summaryrefslogtreecommitdiffstats
path: root/src/fluent-bit/lib/jansson-e23f558
diff options
context:
space:
mode:
Diffstat (limited to 'src/fluent-bit/lib/jansson-e23f558')
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/.gitignore37
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/Android.mk30
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/CHANGES986
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/CMakeLists.txt662
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/CleanSpec.mk49
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/LICENSE19
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/Makefile.am12
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/README.rst74
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/android/jansson_config.h43
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/appveyor.yml18
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/cmake/CheckFunctionKeywords.cmake15
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/cmake/CodeCoverage.cmake163
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/cmake/Coveralls.cmake111
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/cmake/CoverallsClear.cmake24
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/cmake/CoverallsGenerateGcov.cmake380
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/cmake/FindSphinx.cmake315
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/cmake/janssonConfig.cmake.in4
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/cmake/jansson_config.h.cmake74
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/cmake/jansson_private_config.h.cmake53
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/configure.ac181
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/.gitignore1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/Makefile.am20
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/README5
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/apiref.rst2064
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/changes.rst5
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/conf.py217
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/conformance.rst119
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/ext/refcounting.py69
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/gettingstarted.rst264
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/github_commits.c181
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/index.rst53
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/threadsafety.rst82
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/tutorial.rst288
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/doc/upgrading.rst76
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/examples/README.rst4
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/examples/simple_parse.c200
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/jansson.pc.in10
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/release.sh70
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/scripts/clang-format3
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/scripts/clang-format-check27
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/Makefile.am30
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/dump.c490
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/error.c59
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/hashtable.c340
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/hashtable.h186
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/hashtable_seed.c277
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/jansson.def83
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/jansson.h419
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/jansson_config.h.in51
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/jansson_private.h114
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/load.c1106
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/lookup3.h382
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/memory.c61
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/pack_unpack.c936
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/strbuffer.c98
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/strbuffer.h35
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/strconv.c132
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/utf.c159
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/utf.h28
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/value.c1120
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/src/version.c28
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/.gitignore20
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/Makefile.am10
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/bin/Makefile.am5
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/bin/json_process.c366
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/.gitignore1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/Makefile.am32
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/json_load_dump_fuzzer.cc132
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/test/ossfuzz/ossfuzz.sh30
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/standaloneengine.cc74
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/testinput.h3
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/test/ossfuzz/travisoss.sh38
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/test/run-suites50
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/scripts/run-tests.sh100
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/scripts/valgrind.sh35
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/.gitattributes2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/Makefile.am2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/Makefile.am42
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/test/suites/api/check-exports23
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/test/suites/api/run36
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_array.c484
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_chaos.c168
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_copy.c375
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_dump.c311
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_dump_callback.c82
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_equal.c202
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_fixed_size.c228
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_load.c238
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_load_callback.c77
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_loadb.c37
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_memory_funcs.c115
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_number.c123
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_object.c797
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_pack.c547
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_simple.c287
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_sprintf.c29
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_unpack.c431
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_version.c61
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/api/util.h93
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/array/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/env2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/env3
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/env2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/input8
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/env2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/output4
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/env3
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/output4
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/env4
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/output4
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/env3
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/output4
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/env2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/env2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/env2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/output1
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/run32
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/env2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/encoded-surrogate-half/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/encoded-surrogate-half/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-after-backslash/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-after-backslash/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-array/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-escape/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-escape/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-exponent/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-exponent/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-identifier/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-identifier/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-int/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-int/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-string/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-string/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-invalid-utf-8/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-invalid-utf-8/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-utf-8-continuation-byte/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-utf-8-continuation-byte/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/not-in-unicode-range/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/not-in-unicode-range/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-3-byte-encoding/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-3-byte-encoding/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-4-byte-encoding/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-4-byte-encoding/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-ascii-encoding/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-ascii-encoding/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/restricted-utf-8/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/restricted-utf-8/input1
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/run27
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/truncated-utf-8/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/truncated-utf-8/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/apostrophe/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/apostrophe/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/ascii-unicode-identifier/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/ascii-unicode-identifier/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/brace-comma/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/brace-comma/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-comma/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-comma/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/empty/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/empty/input0
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-array/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-multiline-array/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-multiline-array/input6
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-after-newline/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-after-newline/input2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-at-the-end/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-at-the-end/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/integer-starting-with-zero/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/integer-starting-with-zero/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-escape/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-escape/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-identifier/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-identifier/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-integer/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-integer/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-real/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-real/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-second-surrogate/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-second-surrogate/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-unicode-escape/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-unicode-escape/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-second-surrogate/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-second-surrogate/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/minus-sign-without-number/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/minus-sign-without-number/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/negative-integer-starting-with-zero/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/negative-integer-starting-with-zero/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-object-key/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-object-key/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/inputbin0 -> 28 bytes
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/nostrip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/inputbin0 -> 3 bytes
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/nostrip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-escape-in-string/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-escape-in-string/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-apostrophes/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-apostrophes/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-garbage-at-end/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-garbage-at-end/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-garbage-after-e/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-garbage-after-e/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-negative-overflow/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-negative-overflow/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-positive-overflow/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-positive-overflow/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-e/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-e/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-point/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-point/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/recursion-depth/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/recursion-depth/input1
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/test/suites/invalid/run57
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/tab-character-in-string/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/tab-character-in-string/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-negative-integer/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-negative-integer/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-positive-integer/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-positive-integer/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/truncated-unicode-surrogate/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/truncated-unicode-surrogate/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unicode-identifier/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unicode-identifier/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-object-and-array/error2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-object-and-array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/error.normal2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/error.strip2
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/env1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/input5
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-array/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object-in-array/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object-in-array/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-string/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-string/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/escaped-utf-control-char/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/escaped-utf-control-char/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/false/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/false/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-int/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-int/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-one/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-one/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-zero/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-zero/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/null/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/null/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/one-byte-utf-8/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/one-byte-utf-8/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-negative-exponent/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-negative-exponent/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-positive-exponent/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-positive-exponent/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-exponent/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-exponent/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-fraction-exponent/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-fraction-exponent/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-negative-exponent/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-negative-exponent/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-positive-exponent/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-positive-exponent/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-subnormal-number/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-subnormal-number/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-underflow/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-underflow/output1
-rwxr-xr-xsrc/fluent-bit/lib/jansson-e23f558/test/suites/valid/run56
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/short-string/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/short-string/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-ascii-string/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-ascii-string/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-0/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-0/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-1/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-1/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-123/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-123/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-object/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-object/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-real/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-real/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/string-escapes/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/string-escapes/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/three-byte-utf-8/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/three-byte-utf-8/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/true/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/true/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/two-byte-utf-8/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/two-byte-utf-8/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-8-string/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-8-string/output1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-surrogate-four-byte-encoding/input1
-rw-r--r--src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-surrogate-four-byte-encoding/output1
357 files changed, 19378 insertions, 0 deletions
diff --git a/src/fluent-bit/lib/jansson-e23f558/.gitignore b/src/fluent-bit/lib/jansson-e23f558/.gitignore
new file mode 100644
index 000000000..1a028d295
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/.gitignore
@@ -0,0 +1,37 @@
+*~
+*.o
+*.a
+.libs
+.deps
+Makefile
+Makefile.in
+aclocal.m4
+autom4te.cache
+config.guess
+config.h
+config.h.in
+config.log
+config.status
+config.sub
+configure
+depcomp
+install-sh
+libtool
+ltmain.sh
+missing
+compile
+test-driver
+*.lo
+*.la
+stamp-h1
+*.pyc
+*.pc
+/src/jansson_config.h
+/jansson_private_config.h.in
+/jansson_private_config.h
+/build
+*.exe
+.idea
+cmake-build-debug/
+*.log
+*.trs
diff --git a/src/fluent-bit/lib/jansson-e23f558/Android.mk b/src/fluent-bit/lib/jansson-e23f558/Android.mk
new file mode 100644
index 000000000..e3b09e72c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/Android.mk
@@ -0,0 +1,30 @@
+LOCAL_PATH:= $(call my-dir)
+include $(CLEAR_VARS)
+
+LOCAL_ARM_MODE := arm
+
+LOCAL_SRC_FILES := \
+ src/dump.c \
+ src/error.c \
+ src/hashtable.c \
+ src/hashtable_seed.c \
+ src/load.c \
+ src/memory.c \
+ src/pack_unpack.c \
+ src/strbuffer.c \
+ src/strconv.c \
+ src/utf.c \
+ src/value.c
+
+LOCAL_C_INCLUDES += \
+ $(LOCAL_PATH) \
+ $(LOCAL_PATH)/android \
+ $(LOCAL_PATH)/src
+
+LOCAL_MODULE_TAGS := optional
+LOCAL_SHARED_LIBRARIES := libc
+LOCAL_CFLAGS += -O3 -DHAVE_STDINT_H=1
+
+LOCAL_MODULE:= libjansson
+
+include $(BUILD_SHARED_LIBRARY)
diff --git a/src/fluent-bit/lib/jansson-e23f558/CHANGES b/src/fluent-bit/lib/jansson-e23f558/CHANGES
new file mode 100644
index 000000000..cb6ff07cb
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/CHANGES
@@ -0,0 +1,986 @@
+Version 2.14
+============
+
+Released 2021-09-09
+
+* New Features:
+
+ - Add `json_object_getn`, `json_object_setn`, `json_object_deln`, and the
+ corresponding `nocheck` functions. (#520, by Maxim Zhukov)
+
+* Fixes:
+
+ - Handle `sprintf` corner cases (#537, by Tobias Stoeckmann)
+
+* Build:
+
+ - Symbol versioning for all exported symbols (#540, by Simon McVittie)
+ - Fix compiler warnings (#555, by Kelvin Lee)
+
+* Documentation:
+
+ - Small fixes (#544, #546, by @i-ky)
+ - Sphinx 3 compatibility (#543, by Pierce Lopez)
+
+
+Version 2.13.1
+==============
+
+Released 2020-05-07
+
+* Build:
+
+ - Include `jansson_version_str()` and `jansson_version_cmp()` in
+ shared library. (#534)
+
+ - Include ``scripts/`` in tarball. (#535)
+
+
+Version 2.13
+============
+
+Released 2020-05-05
+
+* New Features:
+
+ - Add `jansson_version_str()` and `jansson_version_cmp()` for runtime
+ version checking (#465).
+
+ - Add `json_object_update_new()`, `json_object_update_existing_new()`
+ and `json_object_update_missing_new()` functions (#499).
+
+ - Add `json_object_update_recursive()` (#505).
+
+* Build:
+
+ - Add ``-Wno-format-truncation`` to suppress format truncation warnings (#489).
+
+* Bug fixes:
+
+ - Remove ``strtod`` macro definition for MinGW (#498).
+
+ - Add infinite loop check in `json_deep_copy()` (#490).
+
+ - Add ``pipe`` macro definition for MinGW (#500).
+
+ - Enhance ``JANSSON_ATTRS`` macro to support earlier C standard(C89) (#501).
+
+ - Update version detection for sphinx-build (#502).
+
+* Documentation:
+
+ - Fix typos (#483, #494).
+
+ - Document that call the custom free function to free the return value
+ of `json_dumps()` if you have a custom malloc/free (#490).
+
+ - Add vcpkg installation instructions (#496).
+
+ - Document that non-blocking file descriptor is not supported on
+ `json_loadfd()` (#503).
+
+
+Version 2.12
+============
+
+Released 2018-11-26
+
+* Bug fixes:
+
+ - Fix error message in `json_pack()` for NULL object (#409).
+
+ - Avoid invalid memory read in `json_pack()` (#421).
+
+ - Call va_end after va_copy in `json_vsprintf()` (#427).
+
+ - Improve handling of formats with '?' and '*' in `json_pack()` (#438).
+
+ - Remove inappropriate `jsonp_free()` which caused segmentation fault in
+ error handling (#444).
+
+* Build:
+
+ - Add function attributes for GCC and CLANG to provide warnings on improper
+ use of jansson routines (#404).
+
+ - Many CMake fixes (#408, #412, #415).
+
+ - Enable -Bsymbolic-functions linker flag whenever possible.
+
+ - Resolve various compiler warnings (#423, #430, #435, #436).
+
+ - Fix code coverage ignored paths (#439).
+
+* Other:
+
+ - Test coverage improvements (#398, #400).
+
+ - Add VS 2017 to appveyor, update Visual Studio documentation (#417).
+
+ - Update copyright for 2018 (#424).
+
+ - Update install instructions in README (#401).
+
+Version 2.11
+============
+
+Released 2018-02-09
+
+* New features:
+
+ - Add `json_pack()` format specifiers s*, o* and O* for values that
+ can be omitted if null (#339).
+
+ - Add `json_error_code()` to retrieve numeric error codes (#365, #380,
+ #381).
+
+ - Enable thread safety for `json_dump()` on all systems. Enable thread
+ safe `json_decref()` and `json_incref()` for modern compilers (#389).
+
+ - Add `json_sprintf()` and `json_vsprintf()` (#393).
+
+* Bug Fixes:
+
+ - Fix incorrect report of success from `json_dump_file()` when an error
+ is returned by `fclose()` (#359).
+
+ - Make json_equal() const-correct (#344).
+
+ - Fix incomplete stealing of references by `json_pack()` (#374).
+
+* Build:
+
+ - Work around gcc's -Wimplicit-fallthrough.
+
+ - Fix CMake detection of ``sys/types.h`` header (#375).
+
+ - Fix `jansson.pc` generated by CMake to be more consistent with the one
+ generated using GNU Autotools (#368).
+
+* Other:
+
+ - Miscellaneous documentation fixes (#356, #378, #395).
+
+ - Remove unnecessary reference actions from parsers (#377).
+
+Version 2.10
+============
+
+Released 2017-03-02
+
+* New features:
+
+ - Add JSON_EMBED encoding flag allowing arrays and objects to be encoded
+ into existing streams (#329).
+
+ - Add `json_dumpb()` function for dumping to a pre-allocated buffer (#328).
+
+ - Add `json_dumpfd()` and `json_loadfd()` functions for dumping to streaming
+ file descriptors (#328).
+
+ - Add support for parsing buffers larger than 2GB (#309).
+
+* Build:
+
+ - Fix CMake build when LONG_LONG_INT is defined as "" (#321)
+
+* Other:
+
+ - Internal code cleanup (#311, #314)
+
+Version 2.9
+===========
+
+Released 2016-09-18
+
+* New features:
+
+ - Add ``json_auto_t`` to automatically decref a value that goes out
+ of scope. Available only on GCC and Clang. (#301)
+
+* Build:
+
+ - Fix CMake build (at least on Linux) by removing conflicting
+ jansson_config.h from the distribution (#306)
+
+ - Change CMake install target generation to be optional (#305)
+
+* Documentation:
+
+ - Small documentation fixes.
+
+
+Version 2.8
+===========
+
+Released 2016-08-30
+
+* New features:
+
+ - Always preserve insertion order of object items.
+ `json_object_iter()` and friends, `json_object_foreach()` and
+ `json_dumps()` and friends now always work in the insertion order of
+ object items (#293).
+
+ - Add `json_object_foreach_safe()` macro that allows
+ `json_object_del()` calls during iteration (#230).
+
+ - Add `json_get_alloc_funcs()` to allow reading the allocation
+ functions set by `json_set_alloc_funcs()` (#262, #264).
+
+ - Add `json_pack()` format specifiers s?, o? and O? for values that
+ can be null (#261, #270).
+
+* Bug fixes:
+
+ - Fix a crash when parsing inputs consisting of very deeply nested
+ arrays or objects (#282, #284).
+
+ - Never convert numbers to integers in the parser when
+ JSON_DECODE_INT_AS_REAL is set. This fixes error messages for
+ overflowing numbers when JSON_DECODE_INT_AS_REAL is set (#212).
+
+ - Fix a use-after-free in `json_pack()` error handling.
+
+ - Fix subnormal number parsing on mingw32.
+
+ - Handle out-of-memory situations gracefully in the hashtable
+ implementation (#298).
+
+* Build:
+
+ - Fix build with CMake on all versions of Visual Studio up to 2015
+ (#262, #289).
+
+ - Fix pkgconfig libdir when using CMake (#268).
+
+ - Fix CMake config for static CRT builds on Windows (#206).
+
+ - Fix warnings on LLVM 6.0 targeting iOS arm64 (#208).
+
+ - Add coverlls.io support via Travis for a nice test coverage badge
+ (#211).
+
+ - Don't expect ``jansson_config.h`` to be in the compiler's include
+ path (#209).
+
+ - Add a build-time option to set initial hashtable size (#213).
+
+ - Use snprintf and strncpy in place of sprintf and strcpy to silence
+ linker warnings on OpenBSD (#233).
+
+* Documentation:
+
+ - Fix various typos in documentation, and a broken link (#258).
+
+ - Add an example program in ``examples/`` (#214, #217).
+
+ - Fix building of documentation man pages (#207).
+
+ - Document the fact that copying objects doesn't preserve the
+ insertion order of keys (#237).
+
+* Tests:
+
+ - Don't use the nonstandard __FUNCTION__ macro in tests.
+
+ - Use expr instead of $((...)) in shell scripts for Solaris 10
+ compatibility.
+
+ - Disable Visual Studio warning C4756 when triggered deliberately in
+ tests (#216).
+
+ - Other minor fixes (#221, #248).
+
+* Other changes:
+
+ - List all unrecognized object keys when strict unpacking fails
+ (#263).
+
+ - Alter the order of the members of the hashtable_pair struct for
+ easier debugging.
+
+ - Minor performance improvement to `json_dump()` and friends (#234).
+
+ - Minor style fixes (#255, #257).
+
+
+Version 2.7
+===========
+
+Released 2014-10-02
+
+* New features:
+
+ - `json_pack()` and friends: Add format specifiers ``s%`` and ``+%``
+ for a size_t string length (#141).
+
+ - `json_unpack()` and friends: Add format specifier ``s%`` for
+ unpacking the string length along with the string itself (#141).
+
+ - Add length-aware string constructors `json_stringn()` and
+ `json_stringn_nocheck()`, length-aware string mutators
+ `json_string_setn()` and `json_string_setn_nocheck()`, and a
+ function for getting string's length `json_string_length()` (#141,
+ #143).
+
+ - Support ``\u0000`` escapes in the decoder. The support can be
+ enabled by using the ``JSON_ALLOW_NUL`` decoding flag (#141).
+
+ - Add `json_boolean_value()` as an alias for `json_is_true()`
+ (#146).
+
+ - Add JSON_REAL_PRECISION encoding flag/macro for controlling real
+ number precision (#178).
+
+ - Define the maximum indentation as JSON_MAX_INDENT (#191).
+
+* Bug fixes:
+
+ - Some malformed ``\uNNNN`` escapes could crash the decoder with an
+ assertion failure.
+
+ - Avoid integer overflows with very long strings in UTF-8 decoder and
+ hashtable.
+
+ - Check for *NULL* key in `json_object_get()` and
+ `json_object_del()` (#151).
+
+ - Enhance hashtable seeding on Windows (#162).
+
+ - `json_unpack()`: Allow mixing JSON_STRICT with optional keys
+ (#162, #163).
+
+ - Fix int/int32 mismatch (#142).
+
+ - Parse subnormal numbers correctly (#202).
+
+* Build:
+
+ - Remove VS2010 build files. CMake should be used on Windows instead
+ (#165).
+
+ - Fix CMake build flags for MinGW (#193).
+
+ - Add CMake config files for find_package. Rename config.h to
+ jansson_private_config.h (#157, #159).
+
+ - Make Valgrind checks work with CMake (#160).
+
+ - Fix feature checks to use correct __ATOMIC flags.
+
+ - Fix CMake checks for uint16_t and uint8_t support (#177).
+
+ - Make Jansson build on SmartOS/Solaris (#171).
+
+ - Work around a GCC bug on Solaris (#175).
+
+ - Fix autoreconf on Debian (#182).
+
+ - Don't use GNU make specific export for global AM_CFLAGS (#203,
+ #204).
+
+ - Fix building on Android using the supplied Android.mk (#166,
+ #174).
+
+ - Android.mk: Add -DHAVE_STDINT_H to LOCAL_CFLAGS (#200).
+
+* Documentation:
+
+ - Document JANSSON_BUILD_SHARED_LIBS CMake option (#187).
+
+* Tests:
+
+ - Close file handles correctly (#198).
+
+* Other changes:
+
+ - ``\uNNNN`` escapes are now encoded in upper case for better
+ readability.
+
+ - Enable usage of AddressSanitizer (#180).
+
+
+Version 2.6
+===========
+
+Released 2014-02-11
+
+* Security:
+
+ - CVE-2013-6401: The hash function used by the hashtable
+ implementation has been changed, and is automatically seeded with
+ random data when the first JSON object is created. This prevents
+ an attacker from causing large JSON objects with specially crafted
+ keys perform poorly.
+
+* New features:
+
+ - `json_object_seed()`: Set the seed value of the hash function.
+
+* Bug fixes:
+
+ - Include CMake specific files in the release tarball.
+
+* Documentation:
+
+ - Fix tutorial source to send a User-Agent header, which is now
+ required by the GitHub API.
+
+ - Set all memory to zero in secure_free() example.
+
+
+Version 2.5
+===========
+
+Released 2013-09-19
+
+* New features:
+
+ - `json_pack()` and friends: Add format specifiers ``s#``, ``+`` and
+ ``+#``.
+
+ - Add ``JSON_DECODE_INT_AS_REAL`` decoding flag to treat all numbers
+ as real in the decoder (#123).
+
+ - Add `json_array_foreach()`, paralleling `json_object_foreach()`
+ (#118).
+
+* Bug fixes:
+
+ - `json_dumps()` and friends: Don't crash if json is *NULL* and
+ ``JSON_ENCODE_ANY`` is set.
+
+ - Fix a theoretical integer overflow in `jsonp_strdup()`.
+
+ - Fix `l_isxdigit()` macro (#97).
+
+ - Fix an off-by-one error in `json_array_remove()`.
+
+* Build:
+
+ - Support CMake in addition to GNU Autotools (#106, #107, #112,
+ #115, #120, #127).
+
+ - Support building for Android (#109).
+
+ - Don't use ``-Werror`` by default.
+
+ - Support building and testing with VPATH (#93).
+
+ - Fix compilation when ``NDEBUG`` is defined (#128)
+
+* Tests:
+
+ - Fix a refleak in ``test/bin/json_process.c``.
+
+* Documentation:
+
+ - Clarify the return value of `json_load_callback_t`.
+
+ - Document how to circumvent problems with separate heaps on Windows.
+
+ - Fix memory leaks and warnings in ``github_commits.c``.
+
+ - Use `json_decref()` properly in tutorial.
+
+* Other:
+
+ - Make it possible to forward declare ``struct json_t``.
+
+
+Version 2.4
+===========
+
+Released 2012-09-23
+
+* New features:
+
+ - Add `json_boolean()` macro that returns the JSON true or false
+ value based on its argument (#86).
+
+ - Add `json_load_callback()` that calls a callback function
+ repeatedly to read the JSON input (#57).
+
+ - Add JSON_ESCAPE_SLASH encoding flag to escape all occurences of
+ ``/`` with ``\/``.
+
+* Bug fixes:
+
+ - Check for and reject NaN and Inf values for reals. Encoding these
+ values resulted in invalid JSON.
+
+ - Fix `json_real_set()` to return -1 on error.
+
+* Build:
+
+ - Jansson now builds on Windows with Visual Studio 2010, and
+ includes solution and project files in ``win32/vs2010/``
+ directory.
+
+ - Fix build warnings (#77, #78).
+
+ - Add ``-no-undefined`` to LDFLAGS (#90).
+
+* Tests:
+
+ - Fix the symbol exports test on Linux/PPC64 (#88).
+
+* Documentation:
+
+ - Fix typos (#73, #84).
+
+
+Version 2.3.1
+=============
+
+Released 2012-04-20
+
+* Build issues:
+
+ - Only use ``long long`` if ``strtoll()`` is also available.
+
+* Documentation:
+
+ - Fix the names of library version constants in documentation. (#52)
+
+ - Change the tutorial to use GitHub API v3. (#65)
+
+* Tests:
+
+ - Make some tests locale independent. (#51)
+
+ - Distribute the library exports test in the tarball.
+
+ - Make test run on shells that don't support the ``export FOO=bar``
+ syntax.
+
+
+Version 2.3
+===========
+
+Released 2012-01-27
+
+* New features:
+
+ - `json_unpack()` and friends: Add support for optional object keys
+ with the ``{s?o}`` syntax.
+
+ - Add `json_object_update_existing()` and
+ `json_object_update_missing()`, for updating only existing keys or
+ only adding missing keys to an object. (#37)
+
+ - Add `json_object_foreach()` for more convenient iteration over
+ objects. (#45, #46)
+
+ - When decoding JSON, write the number of bytes that were read from
+ input to ``error.position`` also on success. This is handy with
+ ``JSON_DISABLE_EOF_CHECK``.
+
+ - Add support for decoding any JSON value, not just arrays or
+ objects. The support is enabled with the new ``JSON_DECODE_ANY``
+ flag. Patch by Andrea Marchesini. (#4)
+
+* Bug fixes
+
+ - Avoid problems with object's serial number growing too big. (#40,
+ #41)
+
+ - Decoding functions now return NULL if the first argument is NULL.
+ Patch by Andrea Marchesini.
+
+ - Include ``jansson_config.h.win32`` in the distribution tarball.
+
+ - Remove ``+`` and leading zeros from exponents in the encoder.
+ (#39)
+
+ - Make Jansson build and work on MinGW. (#39, #38)
+
+* Documentation
+
+ - Note that the same JSON values must not be encoded in parallel by
+ separate threads. (#42)
+
+ - Document MinGW support.
+
+
+Version 2.2.1
+=============
+
+Released 2011-10-06
+
+* Bug fixes:
+
+ - Fix real number encoding and decoding under non-C locales. (#32)
+
+ - Fix identifier decoding under non-UTF-8 locales. (#35)
+
+ - `json_load_file()`: Open the input file in binary mode for maximum
+ compatiblity.
+
+* Documentation:
+
+ - Clarify the lifecycle of the result of the ``s`` fromat of
+ `json_unpack()`. (#31)
+
+ - Add some portability info. (#36)
+
+ - Little clarifications here and there.
+
+* Other:
+
+ - Some style fixes, issues detected by static analyzers.
+
+
+Version 2.2
+===========
+
+Released 2011-09-03
+
+* New features:
+
+ - `json_dump_callback()`: Pass the encoder output to a callback
+ function in chunks.
+
+* Bug fixes:
+
+ - `json_string_set()`: Check that target is a string and value is
+ not NULL.
+
+* Other:
+
+ - Documentation typo fixes and clarifications.
+
+
+Version 2.1
+===========
+
+Released 2011-06-10
+
+* New features:
+
+ - `json_loadb()`: Decode a string with a given size, useful if the
+ string is not null terminated.
+
+ - Add ``JSON_ENCODE_ANY`` encoding flag to allow encoding any JSON
+ value. By default, only arrays and objects can be encoded. (#19)
+
+ - Add ``JSON_REJECT_DUPLICATES`` decoding flag to issue a decoding
+ error if any JSON object in the input contins duplicate keys. (#3)
+
+ - Add ``JSON_DISABLE_EOF_CHECK`` decoding flag to stop decoding after a
+ valid JSON input. This allows other data after the JSON data.
+
+* Bug fixes:
+
+ - Fix an additional memory leak when memory allocation fails in
+ `json_object_set()` and friends.
+
+ - Clear errno before calling `strtod()` for better portability. (#27)
+
+* Building:
+
+ - Avoid set-but-not-used warning/error in a test. (#20)
+
+* Other:
+
+ - Minor clarifications to documentation.
+
+
+Version 2.0.1
+=============
+
+Released 2011-03-31
+
+* Bug fixes:
+
+ - Replace a few `malloc()` and `free()` calls with their
+ counterparts that support custom memory management.
+
+ - Fix object key hashing in json_unpack() strict checking mode.
+
+ - Fix the parentheses in ``JANSSON_VERSION_HEX`` macro.
+
+ - Fix `json_object_size()` return value.
+
+ - Fix a few compilation issues.
+
+* Portability:
+
+ - Enhance portability of `va_copy()`.
+
+ - Test framework portability enhancements.
+
+* Documentation:
+
+ - Distribute ``doc/upgrading.rst`` with the source tarball.
+
+ - Build documentation in strict mode in ``make distcheck``.
+
+
+Version 2.0
+===========
+
+Released 2011-02-28
+
+This release is backwards incompatible with the 1.x release series.
+See the chapter "Upgrading from older versions" in documentation for
+details.
+
+* Backwards incompatible changes:
+
+ - Unify unsigned integer usage in the API: All occurences of
+ unsigned int and unsigned long have been replaced with size_t.
+
+ - Change JSON integer's underlying type to the widest signed integer
+ type available, i.e. long long if it's supported, otherwise long.
+ Add a typedef json_int_t that defines the type.
+
+ - Change the maximum indentation depth to 31 spaces in encoder. This
+ frees up bits from the flags parameter of encoding functions
+ `json_dumpf()`, `json_dumps()` and `json_dump_file()`.
