
+2017-10-24  Michael Stone  <mstone@debian.org>
+
+	doc: mention QUOTING_STYLE env var in ls man page
+	* src/ls.c (usage): Mention QUOTING_STYLE with the --quoting-style
+	option, and indicate it has lower precedence than that option.
+
+2017-10-24  Pádraig Brady  <P@draigBrady.com>
+
+	maint: apply suggested cleanup to recent stty.c change
+	This should have been part of commit v8.28-17-gf926f7c
+	* src/stty.c (check_argument): Align line continuation chars,
+	and ensure the function macro is immune to usage with if/else.
+	Suggested by Jim Meyering and Paul Eggert.
+
+	b2sum: fix crash with --check and truncated input
+	* src/md5sum.c (split_3): Ensure we don't walk off
+	the end of the string.
+	* tests/misc/b2sum.sh: Add test cases.
+	Fixes https://bugs.gnu.org/28860
+
+2017-10-24  Pádraig Brady  <P@draigBrady.com>
+
+	stty: fix processing of options when -F is specified
+	This was a latent issue that became significant with
+	the addition of the -F option in FILEUTILS-3_16n-56-ge46a424
+
+	* src/stty.c (apply_settings): Refactor argument checking
+	to a function macro.  Augment the argument check to ignore
+	NULLed out arguments (already processed -F).
+	* NEWS: Mention the fix.
+	* tests/misc/stty-invalid.sh: Add a test case.
+	Fixes https://bugs.gnu.org/28859
+
+2017-10-24  Pádraig Brady  <P@draigBrady.com>
+
+	timeout: fix a small race that would ignore command exit
+	This fixes a regression from commit v8.26-39-g2f69dba
+
+	* src/timeout.c (block_cleanup_and_chld): Rename from block_cleanup
+	to indicate we also block SIGCHLD to avoid the race where SIGCHLD
+	fires between waitpid() polling and sigsuspend() waiting for a signal.
+	* NEWS: Mention the fix.
+
+2017-10-24  Thomas Jarosch  <thomas.jarosch@intra2net.com>
+
+	timeout: fix regression when invoked with blocked SIGCHLD
+	We inherit the signal mask from our parent process,
+	therefore ensure SIGCHLD is not blocked.
+
+	If SIGCHLD is blocked, sigsuspend() won't be interrupted
+	when the child process exits and we hang until the timeout (SIGALRM).
+
+	This fixes a regression from commit v8.26-39-g2f69dba
+
+	* src/timeout.c (install_sigchld): Ensure SIGCHLD is unblocked.
+	* NEWS: Mention the issue.
+
+2017-10-02  Pádraig Brady  <P@draigBrady.com>
+
+	build: reinstate distribution of man pages
+	man pages change little between systems,
+	so falling back to distributed pages make sense
+	when cross compiling or lacking perl.
+
+	* man/local.mk: Add all man pages to EXTRA_DIST
+	so that they're distributed in the generated tarball.
+	Use the dummy-man page generator if cross compiling.
+	Set TZ to avoid a distcheck failure where man pages
+	used a diffent month than those rebuilt (with a .timestamp).
+	* man/dummy-man: Only fall back to generating a stub
+	if copying an existing man page fails.
+	* man/help2man: Sync portable TZ=UTC0 specification
+	from upstream help2man.
+	* NEWS: Mention the build-related change.
+	Fixes https://bugs.gnu.org/28574
+
+2017-10-02  Pádraig Brady  <P@draigBrady.com>
+
+	maint: remove a duplicate entry from THANKS
+	* .mailmap: Prefer Colin Watson's last used email address.
+
+2017-09-25  Paul Eggert  <eggert@cs.ucla.edu>
+
+	copy: revert recent patch for vulnerable dirs
+	I plan to propose a better patch to catch vulnerable parent
+	directories.
+	* NEWS, doc/coreutils.texi (Target directory): Document this.
+	* src/cp.c, src/install.c, src/ln.c, src/mv.c:
+	Do not include targetdir.h.
+	(target_directory_operand): Remove test for vulnerable parents.
+	* src/cp.c (stat_target_operand): Remove.  All uses removed.
+	* src/local.mk (noinst_HEADERS): Remove src/targetdir.h.
+	(src_ginstall_SOURCES, src_cp_SOURCES, src_ln_SOURCES)
+	(src_mv_SOURCES): Remove src/targetdir.c.
+	* src/targetdir.c, src/targetdir.h: Remove.
+	* tests/mv/vulnerable-target.sh: Remove.
+	* tests/local.mk (all_root_tests): Remove it.
+
+2017-09-24  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix test hang on case insenitive file systems
+	* tests/split/filter.sh: Due to an invalid 'FILE = zero.in'
+	construct trying to initialize a FILE variable, it would
+	instead try to run the FILE command which is present on
+	macOS 10.13 with APFS.
+	We also remove a redundant duplicate test clause introduced
+	during a rebase, and simplify the piped timeout command,
+	to avoid requiring a subshell and associated quoting.
+	* THANKS.in: Add the reporter Jack Howarth.
+	Fixes https://bugs.gnu.org/28506
+
+2017-09-21  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid a false failure in expr test with UTF8
+	* tests/misc/expr.pl: Skip the quote varying tests in
+	the multi-byte locales as these tests aren't that interesting
+	in those locales.  Also ERR_SUBST is already defined for
+	some tests so awkward to redefine to munge UTF8 quotes to ASCII.
+
+2017-09-20  Assaf Gordon  <assafgordon@gmail.com>
+
+	expr: add detailed syntax error messages
+	Show offending argument instead of a generic 'syntax error' message.
+	Suggested by Bernhard Voelker in https://bugs.gnu.org/28461#13 .
+
+	* src/expr.c (syntax_error): Remove.
+	(required_more_args): New function.
+	(eval7, main): Replace syntax_error call with detailed die message.
+	* tests/misc/expr.pl: Add tests for new messages.
+
+2017-09-20  Pádraig Brady  <P@draigBrady.com>
+
+	maint: fix new syntax-check failures from HTTPS adjustments
+	* cfg.mk [old_NEWS_hash]: update with `make update-NEWS-hash`.
+	[sc_long_lines]: Avoid flagging (long) URLs in NEWS.
+	* src/sort.c: Tweak to a shorter line.
+	* src/tail.c: Likewise.
+	Introduced in v8.28-4-gbe87d61
+
+	maint: fix new syntax check failures from copy restrictions
+	* doc/coreutils.texi: Remove doubled word.
+	* src/targetdir.c: Explicitly mark exported function.
+	* tests/local.mk: This is not a root only test.
+	* tests/mv/vulnerable-target.sh: Use returns_.
+	Introduced in v8.28-3-g44ccd1c
+
+	shred: reinstate --remove file name length obfuscation
+	This was unintentionally removed in v8.27-60-g2ae1460
+	* src/shred.c (wipename): Interate through all name lengths.
+	* tests/misc/shred-remove.sh: Add test cases.
+	* NEWS: Mention the bug fix.
