diff options
Diffstat (limited to 'third_party/python/pytest/src/_pytest')
50 files changed, 18416 insertions, 0 deletions
diff --git a/third_party/python/pytest/src/_pytest/__init__.py b/third_party/python/pytest/src/_pytest/__init__.py new file mode 100644 index 0000000000..46c7827ed5 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/__init__.py @@ -0,0 +1,8 @@ +__all__ = ["__version__"] + +try: + from ._version import version as __version__ +except ImportError: + # broken installation, we don't even try + # unknown only works because we do poor mans version compare + __version__ = "unknown" diff --git a/third_party/python/pytest/src/_pytest/_argcomplete.py b/third_party/python/pytest/src/_pytest/_argcomplete.py new file mode 100644 index 0000000000..8f480d71d7 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/_argcomplete.py @@ -0,0 +1,107 @@ + +"""allow bash-completion for argparse with argcomplete if installed +needs argcomplete>=0.5.6 for python 3.2/3.3 (older versions fail +to find the magic string, so _ARGCOMPLETE env. var is never set, and +this does not need special code. + +Function try_argcomplete(parser) should be called directly before +the call to ArgumentParser.parse_args(). + +The filescompleter is what you normally would use on the positional +arguments specification, in order to get "dirname/" after "dirn<TAB>" +instead of the default "dirname ": + + optparser.add_argument(Config._file_or_dir, nargs='*' + ).completer=filescompleter + +Other, application specific, completers should go in the file +doing the add_argument calls as they need to be specified as .completer +attributes as well. (If argcomplete is not installed, the function the +attribute points to will not be used). + +SPEEDUP +======= +The generic argcomplete script for bash-completion +(/etc/bash_completion.d/python-argcomplete.sh ) +uses a python program to determine startup script generated by pip. +You can speed up completion somewhat by changing this script to include + # PYTHON_ARGCOMPLETE_OK +so the the python-argcomplete-check-easy-install-script does not +need to be called to find the entry point of the code and see if that is +marked with PYTHON_ARGCOMPLETE_OK + +INSTALL/DEBUGGING +================= +To include this support in another application that has setup.py generated +scripts: +- add the line: + # PYTHON_ARGCOMPLETE_OK + near the top of the main python entry point +- include in the file calling parse_args(): + from _argcomplete import try_argcomplete, filescompleter + , call try_argcomplete just before parse_args(), and optionally add + filescompleter to the positional arguments' add_argument() +If things do not work right away: +- switch on argcomplete debugging with (also helpful when doing custom + completers): + export _ARC_DEBUG=1 +- run: + python-argcomplete-check-easy-install-script $(which appname) + echo $? + will echo 0 if the magic line has been found, 1 if not +- sometimes it helps to find early on errors using: + _ARGCOMPLETE=1 _ARC_DEBUG=1 appname + which should throw a KeyError: 'COMPLINE' (which is properly set by the + global argcomplete script). +""" +from __future__ import absolute_import, division, print_function +import sys +import os +from glob import glob + + +class FastFilesCompleter(object): + "Fast file completer class" + + def __init__(self, directories=True): + self.directories = directories + + def __call__(self, prefix, **kwargs): + """only called on non option completions""" + if os.path.sep in prefix[1:]: + prefix_dir = len(os.path.dirname(prefix) + os.path.sep) + else: + prefix_dir = 0 + completion = [] + globbed = [] + if "*" not in prefix and "?" not in prefix: + # we are on unix, otherwise no bash + if not prefix or prefix[-1] == os.path.sep: + globbed.extend(glob(prefix + ".*")) + prefix += "*" + globbed.extend(glob(prefix)) + for x in sorted(globbed): + if os.path.isdir(x): + x += "/" + # append stripping the prefix (like bash, not like compgen) + completion.append(x[prefix_dir:]) + return completion + + +if os.environ.get("_ARGCOMPLETE"): + try: + import argcomplete.completers + except ImportError: + sys.exit(-1) + filescompleter = FastFilesCompleter() + + def try_argcomplete(parser): + argcomplete.autocomplete(parser, always_complete_options=False) + + +else: + + def try_argcomplete(parser): + pass + + filescompleter = None diff --git a/third_party/python/pytest/src/_pytest/_code/__init__.py b/third_party/python/pytest/src/_pytest/_code/__init__.py new file mode 100644 index 0000000000..815c13b42c --- /dev/null +++ b/third_party/python/pytest/src/_pytest/_code/__init__.py @@ -0,0 +1,10 @@ +""" python inspection/code generation API """ +from __future__ import absolute_import, division, print_function +from .code import Code # noqa +from .code import ExceptionInfo # noqa +from .code import Frame # noqa +from .code import Traceback # noqa +from .code import getrawcode # noqa +from .source import Source # noqa +from .source import compile_ as compile # noqa +from .source import getfslineno # noqa diff --git a/third_party/python/pytest/src/_pytest/_code/_py2traceback.py b/third_party/python/pytest/src/_pytest/_code/_py2traceback.py new file mode 100644 index 0000000000..2dd100c33b --- /dev/null +++ b/third_party/python/pytest/src/_pytest/_code/_py2traceback.py @@ -0,0 +1,89 @@ +# copied from python-2.7.3's traceback.py +# CHANGES: +# - some_str is replaced, trying to create unicode strings +# +from __future__ import absolute_import, division, print_function +import types +from six import text_type + + +def format_exception_only(etype, value): + """Format the exception part of a traceback. + + The arguments are the exception type and value such as given by + sys.last_type and sys.last_value. The return value is a list of + strings, each ending in a newline. + + Normally, the list contains a single string; however, for + SyntaxError exceptions, it contains several lines that (when + printed) display detailed information about where the syntax + error occurred. + + The message indicating which exception occurred is always the last + string in the list. + + """ + + # An instance should not have a meaningful value parameter, but + # sometimes does, particularly for string exceptions, such as + # >>> raise string1, string2 # deprecated + # + # Clear these out first because issubtype(string1, SyntaxError) + # would throw another exception and mask the original problem. + if ( + isinstance(etype, BaseException) + or isinstance(etype, types.InstanceType) + or etype is None + or type(etype) is str + ): + return [_format_final_exc_line(etype, value)] + + stype = etype.__name__ + + if not issubclass(etype, SyntaxError): + return [_format_final_exc_line(stype, value)] + + # It was a syntax error; show exactly where the problem was found. + lines = [] + try: + msg, (filename, lineno, offset, badline) = value.args + except Exception: + pass + else: + filename = filename or "<string>" + lines.append(' File "%s", line %d\n' % (filename, lineno)) + if badline is not None: + if isinstance(badline, bytes): # python 2 only + badline = badline.decode("utf-8", "replace") + lines.append(u" %s\n" % badline.strip()) + if offset is not None: + caretspace = badline.rstrip("\n")[:offset].lstrip() + # non-space whitespace (likes tabs) must be kept for alignment + caretspace = ((c.isspace() and c or " ") for c in caretspace) + # only three spaces to account for offset1 == pos 0 + lines.append(" %s^\n" % "".join(caretspace)) + value = msg + + lines.append(_format_final_exc_line(stype, value)) + return lines + + +def _format_final_exc_line(etype, value): + """Return a list of a single line -- normal case for format_exception_only""" + valuestr = _some_str(value) + if value is None or not valuestr: + line = "%s\n" % etype + else: + line = "%s: %s\n" % (etype, valuestr) + return line + + +def _some_str(value): + try: + return text_type(value) + except Exception: + try: + return str(value) + except Exception: + pass + return "<unprintable %s object>" % type(value).__name__ diff --git a/third_party/python/pytest/src/_pytest/_code/code.py b/third_party/python/pytest/src/_pytest/_code/code.py new file mode 100644 index 0000000000..cb788c17f0 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/_code/code.py @@ -0,0 +1,970 @@ +from __future__ import absolute_import, division, print_function +import inspect +import sys +import traceback +from inspect import CO_VARARGS, CO_VARKEYWORDS + +import attr +import re +from weakref import ref +from _pytest.compat import _PY2, _PY3, PY35, safe_str +from six import text_type +import py + +builtin_repr = repr + +if _PY3: + from traceback import format_exception_only +else: + from ._py2traceback import format_exception_only + + +class Code(object): + """ wrapper around Python code objects """ + + def __init__(self, rawcode): + if not hasattr(rawcode, "co_filename"): + rawcode = getrawcode(rawcode) + try: + self.filename = rawcode.co_filename + self.firstlineno = rawcode.co_firstlineno - 1 + self.name = rawcode.co_name + except AttributeError: + raise TypeError("not a code object: %r" % (rawcode,)) + self.raw = rawcode + + def __eq__(self, other): + return self.raw == other.raw + + __hash__ = None + + def __ne__(self, other): + return not self == other + + @property + def path(self): + """ return a path object pointing to source code (note that it + might not point to an actually existing file). """ + try: + p = py.path.local(self.raw.co_filename) + # maybe don't try this checking + if not p.check(): + raise OSError("py.path check failed.") + except OSError: + # XXX maybe try harder like the weird logic + # in the standard lib [linecache.updatecache] does? + p = self.raw.co_filename + + return p + + @property + def fullsource(self): + """ return a _pytest._code.Source object for the full source file of the code + """ + from _pytest._code import source + + full, _ = source.findsource(self.raw) + return full + + def source(self): + """ return a _pytest._code.Source object for the code object's source only + """ + # return source only for that part of code + import _pytest._code + + return _pytest._code.Source(self.raw) + + def getargs(self, var=False): + """ return a tuple with the argument names for the code object + + if 'var' is set True also return the names of the variable and + keyword arguments when present + """ + # handfull shortcut for getting args + raw = self.raw + argcount = raw.co_argcount + if var: + argcount += raw.co_flags & CO_VARARGS + argcount += raw.co_flags & CO_VARKEYWORDS + return raw.co_varnames[:argcount] + + +class Frame(object): + """Wrapper around a Python frame holding f_locals and f_globals + in which expressions can be evaluated.""" + + def __init__(self, frame): + self.lineno = frame.f_lineno - 1 + self.f_globals = frame.f_globals + self.f_locals = frame.f_locals + self.raw = frame + self.code = Code(frame.f_code) + + @property + def statement(self): + """ statement this frame is at """ + import _pytest._code + + if self.code.fullsource is None: + return _pytest._code.Source("") + return self.code.fullsource.getstatement(self.lineno) + + def eval(self, code, **vars): + """ evaluate 'code' in the frame + + 'vars' are optional additional local variables + + returns the result of the evaluation + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + return eval(code, self.f_globals, f_locals) + + def exec_(self, code, **vars): + """ exec 'code' in the frame + + 'vars' are optiona; additional local variables + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + py.builtin.exec_(code, self.f_globals, f_locals) + + def repr(self, object): + """ return a 'safe' (non-recursive, one-line) string repr for 'object' + """ + return py.io.saferepr(object) + + def is_true(self, object): + return object + + def getargs(self, var=False): + """ return a list of tuples (name, value) for all arguments + + if 'var' is set True also include the variable and keyword + arguments when present + """ + retval = [] + for arg in self.code.getargs(var): + try: + retval.append((arg, self.f_locals[arg])) + except KeyError: + pass # this can occur when using Psyco + return retval + + +class TracebackEntry(object): + """ a single entry in a traceback """ + + _repr_style = None + exprinfo = None + + def __init__(self, rawentry, excinfo=None): + self._excinfo = excinfo + self._rawentry = rawentry + self.lineno = rawentry.tb_lineno - 1 + + def set_repr_style(self, mode): + assert mode in ("short", "long") + self._repr_style = mode + + @property + def frame(self): + import _pytest._code + + return _pytest._code.Frame(self._rawentry.tb_frame) + + @property + def relline(self): + return self.lineno - self.frame.code.firstlineno + + def __repr__(self): + return "<TracebackEntry %s:%d>" % (self.frame.code.path, self.lineno + 1) + + @property + def statement(self): + """ _pytest._code.Source object for the current statement """ + source = self.frame.code.fullsource + return source.getstatement(self.lineno) + + @property + def path(self): + """ path to the source code """ + return self.frame.code.path + + def getlocals(self): + return self.frame.f_locals + + locals = property(getlocals, None, None, "locals of underlaying frame") + + def getfirstlinesource(self): + # on Jython this firstlineno can be -1 apparently + return max(self.frame.code.firstlineno, 0) + + def getsource(self, astcache=None): + """ return failing source code. """ + # we use the passed in astcache to not reparse asttrees + # within exception info printing + from _pytest._code.source import getstatementrange_ast + + source = self.frame.code.fullsource + if source is None: + return None + key = astnode = None + if astcache is not None: + key = self.frame.code.path + if key is not None: + astnode = astcache.get(key, None) + start = self.getfirstlinesource() + try: + astnode, _, end = getstatementrange_ast( + self.lineno, source, astnode=astnode + ) + except SyntaxError: + end = self.lineno + 1 + else: + if key is not None: + astcache[key] = astnode + return source[start:end] + + source = property(getsource) + + def ishidden(self): + """ return True if the current frame has a var __tracebackhide__ + resolving to True + + If __tracebackhide__ is a callable, it gets called with the + ExceptionInfo instance and can decide whether to hide the traceback. + + mostly for internal use + """ + try: + tbh = self.frame.f_locals["__tracebackhide__"] + except KeyError: + try: + tbh = self.frame.f_globals["__tracebackhide__"] + except KeyError: + return False + + if callable(tbh): + return tbh(None if self._excinfo is None else self._excinfo()) + else: + return tbh + + def __str__(self): + try: + fn = str(self.path) + except py.error.Error: + fn = "???" + name = self.frame.code.name + try: + line = str(self.statement).lstrip() + except KeyboardInterrupt: + raise + except: # noqa + line = "???" + return " File %r:%d in %s\n %s\n" % (fn, self.lineno + 1, name, line) + + def name(self): + return self.frame.code.raw.co_name + + name = property(name, None, None, "co_name of underlaying code") + + +class Traceback(list): + """ Traceback objects encapsulate and offer higher level + access to Traceback entries. + """ + Entry = TracebackEntry + + def __init__(self, tb, excinfo=None): + """ initialize from given python traceback object and ExceptionInfo """ + self._excinfo = excinfo + if hasattr(tb, "tb_next"): + + def f(cur): + while cur is not None: + yield self.Entry(cur, excinfo=excinfo) + cur = cur.tb_next + + list.__init__(self, f(tb)) + else: + list.__init__(self, tb) + + def cut(self, path=None, lineno=None, firstlineno=None, excludepath=None): + """ return a Traceback instance wrapping part of this Traceback + + by provding any combination of path, lineno and firstlineno, the + first frame to start the to-be-returned traceback is determined + + this allows cutting the first part of a Traceback instance e.g. + for formatting reasons (removing some uninteresting bits that deal + with handling of the exception/traceback) + """ + for x in self: + code = x.frame.code + codepath = code.path + if ( + (path is None or codepath == path) + and ( + excludepath is None + or not hasattr(codepath, "relto") + or not codepath.relto(excludepath) + ) + and (lineno is None or x.lineno == lineno) + and (firstlineno is None or x.frame.code.firstlineno == firstlineno) + ): + return Traceback(x._rawentry, self._excinfo) + return self + + def __getitem__(self, key): + val = super(Traceback, self).__getitem__(key) + if isinstance(key, type(slice(0))): + val = self.__class__(val) + return val + + def filter(self, fn=lambda x: not x.ishidden()): + """ return a Traceback instance with certain items removed + + fn is a function that gets a single argument, a TracebackEntry + instance, and should return True when the item should be added + to the Traceback, False when not + + by default this removes all the TracebackEntries which are hidden + (see ishidden() above) + """ + return Traceback(filter(fn, self), self._excinfo) + + def getcrashentry(self): + """ return last non-hidden traceback entry that lead + to the exception of a traceback. + """ + for i in range(-1, -len(self) - 1, -1): + entry = self[i] + if not entry.ishidden(): + return entry + return self[-1] + + def recursionindex(self): + """ return the index of the frame/TracebackEntry where recursion + originates if appropriate, None if no recursion occurred + """ + cache = {} + for i, entry in enumerate(self): + # id for the code.raw is needed to work around + # the strange metaprogramming in the decorator lib from pypi + # which generates code objects that have hash/value equality + # XXX needs a test + key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno + # print "checking for recursion at", key + values = cache.setdefault(key, []) + if values: + f = entry.frame + loc = f.f_locals + for otherloc in values: + if f.is_true( + f.eval( + co_equal, + __recursioncache_locals_1=loc, + __recursioncache_locals_2=otherloc, + ) + ): + return i + values.append(entry.frame.f_locals) + return None + + +co_equal = compile( + "__recursioncache_locals_1 == __recursioncache_locals_2", "?", "eval" +) + + +class ExceptionInfo(object): + """ wraps sys.exc_info() objects and offers + help for navigating the traceback. + """ + _striptext = "" + _assert_start_repr = "AssertionError(u'assert " if _PY2 else "AssertionError('assert " + + def __init__(self, tup=None, exprinfo=None): + import _pytest._code + + if tup is None: + tup = sys.exc_info() + if exprinfo is None and isinstance(tup[1], AssertionError): + exprinfo = getattr(tup[1], "msg", None) + if exprinfo is None: + exprinfo = py.io.saferepr(tup[1]) + if exprinfo and exprinfo.startswith(self._assert_start_repr): + self._striptext = "AssertionError: " + self._excinfo = tup + #: the exception class + self.type = tup[0] + #: the exception instance + self.value = tup[1] + #: the exception raw traceback + self.tb = tup[2] + #: the exception type name + self.typename = self.type.__name__ + #: the exception traceback (_pytest._code.Traceback instance) + self.traceback = _pytest._code.Traceback(self.tb, excinfo=ref(self)) + + def __repr__(self): + return "<ExceptionInfo %s tblen=%d>" % (self.typename, len(self.traceback)) + + def exconly(self, tryshort=False): + """ return the exception as a string + + when 'tryshort' resolves to True, and the exception is a + _pytest._code._AssertionError, only the actual exception part of + the exception representation is returned (so 'AssertionError: ' is + removed from the beginning) + """ + lines = format_exception_only(self.type, self.value) + text = "".join(lines) + text = text.rstrip() + if tryshort: + if text.startswith(self._striptext): + text = text[len(self._striptext):] + return text + + def errisinstance(self, exc): + """ return True if the exception is an instance of exc """ + return isinstance(self.value, exc) + + def _getreprcrash(self): + exconly = self.exconly(tryshort=True) + entry = self.traceback.getcrashentry() + path, lineno = entry.frame.code.raw.co_filename, entry.lineno + return ReprFileLocation(path, lineno + 1, exconly) + + def getrepr( + self, + showlocals=False, + style="long", + abspath=False, + tbfilter=True, + funcargs=False, + ): + """ return str()able representation of this exception info. + showlocals: show locals per traceback entry + style: long|short|no|native traceback style + tbfilter: hide entries (where __tracebackhide__ is true) + + in case of style==native, tbfilter and showlocals is ignored. + """ + if style == "native": + return ReprExceptionInfo( + ReprTracebackNative( + traceback.format_exception( + self.type, self.value, self.traceback[0]._rawentry + ) + ), + self._getreprcrash(), + ) + + fmt = FormattedExcinfo( + showlocals=showlocals, + style=style, + abspath=abspath, + tbfilter=tbfilter, + funcargs=funcargs, + ) + return fmt.repr_excinfo(self) + + def __str__(self): + entry = self.traceback[-1] + loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) + return str(loc) + + def __unicode__(self): + entry = self.traceback[-1] + loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) + return text_type(loc) + + def match(self, regexp): + """ + Match the regular expression 'regexp' on the string representation of + the exception. If it matches then True is returned (so that it is + possible to write 'assert excinfo.match()'). If it doesn't match an + AssertionError is raised. + """ + __tracebackhide__ = True + if not re.search(regexp, str(self.value)): + assert 0, "Pattern '{!s}' not found in '{!s}'".format(regexp, self.value) + return True + + +@attr.s +class FormattedExcinfo(object): + """ presenting information about failing Functions and Generators. """ + # for traceback entries + flow_marker = ">" + fail_marker = "E" + + showlocals = attr.ib(default=False) + style = attr.ib(default="long") + abspath = attr.ib(default=True) + tbfilter = attr.ib(default=True) + funcargs = attr.ib(default=False) + astcache = attr.ib(default=attr.Factory(dict), init=False, repr=False) + + def _getindent(self, source): + # figure out indent for given source + try: + s = str(source.getstatement(len(source) - 1)) + except KeyboardInterrupt: + raise + except: # noqa + try: + s = str(source[-1]) + except KeyboardInterrupt: + raise + except: # noqa + return 0 + return 4 + (len(s) - len(s.lstrip())) + + def _getentrysource(self, entry): + source = entry.getsource(self.astcache) + if source is not None: + source = source.deindent() + return source + + def _saferepr(self, obj): + return py.io.saferepr(obj) + + def repr_args(self, entry): + if self.funcargs: + args = [] + for argname, argvalue in entry.frame.getargs(var=True): + args.append((argname, self._saferepr(argvalue))) + return ReprFuncArgs(args) + + def get_source(self, source, line_index=-1, excinfo=None, short=False): + """ return formatted and marked up source lines. """ + import _pytest._code + + lines = [] + if source is None or line_index >= len(source.lines): + source = _pytest._code.Source("???") + line_index = 0 + if line_index < 0: + line_index += len(source) + space_prefix = " " + if short: + lines.append(space_prefix + source.lines[line_index].strip()) + else: + for line in source.lines[:line_index]: + lines.append(space_prefix + line) + lines.append(self.flow_marker + " " + source.lines[line_index]) + for line in source.lines[line_index + 1:]: + lines.append(space_prefix + line) + if excinfo is not None: + indent = 4 if short else self._getindent(source) + lines.extend(self.get_exconly(excinfo, indent=indent, markall=True)) + return lines + + def get_exconly(self, excinfo, indent=4, markall=False): + lines = [] + indent = " " * indent + # get the real exception information out + exlines = excinfo.exconly(tryshort=True).split("\n") + failindent = self.fail_marker + indent[1:] + for line in exlines: + lines.append(failindent + line) + if not markall: + failindent = indent + return lines + + def repr_locals(self, locals): + if self.showlocals: + lines = [] + keys = [loc for loc in locals if loc[0] != "@"] + keys.sort() + for name in keys: + value = locals[name] + if name == "__builtins__": + lines.append("__builtins__ = <builtins>") + else: + # This formatting could all be handled by the + # _repr() function, which is only reprlib.Repr in + # disguise, so is very configurable. + str_repr = self._saferepr(value) + # if len(str_repr) < 70 or not isinstance(value, + # (list, tuple, dict)): + lines.append("%-10s = %s" % (name, str_repr)) + # else: + # self._line("%-10s =\\" % (name,)) + # # XXX + # pprint.pprint(value, stream=self.excinfowriter) + return ReprLocals(lines) + + def repr_traceback_entry(self, entry, excinfo=None): + import _pytest._code + + source = self._getentrysource(entry) + if source is None: + source = _pytest._code.Source("???") + line_index = 0 + else: + # entry.getfirstlinesource() can be -1, should be 0 on jython + line_index = entry.lineno - max(entry.getfirstlinesource(), 0) + + lines = [] + style = entry._repr_style + if style is None: + style = self.style + if style in ("short", "long"): + short = style == "short" + reprargs = self.repr_args(entry) if not short else None + s = self.get_source(source, line_index, excinfo, short=short) + lines.extend(s) + if short: + message = "in %s" % (entry.name) + else: + message = excinfo and excinfo.typename or "" + path = self._makepath(entry.path) + filelocrepr = ReprFileLocation(path, entry.lineno + 1, message) + localsrepr = None + if not short: + localsrepr = self.repr_locals(entry.locals) + return ReprEntry(lines, reprargs, localsrepr, filelocrepr, style) + if excinfo: + lines.extend(self.get_exconly(excinfo, indent=4)) + return ReprEntry(lines, None, None, None, style) + + def _makepath(self, path): + if not self.abspath: + try: + np = py.path.local().bestrelpath(path) + except OSError: + return path + if len(np) < len(str(path)): + path = np + return path + + def repr_traceback(self, excinfo): + traceback = excinfo.traceback + if self.tbfilter: + traceback = traceback.filter() + + if is_recursion_error(excinfo): + traceback, extraline = self._truncate_recursive_traceback(traceback) + else: + extraline = None + + last = traceback[-1] + entries = [] + for index, entry in enumerate(traceback): + einfo = (last == entry) and excinfo or None + reprentry = self.repr_traceback_entry(entry, einfo) + entries.append(reprentry) + return ReprTraceback(entries, extraline, style=self.style) + + def _truncate_recursive_traceback(self, traceback): + """ + Truncate the given recursive traceback trying to find the starting point + of the recursion. + + The detection is done by going through each traceback entry and finding the + point in which the locals of the frame are equal to the locals of a previous frame (see ``recursionindex()``. + + Handle the situation where the recursion process might raise an exception (for example + comparing numpy arrays using equality raises a TypeError), in which case we do our best to + warn the user of the error and show a limited traceback. + """ + try: + recursionindex = traceback.recursionindex() + except Exception as e: + max_frames = 10 + extraline = ( + "!!! Recursion error detected, but an error occurred locating the origin of recursion.\n" + " The following exception happened when comparing locals in the stack frame:\n" + " {exc_type}: {exc_msg}\n" + " Displaying first and last {max_frames} stack frames out of {total}." + ).format( + exc_type=type(e).__name__, + exc_msg=safe_str(e), + max_frames=max_frames, + total=len(traceback), + ) + traceback = traceback[:max_frames] + traceback[-max_frames:] + else: + if recursionindex is not None: + extraline = "!!! Recursion detected (same locals & position)" + traceback = traceback[:recursionindex + 1] + else: + extraline = None + + return traceback, extraline + + def repr_excinfo(self, excinfo): + if _PY2: + reprtraceback = self.repr_traceback(excinfo) + reprcrash = excinfo._getreprcrash() + + return ReprExceptionInfo(reprtraceback, reprcrash) + else: + repr_chain = [] + e = excinfo.value + descr = None + while e is not None: + if excinfo: + reprtraceback = self.repr_traceback(excinfo) + reprcrash = excinfo._getreprcrash() + else: + # fallback to native repr if the exception doesn't have a traceback: + # ExceptionInfo objects require a full traceback to work + reprtraceback = ReprTracebackNative( + traceback.format_exception(type(e), e, None) + ) + reprcrash = None + + repr_chain += [(reprtraceback, reprcrash, descr)] + if e.__cause__ is not None: + e = e.__cause__ + excinfo = ExceptionInfo( + (type(e), e, e.__traceback__) + ) if e.__traceback__ else None + descr = "The above exception was the direct cause of the following exception:" + elif (e.__context__ is not None and not e.__suppress_context__): + e = e.__context__ + excinfo = ExceptionInfo( + (type(e), e, e.__traceback__) + ) if e.__traceback__ else None + descr = "During handling of the above exception, another exception occurred:" + else: + e = None + repr_chain.reverse() + return ExceptionChainRepr(repr_chain) + + +class TerminalRepr(object): + + def __str__(self): + s = self.__unicode__() + if _PY2: + s = s.encode("utf-8") + return s + + def __unicode__(self): + # FYI this is called from pytest-xdist's serialization of exception + # information. + io = py.io.TextIO() + tw = py.io.TerminalWriter(file=io) + self.toterminal(tw) + return io.getvalue().strip() + + def __repr__(self): + return "<%s instance at %0x>" % (self.__class__, id(self)) + + +class ExceptionRepr(TerminalRepr): + + def __init__(self): + self.sections = [] + + def addsection(self, name, content, sep="-"): + self.sections.append((name, content, sep)) + + def toterminal(self, tw): + for name, content, sep in self.sections: + tw.sep(sep, name) + tw.line(content) + + +class ExceptionChainRepr(ExceptionRepr): + + def __init__(self, chain): + super(ExceptionChainRepr, self).__init__() + self.chain = chain + # reprcrash and reprtraceback of the outermost (the newest) exception + # in the chain + self.reprtraceback = chain[-1][0] + self.reprcrash = chain[-1][1] + + def toterminal(self, tw): + for element in self.chain: + element[0].toterminal(tw) + if element[2] is not None: + tw.line("") + tw.line(element[2], yellow=True) + super(ExceptionChainRepr, self).toterminal(tw) + + +class ReprExceptionInfo(ExceptionRepr): + + def __init__(self, reprtraceback, reprcrash): + super(ReprExceptionInfo, self).__init__() + self.reprtraceback = reprtraceback + self.reprcrash = reprcrash + + def toterminal(self, tw): + self.reprtraceback.toterminal(tw) + super(ReprExceptionInfo, self).toterminal(tw) + + +class ReprTraceback(TerminalRepr): + entrysep = "_ " + + def __init__(self, reprentries, extraline, style): + self.reprentries = reprentries + self.extraline = extraline + self.style = style + + def toterminal(self, tw): + # the entries might have different styles + for i, entry in enumerate(self.reprentries): + if entry.style == "long": + tw.line("") + entry.toterminal(tw) + if i < len(self.reprentries) - 1: + next_entry = self.reprentries[i + 1] + if ( + entry.style == "long" + or entry.style == "short" + and next_entry.style == "long" + ): + tw.sep(self.entrysep) + + if self.extraline: + tw.line(self.extraline) + + +class ReprTracebackNative(ReprTraceback): + + def __init__(self, tblines): + self.style = "native" + self.reprentries = [ReprEntryNative(tblines)] + self.extraline = None + + +class ReprEntryNative(TerminalRepr): + style = "native" + + def __init__(self, tblines): + self.lines = tblines + + def toterminal(self, tw): + tw.write("".join(self.lines)) + + +class ReprEntry(TerminalRepr): + localssep = "_ " + + def __init__(self, lines, reprfuncargs, reprlocals, filelocrepr, style): + self.lines = lines + self.reprfuncargs = reprfuncargs + self.reprlocals = reprlocals + self.reprfileloc = filelocrepr + self.style = style + + def toterminal(self, tw): + if self.style == "short": + self.reprfileloc.toterminal(tw) + for line in self.lines: + red = line.startswith("E ") + tw.line(line, bold=True, red=red) + # tw.line("") + return + if self.reprfuncargs: + self.reprfuncargs.toterminal(tw) + for line in self.lines: + red = line.startswith("E ") + tw.line(line, bold=True, red=red) + if self.reprlocals: + # tw.sep(self.localssep, "Locals") + tw.line("") + self.reprlocals.toterminal(tw) + if self.reprfileloc: + if self.lines: + tw.line("") + self.reprfileloc.toterminal(tw) + + def __str__(self): + return "%s\n%s\n%s" % ("\n".join(self.lines), self.reprlocals, self.reprfileloc) + + +class ReprFileLocation(TerminalRepr): + + def __init__(self, path, lineno, message): + self.path = str(path) + self.lineno = lineno + self.message = message + + def toterminal(self, tw): + # filename and lineno output for each entry, + # using an output format that most editors unterstand + msg = self.message + i = msg.find("\n") + if i != -1: + msg = msg[:i] + tw.write(self.path, bold=True, red=True) + tw.line(":%s: %s" % (self.lineno, msg)) + + +class ReprLocals(TerminalRepr): + + def __init__(self, lines): + self.lines = lines + + def toterminal(self, tw): + for line in self.lines: + tw.line(line) + + +class ReprFuncArgs(TerminalRepr): + + def __init__(self, args): + self.args = args + + def toterminal(self, tw): + if self.args: + linesofar = "" + for name, value in self.args: + ns = "%s = %s" % (safe_str(name), safe_str(value)) + if len(ns) + len(linesofar) + 2 > tw.fullwidth: + if linesofar: + tw.line(linesofar) + linesofar = ns + else: + if linesofar: + linesofar += ", " + ns + else: + linesofar = ns + if linesofar: + tw.line(linesofar) + tw.line("") + + +def getrawcode(obj, trycall=True): + """ return code object for given function. """ + try: + return obj.__code__ + except AttributeError: + obj = getattr(obj, "im_func", obj) + obj = getattr(obj, "func_code", obj) + obj = getattr(obj, "f_code", obj) + obj = getattr(obj, "__code__", obj) + if trycall and not hasattr(obj, "co_firstlineno"): + if hasattr(obj, "__call__") and not inspect.isclass(obj): + x = getrawcode(obj.__call__, trycall=False) + if hasattr(x, "co_firstlineno"): + return x + return obj + + +if PY35: # RecursionError introduced in 3.5 + + def is_recursion_error(excinfo): + return excinfo.errisinstance(RecursionError) # noqa + + +else: + + def is_recursion_error(excinfo): + if not excinfo.errisinstance(RuntimeError): + return False + try: + return "maximum recursion depth exceeded" in str(excinfo.value) + except UnicodeError: + return False diff --git a/third_party/python/pytest/src/_pytest/_code/source.py b/third_party/python/pytest/src/_pytest/_code/source.py new file mode 100644 index 0000000000..6b982a4cac --- /dev/null +++ b/third_party/python/pytest/src/_pytest/_code/source.py @@ -0,0 +1,379 @@ +from __future__ import absolute_import, division, generators, print_function + +import ast +from ast import PyCF_ONLY_AST as _AST_FLAG +from bisect import bisect_right +import linecache +import sys +import six +import inspect +import tokenize +import py + +cpy_compile = compile + + +class Source(object): + """ an immutable object holding a source code fragment, + possibly deindenting it. + """ + _compilecounter = 0 + + def __init__(self, *parts, **kwargs): + self.lines = lines = [] + de = kwargs.get("deindent", True) + rstrip = kwargs.get("rstrip", True) + for part in parts: + if not part: + partlines = [] + elif isinstance(part, Source): + partlines = part.lines + elif isinstance(part, (tuple, list)): + partlines = [x.rstrip("\n") for x in part] + elif isinstance(part, six.string_types): + partlines = part.split("\n") + if rstrip: + while partlines: + if partlines[-1].strip(): + break + partlines.pop() + else: + partlines = getsource(part, deindent=de).lines + if de: + partlines = deindent(partlines) + lines.extend(partlines) + + def __eq__(self, other): + try: + return self.lines == other.lines + except AttributeError: + if isinstance(other, str): + return str(self) == other + return False + + __hash__ = None + + def __getitem__(self, key): + if isinstance(key, int): + return self.lines[key] + else: + if key.step not in (None, 1): + raise IndexError("cannot slice a Source with a step") + newsource = Source() + newsource.lines = self.lines[key.start:key.stop] + return newsource + + def __len__(self): + return len(self.lines) + + def strip(self): + """ return new source object with trailing + and leading blank lines removed. + """ + start, end = 0, len(self) + while start < end and not self.lines[start].strip(): + start += 1 + while end > start and not self.lines[end - 1].strip(): + end -= 1 + source = Source() + source.lines[:] = self.lines[start:end] + return source + + def putaround(self, before="", after="", indent=" " * 4): + """ return a copy of the source object with + 'before' and 'after' wrapped around it. + """ + before = Source(before) + after = Source(after) + newsource = Source() + lines = [(indent + line) for line in self.lines] + newsource.lines = before.lines + lines + after.lines + return newsource + + def indent(self, indent=" " * 4): + """ return a copy of the source object with + all lines indented by the given indent-string. + """ + newsource = Source() + newsource.lines = [(indent + line) for line in self.lines] + return newsource + + def getstatement(self, lineno): + """ return Source statement which contains the + given linenumber (counted from 0). + """ + start, end = self.getstatementrange(lineno) + return self[start:end] + + def getstatementrange(self, lineno): + """ return (start, end) tuple which spans the minimal + statement region which containing the given lineno. + """ + if not (0 <= lineno < len(self)): + raise IndexError("lineno out of range") + ast, start, end = getstatementrange_ast(lineno, self) + return start, end + + def deindent(self, offset=None): + """ return a new source object deindented by offset. + If offset is None then guess an indentation offset from + the first non-blank line. Subsequent lines which have a + lower indentation offset will be copied verbatim as + they are assumed to be part of multilines. + """ + # XXX maybe use the tokenizer to properly handle multiline + # strings etc.pp? + newsource = Source() + newsource.lines[:] = deindent(self.lines, offset) + return newsource + + def isparseable(self, deindent=True): + """ return True if source is parseable, heuristically + deindenting it by default. + """ + from parser import suite as syntax_checker + + if deindent: + source = str(self.deindent()) + else: + source = str(self) + try: + # compile(source+'\n', "x", "exec") + syntax_checker(source + "\n") + except KeyboardInterrupt: + raise + except Exception: + return False + else: + return True + + def __str__(self): + return "\n".join(self.lines) + + def compile( + self, + filename=None, + mode="exec", + flag=generators.compiler_flag, + dont_inherit=0, + _genframe=None, + ): + """ return compiled code object. if filename is None + invent an artificial filename which displays + the source/line position of the caller frame. + """ + if not filename or py.path.local(filename).check(file=0): + if _genframe is None: + _genframe = sys._getframe(1) # the caller + fn, lineno = _genframe.f_code.co_filename, _genframe.f_lineno + base = "<%d-codegen " % self._compilecounter + self.__class__._compilecounter += 1 + if not filename: + filename = base + "%s:%d>" % (fn, lineno) + else: + filename = base + "%r %s:%d>" % (filename, fn, lineno) + source = "\n".join(self.lines) + "\n" + try: + co = cpy_compile(source, filename, mode, flag) + except SyntaxError: + ex = sys.exc_info()[1] + # re-represent syntax errors from parsing python strings + msglines = self.lines[:ex.lineno] + if ex.offset: + msglines.append(" " * ex.offset + "^") + msglines.append("(code was compiled probably from here: %s)" % filename) + newex = SyntaxError("\n".join(msglines)) + newex.offset = ex.offset + newex.lineno = ex.lineno + newex.text = ex.text + raise newex + else: + if flag & _AST_FLAG: + return co + lines = [(x + "\n") for x in self.lines] + linecache.cache[filename] = (1, None, lines, filename) + return co + + +# +# public API shortcut functions +# + + +def compile_( + source, filename=None, mode="exec", flags=generators.compiler_flag, dont_inherit=0 +): + """ compile the given source to a raw code object, + and maintain an internal cache which allows later + retrieval of the source code for the code object + and any recursively created code objects. + """ + if isinstance(source, ast.AST): + # XXX should Source support having AST? + return cpy_compile(source, filename, mode, flags, dont_inherit) + _genframe = sys._getframe(1) # the caller + s = Source(source) + co = s.compile(filename, mode, flags, _genframe=_genframe) + return co + + +def getfslineno(obj): + """ Return source location (path, lineno) for the given object. + If the source cannot be determined return ("", -1) + """ + from .code import Code + + try: + code = Code(obj) + except TypeError: + try: + fn = inspect.getsourcefile(obj) or inspect.getfile(obj) + except TypeError: + return "", -1 + + fspath = fn and py.path.local(fn) or None + lineno = -1 + if fspath: + try: + _, lineno = findsource(obj) + except IOError: + pass + else: + fspath = code.path + lineno = code.firstlineno + assert isinstance(lineno, int) + return fspath, lineno + + +# +# helper functions +# + + +def findsource(obj): + try: + sourcelines, lineno = inspect.findsource(obj) + except py.builtin._sysex: + raise + except: # noqa + return None, -1 + source = Source() + source.lines = [line.rstrip() for line in sourcelines] + return source, lineno + + +def getsource(obj, **kwargs): + from .code import getrawcode + + obj = getrawcode(obj) + try: + strsrc = inspect.getsource(obj) + except IndentationError: + strsrc = '"Buggy python version consider upgrading, cannot get source"' + assert isinstance(strsrc, str) + return Source(strsrc, **kwargs) + + +def deindent(lines, offset=None): + if offset is None: + for line in lines: + line = line.expandtabs() + s = line.lstrip() + if s: + offset = len(line) - len(s) + break + else: + offset = 0 + if offset == 0: + return list(lines) + newlines = [] + + def readline_generator(lines): + for line in lines: + yield line + "\n" + + it = readline_generator(lines) + + try: + for _, _, (sline, _), (eline, _), _ in tokenize.generate_tokens( + lambda: next(it) + ): + if sline > len(lines): + break # End of input reached + if sline > len(newlines): + line = lines[sline - 1].expandtabs() + if line.lstrip() and line[:offset].isspace(): + line = line[offset:] # Deindent + newlines.append(line) + + for i in range(sline, eline): + # Don't deindent continuing lines of + # multiline tokens (i.e. multiline strings) + newlines.append(lines[i]) + except (IndentationError, tokenize.TokenError): + pass + # Add any lines we didn't see. E.g. if an exception was raised. + newlines.extend(lines[len(newlines):]) + return newlines + + +def get_statement_startend2(lineno, node): + import ast + + # flatten all statements and except handlers into one lineno-list + # AST's line numbers start indexing at 1 + values = [] + for x in ast.walk(node): + if isinstance(x, (ast.stmt, ast.ExceptHandler)): + values.append(x.lineno - 1) + for name in ("finalbody", "orelse"): + val = getattr(x, name, None) + if val: + # treat the finally/orelse part as its own statement + values.append(val[0].lineno - 1 - 1) + values.sort() + insert_index = bisect_right(values, lineno) + start = values[insert_index - 1] + if insert_index >= len(values): + end = None + else: + end = values[insert_index] + return start, end + + +def getstatementrange_ast(lineno, source, assertion=False, astnode=None): + if astnode is None: + content = str(source) + astnode = compile(content, "source", "exec", 1024) # 1024 for AST + + start, end = get_statement_startend2(lineno, astnode) + # we need to correct the end: + # - ast-parsing strips comments + # - there might be empty lines + # - we might have lesser indented code blocks at the end + if end is None: + end = len(source.lines) + + if end > start + 1: + # make sure we don't span differently indented code blocks + # by using the BlockFinder helper used which inspect.getsource() uses itself + block_finder = inspect.BlockFinder() + # if we start with an indented line, put blockfinder to "started" mode + block_finder.started = source.lines[start][0].isspace() + it = ((x + "\n") for x in source.lines[start:end]) + try: + for tok in tokenize.generate_tokens(lambda: next(it)): + block_finder.tokeneater(*tok) + except (inspect.EndOfBlock, IndentationError): + end = block_finder.last + start + except Exception: + pass + + # the end might still point to a comment or empty line, correct it + while end: + line = source.lines[end - 1].lstrip() + if line.startswith("#") or not line: + end -= 1 + else: + break + return astnode, start, end diff --git a/third_party/python/pytest/src/_pytest/_version.py b/third_party/python/pytest/src/_pytest/_version.py new file mode 100644 index 0000000000..f54dbb0462 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/_version.py @@ -0,0 +1,4 @@ +# coding: utf-8 +# file generated by setuptools_scm +# don't change, don't track in version control +version = '3.6.2' diff --git a/third_party/python/pytest/src/_pytest/assertion/__init__.py b/third_party/python/pytest/src/_pytest/assertion/__init__.py new file mode 100644 index 0000000000..2c9a8890c9 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/assertion/__init__.py @@ -0,0 +1,151 @@ +""" +support for presenting detailed information in failing assertions. +""" +from __future__ import absolute_import, division, print_function +import sys +import six + +from _pytest.assertion import util +from _pytest.assertion import rewrite +from _pytest.assertion import truncate + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--assert", + action="store", + dest="assertmode", + choices=("rewrite", "plain"), + default="rewrite", + metavar="MODE", + help="""Control assertion debugging tools. 'plain' + performs no assertion debugging. 'rewrite' + (the default) rewrites assert statements in + test modules on import to provide assert + expression information.""", + ) + + +def register_assert_rewrite(*names): + """Register one or more module names to be rewritten on import. + + This function will make sure that this module or all modules inside + the package will get their assert statements rewritten. + Thus you should make sure to call this before the module is + actually imported, usually in your __init__.py if you are a plugin + using a package. + + :raise TypeError: if the given module names are not strings. + """ + for name in names: + if not isinstance(name, str): + msg = "expected module names as *args, got {0} instead" + raise TypeError(msg.format(repr(names))) + for hook in sys.meta_path: + if isinstance(hook, rewrite.AssertionRewritingHook): + importhook = hook + break + else: + importhook = DummyRewriteHook() + importhook.mark_rewrite(*names) + + +class DummyRewriteHook(object): + """A no-op import hook for when rewriting is disabled.""" + + def mark_rewrite(self, *names): + pass + + +class AssertionState(object): + """State for the assertion plugin.""" + + def __init__(self, config, mode): + self.mode = mode + self.trace = config.trace.root.get("assertion") + self.hook = None + + +def install_importhook(config): + """Try to install the rewrite hook, raise SystemError if it fails.""" + # Jython has an AST bug that make the assertion rewriting hook malfunction. + if sys.platform.startswith("java"): + raise SystemError("rewrite not supported") + + config._assertstate = AssertionState(config, "rewrite") + config._assertstate.hook = hook = rewrite.AssertionRewritingHook(config) + sys.meta_path.insert(0, hook) + config._assertstate.trace("installed rewrite import hook") + + def undo(): + hook = config._assertstate.hook + if hook is not None and hook in sys.meta_path: + sys.meta_path.remove(hook) + + config.add_cleanup(undo) + return hook + + +def pytest_collection(session): + # this hook is only called when test modules are collected + # so for example not in the master process of pytest-xdist + # (which does not collect test modules) + assertstate = getattr(session.config, "_assertstate", None) + if assertstate: + if assertstate.hook is not None: + assertstate.hook.set_session(session) + + +def pytest_runtest_setup(item): + """Setup the pytest_assertrepr_compare hook + + The newinterpret and rewrite modules will use util._reprcompare if + it exists to use custom reporting via the + pytest_assertrepr_compare hook. This sets up this custom + comparison for the test. + """ + + def callbinrepr(op, left, right): + """Call the pytest_assertrepr_compare hook and prepare the result + + This uses the first result from the hook and then ensures the + following: + * Overly verbose explanations are truncated unless configured otherwise + (eg. if running in verbose mode). + * Embedded newlines are escaped to help util.format_explanation() + later. + * If the rewrite mode is used embedded %-characters are replaced + to protect later % formatting. + + The result can be formatted by util.format_explanation() for + pretty printing. + """ + hook_result = item.ihook.pytest_assertrepr_compare( + config=item.config, op=op, left=left, right=right + ) + for new_expl in hook_result: + if new_expl: + new_expl = truncate.truncate_if_required(new_expl, item) + new_expl = [line.replace("\n", "\\n") for line in new_expl] + res = six.text_type("\n~").join(new_expl) + if item.config.getvalue("assertmode") == "rewrite": + res = res.replace("%", "%%") + return res + + util._reprcompare = callbinrepr + + +def pytest_runtest_teardown(item): + util._reprcompare = None + + +def pytest_sessionfinish(session): + assertstate = getattr(session.config, "_assertstate", None) + if assertstate: + if assertstate.hook is not None: + assertstate.hook.set_session(None) + + +# Expose this plugin's implementation for the pytest_assertrepr_compare hook +pytest_assertrepr_compare = util.assertrepr_compare diff --git a/third_party/python/pytest/src/_pytest/assertion/rewrite.py b/third_party/python/pytest/src/_pytest/assertion/rewrite.py new file mode 100644 index 0000000000..eceed611ff --- /dev/null +++ b/third_party/python/pytest/src/_pytest/assertion/rewrite.py @@ -0,0 +1,954 @@ +"""Rewrite assertion AST to produce nice error messages""" +from __future__ import absolute_import, division, print_function +import ast +import errno +import itertools +import imp +import marshal +import os +import re +import six +import struct +import sys +import types + +import atomicwrites +import py + +from _pytest.assertion import util + + +# pytest caches rewritten pycs in __pycache__. +if hasattr(imp, "get_tag"): + PYTEST_TAG = imp.get_tag() + "-PYTEST" +else: + if hasattr(sys, "pypy_version_info"): + impl = "pypy" + elif sys.platform == "java": + impl = "jython" + else: + impl = "cpython" + ver = sys.version_info + PYTEST_TAG = "%s-%s%s-PYTEST" % (impl, ver[0], ver[1]) + del ver, impl + +PYC_EXT = ".py" + (__debug__ and "c" or "o") +PYC_TAIL = "." + PYTEST_TAG + PYC_EXT + +ASCII_IS_DEFAULT_ENCODING = sys.version_info[0] < 3 + +if sys.version_info >= (3, 5): + ast_Call = ast.Call +else: + + def ast_Call(a, b, c): + return ast.Call(a, b, c, None, None) + + +class AssertionRewritingHook(object): + """PEP302 Import hook which rewrites asserts.""" + + def __init__(self, config): + self.config = config + self.fnpats = config.getini("python_files") + self.session = None + self.modules = {} + self._rewritten_names = set() + self._register_with_pkg_resources() + self._must_rewrite = set() + + def set_session(self, session): + self.session = session + + def find_module(self, name, path=None): + state = self.config._assertstate + state.trace("find_module called for: %s" % name) + names = name.rsplit(".", 1) + lastname = names[-1] + pth = None + if path is not None: + # Starting with Python 3.3, path is a _NamespacePath(), which + # causes problems if not converted to list. + path = list(path) + if len(path) == 1: + pth = path[0] + if pth is None: + try: + fd, fn, desc = imp.find_module(lastname, path) + except ImportError: + return None + if fd is not None: + fd.close() + tp = desc[2] + if tp == imp.PY_COMPILED: + if hasattr(imp, "source_from_cache"): + try: + fn = imp.source_from_cache(fn) + except ValueError: + # Python 3 doesn't like orphaned but still-importable + # .pyc files. + fn = fn[:-1] + else: + fn = fn[:-1] + elif tp != imp.PY_SOURCE: + # Don't know what this is. + return None + else: + fn = os.path.join(pth, name.rpartition(".")[2] + ".py") + + fn_pypath = py.path.local(fn) + if not self._should_rewrite(name, fn_pypath, state): + return None + + self._rewritten_names.add(name) + + # The requested module looks like a test file, so rewrite it. This is + # the most magical part of the process: load the source, rewrite the + # asserts, and load the rewritten source. We also cache the rewritten + # module code in a special pyc. We must be aware of the possibility of + # concurrent pytest processes rewriting and loading pycs. To avoid + # tricky race conditions, we maintain the following invariant: The + # cached pyc is always a complete, valid pyc. Operations on it must be + # atomic. POSIX's atomic rename comes in handy. + write = not sys.dont_write_bytecode + cache_dir = os.path.join(fn_pypath.dirname, "__pycache__") + if write: + try: + os.mkdir(cache_dir) + except OSError: + e = sys.exc_info()[1].errno + if e == errno.EEXIST: + # Either the __pycache__ directory already exists (the + # common case) or it's blocked by a non-dir node. In the + # latter case, we'll ignore it in _write_pyc. + pass + elif e in [errno.ENOENT, errno.ENOTDIR]: + # One of the path components was not a directory, likely + # because we're in a zip file. + write = False + elif e in [errno.EACCES, errno.EROFS, errno.EPERM]: + state.trace("read only directory: %r" % fn_pypath.dirname) + write = False + else: + raise + cache_name = fn_pypath.basename[:-3] + PYC_TAIL + pyc = os.path.join(cache_dir, cache_name) + # Notice that even if we're in a read-only directory, I'm going + # to check for a cached pyc. This may not be optimal... + co = _read_pyc(fn_pypath, pyc, state.trace) + if co is None: + state.trace("rewriting %r" % (fn,)) + source_stat, co = _rewrite_test(self.config, fn_pypath) + if co is None: + # Probably a SyntaxError in the test. + return None + if write: + _write_pyc(state, co, source_stat, pyc) + else: + state.trace("found cached rewritten pyc for %r" % (fn,)) + self.modules[name] = co, pyc + return self + + def _should_rewrite(self, name, fn_pypath, state): + # always rewrite conftest files + fn = str(fn_pypath) + if fn_pypath.basename == "conftest.py": + state.trace("rewriting conftest file: %r" % (fn,)) + return True + + if self.session is not None: + if self.session.isinitpath(fn): + state.trace("matched test file (was specified on cmdline): %r" % (fn,)) + return True + + # modules not passed explicitly on the command line are only + # rewritten if they match the naming convention for test files + for pat in self.fnpats: + if fn_pypath.fnmatch(pat): + state.trace("matched test file %r" % (fn,)) + return True + + for marked in self._must_rewrite: + if name == marked or name.startswith(marked + "."): + state.trace("matched marked file %r (from %r)" % (name, marked)) + return True + + return False + + def mark_rewrite(self, *names): + """Mark import names as needing to be rewritten. + + The named module or package as well as any nested modules will + be rewritten on import. + """ + already_imported = ( + set(names).intersection(sys.modules).difference(self._rewritten_names) + ) + for name in already_imported: + if not AssertionRewriter.is_rewrite_disabled( + sys.modules[name].__doc__ or "" + ): + self._warn_already_imported(name) + self._must_rewrite.update(names) + + def _warn_already_imported(self, name): + self.config.warn( + "P1", "Module already imported so cannot be rewritten: %s" % name + ) + + def load_module(self, name): + # If there is an existing module object named 'fullname' in + # sys.modules, the loader must use that existing module. (Otherwise, + # the reload() builtin will not work correctly.) + if name in sys.modules: + return sys.modules[name] + + co, pyc = self.modules.pop(name) + # I wish I could just call imp.load_compiled here, but __file__ has to + # be set properly. In Python 3.2+, this all would be handled correctly + # by load_compiled. + mod = sys.modules[name] = imp.new_module(name) + try: + mod.__file__ = co.co_filename + # Normally, this attribute is 3.2+. + mod.__cached__ = pyc + mod.__loader__ = self + py.builtin.exec_(co, mod.__dict__) + except: # noqa + if name in sys.modules: + del sys.modules[name] + raise + return sys.modules[name] + + def is_package(self, name): + try: + fd, fn, desc = imp.find_module(name) + except ImportError: + return False + if fd is not None: + fd.close() + tp = desc[2] + return tp == imp.PKG_DIRECTORY + + @classmethod + def _register_with_pkg_resources(cls): + """ + Ensure package resources can be loaded from this loader. May be called + multiple times, as the operation is idempotent. + """ + try: + import pkg_resources + + # access an attribute in case a deferred importer is present + pkg_resources.__name__ + except ImportError: + return + + # Since pytest tests are always located in the file system, the + # DefaultProvider is appropriate. + pkg_resources.register_loader_type(cls, pkg_resources.DefaultProvider) + + def get_data(self, pathname): + """Optional PEP302 get_data API. + """ + with open(pathname, "rb") as f: + return f.read() + + +def _write_pyc(state, co, source_stat, pyc): + # Technically, we don't have to have the same pyc format as + # (C)Python, since these "pycs" should never be seen by builtin + # import. However, there's little reason deviate, and I hope + # sometime to be able to use imp.load_compiled to load them. (See + # the comment in load_module above.) + try: + with atomicwrites.atomic_write(pyc, mode="wb", overwrite=True) as fp: + fp.write(imp.get_magic()) + mtime = int(source_stat.mtime) + size = source_stat.size & 0xFFFFFFFF + fp.write(struct.pack("<ll", mtime, size)) + fp.write(marshal.dumps(co)) + except EnvironmentError as e: + state.trace("error writing pyc file at %s: errno=%s" % (pyc, e.errno)) + # we ignore any failure to write the cache file + # there are many reasons, permission-denied, __pycache__ being a + # file etc. + return False + return True + + +RN = "\r\n".encode("utf-8") +N = "\n".encode("utf-8") + +cookie_re = re.compile(r"^[ \t\f]*#.*coding[:=][ \t]*[-\w.]+") +BOM_UTF8 = "\xef\xbb\xbf" + + +def _rewrite_test(config, fn): + """Try to read and rewrite *fn* and return the code object.""" + state = config._assertstate + try: + stat = fn.stat() + source = fn.read("rb") + except EnvironmentError: + return None, None + if ASCII_IS_DEFAULT_ENCODING: + # ASCII is the default encoding in Python 2. Without a coding + # declaration, Python 2 will complain about any bytes in the file + # outside the ASCII range. Sadly, this behavior does not extend to + # compile() or ast.parse(), which prefer to interpret the bytes as + # latin-1. (At least they properly handle explicit coding cookies.) To + # preserve this error behavior, we could force ast.parse() to use ASCII + # as the encoding by inserting a coding cookie. Unfortunately, that + # messes up line numbers. Thus, we have to check ourselves if anything + # is outside the ASCII range in the case no encoding is explicitly + # declared. For more context, see issue #269. Yay for Python 3 which + # gets this right. + end1 = source.find("\n") + end2 = source.find("\n", end1 + 1) + if ( + not source.startswith(BOM_UTF8) + and cookie_re.match(source[0:end1]) is None + and cookie_re.match(source[end1 + 1:end2]) is None + ): + if hasattr(state, "_indecode"): + # encodings imported us again, so don't rewrite. + return None, None + state._indecode = True + try: + try: + source.decode("ascii") + except UnicodeDecodeError: + # Let it fail in real import. + return None, None + finally: + del state._indecode + try: + tree = ast.parse(source) + except SyntaxError: + # Let this pop up again in the real import. + state.trace("failed to parse: %r" % (fn,)) + return None, None + rewrite_asserts(tree, fn, config) + try: + co = compile(tree, fn.strpath, "exec", dont_inherit=True) + except SyntaxError: + # It's possible that this error is from some bug in the + # assertion rewriting, but I don't know of a fast way to tell. + state.trace("failed to compile: %r" % (fn,)) + return None, None + return stat, co + + +def _read_pyc(source, pyc, trace=lambda x: None): + """Possibly read a pytest pyc containing rewritten code. + + Return rewritten code if successful or None if not. + """ + try: + fp = open(pyc, "rb") + except IOError: + return None + with fp: + try: + mtime = int(source.mtime()) + size = source.size() + data = fp.read(12) + except EnvironmentError as e: + trace("_read_pyc(%s): EnvironmentError %s" % (source, e)) + return None + # Check for invalid or out of date pyc file. + if ( + len(data) != 12 + or data[:4] != imp.get_magic() + or struct.unpack("<ll", data[4:]) != (mtime, size) + ): + trace("_read_pyc(%s): invalid or out of date pyc" % source) + return None + try: + co = marshal.load(fp) + except Exception as e: + trace("_read_pyc(%s): marshal.load error %s" % (source, e)) + return None + if not isinstance(co, types.CodeType): + trace("_read_pyc(%s): not a code object" % source) + return None + return co + + +def rewrite_asserts(mod, module_path=None, config=None): + """Rewrite the assert statements in mod.""" + AssertionRewriter(module_path, config).run(mod) + + +def _saferepr(obj): + """Get a safe repr of an object for assertion error messages. + + The assertion formatting (util.format_explanation()) requires + newlines to be escaped since they are a special character for it. + Normally assertion.util.format_explanation() does this but for a + custom repr it is possible to contain one of the special escape + sequences, especially '\n{' and '\n}' are likely to be present in + JSON reprs. + + """ + repr = py.io.saferepr(obj) + if isinstance(repr, six.text_type): + t = six.text_type + else: + t = six.binary_type + return repr.replace(t("\n"), t("\\n")) + + +from _pytest.assertion.util import format_explanation as _format_explanation # noqa + + +def _format_assertmsg(obj): + """Format the custom assertion message given. + + For strings this simply replaces newlines with '\n~' so that + util.format_explanation() will preserve them instead of escaping + newlines. For other objects py.io.saferepr() is used first. + + """ + # reprlib appears to have a bug which means that if a string + # contains a newline it gets escaped, however if an object has a + # .__repr__() which contains newlines it does not get escaped. + # However in either case we want to preserve the newline. + if isinstance(obj, six.text_type) or isinstance(obj, six.binary_type): + s = obj + is_repr = False + else: + s = py.io.saferepr(obj) + is_repr = True + if isinstance(s, six.text_type): + t = six.text_type + else: + t = six.binary_type + s = s.replace(t("\n"), t("\n~")).replace(t("%"), t("%%")) + if is_repr: + s = s.replace(t("\\n"), t("\n~")) + return s + + +def _should_repr_global_name(obj): + return not hasattr(obj, "__name__") and not callable(obj) + + +def _format_boolop(explanations, is_or): + explanation = "(" + (is_or and " or " or " and ").join(explanations) + ")" + if isinstance(explanation, six.text_type): + t = six.text_type + else: + t = six.binary_type + return explanation.replace(t("%"), t("%%")) + + +def _call_reprcompare(ops, results, expls, each_obj): + for i, res, expl in zip(range(len(ops)), results, expls): + try: + done = not res + except Exception: + done = True + if done: + break + if util._reprcompare is not None: + custom = util._reprcompare(ops[i], each_obj[i], each_obj[i + 1]) + if custom is not None: + return custom + return expl + + +unary_map = {ast.Not: "not %s", ast.Invert: "~%s", ast.USub: "-%s", ast.UAdd: "+%s"} + +binop_map = { + ast.BitOr: "|", + ast.BitXor: "^", + ast.BitAnd: "&", + ast.LShift: "<<", + ast.RShift: ">>", + ast.Add: "+", + ast.Sub: "-", + ast.Mult: "*", + ast.Div: "/", + ast.FloorDiv: "//", + ast.Mod: "%%", # escaped for string formatting + ast.Eq: "==", + ast.NotEq: "!=", + ast.Lt: "<", + ast.LtE: "<=", + ast.Gt: ">", + ast.GtE: ">=", + ast.Pow: "**", + ast.Is: "is", + ast.IsNot: "is not", + ast.In: "in", + ast.NotIn: "not in", +} +# Python 3.5+ compatibility +try: + binop_map[ast.MatMult] = "@" +except AttributeError: + pass + +# Python 3.4+ compatibility +if hasattr(ast, "NameConstant"): + _NameConstant = ast.NameConstant +else: + + def _NameConstant(c): + return ast.Name(str(c), ast.Load()) + + +def set_location(node, lineno, col_offset): + """Set node location information recursively.""" + + def _fix(node, lineno, col_offset): + if "lineno" in node._attributes: + node.lineno = lineno + if "col_offset" in node._attributes: + node.col_offset = col_offset + for child in ast.iter_child_nodes(node): + _fix(child, lineno, col_offset) + + _fix(node, lineno, col_offset) + return node + + +class AssertionRewriter(ast.NodeVisitor): + """Assertion rewriting implementation. + + The main entrypoint is to call .run() with an ast.Module instance, + this will then find all the assert statements and rewrite them to + provide intermediate values and a detailed assertion error. See + http://pybites.blogspot.be/2011/07/behind-scenes-of-pytests-new-assertion.html + for an overview of how this works. + + The entry point here is .run() which will iterate over all the + statements in an ast.Module and for each ast.Assert statement it + finds call .visit() with it. Then .visit_Assert() takes over and + is responsible for creating new ast statements to replace the + original assert statement: it rewrites the test of an assertion + to provide intermediate values and replace it with an if statement + which raises an assertion error with a detailed explanation in + case the expression is false. + + For this .visit_Assert() uses the visitor pattern to visit all the + AST nodes of the ast.Assert.test field, each visit call returning + an AST node and the corresponding explanation string. During this + state is kept in several instance attributes: + + :statements: All the AST statements which will replace the assert + statement. + + :variables: This is populated by .variable() with each variable + used by the statements so that they can all be set to None at + the end of the statements. + + :variable_counter: Counter to create new unique variables needed + by statements. Variables are created using .variable() and + have the form of "@py_assert0". + + :on_failure: The AST statements which will be executed if the + assertion test fails. This is the code which will construct + the failure message and raises the AssertionError. + + :explanation_specifiers: A dict filled by .explanation_param() + with %-formatting placeholders and their corresponding + expressions to use in the building of an assertion message. + This is used by .pop_format_context() to build a message. + + :stack: A stack of the explanation_specifiers dicts maintained by + .push_format_context() and .pop_format_context() which allows + to build another %-formatted string while already building one. + + This state is reset on every new assert statement visited and used + by the other visitors. + + """ + + def __init__(self, module_path, config): + super(AssertionRewriter, self).__init__() + self.module_path = module_path + self.config = config + + def run(self, mod): + """Find all assert statements in *mod* and rewrite them.""" + if not mod.body: + # Nothing to do. + return + # Insert some special imports at the top of the module but after any + # docstrings and __future__ imports. + aliases = [ + ast.alias(py.builtin.builtins.