+
+ - For future needs, add a flags parameter to all decoding functions
+ `json_loadf()`, `json_loads()` and `json_load_file()`.
+
+* New features
+
+ - `json_pack()`, `json_pack_ex()`, `json_vpack_ex()`: Create JSON
+ values based on a format string.
+
+ - `json_unpack()`, `json_unpack_ex()`, `json_vunpack_ex()`: Simple
+ value extraction and validation functionality based on a format
+ string.
+
+ - Add column, position and source fields to the ``json_error_t``
+ struct.
+
+ - Enhance error reporting in the decoder.
+
+ - ``JANSSON_VERSION`` et al.: Preprocessor constants that define the
+ library version.
+
+ - `json_set_alloc_funcs()`: Set custom memory allocation functions.
+
+* Fix many portability issues, especially on Windows.
+
+* Configuration
+
+ - Add file ``jansson_config.h`` that contains site specific
+ configuration. It's created automatically by the configure script,
+ or can be created by hand if the configure script cannot be used.
+ The file ``jansson_config.h.win32`` can be used without
+ modifications on Windows systems.
+
+ - Add a section to documentation describing how to build Jansson on
+ Windows.
+
+ - Documentation now requires Sphinx 1.0 or newer.
+
+
+Version 1.3
+===========
+
+Released 2010-06-13
+
+* New functions:
+
+ - `json_object_iter_set()`, `json_object_iter_set_new()`: Change
+ object contents while iterating over it.
+
+ - `json_object_iter_at()`: Return an iterator that points to a
+ specific object item.
+
+* New encoding flags:
+
+ - ``JSON_PRESERVE_ORDER``: Preserve the insertion order of object
+ keys.
+
+* Bug fixes:
+
+ - Fix an error that occured when an array or object was first
+ encoded as empty, then populated with some data, and then
+ re-encoded
+
+ - Fix the situation like above, but when the first encoding resulted
+ in an error
+
+* Documentation:
+
+ - Clarify the documentation on reference stealing, providing an
+ example usage pattern
+
+
+Version 1.2.1
+=============
+
+Released 2010-04-03
+
+* Bug fixes:
+
+ - Fix reference counting on ``true``, ``false`` and ``null``
+ - Estimate real number underflows in decoder with 0.0 instead of
+ issuing an error
+
+* Portability:
+
+ - Make ``int32_t`` available on all systems
+ - Support compilers that don't have the ``inline`` keyword
+ - Require Autoconf 2.60 (for ``int32_t``)
+
+* Tests:
+
+ - Print test names correctly when ``VERBOSE=1``
+ - ``test/suites/api``: Fail when a test fails
+ - Enhance tests for iterators
+ - Enhance tests for decoding texts that contain null bytes
+
+* Documentation:
+
+ - Don't remove ``changes.rst`` in ``make clean``
+ - Add a chapter on RFC conformance
+
+
+Version 1.2
+===========
+
+Released 2010-01-21
+
+* New functions:
+
+ - `json_equal()`: Test whether two JSON values are equal
+ - `json_copy()` and `json_deep_copy()`: Make shallow and deep copies
+ of JSON values
+ - Add a version of all functions taking a string argument that
+ doesn't check for valid UTF-8: `json_string_nocheck()`,
+ `json_string_set_nocheck()`, `json_object_set_nocheck()`,
+ `json_object_set_new_nocheck()`
+
+* New encoding flags:
+
+ - ``JSON_SORT_KEYS``: Sort objects by key
+ - ``JSON_ENSURE_ASCII``: Escape all non-ASCII Unicode characters
+ - ``JSON_COMPACT``: Use a compact representation with all unneeded
+ whitespace stripped
+
+* Bug fixes:
+
+ - Revise and unify whitespace usage in encoder: Add spaces between
+ array and object items, never append newline to output.
+ - Remove const qualifier from the ``json_t`` parameter in
+ `json_string_set()`, `json_integer_set()` and `json_real_set`.
+ - Use ``int32_t`` internally for representing Unicode code points
+ (int is not enough on all platforms)
+
+* Other changes:
+
+ - Convert ``CHANGES`` (this file) to reStructured text and add it to
+ HTML documentation
+ - The test system has been refactored. Python is no longer required
+ to run the tests.
+ - Documentation can now be built by invoking ``make html``
+ - Support for pkg-config
+
+
+Version 1.1.3
+=============
+
+Released 2009-12-18
+
+* Encode reals correctly, so that first encoding and then decoding a
+ real always produces the same value
+* Don't export private symbols in ``libjansson.so``
+
+
+Version 1.1.2
+=============
+
+Released 2009-11-08
+
+* Fix a bug where an error message was not produced if the input file
+ could not be opened in `json_load_file()`
+* Fix an assertion failure in decoder caused by a minus sign without a
+ digit after it
+* Remove an unneeded include of ``stdint.h`` in ``jansson.h``
+
+
+Version 1.1.1
+=============
+
+Released 2009-10-26
+
+* All documentation files were not distributed with v1.1; build
+ documentation in make distcheck to prevent this in the future
+* Fix v1.1 release date in ``CHANGES``
+
+
+Version 1.1
+===========
+
+Released 2009-10-20
+
+* API additions and improvements:
+
+ - Extend array and object APIs
+ - Add functions to modify integer, real and string values
+ - Improve argument validation
+ - Use unsigned int instead of ``uint32_t`` for encoding flags
+
+* Enhance documentation
+
+ - Add getting started guide and tutorial
+ - Fix some typos
+ - General clarifications and cleanup
+
+* Check for integer and real overflows and underflows in decoder
+* Make singleton values thread-safe (``true``, ``false`` and ``null``)
+* Enhance circular reference handling
+* Don't define ``-std=c99`` in ``AM_CFLAGS``
+* Add C++ guards to ``jansson.h``
+* Minor performance and portability improvements
+* Expand test coverage
+
+
+Version 1.0.4
+=============
+
+Released 2009-10-11
+
+* Relax Autoconf version requirement to 2.59
+* Make Jansson compile on platforms where plain ``char`` is unsigned
+* Fix API tests for object
+
+
+Version 1.0.3
+=============
+
+Released 2009-09-14
+
+* Check for integer and real overflows and underflows in decoder
+* Use the Python json module for tests, or simplejson if the json
+ module is not found
+* Distribute changelog (this file)
+
+
+Version 1.0.2
+=============
+
+Released 2009-09-08
+
+* Handle EOF correctly in decoder
+
+
+Version 1.0.1
+=============
+
+Released 2009-09-04
+
+* Fixed broken `json_is_boolean()`
+
+
+Version 1.0
+===========
+
+Released 2009-08-25
+
+* Initial release
diff --git a/src/fluent-bit/lib/jansson-e23f558/CMakeLists.txt b/src/fluent-bit/lib/jansson-e23f558/CMakeLists.txt
new file mode 100644
index 000000000..ed33e3c47
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/CMakeLists.txt
@@ -0,0 +1,662 @@
+cmake_minimum_required (VERSION 3.1)
+project(jansson C)
+
+# Options
+option(JANSSON_BUILD_SHARED_LIBS "Build shared libraries." OFF)
+option(USE_URANDOM "Use /dev/urandom to seed the hash function." ON)
+option(USE_WINDOWS_CRYPTOAPI "Use CryptGenRandom to seed the hash function." ON)
+
+if (MSVC)
+ # This option must match the settings used in your program, in particular if you
+ # are linking statically
+ option(JANSSON_STATIC_CRT "Link the static CRT libraries" OFF )
+endif ()
+
+option(JANSSON_EXAMPLES "Compile example applications" ON)
+
+if (UNIX)
+ option(JANSSON_COVERAGE "(GCC Only! Requires gcov/lcov to be installed). Include target for doing coverage analysis for the test suite. Note that -DCMAKE_BUILD_TYPE=Debug must be set" OFF)
+endif ()
+
+# Set some nicer output dirs.
+set(CMAKE_RUNTIME_OUTPUT_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/bin)
+set(CMAKE_LIBRARY_OUTPUT_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/lib)
+set(CMAKE_ARCHIVE_OUTPUT_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/lib)
+set(JANSSON_TEMP_DIR ${CMAKE_CURRENT_BINARY_DIR}/tmp)
+
+# Give the debug version a different postfix for windows,
+# so both the debug and release version can be built in the
+# same build-tree on Windows (MSVC).
+if (WIN32 AND NOT CMAKE_DEBUG_POSTFIX)
+ set(CMAKE_DEBUG_POSTFIX "_d")
+endif()
+
+# This is how I thought it should go
+# set (JANSSON_VERSION "2.3.1")
+# set (JANSSON_SOVERSION 2)
+
+set(JANSSON_DISPLAY_VERSION "2.14")
+
+# This is what is required to match the same numbers as automake's
+set(JANSSON_VERSION "4.14.0")
+set(JANSSON_SOVERSION 4)
+
+# for CheckFunctionKeywords
+set(CMAKE_MODULE_PATH "${CMAKE_CURRENT_SOURCE_DIR}/cmake")
+
+include (CheckCSourceCompiles)
+include (CheckFunctionExists)
+include (CheckFunctionKeywords)
+include (CheckIncludeFiles)
+include (CheckTypeSize)
+
+# suppress format-truncation warning
+include (CheckCCompilerFlag)
+check_c_compiler_flag(-Wno-format-truncation HAS_NO_FORMAT_TRUNCATION)
+if (HAS_NO_FORMAT_TRUNCATION)
+ set(CMAKE_C_FLAGS "${CMAKE_C_FLAGS} -Wno-format-truncation")
+endif()
+
+if (MSVC)
+ # Turn off Microsofts "security" warnings.
+ add_definitions( "/W3 /D_CRT_SECURE_NO_WARNINGS /wd4005 /wd4996 /nologo" )
+
+ if (JANSSON_STATIC_CRT)
+ set(CMAKE_C_FLAGS_RELEASE "${CMAKE_C_FLAGS_RELEASE} /MT")
+ set(CMAKE_C_FLAGS_DEBUG "${CMAKE_C_FLAGS_DEBUG} /MTd")
+ endif()
+endif()
+
+message("C compiler: ${CMAKE_C_COMPILER_ID}")
+
+if (JANSSON_COVERAGE)
+ include(CodeCoverage)
+ set(CMAKE_C_FLAGS "${CMAKE_C_FLAGS} -g -O0 -fprofile-arcs -ftest-coverage")
+endif()
+
+check_include_files (endian.h HAVE_ENDIAN_H)
+check_include_files (fcntl.h HAVE_FCNTL_H)
+check_include_files (sched.h HAVE_SCHED_H)
+check_include_files (unistd.h HAVE_UNISTD_H)
+check_include_files (sys/param.h HAVE_SYS_PARAM_H)
+check_include_files (sys/stat.h HAVE_SYS_STAT_H)
+check_include_files (sys/time.h HAVE_SYS_TIME_H)
+check_include_files (sys/types.h HAVE_SYS_TYPES_H)
+
+check_function_exists (close HAVE_CLOSE)
+check_function_exists (getpid HAVE_GETPID)
+check_function_exists (gettimeofday HAVE_GETTIMEOFDAY)
+check_function_exists (open HAVE_OPEN)
+check_function_exists (read HAVE_READ)
+check_function_exists (sched_yield HAVE_SCHED_YIELD)
+
+# Check for the int-type includes
+check_include_files (stdint.h HAVE_STDINT_H)
+
+# Check our 64 bit integer sizes
+check_type_size (__int64 __INT64)
+check_type_size (int64_t INT64_T)
+check_type_size ("long long" LONG_LONG_INT)
+
+# Check our 32 bit integer sizes
+check_type_size (int32_t INT32_T)
+check_type_size (__int32 __INT32)
+check_type_size ("long" LONG_INT)
+check_type_size ("int" INT)
+if (HAVE_INT32_T)
+ set (JSON_INT32 int32_t)
+elseif (HAVE___INT32)
+ set (JSON_INT32 __int32)
+elseif (HAVE_LONG_INT AND (LONG_INT EQUAL 4))
+ set (JSON_INT32 long)
+elseif (HAVE_INT AND (INT EQUAL 4))
+ set (JSON_INT32 int)
+else ()
+ message (FATAL_ERROR "Could not detect a valid 32-bit integer type")
+endif ()
+
+check_type_size ("unsigned long" UNSIGNED_LONG_INT)
+check_type_size ("unsigned int" UNSIGNED_INT)
+check_type_size ("unsigned short" UNSIGNED_SHORT)
+
+check_type_size (uint32_t UINT32_T)
+check_type_size (__uint32 __UINT32)
+if (HAVE_UINT32_T)
+ set (JSON_UINT32 uint32_t)
+elseif (HAVE___UINT32)
+ set (JSON_UINT32 __uint32)
+elseif (HAVE_UNSIGNED_LONG_INT AND (UNSIGNED_LONG_INT EQUAL 4))
+ set (JSON_UINT32 "unsigned long")
+elseif (HAVE_UNSIGNED_INT AND (UNSIGNED_INT EQUAL 4))
+ set (JSON_UINT32 "unsigned int")
+else ()
+ message (FATAL_ERROR "Could not detect a valid unsigned 32-bit integer type")
+endif ()
+
+check_type_size (uint16_t UINT16_T)
+check_type_size (__uint16 __UINT16)
+if (HAVE_UINT16_T)
+ set (JSON_UINT16 uint16_t)
+elseif (HAVE___UINT16)
+ set (JSON_UINT16 __uint16)
+elseif (HAVE_UNSIGNED_INT AND (UNSIGNED_INT EQUAL 2))
+ set (JSON_UINT16 "unsigned int")
+elseif (HAVE_UNSIGNED_SHORT AND (UNSIGNED_SHORT EQUAL 2))
+ set (JSON_UINT16 "unsigned short")
+else ()
+ message (FATAL_ERROR "Could not detect a valid unsigned 16-bit integer type")
+endif ()
+
+check_type_size (uint8_t UINT8_T)
+check_type_size (__uint8 __UINT8)
+if (HAVE_UINT8_T)
+ set (JSON_UINT8 uint8_t)
+elseif (HAVE___UINT8)
+ set (JSON_UINT8 __uint8)
+else ()
+ set (JSON_UINT8 "unsigned char")
+endif ()
+
+# Check for ssize_t and SSIZE_T existence.
+check_type_size(ssize_t SSIZE_T)
+check_type_size(SSIZE_T UPPERCASE_SSIZE_T)
+if(NOT HAVE_SSIZE_T)
+ if(HAVE_UPPERCASE_SSIZE_T)
+ set(JSON_SSIZE SSIZE_T)
+ else()
+ set(JSON_SSIZE int)
+ endif()
+endif()
+set(CMAKE_EXTRA_INCLUDE_FILES "")
+
+# Check for all the variants of strtoll
+check_function_exists (strtoll HAVE_STRTOLL)
+check_function_exists (strtoq HAVE_STRTOQ)
+check_function_exists (_strtoi64 HAVE__STRTOI64)
+
+# Figure out what variant we should use
+if (HAVE_STRTOLL)
+ set (JSON_STRTOINT strtoll)
+elseif (HAVE_STRTOQ)
+ set (JSON_STRTOINT strtoq)
+elseif (HAVE__STRTOI64)
+ set (JSON_STRTOINT _strtoi64)
+else ()
+ # fallback to strtol (32 bit)
+ # this will set all the required variables
+ set (JSON_STRTOINT strtol)
+ set (JSON_INT_T long)
+ set (JSON_INTEGER_FORMAT "\"ld\"")
+endif ()
+
+# if we haven't defined JSON_INT_T, then we have a 64 bit conversion function.
+# detect what to use for the 64 bit type.
+# Note: I will prefer long long if I can get it, as that is what the automake system aimed for.
+if (NOT DEFINED JSON_INT_T)
+ if (HAVE_LONG_LONG_INT AND (LONG_LONG_INT EQUAL 8))
+ set (JSON_INT_T "long long")
+ elseif (HAVE_INT64_T)
+ set (JSON_INT_T int64_t)
+ elseif (HAVE___INT64)
+ set (JSON_INT_T __int64)
+ else ()
+ message (FATAL_ERROR "Could not detect 64 bit type, although I detected the strtoll equivalent")
+ endif ()
+
+ # Apparently, Borland BCC and MSVC wants I64d,
+ # Borland BCC could also accept LD
+ # and gcc wants ldd,
+ # I am not sure what cygwin will want, so I will assume I64d
+
+ if (WIN32) # matches both msvc and cygwin
+ set (JSON_INTEGER_FORMAT "\"I64d\"")
+ else ()
+ set (JSON_INTEGER_FORMAT "\"lld\"")
+ endif ()
+endif ()
+
+
+# If locale.h and localeconv() are available, define to 1, otherwise to 0.
+check_include_files (locale.h HAVE_LOCALE_H)
+check_function_exists (localeconv HAVE_LOCALECONV)
+
+if (HAVE_LOCALECONV AND HAVE_LOCALE_H)
+ set (JSON_HAVE_LOCALECONV 1)
+else ()
+ set (JSON_HAVE_LOCALECONV 0)
+endif()
+
+# check if we have setlocale
+check_function_exists(setlocale HAVE_SETLOCALE)
+
+# Check what the inline keyword is.
+# Note that the original JSON_INLINE was always set to just 'inline', so this goes further.
+check_function_keywords("inline")
+check_function_keywords("__inline")
+check_function_keywords("__inline__")
+
+if (HAVE_INLINE)
+ set(JSON_INLINE inline)
+elseif (HAVE___INLINE)
+ set(JSON_INLINE __inline)
+elseif (HAVE___INLINE__)
+ set(JSON_INLINE __inline__)
+else()
+ # no inline on this platform
+ set (JSON_INLINE)
+endif()
+
+check_c_source_compiles ("int main() { unsigned long val; __sync_bool_compare_and_swap(&val, 0, 1); __sync_add_and_fetch(&val, 1); __sync_sub_and_fetch(&val, 1); return 0; } " HAVE_SYNC_BUILTINS)
+check_c_source_compiles ("int main() { char l; unsigned long v; __atomic_test_and_set(&l, __ATOMIC_RELAXED); __atomic_store_n(&v, 1, __ATOMIC_RELEASE); __atomic_load_n(&v, __ATOMIC_ACQUIRE); __atomic_add_fetch(&v, 1, __ATOMIC_ACQUIRE); __atomic_sub_fetch(&v, 1, __ATOMIC_RELEASE); return 0; }" HAVE_ATOMIC_BUILTINS)
+
+if (HAVE_SYNC_BUILTINS)
+ set(JSON_HAVE_SYNC_BUILTINS 1)
+else()
+ set(JSON_HAVE_SYNC_BUILTINS 0)
+endif()
+
+if (HAVE_ATOMIC_BUILTINS)
+ set(JSON_HAVE_ATOMIC_BUILTINS 1)
+else()
+ set(JSON_HAVE_ATOMIC_BUILTINS 0)
+endif()
+
+set (JANSSON_INITIAL_HASHTABLE_ORDER 3 CACHE STRING "Number of buckets new object hashtables contain is 2 raised to this power. The default is 3, so empty hashtables contain 2^3 = 8 buckets.")
+
+# configure the public config file
+configure_file (${CMAKE_CURRENT_SOURCE_DIR}/cmake/jansson_config.h.cmake
+ ${CMAKE_CURRENT_BINARY_DIR}/include/jansson_config.h)
+
+# Copy the jansson.h file to the public include folder
+file (COPY ${CMAKE_CURRENT_SOURCE_DIR}/src/jansson.h
+ DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/include/)
+
+add_definitions(-DJANSSON_USING_CMAKE)
+
+# configure the private config file
+configure_file (${CMAKE_CURRENT_SOURCE_DIR}/cmake/jansson_private_config.h.cmake
+ ${CMAKE_CURRENT_BINARY_DIR}/private_include/jansson_private_config.h)
+
+# and tell the source code to include it
+add_definitions(-DHAVE_CONFIG_H)
+
+include_directories (${CMAKE_CURRENT_BINARY_DIR}/include)
+include_directories (${CMAKE_CURRENT_BINARY_DIR}/private_include)
+
+# Add the lib sources.
+file(GLOB JANSSON_SRC src/*.c)
+
+set(JANSSON_HDR_PRIVATE
+ ${CMAKE_CURRENT_SOURCE_DIR}/src/hashtable.h
+ ${CMAKE_CURRENT_SOURCE_DIR}/src/jansson_private.h
+ ${CMAKE_CURRENT_SOURCE_DIR}/src/strbuffer.h
+ ${CMAKE_CURRENT_SOURCE_DIR}/src/utf.h
+ ${CMAKE_CURRENT_BINARY_DIR}/private_include/jansson_private_config.h)
+
+set(JANSSON_HDR_PUBLIC
+ ${CMAKE_CURRENT_BINARY_DIR}/include/jansson_config.h
+ ${CMAKE_CURRENT_SOURCE_DIR}/src/jansson.h)
+
+source_group("Library Sources" FILES ${JANSSON_SRC})
+source_group("Library Private Headers" FILES ${JANSSON_HDR_PRIVATE})
+source_group("Library Public Headers" FILES ${JANSSON_HDR_PUBLIC})
+
+if(JANSSON_BUILD_SHARED_LIBS)
+ add_library(jansson SHARED
+ ${JANSSON_SRC}
+ ${JANSSON_HDR_PRIVATE}
+ ${JANSSON_HDR_PUBLIC}
+ src/jansson.def)
+
+# check if linker support --default-symver
+ list(APPEND CMAKE_REQUIRED_LIBRARIES "-Wl,--default-symver")
+ check_c_source_compiles(
+ "
+ int main (void)
+ {
+ return 0;
+ }
+ "
+ DSYMVER_WORKS
+ )
+ list(REMOVE_ITEM CMAKE_REQUIRED_LIBRARIES "-Wl,--default-symver")
+
+ if (SYMVER_WORKS)
+ set(CMAKE_SHARED_LINKER_FLAGS "${CMAKE_SHARED_LINKER_FLAGS} -Wl,--default-symver")
+ else()
+# some linkers may only support --version-script
+ file(WRITE "${CMAKE_CURRENT_BINARY_DIR}/jansson.sym" "JANSSON_${JANSSON_SOVERSION} {
+ global:
+ *;
+};
+")
+ list(APPEND CMAKE_REQUIRED_LIBRARIES "-Wl,--version-script,${CMAKE_CURRENT_BINARY_DIR}/jansson.sym")
+ check_c_source_compiles(
+ "
+ int main (void)
+ {
+ return 0;
+ }
+ "
+ VSCRIPT_WORKS
+ )
+ list(REMOVE_ITEM CMAKE_REQUIRED_LIBRARIES "-Wl,--version-script,${CMAKE_CURRENT_BINARY_DIR}/jansson.sym")
+ if (VSCRIPT_WORKS)
+ set(CMAKE_SHARED_LINKER_FLAGS "${CMAKE_SHARED_LINKER_FLAGS} -Wl,--version-script,${CMAKE_CURRENT_BINARY_DIR}/jansson.sym")
+ endif()
+ endif()
+
+ set_target_properties(jansson PROPERTIES
+ VERSION ${JANSSON_VERSION}
+ SOVERSION ${JANSSON_SOVERSION})
+else()
+ add_library(jansson STATIC
+ ${JANSSON_SRC}
+ ${JANSSON_HDR_PRIVATE}
+ ${JANSSON_HDR_PUBLIC})
+ set_target_properties(jansson PROPERTIES
+ POSITION_INDEPENDENT_CODE true)
+endif()
+
+if (JANSSON_EXAMPLES)
+ add_executable(simple_parse "${CMAKE_CURRENT_SOURCE_DIR}/examples/simple_parse.c")
+ target_link_libraries(simple_parse jansson)
+endif()
+
+# For building Documentation (uses Sphinx)
+option(JANSSON_BUILD_DOCS "Build documentation (uses python-sphinx)." ON)
+if (JANSSON_BUILD_DOCS)
+ find_package(Sphinx)
+
+ if (NOT SPHINX_FOUND)
+ message(WARNING "Sphinx not found. Cannot generate documentation!
+ Set -DJANSSON_BUILD_DOCS=OFF to get rid of this message.")
+ else()
+ if (Sphinx_VERSION_STRING VERSION_LESS 1.0)
+ message(WARNING "Your Sphinx version is too old!
+ This project requires Sphinx v1.0 or above to produce
+ proper documentation (you have v${Sphinx_VERSION_STRING}).
+ You will get output but it will have errors.")
+ endif()
+
+ # configured documentation tools and intermediate build results
+ set(BINARY_BUILD_DIR "${CMAKE_CURRENT_BINARY_DIR}/_build")
+
+ # Sphinx cache with pickled ReST documents
+ set(SPHINX_CACHE_DIR "${CMAKE_CURRENT_BINARY_DIR}/_doctrees")
+
+ # CMake could be used to build the conf.py file too,
+ # eg it could automatically write the version of the program or change the theme.
+ # if(NOT DEFINED SPHINX_THEME)
+ # set(SPHINX_THEME default)
+ # endif()
+ #
+ # if(NOT DEFINED SPHINX_THEME_DIR)
+ # set(SPHINX_THEME_DIR)
+ # endif()
+ #
+ # configure_file(
+ # "${CMAKE_CURRENT_SOURCE_DIR}/conf.py.in"
+ # "${BINARY_BUILD_DIR}/conf.py"
+ # @ONLY)
+
+ # TODO: Add support for all sphinx builders: http://sphinx-doc.org/builders.html
+
+ # Add documentation targets.
+ set(DOC_TARGETS html)
+
+ option(JANSSON_BUILD_MAN "Create a target for building man pages." ON)
+
+ if (JANSSON_BUILD_MAN)
+ if (Sphinx_VERSION_STRING VERSION_LESS 1.0)
+ message(WARNING "Sphinx version 1.0 > is required to build man pages. You have v${Sphinx_VERSION_STRING}.")
+ else()
+ list(APPEND DOC_TARGETS man)
+ endif()
+ endif()
+
+ option(JANSSON_BUILD_LATEX "Create a target for building latex docs (to create PDF)." OFF)
+
+ if (JANSSON_BUILD_LATEX)
+ find_package(LATEX)
+
+ if (NOT LATEX_COMPILER)
+ message("Couldn't find Latex, can't build latex docs using Sphinx")
+ else()
+ message("Latex found! If you have problems building, see Sphinx documentation for required Latex packages.")
+ list(APPEND DOC_TARGETS latex)
+ endif()
+ endif()
+
+ # The doc target will build all documentation targets.
+ add_custom_target(doc)
+
+ foreach (DOC_TARGET ${DOC_TARGETS})
+ add_custom_target(${DOC_TARGET}
+ ${SPHINX_EXECUTABLE}
+ # -q # Enable for quiet mode
+ -b ${DOC_TARGET}
+ -d "${SPHINX_CACHE_DIR}"
+ # -c "${BINARY_BUILD_DIR}" # enable if using cmake-generated conf.py
+ "${CMAKE_CURRENT_SOURCE_DIR}/doc"
+ "${CMAKE_CURRENT_BINARY_DIR}/doc/${DOC_TARGET}"
+ COMMENT "Building ${DOC_TARGET} documentation with Sphinx")
+
+ add_dependencies(doc ${DOC_TARGET})
+ endforeach()
+
+ message("Building documentation enabled for: ${DOC_TARGETS}")
+ endif()
+endif ()
+
+
+option(JANSSON_WITHOUT_TESTS "Don't build tests ('make test' to execute tests)" OFF)
+
+if (NOT JANSSON_WITHOUT_TESTS)
+ option(JANSSON_TEST_WITH_VALGRIND "Enable valgrind tests." OFF)
+
+ ENABLE_TESTING()
+
+ if (JANSSON_TEST_WITH_VALGRIND)
+ # TODO: Add FindValgrind.cmake instead of having a hardcoded path.
+
+ add_definitions(-DVALGRIND)
+
+ # enable valgrind
+ set(CMAKE_MEMORYCHECK_COMMAND valgrind)
+ set(CMAKE_MEMORYCHECK_COMMAND_OPTIONS
+ "--error-exitcode=1 --leak-check=full --show-reachable=yes --track-origins=yes -q")
+
+ set(MEMCHECK_COMMAND
+ "${CMAKE_MEMORYCHECK_COMMAND} ${CMAKE_MEMORYCHECK_COMMAND_OPTIONS}")
+ separate_arguments(MEMCHECK_COMMAND)
+ endif ()
+
+ #
+ # Test suites.
+ #
+ if (CMAKE_COMPILER_IS_GNUCC)
+ add_definitions(-Wall -Wextra -Wdeclaration-after-statement)
+ endif ()
+
+ set(api_tests
+ test_array
+ test_chaos
+ test_copy
+ test_dump
+ test_dump_callback
+ test_equal
+ test_fixed_size
+ test_load
+ test_load_callback
+ test_loadb
+ test_number
+ test_object
+ test_pack
+ test_simple
+ test_sprintf
+ test_unpack)
+
+ # Doing arithmetic on void pointers is not allowed by Microsofts compiler
+ # such as secure_malloc and secure_free is doing, so exclude it for now.
+ if (NOT MSVC)
+ list(APPEND api_tests test_memory_funcs)
+ endif()
+
+ # Helper macro for building and linking a test program.