+	Fixes https://bugs.gnu.org/28507
+
+2017-09-19  Paul Eggert  <eggert@cs.ucla.edu>
+
+	maint: copy bootstrap from Gnulib
+
+	all: prefer HTTPS in URLs
+
+	copy: check for vulnerable target dirs
+	* NEWS, doc/coreutils.texi (Target directory): Document this.
+	* src/cp.c, src/install.c, src/ln.c, src/mv.c: Include targetdir.h.
+	(target_directory_operand): Use the new targetdir_operand_type
+	function to check for vulnerable target directories.
+	* src/cp.c (stat_target_operand): New function.
+	(target_directory_operand, do_copy): Use it.
+	* src/local.mk (noinst_HEADERS): Add src/targetdir.h.
+	(src_ginstall_SOURCES, src_cp_SOURCES, src_ln_SOURCES)
+	(src_mv_SOURCES): Add src/targetdir.c.
+	* src/targetdir.c, src/targetdir.h: New files.
+	* tests/mv/vulnerable-target.sh: New test.
+	* tests/local.mk (all_root_tests): Add it.
+
+2017-09-14  Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	ptx: avoid infloop due to zero-length matches with -S regex
+	* src/ptx.c (find_occurs_in_text): Die with an appropriate error
+	diagnostic when the given regular expression returns a match of
+	length 0.
+	* tests/misc/ptx.pl (S-infloop): Add a test.
+	* NEWS (Bug fixes): Mention the fix.
+
+	Fixes https://bugs.gnu.org/28417 which was detected using
+	Symbolic Execution techniques developed in the course of the
+	SYMBIOSYS research project at COMSYS, RWTH Aachen University.
+
+2017-09-02  Pádraig Brady  <P@draigBrady.com>
+
+	maint: post-release administrivia
+	* NEWS: Add header line for next release.
+	* .prev-version: Record previous version.
+	* cfg.mk (old_NEWS_hash): Auto-update.
+
+	version 8.28
+	* NEWS: Record release date.
+
+2017-09-01  Pádraig Brady  <P@draigBrady.com>
+
+	tests: fix false failure in recent ls --hyperlink test
+	* tests/ls/hyperlink.sh: If the hostname or any part of
+	the absolute path would be changed due to URL encoding,
+	the test would fail.  Therefore simplify to remove
+	these components of the URL from consideration.
+
+	maint: avoid a syntax-check failure
+	* .gitignore: Remove lines indicated by sc_gitignore_redundant
+	in a freshly checked out repo.
+
+2017-08-31  Pádraig Brady  <P@draigBrady.com>
+
+	tests: exclude the expensive gnulib fts-tests
+	* gnulib: The only change in this gnulib update
+	is the tagging of the fts-tests module as longrunning,
+	which gnulib-tool currently implicitly excludes.
+	This test was seen to take about 20s and 285MB.
+	Reported by Assaf Gordon on space restricted VMs.
+
+	tty: don't distinguish input errors
+	* src/tty.c (main): Don't distinguish ENOTTY from other errors,
+	because isatty() doesn't portably distinguish errors.
+	Solaris returns ENOENT for all input errors for example.
+	Musl also returns ENOENT, and ENODEV may be returned as disscussed at:
+	http://openwall.com/lists/musl/2017/04/06/6
+	* tests/misc/tty.sh: Adjust accordingly.
+
+	tests: avoid printf '0*d' construct unsupported by ash
+	* tests/ln/sf-1.sh: Generate specific length with space padding
+	which is supported.
+	Reported by Assaf Gordon on Alpine Linux.
+
+2017-08-31  Pádraig Brady  <P@draigBrady.com>
+
+	tests: skip tests upon failure to set SELinux context
+	On some setups the root:object_r:tmp_t context is invalid.
+	This does indicate a limitation in the test framework,
+	but for now we'll relax this to skipping the tests.
+	The tests still run on a Fedora 25 system for example.
+
+	* tests/cp/cp-a-selinux.sh: Upon chcon error, skip rather than ERROR.
+	* tests/install/install-Z-selinux.sh: Likewise.
+	* tests/misc/chcon.sh: Likewise.
+	* tests/misc/runcon-no-reorder.sh: Likewise.
+	* tests/misc/selinux.sh: Likewise.
+	* tests/mkdir/restorecon.sh: Likewise.
+
+2017-08-30  Kamil Dudka  <kdudka@redhat.com>
+
+	expr: fix a recently introduced memory leak
+	* src/expr.c (eval6): Free memory allocated by mbs_logical_substr().
+
+	Introduced in v8.27-47-ga9f2be5.  Detected by Coverity Analysis:
+
+	Error: RESOURCE_LEAK:
+	src/expr.c:851: leaked_storage: Variable "s" going out of scope
+	leaks the storage it points to.
+	849|             char *s = mbs_logical_substr (l->u.s, pos, len);
+	850|             v = str_value (s);
+	851|->         }
+	852|         freev (l);
+	853|         freev (i1);
+
+2017-08-30  Pádraig Brady  <P@draigBrady.com>
+
+	build: fix build of renameat2 on Alpine Linux
+	* gnulib: The only change included in this update
+	it the added check for the presence of <linux/fs.h>
+	which is not present on Alpine Linux by default.
+
+	tty: fix exit code with EINVAL
+	* src/tty.c (main): All systems mention that isatty()
+	man return EINVAL as well as (the POSIX compliant) ENOTTY.
+	Also Centos 6 was seen to return EINVAL from ttyname().
+	* tests/misc/tty.sh: Fix a test issue where we assume
+	standard input is always a valid tty.
+	Reported by Assaf Gordon on OpenSolaris 5.10 and 5.11,
+	and Centos 6.5
+
+2017-08-30  Pádraig Brady  <P@draigBrady.com>
+
+	runcon: revert "disable use of the TIOCSTI ioctl"
+	This reverts commit v8.27-97-g8cb06d4 because
+	the setsid() fallback was not implemented correctly
+	and disabling the ioctl was not a complete solution
+	to the security issue of the child being passed
+	the tty of the parent.
+
+	Given runcon is not really a sandbox command,
+	the advice is to use `runcon ... setsid ...`
+	to avoid this particular issue.
+
+2017-08-30  Pádraig Brady  <P@draigBrady.com>
+
+	stat: fix determination of max name length on BSD systems
+	We only use one of statfs or statvfs for `stat -f`
+	and on the BSDs we use statfs which doesn't have the
+	f_namelen member.  However on OpenBSD and later FreeBSD
+	systems statfs does provide f_namemax, so use that.
+
+	* NEWS: Mention the improvement for OpenBSD and FreeBSD.
+	* m4/stat-prog.m4: Check for f_namemax in the statfs struct.
+	* src/stat.c: Return '?' rather than '*' when we can't
+	determine the max length of the file system.
+	* tests/ln/sf-1.sh: This test was failing on all BSDs
+	due to '*' being returned for the max length which
+	caused the test to attempt to create 1Mi+1 names.
+	The test now uses a short name when we can't determine
+	the max name length to use.