__name__, "@py_builtins"), + ast.alias("_pytest.assertion.rewrite", "@pytest_ar"), + ] + doc = getattr(mod, "docstring", None) + expect_docstring = doc is None + if doc is not None and self.is_rewrite_disabled(doc): + return + pos = 0 + lineno = 1 + for item in mod.body: + if ( + expect_docstring + and isinstance(item, ast.Expr) + and isinstance(item.value, ast.Str) + ): + doc = item.value.s + if self.is_rewrite_disabled(doc): + return + expect_docstring = False + elif ( + not isinstance(item, ast.ImportFrom) + or item.level > 0 + or item.module != "__future__" + ): + lineno = item.lineno + break + pos += 1 + else: + lineno = item.lineno + imports = [ + ast.Import([alias], lineno=lineno, col_offset=0) for alias in aliases + ] + mod.body[pos:pos] = imports + # Collect asserts. + nodes = [mod] + while nodes: + node = nodes.pop() + for name, field in ast.iter_fields(node): + if isinstance(field, list): + new = [] + for i, child in enumerate(field): + if isinstance(child, ast.Assert): + # Transform assert. + new.extend(self.visit(child)) + else: + new.append(child) + if isinstance(child, ast.AST): + nodes.append(child) + setattr(node, name, new) + elif ( + isinstance(field, ast.AST) + and + # Don't recurse into expressions as they can't contain + # asserts. + not isinstance(field, ast.expr) + ): + nodes.append(field) + + @staticmethod + def is_rewrite_disabled(docstring): + return "PYTEST_DONT_REWRITE" in docstring + + def variable(self): + """Get a new variable.""" + # Use a character invalid in python identifiers to avoid clashing. + name = "@py_assert" + str(next(self.variable_counter)) + self.variables.append(name) + return name + + def assign(self, expr): + """Give *expr* a name.""" + name = self.variable() + self.statements.append(ast.Assign([ast.Name(name, ast.Store())], expr)) + return ast.Name(name, ast.Load()) + + def display(self, expr): + """Call py.io.saferepr on the expression.""" + return self.helper("saferepr", expr) + + def helper(self, name, *args): + """Call a helper in this module.""" + py_name = ast.Name("@pytest_ar", ast.Load()) + attr = ast.Attribute(py_name, "_" + name, ast.Load()) + return ast_Call(attr, list(args), []) + + def builtin(self, name): + """Return the builtin called *name*.""" + builtin_name = ast.Name("@py_builtins", ast.Load()) + return ast.Attribute(builtin_name, name, ast.Load()) + + def explanation_param(self, expr): + """Return a new named %-formatting placeholder for expr. + + This creates a %-formatting placeholder for expr in the + current formatting context, e.g. ``%(py0)s``. The placeholder + and expr are placed in the current format context so that it + can be used on the next call to .pop_format_context(). + + """ + specifier = "py" + str(next(self.variable_counter)) + self.explanation_specifiers[specifier] = expr + return "%(" + specifier + ")s" + + def push_format_context(self): + """Create a new formatting context. + + The format context is used for when an explanation wants to + have a variable value formatted in the assertion message. In + this case the value required can be added using + .explanation_param(). Finally .pop_format_context() is used + to format a string of %-formatted values as added by + .explanation_param(). + + """ + self.explanation_specifiers = {} + self.stack.append(self.explanation_specifiers) + + def pop_format_context(self, expl_expr): + """Format the %-formatted string with current format context. + + The expl_expr should be an ast.Str instance constructed from + the %-placeholders created by .explanation_param(). This will + add the required code to format said string to .on_failure and + return the ast.Name instance of the formatted string. + + """ + current = self.stack.pop() + if self.stack: + self.explanation_specifiers = self.stack[-1] + keys = [ast.Str(key) for key in current.keys()] + format_dict = ast.Dict(keys, list(current.values())) + form = ast.BinOp(expl_expr, ast.Mod(), format_dict) + name = "@py_format" + str(next(self.variable_counter)) + self.on_failure.append(ast.Assign([ast.Name(name, ast.Store())], form)) + return ast.Name(name, ast.Load()) + + def generic_visit(self, node): + """Handle expressions we don't have custom code for.""" + assert isinstance(node, ast.expr) + res = self.assign(node) + return res, self.explanation_param(self.display(res)) + + def visit_Assert(self, assert_): + """Return the AST statements to replace the ast.Assert instance. + + This rewrites the test of an assertion to provide + intermediate values and replace it with an if statement which + raises an assertion error with a detailed explanation in case + the expression is false. + + """ + if isinstance(assert_.test, ast.Tuple) and self.config is not None: + fslocation = (self.module_path, assert_.lineno) + self.config.warn( + "R1", + "assertion is always true, perhaps " "remove parentheses?", + fslocation=fslocation, + ) + self.statements = [] + self.variables = [] + self.variable_counter = itertools.count() + self.stack = [] + self.on_failure = [] + self.push_format_context() + # Rewrite assert into a bunch of statements. + top_condition, explanation = self.visit(assert_.test) + # Create failure message. + body = self.on_failure + negation = ast.UnaryOp(ast.Not(), top_condition) + self.statements.append(ast.If(negation, body, [])) + if assert_.msg: + assertmsg = self.helper("format_assertmsg", assert_.msg) + explanation = "\n>assert " + explanation + else: + assertmsg = ast.Str("") + explanation = "assert " + explanation + template = ast.BinOp(assertmsg, ast.Add(), ast.Str(explanation)) + msg = self.pop_format_context(template) + fmt = self.helper("format_explanation", msg) + err_name = ast.Name("AssertionError", ast.Load()) + exc = ast_Call(err_name, [fmt], []) + if sys.version_info[0] >= 3: + raise_ = ast.Raise(exc, None) + else: + raise_ = ast.Raise(exc, None, None) + body.append(raise_) + # Clear temporary variables by setting them to None. + if self.variables: + variables = [ast.Name(name, ast.Store()) for name in self.variables] + clear = ast.Assign(variables, _NameConstant(None)) + self.statements.append(clear) + # Fix line numbers. + for stmt in self.statements: + set_location(stmt, assert_.lineno, assert_.col_offset) + return self.statements + + def visit_Name(self, name): + # Display the repr of the name if it's a local variable or + # _should_repr_global_name() thinks it's acceptable. + locs = ast_Call(self.builtin("locals"), [], []) + inlocs = ast.Compare(ast.Str(name.id), [ast.In()], [locs]) + dorepr = self.helper("should_repr_global_name", name) + test = ast.BoolOp(ast.Or(), [inlocs, dorepr]) + expr = ast.IfExp(test, self.display(name), ast.Str(name.id)) + return name, self.explanation_param(expr) + + def visit_BoolOp(self, boolop): + res_var = self.variable() + expl_list = self.assign(ast.List([], ast.Load())) + app = ast.Attribute(expl_list, "append", ast.Load()) + is_or = int(isinstance(boolop.op, ast.Or)) + body = save = self.statements + fail_save = self.on_failure + levels = len(boolop.values) - 1 + self.push_format_context() + # Process each operand, short-circuting if needed. + for i, v in enumerate(boolop.values): + if i: + fail_inner = [] + # cond is set in a prior loop iteration below + self.on_failure.append(ast.If(cond, fail_inner, [])) # noqa + self.on_failure = fail_inner + self.push_format_context() + res, expl = self.visit(v) + body.append(ast.Assign([ast.Name(res_var, ast.Store())], res)) + expl_format = self.pop_format_context(ast.Str(expl)) + call = ast_Call(app, [expl_format], []) + self.on_failure.append(ast.Expr(call)) + if i < levels: + cond = res + if is_or: + cond = ast.UnaryOp(ast.Not(), cond) + inner = [] + self.statements.append(ast.If(cond, inner, [])) + self.statements = body = inner + self.statements = save + self.on_failure = fail_save + expl_template = self.helper("format_boolop", expl_list, ast.Num(is_or)) + expl = self.pop_format_context(expl_template) + return ast.Name(res_var, ast.Load()), self.explanation_param(expl) + + def visit_UnaryOp(self, unary): + pattern = unary_map[unary.op.__class__] + operand_res, operand_expl = self.visit(unary.operand) + res = self.assign(ast.UnaryOp(unary.op, operand_res)) + return res, pattern % (operand_expl,) + + def visit_BinOp(self, binop): + symbol = binop_map[binop.op.__class__] + left_expr, left_expl = self.visit(binop.left) + right_expr, right_expl = self.visit(binop.right) + explanation = "(%s %s %s)" % (left_expl, symbol, right_expl) + res = self.assign(ast.BinOp(left_expr, binop.op, right_expr)) + return res, explanation + + def visit_Call_35(self, call): + """ + visit `ast.Call` nodes on Python3.5 and after + """ + new_func, func_expl = self.visit(call.func) + arg_expls = [] + new_args = [] + new_kwargs = [] + for arg in call.args: + res, expl = self.visit(arg) + arg_expls.append(expl) + new_args.append(res) + for keyword in call.keywords: + res, expl = self.visit(keyword.value) + new_kwargs.append(ast.keyword(keyword.arg, res)) + if keyword.arg: + arg_expls.append(keyword.arg + "=" + expl) + else: # **args have `arg` keywords with an .arg of None + arg_expls.append("**" + expl) + + expl = "%s(%s)" % (func_expl, ", ".join(arg_expls)) + new_call = ast.Call(new_func, new_args, new_kwargs) + res = self.assign(new_call) + res_expl = self.explanation_param(self.display(res)) + outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl) + return res, outer_expl + + def visit_Starred(self, starred): + # From Python 3.5, a Starred node can appear in a function call + res, expl = self.visit(starred.value) + return starred, "*" + expl + + def visit_Call_legacy(self, call): + """ + visit `ast.Call nodes on 3.4 and below` + """ + new_func, func_expl = self.visit(call.func) + arg_expls = [] + new_args = [] + new_kwargs = [] + new_star = new_kwarg = None + for arg in call.args: + res, expl = self.visit(arg) + new_args.append(res) + arg_expls.append(expl) + for keyword in call.keywords: + res, expl = self.visit(keyword.value) + new_kwargs.append(ast.keyword(keyword.arg, res)) + arg_expls.append(keyword.arg + "=" + expl) + if call.starargs: + new_star, expl = self.visit(call.starargs) + arg_expls.append("*" + expl) + if call.kwargs: + new_kwarg, expl = self.visit(call.kwargs) + arg_expls.append("**" + expl) + expl = "%s(%s)" % (func_expl, ", ".join(arg_expls)) + new_call = ast.Call(new_func, new_args, new_kwargs, new_star, new_kwarg) + res = self.assign(new_call) + res_expl = self.explanation_param(self.display(res)) + outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl) + return res, outer_expl + + # ast.Call signature changed on 3.5, + # conditionally change which methods is named + # visit_Call depending on Python version + if sys.version_info >= (3, 5): + visit_Call = visit_Call_35 + else: + visit_Call = visit_Call_legacy + + def visit_Attribute(self, attr): + if not isinstance(attr.ctx, ast.Load): + return self.generic_visit(attr) + value, value_expl = self.visit(attr.value) + res = self.assign(ast.Attribute(value, attr.attr, ast.Load())) + res_expl = self.explanation_param(self.display(res)) + pat = "%s\n{%s = %s.%s\n}" + expl = pat % (res_expl, res_expl, value_expl, attr.attr) + return res, expl + + def visit_Compare(self, comp): + self.push_format_context() + left_res, left_expl = self.visit(comp.left) + if isinstance(comp.left, (ast.Compare, ast.BoolOp)): + left_expl = "({})".format(left_expl) + res_variables = [self.variable() for i in range(len(comp.ops))] + load_names = [ast.Name(v, ast.Load()) for v in res_variables] + store_names = [ast.Name(v, ast.Store()) for v in res_variables] + it = zip(range(len(comp.ops)), comp.ops, comp.comparators) + expls = [] + syms = [] + results = [left_res] + for i, op, next_operand in it: + next_res, next_expl = self.visit(next_operand) + if isinstance(next_operand, (ast.Compare, ast.BoolOp)): + next_expl = "({})".format(next_expl) + results.append(next_res) + sym = binop_map[op.__class__] + syms.append(ast.Str(sym)) + expl = "%s %s %s" % (left_expl, sym, next_expl) + expls.append(ast.Str(expl)) + res_expr = ast.Compare(left_res, [op], [next_res]) + self.statements.append(ast.Assign([store_names[i]], res_expr)) + left_res, left_expl = next_res, next_expl + # Use pytest.assertion.util._reprcompare if that's available. + expl_call = self.helper( + "call_reprcompare", + ast.Tuple(syms, ast.Load()), + ast.Tuple(load_names, ast.Load()), + ast.Tuple(expls, ast.Load()), + ast.Tuple(results, ast.Load()), + ) + if len(comp.ops) > 1: + res = ast.BoolOp(ast.And(), load_names) + else: + res = load_names[0] + return res, self.explanation_param(self.pop_format_context(expl_call)) diff --git a/third_party/python/pytest/src/_pytest/assertion/truncate.py b/third_party/python/pytest/src/_pytest/assertion/truncate.py new file mode 100644 index 0000000000..79adeca6a9 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/assertion/truncate.py @@ -0,0 +1,99 @@ +""" +Utilities for truncating assertion output. + +Current default behaviour is to truncate assertion explanations at +~8 terminal lines, unless running in "-vv" mode or running on CI. +""" +from __future__ import absolute_import, division, print_function +import os + +import six + + +DEFAULT_MAX_LINES = 8 +DEFAULT_MAX_CHARS = 8 * 80 +USAGE_MSG = "use '-vv' to show" + + +def truncate_if_required(explanation, item, max_length=None): + """ + Truncate this assertion explanation if the given test item is eligible. + """ + if _should_truncate_item(item): + return _truncate_explanation(explanation) + return explanation + + +def _should_truncate_item(item): + """ + Whether or not this test item is eligible for truncation. + """ + verbose = item.config.option.verbose + return verbose < 2 and not _running_on_ci() + + +def _running_on_ci(): + """Check if we're currently running on a CI system.""" + env_vars = ["CI", "BUILD_NUMBER"] + return any(var in os.environ for var in env_vars) + + +def _truncate_explanation(input_lines, max_lines=None, max_chars=None): + """ + Truncate given list of strings that makes up the assertion explanation. + + Truncates to either 8 lines, or 640 characters - whichever the input reaches + first. The remaining lines will be replaced by a usage message. + """ + + if max_lines is None: + max_lines = DEFAULT_MAX_LINES + if max_chars is None: + max_chars = DEFAULT_MAX_CHARS + + # Check if truncation required + input_char_count = len("".join(input_lines)) + if len(input_lines) <= max_lines and input_char_count <= max_chars: + return input_lines + + # Truncate first to max_lines, and then truncate to max_chars if max_chars + # is exceeded. + truncated_explanation = input_lines[:max_lines] + truncated_explanation = _truncate_by_char_count(truncated_explanation, max_chars) + + # Add ellipsis to final line + truncated_explanation[-1] = truncated_explanation[-1] + "..." + + # Append useful message to explanation + truncated_line_count = len(input_lines) - len(truncated_explanation) + truncated_line_count += 1 # Account for the part-truncated final line + msg = "...Full output truncated" + if truncated_line_count == 1: + msg += " ({} line hidden)".format(truncated_line_count) + else: + msg += " ({} lines hidden)".format(truncated_line_count) + msg += ", {}".format(USAGE_MSG) + truncated_explanation.extend([six.text_type(""), six.text_type(msg)]) + return truncated_explanation + + +def _truncate_by_char_count(input_lines, max_chars): + # Check if truncation required + if len("".join(input_lines)) <= max_chars: + return input_lines + + # Find point at which input length exceeds total allowed length + iterated_char_count = 0 + for iterated_index, input_line in enumerate(input_lines): + if iterated_char_count + len(input_line) > max_chars: + break + iterated_char_count += len(input_line) + + # Create truncated explanation with modified final line + truncated_result = input_lines[:iterated_index] + final_line = input_lines[iterated_index] + if final_line: + final_line_truncate_point = max_chars - iterated_char_count + final_line = final_line[:final_line_truncate_point] + truncated_result.append(final_line) + return truncated_result diff --git a/third_party/python/pytest/src/_pytest/assertion/util.py b/third_party/python/pytest/src/_pytest/assertion/util.py new file mode 100644 index 0000000000..bcb800a4a0 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/assertion/util.py @@ -0,0 +1,338 @@ +"""Utilities for assertion debugging""" +from __future__ import absolute_import, division, print_function +import pprint + +import _pytest._code +import py +import six +from ..compat import Sequence + +u = six.text_type + +# The _reprcompare attribute on the util module is used by the new assertion +# interpretation code and assertion rewriter to detect this plugin was +# loaded and in turn call the hooks defined here as part of the +# DebugInterpreter. +_reprcompare = None + + +# the re-encoding is needed for python2 repr +# with non-ascii characters (see issue 877 and 1379) +def ecu(s): + try: + return u(s, "utf-8", "replace") + except TypeError: + return s + + +def format_explanation(explanation): + """This formats an explanation + + Normally all embedded newlines are escaped, however there are + three exceptions: \n{, \n} and \n~. The first two are intended + cover nested explanations, see function and attribute explanations + for examples (.visit_Call(), visit_Attribute()). The last one is + for when one explanation needs to span multiple lines, e.g. when + displaying diffs. + """ + explanation = ecu(explanation) + lines = _split_explanation(explanation) + result = _format_lines(lines) + return u("\n").join(result) + + +def _split_explanation(explanation): + """Return a list of individual lines in the explanation + + This will return a list of lines split on '\n{', '\n}' and '\n~'. + Any other newlines will be escaped and appear in the line as the + literal '\n' characters. + """ + raw_lines = (explanation or u("")).split("\n") + lines = [raw_lines[0]] + for values in raw_lines[1:]: + if values and values[0] in ["{", "}", "~", ">"]: + lines.append(values) + else: + lines[-1] += "\\n" + values + return lines + + +def _format_lines(lines): + """Format the individual lines + + This will replace the '{', '}' and '~' characters of our mini + formatting language with the proper 'where ...', 'and ...' and ' + + ...' text, taking care of indentation along the way. + + Return a list of formatted lines. + """ + result = lines[:1] + stack = [0] + stackcnt = [0] + for line in lines[1:]: + if line.startswith("{"): + if stackcnt[-1]: + s = u("and ") + else: + s = u("where ") + stack.append(len(result)) + stackcnt[-1] += 1 + stackcnt.append(0) + result.append(u(" +") + u(" ") * (len(stack) - 1) + s + line[1:]) + elif line.startswith("}"): + stack.pop() + stackcnt.pop() + result[stack[-1]] += line[1:] + else: + assert line[0] in ["~", ">"] + stack[-1] += 1 + indent = len(stack) if line.startswith("~") else len(stack) - 1 + result.append(u(" ") * indent + line[1:]) + assert len(stack) == 1 + return result + + +# Provide basestring in python3 +try: + basestring = basestring +except NameError: + basestring = str + + +def assertrepr_compare(config, op, left, right): + """Return specialised explanations for some operators/operands""" + width = 80 - 15 - len(op) - 2 # 15 chars indentation, 1 space around op + left_repr = py.io.saferepr(left, maxsize=int(width // 2)) + right_repr = py.io.saferepr(right, maxsize=width - len(left_repr)) + + summary = u("%s %s %s") % (ecu(left_repr), op, ecu(right_repr)) + + def issequence(x): + return isinstance(x, Sequence) and not isinstance(x, basestring) + + def istext(x): + return isinstance(x, basestring) + + def isdict(x): + return isinstance(x, dict) + + def isset(x): + return isinstance(x, (set, frozenset)) + + def isiterable(obj): + try: + iter(obj) + return not istext(obj) + except TypeError: + return False + + verbose = config.getoption("verbose") + explanation = None + try: + if op == "==": + if istext(left) and istext(right): + explanation = _diff_text(left, right, verbose) + else: + if issequence(left) and issequence(right): + explanation = _compare_eq_sequence(left, right, verbose) + elif isset(left) and isset(right): + explanation = _compare_eq_set(left, right, verbose) + elif isdict(left) and isdict(right): + explanation = _compare_eq_dict(left, right, verbose) + if isiterable(left) and isiterable(right): + expl = _compare_eq_iterable(left, right, verbose) + if explanation is not None: + explanation.extend(expl) + else: + explanation = expl + elif op == "not in": + if istext(left) and istext(right): + explanation = _notin_text(left, right, verbose) + except Exception: + explanation = [ + u( + "(pytest_assertion plugin: representation of details failed. " + "Probably an object has a faulty __repr__.)" + ), + u(_pytest._code.ExceptionInfo()), + ] + + if not explanation: + return None + + return [summary] + explanation + + +def _diff_text(left, right, verbose=False): + """Return the explanation for the diff between text or bytes + + Unless --verbose is used this will skip leading and trailing + characters which are identical to keep the diff minimal. + + If the input are bytes they will be safely converted to text. + """ + from difflib import ndiff + + explanation = [] + + def escape_for_readable_diff(binary_text): + """ + Ensures that the internal string is always valid unicode, converting any bytes safely to valid unicode. + This is done using repr() which then needs post-processing to fix the encompassing quotes and un-escape + newlines and carriage returns (#429). + """ + r = six.text_type(repr(binary_text)[1:-1]) + r = r.replace(r"\n", "\n") + r = r.replace(r"\r", "\r") + return r + + if isinstance(left, six.binary_type): + left = escape_for_readable_diff(left) + if isinstance(right, six.binary_type): + right = escape_for_readable_diff(right) + if not verbose: + i = 0 # just in case left or right has zero length + for i in range(min(len(left), len(right))): + if left[i] != right[i]: + break + if i > 42: + i -= 10 # Provide some context + explanation = [ + u("Skipping %s identical leading " "characters in diff, use -v to show") + % i + ] + left = left[i:] + right = right[i:] + if len(left) == len(right): + for i in range(len(left)): + if left[-i] != right[-i]: + break + if i > 42: + i -= 10 # Provide some context + explanation += [ + u( + "Skipping %s identical trailing " + "characters in diff, use -v to show" + ) + % i + ] + left = left[:-i] + right = right[:-i] + keepends = True + if left.isspace() or right.isspace(): + left = repr(str(left)) + right = repr(str(right)) + explanation += [u"Strings contain only whitespace, escaping them using repr()"] + explanation += [ + line.strip("\n") + for line in ndiff(left.splitlines(keepends), right.splitlines(keepends)) + ] + return explanation + + +def _compare_eq_iterable(left, right, verbose=False): + if not verbose: + return [u("Use -v to get the full diff")] + # dynamic import to speedup pytest + import difflib + + try: + left_formatting = pprint.pformat(left).splitlines() + right_formatting = pprint.pformat(right).splitlines() + explanation = [u("Full diff:")] + except Exception: + # hack: PrettyPrinter.pformat() in python 2 fails when formatting items that can't be sorted(), ie, calling + # sorted() on a list would raise. See issue #718. + # As a workaround, the full diff is generated by using the repr() string of each item of each container. + left_formatting = sorted(repr(x) for x in left) + right_formatting = sorted(repr(x) for x in right) + explanation = [u("Full diff (fallback to calling repr on each item):")] + explanation.extend( + line.strip() for line in difflib.ndiff(left_formatting, right_formatting) + ) + return explanation + + +def _compare_eq_sequence(left, right, verbose=False): + explanation = [] + for i in range(min(len(left), len(right))): + if left[i] != right[i]: + explanation += [u("At index %s diff: %r != %r") % (i, left[i], right[i])] + break + if len(left) > len(right): + explanation += [ + u("Left contains more items, first extra item: %s") + % py.io.saferepr(left[len(right)]) + ] + elif len(left) < len(right): + explanation += [ + u("Right contains more items, first extra item: %s") + % py.io.saferepr(right[len(left)]) + ] + return explanation + + +def _compare_eq_set(left, right, verbose=False): + explanation = [] + diff_left = left - right + diff_right = right - left + if diff_left: + explanation.append(u("Extra items in the left set:")) + for item in diff_left: + explanation.append(py.io.saferepr(item)) + if diff_right: + explanation.append(u("Extra items in the right set:")) + for item in diff_right: + explanation.append(py.io.saferepr(item)) + return explanation + + +def _compare_eq_dict(left, right, verbose=False): + explanation = [] + common = set(left).intersection(set(right)) + same = {k: left[k] for k in common if left[k] == right[k]} + if same and verbose < 2: + explanation += [u("Omitting %s identical items, use -vv to show") % len(same)] + elif same: + explanation += [u("Common items:")] + explanation += pprint.pformat(same).splitlines() + diff = {k for k in common if left[k] != right[k]} + if diff: + explanation += [u("Differing items:")] + for k in diff: + explanation += [ + py.io.saferepr({k: left[k]}) + " != " + py.io.saferepr({k: right[k]}) + ] + extra_left = set(left) - set(right) + if extra_left: + explanation.append(u("Left contains more items:")) + explanation.extend( + pprint.pformat({k: left[k] for k in extra_left}).splitlines() + ) + extra_right = set(right) - set(left) + if extra_right: + explanation.append(u("Right contains more items:")) + explanation.extend( + pprint.pformat({k: right[k] for k in extra_right}).splitlines() + ) + return explanation + + +def _notin_text(term, text, verbose=False): + index = text.find(term) + head = text[:index] + tail = text[index + len(term):] + correct_text = head + tail + diff = _diff_text(correct_text, text, verbose) + newdiff = [u("%s is contained here:") % py.io.saferepr(term, maxsize=42)] + for line in diff: + if line.startswith(u("Skipping")): + continue + if line.startswith(u("- ")): + continue + if line.startswith(u("+ ")): + newdiff.append(u(" ") + line[2:]) + else: + newdiff.append(line) + return newdiff diff --git a/third_party/python/pytest/src/_pytest/cacheprovider.py b/third_party/python/pytest/src/_pytest/cacheprovider.py new file mode 100755 index 0000000000..eb0fcc06f9 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/cacheprovider.py @@ -0,0 +1,339 @@ +""" +merged implementation of the cache provider + +the name cache was not chosen to ensure pluggy automatically +ignores the external pytest-cache +""" +from __future__ import absolute_import, division, print_function + +from collections import OrderedDict + +import py +import six + +import pytest +import json +import os +from os.path import sep as _sep, altsep as _altsep + + +class Cache(object): + + def __init__(self, config): + self.config = config + self._cachedir = Cache.cache_dir_from_config(config) + self.trace = config.trace.root.get("cache") + if config.getoption("cacheclear"): + self.trace("clearing cachedir") + if self._cachedir.check(): + self._cachedir.remove() + self._cachedir.mkdir() + + @staticmethod + def cache_dir_from_config(config): + cache_dir = config.getini("cache_dir") + cache_dir = os.path.expanduser(cache_dir) + cache_dir = os.path.expandvars(cache_dir) + if os.path.isabs(cache_dir): + return py.path.local(cache_dir) + else: + return config.rootdir.join(cache_dir) + + def makedir(self, name): + """ return a directory path object with the given name. If the + directory does not yet exist, it will be created. You can use it + to manage files likes e. g. store/retrieve database + dumps across test sessions. + + :param name: must be a string not containing a ``/`` separator. + Make sure the name contains your plugin or application + identifiers to prevent clashes with other cache users. + """ + if _sep in name or _altsep is not None and _altsep in name: + raise ValueError("name is not allowed to contain path separators") + return self._cachedir.ensure_dir("d", name) + + def _getvaluepath(self, key): + return self._cachedir.join("v", *key.split("/")) + + def get(self, key, default): + """ return cached value for the given key. If no value + was yet cached or the value cannot be read, the specified + default is returned. + + :param key: must be a ``/`` separated value. Usually the first + name is the name of your plugin or your application. + :param default: must be provided in case of a cache-miss or + invalid cache values. + + """ + path = self._getvaluepath(key) + if path.check(): + try: + with path.open("r") as f: + return json.load(f) + except ValueError: + self.trace("cache-invalid at %s" % (path,)) + return default + + def set(self, key, value): + """ save value for the given key. + + :param key: must be a ``/`` separated value. Usually the first + name is the name of your plugin or your application. + :param value: must be of any combination of basic + python types, including nested types + like e. g. lists of dictionaries. + """ + path = self._getvaluepath(key) + try: + path.dirpath().ensure_dir() + except (py.error.EEXIST, py.error.EACCES): + self.config.warn( + code="I9", message="could not create cache path %s" % (path,) + ) + return + try: + f = path.open("w") + except py.error.ENOTDIR: + self.config.warn( + code="I9", message="cache could not write path %s" % (path,) + ) + else: + with f: + self.trace("cache-write %s: %r" % (key, value)) + json.dump(value, f, indent=2, sort_keys=True) + + +class LFPlugin(object): + """ Plugin which implements the --lf (run last-failing) option """ + + def __init__(self, config): + self.config = config + active_keys = "lf", "failedfirst" + self.active = any(config.getoption(key) for key in active_keys) + self.lastfailed = config.cache.get("cache/lastfailed", {}) + self._previously_failed_count = None + self._no_failures_behavior = self.config.getoption("last_failed_no_failures") + + def pytest_report_collectionfinish(self): + if self.active: + if not self._previously_failed_count: + mode = "run {} (no recorded failures)".format( + self._no_failures_behavior + ) + else: + noun = "failure" if self._previously_failed_count == 1 else "failures" + suffix = " first" if self.config.getoption("failedfirst") else "" + mode = "rerun previous {count} {noun}{suffix}".format( + count=self._previously_failed_count, suffix=suffix, noun=noun + ) + return "run-last-failure: %s" % mode + + def pytest_runtest_logreport(self, report): + if (report.when == "call" and report.passed) or report.skipped: + self.lastfailed.pop(report.nodeid, None) + elif report.failed: + self.lastfailed[report.nodeid] = True + + def pytest_collectreport(self, report): + passed = report.outcome in ("passed", "skipped") + if passed: + if report.nodeid in self.lastfailed: + self.lastfailed.pop(report.nodeid) + self.lastfailed.update((item.nodeid, True) for item in report.result) + else: + self.lastfailed[report.nodeid] = True + + def pytest_collection_modifyitems(self, session, config, items): + if self.active: + if self.lastfailed: + previously_failed = [] + previously_passed = [] + for item in items: + if item.nodeid in self.lastfailed: + previously_failed.append(item) + else: + previously_passed.append(item) + self._previously_failed_count = len(previously_failed) + if not previously_failed: + # running a subset of all tests with recorded failures outside + # of the set of tests currently executing + return + if self.config.getoption("lf"): + items[:] = previously_failed + config.hook.pytest_deselected(items=previously_passed) + else: + items[:] = previously_failed + previously_passed + elif self._no_failures_behavior == "none": + config.hook.pytest_deselected(items=items) + items[:] = [] + + def pytest_sessionfinish(self, session): + config = self.config + if config.getoption("cacheshow") or hasattr(config, "slaveinput"): + return + + saved_lastfailed = config.cache.get("cache/lastfailed", {}) + if saved_lastfailed != self.lastfailed: + config.cache.set("cache/lastfailed", self.lastfailed) + + +class NFPlugin(object): + """ Plugin which implements the --nf (run new-first) option """ + + def __init__(self, config): + self.config = config + self.active = config.option.newfirst + self.cached_nodeids = config.cache.get("cache/nodeids", []) + + def pytest_collection_modifyitems(self, session, config, items): + if self.active: + new_items = OrderedDict() + other_items = OrderedDict() + for item in items: + if item.nodeid not in self.cached_nodeids: + new_items[item.nodeid] = item + else: + other_items[item.nodeid] = item + + items[:] = self._get_increasing_order( + six.itervalues(new_items) + ) + self._get_increasing_order( + six.itervalues(other_items) + ) + self.cached_nodeids = [x.nodeid for x in items if isinstance(x, pytest.Item)] + + def _get_increasing_order(self, items): + return sorted(items, key=lambda item: item.fspath.mtime(), reverse=True) + + def pytest_sessionfinish(self, session): + config = self.config + if config.getoption("cacheshow") or hasattr(config, "slaveinput"): + return + + config.cache.set("cache/nodeids", self.cached_nodeids) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--lf", + "--last-failed", + action="store_true", + dest="lf", + help="rerun only the tests that failed " + "at the last run (or all if none failed)", + ) + group.addoption( + "--ff", + "--failed-first", + action="store_true", + dest="failedfirst", + help="run all tests but run the last failures first. " + "This may re-order tests and thus lead to " + "repeated fixture setup/teardown", + ) + group.addoption( + "--nf", + "--new-first", + action="store_true", + dest="newfirst", + help="run tests from new files first, then the rest of the tests " + "sorted by file mtime", + ) + group.addoption( + "--cache-show", + action="store_true", + dest="cacheshow", + help="show cache contents, don't perform collection or tests", + ) + group.addoption( + "--cache-clear", + action="store_true", + dest="cacheclear", + help="remove all cache contents at start of test run.", + ) + parser.addini("cache_dir", default=".pytest_cache", help="cache directory path.") + group.addoption( + "--lfnf", + "--last-failed-no-failures", + action="store", + dest="last_failed_no_failures", + choices=("all", "none"), + default="all", + help="change the behavior when no test failed in the last run or no " + "information about the last failures was found in the cache", + ) + + +def pytest_cmdline_main(config): + if config.option.cacheshow: + from _pytest.main import wrap_session + + return wrap_session(config, cacheshow) + + +@pytest.hookimpl(tryfirst=True) +def pytest_configure(config): + config.cache = Cache(config) + config.pluginmanager.register(LFPlugin(config), "lfplugin") + config.pluginmanager.register(NFPlugin(config), "nfplugin") + + +@pytest.fixture +def cache(request): + """ + Return a cache object that can persist state between testing sessions. + + cache.get(key, default) + cache.set(key, value) + + Keys must be a ``/`` separated value, where the first part is usually the + name of your plugin or application to avoid clashes with other cache users. + + Values can be any object handled by the json stdlib module. + """ + return request.config.cache + + +def pytest_report_header(config): + if config.option.verbose: + relpath = py.path.local().bestrelpath(config.cache._cachedir) + return "cachedir: %s" % relpath + + +def cacheshow(config, session): + from pprint import pprint + + tw = py.io.TerminalWriter() + tw.line("cachedir: " + str(config.cache._cachedir)) + if not config.cache._cachedir.check(): + tw.line("cache is empty") + return 0 + dummy = object() + basedir = config.cache._cachedir + vdir = basedir.join("v") + tw.sep("-", "cache values") + for valpath in sorted(vdir.visit(lambda x: x.isfile())): + key = valpath.relto(vdir).replace(valpath.sep, "/") + val = config.cache.get(key, dummy) + if val is dummy: + tw.line("%s contains unreadable content, " "will be ignored" % key) + else: + tw.line("%s contains:" % key) + stream = py.io.TextIO() + pprint(val, stream=stream) + for line in stream.getvalue().splitlines(): + tw.line(" " + line) + + ddir = basedir.join("d") + if ddir.isdir() and ddir.listdir(): + tw.sep("-", "cache directories") + for p in sorted(basedir.join("d").visit()): + # if p.check(dir=1): + # print("%s/" % p.relto(basedir)) + if p.isfile(): + key = p.relto(basedir) + tw.line("%s is a file of length %d" % (key, p.size())) + return 0 diff --git a/third_party/python/pytest/src/_pytest/capture.py b/third_party/python/pytest/src/_pytest/capture.py new file mode 100644 index 0000000000..7a57adb752 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/capture.py @@ -0,0 +1,724 @@ +""" +per-test stdout/stderr capturing mechanism. + +""" +from __future__ import absolute_import, division, print_function + +import collections +import contextlib +import sys +import os +import io +from io import UnsupportedOperation +from tempfile import TemporaryFile + +import six +import pytest +from _pytest.compat import CaptureIO + + +patchsysdict = {0: "stdin", 1: "stdout", 2: "stderr"} + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + "--capture", + action="store", + default="fd" if hasattr(os, "dup") else "sys", + metavar="method", + choices=["fd", "sys", "no"], + help="per-test capturing method: one of fd|sys|no.", + ) + group._addoption( + "-s", + action="store_const", + const="no", + dest="capture", + help="shortcut for --capture=no.", + ) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_load_initial_conftests(early_config, parser, args): + ns = early_config.known_args_namespace + if ns.capture == "fd": + _py36_windowsconsoleio_workaround(sys.stdout) + _colorama_workaround() + _readline_workaround() + pluginmanager = early_config.pluginmanager + capman = CaptureManager(ns.capture) + pluginmanager.register(capman, "capturemanager") + + # make sure that capturemanager is properly reset at final shutdown + early_config.add_cleanup(capman.stop_global_capturing) + + # make sure logging does not raise exceptions at the end + def silence_logging_at_shutdown(): + if "logging" in sys.modules: + sys.modules["logging"].raiseExceptions = False + + early_config.add_cleanup(silence_logging_at_shutdown) + + # finally trigger conftest loading but while capturing (issue93) + capman.start_global_capturing() + outcome = yield + out, err = capman.suspend_global_capture() + if outcome.excinfo is not None: + sys.stdout.write(out) + sys.stderr.write(err) + + +class CaptureManager(object): + """ + Capture plugin, manages that the appropriate capture method is enabled/disabled during collection and each + test phase (setup, call, teardown). After each of those points, the captured output is obtained and + attached to the collection/runtest report. + + There are two levels of capture: + * global: which is enabled by default and can be suppressed by the ``-s`` option. This is always enabled/disabled + during collection and each test phase. + * fixture: when a test function or one of its fixture depend on the ``capsys`` or ``capfd`` fixtures. In this + case special handling is needed to ensure the fixtures take precedence over the global capture. + """ + + def __init__(self, method): + self._method = method + self._global_capturing = None + + def _getcapture(self, method): + if method == "fd": + return MultiCapture(out=True, err=True, Capture=FDCapture) + elif method == "sys": + return MultiCapture(out=True, err=True, Capture=SysCapture) + elif method == "no": + return MultiCapture(out=False, err=False, in_=False) + else: + raise ValueError("unknown capturing method: %r" % method) + + def start_global_capturing(self): + assert self._global_capturing is None + self._global_capturing = self._getcapture(self._method) + self._global_capturing.start_capturing() + + def stop_global_capturing(self): + if self._global_capturing is not None: + self._global_capturing.pop_outerr_to_orig() + self._global_capturing.stop_capturing() + self._global_capturing = None + + def resume_global_capture(self): + self._global_capturing.resume_capturing() + + def suspend_global_capture(self, item=None, in_=False): + if item is not None: + self.deactivate_fixture(item) + cap = getattr(self, "_global_capturing", None) + if cap is not None: + try: + outerr = cap.readouterr() + finally: + cap.suspend_capturing(in_=in_) + return outerr + + def activate_fixture(self, item): + """If the current item is using ``capsys`` or ``capfd``, activate them so they take precedence over + the global capture. + """ + fixture = getattr(item, "_capture_fixture", None) + if fixture is not None: + fixture._start() + + def deactivate_fixture(self, item): + """Deactivates the ``capsys`` or ``capfd`` fixture of this item, if any.""" + fixture = getattr(item, "_capture_fixture", None) + if fixture is not None: + fixture.close() + + @pytest.hookimpl(hookwrapper=True) + def pytest_make_collect_report(self, collector): + if isinstance(collector, pytest.File): + self.resume_global_capture() + outcome = yield + out, err = self.suspend_global_capture() + rep = outcome.get_result() + if out: + rep.sections.append(("Captured stdout", out)) + if err: + rep.sections.append(("Captured stderr", err)) + else: + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_setup(self, item): + self.resume_global_capture() + # no need to activate a capture fixture because they activate themselves during creation; this + # only makes sense when a fixture uses a capture fixture, otherwise the capture fixture will + # be activated during pytest_runtest_call + yield + self.suspend_capture_item(item, "setup") + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_call(self, item): + self.resume_global_capture() + # it is important to activate this fixture during the call phase so it overwrites the "global" + # capture + self.activate_fixture(item) + yield + self.suspend_capture_item(item, "call") + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_teardown(self, item): + self.resume_global_capture() + self.activate_fixture(item) + yield + self.suspend_capture_item(item, "teardown") + + @pytest.hookimpl(tryfirst=True) + def pytest_keyboard_interrupt(self, excinfo): + self.stop_global_capturing() + + @pytest.hookimpl(tryfirst=True) + def pytest_internalerror(self, excinfo): + self.stop_global_capturing() + + def suspend_capture_item(self, item, when, in_=False): + out, err = self.suspend_global_capture(item, in_=in_) + item.add_report_section(when, "stdout", out) + item.add_report_section(when, "stderr", err) + + +capture_fixtures = {"capfd", "capfdbinary", "capsys", "capsysbinary"} + + +def _ensure_only_one_capture_fixture(request, name): + fixtures = set(request.fixturenames) & capture_fixtures - {name} + if fixtures: + fixtures = sorted(fixtures) + fixtures = fixtures[0] if len(fixtures) == 1 else fixtures + raise request.raiseerror( + "cannot use {} and {} at the same time".format(fixtures, name) + ) + + +@pytest.fixture +def capsys(request): + """Enable capturing of writes to ``sys.stdout`` and ``sys.stderr`` and make + captured output available via ``capsys.readouterr()`` method calls + which return a ``(out, err)`` namedtuple. ``out`` and ``err`` will be ``text`` + objects. + """ + _ensure_only_one_capture_fixture(request, "capsys") + with _install_capture_fixture_on_item(request, SysCapture) as fixture: + yield fixture + + +@pytest.fixture +def capsysbinary(request): + """Enable capturing of writes to ``sys.stdout`` and ``sys.stderr`` and make + captured output available via ``capsys.readouterr()`` method calls + which return a ``(out, err)`` tuple. ``out`` and ``err`` will be ``bytes`` + objects. + """ + _ensure_only_one_capture_fixture(request, "capsysbinary") + # Currently, the implementation uses the python3 specific `.buffer` + # property of CaptureIO. + if sys.version_info < (3,): + raise request.raiseerror("capsysbinary is only supported on python 3") + with _install_capture_fixture_on_item(request, SysCaptureBinary) as fixture: + yield fixture + + +@pytest.fixture +def capfd(request): + """Enable capturing of writes to file descriptors ``1`` and ``2`` and make + captured output available via ``capfd.readouterr()`` method calls + which return a ``(out, err)`` tuple. ``out`` and ``err`` will be ``text`` + objects. + """ + _ensure_only_one_capture_fixture(request, "capfd") + if not hasattr(os, "dup"): + pytest.skip( + "capfd fixture needs os.dup function which is not available in this system" + ) + with _install_capture_fixture_on_item(request, FDCapture) as fixture: + yield fixture + + +@pytest.fixture +def capfdbinary(request): + """Enable capturing of write to file descriptors 1 and 2 and make + captured output available via ``capfdbinary.readouterr`` method calls + which return a ``(out, err)`` tuple. ``out`` and ``err`` will be + ``bytes`` objects. + """ + _ensure_only_one_capture_fixture(request, "capfdbinary") + if not hasattr(os, "dup"): + pytest.skip( + "capfdbinary fixture needs os.dup function which is not available in this system" + ) + with _install_capture_fixture_on_item(request, FDCaptureBinary) as fixture: + yield fixture + + +@contextlib.contextmanager +def _install_capture_fixture_on_item(request, capture_class): + """ + Context manager which creates a ``CaptureFixture`` instance and "installs" it on + the item/node of the given request. Used by ``capsys`` and ``capfd``. + + The CaptureFixture is added as attribute of the item because it needs to accessed + by ``CaptureManager`` during its ``pytest_runtest_*`` hooks. + """ + request.node._capture_fixture = fixture = CaptureFixture(capture_class, request) + capmanager = request.config.pluginmanager.getplugin("capturemanager") + # need to active this fixture right away in case it is being used by another fixture (setup phase) + # if this fixture is being used only by a test function (call phase), then we wouldn't need this + # activation, but it doesn't hurt + capmanager.activate_fixture(request.node) + yield fixture + fixture.close() + del request.node._capture_fixture + + +class CaptureFixture(object): + """ + Object returned by :py:func:`capsys`, :py:func:`capsysbinary`, :py:func:`capfd` and :py:func:`capfdbinary` + fixtures. + """ + + def __init__(self, captureclass, request): + self.captureclass = captureclass + self.request = request + + def _start(self): + self._capture = MultiCapture( + out=True, err=True, in_=False, Capture=self.captureclass + ) + self._capture.start_capturing() + + def close(self): + cap = self.__dict__.pop("_capture", None) + if cap is not None: + self._outerr = cap.pop_outerr_to_orig() + cap.stop_capturing() + + def readouterr(self): + """Read and return the captured output so far, resetting the internal buffer. + + :return: captured content as a namedtuple with ``out`` and ``err`` string attributes + """ + try: + return self._capture.readouterr() + except AttributeError: + return self._outerr + + @contextlib.contextmanager + def disabled(self): + """Temporarily disables capture while inside the 'with' block.""" + self._capture.suspend_capturing() + capmanager = self.request.config.pluginmanager.getplugin("capturemanager") + capmanager.suspend_global_capture(item=None, in_=False) + try: + yield + finally: + capmanager.resume_global_capture() + self._capture.resume_capturing() + + +def safe_text_dupfile(f, mode, default_encoding="UTF8"): + """ return an open text file object that's a duplicate of f on the + FD-level if possible. + """ + encoding = getattr(f, "encoding", None) + try: + fd = f.fileno() + except Exception: + if "b" not in getattr(f, "mode", "") and hasattr(f, "encoding"): + # we seem to have a text stream, let's just use it + return f + else: + newfd = os.dup(fd) + if "b" not in mode: + mode += "b" + f = os.fdopen(newfd, mode, 0) # no buffering + return EncodedFile(f, encoding or default_encoding) + + +class EncodedFile(object): + errors = "strict" # possibly needed by py3 code (issue555) + + def __init__(self, buffer, encoding): + self.buffer = buffer + self.encoding = encoding + + def write(self, obj): + if isinstance(obj, six.text_type): + obj = obj.encode(self.encoding, "replace") + self.buffer.write(obj) + + def writelines(self, linelist): + data = "".join(linelist) + self.write(data) + + @property + def name(self): + """Ensure that file.name is a string.""" + return repr(self.buffer) + + def __getattr__(self, name): + return getattr(object.__getattribute__(self, "buffer"), name) + + +CaptureResult = collections.namedtuple("CaptureResult", ["out", "err"]) + + +class MultiCapture(object): + out = err = in_ = None + + def __init__(self, out=True, err=True, in_=True, Capture=None): + if in_: + self.in_ = Capture(0) + if out: + self.out = Capture(1) + if err: + self.err = Capture(2) + + def start_capturing(self): + if self.in_: + self.in_.start() + if self.out: + self.out.start() + if self.err: + self.err.start() + + def pop_outerr_to_orig(self): + """ pop current snapshot out/err capture and flush to orig streams. """ + out, err = self.readouterr() + if out: + self.out.writeorg(out) + if err: + self.err.writeorg(err) + return out, err + + def suspend_capturing(self, in_=False): + if self.out: + self.out.suspend() + if self.err: + self.err.suspend() + if in_ and self.in_: + self.in_.suspend() + self._in_suspended = True + + def resume_capturing(self): + if self.out: + self.out.resume() + if self.err: + self.err.resume() + if hasattr(self, "_in_suspended"): + self.in_.resume() + del self._in_suspended + + def stop_capturing(self): + """ stop capturing and reset capturing streams """ + if hasattr(self, "_reset"): + raise ValueError("was already stopped") + self._reset = True + if self.out: + self.out.done() + if self.err: + self.err.done() + if self.in_: + self.in_.done() + + def readouterr(self): + """ return snapshot unicode value of stdout/stderr capturings. """ + return CaptureResult( + self.out.snap() if self.out is not None else "", + self.err.snap() if self.err is not None else "", + ) + + +class NoCapture(object): + __init__ = start = done = suspend = resume = lambda *args: None + + +class FDCaptureBinary(object): + """Capture IO to/from a given os-level filedescriptor. + + snap() produces `bytes` + """ + + def __init__(self, targetfd, tmpfile=None): + self.targetfd = targetfd + try: + self.targetfd_save = os.dup(self.targetfd) + except OSError: + self.start = lambda: None + self.done = lambda: None + else: + if targetfd == 0: + assert not tmpfile, "cannot set tmpfile with stdin" + tmpfile = open(os.devnull, "r") + self.syscapture = SysCapture(targetfd) + else: + if tmpfile is None: + f = TemporaryFile() + with f: + tmpfile = safe_text_dupfile(f, mode="wb+") + if targetfd in patchsysdict: + self.syscapture = SysCapture(targetfd, tmpfile) + else: + self.syscapture = NoCapture() + self.tmpfile = tmpfile + self.tmpfile_fd = tmpfile.fileno() + + def __repr__(self): + return "<FDCapture %s oldfd=%s>" % (self.targetfd, self.targetfd_save) + + def start(self): + """ Start capturing on targetfd using memorized tmpfile. """ + try: + os.fstat(self.targetfd_save) + except (AttributeError, OSError): + raise ValueError("saved filedescriptor not valid anymore") + os.dup2(self.tmpfile_fd, self.targetfd) + self.syscapture.start() + + def snap(self): + self.tmpfile.seek(0) + res = self.tmpfile.read() + self.tmpfile.seek(0) + self.tmpfile.truncate() + return res + + def done(self): + """ stop capturing, restore streams, return original capture file, + seeked to position zero. """ + targetfd_save = self.__dict__.pop("targetfd_save") + os.dup2(targetfd_save, self.targetfd) + os.close(targetfd_save) + self.syscapture.done() + _attempt_to_close_capture_file(self.tmpfile) + + def suspend(self): + self.syscapture.suspend() + os.dup2(self.targetfd_save, self.targetfd) + + def resume(self): + self.syscapture.resume() + os.dup2(self.tmpfile_fd, self.targetfd) + + def writeorg(self, data): + """ write to original file descriptor. """ + if isinstance(data, six.text_type): + data = data.encode("utf8") # XXX use encoding of original stream + os.write(self.targetfd_save, data) + + +class FDCapture(FDCaptureBinary): + """Capture IO to/from a given os-level filedescriptor. + + snap() produces text + """ + + def snap(self): + res = FDCaptureBinary.snap(self) + enc = getattr(self.tmpfile, "encoding", None) + if enc and isinstance(res, bytes): + res = six.text_type(res, enc, "replace") + return res + + +class SysCapture(object): + + def __init__(self, fd, tmpfile=None): + name = patchsysdict[fd] + self._old = getattr(sys, name) + self.name = name + if tmpfile is None: + if name == "stdin": + tmpfile = DontReadFromInput() + else: + tmpfile = CaptureIO() + self.tmpfile = tmpfile + + def start(self): + setattr(sys, self.name, self.tmpfile) + + def snap(self): + res = self.tmpfile.getvalue() + self.tmpfile.seek(0) + self.tmpfile.truncate() + return res + + def done(self): + setattr(sys, self.name, self._old) + del self._old + _attempt_to_close_capture_file(self.tmpfile) + + def suspend(self): + setattr(sys, self.name, self._old) + + def resume(self): + setattr(sys, self.name, self.tmpfile) + + def writeorg(self, data): + self._old.write(data) + self._old.flush() + + +class SysCaptureBinary(SysCapture): + + def snap(self): + res = self.tmpfile.buffer.getvalue() + self.tmpfile.seek(0) + self.tmpfile.truncate() + return res + + +class DontReadFromInput(six.Iterator): + """Temporary stub class. Ideally when stdin is accessed, the + capturing should be turned off, with possibly all data captured + so far sent to the screen. This should be configurable, though, + because in automated test runs it is better to crash than + hang indefinitely. + """ + + encoding = None + + def read(self, *args): + raise IOError("reading from stdin while output is captured") + + readline = read + readlines = read + __next__ = read + + def __iter__(self): + return self + + def fileno(self): + raise UnsupportedOperation("redirected stdin is pseudofile, " "has no fileno()") + + def isatty(self): + return False + + def close(self): + pass + + @property + def buffer(self): + if sys.version_info >= (3, 0): + return self + else: + raise AttributeError("redirected stdin has no attribute buffer") + + +def _colorama_workaround(): + """ + Ensure colorama is imported so that it attaches to the correct stdio + handles on Windows. + + colorama uses the terminal on import time. So if something does the + first import of colorama while I/O capture is active, colorama will + fail in various ways. + """ + + if not sys.platform.startswith("win32"): + return + try: + import colorama # noqa + except ImportError: + pass + + +def _readline_workaround(): + """ + Ensure readline is imported so that it attaches to the correct stdio + handles on Windows. + + Pdb uses readline support where available--when not running from the Python + prompt, the readline module is not imported until running the pdb REPL. If + running pytest with the --pdb option this means the readline module is not + imported until after I/O capture has been started. + + This is a problem for pyreadline, which is often used to implement readline + support on Windows, as it does not attach to the correct handles for stdout + and/or stdin if they have been redirected by the FDCapture mechanism. This + workaround ensures that readline is imported before I/O capture is setup so + that it can attach to the actual stdin/out for the console. + + See https://github.com/pytest-dev/pytest/pull/1281 + """ + + if not sys.platform.startswith("win32"): + return + try: + import readline # noqa + except ImportError: + pass + + +def _py36_windowsconsoleio_workaround(stream): + """ + Python 3.6 implemented unicode console handling for Windows. This works + by reading/writing to the raw console handle using + ``{Read,Write}ConsoleW``. + + The problem is that we are going to ``dup2`` over the stdio file + descriptors when doing ``FDCapture`` and this will ``CloseHandle`` the + handles used by Python to write to the console. Though there is still some + weirdness and the console handle seems to only be closed randomly and not + on the first call to ``CloseHandle``, or maybe it gets reopened with the + same handle value when we suspend capturing. + + The workaround in this case will reopen stdio with a different fd which + also means a different handle by replicating the logic in + "Py_lifecycle.c:initstdio/create_stdio". + + :param stream: in practice ``sys.stdout`` or ``sys.stderr``, but given + here as parameter for unittesting purposes. + + See https://github.com/pytest-dev/py/issues/103 + """ + if not sys.platform.startswith("win32") or sys.version_info[:2] < (3, 6): + return + + # bail out if ``stream`` doesn't seem like a proper ``io`` stream (#2666) + if not hasattr(stream, "buffer"): + return + + buffered = hasattr(stream.buffer, "raw") + raw_stdout = stream.buffer.raw if buffered else stream.buffer + + if not isinstance(raw_stdout, io._WindowsConsoleIO): + return + + def _reopen_stdio(f, mode): + if not buffered and mode[0] == "w": + buffering = 0 + else: + buffering = -1 + + return io.TextIOWrapper( + open(os.dup(f.fileno()), mode, buffering), + f.encoding, + f.errors, + f.newlines, + f.line_buffering, + ) + + sys.__stdin__ = sys.stdin = _reopen_stdio(sys.stdin, "rb") + sys.__stdout__ = sys.stdout = _reopen_stdio(sys.stdout, "wb") + sys.__stderr__ = sys.stderr = _reopen_stdio(sys.stderr, "wb") + + +def _attempt_to_close_capture_file(f): + """Suppress IOError when closing the temporary file used for capturing streams in py27 (#2370)""" + if six.PY2: + try: + f.close() + except IOError: + pass + else: + f.close() diff --git a/third_party/python/pytest/src/_pytest/compat.py b/third_party/python/pytest/src/_pytest/compat.py new file mode 100644 index 0000000000..7abd3d53ff --- /dev/null +++ b/third_party/python/pytest/src/_pytest/compat.py @@ -0,0 +1,371 @@ +""" +python version compatibility code +""" +from __future__ import absolute_import, division, print_function + +import codecs +import functools +import inspect +import re +import sys + +import py + +import _pytest +from _pytest.outcomes import TEST_OUTCOME +from six import text_type +import six + +try: + import enum +except ImportError: # pragma: no cover + # Only available in Python 3.4+ or as a backport + enum = None + + +_PY3 = sys.version_info > (3, 0) +_PY2 = not _PY3 + + +if _PY3: + from inspect import signature, Parameter as Parameter +else: + from funcsigs import signature, Parameter as Parameter + + +NoneType = type(None) +NOTSET = object() + +PY35 = sys.version_info[:2] >= (3, 5) +PY36 = sys.version_info[:2] >= (3, 6) +MODULE_NOT_FOUND_ERROR = "ModuleNotFoundError" if PY36 else "ImportError" + +if _PY3: + from collections.abc import MutableMapping as MappingMixin # noqa + from collections.abc import Mapping, Sequence # noqa +else: + # those raise DeprecationWarnings in Python >=3.7 + from collections import MutableMapping as MappingMixin # noqa + from collections import Mapping, Sequence # noqa + + +def _format_args(func): + return str(signature(func)) + + +isfunction = inspect.isfunction +isclass = inspect.isclass +# used to work around a python2 exception info leak +exc_clear = getattr(sys, "exc_clear", lambda: None) +# The type of re.compile objects is not exposed in Python. +REGEX_TYPE = type(re.compile("")) + + +def is_generator(func): + genfunc = inspect.isgeneratorfunction(func) + return genfunc and not iscoroutinefunction(func) + + +def iscoroutinefunction(func): + """Return True if func is a decorated coroutine function. + + Note: copied and modified from Python 3.5's builtin couroutines.py to avoid import asyncio directly, + which in turns also initializes the "logging" module as side-effect (see issue #8). + """ + return ( + getattr(func, "_is_coroutine", False) + or ( + hasattr(inspect, "iscoroutinefunction") + and inspect.iscoroutinefunction(func) + ) + ) + + +def getlocation(function, curdir): + fn = py.path.local(inspect.getfile(function)) + lineno = function.__code__.co_firstlineno + if fn.relto(curdir): + fn = fn.relto(curdir) + return "%s:%d" % (fn, lineno + 1) + + +def num_mock_patch_args(function): + """ return number of arguments used up by mock arguments (if any) """ + patchings = getattr(function, "patchings", None) + if not patchings: + return 0 + mock_modules = [sys.modules.get("mock"), sys.modules.get("unittest.mock")] + if any(mock_modules): + sentinels = [m.DEFAULT for m in mock_modules if m is not None] + return len( + [p for p in patchings if not p.attribute_name and p.new in sentinels] + ) + return len(patchings) + + +def getfuncargnames(function, is_method=False, cls=None): + """Returns the names of a function's mandatory arguments. + + This should return the names of all function arguments that: + * Aren't bound to an instance or type as in instance or class methods. + * Don't have default values. + * Aren't bound with functools.partial. + * Aren't replaced with mocks. + + The is_method and cls arguments indicate that the function should + be treated as a bound method even though it's not unless, only in + the case of cls, the function is a static method. + + @RonnyPfannschmidt: This function should be refactored when we + revisit fixtures. The fixture mechanism should ask the node for + the fixture names, and not try to obtain directly from the + function object well after collection has occurred. + + """ + # The parameters attribute of a Signature object contains an + # ordered mapping of parameter names to Parameter instances. This + # creates a tuple of the names of the parameters that don't have + # defaults. + arg_names = tuple( + p.name + for p in signature(function).parameters.values() + if ( + p.kind is Parameter.POSITIONAL_OR_KEYWORD + or p.kind is Parameter.KEYWORD_ONLY + ) + and p.default is Parameter.empty + ) + # If this function should be treated as a bound method even though + # it's passed as an unbound method or function, remove the first + # parameter name. + if ( + is_method + or ( + cls + and not isinstance(cls.__dict__.get(function.__name__, None), staticmethod) + ) + ): + arg_names = arg_names[1:] + # Remove any names that will be replaced with mocks. + if hasattr(function, "__wrapped__"): + arg_names = arg_names[num_mock_patch_args(function):] + return arg_names + + +def get_default_arg_names(function): + # Note: this code intentionally mirrors the code at the beginning of getfuncargnames, + # to get the arguments which were excluded from its result because they had default values + return tuple( + p.name + for p in signature(function).parameters.values() + if p.kind in (Parameter.POSITIONAL_OR_KEYWORD, Parameter.KEYWORD_ONLY) + and p.default is not Parameter.empty + ) + + +if _PY3: + STRING_TYPES = bytes, str + UNICODE_TYPES = six.text_type + + if PY35: + + def _bytes_to_ascii(val): + return val.decode("ascii", "backslashreplace") + + else: + + def _bytes_to_ascii(val): + if val: + # source: http://goo.gl/bGsnwC + encoded_bytes, _ = codecs.escape_encode(val) + return encoded_bytes.decode("ascii") + else: + # empty bytes crashes codecs.escape_encode (#1087) + return "" + + def ascii_escaped(val): + """If val is pure ascii, returns it as a str(). Otherwise, escapes + bytes objects into a sequence of escaped bytes: + + b'\xc3\xb4\xc5\xd6' -> u'\\xc3\\xb4\\xc5\\xd6' + + and escapes unicode objects into a sequence of escaped unicode + ids, e.g.: + + '4\\nV\\U00043efa\\x0eMXWB\\x1e\\u3028\\u15fd\\xcd\\U0007d944' + + note: + the obvious "v.decode('unicode-escape')" will return + valid utf-8 unicode if it finds them in bytes, but we + want to return escaped bytes for any byte, even if they match + a utf-8 string. + + """ + if isinstance(val, bytes): + return _bytes_to_ascii(val) + else: + return val.encode("unicode_escape").decode("ascii") + + +else: + STRING_TYPES = six.string_types + UNICODE_TYPES = six.text_type + + def ascii_escaped(val): + """In py2 bytes and str are the same type, so return if it's a bytes + object, return it unchanged if it is a full ascii string, + otherwise escape it into its binary form. + + If it's a unicode string, change the unicode characters into + unicode escapes. + + """ + if isinstance(val, bytes): + try: + return val.encode("ascii") + except UnicodeDecodeError: + return val.encode("string-escape") + else: + return val.encode("unicode-escape") + + +def get_real_func(obj): + """ gets the real function object of the (possibly) wrapped object by + functools.wraps or functools.partial. + """ + start_obj = obj + for i in range(100): + new_obj = getattr(obj, "__wrapped__", None) + if new_obj is None: + break + obj = new_obj + else: + raise ValueError( + ("could not find real function of {start}" "\nstopped at {current}").format( + start=py.io.saferepr(start_obj), current=py.io.saferepr(obj) + ) + ) + if isinstance(obj, functools.partial): + obj = obj.func + return obj + + +def getfslineno(obj): + # xxx let decorators etc specify a sane ordering + obj = get_real_func(obj) + if hasattr(obj, "place_as"): + obj = obj.place_as + fslineno = _pytest._code.getfslineno(obj) + assert isinstance(fslineno[1], int), obj + return fslineno + + +def getimfunc(func): + try: + return func.__func__ + except AttributeError: + return func + + +def safe_getattr(object, name, default): + """ Like getattr but return default upon any Exception or any OutcomeException. + + Attribute access can potentially fail for 'evil' Python objects. + See issue #214. + It catches OutcomeException because of #2490 (issue #580), new outcomes are derived from BaseException + instead of Exception (for more details check #2707) + """ + try: + return getattr(object, name, default) + except TEST_OUTCOME: + return default + + +def _is_unittest_unexpected_success_a_failure(): + """Return if the test suite should fail if an @expectedFailure unittest test PASSES. + + From https://docs.python.org/3/library/unittest.html?highlight=unittest#unittest.TestResult.wasSuccessful: + Changed in version 3.4: Returns False if there were any + unexpectedSuccesses from tests marked with the expectedFailure() decorator. + """ + return sys.version_info >= (3, 4) + + +if _PY3: + + def safe_str(v): + """returns v as string""" + return str(v) + + +else: + + def safe_str(v): + """returns v as string, converting to ascii if necessary""" + try: + return str(v) + except UnicodeError: + if not isinstance(v, text_type): + v = text_type(v) + errors = "replace" + return v.encode("utf-8", errors) + + +COLLECT_FAKEMODULE_ATTRIBUTES = ( + "Collector", + "Module", + "Generator", + "Function", + "Instance", + "Session", + "Item", + "Class", + "File", + "_fillfuncargs", +) + + +def _setup_collect_fakemodule(): + from types import ModuleType + import pytest + + pytest.collect = ModuleType("pytest.collect") + pytest.collect.__all__ = [] # used for setns + for attr in COLLECT_FAKEMODULE_ATTRIBUTES: + setattr(pytest.collect, attr, getattr(pytest, attr)) + + +if _PY2: + # Without this the test_dupfile_on_textio will fail, otherwise CaptureIO could directly inherit from StringIO. + from py.io import TextIO + + class CaptureIO(TextIO): + + @property + def encoding(self): + return getattr(self, "_encoding", "UTF-8") + + +else: + import io + + class CaptureIO(io.TextIOWrapper): + + def __init__(self): + super(CaptureIO, self).__init__( + io.BytesIO(), encoding="UTF-8", newline="", write_through=True + ) + + def getvalue(self): + return self.buffer.getvalue().decode("UTF-8") + + +class FuncargnamesCompatAttr(object): + """ helper class so that Metafunc, Function and FixtureRequest + don't need to each define the "funcargnames" compatibility attribute. + """ + + @property + def funcargnames(self): + """ alias attribute for ``fixturenames`` for pre-2.3 compatibility""" + return self.fixturenames diff --git a/third_party/python/pytest/src/_pytest/config/__init__.py b/third_party/python/pytest/src/_pytest/config/__init__.py new file mode 100644 index 0000000000..11348b80d0 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/config/__init__.py @@ -0,0 +1,979 @@ +""" command line options, ini-file and conftest.py processing. """ +from __future__ import absolute_import, division, print_function +import argparse +import shlex +import traceback +import types +import warnings +import copy +import six +import py + +# DON't import pytest here because it causes import cycle troubles +import sys +import os +from _pytest.outcomes import Skipped + +import _pytest._code +import _pytest.hookspec # the extension point definitions +import _pytest.assertion +from pluggy import PluginManager, HookimplMarker, HookspecMarker +from _pytest.compat import safe_str +from .exceptions import UsageError, PrintHelp +from .findpaths import determine_setup, exists + +hookimpl = HookimplMarker("pytest") +hookspec = HookspecMarker("pytest") + +# pytest startup +# + + +class ConftestImportFailure(Exception): + + def __init__(self, path, excinfo): + Exception.