+ macro(build_testprog name dir)
+ add_executable(${name} ${dir}/${name}.c)
+ add_dependencies(${name} jansson)
+ target_link_libraries(${name} jansson)
+ endmacro(build_testprog)
+
+ # Create executables and tests/valgrind tests for API tests.
+ foreach (test ${api_tests})
+ build_testprog(${test} ${CMAKE_CURRENT_SOURCE_DIR}/test/suites/api)
+
+ if (JANSSON_TEST_WITH_VALGRIND)
+ add_test(memcheck__${test}
+ ${MEMCHECK_COMMAND} ${CMAKE_RUNTIME_OUTPUT_DIRECTORY}/${test}
+ WORKING_DIRECTORY ${JANSSON_TEMP_DIR})
+ else()
+ add_test(${test}
+ ${CMAKE_RUNTIME_OUTPUT_DIRECTORY}/${test}
+ WORKING_DIRECTORY ${JANSSON_TEMP_DIR})
+ endif ()
+ endforeach ()
+
+ # Test harness for the suites tests.
+ build_testprog(json_process ${CMAKE_CURRENT_SOURCE_DIR}/test/bin)
+
+ set(SUITE_TEST_CMD ${CMAKE_RUNTIME_OUTPUT_DIRECTORY}/json_process)
+ set(SUITES encoding-flags valid invalid invalid-unicode)
+ foreach (SUITE ${SUITES})
+ file(GLOB TESTDIRS test/suites/${SUITE}/*)
+
+ foreach (TESTDIR ${TESTDIRS})
+ if (IS_DIRECTORY ${TESTDIR})
+ get_filename_component(TNAME ${TESTDIR} NAME)
+
+ if (JANSSON_TEST_WITH_VALGRIND)
+ add_test(memcheck__${SUITE}__${TNAME}
+ ${MEMCHECK_COMMAND} ${SUITE_TEST_CMD} ${TESTDIR})
+ else()
+ add_test(${SUITE}__${TNAME}
+ ${SUITE_TEST_CMD} ${TESTDIR})
+ endif()
+
+ if ((${SUITE} STREQUAL "valid" OR ${SUITE} STREQUAL "invalid") AND NOT EXISTS ${TESTDIR}/nostrip)
+ if (JANSSON_TEST_WITH_VALGRIND)
+ add_test(memcheck__${SUITE}__${TNAME}__strip
+ ${MEMCHECK_COMMAND} ${SUITE_TEST_CMD} --strip ${TESTDIR})
+ else()
+ add_test(${SUITE}__${TNAME}__strip
+ ${SUITE_TEST_CMD} --strip ${TESTDIR})
+ endif()
+ endif ()
+ endif ()
+ endforeach ()
+ endforeach ()
+
+ if (JANSSON_COVERAGE)
+ SETUP_TARGET_FOR_COVERAGE(coverage coverage ctest)
+ endif ()
+
+ # Enable using "make check" just like the autotools project.
+ # By default cmake creates a target "make test"
+ add_custom_target(check COMMAND ${CMAKE_CTEST_COMMAND}
+ DEPENDS json_process ${api_tests})
+endif ()
+
+#
+# Installation preparation.
+#
+
+# Allow the user to override installation directories.
+set(JANSSON_INSTALL_LIB_DIR lib CACHE PATH "Installation directory for libraries")
+set(JANSSON_INSTALL_BIN_DIR bin CACHE PATH "Installation directory for executables")
+set(JANSSON_INSTALL_INCLUDE_DIR include CACHE PATH "Installation directory for header files")
+
+if(WIN32 AND NOT CYGWIN)
+ set(DEF_INSTALL_CMAKE_DIR cmake)
+else()
+ set(DEF_INSTALL_CMAKE_DIR lib/cmake/jansson)
+endif()
+
+set(JANSSON_INSTALL_CMAKE_DIR ${DEF_INSTALL_CMAKE_DIR} CACHE PATH "Installation directory for CMake files")
+
+# Create pkg-conf file.
+# (We use the same files as ./configure does, so we
+# have to defined the same variables used there).
+set(prefix ${CMAKE_INSTALL_PREFIX})
+set(exec_prefix "\${prefix}")
+set(libdir "\${exec_prefix}/${JANSSON_INSTALL_LIB_DIR}")
+set(includedir "\${prefix}/${JANSSON_INSTALL_INCLUDE_DIR}")
+set(VERSION ${JANSSON_DISPLAY_VERSION})
+configure_file(${CMAKE_CURRENT_SOURCE_DIR}/jansson.pc.in
+ ${CMAKE_CURRENT_BINARY_DIR}/jansson.pc @ONLY)
+
+# Make sure the paths are relative.
+foreach(p LIB BIN INCLUDE CMAKE)
+ set(var JANSSON_INSTALL_${p}_DIR)
+endforeach()
+
+# Generate the config file for the build-tree.
+set(JANSSON__INCLUDE_DIRS
+ "${CMAKE_CURRENT_SOURCE_DIR}/include"
+ "${CMAKE_CURRENT_BINARY_DIR}/include")
+set(JANSSON_INCLUDE_DIRS ${JANSSON__INCLUDE_DIRS} CACHE PATH "Jansson include directories")
+configure_file(${CMAKE_CURRENT_SOURCE_DIR}/cmake/janssonConfig.cmake.in
+ ${CMAKE_CURRENT_BINARY_DIR}/janssonConfig.cmake
+ @ONLY)
+
+
+# Generate the config file for the installation tree.
+include(CMakePackageConfigHelpers)
+
+write_basic_package_version_file(
+ "${CMAKE_CURRENT_BINARY_DIR}/cmake/janssonConfigVersion.cmake"
+ VERSION ${JANSSON_VERSION}
+ COMPATIBILITY ExactVersion
+)
+
+configure_package_config_file(
+ "cmake/janssonConfig.cmake.in"
+ "${CMAKE_CURRENT_BINARY_DIR}/cmake/janssonConfig.cmake"
+ INSTALL_DESTINATION "${JANSSON_INSTALL_CMAKE_DIR}"
+)
+
+#
+# Install targets.
+#
+option(JANSSON_INSTALL "Generate installation target" ON)
+if (JANSSON_INSTALL)
+ install(TARGETS jansson
+ EXPORT janssonTargets
+ LIBRARY DESTINATION "lib"
+ ARCHIVE DESTINATION "lib"
+ RUNTIME DESTINATION "bin"
+ INCLUDES DESTINATION "include")
+
+ install(FILES ${JANSSON_HDR_PUBLIC}
+ DESTINATION "include")
+
+ # Install the pkg-config.
+ install(FILES
+ ${CMAKE_CURRENT_BINARY_DIR}/jansson.pc
+ DESTINATION lib/pkgconfig)
+
+ # Install the configs.
+ install(FILES
+ ${CMAKE_CURRENT_BINARY_DIR}/cmake/janssonConfig.cmake
+ ${CMAKE_CURRENT_BINARY_DIR}/cmake/janssonConfigVersion.cmake
+ DESTINATION "${JANSSON_INSTALL_CMAKE_DIR}")
+
+ # Install exports for the install-tree.
+ install(EXPORT janssonTargets
+ NAMESPACE jansson::
+ DESTINATION "${JANSSON_INSTALL_CMAKE_DIR}")
+endif()
+
+# For use when simply using add_library from a parent project to build jansson.
+set(JANSSON_LIBRARIES jansson CACHE STRING "jansson libraries")
diff --git a/src/fluent-bit/lib/jansson-e23f558/CleanSpec.mk b/src/fluent-bit/lib/jansson-e23f558/CleanSpec.mk
new file mode 100644
index 000000000..b84e1b65e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/CleanSpec.mk
@@ -0,0 +1,49 @@
+# Copyright (C) 2007 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+# If you don't need to do a full clean build but would like to touch
+# a file or delete some intermediate files, add a clean step to the end
+# of the list. These steps will only be run once, if they haven't been
+# run before.
+#
+# E.g.:
+# $(call add-clean-step, touch -c external/sqlite/sqlite3.h)
+# $(call add-clean-step, rm -rf $(PRODUCT_OUT)/obj/STATIC_LIBRARIES/libz_intermediates)
+#
+# Always use "touch -c" and "rm -f" or "rm -rf" to gracefully deal with
+# files that are missing or have been moved.
+#
+# Use $(PRODUCT_OUT) to get to the "out/target/product/blah/" directory.
+# Use $(OUT_DIR) to refer to the "out" directory.
+#
+# If you need to re-do something that's already mentioned, just copy
+# the command and add it to the bottom of the list. E.g., if a change
+# that you made last week required touching a file and a change you
+# made today requires touching the same file, just copy the old
+# touch step and add it to the end of the list.
+#
+# ************************************************
+# NEWER CLEAN STEPS MUST BE AT THE END OF THE LIST
+# ************************************************
+
+# For example:
+#$(call add-clean-step, rm -rf $(OUT_DIR)/target/common/obj/APPS/AndroidTests_intermediates)
+#$(call add-clean-step, rm -rf $(OUT_DIR)/target/common/obj/JAVA_LIBRARIES/core_intermediates)
+#$(call add-clean-step, find $(OUT_DIR) -type f -name "IGTalkSession*" -print0 | xargs -0 rm -f)
+#$(call add-clean-step, rm -rf $(PRODUCT_OUT)/data/*)
+
+# ************************************************
+# NEWER CLEAN STEPS MUST BE AT THE END OF THE LIST
+# ************************************************
diff --git a/src/fluent-bit/lib/jansson-e23f558/LICENSE b/src/fluent-bit/lib/jansson-e23f558/LICENSE
new file mode 100644
index 000000000..483459ca9
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2009-2020 Petri Lehtinen <petri@digip.org>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/src/fluent-bit/lib/jansson-e23f558/Makefile.am b/src/fluent-bit/lib/jansson-e23f558/Makefile.am
new file mode 100644
index 000000000..a6f9192d8
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/Makefile.am
@@ -0,0 +1,12 @@
+EXTRA_DIST = CHANGES LICENSE README.rst CMakeLists.txt cmake android examples scripts
+SUBDIRS = doc src test
+
+# "make distcheck" builds the dvi target, so use it to check that the
+# documentation is built correctly.
+dvi:
+ $(MAKE) SPHINXOPTS_EXTRA=-W html
+
+pkgconfigdir = $(libdir)/pkgconfig
+pkgconfig_DATA = jansson.pc
+
+TESTS = scripts/clang-format-check
diff --git a/src/fluent-bit/lib/jansson-e23f558/README.rst b/src/fluent-bit/lib/jansson-e23f558/README.rst
new file mode 100644
index 000000000..4a307dc15
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/README.rst
@@ -0,0 +1,74 @@
+Jansson README
+==============
+
+.. image:: https://github.com/akheron/jansson/workflows/tests/badge.svg
+ :target: https://github.com/akheron/jansson/actions
+
+.. image:: https://ci.appveyor.com/api/projects/status/lmhkkc4q8cwc65ko
+ :target: https://ci.appveyor.com/project/akheron/jansson
+
+.. image:: https://coveralls.io/repos/akheron/jansson/badge.png?branch=master
+ :target: https://coveralls.io/r/akheron/jansson?branch=master
+
+Jansson_ is a C library for encoding, decoding and manipulating JSON
+data. Its main features and design principles are:
+
+- Simple and intuitive API and data model
+
+- `Comprehensive documentation`_
+
+- No dependencies on other libraries
+
+- Full Unicode support (UTF-8)
+
+- Extensive test suite
+
+Jansson is licensed under the `MIT license`_; see LICENSE in the
+source distribution for details.
+
+Compilation and Installation
+----------------------------
+
+If you obtained a ``jansson-X.Y.tar.*`` tarball from GitHub Releases, just use
+the standard autotools commands::
+
+ $ ./configure
+ $ make
+ $ make install
+
+To run the test suite, invoke::
+
+ $ make check
+
+If the source has been checked out from a Git repository, the ``configure``
+script has to be generated first. The easiest way is to use autoreconf::
+
+ $ autoreconf -i
+
+
+Documentation
+-------------
+
+Documentation is available at http://jansson.readthedocs.io/en/latest/.
+
+The documentation source is in the ``doc/`` subdirectory. To generate
+HTML documentation, invoke::
+
+ $ make html
+
+Then, point your browser to ``doc/_build/html/index.html``. Sphinx_
+1.0 or newer is required to generate the documentation.
+
+
+Community
+---------
+
+* `Documentation <http://jansson.readthedocs.io/en/latest/>`_
+* `Issue tracker <https://github.com/akheron/jansson/issues>`_
+* `Mailing list <http://groups.google.com/group/jansson-users>`_
+* `Wiki <https://github.com/akheron/jansson/wiki>`_ contains some development documentation
+
+.. _Jansson: http://www.digip.org/jansson/
+.. _`Comprehensive documentation`: http://jansson.readthedocs.io/en/latest/
+.. _`MIT license`: http://www.opensource.org/licenses/mit-license.php
+.. _Sphinx: http://sphinx.pocoo.org/
diff --git a/src/fluent-bit/lib/jansson-e23f558/android/jansson_config.h b/src/fluent-bit/lib/jansson-e23f558/android/jansson_config.h
new file mode 100644
index 000000000..618a0da73
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/android/jansson_config.h
@@ -0,0 +1,43 @@
+/*
+ * Copyright (c) 2010-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ *
+ *
+ * This file specifies a part of the site-specific configuration for
+ * Jansson, namely those things that affect the public API in
+ * jansson.h.
+ *
+ * The configure script copies this file to jansson_config.h and
+ * replaces @var@ substitutions by values that fit your system. If you
+ * cannot run the configure script, you can do the value substitution
+ * by hand.
+ */
+
+#ifndef JANSSON_CONFIG_H
+#define JANSSON_CONFIG_H
+
+/* If your compiler supports the inline keyword in C, JSON_INLINE is
+ defined to `inline', otherwise empty. In C++, the inline is always
+ supported. */
+#ifdef __cplusplus
+#define JSON_INLINE inline
+#else
+#define JSON_INLINE inline
+#endif
+
+/* If your compiler supports the `long long` type and the strtoll()
+ library function, JSON_INTEGER_IS_LONG_LONG is defined to 1,
+ otherwise to 0. */
+#define JSON_INTEGER_IS_LONG_LONG 1
+
+/* If locale.h and localeconv() are available, define to 1,
+ otherwise to 0. */
+#define JSON_HAVE_LOCALECONV 0
+
+/* Maximum recursion depth for parsing JSON input.
+ This limits the depth of e.g. array-within-array constructions. */
+#define JSON_PARSER_MAX_DEPTH 2048
+
+#endif
diff --git a/src/fluent-bit/lib/jansson-e23f558/appveyor.yml b/src/fluent-bit/lib/jansson-e23f558/appveyor.yml
new file mode 100644
index 000000000..e2bdad7fc
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/appveyor.yml
@@ -0,0 +1,18 @@
+environment:
+ matrix:
+ - VS: Visual Studio 9 2008
+ - VS: Visual Studio 10 2010
+ - VS: Visual Studio 11 2012
+ - VS: Visual Studio 12 2013
+ - VS: Visual Studio 14 2015
+ - APPVEYOR_BUILD_WORKER_IMAGE: Visual Studio 2017
+ VS: Visual Studio 15 2017
+ - APPVEYOR_BUILD_WORKER_IMAGE: Visual Studio 2019
+ VS: Visual Studio 16 2019
+
+build_script:
+ - md build
+ - cd build
+ - cmake -G "%VS%" ..
+ - cmake --build . --config Release
+ - ctest --output-on-failure
diff --git a/src/fluent-bit/lib/jansson-e23f558/cmake/CheckFunctionKeywords.cmake b/src/fluent-bit/lib/jansson-e23f558/cmake/CheckFunctionKeywords.cmake
new file mode 100644
index 000000000..44601fd4e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/cmake/CheckFunctionKeywords.cmake
@@ -0,0 +1,15 @@
+include(CheckCSourceCompiles)
+
+macro(check_function_keywords _wordlist)
+ set(${_result} "")
+ foreach(flag ${_wordlist})
+ string(REGEX REPLACE "[-+/ ()]" "_" flagname "${flag}")
+ string(TOUPPER "${flagname}" flagname)
+ set(have_flag "HAVE_${flagname}")
+ check_c_source_compiles("${flag} void func(); void func() { } int main() { func(); return 0; }" ${have_flag})
+ if(${have_flag} AND NOT ${_result})
+ set(${_result} "${flag}")
+# break()
+ endif(${have_flag} AND NOT ${_result})
+ endforeach(flag)
+endmacro(check_function_keywords)
diff --git a/src/fluent-bit/lib/jansson-e23f558/cmake/CodeCoverage.cmake b/src/fluent-bit/lib/jansson-e23f558/cmake/CodeCoverage.cmake
new file mode 100644
index 000000000..3a21d3d4e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/cmake/CodeCoverage.cmake
@@ -0,0 +1,163 @@
+#
+# Boost Software License - Version 1.0 - August 17th, 2003
+#
+# Permission is hereby granted, free of charge, to any person or organization
+# obtaining a copy of the software and accompanying documentation covered by
+# this license (the "Software") to use, reproduce, display, distribute,
+# execute, and transmit the Software, and to prepare derivative works of the
+# Software, and to permit third-parties to whom the Software is furnished to
+# do so, all subject to the following:
+#
+# The copyright notices in the Software and this entire statement, including
+# the above license grant, this restriction and the following disclaimer,
+# must be included in all copies of the Software, in whole or in part, and
+# all derivative works of the Software, unless such copies or derivative
+# works are solely in the form of machine-executable object code generated by
+# a source language processor.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT
+# SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE
+# FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE,
+# ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
+# DEALINGS IN THE SOFTWARE.
+#
+# 2012-01-31, Lars Bilke
+# - Enable Code Coverage
+#
+# 2013-09-17, Joakim Söderberg
+# - Added support for Clang.
+# - Some additional usage instructions.
+#
+# USAGE:
+# 1. Copy this file into your cmake modules path.
+#
+# 2. Add the following line to your CMakeLists.txt:
+# INCLUDE(CodeCoverage)
+#
+# 3. Set compiler flags to turn off optimization and enable coverage:
+# SET(CMAKE_CXX_FLAGS "-g -O0 -fprofile-arcs -ftest-coverage")
+# SET(CMAKE_C_FLAGS "-g -O0 -fprofile-arcs -ftest-coverage")
+#
+# 3. Use the function SETUP_TARGET_FOR_COVERAGE to create a custom make target
+# which runs your test executable and produces a lcov code coverage report:
+# Example:
+# SETUP_TARGET_FOR_COVERAGE(
+# my_coverage_target # Name for custom target.
+# test_driver # Name of the test driver executable that runs the tests.
+# # NOTE! This should always have a ZERO as exit code
+# # otherwise the coverage generation will not complete.
+# coverage # Name of output directory.
+# )
+#
+# 4. Build a Debug build:
+# cmake -DCMAKE_BUILD_TYPE=Debug ..
+# make
+# make my_coverage_target
+#
+#
+
+# Check prereqs
+FIND_PROGRAM( GCOV_PATH gcov )
+FIND_PROGRAM( LCOV_PATH lcov )
+FIND_PROGRAM( GENHTML_PATH genhtml )
+FIND_PROGRAM( GCOVR_PATH gcovr PATHS ${CMAKE_SOURCE_DIR}/tests)
+
+IF(NOT GCOV_PATH)
+ MESSAGE(FATAL_ERROR "gcov not found! Aborting...")
+ENDIF() # NOT GCOV_PATH
+
+IF(NOT (CMAKE_COMPILER_IS_GNUCXX OR CMAKE_COMPILER_IS_GNUCC))
+ # Clang version 3.0.0 and greater now supports gcov as well.
+ MESSAGE(WARNING "Compiler is not GNU gcc! Clang Version 3.0.0 and greater supports gcov as well, but older versions don't.")
+
+ IF(NOT ("${CMAKE_CXX_COMPILER_ID}" STREQUAL "Clang" OR "${CMAKE_C_COMPILER_ID}" STREQUAL "Clang"))
+ MESSAGE(FATAL_ERROR "Compiler is not GNU gcc or Clang! Aborting...")
+ ENDIF()
+ENDIF() # NOT CMAKE_COMPILER_IS_GNUCXX
+
+IF ( NOT CMAKE_BUILD_TYPE STREQUAL "Debug" )
+ MESSAGE( WARNING "Code coverage results with an optimized (non-Debug) build may be misleading" )
+ENDIF() # NOT CMAKE_BUILD_TYPE STREQUAL "Debug"
+
+
+# Param _targetname The name of new the custom make target
+# Param _outputname lcov output is generated as _outputname.info
+# HTML report is generated in _outputname/index.html
+# Param _testrunner The name of the target which runs the tests.
+# MUST return ZERO always, even on errors.
+# If not, no coverage report will be created!
+# Optional fourth parameter is passed as arguments to _testrunner
+# Pass them in list form, e.g.: "-j;2" for -j 2
+FUNCTION(SETUP_TARGET_FOR_COVERAGE _targetname _outputname _testrunner)
+
+ IF(NOT LCOV_PATH)
+ MESSAGE(FATAL_ERROR "lcov not found! Aborting...")
+ ENDIF() # NOT LCOV_PATH
+
+ IF(NOT GENHTML_PATH)
+ MESSAGE(FATAL_ERROR "genhtml not found! Aborting...")
+ ENDIF() # NOT GENHTML_PATH
+
+ # Setup target
+ ADD_CUSTOM_TARGET(${_targetname}
+
+ # Cleanup lcov
+ ${LCOV_PATH} --directory . --zerocounters
+
+ # Run tests
+ COMMAND ${_testrunner} ${ARGV3}
+
+ # Capturing lcov counters and generating report
+ COMMAND ${LCOV_PATH} --directory . --capture --output-file ${_outputname}.info --rc lcov_branch_coverage=1
+ COMMAND ${LCOV_PATH} --remove ${_outputname}.info '*/build/include/*' '*/test/*' '/usr/include/*' --output-file ${_outputname}.info --rc lcov_branch_coverage=1
+ # COMMAND ${GENHTML_PATH} --branch-coverage -o ${_outputname} ${_outputname}.info.cleaned
+ # COMMAND ${CMAKE_COMMAND} -E remove ${_outputname}.info ${_outputname}.info.cleaned
+
+ WORKING_DIRECTORY ${CMAKE_BINARY_DIR}
+ COMMENT "Resetting code coverage counters to zero.\nProcessing code coverage counters and generating report."
+ )
+
+ # Show info where to find the report
+ ADD_CUSTOM_COMMAND(TARGET ${_targetname} POST_BUILD
+ COMMAND ;
+ COMMENT "Open ./${_outputname}/index.html in your browser to view the coverage report."
+ )
+
+ENDFUNCTION() # SETUP_TARGET_FOR_COVERAGE
+
+# Param _targetname The name of new the custom make target
+# Param _testrunner The name of the target which runs the tests
+# Param _outputname cobertura output is generated as _outputname.xml
+# Optional fourth parameter is passed as arguments to _testrunner
+# Pass them in list form, e.g.: "-j;2" for -j 2
+FUNCTION(SETUP_TARGET_FOR_COVERAGE_COBERTURA _targetname _testrunner _outputname)
+
+ IF(NOT PYTHON_EXECUTABLE)
+ MESSAGE(FATAL_ERROR "Python not found! Aborting...")
+ ENDIF() # NOT PYTHON_EXECUTABLE
+
+ IF(NOT GCOVR_PATH)
+ MESSAGE(FATAL_ERROR "gcovr not found! Aborting...")
+ ENDIF() # NOT GCOVR_PATH
+
+ ADD_CUSTOM_TARGET(${_targetname}
+
+ # Run tests
+ ${_testrunner} ${ARGV3}
+
+ # Running gcovr
+ COMMAND ${GCOVR_PATH} -x -r ${CMAKE_SOURCE_DIR} -e '${CMAKE_SOURCE_DIR}/tests/' -o ${_outputname}.xml
+ WORKING_DIRECTORY ${CMAKE_BINARY_DIR}
+ COMMENT "Running gcovr to produce Cobertura code coverage report."
+ )
+
+ # Show info where to find the report
+ ADD_CUSTOM_COMMAND(TARGET ${_targetname} POST_BUILD
+ COMMAND ;
+ COMMENT "Cobertura code coverage report saved in ${_outputname}.xml."
+ )
+
+ENDFUNCTION() # SETUP_TARGET_FOR_COVERAGE_COBERTURA
+
diff --git a/src/fluent-bit/lib/jansson-e23f558/cmake/Coveralls.cmake b/src/fluent-bit/lib/jansson-e23f558/cmake/Coveralls.cmake
new file mode 100644
index 000000000..29221c917
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/cmake/Coveralls.cmake
@@ -0,0 +1,111 @@
+#
+# Permission is hereby granted, free of charge, to any person obtaining a copy
+# of this software and associated documentation files (the "Software"), to deal
+# in the Software without restriction, including without limitation the rights
+# to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+# copies of the Software, and to permit persons to whom the Software is
+# furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice shall be included in all
+# copies or substantial portions of the Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+# AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+# LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+# SOFTWARE.
+#
+# Copyright (C) 2014 Joakim Söderberg <joakim.soderberg@gmail.com>
+#
+
+
+#
+# Param _COVERAGE_SRCS A list of source files that coverage should be collected for.
+# Param _COVERALLS_UPLOAD Upload the result to coveralls?
+#
+function(coveralls_setup _COVERAGE_SRCS _COVERALLS_UPLOAD)
+ # When passing a CMake list to an external process, the list
+ # will be converted from the format "1;2;3" to "1 2 3".
+ # This means the script we're calling won't see it as a list
+ # of sources, but rather just one long path. We remedy this
+ # by replacing ";" with "*" and then reversing that in the script
+ # that we're calling.
+ # http://cmake.3232098.n2.nabble.com/Passing-a-CMake-list-quot-as-is-quot-to-a-custom-target-td6505681.html
+ set(COVERAGE_SRCS_TMP ${_COVERAGE_SRCS})
+ set(COVERAGE_SRCS "")
+ foreach (COVERAGE_SRC ${COVERAGE_SRCS_TMP})
+ set(COVERAGE_SRCS "${COVERAGE_SRCS}*${COVERAGE_SRC}")
+ endforeach()
+
+ #message("Coverage sources: ${COVERAGE_SRCS}")
+ set(COVERALLS_FILE ${PROJECT_BINARY_DIR}/coveralls.json)
+
+ add_custom_target(coveralls_generate
+
+ # Zero the coverage counters.
+ COMMAND ${CMAKE_COMMAND}
+ -P "${PROJECT_SOURCE_DIR}/cmake/CoverallsClear.cmake"
+
+ # Run regress tests.
+ COMMAND ${CMAKE_CTEST_COMMAND} --output-on-failure
+
+ # Generate Gcov and translate it into coveralls JSON.
+ # We do this by executing an external CMake script.
+ # (We don't want this to run at CMake generation time, but after compilation and everything has run).
+ COMMAND ${CMAKE_COMMAND}
+ -DCOVERAGE_SRCS="${COVERAGE_SRCS}" # TODO: This is passed like: "a b c", not "a;b;c"
+ -DCOVERALLS_OUTPUT_FILE="${COVERALLS_FILE}"
+ -DCOV_PATH="${PROJECT_BINARY_DIR}"
+ -DPROJECT_ROOT="${PROJECT_SOURCE_DIR}"
+ -P "${PROJECT_SOURCE_DIR}/cmake/CoverallsGenerateGcov.cmake"
+
+ WORKING_DIRECTORY ${PROJECT_BINARY_DIR}
+ COMMENT "Generating coveralls output..."
+ )
+
+ if (_COVERALLS_UPLOAD)
+ message("COVERALLS UPLOAD: ON")
+
+ find_program(CURL_EXECUTABLE curl)
+
+ if (NOT CURL_EXECUTABLE)
+ message(FATAL_ERROR "Coveralls: curl not found! Aborting")
+ endif()
+
+ add_custom_target(coveralls_upload
+ # Upload the JSON to coveralls.
+ COMMAND ${CURL_EXECUTABLE}
+ -S -F json_file=@${COVERALLS_FILE}
+ https://coveralls.io/api/v1/jobs
+
+ DEPENDS coveralls_generate
+
+ WORKING_DIRECTORY ${PROJECT_BINARY_DIR}
+ COMMENT "Uploading coveralls output...")
+
+ add_custom_target(coveralls DEPENDS coveralls_upload)
+ else()
+ message("COVERALLS UPLOAD: OFF")
+ add_custom_target(coveralls DEPENDS coveralls_generate)
+ endif()
+
+endfunction()
+
+macro(coveralls_turn_on_coverage)
+ if(NOT (CMAKE_COMPILER_IS_GNUCC OR CMAKE_COMPILER_IS_GNUCXX)
+ AND (NOT "${CMAKE_C_COMPILER_ID}" STREQUAL "Clang"))
+ message(FATAL_ERROR "Coveralls: Compiler ${CMAKE_C_COMPILER_ID} is not GNU gcc! Aborting... You can set this on the command line using CC=/usr/bin/gcc CXX=/usr/bin/g++ cmake <options> ..")