+
+	Reported by Assaf Gordon on various BSD based systems.
+
+2017-08-29  Pádraig Brady  <P@draigBrady.com>
+
+	stat,tail: support "AAFS" AppArmor file system
+	* src/stat.c (human_fstype): This file system is used
+	to manage AppArmor policy in the Linux kernel.
+
+	all: update gnulib submodule to latest
+	* bootstrap: Sync timestamp update.
+
+2017-08-29  Pádraig Brady  <P@draigBrady.com>
+
+	runcon: disable use of the TIOCSTI ioctl
+	Similar to the issue with SELinux sandbox (CVE-2016-7545),
+	children of runcon can inject arbitrary input to the terminal
+	that would be run at the originating terminal privileges.
+
+	The new libseccomp dependency is widely available and used
+	on modern SELinux systems, but is not available by default
+	on older systems like RHEL6 etc.
+
+	* m4/jm-macros.m4: Check for libseccomp and
+	warn if unavailable on selinux supporting systems.
+	* src/local.mk: Link runcon with -lseccomp.
+	* src/runcon.c (disable_tty_inject): A new function to
+	disable use of the TIOCSTI using libseccomp, or with setsid()
+	where libseccomp is unavailable.
+	* tests/misc/runcon-no-inject.sh: A new test that uses
+	python to make the TIOCSTI call, and ensure that doesn't succeed.
+	* tests/local.mk: Reference the new test
+	* NEWS: Mention the fix.
+	Addresses http://bugs.gnu.org/24541
+
+2017-08-29  Pádraig Brady  <P@draigBrady.com>
+
+	ls: support --hyperlink to output file:// URIs
+	Terminals such as iTerm2 and VTE based terminals
+	(as of version 0.49.1), support hyperlinks when
+	passed terminals codes as described at:
+	https://gist.github.com/egmontkob/eb114294efbcd5adb1944c9f3cb5feda
+
+	* src/ls.c (gobble_file): Allocate an absolute file name to output.
+	(quote_name): Output the absolute name with the appropriate codes.
+	(file_escape): A new function to encode file names as per rfc8089.
+	(main): Handle the new option and call the file_escape_init() helper.
+	Disable --dired when --hyperlink is specified.
+	(print_dir): Get the absolute file name here too, so that the
+	directory name can be linkified.
+	* NEWS: Mention the new feature.
+	* tests/ls/hyperlink.sh: Add a new test.
+	* tests/local.mk: Reference the new test.
+	* doc/coreutils.texi (ls invocation): Describe --hyperlink.
+
+2017-08-29  Pádraig Brady  <P@draigBrady.com>
+
+	doc: remove older ChangeLog items
+	This saves about 0.5MB uncompressed from the tarball.
+
+	* Makefile.am: Following on from v8.26-34-g2c64bc8
+	update the oldest documented version to 8.18 which
+	is now about 5 years old.  Also remove older ChangeLogs
+	that were previously thought to be for changes not
+	in the git history, but are adequately recorded upon review.
+	* build-aux/ChangeLog-2007: Remove file.
+	* lib/ChangeLog-2007: Likewise.
+	* m4/ChangeLog-2007: Likewise.
+
+2017-08-29  Colin Watson  <cjwatson@debian.org>
+
+	env: add --chdir option
+	This is useful when chaining with other commands that run commands in a
+	different context, while avoiding using the shell to cd, and thus
+	having to consider shell quoting the chained command.
+
+	* NEWS (New features): Document the new option.
+	* doc/coreutils.texi (env invocation): Likewise.
+	* src/env.c (usage): Likewise.
+	(main): Implement the new option.
+	* tests/misc/env.sh: Test the new option.
+
+2017-08-29  Pádraig Brady  <P@draigBrady.com>
+
+	tests: don't fail tests when failing to write files
+	* tests/sample-test: Use framework_error_ rather than fail=1
+	* tests/chown/deref.sh: Likewise.
+	* tests/chown/preserve-root.sh: Likewise.
+	* tests/cp/src-base-dot.sh: Likewise.
+	* tests/dd/unblock-sync.sh: Likewise.
+	* tests/du/2g.sh: Likewise.
+	* tests/du/inacc-dest.sh: Likewise.
+	* tests/du/one-file-system.sh: Likewise.
+	* tests/fmt/goal-option.sh: Likewise.
+	* tests/ln/hard-backup.sh: Likewise.
+	* tests/ls/color-dtype-dir.sh: Likewise.
+	* tests/ls/m-option.sh: Likewise.
+	* tests/ls/stat-dtype.sh: Likewise.
+	* tests/ls/time-style-diag.sh: Likewise.
+	* tests/ls/x-option.sh: Likewise.
+	* tests/misc/chcon.sh: Likewise.
+	* tests/misc/nohup.sh: Likewise.
+	* tests/misc/od-N.sh: Likewise.
+	* tests/misc/sort-compress.sh: Likewise.
+	* tests/misc/tac-continue.sh: Likewise.
+	* tests/misc/time-style.sh: Likewise.
+	* tests/mv/backup-dir.sh: Likewise.
+	* tests/mv/dir2dir.sh: Likewise.
+	* tests/rm/dir-no-w.sh: Likewise.
+	* tests/rm/dir-nonrecur.sh: Likewise.
+	* tests/rm/inaccessible.sh: Likewise.
+	* tests/rm/interactive-always.sh: Likewise.
+	* tests/rm/interactive-once.sh: Likewise.
+	* tests/rm/rm3.sh: Likewise.
+	* tests/rm/v-slash.sh: Likewise.
+	* tests/touch/relative.sh: Likewise.
+
+2017-08-29  Josef Cejka  <jcejka@suse.com>
+	    Bernhard Voelker  <mail@bernhard-voelker.de>
+
+	df: avoid stat() for dummy file systems with -l
+	When systemd is configured to automount a remote file system - see
+	'man systemd.automount(5)', then the mount point is initially
+	mounted by systemd with the file system type "autofs".
+	When the resource is used later on, then the wanted file system is
+	mounted over that mount point on demand.
+	'df -l' triggered systemd to mount the file system because it called
+	stat() on the mount point.
+	Instead of single-casing "autofs" targets, we can avoid stat()ing
+	all dummy file systems (which includes "autofs"), because those are
+	skipped later on in get_dev() anyway.
+
+	*src/df.c (filter_mount_list): Also skip dummy file systems unless
+	the -a option or a specific target are given.
+	* NEWS: Mention the fix.
+
+
+	Fixes http://bugzilla.suse.com/show_bug.cgi?id=1043059
+
+2017-08-29  Assaf Gordon  <assafgordon@gmail.com>
+
+	doc: add 'realpath usage examples' section
+	* doc/coreutils.texi (Realpath usage examples): New section.
+
+2017-08-29  Assaf Gordon  <assafgordon@gmail.com>
+
+	doc: fix realpath index entry
+	The 'readlink' node has '@findex realpath' in it. This results in
+	    info doc/coreutils.info realpath
+	incorrectly jumping to the 'readlink' node (instead of the 'realpath'
+	node). Change it to @cindex instead.