__init__(self, path, excinfo) + self.path = path + self.excinfo = excinfo + + def __str__(self): + etype, evalue, etb = self.excinfo + formatted = traceback.format_tb(etb) + # The level of the tracebacks we want to print is hand crafted :( + return repr(evalue) + "\n" + "".join(formatted[2:]) + + +def main(args=None, plugins=None): + """ return exit code, after performing an in-process test run. + + :arg args: list of command line arguments. + + :arg plugins: list of plugin objects to be auto-registered during + initialization. + """ + try: + try: + config = _prepareconfig(args, plugins) + except ConftestImportFailure as e: + tw = py.io.TerminalWriter(sys.stderr) + for line in traceback.format_exception(*e.excinfo): + tw.line(line.rstrip(), red=True) + tw.line("ERROR: could not load %s\n" % (e.path,), red=True) + return 4 + else: + try: + return config.hook.pytest_cmdline_main(config=config) + finally: + config._ensure_unconfigure() + except UsageError as e: + tw = py.io.TerminalWriter(sys.stderr) + for msg in e.args: + tw.line("ERROR: {}\n".format(msg), red=True) + return 4 + + +class cmdline(object): # NOQA compatibility namespace + main = staticmethod(main) + + +def filename_arg(path, optname): + """ Argparse type validator for filename arguments. + + :path: path of filename + :optname: name of the option + """ + if os.path.isdir(path): + raise UsageError("{} must be a filename, given: {}".format(optname, path)) + return path + + +def directory_arg(path, optname): + """Argparse type validator for directory arguments. + + :path: path of directory + :optname: name of the option + """ + if not os.path.isdir(path): + raise UsageError("{} must be a directory, given: {}".format(optname, path)) + return path + + +default_plugins = ( + "mark", + "main", + "terminal", + "runner", + "python", + "fixtures", + "debugging", + "unittest", + "capture", + "skipping", + "tmpdir", + "monkeypatch", + "recwarn", + "pastebin", + "helpconfig", + "nose", + "assertion", + "junitxml", + "resultlog", + "doctest", + "cacheprovider", + "freeze_support", + "setuponly", + "setupplan", + "warnings", + "logging", +) + + +builtin_plugins = set(default_plugins) +builtin_plugins.add("pytester") + + +def get_config(): + # subsequent calls to main will create a fresh instance + pluginmanager = PytestPluginManager() + config = Config(pluginmanager) + for spec in default_plugins: + pluginmanager.import_plugin(spec) + return config + + +def get_plugin_manager(): + """ + Obtain a new instance of the + :py:class:`_pytest.config.PytestPluginManager`, with default plugins + already loaded. + + This function can be used by integration with other tools, like hooking + into pytest to run tests into an IDE. + """ + return get_config().pluginmanager + + +def _prepareconfig(args=None, plugins=None): + warning = None + if args is None: + args = sys.argv[1:] + elif isinstance(args, py.path.local): + args = [str(args)] + elif not isinstance(args, (tuple, list)): + if not isinstance(args, str): + raise ValueError("not a string or argument list: %r" % (args,)) + args = shlex.split(args, posix=sys.platform != "win32") + from _pytest import deprecated + + warning = deprecated.MAIN_STR_ARGS + config = get_config() + pluginmanager = config.pluginmanager + try: + if plugins: + for plugin in plugins: + if isinstance(plugin, six.string_types): + pluginmanager.consider_pluginarg(plugin) + else: + pluginmanager.register(plugin) + if warning: + config.warn("C1", warning) + return pluginmanager.hook.pytest_cmdline_parse( + pluginmanager=pluginmanager, args=args + ) + except BaseException: + config._ensure_unconfigure() + raise + + +class PytestPluginManager(PluginManager): + """ + Overwrites :py:class:`pluggy.PluginManager <pluggy.PluginManager>` to add pytest-specific + functionality: + + * loading plugins from the command line, ``PYTEST_PLUGINS`` env variable and + ``pytest_plugins`` global variables found in plugins being loaded; + * ``conftest.py`` loading during start-up; + """ + + def __init__(self): + super(PytestPluginManager, self).__init__("pytest") + self._conftest_plugins = set() + + # state related to local conftest plugins + self._path2confmods = {} + self._conftestpath2mod = {} + self._confcutdir = None + self._noconftest = False + self._duplicatepaths = set() + + self.add_hookspecs(_pytest.hookspec) + self.register(self) + if os.environ.get("PYTEST_DEBUG"): + err = sys.stderr + encoding = getattr(err, "encoding", "utf8") + try: + err = py.io.dupfile(err, encoding=encoding) + except Exception: + pass + self.trace.root.setwriter(err.write) + self.enable_tracing() + + # Config._consider_importhook will set a real object if required. + self.rewrite_hook = _pytest.assertion.DummyRewriteHook() + # Used to know when we are importing conftests after the pytest_configure stage + self._configured = False + + def addhooks(self, module_or_class): + """ + .. deprecated:: 2.8 + + Use :py:meth:`pluggy.PluginManager.add_hookspecs <PluginManager.add_hookspecs>` + instead. + """ + warning = dict( + code="I2", + fslocation=_pytest._code.getfslineno(sys._getframe(1)), + nodeid=None, + message="use pluginmanager.add_hookspecs instead of " + "deprecated addhooks() method.", + ) + self._warn(warning) + return self.add_hookspecs(module_or_class) + + def parse_hookimpl_opts(self, plugin, name): + # pytest hooks are always prefixed with pytest_ + # so we avoid accessing possibly non-readable attributes + # (see issue #1073) + if not name.startswith("pytest_"): + return + # ignore some historic special names which can not be hooks anyway + if name == "pytest_plugins" or name.startswith("pytest_funcarg__"): + return + + method = getattr(plugin, name) + opts = super(PytestPluginManager, self).parse_hookimpl_opts(plugin, name) + + # collect unmarked hooks as long as they have the `pytest_' prefix + if opts is None and name.startswith("pytest_"): + opts = {} + + if opts is not None: + for name in ("tryfirst", "trylast", "optionalhook", "hookwrapper"): + opts.setdefault(name, hasattr(method, name)) + return opts + + def parse_hookspec_opts(self, module_or_class, name): + opts = super(PytestPluginManager, self).parse_hookspec_opts( + module_or_class, name + ) + if opts is None: + method = getattr(module_or_class, name) + if name.startswith("pytest_"): + opts = { + "firstresult": hasattr(method, "firstresult"), + "historic": hasattr(method, "historic"), + } + return opts + + def register(self, plugin, name=None): + if name in ["pytest_catchlog", "pytest_capturelog"]: + self._warn( + "{} plugin has been merged into the core, " + "please remove it from your requirements.".format( + name.replace("_", "-") + ) + ) + return + ret = super(PytestPluginManager, self).register(plugin, name) + if ret: + self.hook.pytest_plugin_registered.call_historic( + kwargs=dict(plugin=plugin, manager=self) + ) + + if isinstance(plugin, types.ModuleType): + self.consider_module(plugin) + return ret + + def getplugin(self, name): + # support deprecated naming because plugins (xdist e.g.) use it + return self.get_plugin(name) + + def hasplugin(self, name): + """Return True if the plugin with the given name is registered.""" + return bool(self.get_plugin(name)) + + def pytest_configure(self, config): + # XXX now that the pluginmanager exposes hookimpl(tryfirst...) + # we should remove tryfirst/trylast as markers + config.addinivalue_line( + "markers", + "tryfirst: mark a hook implementation function such that the " + "plugin machinery will try to call it first/as early as possible.", + ) + config.addinivalue_line( + "markers", + "trylast: mark a hook implementation function such that the " + "plugin machinery will try to call it last/as late as possible.", + ) + self._configured = True + + def _warn(self, message): + kwargs = message if isinstance(message, dict) else { + "code": "I1", "message": message, "fslocation": None, "nodeid": None + } + self.hook.pytest_logwarning.call_historic(kwargs=kwargs) + + # + # internal API for local conftest plugin handling + # + def _set_initial_conftests(self, namespace): + """ load initial conftest files given a preparsed "namespace". + As conftest files may add their own command line options + which have arguments ('--my-opt somepath') we might get some + false positives. All builtin and 3rd party plugins will have + been loaded, however, so common options will not confuse our logic + here. + """ + current = py.path.local() + self._confcutdir = current.join( + namespace.confcutdir, abs=True + ) if namespace.confcutdir else None + self._noconftest = namespace.noconftest + testpaths = namespace.file_or_dir + foundanchor = False + for path in testpaths: + path = str(path) + # remove node-id syntax + i = path.find("::") + if i != -1: + path = path[:i] + anchor = current.join(path, abs=1) + if exists(anchor): # we found some file object + self._try_load_conftest(anchor) + foundanchor = True + if not foundanchor: + self._try_load_conftest(current) + + def _try_load_conftest(self, anchor): + self._getconftestmodules(anchor) + # let's also consider test* subdirs + if anchor.check(dir=1): + for x in anchor.listdir("test*"): + if x.check(dir=1): + self._getconftestmodules(x) + + def _getconftestmodules(self, path): + if self._noconftest: + return [] + try: + return self._path2confmods[path] + except KeyError: + if path.isfile(): + clist = self._getconftestmodules(path.dirpath()) + else: + # XXX these days we may rather want to use config.rootdir + # and allow users to opt into looking into the rootdir parent + # directories instead of requiring to specify confcutdir + clist = [] + for parent in path.parts(): + if self._confcutdir and self._confcutdir.relto(parent): + continue + conftestpath = parent.join("conftest.py") + if conftestpath.isfile(): + mod = self._importconftest(conftestpath) + clist.append(mod) + + self._path2confmods[path] = clist + return clist + + def _rget_with_confmod(self, name, path): + modules = self._getconftestmodules(path) + for mod in reversed(modules): + try: + return mod, getattr(mod, name) + except AttributeError: + continue + raise KeyError(name) + + def _importconftest(self, conftestpath): + try: + return self._conftestpath2mod[conftestpath] + except KeyError: + pkgpath = conftestpath.pypkgpath() + if pkgpath is None: + _ensure_removed_sysmodule(conftestpath.purebasename) + try: + mod = conftestpath.pyimport() + if hasattr(mod, "pytest_plugins") and self._configured: + from _pytest.deprecated import PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST + + warnings.warn(PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST) + except Exception: + raise ConftestImportFailure(conftestpath, sys.exc_info()) + + self._conftest_plugins.add(mod) + self._conftestpath2mod[conftestpath] = mod + dirpath = conftestpath.dirpath() + if dirpath in self._path2confmods: + for path, mods in self._path2confmods.items(): + if path and path.relto(dirpath) or path == dirpath: + assert mod not in mods + mods.append(mod) + self.trace("loaded conftestmodule %r" % (mod)) + self.consider_conftest(mod) + return mod + + # + # API for bootstrapping plugin loading + # + # + + def consider_preparse(self, args): + for opt1, opt2 in zip(args, args[1:]): + if opt1 == "-p": + self.consider_pluginarg(opt2) + + def consider_pluginarg(self, arg): + if arg.startswith("no:"): + name = arg[3:] + self.set_blocked(name) + if not name.startswith("pytest_"): + self.set_blocked("pytest_" + name) + else: + self.import_plugin(arg) + + def consider_conftest(self, conftestmodule): + self.register(conftestmodule, name=conftestmodule.__file__) + + def consider_env(self): + self._import_plugin_specs(os.environ.get("PYTEST_PLUGINS")) + + def consider_module(self, mod): + self._import_plugin_specs(getattr(mod, "pytest_plugins", [])) + + def _import_plugin_specs(self, spec): + plugins = _get_plugin_specs_as_list(spec) + for import_spec in plugins: + self.import_plugin(import_spec) + + def import_plugin(self, modname): + # most often modname refers to builtin modules, e.g. "pytester", + # "terminal" or "capture". Those plugins are registered under their + # basename for historic purposes but must be imported with the + # _pytest prefix. + assert isinstance(modname, (six.text_type, str)), ( + "module name as text required, got %r" % modname + ) + modname = str(modname) + if self.is_blocked(modname) or self.get_plugin(modname) is not None: + return + if modname in builtin_plugins: + importspec = "_pytest." + modname + else: + importspec = modname + self.rewrite_hook.mark_rewrite(importspec) + try: + __import__(importspec) + except ImportError as e: + new_exc_type = ImportError + new_exc_message = 'Error importing plugin "%s": %s' % ( + modname, safe_str(e.args[0]) + ) + new_exc = new_exc_type(new_exc_message) + + six.reraise(new_exc_type, new_exc, sys.exc_info()[2]) + + except Skipped as e: + self._warn("skipped plugin %r: %s" % ((modname, e.msg))) + else: + mod = sys.modules[importspec] + self.register(mod, modname) + + +def _get_plugin_specs_as_list(specs): + """ + Parses a list of "plugin specs" and returns a list of plugin names. + + Plugin specs can be given as a list of strings separated by "," or already as a list/tuple in + which case it is returned as a list. Specs can also be `None` in which case an + empty list is returned. + """ + if specs is not None: + if isinstance(specs, str): + specs = specs.split(",") if specs else [] + if not isinstance(specs, (list, tuple)): + raise UsageError( + "Plugin specs must be a ','-separated string or a " + "list/tuple of strings for plugin names. Given: %r" % specs + ) + return list(specs) + return [] + + +def _ensure_removed_sysmodule(modname): + try: + del sys.modules[modname] + except KeyError: + pass + + +class Notset(object): + + def __repr__(self): + return "<NOTSET>" + + +notset = Notset() + + +def _iter_rewritable_modules(package_files): + for fn in package_files: + is_simple_module = "/" not in fn and fn.endswith(".py") + is_package = fn.count("/") == 1 and fn.endswith("__init__.py") + if is_simple_module: + module_name, _ = os.path.splitext(fn) + yield module_name + elif is_package: + package_name = os.path.dirname(fn) + yield package_name + + +class Config(object): + """ access to configuration values, pluginmanager and plugin hooks. """ + + def __init__(self, pluginmanager): + #: access to command line option as attributes. + #: (deprecated), use :py:func:`getoption() <_pytest.config.Config.getoption>` instead + self.option = argparse.Namespace() + from .argparsing import Parser, FILE_OR_DIR + + _a = FILE_OR_DIR + self._parser = Parser( + usage="%%(prog)s [options] [%s] [%s] [...]" % (_a, _a), + processopt=self._processopt, + ) + #: a pluginmanager instance + self.pluginmanager = pluginmanager + self.trace = self.pluginmanager.trace.root.get("config") + self.hook = self.pluginmanager.hook + self._inicache = {} + self._override_ini = () + self._opt2dest = {} + self._cleanup = [] + self._warn = self.pluginmanager._warn + self.pluginmanager.register(self, "pytestconfig") + self._configured = False + + def do_setns(dic): + import pytest + + setns(pytest, dic) + + self.hook.pytest_namespace.call_historic(do_setns, {}) + self.hook.pytest_addoption.call_historic(kwargs=dict(parser=self._parser)) + + def add_cleanup(self, func): + """ Add a function to be called when the config object gets out of + use (usually coninciding with pytest_unconfigure).""" + self._cleanup.append(func) + + def _do_configure(self): + assert not self._configured + self._configured = True + self.hook.pytest_configure.call_historic(kwargs=dict(config=self)) + + def _ensure_unconfigure(self): + if self._configured: + self._configured = False + self.hook.pytest_unconfigure(config=self) + self.hook.pytest_configure._call_history = [] + while self._cleanup: + fin = self._cleanup.pop() + fin() + + def warn(self, code, message, fslocation=None, nodeid=None): + """ generate a warning for this test session. """ + self.hook.pytest_logwarning.call_historic( + kwargs=dict( + code=code, message=message, fslocation=fslocation, nodeid=nodeid + ) + ) + + def get_terminal_writer(self): + return self.pluginmanager.get_plugin("terminalreporter")._tw + + def pytest_cmdline_parse(self, pluginmanager, args): + # REF1 assert self == pluginmanager.config, (self, pluginmanager.config) + self.parse(args) + return self + + def notify_exception(self, excinfo, option=None): + if option and option.fulltrace: + style = "long" + else: + style = "native" + excrepr = excinfo.getrepr( + funcargs=True, showlocals=getattr(option, "showlocals", False), style=style + ) + res = self.hook.pytest_internalerror(excrepr=excrepr, excinfo=excinfo) + if not any(res): + for line in str(excrepr).split("\n"): + sys.stderr.write("INTERNALERROR> %s\n" % line) + sys.stderr.flush() + + def cwd_relative_nodeid(self, nodeid): + # nodeid's are relative to the rootpath, compute relative to cwd + if self.invocation_dir != self.rootdir: + fullpath = self.rootdir.join(nodeid) + nodeid = self.invocation_dir.bestrelpath(fullpath) + return nodeid + + @classmethod + def fromdictargs(cls, option_dict, args): + """ constructor useable for subprocesses. """ + config = get_config() + config.option.__dict__.update(option_dict) + config.parse(args, addopts=False) + for x in config.option.plugins: + config.pluginmanager.consider_pluginarg(x) + return config + + def _processopt(self, opt): + for name in opt._short_opts + opt._long_opts: + self._opt2dest[name] = opt.dest + + if hasattr(opt, "default") and opt.dest: + if not hasattr(self.option, opt.dest): + setattr(self.option, opt.dest, opt.default) + + @hookimpl(trylast=True) + def pytest_load_initial_conftests(self, early_config): + self.pluginmanager._set_initial_conftests(early_config.known_args_namespace) + + def _initini(self, args): + ns, unknown_args = self._parser.parse_known_and_unknown_args( + args, namespace=copy.copy(self.option) + ) + r = determine_setup( + ns.inifilename, + ns.file_or_dir + unknown_args, + warnfunc=self.warn, + rootdir_cmd_arg=ns.rootdir or None, + ) + self.rootdir, self.inifile, self.inicfg = r + self._parser.extra_info["rootdir"] = self.rootdir + self._parser.extra_info["inifile"] = self.inifile + self.invocation_dir = py.path.local() + self._parser.addini("addopts", "extra command line options", "args") + self._parser.addini("minversion", "minimally required pytest version") + self._override_ini = ns.override_ini or () + + def _consider_importhook(self, args): + """Install the PEP 302 import hook if using assertion rewriting. + + Needs to parse the --assert=<mode> option from the commandline + and find all the installed plugins to mark them for rewriting + by the importhook. + """ + ns, unknown_args = self._parser.parse_known_and_unknown_args(args) + mode = ns.assertmode + if mode == "rewrite": + try: + hook = _pytest.assertion.install_importhook(self) + except SystemError: + mode = "plain" + else: + self._mark_plugins_for_rewrite(hook) + _warn_about_missing_assertion(mode) + + def _mark_plugins_for_rewrite(self, hook): + """ + Given an importhook, mark for rewrite any top-level + modules or packages in the distribution package for + all pytest plugins. + """ + import pkg_resources + + self.pluginmanager.rewrite_hook = hook + + # 'RECORD' available for plugins installed normally (pip install) + # 'SOURCES.txt' available for plugins installed in dev mode (pip install -e) + # for installed plugins 'SOURCES.txt' returns an empty list, and vice-versa + # so it shouldn't be an issue + metadata_files = "RECORD", "SOURCES.txt" + + package_files = ( + entry.split(",")[0] + for entrypoint in pkg_resources.iter_entry_points("pytest11") + for metadata in metadata_files + for entry in entrypoint.dist._get_metadata(metadata) + ) + + for name in _iter_rewritable_modules(package_files): + hook.mark_rewrite(name) + + def _preparse(self, args, addopts=True): + if addopts: + args[:] = shlex.split(os.environ.get("PYTEST_ADDOPTS", "")) + args + self._initini(args) + if addopts: + args[:] = self.getini("addopts") + args + self._checkversion() + self._consider_importhook(args) + self.pluginmanager.consider_preparse(args) + self.pluginmanager.load_setuptools_entrypoints("pytest11") + self.pluginmanager.consider_env() + self.known_args_namespace = ns = self._parser.parse_known_args( + args, namespace=copy.copy(self.option) + ) + if self.known_args_namespace.confcutdir is None and self.inifile: + confcutdir = py.path.local(self.inifile).dirname + self.known_args_namespace.confcutdir = confcutdir + try: + self.hook.pytest_load_initial_conftests( + early_config=self, args=args, parser=self._parser + ) + except ConftestImportFailure: + e = sys.exc_info()[1] + if ns.help or ns.version: + # we don't want to prevent --help/--version to work + # so just let is pass and print a warning at the end + self._warn("could not load initial conftests (%s)\n" % e.path) + else: + raise + + def _checkversion(self): + import pytest + + minver = self.inicfg.get("minversion", None) + if minver: + ver = minver.split(".") + myver = pytest.__version__.split(".") + if myver < ver: + raise pytest.UsageError( + "%s:%d: requires pytest-%s, actual pytest-%s'" + % ( + self.inicfg.config.path, + self.inicfg.lineof("minversion"), + minver, + pytest.__version__, + ) + ) + + def parse(self, args, addopts=True): + # parse given cmdline arguments into this config object. + assert not hasattr( + self, "args" + ), "can only parse cmdline args at most once per Config object" + self._origargs = args + self.hook.pytest_addhooks.call_historic( + kwargs=dict(pluginmanager=self.pluginmanager) + ) + self._preparse(args, addopts=addopts) + # XXX deprecated hook: + self.hook.pytest_cmdline_preparse(config=self, args=args) + self._parser.after_preparse = True + try: + args = self._parser.parse_setoption( + args, self.option, namespace=self.option + ) + if not args: + cwd = os.getcwd() + if cwd == self.rootdir: + args = self.getini("testpaths") + if not args: + args = [cwd] + self.args = args + except PrintHelp: + pass + + def addinivalue_line(self, name, line): + """ add a line to an ini-file option. The option must have been + declared but might not yet be set in which case the line becomes the + the first line in its value. """ + x = self.getini(name) + assert isinstance(x, list) + x.append(line) # modifies the cached list inline + + def getini(self, name): + """ return configuration value from an :ref:`ini file <inifiles>`. If the + specified name hasn't been registered through a prior + :py:func:`parser.addini <_pytest.config.Parser.addini>` + call (usually from a plugin), a ValueError is raised. """ + try: + return self._inicache[name] + except KeyError: + self._inicache[name] = val = self._getini(name) + return val + + def _getini(self, name): + try: + description, type, default = self._parser._inidict[name] + except KeyError: + raise ValueError("unknown configuration value: %r" % (name,)) + value = self._get_override_ini_value(name) + if value is None: + try: + value = self.inicfg[name] + except KeyError: + if default is not None: + return default + if type is None: + return "" + return [] + if type == "pathlist": + dp = py.path.local(self.inicfg.config.path).dirpath() + values = [] + for relpath in shlex.split(value): + values.append(dp.join(relpath, abs=True)) + return values + elif type == "args": + return shlex.split(value) + elif type == "linelist": + return [t for t in map(lambda x: x.strip(), value.split("\n")) if t] + elif type == "bool": + return bool(_strtobool(value.strip())) + else: + assert type is None + return value + + def _getconftest_pathlist(self, name, path): + try: + mod, relroots = self.pluginmanager._rget_with_confmod(name, path) + except KeyError: + return None + modpath = py.path.local(mod.__file__).dirpath() + values = [] + for relroot in relroots: + if not isinstance(relroot, py.path.local): + relroot = relroot.replace("/", py.path.local.sep) + relroot = modpath.join(relroot, abs=True) + values.append(relroot) + return values + + def _get_override_ini_value(self, name): + value = None + # override_ini is a list of "ini=value" options + # always use the last item if multiple values are set for same ini-name, + # e.g. -o foo=bar1 -o foo=bar2 will set foo to bar2 + for ini_config in self._override_ini: + try: + key, user_ini_value = ini_config.split("=", 1) + except ValueError: + raise UsageError("-o/--override-ini expects option=value style.") + else: + if key == name: + value = user_ini_value + return value + + def getoption(self, name, default=notset, skip=False): + """ return command line option value. + + :arg name: name of the option. You may also specify + the literal ``--OPT`` option instead of the "dest" option name. + :arg default: default value if no option of that name exists. + :arg skip: if True raise pytest.skip if option does not exists + or has a None value. + """ + name = self._opt2dest.get(name, name) + try: + val = getattr(self.option, name) + if val is None and skip: + raise AttributeError(name) + return val + except AttributeError: + if default is not notset: + return default + if skip: + import pytest + + pytest.skip("no %r option found" % (name,)) + raise ValueError("no option named %r" % (name,)) + + def getvalue(self, name, path=None): + """ (deprecated, use getoption()) """ + return self.getoption(name) + + def getvalueorskip(self, name, path=None): + """ (deprecated, use getoption(skip=True)) """ + return self.getoption(name, skip=True) + + +def _assertion_supported(): + try: + assert False + except AssertionError: + return True + else: + return False + + +def _warn_about_missing_assertion(mode): + if not _assertion_supported(): + if mode == "plain": + sys.stderr.write( + "WARNING: ASSERTIONS ARE NOT EXECUTED" + " and FAILING TESTS WILL PASS. Are you" + " using python -O?" + ) + else: + sys.stderr.write( + "WARNING: assertions not in test modules or" + " plugins will be ignored" + " because assert statements are not executed " + "by the underlying Python interpreter " + "(are you using python -O?)\n" + ) + + +def setns(obj, dic): + import pytest + + for name, value in dic.items(): + if isinstance(value, dict): + mod = getattr(obj, name, None) + if mod is None: + modname = "pytest.%s" % name + mod = types.ModuleType(modname) + sys.modules[modname] = mod + mod.__all__ = [] + setattr(obj, name, mod) + obj.__all__.append(name) + setns(mod, value) + else: + setattr(obj, name, value) + obj.__all__.append(name) + # if obj != pytest: + # pytest.__all__.append(name) + setattr(pytest, name, value) + + +def create_terminal_writer(config, *args, **kwargs): + """Create a TerminalWriter instance configured according to the options + in the config object. Every code which requires a TerminalWriter object + and has access to a config object should use this function. + """ + tw = py.io.TerminalWriter(*args, **kwargs) + if config.option.color == "yes": + tw.hasmarkup = True + if config.option.color == "no": + tw.hasmarkup = False + return tw + + +def _strtobool(val): + """Convert a string representation of truth to true (1) or false (0). + + True values are 'y', 'yes', 't', 'true', 'on', and '1'; false values + are 'n', 'no', 'f', 'false', 'off', and '0'. Raises ValueError if + 'val' is anything else. + + .. note:: copied from distutils.util + """ + val = val.lower() + if val in ("y", "yes", "t", "true", "on", "1"): + return 1 + elif val in ("n", "no", "f", "false", "off", "0"): + return 0 + else: + raise ValueError("invalid truth value %r" % (val,)) diff --git a/third_party/python/pytest/src/_pytest/config/argparsing.py b/third_party/python/pytest/src/_pytest/config/argparsing.py new file mode 100644 index 0000000000..781d8e8c4e --- /dev/null +++ b/third_party/python/pytest/src/_pytest/config/argparsing.py @@ -0,0 +1,394 @@ +import six +import warnings +import argparse + +FILE_OR_DIR = "file_or_dir" + + +class Parser(object): + """ Parser for command line arguments and ini-file values. + + :ivar extra_info: dict of generic param -> value to display in case + there's an error processing the command line arguments. + """ + + def __init__(self, usage=None, processopt=None): + self._anonymous = OptionGroup("custom options", parser=self) + self._groups = [] + self._processopt = processopt + self._usage = usage + self._inidict = {} + self._ininames = [] + self.extra_info = {} + + def processoption(self, option): + if self._processopt: + if option.dest: + self._processopt(option) + + def getgroup(self, name, description="", after=None): + """ get (or create) a named option Group. + + :name: name of the option group. + :description: long description for --help output. + :after: name of other group, used for ordering --help output. + + The returned group object has an ``addoption`` method with the same + signature as :py:func:`parser.addoption + <_pytest.config.Parser.addoption>` but will be shown in the + respective group in the output of ``pytest. --help``. + """ + for group in self._groups: + if group.name == name: + return group + group = OptionGroup(name, description, parser=self) + i = 0 + for i, grp in enumerate(self._groups): + if grp.name == after: + break + self._groups.insert(i + 1, group) + return group + + def addoption(self, *opts, **attrs): + """ register a command line option. + + :opts: option names, can be short or long options. + :attrs: same attributes which the ``add_option()`` function of the + `argparse library + <http://docs.python.org/2/library/argparse.html>`_ + accepts. + + After command line parsing options are available on the pytest config + object via ``config.option.NAME`` where ``NAME`` is usually set + by passing a ``dest`` attribute, for example + ``addoption("--long", dest="NAME", ...)``. + """ + self._anonymous.addoption(*opts, **attrs) + + def parse(self, args, namespace=None): + from _pytest._argcomplete import try_argcomplete + + self.optparser = self._getparser() + try_argcomplete(self.optparser) + return self.optparser.parse_args([str(x) for x in args], namespace=namespace) + + def _getparser(self): + from _pytest._argcomplete import filescompleter + + optparser = MyOptionParser(self, self.extra_info) + groups = self._groups + [self._anonymous] + for group in groups: + if group.options: + desc = group.description or group.name + arggroup = optparser.add_argument_group(desc) + for option in group.options: + n = option.names() + a = option.attrs() + arggroup.add_argument(*n, **a) + # bash like autocompletion for dirs (appending '/') + optparser.add_argument(FILE_OR_DIR, nargs="*").completer = filescompleter + return optparser + + def parse_setoption(self, args, option, namespace=None): + parsedoption = self.parse(args, namespace=namespace) + for name, value in parsedoption.__dict__.items(): + setattr(option, name, value) + return getattr(parsedoption, FILE_OR_DIR) + + def parse_known_args(self, args, namespace=None): + """parses and returns a namespace object with known arguments at this + point. + """ + return self.parse_known_and_unknown_args(args, namespace=namespace)[0] + + def parse_known_and_unknown_args(self, args, namespace=None): + """parses and returns a namespace object with known arguments, and + the remaining arguments unknown at this point. + """ + optparser = self._getparser() + args = [str(x) for x in args] + return optparser.parse_known_args(args, namespace=namespace) + + def addini(self, name, help, type=None, default=None): + """ register an ini-file option. + + :name: name of the ini-variable + :type: type of the variable, can be ``pathlist``, ``args``, ``linelist`` + or ``bool``. + :default: default value if no ini-file option exists but is queried. + + The value of ini-variables can be retrieved via a call to + :py:func:`config.getini(name) <_pytest.config.Config.getini>`. + """ + assert type in (None, "pathlist", "args", "linelist", "bool") + self._inidict[name] = (help, type, default) + self._ininames.append(name) + + +class ArgumentError(Exception): + """ + Raised if an Argument instance is created with invalid or + inconsistent arguments. + """ + + def __init__(self, msg, option): + self.msg = msg + self.option_id = str(option) + + def __str__(self): + if self.option_id: + return "option %s: %s" % (self.option_id, self.msg) + else: + return self.msg + + +class Argument(object): + """class that mimics the necessary behaviour of optparse.Option + + its currently a least effort implementation + and ignoring choices and integer prefixes + https://docs.python.org/3/library/optparse.html#optparse-standard-option-types + """ + _typ_map = {"int": int, "string": str, "float": float, "complex": complex} + + def __init__(self, *names, **attrs): + """store parms in private vars for use in add_argument""" + self._attrs = attrs + self._short_opts = [] + self._long_opts = [] + self.dest = attrs.get("dest") + if "%default" in (attrs.get("help") or ""): + warnings.warn( + 'pytest now uses argparse. "%default" should be' + ' changed to "%(default)s" ', + DeprecationWarning, + stacklevel=3, + ) + try: + typ = attrs["type"] + except KeyError: + pass + else: + # this might raise a keyerror as well, don't want to catch that + if isinstance(typ, six.string_types): + if typ == "choice": + warnings.warn( + "type argument to addoption() is a string %r." + " For parsearg this is optional and when supplied" + " should be a type." + " (options: %s)" % (typ, names), + DeprecationWarning, + stacklevel=3, + ) + # argparse expects a type here take it from + # the type of the first element + attrs["type"] = type(attrs["choices"][0]) + else: + warnings.warn( + "type argument to addoption() is a string %r." + " For parsearg this should be a type." + " (options: %s)" % (typ, names), + DeprecationWarning, + stacklevel=3, + ) + attrs["type"] = Argument._typ_map[typ] + # used in test_parseopt -> test_parse_defaultgetter + self.type = attrs["type"] + else: + self.type = typ + try: + # attribute existence is tested in Config._processopt + self.default = attrs["default"] + except KeyError: + pass + self._set_opt_strings(names) + if not self.dest: + if self._long_opts: + self.dest = self._long_opts[0][2:].replace("-", "_") + else: + try: + self.dest = self._short_opts[0][1:] + except IndexError: + raise ArgumentError("need a long or short option", self) + + def names(self): + return self._short_opts + self._long_opts + + def attrs(self): + # update any attributes set by processopt + attrs = "default dest help".split() + if self.dest: + attrs.append(self.dest) + for attr in attrs: + try: + self._attrs[attr] = getattr(self, attr) + except AttributeError: + pass + if self._attrs.get("help"): + a = self._attrs["help"] + a = a.replace("%default", "%(default)s") + # a = a.replace('%prog', '%(prog)s') + self._attrs["help"] = a + return self._attrs + + def _set_opt_strings(self, opts): + """directly from optparse + + might not be necessary as this is passed to argparse later on""" + for opt in opts: + if len(opt) < 2: + raise ArgumentError( + "invalid option string %r: " + "must be at least two characters long" % opt, + self, + ) + elif len(opt) == 2: + if not (opt[0] == "-" and opt[1] != "-"): + raise ArgumentError( + "invalid short option string %r: " + "must be of the form -x, (x any non-dash char)" % opt, + self, + ) + self._short_opts.append(opt) + else: + if not (opt[0:2] == "--" and opt[2] != "-"): + raise ArgumentError( + "invalid long option string %r: " + "must start with --, followed by non-dash" % opt, + self, + ) + self._long_opts.append(opt) + + def __repr__(self): + args = [] + if self._short_opts: + args += ["_short_opts: " + repr(self._short_opts)] + if self._long_opts: + args += ["_long_opts: " + repr(self._long_opts)] + args += ["dest: " + repr(self.dest)] + if hasattr(self, "type"): + args += ["type: " + repr(self.type)] + if hasattr(self, "default"): + args += ["default: " + repr(self.default)] + return "Argument({})".format(", ".join(args)) + + +class OptionGroup(object): + + def __init__(self, name, description="", parser=None): + self.name = name + self.description = description + self.options = [] + self.parser = parser + + def addoption(self, *optnames, **attrs): + """ add an option to this group. + + if a shortened version of a long option is specified it will + be suppressed in the help. addoption('--twowords', '--two-words') + results in help showing '--two-words' only, but --twowords gets + accepted **and** the automatic destination is in args.twowords + """ + conflict = set(optnames).intersection( + name for opt in self.options for name in opt.names() + ) + if conflict: + raise ValueError("option names %s already added" % conflict) + option = Argument(*optnames, **attrs) + self._addoption_instance(option, shortupper=False) + + def _addoption(self, *optnames, **attrs): + option = Argument(*optnames, **attrs) + self._addoption_instance(option, shortupper=True) + + def _addoption_instance(self, option, shortupper=False): + if not shortupper: + for opt in option._short_opts: + if opt[0] == "-" and opt[1].islower(): + raise ValueError("lowercase shortoptions reserved") + if self.parser: + self.parser.processoption(option) + self.options.append(option) + + +class MyOptionParser(argparse.ArgumentParser): + + def __init__(self, parser, extra_info=None): + if not extra_info: + extra_info = {} + self._parser = parser + argparse.ArgumentParser.__init__( + self, + usage=parser._usage, + add_help=False, + formatter_class=DropShorterLongHelpFormatter, + ) + # extra_info is a dict of (param -> value) to display if there's + # an usage error to provide more contextual information to the user + self.extra_info = extra_info + + def parse_args(self, args=None, namespace=None): + """allow splitting of positional arguments""" + args, argv = self.parse_known_args(args, namespace) + if argv: + for arg in argv: + if arg and arg[0] == "-": + lines = ["unrecognized arguments: %s" % (" ".join(argv))] + for k, v in sorted(self.extra_info.items()): + lines.append(" %s: %s" % (k, v)) + self.error("\n".join(lines)) + getattr(args, FILE_OR_DIR).extend(argv) + return args + + +class DropShorterLongHelpFormatter(argparse.HelpFormatter): + """shorten help for long options that differ only in extra hyphens + + - collapse **long** options that are the same except for extra hyphens + - special action attribute map_long_option allows surpressing additional + long options + - shortcut if there are only two options and one of them is a short one + - cache result on action object as this is called at least 2 times + """ + + def _format_action_invocation(self, action): + orgstr = argparse.HelpFormatter._format_action_invocation(self, action) + if orgstr and orgstr[0] != "-": # only optional arguments + return orgstr + res = getattr(action, "_formatted_action_invocation", None) + if res: + return res + options = orgstr.split(", ") + if len(options) == 2 and (len(options[0]) == 2 or len(options[1]) == 2): + # a shortcut for '-h, --help' or '--abc', '-a' + action._formatted_action_invocation = orgstr + return orgstr + return_list = [] + option_map = getattr(action, "map_long_option", {}) + if option_map is None: + option_map = {} + short_long = {} + for option in options: + if len(option) == 2 or option[2] == " ": + continue + if not option.startswith("--"): + raise ArgumentError( + 'long optional argument without "--": [%s]' % (option), self + ) + xxoption = option[2:] + if xxoption.split()[0] not in option_map: + shortened = xxoption.replace("-", "") + if ( + shortened not in short_long + or len(short_long[shortened]) < len(xxoption) + ): + short_long[shortened] = xxoption + # now short_long has been filled out to the longest with dashes + # **and** we keep the right option ordering from add_argument + for option in options: + if len(option) == 2 or option[2] == " ": + return_list.append(option) + if option[2:] == short_long.get(option.replace("-", "")): + return_list.append(option.replace(" ", "=", 1)) + action._formatted_action_invocation = ", ".join(return_list) + return action._formatted_action_invocation diff --git a/third_party/python/pytest/src/_pytest/config/exceptions.py b/third_party/python/pytest/src/_pytest/config/exceptions.py new file mode 100644 index 0000000000..64bae834d1 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/config/exceptions.py @@ -0,0 +1,8 @@ +class UsageError(Exception): + """ error in pytest usage or invocation""" + + +class PrintHelp(Exception): + """Raised when pytest should print it's help to skip the rest of the + argument parsing and validation.""" + pass diff --git a/third_party/python/pytest/src/_pytest/config/findpaths.py b/third_party/python/pytest/src/_pytest/config/findpaths.py new file mode 100644 index 0000000000..fde7bddb93 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/config/findpaths.py @@ -0,0 +1,140 @@ +import py +import os +from .exceptions import UsageError + + +def exists(path, ignore=EnvironmentError): + try: + return path.check() + except ignore: + return False + + +def getcfg(args, warnfunc=None): + """ + Search the list of arguments for a valid ini-file for pytest, + and return a tuple of (rootdir, inifile, cfg-dict). + + note: warnfunc is an optional function used to warn + about ini-files that use deprecated features. + This parameter should be removed when pytest + adopts standard deprecation warnings (#1804). + """ + from _pytest.deprecated import CFG_PYTEST_SECTION + + inibasenames = ["pytest.ini", "tox.ini", "setup.cfg"] + args = [x for x in args if not str(x).startswith("-")] + if not args: + args = [py.path.local()] + for arg in args: + arg = py.path.local(arg) + for base in arg.parts(reverse=True): + for inibasename in inibasenames: + p = base.join(inibasename) + if exists(p): + iniconfig = py.iniconfig.IniConfig(p) + if "pytest" in iniconfig.sections: + if inibasename == "setup.cfg" and warnfunc: + warnfunc( + "C1", CFG_PYTEST_SECTION.format(filename=inibasename) + ) + return base, p, iniconfig["pytest"] + if ( + inibasename == "setup.cfg" + and "tool:pytest" in iniconfig.sections + ): + return base, p, iniconfig["tool:pytest"] + elif inibasename == "pytest.ini": + # allowed to be empty + return base, p, {} + return None, None, None + + +def get_common_ancestor(paths): + common_ancestor = None + for path in paths: + if not path.exists(): + continue + if common_ancestor is None: + common_ancestor = path + else: + if path.relto(common_ancestor) or path == common_ancestor: + continue + elif common_ancestor.relto(path): + common_ancestor = path + else: + shared = path.common(common_ancestor) + if shared is not None: + common_ancestor = shared + if common_ancestor is None: + common_ancestor = py.path.local() + elif common_ancestor.isfile(): + common_ancestor = common_ancestor.dirpath() + return common_ancestor + + +def get_dirs_from_args(args): + + def is_option(x): + return str(x).startswith("-") + + def get_file_part_from_node_id(x): + return str(x).split("::")[0] + + def get_dir_from_path(path): + if path.isdir(): + return path + return py.path.local(path.dirname) + + # These look like paths but may not exist + possible_paths = ( + py.path.local(get_file_part_from_node_id(arg)) + for arg in args + if not is_option(arg) + ) + + return [get_dir_from_path(path) for path in possible_paths if path.exists()] + + +def determine_setup(inifile, args, warnfunc=None, rootdir_cmd_arg=None): + dirs = get_dirs_from_args(args) + if inifile: + iniconfig = py.iniconfig.IniConfig(inifile) + is_cfg_file = str(inifile).endswith(".cfg") + # TODO: [pytest] section in *.cfg files is depricated. Need refactoring. + sections = ["tool:pytest", "pytest"] if is_cfg_file else ["pytest"] + for section in sections: + try: + inicfg = iniconfig[section] + if is_cfg_file and section == "pytest" and warnfunc: + from _pytest.deprecated import CFG_PYTEST_SECTION + + warnfunc("C1", CFG_PYTEST_SECTION.format(filename=str(inifile))) + break + except KeyError: + inicfg = None + rootdir = get_common_ancestor(dirs) + else: + ancestor = get_common_ancestor(dirs) + rootdir, inifile, inicfg = getcfg([ancestor], warnfunc=warnfunc) + if rootdir is None: + for rootdir in ancestor.parts(reverse=True): + if rootdir.join("setup.py").exists(): + break + else: + rootdir, inifile, inicfg = getcfg(dirs, warnfunc=warnfunc) + if rootdir is None: + rootdir = get_common_ancestor([py.path.local(), ancestor]) + is_fs_root = os.path.splitdrive(str(rootdir))[1] == "/" + if is_fs_root: + rootdir = ancestor + if rootdir_cmd_arg: + rootdir_abs_path = py.path.local(os.path.expandvars(rootdir_cmd_arg)) + if not os.path.isdir(str(rootdir_abs_path)): + raise UsageError( + "Directory '{}' not found. Check your '--rootdir' option.".format( + rootdir_abs_path + ) + ) + rootdir = rootdir_abs_path + return rootdir, inifile, inicfg or {} diff --git a/third_party/python/pytest/src/_pytest/debugging.py b/third_party/python/pytest/src/_pytest/debugging.py new file mode 100644 index 0000000000..2e253aaa2a --- /dev/null +++ b/third_party/python/pytest/src/_pytest/debugging.py @@ -0,0 +1,162 @@ +""" interactive debugging with PDB, the Python Debugger. """ +from __future__ import absolute_import, division, print_function +import pdb +import sys +import os +from doctest import UnexpectedException + +try: + from builtins import breakpoint # noqa + + SUPPORTS_BREAKPOINT_BUILTIN = True +except ImportError: + SUPPORTS_BREAKPOINT_BUILTIN = False + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + "--pdb", + dest="usepdb", + action="store_true", + help="start the interactive Python debugger on errors or KeyboardInterrupt.", + ) + group._addoption( + "--pdbcls", + dest="usepdb_cls", + metavar="modulename:classname", + help="start a custom interactive Python debugger on errors. " + "For example: --pdbcls=IPython.terminal.debugger:TerminalPdb", + ) + + +def pytest_configure(config): + if config.getvalue("usepdb_cls"): + modname, classname = config.getvalue("usepdb_cls").split(":") + __import__(modname) + pdb_cls = getattr(sys.modules[modname], classname) + else: + pdb_cls = pdb.Pdb + + if config.getvalue("usepdb"): + config.pluginmanager.register(PdbInvoke(), "pdbinvoke") + + # Use custom Pdb class set_trace instead of default Pdb on breakpoint() call + if SUPPORTS_BREAKPOINT_BUILTIN: + _environ_pythonbreakpoint = os.environ.get("PYTHONBREAKPOINT", "") + if _environ_pythonbreakpoint == "": + sys.breakpointhook = pytestPDB.set_trace + + old = (pdb.set_trace, pytestPDB._pluginmanager) + + def fin(): + pdb.set_trace, pytestPDB._pluginmanager = old + pytestPDB._config = None + pytestPDB._pdb_cls = pdb.Pdb + if SUPPORTS_BREAKPOINT_BUILTIN: + sys.breakpointhook = sys.__breakpointhook__ + + pdb.set_trace = pytestPDB.set_trace + pytestPDB._pluginmanager = config.pluginmanager + pytestPDB._config = config + pytestPDB._pdb_cls = pdb_cls + config._cleanup.append(fin) + + +class pytestPDB(object): + """ Pseudo PDB that defers to the real pdb. """ + _pluginmanager = None + _config = None + _pdb_cls = pdb.Pdb + + @classmethod + def set_trace(cls): + """ invoke PDB set_trace debugging, dropping any IO capturing. """ + import _pytest.config + + frame = sys._getframe().f_back + if cls._pluginmanager is not None: + capman = cls._pluginmanager.getplugin("capturemanager") + if capman: + capman.suspend_global_capture(in_=True) + tw = _pytest.config.create_terminal_writer(cls._config) + tw.line() + tw.sep(">", "PDB set_trace (IO-capturing turned off)") + cls._pluginmanager.hook.pytest_enter_pdb(config=cls._config) + cls._pdb_cls().set_trace(frame) + + +class PdbInvoke(object): + + def pytest_exception_interact(self, node, call, report): + capman = node.config.pluginmanager.getplugin("capturemanager") + if capman: + out, err = capman.suspend_global_capture(in_=True) + sys.stdout.write(out) + sys.stdout.write(err) + _enter_pdb(node, call.excinfo, report) + + def pytest_internalerror(self, excrepr, excinfo): + for line in str(excrepr).split("\n"): + sys.stderr.write("INTERNALERROR> %s\n" % line) + sys.stderr.flush() + tb = _postmortem_traceback(excinfo) + post_mortem(tb) + + +def _enter_pdb(node, excinfo, rep): + # XXX we re-use the TerminalReporter's terminalwriter + # because this seems to avoid some encoding related troubles + # for not completely clear reasons. + tw = node.config.pluginmanager.getplugin("terminalreporter")._tw + tw.line() + + showcapture = node.config.option.showcapture + + for sectionname, content in ( + ("stdout", rep.capstdout), ("stderr", rep.capstderr), ("log", rep.caplog) + ): + if showcapture in (sectionname, "all") and content: + tw.sep(">", "captured " + sectionname) + if content[-1:] == "\n": + content = content[:-1] + tw.line(content) + + tw.sep(">", "traceback") + rep.toterminal(tw) + tw.sep(">", "entering PDB") + tb = _postmortem_traceback(excinfo) + post_mortem(tb) + rep._pdbshown = True + return rep + + +def _postmortem_traceback(excinfo): + if isinstance(excinfo.value, UnexpectedException): + # A doctest.UnexpectedException is not useful for post_mortem. + # Use the underlying exception instead: + return excinfo.value.exc_info[2] + else: + return excinfo._excinfo[2] + + +def _find_last_non_hidden_frame(stack): + i = max(0, len(stack) - 1) + while i and stack[i][0].f_locals.get("__tracebackhide__", False): + i -= 1 + return i + + +def post_mortem(t): + + class Pdb(pytestPDB._pdb_cls): + + def get_stack(self, f, t): + stack, i = pdb.Pdb.get_stack(self, f, t) + if f is None: + i = _find_last_non_hidden_frame(stack) + return stack, i + + p = Pdb() + p.reset() + p.interaction(None, t) diff --git a/third_party/python/pytest/src/_pytest/deprecated.py b/third_party/python/pytest/src/_pytest/deprecated.py new file mode 100644 index 0000000000..7ebdcf9997 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/deprecated.py @@ -0,0 +1,65 @@ +""" +This module contains deprecation messages and bits of code used elsewhere in the codebase +that is planned to be removed in the next pytest release. + +Keeping it in a central location makes it easy to track what is deprecated and should +be removed when the time comes. +""" +from __future__ import absolute_import, division, print_function + + +class RemovedInPytest4Warning(DeprecationWarning): + """warning class for features removed in pytest 4.0""" + + +MAIN_STR_ARGS = "passing a string to pytest.main() is deprecated, " "pass a list of arguments instead." + +YIELD_TESTS = "yield tests are deprecated, and scheduled to be removed in pytest 4.0" + +FUNCARG_PREFIX = ( + '{name}: declaring fixtures using "pytest_funcarg__" prefix is deprecated ' + "and scheduled to be removed in pytest 4.0. " + "Please remove the prefix and use the @pytest.fixture decorator instead." +) + +CFG_PYTEST_SECTION = "[pytest] section in {filename} files is deprecated, use [tool:pytest] instead." + +GETFUNCARGVALUE = "use of getfuncargvalue is deprecated, use getfixturevalue" + +RESULT_LOG = ( + "--result-log is deprecated and scheduled for removal in pytest 4.0.\n" + "See https://docs.pytest.org/en/latest/usage.html#creating-resultlog-format-files for more information." +) + +MARK_INFO_ATTRIBUTE = RemovedInPytest4Warning( + "MarkInfo objects are deprecated as they contain merged marks which are hard to deal with correctly.\n" + "Please use node.get_closest_marker(name) or node.iter_markers(name).\n" + "Docs: https://docs.pytest.org/en/latest/mark.html#updating-code" +) + +MARK_PARAMETERSET_UNPACKING = RemovedInPytest4Warning( + "Applying marks directly to parameters is deprecated," + " please use pytest.param(..., marks=...) instead.\n" + "For more details, see: https://docs.pytest.org/en/latest/parametrize.html" +) + +RECORD_XML_PROPERTY = ( + 'Fixture renamed from "record_xml_property" to "record_property" as user ' + "properties are now available to all reporters.\n" + '"record_xml_property" is now deprecated.' +) + +COLLECTOR_MAKEITEM = RemovedInPytest4Warning( + "pycollector makeitem was removed " "as it is an accidentially leaked internal api" +) + +METAFUNC_ADD_CALL = ( + "Metafunc.addcall is deprecated and scheduled to be removed in pytest 4.0.\n" + "Please use Metafunc.parametrize instead." +) + +PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST = RemovedInPytest4Warning( + "Defining pytest_plugins in a non-top-level conftest is deprecated, " + "because it affects the entire directory tree in a non-explicit way.\n" + "Please move it to the top level conftest file instead." +) diff --git a/third_party/python/pytest/src/_pytest/doctest.py b/third_party/python/pytest/src/_pytest/doctest.py new file mode 100644 index 0000000000..b0a3ad08df --- /dev/null +++ b/third_party/python/pytest/src/_pytest/doctest.py @@ -0,0 +1,520 @@ +""" discover and run doctests in modules and test files.""" +from __future__ import absolute_import, division, print_function + +import traceback +import sys +import platform + +import pytest +from _pytest._code.code import ExceptionInfo, ReprFileLocation, TerminalRepr +from _pytest.fixtures import FixtureRequest + + +DOCTEST_REPORT_CHOICE_NONE = "none" +DOCTEST_REPORT_CHOICE_CDIFF = "cdiff" +DOCTEST_REPORT_CHOICE_NDIFF = "ndiff" +DOCTEST_REPORT_CHOICE_UDIFF = "udiff" +DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE = "only_first_failure" + +DOCTEST_REPORT_CHOICES = ( + DOCTEST_REPORT_CHOICE_NONE, + DOCTEST_REPORT_CHOICE_CDIFF, + DOCTEST_REPORT_CHOICE_NDIFF, + DOCTEST_REPORT_CHOICE_UDIFF, + DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE, +) + +# Lazy definition of runner class +RUNNER_CLASS = None + + +def pytest_addoption(parser): + parser.addini( + "doctest_optionflags", + "option flags for doctests", + type="args", + default=["ELLIPSIS"], + ) + parser.addini( + "doctest_encoding", "encoding used for doctest files", default="utf-8" + ) + group = parser.getgroup("collect") + group.addoption( + "--doctest-modules", + action="store_true", + default=False, + help="run doctests in all .py modules", + dest="doctestmodules", + ) + group.addoption( + "--doctest-report", + type=str.lower, + default="udiff", + help="choose another output format for diffs on doctest failure", + choices=DOCTEST_REPORT_CHOICES, + dest="doctestreport", + ) + group.addoption( + "--doctest-glob", + action="append", + default=[], + metavar="pat", + help="doctests file matching pattern, default: test*.txt", + dest="doctestglob", + ) + group.addoption( + "--doctest-ignore-import-errors", + action="store_true", + default=False, + help="ignore doctest ImportErrors", + dest="doctest_ignore_import_errors", + ) + group.addoption( + "--doctest-continue-on-failure", + action="store_true", + default=False, + help="for a given doctest, continue to run after the first failure", + dest="doctest_continue_on_failure", + ) + + +def pytest_collect_file(path, parent): + config = parent.config + if path.ext == ".py": + if config.option.doctestmodules and not _is_setup_py(config, path, parent): + return DoctestModule(path, parent) + elif _is_doctest(config, path, parent): + return DoctestTextfile(path, parent) + + +def _is_setup_py(config, path, parent): + if path.basename != "setup.py": + return False + contents = path.read() + return "setuptools" in contents or "distutils" in contents + + +def _is_doctest(config, path, parent): + if path.ext in (".txt", ".rst") and parent.session.isinitpath(path): + return True + globs = config.getoption("doctestglob") or ["test*.txt"] + for glob in globs: + if path.check(fnmatch=glob): + return True + return False + + +class ReprFailDoctest(TerminalRepr): + + def __init__(self, reprlocation_lines): + # List of (reprlocation, lines) tuples + self.reprlocation_lines = reprlocation_lines + + def toterminal(self, tw): + for reprlocation, lines in self.reprlocation_lines: + for line in lines: + tw.line(line) + reprlocation.toterminal(tw) + + +class MultipleDoctestFailures(Exception): + + def __init__(self, failures): + super(MultipleDoctestFailures, self).__init__() + self.failures = failures + + +def _init_runner_class(): + import doctest + + class PytestDoctestRunner(doctest.DebugRunner): + """ + Runner to collect failures. Note that the out variable in this case is + a list instead of a stdout-like object + """ + + def __init__( + self, checker=None, verbose=None, optionflags=0, continue_on_failure=True + ): + doctest.DebugRunner.__init__( + self, checker=checker, verbose=verbose, optionflags=optionflags + ) + self.continue_on_failure = continue_on_failure + + def report_failure(self, out, test, example, got): + failure = doctest.DocTestFailure(test, example, got) + if self.continue_on_failure: + out.append(failure) + else: + raise failure + + def report_unexpected_exception(self, out, test, example, exc_info): + failure = doctest.UnexpectedException(test, example, exc_info) + if self.continue_on_failure: + out.append(failure) + else: + raise failure + + return PytestDoctestRunner + + +def _get_runner(checker=None, verbose=None, optionflags=0, continue_on_failure=True): + # We need this in order to do a lazy import on doctest + global RUNNER_CLASS + if RUNNER_CLASS is None: + RUNNER_CLASS = _init_runner_class() + return RUNNER_CLASS( + checker=checker, + verbose=verbose, + optionflags=optionflags, + continue_on_failure=continue_on_failure, + ) + + +class DoctestItem(pytest.Item): + + def __init__(self, name, parent, runner=None, dtest=None): + super(DoctestItem, self).__init__(name, parent) + self.runner = runner + self.dtest = dtest + self.obj = None + self.fixture_request = None + + def setup(self): + if self.dtest is not None: + self.fixture_request = _setup_fixtures(self) + globs = dict(getfixture=self.fixture_request.getfixturevalue) + for name, value in self.fixture_request.getfixturevalue( + "doctest_namespace" + ).items(): + globs[name] = value + self.dtest.globs.update(globs) + + def runtest(self): + _check_all_skipped(self.dtest) + self._disable_output_capturing_for_darwin() + failures = [] + self.runner.run(self.dtest, out=failures) + if failures: + raise MultipleDoctestFailures(failures) + + def _disable_output_capturing_for_darwin(self): + """ + Disable output capturing. Otherwise, stdout is lost to doctest (#985) + """ + if platform.system() != "Darwin": + return + capman = self.config.pluginmanager.getplugin("capturemanager") + if capman: + out, err = capman.suspend_global_capture(in_=True) + sys.stdout.write(out) + sys.stderr.write(err) + + def repr_failure(self, excinfo): + import doctest + + failures = None + if excinfo.errisinstance((doctest.DocTestFailure, doctest.UnexpectedException)): + failures = [excinfo.value] + elif excinfo.errisinstance(MultipleDoctestFailures): + failures = excinfo.value.failures + + if failures is not None: + reprlocation_lines = [] + for failure in failures: + example = failure.example + test = failure.test + filename = test.filename + if test.lineno is None: + lineno = None + else: + lineno = test.lineno + example.lineno + 1 + message = type(failure).__name__ + reprlocation = ReprFileLocation(filename, lineno, message) + checker = _get_checker() + report_choice = _get_report_choice( + self.config.getoption("doctestreport") + ) + if lineno is not None: + lines = failure.test.docstring.splitlines(False) + # add line numbers to the left of the error message + lines = [ + "%03d %s" % (i + test.lineno + 1, x) + for (i, x) in enumerate(lines) + ] + # trim docstring error lines to 10 + lines = lines[max(example.lineno - 9, 0):example.lineno + 1] + else: + lines = [ + "EXAMPLE LOCATION UNKNOWN, not showing all tests of that example" + ] + indent = ">>>" + for line in example.source.splitlines(): + lines.append("??? %s %s" % (indent, line)) + indent = "..." + if isinstance(failure, doctest.DocTestFailure): + lines += checker.output_difference( + example, failure.got, report_choice + ).split( + "\n" + ) + else: + inner_excinfo = ExceptionInfo(failure.exc_info) + lines += ["UNEXPECTED EXCEPTION: %s" % repr(inner_excinfo.value)] + lines += traceback.format_exception(*failure.exc_info) + reprlocation_lines.append((reprlocation, lines)) + return ReprFailDoctest(reprlocation_lines) + else: + return super(DoctestItem, self).repr_failure(excinfo) + + def reportinfo(self): + return self.fspath, self.dtest.lineno, "[doctest] %s" % self.name + + +def _get_flag_lookup(): + import doctest + + return dict( + DONT_ACCEPT_TRUE_FOR_1=doctest.DONT_ACCEPT_TRUE_FOR_1, + DONT_ACCEPT_BLANKLINE=doctest.DONT_ACCEPT_BLANKLINE, + NORMALIZE_WHITESPACE=doctest.NORMALIZE_WHITESPACE, + ELLIPSIS=doctest.ELLIPSIS, + IGNORE_EXCEPTION_DETAIL=doctest.IGNORE_EXCEPTION_DETAIL, + COMPARISON_FLAGS=doctest.COMPARISON_FLAGS, + ALLOW_UNICODE=_get_allow_unicode_flag(), + ALLOW_BYTES=_get_allow_bytes_flag(), + ) + + +def get_optionflags(parent): + optionflags_str = parent.config.getini("doctest_optionflags") + flag_lookup_table = _get_flag_lookup() + flag_acc = 0 + for flag in optionflags_str: + flag_acc |= flag_lookup_table[flag] + return flag_acc + + +def _get_continue_on_failure(config): + continue_on_failure = config.getvalue("doctest_continue_on_failure") + if continue_on_failure: + # We need to turn off this if we use pdb since we should stop at + # the first failure + if config.getvalue("usepdb"): + continue_on_failure = False + return continue_on_failure + + +class DoctestTextfile(pytest.Module): + obj = None + + def collect(self): + import doctest + + # inspired by doctest.testfile; ideally we would use it directly, + # but it doesn't support passing a custom checker + encoding = self.config.getini("doctest_encoding") + text = self.fspath.read_text(encoding) + filename = str(self.fspath) + name = self.fspath.basename + globs = {"__name__": "__main__"} + + optionflags = get_optionflags(self) + + runner = _get_runner( + verbose=0, + optionflags=optionflags, + checker=_get_checker(), + continue_on_failure=_get_continue_on_failure(self.config), + ) + _fix_spoof_python2(runner, encoding) + + parser = doctest.DocTestParser() + test = parser.get_doctest(text, globs, name, filename, 0) + if test.examples: + yield DoctestItem(test.name, self, runner, test) + + +def _check_all_skipped(test): + """raises pytest.skip() if all examples in the given DocTest have the SKIP + option set. + """ + import doctest + + all_skipped = all(x.options.get(doctest.SKIP, False) for x in test.examples) + if all_skipped: + pytest.skip("all tests skipped by +SKIP option") + + +class DoctestModule(pytest.Module): + + def collect(self): + import doctest + + if self.fspath.basename == "conftest.py": + module = self.config.pluginmanager._importconftest(self.fspath) + else: + try: + module = self.fspath.pyimport() + except ImportError: + if self.config.getvalue("doctest_ignore_import_errors"): + pytest.skip("unable to import module %r" % self.fspath) + else: + raise + # uses internal doctest module parsing mechanism + finder = doctest.DocTestFinder() + optionflags = get_optionflags(self) + runner = _get_runner( + verbose=0, + optionflags=optionflags, + checker=_get_checker(), + continue_on_failure=_get_continue_on_failure(self.config), + ) + + for test in finder.find(module, module.__name__): + if test.examples: # skip empty doctests + yield DoctestItem(test.name, self, runner, test) + + +def _setup_fixtures(doctest_item): + """ + Used by DoctestTextfile and DoctestItem to setup fixture information. + """ + + def func(): + pass + + doctest_item.funcargs = {} + fm = doctest_item.session._fixturemanager + doctest_item._fixtureinfo = fm.getfixtureinfo( + node=doctest_item, func=func, cls=None, funcargs=False + ) + fixture_request = FixtureRequest(doctest_item) + fixture_request._fillfixtures() + return fixture_request + + +def _get_checker(): + """ + Returns a doctest.OutputChecker subclass that takes in account the + ALLOW_UNICODE option to ignore u'' prefixes in strings and ALLOW_BYTES + to strip b'' prefixes. + Useful when the same doctest should run in Python 2 and Python 3. + + An inner class is used to avoid importing "doctest" at the module + level. + """ + if hasattr(_get_checker, "LiteralsOutputChecker"): + return _get_checker.LiteralsOutputChecker() + + import doctest + import re + + class LiteralsOutputChecker(doctest.OutputChecker): + """ + Copied from doctest_nose_plugin.py from the nltk project: + https://github.com/nltk/nltk + + Further extended to also support byte literals. + """ + + _unicode_literal_re = re.compile(r"(\W|^)[uU]([rR]?[\'\"])", re.UNICODE) + _bytes_literal_re = re.compile(r"(\W|^)[bB]([rR]?[\'\"])", re.UNICODE) + + def check_output(self, want, got, optionflags): + res = doctest.OutputChecker.check_output(self, want, got, optionflags) + if res: + return True + + allow_unicode = optionflags & _get_allow_unicode_flag() + allow_bytes = optionflags & _get_allow_bytes_flag() + if not allow_unicode and not allow_bytes: + return False + + else: # pragma: no cover + + def remove_prefixes(regex, txt): + return re.sub(regex, r"\1\2", txt) + + if allow_unicode: + want = remove_prefixes(self._unicode_literal_re, want) + got = remove_prefixes(self._unicode_literal_re, got) + if allow_bytes: + want = remove_prefixes(self._bytes_literal_re, want) + got = remove_prefixes(self._bytes_literal_re, got) + res = doctest.OutputChecker.check_output(self, want, got, optionflags) + return res + + _get_checker.LiteralsOutputChecker = LiteralsOutputChecker + return _get_checker.LiteralsOutputChecker() + + +def _get_allow_unicode_flag(): + """ + Registers and returns the ALLOW_UNICODE flag. + """ + import doctest + + return doctest.register_optionflag("ALLOW_UNICODE") + + +def _get_allow_bytes_flag(): + """ + Registers and returns the ALLOW_BYTES flag. + """ + import doctest + + return doctest.register_optionflag("ALLOW_BYTES") + + +def _get_report_choice(key): + """ + This function returns the actual `doctest` module flag value, we want to do it as late as possible to avoid + importing `doctest` and all its dependencies when parsing options, as it adds overhead and breaks tests. + """ + import doctest + + return { + DOCTEST_REPORT_CHOICE_UDIFF: doctest.REPORT_UDIFF, + DOCTEST_REPORT_CHOICE_CDIFF: doctest.REPORT_CDIFF, + DOCTEST_REPORT_CHOICE_NDIFF: doctest.REPORT_NDIFF, + DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE: doctest.REPORT_ONLY_FIRST_FAILURE, + DOCTEST_REPORT_CHOICE_NONE: 0, + }[ + key + ] + + +def _fix_spoof_python2(runner, encoding): + """ + Installs a "SpoofOut" into the given DebugRunner so it properly deals with unicode output. This + should patch only doctests for text files because they don't have a way to declare their + encoding. Doctests in docstrings from Python modules don't have the same problem given that + Python already decoded the strings. + + This fixes the problem related in issue #2434. + """ + from _pytest.compat import _PY2 + + if not _PY2: + return + + from doctest import _SpoofOut + + class UnicodeSpoof(_SpoofOut): + + def getvalue(self): + result = _SpoofOut.getvalue(self) + if encoding and isinstance(result, bytes): + result = result.decode(encoding) + return result + + runner._fakeout = UnicodeSpoof() + + +@pytest.fixture(scope="session") +def doctest_namespace(): + """ + Fixture that returns a :py:class:`dict` that will be injected into the namespace of doctests. + """ + return dict() diff --git a/third_party/python/pytest/src/_pytest/fixtures.py b/third_party/python/pytest/src/_pytest/fixtures.py new file mode 100644 index 0000000000..495e6b9b33 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/fixtures.py @@ -0,0 +1,1229 @@ +from __future__ import absolute_import, division, print_function + +import functools +import inspect +import sys +import warnings +from collections import OrderedDict, deque, defaultdict +from more_itertools import flatten + +import attr +import py +from py._code.code import FormattedExcinfo + +import _pytest +from _pytest import nodes +from _pytest._code.code import TerminalRepr +from _pytest.compat import ( + NOTSET, + exc_clear, + _format_args, + getfslineno, + get_real_func, + is_generator, + isclass, + getimfunc, + getlocation, + getfuncargnames, + safe_getattr, + FuncargnamesCompatAttr, +) +from _pytest.outcomes import fail, TEST_OUTCOME + +FIXTURE_MSG = 'fixtures cannot have "pytest_funcarg__" prefix and be decorated with @pytest.fixture:\n{}' + + +@attr.s(frozen=True) +class PseudoFixtureDef(object): + cached_result = attr.ib() + scope = attr.ib() + + +def pytest_sessionstart(session): + import _pytest.python + import _pytest.nodes + + scopename2class.update( + { + "class": _pytest.python.Class, + "module": _pytest.python.Module, + "function": _pytest.nodes.Item, + "session": _pytest.main.Session, + } + ) + session._fixturemanager = FixtureManager(session) + + +scopename2class = {} + + +scope2props = dict(session=()) +scope2props["module"] = ("fspath", "module") +scope2props["class"] = scope2props["module"] + ("cls",) +scope2props["instance"] = scope2props["class"] + ("instance",) +scope2props["function"] = scope2props["instance"] + ("function", "keywords") + + +def scopeproperty(name=None, doc=None): + + def decoratescope(func): + scopename = name or func.