+ endif()
+
+ if(NOT CMAKE_BUILD_TYPE STREQUAL "Debug")
+ message(FATAL_ERROR "Coveralls: Code coverage results with an optimised (non-Debug) build may be misleading! Add -DCMAKE_BUILD_TYPE=Debug")
+ endif()
+
+ set(CMAKE_CXX_FLAGS "${CMAKE_CXX_FLAGS} -g -O0 -fprofile-arcs -ftest-coverage")
+ set(CMAKE_C_FLAGS "${CMAKE_C_FLAGS} -g -O0 -fprofile-arcs -ftest-coverage")
+endmacro()
+
+
+
diff --git a/src/fluent-bit/lib/jansson-e23f558/cmake/CoverallsClear.cmake b/src/fluent-bit/lib/jansson-e23f558/cmake/CoverallsClear.cmake
new file mode 100644
index 000000000..eb68695a2
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/cmake/CoverallsClear.cmake
@@ -0,0 +1,24 @@
+#
+# Permission is hereby granted, free of charge, to any person obtaining a copy
+# of this software and associated documentation files (the "Software"), to deal
+# in the Software without restriction, including without limitation the rights
+# to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+# copies of the Software, and to permit persons to whom the Software is
+# furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice shall be included in all
+# copies or substantial portions of the Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+# AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+# LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+# SOFTWARE.
+#
+# Copyright (C) 2014 Joakim Söderberg <joakim.soderberg@gmail.com>
+#
+
+file(REMOVE_RECURSE ${PROJECT_BINARY_DIR}/*.gcda)
+
diff --git a/src/fluent-bit/lib/jansson-e23f558/cmake/CoverallsGenerateGcov.cmake b/src/fluent-bit/lib/jansson-e23f558/cmake/CoverallsGenerateGcov.cmake
new file mode 100644
index 000000000..c4da8fbdf
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/cmake/CoverallsGenerateGcov.cmake
@@ -0,0 +1,380 @@
+#
+# Permission is hereby granted, free of charge, to any person obtaining a copy
+# of this software and associated documentation files (the "Software"), to deal
+# in the Software without restriction, including without limitation the rights
+# to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+# copies of the Software, and to permit persons to whom the Software is
+# furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice shall be included in all
+# copies or substantial portions of the Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+# AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+# LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+# SOFTWARE.
+#
+# Copyright (C) 2014 Joakim Söderberg <joakim.soderberg@gmail.com>
+#
+# This is intended to be run by a custom target in a CMake project like this.
+# 0. Compile program with coverage support.
+# 1. Clear coverage data. (Recursively delete *.gcda in build dir)
+# 2. Run the unit tests.
+# 3. Run this script specifying which source files the coverage should be performed on.
+#
+# This script will then use gcov to generate .gcov files in the directory specified
+# via the COV_PATH var. This should probably be the same as your cmake build dir.
+#
+# It then parses the .gcov files to convert them into the Coveralls JSON format:
+# https://coveralls.io/docs/api
+#
+# Example for running as standalone CMake script from the command line:
+# (Note it is important the -P is at the end...)
+# $ cmake -DCOV_PATH=$(pwd)
+# -DCOVERAGE_SRCS="catcierge_rfid.c;catcierge_timer.c"
+# -P ../cmake/CoverallsGcovUpload.cmake
+#
+CMAKE_MINIMUM_REQUIRED(VERSION 2.8)
+
+
+#
+# Make sure we have the needed arguments.
+#
+if (NOT COVERALLS_OUTPUT_FILE)
+ message(FATAL_ERROR "Coveralls: No coveralls output file specified. Please set COVERALLS_OUTPUT_FILE")
+endif()
+
+if (NOT COV_PATH)
+ message(FATAL_ERROR "Coveralls: Missing coverage directory path where gcov files will be generated. Please set COV_PATH")
+endif()
+
+if (NOT COVERAGE_SRCS)
+ message(FATAL_ERROR "Coveralls: Missing the list of source files that we should get the coverage data for COVERAGE_SRCS")
+endif()
+
+if (NOT PROJECT_ROOT)
+ message(FATAL_ERROR "Coveralls: Missing PROJECT_ROOT.")
+endif()
+
+# Since it's not possible to pass a CMake list properly in the
+# "1;2;3" format to an external process, we have replaced the
+# ";" with "*", so reverse that here so we get it back into the
+# CMake list format.
+string(REGEX REPLACE "\\*" ";" COVERAGE_SRCS ${COVERAGE_SRCS})
+
+find_program(GCOV_EXECUTABLE gcov)
+
+if (NOT GCOV_EXECUTABLE)
+ message(FATAL_ERROR "gcov not found! Aborting...")
+endif()
+
+find_package(Git)
+
+# TODO: Add these git things to the coveralls json.
+if (GIT_FOUND)
+ # Branch.
+ execute_process(
+ COMMAND ${GIT_EXECUTABLE} rev-parse --abbrev-ref HEAD
+ WORKING_DIRECTORY ${CMAKE_SOURCE_DIR}
+ OUTPUT_VARIABLE GIT_BRANCH
+ OUTPUT_STRIP_TRAILING_WHITESPACE
+ )
+
+ macro (git_log_format FORMAT_CHARS VAR_NAME)
+ execute_process(
+ COMMAND ${GIT_EXECUTABLE} log -1 --pretty=format:%${FORMAT_CHARS}
+ WORKING_DIRECTORY ${CMAKE_SOURCE_DIR}
+ OUTPUT_VARIABLE ${VAR_NAME}
+ OUTPUT_STRIP_TRAILING_WHITESPACE
+ )
+ endmacro()
+
+ git_log_format(an GIT_AUTHOR_EMAIL)
+ git_log_format(ae GIT_AUTHOR_EMAIL)
+ git_log_format(cn GIT_COMMITTER_NAME)
+ git_log_format(ce GIT_COMMITTER_EMAIL)
+ git_log_format(B GIT_COMMIT_MESSAGE)
+
+ message("Git exe: ${GIT_EXECUTABLE}")
+ message("Git branch: ${GIT_BRANCH}")
+ message("Git author: ${GIT_AUTHOR_NAME}")
+ message("Git e-mail: ${GIT_AUTHOR_EMAIL}")
+ message("Git committer name: ${GIT_COMMITTER_NAME}")
+ message("Git committer e-mail: ${GIT_COMMITTER_EMAIL}")
+ message("Git commit message: ${GIT_COMMIT_MESSAGE}")
+
+endif()
+
+############################# Macros #########################################
+
+#
+# This macro converts from the full path format gcov outputs:
+#
+# /path/to/project/root/build/#path#to#project#root#subdir#the_file.c.gcov
+#
+# to the original source file path the .gcov is for:
+#
+# /path/to/project/root/subdir/the_file.c
+#
+macro(get_source_path_from_gcov_filename _SRC_FILENAME _GCOV_FILENAME)
+
+ # /path/to/project/root/build/#path#to#project#root#subdir#the_file.c.gcov
+ # ->
+ # #path#to#project#root#subdir#the_file.c.gcov
+ get_filename_component(_GCOV_FILENAME_WEXT ${_GCOV_FILENAME} NAME)
+
+ # #path#to#project#root#subdir#the_file.c.gcov -> /path/to/project/root/subdir/the_file.c
+ string(REGEX REPLACE "\\.gcov$" "" SRC_FILENAME_TMP ${_GCOV_FILENAME_WEXT})
+ string(REGEX REPLACE "\#" "/" SRC_FILENAME_TMP ${SRC_FILENAME_TMP})
+ set(${_SRC_FILENAME} "${SRC_FILENAME_TMP}")
+endmacro()
+
+##############################################################################
+
+# Get the coverage data.
+file(GLOB_RECURSE GCDA_FILES "${COV_PATH}/*.gcda")
+message("GCDA files:")
+
+# Get a list of all the object directories needed by gcov
+# (The directories the .gcda files and .o files are found in)
+# and run gcov on those.
+foreach(GCDA ${GCDA_FILES})
+ message("Process: ${GCDA}")
+ message("------------------------------------------------------------------------------")
+ get_filename_component(GCDA_DIR ${GCDA} PATH)
+
+ #
+ # The -p below refers to "Preserve path components",
+ # This means that the generated gcov filename of a source file will
+ # keep the original files entire filepath, but / is replaced with #.
+ # Example:
+ #
+ # /path/to/project/root/build/CMakeFiles/the_file.dir/subdir/the_file.c.gcda
+ # ------------------------------------------------------------------------------
+ # File '/path/to/project/root/subdir/the_file.c'
+ # Lines executed:68.34% of 199
+ # /path/to/project/root/subdir/the_file.c:creating '#path#to#project#root#subdir#the_file.c.gcov'
+ #
+ # If -p is not specified then the file is named only "the_file.c.gcov"
+ #
+ execute_process(
+ COMMAND ${GCOV_EXECUTABLE} -p -o ${GCDA_DIR} ${GCDA}
+ WORKING_DIRECTORY ${COV_PATH}
+ )
+endforeach()
+
+# TODO: Make these be absolute path
+file(GLOB ALL_GCOV_FILES ${COV_PATH}/*.gcov)
+
+# Get only the filenames to use for filtering.
+#set(COVERAGE_SRCS_NAMES "")
+#foreach (COVSRC ${COVERAGE_SRCS})
+# get_filename_component(COVSRC_NAME ${COVSRC} NAME)
+# message("${COVSRC} -> ${COVSRC_NAME}")
+# list(APPEND COVERAGE_SRCS_NAMES "${COVSRC_NAME}")
+#endforeach()
+
+#
+# Filter out all but the gcov files we want.
+#
+# We do this by comparing the list of COVERAGE_SRCS filepaths that the
+# user wants the coverage data for with the paths of the generated .gcov files,
+# so that we only keep the relevant gcov files.
+#
+# Example:
+# COVERAGE_SRCS =
+# /path/to/project/root/subdir/the_file.c
+#
+# ALL_GCOV_FILES =
+# /path/to/project/root/build/#path#to#project#root#subdir#the_file.c.gcov
+# /path/to/project/root/build/#path#to#project#root#subdir#other_file.c.gcov
+#
+# Result should be:
+# GCOV_FILES =
+# /path/to/project/root/build/#path#to#project#root#subdir#the_file.c.gcov
+#
+set(GCOV_FILES "")
+#message("Look in coverage sources: ${COVERAGE_SRCS}")
+message("\nFilter out unwanted GCOV files:")
+message("===============================")
+
+set(COVERAGE_SRCS_REMAINING ${COVERAGE_SRCS})
+
+foreach (GCOV_FILE ${ALL_GCOV_FILES})
+
+ #
+ # /path/to/project/root/build/#path#to#project#root#subdir#the_file.c.gcov
+ # ->
+ # /path/to/project/root/subdir/the_file.c
+ get_source_path_from_gcov_filename(GCOV_SRC_PATH ${GCOV_FILE})
+
+ # Is this in the list of source files?
+ # TODO: We want to match against relative path filenames from the source file root...
+ list(FIND COVERAGE_SRCS ${GCOV_SRC_PATH} WAS_FOUND)
+
+ if (NOT WAS_FOUND EQUAL -1)
+ message("YES: ${GCOV_FILE}")
+ list(APPEND GCOV_FILES ${GCOV_FILE})
+
+ # We remove it from the list, so we don't bother searching for it again.
+ # Also files left in COVERAGE_SRCS_REMAINING after this loop ends should
+ # have coverage data generated from them (no lines are covered).
+ list(REMOVE_ITEM COVERAGE_SRCS_REMAINING ${GCOV_SRC_PATH})
+ else()
+ message("NO: ${GCOV_FILE}")
+ endif()
+endforeach()
+
+# TODO: Enable setting these
+set(JSON_SERVICE_NAME "travis-ci")
+set(JSON_SERVICE_JOB_ID $ENV{TRAVIS_JOB_ID})
+
+set(JSON_TEMPLATE
+"{
+ \"service_name\": \"\@JSON_SERVICE_NAME\@\",
+ \"service_job_id\": \"\@JSON_SERVICE_JOB_ID\@\",
+ \"source_files\": \@JSON_GCOV_FILES\@
+}"
+)
+
+set(SRC_FILE_TEMPLATE
+"{
+ \"name\": \"\@GCOV_SRC_REL_PATH\@\",
+ \"source\": \"\@GCOV_FILE_SOURCE\@\",
+ \"coverage\": \@GCOV_FILE_COVERAGE\@
+}"
+)
+
+message("\nGenerate JSON for files:")
+message("=========================")
+
+set(JSON_GCOV_FILES "[")
+
+# Read the GCOV files line by line and get the coverage data.
+foreach (GCOV_FILE ${GCOV_FILES})
+
+ get_source_path_from_gcov_filename(GCOV_SRC_PATH ${GCOV_FILE})
+ file(RELATIVE_PATH GCOV_SRC_REL_PATH "${PROJECT_ROOT}" "${GCOV_SRC_PATH}")
+
+ # Loads the gcov file as a list of lines.
+ file(STRINGS ${GCOV_FILE} GCOV_LINES)
+
+ # Instead of trying to parse the source from the
+ # gcov file, simply read the file contents from the source file.
+ # (Parsing it from the gcov is hard because C-code uses ; in many places
+ # which also happens to be the same as the CMake list delimiter).
+ file(READ ${GCOV_SRC_PATH} GCOV_FILE_SOURCE)
+
+ string(REPLACE "\\" "\\\\" GCOV_FILE_SOURCE "${GCOV_FILE_SOURCE}")
+ string(REGEX REPLACE "\"" "\\\\\"" GCOV_FILE_SOURCE "${GCOV_FILE_SOURCE}")
+ string(REPLACE "\t" "\\\\t" GCOV_FILE_SOURCE "${GCOV_FILE_SOURCE}")
+ string(REPLACE "\r" "\\\\r" GCOV_FILE_SOURCE "${GCOV_FILE_SOURCE}")
+ string(REPLACE "\n" "\\\\n" GCOV_FILE_SOURCE "${GCOV_FILE_SOURCE}")
+ # According to http://json.org/ these should be escaped as well.
+ # Don't know how to do that in CMake however...
+ #string(REPLACE "\b" "\\\\b" GCOV_FILE_SOURCE "${GCOV_FILE_SOURCE}")
+ #string(REPLACE "\f" "\\\\f" GCOV_FILE_SOURCE "${GCOV_FILE_SOURCE}")
+ #string(REGEX REPLACE "\u([a-fA-F0-9]{4})" "\\\\u\\1" GCOV_FILE_SOURCE "${GCOV_FILE_SOURCE}")
+
+ # We want a json array of coverage data as a single string
+ # start building them from the contents of the .gcov
+ set(GCOV_FILE_COVERAGE "[")
+
+ foreach (GCOV_LINE ${GCOV_LINES})
+ # Example of what we're parsing:
+ # Hitcount |Line | Source
+ # " 8: 26: if (!allowed || (strlen(allowed) == 0))"
+ string(REGEX REPLACE
+ "^([^:]*):([^:]*):(.*)$"
+ "\\1;\\2;\\3"
+ RES
+ "${GCOV_LINE}")
+
+ list(LENGTH RES RES_COUNT)
+ if (RES_COUNT GREATER 2)
+ list(GET RES 0 HITCOUNT)
+ list(GET RES 1 LINE)
+ list(GET RES 2 SOURCE)
+
+ string(STRIP ${HITCOUNT} HITCOUNT)
+ string(STRIP ${LINE} LINE)
+
+ # Lines with 0 line numbers are metadata and can be ignored.
+ if (NOT ${LINE} EQUAL 0)
+
+ # Translate the hitcount into valid JSON values.
+ if (${HITCOUNT} STREQUAL "#####")
+ set(GCOV_FILE_COVERAGE "${GCOV_FILE_COVERAGE}0, ")
+ elseif (${HITCOUNT} STREQUAL "-")
+ set(GCOV_FILE_COVERAGE "${GCOV_FILE_COVERAGE}null, ")
+ else()
+ set(GCOV_FILE_COVERAGE "${GCOV_FILE_COVERAGE}${HITCOUNT}, ")
+ endif()
+ # TODO: Look for LCOV_EXCL_LINE in SOURCE to get rid of false positives.
+ endif()
+ else()
+ message(WARNING "Failed to properly parse line --> ${GCOV_LINE}")
+ endif()
+ endforeach()
+
+ # Advanced way of removing the trailing comma in the JSON array.
+ # "[1, 2, 3, " -> "[1, 2, 3"
+ string(REGEX REPLACE ",[ ]*$" "" GCOV_FILE_COVERAGE ${GCOV_FILE_COVERAGE})
+
+ # Append the trailing ] to complete the JSON array.
+ set(GCOV_FILE_COVERAGE "${GCOV_FILE_COVERAGE}]")
+
+ # Generate the final JSON for this file.
+ message("Generate JSON for file: ${GCOV_SRC_REL_PATH}...")
+ string(CONFIGURE ${SRC_FILE_TEMPLATE} FILE_JSON)
+
+ set(JSON_GCOV_FILES "${JSON_GCOV_FILES}${FILE_JSON}, ")
+endforeach()
+
+# Loop through all files we couldn't find any coverage for
+# as well, and generate JSON for those as well with 0% coverage.
+foreach(NOT_COVERED_SRC ${COVERAGE_SRCS_REMAINING})
+
+ # Loads the source file as a list of lines.
+ file(STRINGS ${NOT_COVERED_SRC} SRC_LINES)
+
+ set(GCOV_FILE_COVERAGE "[")
+ set(GCOV_FILE_SOURCE "")
+
+ foreach (SOURCE ${SRC_LINES})
+ set(GCOV_FILE_COVERAGE "${GCOV_FILE_COVERAGE}0, ")
+
+ string(REPLACE "\\" "\\\\" SOURCE "${SOURCE}")
+ string(REGEX REPLACE "\"" "\\\\\"" SOURCE "${SOURCE}")
+ string(REPLACE "\t" "\\\\t" SOURCE "${SOURCE}")
+ string(REPLACE "\r" "\\\\r" SOURCE "${SOURCE}")
+ set(GCOV_FILE_SOURCE "${GCOV_FILE_SOURCE}${SOURCE}\\n")
+ endforeach()
+
+ # Remove trailing comma, and complete JSON array with ]
+ string(REGEX REPLACE ",[ ]*$" "" GCOV_FILE_COVERAGE ${GCOV_FILE_COVERAGE})
+ set(GCOV_FILE_COVERAGE "${GCOV_FILE_COVERAGE}]")
+
+ # Generate the final JSON for this file.
+ message("Generate JSON for non-gcov file: ${NOT_COVERED_SRC}...")
+ string(CONFIGURE ${SRC_FILE_TEMPLATE} FILE_JSON)
+ set(JSON_GCOV_FILES "${JSON_GCOV_FILES}${FILE_JSON}, ")
+endforeach()
+
+# Get rid of trailing comma.
+string(REGEX REPLACE ",[ ]*$" "" JSON_GCOV_FILES ${JSON_GCOV_FILES})
+set(JSON_GCOV_FILES "${JSON_GCOV_FILES}]")
+
+# Generate the final complete JSON!
+message("Generate final JSON...")
+string(CONFIGURE ${JSON_TEMPLATE} JSON)
+
+file(WRITE "${COVERALLS_OUTPUT_FILE}" "${JSON}")
+message("###########################################################################")
+message("Generated coveralls JSON containing coverage data:")
+message("${COVERALLS_OUTPUT_FILE}")
+message("###########################################################################")
+
diff --git a/src/fluent-bit/lib/jansson-e23f558/cmake/FindSphinx.cmake b/src/fluent-bit/lib/jansson-e23f558/cmake/FindSphinx.cmake
new file mode 100644
index 000000000..3bf0a5d4d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/cmake/FindSphinx.cmake
@@ -0,0 +1,315 @@
+#
+# PART B. DOWNLOADING AGREEMENT - LICENSE FROM SBIA WITH RIGHT TO SUBLICENSE ("SOFTWARE LICENSE").
+# ------------------------------------------------------------------------------------------------
+#
+# 1. As used in this Software License, "you" means the individual downloading and/or
+# using, reproducing, modifying, displaying and/or distributing the Software and
+# the institution or entity which employs or is otherwise affiliated with such
+# individual in connection therewith. The Section of Biomedical Image Analysis,
+# Department of Radiology at the Universiy of Pennsylvania ("SBIA") hereby grants
+# you, with right to sublicense, with respect to SBIA's rights in the software,
+# and data, if any, which is the subject of this Software License (collectively,
+# the "Software"), a royalty-free, non-exclusive license to use, reproduce, make
+# derivative works of, display and distribute the Software, provided that:
+# (a) you accept and adhere to all of the terms and conditions of this Software
+# License; (b) in connection with any copy of or sublicense of all or any portion
+# of the Software, all of the terms and conditions in this Software License shall
+# appear in and shall apply to such copy and such sublicense, including without
+# limitation all source and executable forms and on any user documentation,
+# prefaced with the following words: "All or portions of this licensed product
+# (such portions are the "Software") have been obtained under license from the
+# Section of Biomedical Image Analysis, Department of Radiology at the University
+# of Pennsylvania and are subject to the following terms and conditions:"
+# (c) you preserve and maintain all applicable attributions, copyright notices
+# and licenses included in or applicable to the Software; (d) modified versions
+# of the Software must be clearly identified and marked as such, and must not
+# be misrepresented as being the original Software; and (e) you consider making,
+# but are under no obligation to make, the source code of any of your modifications
+# to the Software freely available to others on an open source basis.
+#
+# 2. The license granted in this Software License includes without limitation the
+# right to (i) incorporate the Software into proprietary programs (subject to
+# any restrictions applicable to such programs), (ii) add your own copyright
+# statement to your modifications of the Software, and (iii) provide additional
+# or different license terms and conditions in your sublicenses of modifications
+# of the Software; provided that in each case your use, reproduction or
+# distribution of such modifications otherwise complies with the conditions
+# stated in this Software License.
+#
+# 3. This Software License does not grant any rights with respect to third party
+# software, except those rights that SBIA has been authorized by a third
+# party to grant to you, and accordingly you are solely responsible for
+# (i) obtaining any permissions from third parties that you need to use,
+# reproduce, make derivative works of, display and distribute the Software,
+# and (ii) informing your sublicensees, including without limitation your
+# end-users, of their obligations to secure any such required permissions.
+#
+# 4. The Software has been designed for research purposes only and has not been
+# reviewed or approved by the Food and Drug Administration or by any other
+# agency. YOU ACKNOWLEDGE AND AGREE THAT CLINICAL APPLICATIONS ARE NEITHER
+# RECOMMENDED NOR ADVISED. Any commercialization of the Software is at the
+# sole risk of the party or parties engaged in such commercialization.
+# You further agree to use, reproduce, make derivative works of, display
+# and distribute the Software in compliance with all applicable governmental
+# laws, regulations and orders, including without limitation those relating
+# to export and import control.
+#
+# 5. The Software is provided "AS IS" and neither SBIA nor any contributor to
+# the software (each a "Contributor") shall have any obligation to provide
+# maintenance, support, updates, enhancements or modifications thereto.
+# SBIA AND ALL CONTRIBUTORS SPECIFICALLY DISCLAIM ALL EXPRESS AND IMPLIED
+# WARRANTIES OF ANY KIND INCLUDING, BUT NOT LIMITED TO, ANY WARRANTIES OF
+# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT.
+# IN NO EVENT SHALL SBIA OR ANY CONTRIBUTOR BE LIABLE TO ANY PARTY FOR
+# DIRECT, INDIRECT, SPECIAL, INCIDENTAL, EXEMPLARY OR CONSEQUENTIAL DAMAGES
+# HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY ARISING IN ANY WAY RELATED
+# TO THE SOFTWARE, EVEN IF SBIA OR ANY CONTRIBUTOR HAS BEEN ADVISED OF THE
+# POSSIBILITY OF SUCH DAMAGES. TO THE MAXIMUM EXTENT NOT PROHIBITED BY LAW OR
+# REGULATION, YOU FURTHER ASSUME ALL LIABILITY FOR YOUR USE, REPRODUCTION,
+# MAKING OF DERIVATIVE WORKS, DISPLAY, LICENSE OR DISTRIBUTION OF THE SOFTWARE
+# AND AGREE TO INDEMNIFY AND HOLD HARMLESS SBIA AND ALL CONTRIBUTORS FROM
+# AND AGAINST ANY AND ALL CLAIMS, SUITS, ACTIONS, DEMANDS AND JUDGMENTS ARISING
+# THEREFROM.
+#
+# 6. None of the names, logos or trademarks of SBIA or any of SBIA's affiliates
+# or any of the Contributors, or any funding agency, may be used to endorse
+# or promote products produced in whole or in part by operation of the Software
+# or derived from or based on the Software without specific prior written
+# permission from the applicable party.
+#
+# 7. Any use, reproduction or distribution of the Software which is not in accordance
+# with this Software License shall automatically revoke all rights granted to you
+# under this Software License and render Paragraphs 1 and 2 of this Software
+# License null and void.
+#
+# 8. This Software License does not grant any rights in or to any intellectual
+# property owned by SBIA or any Contributor except those rights expressly
+# granted hereunder.
+#
+#
+# PART C. MISCELLANEOUS
+# ---------------------
+#
+# This Agreement shall be governed by and construed in accordance with the laws
+# of The Commonwealth of Pennsylvania without regard to principles of conflicts
+# of law. This Agreement shall supercede and replace any license terms that you
+# may have agreed to previously with respect to Software from SBIA.
+#
+##############################################################################
+# @file FindSphinx.cmake
+# @brief Find Sphinx documentation build tools.
+#
+# @par Input variables:
+# <table border="0">
+# <tr>
+# @tp @b Sphinx_DIR @endtp
+# <td>Installation directory of Sphinx tools. Can also be set as environment variable.</td>
+# </tr>
+# <tr>
+# @tp @b SPHINX_DIR @endtp
+# <td>Alternative environment variable for @c Sphinx_DIR.</td>
+# </tr>
+# <tr>
+# @tp @b Sphinx_FIND_COMPONENTS @endtp
+# <td>Sphinx build tools to look for, i.e., 'apidoc' and/or 'build'.</td>
+# </tr>
+# </table>
+#
+# @par Output variables:
+# <table border="0">
+# <tr>
+# @tp @b Sphinx_FOUND @endtp
+# <td>Whether all or only the requested Sphinx build tools were found.</td>
+# </tr>
+# <tr>
+# @tp @b SPHINX_FOUND @endtp
+# <td>Alias for @c Sphinx_FOUND.<td>
+# </tr>
+# <tr>
+# @tp @b SPHINX_EXECUTABLE @endtp
+# <td>Non-cached alias for @c Sphinx-build_EXECUTABLE.</td>
+# </tr>
+# <tr>
+# @tp @b Sphinx_PYTHON_EXECUTABLE @endtp
+# <td>Python executable used to run sphinx-build. This is either the
+# by default found Python interpreter or a specific version as
+# specified by the shebang (#!) of the sphinx-build script.</td>
+# </tr>
+# <tr>
+# @tp @b Sphinx_PYTHON_OPTIONS @endtp
+# <td>A list of Python options extracted from the shebang (#!) of the
+# sphinx-build script. The -E option is added by this module
+# if the Python executable is not the system default to avoid
+# problems with a differing setting of the @c PYTHONHOME.</td>
+# </tr>
+# <tr>
+# @tp @b Sphinx-build_EXECUTABLE @endtp
+# <td>Absolute path of the found sphinx-build tool.</td>
+# </tr>
+# <tr>
+# @tp @b Sphinx-apidoc_EXECUTABLE @endtp
+# <td>Absolute path of the found sphinx-apidoc tool.</td>
+# </tr>
+# <tr>
+# @tp @b Sphinx_VERSION_STRING @endtp
+# <td>Sphinx version found e.g. 1.1.2.</td>
+# </tr>
+# <tr>
+# @tp @b Sphinx_VERSION_MAJOR @endtp
+# <td>Sphinx major version found e.g. 1.</td>
+# </tr>
+# <tr>
+# @tp @b Sphinx_VERSION_MINOR @endtp
+# <td>Sphinx minor version found e.g. 1.</td>
+# </tr>
+# <tr>
+# @tp @b Sphinx_VERSION_PATCH @endtp
+# <td>Sphinx patch version found e.g. 2.</td>
+# </tr>
+# </table>
+#
+# @ingroup CMakeFindModules
+##############################################################################
+
+set (_Sphinx_REQUIRED_VARS)
+
+# ----------------------------------------------------------------------------
+# initialize search
+if (NOT Sphinx_DIR)
+ if (NOT $ENV{Sphinx_DIR} STREQUAL "")
+ set (Sphinx_DIR "$ENV{Sphinx_DIR}" CACHE PATH "Installation prefix of Sphinx (docutils)." FORCE)
+ else ()
+ set (Sphinx_DIR "$ENV{SPHINX_DIR}" CACHE PATH "Installation prefix of Sphinx (docutils)." FORCE)
+ endif ()
+endif ()
+
+# ----------------------------------------------------------------------------
+# default components to look for
+if (NOT Sphinx_FIND_COMPONENTS)
+ set (Sphinx_FIND_COMPONENTS "build")
+elseif (NOT Sphinx_FIND_COMPONENTS MATCHES "^(build|apidoc)$")
+ message (FATAL_ERROR "Invalid Sphinx component in: ${Sphinx_FIND_COMPONENTS}")
+endif ()
+
+# ----------------------------------------------------------------------------
+# find components, i.e., build tools
+foreach (_Sphinx_TOOL IN LISTS Sphinx_FIND_COMPONENTS)
+ if (Sphinx_DIR)
+ find_program (
+ Sphinx-${_Sphinx_TOOL}_EXECUTABLE
+ NAMES sphinx-${_Sphinx_TOOL} sphinx-${_Sphinx_TOOL}.py
+ HINTS "${Sphinx_DIR}"
+ PATH_SUFFIXES bin
+ DOC "The sphinx-${_Sphinx_TOOL} Python script."