+
+	* doc/coreutils.texi (readlink): Change '@findex realpath' to @cindex.
+
+2017-08-29  Assaf Gordon  <assafgordon@gmail.com>
+
+	realpath: improve usage description for --relative-{to,base}
+	* src/realpath.c (usage): Explicitly say 'DIR' instead of 'FILE' for
+	--relative-{to,base} parameters, to avoid giving the impression
+	that regular files can be used as relative base.
+	* doc/coreutils.texi (realpath): Same.
+
+2017-08-25  Pádraig Brady  <P@draigBrady.com>
+
+	ls: consistently quote symlink targets
+	* src/ls.c (gobble_file): Disable the optimization to avoid quoting
+	if the symlink target itself needs quoting.  This was introduced
+	with the quoting alignment adjustments in v8.25-106-g01971c0
+	* tests/ls/symlink-quote.sh: Add a test.
+	* tests/local.mk: Reference the test.
+	* NEWS: Mention the fix.
+
+2017-08-25  Pádraig Brady  <P@draigBrady.com>
+
+	tail: reinstate inotify use with FIFOs
+	commit v8.27-44-g18f6b22 was too aggressive in
+	only allowing inotify use with regular files. This will
+	support responsive processing of `tail -f fifo | ...`
+
+	* src/tail.c (any_non_regular): Adjust to allow FIFOs
+	since inotify supports these well.
+	* tests/tail-2/inotify-only-regular.sh: Adjust comment.
+
+2017-08-19  Pádraig Brady  <P@draigBrady.com>
+
+	maint: avoid a syntax check failure
+	* src/sort.c: Don't include stdio--.h as fopen() is no longer used.
+
+	tests: fix issues on alpine linux
+	* tests/misc/seq-epipe.sh: Remove stale comment.
+	* tests/misc/sort-debug-warn.sh: musl doesn't indicate a set_locale()
+	failure with missing locales, so avoid a test portion in that case.
+	* tests/misc/wc-files0.sh: Avoid a bug on older ash implementations.
+	Addresses http://bugs.gnu.org/28054
+
+2017-08-17  Paul Eggert  <eggert@cs.ucla.edu>
+
+	ptx: fix some integer overflow bugs
+	Problem reported by Lukas Zachar at:
+	http://bugzilla.redhat.com/1482445
+	* src/ptx.c (line_width, gap_size, maximum_word_length)
+	(reference_max_width, half_line_width, before_max_width)
+	(keyafter_max_width, truncation_string_length, compare_words)
+	(compare_occurs, search_table, find_occurs_in_text, print_spaces)
+	(fix_output_parameters, define_all_fields):
+	Use ptrdiff_t, not int, for object offsets and sizes.
+	(WORD, OCCURS): Use ptrdiff_t, not short int.
+	(WORD_TABLE, number_of_occurs, generate_all_output):
+	Prefer ptrdiff_t to size_t where either will do.
+	(total_line_count, file_line_count, OCCURS, fix_output_parameters)
+	(define_all_fields):
+	Use intmax_t, not int, for line counts.
+	(DELTA): Remove.  All uses changed.
+	(OCCURS, find_occurs_in_text, fix_output_parameters):
+	Use int, not size_t, for file indexes.
+	(tail_truncation, before_truncation, keyafter_truncation)
+	(head_truncation, search_table, define_all_fields)
+	(generate_all_output):
+	Use bool for booleans.
+	(digest_word_file, find_occurs_in_text):
+	Use x2nrealloc instead of checking for overflow by hand.
+	(find_occurs_in_text, fix_output_parameters, define_all_fields):
+	Omit unnecessary cast.
+	(fix_output_parameters): Don’t assume integers fit in 11 digits.
+	(fix_output_parameters, define_all_fields):
+	Use sprintf return value rather than calling strlen.
+	(define_all_fields): Do not rely on sprintf to generate a string
+	that may contain more than INT_MAX bytes.
+	(main): Use xstrtoimax, not xstrtoul.
+	Use xnmalloc to catch integer overflow.
+
+	nohup: simplify by using fcntl
+	* src/nohup.c: Do not include cloexec.h.
+	(main): Use fcntl rather than dup + set_cloexec_flag.
+
+	sort: use pthread_sigmask, not sigprocmask
+	POSIX says sigprocmask has unspecified behavior in a multithreaded
+	program like ‘sort’.
+	* src/sort.c (pthread_sigmask) [GNULIB_defined_pthread_functions]:
+	New macro, for use when ‘sort’ is not multithreaded.
+	(cs_enter, cs_leave): Use it.  Pass address, not value, as
+	this is typically a tad faster.  All callers changed.
+
+	sort: minor cleanups
+	* src/sort.c (move_fd): Rename from move_fd_or_die,
+	since it no longer can die.
+
+	sort: file descriptor discipline
+	Use O_CLOEXEC when creating file descriptors, so that subsidiary
+	processes do not inherit file descriptors that they do not need.
+	This is helpful for ‘sort’, as it is a multithreaded program that
+	forks and execs.
+	* bootstrap.conf (gnulib_modules): Add mkostemp, open, pipe2.
+	* src/sort.c (create_temp_file): Open temporary file with O_CLOEXEC.
+	(stream_open): Open the stream with O_CLOEXEC.
+	(pipe_fork): Create the pipe with O_CLOEXEC.
+	(check_output): Open the output file with O_CLOEXEC.
+	(main): Use xfopen/xfclose to handle --files0-from, so that
+	O_CLOEXEC is used properly.  This is simpler anyway.
+	* tests/misc/sort-files0-from.pl: Adjust to change in diagnostic
+	wording.
+
+	build: update gnulib submodule to latest
+
+2017-08-14  Pádraig Brady  <P@draigBrady.com>
+
+	kill: fix signal number to name lookup on AIX
+	* src/operand2sig.c (operand2sig): AIX uses a different bit pattern
+	in the returned status from the wait() functions and from shells.
+	Therefore hardcode the selection of the lower bits of the number.
+	* NEWS: Mention the fix.
+
+	build: use the appropriate single file include option with xlc
+	* configure.ac: Set USE_XLC_INCLUDE when __xlc__ is defined.
+	* src/local.mk: Use it to select the appropriate include option.
+	Reported by Michael Felt.
+
+	tests: avoid false failures on AIX
+	* tests/ln/sf-1.sh: Limit the symlink size to 1MiB
+	to avoid memory exhaustion seen on NFS on AIX, giving:
+	  + printf '%0*d' 4294967296 0
+	  + ./tests/ln/sf-1.sh: line 38: printf: warning: 0: Result too large
+	* tests/id/setgid.sh: Skip the test when the adjusted gid
+	would equal 4294967295, as that's reserved on AIX.
+	Reported by Michael Felt.
+
+	sort: handle musl locale differences in --debug reporting
+	* src/sort.c (main): Don't assume hard_LC_COLLATE implies
+	a successful setting of the locale as musl defaults to
+	UTF8 when failing to set the specified locale.