__name__ + + def provide(self): + if func.__name__ in scope2props[self.scope]: + return func(self) + raise AttributeError( + "%s not available in %s-scoped context" % (scopename, self.scope) + ) + + return property(provide, None, None, func.__doc__) + + return decoratescope + + +def get_scope_node(node, scope): + cls = scopename2class.get(scope) + if cls is None: + raise ValueError("unknown scope") + return node.getparent(cls) + + +def add_funcarg_pseudo_fixture_def(collector, metafunc, fixturemanager): + # this function will transform all collected calls to a functions + # if they use direct funcargs (i.e. direct parametrization) + # because we want later test execution to be able to rely on + # an existing FixtureDef structure for all arguments. + # XXX we can probably avoid this algorithm if we modify CallSpec2 + # to directly care for creating the fixturedefs within its methods. + if not metafunc._calls[0].funcargs: + return # this function call does not have direct parametrization + # collect funcargs of all callspecs into a list of values + arg2params = {} + arg2scope = {} + for callspec in metafunc._calls: + for argname, argvalue in callspec.funcargs.items(): + assert argname not in callspec.params + callspec.params[argname] = argvalue + arg2params_list = arg2params.setdefault(argname, []) + callspec.indices[argname] = len(arg2params_list) + arg2params_list.append(argvalue) + if argname not in arg2scope: + scopenum = callspec._arg2scopenum.get(argname, scopenum_function) + arg2scope[argname] = scopes[scopenum] + callspec.funcargs.clear() + + # register artificial FixtureDef's so that later at test execution + # time we can rely on a proper FixtureDef to exist for fixture setup. + arg2fixturedefs = metafunc._arg2fixturedefs + for argname, valuelist in arg2params.items(): + # if we have a scope that is higher than function we need + # to make sure we only ever create an according fixturedef on + # a per-scope basis. We thus store and cache the fixturedef on the + # node related to the scope. + scope = arg2scope[argname] + node = None + if scope != "function": + node = get_scope_node(collector, scope) + if node is None: + assert scope == "class" and isinstance(collector, _pytest.python.Module) + # use module-level collector for class-scope (for now) + node = collector + if node and argname in node._name2pseudofixturedef: + arg2fixturedefs[argname] = [node._name2pseudofixturedef[argname]] + else: + fixturedef = FixtureDef( + fixturemanager, + "", + argname, + get_direct_param_fixture_func, + arg2scope[argname], + valuelist, + False, + False, + ) + arg2fixturedefs[argname] = [fixturedef] + if node is not None: + node._name2pseudofixturedef[argname] = fixturedef + + +def getfixturemarker(obj): + """ return fixturemarker or None if it doesn't exist or raised + exceptions.""" + try: + return getattr(obj, "_pytestfixturefunction", None) + except TEST_OUTCOME: + # some objects raise errors like request (from flask import request) + # we don't expect them to be fixture functions + return None + + +def get_parametrized_fixture_keys(item, scopenum): + """ return list of keys for all parametrized arguments which match + the specified scope. """ + assert scopenum < scopenum_function # function + try: + cs = item.callspec + except AttributeError: + pass + else: + # cs.indices.items() is random order of argnames. Need to + # sort this so that different calls to + # get_parametrized_fixture_keys will be deterministic. + for argname, param_index in sorted(cs.indices.items()): + if cs._arg2scopenum[argname] != scopenum: + continue + if scopenum == 0: # session + key = (argname, param_index) + elif scopenum == 1: # module + key = (argname, param_index, item.fspath) + elif scopenum == 2: # class + key = (argname, param_index, item.fspath, item.cls) + yield key + + +# algorithm for sorting on a per-parametrized resource setup basis +# it is called for scopenum==0 (session) first and performs sorting +# down to the lower scopes such as to minimize number of "high scope" +# setups and teardowns + + +def reorder_items(items): + argkeys_cache = {} + items_by_argkey = {} + for scopenum in range(0, scopenum_function): + argkeys_cache[scopenum] = d = {} + items_by_argkey[scopenum] = item_d = defaultdict(deque) + for item in items: + keys = OrderedDict.fromkeys(get_parametrized_fixture_keys(item, scopenum)) + if keys: + d[item] = keys + for key in keys: + item_d[key].append(item) + items = OrderedDict.fromkeys(items) + return list(reorder_items_atscope(items, argkeys_cache, items_by_argkey, 0)) + + +def fix_cache_order(item, argkeys_cache, items_by_argkey): + for scopenum in range(0, scopenum_function): + for key in argkeys_cache[scopenum].get(item, []): + items_by_argkey[scopenum][key].appendleft(item) + + +def reorder_items_atscope(items, argkeys_cache, items_by_argkey, scopenum): + if scopenum >= scopenum_function or len(items) < 3: + return items + ignore = set() + items_deque = deque(items) + items_done = OrderedDict() + scoped_items_by_argkey = items_by_argkey[scopenum] + scoped_argkeys_cache = argkeys_cache[scopenum] + while items_deque: + no_argkey_group = OrderedDict() + slicing_argkey = None + while items_deque: + item = items_deque.popleft() + if item in items_done or item in no_argkey_group: + continue + argkeys = OrderedDict.fromkeys( + k for k in scoped_argkeys_cache.get(item, []) if k not in ignore + ) + if not argkeys: + no_argkey_group[item] = None + else: + slicing_argkey, _ = argkeys.popitem() + # we don't have to remove relevant items from later in the deque because they'll just be ignored + matching_items = [ + i for i in scoped_items_by_argkey[slicing_argkey] if i in items + ] + for i in reversed(matching_items): + fix_cache_order(i, argkeys_cache, items_by_argkey) + items_deque.appendleft(i) + break + if no_argkey_group: + no_argkey_group = reorder_items_atscope( + no_argkey_group, argkeys_cache, items_by_argkey, scopenum + 1 + ) + for item in no_argkey_group: + items_done[item] = None + ignore.add(slicing_argkey) + return items_done + + +def fillfixtures(function): + """ fill missing funcargs for a test function. """ + try: + request = function._request + except AttributeError: + # XXX this special code path is only expected to execute + # with the oejskit plugin. It uses classes with funcargs + # and we thus have to work a bit to allow this. + fm = function.session._fixturemanager + fi = fm.getfixtureinfo(function.parent, function.obj, None) + function._fixtureinfo = fi + request = function._request = FixtureRequest(function) + request._fillfixtures() + # prune out funcargs for jstests + newfuncargs = {} + for name in fi.argnames: + newfuncargs[name] = function.funcargs[name] + function.funcargs = newfuncargs + else: + request._fillfixtures() + + +def get_direct_param_fixture_func(request): + return request.param + + +class FuncFixtureInfo(object): + + def __init__(self, argnames, names_closure, name2fixturedefs): + self.argnames = argnames + self.names_closure = names_closure + self.name2fixturedefs = name2fixturedefs + + +class FixtureRequest(FuncargnamesCompatAttr): + """ A request for a fixture from a test or fixture function. + + A request object gives access to the requesting test context + and has an optional ``param`` attribute in case + the fixture is parametrized indirectly. + """ + + def __init__(self, pyfuncitem): + self._pyfuncitem = pyfuncitem + #: fixture for which this request is being performed + self.fixturename = None + #: Scope string, one of "function", "class", "module", "session" + self.scope = "function" + self._fixture_defs = {} # argname -> FixtureDef + fixtureinfo = pyfuncitem._fixtureinfo + self._arg2fixturedefs = fixtureinfo.name2fixturedefs.copy() + self._arg2index = {} + self._fixturemanager = pyfuncitem.session._fixturemanager + + @property + def fixturenames(self): + # backward incompatible note: now a readonly property + return list(self._pyfuncitem._fixtureinfo.names_closure) + + @property + def node(self): + """ underlying collection node (depends on current request scope)""" + return self._getscopeitem(self.scope) + + def _getnextfixturedef(self, argname): + fixturedefs = self._arg2fixturedefs.get(argname, None) + if fixturedefs is None: + # we arrive here because of a dynamic call to + # getfixturevalue(argname) usage which was naturally + # not known at parsing/collection time + parentid = self._pyfuncitem.parent.nodeid + fixturedefs = self._fixturemanager.getfixturedefs(argname, parentid) + self._arg2fixturedefs[argname] = fixturedefs + # fixturedefs list is immutable so we maintain a decreasing index + index = self._arg2index.get(argname, 0) - 1 + if fixturedefs is None or (-index > len(fixturedefs)): + raise FixtureLookupError(argname, self) + self._arg2index[argname] = index + return fixturedefs[index] + + @property + def config(self): + """ the pytest config object associated with this request. """ + return self._pyfuncitem.config + + @scopeproperty() + def function(self): + """ test function object if the request has a per-function scope. """ + return self._pyfuncitem.obj + + @scopeproperty("class") + def cls(self): + """ class (can be None) where the test function was collected. """ + clscol = self._pyfuncitem.getparent(_pytest.python.Class) + if clscol: + return clscol.obj + + @property + def instance(self): + """ instance (can be None) on which test function was collected. """ + # unittest support hack, see _pytest.unittest.TestCaseFunction + try: + return self._pyfuncitem._testcase + except AttributeError: + function = getattr(self, "function", None) + return getattr(function, "__self__", None) + + @scopeproperty() + def module(self): + """ python module object where the test function was collected. """ + return self._pyfuncitem.getparent(_pytest.python.Module).obj + + @scopeproperty() + def fspath(self): + """ the file system path of the test module which collected this test. """ + return self._pyfuncitem.fspath + + @property + def keywords(self): + """ keywords/markers dictionary for the underlying node. """ + return self.node.keywords + + @property + def session(self): + """ pytest session object. """ + return self._pyfuncitem.session + + def addfinalizer(self, finalizer): + """ add finalizer/teardown function to be called after the + last test within the requesting test context finished + execution. """ + # XXX usually this method is shadowed by fixturedef specific ones + self._addfinalizer(finalizer, scope=self.scope) + + def _addfinalizer(self, finalizer, scope): + colitem = self._getscopeitem(scope) + self._pyfuncitem.session._setupstate.addfinalizer( + finalizer=finalizer, colitem=colitem + ) + + def applymarker(self, marker): + """ Apply a marker to a single test function invocation. + This method is useful if you don't want to have a keyword/marker + on all function invocations. + + :arg marker: a :py:class:`_pytest.mark.MarkDecorator` object + created by a call to ``pytest.mark.NAME(...)``. + """ + self.node.add_marker(marker) + + def raiseerror(self, msg): + """ raise a FixtureLookupError with the given message. """ + raise self._fixturemanager.FixtureLookupError(None, self, msg) + + def _fillfixtures(self): + item = self._pyfuncitem + fixturenames = getattr(item, "fixturenames", self.fixturenames) + for argname in fixturenames: + if argname not in item.funcargs: + item.funcargs[argname] = self.getfixturevalue(argname) + + def cached_setup(self, setup, teardown=None, scope="module", extrakey=None): + """ (deprecated) Return a testing resource managed by ``setup`` & + ``teardown`` calls. ``scope`` and ``extrakey`` determine when the + ``teardown`` function will be called so that subsequent calls to + ``setup`` would recreate the resource. With pytest-2.3 you often + do not need ``cached_setup()`` as you can directly declare a scope + on a fixture function and register a finalizer through + ``request.addfinalizer()``. + + :arg teardown: function receiving a previously setup resource. + :arg setup: a no-argument function creating a resource. + :arg scope: a string value out of ``function``, ``class``, ``module`` + or ``session`` indicating the caching lifecycle of the resource. + :arg extrakey: added to internal caching key of (funcargname, scope). + """ + if not hasattr(self.config, "_setupcache"): + self.config._setupcache = {} # XXX weakref? + cachekey = (self.fixturename, self._getscopeitem(scope), extrakey) + cache = self.config._setupcache + try: + val = cache[cachekey] + except KeyError: + self._check_scope(self.fixturename, self.scope, scope) + val = setup() + cache[cachekey] = val + if teardown is not None: + + def finalizer(): + del cache[cachekey] + teardown(val) + + self._addfinalizer(finalizer, scope=scope) + return val + + def getfixturevalue(self, argname): + """ Dynamically run a named fixture function. + + Declaring fixtures via function argument is recommended where possible. + But if you can only decide whether to use another fixture at test + setup time, you may use this function to retrieve it inside a fixture + or test function body. + """ + return self._get_active_fixturedef(argname).cached_result[0] + + def getfuncargvalue(self, argname): + """ Deprecated, use getfixturevalue. """ + from _pytest import deprecated + + warnings.warn(deprecated.GETFUNCARGVALUE, DeprecationWarning, stacklevel=2) + return self.getfixturevalue(argname) + + def _get_active_fixturedef(self, argname): + try: + return self._fixture_defs[argname] + except KeyError: + try: + fixturedef = self._getnextfixturedef(argname) + except FixtureLookupError: + if argname == "request": + cached_result = (self, [0], None) + scope = "function" + return PseudoFixtureDef(cached_result, scope) + raise + # remove indent to prevent the python3 exception + # from leaking into the call + self._compute_fixture_value(fixturedef) + self._fixture_defs[argname] = fixturedef + return fixturedef + + def _get_fixturestack(self): + current = self + values = [] + while 1: + fixturedef = getattr(current, "_fixturedef", None) + if fixturedef is None: + values.reverse() + return values + values.append(fixturedef) + current = current._parent_request + + def _compute_fixture_value(self, fixturedef): + """ + Creates a SubRequest based on "self" and calls the execute method of the given fixturedef object. This will + force the FixtureDef object to throw away any previous results and compute a new fixture value, which + will be stored into the FixtureDef object itself. + + :param FixtureDef fixturedef: + """ + # prepare a subrequest object before calling fixture function + # (latter managed by fixturedef) + argname = fixturedef.argname + funcitem = self._pyfuncitem + scope = fixturedef.scope + try: + param = funcitem.callspec.getparam(argname) + except (AttributeError, ValueError): + param = NOTSET + param_index = 0 + if fixturedef.params is not None: + frame = inspect.stack()[3] + frameinfo = inspect.getframeinfo(frame[0]) + source_path = frameinfo.filename + source_lineno = frameinfo.lineno + source_path = py.path.local(source_path) + if source_path.relto(funcitem.config.rootdir): + source_path = source_path.relto(funcitem.config.rootdir) + msg = ( + "The requested fixture has no parameter defined for the " + "current test.\n\nRequested fixture '{}' defined in:\n{}" + "\n\nRequested here:\n{}:{}".format( + fixturedef.argname, + getlocation(fixturedef.func, funcitem.config.rootdir), + source_path, + source_lineno, + ) + ) + fail(msg) + else: + # indices might not be set if old-style metafunc.addcall() was used + param_index = funcitem.callspec.indices.get(argname, 0) + # if a parametrize invocation set a scope it will override + # the static scope defined with the fixture function + paramscopenum = funcitem.callspec._arg2scopenum.get(argname) + if paramscopenum is not None: + scope = scopes[paramscopenum] + + subrequest = SubRequest(self, scope, param, param_index, fixturedef) + + # check if a higher-level scoped fixture accesses a lower level one + subrequest._check_scope(argname, self.scope, scope) + + # clear sys.exc_info before invoking the fixture (python bug?) + # if its not explicitly cleared it will leak into the call + exc_clear() + try: + # call the fixture function + fixturedef.execute(request=subrequest) + finally: + # if fixture function failed it might have registered finalizers + self.session._setupstate.addfinalizer( + functools.partial(fixturedef.finish, request=subrequest), + subrequest.node, + ) + + def _check_scope(self, argname, invoking_scope, requested_scope): + if argname == "request": + return + if scopemismatch(invoking_scope, requested_scope): + # try to report something helpful + lines = self._factorytraceback() + fail( + "ScopeMismatch: You tried to access the %r scoped " + "fixture %r with a %r scoped request object, " + "involved factories\n%s" + % ((requested_scope, argname, invoking_scope, "\n".join(lines))), + pytrace=False, + ) + + def _factorytraceback(self): + lines = [] + for fixturedef in self._get_fixturestack(): + factory = fixturedef.func + fs, lineno = getfslineno(factory) + p = self._pyfuncitem.session.fspath.bestrelpath(fs) + args = _format_args(factory) + lines.append("%s:%d: def %s%s" % (p, lineno, factory.__name__, args)) + return lines + + def _getscopeitem(self, scope): + if scope == "function": + # this might also be a non-function Item despite its attribute name + return self._pyfuncitem + node = get_scope_node(self._pyfuncitem, scope) + if node is None and scope == "class": + # fallback to function item itself + node = self._pyfuncitem + assert node, 'Could not obtain a node for scope "{}" for function {!r}'.format( + scope, self._pyfuncitem + ) + return node + + def __repr__(self): + return "<FixtureRequest for %r>" % (self.node) + + +class SubRequest(FixtureRequest): + """ a sub request for handling getting a fixture from a + test function/fixture. """ + + def __init__(self, request, scope, param, param_index, fixturedef): + self._parent_request = request + self.fixturename = fixturedef.argname + if param is not NOTSET: + self.param = param + self.param_index = param_index + self.scope = scope + self._fixturedef = fixturedef + self._pyfuncitem = request._pyfuncitem + self._fixture_defs = request._fixture_defs + self._arg2fixturedefs = request._arg2fixturedefs + self._arg2index = request._arg2index + self._fixturemanager = request._fixturemanager + + def __repr__(self): + return "<SubRequest %r for %r>" % (self.fixturename, self._pyfuncitem) + + def addfinalizer(self, finalizer): + self._fixturedef.addfinalizer(finalizer) + + +class ScopeMismatchError(Exception): + """ A fixture function tries to use a different fixture function which + which has a lower scope (e.g. a Session one calls a function one) + """ + + +scopes = "session module class function".split() +scopenum_function = scopes.index("function") + + +def scopemismatch(currentscope, newscope): + return scopes.index(newscope) > scopes.index(currentscope) + + +def scope2index(scope, descr, where=None): + """Look up the index of ``scope`` and raise a descriptive value error + if not defined. + """ + try: + return scopes.index(scope) + except ValueError: + raise ValueError( + "{} {}has an unsupported scope value '{}'".format( + descr, "from {} ".format(where) if where else "", scope + ) + ) + + +class FixtureLookupError(LookupError): + """ could not return a requested Fixture (missing or invalid). """ + + def __init__(self, argname, request, msg=None): + self.argname = argname + self.request = request + self.fixturestack = request._get_fixturestack() + self.msg = msg + + def formatrepr(self): + tblines = [] + addline = tblines.append + stack = [self.request._pyfuncitem.obj] + stack.extend(map(lambda x: x.func, self.fixturestack)) + msg = self.msg + if msg is not None: + # the last fixture raise an error, let's present + # it at the requesting side + stack = stack[:-1] + for function in stack: + fspath, lineno = getfslineno(function) + try: + lines, _ = inspect.getsourcelines(get_real_func(function)) + except (IOError, IndexError, TypeError): + error_msg = "file %s, line %s: source code not available" + addline(error_msg % (fspath, lineno + 1)) + else: + addline("file %s, line %s" % (fspath, lineno + 1)) + for i, line in enumerate(lines): + line = line.rstrip() + addline(" " + line) + if line.lstrip().startswith("def"): + break + + if msg is None: + fm = self.request._fixturemanager + available = [] + parentid = self.request._pyfuncitem.parent.nodeid + for name, fixturedefs in fm._arg2fixturedefs.items(): + faclist = list(fm._matchfactories(fixturedefs, parentid)) + if faclist and name not in available: + available.append(name) + msg = "fixture %r not found" % (self.argname,) + msg += "\n available fixtures: %s" % (", ".join(sorted(available)),) + msg += "\n use 'pytest --fixtures [testpath]' for help on them." + + return FixtureLookupErrorRepr(fspath, lineno, tblines, msg, self.argname) + + +class FixtureLookupErrorRepr(TerminalRepr): + + def __init__(self, filename, firstlineno, tblines, errorstring, argname): + self.tblines = tblines + self.errorstring = errorstring + self.filename = filename + self.firstlineno = firstlineno + self.argname = argname + + def toterminal(self, tw): + # tw.line("FixtureLookupError: %s" %(self.argname), red=True) + for tbline in self.tblines: + tw.line(tbline.rstrip()) + lines = self.errorstring.split("\n") + if lines: + tw.line( + "{} {}".format(FormattedExcinfo.fail_marker, lines[0].strip()), + red=True, + ) + for line in lines[1:]: + tw.line( + "{} {}".format(FormattedExcinfo.flow_marker, line.strip()), + red=True, + ) + tw.line() + tw.line("%s:%d" % (self.filename, self.firstlineno + 1)) + + +def fail_fixturefunc(fixturefunc, msg): + fs, lineno = getfslineno(fixturefunc) + location = "%s:%s" % (fs, lineno + 1) + source = _pytest._code.Source(fixturefunc) + fail(msg + ":\n\n" + str(source.indent()) + "\n" + location, pytrace=False) + + +def call_fixture_func(fixturefunc, request, kwargs): + yieldctx = is_generator(fixturefunc) + if yieldctx: + it = fixturefunc(**kwargs) + res = next(it) + + def teardown(): + try: + next(it) + except StopIteration: + pass + else: + fail_fixturefunc( + fixturefunc, "yield_fixture function has more than one 'yield'" + ) + + request.addfinalizer(teardown) + else: + res = fixturefunc(**kwargs) + return res + + +class FixtureDef(object): + """ A container for a factory definition. """ + + def __init__( + self, + fixturemanager, + baseid, + argname, + func, + scope, + params, + unittest=False, + ids=None, + ): + self._fixturemanager = fixturemanager + self.baseid = baseid or "" + self.has_location = baseid is not None + self.func = func + self.argname = argname + self.scope = scope + self.scopenum = scope2index( + scope or "function", descr="fixture {}".format(func.__name__), where=baseid + ) + self.params = params + self.argnames = getfuncargnames(func, is_method=unittest) + self.unittest = unittest + self.ids = ids + self._finalizers = [] + + def addfinalizer(self, finalizer): + self._finalizers.append(finalizer) + + def finish(self, request): + exceptions = [] + try: + while self._finalizers: + try: + func = self._finalizers.pop() + func() + except: # noqa + exceptions.append(sys.exc_info()) + if exceptions: + e = exceptions[0] + del exceptions # ensure we don't keep all frames alive because of the traceback + py.builtin._reraise(*e) + + finally: + hook = self._fixturemanager.session.gethookproxy(request.node.fspath) + hook.pytest_fixture_post_finalizer(fixturedef=self, request=request) + # even if finalization fails, we invalidate + # the cached fixture value and remove + # all finalizers because they may be bound methods which will + # keep instances alive + if hasattr(self, "cached_result"): + del self.cached_result + self._finalizers = [] + + def execute(self, request): + # get required arguments and register our own finish() + # with their finalization + for argname in self.argnames: + fixturedef = request._get_active_fixturedef(argname) + if argname != "request": + fixturedef.addfinalizer(functools.partial(self.finish, request=request)) + + my_cache_key = request.param_index + cached_result = getattr(self, "cached_result", None) + if cached_result is not None: + result, cache_key, err = cached_result + if my_cache_key == cache_key: + if err is not None: + py.builtin._reraise(*err) + else: + return result + # we have a previous but differently parametrized fixture instance + # so we need to tear it down before creating a new one + self.finish(request) + assert not hasattr(self, "cached_result") + + hook = self._fixturemanager.session.gethookproxy(request.node.fspath) + return hook.pytest_fixture_setup(fixturedef=self, request=request) + + def __repr__(self): + return ( + "<FixtureDef name=%r scope=%r baseid=%r >" + % (self.argname, self.scope, self.baseid) + ) + + +def pytest_fixture_setup(fixturedef, request): + """ Execution of fixture setup. """ + kwargs = {} + for argname in fixturedef.argnames: + fixdef = request._get_active_fixturedef(argname) + result, arg_cache_key, exc = fixdef.cached_result + request._check_scope(argname, request.scope, fixdef.scope) + kwargs[argname] = result + + fixturefunc = fixturedef.func + if fixturedef.unittest: + if request.instance is not None: + # bind the unbound method to the TestCase instance + fixturefunc = fixturedef.func.__get__(request.instance) + else: + # the fixture function needs to be bound to the actual + # request.instance so that code working with "fixturedef" behaves + # as expected. + if request.instance is not None: + fixturefunc = getimfunc(fixturedef.func) + if fixturefunc != fixturedef.func: + fixturefunc = fixturefunc.__get__(request.instance) + my_cache_key = request.param_index + try: + result = call_fixture_func(fixturefunc, request, kwargs) + except TEST_OUTCOME: + fixturedef.cached_result = (None, my_cache_key, sys.exc_info()) + raise + fixturedef.cached_result = (result, my_cache_key, None) + return result + + +def _ensure_immutable_ids(ids): + if ids is None: + return + if callable(ids): + return ids + return tuple(ids) + + +@attr.s(frozen=True) +class FixtureFunctionMarker(object): + scope = attr.ib() + params = attr.ib(converter=attr.converters.optional(tuple)) + autouse = attr.ib(default=False) + ids = attr.ib(default=None, converter=_ensure_immutable_ids) + name = attr.ib(default=None) + + def __call__(self, function): + if isclass(function): + raise ValueError("class fixtures not supported (may be in the future)") + + if getattr(function, "_pytestfixturefunction", False): + raise ValueError( + "fixture is being applied more than once to the same function" + ) + + function._pytestfixturefunction = self + return function + + +def fixture(scope="function", params=None, autouse=False, ids=None, name=None): + """Decorator to mark a fixture factory function. + + This decorator can be used (with or without parameters) to define a + fixture function. The name of the fixture function can later be + referenced to cause its invocation ahead of running tests: test + modules or classes can use the pytest.mark.usefixtures(fixturename) + marker. Test functions can directly use fixture names as input + arguments in which case the fixture instance returned from the fixture + function will be injected. + + :arg scope: the scope for which this fixture is shared, one of + "function" (default), "class", "module" or "session". + + :arg params: an optional list of parameters which will cause multiple + invocations of the fixture function and all of the tests + using it. + + :arg autouse: if True, the fixture func is activated for all tests that + can see it. If False (the default) then an explicit + reference is needed to activate the fixture. + + :arg ids: list of string ids each corresponding to the params + so that they are part of the test id. If no ids are provided + they will be generated automatically from the params. + + :arg name: the name of the fixture. This defaults to the name of the + decorated function. If a fixture is used in the same module in + which it is defined, the function name of the fixture will be + shadowed by the function arg that requests the fixture; one way + to resolve this is to name the decorated function + ``fixture_<fixturename>`` and then use + ``@pytest.fixture(name='<fixturename>')``. + + Fixtures can optionally provide their values to test functions using a ``yield`` statement, + instead of ``return``. In this case, the code block after the ``yield`` statement is executed + as teardown code regardless of the test outcome. A fixture function must yield exactly once. + """ + if callable(scope) and params is None and autouse is False: + # direct decoration + return FixtureFunctionMarker("function", params, autouse, name=name)(scope) + if params is not None and not isinstance(params, (list, tuple)): + params = list(params) + return FixtureFunctionMarker(scope, params, autouse, ids=ids, name=name) + + +def yield_fixture(scope="function", params=None, autouse=False, ids=None, name=None): + """ (return a) decorator to mark a yield-fixture factory function. + + .. deprecated:: 3.0 + Use :py:func:`pytest.fixture` directly instead. + """ + if callable(scope) and params is None and not autouse: + # direct decoration + return FixtureFunctionMarker("function", params, autouse, ids=ids, name=name)( + scope + ) + else: + return FixtureFunctionMarker(scope, params, autouse, ids=ids, name=name) + + +defaultfuncargprefixmarker = fixture() + + +@fixture(scope="session") +def pytestconfig(request): + """Session-scoped fixture that returns the :class:`_pytest.config.Config` object. + + Example:: + + def test_foo(pytestconfig): + if pytestconfig.getoption("verbose"): + ... + + """ + return request.config + + +class FixtureManager(object): + """ + pytest fixtures definitions and information is stored and managed + from this class. + + During collection fm.parsefactories() is called multiple times to parse + fixture function definitions into FixtureDef objects and internal + data structures. + + During collection of test functions, metafunc-mechanics instantiate + a FuncFixtureInfo object which is cached per node/func-name. + This FuncFixtureInfo object is later retrieved by Function nodes + which themselves offer a fixturenames attribute. + + The FuncFixtureInfo object holds information about fixtures and FixtureDefs + relevant for a particular function. An initial list of fixtures is + assembled like this: + + - ini-defined usefixtures + - autouse-marked fixtures along the collection chain up from the function + - usefixtures markers at module/class/function level + - test function funcargs + + Subsequently the funcfixtureinfo.fixturenames attribute is computed + as the closure of the fixtures needed to setup the initial fixtures, + i. e. fixtures needed by fixture functions themselves are appended + to the fixturenames list. + + Upon the test-setup phases all fixturenames are instantiated, retrieved + by a lookup of their FuncFixtureInfo. + """ + + _argprefix = "pytest_funcarg__" + FixtureLookupError = FixtureLookupError + FixtureLookupErrorRepr = FixtureLookupErrorRepr + + def __init__(self, session): + self.session = session + self.config = session.config + self._arg2fixturedefs = {} + self._holderobjseen = set() + self._arg2finish = {} + self._nodeid_and_autousenames = [("", self.config.getini("usefixtures"))] + session.config.pluginmanager.register(self, "funcmanage") + + def getfixtureinfo(self, node, func, cls, funcargs=True): + if funcargs and not getattr(node, "nofuncargs", False): + argnames = getfuncargnames(func, cls=cls) + else: + argnames = () + usefixtures = flatten( + mark.args for mark in node.iter_markers(name="usefixtures") + ) + initialnames = argnames + initialnames = tuple(usefixtures) + initialnames + fm = node.session._fixturemanager + names_closure, arg2fixturedefs = fm.getfixtureclosure(initialnames, node) + return FuncFixtureInfo(argnames, names_closure, arg2fixturedefs) + + def pytest_plugin_registered(self, plugin): + nodeid = None + try: + p = py.path.local(plugin.__file__) + except AttributeError: + pass + else: + # construct the base nodeid which is later used to check + # what fixtures are visible for particular tests (as denoted + # by their test id) + if p.basename.startswith("conftest.py"): + nodeid = p.dirpath().relto(self.config.rootdir) + if p.sep != nodes.SEP: + nodeid = nodeid.replace(p.sep, nodes.SEP) + self.parsefactories(plugin, nodeid) + + def _getautousenames(self, nodeid): + """ return a tuple of fixture names to be used. """ + autousenames = [] + for baseid, basenames in self._nodeid_and_autousenames: + if nodeid.startswith(baseid): + if baseid: + i = len(baseid) + nextchar = nodeid[i:i + 1] + if nextchar and nextchar not in ":/": + continue + autousenames.extend(basenames) + return autousenames + + def getfixtureclosure(self, fixturenames, parentnode): + # collect the closure of all fixtures , starting with the given + # fixturenames as the initial set. As we have to visit all + # factory definitions anyway, we also return an arg2fixturedefs + # mapping so that the caller can reuse it and does not have + # to re-discover fixturedefs again for each fixturename + # (discovering matching fixtures for a given name/node is expensive) + + parentid = parentnode.nodeid + fixturenames_closure = self._getautousenames(parentid) + + def merge(otherlist): + for arg in otherlist: + if arg not in fixturenames_closure: + fixturenames_closure.append(arg) + + merge(fixturenames) + arg2fixturedefs = {} + lastlen = -1 + while lastlen != len(fixturenames_closure): + lastlen = len(fixturenames_closure) + for argname in fixturenames_closure: + if argname in arg2fixturedefs: + continue + fixturedefs = self.getfixturedefs(argname, parentid) + if fixturedefs: + arg2fixturedefs[argname] = fixturedefs + merge(fixturedefs[-1].argnames) + + def sort_by_scope(arg_name): + try: + fixturedefs = arg2fixturedefs[arg_name] + except KeyError: + return scopes.index("function") + else: + return fixturedefs[-1].scopenum + + fixturenames_closure.sort(key=sort_by_scope) + return fixturenames_closure, arg2fixturedefs + + def pytest_generate_tests(self, metafunc): + for argname in metafunc.fixturenames: + faclist = metafunc._arg2fixturedefs.get(argname) + if faclist: + fixturedef = faclist[-1] + if fixturedef.params is not None: + parametrize_func = getattr(metafunc.function, "parametrize", None) + if parametrize_func is not None: + parametrize_func = parametrize_func.combined + func_params = getattr(parametrize_func, "args", [[None]]) + func_kwargs = getattr(parametrize_func, "kwargs", {}) + # skip directly parametrized arguments + if "argnames" in func_kwargs: + argnames = parametrize_func.kwargs["argnames"] + else: + argnames = func_params[0] + if not isinstance(argnames, (tuple, list)): + argnames = [x.strip() for x in argnames.split(",") if x.strip()] + if argname not in func_params and argname not in argnames: + metafunc.parametrize( + argname, + fixturedef.params, + indirect=True, + scope=fixturedef.scope, + ids=fixturedef.ids, + ) + else: + continue # will raise FixtureLookupError at setup time + + def pytest_collection_modifyitems(self, items): + # separate parametrized setups + items[:] = reorder_items(items) + + def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False): + if nodeid is not NOTSET: + holderobj = node_or_obj + else: + holderobj = node_or_obj.obj + nodeid = node_or_obj.nodeid + if holderobj in self._holderobjseen: + return + self._holderobjseen.add(holderobj) + autousenames = [] + for name in dir(holderobj): + # The attribute can be an arbitrary descriptor, so the attribute + # access below can raise. safe_getatt() ignores such exceptions. + obj = safe_getattr(holderobj, name, None) + # fixture functions have a pytest_funcarg__ prefix (pre-2.3 style) + # or are "@pytest.fixture" marked + marker = getfixturemarker(obj) + if marker is None: + if not name.startswith(self._argprefix): + continue + if not callable(obj): + continue + marker = defaultfuncargprefixmarker + from _pytest import deprecated + + self.config.warn( + "C1", deprecated.FUNCARG_PREFIX.format(name=name), nodeid=nodeid + ) + name = name[len(self._argprefix):] + elif not isinstance(marker, FixtureFunctionMarker): + # magic globals with __getattr__ might have got us a wrong + # fixture attribute + continue + else: + if marker.name: + name = marker.name + assert not name.startswith(self._argprefix), FIXTURE_MSG.format(name) + + fixture_def = FixtureDef( + self, + nodeid, + name, + obj, + marker.scope, + marker.params, + unittest=unittest, + ids=marker.ids, + ) + + faclist = self._arg2fixturedefs.setdefault(name, []) + if fixture_def.has_location: + faclist.append(fixture_def) + else: + # fixturedefs with no location are at the front + # so this inserts the current fixturedef after the + # existing fixturedefs from external plugins but + # before the fixturedefs provided in conftests. + i = len([f for f in faclist if not f.has_location]) + faclist.insert(i, fixture_def) + if marker.autouse: + autousenames.append(name) + + if autousenames: + self._nodeid_and_autousenames.append((nodeid or "", autousenames)) + + def getfixturedefs(self, argname, nodeid): + """ + Gets a list of fixtures which are applicable to the given node id. + + :param str argname: name of the fixture to search for + :param str nodeid: full node id of the requesting test. + :return: list[FixtureDef] + """ + try: + fixturedefs = self._arg2fixturedefs[argname] + except KeyError: + return None + else: + return tuple(self._matchfactories(fixturedefs, nodeid)) + + def _matchfactories(self, fixturedefs, nodeid): + for fixturedef in fixturedefs: + if nodes.ischildnode(fixturedef.baseid, nodeid): + yield fixturedef diff --git a/third_party/python/pytest/src/_pytest/freeze_support.py b/third_party/python/pytest/src/_pytest/freeze_support.py new file mode 100644 index 0000000000..002e077301 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/freeze_support.py @@ -0,0 +1,45 @@ +""" +Provides a function to report all internal modules for using freezing tools +pytest +""" +from __future__ import absolute_import, division, print_function + + +def freeze_includes(): + """ + Returns a list of module names used by pytest that should be + included by cx_freeze. + """ + import py + import _pytest + + result = list(_iter_all_modules(py)) + result += list(_iter_all_modules(_pytest)) + return result + + +def _iter_all_modules(package, prefix=""): + """ + Iterates over the names of all modules that can be found in the given + package, recursively. + Example: + _iter_all_modules(_pytest) -> + ['_pytest.assertion.newinterpret', + '_pytest.capture', + '_pytest.core', + ... + ] + """ + import os + import pkgutil + + if type(package) is not str: + path, prefix = package.__path__[0], package.__name__ + "." + else: + path = package + for _, name, is_package in pkgutil.iter_modules([path]): + if is_package: + for m in _iter_all_modules(os.path.join(path, name), prefix=name + "."): + yield prefix + m + else: + yield prefix + name diff --git a/third_party/python/pytest/src/_pytest/helpconfig.py b/third_party/python/pytest/src/_pytest/helpconfig.py new file mode 100644 index 0000000000..5514fec404 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/helpconfig.py @@ -0,0 +1,212 @@ +""" version info, help messages, tracing configuration. """ +from __future__ import absolute_import, division, print_function + +import py +import pytest +from _pytest.config import PrintHelp +import os +import sys +from argparse import Action + + +class HelpAction(Action): + """This is an argparse Action that will raise an exception in + order to skip the rest of the argument parsing when --help is passed. + This prevents argparse from quitting due to missing required arguments + when any are defined, for example by ``pytest_addoption``. + This is similar to the way that the builtin argparse --help option is + implemented by raising SystemExit. + """ + + def __init__(self, option_strings, dest=None, default=False, help=None): + super(HelpAction, self).__init__( + option_strings=option_strings, + dest=dest, + const=True, + default=default, + nargs=0, + help=help, + ) + + def __call__(self, parser, namespace, values, option_string=None): + setattr(namespace, self.dest, self.const) + + # We should only skip the rest of the parsing after preparse is done + if getattr(parser._parser, "after_preparse", False): + raise PrintHelp + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--version", + action="store_true", + help="display pytest lib version and import information.", + ) + group._addoption( + "-h", + "--help", + action=HelpAction, + dest="help", + help="show help message and configuration info", + ) + group._addoption( + "-p", + action="append", + dest="plugins", + default=[], + metavar="name", + help="early-load given plugin (multi-allowed). " + "To avoid loading of plugins, use the `no:` prefix, e.g. " + "`no:doctest`.", + ) + group.addoption( + "--traceconfig", + "--trace-config", + action="store_true", + default=False, + help="trace considerations of conftest.py files.", + ), + group.addoption( + "--debug", + action="store_true", + dest="debug", + default=False, + help="store internal tracing debug information in 'pytestdebug.log'.", + ) + group._addoption( + "-o", + "--override-ini", + dest="override_ini", + action="append", + help='override ini option with "option=value" style, e.g. `-o xfail_strict=True -o cache_dir=cache`.', + ) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_cmdline_parse(): + outcome = yield + config = outcome.get_result() + if config.option.debug: + path = os.path.abspath("pytestdebug.log") + debugfile = open(path, "w") + debugfile.write( + "versions pytest-%s, py-%s, " + "python-%s\ncwd=%s\nargs=%s\n\n" + % ( + pytest.__version__, + py.__version__, + ".".join(map(str, sys.version_info)), + os.getcwd(), + config._origargs, + ) + ) + config.trace.root.setwriter(debugfile.write) + undo_tracing = config.pluginmanager.enable_tracing() + sys.stderr.write("writing pytestdebug information to %s\n" % path) + + def unset_tracing(): + debugfile.close() + sys.stderr.write("wrote pytestdebug information to %s\n" % debugfile.name) + config.trace.root.setwriter(None) + undo_tracing() + + config.add_cleanup(unset_tracing) + + +def pytest_cmdline_main(config): + if config.option.version: + p = py.path.local(pytest.__file__) + sys.stderr.write( + "This is pytest version %s, imported from %s\n" % (pytest.__version__, p) + ) + plugininfo = getpluginversioninfo(config) + if plugininfo: + for line in plugininfo: + sys.stderr.write(line + "\n") + return 0 + elif config.option.help: + config._do_configure() + showhelp(config) + config._ensure_unconfigure() + return 0 + + +def showhelp(config): + reporter = config.pluginmanager.get_plugin("terminalreporter") + tw = reporter._tw + tw.write(config._parser.optparser.format_help()) + tw.line() + tw.line() + tw.line( + "[pytest] ini-options in the first " "pytest.ini|tox.ini|setup.cfg file found:" + ) + tw.line() + + for name in config._parser._ininames: + help, type, default = config._parser._inidict[name] + if type is None: + type = "string" + spec = "%s (%s)" % (name, type) + line = " %-24s %s" % (spec, help) + tw.line(line[:tw.fullwidth]) + + tw.line() + tw.line("environment variables:") + vars = [ + ("PYTEST_ADDOPTS", "extra command line options"), + ("PYTEST_PLUGINS", "comma-separated plugins to load during startup"), + ("PYTEST_DEBUG", "set to enable debug tracing of pytest's internals"), + ] + for name, help in vars: + tw.line(" %-24s %s" % (name, help)) + tw.line() + tw.line() + + tw.line("to see available markers type: pytest --markers") + tw.line("to see available fixtures type: pytest --fixtures") + tw.line( + "(shown according to specified file_or_dir or current dir " + "if not specified; fixtures with leading '_' are only shown " + "with the '-v' option" + ) + + for warningreport in reporter.stats.get("warnings", []): + tw.line("warning : " + warningreport.message, red=True) + return + + +conftest_options = [("pytest_plugins", "list of plugin names to load")] + + +def getpluginversioninfo(config): + lines = [] + plugininfo = config.pluginmanager.list_plugin_distinfo() + if plugininfo: + lines.append("setuptools registered plugins:") + for plugin, dist in plugininfo: + loc = getattr(plugin, "__file__", repr(plugin)) + content = "%s-%s at %s" % (dist.project_name, dist.version, loc) + lines.append(" " + content) + return lines + + +def pytest_report_header(config): + lines = [] + if config.option.debug or config.option.traceconfig: + lines.append("using: pytest-%s pylib-%s" % (pytest.__version__, py.__version__)) + + verinfo = getpluginversioninfo(config) + if verinfo: + lines.extend(verinfo) + + if config.option.traceconfig: + lines.append("active plugins:") + items = config.pluginmanager.list_name_plugin() + for name, plugin in items: + if hasattr(plugin, "__file__"): + r = plugin.__file__ + else: + r = repr(plugin) + lines.append(" %-20s: %s" % (name, r)) + return lines diff --git a/third_party/python/pytest/src/_pytest/hookspec.py b/third_party/python/pytest/src/_pytest/hookspec.py new file mode 100644 index 0000000000..fec43a4009 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/hookspec.py @@ -0,0 +1,563 @@ +""" hook specifications for pytest plugins, invoked from main.py and builtin plugins. """ + +from pluggy import HookspecMarker + +hookspec = HookspecMarker("pytest") + +# ------------------------------------------------------------------------- +# Initialization hooks called for every plugin +# ------------------------------------------------------------------------- + + +@hookspec(historic=True) +def pytest_addhooks(pluginmanager): + """called at plugin registration time to allow adding new hooks via a call to + ``pluginmanager.add_hookspecs(module_or_class, prefix)``. + + + :param _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_namespace(): + """ + (**Deprecated**) this hook causes direct monkeypatching on pytest, its use is strongly discouraged + return dict of name->object to be made globally available in + the pytest namespace. + + This hook is called at plugin registration time. + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_plugin_registered(plugin, manager): + """ a new pytest plugin got registered. + + :param plugin: the plugin module or instance + :param _pytest.config.PytestPluginManager manager: pytest plugin manager + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_addoption(parser): + """register argparse-style options and ini-style config values, + called once at the beginning of a test run. + + .. note:: + + This function should be implemented only in plugins or ``conftest.py`` + files situated at the tests root directory due to how pytest + :ref:`discovers plugins during startup <pluginorder>`. + + :arg _pytest.config.Parser parser: To add command line options, call + :py:func:`parser.addoption(...) <_pytest.config.Parser.addoption>`. + To add ini-file values call :py:func:`parser.addini(...) + <_pytest.config.Parser.addini>`. + + Options can later be accessed through the + :py:class:`config <_pytest.config.Config>` object, respectively: + + - :py:func:`config.getoption(name) <_pytest.config.Config.getoption>` to + retrieve the value of a command line option. + + - :py:func:`config.getini(name) <_pytest.config.Config.getini>` to retrieve + a value read from an ini-style file. + + The config object is passed around on many internal objects via the ``.config`` + attribute or can be retrieved as the ``pytestconfig`` fixture. + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_configure(config): + """ + Allows plugins and conftest files to perform initial configuration. + + This hook is called for every plugin and initial conftest file + after command line options have been parsed. + + After that, the hook is called for other conftest files as they are + imported. + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + + :arg _pytest.config.Config config: pytest config object + """ + + +# ------------------------------------------------------------------------- +# Bootstrapping hooks called for plugins registered early enough: +# internal and 3rd party plugins. +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_cmdline_parse(pluginmanager, args): + """return initialized config object, parsing the specified args. + + Stops at first non-None result, see :ref:`firstresult` + + .. note:: + This hook will not be called for ``conftest.py`` files, only for setuptools plugins. + + :param _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager + :param list[str] args: list of arguments passed on the command line + """ + + +def pytest_cmdline_preparse(config, args): + """(**Deprecated**) modify command line arguments before option parsing. + + This hook is considered deprecated and will be removed in a future pytest version. Consider + using :func:`pytest_load_initial_conftests` instead. + + .. note:: + This hook will not be called for ``conftest.py`` files, only for setuptools plugins. + + :param _pytest.config.Config config: pytest config object + :param list[str] args: list of arguments passed on the command line + """ + + +@hookspec(firstresult=True) +def pytest_cmdline_main(config): + """ called for performing the main command line action. The default + implementation will invoke the configure hooks and runtest_mainloop. + + .. note:: + This hook will not be called for ``conftest.py`` files, only for setuptools plugins. + + Stops at first non-None result, see :ref:`firstresult` + + :param _pytest.config.Config config: pytest config object + """ + + +def pytest_load_initial_conftests(early_config, parser, args): + """ implements the loading of initial conftest files ahead + of command line option parsing. + + .. note:: + This hook will not be called for ``conftest.py`` files, only for setuptools plugins. + + :param _pytest.config.Config early_config: pytest config object + :param list[str] args: list of arguments passed on the command line + :param _pytest.config.Parser parser: to add command line options + """ + + +# ------------------------------------------------------------------------- +# collection hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_collection(session): + """Perform the collection protocol for the given session. + + Stops at first non-None result, see :ref:`firstresult`. + + :param _pytest.main.Session session: the pytest session object + """ + + +def pytest_collection_modifyitems(session, config, items): + """ called after collection has been performed, may filter or re-order + the items in-place. + + :param _pytest.main.Session session: the pytest session object + :param _pytest.config.Config config: pytest config object + :param List[_pytest.nodes.Item] items: list of item objects + """ + + +def pytest_collection_finish(session): + """ called after collection has been performed and modified. + + :param _pytest.main.Session session: the pytest session object + """ + + +@hookspec(firstresult=True) +def pytest_ignore_collect(path, config): + """ return True to prevent considering this path for collection. + This hook is consulted for all files and directories prior to calling + more specific hooks. + + Stops at first non-None result, see :ref:`firstresult` + + :param str path: the path to analyze + :param _pytest.config.Config config: pytest config object + """ + + +@hookspec(firstresult=True) +def pytest_collect_directory(path, parent): + """ called before traversing a directory for collection files. + + Stops at first non-None result, see :ref:`firstresult` + + :param str path: the path to analyze + """ + + +def pytest_collect_file(path, parent): + """ return collection Node or None for the given path. Any new node + needs to have the specified ``parent`` as a parent. + + :param str path: the path to collect + """ + + +# logging hooks for collection + + +def pytest_collectstart(collector): + """ collector starts collecting. """ + + +def pytest_itemcollected(item): + """ we just collected a test item. """ + + +def pytest_collectreport(report): + """ collector finished collecting. """ + + +def pytest_deselected(items): + """ called for test items deselected by keyword. """ + + +@hookspec(firstresult=True) +def pytest_make_collect_report(collector): + """ perform ``collector.collect()`` and return a CollectReport. + + Stops at first non-None result, see :ref:`firstresult` """ + + +# ------------------------------------------------------------------------- +# Python test function related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_pycollect_makemodule(path, parent): + """ return a Module collector or None for the given path. + This hook will be called for each matching test module path. + The pytest_collect_file hook needs to be used if you want to + create test modules for files that do not match as a test module. + + Stops at first non-None result, see :ref:`firstresult` """ + + +@hookspec(firstresult=True) +def pytest_pycollect_makeitem(collector, name, obj): + """ return custom item/collector for a python object in a module, or None. + + Stops at first non-None result, see :ref:`firstresult` """ + + +@hookspec(firstresult=True) +def pytest_pyfunc_call(pyfuncitem): + """ call underlying test function. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_generate_tests(metafunc): + """ generate (multiple) parametrized calls to a test function.""" + + +@hookspec(firstresult=True) +def pytest_make_parametrize_id(config, val, argname): + """Return a user-friendly string representation of the given ``val`` that will be used + by @pytest.mark.parametrize calls. Return None if the hook doesn't know about ``val``. + The parameter name is available as ``argname``, if required. + + Stops at first non-None result, see :ref:`firstresult` + + :param _pytest.config.Config config: pytest config object + :param val: the parametrized value + :param str argname: the automatic parameter name produced by pytest + """ + + +# ------------------------------------------------------------------------- +# generic runtest related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_runtestloop(session): + """ called for performing the main runtest loop + (after collection finished). + + Stops at first non-None result, see :ref:`firstresult` + + :param _pytest.main.Session session: the pytest session object + """ + + +def pytest_itemstart(item, node): + """(**Deprecated**) use pytest_runtest_logstart. """ + + +@hookspec(firstresult=True) +def pytest_runtest_protocol(item, nextitem): + """ implements the runtest_setup/call/teardown protocol for + the given test item, including capturing exceptions and calling + reporting hooks. + + :arg item: test item for which the runtest protocol is performed. + + :arg nextitem: the scheduled-to-be-next test item (or None if this + is the end my friend). This argument is passed on to + :py:func:`pytest_runtest_teardown`. + + :return boolean: True if no further hook implementations should be invoked. + + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_runtest_logstart(nodeid, location): + """ signal the start of running a single test item. + + This hook will be called **before** :func:`pytest_runtest_setup`, :func:`pytest_runtest_call` and + :func:`pytest_runtest_teardown` hooks. + + :param str nodeid: full id of the item + :param location: a triple of ``(filename, linenum, testname)`` + """ + + +def pytest_runtest_logfinish(nodeid, location): + """ signal the complete finish of running a single test item. + + This hook will be called **after** :func:`pytest_runtest_setup`, :func:`pytest_runtest_call` and + :func:`pytest_runtest_teardown` hooks. + + :param str nodeid: full id of the item + :param location: a triple of ``(filename, linenum, testname)`` + """ + + +def pytest_runtest_setup(item): + """ called before ``pytest_runtest_call(item)``. """ + + +def pytest_runtest_call(item): + """ called to execute the test ``item``. """ + + +def pytest_runtest_teardown(item, nextitem): + """ called after ``pytest_runtest_call``. + + :arg nextitem: the scheduled-to-be-next test item (None if no further + test item is scheduled). This argument can be used to + perform exact teardowns, i.e. calling just enough finalizers + so that nextitem only needs to call setup-functions. + """ + + +@hookspec(firstresult=True) +def pytest_runtest_makereport(item, call): + """ return a :py:class:`_pytest.runner.TestReport` object + for the given :py:class:`pytest.Item <_pytest.main.Item>` and + :py:class:`_pytest.runner.CallInfo`. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_runtest_logreport(report): + """ process a test setup/call/teardown report relating to + the respective phase of executing a test. """ + + +# ------------------------------------------------------------------------- +# Fixture related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_fixture_setup(fixturedef, request): + """ performs fixture setup execution. + + :return: The return value of the call to the fixture function + + Stops at first non-None result, see :ref:`firstresult` + + .. note:: + If the fixture function returns None, other implementations of + this hook function will continue to be called, according to the + behavior of the :ref:`firstresult` option. + """ + + +def pytest_fixture_post_finalizer(fixturedef, request): + """ called after fixture teardown, but before the cache is cleared so + the fixture result cache ``fixturedef.cached_result`` can + still be accessed.""" + + +# ------------------------------------------------------------------------- +# test session related hooks +# ------------------------------------------------------------------------- + + +def pytest_sessionstart(session): + """ called after the ``Session`` object has been created and before performing collection + and entering the run test loop. + + :param _pytest.main.Session session: the pytest session object + """ + + +def pytest_sessionfinish(session, exitstatus): + """ called after whole test run finished, right before returning the exit status to the system. + + :param _pytest.main.Session session: the pytest session object + :param int exitstatus: the status which pytest will return to the system + """ + + +def pytest_unconfigure(config): + """ called before test process is exited. + + :param _pytest.config.Config config: pytest config object + """ + + +# ------------------------------------------------------------------------- +# hooks for customizing the assert methods +# ------------------------------------------------------------------------- + + +def pytest_assertrepr_compare(config, op, left, right): + """return explanation for comparisons in failing assert expressions. + + Return None for no custom explanation, otherwise return a list + of strings. The strings will be joined by newlines but any newlines + *in* a string will be escaped. Note that all but the first line will + be indented slightly, the intention is for the first line to be a summary. + + :param _pytest.config.Config config: pytest config object + """ + + +# ------------------------------------------------------------------------- +# hooks for influencing reporting (invoked from _pytest_terminal) +# ------------------------------------------------------------------------- + + +def pytest_report_header(config, startdir): + """ return a string or list of strings to be displayed as header info for terminal reporting. + + :param _pytest.config.Config config: pytest config object + :param startdir: py.path object with the starting dir + + .. note:: + + This function should be implemented only in plugins or ``conftest.py`` + files situated at the tests root directory due to how pytest + :ref:`discovers plugins during startup <pluginorder>`. + """ + + +def pytest_report_collectionfinish(config, startdir, items): + """ + .. versionadded:: 3.2 + + return a string or list of strings to be displayed after collection has finished successfully. + + This strings will be displayed after the standard "collected X items" message. + + :param _pytest.config.Config config: pytest config object + :param startdir: py.path object with the starting dir + :param items: list of pytest items that are going to be executed; this list should not be modified. + """ + + +@hookspec(firstresult=True) +def pytest_report_teststatus(report): + """ return result-category, shortletter and verbose word for reporting. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_terminal_summary(terminalreporter, exitstatus): + """Add a section to terminal summary reporting. + + :param _pytest.terminal.TerminalReporter terminalreporter: the internal terminal reporter object + :param int exitstatus: the exit status that will be reported back to the OS + + .. versionadded:: 3.5 + The ``config`` parameter. + """ + + +@hookspec(historic=True) +def pytest_logwarning(message, code, nodeid, fslocation): + """ process a warning specified by a message, a code string, + a nodeid and fslocation (both of which may be None + if the warning is not tied to a particular node/location). + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +# ------------------------------------------------------------------------- +# doctest hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_doctest_prepare_content(content): + """ return processed content for a given doctest + + Stops at first non-None result, see :ref:`firstresult` """ + + +# ------------------------------------------------------------------------- +# error handling and internal debugging hooks +# ------------------------------------------------------------------------- + + +def pytest_internalerror(excrepr, excinfo): + """ called for internal errors. """ + + +def pytest_keyboard_interrupt(excinfo): + """ called for keyboard interrupt. """ + + +def pytest_exception_interact(node, call, report): + """called when an exception was raised which can potentially be + interactively handled. + + This hook is only called if an exception was raised + that is not an internal exception like ``skip.Exception``. + """ + + +def pytest_enter_pdb(config): + """ called upon pdb.set_trace(), can be used by plugins to take special + action just before the python debugger enters in interactive mode. + + :param _pytest.config.Config config: pytest config object + """ diff --git a/third_party/python/pytest/src/_pytest/junitxml.py b/third_party/python/pytest/src/_pytest/junitxml.py new file mode 100644 index 0000000000..29da27de7c --- /dev/null +++ b/third_party/python/pytest/src/_pytest/junitxml.py @@ -0,0 +1,569 @@ +""" + report test results in JUnit-XML format, + for use with Jenkins and build integration servers. + + +Based on initial code from Ross Lawley. + +Output conforms to https://github.com/jenkinsci/xunit-plugin/blob/master/ +src/main/resources/org/jenkinsci/plugins/xunit/types/model/xsd/junit-10.xsd +""" +from __future__ import absolute_import, division, print_function + +import functools +import py +import os +import re +import sys +import time +import pytest +from _pytest import nodes +from _pytest.config import filename_arg + +# Python 2.X and 3.X compatibility +if sys.version_info[0] < 3: + from codecs import open +else: + unichr = chr + unicode = str + long = int + + +class Junit(py.xml.Namespace): + pass + + +# We need to get the subset of the invalid unicode ranges according to +# XML 1.0 which are valid in this python build. Hence we calculate +# this dynamically instead of hardcoding it. The spec range of valid +# chars is: Char ::= #x9 | #xA | #xD | [#x20-#xD7FF] | [#xE000-#xFFFD] +# | [#x10000-#x10FFFF] +_legal_chars = (0x09, 0x0A, 0x0d) +_legal_ranges = ((0x20, 0x7E), (0x80, 0xD7FF), (0xE000, 0xFFFD), (0x10000, 0x10FFFF)) +_legal_xml_re = [ + unicode("%s-%s") % (unichr(low), unichr(high)) + for (low, high) in _legal_ranges + if low < sys.maxunicode +] +_legal_xml_re = [unichr(x) for x in _legal_chars] + _legal_xml_re +illegal_xml_re = re.compile(unicode("[^%s]") % unicode("").join(_legal_xml_re)) +del _legal_chars +del _legal_ranges +del _legal_xml_re + +_py_ext_re = re.compile(r"\.py$") + + +def bin_xml_escape(arg): + + def repl(matchobj): + i = ord(matchobj.group()) + if i <= 0xFF: + return unicode("#x%02X") % i + else: + return unicode("#x%04X") % i + + return py.xml.raw(illegal_xml_re.sub(repl, py.xml.escape(arg))) + + +class _NodeReporter(object): + + def __init__(self, nodeid, xml): + + self.id = nodeid + self.xml = xml + self.add_stats = self.xml.add_stats + self.duration = 0 + self.properties = [] + self.nodes = [] + self.testcase = None + self.attrs = {} + + def append(self, node): + self.xml.add_stats(type(node).__name__) + self.nodes.append(node) + + def add_property(self, name, value): + self.properties.append((str(name), bin_xml_escape(value))) + + def add_attribute(self, name, value): + self.attrs[str(name)] = bin_xml_escape(value) + + def make_properties_node(self): + """Return a Junit node containing custom properties, if any. + """ + if self.properties: + return Junit.properties( + [ + Junit.property(name=name, value=value) + for name, value in self.properties + ] + ) + return "" + + def record_testreport(self, testreport): + assert not self.testcase + names = mangle_test_address(testreport.nodeid) + existing_attrs = self.attrs + classnames = names[:-1] + if self.xml.prefix: + classnames.insert(0, self.xml.prefix) + attrs = { + "classname": ".".join(classnames), + "name": bin_xml_escape(names[-1]), + "file": testreport.location[0], + } + if testreport.location[1] is not None: + attrs["line"] = testreport.location[1] + if hasattr(testreport, "url"): + attrs["url"] = testreport.url + self.attrs = attrs + self.attrs.update(existing_attrs) # restore any user-defined attributes + + def to_xml(self): + testcase = Junit.testcase(time=self.duration, **self.attrs) + testcase.append(self.make_properties_node()) + for node in self.nodes: + testcase.append(node) + return testcase + + def _add_simple(self, kind, message, data=None): + data = bin_xml_escape(data) + node = kind(data, message=message) + self.append(node) + + def write_captured_output(self, report): + content_out = report.capstdout + content_log = report.caplog + content_err = report.capstderr + + if content_log or content_out: + if content_log and self.xml.logging == "system-out": + if content_out: + # syncing stdout and the log-output is not done yet. It's + # probably not worth the effort. Therefore, first the captured + # stdout is shown and then the captured logs. + content = "\n".join( + [ + " Captured Stdout ".center(80, "-"), + content_out, + "", + " Captured Log ".center(80, "-"), + content_log, + ] + ) + else: + content = content_log + else: + content = content_out + + if content: + tag = getattr(Junit, "system-out") + self.append(tag(bin_xml_escape(content))) + + if content_log or content_err: + if content_log and self.xml.logging == "system-err": + if content_err: + content = "\n".join( + [ + " Captured Stderr ".center(80, "-"), + content_err, + "", + " Captured Log ".center(80, "-"), + content_log, + ] + ) + else: + content = content_log + else: + content = content_err + + if content: + tag = getattr(Junit, "system-err") + self.append(tag(bin_xml_escape(content))) + + def append_pass(self, report): + self.add_stats("passed") + + def append_failure(self, report): + # msg = str(report.longrepr.reprtraceback.extraline) + if hasattr(report, "wasxfail"): + self._add_simple(Junit.skipped, "xfail-marked test passes unexpectedly") + else: + if hasattr(report.longrepr, "reprcrash"): + message = report.longrepr.reprcrash.message + elif isinstance(report.longrepr, (unicode, str)): + message = report.longrepr + else: + message = str(report.longrepr) + message = bin_xml_escape(message) + fail = Junit.failure(message=message) + fail.append(bin_xml_escape(report.longrepr)) + self.append(fail) + + def append_collect_error(self, report): + # msg = str(report.longrepr.reprtraceback.extraline) + self.append( + Junit.error(bin_xml_escape(report.longrepr), message="collection failure") + ) + + def append_collect_skipped(self, report): + self._add_simple(Junit.skipped, "collection skipped", report.longrepr) + + def append_error(self, report): + if getattr(report, "when", None) == "teardown": + msg = "test teardown failure" + else: + msg = "test setup failure" + self._add_simple(Junit.error, msg, report.longrepr) + + def append_skipped(self, report): + if hasattr(report, "wasxfail"): + self._add_simple(Junit.skipped, "expected test failure", report.wasxfail) + else: + filename, lineno, skipreason = report.longrepr + if skipreason.startswith("Skipped: "): + skipreason = bin_xml_escape(skipreason[9:]) + self.append( + Junit.skipped( + "%s:%s: %s" % (filename, lineno, skipreason), + type="pytest.skip", + message=skipreason, + ) + ) + self.write_captured_output(report) + + def finalize(self): + data = self.to_xml().unicode(indent=0) + self.