+ NO_DEFAULT_PATH
+ )
+ else ()
+ find_program (
+ Sphinx-${_Sphinx_TOOL}_EXECUTABLE
+ NAMES sphinx-${_Sphinx_TOOL} sphinx-${_Sphinx_TOOL}.py
+ DOC "The sphinx-${_Sphinx_TOOL} Python script."
+ )
+ endif ()
+ mark_as_advanced (Sphinx-${_Sphinx_TOOL}_EXECUTABLE)
+ list (APPEND _Sphinx_REQUIRED_VARS Sphinx-${_Sphinx_TOOL}_EXECUTABLE)
+endforeach ()
+
+# ----------------------------------------------------------------------------
+# determine Python executable used by Sphinx
+if (Sphinx-build_EXECUTABLE)
+ # extract python executable from shebang of sphinx-build
+ find_package (PythonInterp QUIET)
+ set (Sphinx_PYTHON_EXECUTABLE "${PYTHON_EXECUTABLE}")
+ set (Sphinx_PYTHON_OPTIONS)
+ file (STRINGS "${Sphinx-build_EXECUTABLE}" FIRST_LINE LIMIT_COUNT 1)
+ if (FIRST_LINE MATCHES "^#!(.*/python.*)") # does not match "#!/usr/bin/env python" !
+ string (REGEX REPLACE "^ +| +$" "" Sphinx_PYTHON_EXECUTABLE "${CMAKE_MATCH_1}")
+ if (Sphinx_PYTHON_EXECUTABLE MATCHES "([^ ]+) (.*)")
+ set (Sphinx_PYTHON_EXECUTABLE "${CMAKE_MATCH_1}")
+ string (REGEX REPLACE " +" ";" Sphinx_PYTHON_OPTIONS "${CMAKE_MATCH_2}")
+ endif ()
+ endif ()
+ # this is done to avoid problems with multiple Python versions being installed
+ # remember: CMake command if(STR EQUAL STR) is bad and may cause many troubles !
+ string (REGEX REPLACE "([.+*?^$])" "\\\\\\1" _Sphinx_PYTHON_EXECUTABLE_RE "${PYTHON_EXECUTABLE}")
+ list (FIND Sphinx_PYTHON_OPTIONS -E IDX)
+ if (IDX EQUAL -1 AND NOT Sphinx_PYTHON_EXECUTABLE MATCHES "^${_Sphinx_PYTHON_EXECUTABLE_RE}$")
+ list (INSERT Sphinx_PYTHON_OPTIONS 0 -E)
+ endif ()
+ unset (_Sphinx_PYTHON_EXECUTABLE_RE)
+endif ()
+
+# ----------------------------------------------------------------------------
+# determine Sphinx version
+# some quick experiments by @ploxiln
+# - sphinx 1.7 and later have the version output format like "sphinx-build 1.7.2"
+# - sphinx 1.2 through 1.6 have the version output format like "Sphinx (sphinx-build) 1.2.2"
+# - sphinx 1.1 and before do not have a "--version" flag, but it causes the help output like "-h" does which includes version like "Sphinx v1.0.2"
+if (Sphinx-build_EXECUTABLE)
+ # intentionally use invalid -h option here as the help that is shown then
+ # will include the Sphinx version information
+ if (Sphinx_PYTHON_EXECUTABLE)
+ execute_process (
+ COMMAND "${Sphinx_PYTHON_EXECUTABLE}" ${Sphinx_PYTHON_OPTIONS} "${Sphinx-build_EXECUTABLE}" --version
+ OUTPUT_VARIABLE _Sphinx_VERSION
+ ERROR_VARIABLE _Sphinx_VERSION
+ )
+ elseif (UNIX)
+ execute_process (
+ COMMAND "${Sphinx-build_EXECUTABLE}" --version
+ OUTPUT_VARIABLE _Sphinx_VERSION
+ ERROR_VARIABLE _Sphinx_VERSION
+ )
+ endif ()
+
+ # The sphinx version can also contain a "b" instead of the last dot.
+ # For example "Sphinx v1.2b1" or "Sphinx 1.7.0b2" so we cannot just split on "."
+ if (_Sphinx_VERSION MATCHES "sphinx-build ([0-9]+\\.[0-9]+(\\.|a?|b?)([0-9]*)(b?)([0-9]*))")
+ set (Sphinx_VERSION_STRING "${CMAKE_MATCH_1}")
+ set (_SPHINX_VERSION_FOUND)
+ elseif (_Sphinx_VERSION MATCHES "Sphinx v([0-9]+\\.[0-9]+(\\.|b?)([0-9]*)(b?)([0-9]*))")
+ set (Sphinx_VERSION_STRING "${CMAKE_MATCH_1}")
+ set (_SPHINX_VERSION_FOUND)
+ elseif (_Sphinx_VERSION MATCHES "Sphinx \\(sphinx-build\\) ([0-9]+\\.[0-9]+(\\.|a?|b?)([0-9]*)(b?)([0-9]*))")
+ set (Sphinx_VERSION_STRING "${CMAKE_MATCH_1}")
+ set (_SPHINX_VERSION_FOUND)
+ endif ()
+endif ()
+
+if(_SPHINX_VERSION_FOUND)
+ string(REGEX REPLACE "([0-9]+)\\.[0-9]+(\\.|b)[0-9]+" "\\1" Sphinx_VERSION_MAJOR ${Sphinx_VERSION_STRING})
+ string(REGEX REPLACE "[0-9]+\\.([0-9]+)(\\.|b)[0-9]+" "\\1" Sphinx_VERSION_MINOR ${Sphinx_VERSION_STRING})
+ string(REGEX REPLACE "[0-9]+\\.[0-9]+(\\.|b)([0-9]+)" "\\1" Sphinx_VERSION_PATCH ${Sphinx_VERSION_STRING})
+
+ # v1.2.0 -> v1.2
+ if (Sphinx_VERSION_PATCH EQUAL 0)
+ string (REGEX REPLACE "\\.0$" "" Sphinx_VERSION_STRING "${Sphinx_VERSION_STRING}")
+ endif ()
+endif ()
+
+# ----------------------------------------------------------------------------
+# compatibility with FindPythonInterp.cmake and FindPerl.cmake
+set (SPHINX_EXECUTABLE "${Sphinx-build_EXECUTABLE}")
+
+# ----------------------------------------------------------------------------
+# handle the QUIETLY and REQUIRED arguments and set SPHINX_FOUND to TRUE if
+# all listed variables are TRUE
+include (FindPackageHandleStandardArgs)
+FIND_PACKAGE_HANDLE_STANDARD_ARGS (
+ Sphinx
+ REQUIRED_VARS
+ ${_Sphinx_REQUIRED_VARS}
+# VERSION_VAR # This isn't available until CMake 2.8.8 so don't use it.
+ Sphinx_VERSION_STRING
+)
+
+# ----------------------------------------------------------------------------
+# set Sphinx_DIR
+if (NOT Sphinx_DIR AND Sphinx-build_EXECUTABLE)
+ get_filename_component (Sphinx_DIR "${Sphinx-build_EXECUTABLE}" PATH)
+ string (REGEX REPLACE "/bin/?" "" Sphinx_DIR "${Sphinx_DIR}")
+ set (Sphinx_DIR "${Sphinx_DIR}" CACHE PATH "Installation directory of Sphinx tools." FORCE)
+endif ()
+
+unset (_Sphinx_VERSION)
+unset (_Sphinx_REQUIRED_VARS) \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/cmake/janssonConfig.cmake.in b/src/fluent-bit/lib/jansson-e23f558/cmake/janssonConfig.cmake.in
new file mode 100644
index 000000000..abd6793c5
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/cmake/janssonConfig.cmake.in
@@ -0,0 +1,4 @@
+@PACKAGE_INIT@
+
+include("${CMAKE_CURRENT_LIST_DIR}/janssonTargets.cmake")
+check_required_components("@PROJECT_NAME@")
diff --git a/src/fluent-bit/lib/jansson-e23f558/cmake/jansson_config.h.cmake b/src/fluent-bit/lib/jansson-e23f558/cmake/jansson_config.h.cmake
new file mode 100644
index 000000000..2f248cbcb
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/cmake/jansson_config.h.cmake
@@ -0,0 +1,74 @@
+/*
+ * Copyright (c) 2010-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ *
+ *
+ * This file specifies a part of the site-specific configuration for
+ * Jansson, namely those things that affect the public API in
+ * jansson.h.
+ *
+ * The CMake system will generate the jansson_config.h file and
+ * copy it to the build and install directories.
+ */
+
+#ifndef JANSSON_CONFIG_H
+#define JANSSON_CONFIG_H
+
+/* Define this so that we can disable scattered automake configuration in source files */
+#ifndef JANSSON_USING_CMAKE
+#define JANSSON_USING_CMAKE
+#endif
+
+/* Note: when using cmake, JSON_INTEGER_IS_LONG_LONG is not defined nor used,
+ * as we will also check for __int64 etc types.
+ * (the definition was used in the automake system) */
+
+/* Bring in the cmake-detected defines */
+#cmakedefine HAVE_STDINT_H 1
+#cmakedefine HAVE_INTTYPES_H 1
+#cmakedefine HAVE_SYS_TYPES_H 1
+
+/* Include our standard type header for the integer typedef */
+
+#if defined(HAVE_STDINT_H)
+# include <stdint.h>
+#elif defined(HAVE_INTTYPES_H)
+# include <inttypes.h>
+#elif defined(HAVE_SYS_TYPES_H)
+# include <sys/types.h>
+#endif
+
+
+/* If your compiler supports the inline keyword in C, JSON_INLINE is
+ defined to `inline', otherwise empty. In C++, the inline is always
+ supported. */
+#ifdef __cplusplus
+#define JSON_INLINE inline
+#else
+#define JSON_INLINE @JSON_INLINE@
+#endif
+
+
+#define json_int_t @JSON_INT_T@
+#define json_strtoint @JSON_STRTOINT@
+#define JSON_INTEGER_FORMAT @JSON_INTEGER_FORMAT@
+
+
+/* If locale.h and localeconv() are available, define to 1, otherwise to 0. */
+#define JSON_HAVE_LOCALECONV @JSON_HAVE_LOCALECONV@
+
+/* If __atomic builtins are available they will be used to manage
+ reference counts of json_t. */
+#define JSON_HAVE_ATOMIC_BUILTINS @JSON_HAVE_ATOMIC_BUILTINS@
+
+/* If __atomic builtins are not available we try using __sync builtins
+ to manage reference counts of json_t. */
+#define JSON_HAVE_SYNC_BUILTINS @JSON_HAVE_SYNC_BUILTINS@
+
+/* Maximum recursion depth for parsing JSON input.
+ This limits the depth of e.g. array-within-array constructions. */
+#define JSON_PARSER_MAX_DEPTH 2048
+
+#endif
diff --git a/src/fluent-bit/lib/jansson-e23f558/cmake/jansson_private_config.h.cmake b/src/fluent-bit/lib/jansson-e23f558/cmake/jansson_private_config.h.cmake
new file mode 100644
index 000000000..b7c451497
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/cmake/jansson_private_config.h.cmake
@@ -0,0 +1,53 @@
+#cmakedefine HAVE_ENDIAN_H 1
+#cmakedefine HAVE_FCNTL_H 1
+#cmakedefine HAVE_SCHED_H 1
+#cmakedefine HAVE_UNISTD_H 1
+#cmakedefine HAVE_SYS_PARAM_H 1
+#cmakedefine HAVE_SYS_STAT_H 1
+#cmakedefine HAVE_SYS_TIME_H 1
+#cmakedefine HAVE_SYS_TYPES_H 1
+#cmakedefine HAVE_STDINT_H 1
+
+#cmakedefine HAVE_CLOSE 1
+#cmakedefine HAVE_GETPID 1
+#cmakedefine HAVE_GETTIMEOFDAY 1
+#cmakedefine HAVE_OPEN 1
+#cmakedefine HAVE_READ 1
+#cmakedefine HAVE_SCHED_YIELD 1
+
+#cmakedefine HAVE_SYNC_BUILTINS 1
+#cmakedefine HAVE_ATOMIC_BUILTINS 1
+
+#cmakedefine HAVE_LOCALE_H 1
+#cmakedefine HAVE_SETLOCALE 1
+
+#cmakedefine HAVE_INT32_T 1
+#ifndef HAVE_INT32_T
+# define int32_t @JSON_INT32@
+#endif
+
+#cmakedefine HAVE_UINT32_T 1
+#ifndef HAVE_UINT32_T
+# define uint32_t @JSON_UINT32@
+#endif
+
+#cmakedefine HAVE_UINT16_T 1
+#ifndef HAVE_UINT16_T
+# define uint16_t @JSON_UINT16@
+#endif
+
+#cmakedefine HAVE_UINT8_T 1
+#ifndef HAVE_UINT8_T
+# define uint8_t @JSON_UINT8@
+#endif
+
+#cmakedefine HAVE_SSIZE_T 1
+
+#ifndef HAVE_SSIZE_T
+# define ssize_t @JSON_SSIZE@
+#endif
+
+#cmakedefine USE_URANDOM 1
+#cmakedefine USE_WINDOWS_CRYPTOAPI 1
+
+#define INITIAL_HASHTABLE_ORDER @JANSSON_INITIAL_HASHTABLE_ORDER@
diff --git a/src/fluent-bit/lib/jansson-e23f558/configure.ac b/src/fluent-bit/lib/jansson-e23f558/configure.ac
new file mode 100644
index 000000000..f022eb72a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/configure.ac
@@ -0,0 +1,181 @@
+AC_PREREQ([2.60])
+AC_INIT([jansson], [2.14], [https://github.com/akheron/jansson/issues])
+
+AC_CONFIG_AUX_DIR([.])
+AM_INIT_AUTOMAKE([1.10 foreign])
+
+AC_CONFIG_SRCDIR([src/value.c])
+AC_CONFIG_HEADERS([jansson_private_config.h])
+
+# Checks for programs.
+AC_PROG_CC
+AC_PROG_CXX
+AC_PROG_LIBTOOL
+AM_CONDITIONAL([GCC], [test x$GCC = xyes])
+
+# Checks for libraries.
+
+# Checks for header files.
+AC_CHECK_HEADERS([endian.h fcntl.h locale.h sched.h unistd.h sys/param.h sys/stat.h sys/time.h sys/types.h])
+
+# Checks for typedefs, structures, and compiler characteristics.
+AC_TYPE_INT32_T
+AC_TYPE_UINT32_T
+AC_TYPE_UINT16_T
+AC_TYPE_UINT8_T
+AC_TYPE_LONG_LONG_INT
+
+AC_C_INLINE
+case $ac_cv_c_inline in
+ yes) json_inline=inline;;
+ no) json_inline=;;
+ *) json_inline=$ac_cv_c_inline;;
+esac
+AC_SUBST([json_inline])
+
+# Checks for library functions.
+AC_CHECK_FUNCS([close getpid gettimeofday localeconv open read sched_yield strtoll])
+
+AC_MSG_CHECKING([for gcc __sync builtins])
+have_sync_builtins=no
+AC_TRY_LINK(
+ [], [unsigned long val; __sync_bool_compare_and_swap(&val, 0, 1); __sync_add_and_fetch(&val, 1); __sync_sub_and_fetch(&val, 1);],
+ [have_sync_builtins=yes],
+)
+if test "x$have_sync_builtins" = "xyes"; then
+ AC_DEFINE([HAVE_SYNC_BUILTINS], [1],
+ [Define to 1 if gcc's __sync builtins are available])
+ json_have_sync_builtins=1
+else
+ json_have_sync_builtins=0
+fi
+AC_SUBST([json_have_sync_builtins])
+AC_MSG_RESULT([$have_sync_builtins])
+
+AC_MSG_CHECKING([for gcc __atomic builtins])
+have_atomic_builtins=no
+AC_TRY_LINK(
+ [], [char l; unsigned long v; __atomic_test_and_set(&l, __ATOMIC_RELAXED); __atomic_store_n(&v, 1, __ATOMIC_RELEASE); __atomic_load_n(&v, __ATOMIC_ACQUIRE); __atomic_add_fetch(&v, 1, __ATOMIC_ACQUIRE); __atomic_sub_fetch(&v, 1, __ATOMIC_RELEASE);],
+ [have_atomic_builtins=yes],
+)
+if test "x$have_atomic_builtins" = "xyes"; then
+ AC_DEFINE([HAVE_ATOMIC_BUILTINS], [1],
+ [Define to 1 if gcc's __atomic builtins are available])
+ json_have_atomic_builtins=1
+else
+ json_have_atomic_builtins=0
+fi
+AC_SUBST([json_have_atomic_builtins])
+AC_MSG_RESULT([$have_atomic_builtins])
+
+case "$ac_cv_type_long_long_int$ac_cv_func_strtoll" in
+ yesyes) json_have_long_long=1;;
+ *) json_have_long_long=0;;
+esac
+AC_SUBST([json_have_long_long])
+
+case "$ac_cv_header_locale_h$ac_cv_func_localeconv" in
+ yesyes) json_have_localeconv=1;;
+ *) json_have_localeconv=0;;
+esac
+AC_SUBST([json_have_localeconv])
+
+# Features
+AC_ARG_ENABLE([urandom],
+ [AS_HELP_STRING([--disable-urandom],
+ [Don't use /dev/urandom to seed the hash function])],
+ [use_urandom=$enableval], [use_urandom=yes])
+
+if test "x$use_urandom" = xyes; then
+AC_DEFINE([USE_URANDOM], [1],
+ [Define to 1 if /dev/urandom should be used for seeding the hash function])
+fi
+
+AC_ARG_ENABLE([windows-cryptoapi],
+ [AS_HELP_STRING([--disable-windows-cryptoapi],
+ [Don't use CryptGenRandom to seed the hash function])],
+ [use_windows_cryptoapi=$enableval], [use_windows_cryptoapi=yes])
+
+if test "x$use_windows_cryptoapi" = xyes; then
+AC_DEFINE([USE_WINDOWS_CRYPTOAPI], [1],
+ [Define to 1 if CryptGenRandom should be used for seeding the hash function])
+fi
+
+AC_ARG_ENABLE([initial-hashtable-order],
+ [AS_HELP_STRING([--enable-initial-hashtable-order=VAL],
+ [Number of buckets new object hashtables contain is 2 raised to this power. The default is 3, so empty hashtables contain 2^3 = 8 buckets.])],
+ [initial_hashtable_order=$enableval], [initial_hashtable_order=3])
+AC_DEFINE_UNQUOTED([INITIAL_HASHTABLE_ORDER], [$initial_hashtable_order],
+ [Number of buckets new object hashtables contain is 2 raised to this power. E.g. 3 -> 2^3 = 8.])
+
+AC_ARG_ENABLE([Bsymbolic],
+ [AS_HELP_STRING([--disable-Bsymbolic],
+ [Avoid linking with -Bsymbolic-function])],
+ [], [with_Bsymbolic=check])
+
+if test "x$with_Bsymbolic" != "xno" ; then
+ AC_MSG_CHECKING([for -Bsymbolic-functions linker flag])
+ saved_LDFLAGS="${LDFLAGS}"
+ LDFLAGS=-Wl,-Bsymbolic-functions
+ AC_TRY_LINK(
+ [], [int main (void) { return 0; }],
+ [AC_MSG_RESULT([yes])
+ have_Bsymbolic=yes],
+ [AC_MSG_RESULT([no])
+ have_Bsymbolic=no]
+ )
+ LDFLAGS="${saved_LDFLAGS}"
+
+ if test "x$with_Bsymbolic" = "xcheck" ; then
+ with_Bsymbolic=$have_Bsymbolic;
+ fi
+ if test "x$with_Bsymbolic:x$have_Bsymbolic" = "xyes:xno" ; then
+ AC_MSG_ERROR([linker support is required for -Bsymbolic])
+ fi
+fi
+
+AS_IF([test "x$with_Bsymbolic" = "xyes"], [JSON_BSYMBOLIC_LDFLAGS=-Wl[,]-Bsymbolic-functions])
+AC_SUBST(JSON_BSYMBOLIC_LDFLAGS)
+
+# Enable symbol versioning on GNU libc
+JSON_SYMVER_LDFLAGS=
+AC_CHECK_DECL([__GLIBC__], [JSON_SYMVER_LDFLAGS=-Wl,--default-symver])
+AC_SUBST([JSON_SYMVER_LDFLAGS])
+
+AC_ARG_ENABLE([ossfuzzers],
+ [AS_HELP_STRING([--enable-ossfuzzers],
+ [Whether to generate the fuzzers for OSS-Fuzz])],
+ [have_ossfuzzers=yes], [have_ossfuzzers=no])
+AM_CONDITIONAL([USE_OSSFUZZERS], [test "x$have_ossfuzzers" = "xyes"])
+
+
+AC_SUBST([LIB_FUZZING_ENGINE])
+AM_CONDITIONAL([USE_OSSFUZZ_FLAG], [test "x$LIB_FUZZING_ENGINE" = "x-fsanitize=fuzzer"])
+AM_CONDITIONAL([USE_OSSFUZZ_STATIC], [test -f "$LIB_FUZZING_ENGINE"])
+
+
+if test x$GCC = xyes; then
+ AC_MSG_CHECKING(for -Wno-format-truncation)
+ wnoformat_truncation="-Wno-format-truncation"
+ AS_IF([${CC} -Wno-format-truncation -Werror -S -o /dev/null -xc /dev/null > /dev/null 2>&1],
+ [AC_MSG_RESULT(yes)],
+ [AC_MSG_RESULT(no)
+ wnoformat_truncation=""])
+
+ AM_CFLAGS="-Wall -Wextra -Wdeclaration-after-statement -Wshadow ${wnoformat_truncation}"
+fi
+AC_SUBST([AM_CFLAGS])
+
+AC_CONFIG_FILES([
+ jansson.pc
+ Makefile
+ doc/Makefile
+ src/Makefile
+ src/jansson_config.h
+ test/Makefile
+ test/bin/Makefile
+ test/ossfuzz/Makefile
+ test/suites/Makefile
+ test/suites/api/Makefile
+])
+AC_OUTPUT
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/.gitignore b/src/fluent-bit/lib/jansson-e23f558/doc/.gitignore
new file mode 100644
index 000000000..69fa449dd
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/.gitignore
@@ -0,0 +1 @@
+_build/
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/Makefile.am b/src/fluent-bit/lib/jansson-e23f558/doc/Makefile.am
new file mode 100644
index 000000000..8186a7db8
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/Makefile.am
@@ -0,0 +1,20 @@
+EXTRA_DIST = conf.py apiref.rst changes.rst conformance.rst \
+ gettingstarted.rst github_commits.c index.rst threadsafety.rst \
+ tutorial.rst upgrading.rst ext/refcounting.py
+
+SPHINXBUILD = sphinx-build
+SPHINXOPTS = -d _build/doctrees $(SPHINXOPTS_EXTRA)
+
+html-local:
+ $(SPHINXBUILD) -b html $(SPHINXOPTS) $(srcdir) _build/html
+
+install-html-local: html
+ mkdir -p $(DESTDIR)$(htmldir)
+ cp -r _build/html $(DESTDIR)$(htmldir)
+
+uninstall-local:
+ rm -rf $(DESTDIR)$(htmldir)
+
+clean-local:
+ rm -rf _build
+ rm -f ext/refcounting.pyc
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/README b/src/fluent-bit/lib/jansson-e23f558/doc/README
new file mode 100644
index 000000000..930b3bf0c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/README
@@ -0,0 +1,5 @@
+To build the documentation, invoke
+
+ make html
+
+Then point your browser to _build/html/index.html.
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/apiref.rst b/src/fluent-bit/lib/jansson-e23f558/doc/apiref.rst
new file mode 100644
index 000000000..4bfb68799
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/apiref.rst
@@ -0,0 +1,2064 @@
+.. _apiref:
+
+*************
+API Reference
+*************
+
+.. highlight:: c
+
+Preliminaries
+=============
+
+All declarations are in :file:`jansson.h`, so it's enough to
+
+::
+
+ #include <jansson.h>
+
+in each source file.
+
+All constants are prefixed with ``JSON_`` (except for those describing
+the library version, prefixed with ``JANSSON_``). Other identifiers
+are prefixed with ``json_``. Type names are suffixed with ``_t`` and
+``typedef``\ 'd so that the ``struct`` keyword need not be used.
+
+
+Library Version
+===============
+
+The Jansson version is of the form *A.B.C*, where *A* is the major
+version, *B* is the minor version and *C* is the micro version. If the
+micro version is zero, it's omitted from the version string, i.e. the
+version string is just *A.B*.
+
+When a new release only fixes bugs and doesn't add new features or
+functionality, the micro version is incremented. When new features are
+added in a backwards compatible way, the minor version is incremented
+and the micro version is set to zero. When there are backwards
+incompatible changes, the major version is incremented and others are
+set to zero.
+
+The following preprocessor constants specify the current version of
+the library:
+
+``JANSSON_MAJOR_VERSION``, ``JANSSON_MINOR_VERSION``, ``JANSSON_MICRO_VERSION``
+ Integers specifying the major, minor and micro versions,
+ respectively.
+
+``JANSSON_VERSION``
+ A string representation of the current version, e.g. ``"1.2.1"`` or
+ ``"1.3"``.
+
+``JANSSON_VERSION_HEX``
+ A 3-byte hexadecimal representation of the version, e.g.
+ ``0x010201`` for version 1.2.1 and ``0x010300`` for version 1.3.
+ This is useful in numeric comparisons, e.g.::
+
+ #if JANSSON_VERSION_HEX >= 0x010300
+ /* Code specific to version 1.3 and above */
+ #endif
+
+Additionally, there are functions to determine the version of Jansson at
+runtime:
+
+.. function:: const char *jansson_version_str()
+
+ Return the version of the Jansson library, in the same format as
+ the ``JANSSON_VERSION`` preprocessor constant.
+
+ .. versionadded:: 2.13
+
+.. function:: int jansson_version_cmp(int major, int minor, int micro)
+
+ Returns an integer less than, equal to, or greater than zero if
+ the runtime version of Jansson is found, respectively, to be less
+ than, to match, or be greater than the provided *major*, *minor*, and
+ *micro*.
+
+ .. versionadded:: 2.13
+
+``JANSSON_THREAD_SAFE_REFCOUNT``
+ If this value is defined all read-only operations and reference counting in
+ Jansson are thread safe. This value is not defined for versions older than
+ ``2.11`` or when the compiler does not provide built-in atomic functions.
+
+
+Value Representation
+====================
+
+The JSON specification (:rfc:`4627`) defines the following data types:
+*object*, *array*, *string*, *number*, *boolean*, and *null*. JSON
+types are used dynamically; arrays and objects can hold any other data
+type, including themselves. For this reason, Jansson's type system is
+also dynamic in nature. There's one C type to represent all JSON
+values, and this structure knows the type of the JSON value it holds.
+
+.. type:: json_t
+
+ This data structure is used throughout the library to represent all
+ JSON values. It always contains the type of the JSON value it holds
+ and the value's reference count. The rest depends on the type of the
+ value.
+
+Objects of :type:`json_t` are always used through a pointer. There
+are APIs for querying the type, manipulating the reference count, and
+for constructing and manipulating values of different types.
+
+Unless noted otherwise, all API functions return an error value if an
+error occurs. Depending on the function's signature, the error value
+is either *NULL* or -1. Invalid arguments or invalid input are
+apparent sources for errors. Memory allocation and I/O operations may
+also cause errors.
+
+
+Type
+----
+
+.. c:enum:: json_type
+
+ The type of a JSON value. The following members are defined:
+
+ +--------------------+
+ | ``JSON_OBJECT`` |
+ +--------------------+
+ | ``JSON_ARRAY`` |
+ +--------------------+
+ | ``JSON_STRING`` |
+ +--------------------+
+ | ``JSON_INTEGER`` |
+ +--------------------+
+ | ``JSON_REAL`` |
+ +--------------------+
+ | ``JSON_TRUE`` |
+ +--------------------+
+ | ``JSON_FALSE`` |
+ +--------------------+
+ | ``JSON_NULL`` |
+ +--------------------+
+
+ These correspond to JSON object, array, string, number, boolean and
+ null. A number is represented by either a value of the type
+ ``JSON_INTEGER`` or of the type ``JSON_REAL``. A true boolean value
+ is represented by a value of the type ``JSON_TRUE`` and false by a
+ value of the type ``JSON_FALSE``.
