diff options
Diffstat (limited to 'vendor/papergrid/src/grid/iterable.rs')
-rw-r--r-- | vendor/papergrid/src/grid/iterable.rs | 1358 |
1 files changed, 1358 insertions, 0 deletions
diff --git a/vendor/papergrid/src/grid/iterable.rs b/vendor/papergrid/src/grid/iterable.rs new file mode 100644 index 000000000..c02998b0b --- /dev/null +++ b/vendor/papergrid/src/grid/iterable.rs @@ -0,0 +1,1358 @@ +//! The module contains a [`Grid`] structure. + +use std::{ + borrow::{Borrow, Cow}, + cmp, + collections::BTreeMap, + fmt::{self, Write}, +}; + +use crate::{ + color::{AnsiColor, Color}, + colors::Colors, + config::{AlignmentHorizontal, AlignmentVertical, Indent, Position, Sides}, + dimension::Dimension, + records::Records, + util::string::{count_lines, get_lines, string_width, string_width_multiline, Lines}, +}; + +use crate::config::spanned::{Formatting, Offset, SpannedConfig}; + +/// Grid provides a set of methods for building a text-based table. +#[derive(Debug, Clone)] +pub struct Grid<R, D, G, C> { + records: R, + config: G, + dimension: D, + colors: C, +} + +impl<R, D, G, C> Grid<R, D, G, C> { + /// The new method creates a grid instance with default styles. + pub fn new(records: R, dimension: D, config: G, colors: C) -> Self { + Grid { + records, + config, + dimension, + colors, + } + } +} + +impl<R, D, G, C> Grid<R, D, G, C> { + /// Builds a table. + pub fn build<F>(self, mut f: F) -> fmt::Result + where + R: Records, + D: Dimension, + C: Colors, + G: Borrow<SpannedConfig>, + F: Write, + { + if self.records.count_columns() == 0 || self.records.hint_count_rows() == Some(0) { + return Ok(()); + } + + let config = self.config.borrow(); + print_grid(&mut f, self.records, config, &self.dimension, &self.colors) + } + + /// Builds a table into string. + /// + /// Notice that it consumes self. + #[allow(clippy::inherent_to_string)] + pub fn to_string(self) -> String + where + R: Records, + D: Dimension, + G: Borrow<SpannedConfig>, + C: Colors, + { + let mut buf = String::new(); + self.build(&mut buf).expect("It's guaranteed to never happen otherwise it's considered an stdlib error or impl error"); + buf + } +} + +fn print_grid<F: Write, R: Records, D: Dimension, C: Colors>( + f: &mut F, + records: R, + cfg: &SpannedConfig, + dimension: &D, + colors: &C, +) -> fmt::Result { + // spanned version is a bit more complex and 'supposedly' slower, + // because spans are considered to be not a general case we are having 2 versions + let grid_has_spans = cfg.has_column_spans() || cfg.has_row_spans(); + if grid_has_spans { + print_grid_spanned(f, records, cfg, dimension, colors) + } else { + print_grid_general(f, records, cfg, dimension, colors) + } +} + +fn print_grid_general<F: Write, R: Records, D: Dimension, C: Colors>( + f: &mut F, + records: R, + cfg: &SpannedConfig, + dims: &D, + colors: &C, +) -> fmt::Result { + let count_columns = records.count_columns(); + + let mut totalw = None; + let totalh = records + .hint_count_rows() + .map(|count_rows| total_height(cfg, dims, count_rows)); + + let mut records_iter = records.iter_rows().into_iter(); + let mut next_columns = records_iter.next(); + + if next_columns.is_none() { + return Ok(()); + } + + if cfg.get_margin().top.size > 0 { + totalw = Some(output_width(cfg, dims, count_columns)); + + print_margin_top(f, cfg, totalw.unwrap())?; + f.write_char('\n')?; + } + + let mut row = 0; + let mut line = 0; + let mut is_prev_row_skipped = false; + let mut buf = None; + while let Some(columns) = next_columns { + let columns = columns.into_iter(); + next_columns = records_iter.next(); + let is_last_row = next_columns.is_none(); + + let height = dims.get_height(row); + let count_rows = convert_count_rows(row, is_last_row); + let has_horizontal = cfg.has_horizontal(row, count_rows); + let shape = (count_rows, count_columns); + + if row > 0 && !is_prev_row_skipped && (has_horizontal || height > 0) { + f.write_char('\n')?; + } + + if has_horizontal { + print_horizontal_line(f, cfg, line, totalh, dims, row, shape)?; + + line += 1; + + if height > 0 { + f.write_char('\n')?; + } + } + + if height == 1 { + print_single_line_columns(f, columns, cfg, colors, dims, row, line, totalh, shape)? + } else if height > 0 { + if buf.is_none() { + buf = Some(Vec::with_capacity(count_columns)); + } + + let buf = buf.as_mut().unwrap(); + print_multiline_columns( + f, columns, cfg, colors, dims, height, row, line, totalh, shape, buf, + )?; + + buf.clear(); + } + + if height == 0 && !has_horizontal { + is_prev_row_skipped = true; + } else { + is_prev_row_skipped = false; + } + + line += height; + row += 1; + } + + if cfg.has_horizontal(row, row) { + f.write_char('\n')?; + let shape = (row, count_columns); + print_horizontal_line(f, cfg, line, totalh, dims, row, shape)?; + } + + { + let margin = cfg.get_margin(); + if margin.bottom.size > 0 { + let totalw = totalw.unwrap_or_else(|| output_width(cfg, dims, count_columns)); + + f.write_char('\n')?; + print_margin_bottom(f, cfg, totalw)?; + } + } + + Ok(()) +} + +fn output_width<D: Dimension>(cfg: &SpannedConfig, d: D, count_columns: usize) -> usize { + let margin = cfg.get_margin(); + total_width(cfg, &d, count_columns) + margin.left.size + margin.right.size +} + +#[allow(clippy::too_many_arguments)] +fn print_horizontal_line<F: Write, D: Dimension>( + f: &mut F, + cfg: &SpannedConfig, + line: usize, + totalh: Option<usize>, + dimension: &D, + row: usize, + shape: (usize, usize), +) -> fmt::Result { + print_margin_left(f, cfg, line, totalh)?; + print_split_line(f, cfg, dimension, row, shape)?; + print_margin_right(f, cfg, line, totalh)?; + Ok(()) +} + +#[allow(clippy::too_many_arguments)] +fn print_multiline_columns<'a, F, I, D, C>( + f: &mut F, + columns: I, + cfg: &'a SpannedConfig, + colors: &'a C, + dimension: &D, + height: usize, + row: usize, + line: usize, + totalh: Option<usize>, + shape: (usize, usize), + buf: &mut Vec<Cell<I::Item, &'a C::Color>>, +) -> fmt::Result +where + F: Write, + I: Iterator, + I::Item: AsRef<str>, + D: Dimension, + C: Colors, +{ + collect_columns(buf, columns, cfg, colors, dimension, height, row); + print_columns_lines(f, buf, height, cfg, line, row, totalh, shape)?; + Ok(()) +} + +#[allow(clippy::too_many_arguments)] +fn print_single_line_columns<F, I, D, C>( + f: &mut F, + columns: I, + cfg: &SpannedConfig, + colors: &C, + dims: &D, + row: usize, + line: usize, + totalh: Option<usize>, + shape: (usize, usize), +) -> fmt::Result +where + F: Write, + I: Iterator, + I::Item: AsRef<str>, + D: Dimension, + C: Colors, +{ + print_margin_left(f, cfg, line, totalh)?; + + for (col, cell) in columns.enumerate() { + let pos = (row, col); + let width = dims.get_width(col); + let color = colors.get_color(pos); + print_vertical_char(f, cfg, pos, 0, 1, shape.1)?; + print_single_line_column(f, cell.as_ref(), cfg, width, color, pos)?; + } + + print_vertical_char(f, cfg, (row, shape.1), 0, 1, shape.1)?; + + print_margin_right(f, cfg, line, totalh)?; + + Ok(()) +} + +fn print_single_line_column<F: Write, C: Color>( + f: &mut F, + text: &str, + cfg: &SpannedConfig, + width: usize, + color: Option<&C>, + pos: Position, +) -> fmt::Result { + let pos = pos.into(); + let pad = cfg.get_padding(pos); + let pad_color = cfg.get_padding_color(pos); + let fmt = cfg.get_formatting(pos); + let space = cfg.get_justification(pos); + let space_color = cfg.get_justification_color(pos); + + let (text, text_width) = if fmt.horizontal_trim && !text.is_empty() { + let text = string_trim(text); + let width = string_width(&text); + + (text, width) + } else { + let text = Cow::Borrowed(text); + let width = string_width_multiline(&text); + + (text, width) + }; + + let alignment = *cfg.get_alignment_horizontal(pos); + let available_width = width - pad.left.size - pad.right.size; + let (left, right) = calculate_indent(alignment, text_width, available_width); + + print_padding(f, &pad.left, pad_color.left.as_ref())?; + + print_indent(f, space, left, space_color)?; + print_text(f, &text, color)?; + print_indent(f, space, right, space_color)?; + + print_padding(f, &pad.right, pad_color.right.as_ref())?; + + Ok(()) +} + +#[allow(clippy::too_many_arguments)] +fn