__dict__.clear() + self.to_xml = lambda: py.xml.raw(data) + + +@pytest.fixture +def record_property(request): + """Add an extra properties the calling test. + User properties become part of the test report and are available to the + configured reporters, like JUnit XML. + The fixture is callable with ``(name, value)``, with value being automatically + xml-encoded. + + Example:: + + def test_function(record_property): + record_property("example_key", 1) + """ + + def append_property(name, value): + request.node.user_properties.append((name, value)) + + return append_property + + +@pytest.fixture +def record_xml_property(record_property): + """(Deprecated) use record_property.""" + import warnings + from _pytest import deprecated + + warnings.warn(deprecated.RECORD_XML_PROPERTY, DeprecationWarning, stacklevel=2) + + return record_property + + +@pytest.fixture +def record_xml_attribute(request): + """Add extra xml attributes to the tag for the calling test. + The fixture is callable with ``(name, value)``, with value being + automatically xml-encoded + """ + request.node.warn( + code="C3", message="record_xml_attribute is an experimental feature" + ) + xml = getattr(request.config, "_xml", None) + if xml is not None: + node_reporter = xml.node_reporter(request.node.nodeid) + return node_reporter.add_attribute + else: + + def add_attr_noop(name, value): + pass + + return add_attr_noop + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting") + group.addoption( + "--junitxml", + "--junit-xml", + action="store", + dest="xmlpath", + metavar="path", + type=functools.partial(filename_arg, optname="--junitxml"), + default=None, + help="create junit-xml style report file at given path.", + ) + group.addoption( + "--junitprefix", + "--junit-prefix", + action="store", + metavar="str", + default=None, + help="prepend prefix to classnames in junit-xml output", + ) + parser.addini( + "junit_suite_name", "Test suite name for JUnit report", default="pytest" + ) + parser.addini( + "junit_logging", + "Write captured log messages to JUnit report: " + "one of no|system-out|system-err", + default="no", + ) # choices=['no', 'stdout', 'stderr']) + + +def pytest_configure(config): + xmlpath = config.option.xmlpath + # prevent opening xmllog on slave nodes (xdist) + if xmlpath and not hasattr(config, "slaveinput"): + config._xml = LogXML( + xmlpath, + config.option.junitprefix, + config.getini("junit_suite_name"), + config.getini("junit_logging"), + ) + config.pluginmanager.register(config._xml) + + +def pytest_unconfigure(config): + xml = getattr(config, "_xml", None) + if xml: + del config._xml + config.pluginmanager.unregister(xml) + + +def mangle_test_address(address): + path, possible_open_bracket, params = address.partition("[") + names = path.split("::") + try: + names.remove("()") + except ValueError: + pass + # convert file path to dotted path + names[0] = names[0].replace(nodes.SEP, ".") + names[0] = _py_ext_re.sub("", names[0]) + # put any params back + names[-1] += possible_open_bracket + params + return names + + +class LogXML(object): + + def __init__(self, logfile, prefix, suite_name="pytest", logging="no"): + logfile = os.path.expanduser(os.path.expandvars(logfile)) + self.logfile = os.path.normpath(os.path.abspath(logfile)) + self.prefix = prefix + self.suite_name = suite_name + self.logging = logging + self.stats = dict.fromkeys(["error", "passed", "failure", "skipped"], 0) + self.node_reporters = {} # nodeid -> _NodeReporter + self.node_reporters_ordered = [] + self.global_properties = [] + # List of reports that failed on call but teardown is pending. + self.open_reports = [] + self.cnt_double_fail_tests = 0 + + def finalize(self, report): + nodeid = getattr(report, "nodeid", report) + # local hack to handle xdist report order + slavenode = getattr(report, "node", None) + reporter = self.node_reporters.pop((nodeid, slavenode)) + if reporter is not None: + reporter.finalize() + + def node_reporter(self, report): + nodeid = getattr(report, "nodeid", report) + # local hack to handle xdist report order + slavenode = getattr(report, "node", None) + + key = nodeid, slavenode + + if key in self.node_reporters: + # TODO: breasks for --dist=each + return self.node_reporters[key] + + reporter = _NodeReporter(nodeid, self) + + self.node_reporters[key] = reporter + self.node_reporters_ordered.append(reporter) + + return reporter + + def add_stats(self, key): + if key in self.stats: + self.stats[key] += 1 + + def _opentestcase(self, report): + reporter = self.node_reporter(report) + reporter.record_testreport(report) + return reporter + + def pytest_runtest_logreport(self, report): + """handle a setup/call/teardown report, generating the appropriate + xml tags as necessary. + + note: due to plugins like xdist, this hook may be called in interlaced + order with reports from other nodes. for example: + + usual call order: + -> setup node1 + -> call node1 + -> teardown node1 + -> setup node2 + -> call node2 + -> teardown node2 + + possible call order in xdist: + -> setup node1 + -> call node1 + -> setup node2 + -> call node2 + -> teardown node2 + -> teardown node1 + """ + close_report = None + if report.passed: + if report.when == "call": # ignore setup/teardown + reporter = self._opentestcase(report) + reporter.append_pass(report) + elif report.failed: + if report.when == "teardown": + # The following vars are needed when xdist plugin is used + report_wid = getattr(report, "worker_id", None) + report_ii = getattr(report, "item_index", None) + close_report = next( + ( + rep + for rep in self.open_reports + if ( + rep.nodeid == report.nodeid + and getattr(rep, "item_index", None) == report_ii + and getattr(rep, "worker_id", None) == report_wid + ) + ), + None, + ) + if close_report: + # We need to open new testcase in case we have failure in + # call and error in teardown in order to follow junit + # schema + self.finalize(close_report) + self.cnt_double_fail_tests += 1 + reporter = self._opentestcase(report) + if report.when == "call": + reporter.append_failure(report) + self.open_reports.append(report) + else: + reporter.append_error(report) + elif report.skipped: + reporter = self._opentestcase(report) + reporter.append_skipped(report) + self.update_testcase_duration(report) + if report.when == "teardown": + reporter = self._opentestcase(report) + reporter.write_captured_output(report) + + for propname, propvalue in report.user_properties: + reporter.add_property(propname, propvalue) + + self.finalize(report) + report_wid = getattr(report, "worker_id", None) + report_ii = getattr(report, "item_index", None) + close_report = next( + ( + rep + for rep in self.open_reports + if ( + rep.nodeid == report.nodeid + and getattr(rep, "item_index", None) == report_ii + and getattr(rep, "worker_id", None) == report_wid + ) + ), + None, + ) + if close_report: + self.open_reports.remove(close_report) + + def update_testcase_duration(self, report): + """accumulates total duration for nodeid from given report and updates + the Junit.testcase with the new total if already created. + """ + reporter = self.node_reporter(report) + reporter.duration += getattr(report, "duration", 0.0) + + def pytest_collectreport(self, report): + if not report.passed: + reporter = self._opentestcase(report) + if report.failed: + reporter.append_collect_error(report) + else: + reporter.append_collect_skipped(report) + + def pytest_internalerror(self, excrepr): + reporter = self.node_reporter("internal") + reporter.attrs.update(classname="pytest", name="internal") + reporter._add_simple(Junit.error, "internal error", excrepr) + + def pytest_sessionstart(self): + self.suite_start_time = time.time() + + def pytest_sessionfinish(self): + dirname = os.path.dirname(os.path.abspath(self.logfile)) + if not os.path.isdir(dirname): + os.makedirs(dirname) + logfile = open(self.logfile, "w", encoding="utf-8") + suite_stop_time = time.time() + suite_time_delta = suite_stop_time - self.suite_start_time + + numtests = ( + self.stats["passed"] + + self.stats["failure"] + + self.stats["skipped"] + + self.stats["error"] + - self.cnt_double_fail_tests + ) + logfile.write('<?xml version="1.0" encoding="utf-8"?>') + + logfile.write( + Junit.testsuite( + self._get_global_properties_node(), + [x.to_xml() for x in self.node_reporters_ordered], + name=self.suite_name, + errors=self.stats["error"], + failures=self.stats["failure"], + skips=self.stats["skipped"], + tests=numtests, + time="%.3f" % suite_time_delta, + ).unicode( + indent=0 + ) + ) + logfile.close() + + def pytest_terminal_summary(self, terminalreporter): + terminalreporter.write_sep("-", "generated xml file: %s" % (self.logfile)) + + def add_global_property(self, name, value): + self.global_properties.append((str(name), bin_xml_escape(value))) + + def _get_global_properties_node(self): + """Return a Junit node containing custom properties, if any. + """ + if self.global_properties: + return Junit.properties( + [ + Junit.property(name=name, value=value) + for name, value in self.global_properties + ] + ) + return "" diff --git a/third_party/python/pytest/src/_pytest/logging.py b/third_party/python/pytest/src/_pytest/logging.py new file mode 100644 index 0000000000..00bb9aeb54 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/logging.py @@ -0,0 +1,575 @@ +""" Access and control log capturing. """ +from __future__ import absolute_import, division, print_function + +import logging +from contextlib import closing, contextmanager +import re +import six + +from _pytest.config import create_terminal_writer +import pytest +import py + + +DEFAULT_LOG_FORMAT = "%(filename)-25s %(lineno)4d %(levelname)-8s %(message)s" +DEFAULT_LOG_DATE_FORMAT = "%H:%M:%S" + + +class ColoredLevelFormatter(logging.Formatter): + """ + Colorize the %(levelname)..s part of the log format passed to __init__. + """ + + LOGLEVEL_COLOROPTS = { + logging.CRITICAL: {"red"}, + logging.ERROR: {"red", "bold"}, + logging.WARNING: {"yellow"}, + logging.WARN: {"yellow"}, + logging.INFO: {"green"}, + logging.DEBUG: {"purple"}, + logging.NOTSET: set(), + } + LEVELNAME_FMT_REGEX = re.compile(r"%\(levelname\)([+-]?\d*s)") + + def __init__(self, terminalwriter, *args, **kwargs): + super(ColoredLevelFormatter, self).__init__(*args, **kwargs) + if six.PY2: + self._original_fmt = self._fmt + else: + self._original_fmt = self._style._fmt + self._level_to_fmt_mapping = {} + + levelname_fmt_match = self.LEVELNAME_FMT_REGEX.search(self._fmt) + if not levelname_fmt_match: + return + levelname_fmt = levelname_fmt_match.group() + + for level, color_opts in self.LOGLEVEL_COLOROPTS.items(): + formatted_levelname = levelname_fmt % { + "levelname": logging.getLevelName(level) + } + + # add ANSI escape sequences around the formatted levelname + color_kwargs = {name: True for name in color_opts} + colorized_formatted_levelname = terminalwriter.markup( + formatted_levelname, **color_kwargs + ) + self._level_to_fmt_mapping[level] = self.LEVELNAME_FMT_REGEX.sub( + colorized_formatted_levelname, self._fmt + ) + + def format(self, record): + fmt = self._level_to_fmt_mapping.get(record.levelno, self._original_fmt) + if six.PY2: + self._fmt = fmt + else: + self._style._fmt = fmt + return super(ColoredLevelFormatter, self).format(record) + + +def get_option_ini(config, *names): + for name in names: + ret = config.getoption(name) # 'default' arg won't work as expected + if ret is None: + ret = config.getini(name) + if ret: + return ret + + +def pytest_addoption(parser): + """Add options to control log capturing.""" + group = parser.getgroup("logging") + + def add_option_ini(option, dest, default=None, type=None, **kwargs): + parser.addini( + dest, default=default, type=type, help="default value for " + option + ) + group.addoption(option, dest=dest, **kwargs) + + add_option_ini( + "--no-print-logs", + dest="log_print", + action="store_const", + const=False, + default=True, + type="bool", + help="disable printing caught logs on failed tests.", + ) + add_option_ini( + "--log-level", + dest="log_level", + default=None, + help="logging level used by the logging module", + ) + add_option_ini( + "--log-format", + dest="log_format", + default=DEFAULT_LOG_FORMAT, + help="log format as used by the logging module.", + ) + add_option_ini( + "--log-date-format", + dest="log_date_format", + default=DEFAULT_LOG_DATE_FORMAT, + help="log date format as used by the logging module.", + ) + parser.addini( + "log_cli", + default=False, + type="bool", + help='enable log display during test run (also known as "live logging").', + ) + add_option_ini( + "--log-cli-level", dest="log_cli_level", default=None, help="cli logging level." + ) + add_option_ini( + "--log-cli-format", + dest="log_cli_format", + default=None, + help="log format as used by the logging module.", + ) + add_option_ini( + "--log-cli-date-format", + dest="log_cli_date_format", + default=None, + help="log date format as used by the logging module.", + ) + add_option_ini( + "--log-file", + dest="log_file", + default=None, + help="path to a file when logging will be written to.", + ) + add_option_ini( + "--log-file-level", + dest="log_file_level", + default=None, + help="log file logging level.", + ) + add_option_ini( + "--log-file-format", + dest="log_file_format", + default=DEFAULT_LOG_FORMAT, + help="log format as used by the logging module.", + ) + add_option_ini( + "--log-file-date-format", + dest="log_file_date_format", + default=DEFAULT_LOG_DATE_FORMAT, + help="log date format as used by the logging module.", + ) + + +@contextmanager +def catching_logs(handler, formatter=None, level=None): + """Context manager that prepares the whole logging machinery properly.""" + root_logger = logging.getLogger() + + if formatter is not None: + handler.setFormatter(formatter) + if level is not None: + handler.setLevel(level) + + # Adding the same handler twice would confuse logging system. + # Just don't do that. + add_new_handler = handler not in root_logger.handlers + + if add_new_handler: + root_logger.addHandler(handler) + if level is not None: + orig_level = root_logger.level + root_logger.setLevel(min(orig_level, level)) + try: + yield handler + finally: + if level is not None: + root_logger.setLevel(orig_level) + if add_new_handler: + root_logger.removeHandler(handler) + + +class LogCaptureHandler(logging.StreamHandler): + """A logging handler that stores log records and the log text.""" + + def __init__(self): + """Creates a new log handler.""" + logging.StreamHandler.__init__(self, py.io.TextIO()) + self.records = [] + + def emit(self, record): + """Keep the log records in a list in addition to the log text.""" + self.records.append(record) + logging.StreamHandler.emit(self, record) + + def reset(self): + self.records = [] + self.stream = py.io.TextIO() + + +class LogCaptureFixture(object): + """Provides access and control of log capturing.""" + + def __init__(self, item): + """Creates a new funcarg.""" + self._item = item + self._initial_log_levels = {} # type: Dict[str, int] # dict of log name -> log level + + def _finalize(self): + """Finalizes the fixture. + + This restores the log levels changed by :meth:`set_level`. + """ + # restore log levels + for logger_name, level in self._initial_log_levels.items(): + logger = logging.getLogger(logger_name) + logger.setLevel(level) + + @property + def handler(self): + """ + :rtype: LogCaptureHandler + """ + return self._item.catch_log_handler + + def get_records(self, when): + """ + Get the logging records for one of the possible test phases. + + :param str when: + Which test phase to obtain the records from. Valid values are: "setup", "call" and "teardown". + + :rtype: List[logging.LogRecord] + :return: the list of captured records at the given stage + + .. versionadded:: 3.4 + """ + handler = self._item.catch_log_handlers.get(when) + if handler: + return handler.records + else: + return [] + + @property + def text(self): + """Returns the log text.""" + return self.handler.stream.getvalue() + + @property + def records(self): + """Returns the list of log records.""" + return self.handler.records + + @property + def record_tuples(self): + """Returns a list of a striped down version of log records intended + for use in assertion comparison. + + The format of the tuple is: + + (logger_name, log_level, message) + """ + return [(r.name, r.levelno, r.getMessage()) for r in self.records] + + def clear(self): + """Reset the list of log records and the captured log text.""" + self.handler.reset() + + def set_level(self, level, logger=None): + """Sets the level for capturing of logs. The level will be restored to its previous value at the end of + the test. + + :param int level: the logger to level. + :param str logger: the logger to update the level. If not given, the root logger level is updated. + + .. versionchanged:: 3.4 + The levels of the loggers changed by this function will be restored to their initial values at the + end of the test. + """ + logger_name = logger + logger = logging.getLogger(logger_name) + # save the original log-level to restore it during teardown + self._initial_log_levels.setdefault(logger_name, logger.level) + logger.setLevel(level) + + @contextmanager + def at_level(self, level, logger=None): + """Context manager that sets the level for capturing of logs. After the end of the 'with' statement the + level is restored to its original value. + + :param int level: the logger to level. + :param str logger: the logger to update the level. If not given, the root logger level is updated. + """ + logger = logging.getLogger(logger) + orig_level = logger.level + logger.setLevel(level) + try: + yield + finally: + logger.setLevel(orig_level) + + +@pytest.fixture +def caplog(request): + """Access and control log capturing. + + Captured logs are available through the following methods:: + + * caplog.text -> string containing formatted log output + * caplog.records -> list of logging.LogRecord instances + * caplog.record_tuples -> list of (logger_name, level, message) tuples + * caplog.clear() -> clear captured records and formatted log output string + """ + result = LogCaptureFixture(request.node) + yield result + result._finalize() + + +def get_actual_log_level(config, *setting_names): + """Return the actual logging level.""" + + for setting_name in setting_names: + log_level = config.getoption(setting_name) + if log_level is None: + log_level = config.getini(setting_name) + if log_level: + break + else: + return + + if isinstance(log_level, six.string_types): + log_level = log_level.upper() + try: + return int(getattr(logging, log_level, log_level)) + except ValueError: + # Python logging does not recognise this as a logging level + raise pytest.UsageError( + "'{}' is not recognized as a logging level name for " + "'{}'. Please consider passing the " + "logging level num instead.".format(log_level, setting_name) + ) + + +def pytest_configure(config): + config.pluginmanager.register(LoggingPlugin(config), "logging-plugin") + + +@contextmanager +def _dummy_context_manager(): + yield + + +class LoggingPlugin(object): + """Attaches to the logging module and captures log messages for each test. + """ + + def __init__(self, config): + """Creates a new plugin to capture log messages. + + The formatter can be safely shared across all handlers so + create a single one for the entire test session here. + """ + self._config = config + + # enable verbose output automatically if live logging is enabled + if self._log_cli_enabled() and not config.getoption("verbose"): + # sanity check: terminal reporter should not have been loaded at this point + assert self._config.pluginmanager.get_plugin("terminalreporter") is None + config.option.verbose = 1 + + self.print_logs = get_option_ini(config, "log_print") + self.formatter = logging.Formatter( + get_option_ini(config, "log_format"), + get_option_ini(config, "log_date_format"), + ) + self.log_level = get_actual_log_level(config, "log_level") + + log_file = get_option_ini(config, "log_file") + if log_file: + self.log_file_level = get_actual_log_level(config, "log_file_level") + + log_file_format = get_option_ini(config, "log_file_format", "log_format") + log_file_date_format = get_option_ini( + config, "log_file_date_format", "log_date_format" + ) + # Each pytest runtests session will write to a clean logfile + self.log_file_handler = logging.FileHandler(log_file, mode="w") + log_file_formatter = logging.Formatter( + log_file_format, datefmt=log_file_date_format + ) + self.log_file_handler.setFormatter(log_file_formatter) + else: + self.log_file_handler = None + + # initialized during pytest_runtestloop + self.log_cli_handler = None + + def _log_cli_enabled(self): + """Return True if log_cli should be considered enabled, either explicitly + or because --log-cli-level was given in the command-line. + """ + return self._config.getoption( + "--log-cli-level" + ) is not None or self._config.getini( + "log_cli" + ) + + @contextmanager + def _runtest_for(self, item, when): + """Implements the internals of pytest_runtest_xxx() hook.""" + with catching_logs( + LogCaptureHandler(), formatter=self.formatter, level=self.log_level + ) as log_handler: + if self.log_cli_handler: + self.log_cli_handler.set_when(when) + + if item is None: + yield # run the test + return + + if not hasattr(item, "catch_log_handlers"): + item.catch_log_handlers = {} + item.catch_log_handlers[when] = log_handler + item.catch_log_handler = log_handler + try: + yield # run test + finally: + del item.catch_log_handler + if when == "teardown": + del item.catch_log_handlers + + if self.print_logs: + # Add a captured log section to the report. + log = log_handler.stream.getvalue().strip() + item.add_report_section(when, "log", log) + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_setup(self, item): + with self._runtest_for(item, "setup"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_call(self, item): + with self._runtest_for(item, "call"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_teardown(self, item): + with self._runtest_for(item, "teardown"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_logstart(self): + if self.log_cli_handler: + self.log_cli_handler.reset() + with self._runtest_for(None, "start"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_logfinish(self): + with self._runtest_for(None, "finish"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtestloop(self, session): + """Runs all collected test items.""" + self._setup_cli_logging() + with self.live_logs_context: + if self.log_file_handler is not None: + with closing(self.log_file_handler): + with catching_logs( + self.log_file_handler, level=self.log_file_level + ): + yield # run all the tests + else: + yield # run all the tests + + def _setup_cli_logging(self): + """Sets up the handler and logger for the Live Logs feature, if enabled. + + This must be done right before starting the loop so we can access the terminal reporter plugin. + """ + terminal_reporter = self._config.pluginmanager.get_plugin("terminalreporter") + if self._log_cli_enabled() and terminal_reporter is not None: + capture_manager = self._config.pluginmanager.get_plugin("capturemanager") + log_cli_handler = _LiveLoggingStreamHandler( + terminal_reporter, capture_manager + ) + log_cli_format = get_option_ini( + self._config, "log_cli_format", "log_format" + ) + log_cli_date_format = get_option_ini( + self._config, "log_cli_date_format", "log_date_format" + ) + if ( + self._config.option.color != "no" + and ColoredLevelFormatter.LEVELNAME_FMT_REGEX.search(log_cli_format) + ): + log_cli_formatter = ColoredLevelFormatter( + create_terminal_writer(self._config), + log_cli_format, + datefmt=log_cli_date_format, + ) + else: + log_cli_formatter = logging.Formatter( + log_cli_format, datefmt=log_cli_date_format + ) + log_cli_level = get_actual_log_level( + self._config, "log_cli_level", "log_level" + ) + self.log_cli_handler = log_cli_handler + self.live_logs_context = catching_logs( + log_cli_handler, formatter=log_cli_formatter, level=log_cli_level + ) + else: + self.live_logs_context = _dummy_context_manager() + + +class _LiveLoggingStreamHandler(logging.StreamHandler): + """ + Custom StreamHandler used by the live logging feature: it will write a newline before the first log message + in each test. + + During live logging we must also explicitly disable stdout/stderr capturing otherwise it will get captured + and won't appear in the terminal. + """ + + def __init__(self, terminal_reporter, capture_manager): + """ + :param _pytest.terminal.TerminalReporter terminal_reporter: + :param _pytest.capture.CaptureManager capture_manager: + """ + logging.StreamHandler.__init__(self, stream=terminal_reporter) + self.capture_manager = capture_manager + self.reset() + self.set_when(None) + self._test_outcome_written = False + + def reset(self): + """Reset the handler; should be called before the start of each test""" + self._first_record_emitted = False + + def set_when(self, when): + """Prepares for the given test phase (setup/call/teardown)""" + self._when = when + self._section_name_shown = False + if when == "start": + self._test_outcome_written = False + + def emit(self, record): + if self.capture_manager is not None: + self.capture_manager.suspend_global_capture() + try: + if not self._first_record_emitted: + self.stream.write("\n") + self._first_record_emitted = True + elif self._when in ("teardown", "finish"): + if not self._test_outcome_written: + self._test_outcome_written = True + self.stream.write("\n") + if not self._section_name_shown and self._when: + self.stream.section("live log " + self._when, sep="-", bold=True) + self._section_name_shown = True + logging.StreamHandler.emit(self, record) + finally: + if self.capture_manager is not None: + self.capture_manager.resume_global_capture() diff --git a/third_party/python/pytest/src/_pytest/main.py b/third_party/python/pytest/src/_pytest/main.py new file mode 100644 index 0000000000..23562358d7 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/main.py @@ -0,0 +1,611 @@ +""" core implementation of testing process: init, session, runtest loop. """ +from __future__ import absolute_import, division, print_function + +import contextlib +import functools +import os +import pkgutil +import six +import sys + +import _pytest +from _pytest import nodes +import _pytest._code +import py + +from _pytest.config import directory_arg, UsageError, hookimpl +from _pytest.outcomes import exit +from _pytest.runner import collect_one_node + + +# exitcodes for the command line +EXIT_OK = 0 +EXIT_TESTSFAILED = 1 +EXIT_INTERRUPTED = 2 +EXIT_INTERNALERROR = 3 +EXIT_USAGEERROR = 4 +EXIT_NOTESTSCOLLECTED = 5 + + +def pytest_addoption(parser): + parser.addini( + "norecursedirs", + "directory patterns to avoid for recursion", + type="args", + default=[".*", "build", "dist", "CVS", "_darcs", "{arch}", "*.egg", "venv"], + ) + parser.addini( + "testpaths", + "directories to search for tests when no files or directories are given in the " + "command line.", + type="args", + default=[], + ) + # parser.addini("dirpatterns", + # "patterns specifying possible locations of test files", + # type="linelist", default=["**/test_*.txt", + # "**/test_*.py", "**/*_test.py"] + # ) + group = parser.getgroup("general", "running and selection options") + group._addoption( + "-x", + "--exitfirst", + action="store_const", + dest="maxfail", + const=1, + help="exit instantly on first error or failed test.", + ), + group._addoption( + "--maxfail", + metavar="num", + action="store", + type=int, + dest="maxfail", + default=0, + help="exit after first num failures or errors.", + ) + group._addoption( + "--strict", + action="store_true", + help="marks not registered in configuration file raise errors.", + ) + group._addoption( + "-c", + metavar="file", + type=str, + dest="inifilename", + help="load configuration from `file` instead of trying to locate one of the implicit " + "configuration files.", + ) + group._addoption( + "--continue-on-collection-errors", + action="store_true", + default=False, + dest="continue_on_collection_errors", + help="Force test execution even if collection errors occur.", + ) + group._addoption( + "--rootdir", + action="store", + dest="rootdir", + help="Define root directory for tests. Can be relative path: 'root_dir', './root_dir', " + "'root_dir/another_dir/'; absolute path: '/home/user/root_dir'; path with variables: " + "'$HOME/root_dir'.", + ) + + group = parser.getgroup("collect", "collection") + group.addoption( + "--collectonly", + "--collect-only", + action="store_true", + help="only collect tests, don't execute them.", + ), + group.addoption( + "--pyargs", + action="store_true", + help="try to interpret all arguments as python packages.", + ) + group.addoption( + "--ignore", + action="append", + metavar="path", + help="ignore path during collection (multi-allowed).", + ) + group.addoption( + "--deselect", + action="append", + metavar="nodeid_prefix", + help="deselect item during collection (multi-allowed).", + ) + # when changing this to --conf-cut-dir, config.py Conftest.setinitial + # needs upgrading as well + group.addoption( + "--confcutdir", + dest="confcutdir", + default=None, + metavar="dir", + type=functools.partial(directory_arg, optname="--confcutdir"), + help="only load conftest.py's relative to specified dir.", + ) + group.addoption( + "--noconftest", + action="store_true", + dest="noconftest", + default=False, + help="Don't load any conftest.py files.", + ) + group.addoption( + "--keepduplicates", + "--keep-duplicates", + action="store_true", + dest="keepduplicates", + default=False, + help="Keep duplicate tests.", + ) + group.addoption( + "--collect-in-virtualenv", + action="store_true", + dest="collect_in_virtualenv", + default=False, + help="Don't ignore tests in a local virtualenv directory", + ) + + group = parser.getgroup("debugconfig", "test session debugging and configuration") + group.addoption( + "--basetemp", + dest="basetemp", + default=None, + metavar="dir", + help="base temporary directory for this test run.", + ) + + +def pytest_configure(config): + __import__("pytest").config = config # compatibility + + +def wrap_session(config, doit): + """Skeleton command line program""" + session = Session(config) + session.exitstatus = EXIT_OK + initstate = 0 + try: + try: + config._do_configure() + initstate = 1 + config.hook.pytest_sessionstart(session=session) + initstate = 2 + session.exitstatus = doit(config, session) or 0 + except UsageError: + raise + except Failed: + session.exitstatus = EXIT_TESTSFAILED + except KeyboardInterrupt: + excinfo = _pytest._code.ExceptionInfo() + if initstate < 2 and isinstance(excinfo.value, exit.Exception): + sys.stderr.write("{}: {}\n".format(excinfo.typename, excinfo.value.msg)) + config.hook.pytest_keyboard_interrupt(excinfo=excinfo) + session.exitstatus = EXIT_INTERRUPTED + except: # noqa + excinfo = _pytest._code.ExceptionInfo() + config.notify_exception(excinfo, config.option) + session.exitstatus = EXIT_INTERNALERROR + if excinfo.errisinstance(SystemExit): + sys.stderr.write("mainloop: caught Spurious SystemExit!\n") + + finally: + excinfo = None # Explicitly break reference cycle. + session.startdir.chdir() + if initstate >= 2: + config.hook.pytest_sessionfinish( + session=session, exitstatus=session.exitstatus + ) + config._ensure_unconfigure() + return session.exitstatus + + +def pytest_cmdline_main(config): + return wrap_session(config, _main) + + +def _main(config, session): + """ default command line protocol for initialization, session, + running tests and reporting. """ + config.hook.pytest_collection(session=session) + config.hook.pytest_runtestloop(session=session) + + if session.testsfailed: + return EXIT_TESTSFAILED + elif session.testscollected == 0: + return EXIT_NOTESTSCOLLECTED + + +def pytest_collection(session): + return session.perform_collect() + + +def pytest_runtestloop(session): + if session.testsfailed and not session.config.option.continue_on_collection_errors: + raise session.Interrupted("%d errors during collection" % session.testsfailed) + + if session.config.option.collectonly: + return True + + for i, item in enumerate(session.items): + nextitem = session.items[i + 1] if i + 1 < len(session.items) else None + item.config.hook.pytest_runtest_protocol(item=item, nextitem=nextitem) + if session.shouldfail: + raise session.Failed(session.shouldfail) + if session.shouldstop: + raise session.Interrupted(session.shouldstop) + return True + + +def _in_venv(path): + """Attempts to detect if ``path`` is the root of a Virtual Environment by + checking for the existence of the appropriate activate script""" + bindir = path.join("Scripts" if sys.platform.startswith("win") else "bin") + if not bindir.isdir(): + return False + activates = ( + "activate", + "activate.csh", + "activate.fish", + "Activate", + "Activate.bat", + "Activate.ps1", + ) + return any([fname.basename in activates for fname in bindir.listdir()]) + + +def pytest_ignore_collect(path, config): + ignore_paths = config._getconftest_pathlist("collect_ignore", path=path.dirpath()) + ignore_paths = ignore_paths or [] + excludeopt = config.getoption("ignore") + if excludeopt: + ignore_paths.extend([py.path.local(x) for x in excludeopt]) + + if py.path.local(path) in ignore_paths: + return True + + allow_in_venv = config.getoption("collect_in_virtualenv") + if _in_venv(path) and not allow_in_venv: + return True + + # Skip duplicate paths. + keepduplicates = config.getoption("keepduplicates") + duplicate_paths = config.pluginmanager._duplicatepaths + if not keepduplicates: + if path in duplicate_paths: + return True + else: + duplicate_paths.add(path) + + return False + + +def pytest_collection_modifyitems(items, config): + deselect_prefixes = tuple(config.getoption("deselect") or []) + if not deselect_prefixes: + return + + remaining = [] + deselected = [] + for colitem in items: + if colitem.nodeid.startswith(deselect_prefixes): + deselected.append(colitem) + else: + remaining.append(colitem) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +@contextlib.contextmanager +def _patched_find_module(): + """Patch bug in pkgutil.ImpImporter.find_module + + When using pkgutil.find_loader on python<3.4 it removes symlinks + from the path due to a call to os.path.realpath. This is not consistent + with actually doing the import (in these versions, pkgutil and __import__ + did not share the same underlying code). This can break conftest + discovery for pytest where symlinks are involved. + + The only supported python<3.4 by pytest is python 2.7. + """ + if six.PY2: # python 3.4+ uses importlib instead + + def find_module_patched(self, fullname, path=None): + # Note: we ignore 'path' argument since it is only used via meta_path + subname = fullname.split(".")[-1] + if subname != fullname and self.path is None: + return None + if self.path is None: + path = None + else: + # original: path = [os.path.realpath(self.path)] + path = [self.path] + try: + file, filename, etc = pkgutil.imp.find_module(subname, path) + except ImportError: + return None + return pkgutil.ImpLoader(fullname, file, filename, etc) + + old_find_module = pkgutil.ImpImporter.find_module + pkgutil.ImpImporter.find_module = find_module_patched + try: + yield + finally: + pkgutil.ImpImporter.find_module = old_find_module + else: + yield + + +class FSHookProxy(object): + + def __init__(self, fspath, pm, remove_mods): + self.fspath = fspath + self.pm = pm + self.remove_mods = remove_mods + + def __getattr__(self, name): + x = self.pm.subset_hook_caller(name, remove_plugins=self.remove_mods) + self.__dict__[name] = x + return x + + +class NoMatch(Exception): + """ raised if matching cannot locate a matching names. """ + + +class Interrupted(KeyboardInterrupt): + """ signals an interrupted test run. """ + __module__ = "builtins" # for py3 + + +class Failed(Exception): + """ signals a stop as failed test run. """ + + +class Session(nodes.FSCollector): + Interrupted = Interrupted + Failed = Failed + + def __init__(self, config): + nodes.FSCollector.__init__( + self, config.rootdir, parent=None, config=config, session=self, nodeid="" + ) + self.testsfailed = 0 + self.testscollected = 0 + self.shouldstop = False + self.shouldfail = False + self.trace = config.trace.root.get("collection") + self._norecursepatterns = config.getini("norecursedirs") + self.startdir = py.path.local() + + self.config.pluginmanager.register(self, name="session") + + @hookimpl(tryfirst=True) + def pytest_collectstart(self): + if self.shouldfail: + raise self.Failed(self.shouldfail) + if self.shouldstop: + raise self.Interrupted(self.shouldstop) + + @hookimpl(tryfirst=True) + def pytest_runtest_logreport(self, report): + if report.failed and not hasattr(report, "wasxfail"): + self.testsfailed += 1 + maxfail = self.config.getvalue("maxfail") + if maxfail and self.testsfailed >= maxfail: + self.shouldfail = "stopping after %d failures" % (self.testsfailed) + + pytest_collectreport = pytest_runtest_logreport + + def isinitpath(self, path): + return path in self._initialpaths + + def gethookproxy(self, fspath): + # check if we have the common case of running + # hooks with all conftest.py files + pm = self.config.pluginmanager + my_conftestmodules = pm._getconftestmodules(fspath) + remove_mods = pm._conftest_plugins.difference(my_conftestmodules) + if remove_mods: + # one or more conftests are not in use at this fspath + proxy = FSHookProxy(fspath, pm, remove_mods) + else: + # all plugis are active for this fspath + proxy = self.config.hook + return proxy + + def perform_collect(self, args=None, genitems=True): + hook = self.config.hook + try: + items = self._perform_collect(args, genitems) + self.config.pluginmanager.check_pending() + hook.pytest_collection_modifyitems( + session=self, config=self.config, items=items + ) + finally: + hook.pytest_collection_finish(session=self) + self.testscollected = len(items) + return items + + def _perform_collect(self, args, genitems): + if args is None: + args = self.config.args + self.trace("perform_collect", self, args) + self.trace.root.indent += 1 + self._notfound = [] + self._initialpaths = set() + self._initialparts = [] + self.items = items = [] + for arg in args: + parts = self._parsearg(arg) + self._initialparts.append(parts) + self._initialpaths.add(parts[0]) + rep = collect_one_node(self) + self.ihook.pytest_collectreport(report=rep) + self.trace.root.indent -= 1 + if self._notfound: + errors = [] + for arg, exc in self._notfound: + line = "(no name %r in any of %r)" % (arg, exc.args[0]) + errors.append("not found: %s\n%s" % (arg, line)) + # XXX: test this + raise UsageError(*errors) + if not genitems: + return rep.result + else: + if rep.passed: + for node in rep.result: + self.items.extend(self.genitems(node)) + return items + + def collect(self): + for parts in self._initialparts: + arg = "::".join(map(str, parts)) + self.trace("processing argument", arg) + self.trace.root.indent += 1 + try: + for x in self._collect(arg): + yield x + except NoMatch: + # we are inside a make_report hook so + # we cannot directly pass through the exception + self._notfound.append((arg, sys.exc_info()[1])) + + self.trace.root.indent -= 1 + + def _collect(self, arg): + names = self._parsearg(arg) + path = names.pop(0) + if path.check(dir=1): + assert not names, "invalid arg %r" % (arg,) + for path in path.visit( + fil=lambda x: x.check(file=1), rec=self._recurse, bf=True, sort=True + ): + for x in self._collectfile(path): + yield x + else: + assert path.check(file=1) + for x in self.matchnodes(self._collectfile(path), names): + yield x + + def _collectfile(self, path): + ihook = self.gethookproxy(path) + if not self.isinitpath(path): + if ihook.pytest_ignore_collect(path=path, config=self.config): + return () + return ihook.pytest_collect_file(path=path, parent=self) + + def _recurse(self, path): + ihook = self.gethookproxy(path.dirpath()) + if ihook.pytest_ignore_collect(path=path, config=self.config): + return + for pat in self._norecursepatterns: + if path.check(fnmatch=pat): + return False + ihook = self.gethookproxy(path) + ihook.pytest_collect_directory(path=path, parent=self) + return True + + def _tryconvertpyarg(self, x): + """Convert a dotted module name to path. + + """ + + try: + with _patched_find_module(): + loader = pkgutil.find_loader(x) + except ImportError: + return x + if loader is None: + return x + # This method is sometimes invoked when AssertionRewritingHook, which + # does not define a get_filename method, is already in place: + try: + with _patched_find_module(): + path = loader.get_filename(x) + except AttributeError: + # Retrieve path from AssertionRewritingHook: + path = loader.modules[x][0].co_filename + if loader.is_package(x): + path = os.path.dirname(path) + return path + + def _parsearg(self, arg): + """ return (fspath, names) tuple after checking the file exists. """ + parts = str(arg).split("::") + if self.config.option.pyargs: + parts[0] = self._tryconvertpyarg(parts[0]) + relpath = parts[0].replace("/", os.sep) + path = self.config.invocation_dir.join(relpath, abs=True) + if not path.check(): + if self.config.option.pyargs: + raise UsageError( + "file or package not found: " + arg + " (missing __init__.py?)" + ) + else: + raise UsageError("file not found: " + arg) + parts[0] = path + return parts + + def matchnodes(self, matching, names): + self.trace("matchnodes", matching, names) + self.trace.root.indent += 1 + nodes = self._matchnodes(matching, names) + num = len(nodes) + self.trace("matchnodes finished -> ", num, "nodes") + self.trace.root.indent -= 1 + if num == 0: + raise NoMatch(matching, names[:1]) + return nodes + + def _matchnodes(self, matching, names): + if not matching or not names: + return matching + name = names[0] + assert name + nextnames = names[1:] + resultnodes = [] + for node in matching: + if isinstance(node, nodes.Item): + if not names: + resultnodes.append(node) + continue + assert isinstance(node, nodes.Collector) + rep = collect_one_node(node) + if rep.passed: + has_matched = False + for x in rep.result: + # TODO: remove parametrized workaround once collection structure contains parametrization + if x.name == name or x.name.split("[")[0] == name: + resultnodes.extend(self.matchnodes([x], nextnames)) + has_matched = True + # XXX accept IDs that don't have "()" for class instances + if not has_matched and len(rep.result) == 1 and x.name == "()": + nextnames.insert(0, name) + resultnodes.extend(self.matchnodes([x], nextnames)) + else: + # report collection failures here to avoid failing to run some test + # specified in the command line because the module could not be + # imported (#134) + node.ihook.pytest_collectreport(report=rep) + return resultnodes + + def genitems(self, node): + self.trace("genitems", node) + if isinstance(node, nodes.Item): + node.ihook.pytest_itemcollected(item=node) + yield node + else: + assert isinstance(node, nodes.Collector) + rep = collect_one_node(node) + if rep.passed: + for subnode in rep.result: + for x in self.genitems(subnode): + yield x + node.ihook.pytest_collectreport(report=rep) diff --git a/third_party/python/pytest/src/_pytest/mark/__init__.py b/third_party/python/pytest/src/_pytest/mark/__init__.py new file mode 100644 index 0000000000..e3918ca6a4 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/mark/__init__.py @@ -0,0 +1,174 @@ +""" generic mechanism for marking and selecting python functions. """ +from __future__ import absolute_import, division, print_function +from _pytest.config import UsageError +from .structures import ( + ParameterSet, + EMPTY_PARAMETERSET_OPTION, + MARK_GEN, + Mark, + MarkInfo, + MarkDecorator, + MarkGenerator, + transfer_markers, + get_empty_parameterset_mark, +) +from .legacy import matchkeyword, matchmark + +__all__ = [ + "Mark", + "MarkInfo", + "MarkDecorator", + "MarkGenerator", + "transfer_markers", + "get_empty_parameterset_mark", +] + + +class MarkerError(Exception): + + """Error in use of a pytest marker/attribute.""" + + +def param(*values, **kw): + """Specify a parameter in `pytest.mark.parametrize`_ calls or + :ref:`parametrized fixtures <fixture-parametrize-marks>`. + + .. code-block:: python + + @pytest.mark.parametrize("test_input,expected", [ + ("3+5", 8), + pytest.param("6*9", 42, marks=pytest.mark.xfail), + ]) + def test_eval(test_input, expected): + assert eval(test_input) == expected + + :param values: variable args of the values of the parameter set, in order. + :keyword marks: a single mark or a list of marks to be applied to this parameter set. + :keyword str id: the id to attribute to this parameter set. + """ + return ParameterSet.param(*values, **kw) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + "-k", + action="store", + dest="keyword", + default="", + metavar="EXPRESSION", + help="only run tests which match the given substring expression. " + "An expression is a python evaluatable expression " + "where all names are substring-matched against test names " + "and their parent classes. Example: -k 'test_method or test_" + "other' matches all test functions and classes whose name " + "contains 'test_method' or 'test_other', while -k 'not test_method' " + "matches those that don't contain 'test_method' in their names. " + "Additionally keywords are matched to classes and functions " + "containing extra names in their 'extra_keyword_matches' set, " + "as well as functions which have names assigned directly to them.", + ) + + group._addoption( + "-m", + action="store", + dest="markexpr", + default="", + metavar="MARKEXPR", + help="only run tests matching given mark expression. " + "example: -m 'mark1 and not mark2'.", + ) + + group.addoption( + "--markers", + action="store_true", + help="show markers (builtin, plugin and per-project ones).", + ) + + parser.addini("markers", "markers for test functions", "linelist") + parser.addini(EMPTY_PARAMETERSET_OPTION, "default marker for empty parametersets") + + +def pytest_cmdline_main(config): + import _pytest.config + + if config.option.markers: + config._do_configure() + tw = _pytest.config.create_terminal_writer(config) + for line in config.getini("markers"): + parts = line.split(":", 1) + name = parts[0] + rest = parts[1] if len(parts) == 2 else "" + tw.write("@pytest.mark.%s:" % name, bold=True) + tw.line(rest) + tw.line() + config._ensure_unconfigure() + return 0 + + +pytest_cmdline_main.tryfirst = True + + +def deselect_by_keyword(items, config): + keywordexpr = config.option.keyword.lstrip() + if keywordexpr.startswith("-"): + keywordexpr = "not " + keywordexpr[1:] + selectuntil = False + if keywordexpr[-1:] == ":": + selectuntil = True + keywordexpr = keywordexpr[:-1] + + remaining = [] + deselected = [] + for colitem in items: + if keywordexpr and not matchkeyword(colitem, keywordexpr): + deselected.append(colitem) + else: + if selectuntil: + keywordexpr = None + remaining.append(colitem) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +def deselect_by_mark(items, config): + matchexpr = config.option.markexpr + if not matchexpr: + return + + remaining = [] + deselected = [] + for item in items: + if matchmark(item, matchexpr): + remaining.append(item) + else: + deselected.append(item) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +def pytest_collection_modifyitems(items, config): + deselect_by_keyword(items, config) + deselect_by_mark(items, config) + + +def pytest_configure(config): + config._old_mark_config = MARK_GEN._config + if config.option.strict: + MARK_GEN._config = config + + empty_parameterset = config.getini(EMPTY_PARAMETERSET_OPTION) + + if empty_parameterset not in ("skip", "xfail", None, ""): + raise UsageError( + "{!s} must be one of skip and xfail," + " but it is {!r}".format(EMPTY_PARAMETERSET_OPTION, empty_parameterset) + ) + + +def pytest_unconfigure(config): + MARK_GEN._config = getattr(config, "_old_mark_config", None) diff --git a/third_party/python/pytest/src/_pytest/mark/evaluate.py b/third_party/python/pytest/src/_pytest/mark/evaluate.py new file mode 100644 index 0000000000..a3d11ee0f8 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/mark/evaluate.py @@ -0,0 +1,121 @@ +import os +import six +import sys +import platform +import traceback + +from ..outcomes import fail, TEST_OUTCOME + + +def cached_eval(config, expr, d): + if not hasattr(config, "_evalcache"): + config._evalcache = {} + try: + return config._evalcache[expr] + except KeyError: + import _pytest._code + + exprcode = _pytest._code.compile(expr, mode="eval") + config._evalcache[expr] = x = eval(exprcode, d) + return x + + +class MarkEvaluator(object): + + def __init__(self, item, name): + self.item = item + self._marks = None + self._mark = None + self._mark_name = name + + def __bool__(self): + # dont cache here to prevent staleness + return bool(self._get_marks()) + + __nonzero__ = __bool__ + + def wasvalid(self): + return not hasattr(self, "exc") + + def _get_marks(self): + return list(self.item.iter_markers(name=self._mark_name)) + + def invalidraise(self, exc): + raises = self.get("raises") + if not raises: + return + return not isinstance(exc, raises) + + def istrue(self): + try: + return self._istrue() + except TEST_OUTCOME: + self.exc = sys.exc_info() + if isinstance(self.exc[1], SyntaxError): + msg = [" " * (self.exc[1].offset + 4) + "^"] + msg.append("SyntaxError: invalid syntax") + else: + msg = traceback.format_exception_only(*self.exc[:2]) + fail( + "Error evaluating %r expression\n" + " %s\n" + "%s" % (self._mark_name, self.expr, "\n".join(msg)), + pytrace=False, + ) + + def _getglobals(self): + d = {"os": os, "sys": sys, "platform": platform, "config": self.item.config} + if hasattr(self.item, "obj"): + d.update(self.item.obj.__globals__) + return d + + def _istrue(self): + if hasattr(self, "result"): + return self.result + self._marks = self._get_marks() + + if self._marks: + self.result = False + for mark in self._marks: + self._mark = mark + if "condition" in mark.kwargs: + args = (mark.kwargs["condition"],) + else: + args = mark.args + + for expr in args: + self.expr = expr + if isinstance(expr, six.string_types): + d = self._getglobals() + result = cached_eval(self.item.config, expr, d) + else: + if "reason" not in mark.kwargs: + # XXX better be checked at collection time + msg = "you need to specify reason=STRING " "when using booleans as conditions." + fail(msg) + result = bool(expr) + if result: + self.result = True + self.reason = mark.kwargs.get("reason", None) + self.expr = expr + return self.result + + if not args: + self.result = True + self.reason = mark.kwargs.get("reason", None) + return self.result + return False + + def get(self, attr, default=None): + if self._mark is None: + return default + return self._mark.kwargs.get(attr, default) + + def getexplanation(self): + expl = getattr(self, "reason", None) or self.get("reason", None) + if not expl: + if not hasattr(self, "expr"): + return "" + else: + return "condition: " + str(self.expr) + return expl diff --git a/third_party/python/pytest/src/_pytest/mark/legacy.py b/third_party/python/pytest/src/_pytest/mark/legacy.py new file mode 100644 index 0000000000..ab016a0355 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/mark/legacy.py @@ -0,0 +1,97 @@ +""" +this is a place where we put datastructures used by legacy apis +we hope ot remove +""" +import attr +import keyword + +from _pytest.config import UsageError + + +@attr.s +class MarkMapping(object): + """Provides a local mapping for markers where item access + resolves to True if the marker is present. """ + + own_mark_names = attr.ib() + + @classmethod + def from_item(cls, item): + mark_names = {mark.name for mark in item.iter_markers()} + return cls(mark_names) + + def __getitem__(self, name): + return name in self.own_mark_names + + +class KeywordMapping(object): + """Provides a local mapping for keywords. + Given a list of names, map any substring of one of these names to True. + """ + + def __init__(self, names): + self._names = names + + @classmethod + def from_item(cls, item): + mapped_names = set() + + # Add the names of the current item and any parent items + import pytest + + for item in item.listchain(): + if not isinstance(item, pytest.Instance): + mapped_names.add(item.name) + + # Add the names added as extra keywords to current or parent items + for name in item.listextrakeywords(): + mapped_names.add(name) + + # Add the names attached to the current function through direct assignment + if hasattr(item, "function"): + for name in item.function.__dict__: + mapped_names.add(name) + + return cls(mapped_names) + + def __getitem__(self, subname): + for name in self._names: + if subname in name: + return True + return False + + +python_keywords_allowed_list = ["or", "and", "not"] + + +def matchmark(colitem, markexpr): + """Tries to match on any marker names, attached to the given colitem.""" + return eval(markexpr, {}, MarkMapping.from_item(colitem)) + + +def matchkeyword(colitem, keywordexpr): + """Tries to match given keyword expression to given collector item. + + Will match on the name of colitem, including the names of its parents. + Only matches names of items which are either a :class:`Class` or a + :class:`Function`. + Additionally, matches on names in the 'extra_keyword_matches' set of + any item, as well as names directly assigned to test functions. + """ + mapping = KeywordMapping.from_item(colitem) + if " " not in keywordexpr: + # special case to allow for simple "-k pass" and "-k 1.3" + return mapping[keywordexpr] + elif keywordexpr.startswith("not ") and " " not in keywordexpr[4:]: + return not mapping[keywordexpr[4:]] + for kwd in keywordexpr.split(): + if keyword.iskeyword(kwd) and kwd not in python_keywords_allowed_list: + raise UsageError( + "Python keyword '{}' not accepted in expressions passed to '-k'".format( + kwd + ) + ) + try: + return eval(keywordexpr, {}, mapping) + except SyntaxError: + raise UsageError("Wrong expression passed to '-k': {}".format(keywordexpr)) diff --git a/third_party/python/pytest/src/_pytest/mark/structures.py b/third_party/python/pytest/src/_pytest/mark/structures.py new file mode 100644 index 0000000000..1a2bd73de5 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/mark/structures.py @@ -0,0 +1,428 @@ +import inspect +import warnings +from collections import namedtuple +from operator import attrgetter + +import attr + +from ..deprecated import MARK_PARAMETERSET_UNPACKING, MARK_INFO_ATTRIBUTE +from ..compat import NOTSET, getfslineno, MappingMixin +from six.moves import map, reduce + + +EMPTY_PARAMETERSET_OPTION = "empty_parameter_set_mark" + + +def alias(name, warning=None): + getter = attrgetter(name) + + def warned(self): + warnings.warn(warning, stacklevel=2) + return getter(self) + + return property(getter if warning is None else warned, doc="alias for " + name) + + +def istestfunc(func): + return hasattr(func, "__call__") and getattr( + func, "__name__", "<lambda>" + ) != "<lambda>" + + +def get_empty_parameterset_mark(config, argnames, func): + requested_mark = config.getini(EMPTY_PARAMETERSET_OPTION) + if requested_mark in ("", None, "skip"): + mark = MARK_GEN.skip + elif requested_mark == "xfail": + mark = MARK_GEN.xfail(run=False) + else: + raise LookupError(requested_mark) + fs, lineno = getfslineno(func) + reason = "got empty parameter set %r, function %s at %s:%d" % ( + argnames, func.__name__, fs, lineno + ) + return mark(reason=reason) + + +class ParameterSet(namedtuple("ParameterSet", "values, marks, id")): + + @classmethod + def param(cls, *values, **kw): + marks = kw.pop("marks", ()) + if isinstance(marks, MarkDecorator): + marks = marks, + else: + assert isinstance(marks, (tuple, list, set)) + + def param_extract_id(id=None): + return id + + id_ = param_extract_id(**kw) + return cls(values, marks, id_) + + @classmethod + def extract_from(cls, parameterset, legacy_force_tuple=False): + """ + :param parameterset: + a legacy style parameterset that may or may not be a tuple, + and may or may not be wrapped into a mess of mark objects + + :param legacy_force_tuple: + enforce tuple wrapping so single argument tuple values + don't get decomposed and break tests + + """ + + if isinstance(parameterset, cls): + return parameterset + if not isinstance(parameterset, MarkDecorator) and legacy_force_tuple: + return cls.param(parameterset) + + newmarks = [] + argval = parameterset + while isinstance(argval, MarkDecorator): + newmarks.append( + MarkDecorator(Mark(argval.markname, argval.args[:-1], argval.kwargs)) + ) + argval = argval.args[-1] + assert not isinstance(argval, ParameterSet) + if legacy_force_tuple: + argval = argval, + + if newmarks: + warnings.warn(MARK_PARAMETERSET_UNPACKING) + + return cls(argval, marks=newmarks, id=None) + + @classmethod + def _for_parametrize(cls, argnames, argvalues, func, config): + if not isinstance(argnames, (tuple, list)): + argnames = [x.strip() for x in argnames.split(",") if x.strip()] + force_tuple = len(argnames) == 1 + else: + force_tuple = False + parameters = [ + ParameterSet.extract_from(x, legacy_force_tuple=force_tuple) + for x in argvalues + ] + del argvalues + + if not parameters: + mark = get_empty_parameterset_mark(config, argnames, func) + parameters.append( + ParameterSet(values=(NOTSET,) * len(argnames), marks=[mark], id=None) + ) + return argnames, parameters + + +@attr.s(frozen=True) +class Mark(object): + #: name of the mark + name = attr.ib(type=str) + #: positional arguments of the mark decorator + args = attr.ib(type="List[object]") + #: keyword arguments of the mark decorator + kwargs = attr.ib(type="Dict[str, object]") + + def combined_with(self, other): + """ + :param other: the mark to combine with + :type other: Mark + :rtype: Mark + + combines by appending aargs and merging the mappings + """ + assert self.name == other.name + return Mark( + self.name, self.args + other.args, dict(self.kwargs, **other.kwargs) + ) + + +@attr.s +class MarkDecorator(object): + """ A decorator for test functions and test classes. When applied + it will create :class:`MarkInfo` objects which may be + :ref:`retrieved by hooks as item keywords <excontrolskip>`. + MarkDecorator instances are often created like this:: + + mark1 = pytest.mark.NAME # simple MarkDecorator + mark2 = pytest.mark.NAME(name1=value) # parametrized MarkDecorator + + and can then be applied as decorators to test functions:: + + @mark2 + def test_function(): + pass + + When a MarkDecorator instance is called it does the following: + 1. If called with a single class as its only positional argument and no + additional keyword arguments, it attaches itself to the class so it + gets applied automatically to all test cases found in that class. + 2. If called with a single function as its only positional argument and + no additional keyword arguments, it attaches a MarkInfo object to the + function, containing all the arguments already stored internally in + the MarkDecorator. + 3. When called in any other case, it performs a 'fake construction' call, + i.e. it returns a new MarkDecorator instance with the original + MarkDecorator's content updated with the arguments passed to this + call. + + Note: The rules above prevent MarkDecorator objects from storing only a + single function or class reference as their positional argument with no + additional keyword or positional arguments. + + """ + + mark = attr.ib(validator=attr.validators.instance_of(Mark)) + + name = alias("mark.name") + args = alias("mark.args") + kwargs = alias("mark.kwargs") + + @property + def markname(self): + return self.name # for backward-compat (2.4.1 had this attr) + + def __eq__(self, other): + return self.mark == other.mark if isinstance(other, MarkDecorator) else False + + def __repr__(self): + return "<MarkDecorator %r>" % (self.mark,) + + def with_args(self, *args, **kwargs): + """ return a MarkDecorator with extra arguments added + + unlike call this can be used even if the sole argument is a callable/class + + :return: MarkDecorator + """ + + mark = Mark(self.name, args, kwargs) + return self.__class__(self.mark.combined_with(mark)) + + def __call__(self, *args, **kwargs): + """ if passed a single callable argument: decorate it with mark info. + otherwise add *args/**kwargs in-place to mark information. """ + if args and not kwargs: + func = args[0] + is_class = inspect.isclass(func) + if len(args) == 1 and (istestfunc(func) or is_class): + if is_class: + store_mark(func, self.mark) + else: + store_legacy_markinfo(func, self.mark) + store_mark(func, self.mark) + return func + return self.with_args(*args, **kwargs) + + +def get_unpacked_marks(obj): + """ + obtain the unpacked marks that are stored on an object + """ + mark_list = getattr(obj, "pytestmark", []) + + if not isinstance(mark_list, list): + mark_list = [mark_list] + return [getattr(mark, "mark", mark) for mark in mark_list] # unpack MarkDecorator + + +def store_mark(obj, mark): + """store a Mark on an object + this is used to implement the Mark declarations/decorators correctly + """ + assert isinstance(mark, Mark), mark + # always reassign name to avoid updating pytestmark + # in a reference that was only borrowed + obj.pytestmark = get_unpacked_marks(obj) + [mark] + + +def store_legacy_markinfo(func, mark): + """create the legacy MarkInfo objects and put them onto the function + """ + if not isinstance(mark, Mark): + raise TypeError("got {mark!r} instead of a Mark".format(mark=mark)) + holder = getattr(func, mark.name, None) + if holder is None: + holder = MarkInfo.for_mark(mark) + setattr(func, mark.name, holder) + else: + holder.add_mark(mark) + + +def transfer_markers(funcobj, cls, mod): + """ + this function transfers class level markers and module level markers + into function level markinfo objects + + this is the main reason why marks are so broken + the resolution will involve phasing out function level MarkInfo objects + + """ + for obj in (cls, mod): + for mark in get_unpacked_marks(obj): + if not _marked(funcobj, mark): + store_legacy_markinfo(funcobj, mark) + + +def _marked(func, mark): + """ Returns True if :func: is already marked with :mark:, False otherwise. + This can happen if marker is applied to class and the test file is + invoked more than once. + """ + try: + func_mark = getattr(func, getattr(mark, "combined", mark).name) + except AttributeError: + return False + return any(mark == info.combined for info in func_mark) + + +@attr.s +class MarkInfo(object): + """ Marking object created by :class:`MarkDecorator` instances. """ + + _marks = attr.ib(convert=list) + + @_marks.validator + def validate_marks(self, attribute, value): + for item in value: + if not isinstance(item, Mark): + raise ValueError( + "MarkInfo expects Mark instances, got {!r} ({!r})".format( + item, type(item) + ) + ) + + combined = attr.ib( + repr=False, + default=attr.Factory( + lambda self: reduce(Mark.combined_with, self._marks), takes_self=True + ), + ) + + name = alias("combined.name", warning=MARK_INFO_ATTRIBUTE) + args = alias("combined.args", warning=MARK_INFO_ATTRIBUTE) + kwargs = alias("combined.kwargs", warning=MARK_INFO_ATTRIBUTE) + + @classmethod + def for_mark(cls, mark): + return cls([mark]) + + def __repr__(self): + return "<MarkInfo {!r}>".format(self.combined) + + def add_mark(self, mark): + """ add a MarkInfo with the given args and kwargs. """ + self._marks.append(mark) + self.combined = self.combined.combined_with(mark) + + def __iter__(self): + """ yield MarkInfo objects each relating to a marking-call. """ + return map(MarkInfo.for_mark, self._marks) + + +class MarkGenerator(object): + """ Factory for :class:`MarkDecorator` objects - exposed as + a ``pytest.mark`` singleton instance. Example:: + + import pytest + @pytest.mark.slowtest + def test_function(): + pass + + will set a 'slowtest' :class:`MarkInfo` object + on the ``test_function`` object. """ + _config = None + + def __getattr__(self, name): + if name[0] == "_": + raise AttributeError("Marker name must NOT start with underscore") + if self._config is not None: + self._check(name) + return MarkDecorator(Mark(name, (), {})) + + def _check(self, name): + try: + if name in self._markers: + return + except AttributeError: + pass + self._markers = values = set() + for line in self._config.getini("markers"): + marker = line.split(":", 1)[0] + marker = marker.rstrip() + x = marker.split("(", 1)[0] + values.add(x) + if name not in self._markers: + raise AttributeError("%r not a registered marker" % (name,)) + + +MARK_GEN = MarkGenerator() + + +class NodeKeywords(MappingMixin): + + def __init__(self, node): + self.node = node + self.parent = node.parent + self._markers = {node.name: True} + + def __getitem__(self, key): + try: + return self._markers[key] + except KeyError: + if self.parent is None: + raise + return self.parent.keywords[key] + + def __setitem__(self, key, value): + self._markers[key] = value + + def __delitem__(self, key): + raise ValueError("cannot delete key in keywords dict") + + def __iter__(self): + seen = self._seen() + return iter(seen) + + def _seen(self): + seen = set(self._markers) + if self.parent is not None: + seen.update(self.parent.keywords) + return seen + + def __len__(self): + return len(self._seen()) + + def __repr__(self): + return "<NodeKeywords for node %s>" % (self.node,) + + +@attr.s(cmp=False, hash=False) +class NodeMarkers(object): + """ + internal strucutre for storing marks belongong to a node + + ..warning:: + + unstable api + + """ + own_markers = attr.ib(default=attr.Factory(list)) + + def update(self, add_markers): + """update the own markers + """ + self.own_markers.extend(add_markers) + + def find(self, name): + """ + find markers in own nodes or parent nodes + needs a better place + """ + for mark in self.own_markers: + if mark.name == name: + yield mark + + def __iter__(self): + return iter(self.own_markers) diff --git a/third_party/python/pytest/src/_pytest/monkeypatch.py b/third_party/python/pytest/src/_pytest/monkeypatch.py new file mode 100644 index 0000000000..16080b5d5c --- /dev/null +++ b/third_party/python/pytest/src/_pytest/monkeypatch.py @@ -0,0 +1,283 @@ +""" monkeypatching and mocking functionality. """ +from __future__ import absolute_import, division, print_function + +import os +import sys +import re +from contextlib import contextmanager + +import six +from _pytest.fixtures import fixture + +RE_IMPORT_ERROR_NAME = re.compile("^No module named (.