+
+.. function:: int json_typeof(const json_t *json)
+
+ Return the type of the JSON value (a :type:`json_type` cast to
+ ``int``). *json* MUST NOT be *NULL*. This function is actually
+ implemented as a macro for speed.
+
+.. function:: int json_is_object(const json_t *json)
+ int json_is_array(const json_t *json)
+ int json_is_string(const json_t *json)
+ int json_is_integer(const json_t *json)
+ int json_is_real(const json_t *json)
+ int json_is_true(const json_t *json)
+ int json_is_false(const json_t *json)
+ int json_is_null(const json_t *json)
+
+ These functions (actually macros) return true (non-zero) for values
+ of the given type, and false (zero) for values of other types and
+ for *NULL*.
+
+.. function:: int json_is_number(const json_t *json)
+
+ Returns true for values of types ``JSON_INTEGER`` and
+ ``JSON_REAL``, and false for other types and for *NULL*.
+
+.. function:: int json_is_boolean(const json_t *json)
+
+ Returns true for types ``JSON_TRUE`` and ``JSON_FALSE``, and false
+ for values of other types and for *NULL*.
+
+.. function:: int json_boolean_value(const json_t *json)
+
+ Alias of :func:`json_is_true()`, i.e. returns 1 for ``JSON_TRUE``
+ and 0 otherwise.
+
+ .. versionadded:: 2.7
+
+
+.. _apiref-reference-count:
+
+Reference Count
+---------------
+
+The reference count is used to track whether a value is still in use
+or not. When a value is created, it's reference count is set to 1. If
+a reference to a value is kept (e.g. a value is stored somewhere for
+later use), its reference count is incremented, and when the value is
+no longer needed, the reference count is decremented. When the
+reference count drops to zero, there are no references left, and the
+value can be destroyed.
+
+.. function:: json_t *json_incref(json_t *json)
+
+ Increment the reference count of *json* if it's not *NULL*.
+ Returns *json*.
+
+.. function:: void json_decref(json_t *json)
+
+ Decrement the reference count of *json*. As soon as a call to
+ :func:`json_decref()` drops the reference count to zero, the value
+ is destroyed and it can no longer be used.
+
+Functions creating new JSON values set the reference count to 1. These
+functions are said to return a **new reference**. Other functions
+returning (existing) JSON values do not normally increase the
+reference count. These functions are said to return a **borrowed
+reference**. So, if the user will hold a reference to a value returned
+as a borrowed reference, he must call :func:`json_incref`. As soon as
+the value is no longer needed, :func:`json_decref` should be called
+to release the reference.
+
+Normally, all functions accepting a JSON value as an argument will
+manage the reference, i.e. increase and decrease the reference count
+as needed. However, some functions **steal** the reference, i.e. they
+have the same result as if the user called :func:`json_decref()` on
+the argument right after calling the function. These functions are
+suffixed with ``_new`` or have ``_new_`` somewhere in their name.
+
+For example, the following code creates a new JSON array and appends
+an integer to it::
+
+ json_t *array, *integer;
+
+ array = json_array();
+ integer = json_integer(42);
+
+ json_array_append(array, integer);
+ json_decref(integer);
+
+Note how the caller has to release the reference to the integer value
+by calling :func:`json_decref()`. By using a reference stealing
+function :func:`json_array_append_new()` instead of
+:func:`json_array_append()`, the code becomes much simpler::
+
+ json_t *array = json_array();
+ json_array_append_new(array, json_integer(42));
+
+In this case, the user doesn't have to explicitly release the
+reference to the integer value, as :func:`json_array_append_new()`
+steals the reference when appending the value to the array.
+
+In the following sections it is clearly documented whether a function
+will return a new or borrowed reference or steal a reference to its
+argument.
+
+
+Circular References
+-------------------
+
+A circular reference is created when an object or an array is,
+directly or indirectly, inserted inside itself. The direct case is
+simple::
+
+ json_t *obj = json_object();
+ json_object_set(obj, "foo", obj);
+
+Jansson will refuse to do this, and :func:`json_object_set()` (and
+all the other such functions for objects and arrays) will return with
+an error status. The indirect case is the dangerous one::
+
+ json_t *arr1 = json_array(), *arr2 = json_array();
+ json_array_append(arr1, arr2);
+ json_array_append(arr2, arr1);
+
+In this example, the array ``arr2`` is contained in the array
+``arr1``, and vice versa. Jansson cannot check for this kind of
+indirect circular references without a performance hit, so it's up to
+the user to avoid them.
+
+If a circular reference is created, the memory consumed by the values
+cannot be freed by :func:`json_decref()`. The reference counts never
+drops to zero because the values are keeping the references to each
+other. Moreover, trying to encode the values with any of the encoding
+functions will fail. The encoder detects circular references and
+returns an error status.
+
+Scope Dereferencing
+-------------------
+
+.. versionadded:: 2.9
+
+It is possible to use the ``json_auto_t`` type to automatically
+dereference a value at the end of a scope. For example::
+
+ void function(void) {
+ json_auto_t *value = NULL;
+ value = json_string("foo");
+ /* json_decref(value) is automatically called. */
+ }
+
+This feature is only available on GCC and Clang. So if your project
+has a portability requirement for other compilers, you should avoid
+this feature.
+
+Additionally, as always, care should be taken when passing values to
+functions that steal references.
+
+True, False and Null
+====================
+
+These three values are implemented as singletons, so the returned
+pointers won't change between invocations of these functions.
+
+.. function:: json_t *json_true(void)
+
+ .. refcounting:: new
+
+ Returns the JSON true value.
+
+.. function:: json_t *json_false(void)
+
+ .. refcounting:: new
+
+ Returns the JSON false value.
+
+.. function:: json_t *json_boolean(val)
+
+ .. refcounting:: new
+
+ Returns JSON false if ``val`` is zero, and JSON true otherwise.
+ This is a macro, and equivalent to ``val ? json_true() :
+ json_false()``.
+
+ .. versionadded:: 2.4
+
+
+.. function:: json_t *json_null(void)
+
+ .. refcounting:: new
+
+ Returns the JSON null value.
+
+
+String
+======
+
+Jansson uses UTF-8 as the character encoding. All JSON strings must be
+valid UTF-8 (or ASCII, as it's a subset of UTF-8). All Unicode
+codepoints U+0000 through U+10FFFF are allowed, but you must use
+length-aware functions if you wish to embed null bytes in strings.
+
+.. function:: json_t *json_string(const char *value)
+
+ .. refcounting:: new
+
+ Returns a new JSON string, or *NULL* on error. *value* must be a
+ valid null terminated UTF-8 encoded Unicode string.
+
+.. function:: json_t *json_stringn(const char *value, size_t len)
+
+ .. refcounting:: new
+
+ Like :func:`json_string`, but with explicit length, so *value* may
+ contain null characters or not be null terminated.
+
+ .. versionadded:: 2.7
+
+.. function:: json_t *json_string_nocheck(const char *value)
+
+ .. refcounting:: new
+
+ Like :func:`json_string`, but doesn't check that *value* is valid
+ UTF-8. Use this function only if you are certain that this really
+ is the case (e.g. you have already checked it by other means).
+
+.. function:: json_t *json_stringn_nocheck(const char *value, size_t len)
+
+ .. refcounting:: new
+
+ Like :func:`json_string_nocheck`, but with explicit length, so
+ *value* may contain null characters or not be null terminated.
+
+ .. versionadded:: 2.7
+
+.. function:: const char *json_string_value(const json_t *string)
+
+ Returns the associated value of *string* as a null terminated UTF-8
+ encoded string, or *NULL* if *string* is not a JSON string.
+
+ The returned value is read-only and must not be modified or freed by
+ the user. It is valid as long as *string* exists, i.e. as long as
+ its reference count has not dropped to zero.
+
+.. function:: size_t json_string_length(const json_t *string)
+
+ Returns the length of *string* in its UTF-8 presentation, or zero
+ if *string* is not a JSON string.
+
+ .. versionadded:: 2.7
+
+.. function:: int json_string_set(json_t *string, const char *value)
+
+ Sets the associated value of *string* to *value*. *value* must be a
+ valid UTF-8 encoded Unicode string. Returns 0 on success and -1 on
+ error.
+
+.. function:: int json_string_setn(json_t *string, const char *value, size_t len)
+
+ Like :func:`json_string_set`, but with explicit length, so *value*
+ may contain null characters or not be null terminated.
+
+ .. versionadded:: 2.7
+
+.. function:: int json_string_set_nocheck(json_t *string, const char *value)
+
+ Like :func:`json_string_set`, but doesn't check that *value* is
+ valid UTF-8. Use this function only if you are certain that this
+ really is the case (e.g. you have already checked it by other
+ means).
+
+.. function:: int json_string_setn_nocheck(json_t *string, const char *value, size_t len)
+
+ Like :func:`json_string_set_nocheck`, but with explicit length,
+ so *value* may contain null characters or not be null terminated.
+
+ .. versionadded:: 2.7
+
+.. function:: json_t *json_sprintf(const char *format, ...)
+ json_t *json_vsprintf(const char *format, va_list ap)
+
+ .. refcounting:: new
+
+ Construct a JSON string from a format string and varargs, just like
+ :func:`printf()`.
+
+ .. versionadded:: 2.11
+
+
+Number
+======
+
+The JSON specification only contains one numeric type, "number". The C
+programming language has distinct types for integer and floating-point
+numbers, so for practical reasons Jansson also has distinct types for
+the two. They are called "integer" and "real", respectively. For more
+information, see :ref:`rfc-conformance`.
+
+.. type:: json_int_t
+
+ This is the C type that is used to store JSON integer values. It
+ represents the widest integer type available on your system. In
+ practice it's just a typedef of ``long long`` if your compiler
+ supports it, otherwise ``long``.
+
+ Usually, you can safely use plain ``int`` in place of
+ ``json_int_t``, and the implicit C integer conversion handles the
+ rest. Only when you know that you need the full 64-bit range, you
+ should use ``json_int_t`` explicitly.
+
+``JSON_INTEGER_IS_LONG_LONG``
+ This is a preprocessor variable that holds the value 1 if
+ :type:`json_int_t` is ``long long``, and 0 if it's ``long``. It
+ can be used as follows::
+
+ #if JSON_INTEGER_IS_LONG_LONG
+ /* Code specific for long long */
+ #else
+ /* Code specific for long */
+ #endif
+
+``JSON_INTEGER_FORMAT``
+ This is a macro that expands to a :func:`printf()` conversion
+ specifier that corresponds to :type:`json_int_t`, without the
+ leading ``%`` sign, i.e. either ``"lld"`` or ``"ld"``. This macro
+ is required because the actual type of :type:`json_int_t` can be
+ either ``long`` or ``long long``, and :func:`printf()` requires
+ different length modifiers for the two.
+
+ Example::
+
+ json_int_t x = 123123123;
+ printf("x is %" JSON_INTEGER_FORMAT "\n", x);
+
+
+.. function:: json_t *json_integer(json_int_t value)
+
+ .. refcounting:: new
+
+ Returns a new JSON integer, or *NULL* on error.
+
+.. function:: json_int_t json_integer_value(const json_t *integer)
+
+ Returns the associated value of *integer*, or 0 if *json* is not a
+ JSON integer.
+
+.. function:: int json_integer_set(const json_t *integer, json_int_t value)
+
+ Sets the associated value of *integer* to *value*. Returns 0 on
+ success and -1 if *integer* is not a JSON integer.
+
+.. function:: json_t *json_real(double value)
+
+ .. refcounting:: new
+
+ Returns a new JSON real, or *NULL* on error.
+
+.. function:: double json_real_value(const json_t *real)
+
+ Returns the associated value of *real*, or 0.0 if *real* is not a
+ JSON real.
+
+.. function:: int json_real_set(const json_t *real, double value)
+
+ Sets the associated value of *real* to *value*. Returns 0 on
+ success and -1 if *real* is not a JSON real.
+
+.. function:: double json_number_value(const json_t *json)
+
+ Returns the associated value of the JSON integer or JSON real
+ *json*, cast to double regardless of the actual type. If *json* is
+ neither JSON real nor JSON integer, 0.0 is returned.
+
+
+Array
+=====
+
+A JSON array is an ordered collection of other JSON values.
+
+.. function:: json_t *json_array(void)
+
+ .. refcounting:: new
+
+ Returns a new JSON array, or *NULL* on error. Initially, the array
+ is empty.
+
+.. function:: size_t json_array_size(const json_t *array)
+
+ Returns the number of elements in *array*, or 0 if *array* is NULL
+ or not a JSON array.
+
+.. function:: json_t *json_array_get(const json_t *array, size_t index)
+
+ .. refcounting:: borrow
+
+ Returns the element in *array* at position *index*. The valid range
+ for *index* is from 0 to the return value of
+ :func:`json_array_size()` minus 1. If *array* is not a JSON array,
+ if *array* is *NULL*, or if *index* is out of range, *NULL* is
+ returned.
+
+.. function:: int json_array_set(json_t *array, size_t index, json_t *value)
+
+ Replaces the element in *array* at position *index* with *value*.
+ The valid range for *index* is from 0 to the return value of
+ :func:`json_array_size()` minus 1. Returns 0 on success and -1 on
+ error.
+
+.. function:: int json_array_set_new(json_t *array, size_t index, json_t *value)
+
+ Like :func:`json_array_set()` but steals the reference to *value*.
+ This is useful when *value* is newly created and not used after
+ the call.
+
+.. function:: int json_array_append(json_t *array, json_t *value)
+
+ Appends *value* to the end of *array*, growing the size of *array*
+ by 1. Returns 0 on success and -1 on error.
+
+.. function:: int json_array_append_new(json_t *array, json_t *value)
+
+ Like :func:`json_array_append()` but steals the reference to
+ *value*. This is useful when *value* is newly created and not used
+ after the call.
+
+.. function:: int json_array_insert(json_t *array, size_t index, json_t *value)
+
+ Inserts *value* to *array* at position *index*, shifting the
+ elements at *index* and after it one position towards the end of
+ the array. Returns 0 on success and -1 on error.
+
+.. function:: int json_array_insert_new(json_t *array, size_t index, json_t *value)
+
+ Like :func:`json_array_insert()` but steals the reference to
+ *value*. This is useful when *value* is newly created and not used
+ after the call.
+
+.. function:: int json_array_remove(json_t *array, size_t index)
+
+ Removes the element in *array* at position *index*, shifting the
+ elements after *index* one position towards the start of the array.
+ Returns 0 on success and -1 on error. The reference count of the
+ removed value is decremented.
+
+.. function:: int json_array_clear(json_t *array)
+
+ Removes all elements from *array*. Returns 0 on success and -1 on
+ error. The reference count of all removed values are decremented.
+
+.. function:: int json_array_extend(json_t *array, json_t *other_array)
+
+ Appends all elements in *other_array* to the end of *array*.
+ Returns 0 on success and -1 on error.
+
+.. function:: void json_array_foreach(array, index, value)
+
+ Iterate over every element of ``array``, running the block
+ of code that follows each time with the proper values set to
+ variables ``index`` and ``value``, of types :type:`size_t` and
+ :type:`json_t` pointer respectively. Example::
+
+ /* array is a JSON array */
+ size_t index;
+ json_t *value;
+
+ json_array_foreach(array, index, value) {
+ /* block of code that uses index and value */
+ }
+
+ The items are returned in increasing index order.
+
+ This macro expands to an ordinary ``for`` statement upon
+ preprocessing, so its performance is equivalent to that of
+ hand-written code using the array access functions.
+ The main advantage of this macro is that it abstracts
+ away the complexity, and makes for more concise and readable code.
+
+ .. versionadded:: 2.5
+
+
+Object
+======
+
+A JSON object is a dictionary of key-value pairs, where the key is a
+Unicode string and the value is any JSON value.
+
+Even though null bytes are allowed in string values, they are not
+allowed in object keys.
+
+.. function:: json_t *json_object(void)
+
+ .. refcounting:: new
+
+ Returns a new JSON object, or *NULL* on error. Initially, the
+ object is empty.
+
+.. function:: size_t json_object_size(const json_t *object)
+
+ Returns the number of elements in *object*, or 0 if *object* is not
+ a JSON object.
+
+.. function:: json_t *json_object_get(const json_t *object, const char *key)
+
+ .. refcounting:: borrow
+
+ Get a value corresponding to *key* from *object*. Returns *NULL* if
+ *key* is not found and on error.
+
+.. function:: json_t *json_object_getn(const json_t *object, const char *key, size_t key_len)
+
+ .. refcounting:: borrow
+
+ Like :func:`json_object_get`, but give the fixed-length *key* with length *key_len*.
+ See :ref:`fixed_length_keys` for details.
+
+ .. versionadded:: 2.14
+
+.. function:: int json_object_set(json_t *object, const char *key, json_t *value)
+
+ Set the value of *key* to *value* in *object*. *key* must be a
+ valid null terminated UTF-8 encoded Unicode string. If there
+ already is a value for *key*, it is replaced by the new value.
+ Returns 0 on success and -1 on error.
+
+.. function:: int json_object_setn(json_t *object, const char *key, size_t key_len, json_t *value)
+
+ Like :func:`json_object_set`, but give the fixed-length *key* with length *key_len*.
+ See :ref:`fixed_length_keys` for details.
+
+ .. versionadded:: 2.14
+
+.. function:: int json_object_set_nocheck(json_t *object, const char *key, json_t *value)
+
+ Like :func:`json_object_set`, but doesn't check that *key* is
+ valid UTF-8. Use this function only if you are certain that this
+ really is the case (e.g. you have already checked it by other
+ means).
+
+.. function:: int json_object_setn_nocheck(json_t *object, const char *key, size_t key_len, json_t *value)
+
+ Like :func:`json_object_set_nocheck`, but give the fixed-length *key* with length *key_len*.
+ See :ref:`fixed_length_keys` for details.
+
+ .. versionadded:: 2.14
+
+.. function:: int json_object_set_new(json_t *object, const char *key, json_t *value)
+
+ Like :func:`json_object_set()` but steals the reference to
+ *value*. This is useful when *value* is newly created and not used
+ after the call.
+
+.. function:: int json_object_setn_new(json_t *object, const char *key, size_t key_len, json_t *value)
+
+ Like :func:`json_object_set_new`, but give the fixed-length *key* with length *key_len*.
+ See :ref:`fixed_length_keys` for details.
+
+ .. versionadded:: 2.14
+
+.. function:: int json_object_set_new_nocheck(json_t *object, const char *key, json_t *value)
+
+ Like :func:`json_object_set_new`, but doesn't check that *key* is
+ valid UTF-8. Use this function only if you are certain that this
+ really is the case (e.g. you have already checked it by other
+ means).
+
+.. function:: int json_object_setn_new_nocheck(json_t *object, const char *key, size_t key_len, json_t *value)
+
+ Like :func:`json_object_set_new_nocheck`, but give the fixed-length *key* with length *key_len*.
+ See :ref:`fixed_length_keys` for details.
+
+ .. versionadded:: 2.14
+
+.. function:: int json_object_del(json_t *object, const char *key)
+
+ Delete *key* from *object* if it exists. Returns 0 on success, or
+ -1 if *key* was not found. The reference count of the removed value
+ is decremented.
+
+.. function:: int json_object_deln(json_t *object, const char *key, size_t key_len)
+
+ Like :func:`json_object_del`, but give the fixed-length *key* with length *key_len*.
+ See :ref:`fixed_length_keys` for details.
+
+ .. versionadded:: 2.14
+
+.. function:: int json_object_clear(json_t *object)
+
+ Remove all elements from *object*. Returns 0 on success and -1 if
+ *object* is not a JSON object. The reference count of all removed
+ values are decremented.
+
+.. function:: int json_object_update(json_t *object, json_t *other)
+
+ Update *object* with the key-value pairs from *other*, overwriting
+ existing keys. Returns 0 on success or -1 on error.
+
+.. function:: int json_object_update_existing(json_t *object, json_t *other)
+
+ Like :func:`json_object_update()`, but only the values of existing
+ keys are updated. No new keys are created. Returns 0 on success or
+ -1 on error.
+
+ .. versionadded:: 2.3
+
+.. function:: int json_object_update_missing(json_t *object, json_t *other)
+
+ Like :func:`json_object_update()`, but only new keys are created.
+ The value of any existing key is not changed. Returns 0 on success
+ or -1 on error.
+
+ .. versionadded:: 2.3
+
+.. function:: int json_object_update_new(json_t *object, json_t *other)
+
+ Like :func:`json_object_update()`, but steals the reference to
+ *other*. This is useful when *other* is newly created and not used
+ after the call.
+
+.. function:: int json_object_update_existing_new(json_t *object, json_t *other)
+
+ Like :func:`json_object_update_new()`, but only the values of existing
+ keys are updated. No new keys are created. Returns 0 on success or
+ -1 on error.
+
+.. function:: int json_object_update_missing_new(json_t *object, json_t *other)
+
+ Like :func:`json_object_update_new()`, but only new keys are created.
+ The value of any existing key is not changed. Returns 0 on success
+ or -1 on error.
+
+.. function:: int json_object_update_recursive(json_t *object, json_t *other)
+
+ Like :func:`json_object_update()`, but object values in *other* are
+ recursively merged with the corresponding values in *object* if they are also
+ objects, instead of overwriting them. Returns 0 on success or -1 on error.
+
+.. function:: void json_object_foreach(object, key, value)
+
+ Iterate over every key-value pair of ``object``, running the block
+ of code that follows each time with the proper values set to
+ variables ``key`` and ``value``, of types ``const char *`` and
+ :type:`json_t` pointer respectively. Example::
+
+ /* obj is a JSON object */
+ const char *key;
+ json_t *value;
+
+ json_object_foreach(obj, key, value) {
+ /* block of code that uses key and value */
+ }
+
+ The items are returned in the order they were inserted to the
+ object.
+
+ **Note:** It's not safe to call ``json_object_del(object, key)`` or ``json_object_deln(object, key, key_len)``
+ during iteration. If you need to, use
+ :func:`json_object_foreach_safe` instead.
+
+ This macro expands to an ordinary ``for`` statement upon
+ preprocessing, so its performance is equivalent to that of
+ hand-written iteration code using the object iteration protocol
+ (see below). The main advantage of this macro is that it abstracts
+ away the complexity behind iteration, and makes for more concise and
+ readable code.
+
+ .. versionadded:: 2.3
+
+
+.. function:: void json_object_foreach_safe(object, tmp, key, value)
+
+ Like :func:`json_object_foreach()`, but it's safe to call
+ ``json_object_del(object, key)`` or ``json_object_deln(object, key, key_len)`` during iteration.
+ You need to pass an extra ``void *`` parameter ``tmp`` that is used for temporary storage.
+
+ .. versionadded:: 2.8
+
+.. function:: void json_object_keylen_foreach(object, key, key_len, value)
+
+ Like :c:func:`json_object_foreach`, but in *key_len* stored length of the *key*.
+ Example::
+
+ /* obj is a JSON object */
+ const char *key;
+ json_t *value;
+ size_t len;
+
+ json_object_keylen_foreach(obj, key, len, value) {
+ printf("got key %s with length %zu\n", key, len);
+ }
+
+ **Note:** It's not safe to call ``json_object_deln(object, key, key_len)``
+ during iteration. If you need to, use
+ :func:`json_object_keylen_foreach_safe` instead.
+
+ .. versionadded:: 2.14
+
+
+.. function:: void json_object_keylen_foreach_safe(object, tmp, key, key_len, value)
+
+ Like :func:`json_object_keylen_foreach()`, but it's safe to call
+ ``json_object_deln(object, key, key_len)`` during iteration.
+ You need to pass an extra ``void *`` parameter ``tmp`` that is used for temporary storage.
+
+ .. versionadded:: 2.14
+
+The following functions can be used to iterate through all key-value
+pairs in an object. The items are returned in the order they were
+inserted to the object.
+
+.. function:: void *json_object_iter(json_t *object)
+
+ Returns an opaque iterator which can be used to iterate over all
+ key-value pairs in *object*, or *NULL* if *object* is empty.
+
+.. function:: void *json_object_iter_at(json_t *object, const char *key)
+
+ Like :func:`json_object_iter()`, but returns an iterator to the
+ key-value pair in *object* whose key is equal to *key*, or NULL if
+ *key* is not found in *object*. Iterating forward to the end of
+ *object* only yields all key-value pairs of the object if *key*
+ happens to be the first key in the underlying hash table.
+
+.. function:: void *json_object_iter_next(json_t *object, void *iter)
+
+ Returns an iterator pointing to the next key-value pair in *object*
+ after *iter*, or *NULL* if the whole object has been iterated
+ through.
+
+.. function:: const char *json_object_iter_key(void *iter)
+
+ Extract the associated key from *iter*.
+
+.. function:: size_t json_object_iter_key_len(void *iter)
+
+ Extract the associated key length from *iter*.
+
+ .. versionadded:: 2.14
+
+.. function:: json_t *json_object_iter_value(void *iter)
+
+ .. refcounting:: borrow
+
+ Extract the associated value from *iter*.
+
+.. function:: int json_object_iter_set(json_t *object, void *iter, json_t *value)
+
+ Set the value of the key-value pair in *object*, that is pointed to
+ by *iter*, to *value*.
+
+.. function:: int json_object_iter_set_new(json_t *object, void *iter, json_t *value)
+
+ Like :func:`json_object_iter_set()`, but steals the reference to
+ *value*. This is useful when *value* is newly created and not used
+ after the call.
+
+.. function:: void *json_object_key_to_iter(const char *key)
+
+ Like :func:`json_object_iter_at()`, but much faster. Only works for
+ values returned by :func:`json_object_iter_key()`. Using other keys
+ will lead to segfaults. This function is used internally to
+ implement :func:`json_object_foreach`. Example::
+
+ /* obj is a JSON object */
+ const char *key;
+ json_t *value;
+
+ void *iter = json_object_iter(obj);
+ while(iter)
+ {
+ key = json_object_iter_key(iter);
+ value = json_object_iter_value(iter);
+ /* use key and value ... */
+ iter = json_object_iter_next(obj, iter);
+ }
+
+ .. versionadded:: 2.3
+
+.. function:: void json_object_seed(size_t seed)
+
+ Seed the hash function used in Jansson's hashtable implementation.
+ The seed is used to randomize the hash function so that an
+ attacker cannot control its output.
+
+ If *seed* is 0, Jansson generates the seed itself by reading
+ random data from the operating system's entropy sources. If no
+ entropy sources are available, falls back to using a combination
+ of the current timestamp (with microsecond precision if possible)
+ and the process ID.
+
+ If called at all, this function must be called before any calls to
+ :func:`json_object()`, either explicit or implicit. If this
+ function is not called by the user, the first call to
+ :func:`json_object()` (either explicit or implicit) seeds the hash
+ function. See :ref:`thread-safety` for notes on thread safety.
+
+ If repeatable results are required, for e.g. unit tests, the hash
+ function can be "unrandomized" by calling :func:`json_object_seed`
+ with a constant value on program startup, e.g.
+ ``json_object_seed(1)``.
+
+ .. versionadded:: 2.6
+
+
+Error reporting
+===============
+
+Jansson uses a single struct type to pass error information to the
+user. See sections :ref:`apiref-decoding`, :ref:`apiref-pack` and
+:ref:`apiref-unpack` for functions that pass error information using
+this struct.
+
+.. type:: json_error_t
+
+ .. member:: char text[]
+
+ The error message (in UTF-8), or an empty string if a message is
+ not available.
+
+ The last byte of this array contains a numeric error code. Use
+ :func:`json_error_code()` to extract this code.
+
+ .. member:: char source[]
+
+ Source of the error. This can be (a part of) the file name or a
+ special identifier in angle brackets (e.g. ``<string>``).
+
+ .. member:: int line
+
+ The line number on which the error occurred.
+
+ .. member:: int column
+
+ The column on which the error occurred. Note that this is the
+ *character column*, not the byte column, i.e. a multibyte UTF-8
+ character counts as one column.
+
+ .. member:: int position
+
+ The position in bytes from the start of the input. This is
+ useful for debugging Unicode encoding problems.
+
+The normal use of :type:`json_error_t` is to allocate it on the stack,
+and pass a pointer to a function. Example::
+
+ int main() {
+ json_t *json;
+ json_error_t error;
+
+ json = json_load_file("/path/to/file.json", 0, &error);
+ if(!json) {
+ /* the error variable contains error information */
+ }
+ ...
+ }
+
+Also note that if the call succeeded (``json != NULL`` in the above
+example), the contents of ``error`` are generally left unspecified.
+The decoding functions write to the ``position`` member also on
+success. See :ref:`apiref-decoding` for more info.
+
+All functions also accept *NULL* as the :type:`json_error_t` pointer,
+in which case no error information is returned to the caller.
+
+.. c:enum:: json_error_code
+
+ An enumeration containing numeric error codes. The following errors are
+ currently defined:
+
+ ``json_error_unknown``
+
+ Unknown error. This should only be returned for non-errorneous
+ :type:`json_error_t` structures.
+
+ ``json_error_out_of_memory``
+
+ The library couldn’t allocate any heap memory.