+	* tests/misc/sort-debug-warn.sh: Adjust for the now
+	separated locale debug info and map the musl specific
+	message back to the common case.
+	Addresses https://bugs.gnu.org/28054
+
+	seq: produce consistent error messages upon write error
+	* src/seq.c (io_error): Use the same error message as would
+	be generated at exit time when closing the stdout stream.
+	The inconsistency was added with commit v8.25-26-gc92585b.
+	This was noticed due to an inconsistency in the expected
+	error message generated by seq on musl libc.
+	Addresses https://bugs.gnu.org/28054
+
+	tests: fix false failure with large printf formats
+	* tests/misc/printf-surprise.sh: With musl libc the
+	large printf format does succeed, outputting data.
+	To avoid SIGPIPE being generated we ignore that signal
+	and then handle the subsequent EPIPE error.
+	Addresses https://bugs.gnu.org/28054
+
+2017-08-12  Jim Meyering  <meyering@fb.com>
+
+	build: adjust warning options to work with latest GCC
+	* configure.ac: Disable some new warnings to avoid false positives.
+	Building with warnings enabled and latest gcc would evoke build
+	failure without these changes.  Disable the following in coreutils
+	proper: -Wformat-overflow=2 -Wformat-truncation=2, and
+	disable these for gnulib: -Wformat-truncation=2 -Wduplicated-branches
+
+	gnulib: update to latest and adjust gl/modules/tempname.diff
+	* gnulib: Update to latest.
+	* gl/modules/tempname.diff: This patch failed to apply.
+	Adjust it to reflect removal of the secure_getenv dependency.
+
+	chroot: fix typo in preceding change: didn't compile
+	* src/chroot.c (usage): Add backslashes.
+
+2017-08-10  Jim Meyering  <meyering@fb.com>
+
+	doc: correct technicality in chroot's --help output
+	* src/chroot.c (usage): Use correct quoting in descriptive diagnostic.
+	We would run `"$SHELL" -i`, not `${SHELL} -i`.
+
+2017-08-09  Assaf Gordon  <assafgordon@gmail.com>
+
+	doc: fix join example
+	* doc/coreutils.texi (join invocation): Fix incorrect output in example.
+	Reported by Phlosioneer in https://bugs.gnu.org/28014 .
+
+2017-08-04  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+2017-08-03  Paul Eggert  <eggert@cs.ucla.edu>
+
+	copy: more-accurate warning about destruction
+	* src/copy.c (copy_internal):
+	* tests/cp/backup-is-src.sh, tests/mv/backup-is-src.sh:
+	Say "might destroy", not "would destroy".
+
+2017-08-03  Pádraig Brady  <P@draigBrady.com>
+
+	maint: avoid a syntax-check failure
+	* src/shred.c (wipename): As per the comment, the arguments
+	to error() are sufficiently quoted, so split the call over
+	multiple lines to avoid the syntax-check.
+
+2017-08-02  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+2017-08-01  Paul Eggert  <eggert@cs.ucla.edu>
+
+	copy: go back to failing 'cp --backup a~ a'
+	Suggested by Kamil Dudka in:
+	http://lists.gnu.org/archive/html/coreutils/2017-07/msg00072.html
+	* NEWS: Document the changed nature of the fix.
+	* doc/coreutils.texi, tests/cp/backup-is-src.sh:
+	* tests/mv/backup-is-src.sh: Revert previous change.
+	* src/copy.c (source_is_dst_backup): New function.
+	(copy_internal): Use it.  Fail instead of falling back on numbered
+	backups when it looks like the backup will overwrite the source.
+	Although this reintroduces a race, it's more compatible with
+	previous behavior.
+
+2017-07-31  Paul Eggert  <eggert@cs.ucla.edu>
+
+	copy: sanity-check --suffix
+	* src/cp.c, src/install.c, src/ln.c, src/mv.c (main):
+	Use set_simple_backup_suffix, to sanity-check the user-supplied
+	backup suffix.
+
+	copy: make backup files more reliably
+	* NEWS, doc/coreutils.texi (Backup options): Document the change.
+	* bootstrap.conf (gnulib_modules): Add backup-rename.
+	* src/copy.c (copy_internal): Silently switch to numbered backups
+	if a simple backup might lose data.  Use backup_file_rename
+	to avoid races with numbered backups.
+	* tests/cp/backup-is-src.sh, tests/mv/backup-is-src.sh:
+	Adjust to match new behavior.
+
+	shred: avoid rename race
+	Use renameat2 to avoid a rename race condition, on recent-enough
+	GNU/Linux.
+	* bootstrap.conf (gnulib_modules): Add renameat2.
+	* src/shred.c: Include renameat2.h.
+	(wipename): Use renameat2 instead of rename.
+
+	build: update gnulib submodule to latest
+
+2017-07-25  Jim Meyering  <meyering@fb.com>
+
+	maint: fix grammar in a shred.c comment
+	* src/shred.c: Remove spurious "to" in an old comment.
+
+2017-07-23  Pádraig Brady  <P@draigBrady.com>
+
+	maint: fix recent syntax-check failures
+	* .gitignore: Add /lib/utime.h from the recent gnulib update.
+	* src/nproc.c (usage): Adjust spacing to placate help2man.
+
+	shred: remove redundant zeroing of freed memory
+	* src/shred.c (dopass): shred used to read the input file,
+	and so needed to ensure internal memory was cleared.
+	This is no longer the case since SH-UTILS-1_16f-260-gf381610
+	so avoid this redundant clearing.
+	(do_wipefd): Likewise.
+	* NEWS: Remove the recent mention of this issue.
+
+	maint: resync with blake2 upstream
+	* src/blake2/blake2-impl.h: Don't use the equivalent explicit_bzero().
+
+	tests: avoid a false failure on AIX
+	* tests/misc/sync.sh: Normalize the error messages
+	when syncing a non read/write directory, as AIX
+	gives the "Is a directory" error.
+	Also ensure that sync(1) returns an error for this
+	case on all systems.
+
+2017-07-20  Paul Eggert  <eggert@cs.ucla.edu>
+
+	shred: use explicit_bzero
+	* NEWS: Document this.
+	* bootstrap.conf (gnulib_modules): Add explicit_bzero.
+	* gl/lib/randint.c (randint_free):
+	* gl/lib/randread.c (randread_free):
+	* src/blake2/blake2-impl.h (secure_zero_memory):
+	* src/shred.c (dopass, do_wipefd):
+	Prefer explicit_bzero to memset when erasing secrets.
+
+	build: update gnulib submodule to latest
+
+2017-07-10  Andreas Schwab  <schwab@linux-m68k.org>
+
+	nproc: fix indentation of usage output
+	* src/nproc.c (usage): Align output.
+
+2017-07-10  Jim Meyering  <meyering@fb.com>
+
+	groups: do not exit early
+	Most programs take care to operate on all command-line-specified
+	operands before exiting.  That is an important feature that allows
+	to identify all problems with the first run.  However, groups would
+	exit upon the first problematic user name.