*)$") + + +@fixture +def monkeypatch(): + """The returned ``monkeypatch`` fixture provides these + helper methods to modify objects, dictionaries or os.environ:: + + monkeypatch.setattr(obj, name, value, raising=True) + monkeypatch.delattr(obj, name, raising=True) + monkeypatch.setitem(mapping, name, value) + monkeypatch.delitem(obj, name, raising=True) + monkeypatch.setenv(name, value, prepend=False) + monkeypatch.delenv(name, value, raising=True) + monkeypatch.syspath_prepend(path) + monkeypatch.chdir(path) + + All modifications will be undone after the requesting + test function or fixture has finished. The ``raising`` + parameter determines if a KeyError or AttributeError + will be raised if the set/deletion operation has no target. + """ + mpatch = MonkeyPatch() + yield mpatch + mpatch.undo() + + +def resolve(name): + # simplified from zope.dottedname + parts = name.split(".") + + used = parts.pop(0) + found = __import__(used) + for part in parts: + used += "." + part + try: + found = getattr(found, part) + except AttributeError: + pass + else: + continue + # we use explicit un-nesting of the handling block in order + # to avoid nested exceptions on python 3 + try: + __import__(used) + except ImportError as ex: + # str is used for py2 vs py3 + expected = str(ex).split()[-1] + if expected == used: + raise + else: + raise ImportError("import error in %s: %s" % (used, ex)) + found = annotated_getattr(found, part, used) + return found + + +def annotated_getattr(obj, name, ann): + try: + obj = getattr(obj, name) + except AttributeError: + raise AttributeError( + "%r object at %s has no attribute %r" % (type(obj).__name__, ann, name) + ) + return obj + + +def derive_importpath(import_path, raising): + if not isinstance(import_path, six.string_types) or "." not in import_path: + raise TypeError("must be absolute import path string, not %r" % (import_path,)) + module, attr = import_path.rsplit(".", 1) + target = resolve(module) + if raising: + annotated_getattr(target, attr, ann=module) + return attr, target + + +class Notset(object): + + def __repr__(self): + return "<notset>" + + +notset = Notset() + + +class MonkeyPatch(object): + """ Object returned by the ``monkeypatch`` fixture keeping a record of setattr/item/env/syspath changes. + """ + + def __init__(self): + self._setattr = [] + self._setitem = [] + self._cwd = None + self._savesyspath = None + + @contextmanager + def context(self): + """ + Context manager that returns a new :class:`MonkeyPatch` object which + undoes any patching done inside the ``with`` block upon exit: + + .. code-block:: python + + import functools + def test_partial(monkeypatch): + with monkeypatch.context() as m: + m.setattr(functools, "partial", 3) + + Useful in situations where it is desired to undo some patches before the test ends, + such as mocking ``stdlib`` functions that might break pytest itself if mocked (for examples + of this see `#3290 <https://github.com/pytest-dev/pytest/issues/3290>`_. + """ + m = MonkeyPatch() + try: + yield m + finally: + m.undo() + + def setattr(self, target, name, value=notset, raising=True): + """ Set attribute value on target, memorizing the old value. + By default raise AttributeError if the attribute did not exist. + + For convenience you can specify a string as ``target`` which + will be interpreted as a dotted import path, with the last part + being the attribute name. Example: + ``monkeypatch.setattr("os.getcwd", lambda: "/")`` + would set the ``getcwd`` function of the ``os`` module. + + The ``raising`` value determines if the setattr should fail + if the attribute is not already present (defaults to True + which means it will raise). + """ + __tracebackhide__ = True + import inspect + + if value is notset: + if not isinstance(target, six.string_types): + raise TypeError( + "use setattr(target, name, value) or " + "setattr(target, value) with target being a dotted " + "import string" + ) + value = name + name, target = derive_importpath(target, raising) + + oldval = getattr(target, name, notset) + if raising and oldval is notset: + raise AttributeError("%r has no attribute %r" % (target, name)) + + # avoid class descriptors like staticmethod/classmethod + if inspect.isclass(target): + oldval = target.__dict__.get(name, notset) + self._setattr.append((target, name, oldval)) + setattr(target, name, value) + + def delattr(self, target, name=notset, raising=True): + """ Delete attribute ``name`` from ``target``, by default raise + AttributeError it the attribute did not previously exist. + + If no ``name`` is specified and ``target`` is a string + it will be interpreted as a dotted import path with the + last part being the attribute name. + + If ``raising`` is set to False, no exception will be raised if the + attribute is missing. + """ + __tracebackhide__ = True + if name is notset: + if not isinstance(target, six.string_types): + raise TypeError( + "use delattr(target, name) or " + "delattr(target) with target being a dotted " + "import string" + ) + name, target = derive_importpath(target, raising) + + if not hasattr(target, name): + if raising: + raise AttributeError(name) + else: + self._setattr.append((target, name, getattr(target, name, notset))) + delattr(target, name) + + def setitem(self, dic, name, value): + """ Set dictionary entry ``name`` to value. """ + self._setitem.append((dic, name, dic.get(name, notset))) + dic[name] = value + + def delitem(self, dic, name, raising=True): + """ Delete ``name`` from dict. Raise KeyError if it doesn't exist. + + If ``raising`` is set to False, no exception will be raised if the + key is missing. + """ + if name not in dic: + if raising: + raise KeyError(name) + else: + self._setitem.append((dic, name, dic.get(name, notset))) + del dic[name] + + def setenv(self, name, value, prepend=None): + """ Set environment variable ``name`` to ``value``. If ``prepend`` + is a character, read the current environment variable value + and prepend the ``value`` adjoined with the ``prepend`` character.""" + value = str(value) + if prepend and name in os.environ: + value = value + prepend + os.environ[name] + self.setitem(os.environ, name, value) + + def delenv(self, name, raising=True): + """ Delete ``name`` from the environment. Raise KeyError it does not + exist. + + If ``raising`` is set to False, no exception will be raised if the + environment variable is missing. + """ + self.delitem(os.environ, name, raising=raising) + + def syspath_prepend(self, path): + """ Prepend ``path`` to ``sys.path`` list of import locations. """ + if self._savesyspath is None: + self._savesyspath = sys.path[:] + sys.path.insert(0, str(path)) + + def chdir(self, path): + """ Change the current working directory to the specified path. + Path can be a string or a py.path.local object. + """ + if self._cwd is None: + self._cwd = os.getcwd() + if hasattr(path, "chdir"): + path.chdir() + else: + os.chdir(path) + + def undo(self): + """ Undo previous changes. This call consumes the + undo stack. Calling it a second time has no effect unless + you do more monkeypatching after the undo call. + + There is generally no need to call `undo()`, since it is + called automatically during tear-down. + + Note that the same `monkeypatch` fixture is used across a + single test function invocation. If `monkeypatch` is used both by + the test function itself and one of the test fixtures, + calling `undo()` will undo all of the changes made in + both functions. + """ + for obj, name, value in reversed(self._setattr): + if value is not notset: + setattr(obj, name, value) + else: + delattr(obj, name) + self._setattr[:] = [] + for dictionary, name, value in reversed(self._setitem): + if value is notset: + try: + del dictionary[name] + except KeyError: + pass # was already deleted, so we have the desired state + else: + dictionary[name] = value + self._setitem[:] = [] + if self._savesyspath is not None: + sys.path[:] = self._savesyspath + self._savesyspath = None + + if self._cwd is not None: + os.chdir(self._cwd) + self._cwd = None diff --git a/third_party/python/pytest/src/_pytest/nodes.py b/third_party/python/pytest/src/_pytest/nodes.py new file mode 100644 index 0000000000..ef74c53eba --- /dev/null +++ b/third_party/python/pytest/src/_pytest/nodes.py @@ -0,0 +1,419 @@ +from __future__ import absolute_import, division, print_function +import os + +import six +import py +import attr + +import _pytest +import _pytest._code + +from _pytest.mark.structures import NodeKeywords, MarkInfo + +SEP = "/" + +tracebackcutdir = py.path.local(_pytest.__file__).dirpath() + + +def _splitnode(nodeid): + """Split a nodeid into constituent 'parts'. + + Node IDs are strings, and can be things like: + '' + 'testing/code' + 'testing/code/test_excinfo.py' + 'testing/code/test_excinfo.py::TestFormattedExcinfo::()' + + Return values are lists e.g. + [] + ['testing', 'code'] + ['testing', 'code', 'test_excinfo.py'] + ['testing', 'code', 'test_excinfo.py', 'TestFormattedExcinfo', '()'] + """ + if nodeid == "": + # If there is no root node at all, return an empty list so the caller's logic can remain sane + return [] + parts = nodeid.split(SEP) + # Replace single last element 'test_foo.py::Bar::()' with multiple elements 'test_foo.py', 'Bar', '()' + parts[-1:] = parts[-1].split("::") + return parts + + +def ischildnode(baseid, nodeid): + """Return True if the nodeid is a child node of the baseid. + + E.g. 'foo/bar::Baz::()' is a child of 'foo', 'foo/bar' and 'foo/bar::Baz', but not of 'foo/blorp' + """ + base_parts = _splitnode(baseid) + node_parts = _splitnode(nodeid) + if len(node_parts) < len(base_parts): + return False + return node_parts[:len(base_parts)] == base_parts + + +@attr.s +class _CompatProperty(object): + name = attr.ib() + + def __get__(self, obj, owner): + if obj is None: + return self + + # TODO: reenable in the features branch + # warnings.warn( + # "usage of {owner!r}.{name} is deprecated, please use pytest.{name} instead".format( + # name=self.name, owner=type(owner).__name__), + # PendingDeprecationWarning, stacklevel=2) + return getattr(__import__("pytest"), self.name) + + +class Node(object): + """ base class for Collector and Item the test collection tree. + Collector subclasses have children, Items are terminal nodes.""" + + def __init__( + self, name, parent=None, config=None, session=None, fspath=None, nodeid=None + ): + #: a unique name within the scope of the parent node + self.name = name + + #: the parent collector node. + self.parent = parent + + #: the pytest config object + self.config = config or parent.config + + #: the session this node is part of + self.session = session or parent.session + + #: filesystem path where this node was collected from (can be None) + self.fspath = fspath or getattr(parent, "fspath", None) + + #: keywords/markers collected from all scopes + self.keywords = NodeKeywords(self) + + #: the marker objects belonging to this node + self.own_markers = [] + + #: allow adding of extra keywords to use for matching + self.extra_keyword_matches = set() + + # used for storing artificial fixturedefs for direct parametrization + self._name2pseudofixturedef = {} + + if nodeid is not None: + self._nodeid = nodeid + else: + assert parent is not None + self._nodeid = self.parent.nodeid + "::" + self.name + + @property + def ihook(self): + """ fspath sensitive hook proxy used to call pytest hooks""" + return self.session.gethookproxy(self.fspath) + + Module = _CompatProperty("Module") + Class = _CompatProperty("Class") + Instance = _CompatProperty("Instance") + Function = _CompatProperty("Function") + File = _CompatProperty("File") + Item = _CompatProperty("Item") + + def _getcustomclass(self, name): + maybe_compatprop = getattr(type(self), name) + if isinstance(maybe_compatprop, _CompatProperty): + return getattr(__import__("pytest"), name) + else: + cls = getattr(self, name) + # TODO: reenable in the features branch + # warnings.warn("use of node.%s is deprecated, " + # "use pytest_pycollect_makeitem(...) to create custom " + # "collection nodes" % name, category=DeprecationWarning) + return cls + + def __repr__(self): + return "<%s %r>" % (self.__class__.__name__, getattr(self, "name", None)) + + def warn(self, code, message): + """ generate a warning with the given code and message for this + item. """ + assert isinstance(code, str) + fslocation = getattr(self, "location", None) + if fslocation is None: + fslocation = getattr(self, "fspath", None) + self.ihook.pytest_logwarning.call_historic( + kwargs=dict( + code=code, message=message, nodeid=self.nodeid, fslocation=fslocation + ) + ) + + # methods for ordering nodes + @property + def nodeid(self): + """ a ::-separated string denoting its collection tree address. """ + return self._nodeid + + def __hash__(self): + return hash(self.nodeid) + + def setup(self): + pass + + def teardown(self): + pass + + def listchain(self): + """ return list of all parent collectors up to self, + starting from root of collection tree. """ + chain = [] + item = self + while item is not None: + chain.append(item) + item = item.parent + chain.reverse() + return chain + + def add_marker(self, marker): + """dynamically add a marker object to the node. + + :type marker: str or pytest.mark.* + """ + from _pytest.mark import MarkDecorator, MARK_GEN + + if isinstance(marker, six.string_types): + marker = getattr(MARK_GEN, marker) + elif not isinstance(marker, MarkDecorator): + raise ValueError("is not a string or pytest.mark.* Marker") + self.keywords[marker.name] = marker + self.own_markers.append(marker.mark) + + def iter_markers(self, name=None): + """ + :param name: if given, filter the results by the name attribute + + iterate over all markers of the node + """ + return (x[1] for x in self.iter_markers_with_node(name=name)) + + def iter_markers_with_node(self, name=None): + """ + :param name: if given, filter the results by the name attribute + + iterate over all markers of the node + returns sequence of tuples (node, mark) + """ + for node in reversed(self.listchain()): + for mark in node.own_markers: + if name is None or getattr(mark, "name", None) == name: + yield node, mark + + def get_closest_marker(self, name, default=None): + """return the first marker matching the name, from closest (for example function) to farther level (for example + module level). + + :param default: fallback return value of no marker was found + :param name: name to filter by + """ + return next(self.iter_markers(name=name), default) + + def get_marker(self, name): + """ get a marker object from this node or None if + the node doesn't have a marker with that name. + + .. deprecated:: 3.6 + This function has been deprecated in favor of + :meth:`Node.get_closest_marker <_pytest.nodes.Node.get_closest_marker>` and + :meth:`Node.iter_markers <_pytest.nodes.Node.iter_markers>`, see :ref:`update marker code` + for more details. + """ + markers = list(self.iter_markers(name=name)) + if markers: + return MarkInfo(markers) + + def listextrakeywords(self): + """ Return a set of all extra keywords in self and any parents.""" + extra_keywords = set() + for item in self.listchain(): + extra_keywords.update(item.extra_keyword_matches) + return extra_keywords + + def listnames(self): + return [x.name for x in self.listchain()] + + def addfinalizer(self, fin): + """ register a function to be called when this node is finalized. + + This method can only be called when this node is active + in a setup chain, for example during self.setup(). + """ + self.session._setupstate.addfinalizer(fin, self) + + def getparent(self, cls): + """ get the next parent node (including ourself) + which is an instance of the given class""" + current = self + while current and not isinstance(current, cls): + current = current.parent + return current + + def _prunetraceback(self, excinfo): + pass + + def _repr_failure_py(self, excinfo, style=None): + fm = self.session._fixturemanager + if excinfo.errisinstance(fm.FixtureLookupError): + return excinfo.value.formatrepr() + tbfilter = True + if self.config.option.fulltrace: + style = "long" + else: + tb = _pytest._code.Traceback([excinfo.traceback[-1]]) + self._prunetraceback(excinfo) + if len(excinfo.traceback) == 0: + excinfo.traceback = tb + tbfilter = False # prunetraceback already does it + if style == "auto": + style = "long" + # XXX should excinfo.getrepr record all data and toterminal() process it? + if style is None: + if self.config.option.tbstyle == "short": + style = "short" + else: + style = "long" + + try: + os.getcwd() + abspath = False + except OSError: + abspath = True + + return excinfo.getrepr( + funcargs=True, + abspath=abspath, + showlocals=self.config.option.showlocals, + style=style, + tbfilter=tbfilter, + ) + + repr_failure = _repr_failure_py + + +class Collector(Node): + """ Collector instances create children through collect() + and thus iteratively build a tree. + """ + + class CollectError(Exception): + """ an error during collection, contains a custom message. """ + + def collect(self): + """ returns a list of children (items and collectors) + for this collection node. + """ + raise NotImplementedError("abstract") + + def repr_failure(self, excinfo): + """ represent a collection failure. """ + if excinfo.errisinstance(self.CollectError): + exc = excinfo.value + return str(exc.args[0]) + return self._repr_failure_py(excinfo, style="short") + + def _prunetraceback(self, excinfo): + if hasattr(self, "fspath"): + traceback = excinfo.traceback + ntraceback = traceback.cut(path=self.fspath) + if ntraceback == traceback: + ntraceback = ntraceback.cut(excludepath=tracebackcutdir) + excinfo.traceback = ntraceback.filter() + + +def _check_initialpaths_for_relpath(session, fspath): + for initial_path in session._initialpaths: + if fspath.common(initial_path) == initial_path: + return fspath.relto(initial_path.dirname) + + +class FSCollector(Collector): + + def __init__(self, fspath, parent=None, config=None, session=None, nodeid=None): + fspath = py.path.local(fspath) # xxx only for test_resultlog.py? + name = fspath.basename + if parent is not None: + rel = fspath.relto(parent.fspath) + if rel: + name = rel + name = name.replace(os.sep, SEP) + self.fspath = fspath + + session = session or parent.session + + if nodeid is None: + nodeid = self.fspath.relto(session.config.rootdir) + + if not nodeid: + nodeid = _check_initialpaths_for_relpath(session, fspath) + if os.sep != SEP: + nodeid = nodeid.replace(os.sep, SEP) + + super(FSCollector, self).__init__( + name, parent, config, session, nodeid=nodeid, fspath=fspath + ) + + +class File(FSCollector): + """ base class for collecting tests from a file. """ + + +class Item(Node): + """ a basic test invocation item. Note that for a single function + there might be multiple test invocation items. + """ + nextitem = None + + def __init__(self, name, parent=None, config=None, session=None, nodeid=None): + super(Item, self).__init__(name, parent, config, session, nodeid=nodeid) + self._report_sections = [] + + #: user properties is a list of tuples (name, value) that holds user + #: defined properties for this test. + self.user_properties = [] + + def add_report_section(self, when, key, content): + """ + Adds a new report section, similar to what's done internally to add stdout and + stderr captured output:: + + item.add_report_section("call", "stdout", "report section contents") + + :param str when: + One of the possible capture states, ``"setup"``, ``"call"``, ``"teardown"``. + :param str key: + Name of the section, can be customized at will. Pytest uses ``"stdout"`` and + ``"stderr"`` internally. + + :param str content: + The full contents as a string. + """ + if content: + self._report_sections.append((when, key, content)) + + def reportinfo(self): + return self.fspath, None, "" + + @property + def location(self): + try: + return self._location + except AttributeError: + location = self.reportinfo() + # bestrelpath is a quite slow function + cache = self.config.__dict__.setdefault("_bestrelpathcache", {}) + try: + fspath = cache[location[0]] + except KeyError: + fspath = self.session.fspath.bestrelpath(location[0]) + cache[location[0]] = fspath + location = (fspath, location[1], str(location[2])) + self._location = location + return location diff --git a/third_party/python/pytest/src/_pytest/nose.py b/third_party/python/pytest/src/_pytest/nose.py new file mode 100644 index 0000000000..bb2e4277d1 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/nose.py @@ -0,0 +1,72 @@ +""" run test suites written for nose. """ +from __future__ import absolute_import, division, print_function + +import sys + +from _pytest import unittest, runner, python +from _pytest.config import hookimpl + + +def get_skip_exceptions(): + skip_classes = set() + for module_name in ("unittest", "unittest2", "nose"): + mod = sys.modules.get(module_name) + if hasattr(mod, "SkipTest"): + skip_classes.add(mod.SkipTest) + return tuple(skip_classes) + + +def pytest_runtest_makereport(item, call): + if call.excinfo and call.excinfo.errisinstance(get_skip_exceptions()): + # let's substitute the excinfo with a pytest.skip one + call2 = call.__class__(lambda: runner.skip(str(call.excinfo.value)), call.when) + call.excinfo = call2.excinfo + + +@hookimpl(trylast=True) +def pytest_runtest_setup(item): + if is_potential_nosetest(item): + if isinstance(item.parent, python.Generator): + gen = item.parent + if not hasattr(gen, "_nosegensetup"): + call_optional(gen.obj, "setup") + if isinstance(gen.parent, python.Instance): + call_optional(gen.parent.obj, "setup") + gen._nosegensetup = True + if not call_optional(item.obj, "setup"): + # call module level setup if there is no object level one + call_optional(item.parent.obj, "setup") + # XXX this implies we only call teardown when setup worked + item.session._setupstate.addfinalizer((lambda: teardown_nose(item)), item) + + +def teardown_nose(item): + if is_potential_nosetest(item): + if not call_optional(item.obj, "teardown"): + call_optional(item.parent.obj, "teardown") + # if hasattr(item.parent, '_nosegensetup'): + # #call_optional(item._nosegensetup, 'teardown') + # del item.parent._nosegensetup + + +def pytest_make_collect_report(collector): + if isinstance(collector, python.Generator): + call_optional(collector.obj, "setup") + + +def is_potential_nosetest(item): + # extra check needed since we do not do nose style setup/teardown + # on direct unittest style classes + return isinstance(item, python.Function) and not isinstance( + item, unittest.TestCaseFunction + ) + + +def call_optional(obj, name): + method = getattr(obj, name, None) + isfixture = hasattr(method, "_pytestfixturefunction") + if method is not None and not isfixture and callable(method): + # If there's any problems allow the exception to raise rather than + # silently ignoring them + method() + return True diff --git a/third_party/python/pytest/src/_pytest/outcomes.py b/third_party/python/pytest/src/_pytest/outcomes.py new file mode 100644 index 0000000000..8a3662e1b3 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/outcomes.py @@ -0,0 +1,157 @@ +""" +exception classes and constants handling test outcomes +as well as functions creating them +""" +from __future__ import absolute_import, division, print_function +import py +import sys + + +class OutcomeException(BaseException): + """ OutcomeException and its subclass instances indicate and + contain info about test and collection outcomes. + """ + + def __init__(self, msg=None, pytrace=True): + BaseException.__init__(self, msg) + self.msg = msg + self.pytrace = pytrace + + def __repr__(self): + if self.msg: + val = self.msg + if isinstance(val, bytes): + val = py._builtin._totext(val, errors="replace") + return val + return "<%s instance>" % (self.__class__.__name__,) + + __str__ = __repr__ + + +TEST_OUTCOME = (OutcomeException, Exception) + + +class Skipped(OutcomeException): + # XXX hackish: on 3k we fake to live in the builtins + # in order to have Skipped exception printing shorter/nicer + __module__ = "builtins" + + def __init__(self, msg=None, pytrace=True, allow_module_level=False): + OutcomeException.__init__(self, msg=msg, pytrace=pytrace) + self.allow_module_level = allow_module_level + + +class Failed(OutcomeException): + """ raised from an explicit call to pytest.fail() """ + __module__ = "builtins" + + +class Exit(KeyboardInterrupt): + """ raised for immediate program exits (no tracebacks/summaries)""" + + def __init__(self, msg="unknown reason"): + self.msg = msg + KeyboardInterrupt.__init__(self, msg) + + +# exposed helper methods + + +def exit(msg): + """ exit testing process as if KeyboardInterrupt was triggered. """ + __tracebackhide__ = True + raise Exit(msg) + + +exit.Exception = Exit + + +def skip(msg="", **kwargs): + """ skip an executing test with the given message. Note: it's usually + better to use the pytest.mark.skipif marker to declare a test to be + skipped under certain conditions like mismatching platforms or + dependencies. See the pytest_skipping plugin for details. + + :kwarg bool allow_module_level: allows this function to be called at + module level, skipping the rest of the module. Default to False. + """ + __tracebackhide__ = True + allow_module_level = kwargs.pop("allow_module_level", False) + if kwargs: + keys = [k for k in kwargs.keys()] + raise TypeError("unexpected keyword arguments: {}".format(keys)) + raise Skipped(msg=msg, allow_module_level=allow_module_level) + + +skip.Exception = Skipped + + +def fail(msg="", pytrace=True): + """ explicitly fail a currently-executing test with the given Message. + + :arg pytrace: if false the msg represents the full failure information + and no python traceback will be reported. + """ + __tracebackhide__ = True + raise Failed(msg=msg, pytrace=pytrace) + + +fail.Exception = Failed + + +class XFailed(fail.Exception): + """ raised from an explicit call to pytest.xfail() """ + + +def xfail(reason=""): + """ xfail an executing test or setup functions with the given reason.""" + __tracebackhide__ = True + raise XFailed(reason) + + +xfail.Exception = XFailed + + +def importorskip(modname, minversion=None): + """ return imported module if it has at least "minversion" as its + __version__ attribute. If no minversion is specified the a skip + is only triggered if the module can not be imported. + """ + import warnings + + __tracebackhide__ = True + compile(modname, "", "eval") # to catch syntaxerrors + should_skip = False + + with warnings.catch_warnings(): + # make sure to ignore ImportWarnings that might happen because + # of existing directories with the same name we're trying to + # import but without a __init__.py file + warnings.simplefilter("ignore") + try: + __import__(modname) + except ImportError: + # Do not raise chained exception here(#1485) + should_skip = True + if should_skip: + raise Skipped("could not import %r" % (modname,), allow_module_level=True) + mod = sys.modules[modname] + if minversion is None: + return mod + verattr = getattr(mod, "__version__", None) + if minversion is not None: + try: + from pkg_resources import parse_version as pv + except ImportError: + raise Skipped( + "we have a required version for %r but can not import " + "pkg_resources to parse version strings." % (modname,), + allow_module_level=True, + ) + if verattr is None or pv(verattr) < pv(minversion): + raise Skipped( + "module %r has __version__ %r, required is: %r" + % (modname, verattr, minversion), + allow_module_level=True, + ) + return mod diff --git a/third_party/python/pytest/src/_pytest/pastebin.py b/third_party/python/pytest/src/_pytest/pastebin.py new file mode 100644 index 0000000000..6af202d1f0 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/pastebin.py @@ -0,0 +1,109 @@ +""" submit failure or test session information to a pastebin service. """ +from __future__ import absolute_import, division, print_function + +import pytest +import six +import sys +import tempfile + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting") + group._addoption( + "--pastebin", + metavar="mode", + action="store", + dest="pastebin", + default=None, + choices=["failed", "all"], + help="send failed|all info to bpaste.net pastebin service.", + ) + + +@pytest.hookimpl(trylast=True) +def pytest_configure(config): + if config.option.pastebin == "all": + tr = config.pluginmanager.getplugin("terminalreporter") + # if no terminal reporter plugin is present, nothing we can do here; + # this can happen when this function executes in a slave node + # when using pytest-xdist, for example + if tr is not None: + # pastebin file will be utf-8 encoded binary file + config._pastebinfile = tempfile.TemporaryFile("w+b") + oldwrite = tr._tw.write + + def tee_write(s, **kwargs): + oldwrite(s, **kwargs) + if isinstance(s, six.text_type): + s = s.encode("utf-8") + config._pastebinfile.write(s) + + tr._tw.write = tee_write + + +def pytest_unconfigure(config): + if hasattr(config, "_pastebinfile"): + # get terminal contents and delete file + config._pastebinfile.seek(0) + sessionlog = config._pastebinfile.read() + config._pastebinfile.close() + del config._pastebinfile + # undo our patching in the terminal reporter + tr = config.pluginmanager.getplugin("terminalreporter") + del tr._tw.__dict__["write"] + # write summary + tr.write_sep("=", "Sending information to Paste Service") + pastebinurl = create_new_paste(sessionlog) + tr.write_line("pastebin session-log: %s\n" % pastebinurl) + + +def create_new_paste(contents): + """ + Creates a new paste using bpaste.net service. + + :contents: paste contents as utf-8 encoded bytes + :returns: url to the pasted contents + """ + import re + + if sys.version_info < (3, 0): + from urllib import urlopen, urlencode + else: + from urllib.request import urlopen + from urllib.parse import urlencode + + params = { + "code": contents, + "lexer": "python3" if sys.version_info[0] == 3 else "python", + "expiry": "1week", + } + url = "https://bpaste.net" + response = urlopen(url, data=urlencode(params).encode("ascii")).read() + m = re.search(r'href="/raw/(\w+)"', response.decode("utf-8")) + if m: + return "%s/show/%s" % (url, m.group(1)) + else: + return "bad response: " + response + + +def pytest_terminal_summary(terminalreporter): + import _pytest.config + + if terminalreporter.config.option.pastebin != "failed": + return + tr = terminalreporter + if "failed" in tr.stats: + terminalreporter.write_sep("=", "Sending information to Paste Service") + for rep in terminalreporter.stats.get("failed"): + try: + msg = rep.longrepr.reprtraceback.reprentries[-1].reprfileloc + except AttributeError: + msg = tr._getfailureheadline(rep) + tw = _pytest.config.create_terminal_writer( + terminalreporter.config, stringio=True + ) + rep.toterminal(tw) + s = tw.stringio.getvalue() + assert len(s) + pastebinurl = create_new_paste(s) + tr.write_line("%s --> %s" % (msg, pastebinurl)) diff --git a/third_party/python/pytest/src/_pytest/pytester.py b/third_party/python/pytest/src/_pytest/pytester.py new file mode 100644 index 0000000000..c9defe03a6 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/pytester.py @@ -0,0 +1,1272 @@ +"""(disabled by default) support for testing pytest and pytest plugins.""" +from __future__ import absolute_import, division, print_function + +import codecs +import gc +import os +import platform +import re +import subprocess +import six +import sys +import time +import traceback +from fnmatch import fnmatch + +from weakref import WeakKeyDictionary + +from _pytest.capture import MultiCapture, SysCapture +from _pytest._code import Source +import py +import pytest +from _pytest.main import Session, EXIT_OK +from _pytest.assertion.rewrite import AssertionRewritingHook + + +PYTEST_FULLPATH = os.path.abspath(pytest.__file__.rstrip("oc")).replace( + "$py.class", ".py" +) + + +IGNORE_PAM = [ # filenames added when obtaining details about the current user + u"/var/lib/sss/mc/passwd" +] + + +def pytest_addoption(parser): + parser.addoption( + "--lsof", + action="store_true", + dest="lsof", + default=False, + help=("run FD checks if lsof is available"), + ) + + parser.addoption( + "--runpytest", + default="inprocess", + dest="runpytest", + choices=("inprocess", "subprocess"), + help=( + "run pytest sub runs in tests using an 'inprocess' " + "or 'subprocess' (python -m main) method" + ), + ) + + +def pytest_configure(config): + if config.getvalue("lsof"): + checker = LsofFdLeakChecker() + if checker.matching_platform(): + config.pluginmanager.register(checker) + + +class LsofFdLeakChecker(object): + + def get_open_files(self): + out = self._exec_lsof() + open_files = self._parse_lsof_output(out) + return open_files + + def _exec_lsof(self): + pid = os.getpid() + return py.process.cmdexec("lsof -Ffn0 -p %d" % pid) + + def _parse_lsof_output(self, out): + + def isopen(line): + return line.startswith("f") and ( + "deleted" not in line + and "mem" not in line + and "txt" not in line + and "cwd" not in line + ) + + open_files = [] + + for line in out.split("\n"): + if isopen(line): + fields = line.split("\0") + fd = fields[0][1:] + filename = fields[1][1:] + if filename in IGNORE_PAM: + continue + if filename.startswith("/"): + open_files.append((fd, filename)) + + return open_files + + def matching_platform(self): + try: + py.process.cmdexec("lsof -v") + except (py.process.cmdexec.Error, UnicodeDecodeError): + # cmdexec may raise UnicodeDecodeError on Windows systems with + # locale other than English: + # https://bitbucket.org/pytest-dev/py/issues/66 + return False + else: + return True + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_runtest_protocol(self, item): + lines1 = self.get_open_files() + yield + if hasattr(sys, "pypy_version_info"): + gc.collect() + lines2 = self.get_open_files() + + new_fds = {t[0] for t in lines2} - {t[0] for t in lines1} + leaked_files = [t for t in lines2 if t[0] in new_fds] + if leaked_files: + error = [] + error.append("***** %s FD leakage detected" % len(leaked_files)) + error.extend([str(f) for f in leaked_files]) + error.append("*** Before:") + error.extend([str(f) for f in lines1]) + error.append("*** After:") + error.extend([str(f) for f in lines2]) + error.append(error[0]) + error.append("*** function %s:%s: %s " % item.location) + error.append("See issue #2366") + item.warn("", "\n".join(error)) + + +# XXX copied from execnet's conftest.py - needs to be merged +winpymap = { + "python2.7": r"C:\Python27\python.exe", + "python3.4": r"C:\Python34\python.exe", + "python3.5": r"C:\Python35\python.exe", + "python3.6": r"C:\Python36\python.exe", +} + + +def getexecutable(name, cache={}): + try: + return cache[name] + except KeyError: + executable = py.path.local.sysfind(name) + if executable: + import subprocess + + popen = subprocess.Popen( + [str(executable), "--version"], + universal_newlines=True, + stderr=subprocess.PIPE, + ) + out, err = popen.communicate() + if name == "jython": + if not err or "2.5" not in err: + executable = None + if "2.5.2" in err: + executable = None # http://bugs.jython.org/issue1790 + elif popen.returncode != 0: + # handle pyenv's 127 + executable = None + cache[name] = executable + return executable + + +@pytest.fixture(params=["python2.7", "python3.4", "pypy", "pypy3"]) +def anypython(request): + name = request.param + executable = getexecutable(name) + if executable is None: + if sys.platform == "win32": + executable = winpymap.get(name, None) + if executable: + executable = py.path.local(executable) + if executable.check(): + return executable + pytest.skip("no suitable %s found" % (name,)) + return executable + + +# used at least by pytest-xdist plugin + + +@pytest.fixture +def _pytest(request): + """Return a helper which offers a gethookrecorder(hook) method which + returns a HookRecorder instance which helps to make assertions about called + hooks. + + """ + return PytestArg(request) + + +class PytestArg(object): + + def __init__(self, request): + self.request = request + + def gethookrecorder(self, hook): + hookrecorder = HookRecorder(hook._pm) + self.request.addfinalizer(hookrecorder.finish_recording) + return hookrecorder + + +def get_public_names(values): + """Only return names from iterator values without a leading underscore.""" + return [x for x in values if x[0] != "_"] + + +class ParsedCall(object): + + def __init__(self, name, kwargs): + self.__dict__.update(kwargs) + self._name = name + + def __repr__(self): + d = self.__dict__.copy() + del d["_name"] + return "<ParsedCall %r(**%r)>" % (self._name, d) + + +class HookRecorder(object): + """Record all hooks called in a plugin manager. + + This wraps all the hook calls in the plugin manager, recording each call + before propagating the normal calls. + + """ + + def __init__(self, pluginmanager): + self._pluginmanager = pluginmanager + self.calls = [] + + def before(hook_name, hook_impls, kwargs): + self.calls.append(ParsedCall(hook_name, kwargs)) + + def after(outcome, hook_name, hook_impls, kwargs): + pass + + self._undo_wrapping = pluginmanager.add_hookcall_monitoring(before, after) + + def finish_recording(self): + self._undo_wrapping() + + def getcalls(self, names): + if isinstance(names, str): + names = names.split() + return [call for call in self.calls if call._name in names] + + def assert_contains(self, entries): + __tracebackhide__ = True + i = 0 + entries = list(entries) + backlocals = sys._getframe(1).f_locals + while entries: + name, check = entries.pop(0) + for ind, call in enumerate(self.calls[i:]): + if call._name == name: + print("NAMEMATCH", name, call) + if eval(check, backlocals, call.__dict__): + print("CHECKERMATCH", repr(check), "->", call) + else: + print("NOCHECKERMATCH", repr(check), "-", call) + continue + i += ind + 1 + break + print("NONAMEMATCH", name, "with", call) + else: + pytest.fail("could not find %r check %r" % (name, check)) + + def popcall(self, name): + __tracebackhide__ = True + for i, call in enumerate(self.calls): + if call._name == name: + del self.calls[i] + return call + lines = ["could not find call %r, in:" % (name,)] + lines.extend([" %s" % str(x) for x in self.calls]) + pytest.fail("\n".join(lines)) + + def getcall(self, name): + values = self.getcalls(name) + assert len(values) == 1, (name, values) + return values[0] + + # functionality for test reports + + def getreports(self, names="pytest_runtest_logreport pytest_collectreport"): + return [x.report for x in self.getcalls(names)] + + def matchreport( + self, + inamepart="", + names="pytest_runtest_logreport pytest_collectreport", + when=None, + ): + """return a testreport whose dotted import path matches""" + values = [] + for rep in self.getreports(names=names): + try: + if not when and rep.when != "call" and rep.passed: + # setup/teardown passing reports - let's ignore those + continue + except AttributeError: + pass + if when and getattr(rep, "when", None) != when: + continue + if not inamepart or inamepart in rep.nodeid.split("::"): + values.append(rep) + if not values: + raise ValueError( + "could not find test report matching %r: " + "no test reports at all!" % (inamepart,) + ) + if len(values) > 1: + raise ValueError( + "found 2 or more testreports matching %r: %s" % (inamepart, values) + ) + return values[0] + + def getfailures(self, names="pytest_runtest_logreport pytest_collectreport"): + return [rep for rep in self.getreports(names) if rep.failed] + + def getfailedcollections(self): + return self.getfailures("pytest_collectreport") + + def listoutcomes(self): + passed = [] + skipped = [] + failed = [] + for rep in self.getreports("pytest_collectreport pytest_runtest_logreport"): + if rep.passed: + if getattr(rep, "when", None) == "call": + passed.append(rep) + elif rep.skipped: + skipped.append(rep) + elif rep.failed: + failed.append(rep) + return passed, skipped, failed + + def countoutcomes(self): + return [len(x) for x in self.listoutcomes()] + + def assertoutcome(self, passed=0, skipped=0, failed=0): + realpassed, realskipped, realfailed = self.listoutcomes() + assert passed == len(realpassed) + assert skipped == len(realskipped) + assert failed == len(realfailed) + + def clear(self): + self.calls[:] = [] + + +@pytest.fixture +def linecomp(request): + return LineComp() + + +@pytest.fixture(name="LineMatcher") +def LineMatcher_fixture(request): + return LineMatcher + + +@pytest.fixture +def testdir(request, tmpdir_factory): + return Testdir(request, tmpdir_factory) + + +rex_outcome = re.compile(r"(\d+) ([\w-]+)") + + +class RunResult(object): + """The result of running a command. + + Attributes: + + :ret: the return value + :outlines: list of lines captured from stdout + :errlines: list of lines captures from stderr + :stdout: :py:class:`LineMatcher` of stdout, use ``stdout.str()`` to + reconstruct stdout or the commonly used ``stdout.fnmatch_lines()`` + method + :stderr: :py:class:`LineMatcher` of stderr + :duration: duration in seconds + + """ + + def __init__(self, ret, outlines, errlines, duration): + self.ret = ret + self.outlines = outlines + self.errlines = errlines + self.stdout = LineMatcher(outlines) + self.stderr = LineMatcher(errlines) + self.duration = duration + + def parseoutcomes(self): + """Return a dictionary of outcomestring->num from parsing the terminal + output that the test process produced. + + """ + for line in reversed(self.outlines): + if "seconds" in line: + outcomes = rex_outcome.findall(line) + if outcomes: + d = {} + for num, cat in outcomes: + d[cat] = int(num) + return d + raise ValueError("Pytest terminal report not found") + + def assert_outcomes(self, passed=0, skipped=0, failed=0, error=0): + """Assert that the specified outcomes appear with the respective + numbers (0 means it didn't occur) in the text output from a test run. + + """ + d = self.parseoutcomes() + obtained = { + "passed": d.get("passed", 0), + "skipped": d.get("skipped", 0), + "failed": d.get("failed", 0), + "error": d.get("error", 0), + } + assert ( + obtained == dict(passed=passed, skipped=skipped, failed=failed, error=error) + ) + + +class CwdSnapshot(object): + + def __init__(self): + self.__saved = os.getcwd() + + def restore(self): + os.chdir(self.__saved) + + +class SysModulesSnapshot(object): + + def __init__(self, preserve=None): + self.__preserve = preserve + self.__saved = dict(sys.modules) + + def restore(self): + if self.__preserve: + self.__saved.update( + (k, m) for k, m in sys.modules.items() if self.__preserve(k) + ) + sys.modules.clear() + sys.modules.update(self.__saved) + + +class SysPathsSnapshot(object): + + def __init__(self): + self.__saved = list(sys.path), list(sys.meta_path) + + def restore(self): + sys.path[:], sys.meta_path[:] = self.__saved + + +class Testdir(object): + """Temporary test directory with tools to test/run pytest itself. + + This is based on the ``tmpdir`` fixture but provides a number of methods + which aid with testing pytest itself. Unless :py:meth:`chdir` is used all + methods will use :py:attr:`tmpdir` as their current working directory. + + Attributes: + + :tmpdir: The :py:class:`py.path.local` instance of the temporary directory. + + :plugins: A list of plugins to use with :py:meth:`parseconfig` and + :py:meth:`runpytest`. Initially this is an empty list but plugins can + be added to the list. The type of items to add to the list depends on + the method using them so refer to them for details. + + """ + + def __init__(self, request, tmpdir_factory): + self.request = request + self._mod_collections = WeakKeyDictionary() + name = request.function.__name__ + self.tmpdir = tmpdir_factory.mktemp(name, numbered=True) + self.plugins = [] + self._cwd_snapshot = CwdSnapshot() + self._sys_path_snapshot = SysPathsSnapshot() + self._sys_modules_snapshot = self.__take_sys_modules_snapshot() + self.chdir() + self.request.addfinalizer(self.finalize) + method = self.request.config.getoption("--runpytest") + if method == "inprocess": + self._runpytest_method = self.runpytest_inprocess + elif method == "subprocess": + self._runpytest_method = self.runpytest_subprocess + + def __repr__(self): + return "<Testdir %r>" % (self.tmpdir,) + + def finalize(self): + """Clean up global state artifacts. + + Some methods modify the global interpreter state and this tries to + clean this up. It does not remove the temporary directory however so + it can be looked at after the test run has finished. + + """ + self._sys_modules_snapshot.restore() + self._sys_path_snapshot.restore() + self._cwd_snapshot.restore() + + def __take_sys_modules_snapshot(self): + # some zope modules used by twisted-related tests keep internal state + # and can't be deleted; we had some trouble in the past with + # `zope.interface` for example + def preserve_module(name): + return name.startswith("zope") + + return SysModulesSnapshot(preserve=preserve_module) + + def make_hook_recorder(self, pluginmanager): + """Create a new :py:class:`HookRecorder` for a PluginManager.""" + assert not hasattr(pluginmanager, "reprec") + pluginmanager.reprec = reprec = HookRecorder(pluginmanager) + self.request.addfinalizer(reprec.finish_recording) + return reprec + + def chdir(self): + """Cd into the temporary directory. + + This is done automatically upon instantiation. + + """ + self.tmpdir.chdir() + + def _makefile(self, ext, args, kwargs, encoding="utf-8"): + items = list(kwargs.items()) + + def to_text(s): + return s.decode(encoding) if isinstance(s, bytes) else six.text_type(s) + + if args: + source = u"\n".join(to_text(x) for x in args) + basename = self.request.function.__name__ + items.insert(0, (basename, source)) + + ret = None + for basename, value in items: + p = self.tmpdir.join(basename).new(ext=ext) + p.dirpath().ensure_dir() + source = Source(value) + source = u"\n".join(to_text(line) for line in source.lines) + p.write(source.strip().encode(encoding), "wb") + if ret is None: + ret = p + return ret + + def makefile(self, ext, *args, **kwargs): + """Create a new file in the testdir. + + ext: The extension the file should use, including the dot, e.g. `.py`. + + args: All args will be treated as strings and joined using newlines. + The result will be written as contents to the file. The name of the + file will be based on the test function requesting this fixture. + E.g. "testdir.makefile('.txt', 'line1', 'line2')" + + kwargs: Each keyword is the name of a file, while the value of it will + be written as contents of the file. + E.g. "testdir.makefile('.ini', pytest='[pytest]\naddopts=-rs\n')" + + """ + return self._makefile(ext, args, kwargs) + + def makeconftest(self, source): + """Write a contest.py file with 'source' as contents.""" + return self.makepyfile(conftest=source) + + def makeini(self, source): + """Write a tox.ini file with 'source' as contents.""" + return self.makefile(".ini", tox=source) + + def getinicfg(self, source): + """Return the pytest section from the tox.ini config file.""" + p = self.makeini(source) + return py.iniconfig.IniConfig(p)["pytest"] + + def makepyfile(self, *args, **kwargs): + """Shortcut for .makefile() with a .py extension.""" + return self._makefile(".py", args, kwargs) + + def maketxtfile(self, *args, **kwargs): + """Shortcut for .makefile() with a .txt extension.""" + return self._makefile(".txt", args, kwargs) + + def syspathinsert(self, path=None): + """Prepend a directory to sys.path, defaults to :py:attr:`tmpdir`. + + This is undone automatically when this object dies at the end of each + test. + + """ + if path is None: + path = self.tmpdir + sys.path.insert(0, str(path)) + # a call to syspathinsert() usually means that the caller wants to + # import some dynamically created files, thus with python3 we + # invalidate its import caches + self._possibly_invalidate_import_caches() + + def _possibly_invalidate_import_caches(self): + # invalidate caches if we can (py33 and above) + try: + import importlib + except ImportError: + pass + else: + if hasattr(importlib, "invalidate_caches"): + importlib.invalidate_caches() + + def mkdir(self, name): + """Create a new (sub)directory.""" + return self.tmpdir.mkdir(name) + + def mkpydir(self, name): + """Create a new python package. + + This creates a (sub)directory with an empty ``__init__.py`` file so it + gets recognised as a python package. + + """ + p = self.mkdir(name) + p.ensure("__init__.py") + return p + + Session = Session + + def getnode(self, config, arg): + """Return the collection node of a file. + + :param config: :py:class:`_pytest.config.Config` instance, see + :py:meth:`parseconfig` and :py:meth:`parseconfigure` to create the + configuration + + :param arg: a :py:class:`py.path.local` instance of the file + + """ + session = Session(config) + assert "::" not in str(arg) + p = py.path.local(arg) + config.hook.pytest_sessionstart(session=session) + res = session.perform_collect([str(p)], genitems=False)[0] + config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK) + return res + + def getpathnode(self, path): + """Return the collection node of a file. + + This is like :py:meth:`getnode` but uses :py:meth:`parseconfigure` to + create the (configured) pytest Config instance. + + :param path: a :py:class:`py.path.local` instance of the file + + """ + config = self.parseconfigure(path) + session = Session(config) + x = session.fspath.bestrelpath(path) + config.hook.pytest_sessionstart(session=session) + res = session.perform_collect([x], genitems=False)[0] + config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK) + return res + + def genitems(self, colitems): + """Generate all test items from a collection node. + + This recurses into the collection node and returns a list of all the + test items contained within. + + """ + session = colitems[0].session + result = [] + for colitem in colitems: + result.extend(session.genitems(colitem)) + return result + + def runitem(self, source): + """Run the "test_func" Item. + + The calling test instance (class containing the test method) must + provide a ``.getrunner()`` method which should return a runner which + can run the test protocol for a single item, e.g. + :py:func:`_pytest.runner.runtestprotocol`. + + """ + # used from runner functional tests + item = self.getitem(source) + # the test class where we are called from wants to provide the runner + testclassinstance = self.request.instance + runner = testclassinstance.getrunner() + return runner(item) + + def inline_runsource(self, source, *cmdlineargs): + """Run a test module in process using ``pytest.main()``. + + This run writes "source" into a temporary file and runs + ``pytest.main()`` on it, returning a :py:class:`HookRecorder` instance + for the result. + + :param source: the source code of the test module + + :param cmdlineargs: any extra command line arguments to use + + :return: :py:class:`HookRecorder` instance of the result + + """ + p = self.makepyfile(source) + values = list(cmdlineargs) + [p] + return self.inline_run(*values) + + def inline_genitems(self, *args): + """Run ``pytest.main(['--collectonly'])`` in-process. + + Runs the :py:func:`pytest.main` function to run all of pytest inside + the test process itself like :py:meth:`inline_run`, but returns a + tuple of the collected items and a :py:class:`HookRecorder` instance. + + """ + rec = self.inline_run("--collect-only", *args) + items = [x.item for x in rec.getcalls("pytest_itemcollected")] + return items, rec + + def inline_run(self, *args, **kwargs): + """Run ``pytest.main()`` in-process, returning a HookRecorder. + + Runs the :py:func:`pytest.main` function to run all of pytest inside + the test process itself. This means it can return a + :py:class:`HookRecorder` instance which gives more detailed results + from that run than can be done by matching stdout/stderr from + :py:meth:`runpytest`. + + :param args: command line arguments to pass to :py:func:`pytest.main` + + :param plugin: (keyword-only) extra plugin instances the + ``pytest.main()`` instance should use + + :return: a :py:class:`HookRecorder` instance + + """ + finalizers = [] + try: + # When running pytest inline any plugins active in the main test + # process are already imported. So this disables the warning which + # will trigger to say they can no longer be rewritten, which is + # fine as they have already been rewritten. + orig_warn = AssertionRewritingHook._warn_already_imported + + def revert_warn_already_imported(): + AssertionRewritingHook._warn_already_imported = orig_warn + + finalizers.append(revert_warn_already_imported) + AssertionRewritingHook._warn_already_imported = lambda *a: None + + # Any sys.module or sys.path changes done while running pytest + # inline should be reverted after the test run completes to avoid + # clashing with later inline tests run within the same pytest test, + # e.g. just because they use matching test module names. + finalizers.append(self.__take_sys_modules_snapshot().restore) + finalizers.append(SysPathsSnapshot().restore) + + # Important note: + # - our tests should not leave any other references/registrations + # laying around other than possibly loaded test modules + # referenced from sys.modules, as nothing will clean those up + # automatically + + rec = [] + + class Collect(object): + + def pytest_configure(x, config): + rec.append(self.make_hook_recorder(config.pluginmanager)) + + plugins = kwargs.get("plugins") or [] + plugins.append(Collect()) + ret = pytest.main(list(args), plugins=plugins) + if len(rec) == 1: + reprec = rec.pop() + else: + + class reprec(object): + pass + + reprec.ret = ret + + # typically we reraise keyboard interrupts from the child run + # because it's our user requesting interruption of the testing + if ret == 2 and not kwargs.get("no_reraise_ctrlc"): + calls = reprec.getcalls("pytest_keyboard_interrupt") + if calls and calls[-1].excinfo.type == KeyboardInterrupt: + raise KeyboardInterrupt() + return reprec + finally: + for finalizer in finalizers: + finalizer() + + def runpytest_inprocess(self, *args, **kwargs): + """Return result of running pytest in-process, providing a similar + interface to what self.runpytest() provides. + + """ + if kwargs.get("syspathinsert"): + self.syspathinsert() + now = time.time() + capture = MultiCapture(Capture=SysCapture) + capture.start_capturing() + try: + try: + reprec = self.inline_run(*args, **kwargs) + except SystemExit as e: + + class reprec(object): + ret = e.args[0] + + except Exception: + traceback.print_exc() + + class reprec(object): + ret = 3 + + finally: + out, err = capture.readouterr() + capture.stop_capturing() + sys.stdout.write(out) + sys.stderr.write(err) + + res = RunResult(reprec.ret, out.split("\n"), err.split("\n"), time.time() - now) + res.reprec = reprec + return res + + def runpytest(self, *args, **kwargs): + """Run pytest inline or in a subprocess, depending on the command line + option "--runpytest" and return a :py:class:`RunResult`. + + """ + args = self._ensure_basetemp(args) + return self._runpytest_method(*args, **kwargs) + + def _ensure_basetemp(self, args): + args = [str(x) for x in args] + for x in args: + if str(x).startswith("--basetemp"): + # print("basedtemp exists: %s" %(args,)) + break + else: + args.append("--basetemp=%s" % self.tmpdir.dirpath("basetemp")) + # print("added basetemp: %s" %(args,)) + return args + + def parseconfig(self, *args): + """Return a new pytest Config instance from given commandline args. + + This invokes the pytest bootstrapping code in _pytest.config to create + a new :py:class:`_pytest.core.PluginManager` and call the + pytest_cmdline_parse hook to create a new + :py:class:`_pytest.config.Config` instance. + + If :py:attr:`plugins` has been populated they should be plugin modules + to be registered with the PluginManager. + + """ + args = self._ensure_basetemp(args) + + import _pytest.config + + config = _pytest.config._prepareconfig(args, self.plugins) + # we don't know what the test will do with this half-setup config + # object and thus we make sure it gets unconfigured properly in any + # case (otherwise capturing could still be active, for example) + self.request.addfinalizer(config._ensure_unconfigure) + return config + + def parseconfigure(self, *args): + """Return a new pytest configured Config instance. + + This returns a new :py:class:`_pytest.config.Config` instance like + :py:meth:`parseconfig`, but also calls the pytest_configure hook. + + """ + config = self.parseconfig(*args) + config._do_configure() + self.request.addfinalizer(config._ensure_unconfigure) + return config + + def getitem(self, source, funcname="test_func"): + """Return the test item for a test function. + + This writes the source to a python file and runs pytest's collection on + the resulting module, returning the test item for the requested + function name. + + :param source: the module source + + :param funcname: the name of the test function for which to return a + test item + + """ + items = self.getitems(source) + for item in items: + if item.name == funcname: + return item + assert 0, ( + "%r item not found in module:\n%s\nitems: %s" % (funcname, source, items) + ) + + def getitems(self, source): + """Return all test items collected from the module. + + This writes the source to a python file and runs pytest's collection on + the resulting module, returning all test items contained within. + + """ + modcol = self.getmodulecol(source) + return self.genitems([modcol]) + + def getmodulecol(self, source, configargs=(), withinit=False): + """Return the module collection node for ``source``. + + This writes ``source`` to a file using :py:meth:`makepyfile` and then + runs the pytest collection on it, returning the collection node for the + test module. + + :param source: the source code of the module to collect + + :param configargs: any extra arguments to pass to + :py:meth:`parseconfigure` + + :param withinit: whether to also write an ``__init__.py`` file to the + same directory to ensure it is a package + + """ + kw = {self.request.function.__name__: Source(source).strip()} + path = self.makepyfile(**kw) + if withinit: + self.makepyfile(__init__="#") + self.config = config = self.parseconfigure(path, *configargs) + node = self.getnode(config, path) + + return node + + def collect_by_name(self, modcol, name): + """Return the collection node for name from the module collection. + + This will search a module collection node for a collection node + matching the given name. + + :param modcol: a module collection node; see :py:meth:`getmodulecol` + + :param name: the name of the node to return + + """ + if modcol not in self._mod_collections: + self._mod_collections[modcol] = list(modcol.collect()) + for colitem in self._mod_collections[modcol]: + if colitem.name == name: + return colitem + + def popen(self, cmdargs, stdout, stderr, **kw): + """Invoke subprocess.Popen. + + This calls subprocess.Popen making sure the current working directory + is in the PYTHONPATH. + + You probably want to use :py:meth:`run` instead. + + """ + env = os.environ.copy() + env["PYTHONPATH"] = os.pathsep.join( + filter(None, [str(os.getcwd()), env.get("PYTHONPATH", "")]) + ) + kw["env"] = env + + popen = subprocess.Popen( + cmdargs, stdin=subprocess.PIPE, stdout=stdout, stderr=stderr, **kw + ) + popen.stdin.close() + + return popen + + def run(self, *cmdargs): + """Run a command with arguments. + + Run a process using subprocess.Popen saving the stdout and stderr. + + Returns a :py:class:`RunResult`. + + """ + return self._run(*cmdargs) + + def _run(self, *cmdargs): + cmdargs = [str(x) for x in cmdargs] + p1 = self.tmpdir.join("stdout") + p2 = self.tmpdir.join("stderr") + print("running:", " ".join(cmdargs)) + print(" in:", str(py.path.local())) + f1 = codecs.open(str(p1), "w", encoding="utf8") + f2 = codecs.open(str(p2), "w", encoding="utf8") + try: + now = time.time() + popen = self.popen( + cmdargs, stdout=f1, stderr=f2, close_fds=(sys.platform != "win32") + ) + ret = popen.wait() + finally: + f1.close() + f2.close() + f1 = codecs.open(str(p1), "r", encoding="utf8") + f2 = codecs.open(str(p2), "r", encoding="utf8") + try: + out = f1.read().splitlines() + err = f2.read().splitlines() + finally: + f1.close() + f2.close() + self._dump_lines(out, sys.stdout) + self._dump_lines(err, sys.stderr) + return RunResult(ret, out, err, time.time() - now) + + def _dump_lines(self, lines, fp): + try: + for line in lines: + print(line, file=fp) + except UnicodeEncodeError: + print("couldn't print to %s because of encoding" % (fp,)) + + def _getpytestargs(self): + # we cannot use `(sys.executable, script)` because on Windows the + # script is e.g. `pytest.exe` + return (sys.executable, PYTEST_FULLPATH) # noqa + + def runpython(self, script): + """Run a python script using sys.executable as interpreter. + + Returns a :py:class:`RunResult`. + + """ + return self.run(sys.executable, script) + + def runpython_c(self, command): + """Run python -c "command", return a :py:class:`RunResult`.""" + return self.run(sys.executable, "-c", command) + + def runpytest_subprocess(self, *args, **kwargs): + """Run pytest as a subprocess with given arguments. + + Any plugins added to the :py:attr:`plugins` list will added using the + ``-p`` command line option. Additionally ``--basetemp`` is used put + any temporary files and directories in a numbered directory prefixed + with "runpytest-" so they do not conflict with the normal numbered + pytest location for temporary files and directories. + + Returns a :py:class:`RunResult`. + + """ + p = py.path.local.make_numbered_dir( + prefix="runpytest-", keep=None, rootdir=self.tmpdir + ) + args = ("--basetemp=%s" % p,) + args + plugins = [x for x in self.plugins if isinstance(x, str)] + if plugins: + args = ("-p", plugins[0]) + args + args = self._getpytestargs() + args + return self.run(*args) + + def spawn_pytest(self, string, expect_timeout=10.0): + """Run pytest using pexpect. + + This makes sure to use the right pytest and sets up the temporary + directory locations. + + The pexpect child is returned. + + """ + basetemp = self.tmpdir.mkdir("temp-pexpect") + invoke = " ".join(map(str, self._getpytestargs())) + cmd = "%s --basetemp=%s %s" % (invoke, basetemp, string) + return self.spawn(cmd, expect_timeout=expect_timeout) + + def spawn(self, cmd, expect_timeout=10.0): + """Run a command using pexpect. + + The pexpect child is returned. + + """ + pexpect = pytest.importorskip("pexpect", "3.0") + if hasattr(sys, "pypy_version_info") and "64" in platform.machine(): + pytest.skip("pypy-64 bit not supported") + if sys.platform.startswith("freebsd"): + pytest.xfail("pexpect does not work reliably on freebsd") + logfile = self.tmpdir.join("spawn.out").open("wb") + child = pexpect.spawn(cmd, logfile=logfile) + self.request.addfinalizer(logfile.close) + child.timeout = expect_timeout + return child + + +def getdecoded(out): + try: + return out.decode("utf-8") + except UnicodeDecodeError: + return "INTERNAL not-utf8-decodeable, truncated string:\n%s" % ( + py.io.saferepr(out), + ) + + +class LineComp(object): + + def __init__(self): + self.stringio = py.io.TextIO() + + def assert_contains_lines(self, lines2): + """Assert that lines2 are contained (linearly) in lines1. + + Return a list of extralines found. + + """ + __tracebackhide__ = True + val = self.stringio.getvalue() + self.stringio.truncate(0) + self.stringio.seek(0) + lines1 = val.split("\n") + return LineMatcher(lines1).fnmatch_lines(lines2) + + +class LineMatcher(object): + """Flexible matching of text. + + This is a convenience class to test large texts like the output of + commands. + + The constructor takes a list of lines without their trailing newlines, i.e. + ``text.splitlines()``. + + """ + + def __init__(self, lines): + self.lines = lines + self._log_output = [] + + def str(self): + """Return the entire original text.""" + return "\n".join(self.lines) + + def _getlines(self, lines2): + if isinstance(lines2, str): + lines2 = Source(lines2) + if isinstance(lines2, Source): + lines2 = lines2.strip().lines + return lines2 + + def fnmatch_lines_random(self, lines2): + """Check lines exist in the output using in any order. + + Lines are checked using ``fnmatch.fnmatch``. The argument is a list of + lines which have to occur in the output, in any order. + + """ + self._match_lines_random(lines2, fnmatch) + + def re_match_lines_random(self, lines2): + """Check lines exist in the output using ``re.match``, in any order. + + The argument is a list of lines which have to occur in the output, in + any order. + + """ + self._match_lines_random(lines2, lambda name, pat: re.match(pat, name)) + + def _match_lines_random(self, lines2, match_func): + """Check lines exist in the output. + + The argument is a list of lines which have to occur in the output, in + any order. Each line can contain glob whildcards. + + """ + lines2 = self._getlines(lines2) + for line in lines2: + for x in self.lines: + if line == x or match_func(x, line): + self._log("matched: ", repr(line)) + break + else: + self._log("line %r not found in output" % line) + raise ValueError(self._log_text) + + def get_lines_after(self, fnline): + """Return all lines following the given line in the text. + + The given line can contain glob wildcards. + + """ + for i, line in enumerate(self.lines): + if fnline == line or fnmatch(line, fnline): + return self.lines[i + 1:] + raise ValueError("line %r not found in output" % fnline) + + def _log(self, *args): + self._log_output.append(" ".join((str(x) for x in args))) + + @property + def _log_text(self): + return "\n".join(self._log_output) + + def fnmatch_lines(self, lines2): + """Search captured text for matching lines using ``fnmatch.fnmatch``. + + The argument is a list of lines which have to match and can use glob + wildcards. If they do not match a pytest.fail() is called. The + matches and non-matches are also printed on stdout. + + """ + self._match_lines(lines2, fnmatch, "fnmatch") + + def re_match_lines(self, lines2): + """Search captured text for matching lines using ``re.match``. + + The argument is a list of lines which have to match using ``re.match``. + If they do not match a pytest.fail() is called. + + The matches and non-matches are also printed on stdout. + + """ + self._match_lines(lines2, lambda name, pat: re.match(pat, name), "re.match") + + def _match_lines(self, lines2, match_func, match_nickname): + """Underlying implementation of ``fnmatch_lines`` and ``re_match_lines``. + + :param list[str] lines2: list of string patterns to match. The actual + format depends on ``match_func`` + :param match_func: a callable ``match_func(line, pattern)`` where line + is the captured line from stdout/stderr and pattern is the matching + pattern + :param str match_nickname: the nickname for the match function that + will be logged to stdout when a match occurs + + """ + lines2 = self._getlines(lines2) + lines1 = self.lines[:] + nextline = None + extralines = [] + __tracebackhide__ = True + for line in lines2: + nomatchprinted = False + while lines1: + nextline = lines1.pop(0) + if line == nextline: + self._log("exact match:", repr(line)) + break + elif match_func(nextline, line): + self._log("%s:" % match_nickname, repr(line)) + self._log(" with:", repr(nextline)) + break + else: + if not nomatchprinted: + self._log("nomatch:", repr(line)) + nomatchprinted = True + self._log(" and:", repr(nextline)) + extralines.append(nextline) + else: + self._log("remains unmatched: %r" % (line,)) + pytest.fail(self._log_text) diff --git a/third_party/python/pytest/src/_pytest/python.py b/third_party/python/pytest/src/_pytest/python.py new file mode 100644 index 0000000000..48516199ff --- /dev/null +++ b/third_party/python/pytest/src/_pytest/python.py @@ -0,0 +1,1331 @@ +""" Python test discovery, setup and run of test functions. """ +from __future__ import absolute_import, division, print_function + +import fnmatch +import inspect +import sys +import os +import collections +import warnings +from textwrap import dedent +from itertools import count + + +import py +import six +from _pytest.mark import MarkerError +from _pytest.config import hookimpl + +import _pytest +import pluggy +from _pytest import fixtures +from _pytest import nodes +from _pytest import deprecated +from _pytest.compat import ( + isclass, + isfunction, + is_generator, + ascii_escaped, + REGEX_TYPE, + STRING_TYPES, + NoneType, + NOTSET, + get_real_func, + getfslineno, + safe_getattr, + safe_str, + getlocation, + enum, + get_default_arg_names, +) +from _pytest.outcomes import fail +from _pytest.mark.structures import transfer_markers, get_unpacked_marks + + +# relative paths that we use to filter traceback entries from appearing to the user; +# see filter_traceback +# note: if we need to add more paths than what we have now we should probably use a list +# for better maintenance +_pluggy_dir = py.path.local(pluggy.__file__.rstrip("oc")) +# pluggy is either a package or a single module depending on the version +if _pluggy_dir.basename == "__init__.py": + _pluggy_dir = _pluggy_dir.dirpath() +_pytest_dir = py.path.local(_pytest.__file__).dirpath() +_py_dir = py.path.local(py.