+
+ ``json_error_stack_overflow``
+
+ Nesting too deep.
+
+ ``json_error_cannot_open_file``
+
+ Couldn’t open input file.
+
+ ``json_error_invalid_argument``
+
+ A function argument was invalid.
+
+ ``json_error_invalid_utf8``
+
+ The input string isn’t valid UTF-8.
+
+ ``json_error_premature_end_of_input``
+
+ The input ended in the middle of a JSON value.
+
+ ``json_error_end_of_input_expected``
+
+ There was some text after the end of a JSON value. See the
+ ``JSON_DISABLE_EOF_CHECK`` flag.
+
+ ``json_error_invalid_syntax``
+
+ JSON syntax error.
+
+ ``json_error_invalid_format``
+
+ Invalid format string for packing or unpacking.
+
+ ``json_error_wrong_type``
+
+ When packing or unpacking, the actual type of a value differed from the
+ one specified in the format string.
+
+ ``json_error_null_character``
+
+ A null character was detected in a JSON string. See the
+ ``JSON_ALLOW_NUL`` flag.
+
+ ``json_error_null_value``
+
+ When packing or unpacking, some key or value was ``NULL``.
+
+ ``json_error_null_byte_in_key``
+
+ An object key would contain a null byte. Jansson can’t represent such
+ keys; see :ref:`rfc-conformance`.
+
+ ``json_error_duplicate_key``
+
+ Duplicate key in object. See the ``JSON_REJECT_DUPLICATES`` flag.
+
+ ``json_error_numeric_overflow``
+
+ When converting a JSON number to a C numeric type, a numeric overflow
+ was detected.
+
+ ``json_error_item_not_found``
+
+ Key in object not found.
+
+ ``json_error_index_out_of_range``
+
+ Array index is out of range.
+
+ .. versionadded:: 2.11
+
+.. function:: enum json_error_code json_error_code(const json_error_t *error)
+
+ Returns the error code embedded in ``error->text``.
+
+ .. versionadded:: 2.11
+
+
+Encoding
+========
+
+This section describes the functions that can be used to encode
+values to JSON. By default, only objects and arrays can be encoded
+directly, since they are the only valid *root* values of a JSON text.
+To encode any JSON value, use the ``JSON_ENCODE_ANY`` flag (see
+below).
+
+By default, the output has no newlines, and spaces are used between
+array and object elements for a readable output. This behavior can be
+altered by using the ``JSON_INDENT`` and ``JSON_COMPACT`` flags
+described below. A newline is never appended to the end of the encoded
+JSON data.
+
+Each function takes a *flags* parameter that controls some aspects of
+how the data is encoded. Its default value is 0. The following macros
+can be ORed together to obtain *flags*.
+
+``JSON_INDENT(n)``
+ Pretty-print the result, using newlines between array and object
+ items, and indenting with *n* spaces. The valid range for *n* is
+ between 0 and 31 (inclusive), other values result in an undefined
+ output. If ``JSON_INDENT`` is not used or *n* is 0, no newlines are
+ inserted between array and object items.
+
+ The ``JSON_MAX_INDENT`` constant defines the maximum indentation
+ that can be used, and its value is 31.
+
+ .. versionchanged:: 2.7
+ Added ``JSON_MAX_INDENT``.
+
+``JSON_COMPACT``
+ This flag enables a compact representation, i.e. sets the separator
+ between array and object items to ``","`` and between object keys
+ and values to ``":"``. Without this flag, the corresponding
+ separators are ``", "`` and ``": "`` for more readable output.
+
+``JSON_ENSURE_ASCII``
+ If this flag is used, the output is guaranteed to consist only of
+ ASCII characters. This is achieved by escaping all Unicode
+ characters outside the ASCII range.
+
+``JSON_SORT_KEYS``
+ If this flag is used, all the objects in output are sorted by key.
+ This is useful e.g. if two JSON texts are diffed or visually
+ compared.
+
+``JSON_PRESERVE_ORDER``
+ **Deprecated since version 2.8:** Order of object keys
+ is always preserved.
+
+ Prior to version 2.8: If this flag is used, object keys in the
+ output are sorted into the same order in which they were first
+ inserted to the object. For example, decoding a JSON text and then
+ encoding with this flag preserves the order of object keys.
+
+``JSON_ENCODE_ANY``
+ Specifying this flag makes it possible to encode any JSON value on
+ its own. Without it, only objects and arrays can be passed as the
+ *json* value to the encoding functions.
+
+ **Note:** Encoding any value may be useful in some scenarios, but
+ it's generally discouraged as it violates strict compatibility with
+ :rfc:`4627`. If you use this flag, don't expect interoperability
+ with other JSON systems.
+
+ .. versionadded:: 2.1
+
+``JSON_ESCAPE_SLASH``
+ Escape the ``/`` characters in strings with ``\/``.
+
+ .. versionadded:: 2.4
+
+``JSON_REAL_PRECISION(n)``
+ Output all real numbers with at most *n* digits of precision. The
+ valid range for *n* is between 0 and 31 (inclusive), and other
+ values result in an undefined behavior.
+
+ By default, the precision is 17, to correctly and losslessly encode
+ all IEEE 754 double precision floating point numbers.
+
+ .. versionadded:: 2.7
+
+``JSON_EMBED``
+ If this flag is used, the opening and closing characters of the top-level
+ array ('[', ']') or object ('{', '}') are omitted during encoding. This
+ flag is useful when concatenating multiple arrays or objects into a stream.
+
+ .. versionadded:: 2.10
+
+These functions output UTF-8:
+
+.. function:: char *json_dumps(const json_t *json, size_t flags)
+
+ Returns the JSON representation of *json* as a string, or *NULL* on
+ error. *flags* is described above. The return value must be freed
+ by the caller using :func:`free()`. Note that if you have called
+ :func:`json_set_alloc_funcs()` to override :func:`free()`, you should
+ call your custom free function instead to free the return value.
+
+.. function:: size_t json_dumpb(const json_t *json, char *buffer, size_t size, size_t flags)
+
+ Writes the JSON representation of *json* to the *buffer* of
+ *size* bytes. Returns the number of bytes that would be written
+ or 0 on error. *flags* is described above. *buffer* is not
+ null-terminated.
+
+ This function never writes more than *size* bytes. If the return
+ value is greater than *size*, the contents of the *buffer* are
+ undefined. This behavior enables you to specify a NULL *buffer*
+ to determine the length of the encoding. For example::
+
+ size_t size = json_dumpb(json, NULL, 0, 0);
+ if (size == 0)
+ return -1;
+
+ char *buf = alloca(size);
+
+ size = json_dumpb(json, buf, size, 0);
+
+ .. versionadded:: 2.10
+
+.. function:: int json_dumpf(const json_t *json, FILE *output, size_t flags)
+
+ Write the JSON representation of *json* to the stream *output*.
+ *flags* is described above. Returns 0 on success and -1 on error.
+ If an error occurs, something may have already been written to
+ *output*. In this case, the output is undefined and most likely not
+ valid JSON.
+
+.. function:: int json_dumpfd(const json_t *json, int output, size_t flags)
+
+ Write the JSON representation of *json* to the stream *output*.
+ *flags* is described above. Returns 0 on success and -1 on error.
+ If an error occurs, something may have already been written to
+ *output*. In this case, the output is undefined and most likely not
+ valid JSON.
+
+ It is important to note that this function can only succeed on stream
+ file descriptors (such as SOCK_STREAM). Using this function on a
+ non-stream file descriptor will result in undefined behavior. For
+ non-stream file descriptors, see instead :func:`json_dumpb()`.
+
+ This function requires POSIX and fails on all non-POSIX systems.
+
+ .. versionadded:: 2.10
+
+.. function:: int json_dump_file(const json_t *json, const char *path, size_t flags)
+
+ Write the JSON representation of *json* to the file *path*. If
+ *path* already exists, it is overwritten. *flags* is described
+ above. Returns 0 on success and -1 on error.
+
+.. type:: json_dump_callback_t
+
+ A typedef for a function that's called by
+ :func:`json_dump_callback()`::
+
+ typedef int (*json_dump_callback_t)(const char *buffer, size_t size, void *data);
+
+ *buffer* points to a buffer containing a chunk of output, *size* is
+ the length of the buffer, and *data* is the corresponding
+ :func:`json_dump_callback()` argument passed through.
+
+ *buffer* is guaranteed to be a valid UTF-8 string (i.e. multi-byte
+ code unit sequences are preserved). *buffer* never contains
+ embedded null bytes.
+
+ On error, the function should return -1 to stop the encoding
+ process. On success, it should return 0.
+
+ .. versionadded:: 2.2
+
+.. function:: int json_dump_callback(const json_t *json, json_dump_callback_t callback, void *data, size_t flags)
+
+ Call *callback* repeatedly, passing a chunk of the JSON
+ representation of *json* each time. *flags* is described above.
+ Returns 0 on success and -1 on error.
+
+ .. versionadded:: 2.2
+
+
+.. _apiref-decoding:
+
+Decoding
+========
+
+This section describes the functions that can be used to decode JSON
+text to the Jansson representation of JSON data. The JSON
+specification requires that a JSON text is either a serialized array
+or object, and this requirement is also enforced with the following
+functions. In other words, the top level value in the JSON text being
+decoded must be either array or object. To decode any JSON value, use
+the ``JSON_DECODE_ANY`` flag (see below).
+
+See :ref:`rfc-conformance` for a discussion on Jansson's conformance
+to the JSON specification. It explains many design decisions that
+affect especially the behavior of the decoder.
+
+Each function takes a *flags* parameter that can be used to control
+the behavior of the decoder. Its default value is 0. The following
+macros can be ORed together to obtain *flags*.
+
+``JSON_REJECT_DUPLICATES``
+ Issue a decoding error if any JSON object in the input text
+ contains duplicate keys. Without this flag, the value of the last
+ occurrence of each key ends up in the result. Key equivalence is
+ checked byte-by-byte, without special Unicode comparison
+ algorithms.
+
+ .. versionadded:: 2.1
+
+``JSON_DECODE_ANY``
+ By default, the decoder expects an array or object as the input.
+ With this flag enabled, the decoder accepts any valid JSON value.
+
+ **Note:** Decoding any value may be useful in some scenarios, but
+ it's generally discouraged as it violates strict compatibility with
+ :rfc:`4627`. If you use this flag, don't expect interoperability
+ with other JSON systems.
+
+ .. versionadded:: 2.3
+
+``JSON_DISABLE_EOF_CHECK``
+ By default, the decoder expects that its whole input constitutes a
+ valid JSON text, and issues an error if there's extra data after
+ the otherwise valid JSON input. With this flag enabled, the decoder
+ stops after decoding a valid JSON array or object, and thus allows
+ extra data after the JSON text.
+
+ Normally, reading will stop when the last ``]`` or ``}`` in the
+ JSON input is encountered. If both ``JSON_DISABLE_EOF_CHECK`` and
+ ``JSON_DECODE_ANY`` flags are used, the decoder may read one extra
+ UTF-8 code unit (up to 4 bytes of input). For example, decoding
+ ``4true`` correctly decodes the integer 4, but also reads the
+ ``t``. For this reason, if reading multiple consecutive values that
+ are not arrays or objects, they should be separated by at least one
+ whitespace character.
+
+ .. versionadded:: 2.1
+
+``JSON_DECODE_INT_AS_REAL``
+ JSON defines only one number type. Jansson distinguishes between
+ ints and reals. For more information see :ref:`real-vs-integer`.
+ With this flag enabled the decoder interprets all numbers as real
+ values. Integers that do not have an exact double representation
+ will silently result in a loss of precision. Integers that cause
+ a double overflow will cause an error.
+
+ .. versionadded:: 2.5
+
+``JSON_ALLOW_NUL``
+ Allow ``\u0000`` escape inside string values. This is a safety
+ measure; If you know your input can contain null bytes, use this
+ flag. If you don't use this flag, you don't have to worry about null
+ bytes inside strings unless you explicitly create themselves by
+ using e.g. :func:`json_stringn()` or ``s#`` format specifier for
+ :func:`json_pack()`.
+
+ Object keys cannot have embedded null bytes even if this flag is
+ used.
+
+ .. versionadded:: 2.6
+
+Each function also takes an optional :type:`json_error_t` parameter
+that is filled with error information if decoding fails. It's also
+updated on success; the number of bytes of input read is written to
+its ``position`` field. This is especially useful when using
+``JSON_DISABLE_EOF_CHECK`` to read multiple consecutive JSON texts.
+
+.. versionadded:: 2.3
+ Number of bytes of input read is written to the ``position`` field
+ of the :type:`json_error_t` structure.
+
+If no error or position information is needed, you can pass *NULL*.
+
+.. function:: json_t *json_loads(const char *input, size_t flags, json_error_t *error)
+
+ .. refcounting:: new
+
+ Decodes the JSON string *input* and returns the array or object it
+ contains, or *NULL* on error, in which case *error* is filled with
+ information about the error. *flags* is described above.
+
+.. function:: json_t *json_loadb(const char *buffer, size_t buflen, size_t flags, json_error_t *error)
+
+ .. refcounting:: new
+
+ Decodes the JSON string *buffer*, whose length is *buflen*, and
+ returns the array or object it contains, or *NULL* on error, in
+ which case *error* is filled with information about the error. This
+ is similar to :func:`json_loads()` except that the string doesn't
+ need to be null-terminated. *flags* is described above.
+
+ .. versionadded:: 2.1
+
+.. function:: json_t *json_loadf(FILE *input, size_t flags, json_error_t *error)
+
+ .. refcounting:: new
+
+ Decodes the JSON text in stream *input* and returns the array or
+ object it contains, or *NULL* on error, in which case *error* is
+ filled with information about the error. *flags* is described
+ above.
+
+ This function will start reading the input from whatever position
+ the input file was in, without attempting to seek first. If an error
+ occurs, the file position will be left indeterminate. On success,
+ the file position will be at EOF, unless ``JSON_DISABLE_EOF_CHECK``
+ flag was used. In this case, the file position will be at the first
+ character after the last ``]`` or ``}`` in the JSON input. This
+ allows calling :func:`json_loadf()` on the same ``FILE`` object
+ multiple times, if the input consists of consecutive JSON texts,
+ possibly separated by whitespace.
+
+.. function:: json_t *json_loadfd(int input, size_t flags, json_error_t *error)
+
+ .. refcounting:: new
+
+ Decodes the JSON text in stream *input* and returns the array or
+ object it contains, or *NULL* on error, in which case *error* is
+ filled with information about the error. *flags* is described
+ above.
+
+ This function will start reading the input from whatever position
+ the input file descriptor was in, without attempting to seek first.
+ If an error occurs, the file position will be left indeterminate.
+ On success, the file position will be at EOF, unless
+ ``JSON_DISABLE_EOF_CHECK`` flag was used. In this case, the file
+ descriptor's position will be at the first character after the last
+ ``]`` or ``}`` in the JSON input. This allows calling
+ :func:`json_loadfd()` on the same file descriptor multiple times,
+ if the input consists of consecutive JSON texts, possibly separated
+ by whitespace.
+
+ It is important to note that this function can only succeed on stream
+ file descriptors (such as SOCK_STREAM). Using this function on a
+ non-stream file descriptor will result in undefined behavior. For
+ non-stream file descriptors, see instead :func:`json_loadb()`. In
+ addition, please note that this function cannot be used on non-blocking
+ file descriptors (such as a non-blocking socket). Using this function
+ on non-blocking file descriptors has a high risk of data loss because
+ it does not support resuming.
+
+ This function requires POSIX and fails on all non-POSIX systems.
+
+ .. versionadded:: 2.10
+
+.. function:: json_t *json_load_file(const char *path, size_t flags, json_error_t *error)
+
+ .. refcounting:: new
+
+ Decodes the JSON text in file *path* and returns the array or
+ object it contains, or *NULL* on error, in which case *error* is
+ filled with information about the error. *flags* is described
+ above.
+
+.. type:: json_load_callback_t
+
+ A typedef for a function that's called by
+ :func:`json_load_callback()` to read a chunk of input data::
+
+ typedef size_t (*json_load_callback_t)(void *buffer, size_t buflen, void *data);
+
+ *buffer* points to a buffer of *buflen* bytes, and *data* is the
+ corresponding :func:`json_load_callback()` argument passed through.
+
+ On success, the function should write at most *buflen* bytes to
+ *buffer*, and return the number of bytes written; a returned value
+ of 0 indicates that no data was produced and that the end of file
+ has been reached. On error, the function should return
+ ``(size_t)-1`` to abort the decoding process.
+
+ In UTF-8, some code points are encoded as multi-byte sequences. The
+ callback function doesn't need to worry about this, as Jansson
+ handles it at a higher level. For example, you can safely read a
+ fixed number of bytes from a network connection without having to
+ care about code unit sequences broken apart by the chunk
+ boundaries.
+
+ .. versionadded:: 2.4
+
+.. function:: json_t *json_load_callback(json_load_callback_t callback, void *data, size_t flags, json_error_t *error)
+
+ .. refcounting:: new
+
+ Decodes the JSON text produced by repeated calls to *callback*, and
+ returns the array or object it contains, or *NULL* on error, in
+ which case *error* is filled with information about the error.
+ *data* is passed through to *callback* on each call. *flags* is
+ described above.
+
+ .. versionadded:: 2.4
+
+
+.. _apiref-pack:
+
+Building Values
+===============
+
+This section describes functions that help to create, or *pack*,
+complex JSON values, especially nested objects and arrays. Value
+building is based on a *format string* that is used to tell the
+functions about the expected arguments.
+
+For example, the format string ``"i"`` specifies a single integer
+value, while the format string ``"[ssb]"`` or the equivalent ``"[s, s,
+b]"`` specifies an array value with two strings and a boolean as its
+items::
+
+ /* Create the JSON integer 42 */
+ json_pack("i", 42);
+
+ /* Create the JSON array ["foo", "bar", true] */
+ json_pack("[ssb]", "foo", "bar", 1);
+
+Here's the full list of format specifiers. The type in parentheses
+denotes the resulting JSON type, and the type in brackets (if any)
+denotes the C type that is expected as the corresponding argument or
+arguments.
+
+``s`` (string) [const char \*]
+ Convert a null terminated UTF-8 string to a JSON string.
+
+``s?`` (string) [const char \*]
+ Like ``s``, but if the argument is *NULL*, output a JSON null
+ value.
+
+ .. versionadded:: 2.8
+
+``s*`` (string) [const char \*]
+ Like ``s``, but if the argument is *NULL*, do not output any value.
+ This format can only be used inside an object or an array. If used
+ inside an object, the corresponding key is additionally suppressed
+ when the value is omitted. See below for an example.
+
+ .. versionadded:: 2.11
+
+``s#`` (string) [const char \*, int]
+ Convert a UTF-8 buffer of a given length to a JSON string.
+
+ .. versionadded:: 2.5
+
+``s%`` (string) [const char \*, size_t]
+ Like ``s#`` but the length argument is of type :type:`size_t`.
+
+ .. versionadded:: 2.6
+
+``+`` [const char \*]
+ Like ``s``, but concatenate to the previous string. Only valid
+ after ``s``, ``s#``, ``+`` or ``+#``.
+
+ .. versionadded:: 2.5
+
+``+#`` [const char \*, int]
+ Like ``s#``, but concatenate to the previous string. Only valid
+ after ``s``, ``s#``, ``+`` or ``+#``.
+
+ .. versionadded:: 2.5
+
+``+%`` (string) [const char \*, size_t]
+ Like ``+#`` but the length argument is of type :type:`size_t`.
+
+ .. versionadded:: 2.6
+
+``n`` (null)
+ Output a JSON null value. No argument is consumed.
+
+``b`` (boolean) [int]
+ Convert a C ``int`` to JSON boolean value. Zero is converted
+ to ``false`` and non-zero to ``true``.
+
+``i`` (integer) [int]
+ Convert a C ``int`` to JSON integer.
+
+``I`` (integer) [json_int_t]
+ Convert a C :type:`json_int_t` to JSON integer.
+
+``f`` (real) [double]
+ Convert a C ``double`` to JSON real.
+
+``o`` (any value) [json_t \*]
+ Output any given JSON value as-is. If the value is added to an
+ array or object, the reference to the value passed to ``o`` is
+ stolen by the container.
+
+``O`` (any value) [json_t \*]
+ Like ``o``, but the argument's reference count is incremented.
+ This is useful if you pack into an array or object and want to
+ keep the reference for the JSON value consumed by ``O`` to
+ yourself.
+
+``o?``, ``O?`` (any value) [json_t \*]
+ Like ``o`` and ``O``, respectively, but if the argument is
+ *NULL*, output a JSON null value.
+
+ .. versionadded:: 2.8
+
+``o*``, ``O*`` (any value) [json_t \*]
+ Like ``o`` and ``O``, respectively, but if the argument is
+ *NULL*, do not output any value. This format can only be used
+ inside an object or an array. If used inside an object, the
+ corresponding key is additionally suppressed. See below for an
+ example.
+
+ .. versionadded:: 2.11
+
+``[fmt]`` (array)
+ Build an array with contents from the inner format string. ``fmt``
+ may contain objects and arrays, i.e. recursive value building is
+ supported.
+
+``{fmt}`` (object)
+ Build an object with contents from the inner format string
+ ``fmt``. The first, third, etc. format specifier represent a key,
+ and must be a string (see ``s``, ``s#``, ``+`` and ``+#`` above),
+ as object keys are always strings. The second, fourth, etc. format
+ specifier represent a value. Any value may be an object or array,
+ i.e. recursive value building is supported.
+
+Whitespace, ``:`` and ``,`` are ignored.
+
+.. function:: json_t *json_pack(const char *fmt, ...)
+
+ .. refcounting:: new
+
+ Build a new JSON value according to the format string *fmt*. For
+ each format specifier (except for ``{}[]n``), one or more arguments
+ are consumed and used to build the corresponding value. Returns
+ *NULL* on error.
+
+.. function:: json_t *json_pack_ex(json_error_t *error, size_t flags, const char *fmt, ...)
+ json_t *json_vpack_ex(json_error_t *error, size_t flags, const char *fmt, va_list ap)
+
+ .. refcounting:: new
+
+ Like :func:`json_pack()`, but an in the case of an error, an error
+ message is written to *error*, if it's not *NULL*. The *flags*
+ parameter is currently unused and should be set to 0.
+
+ As only the errors in format string (and out-of-memory errors) can
+ be caught by the packer, these two functions are most likely only
+ useful for debugging format strings.
+
+More examples::
+
+ /* Build an empty JSON object */
+ json_pack("{}");
+
+ /* Build the JSON object {"foo": 42, "bar": 7} */
+ json_pack("{sisi}", "foo", 42, "bar", 7);
+
+ /* Like above, ':', ',' and whitespace are ignored */
+ json_pack("{s:i, s:i}", "foo", 42, "bar", 7);
+
+ /* Build the JSON array [[1, 2], {"cool": true}] */
+ json_pack("[[i,i],{s:b}]", 1, 2, "cool", 1);
+
+ /* Build a string from a non-null terminated buffer */
+ char buffer[4] = {'t', 'e', 's', 't'};
+ json_pack("s#", buffer, 4);
+
+ /* Concatenate strings together to build the JSON string "foobarbaz" */
+ json_pack("s++", "foo", "bar", "baz");
+
+ /* Create an empty object or array when optional members are missing */
+ json_pack("{s:s*,s:o*,s:O*}", "foo", NULL, "bar", NULL, "baz", NULL);
+ json_pack("[s*,o*,O*]", NULL, NULL, NULL);
+
+
+.. _apiref-unpack:
+
+Parsing and Validating Values
+=============================
+
+This section describes functions that help to validate complex values
+and extract, or *unpack*, data from them. Like :ref:`building values
+<apiref-pack>`, this is also based on format strings.
+
+While a JSON value is unpacked, the type specified in the format
+string is checked to match that of the JSON value. This is the
+validation part of the process. In addition to this, the unpacking
+functions can also check that all items of arrays and objects are
+unpacked. This check be enabled with the format specifier ``!`` or by
+using the flag ``JSON_STRICT``. See below for details.
+
+Here's the full list of format specifiers. The type in parentheses
+denotes the JSON type, and the type in brackets (if any) denotes the C
+type whose address should be passed.
+
+``s`` (string) [const char \*]
+ Convert a JSON string to a pointer to a null terminated UTF-8
+ string. The resulting string is extracted by using
+ :func:`json_string_value()` internally, so it exists as long as
+ there are still references to the corresponding JSON string.
+
+``s%`` (string) [const char \*, size_t \*]
+ Convert a JSON string to a pointer to a null terminated UTF-8
+ string and its length.
+
+ .. versionadded:: 2.6
+
+``n`` (null)
+ Expect a JSON null value. Nothing is extracted.
+
+``b`` (boolean) [int]
+ Convert a JSON boolean value to a C ``int``, so that ``true``
+ is converted to 1 and ``false`` to 0.
+
+``i`` (integer) [int]
+ Convert a JSON integer to C ``int``.
+
+``I`` (integer) [json_int_t]
+ Convert a JSON integer to C :type:`json_int_t`.
+
+``f`` (real) [double]
+ Convert a JSON real to C ``double``.
+
+``F`` (integer or real) [double]
+ Convert a JSON number (integer or real) to C ``double``.
+
+``o`` (any value) [json_t \*]
+ Store a JSON value with no conversion to a :type:`json_t` pointer.
+
+``O`` (any value) [json_t \*]
+ Like ``o``, but the JSON value's reference count is incremented.
+ Storage pointers should be initialized NULL before using unpack.
+ The caller is responsible for releasing all references incremented
+ by unpack, even when an error occurs.
+
+``[fmt]`` (array)
+ Convert each item in the JSON array according to the inner format
+ string. ``fmt`` may contain objects and arrays, i.e. recursive
+ value extraction is supported.
+
+``{fmt}`` (object)
+ Convert each item in the JSON object according to the inner format
+ string ``fmt``. The first, third, etc. format specifier represent
+ a key, and must be ``s``. The corresponding argument to unpack
+ functions is read as the object key. The second, fourth, etc.
+ format specifier represent a value and is written to the address
+ given as the corresponding argument. **Note** that every other
+ argument is read from and every other is written to.
+
+ ``fmt`` may contain objects and arrays as values, i.e. recursive
+ value extraction is supported.
+
+ .. versionadded:: 2.3
+ Any ``s`` representing a key may be suffixed with a ``?`` to
+ make the key optional. If the key is not found, nothing is
+ extracted. See below for an example.
+
+``!``
+ This special format specifier is used to enable the check that
+ all object and array items are accessed, on a per-value basis. It
+ must appear inside an array or object as the last format specifier
+ before the closing bracket or brace. To enable the check globally,
+ use the ``JSON_STRICT`` unpacking flag.
+
+``*``
+ This special format specifier is the opposite of ``!``. If the
+ ``JSON_STRICT`` flag is used, ``*`` can be used to disable the
+ strict check on a per-value basis. It must appear inside an array
+ or object as the last format specifier before the closing bracket
+ or brace.
+
+Whitespace, ``:`` and ``,`` are ignored.
+
+.. function:: int json_unpack(json_t *root, const char *fmt, ...)
+
+ Validate and unpack the JSON value *root* according to the format
+ string *fmt*. Returns 0 on success and -1 on failure.
+
+.. function:: int json_unpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt, ...)
+ int json_vunpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt, va_list ap)
+
+ Validate and unpack the JSON value *root* according to the format
+ string *fmt*. If an error occurs and *error* is not *NULL*, write
+ error information to *error*. *flags* can be used to control the
+ behaviour of the unpacker, see below for the flags. Returns 0 on
+ success and -1 on failure.
+
+.. note::
+
+ The first argument of all unpack functions is ``json_t *root``
+ instead of ``const json_t *root``, because the use of ``O`` format
+ specifier causes the reference count of ``root``, or some value
+ reachable from ``root``, to be increased. Furthermore, the ``o``
+ format specifier may be used to extract a value as-is, which allows
+ modifying the structure or contents of a value reachable from
+ ``root``.
+
+ If the ``O`` and ``o`` format specifiers are not used, it's
+ perfectly safe to cast a ``const json_t *`` variable to plain
+ ``json_t *`` when used with these functions.
+
+The following unpacking flags are available:
+
+``JSON_STRICT``
+ Enable the extra validation step checking that all object and
+ array items are unpacked. This is equivalent to appending the
+ format specifier ``!`` to the end of every array and object in the
+ format string.
+
+``JSON_VALIDATE_ONLY``
+ Don't extract any data, just validate the JSON value against the
+ given format string. Note that object keys must still be specified
+ after the format string.