print_columns_lines<T, F: Write, C: Color>( + f: &mut F, + buf: &mut [Cell<T, C>], + height: usize, + cfg: &SpannedConfig, + line: usize, + row: usize, + totalh: Option<usize>, + shape: (usize, usize), +) -> fmt::Result { + for i in 0..height { + let exact_line = line + i; + + print_margin_left(f, cfg, exact_line, totalh)?; + + for (col, cell) in buf.iter_mut().enumerate() { + print_vertical_char(f, cfg, (row, col), i, height, shape.1)?; + cell.display(f)?; + } + + print_vertical_char(f, cfg, (row, shape.1), i, height, shape.1)?; + + print_margin_right(f, cfg, exact_line, totalh)?; + + if i + 1 != height { + f.write_char('\n')?; + } + } + + Ok(()) +} + +fn collect_columns<'a, I, D, C>( + buf: &mut Vec<Cell<I::Item, &'a C::Color>>, + iter: I, + cfg: &SpannedConfig, + colors: &'a C, + dimension: &D, + height: usize, + row: usize, +) where + I: Iterator, + I::Item: AsRef<str>, + C: Colors, + D: Dimension, +{ + let iter = iter.enumerate().map(|(col, cell)| { + let pos = (row, col); + let width = dimension.get_width(col); + let color = colors.get_color(pos); + Cell::new(cell, width, height, cfg, color, pos) + }); + + buf.extend(iter); +} + +fn print_split_line<F: Write, D: Dimension>( + f: &mut F, + cfg: &SpannedConfig, + dimension: &D, + row: usize, + shape: (usize, usize), +) -> fmt::Result { + let mut used_color = None; + print_vertical_intersection(f, cfg, (row, 0), shape, &mut used_color)?; + + for col in 0..shape.1 { + let width = dimension.get_width(col); + + // general case + if width > 0 { + let pos = (row, col); + let main = cfg.get_horizontal(pos, shape.0); + match main { + Some(c) => { + let clr = cfg.get_horizontal_color(pos, shape.0); + prepare_coloring(f, clr, &mut used_color)?; + print_horizontal_border(f, cfg, pos, width, c, &used_color)?; + } + None => repeat_char(f, ' ', width)?, + } + } + + print_vertical_intersection(f, cfg, (row, col + 1), shape, &mut used_color)?; + } + + if let Some(clr) = used_color.take() { + clr.fmt_suffix(f)?; + } + + Ok(()) +} + +fn print_grid_spanned<F: Write, R: Records, D: Dimension, C: Colors>( + f: &mut F, + records: R, + cfg: &SpannedConfig, + dims: &D, + colors: &C, +) -> fmt::Result { + let count_columns = records.count_columns(); + + let total_width = total_width(cfg, dims, count_columns); + let margin = cfg.get_margin(); + let total_width_with_margin = total_width + margin.left.size + margin.right.size; + + let totalh = records + .hint_count_rows() + .map(|rows| total_height(cfg, dims, rows)); + + if margin.top.size > 0 { + print_margin_top(f, cfg, total_width_with_margin)?; + f.write_char('\n')?; + } + + let mut buf = BTreeMap::new(); + + let mut records_iter = records.iter_rows().into_iter(); + let mut next_columns = records_iter.next(); + + let mut need_new_line = false; + let mut line = 0; + let mut row = 0; + while let Some(columns) = next_columns { + let columns = columns.into_iter(); + next_columns = records_iter.next(); + let is_last_row = next_columns.is_none(); + + let height = dims.get_height(row); + let count_rows = convert_count_rows(row, is_last_row); + let shape = (count_rows, count_columns); + + let has_horizontal = cfg.has_horizontal(row, count_rows); + if need_new_line && (has_horizontal || height > 0) { + f.write_char('\n')?; + need_new_line = false; + } + + if has_horizontal { + print_margin_left(f, cfg, line, totalh)?; + print_split_line_spanned(f, &mut buf, cfg, dims, row, shape)?; + print_margin_right(f, cfg, line, totalh)?; + + line += 1; + + if height > 0 { + f.write_char('\n')?; + } + } + + print_spanned_columns( + f, &mut buf, columns, cfg, colors, dims, height, row, line, totalh, shape, + )?; + + if has_horizontal || height > 0 { + need_new_line = true; + } + + line += height; + row += 1; + } + + if row > 0 { + if cfg.has_horizontal(row, row) { + f.write_char('\n')?; + let shape = (row, count_columns); + print_horizontal_line(f, cfg, line, totalh, dims, row, shape)?; + } + + if margin.bottom.size > 0 { + f.write_char('\n')?; + print_margin_bottom(f, cfg, total_width_with_margin)?; + } + } + + Ok(()) +} + +fn print_split_line_spanned<S, F: Write, D: Dimension, C: Color>( + f: &mut F, + buf: &mut BTreeMap<usize, (Cell<S, C>, usize, usize)>, + cfg: &SpannedConfig, + dimension: &D, + row: usize, + shape: (usize, usize), +) -> fmt::Result { + let mut used_color = None; + print_vertical_intersection(f, cfg, (row, 0), shape, &mut used_color)?; + + for col in 0..shape.1 { + let pos = (row, col); + if cfg.is_cell_covered_by_both_spans(pos) { + continue; + } + + let width = dimension.get_width(col); + let mut col = col; + if cfg.is_cell_covered_by_row_span(pos) { + // means it's part of other a spanned cell + // so. we just need to use line from other cell. + + let (cell, _, _) = buf.get_mut(&col).unwrap(); + cell.display(f)?; + + // We need to use a correct right split char. + let original_row = closest_visible_row(cfg, pos).unwrap(); + if let Some(span) = cfg.get_column_span((original_row, col)) { + col += span - 1; + } + } else if width > 0 { + // general case + let main = cfg.get_horizontal(pos, shape.0); + match main { + Some(c) => { + let clr = cfg.get_horizontal_color(pos, shape.0); + prepare_coloring(f, clr, &mut used_color)?; + print_horizontal_border(f, cfg, pos, width, c, &used_color)?; + } + None => repeat_char(f, ' ', width)?, + } + } + + print_vertical_intersection(f, cfg, (row, col + 1), shape, &mut used_color)?; + } + + if let Some(clr) = used_color.take() { + clr.fmt_suffix(f)?; + } + + Ok(()) +} + +fn print_vertical_intersection<'a, F: fmt::Write>( + f: &mut F, + cfg: &'a SpannedConfig, + pos: Position, + shape: (usize, usize), + used_color: &mut Option<&'a AnsiColor<'static>>, +) -> fmt::Result { + match cfg.get_intersection(pos, shape) { + Some(c) => { + let clr = cfg.get_intersection_color(pos, shape); + prepare_coloring(f, clr, used_color)?; + f.write_char(c) + } + None => Ok(()), + } +} + +#[allow(clippy::too_many_arguments, clippy::type_complexity)] +fn print_spanned_columns<'a, F, I, D, C>( + f: &mut F, + buf: &mut BTreeMap<usize, (Cell<I::Item, &'a C::Color>, usize, usize)>, + iter: I, + cfg: &SpannedConfig, + colors: &'a C, + dimension: &D, + this_height: usize, + row: usize, + line: usize, + totalh: Option<usize>, + shape: (usize, usize), +) -> fmt::Result +where + F: Write, + I: Iterator, + I::Item: AsRef<str>, + D: Dimension, + C: Colors, +{ + if this_height == 0 { + // it's possible that we dont show row but it contains an actual cell which will be + // rendered after all cause it's a rowspanned + + let mut skip = 0; + for (col, cell) in iter.enumerate() { + if skip > 0 { + skip -= 1; + continue; + } + + if let Some((_, _, colspan)) = buf.get(&col) { + skip = *colspan - 1; + continue; + } + + let pos = (row, col); + let rowspan = cfg.get_row_span(pos).unwrap_or(1); + if rowspan < 2 { + continue; + } + + let height = if rowspan > 1 { + range_height(cfg, dimension, row, row + rowspan, shape.0) + } else { + this_height + }; + + let colspan = cfg.get_column_span(pos).unwrap_or(1); + skip = colspan - 1; + let width = if colspan > 1 { + range_width(cfg, dimension, col, col + colspan, shape.1) + } else { + dimension.get_width(col) + }; + + let color = colors.get_color(pos); + let cell = Cell::new(cell, width, height, cfg, color, pos); + + buf.insert(col, (cell, rowspan, colspan)); + } + + buf.retain(|_, (_, rowspan, _)| { + *rowspan -= 1; + *rowspan != 0 + }); + + return Ok(()); + } + + let mut skip = 0; + for (col, cell) in iter.enumerate() { + if skip > 0 { + skip -= 1; + continue; + } + + if let Some((_, _, colspan)) = buf.get(&col) { + skip = *colspan - 1; + continue; + } + + let pos = (row, col); + let colspan = cfg.get_column_span(pos).unwrap_or(1); + skip = colspan - 1; + + let width = if colspan > 1 { + range_width(cfg, dimension, col, col + colspan, shape.1) + } else { + dimension.get_width(col) + }; + + let rowspan = cfg.get_row_span(pos).unwrap_or(1); + let height = if rowspan > 1 { + range_height(cfg, dimension, row, row + rowspan, shape.0) + } else { + this_height + }; + + let color = colors.get_color(pos); + let cell = Cell::new(cell, width, height, cfg, color, pos); + + buf.insert(col, (cell, rowspan, colspan)); + } + + for i in 0..this_height { + let exact_line = line + i; + let cell_line = i; + + print_margin_left(f, cfg, exact_line, totalh)?; + + for (&col, (cell, _, _)) in buf.iter_mut() { + print_vertical_char(f, cfg, (row, col), cell_line, this_height, shape.1)?; + cell.display(f)?; + } + + print_vertical_char(f, cfg, (row, shape.1), cell_line, this_height, shape.1)?; + + print_margin_right(f, cfg, exact_line, totalh)?; + + if i + 1 != this_height { + f.write_char('\n')?; + } + } + + buf.retain(|_, (_, rowspan, _)| { + *rowspan -= 1; + *rowspan != 0 + }); + + Ok(()) +} + +fn print_horizontal_border<F: Write>( + f: &mut F, + cfg: &SpannedConfig, + pos: Position, + width: usize, + c: char, + used_color: &Option<&AnsiColor<'static>>, +) -> fmt::Result { + if !cfg.is_overridden_horizontal(pos) { + return repeat_char(f, c, width); + } + + for i in 0..width { + let c = cfg.lookup_horizontal_char(pos, i, width).unwrap_or(c); + match cfg.lookup_horizontal_color(pos, i, width) { + Some(color) => match used_color { + Some(clr) => { + clr.fmt_suffix(f)?; + color.fmt_prefix(f)?; + f.write_char(c)?; + color.fmt_suffix(f)?; + clr.fmt_prefix(f)?; + } + None => { + color.fmt_prefix(f)?; + f.write_char(c)?; + color.fmt_suffix(f)?; + } + }, + _ => f.write_char(c)?, + } + } + + Ok(()) +} + +struct Cell<T, C> { + lines: LinesIter<T>, + width: usize, + indent_top: usize, + indent_left: Option<usize>, + alignh: AlignmentHorizontal, + fmt: Formatting, + pad: Sides<Indent>, + pad_color: Sides<Option<AnsiColor<'static>>>, + color: Option<C>, + justification: (char, Option<AnsiColor<'static>>), +} + +impl<T, C> Cell<T, C> +where + T: AsRef<str>, +{ + fn new( + text: T, + width: usize, + height: usize, + cfg: &SpannedConfig, + color: Option<C>, + pos: Position, + ) -> Cell<T, C> { + let fmt = *cfg.get_formatting(pos.into()); + let pad = cfg.get_padding(pos.into()); + let pad_color = cfg.get_padding_color(pos.into()).clone(); + let alignh = *cfg.get_alignment_horizontal(pos.into()); + let alignv = *cfg.get_alignment_vertical(pos.into()); + let justification = ( + cfg.get_justification(pos.into()), + cfg.get_justification_color(pos.into()).cloned(), + ); + + let (count_lines, skip) = if fmt.vertical_trim { + let (len, top, _) = count_empty_lines(text.as_ref()); + (len, top) + } else { + (count_lines(text.as_ref()), 0) + }; + + let indent_top = top_indent(&pad, alignv, count_lines, height); + + let mut indent_left = None; + if !fmt.allow_lines_alignment { + let text_width = get_text_width(text.as_ref(), fmt.horizontal_trim); + let available = width - pad.left.size - pad.right.size; + indent_left = Some(calculate_indent(alignh, text_width, available).0); + } + + let mut lines = LinesIter::new(text); + for _ in 0..skip { + let _ = lines.lines.next(); + } + + Self { + lines, + indent_left, + indent_top, + width, + alignh, + fmt, + pad, + pad_color, + color, + justification, + } + } +} + +impl<T, C> Cell<T, C> +where + C: Color, +{ + fn display<F: Write>(&mut self, f: &mut F) -> fmt::Result { + if self.indent_top > 0 { + self.indent_top -= 1; + print_padding_n(f, &self.pad.top, self.pad_color.top.as_ref(), self.width)?; + return Ok(()); + } + + let line = match self.lines.lines.next() { + Some(line) => line, + None => { + let color = self.pad_color.bottom.as_ref(); + print_padding_n(f, &self.pad.bottom, color, self.width)?; + return Ok(()); + } + }; + + let line = if self.fmt.horizontal_trim && !line.is_empty() { + string_trim(&line) + } else { + line + }; + + let line_width = string_width(&line); + let available_width = self.width - self.pad.left.size - self.pad.right.size; + + let (left, right) = if self.fmt.allow_lines_alignment { + calculate_indent(self.alignh, line_width, available_width) + } else { + let left = self.indent_left.expect("must be here"); + (left, available_width - line_width - left) + }; + + let (justification, justification_color) = + (self.justification.0, self.justification.1.as_ref()); + + print_padding(f, &self.pad.left, self.pad_color.left.as_ref())?; + + print_indent(f, justification, left, justification_color)?; + print_text(f, &line, self.color.as_ref())?; + print_indent(f, justification, right, justification_color)?; + + print_padding(f, &self.pad.right, self.pad_color.right.as_ref())?; + + Ok(()) + } +} + +struct LinesIter<C> { + _cell: C, + /// SAFETY: IT'S NOT SAFE TO KEEP THE 'static REFERENCES AROUND AS THEY ARE NOT 'static in reality AND WILL BE DROPPED + _text: &'static str, + /// SAFETY: IT'S NOT SAFE TO KEEP THE 'static REFERENCES AROUND AS THEY ARE NOT 'static in reality AND WILL BE DROPPED + lines: Lines<'static>, +} + +impl<C> LinesIter<C> { + fn new(cell: C) -> Self + where + C: AsRef<str>, + { + // We want to not allocate a String/Vec. + // It's currently not possible due to a lifetime issues. (It's known as self-referential struct) + // + // Here we change the lifetime of text. + // + // # Safety + // + // It must be safe because the referenced string and the references are dropped at the same time. + // And the referenced String is guaranteed to not be changed. + let text = cell.as_ref(); + let text = unsafe { + std::str::from_utf8_unchecked(std::slice::from_raw_parts(text.as_ptr(), text.len())) + }; + + let lines = get_lines(text); + + Self { + _cell: cell, + _text: text, + lines, + } + } +} + +fn print_text<F: Write>(f: &mut F, text: &str, clr: Option<impl Color>) -> fmt::Result { + match clr { + Some(color) => { + color.fmt_prefix(f)?; + f.write_str(text)?; + color.fmt_suffix(f) + } + None => f.write_str(text), + } +} + +fn prepare_coloring<'a, 'b, F: Write>( + f: &mut F, + clr: Option<&'a AnsiColor<'b>>, + used_color: &mut Option<&'a AnsiColor<'b>>, +) -> fmt::Result { + match clr { + Some(clr) => match used_color.as_mut() { + Some(used_clr) => { + if **used_clr != *clr { + used_clr.fmt_suffix(f)?; + clr.fmt_prefix(f)?; + *used_clr = clr; + } + } + None => { + clr.fmt_prefix(f)?; + *used_color = Some(clr); + } + }, + None => { + if let Some(clr) = used_color.take() { + clr.fmt_suffix(f)? + } + } + } + + Ok(()) +} + +fn top_indent( + padding: &Sides<Indent>, + alignment: AlignmentVertical, + cell_height: usize, + available: usize, +) -> usize { + let height = available - padding.top.size; + let indent = indent_from_top(alignment, height, cell_height); + + indent + padding.top.size +} + +fn indent_from_top(alignment: AlignmentVertical, available: usize, real: usize) -> usize { + match alignment { + AlignmentVertical::Top => 0, + AlignmentVertical::Bottom => available - real, + AlignmentVertical::Center => (available - real) / 2, + } +} + +fn calculate_indent( + alignment: AlignmentHorizontal, + text_width: usize, + available: usize, +) -> (usize, usize) { + let diff = available - text_width; + match alignment { + AlignmentHorizontal::Left => (0, diff), + AlignmentHorizontal::Right => (diff, 0), + AlignmentHorizontal::Center => { + let left = diff / 2; + let rest = diff - left; + (left, rest) + } + } +} + +fn repeat_char<F: Write>(f: &mut F, c: char, n: usize) -> fmt::Result { + for _ in 0..n { + f.write_char(c)?; + } + + Ok(()) +} + +fn print_vertical_char<F: Write>( + f: &mut F, + cfg: &SpannedConfig, + pos: Position, + line: usize, + count_lines: usize, + count_columns: usize, +) -> fmt::Result { + let symbol = match cfg.get_vertical(pos, count_columns) { + Some(c) => c, + None => return Ok(()), + }; + + let symbol = cfg + .is_overridden_vertical(pos) + .then(|| cfg.lookup_vertical_char(pos, line, count_lines)) + .flatten() + .unwrap_or(symbol); + + match cfg.get_vertical_color(pos, count_columns) { + Some(clr) => { + clr.fmt_prefix(f)?; + f.write_char(symbol)?; + clr.fmt_suffix(f)?; + } + None => f.write_char(symbol)?, + } + + Ok(()) +} + +fn