__file__).dirpath() + + +def filter_traceback(entry): + """Return True if a TracebackEntry instance should be removed from tracebacks: + * dynamically generated code (no code to show up for it); + * internal traceback from pytest or its internal libraries, py and pluggy. + """ + # entry.path might sometimes return a str object when the entry + # points to dynamically generated code + # see https://bitbucket.org/pytest-dev/py/issues/71 + raw_filename = entry.frame.code.raw.co_filename + is_generated = "<" in raw_filename and ">" in raw_filename + if is_generated: + return False + # entry.path might point to a non-existing file, in which case it will + # also return a str object. see #1133 + p = py.path.local(entry.path) + return not p.relto(_pluggy_dir) and not p.relto(_pytest_dir) and not p.relto( + _py_dir + ) + + +def pyobj_property(name): + + def get(self): + node = self.getparent(getattr(__import__("pytest"), name)) + if node is not None: + return node.obj + + doc = "python %s object this node was collected from (can be None)." % ( + name.lower(), + ) + return property(get, None, None, doc) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--fixtures", + "--funcargs", + action="store_true", + dest="showfixtures", + default=False, + help="show available fixtures, sorted by plugin appearance " + "(fixtures with leading '_' are only shown with '-v')", + ) + group.addoption( + "--fixtures-per-test", + action="store_true", + dest="show_fixtures_per_test", + default=False, + help="show fixtures per test", + ) + parser.addini( + "usefixtures", + type="args", + default=[], + help="list of default fixtures to be used with this project", + ) + parser.addini( + "python_files", + type="args", + default=["test_*.py", "*_test.py"], + help="glob-style file patterns for Python test module discovery", + ) + parser.addini( + "python_classes", + type="args", + default=["Test"], + help="prefixes or glob names for Python test class discovery", + ) + parser.addini( + "python_functions", + type="args", + default=["test"], + help="prefixes or glob names for Python test function and " "method discovery", + ) + + group.addoption( + "--import-mode", + default="prepend", + choices=["prepend", "append"], + dest="importmode", + help="prepend/append to sys.path when importing test modules, " + "default is to prepend.", + ) + + +def pytest_cmdline_main(config): + if config.option.showfixtures: + showfixtures(config) + return 0 + if config.option.show_fixtures_per_test: + show_fixtures_per_test(config) + return 0 + + +def pytest_generate_tests(metafunc): + # those alternative spellings are common - raise a specific error to alert + # the user + alt_spellings = ["parameterize", "parametrise", "parameterise"] + for attr in alt_spellings: + if hasattr(metafunc.function, attr): + msg = "{0} has '{1}', spelling should be 'parametrize'" + raise MarkerError(msg.format(metafunc.function.__name__, attr)) + for marker in metafunc.definition.iter_markers(name="parametrize"): + metafunc.parametrize(*marker.args, **marker.kwargs) + + +def pytest_configure(config): + config.addinivalue_line( + "markers", + "parametrize(argnames, argvalues): call a test function multiple " + "times passing in different arguments in turn. argvalues generally " + "needs to be a list of values if argnames specifies only one name " + "or a list of tuples of values if argnames specifies multiple names. " + "Example: @parametrize('arg1', [1,2]) would lead to two calls of the " + "decorated test function, one with arg1=1 and another with arg1=2." + "see http://pytest.org/latest/parametrize.html for more info and " + "examples.", + ) + config.addinivalue_line( + "markers", + "usefixtures(fixturename1, fixturename2, ...): mark tests as needing " + "all of the specified fixtures. see http://pytest.org/latest/fixture.html#usefixtures ", + ) + + +@hookimpl(trylast=True) +def pytest_pyfunc_call(pyfuncitem): + testfunction = pyfuncitem.obj + if pyfuncitem._isyieldedfunction(): + testfunction(*pyfuncitem._args) + else: + funcargs = pyfuncitem.funcargs + testargs = {} + for arg in pyfuncitem._fixtureinfo.argnames: + testargs[arg] = funcargs[arg] + testfunction(**testargs) + return True + + +def pytest_collect_file(path, parent): + ext = path.ext + if ext == ".py": + if not parent.session.isinitpath(path): + for pat in parent.config.getini("python_files"): + if path.fnmatch(pat): + break + else: + return + ihook = parent.session.gethookproxy(path) + return ihook.pytest_pycollect_makemodule(path=path, parent=parent) + + +def pytest_pycollect_makemodule(path, parent): + return Module(path, parent) + + +@hookimpl(hookwrapper=True) +def pytest_pycollect_makeitem(collector, name, obj): + outcome = yield + res = outcome.get_result() + if res is not None: + return + # nothing was collected elsewhere, let's do it here + if isclass(obj): + if collector.istestclass(obj, name): + Class = collector._getcustomclass("Class") + outcome.force_result(Class(name, parent=collector)) + elif collector.istestfunction(obj, name): + # mock seems to store unbound methods (issue473), normalize it + obj = getattr(obj, "__func__", obj) + # We need to try and unwrap the function if it's a functools.partial + # or a funtools.wrapped. + # We musn't if it's been wrapped with mock.patch (python 2 only) + if not (isfunction(obj) or isfunction(get_real_func(obj))): + collector.warn( + code="C2", + message="cannot collect %r because it is not a function." % name, + ) + elif getattr(obj, "__test__", True): + if is_generator(obj): + res = Generator(name, parent=collector) + else: + res = list(collector._genfunctions(name, obj)) + outcome.force_result(res) + + +def pytest_make_parametrize_id(config, val, argname=None): + return None + + +class PyobjContext(object): + module = pyobj_property("Module") + cls = pyobj_property("Class") + instance = pyobj_property("Instance") + + +class PyobjMixin(PyobjContext): + _ALLOW_MARKERS = True + + def __init__(self, *k, **kw): + super(PyobjMixin, self).__init__(*k, **kw) + + def obj(): + + def fget(self): + obj = getattr(self, "_obj", None) + if obj is None: + self._obj = obj = self._getobj() + # XXX evil hack + # used to avoid Instance collector marker duplication + if self._ALLOW_MARKERS: + self.own_markers.extend(get_unpacked_marks(self.obj)) + return obj + + def fset(self, value): + self._obj = value + + return property(fget, fset, None, "underlying python object") + + obj = obj() + + def _getobj(self): + return getattr(self.parent.obj, self.name) + + def getmodpath(self, stopatmodule=True, includemodule=False): + """ return python path relative to the containing module. """ + chain = self.listchain() + chain.reverse() + parts = [] + for node in chain: + if isinstance(node, Instance): + continue + name = node.name + if isinstance(node, Module): + name = os.path.splitext(name)[0] + if stopatmodule: + if includemodule: + parts.append(name) + break + parts.append(name) + parts.reverse() + s = ".".join(parts) + return s.replace(".[", "[") + + def _getfslineno(self): + return getfslineno(self.obj) + + def reportinfo(self): + # XXX caching? + obj = self.obj + compat_co_firstlineno = getattr(obj, "compat_co_firstlineno", None) + if isinstance(compat_co_firstlineno, int): + # nose compatibility + fspath = sys.modules[obj.__module__].__file__ + if fspath.endswith(".pyc"): + fspath = fspath[:-1] + lineno = compat_co_firstlineno + else: + fspath, lineno = getfslineno(obj) + modpath = self.getmodpath() + assert isinstance(lineno, int) + return fspath, lineno, modpath + + +class PyCollector(PyobjMixin, nodes.Collector): + + def funcnamefilter(self, name): + return self._matches_prefix_or_glob_option("python_functions", name) + + def isnosetest(self, obj): + """ Look for the __test__ attribute, which is applied by the + @nose.tools.istest decorator + """ + # We explicitly check for "is True" here to not mistakenly treat + # classes with a custom __getattr__ returning something truthy (like a + # function) as test classes. + return safe_getattr(obj, "__test__", False) is True + + def classnamefilter(self, name): + return self._matches_prefix_or_glob_option("python_classes", name) + + def istestfunction(self, obj, name): + if self.funcnamefilter(name) or self.isnosetest(obj): + if isinstance(obj, staticmethod): + # static methods need to be unwrapped + obj = safe_getattr(obj, "__func__", False) + if obj is False: + # Python 2.6 wraps in a different way that we won't try to handle + msg = "cannot collect static method %r because it is not a function" + self.warn(code="C2", message=msg % name) + return False + return ( + safe_getattr(obj, "__call__", False) + and fixtures.getfixturemarker(obj) is None + ) + else: + return False + + def istestclass(self, obj, name): + return self.classnamefilter(name) or self.isnosetest(obj) + + def _matches_prefix_or_glob_option(self, option_name, name): + """ + checks if the given name matches the prefix or glob-pattern defined + in ini configuration. + """ + for option in self.config.getini(option_name): + if name.startswith(option): + return True + # check that name looks like a glob-string before calling fnmatch + # because this is called for every name in each collected module, + # and fnmatch is somewhat expensive to call + elif ("*" in option or "?" in option or "[" in option) and fnmatch.fnmatch( + name, option + ): + return True + return False + + def collect(self): + if not getattr(self.obj, "__test__", True): + return [] + + # NB. we avoid random getattrs and peek in the __dict__ instead + # (XXX originally introduced from a PyPy need, still true?) + dicts = [getattr(self.obj, "__dict__", {})] + for basecls in inspect.getmro(self.obj.__class__): + dicts.append(basecls.__dict__) + seen = {} + values = [] + for dic in dicts: + for name, obj in list(dic.items()): + if name in seen: + continue + seen[name] = True + res = self._makeitem(name, obj) + if res is None: + continue + if not isinstance(res, list): + res = [res] + values.extend(res) + values.sort(key=lambda item: item.reportinfo()[:2]) + return values + + def makeitem(self, name, obj): + warnings.warn(deprecated.COLLECTOR_MAKEITEM, stacklevel=2) + self._makeitem(name, obj) + + def _makeitem(self, name, obj): + # assert self.ihook.fspath == self.fspath, self + return self.ihook.pytest_pycollect_makeitem(collector=self, name=name, obj=obj) + + def _genfunctions(self, name, funcobj): + module = self.getparent(Module).obj + clscol = self.getparent(Class) + cls = clscol and clscol.obj or None + transfer_markers(funcobj, cls, module) + fm = self.session._fixturemanager + + definition = FunctionDefinition(name=name, parent=self, callobj=funcobj) + fixtureinfo = fm.getfixtureinfo(definition, funcobj, cls) + + metafunc = Metafunc( + definition, fixtureinfo, self.config, cls=cls, module=module + ) + methods = [] + if hasattr(module, "pytest_generate_tests"): + methods.append(module.pytest_generate_tests) + if hasattr(cls, "pytest_generate_tests"): + methods.append(cls().pytest_generate_tests) + if methods: + self.ihook.pytest_generate_tests.call_extra( + methods, dict(metafunc=metafunc) + ) + else: + self.ihook.pytest_generate_tests(metafunc=metafunc) + + Function = self._getcustomclass("Function") + if not metafunc._calls: + yield Function(name, parent=self, fixtureinfo=fixtureinfo) + else: + # add funcargs() as fixturedefs to fixtureinfo.arg2fixturedefs + fixtures.add_funcarg_pseudo_fixture_def(self, metafunc, fm) + + for callspec in metafunc._calls: + subname = "%s[%s]" % (name, callspec.id) + yield Function( + name=subname, + parent=self, + callspec=callspec, + callobj=funcobj, + fixtureinfo=fixtureinfo, + keywords={callspec.id: True}, + originalname=name, + ) + + +class Module(nodes.File, PyCollector): + """ Collector for test classes and functions. """ + + def _getobj(self): + return self._importtestmodule() + + def collect(self): + self.session._fixturemanager.parsefactories(self) + return super(Module, self).collect() + + def _importtestmodule(self): + # we assume we are only called once per module + importmode = self.config.getoption("--import-mode") + try: + mod = self.fspath.pyimport(ensuresyspath=importmode) + except SyntaxError: + raise self.CollectError( + _pytest._code.ExceptionInfo().getrepr(style="short") + ) + except self.fspath.ImportMismatchError: + e = sys.exc_info()[1] + raise self.CollectError( + "import file mismatch:\n" + "imported module %r has this __file__ attribute:\n" + " %s\n" + "which is not the same as the test file we want to collect:\n" + " %s\n" + "HINT: remove __pycache__ / .pyc files and/or use a " + "unique basename for your test file modules" % e.args + ) + except ImportError: + from _pytest._code.code import ExceptionInfo + + exc_info = ExceptionInfo() + if self.config.getoption("verbose") < 2: + exc_info.traceback = exc_info.traceback.filter(filter_traceback) + exc_repr = exc_info.getrepr( + style="short" + ) if exc_info.traceback else exc_info.exconly() + formatted_tb = safe_str(exc_repr) + raise self.CollectError( + "ImportError while importing test module '{fspath}'.\n" + "Hint: make sure your test modules/packages have valid Python names.\n" + "Traceback:\n" + "{traceback}".format(fspath=self.fspath, traceback=formatted_tb) + ) + except _pytest.runner.Skipped as e: + if e.allow_module_level: + raise + raise self.CollectError( + "Using pytest.skip outside of a test is not allowed. " + "To decorate a test function, use the @pytest.mark.skip " + "or @pytest.mark.skipif decorators instead, and to skip a " + "module use `pytestmark = pytest.mark.{skip,skipif}." + ) + self.config.pluginmanager.consider_module(mod) + return mod + + def setup(self): + setup_module = _get_xunit_setup_teardown(self.obj, "setUpModule") + if setup_module is None: + setup_module = _get_xunit_setup_teardown(self.obj, "setup_module") + if setup_module is not None: + setup_module() + + teardown_module = _get_xunit_setup_teardown(self.obj, "tearDownModule") + if teardown_module is None: + teardown_module = _get_xunit_setup_teardown(self.obj, "teardown_module") + if teardown_module is not None: + self.addfinalizer(teardown_module) + + +def _get_xunit_setup_teardown(holder, attr_name, param_obj=None): + """ + Return a callable to perform xunit-style setup or teardown if + the function exists in the ``holder`` object. + The ``param_obj`` parameter is the parameter which will be passed to the function + when the callable is called without arguments, defaults to the ``holder`` object. + Return ``None`` if a suitable callable is not found. + """ + param_obj = param_obj if param_obj is not None else holder + result = _get_xunit_func(holder, attr_name) + if result is not None: + arg_count = result.__code__.co_argcount + if inspect.ismethod(result): + arg_count -= 1 + if arg_count: + return lambda: result(param_obj) + else: + return result + + +def _get_xunit_func(obj, name): + """Return the attribute from the given object to be used as a setup/teardown + xunit-style function, but only if not marked as a fixture to + avoid calling it twice. + """ + meth = getattr(obj, name, None) + if fixtures.getfixturemarker(meth) is None: + return meth + + +class Class(PyCollector): + """ Collector for test methods. """ + + def collect(self): + if not safe_getattr(self.obj, "__test__", True): + return [] + if hasinit(self.obj): + self.warn( + "C1", + "cannot collect test class %r because it has a " + "__init__ constructor" % self.obj.__name__, + ) + return [] + elif hasnew(self.obj): + self.warn( + "C1", + "cannot collect test class %r because it has a " + "__new__ constructor" % self.obj.__name__, + ) + return [] + return [self._getcustomclass("Instance")(name="()", parent=self)] + + def setup(self): + setup_class = _get_xunit_func(self.obj, "setup_class") + if setup_class is not None: + setup_class = getattr(setup_class, "im_func", setup_class) + setup_class = getattr(setup_class, "__func__", setup_class) + setup_class(self.obj) + + fin_class = getattr(self.obj, "teardown_class", None) + if fin_class is not None: + fin_class = getattr(fin_class, "im_func", fin_class) + fin_class = getattr(fin_class, "__func__", fin_class) + self.addfinalizer(lambda: fin_class(self.obj)) + + +class Instance(PyCollector): + _ALLOW_MARKERS = False # hack, destroy later + # instances share the object with their parents in a way + # that duplicates markers instances if not taken out + # can be removed at node strucutre reorganization time + + def _getobj(self): + return self.parent.obj() + + def collect(self): + self.session._fixturemanager.parsefactories(self) + return super(Instance, self).collect() + + def newinstance(self): + self.obj = self._getobj() + return self.obj + + +class FunctionMixin(PyobjMixin): + """ mixin for the code common to Function and Generator. + """ + + def setup(self): + """ perform setup for this test function. """ + if hasattr(self, "_preservedparent"): + obj = self._preservedparent + elif isinstance(self.parent, Instance): + obj = self.parent.newinstance() + self.obj = self._getobj() + else: + obj = self.parent.obj + if inspect.ismethod(self.obj): + setup_name = "setup_method" + teardown_name = "teardown_method" + else: + setup_name = "setup_function" + teardown_name = "teardown_function" + setup_func_or_method = _get_xunit_setup_teardown( + obj, setup_name, param_obj=self.obj + ) + if setup_func_or_method is not None: + setup_func_or_method() + teardown_func_or_method = _get_xunit_setup_teardown( + obj, teardown_name, param_obj=self.obj + ) + if teardown_func_or_method is not None: + self.addfinalizer(teardown_func_or_method) + + def _prunetraceback(self, excinfo): + if hasattr(self, "_obj") and not self.config.option.fulltrace: + code = _pytest._code.Code(get_real_func(self.obj)) + path, firstlineno = code.path, code.firstlineno + traceback = excinfo.traceback + ntraceback = traceback.cut(path=path, firstlineno=firstlineno) + if ntraceback == traceback: + ntraceback = ntraceback.cut(path=path) + if ntraceback == traceback: + ntraceback = ntraceback.filter(filter_traceback) + if not ntraceback: + ntraceback = traceback + + excinfo.traceback = ntraceback.filter() + # issue364: mark all but first and last frames to + # only show a single-line message for each frame + if self.config.option.tbstyle == "auto": + if len(excinfo.traceback) > 2: + for entry in excinfo.traceback[1:-1]: + entry.set_repr_style("short") + + def _repr_failure_py(self, excinfo, style="long"): + if excinfo.errisinstance(fail.Exception): + if not excinfo.value.pytrace: + return py._builtin._totext(excinfo.value) + return super(FunctionMixin, self)._repr_failure_py(excinfo, style=style) + + def repr_failure(self, excinfo, outerr=None): + assert outerr is None, "XXX outerr usage is deprecated" + style = self.config.option.tbstyle + if style == "auto": + style = "long" + return self._repr_failure_py(excinfo, style=style) + + +class Generator(FunctionMixin, PyCollector): + + def collect(self): + # test generators are seen as collectors but they also + # invoke setup/teardown on popular request + # (induced by the common "test_*" naming shared with normal tests) + from _pytest import deprecated + + self.session._setupstate.prepare(self) + # see FunctionMixin.setup and test_setupstate_is_preserved_134 + self._preservedparent = self.parent.obj + values = [] + seen = {} + for i, x in enumerate(self.obj()): + name, call, args = self.getcallargs(x) + if not callable(call): + raise TypeError("%r yielded non callable test %r" % (self.obj, call)) + if name is None: + name = "[%d]" % i + else: + name = "['%s']" % name + if name in seen: + raise ValueError( + "%r generated tests with non-unique name %r" % (self, name) + ) + seen[name] = True + values.append(self.Function(name, self, args=args, callobj=call)) + self.warn("C1", deprecated.YIELD_TESTS) + return values + + def getcallargs(self, obj): + if not isinstance(obj, (tuple, list)): + obj = (obj,) + # explicit naming + if isinstance(obj[0], six.string_types): + name = obj[0] + obj = obj[1:] + else: + name = None + call, args = obj[0], obj[1:] + return name, call, args + + +def hasinit(obj): + init = getattr(obj, "__init__", None) + if init: + return init != object.__init__ + + +def hasnew(obj): + new = getattr(obj, "__new__", None) + if new: + return new != object.__new__ + + +class CallSpec2(object): + + def __init__(self, metafunc): + self.metafunc = metafunc + self.funcargs = {} + self._idlist = [] + self.params = {} + self._globalid = NOTSET + self._globalid_args = set() + self._globalparam = NOTSET + self._arg2scopenum = {} # used for sorting parametrized resources + self.marks = [] + self.indices = {} + + def copy(self, metafunc): + cs = CallSpec2(self.metafunc) + cs.funcargs.update(self.funcargs) + cs.params.update(self.params) + cs.marks.extend(self.marks) + cs.indices.update(self.indices) + cs._arg2scopenum.update(self._arg2scopenum) + cs._idlist = list(self._idlist) + cs._globalid = self._globalid + cs._globalid_args = self._globalid_args + cs._globalparam = self._globalparam + return cs + + def _checkargnotcontained(self, arg): + if arg in self.params or arg in self.funcargs: + raise ValueError("duplicate %r" % (arg,)) + + def getparam(self, name): + try: + return self.params[name] + except KeyError: + if self._globalparam is NOTSET: + raise ValueError(name) + return self._globalparam + + @property + def id(self): + return "-".join(map(str, filter(None, self._idlist))) + + def setmulti2(self, valtypes, argnames, valset, id, marks, scopenum, param_index): + for arg, val in zip(argnames, valset): + self._checkargnotcontained(arg) + valtype_for_arg = valtypes[arg] + getattr(self, valtype_for_arg)[arg] = val + self.indices[arg] = param_index + self._arg2scopenum[arg] = scopenum + self._idlist.append(id) + self.marks.extend(marks) + + def setall(self, funcargs, id, param): + for x in funcargs: + self._checkargnotcontained(x) + self.funcargs.update(funcargs) + if id is not NOTSET: + self._idlist.append(id) + if param is not NOTSET: + assert self._globalparam is NOTSET + self._globalparam = param + for arg in funcargs: + self._arg2scopenum[arg] = fixtures.scopenum_function + + +class Metafunc(fixtures.FuncargnamesCompatAttr): + """ + Metafunc objects are passed to the :func:`pytest_generate_tests <_pytest.hookspec.pytest_generate_tests>` hook. + They help to inspect a test function and to generate tests according to + test configuration or values specified in the class or module where a + test function is defined. + """ + + def __init__(self, definition, fixtureinfo, config, cls=None, module=None): + #: access to the :class:`_pytest.config.Config` object for the test session + assert ( + isinstance(definition, FunctionDefinition) + or type(definition).__name__ == "DefinitionMock" + ) + self.definition = definition + self.config = config + + #: the module object where the test function is defined in. + self.module = module + + #: underlying python test function + self.function = definition.obj + + #: set of fixture names required by the test function + self.fixturenames = fixtureinfo.names_closure + + #: class object where the test function is defined in or ``None``. + self.cls = cls + + self._calls = [] + self._ids = set() + self._arg2fixturedefs = fixtureinfo.name2fixturedefs + + def parametrize(self, argnames, argvalues, indirect=False, ids=None, scope=None): + """ Add new invocations to the underlying test function using the list + of argvalues for the given argnames. Parametrization is performed + during the collection phase. If you need to setup expensive resources + see about setting indirect to do it rather at test setup time. + + :arg argnames: a comma-separated string denoting one or more argument + names, or a list/tuple of argument strings. + + :arg argvalues: The list of argvalues determines how often a + test is invoked with different argument values. If only one + argname was specified argvalues is a list of values. If N + argnames were specified, argvalues must be a list of N-tuples, + where each tuple-element specifies a value for its respective + argname. + + :arg indirect: The list of argnames or boolean. A list of arguments' + names (subset of argnames). If True the list contains all names from + the argnames. Each argvalue corresponding to an argname in this list will + be passed as request.param to its respective argname fixture + function so that it can perform more expensive setups during the + setup phase of a test rather than at collection time. + + :arg ids: list of string ids, or a callable. + If strings, each is corresponding to the argvalues so that they are + part of the test id. If None is given as id of specific test, the + automatically generated id for that argument will be used. + If callable, it should take one argument (a single argvalue) and return + a string or return None. If None, the automatically generated id for that + argument will be used. + If no ids are provided they will be generated automatically from + the argvalues. + + :arg scope: if specified it denotes the scope of the parameters. + The scope is used for grouping tests by parameter instances. + It will also override any fixture-function defined scope, allowing + to set a dynamic scope using test context or configuration. + """ + from _pytest.fixtures import scope2index + from _pytest.mark import ParameterSet + from py.io import saferepr + + argnames, parameters = ParameterSet._for_parametrize( + argnames, argvalues, self.function, self.config + ) + del argvalues + default_arg_names = set(get_default_arg_names(self.function)) + + if scope is None: + scope = _find_parametrized_scope(argnames, self._arg2fixturedefs, indirect) + + scopenum = scope2index(scope, descr="call to {}".format(self.parametrize)) + valtypes = {} + for arg in argnames: + if arg not in self.fixturenames: + if arg in default_arg_names: + raise ValueError( + "%r already takes an argument %r with a default value" + % (self.function, arg) + ) + else: + if isinstance(indirect, (tuple, list)): + name = "fixture" if arg in indirect else "argument" + else: + name = "fixture" if indirect else "argument" + raise ValueError("%r uses no %s %r" % (self.function, name, arg)) + + if indirect is True: + valtypes = dict.fromkeys(argnames, "params") + elif indirect is False: + valtypes = dict.fromkeys(argnames, "funcargs") + elif isinstance(indirect, (tuple, list)): + valtypes = dict.fromkeys(argnames, "funcargs") + for arg in indirect: + if arg not in argnames: + raise ValueError( + "indirect given to %r: fixture %r doesn't exist" + % (self.function, arg) + ) + valtypes[arg] = "params" + idfn = None + if callable(ids): + idfn = ids + ids = None + if ids: + if len(ids) != len(parameters): + raise ValueError( + "%d tests specified with %d ids" % (len(parameters), len(ids)) + ) + for id_value in ids: + if id_value is not None and not isinstance(id_value, six.string_types): + msg = "ids must be list of strings, found: %s (type: %s)" + raise ValueError( + msg % (saferepr(id_value), type(id_value).__name__) + ) + ids = idmaker(argnames, parameters, idfn, ids, self.config) + newcalls = [] + for callspec in self._calls or [CallSpec2(self)]: + elements = zip(ids, parameters, count()) + for a_id, param, param_index in elements: + if len(param.values) != len(argnames): + raise ValueError( + 'In "parametrize" the number of values ({}) must be ' + "equal to the number of names ({})".format( + param.values, argnames + ) + ) + newcallspec = callspec.copy(self) + newcallspec.setmulti2( + valtypes, + argnames, + param.values, + a_id, + param.marks, + scopenum, + param_index, + ) + newcalls.append(newcallspec) + self._calls = newcalls + + def addcall(self, funcargs=None, id=NOTSET, param=NOTSET): + """ Add a new call to the underlying test function during the collection phase of a test run. + + .. deprecated:: 3.3 + + Use :meth:`parametrize` instead. + + Note that request.addcall() is called during the test collection phase prior and + independently to actual test execution. You should only use addcall() + if you need to specify multiple arguments of a test function. + + :arg funcargs: argument keyword dictionary used when invoking + the test function. + + :arg id: used for reporting and identification purposes. If you + don't supply an `id` an automatic unique id will be generated. + + :arg param: a parameter which will be exposed to a later fixture function + invocation through the ``request.param`` attribute. + """ + if self.config: + self.config.warn( + "C1", message=deprecated.METAFUNC_ADD_CALL, fslocation=None + ) + assert funcargs is None or isinstance(funcargs, dict) + if funcargs is not None: + for name in funcargs: + if name not in self.fixturenames: + fail("funcarg %r not used in this function." % name) + else: + funcargs = {} + if id is None: + raise ValueError("id=None not allowed") + if id is NOTSET: + id = len(self._calls) + id = str(id) + if id in self._ids: + raise ValueError("duplicate id %r" % id) + self._ids.add(id) + + cs = CallSpec2(self) + cs.setall(funcargs, id, param) + self._calls.append(cs) + + +def _find_parametrized_scope(argnames, arg2fixturedefs, indirect): + """Find the most appropriate scope for a parametrized call based on its arguments. + + When there's at least one direct argument, always use "function" scope. + + When a test function is parametrized and all its arguments are indirect + (e.g. fixtures), return the most narrow scope based on the fixtures used. + + Related to issue #1832, based on code posted by @Kingdread. + """ + from _pytest.fixtures import scopes + + indirect_as_list = isinstance(indirect, (list, tuple)) + all_arguments_are_fixtures = indirect is True or indirect_as_list and len( + indirect + ) == argnames + if all_arguments_are_fixtures: + fixturedefs = arg2fixturedefs or {} + used_scopes = [fixturedef[0].scope for name, fixturedef in fixturedefs.items()] + if used_scopes: + # Takes the most narrow scope from used fixtures + for scope in reversed(scopes): + if scope in used_scopes: + return scope + + return "function" + + +def _idval(val, argname, idx, idfn, config=None): + if idfn: + s = None + try: + s = idfn(val) + except Exception: + # See issue https://github.com/pytest-dev/pytest/issues/2169 + import warnings + + msg = "Raised while trying to determine id of parameter %s at position %d." % ( + argname, idx + ) + msg += "\nUpdate your code as this will raise an error in pytest-4.0." + warnings.warn(msg, DeprecationWarning) + if s: + return ascii_escaped(s) + + if config: + hook_id = config.hook.pytest_make_parametrize_id( + config=config, val=val, argname=argname + ) + if hook_id: + return hook_id + + if isinstance(val, STRING_TYPES): + return ascii_escaped(val) + elif isinstance(val, (float, int, bool, NoneType)): + return str(val) + elif isinstance(val, REGEX_TYPE): + return ascii_escaped(val.pattern) + elif enum is not None and isinstance(val, enum.Enum): + return str(val) + elif (isclass(val) or isfunction(val)) and hasattr(val, "__name__"): + return val.__name__ + return str(argname) + str(idx) + + +def _idvalset(idx, parameterset, argnames, idfn, ids, config=None): + if parameterset.id is not None: + return parameterset.id + if ids is None or (idx >= len(ids) or ids[idx] is None): + this_id = [ + _idval(val, argname, idx, idfn, config) + for val, argname in zip(parameterset.values, argnames) + ] + return "-".join(this_id) + else: + return ascii_escaped(ids[idx]) + + +def idmaker(argnames, parametersets, idfn=None, ids=None, config=None): + ids = [ + _idvalset(valindex, parameterset, argnames, idfn, ids, config) + for valindex, parameterset in enumerate(parametersets) + ] + if len(set(ids)) != len(ids): + # The ids are not unique + duplicates = [testid for testid in ids if ids.count(testid) > 1] + counters = collections.defaultdict(lambda: 0) + for index, testid in enumerate(ids): + if testid in duplicates: + ids[index] = testid + str(counters[testid]) + counters[testid] += 1 + return ids + + +def show_fixtures_per_test(config): + from _pytest.main import wrap_session + + return wrap_session(config, _show_fixtures_per_test) + + +def _show_fixtures_per_test(config, session): + import _pytest.config + + session.perform_collect() + curdir = py.path.local() + tw = _pytest.config.create_terminal_writer(config) + verbose = config.getvalue("verbose") + + def get_best_relpath(func): + loc = getlocation(func, curdir) + return curdir.bestrelpath(loc) + + def write_fixture(fixture_def): + argname = fixture_def.argname + if verbose <= 0 and argname.startswith("_"): + return + if verbose > 0: + bestrel = get_best_relpath(fixture_def.func) + funcargspec = "{} -- {}".format(argname, bestrel) + else: + funcargspec = argname + tw.line(funcargspec, green=True) + fixture_doc = fixture_def.func.__doc__ + if fixture_doc: + write_docstring(tw, fixture_doc) + else: + tw.line(" no docstring available", red=True) + + def write_item(item): + try: + info = item._fixtureinfo + except AttributeError: + # doctests items have no _fixtureinfo attribute + return + if not info.name2fixturedefs: + # this test item does not use any fixtures + return + tw.line() + tw.sep("-", "fixtures used by {}".format(item.name)) + tw.sep("-", "({})".format(get_best_relpath(item.function))) + # dict key not used in loop but needed for sorting + for _, fixturedefs in sorted(info.name2fixturedefs.items()): + assert fixturedefs is not None + if not fixturedefs: + continue + # last item is expected to be the one used by the test item + write_fixture(fixturedefs[-1]) + + for session_item in session.items: + write_item(session_item) + + +def showfixtures(config): + from _pytest.main import wrap_session + + return wrap_session(config, _showfixtures_main) + + +def _showfixtures_main(config, session): + import _pytest.config + + session.perform_collect() + curdir = py.path.local() + tw = _pytest.config.create_terminal_writer(config) + verbose = config.getvalue("verbose") + + fm = session._fixturemanager + + available = [] + seen = set() + + for argname, fixturedefs in fm._arg2fixturedefs.items(): + assert fixturedefs is not None + if not fixturedefs: + continue + for fixturedef in fixturedefs: + loc = getlocation(fixturedef.func, curdir) + if (fixturedef.argname, loc) in seen: + continue + seen.add((fixturedef.argname, loc)) + available.append( + ( + len(fixturedef.baseid), + fixturedef.func.__module__, + curdir.bestrelpath(loc), + fixturedef.argname, + fixturedef, + ) + ) + + available.sort() + currentmodule = None + for baseid, module, bestrel, argname, fixturedef in available: + if currentmodule != module: + if not module.startswith("_pytest."): + tw.line() + tw.sep("-", "fixtures defined from %s" % (module,)) + currentmodule = module + if verbose <= 0 and argname[0] == "_": + continue + if verbose > 0: + funcargspec = "%s -- %s" % (argname, bestrel) + else: + funcargspec = argname + tw.line(funcargspec, green=True) + loc = getlocation(fixturedef.func, curdir) + doc = fixturedef.func.__doc__ or "" + if doc: + write_docstring(tw, doc) + else: + tw.line(" %s: no docstring available" % (loc,), red=True) + + +def write_docstring(tw, doc): + INDENT = " " + doc = doc.rstrip() + if "\n" in doc: + firstline, rest = doc.split("\n", 1) + else: + firstline, rest = doc, "" + + if firstline.strip(): + tw.line(INDENT + firstline.strip()) + + if rest: + for line in dedent(rest).split("\n"): + tw.write(INDENT + line + "\n") + + +class Function(FunctionMixin, nodes.Item, fixtures.FuncargnamesCompatAttr): + """ a Function Item is responsible for setting up and executing a + Python test function. + """ + _genid = None + # disable since functions handle it themselfes + _ALLOW_MARKERS = False + + def __init__( + self, + name, + parent, + args=None, + config=None, + callspec=None, + callobj=NOTSET, + keywords=None, + session=None, + fixtureinfo=None, + originalname=None, + ): + super(Function, self).__init__(name, parent, config=config, session=session) + self._args = args + if callobj is not NOTSET: + self.obj = callobj + + self.keywords.update(self.obj.__dict__) + self.own_markers.extend(get_unpacked_marks(self.obj)) + if callspec: + self.callspec = callspec + # this is total hostile and a mess + # keywords are broken by design by now + # this will be redeemed later + for mark in callspec.marks: + # feel free to cry, this was broken for years before + # and keywords cant fix it per design + self.keywords[mark.name] = mark + self.own_markers.extend(callspec.marks) + if keywords: + self.keywords.update(keywords) + + if fixtureinfo is None: + fixtureinfo = self.session._fixturemanager.getfixtureinfo( + self, self.obj, self.cls, funcargs=not self._isyieldedfunction() + ) + self._fixtureinfo = fixtureinfo + self.fixturenames = fixtureinfo.names_closure + self._initrequest() + + #: original function name, without any decorations (for example + #: parametrization adds a ``"[...]"`` suffix to function names). + #: + #: .. versionadded:: 3.0 + self.originalname = originalname + + def _initrequest(self): + self.funcargs = {} + if self._isyieldedfunction(): + assert not hasattr( + self, "callspec" + ), "yielded functions (deprecated) cannot have funcargs" + else: + if hasattr(self, "callspec"): + callspec = self.callspec + assert not callspec.funcargs + self._genid = callspec.id + if hasattr(callspec, "param"): + self.param = callspec.param + self._request = fixtures.FixtureRequest(self) + + @property + def function(self): + "underlying python 'function' object" + return getattr(self.obj, "im_func", self.obj) + + def _getobj(self): + name = self.name + i = name.find("[") # parametrization + if i != -1: + name = name[:i] + return getattr(self.parent.obj, name) + + @property + def _pyfuncitem(self): + "(compatonly) for code expecting pytest-2.2 style request objects" + return self + + def _isyieldedfunction(self): + return getattr(self, "_args", None) is not None + + def runtest(self): + """ execute the underlying test function. """ + self.ihook.pytest_pyfunc_call(pyfuncitem=self) + + def setup(self): + super(Function, self).setup() + fixtures.fillfixtures(self) + + +class FunctionDefinition(Function): + """ + internal hack until we get actual definition nodes instead of the + crappy metafunc hack + """ + + def runtest(self): + raise RuntimeError("function definitions are not supposed to be used") + + setup = runtest diff --git a/third_party/python/pytest/src/_pytest/python_api.py b/third_party/python/pytest/src/_pytest/python_api.py new file mode 100644 index 0000000000..9257d210c2 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/python_api.py @@ -0,0 +1,674 @@ +import math +import sys + +import py +from six.moves import zip, filterfalse +from more_itertools.more import always_iterable + +from _pytest.compat import isclass + +from _pytest.compat import Mapping, Sequence +from _pytest.compat import STRING_TYPES + +from _pytest.outcomes import fail +import _pytest._code + +BASE_TYPE = (type, STRING_TYPES) + + +def _cmp_raises_type_error(self, other): + """__cmp__ implementation which raises TypeError. Used + by Approx base classes to implement only == and != and raise a + TypeError for other comparisons. + + Needed in Python 2 only, Python 3 all it takes is not implementing the + other operators at all. + """ + __tracebackhide__ = True + raise TypeError( + "Comparison operators other than == and != not supported by approx objects" + ) + + +# builtin pytest.approx helper + + +class ApproxBase(object): + """ + Provide shared utilities for making approximate comparisons between numbers + or sequences of numbers. + """ + + # Tell numpy to use our `__eq__` operator instead of its + __array_ufunc__ = None + __array_priority__ = 100 + + def __init__(self, expected, rel=None, abs=None, nan_ok=False): + self.expected = expected + self.abs = abs + self.rel = rel + self.nan_ok = nan_ok + + def __repr__(self): + raise NotImplementedError + + def __eq__(self, actual): + return all( + a == self._approx_scalar(x) for a, x in self._yield_comparisons(actual) + ) + + __hash__ = None + + def __ne__(self, actual): + return not (actual == self) + + if sys.version_info[0] == 2: + __cmp__ = _cmp_raises_type_error + + def _approx_scalar(self, x): + return ApproxScalar(x, rel=self.rel, abs=self.abs, nan_ok=self.nan_ok) + + def _yield_comparisons(self, actual): + """ + Yield all the pairs of numbers to be compared. This is used to + implement the `__eq__` method. + """ + raise NotImplementedError + + +class ApproxNumpy(ApproxBase): + """ + Perform approximate comparisons for numpy arrays. + """ + + def __repr__(self): + # It might be nice to rewrite this function to account for the + # shape of the array... + import numpy as np + + return "approx({!r})".format( + list(self._approx_scalar(x) for x in np.asarray(self.expected)) + ) + + if sys.version_info[0] == 2: + __cmp__ = _cmp_raises_type_error + + def __eq__(self, actual): + import numpy as np + + # self.expected is supposed to always be an array here + + if not np.isscalar(actual): + try: + actual = np.asarray(actual) + except: # noqa + raise TypeError("cannot compare '{}' to numpy.ndarray".format(actual)) + + if not np.isscalar(actual) and actual.shape != self.expected.shape: + return False + + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + import numpy as np + + # `actual` can either be a numpy array or a scalar, it is treated in + # `__eq__` before being passed to `ApproxBase.__eq__`, which is the + # only method that calls this one. + + if np.isscalar(actual): + for i in np.ndindex(self.expected.shape): + yield actual, np.asscalar(self.expected[i]) + else: + for i in np.ndindex(self.expected.shape): + yield np.asscalar(actual[i]), np.asscalar(self.expected[i]) + + +class ApproxMapping(ApproxBase): + """ + Perform approximate comparisons for mappings where the values are numbers + (the keys can be anything). + """ + + def __repr__(self): + return "approx({!r})".format( + {k: self._approx_scalar(v) for k, v in self.expected.items()} + ) + + def __eq__(self, actual): + if set(actual.keys()) != set(self.expected.keys()): + return False + + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + for k in self.expected.keys(): + yield actual[k], self.expected[k] + + +class ApproxSequence(ApproxBase): + """ + Perform approximate comparisons for sequences of numbers. + """ + + def __repr__(self): + seq_type = type(self.expected) + if seq_type not in (tuple, list, set): + seq_type = list + return "approx({!r})".format( + seq_type(self._approx_scalar(x) for x in self.expected) + ) + + def __eq__(self, actual): + if len(actual) != len(self.expected): + return False + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + return zip(actual, self.expected) + + +class ApproxScalar(ApproxBase): + """ + Perform approximate comparisons for single numbers only. + """ + DEFAULT_ABSOLUTE_TOLERANCE = 1e-12 + DEFAULT_RELATIVE_TOLERANCE = 1e-6 + + def __repr__(self): + """ + Return a string communicating both the expected value and the tolerance + for the comparison being made, e.g. '1.0 +- 1e-6'. Use the unicode + plus/minus symbol if this is python3 (it's too hard to get right for + python2). + """ + if isinstance(self.expected, complex): + return str(self.expected) + + # Infinities aren't compared using tolerances, so don't show a + # tolerance. + if math.isinf(self.expected): + return str(self.expected) + + # If a sensible tolerance can't be calculated, self.tolerance will + # raise a ValueError. In this case, display '???'. + try: + vetted_tolerance = "{:.1e}".format(self.tolerance) + except ValueError: + vetted_tolerance = "???" + + if sys.version_info[0] == 2: + return "{} +- {}".format(self.expected, vetted_tolerance) + else: + return u"{} \u00b1 {}".format(self.expected, vetted_tolerance) + + def __eq__(self, actual): + """ + Return true if the given value is equal to the expected value within + the pre-specified tolerance. + """ + if _is_numpy_array(actual): + return ApproxNumpy(actual, self.abs, self.rel, self.nan_ok) == self.expected + + # Short-circuit exact equality. + if actual == self.expected: + return True + + # Allow the user to control whether NaNs are considered equal to each + # other or not. The abs() calls are for compatibility with complex + # numbers. + if math.isnan(abs(self.expected)): + return self.nan_ok and math.isnan(abs(actual)) + + # Infinity shouldn't be approximately equal to anything but itself, but + # if there's a relative tolerance, it will be infinite and infinity + # will seem approximately equal to everything. The equal-to-itself + # case would have been short circuited above, so here we can just + # return false if the expected value is infinite. The abs() call is + # for compatibility with complex numbers. + if math.isinf(abs(self.expected)): + return False + + # Return true if the two numbers are within the tolerance. + return abs(self.expected - actual) <= self.tolerance + + __hash__ = None + + @property + def tolerance(self): + """ + Return the tolerance for the comparison. This could be either an + absolute tolerance or a relative tolerance, depending on what the user + specified or which would be larger. + """ + + def set_default(x, default): + return x if x is not None else default + + # Figure out what the absolute tolerance should be. ``self.abs`` is + # either None or a value specified by the user. + absolute_tolerance = set_default(self.abs, self.DEFAULT_ABSOLUTE_TOLERANCE) + + if absolute_tolerance < 0: + raise ValueError( + "absolute tolerance can't be negative: {}".format(absolute_tolerance) + ) + if math.isnan(absolute_tolerance): + raise ValueError("absolute tolerance can't be NaN.") + + # If the user specified an absolute tolerance but not a relative one, + # just return the absolute tolerance. + if self.rel is None: + if self.abs is not None: + return absolute_tolerance + + # Figure out what the relative tolerance should be. ``self.rel`` is + # either None or a value specified by the user. This is done after + # we've made sure the user didn't ask for an absolute tolerance only, + # because we don't want to raise errors about the relative tolerance if + # we aren't even going to use it. + relative_tolerance = set_default( + self.rel, self.DEFAULT_RELATIVE_TOLERANCE + ) * abs( + self.expected + ) + + if relative_tolerance < 0: + raise ValueError( + "relative tolerance can't be negative: {}".format(absolute_tolerance) + ) + if math.isnan(relative_tolerance): + raise ValueError("relative tolerance can't be NaN.") + + # Return the larger of the relative and absolute tolerances. + return max(relative_tolerance, absolute_tolerance) + + +class ApproxDecimal(ApproxScalar): + from decimal import Decimal + + DEFAULT_ABSOLUTE_TOLERANCE = Decimal("1e-12") + DEFAULT_RELATIVE_TOLERANCE = Decimal("1e-6") + + +def approx(expected, rel=None, abs=None, nan_ok=False): + """ + Assert that two numbers (or two sets of numbers) are equal to each other + within some tolerance. + + Due to the `intricacies of floating-point arithmetic`__, numbers that we + would intuitively expect to be equal are not always so:: + + >>> 0.1 + 0.2 == 0.3 + False + + __ https://docs.python.org/3/tutorial/floatingpoint.html + + This problem is commonly encountered when writing tests, e.g. when making + sure that floating-point values are what you expect them to be. One way to + deal with this problem is to assert that two floating-point numbers are + equal to within some appropriate tolerance:: + + >>> abs((0.1 + 0.2) - 0.3) < 1e-6 + True + + However, comparisons like this are tedious to write and difficult to + understand. Furthermore, absolute comparisons like the one above are + usually discouraged because there's no tolerance that works well for all + situations. ``1e-6`` is good for numbers around ``1``, but too small for + very big numbers and too big for very small ones. It's better to express + the tolerance as a fraction of the expected value, but relative comparisons + like that are even more difficult to write correctly and concisely. + + The ``approx`` class performs floating-point comparisons using a syntax + that's as intuitive as possible:: + + >>> from pytest import approx + >>> 0.1 + 0.2 == approx(0.3) + True + + The same syntax also works for sequences of numbers:: + + >>> (0.1 + 0.2, 0.2 + 0.4) == approx((0.3, 0.6)) + True + + Dictionary *values*:: + + >>> {'a': 0.1 + 0.2, 'b': 0.2 + 0.4} == approx({'a': 0.3, 'b': 0.6}) + True + + ``numpy`` arrays:: + + >>> import numpy as np # doctest: +SKIP + >>> np.array([0.1, 0.2]) + np.array([0.2, 0.4]) == approx(np.array([0.3, 0.6])) # doctest: +SKIP + True + + And for a ``numpy`` array against a scalar:: + + >>> import numpy as np # doctest: +SKIP + >>> np.array([0.1, 0.2]) + np.array([0.2, 0.1]) == approx(0.3) # doctest: +SKIP + True + + By default, ``approx`` considers numbers within a relative tolerance of + ``1e-6`` (i.e. one part in a million) of its expected value to be equal. + This treatment would lead to surprising results if the expected value was + ``0.0``, because nothing but ``0.0`` itself is relatively close to ``0.0``. + To handle this case less surprisingly, ``approx`` also considers numbers + within an absolute tolerance of ``1e-12`` of its expected value to be + equal. Infinity and NaN are special cases. Infinity is only considered + equal to itself, regardless of the relative tolerance. NaN is not + considered equal to anything by default, but you can make it be equal to + itself by setting the ``nan_ok`` argument to True. (This is meant to + facilitate comparing arrays that use NaN to mean "no data".) + + Both the relative and absolute tolerances can be changed by passing + arguments to the ``approx`` constructor:: + + >>> 1.0001 == approx(1) + False + >>> 1.0001 == approx(1, rel=1e-3) + True + >>> 1.0001 == approx(1, abs=1e-3) + True + + If you specify ``abs`` but not ``rel``, the comparison will not consider + the relative tolerance at all. In other words, two numbers that are within + the default relative tolerance of ``1e-6`` will still be considered unequal + if they exceed the specified absolute tolerance. If you specify both + ``abs`` and ``rel``, the numbers will be considered equal if either + tolerance is met:: + + >>> 1 + 1e-8 == approx(1) + True + >>> 1 + 1e-8 == approx(1, abs=1e-12) + False + >>> 1 + 1e-8 == approx(1, rel=1e-6, abs=1e-12) + True + + If you're thinking about using ``approx``, then you might want to know how + it compares to other good ways of comparing floating-point numbers. All of + these algorithms are based on relative and absolute tolerances and should + agree for the most part, but they do have meaningful differences: + + - ``math.isclose(a, b, rel_tol=1e-9, abs_tol=0.0)``: True if the relative + tolerance is met w.r.t. either ``a`` or ``b`` or if the absolute + tolerance is met. Because the relative tolerance is calculated w.r.t. + both ``a`` and ``b``, this test is symmetric (i.e. neither ``a`` nor + ``b`` is a "reference value"). You have to specify an absolute tolerance + if you want to compare to ``0.0`` because there is no tolerance by + default. Only available in python>=3.5. `More information...`__ + + __ https://docs.python.org/3/library/math.html#math.isclose + + - ``numpy.isclose(a, b, rtol=1e-5, atol=1e-8)``: True if the difference + between ``a`` and ``b`` is less that the sum of the relative tolerance + w.r.t. ``b`` and the absolute tolerance. Because the relative tolerance + is only calculated w.r.t. ``b``, this test is asymmetric and you can + think of ``b`` as the reference value. Support for comparing sequences + is provided by ``numpy.allclose``. `More information...`__ + + __ http://docs.scipy.org/doc/numpy-1.10.0/reference/generated/numpy.isclose.html + + - ``unittest.TestCase.assertAlmostEqual(a, b)``: True if ``a`` and ``b`` + are within an absolute tolerance of ``1e-7``. No relative tolerance is + considered and the absolute tolerance cannot be changed, so this function + is not appropriate for very large or very small numbers. Also, it's only + available in subclasses of ``unittest.TestCase`` and it's ugly because it + doesn't follow PEP8. `More information...`__ + + __ https://docs.python.org/3/library/unittest.html#unittest.TestCase.assertAlmostEqual + + - ``a == pytest.approx(b, rel=1e-6, abs=1e-12)``: True if the relative + tolerance is met w.r.t. ``b`` or if the absolute tolerance is met. + Because the relative tolerance is only calculated w.r.t. ``b``, this test + is asymmetric and you can think of ``b`` as the reference value. In the + special case that you explicitly specify an absolute tolerance but not a + relative tolerance, only the absolute tolerance is considered. + + .. warning:: + + .. versionchanged:: 3.2 + + In order to avoid inconsistent behavior, ``TypeError`` is + raised for ``>``, ``>=``, ``<`` and ``<=`` comparisons. + The example below illustrates the problem:: + + assert approx(0.1) > 0.1 + 1e-10 # calls approx(0.1).__gt__(0.1 + 1e-10) + assert 0.1 + 1e-10 > approx(0.1) # calls approx(0.1).__lt__(0.1 + 1e-10) + + In the second example one expects ``approx(0.1).__le__(0.1 + 1e-10)`` + to be called. But instead, ``approx(0.1).__lt__(0.1 + 1e-10)`` is used to + comparison. This is because the call hierarchy of rich comparisons + follows a fixed behavior. `More information...`__ + + __ https://docs.python.org/3/reference/datamodel.html#object.__ge__ + """ + + from decimal import Decimal + + # Delegate the comparison to a class that knows how to deal with the type + # of the expected value (e.g. int, float, list, dict, numpy.array, etc). + # + # This architecture is really driven by the need to support numpy arrays. + # The only way to override `==` for arrays without requiring that approx be + # the left operand is to inherit the approx object from `numpy.ndarray`. + # But that can't be a general solution, because it requires (1) numpy to be + # installed and (2) the expected value to be a numpy array. So the general + # solution is to delegate each type of expected value to a different class. + # + # This has the advantage that it made it easy to support mapping types + # (i.e. dict). The old code accepted mapping types, but would only compare + # their keys, which is probably not what most people would expect. + + if _is_numpy_array(expected): + cls = ApproxNumpy + elif isinstance(expected, Mapping): + cls = ApproxMapping + elif isinstance(expected, Sequence) and not isinstance(expected, STRING_TYPES): + cls = ApproxSequence + elif isinstance(expected, Decimal): + cls = ApproxDecimal + else: + cls = ApproxScalar + + return cls(expected, rel, abs, nan_ok) + + +def _is_numpy_array(obj): + """ + Return true if the given object is a numpy array. Make a special effort to + avoid importing numpy unless it's really necessary. + """ + import inspect + + for cls in inspect.getmro(type(obj)): + if cls.__module__ == "numpy": + try: + import numpy as np + + return isinstance(obj, np.ndarray) + except ImportError: + pass + + return False + + +# builtin pytest.raises helper + + +def raises(expected_exception, *args, **kwargs): + r""" + Assert that a code block/function call raises ``expected_exception`` + and raise a failure exception otherwise. + + :arg message: if specified, provides a custom failure message if the + exception is not raised + :arg match: if specified, asserts that the exception matches a text or regex + + This helper produces a ``ExceptionInfo()`` object (see below). + + You may use this function as a context manager:: + + >>> with raises(ZeroDivisionError): + ... 1/0 + + .. versionchanged:: 2.10 + + In the context manager form you may use the keyword argument + ``message`` to specify a custom failure message:: + + >>> with raises(ZeroDivisionError, message="Expecting ZeroDivisionError"): + ... pass + Traceback (most recent call last): + ... + Failed: Expecting ZeroDivisionError + + .. note:: + + When using ``pytest.raises`` as a context manager, it's worthwhile to + note that normal context manager rules apply and that the exception + raised *must* be the final line in the scope of the context manager. + Lines of code after that, within the scope of the context manager will + not be executed. For example:: + + >>> value = 15 + >>> with raises(ValueError) as exc_info: + ... if value > 10: + ... raise ValueError("value must be <= 10") + ... assert exc_info.type == ValueError # this will not execute + + Instead, the following approach must be taken (note the difference in + scope):: + + >>> with raises(ValueError) as exc_info: + ... if value > 10: + ... raise ValueError("value must be <= 10") + ... + >>> assert exc_info.type == ValueError + + + Since version ``3.1`` you can use the keyword argument ``match`` to assert that the + exception matches a text or regex:: + + >>> with raises(ValueError, match='must be 0 or None'): + ... raise ValueError("value must be 0 or None") + + >>> with raises(ValueError, match=r'must be \d+$'): + ... raise ValueError("value must be 42") + + **Legacy forms** + + The forms below are fully supported but are discouraged for new code because the + context manager form is regarded as more readable and less error-prone. + + It is possible to specify a callable by passing a to-be-called lambda:: + + >>> raises(ZeroDivisionError, lambda: 1/0) + <ExceptionInfo ...> + + or you can specify an arbitrary callable with arguments:: + + >>> def f(x): return 1/x + ... + >>> raises(ZeroDivisionError, f, 0) + <ExceptionInfo ...> + >>> raises(ZeroDivisionError, f, x=0) + <ExceptionInfo ...> + + It is also possible to pass a string to be evaluated at runtime:: + + >>> raises(ZeroDivisionError, "f(0)") + <ExceptionInfo ...> + + The string will be evaluated using the same ``locals()`` and ``globals()`` + at the moment of the ``raises`` call. + + .. currentmodule:: _pytest._code + + Consult the API of ``excinfo`` objects: :class:`ExceptionInfo`. + + .. note:: + Similar to caught exception objects in Python, explicitly clearing + local references to returned ``ExceptionInfo`` objects can + help the Python interpreter speed up its garbage collection. + + Clearing those references breaks a reference cycle + (``ExceptionInfo`` --> caught exception --> frame stack raising + the exception --> current frame stack --> local variables --> + ``ExceptionInfo``) which makes Python keep all objects referenced + from that cycle (including all local variables in the current + frame) alive until the next cyclic garbage collection run. See the + official Python ``try`` statement documentation for more detailed + information. + + """ + __tracebackhide__ = True + for exc in filterfalse(isclass, always_iterable(expected_exception, BASE_TYPE)): + msg = ( + "exceptions must be old-style classes or" + " derived from BaseException, not %s" + ) + raise TypeError(msg % type(exc)) + + message = "DID NOT RAISE {}".format(expected_exception) + match_expr = None + + if not args: + if "message" in kwargs: + message = kwargs.pop("message") + if "match" in kwargs: + match_expr = kwargs.pop("match") + if kwargs: + msg = "Unexpected keyword arguments passed to pytest.raises: " + msg += ", ".join(kwargs.keys()) + raise TypeError(msg) + return RaisesContext(expected_exception, message, match_expr) + elif isinstance(args[0], str): + code, = args + assert isinstance(code, str) + frame = sys._getframe(1) + loc = frame.f_locals.copy() + loc.update(kwargs) + # print "raises frame scope: %r" % frame.f_locals + try: + code = _pytest._code.Source(code).compile() + py.builtin.exec_(code, frame.f_globals, loc) + # XXX didn'T mean f_globals == f_locals something special? + # this is destroyed here ... + except expected_exception: + return _pytest._code.ExceptionInfo() + else: + func = args[0] + try: + func(*args[1:], **kwargs) + except expected_exception: + return _pytest._code.ExceptionInfo() + fail(message) + + +raises.Exception = fail.Exception + + +class RaisesContext(object): + + def __init__(self, expected_exception, message, match_expr): + self.expected_exception = expected_exception + self.message = message + self.match_expr = match_expr + self.excinfo = None + + def __enter__(self): + self.excinfo = object.__new__(_pytest._code.ExceptionInfo) + return self.excinfo + + def __exit__(self, *tp): + __tracebackhide__ = True + if tp[0] is None: + fail(self.message) + self.excinfo.__init__(tp) + suppress_exception = issubclass(self.excinfo.type, self.expected_exception) + if sys.version_info[0] == 2 and suppress_exception: + sys.exc_clear() + if self.match_expr and suppress_exception: + self.excinfo.match(self.match_expr) + return suppress_exception diff --git a/third_party/python/pytest/src/_pytest/recwarn.py b/third_party/python/pytest/src/_pytest/recwarn.py new file mode 100644 index 0000000000..7839f5700c --- /dev/null +++ b/third_party/python/pytest/src/_pytest/recwarn.py @@ -0,0 +1,243 @@ +""" recording warnings during test function execution. """ +from __future__ import absolute_import, division, print_function + +import inspect + +import _pytest._code +import py +import sys +import warnings + +import re + +from _pytest.fixtures import yield_fixture +from _pytest.outcomes import fail + + +@yield_fixture +def recwarn(): + """Return a :class:`WarningsRecorder` instance that records all warnings emitted by test functions. + + See http://docs.python.org/library/warnings.html for information + on warning categories. + """ + wrec = WarningsRecorder() + with wrec: + warnings.simplefilter("default") + yield wrec + + +def deprecated_call(func=None, *args, **kwargs): + """context manager that can be used to ensure a block of code triggers a + ``DeprecationWarning`` or ``PendingDeprecationWarning``:: + + >>> import warnings + >>> def api_call_v2(): + ... warnings.warn('use v3 of this api', DeprecationWarning) + ... return 200 + + >>> with deprecated_call(): + ... assert api_call_v2() == 200 + + ``deprecated_call`` can also be used by passing a function and ``*args`` and ``*kwargs``, + in which case it will ensure calling ``func(*args, **kwargs)`` produces one of the warnings + types above. + """ + if not func: + return _DeprecatedCallContext() + else: + __tracebackhide__ = True + with _DeprecatedCallContext(): + return func(*args, **kwargs) + + +class _DeprecatedCallContext(object): + """Implements the logic to capture deprecation warnings as a context manager.""" + + def __enter__(self): + self._captured_categories = [] + self._old_warn = warnings.warn + self._old_warn_explicit = warnings.warn_explicit + warnings.warn_explicit = self._warn_explicit + warnings.warn = self._warn + + def _warn_explicit(self, message, category, *args, **kwargs): + self._captured_categories.append(category) + + def _warn(self, message, category=None, *args, **kwargs): + if isinstance(message, Warning): + self._captured_categories.append(message.__class__) + else: + self._captured_categories.append(category) + + def __exit__(self, exc_type, exc_val, exc_tb): + warnings.warn_explicit = self._old_warn_explicit + warnings.warn = self._old_warn + + if exc_type is None: + deprecation_categories = (DeprecationWarning, PendingDeprecationWarning) + if not any( + issubclass(c, deprecation_categories) for c in self._captured_categories + ): + __tracebackhide__ = True + msg = "Did not produce DeprecationWarning or PendingDeprecationWarning" + raise AssertionError(msg) + + +def warns(expected_warning, *args, **kwargs): + r"""Assert that code raises a particular class of warning. + + Specifically, the parameter ``expected_warning`` can be a warning class or + sequence of warning classes, and the inside the ``with`` block must issue a warning of that class or + classes. + + This helper produces a list of :class:`warnings.WarningMessage` objects, + one for each warning raised. + + This function can be used as a context manager, or any of the other ways + ``pytest.raises`` can be used:: + + >>> with warns(RuntimeWarning): + ... warnings.warn("my warning", RuntimeWarning) + + In the context manager form you may use the keyword argument ``match`` to assert + that the exception matches a text or regex:: + + >>> with warns(UserWarning, match='must be 0 or None'): + ... warnings.warn("value must be 0 or None", UserWarning) + + >>> with warns(UserWarning, match=r'must be \d+$'): + ... warnings.warn("value must be 42", UserWarning) + + >>> with warns(UserWarning, match=r'must be \d+$'): + ... warnings.warn("this is not here", UserWarning) + Traceback (most recent call last): + ... + Failed: DID NOT WARN. No warnings of type ...UserWarning... was emitted... + + """ + match_expr = None + if not args: + if "match" in kwargs: + match_expr = kwargs.pop("match") + return WarningsChecker(expected_warning, match_expr=match_expr) + elif isinstance(args[0], str): + code, = args + assert isinstance(code, str) + frame = sys._getframe(1) + loc = frame.f_locals.copy() + loc.update(kwargs) + + with WarningsChecker(expected_warning, match_expr=match_expr): + code = _pytest._code.Source(code).compile() + py.builtin.exec_(code, frame.f_globals, loc) + else: + func = args[0] + with WarningsChecker(expected_warning, match_expr=match_expr): + return func(*args[1:], **kwargs) + + +class WarningsRecorder(warnings.catch_warnings): + """A context manager to record raised warnings. + + Adapted from `warnings.catch_warnings`. + """ + + def __init__(self): + super(WarningsRecorder, self).__init__(record=True) + self._entered = False + self._list = [] + + @property + def list(self): + """The list of recorded warnings.""" + return self._list + + def __getitem__(self, i): + """Get a recorded warning by index.""" + return self._list[i] + + def __iter__(self): + """Iterate through the recorded warnings.""" + return iter(self._list) + + def __len__(self): + """The number of recorded warnings.""" + return len(self._list) + + def pop(self, cls=Warning): + """Pop the first recorded warning, raise exception if not exists.""" + for i, w in enumerate(self._list): + if issubclass(w.category, cls): + return self._list.pop(i) + __tracebackhide__ = True + raise AssertionError("%r not found in warning list" % cls) + + def clear(self): + """Clear the list of recorded warnings.""" + self._list[:] = [] + + def __enter__(self): + if self._entered: + __tracebackhide__ = True + raise RuntimeError("Cannot enter %r twice" % self) + self._list = super(WarningsRecorder, self).__enter__() + warnings.simplefilter("always") + return self + + def __exit__(self, *exc_info): + if not self._entered: + __tracebackhide__ = True + raise RuntimeError("Cannot exit %r without entering first" % self) + super(WarningsRecorder, self).__exit__(*exc_info) + + +class WarningsChecker(WarningsRecorder): + + def __init__(self, expected_warning=None, match_expr=None): + super(WarningsChecker, self).__init__() + + msg = ( + "exceptions must be old-style classes or " "derived from Warning, not %s" + ) + if isinstance(expected_warning, tuple): + for exc in expected_warning: + if not inspect.isclass(exc): + raise TypeError(msg % type(exc)) + elif inspect.isclass(expected_warning): + expected_warning = (expected_warning,) + elif expected_warning is not None: + raise TypeError(msg % type(expected_warning)) + + self.expected_warning = expected_warning + self.match_expr = match_expr + + def __exit__(self, *exc_info): + super(WarningsChecker, self).