+	Bug introduced via commit v6.10-56-g167b8025ac.
+	* src/groups.c (main): Do not exit immediately upon error.
+	* tests/misc/groups-process-all.sh: New file. Test for this.
+	* tests/local.mk (all_tests): Add it.
+	* NEWS (Bug fixes): Mention this.
+
+2017-07-08  Jim Meyering  <jim@meyering.net>
+
+	tests: groups-dash.sh: avoid false failure
+	* tests/misc/groups-dash.sh: Avoid false failure on a system for which
+	"none" is a valid user name.  The first invocation would succeed, and
+	the second would fail with "groups: ‘--’: no such user".
+	Use a user name that cannot exist.
+
+	doc: tweak wording
+	* NEWS (Bug fixes): Tweak wording of the mv/cp-vs-symlink-ownership
+	entry and the one about df.
+
+2017-06-28  Assaf Gordon  <assafgordon@gmail.com>
+
+	expr: add multibyte support
+	Discussed in https://bugs.gnu.org/26779 .
+
+	* NEWS: Mention the improvement.
+	* bootstrap.conf: Add gnulib modules mbslen,mbschr.
+	* src/expr.c (mbs_logical_substr): New function to return a substring
+	based on logical character positions (instead of bytes).
+	(mbs_logical_cspn): Similar to strcspn/mbscspn, but returns number of
+	logical characters instead of byte offset.
+	(mbs_offset_to_chars): New function to return number of logical
+	characters fitting in a given byte offset.
+	(docolon): Report matched logical characters instead of bytes.
+	(eval6): For length/substr/index operations, use logical characters
+	instead of bytes by calling the above new functions.
+	* tests/misc/expr.pl: Repeat all tests with non-C locale to detect any
+	regressions.
+	* tests/misc/expr-multibyte.pl: New tests with multibyte input.
+	* tests/local.mk: Add new test file.
+
+2017-06-21  Jim Meyering  <meyering@fb.com>
+
+	maint: avoid spurious "make distcheck" failure
+	When the generated file, doc/constants.texi, happens to be older than
+	doc/coreutils.info, it will not be updated until/unless its generated
+	contents change.  This is due to way that rule is careful to update
+	the file, to avoid provoking a pointless rerunning of makeinfo.
+
+	Note that this does not happen when one first runs "make distclean",
+	as recommended in README-release.  However, I sometimes run it as
+	a more-rigorous "make check", and shouldn't have to manually run
+	"make distclean" first, in that case.
+
+	Before this change, one could reproduce the failure by running
+	`touch -dyesterday doc/constants.texi && make distcheck`.  It would
+	fail with "makeinfo: could not open ../../doc/coreutils.info-t
+	for writing: Permission denied"
+	* Makefile.am (dist-hook): Touch the two generated files, so that
+	they cannot be out of date wrt doc/coreutils.texi.
+
+2017-06-17  Pádraig Brady  <P@draigBrady.com>
+
+	maint: use C99 for loop initial declarations where possible
+	This results in a net reduction of about 120 lines.
+
+	tail: only use inotify with regular files
+	* src/tail.c (any_non_regular): A new function to check passed files.
+	(main): Use the above to skip inotify if any non regular files passed
+	like /dev/tty or /dev/ttyUSB0 etc.
+	* tests/tail-2/inotify-only-regular.sh: A new test.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the bug fix.
+	Fixes http://bugs.gnu.org/21265 and http://bugs.gnu.org/27368
+
+	tail: with -f don't warn if doing a blocking read of a tty
+	* src/tail.c: (main): Only issue the warning about -f being
+	ineffective when we're not going into simple blocking mode.
+	* tests/tail-2/follow-stdin.sh: Ensure the warning is output correctly.
+	Fixes http://bugs.gnu.org/27368
+
+2017-06-11  Pádraig Brady  <P@draigBrady.com>
+
+	tail: exit promptly when output no longer writable
+	This will support use cases like:
+
+	  tail -f file.log | grep -q trigger &&
+	  process_immediately
+
+	* src/tail.c (check_output_alive): A new function that
+	uses select on fifos or pipes to detect if they're broken.
+	(tail_forever): Call check_output_alive() periodically.
+	(tail_forever_inotify): Merge the select() call from
+	check_output_alive() into the select() originally present
+	for the --pid case, and adjust accordingly.
+	* tests/tail-2/pipe-f.sh: Add test cases.
+	* NEWS: Mention the improvement.
+
+2017-06-11  Jim Meyering  <meyering@fb.com>
+
+	maint: update to work with GCC7's -Werror=implicit-fallthrough=5
+	* src/system.h (FALLTHROUGH): Define.
+	* src/cp.c (main): Use new FALLTHROUGH macro in place of comments.
+	* src/basename.c (main): Likewise.
+	* src/dircolors.c (append_quoted): Likewise.
+	* src/echo.c (main): Likewise.
+	* src/fold.c (main): Likewise.
+	* src/join.c (main): Likewise.
+	* src/kill.c (main): Likewise.
+	* src/ls.c (get_funky_string, gobble_file): Likewise.
+	* src/sort.c (parse_field_count, main): Likewise.
+	* src/stat.c (print_it): Likewise.
+	* src/tail.c (parse_obsolete_option): Likewise.
+	* src/test.c (posixtest): Likewise.
+	* src/wc.c (wc): Likewise.
+	* src/who.c (main): Likewise.
+
+2017-06-07  Pádraig Brady  <P@draigBrady.com>
+
+	tail: with --pid, ensure all inotify events are processed
+	* NEWS: Mention the bug fix.
+	* src/tail.c (tail_forever_inotify): With --pid, avoid waiting
+	for new events if there are still events to process.
+	* tests/tail-2/inotify-dir-recreate.sh: Adjust to trigger.
+
+	tests: fix issues with recently added tail test
+	* tests/tail-2/inotify-dir-recreate.sh: Skip when
+	inotify is not usable.  Also remove a bash specific &> construct.
+
+2017-06-03  Pádraig Brady  <P@draigBrady.com>
+
+	copy: don't fail when unable to chown symlinks
+	* src/copy.c (copy_internal): Honor the x->require_preserve flag
+	for symlinks as we do for ordinary files, so we don't exit with
+	failure upon failure to chown a symbolic link.
+	* NEWS: Mention the bug fix.
+
+2017-05-29  Sebastian Kisela  <skisela@redhat.com>
+
+	doc: mention `setpriv --no-new-privs` feature in runcon info
+	* doc/coreutils.texi (runcon invocation): Mention setpriv usage.
+	Discussed at https://bugzilla.redhat.com/1360903
+
+2017-05-18  Pádraig Brady  <P@draigBrady.com>
+
+	mv: distinguish copy and rename operations with --verbose
+	* src/copy.c (copy_internal): In x->move_mode distinguish
+	whether we're copying, creating directory, or renaming.
+	* tests/mv/backup-dir.sh: Adjust to new output.
+	* tests/mv/mv-n.sh: Likewise.
+	* tests/mv/mv-special-1.sh: Likewise.
+	* NEWS: Mention the improvement.