print_margin_top<F: Write>(f: &mut F, cfg: &SpannedConfig, width: usize) -> fmt::Result { + let indent = cfg.get_margin().top; + let offset = cfg.get_margin_offset().top; + let color = cfg.get_margin_color(); + let color = color.top.as_ref(); + print_indent_lines(f, &indent, &offset, color, width) +} + +fn print_margin_bottom<F: Write>(f: &mut F, cfg: &SpannedConfig, width: usize) -> fmt::Result { + let indent = cfg.get_margin().bottom; + let offset = cfg.get_margin_offset().bottom; + let color = cfg.get_margin_color(); + let color = color.bottom.as_ref(); + print_indent_lines(f, &indent, &offset, color, width) +} + +fn print_margin_left<F: Write>( + f: &mut F, + cfg: &SpannedConfig, + line: usize, + height: Option<usize>, +) -> fmt::Result { + let indent = cfg.get_margin().left; + let offset = cfg.get_margin_offset().left; + let color = cfg.get_margin_color(); + let color = color.left.as_ref(); + print_margin_vertical(f, indent, offset, color, line, height) +} + +fn print_margin_right<F: Write>( + f: &mut F, + cfg: &SpannedConfig, + line: usize, + height: Option<usize>, +) -> fmt::Result { + let indent = cfg.get_margin().right; + let offset = cfg.get_margin_offset().right; + let color = cfg.get_margin_color(); + let color = color.right.as_ref(); + print_margin_vertical(f, indent, offset, color, line, height) +} + +fn print_margin_vertical<F: Write>( + f: &mut F, + indent: Indent, + offset: Offset, + color: Option<&AnsiColor<'_>>, + line: usize, + height: Option<usize>, +) -> fmt::Result { + if indent.size == 0 { + return Ok(()); + } + + match offset { + Offset::Begin(mut offset) => { + if let Some(max) = height { + offset = cmp::min(offset, max); + } + + if line >= offset { + print_indent(f, indent.fill, indent.size, color)?; + } else { + repeat_char(f, ' ', indent.size)?; + } + } + Offset::End(mut offset) => { + if let Some(max) = height { + offset = cmp::min(offset, max); + let pos = max - offset; + + if line >= pos { + repeat_char(f, ' ', indent.size)?; + } else { + print_indent(f, indent.fill, indent.size, color)?; + } + } else { + print_indent(f, indent.fill, indent.size, color)?; + } + } + } + + Ok(()) +} + +fn print_indent_lines<F: Write>( + f: &mut F, + indent: &Indent, + offset: &Offset, + color: Option<&AnsiColor<'_>>, + width: usize, +) -> fmt::Result { + if indent.size == 0 { + return Ok(()); + } + + let (start_offset, end_offset) = match offset { + Offset::Begin(start) => (*start, 0), + Offset::End(end) => (0, *end), + }; + + let start_offset = std::cmp::min(start_offset, width); + let end_offset = std::cmp::min(end_offset, width); + let indent_size = width - start_offset - end_offset; + + for i in 0..indent.size { + if start_offset > 0 { + repeat_char(f, ' ', start_offset)?; + } + + if indent_size > 0 { + print_indent(f, indent.fill, indent_size, color)?; + } + + if end_offset > 0 { + repeat_char(f, ' ', end_offset)?; + } + + if i + 1 != indent.size { + f.write_char('\n')?; + } + } + + Ok(()) +} + +fn print_padding<F: Write>(f: &mut F, pad: &Indent, color: Option<&AnsiColor<'_>>) -> fmt::Result { + print_indent(f, pad.fill, pad.size, color) +} + +fn print_padding_n<F: Write>( + f: &mut F, + pad: &Indent, + color: Option<&AnsiColor<'_>>, + n: usize, +) -> fmt::Result { + print_indent(f, pad.fill, n, color) +} + +fn print_indent<F: Write>( + f: &mut F, + c: char, + n: usize, + color: Option<&AnsiColor<'_>>, +) -> fmt::Result { + if n == 0 { + return Ok(()); + } + + match color { + Some(color) => { + color.fmt_prefix(f)?; + repeat_char(f, c, n)?; + color.fmt_suffix(f) + } + None => repeat_char(f, c, n), + } +} + +fn range_width( + cfg: &SpannedConfig, + d: impl Dimension, + start: usize, + end: usize, + max: usize, +) -> usize { + let count_borders = count_verticals_in_range(cfg, start, end, max); + let range_width = (start..end).map(|col| d.get_width(col)).sum::<usize>(); + + count_borders + range_width +} + +fn range_height( + cfg: &SpannedConfig, + d: impl Dimension, + from: usize, + end: usize, + max: usize, +) -> usize { + let count_borders = count_horizontals_in_range(cfg, from, end, max); + let range_width = (from..end).map(|col| d.get_height(col)).sum::<usize>(); + + count_borders + range_width +} + +fn count_horizontals_in_range(cfg: &SpannedConfig, from: usize, end: usize, max: usize) -> usize { + (from + 1..end) + .map(|i| cfg.has_horizontal(i, max) as usize) + .sum() +} + +fn count_verticals_in_range(cfg: &SpannedConfig, start: usize, end: usize, max: usize) -> usize { + (start..end) + .skip(1) + .map(|i| cfg.has_vertical(i, max) as usize) + .sum() +} + +fn closest_visible_row(cfg: &SpannedConfig, mut pos: Position) -> Option<usize> { + loop { + if cfg.is_cell_visible(pos) { + return Some(pos.0); + } + + if pos.0 == 0 { + return None; + } + + pos.0 -= 1; + } +} + +fn convert_count_rows(row: usize, is_last: bool) -> usize { + if is_last { + row + 1 + } else { + row + 2 + } +} + +/// Trims a string. +fn string_trim(text: &str) -> Cow<'_, str> { + #[cfg(feature = "color")] + { + ansi_str::AnsiStr::ansi_trim(text) + } + + #[cfg(not(feature = "color"))] + { + text.trim().into() + } +} + +fn total_width<D: Dimension>(cfg: &SpannedConfig, dimension: &D, count_columns: usize) -> usize { + (0..count_columns) + .map(|i| dimension.get_width(i)) + .sum::<usize>() + + cfg.count_vertical(count_columns) +} + +fn total_height<D: Dimension>(cfg: &SpannedConfig, dimension: &D, count_rows: usize) -> usize { + (0..count_rows) + .map(|i| dimension.get_height(i)) + .sum::<usize>() + + cfg.count_horizontal(count_rows) +} + +fn count_empty_lines(cell: &str) -> (usize, usize, usize) { + let mut len = 0; + let mut top = 0; + let mut bottom = 0; + let mut top_check = true; + + for line in get_lines(cell) { + let is_empty = line.trim().is_empty(); + if top_check { + if is_empty { + top += 1; + } else { + len = 1; + top_check = false; + } + + continue; + } + + if is_empty { + bottom += 1; + } else { + len += bottom + 1; + bottom = 0; + } + } + + (len, top, bottom) +} + +fn get_text_width(text: &str, trim: bool) -> usize { + if trim { + get_lines(text) + .map(|line| string_width(line.trim())) + .max() + .unwrap_or(0) + } else { + string_width_multiline(text) + } +} + +#[cfg(test)] +mod tests { + // use crate::util::string_width; + + use super::*; + + // #[test] + // fn horizontal_alignment_test() { + // use std::fmt; + + // struct F<'a>(&'a str, AlignmentHorizontal, usize); + + // impl fmt::Display for F<'_> { + // fn fmt(&self, f: &mut impl fmt::Write) -> fmt::Result { + // let (left, right) = calculate_indent(self.1, string_width(self.0), self.2); + // print_text_formatted(f, &self.0, 4, Option::<&AnsiColor<'_>>::None) + // } + // } + + // assert_eq!(F("AAA", AlignmentHorizontal::Right, 4).to_string(), " AAA"); + // assert_eq!(F("AAA", AlignmentHorizontal::Left, 4).to_string(), "AAA "); + // assert_eq!(F("AAA", AlignmentHorizontal::Center, 4).to_string(), "AAA "); + // assert_eq!(F("🎩", AlignmentHorizontal::Center, 4).to_string(), " 🎩 "); + // assert_eq!(F("🎩", AlignmentHorizontal::Center, 3).to_string(), "🎩 "); + + // #[cfg(feature = "color")] + // { + // use owo_colors::OwoColorize; + // let text = "Colored Text".red().to_string(); + // assert_eq!( + // F(&text, AlignmentHorizontal::Center, 15).to_string(), + // format!(" {} ", text) + // ); + // } + // } + + #[test] + fn vertical_alignment_test() { + use AlignmentVertical::*; + + assert_eq!(indent_from_top(Bottom, 1, 1), 0); + assert_eq!(indent_from_top(Top, 1, 1), 0); + assert_eq!(indent_from_top(Center, 1, 1), 0); + assert_eq!(indent_from_top(Bottom, 3, 1), 2); + assert_eq!(indent_from_top(Top, 3, 1), 0); + assert_eq!(indent_from_top(Center, 3, 1), 1); + assert_eq!(indent_from_top(Center, 4, 1), 1); + } + + #[test] + fn count_empty_lines_test() { + assert_eq!(count_empty_lines("\n\nsome text\n\n\n"), (1, 2, 3)); + assert_eq!(count_empty_lines("\n\nsome\ntext\n\n\n"), (2, 2, 3)); + assert_eq!(count_empty_lines("\n\nsome\nsome\ntext\n\n\n"), (3, 2, 3)); + assert_eq!(count_empty_lines("\n\n\n\n"), (0, 5, 0)); + } +} |