__exit__(*exc_info) + + # only check if we're not currently handling an exception + if all(a is None for a in exc_info): + if self.expected_warning is not None: + if not any(issubclass(r.category, self.expected_warning) for r in self): + __tracebackhide__ = True + fail( + "DID NOT WARN. No warnings of type {} was emitted. " + "The list of emitted warnings is: {}.".format( + self.expected_warning, [each.message for each in self] + ) + ) + elif self.match_expr is not None: + for r in self: + if issubclass(r.category, self.expected_warning): + if re.compile(self.match_expr).search(str(r.message)): + break + else: + fail( + "DID NOT WARN. No warnings of type {} matching" + " ('{}') was emitted. The list of emitted warnings" + " is: {}.".format( + self.expected_warning, + self.match_expr, + [each.message for each in self], + ) + ) diff --git a/third_party/python/pytest/src/_pytest/resultlog.py b/third_party/python/pytest/src/_pytest/resultlog.py new file mode 100644 index 0000000000..8f300c9830 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/resultlog.py @@ -0,0 +1,120 @@ +""" log machine-parseable test session result information in a plain +text file. +""" +from __future__ import absolute_import, division, print_function + +import py +import os + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "resultlog plugin options") + group.addoption( + "--resultlog", + "--result-log", + action="store", + metavar="path", + default=None, + help="DEPRECATED path for machine-readable result log.", + ) + + +def pytest_configure(config): + resultlog = config.option.resultlog + # prevent opening resultlog on slave nodes (xdist) + if resultlog and not hasattr(config, "slaveinput"): + dirname = os.path.dirname(os.path.abspath(resultlog)) + if not os.path.isdir(dirname): + os.makedirs(dirname) + logfile = open(resultlog, "w", 1) # line buffered + config._resultlog = ResultLog(config, logfile) + config.pluginmanager.register(config._resultlog) + + from _pytest.deprecated import RESULT_LOG + + config.warn("C1", RESULT_LOG) + + +def pytest_unconfigure(config): + resultlog = getattr(config, "_resultlog", None) + if resultlog: + resultlog.logfile.close() + del config._resultlog + config.pluginmanager.unregister(resultlog) + + +def generic_path(item): + chain = item.listchain() + gpath = [chain[0].name] + fspath = chain[0].fspath + fspart = False + for node in chain[1:]: + newfspath = node.fspath + if newfspath == fspath: + if fspart: + gpath.append(":") + fspart = False + else: + gpath.append(".") + else: + gpath.append("/") + fspart = True + name = node.name + if name[0] in "([": + gpath.pop() + gpath.append(name) + fspath = newfspath + return "".join(gpath) + + +class ResultLog(object): + + def __init__(self, config, logfile): + self.config = config + self.logfile = logfile # preferably line buffered + + def write_log_entry(self, testpath, lettercode, longrepr): + print("%s %s" % (lettercode, testpath), file=self.logfile) + for line in longrepr.splitlines(): + print(" %s" % line, file=self.logfile) + + def log_outcome(self, report, lettercode, longrepr): + testpath = getattr(report, "nodeid", None) + if testpath is None: + testpath = report.fspath + self.write_log_entry(testpath, lettercode, longrepr) + + def pytest_runtest_logreport(self, report): + if report.when != "call" and report.passed: + return + res = self.config.hook.pytest_report_teststatus(report=report) + code = res[1] + if code == "x": + longrepr = str(report.longrepr) + elif code == "X": + longrepr = "" + elif report.passed: + longrepr = "" + elif report.failed: + longrepr = str(report.longrepr) + elif report.skipped: + longrepr = str(report.longrepr[2]) + self.log_outcome(report, code, longrepr) + + def pytest_collectreport(self, report): + if not report.passed: + if report.failed: + code = "F" + longrepr = str(report.longrepr) + else: + assert report.skipped + code = "S" + longrepr = "%s:%d: %s" % report.longrepr + self.log_outcome(report, code, longrepr) + + def pytest_internalerror(self, excrepr): + reprcrash = getattr(excrepr, "reprcrash", None) + path = getattr(reprcrash, "path", None) + if path is None: + path = "cwd:%s" % py.path.local() + self.write_log_entry(path, "!", str(excrepr)) diff --git a/third_party/python/pytest/src/_pytest/runner.py b/third_party/python/pytest/src/_pytest/runner.py new file mode 100644 index 0000000000..18e925509e --- /dev/null +++ b/third_party/python/pytest/src/_pytest/runner.py @@ -0,0 +1,570 @@ +""" basic collect and runtest protocol implementations """ +from __future__ import absolute_import, division, print_function + +import bdb +import os +import sys +from time import time + +import py +from _pytest._code.code import TerminalRepr, ExceptionInfo +from _pytest.outcomes import skip, Skipped, TEST_OUTCOME + +# +# pytest plugin hooks + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "reporting", after="general") + group.addoption( + "--durations", + action="store", + type=int, + default=None, + metavar="N", + help="show N slowest setup/test durations (N=0 for all).", + ), + + +def pytest_terminal_summary(terminalreporter): + durations = terminalreporter.config.option.durations + if durations is None: + return + tr = terminalreporter + dlist = [] + for replist in tr.stats.values(): + for rep in replist: + if hasattr(rep, "duration"): + dlist.append(rep) + if not dlist: + return + dlist.sort(key=lambda x: x.duration) + dlist.reverse() + if not durations: + tr.write_sep("=", "slowest test durations") + else: + tr.write_sep("=", "slowest %s test durations" % durations) + dlist = dlist[:durations] + + for rep in dlist: + nodeid = rep.nodeid.replace("::()::", "::") + tr.write_line("%02.2fs %-8s %s" % (rep.duration, rep.when, nodeid)) + + +def pytest_sessionstart(session): + session._setupstate = SetupState() + + +def pytest_sessionfinish(session): + session._setupstate.teardown_all() + + +def pytest_runtest_protocol(item, nextitem): + item.ihook.pytest_runtest_logstart(nodeid=item.nodeid, location=item.location) + runtestprotocol(item, nextitem=nextitem) + item.ihook.pytest_runtest_logfinish(nodeid=item.nodeid, location=item.location) + return True + + +def runtestprotocol(item, log=True, nextitem=None): + hasrequest = hasattr(item, "_request") + if hasrequest and not item._request: + item._initrequest() + rep = call_and_report(item, "setup", log) + reports = [rep] + if rep.passed: + if item.config.option.setupshow: + show_test_item(item) + if not item.config.option.setuponly: + reports.append(call_and_report(item, "call", log)) + reports.append(call_and_report(item, "teardown", log, nextitem=nextitem)) + # after all teardown hooks have been called + # want funcargs and request info to go away + if hasrequest: + item._request = False + item.funcargs = None + return reports + + +def show_test_item(item): + """Show test function, parameters and the fixtures of the test item.""" + tw = item.config.get_terminal_writer() + tw.line() + tw.write(" " * 8) + tw.write(item._nodeid) + used_fixtures = sorted(item._fixtureinfo.name2fixturedefs.keys()) + if used_fixtures: + tw.write(" (fixtures used: {})".format(", ".join(used_fixtures))) + + +def pytest_runtest_setup(item): + _update_current_test_var(item, "setup") + item.session._setupstate.prepare(item) + + +def pytest_runtest_call(item): + _update_current_test_var(item, "call") + sys.last_type, sys.last_value, sys.last_traceback = (None, None, None) + try: + item.runtest() + except Exception: + # Store trace info to allow postmortem debugging + type, value, tb = sys.exc_info() + tb = tb.tb_next # Skip *this* frame + sys.last_type = type + sys.last_value = value + sys.last_traceback = tb + del type, value, tb # Get rid of these in this frame + raise + + +def pytest_runtest_teardown(item, nextitem): + _update_current_test_var(item, "teardown") + item.session._setupstate.teardown_exact(item, nextitem) + _update_current_test_var(item, None) + + +def _update_current_test_var(item, when): + """ + Update PYTEST_CURRENT_TEST to reflect the current item and stage. + + If ``when`` is None, delete PYTEST_CURRENT_TEST from the environment. + """ + var_name = "PYTEST_CURRENT_TEST" + if when: + value = "{} ({})".format(item.nodeid, when) + # don't allow null bytes on environment variables (see #2644, #2957) + value = value.replace("\x00", "(null)") + os.environ[var_name] = value + else: + os.environ.pop(var_name) + + +def pytest_report_teststatus(report): + if report.when in ("setup", "teardown"): + if report.failed: + # category, shortletter, verbose-word + return "error", "E", "ERROR" + elif report.skipped: + return "skipped", "s", "SKIPPED" + else: + return "", "", "" + + +# +# Implementation + + +def call_and_report(item, when, log=True, **kwds): + call = call_runtest_hook(item, when, **kwds) + hook = item.ihook + report = hook.pytest_runtest_makereport(item=item, call=call) + if log: + hook.pytest_runtest_logreport(report=report) + if check_interactive_exception(call, report): + hook.pytest_exception_interact(node=item, call=call, report=report) + return report + + +def check_interactive_exception(call, report): + return call.excinfo and not ( + hasattr(report, "wasxfail") + or call.excinfo.errisinstance(skip.Exception) + or call.excinfo.errisinstance(bdb.BdbQuit) + ) + + +def call_runtest_hook(item, when, **kwds): + hookname = "pytest_runtest_" + when + ihook = getattr(item.ihook, hookname) + return CallInfo( + lambda: ihook(item=item, **kwds), + when=when, + treat_keyboard_interrupt_as_exception=item.config.getvalue("usepdb"), + ) + + +class CallInfo(object): + """ Result/Exception info a function invocation. """ + #: None or ExceptionInfo object. + excinfo = None + + def __init__(self, func, when, treat_keyboard_interrupt_as_exception=False): + #: context of invocation: one of "setup", "call", + #: "teardown", "memocollect" + self.when = when + self.start = time() + try: + self.result = func() + except KeyboardInterrupt: + if treat_keyboard_interrupt_as_exception: + self.excinfo = ExceptionInfo() + else: + self.stop = time() + raise + except: # noqa + self.excinfo = ExceptionInfo() + self.stop = time() + + def __repr__(self): + if self.excinfo: + status = "exception: %s" % str(self.excinfo.value) + else: + status = "result: %r" % (self.result,) + return "<CallInfo when=%r %s>" % (self.when, status) + + +def getslaveinfoline(node): + try: + return node._slaveinfocache + except AttributeError: + d = node.slaveinfo + ver = "%s.%s.%s" % d["version_info"][:3] + node._slaveinfocache = s = "[%s] %s -- Python %s %s" % ( + d["id"], d["sysplatform"], ver, d["executable"] + ) + return s + + +class BaseReport(object): + + def __init__(self, **kw): + self.__dict__.update(kw) + + def toterminal(self, out): + if hasattr(self, "node"): + out.line(getslaveinfoline(self.node)) + + longrepr = self.longrepr + if longrepr is None: + return + + if hasattr(longrepr, "toterminal"): + longrepr.toterminal(out) + else: + try: + out.line(longrepr) + except UnicodeEncodeError: + out.line("<unprintable longrepr>") + + def get_sections(self, prefix): + for name, content in self.sections: + if name.startswith(prefix): + yield prefix, content + + @property + def longreprtext(self): + """ + Read-only property that returns the full string representation + of ``longrepr``. + + .. versionadded:: 3.0 + """ + tw = py.io.TerminalWriter(stringio=True) + tw.hasmarkup = False + self.toterminal(tw) + exc = tw.stringio.getvalue() + return exc.strip() + + @property + def caplog(self): + """Return captured log lines, if log capturing is enabled + + .. versionadded:: 3.5 + """ + return "\n".join( + content for (prefix, content) in self.get_sections("Captured log") + ) + + @property + def capstdout(self): + """Return captured text from stdout, if capturing is enabled + + .. versionadded:: 3.0 + """ + return "".join( + content for (prefix, content) in self.get_sections("Captured stdout") + ) + + @property + def capstderr(self): + """Return captured text from stderr, if capturing is enabled + + .. versionadded:: 3.0 + """ + return "".join( + content for (prefix, content) in self.get_sections("Captured stderr") + ) + + passed = property(lambda x: x.outcome == "passed") + failed = property(lambda x: x.outcome == "failed") + skipped = property(lambda x: x.outcome == "skipped") + + @property + def fspath(self): + return self.nodeid.split("::")[0] + + +def pytest_runtest_makereport(item, call): + when = call.when + duration = call.stop - call.start + keywords = {x: 1 for x in item.keywords} + excinfo = call.excinfo + sections = [] + if not call.excinfo: + outcome = "passed" + longrepr = None + else: + if not isinstance(excinfo, ExceptionInfo): + outcome = "failed" + longrepr = excinfo + elif excinfo.errisinstance(skip.Exception): + outcome = "skipped" + r = excinfo._getreprcrash() + longrepr = (str(r.path), r.lineno, r.message) + else: + outcome = "failed" + if call.when == "call": + longrepr = item.repr_failure(excinfo) + else: # exception in setup or teardown + longrepr = item._repr_failure_py( + excinfo, style=item.config.option.tbstyle + ) + for rwhen, key, content in item._report_sections: + sections.append(("Captured %s %s" % (key, rwhen), content)) + return TestReport( + item.nodeid, + item.location, + keywords, + outcome, + longrepr, + when, + sections, + duration, + user_properties=item.user_properties, + ) + + +class TestReport(BaseReport): + """ Basic test report object (also used for setup and teardown calls if + they fail). + """ + + def __init__( + self, + nodeid, + location, + keywords, + outcome, + longrepr, + when, + sections=(), + duration=0, + user_properties=(), + **extra + ): + #: normalized collection node id + self.nodeid = nodeid + + #: a (filesystempath, lineno, domaininfo) tuple indicating the + #: actual location of a test item - it might be different from the + #: collected one e.g. if a method is inherited from a different module. + self.location = location + + #: a name -> value dictionary containing all keywords and + #: markers associated with a test invocation. + self.keywords = keywords + + #: test outcome, always one of "passed", "failed", "skipped". + self.outcome = outcome + + #: None or a failure representation. + self.longrepr = longrepr + + #: one of 'setup', 'call', 'teardown' to indicate runtest phase. + self.when = when + + #: user properties is a list of tuples (name, value) that holds user + #: defined properties of the test + self.user_properties = user_properties + + #: list of pairs ``(str, str)`` of extra information which needs to + #: marshallable. Used by pytest to add captured text + #: from ``stdout`` and ``stderr``, but may be used by other plugins + #: to add arbitrary information to reports. + self.sections = list(sections) + + #: time it took to run just the test + self.duration = duration + + self.__dict__.update(extra) + + def __repr__(self): + return "<TestReport %r when=%r outcome=%r>" % ( + self.nodeid, self.when, self.outcome + ) + + +class TeardownErrorReport(BaseReport): + outcome = "failed" + when = "teardown" + + def __init__(self, longrepr, **extra): + self.longrepr = longrepr + self.sections = [] + self.__dict__.update(extra) + + +def pytest_make_collect_report(collector): + call = CallInfo(lambda: list(collector.collect()), "collect") + longrepr = None + if not call.excinfo: + outcome = "passed" + else: + from _pytest import nose + + skip_exceptions = (Skipped,) + nose.get_skip_exceptions() + if call.excinfo.errisinstance(skip_exceptions): + outcome = "skipped" + r = collector._repr_failure_py(call.excinfo, "line").reprcrash + longrepr = (str(r.path), r.lineno, r.message) + else: + outcome = "failed" + errorinfo = collector.repr_failure(call.excinfo) + if not hasattr(errorinfo, "toterminal"): + errorinfo = CollectErrorRepr(errorinfo) + longrepr = errorinfo + rep = CollectReport( + collector.nodeid, outcome, longrepr, getattr(call, "result", None) + ) + rep.call = call # see collect_one_node + return rep + + +class CollectReport(BaseReport): + + def __init__(self, nodeid, outcome, longrepr, result, sections=(), **extra): + self.nodeid = nodeid + self.outcome = outcome + self.longrepr = longrepr + self.result = result or [] + self.sections = list(sections) + self.__dict__.update(extra) + + @property + def location(self): + return (self.fspath, None, self.fspath) + + def __repr__(self): + return "<CollectReport %r lenresult=%s outcome=%r>" % ( + self.nodeid, len(self.result), self.outcome + ) + + +class CollectErrorRepr(TerminalRepr): + + def __init__(self, msg): + self.longrepr = msg + + def toterminal(self, out): + out.line(self.longrepr, red=True) + + +class SetupState(object): + """ shared state for setting up/tearing down test items or collectors. """ + + def __init__(self): + self.stack = [] + self._finalizers = {} + + def addfinalizer(self, finalizer, colitem): + """ attach a finalizer to the given colitem. + if colitem is None, this will add a finalizer that + is called at the end of teardown_all(). + """ + assert colitem and not isinstance(colitem, tuple) + assert callable(finalizer) + # assert colitem in self.stack # some unit tests don't setup stack :/ + self._finalizers.setdefault(colitem, []).append(finalizer) + + def _pop_and_teardown(self): + colitem = self.stack.pop() + self._teardown_with_finalization(colitem) + + def _callfinalizers(self, colitem): + finalizers = self._finalizers.pop(colitem, None) + exc = None + while finalizers: + fin = finalizers.pop() + try: + fin() + except TEST_OUTCOME: + # XXX Only first exception will be seen by user, + # ideally all should be reported. + if exc is None: + exc = sys.exc_info() + if exc: + py.builtin._reraise(*exc) + + def _teardown_with_finalization(self, colitem): + self._callfinalizers(colitem) + if hasattr(colitem, "teardown"): + colitem.teardown() + for colitem in self._finalizers: + assert ( + colitem is None or colitem in self.stack or isinstance(colitem, tuple) + ) + + def teardown_all(self): + while self.stack: + self._pop_and_teardown() + for key in list(self._finalizers): + self._teardown_with_finalization(key) + assert not self._finalizers + + def teardown_exact(self, item, nextitem): + needed_collectors = nextitem and nextitem.listchain() or [] + self._teardown_towards(needed_collectors) + + def _teardown_towards(self, needed_collectors): + exc = None + while self.stack: + if self.stack == needed_collectors[:len(self.stack)]: + break + try: + self._pop_and_teardown() + except TEST_OUTCOME: + # XXX Only first exception will be seen by user, + # ideally all should be reported. + if exc is None: + exc = sys.exc_info() + if exc: + py.builtin._reraise(*exc) + + def prepare(self, colitem): + """ setup objects along the collector chain to the test-method + and teardown previously setup objects.""" + needed_collectors = colitem.listchain() + self._teardown_towards(needed_collectors) + + # check if the last collection node has raised an error + for col in self.stack: + if hasattr(col, "_prepare_exc"): + py.builtin._reraise(*col._prepare_exc) + for col in needed_collectors[len(self.stack):]: + self.stack.append(col) + try: + col.setup() + except TEST_OUTCOME: + col._prepare_exc = sys.exc_info() + raise + + +def collect_one_node(collector): + ihook = collector.ihook + ihook.pytest_collectstart(collector=collector) + rep = ihook.pytest_make_collect_report(collector=collector) + call = rep.__dict__.pop("call", None) + if call and check_interactive_exception(call, rep): + ihook.pytest_exception_interact(node=collector, call=call, report=rep) + return rep diff --git a/third_party/python/pytest/src/_pytest/setuponly.py b/third_party/python/pytest/src/_pytest/setuponly.py new file mode 100644 index 0000000000..81240d9d05 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/setuponly.py @@ -0,0 +1,84 @@ +from __future__ import absolute_import, division, print_function + +import pytest +import sys + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--setuponly", + "--setup-only", + action="store_true", + help="only setup fixtures, do not execute tests.", + ) + group.addoption( + "--setupshow", + "--setup-show", + action="store_true", + help="show setup of fixtures while executing tests.", + ) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_fixture_setup(fixturedef, request): + yield + config = request.config + if config.option.setupshow: + if hasattr(request, "param"): + # Save the fixture parameter so ._show_fixture_action() can + # display it now and during the teardown (in .finish()). + if fixturedef.ids: + if callable(fixturedef.ids): + fixturedef.cached_param = fixturedef.ids(request.param) + else: + fixturedef.cached_param = fixturedef.ids[request.param_index] + else: + fixturedef.cached_param = request.param + _show_fixture_action(fixturedef, "SETUP") + + +def pytest_fixture_post_finalizer(fixturedef): + if hasattr(fixturedef, "cached_result"): + config = fixturedef._fixturemanager.config + if config.option.setupshow: + _show_fixture_action(fixturedef, "TEARDOWN") + if hasattr(fixturedef, "cached_param"): + del fixturedef.cached_param + + +def _show_fixture_action(fixturedef, msg): + config = fixturedef._fixturemanager.config + capman = config.pluginmanager.getplugin("capturemanager") + if capman: + out, err = capman.suspend_global_capture() + + tw = config.get_terminal_writer() + tw.line() + tw.write(" " * 2 * fixturedef.scopenum) + tw.write( + "{step} {scope} {fixture}".format( + step=msg.ljust(8), # align the output to TEARDOWN + scope=fixturedef.scope[0].upper(), + fixture=fixturedef.argname, + ) + ) + + if msg == "SETUP": + deps = sorted(arg for arg in fixturedef.argnames if arg != "request") + if deps: + tw.write(" (fixtures used: {})".format(", ".join(deps))) + + if hasattr(fixturedef, "cached_param"): + tw.write("[{}]".format(fixturedef.cached_param)) + + if capman: + capman.resume_global_capture() + sys.stdout.write(out) + sys.stderr.write(err) + + +@pytest.hookimpl(tryfirst=True) +def pytest_cmdline_main(config): + if config.option.setuponly: + config.option.setupshow = True diff --git a/third_party/python/pytest/src/_pytest/setupplan.py b/third_party/python/pytest/src/_pytest/setupplan.py new file mode 100644 index 0000000000..23f4f97e6d --- /dev/null +++ b/third_party/python/pytest/src/_pytest/setupplan.py @@ -0,0 +1,29 @@ +from __future__ import absolute_import, division, print_function + +import pytest + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--setupplan", + "--setup-plan", + action="store_true", + help="show what fixtures and tests would be executed but " + "don't execute anything.", + ) + + +@pytest.hookimpl(tryfirst=True) +def pytest_fixture_setup(fixturedef, request): + # Will return a dummy fixture if the setuponly option is provided. + if request.config.option.setupplan: + fixturedef.cached_result = (None, None, None) + return fixturedef.cached_result + + +@pytest.hookimpl(tryfirst=True) +def pytest_cmdline_main(config): + if config.option.setupplan: + config.option.setuponly = True + config.option.setupshow = True diff --git a/third_party/python/pytest/src/_pytest/skipping.py b/third_party/python/pytest/src/_pytest/skipping.py new file mode 100644 index 0000000000..a348d5484c --- /dev/null +++ b/third_party/python/pytest/src/_pytest/skipping.py @@ -0,0 +1,293 @@ +""" support for skip/xfail functions and markers. """ +from __future__ import absolute_import, division, print_function + +from _pytest.config import hookimpl +from _pytest.mark.evaluate import MarkEvaluator +from _pytest.outcomes import fail, skip, xfail + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--runxfail", + action="store_true", + dest="runxfail", + default=False, + help="run tests even if they are marked xfail", + ) + + parser.addini( + "xfail_strict", + "default for the strict parameter of xfail " + "markers when not given explicitly (default: False)", + default=False, + type="bool", + ) + + +def pytest_configure(config): + if config.option.runxfail: + # yay a hack + import pytest + + old = pytest.xfail + config._cleanup.append(lambda: setattr(pytest, "xfail", old)) + + def nop(*args, **kwargs): + pass + + nop.Exception = xfail.Exception + setattr(pytest, "xfail", nop) + + config.addinivalue_line( + "markers", + "skip(reason=None): skip the given test function with an optional reason. " + 'Example: skip(reason="no way of currently testing this") skips the ' + "test.", + ) + config.addinivalue_line( + "markers", + "skipif(condition): skip the given test function if eval(condition) " + "results in a True value. Evaluation happens within the " + "module global context. Example: skipif('sys.platform == \"win32\"') " + "skips the test if we are on the win32 platform. see " + "http://pytest.org/latest/skipping.html", + ) + config.addinivalue_line( + "markers", + "xfail(condition, reason=None, run=True, raises=None, strict=False): " + "mark the test function as an expected failure if eval(condition) " + "has a True value. Optionally specify a reason for better reporting " + "and run=False if you don't even want to execute the test function. " + "If only specific exception(s) are expected, you can list them in " + "raises, and if the test fails in other ways, it will be reported as " + "a true failure. See http://pytest.org/latest/skipping.html", + ) + + +@hookimpl(tryfirst=True) +def pytest_runtest_setup(item): + # Check if skip or skipif are specified as pytest marks + item._skipped_by_mark = False + eval_skipif = MarkEvaluator(item, "skipif") + if eval_skipif.istrue(): + item._skipped_by_mark = True + skip(eval_skipif.getexplanation()) + + for skip_info in item.iter_markers(name="skip"): + item._skipped_by_mark = True + if "reason" in skip_info.kwargs: + skip(skip_info.kwargs["reason"]) + elif skip_info.args: + skip(skip_info.args[0]) + else: + skip("unconditional skip") + + item._evalxfail = MarkEvaluator(item, "xfail") + check_xfail_no_run(item) + + +@hookimpl(hookwrapper=True) +def pytest_pyfunc_call(pyfuncitem): + check_xfail_no_run(pyfuncitem) + outcome = yield + passed = outcome.excinfo is None + if passed: + check_strict_xfail(pyfuncitem) + + +def check_xfail_no_run(item): + """check xfail(run=False)""" + if not item.config.option.runxfail: + evalxfail = item._evalxfail + if evalxfail.istrue(): + if not evalxfail.get("run", True): + xfail("[NOTRUN] " + evalxfail.getexplanation()) + + +def check_strict_xfail(pyfuncitem): + """check xfail(strict=True) for the given PASSING test""" + evalxfail = pyfuncitem._evalxfail + if evalxfail.istrue(): + strict_default = pyfuncitem.config.getini("xfail_strict") + is_strict_xfail = evalxfail.get("strict", strict_default) + if is_strict_xfail: + del pyfuncitem._evalxfail + explanation = evalxfail.getexplanation() + fail("[XPASS(strict)] " + explanation, pytrace=False) + + +@hookimpl(hookwrapper=True) +def pytest_runtest_makereport(item, call): + outcome = yield + rep = outcome.get_result() + evalxfail = getattr(item, "_evalxfail", None) + # unitttest special case, see setting of _unexpectedsuccess + if hasattr(item, "_unexpectedsuccess") and rep.when == "call": + from _pytest.compat import _is_unittest_unexpected_success_a_failure + + if item._unexpectedsuccess: + rep.longrepr = "Unexpected success: {}".format(item._unexpectedsuccess) + else: + rep.longrepr = "Unexpected success" + if _is_unittest_unexpected_success_a_failure(): + rep.outcome = "failed" + else: + rep.outcome = "passed" + rep.wasxfail = rep.longrepr + elif item.config.option.runxfail: + pass # don't interefere + elif call.excinfo and call.excinfo.errisinstance(xfail.Exception): + rep.wasxfail = "reason: " + call.excinfo.value.msg + rep.outcome = "skipped" + elif evalxfail and not rep.skipped and evalxfail.wasvalid() and evalxfail.istrue(): + if call.excinfo: + if evalxfail.invalidraise(call.excinfo.value): + rep.outcome = "failed" + else: + rep.outcome = "skipped" + rep.wasxfail = evalxfail.getexplanation() + elif call.when == "call": + strict_default = item.config.getini("xfail_strict") + is_strict_xfail = evalxfail.get("strict", strict_default) + explanation = evalxfail.getexplanation() + if is_strict_xfail: + rep.outcome = "failed" + rep.longrepr = "[XPASS(strict)] {}".format(explanation) + else: + rep.outcome = "passed" + rep.wasxfail = explanation + elif getattr(item, "_skipped_by_mark", False) and rep.skipped and type( + rep.longrepr + ) is tuple: + # skipped by mark.skipif; change the location of the failure + # to point to the item definition, otherwise it will display + # the location of where the skip exception was raised within pytest + filename, line, reason = rep.longrepr + filename, line = item.location[:2] + rep.longrepr = filename, line, reason + + +# called by terminalreporter progress reporting + + +def pytest_report_teststatus(report): + if hasattr(report, "wasxfail"): + if report.skipped: + return "xfailed", "x", "xfail" + elif report.passed: + return "xpassed", "X", ("XPASS", {"yellow": True}) + + +# called by the terminalreporter instance/plugin + + +def pytest_terminal_summary(terminalreporter): + tr = terminalreporter + if not tr.reportchars: + # for name in "xfailed skipped failed xpassed": + # if not tr.stats.get(name, 0): + # tr.write_line("HINT: use '-r' option to see extra " + # "summary info about tests") + # break + return + + lines = [] + for char in tr.reportchars: + action = REPORTCHAR_ACTIONS.get(char, lambda tr, lines: None) + action(terminalreporter, lines) + + if lines: + tr._tw.sep("=", "short test summary info") + for line in lines: + tr._tw.line(line) + + +def show_simple(terminalreporter, lines, stat, format): + failed = terminalreporter.stats.get(stat) + if failed: + for rep in failed: + pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) + lines.append(format % (pos,)) + + +def show_xfailed(terminalreporter, lines): + xfailed = terminalreporter.stats.get("xfailed") + if xfailed: + for rep in xfailed: + pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) + reason = rep.wasxfail + lines.append("XFAIL %s" % (pos,)) + if reason: + lines.append(" " + str(reason)) + + +def show_xpassed(terminalreporter, lines): + xpassed = terminalreporter.stats.get("xpassed") + if xpassed: + for rep in xpassed: + pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid) + reason = rep.wasxfail + lines.append("XPASS %s %s" % (pos, reason)) + + +def folded_skips(skipped): + d = {} + for event in skipped: + key = event.longrepr + assert len(key) == 3, (event, key) + keywords = getattr(event, "keywords", {}) + # folding reports with global pytestmark variable + # this is workaround, because for now we cannot identify the scope of a skip marker + # TODO: revisit after marks scope would be fixed + when = getattr(event, "when", None) + if when == "setup" and "skip" in keywords and "pytestmark" not in keywords: + key = (key[0], None, key[2]) + d.setdefault(key, []).append(event) + values = [] + for key, events in d.items(): + values.append((len(events),) + key) + return values + + +def show_skipped(terminalreporter, lines): + tr = terminalreporter + skipped = tr.stats.get("skipped", []) + if skipped: + # if not tr.hasopt('skipped'): + # tr.write_line( + # "%d skipped tests, specify -rs for more info" % + # len(skipped)) + # return + fskips = folded_skips(skipped) + if fskips: + # tr.write_sep("_", "skipped test summary") + for num, fspath, lineno, reason in fskips: + if reason.startswith("Skipped: "): + reason = reason[9:] + if lineno is not None: + lines.append( + "SKIP [%d] %s:%d: %s" % (num, fspath, lineno + 1, reason) + ) + else: + lines.append("SKIP [%d] %s: %s" % (num, fspath, reason)) + + +def shower(stat, format): + + def show_(terminalreporter, lines): + return show_simple(terminalreporter, lines, stat, format) + + return show_ + + +REPORTCHAR_ACTIONS = { + "x": show_xfailed, + "X": show_xpassed, + "f": shower("failed", "FAIL %s"), + "F": shower("failed", "FAIL %s"), + "s": show_skipped, + "S": show_skipped, + "p": shower("passed", "PASSED %s"), + "E": shower("error", "ERROR %s"), +} diff --git a/third_party/python/pytest/src/_pytest/terminal.py b/third_party/python/pytest/src/_pytest/terminal.py new file mode 100644 index 0000000000..9c4eec7531 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/terminal.py @@ -0,0 +1,829 @@ +""" terminal reporting of the full testing process. + +This is a good source for looking at the various reporting hooks. +""" +from __future__ import absolute_import, division, print_function + +import itertools +import platform +import sys +import time + +import pluggy +import py +import six +from more_itertools import collapse + +import pytest +from _pytest import nodes +from _pytest.main import ( + EXIT_OK, + EXIT_TESTSFAILED, + EXIT_INTERRUPTED, + EXIT_USAGEERROR, + EXIT_NOTESTSCOLLECTED, +) + + +import argparse + + +class MoreQuietAction(argparse.Action): + """ + a modified copy of the argparse count action which counts down and updates + the legacy quiet attribute at the same time + + used to unify verbosity handling + """ + + def __init__(self, option_strings, dest, default=None, required=False, help=None): + super(MoreQuietAction, self).__init__( + option_strings=option_strings, + dest=dest, + nargs=0, + default=default, + required=required, + help=help, + ) + + def __call__(self, parser, namespace, values, option_string=None): + new_count = getattr(namespace, self.dest, 0) - 1 + setattr(namespace, self.dest, new_count) + # todo Deprecate config.quiet + namespace.quiet = getattr(namespace, "quiet", 0) + 1 + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "reporting", after="general") + group._addoption( + "-v", + "--verbose", + action="count", + default=0, + dest="verbose", + help="increase verbosity.", + ), + group._addoption( + "-q", + "--quiet", + action=MoreQuietAction, + default=0, + dest="verbose", + help="decrease verbosity.", + ), + group._addoption( + "--verbosity", dest="verbose", type=int, default=0, help="set verbosity" + ) + group._addoption( + "-r", + action="store", + dest="reportchars", + default="", + metavar="chars", + help="show extra test summary info as specified by chars (f)ailed, " + "(E)error, (s)skipped, (x)failed, (X)passed, " + "(p)passed, (P)passed with output, (a)all except pP. " + "Warnings are displayed at all times except when " + "--disable-warnings is set", + ) + group._addoption( + "--disable-warnings", + "--disable-pytest-warnings", + default=False, + dest="disable_warnings", + action="store_true", + help="disable warnings summary", + ) + group._addoption( + "-l", + "--showlocals", + action="store_true", + dest="showlocals", + default=False, + help="show locals in tracebacks (disabled by default).", + ) + group._addoption( + "--tb", + metavar="style", + action="store", + dest="tbstyle", + default="auto", + choices=["auto", "long", "short", "no", "line", "native"], + help="traceback print mode (auto/long/short/line/native/no).", + ) + group._addoption( + "--show-capture", + action="store", + dest="showcapture", + choices=["no", "stdout", "stderr", "log", "all"], + default="all", + help="Controls how captured stdout/stderr/log is shown on failed tests. " + "Default is 'all'.", + ) + group._addoption( + "--fulltrace", + "--full-trace", + action="store_true", + default=False, + help="don't cut any tracebacks (default is to cut).", + ) + group._addoption( + "--color", + metavar="color", + action="store", + dest="color", + default="auto", + choices=["yes", "no", "auto"], + help="color terminal output (yes/no/auto).", + ) + + parser.addini( + "console_output_style", + help="console output: classic or with additional progress information (classic|progress).", + default="progress", + ) + + +def pytest_configure(config): + reporter = TerminalReporter(config, sys.stdout) + config.pluginmanager.register(reporter, "terminalreporter") + if config.option.debug or config.option.traceconfig: + + def mywriter(tags, args): + msg = " ".join(map(str, args)) + reporter.write_line("[traceconfig] " + msg) + + config.trace.root.setprocessor("pytest:config", mywriter) + + +def getreportopt(config): + reportopts = "" + reportchars = config.option.reportchars + if not config.option.disable_warnings and "w" not in reportchars: + reportchars += "w" + elif config.option.disable_warnings and "w" in reportchars: + reportchars = reportchars.replace("w", "") + if reportchars: + for char in reportchars: + if char not in reportopts and char != "a": + reportopts += char + elif char == "a": + reportopts = "fEsxXw" + return reportopts + + +def pytest_report_teststatus(report): + if report.passed: + letter = "." + elif report.skipped: + letter = "s" + elif report.failed: + letter = "F" + if report.when != "call": + letter = "f" + return report.outcome, letter, report.outcome.upper() + + +class WarningReport(object): + """ + Simple structure to hold warnings information captured by ``pytest_logwarning``. + """ + + def __init__(self, code, message, nodeid=None, fslocation=None): + """ + :param code: unused + :param str message: user friendly message about the warning + :param str|None nodeid: node id that generated the warning (see ``get_location``). + :param tuple|py.path.local fslocation: + file system location of the source of the warning (see ``get_location``). + """ + self.code = code + self.message = message + self.nodeid = nodeid + self.fslocation = fslocation + + def get_location(self, config): + """ + Returns the more user-friendly information about the location + of a warning, or None. + """ + if self.nodeid: + return self.nodeid + if self.fslocation: + if isinstance(self.fslocation, tuple) and len(self.fslocation) >= 2: + filename, linenum = self.fslocation[:2] + relpath = py.path.local(filename).relto(config.invocation_dir) + return "%s:%s" % (relpath, linenum) + else: + return str(self.fslocation) + return None + + +class TerminalReporter(object): + + def __init__(self, config, file=None): + import _pytest.config + + self.config = config + self.verbosity = self.config.option.verbose + self.showheader = self.verbosity >= 0 + self.showfspath = self.verbosity >= 0 + self.showlongtestinfo = self.verbosity > 0 + self._numcollected = 0 + self._session = None + + self.stats = {} + self.startdir = py.path.local() + if file is None: + file = sys.stdout + self._tw = _pytest.config.create_terminal_writer(config, file) + # self.writer will be deprecated in pytest-3.4 + self.writer = self._tw + self._screen_width = self._tw.fullwidth + self.currentfspath = None + self.reportchars = getreportopt(config) + self.hasmarkup = self._tw.hasmarkup + self.isatty = file.isatty() + self._progress_nodeids_reported = set() + self._show_progress_info = self._determine_show_progress_info() + + def _determine_show_progress_info(self): + """Return True if we should display progress information based on the current config""" + # do not show progress if we are not capturing output (#3038) + if self.config.getoption("capture") == "no": + return False + # do not show progress if we are showing fixture setup/teardown + if self.config.getoption("setupshow"): + return False + return self.config.getini("console_output_style") == "progress" + + def hasopt(self, char): + char = {"xfailed": "x", "skipped": "s"}.get(char, char) + return char in self.reportchars + + def write_fspath_result(self, nodeid, res): + fspath = self.config.rootdir.join(nodeid.split("::")[0]) + if fspath != self.currentfspath: + if self.currentfspath is not None: + self._write_progress_information_filling_space() + self.currentfspath = fspath + fspath = self.startdir.bestrelpath(fspath) + self._tw.line() + self._tw.write(fspath + " ") + self._tw.write(res) + + def write_ensure_prefix(self, prefix, extra="", **kwargs): + if self.currentfspath != prefix: + self._tw.line() + self.currentfspath = prefix + self._tw.write(prefix) + if extra: + self._tw.write(extra, **kwargs) + self.currentfspath = -2 + + def ensure_newline(self): + if self.currentfspath: + self._tw.line() + self.currentfspath = None + + def write(self, content, **markup): + self._tw.write(content, **markup) + + def write_line(self, line, **markup): + if not isinstance(line, six.text_type): + line = six.text_type(line, errors="replace") + self.ensure_newline() + self._tw.line(line, **markup) + + def rewrite(self, line, **markup): + """ + Rewinds the terminal cursor to the beginning and writes the given line. + + :kwarg erase: if True, will also add spaces until the full terminal width to ensure + previous lines are properly erased. + + The rest of the keyword arguments are markup instructions. + """ + erase = markup.pop("erase", False) + if erase: + fill_count = self._tw.fullwidth - len(line) - 1 + fill = " " * fill_count + else: + fill = "" + line = str(line) + self._tw.write("\r" + line + fill, **markup) + + def write_sep(self, sep, title=None, **markup): + self.ensure_newline() + self._tw.sep(sep, title, **markup) + + def section(self, title, sep="=", **kw): + self._tw.sep(sep, title, **kw) + + def line(self, msg, **kw): + self._tw.line(msg, **kw) + + def pytest_internalerror(self, excrepr): + for line in six.text_type(excrepr).split("\n"): + self.write_line("INTERNALERROR> " + line) + return 1 + + def pytest_logwarning(self, code, fslocation, message, nodeid): + warnings = self.stats.setdefault("warnings", []) + warning = WarningReport( + code=code, fslocation=fslocation, message=message, nodeid=nodeid + ) + warnings.append(warning) + + def pytest_plugin_registered(self, plugin): + if self.config.option.traceconfig: + msg = "PLUGIN registered: %s" % (plugin,) + # XXX this event may happen during setup/teardown time + # which unfortunately captures our output here + # which garbles our output if we use self.write_line + self.write_line(msg) + + def pytest_deselected(self, items): + self.stats.setdefault("deselected", []).extend(items) + + def pytest_runtest_logstart(self, nodeid, location): + # ensure that the path is printed before the + # 1st test of a module starts running + if self.showlongtestinfo: + line = self._locationline(nodeid, *location) + self.write_ensure_prefix(line, "") + elif self.showfspath: + fsid = nodeid.split("::")[0] + self.write_fspath_result(fsid, "") + + def pytest_runtest_logreport(self, report): + rep = report + res = self.config.hook.pytest_report_teststatus(report=rep) + cat, letter, word = res + if isinstance(word, tuple): + word, markup = word + else: + markup = None + self.stats.setdefault(cat, []).append(rep) + self._tests_ran = True + if not letter and not word: + # probably passed setup/teardown + return + running_xdist = hasattr(rep, "node") + if self.verbosity <= 0: + if not running_xdist and self.showfspath: + self.write_fspath_result(rep.nodeid, letter) + else: + self._tw.write(letter) + else: + self._progress_nodeids_reported.add(rep.nodeid) + if markup is None: + if rep.passed: + markup = {"green": True} + elif rep.failed: + markup = {"red": True} + elif rep.skipped: + markup = {"yellow": True} + else: + markup = {} + line = self._locationline(rep.nodeid, *rep.location) + if not running_xdist: + self.write_ensure_prefix(line, word, **markup) + if self._show_progress_info: + self._write_progress_information_filling_space() + else: + self.ensure_newline() + self._tw.write("[%s]" % rep.node.gateway.id) + if self._show_progress_info: + self._tw.write( + self._get_progress_information_message() + " ", cyan=True + ) + else: + self._tw.write(" ") + self._tw.write(word, **markup) + self._tw.write(" " + line) + self.currentfspath = -2 + + def pytest_runtest_logfinish(self, nodeid): + if self.verbosity <= 0 and self._show_progress_info: + self._progress_nodeids_reported.add(nodeid) + last_item = len( + self._progress_nodeids_reported + ) == self._session.testscollected + if last_item: + self._write_progress_information_filling_space() + else: + past_edge = self._tw.chars_on_current_line + self._PROGRESS_LENGTH + 1 >= self._screen_width + if past_edge: + msg = self._get_progress_information_message() + self._tw.write(msg + "\n", cyan=True) + + _PROGRESS_LENGTH = len(" [100%]") + + def _get_progress_information_message(self): + if self.config.getoption("capture") == "no": + return "" + collected = self._session.testscollected + if collected: + progress = len(self._progress_nodeids_reported) * 100 // collected + return " [{:3d}%]".format(progress) + return " [100%]" + + def _write_progress_information_filling_space(self): + msg = self._get_progress_information_message() + fill = " " * ( + self._tw.fullwidth - self._tw.chars_on_current_line - len(msg) - 1 + ) + self.write(fill + msg, cyan=True) + + def pytest_collection(self): + if not self.isatty and self.config.option.verbose >= 1: + self.write("collecting ... ", bold=True) + + def pytest_collectreport(self, report): + if report.failed: + self.stats.setdefault("error", []).append(report) + elif report.skipped: + self.stats.setdefault("skipped", []).append(report) + items = [x for x in report.result if isinstance(x, pytest.Item)] + self._numcollected += len(items) + if self.isatty: + # self.write_fspath_result(report.nodeid, 'E') + self.report_collect() + + def report_collect(self, final=False): + if self.config.option.verbose < 0: + return + + errors = len(self.stats.get("error", [])) + skipped = len(self.stats.get("skipped", [])) + deselected = len(self.stats.get("deselected", [])) + if final: + line = "collected " + else: + line = "collecting " + line += str(self._numcollected) + " item" + ( + "" if self._numcollected == 1 else "s" + ) + if errors: + line += " / %d errors" % errors + if deselected: + line += " / %d deselected" % deselected + if skipped: + line += " / %d skipped" % skipped + if self.isatty: + self.rewrite(line, bold=True, erase=True) + if final: + self.write("\n") + else: + self.write_line(line) + + @pytest.hookimpl(trylast=True) + def pytest_collection_modifyitems(self): + self.report_collect(True) + + @pytest.hookimpl(trylast=True) + def pytest_sessionstart(self, session): + self._session = session + self._sessionstarttime = time.time() + if not self.showheader: + return + self.write_sep("=", "test session starts", bold=True) + verinfo = platform.python_version() + msg = "platform %s -- Python %s" % (sys.platform, verinfo) + if hasattr(sys, "pypy_version_info"): + verinfo = ".".join(map(str, sys.pypy_version_info[:3])) + msg += "[pypy-%s-%s]" % (verinfo, sys.pypy_version_info[3]) + msg += ", pytest-%s, py-%s, pluggy-%s" % ( + pytest.__version__, py.__version__, pluggy.__version__ + ) + if ( + self.verbosity > 0 + or self.config.option.debug + or getattr(self.config.option, "pastebin", None) + ): + msg += " -- " + str(sys.executable) + self.write_line(msg) + lines = self.config.hook.pytest_report_header( + config=self.config, startdir=self.startdir + ) + self._write_report_lines_from_hooks(lines) + + def _write_report_lines_from_hooks(self, lines): + lines.reverse() + for line in collapse(lines): + self.write_line(line) + + def pytest_report_header(self, config): + inifile = "" + if config.inifile: + inifile = " " + config.rootdir.bestrelpath(config.inifile) + lines = ["rootdir: %s, inifile:%s" % (config.rootdir, inifile)] + + plugininfo = config.pluginmanager.list_plugin_distinfo() + if plugininfo: + + lines.append("plugins: %s" % ", ".join(_plugin_nameversions(plugininfo))) + return lines + + def pytest_collection_finish(self, session): + if self.config.option.collectonly: + self._printcollecteditems(session.items) + if self.stats.get("failed"): + self._tw.sep("!", "collection failures") + for rep in self.stats.get("failed"): + rep.toterminal(self._tw) + return 1 + return 0 + lines = self.config.hook.pytest_report_collectionfinish( + config=self.config, startdir=self.startdir, items=session.items + ) + self._write_report_lines_from_hooks(lines) + + def _printcollecteditems(self, items): + # to print out items and their parent collectors + # we take care to leave out Instances aka () + # because later versions are going to get rid of them anyway + if self.config.option.verbose < 0: + if self.config.option.verbose < -1: + counts = {} + for item in items: + name = item.nodeid.split("::", 1)[0] + counts[name] = counts.get(name, 0) + 1 + for name, count in sorted(counts.items()): + self._tw.line("%s: %d" % (name, count)) + else: + for item in items: + nodeid = item.nodeid + nodeid = nodeid.replace("::()::", "::") + self._tw.line(nodeid) + return + stack = [] + indent = "" + for item in items: + needed_collectors = item.listchain()[1:] # strip root node + while stack: + if stack == needed_collectors[:len(stack)]: + break + stack.pop() + for col in needed_collectors[len(stack):]: + stack.append(col) + # if col.name == "()": + # continue + indent = (len(stack) - 1) * " " + self._tw.line("%s%s" % (indent, col)) + + @pytest.hookimpl(hookwrapper=True) + def pytest_sessionfinish(self, exitstatus): + outcome = yield + outcome.get_result() + self._tw.line("") + summary_exit_codes = ( + EXIT_OK, + EXIT_TESTSFAILED, + EXIT_INTERRUPTED, + EXIT_USAGEERROR, + EXIT_NOTESTSCOLLECTED, + ) + if exitstatus in summary_exit_codes: + self.config.hook.pytest_terminal_summary( + terminalreporter=self, exitstatus=exitstatus + ) + if exitstatus == EXIT_INTERRUPTED: + self._report_keyboardinterrupt() + del self._keyboardinterrupt_memo + self.summary_stats() + + @pytest.hookimpl(hookwrapper=True) + def pytest_terminal_summary(self): + self.summary_errors() + self.summary_failures() + yield + self.summary_warnings() + self.summary_passes() + + def pytest_keyboard_interrupt(self, excinfo): + self._keyboardinterrupt_memo = excinfo.getrepr(funcargs=True) + + def pytest_unconfigure(self): + if hasattr(self, "_keyboardinterrupt_memo"): + self._report_keyboardinterrupt() + + def _report_keyboardinterrupt(self): + excrepr = self._keyboardinterrupt_memo + msg = excrepr.reprcrash.message + self.write_sep("!", msg) + if "KeyboardInterrupt" in msg: + if self.config.option.fulltrace: + excrepr.toterminal(self._tw) + else: + excrepr.reprcrash.toterminal(self._tw) + self._tw.line( + "(to show a full traceback on KeyboardInterrupt use --fulltrace)", + yellow=True, + ) + + def _locationline(self, nodeid, fspath, lineno, domain): + + def mkrel(nodeid): + line = self.config.cwd_relative_nodeid(nodeid) + if domain and line.endswith(domain): + line = line[:-len(domain)] + values = domain.split("[") + values[0] = values[0].replace(".", "::") # don't replace '.' in params + line += "[".join(values) + return line + + # collect_fspath comes from testid which has a "/"-normalized path + + if fspath: + res = mkrel(nodeid).replace("::()", "") # parens-normalization + if nodeid.split("::")[0] != fspath.replace("\\", nodes.SEP): + res += " <- " + self.startdir.bestrelpath(fspath) + else: + res = "[location]" + return res + " " + + def _getfailureheadline(self, rep): + if hasattr(rep, "location"): + fspath, lineno, domain = rep.location + return domain + else: + return "test session" # XXX? + + def _getcrashline(self, rep): + try: + return str(rep.longrepr.reprcrash) + except AttributeError: + try: + return str(rep.longrepr)[:50] + except AttributeError: + return "" + + # + # summaries for sessionfinish + # + def getreports(self, name): + values = [] + for x in self.stats.get(name, []): + if not hasattr(x, "_pdbshown"): + values.append(x) + return values + + def summary_warnings(self): + if self.hasopt("w"): + all_warnings = self.stats.get("warnings") + if not all_warnings: + return + + grouped = itertools.groupby( + all_warnings, key=lambda wr: wr.get_location(self.config) + ) + + self.write_sep("=", "warnings summary", yellow=True, bold=False) + for location, warning_records in grouped: + self._tw.line(str(location) if location else "<undetermined location>") + for w in warning_records: + lines = w.message.splitlines() + indented = "\n".join(" " + x for x in lines) + self._tw.line(indented) + self._tw.line() + self._tw.line("-- Docs: http://doc.pytest.org/en/latest/warnings.html") + + def summary_passes(self): + if self.config.option.tbstyle != "no": + if self.hasopt("P"): + reports = self.getreports("passed") + if not reports: + return + self.write_sep("=", "PASSES") + for rep in reports: + msg = self._getfailureheadline(rep) + self.write_sep("_", msg) + self._outrep_summary(rep) + + def print_teardown_sections(self, rep): + for secname, content in rep.sections: + if "teardown" in secname: + self._tw.sep("-", secname) + if content[-1:] == "\n": + content = content[:-1] + self._tw.line(content) + + def summary_failures(self): + if self.config.option.tbstyle != "no": + reports = self.getreports("failed") + if not reports: + return + self.write_sep("=", "FAILURES") + for rep in reports: + if self.config.option.tbstyle == "line": + line = self._getcrashline(rep) + self.write_line(line) + else: + msg = self._getfailureheadline(rep) + markup = {"red": True, "bold": True} + self.write_sep("_", msg, **markup) + self._outrep_summary(rep) + for report in self.getreports(""): + if report.nodeid == rep.nodeid and report.when == "teardown": + self.print_teardown_sections(report) + + def summary_errors(self): + if self.config.option.tbstyle != "no": + reports = self.getreports("error") + if not reports: + return + self.write_sep("=", "ERRORS") + for rep in self.stats["error"]: + msg = self._getfailureheadline(rep) + if not hasattr(rep, "when"): + # collect + msg = "ERROR collecting " + msg + elif rep.when == "setup": + msg = "ERROR at setup of " + msg + elif rep.when == "teardown": + msg = "ERROR at teardown of " + msg + self.write_sep("_", msg) + self._outrep_summary(rep) + + def _outrep_summary(self, rep): + rep.toterminal(self._tw) + showcapture = self.config.option.showcapture + if showcapture == "no": + return + for secname, content in rep.sections: + if showcapture != "all" and showcapture not in secname: + continue + self._tw.sep("-", secname) + if content[-1:] == "\n": + content = content[:-1] + self._tw.line(content) + + def summary_stats(self): + session_duration = time.time() - self._sessionstarttime + (line, color) = build_summary_stats_line(self.stats) + msg = "%s in %.2f seconds" % (line, session_duration) + markup = {color: True, "bold": True} + + if self.verbosity >= 0: + self.write_sep("=", msg, **markup) + if self.verbosity == -1: + self.write_line(msg, **markup) + + +def repr_pythonversion(v=None): + if v is None: + v = sys.version_info + try: + return "%s.%s.%s-%s-%s" % v + except (TypeError, ValueError): + return str(v) + + +def build_summary_stats_line(stats): + keys = ( + "failed passed skipped deselected " "xfailed xpassed warnings error" + ).split() + unknown_key_seen = False + for key in stats.keys(): + if key not in keys: + if key: # setup/teardown reports have an empty key, ignore them + keys.append(key) + unknown_key_seen = True + parts = [] + for key in keys: + val = stats.get(key, None) + if val: + parts.append("%d %s" % (len(val), key)) + + if parts: + line = ", ".join(parts) + else: + line = "no tests ran" + + if "failed" in stats or "error" in stats: + color = "red" + elif "warnings" in stats or unknown_key_seen: + color = "yellow" + elif "passed" in stats: + color = "green" + else: + color = "yellow" + + return (line, color) + + +def _plugin_nameversions(plugininfo): + values = [] + for plugin, dist in plugininfo: + # gets us name and version! + name = "{dist.project_name}-{dist.version}".format(dist=dist) + # questionable convenience, but it keeps things short + if name.startswith("pytest-"): + name = name[7:] + # we decided to print python package names + # they can have more than one plugin + if name not in values: + values.append(name) + return values diff --git a/third_party/python/pytest/src/_pytest/tmpdir.py b/third_party/python/pytest/src/_pytest/tmpdir.py new file mode 100644 index 0000000000..260d284223 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/tmpdir.py @@ -0,0 +1,131 @@ +""" support for providing temporary directories to test functions. """ +from __future__ import absolute_import, division, print_function + +import re + +import pytest +import py +from _pytest.monkeypatch import MonkeyPatch + + +class TempdirFactory(object): + """Factory for temporary directories under the common base temp directory. + + The base directory can be configured using the ``--basetemp`` option. + """ + + def __init__(self, config): + self.config = config + self.trace = config.trace.get("tmpdir") + + def ensuretemp(self, string, dir=1): + """ (deprecated) return temporary directory path with + the given string as the trailing part. It is usually + better to use the 'tmpdir' function argument which + provides an empty unique-per-test-invocation directory + and is guaranteed to be empty. + """ + # py.log._apiwarn(">1.1", "use tmpdir function argument") + return self.getbasetemp().ensure(string, dir=dir) + + def mktemp(self, basename, numbered=True): + """Create a subdirectory of the base temporary directory and return it. + If ``numbered``, ensure the directory is unique by adding a number + prefix greater than any existing one. + """ + basetemp = self.getbasetemp() + if not numbered: + p = basetemp.mkdir(basename) + else: + p = py.path.local.make_numbered_dir( + prefix=basename, keep=0, rootdir=basetemp, lock_timeout=None + ) + self.trace("mktemp", p) + return p + + def getbasetemp(self): + """ return base temporary directory. """ + try: + return self._basetemp + except AttributeError: + basetemp = self.config.option.basetemp + if basetemp: + basetemp = py.path.local(basetemp) + if basetemp.check(): + basetemp.remove() + basetemp.mkdir() + else: + temproot = py.path.local.get_temproot() + user = get_user() + if user: + # use a sub-directory in the temproot to speed-up + # make_numbered_dir() call + rootdir = temproot.join("pytest-of-%s" % user) + else: + rootdir = temproot + rootdir.ensure(dir=1) + basetemp = py.path.local.make_numbered_dir( + prefix="pytest-", rootdir=rootdir + ) + self._basetemp = t = basetemp.realpath() + self.trace("new basetemp", t) + return t + + def finish(self): + self.trace("finish") + + +def get_user(): + """Return the current user name, or None if getuser() does not work + in the current environment (see #1010). + """ + import getpass + + try: + return getpass.getuser() + except (ImportError, KeyError): + return None + + +# backward compatibility +TempdirHandler = TempdirFactory + + +def pytest_configure(config): + """Create a TempdirFactory and attach it to the config object. + + This is to comply with existing plugins which expect the handler to be + available at pytest_configure time, but ideally should be moved entirely + to the tmpdir_factory session fixture. + """ + mp = MonkeyPatch() + t = TempdirFactory(config) + config._cleanup.extend([mp.undo, t.finish]) + mp.setattr(config, "_tmpdirhandler", t, raising=False) + mp.setattr(pytest, "ensuretemp", t.ensuretemp, raising=False) + + +@pytest.fixture(scope="session") +def tmpdir_factory(request): + """Return a TempdirFactory instance for the test session. + """ + return request.config._tmpdirhandler + + +@pytest.fixture +def tmpdir(request, tmpdir_factory): + """Return a temporary directory path object + which is unique to each test function invocation, + created as a sub directory of the base temporary + directory. The returned object is a `py.path.local`_ + path object. + + .. _`py.path.local`: https://py.readthedocs.io/en/latest/path.html + """ + name = request.node.name + name = re.sub(r"[\W]", "_", name) + MAXVAL = 30 + if len(name) > MAXVAL: + name = name[:MAXVAL] + x = tmpdir_factory.mktemp(name, numbered=True) + return x diff --git a/third_party/python/pytest/src/_pytest/unittest.py b/third_party/python/pytest/src/_pytest/unittest.py new file mode 100644 index 0000000000..6ad9fda887 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/unittest.py @@ -0,0 +1,253 @@ +""" discovery and running of std-library "unittest" style tests. """ +from __future__ import absolute_import, division, print_function + +import sys +import traceback + +# for transferring markers +import _pytest._code +from _pytest.config import hookimpl +from _pytest.outcomes import fail, skip, xfail +from _pytest.python import transfer_markers, Class, Module, Function + + +def pytest_pycollect_makeitem(collector, name, obj): + # has unittest been imported and is obj a subclass of its TestCase? + try: + if not issubclass(obj, sys.modules["unittest"].TestCase): + return + except Exception: + return + # yes, so let's collect it + return UnitTestCase(name, parent=collector) + + +class UnitTestCase(Class): + # marker for fixturemanger.getfixtureinfo() + # to declare that our children do not support funcargs + nofuncargs = True + + def setup(self): + cls = self.obj + if getattr(cls, "__unittest_skip__", False): + return # skipped + setup = getattr(cls, "setUpClass", None) + if setup is not None: + setup() + teardown = getattr(cls, "tearDownClass", None) + if teardown is not None: + self.addfinalizer(teardown) + super(UnitTestCase, self).setup() + + def collect(self): + from unittest import TestLoader + + cls = self.obj + if not getattr(cls, "__test__", True): + return + self.session._fixturemanager.parsefactories(self, unittest=True) + loader = TestLoader() + module = self.getparent(Module).obj + foundsomething = False + for name in loader.getTestCaseNames(self.obj): + x = getattr(self.obj, name) + if not getattr(x, "__test__", True): + continue + funcobj = getattr(x, "im_func", x) + transfer_markers(funcobj, cls, module) + yield TestCaseFunction(name, parent=self, callobj=funcobj) + foundsomething = True + + if not foundsomething: + runtest = getattr(self.obj, "runTest", None) + if runtest is not None: + ut = sys.modules.get("twisted.trial.unittest", None) + if ut is None or runtest != ut.TestCase.runTest: + yield TestCaseFunction("runTest", parent=self) + + +class TestCaseFunction(Function): + nofuncargs = True + _excinfo = None + + def setup(self): + self._testcase = self.parent.obj(self.name) + self._fix_unittest_skip_decorator() + self._obj = getattr(self._testcase, self.name) + if hasattr(self._testcase, "setup_method"): + self._testcase.setup_method(self._obj) + if hasattr(self, "_request"): + self._request._fillfixtures() + + def _fix_unittest_skip_decorator(self): + """ + The @unittest.skip decorator calls functools.wraps(self._testcase) + The call to functools.wraps() fails unless self._testcase + has a __name__ attribute. This is usually automatically supplied + if the test is a function or method, but we need to add manually + here. + + See issue #1169 + """ + if sys.version_info[0] == 2: + setattr(self._testcase, "__name__", self.name) + + def teardown(self): + if hasattr(self._testcase, "teardown_method"): + self._testcase.teardown_method(self._obj) + # Allow garbage collection on TestCase instance attributes. + self._testcase = None + self._obj = None + + def startTest(self, testcase): + pass + + def _addexcinfo(self, rawexcinfo): + # unwrap potential exception info (see twisted trial support below) + rawexcinfo = getattr(rawexcinfo, "_rawexcinfo", rawexcinfo) + try: + excinfo = _pytest._code.ExceptionInfo(rawexcinfo) + except TypeError: + try: + try: + values = traceback.format_exception(*rawexcinfo) + values.insert( + 0, + "NOTE: Incompatible Exception Representation, " + "displaying natively:\n\n", + ) + fail("".join(values), pytrace=False) + except (fail.Exception, KeyboardInterrupt): + raise + except: # noqa + fail( + "ERROR: Unknown Incompatible Exception " + "representation:\n%r" % (rawexcinfo,), + pytrace=False, + ) + except KeyboardInterrupt: + raise + except fail.Exception: + excinfo = _pytest._code.ExceptionInfo() + self.__dict__.setdefault("_excinfo", []).append(excinfo) + + def addError(self, testcase, rawexcinfo): + self._addexcinfo(rawexcinfo) + + def addFailure(self, testcase, rawexcinfo): + self._addexcinfo(rawexcinfo) + + def addSkip(self, testcase, reason): + try: + skip(reason) + except skip.Exception: + self._skipped_by_mark = True + self._addexcinfo(sys.exc_info()) + + def addExpectedFailure(self, testcase, rawexcinfo, reason=""): + try: + xfail(str(reason)) + except xfail.Exception: + self._addexcinfo(sys.exc_info()) + + def addUnexpectedSuccess(self, testcase, reason=""): + self._unexpectedsuccess = reason + + def addSuccess(self, testcase): + pass + + def stopTest(self, testcase): + pass + + def _handle_skip(self): + # implements the skipping machinery (see #2137) + # analog to pythons Lib/unittest/case.py:run + testMethod = getattr(self._testcase, self._testcase._testMethodName) + if ( + getattr(self._testcase.__class__, "__unittest_skip__", False) + or getattr(testMethod, "__unittest_skip__", False) + ): + # If the class or method was skipped. + skip_why = ( + getattr(self._testcase.__class__, "__unittest_skip_why__", "") + or getattr(testMethod, "__unittest_skip_why__", "") + ) + try: # PY3, unittest2 on PY2 + self._testcase._addSkip(self, self._testcase, skip_why) + except TypeError: # PY2 + if sys.version_info[0] != 2: + raise + self._testcase._addSkip(self, skip_why) + return True + return False + + def runtest(self): + if self.config.pluginmanager.get_plugin("pdbinvoke") is None: + self._testcase(result=self) + else: + # disables tearDown and cleanups for post mortem debugging (see #1890) + if self._handle_skip(): + return + self._testcase.debug() + + def _prunetraceback(self, excinfo): + Function._prunetraceback(self, excinfo) + traceback = excinfo.traceback.filter( + lambda x: not x.frame.f_globals.get("__unittest") + ) + if traceback: + excinfo.traceback = traceback + + +@hookimpl(tryfirst=True) +def pytest_runtest_makereport(item, call): + if isinstance(item, TestCaseFunction): + if item._excinfo: + call.excinfo = item._excinfo.pop(0) + try: + del call.result + except AttributeError: + pass + + +# twisted trial support + + +@hookimpl(hookwrapper=True) +def pytest_runtest_protocol(item): + if isinstance(item, TestCaseFunction) and "twisted.trial.unittest" in sys.modules: + ut = sys.modules["twisted.python.failure"] + Failure__init__ = ut.Failure.__init__ + check_testcase_implements_trial_reporter() + + def excstore( + self, exc_value=None, exc_type=None, exc_tb=None, captureVars=None + ): + if exc_value is None: + self._rawexcinfo = sys.exc_info() + else: + if exc_type is None: + exc_type = type(exc_value) + self._rawexcinfo = (exc_type, exc_value, exc_tb) + try: + Failure__init__( + self, exc_value, exc_type, exc_tb, captureVars=captureVars + ) + except TypeError: + Failure__init__(self, exc_value, exc_type, exc_tb) + + ut.Failure.__init__ = excstore + yield + ut.Failure.__init__ = Failure__init__ + else: + yield + + +def check_testcase_implements_trial_reporter(done=[]): + if done: + return + from zope.interface import classImplements + from twisted.trial.itrial import IReporter + + classImplements(TestCaseFunction, IReporter) + done.append(1) diff --git a/third_party/python/pytest/src/_pytest/warnings.py b/third_party/python/pytest/src/_pytest/warnings.py new file mode 100644 index 0000000000..e023d0ab49 --- /dev/null +++ b/third_party/python/pytest/src/_pytest/warnings.py @@ -0,0 +1,112 @@ +from __future__ import absolute_import, division, print_function + +import warnings +from contextlib import contextmanager + +import pytest + +from _pytest import compat + + +def _setoption(wmod, arg): + """ + Copy of the warning._setoption function but does not escape arguments. + """ + parts = arg.split(":") + if len(parts) > 5: + raise wmod._OptionError("too many fields (max 5): %r" % (arg,)) + while len(parts) < 5: + parts.append("") + action, message, category, module, lineno = [s.strip() for s in parts] + action = wmod._getaction(action) + category = wmod._getcategory(category) + if lineno: + try: + lineno = int(lineno) + if lineno < 0: + raise ValueError + except (ValueError, OverflowError): + raise wmod._OptionError("invalid lineno %r" % (lineno,)) + else: + lineno = 0 + wmod.filterwarnings(action, message, category, module, lineno) + + +def pytest_addoption(parser): + group = parser.getgroup("pytest-warnings") + group.addoption( + "-W", + "--pythonwarnings", + action="append", + help="set which warnings to report, see -W option of python itself.", + ) + parser.addini( + "filterwarnings", + type="linelist", + help="Each line specifies a pattern for " + "warnings.filterwarnings. " + "Processed after -W and --pythonwarnings.", + ) + + +@contextmanager +def catch_warnings_for_item(item): + """ + catches the warnings generated during setup/call/teardown execution + of the given item and after it is done posts them as warnings to this + item. + """ + args = item.config.getoption("pythonwarnings") or [] + inifilters = item.config.getini("filterwarnings") + with warnings.catch_warnings(record=True) as log: + for arg in args: + warnings._setoption(arg) + + for arg in inifilters: + _setoption(warnings, arg) + + for mark in item.iter_markers(name="filterwarnings"): + for arg in mark.args: + warnings._setoption(arg) + + yield + + for warning in log: + warn_msg = warning.message + unicode_warning = False + + if ( + compat._PY2 + and any(isinstance(m, compat.UNICODE_TYPES) for m in warn_msg.args) + ): + new_args = [] + for m in warn_msg.args: + new_args.append( + compat.ascii_escaped(m) + if isinstance(m, compat.UNICODE_TYPES) + else m + ) + unicode_warning = list(warn_msg.args) != new_args + warn_msg.args = new_args + + msg = warnings.formatwarning( + warn_msg, + warning.category, + warning.filename, + warning.lineno, + warning.line, + ) + item.warn("unused", msg) + + if unicode_warning: + warnings.warn( + "Warning is using unicode non convertible to ascii, " + "converting to a safe representation:\n %s" % msg, + UnicodeWarning, + ) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_runtest_protocol(item): + with catch_warnings_for_item(item): + yield |