+	Fixes http://bugs.gnu.org/26971
+
+2017-05-11  Prateek saxena  <prateeksaxena2@gmail.com>
+
+	uptime: remove inconsistent AM/PM from current time
+	* src/uptime.c (main): 00-23 was always used for the hour component
+	of the current time, so remove the AM/PM output (which was only
+	present in some locales anyway).  Also add seconds to the time
+	to be more consistent with the usual procps-ng uptime implementation
+	on GNU/Linux.
+	* NEWS: Mention the fix.
+	Fixes http://bugs.gnu.org/26783
+
+2017-05-04  Pádraig Brady  <P@draigBrady.com>
+
+	maint: fix various typos in recent commits
+	* NEWS: Grammar fixes.
+	* HACKING: Likewise.
+
+2017-05-04  Jaak Ristioja  <jaak.ristioja@cyber.ee>
+
+	doc: Fixed typo in timeout man page
+	* man/timeout.x: Correct spelling of "currently".
+	Fixes http://bugs.gnu.org/26762
+
+2017-04-30  Pádraig Brady  <P@draigBrady.com>
+
+	doc: update the instructions for generating a coverage report
+	* HACKING: Change from explicit instructions to using gnulib
+	provided coverage testing targets.  Also include instructions
+	for adding root only tests to the report.
+	Fixes http://bugs.gnu.org/26709
+
+2017-04-27  Paul Eggert  <eggert@cs.ucla.edu>
+
+	dd: simplify translator’s jobs
+	* src/dd.c (print_xfer_stats): Format the SI units directly,
+	without translating them, to simplify the translators’ jobs.
+	See Bug#26621.
+
+2017-04-27  Pádraig Brady  <P@draigBrady.com>
+
+	date,touch: test and document large TZ security issue
+	Add a test for CVE-2017-7476 which was fixed in gnulib at:
+	http://git.sv.gnu.org/gitweb/?p=gnulib.git;a=commitdiff;h=94e01571
+
+	* tests/misc/date-tz.sh: Add a new test which overwrites enough
+	of the heap to trigger a segfault, even without ASAN enabled.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the bug fix.
+
+2017-04-27  Pádraig Brady  <P@draigBrady.com>
+
+	build: update gnulib submodule to latest
+	* .gitignore: Add new entry as indicated by `make syntax-check`.
+
+2017-04-24  Paul Eggert  <eggert@cs.ucla.edu>
+
+	dd: status=progress outputs "6 s", not "6.00001 s"
+	Problem reported by Benno Schulenberg (Bug#26621).
+	* NEWS: Document this.
+	* src/dd.c (print_xfer_stats): With status=progress,
+	format times with %.0f rather than %g.  Improve
+	translator comments.
+
+2017-04-22  Paul Eggert  <eggert@cs.ucla.edu>
+
+	build: update gnulib submodule to latest
+
+	maint: remove unused functions and constants
+	These were found by clang.
+	* gl/lib/rand-isaac.c (min):
+	* gl/lib/randint.c (shift_right):
+	* src/md5sum.c (algorithm):
+	Remove; unused.
+
+	date: adjust to gnulib parse-datetime changes
+	* doc/coreutils.texi (Options for date): Capitalize a sentence.
+	* tests/misc/date-debug.sh: Adjust --debug output to match
+	recent changes to Gnulib’s parse-datetime module.
+
+	build: update gnulib submodule to latest
+	* gl/modules/tempname.diff: Update to match current Gnulib.
+
+2017-04-18  Bogdan Drozdowski  <bogdandr@op.pl>
+
+	shred: fix invalid pattern generation for certain sizes
+	* src/shred.c (fillpattern): Fix the "off by one" issue when
+	testing whether we have enough space to copy the already
+	written portion of the buffer to the remainder of the buffer.
+	Specifically for buffer sizes that are (3*(2^x))+1, i.e. 7,13,...
+	we both use an uninitialized byte and invoke undefined
+	behavior in memcpy() operation on overlapping memory regions.
+	* tests/misc/shred-passes.sh: Add an invocation that will
+	trigger either valgrind UMR, or ASAN like:
+	  ERROR: AddressSanitizer: memcpy-param-overlap: memory ranges
+	  #1 0x403065 in fillpattern src/shred.c:293
+	A direct test is awkward due to the random writes surrounding
+	the problematic pattern writes.
+	Fixes http://bugs.gnu.org/26545
+
+2017-04-17  Bo Rydberg  <bolry@hotmail.com>
+
+	doc: fix awk example for getting penultimate field
+	* doc/coreutils.texi (cut invocation): Add required brackets.
+	Fixes http://bugs.gnu.org/26519
+
+2017-04-06  Sebastian Kisela  <skisela@redhat.com>
+
+	tail: revert to polling if a followed directory is replaced
+	* src/tail.c (tail_forever_inotify): Add the IN_DELETE_SELF flag when
+	creating watch for the parent directory.  After the parent directory
+	is removed, an event is caught and then we switch from inotify to
+	polling mode.  Till now, inotify has always frozen because it waited for
+	an event from a watched dir, which has been already deleted and was not
+	added again.
+	* tests/tail-2/inotify-dir-recreate.sh: Add a test case.
+	* tests/local.mk: Reference the new test.
+	* NEWS: Mention the bug fix.
+	Fixes http://bugs.gnu.org/26363
+	Reported at https://bugzilla.redhat.com/1283760
+
+2017-04-06  Pádraig Brady  <P@draigBrady.com>
+
+	maint: fix syntax-check issues in previous tty commit
+	* src/tty.c: Avoid EXIT_FAILURE to be more descriptive
+	and to placate sc_some_programs_must_avoid_exit_failure.
+
+2017-04-05  Paul Eggert  <eggert@cs.ucla.edu>
+
+	tty: handle misconfigured namespaces
+	On some platforms, isatty succeeds but ttyname fails.
+	POSIX does not seem to allow this, but there it is.
+	Problem reported by Christian Brauner (Bug#26371).
+	While we’re at it, check for errors more carefully and return a
+	new exit status 4 if stdin is closed or a similar error occurs.
+	* doc/coreutils.texi (tty invocation): Document new behavior.
+	* init.cfg (stderr_fileno_):
+	Don't assume have_input_tty is not in the environment.
+	* src/tty.c (TTY_STDIN_ERROR): New constant.
+	(main): Exit with nonzero status if there is a usage error,
+	like other coreutils programs.
+	Check for error in getting stdin type.
+	* tests/misc/tty.sh: New file.
+	* tests/local.mk (all_tests): Add it.
+
+2017-04-03  Pádraig Brady  <P@draigBrady.com>
+
+	doc: refactor and update expand and unexpand --help
+	* src/expand-common.c (emit_tab_list_info): A new function to
+	output the extended info on --tab=LIST, including the new
+	'+' and '/' prefixes.
+	* src/expand-common.h: Declare the above.
+	* src/expand.c (usage:): Call emit_tab_list_info and
+	match alignment with that used in unexpand --help.
+	* src/unexpand.c (usage): Likewise.
+
+2017-04-03  Jacob Keller  <jacob.e.keller@intel.com>
+
+	expand,unexpand: add support for incremental tab stops
+	Support --tabs="1,+8" which is equivalent to --tabs="1,9,17,..."
+	useful for viewing unified diff output with its 1 character
+	gutter for example.
+
+	* doc/coreutils.texi ({expand,unexpand} invocation): Document,
+	using diff processing as the example.
+	* src/expand-common.c (set_increment_size): Update the new
+	increment_size global.
+	(parse_tab_stops): Handle the new '+' prefix.
+	(finalize_tab_stops): Verify both '+' and '/' prefixes
+	are not used together.
+	* tests/misc/expand.pl: Add test cases.
+	* NEWS: Mention the new feature.
+
+2017-03-30  Paul Eggert  <eggert@cs.ucla.edu>
+
+	sort: update comment
+	* src/sort.c: Update identifiers in comment.
+
+2017-03-30  Chris Davies  <chris@roaima.co.uk>
+
+	doc: clarify in dd man page that bs= overrides [io]bs=
+	* src/dd.c (usage): Add the extra info.
+	Reported in https://bugs.debian.org/859021
+
+2017-03-28  Ludovic Courtès  <ludo@gnu.org>
+
+	tests: avoid false ulimit failure on some systems
+	* tests/misc/cut-huge-range.sh: On some systems returns_ may
+	use more memory, so incorporate that in the determination
+	of the ulimit value to use.  Noticed on ARMv7 with bash-4.4.12,
+	and x86_64 with bash-4.2.37.
+	Fixes http://bugs.gnu.org/26253
+
+2017-03-28  Pádraig Brady  <P@draigBrady.com>
+
+	maint: avoid syntax check failure with wrapped returns_
+	* cfg.mk (sc_prohibit_env_returns): Allow wrapped calls to
+	return_ of the form: `wrapper_ returns_ ...` which is needed
+	with the following commit.
+
+2017-03-28  Michael Heimpold  <mhei@heimpold.de>
+
+	split: add new --hex-suffixes option
+	* doc/coreutils.texi (split invocation): Document the new option.
+	* src/split.c (usage): Likewise.
+	(main): Process the new option much like --numeric-suffixes,
+	but with an adjusted alphabet.
+	* tests/split/numeric.sh: Refactor to support --hex mode.
+	* NEWS: Mention the new feature.
+
+2017-03-28  Pádraig Brady  <P@draigBrady.com>
+
+	md5sum,b2sum,sha*sum: don't erroneously trigger BSD reversed mode
+	* src/md5sum.c (split_3): Verify hex digits internally before
+	triggering the global bsd_reversed mode flag.
+	(bsd_split_3): Likewise.
+	* tests/misc/md5sum-bsd.sh: Add a test case.
+	* NEWS: Mention the bug fix.
+	Fixes http://bugs.gnu.org/26263
+
+2017-03-27  Philipp Thomas  <pth@suse.de>
+
+	df: avoid querying excluded file systems
+	* src/df.c (filter_mount_list): Avoid stat() on
+	explicitly excluded file systems, which is especially
+	significant in cases like `-x nfs` which may hang.
+	* NEWS: Mention the bug fix.
+
+2017-03-26  Pádraig Brady  <P@draigBrady.com>
+
+	maint: avoid a static analysis warning in expand-common
+	* src/expand-common.c (next_file): We're dependent on calling
+	this function with NULL to initialize things appropriately.
+	So enforce this with assert(), which avoids a warning from
+	clang-anaylzer.
+
+	split: process more efficiently when filters exit early
+	* src/split.c (bytes_split): Don't write to an existing filter
+	if it has exited.  When filters exit early, skip input data if
+	possible.  Refactor out 2 redundant variables.
+	* tests/split/filter.sh: Improve test coverage given the
+	new more efficient processing.  Also use a 10TB file to
+	expand the file systems tested on.
+
+2017-03-26  Pádraig Brady  <P@draigBrady.com>
+
+	split: ensure input is processed when filters exit early
+	commit v8.25-4-g62e7af0 introduced the issue as it
+	broke out of the processing loop irrespective of
+	the value of new_file_flag which was used to indicate
+	a finite number of filters or not.
+
+	For example, this ran forever (as it should):
+	  $ yes | split --filter="head -c1 >/dev/null" -b 1000
+	However this exited immediately due to EPIPE being propagated
+	back through cwrite and the loop not considering new filters:
+	  $ yes | split --filter="head -c1 >/dev/null" -b 100000
+
+	Similarly processing would exit early for a bounded number of
+	output files, resulting in empty data sent to all but the first:
+	  $ truncate -s10T big.in
+	  $ split --filter='head -c1 >$FILE' -n 2 big.in
+	  $ echo $(stat -c%s x??)
+	  1 0
+
+	I was alerted to this code by clang-analyzer,
+	which indicated dead assigments, which is often
+	an indication of code that hasn't considered all cases.
+
+	* src/split.c (bytes_split): Change the last condition in
+	the processing loop to also consider the number of files
+	before breaking out of the processing loop.
+	* tests/split/filter.sh: Add a test case.
+	* NEWS: Mention the bug fix.
+
+2017-03-11  Pádraig Brady  <P@draigBrady.com>
+
+	tests: avoid a false failure on OS X 10.5.8
+	* tests/misc/sort-debug-keys.sh: Disparate LC_CTYPE and LC_MESSAGES
+	are not supported, with the result LC_MESSAGES=C is used throughout.
+	Therefore just set LC_ALL in the test, and normalize the message
+	variants with sed.
+	Reported and tested by J Rogowsky.
+
+	build: fix missing renameat() on OS X 10.5.8
+	* bootstrap.conf: Depend on renameat.
+	Reported and tested by J Rogowsky.
+	Fixes http://bugs.gnu.org/26044
+
+2017-03-10  Paul Eggert  <eggert@cs.ucla.edu>
+
+	tests: port to tzdb-2017a
+	Problem reported by Bernhard Voelker in:
+	http://lists.gnu.org/archive/html/coreutils/2017-03/msg00026.html
+	* tests/misc/date-debug.sh: Port test to tzdb 2017a,
+	and future-proof the America/Belize test.
+
+2017-03-09  Pádraig Brady  <P@draigBrady.com>
+
+	build: for factor use C in more cases for arm64 and ppc64
+	* src/longlong.h: Sync from gmp repo incorporating:
+	Use asm-free umul_ppmm() on arm64 and ppc64.
+
+	doc: rearrange a recent bug entry to an improvement in NEWS
+	* NEWS: The stat,tail change was an improvement, not a bug fix.
+	* cfg.mk [old_NEWS_hash]: update with `make update-NEWS-hash`.
+
+	maint: post-release administrivia
+	* NEWS: Add header line for next release.
+	* .prev-version: Record previous version.
+	* cfg.mk (old_NEWS_hash): Auto-update.
+
+	version 8.27
+	* NEWS: Record release date.
+
+
+See the source repo for older entries