+
+Examples::
+
+ /* root is the JSON integer 42 */
+ int myint;
+ json_unpack(root, "i", &myint);
+ assert(myint == 42);
+
+ /* root is the JSON object {"foo": "bar", "quux": true} */
+ const char *str;
+ int boolean;
+ json_unpack(root, "{s:s, s:b}", "foo", &str, "quux", &boolean);
+ assert(strcmp(str, "bar") == 0 && boolean == 1);
+
+ /* root is the JSON array [[1, 2], {"baz": null} */
+ json_error_t error;
+ json_unpack_ex(root, &error, JSON_VALIDATE_ONLY, "[[i,i], {s:n}]", "baz");
+ /* returns 0 for validation success, nothing is extracted */
+
+ /* root is the JSON array [1, 2, 3, 4, 5] */
+ int myint1, myint2;
+ json_unpack(root, "[ii!]", &myint1, &myint2);
+ /* returns -1 for failed validation */
+
+ /* root is an empty JSON object */
+ int myint = 0, myint2 = 0, myint3 = 0;
+ json_unpack(root, "{s?i, s?[ii]}",
+ "foo", &myint1,
+ "bar", &myint2, &myint3);
+ /* myint1, myint2 or myint3 is no touched as "foo" and "bar" don't exist */
+
+
+Equality
+========
+
+Testing for equality of two JSON values cannot, in general, be
+achieved using the ``==`` operator. Equality in the terms of the
+``==`` operator states that the two :type:`json_t` pointers point to
+exactly the same JSON value. However, two JSON values can be equal not
+only if they are exactly the same value, but also if they have equal
+"contents":
+
+* Two integer or real values are equal if their contained numeric
+ values are equal. An integer value is never equal to a real value,
+ though.
+
+* Two strings are equal if their contained UTF-8 strings are equal,
+ byte by byte. Unicode comparison algorithms are not implemented.
+
+* Two arrays are equal if they have the same number of elements and
+ each element in the first array is equal to the corresponding
+ element in the second array.
+
+* Two objects are equal if they have exactly the same keys and the
+ value for each key in the first object is equal to the value of the
+ corresponding key in the second object.
+
+* Two true, false or null values have no "contents", so they are equal
+ if their types are equal. (Because these values are singletons,
+ their equality can actually be tested with ``==``.)
+
+.. function:: int json_equal(json_t *value1, json_t *value2)
+
+ Returns 1 if *value1* and *value2* are equal, as defined above.
+ Returns 0 if they are unequal or one or both of the pointers are
+ *NULL*.
+
+
+Copying
+=======
+
+Because of reference counting, passing JSON values around doesn't
+require copying them. But sometimes a fresh copy of a JSON value is
+needed. For example, if you need to modify an array, but still want to
+use the original afterwards, you should take a copy of it first.
+
+Jansson supports two kinds of copying: shallow and deep. There is a
+difference between these methods only for arrays and objects. Shallow
+copying only copies the first level value (array or object) and uses
+the same child values in the copied value. Deep copying makes a fresh
+copy of the child values, too. Moreover, all the child values are deep
+copied in a recursive fashion.
+
+Copying objects preserves the insertion order of keys.
+
+.. function:: json_t *json_copy(json_t *value)
+
+ .. refcounting:: new
+
+ Returns a shallow copy of *value*, or *NULL* on error.
+
+.. function:: json_t *json_deep_copy(const json_t *value)
+
+ .. refcounting:: new
+
+ Returns a deep copy of *value*, or *NULL* on error.
+
+
+.. _apiref-custom-memory-allocation:
+
+Custom Memory Allocation
+========================
+
+By default, Jansson uses :func:`malloc()` and :func:`free()` for
+memory allocation. These functions can be overridden if custom
+behavior is needed.
+
+.. type:: json_malloc_t
+
+ A typedef for a function pointer with :func:`malloc()`'s
+ signature::
+
+ typedef void *(*json_malloc_t)(size_t);
+
+.. type:: json_free_t
+
+ A typedef for a function pointer with :func:`free()`'s
+ signature::
+
+ typedef void (*json_free_t)(void *);
+
+.. function:: void json_set_alloc_funcs(json_malloc_t malloc_fn, json_free_t free_fn)
+
+ Use *malloc_fn* instead of :func:`malloc()` and *free_fn* instead
+ of :func:`free()`. This function has to be called before any other
+ Jansson's API functions to ensure that all memory operations use
+ the same functions.
+
+.. function:: void json_get_alloc_funcs(json_malloc_t *malloc_fn, json_free_t *free_fn)
+
+ Fetch the current malloc_fn and free_fn used. Either parameter
+ may be NULL.
+
+ .. versionadded:: 2.8
+
+**Examples:**
+
+Circumvent problems with different CRT heaps on Windows by using
+application's :func:`malloc()` and :func:`free()`::
+
+ json_set_alloc_funcs(malloc, free);
+
+Use the `Boehm's conservative garbage collector`_ for memory
+operations::
+
+ json_set_alloc_funcs(GC_malloc, GC_free);
+
+.. _Boehm's conservative garbage collector: http://www.hboehm.info/gc/
+
+Allow storing sensitive data (e.g. passwords or encryption keys) in
+JSON structures by zeroing all memory when freed::
+
+ static void *secure_malloc(size_t size)
+ {
+ /* Store the memory area size in the beginning of the block */
+ void *ptr = malloc(size + 8);
+ *((size_t *)ptr) = size;
+ return ptr + 8;
+ }
+
+ static void secure_free(void *ptr)
+ {
+ size_t size;
+
+ ptr -= 8;
+ size = *((size_t *)ptr);
+
+ guaranteed_memset(ptr, 0, size + 8);
+ free(ptr);
+ }
+
+ int main()
+ {
+ json_set_alloc_funcs(secure_malloc, secure_free);
+ /* ... */
+ }
+
+For more information about the issues of storing sensitive data in
+memory, see
+http://www.dwheeler.com/secure-programs/Secure-Programs-HOWTO/protect-secrets.html.
+The page also explains the :func:`guaranteed_memset()` function used
+in the example and gives a sample implementation for it.
+
+.. _fixed_length_keys:
+
+Fixed-Length keys
+=================
+
+The Jansson API allows work with fixed-length keys. This can be useful in the following cases:
+
+* The key is contained inside a buffer and is not null-terminated. In this case creating a new temporary buffer is not needed.
+* The key contains U+0000 inside it.
+
+List of API for fixed-length keys:
+
+* :c:func:`json_object_getn`
+* :c:func:`json_object_setn`
+* :c:func:`json_object_setn_nocheck`
+* :c:func:`json_object_setn_new`
+* :c:func:`json_object_setn_new_nocheck`
+* :c:func:`json_object_deln`
+* :c:func:`json_object_iter_key_len`
+* :c:func:`json_object_keylen_foreach`
+* :c:func:`json_object_keylen_foreach_safe`
+
+**Examples:**
+
+Try to write a new function to get :c:struct:`json_t` by path separated by ``.``
+
+This requires:
+
+* string iterator (no need to modify the input for better performance)
+* API for working with fixed-size keys
+
+The iterator::
+
+ struct string {
+ const char *string;
+ size_t length;
+ };
+
+ size_t string_try_next(struct string *str, const char *delimiter) {
+ str->string += strspn(str->string, delimiter);
+ str->length = strcspn(str->string, delimiter);
+ return str->length;
+ }
+
+ #define string_foreach(_string, _delimiter) \
+ for (; string_try_next(&(_string), _delimiter); (_string).string += (_string).length)
+
+
+The function::
+
+ json_t *json_object_get_by_path(json_t *object, const char *path) {
+ struct string str;
+ json_t *out = object;
+
+ str.string = path;
+
+ string_foreach(str, ".") {
+ out = json_object_getn(out, str.string, str.length);
+ if (out == NULL)
+ return NULL;
+ }
+
+ return out;
+ }
+
+And usage::
+
+ int main(void) {
+ json_t *obj = json_pack("{s:{s:{s:b}}}", "a", "b", "c", 1);
+
+ json_t *c = json_object_get_by_path(obj, "a.b.c");
+ assert(json_is_true(c));
+
+ json_decref(obj);
+ }
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/changes.rst b/src/fluent-bit/lib/jansson-e23f558/doc/changes.rst
new file mode 100644
index 000000000..ea5684377
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/changes.rst
@@ -0,0 +1,5 @@
+******************
+Changes in Jansson
+******************
+
+.. include:: ../CHANGES
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/conf.py b/src/fluent-bit/lib/jansson-e23f558/doc/conf.py
new file mode 100644
index 000000000..242617170
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/conf.py
@@ -0,0 +1,217 @@
+# -*- coding: utf-8 -*-
+#
+# Jansson documentation build configuration file, created by
+# sphinx-quickstart on Sun Sep 5 21:47:20 2010.
+#
+# This file is execfile()d with the current directory set to its containing dir.
+#
+# Note that not all possible configuration values are present in this
+# autogenerated file.
+#
+# All configuration values have a default; values that are commented out
+# serve to show the default.
+
+import sys, os
+
+# If extensions (or modules to document with autodoc) are in another directory,
+# add these directories to sys.path here. If the directory is relative to the
+# documentation root, use os.path.abspath to make it absolute, like shown here.
+sys.path.insert(0, os.path.abspath('ext'))
+
+# -- General configuration -----------------------------------------------------
+
+# If your documentation needs a minimal Sphinx version, state it here.
+needs_sphinx = '1.0'
+
+# Add any Sphinx extension module names here, as strings. They can be extensions
+# coming with Sphinx (named 'sphinx.ext.*') or your custom ones.
+extensions = ['refcounting']
+
+# Add any paths that contain templates here, relative to this directory.
+templates_path = ['_templates']
+
+# The suffix of source filenames.
+source_suffix = '.rst'
+
+# The encoding of source files.
+#source_encoding = 'utf-8-sig'
+
+# The master toctree document.
+master_doc = 'index'
+
+# General information about the project.
+project = u'Jansson'
+copyright = u'2009-2020, Petri Lehtinen'
+
+# The version info for the project you're documenting, acts as replacement for
+# |version| and |release|, also used in various other places throughout the
+# built documents.
+#
+# The short X.Y version.
+version = '2.14'
+# The full version, including alpha/beta/rc tags.
+release = version
+
+# The language for content autogenerated by Sphinx. Refer to documentation
+# for a list of supported languages.
+#language = None
+
+# There are two options for replacing |today|: either, you set today to some
+# non-false value, then it is used:
+#today = ''
+# Else, today_fmt is used as the format for a strftime call.
+#today_fmt = '%B %d, %Y'
+
+# List of patterns, relative to source directory, that match files and
+# directories to ignore when looking for source files.
+exclude_patterns = ['_build']
+
+# The reST default role (used for this markup: `text`) to use for all documents.
+default_role = 'c:func'
+primary_domain = 'c'
+
+# If true, '()' will be appended to :func: etc. cross-reference text.
+#add_function_parentheses = True
+
+# If true, the current module name will be prepended to all description
+# unit titles (such as .. function::).
+#add_module_names = True
+
+# If true, sectionauthor and moduleauthor directives will be shown in the
+# output. They are ignored by default.
+#show_authors = False
+
+# The name of the Pygments (syntax highlighting) style to use.
+pygments_style = 'sphinx'
+
+# A list of ignored prefixes for module index sorting.
+#modindex_common_prefix = []
+
+
+# -- Options for HTML output ---------------------------------------------------
+
+# The theme to use for HTML and HTML Help pages. See the documentation for
+# a list of builtin themes.
+#html_theme = 'default'
+
+# Theme options are theme-specific and customize the look and feel of a theme
+# further. For a list of options available for each theme, see the
+# documentation.
+#html_theme_options = {}
+
+# Add any paths that contain custom themes here, relative to this directory.
+#html_theme_path = []
+
+# The name for this set of Sphinx documents. If None, it defaults to
+# "<project> v<release> documentation".
+#html_title = None
+
+# A shorter title for the navigation bar. Default is the same as html_title.
+#html_short_title = None
+
+# The name of an image file (relative to this directory) to place at the top
+# of the sidebar.
+#html_logo = None
+
+# The name of an image file (within the static path) to use as favicon of the
+# docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32
+# pixels large.
+#html_favicon = None
+
+# Add any paths that contain custom static files (such as style sheets) here,
+# relative to this directory. They are copied after the builtin static files,
+# so a file named "default.css" will overwrite the builtin "default.css".
+#html_static_path = ['_static']
+
+# If not '', a 'Last updated on:' timestamp is inserted at every page bottom,
+# using the given strftime format.
+#html_last_updated_fmt = '%b %d, %Y'
+
+# If true, SmartyPants will be used to convert quotes and dashes to
+# typographically correct entities.
+#html_use_smartypants = True
+
+# Custom sidebar templates, maps document names to template names.
+#html_sidebars = {}
+
+# Additional templates that should be rendered to pages, maps page names to
+# template names.
+#html_additional_pages = {}
+
+# If false, no module index is generated.
+#html_domain_indices = True
+
+# If false, no index is generated.
+#html_use_index = True
+
+# If true, the index is split into individual pages for each letter.
+#html_split_index = False
+
+# If true, links to the reST sources are added to the pages.
+#html_show_sourcelink = True
+
+# If true, "Created using Sphinx" is shown in the HTML footer. Default is True.
+#html_show_sphinx = True
+
+# If true, "(C) Copyright ..." is shown in the HTML footer. Default is True.
+#html_show_copyright = True
+
+# If true, an OpenSearch description file will be output, and all pages will
+# contain a <link> tag referring to it. The value of this option must be the
+# base URL from which the finished HTML is served.
+#html_use_opensearch = ''
+
+# This is the file name suffix for HTML files (e.g. ".xhtml").
+#html_file_suffix = None
+
+# Output file base name for HTML help builder.
+htmlhelp_basename = 'Janssondoc'
+
+
+# -- Options for LaTeX output --------------------------------------------------
+
+# The paper size ('letter' or 'a4').
+#latex_paper_size = 'letter'
+
+# The font size ('10pt', '11pt' or '12pt').
+#latex_font_size = '10pt'
+
+# Grouping the document tree into LaTeX files. List of tuples
+# (source start file, target name, title, author, documentclass [howto/manual]).
+latex_documents = [
+ ('index', 'Jansson.tex', u'Jansson Documentation',
+ u'Petri Lehtinen', 'manual'),
+]
+
+# The name of an image file (relative to this directory) to place at the top of
+# the title page.
+#latex_logo = None
+
+# For "manual" documents, if this is true, then toplevel headings are parts,
+# not chapters.
+#latex_use_parts = False
+
+# If true, show page references after internal links.
+#latex_show_pagerefs = False
+
+# If true, show URL addresses after external links.
+#latex_show_urls = False
+
+# Additional stuff for the LaTeX preamble.
+#latex_preamble = ''
+
+# Documents to append as an appendix to all manuals.
+#latex_appendices = []
+
+# If false, no module index is generated.
+#latex_domain_indices = True
+
+
+# -- Options for manual page output --------------------------------------------
+
+# One entry per manual page. List of tuples
+# (source start file, name, description, authors, manual section).
+man_pages = [
+ ('index', 'jansson', u'Jansson Documentation',
+ [u'Petri Lehtinen'], 1)
+]
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/conformance.rst b/src/fluent-bit/lib/jansson-e23f558/doc/conformance.rst
new file mode 100644
index 000000000..5556a6b81
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/conformance.rst
@@ -0,0 +1,119 @@
+.. _rfc-conformance:
+
+***************
+RFC Conformance
+***************
+
+JSON is specified in :rfc:`4627`, *"The application/json Media Type
+for JavaScript Object Notation (JSON)"*.
+
+Character Encoding
+==================
+
+Jansson only supports UTF-8 encoded JSON texts. It does not support or
+auto-detect any of the other encodings mentioned in the RFC, namely
+UTF-16LE, UTF-16BE, UTF-32LE or UTF-32BE. Pure ASCII is supported, as
+it's a subset of UTF-8.
+
+Strings
+=======
+
+JSON strings are mapped to C-style null-terminated character arrays,
+and UTF-8 encoding is used internally.
+
+All Unicode codepoints U+0000 through U+10FFFF are allowed in string
+values. However, U+0000 is allowed in object keys only for length-aware functions.
+
+Unicode normalization or any other transformation is never performed
+on any strings (string values or object keys). When checking for
+equivalence of strings or object keys, the comparison is performed
+byte by byte between the original UTF-8 representations of the
+strings.
+
+Numbers
+=======
+
+.. _real-vs-integer:
+
+Real vs. Integer
+----------------
+
+JSON makes no distinction between real and integer numbers; Jansson
+does. Real numbers are mapped to the ``double`` type and integers to
+the ``json_int_t`` type, which is a typedef of ``long long`` or
+``long``, depending on whether ``long long`` is supported by your
+compiler or not.
+
+A JSON number is considered to be a real number if its lexical
+representation includes one of ``e``, ``E``, or ``.``; regardless if
+its actual numeric value is a true integer (e.g., all of ``1E6``,
+``3.0``, ``400E-2``, and ``3.14E3`` are mathematical integers, but
+will be treated as real values). With the ``JSON_DECODE_INT_AS_REAL``
+decoder flag set all numbers are interpreted as real.
+
+All other JSON numbers are considered integers.
+
+When encoding to JSON, real values are always represented
+with a fractional part; e.g., the ``double`` value 3.0 will be
+represented in JSON as ``3.0``, not ``3``.
+
+Overflow, Underflow & Precision
+-------------------------------
+
+Real numbers whose absolute values are too small to be represented in
+a C ``double`` will be silently estimated with 0.0. Thus, depending on
+platform, JSON numbers very close to zero such as 1E-999 may result in
+0.0.
+
+Real numbers whose absolute values are too large to be represented in
+a C ``double`` will result in an overflow error (a JSON decoding
+error). Thus, depending on platform, JSON numbers like 1E+999 or
+-1E+999 may result in a parsing error.
+
+Likewise, integer numbers whose absolute values are too large to be
+represented in the ``json_int_t`` type (see above) will result in an
+overflow error (a JSON decoding error). Thus, depending on platform,
+JSON numbers like 1000000000000000 may result in parsing error.
+
+Parsing JSON real numbers may result in a loss of precision. As long
+as overflow does not occur (i.e. a total loss of precision), the
+rounded approximate value is silently used. Thus the JSON number
+1.000000000000000005 may, depending on platform, result in the
+``double`` value 1.0.
+
+Signed zeros
+------------
+
+JSON makes no statement about what a number means; however Javascript
+(ECMAscript) does state that +0.0 and -0.0 must be treated as being
+distinct values, i.e. -0.0 |not-equal| 0.0. Jansson relies on the
+underlying floating point library in the C environment in which it is
+compiled. Therefore it is platform-dependent whether 0.0 and -0.0 will
+be distinct values. Most platforms that use the IEEE 754
+floating-point standard will support signed zeros.
+
+Note that this only applies to floating-point; neither JSON, C, or
+IEEE support the concept of signed integer zeros.
+
+.. |not-equal| unicode:: U+2260
+
+Types
+-----
+
+No support is provided in Jansson for any C numeric types other than
+``json_int_t`` and ``double``. This excludes things such as unsigned
+types, ``long double``, etc. Obviously, shorter types like ``short``,
+``int``, ``long`` (if ``json_int_t`` is ``long long``) and ``float``
+are implicitly handled via the ordinary C type coercion rules (subject
+to overflow semantics). Also, no support or hooks are provided for any
+supplemental "bignum" type add-on packages.
+
+Depth of nested values
+======================
+
+To avoid stack exhaustion, Jansson currently limits the nesting depth
+for arrays and objects to a certain value (default: 2048), defined as
+a macro ``JSON_PARSER_MAX_DEPTH`` within ``jansson_config.h``.
+
+The limit is allowed to be set by the RFC; there is no recommended value
+or required minimum depth to be supported.
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/ext/refcounting.py b/src/fluent-bit/lib/jansson-e23f558/doc/ext/refcounting.py
new file mode 100644
index 000000000..e72c481c5
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/ext/refcounting.py
@@ -0,0 +1,69 @@
+"""
+ refcounting
+ ~~~~~~~~~~~
+
+ Reference count annotations for C API functions. Has the same
+ result as the sphinx.ext.refcounting extension but works for all
+ functions regardless of the signature, and the reference counting
+ information is written inline with the documentation instead of a
+ separate file.
+
+ Adds a new directive "refcounting". The directive has no content
+ and one required positional parameter:: "new" or "borrow".
+
+ Example:
+
+ .. cfunction:: json_t *json_object(void)
+
+ .. refcounting:: new
+
+ <description of the json_object function>
+
+ :copyright: Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ :license: MIT, see LICENSE for details.
+"""
+
+from docutils import nodes
+from docutils.parsers.rst import Directive
+
+
+def visit(self, node):
+ self.visit_emphasis(node)
+
+def depart(self, node):
+ self.depart_emphasis(node)
+
+def html_visit(self, node):
+ self.body.append(self.starttag(node, 'em', '', CLASS='refcount'))
+
+def html_depart(self, node):
+ self.body.append('</em>')
+
+
+class refcounting(nodes.emphasis):
+ pass
+
+class refcounting_directive(Directive):
+ has_content = False
+ required_arguments = 1
+ optional_arguments = 0
+ final_argument_whitespace = False
+
+ def run(self):
+ if self.arguments[0] == 'borrow':
+ text = 'Return value: Borrowed reference.'
+ elif self.arguments[0] == 'new':
+ text = 'Return value: New reference.'
+ else:
+ raise Error('Valid arguments: new, borrow')
+
+ return [refcounting(text, text)]
+
+
+def setup(app):
+ app.add_node(refcounting,
+ html=(html_visit, html_depart),
+ latex=(visit, depart),
+ text=(visit, depart),
+ man=(visit, depart))
+ app.add_directive('refcounting', refcounting_directive)
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/gettingstarted.rst b/src/fluent-bit/lib/jansson-e23f558/doc/gettingstarted.rst
new file mode 100644
index 000000000..4cd19773d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/gettingstarted.rst
@@ -0,0 +1,264 @@
+***************
+Getting Started
+***************
+
+.. highlight:: c
+
+Compiling and Installing Jansson
+================================
+
+The Jansson source is available at
+http://www.digip.org/jansson/releases/.
+
+Unix-like systems (including MinGW)
+-----------------------------------
+
+Unpack the source tarball and change to the source directory:
+
+.. parsed-literal::
+
+ bunzip2 -c jansson-|release|.tar.bz2 | tar xf -
+ cd jansson-|release|
+
+The source uses GNU Autotools (autoconf_, automake_, libtool_), so
+compiling and installing is extremely simple::
+
+ ./configure
+ make
+ make check
+ make install
+
+To change the destination directory (``/usr/local`` by default), use
+the ``--prefix=DIR`` argument to ``./configure``. See ``./configure
+--help`` for the list of all possible configuration options.
+
+The command ``make check`` runs the test suite distributed with
+Jansson. This step is not strictly necessary, but it may find possible
+problems that Jansson has on your platform. If any problems are found,
+please report them.
+
+If you obtained the source from a Git repository (or any other source
+control system), there's no ``./configure`` script as it's not kept in
+version control. To create the script, the build system needs to be
+bootstrapped. There are many ways to do this, but the easiest one is
+to use ``autoreconf``::
+
+ autoreconf -fi
+
+This command creates the ``./configure`` script, which can then be
+used as described above.
+
+.. _autoconf: http://www.gnu.org/software/autoconf/
+.. _automake: http://www.gnu.org/software/automake/
+.. _libtool: http://www.gnu.org/software/libtool/
+
+
+.. _build-cmake:
+
+CMake (various platforms, including Windows)
+--------------------------------------------
+
+Jansson can be built using CMake_. Create a build directory for an
+out-of-tree build, change to that directory, and run ``cmake`` (or ``ccmake``,
+``cmake-gui``, or similar) to configure the project.
+
+See the examples below for more detailed information.
+
+.. note:: In the below examples ``..`` is used as an argument for ``cmake``.
+ This is simply the path to the jansson project root directory.
+ In the example it is assumed you've created a sub-directory ``build``
+ and are using that. You could use any path you want.
+
+.. _build-cmake-unix:
+
+Unix (Make files)
+^^^^^^^^^^^^^^^^^
+Generating make files on unix:
+
+.. parsed-literal::
+
+ bunzip2 -c jansson-|release|.tar.bz2 | tar xf -
+ cd jansson-|release|
+
+ mkdir build
+ cd build
+ cmake .. # or ccmake .. for a GUI.
+
+.. note::
+
+ If you don't want to build docs or ``Sphinx`` is not installed, you should add ``"-DJANSSON_BUILD_DOCS=OFF"`` in the ``cmake`` command.
+
+
+Then to build::
+
+ make
+ make check
+ make install
+
+Windows (Visual Studio)
+^^^^^^^^^^^^^^^^^^^^^^^
+Creating Visual Studio project files from the command line:
+
+.. parsed-literal::
+
+ <unpack>
+ cd jansson-|release|
+
+ md build
+ cd build
+ cmake -G "Visual Studio 15 2017" ..
+
+.. note::
+
+ You should replace the name of the generator (``-G`` flag) matching
+ the Visual Studio version installed on your system. Currently, the
+ following versions are supported:
+
+ - ``Visual Studio 9 2008``
+ - ``Visual Studio 10 2010``
+ - ``Visual Studio 11 2012``
+ - ``Visual Studio 12 2013``
+ - ``Visual Studio 14 2015``
+ - ``Visual Studio 15 2017``
+ - ``Visual Studio 16 2019``
+
+ Any later version should also work.
+
+You will now have a *Visual Studio Solution* in your build directory.
+To run the unit tests build the ``RUN_TESTS`` project.
+
+If you prefer a GUI the ``cmake`` line in the above example can
+be replaced with::
+
+ cmake-gui ..
+
+For command line help (including a list of available generators)
+for CMake_ simply run::
+
+ cmake
+
+To list available CMake_ settings (and what they are currently set to)
+for the project, run::
+
+ cmake -LH ..
+
+Windows (MinGW)
+^^^^^^^^^^^^^^^
+If you prefer using MinGW on Windows, make sure MinGW installed and ``{MinGW}/bin`` has been added to ``PATH``, then do the following commands:
+
+.. parsed-literal::
+
+ <unpack>
+ cd jansson-|release|
+
+ md build
+ cd build
+ cmake -G "MinGW Makefiles" ..
+ mingw32-make
+
+
+Mac OSX (Xcode)
+^^^^^^^^^^^^^^^
+If you prefer using Xcode instead of make files on OSX,
+do the following. (Use the same steps as
+for :ref:`Unix <build-cmake-unix>`)::
+
+ ...
+ cmake -G "Xcode" ..
+
+Additional CMake settings
+^^^^^^^^^^^^^^^^^^^^^^^^^
+
+Shared library
+""""""""""""""
+By default the CMake_ project will generate build files for building the
+static library. To build the shared version use::
+
+ ...
+ cmake -DJANSSON_BUILD_SHARED_LIBS=1 ..
+
+Changing install directory (same as autoconf --prefix)
+""""""""""""""""""""""""""""""""""""""""""""""""""""""
+Just as with the autoconf_ project you can change the destination directory
+for ``make install``. The equivalent for autoconfs ``./configure --prefix``
+in CMake_ is::
+
+ ...
+ cmake -DCMAKE_INSTALL_PREFIX:PATH=/some/other/path ..
+ make install
+
+.. _CMake: http://www.cmake.org
+
+
+Android
+-------
+
+Jansson can be built for Android platforms. Android.mk is in the
+source root directory. The configuration header file is located in the
+``android`` directory in the source distribution.
+
+
+Other Systems
+-------------
+
+On non Unix-like systems, you may be unable to run the ``./configure``
+script. In this case, follow these steps. All the files mentioned can
+be found in the ``src/`` directory.
+
+1. Create ``jansson_config.h`` (which has some platform-specific
+ parameters that are normally filled in by the ``./configure``
+ script). Edit ``jansson_config.h.in``, replacing all ``@variable@``
+ placeholders, and rename the file to ``jansson_config.h``.
+
+2. Make ``jansson.h`` and ``jansson_config.h`` available to the
+ compiler, so that they can be found when compiling programs that
+ use Jansson.
+
+3. Compile all the ``.c`` files (in the ``src/`` directory) into a
+ library file. Make the library available to the compiler, as in
+ step 2.
+
+
+Building the Documentation
+--------------------------
+
+(This subsection describes how to build the HTML documentation you are
+currently reading, so it can be safely skipped.)
+
+Documentation is in the ``doc/`` subdirectory. It's written in
+reStructuredText_ with Sphinx_ annotations. To generate the HTML
+documentation, invoke::
+
+ make html
+
+and point your browser to ``doc/_build/html/index.html``. Sphinx_ 1.0
+or newer is required to generate the documentation.
+
+.. _reStructuredText: http://docutils.sourceforge.net/rst.html
+.. _Sphinx: http://sphinx.pocoo.org/
+
+
+Compiling Programs that Use Jansson
+===================================
+
+Jansson involves one C header file, :file:`jansson.h`, so it's enough
+to put the line
+
+::
+
+ #include <jansson.h>
+
+in the beginning of every source file that uses Jansson.
+
+There's also just one library to link with, ``libjansson``. Compile and
+link the program as follows::
+
+ cc -o prog prog.c -ljansson
+
+Starting from version 1.2, there's also support for pkg-config_:
+
+.. code-block:: shell
+
+ cc -o prog prog.c `pkg-config --cflags --libs jansson`
+
+.. _pkg-config: http://pkg-config.freedesktop.org/
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/github_commits.c b/src/fluent-bit/lib/jansson-e23f558/doc/github_commits.c
new file mode 100644
index 000000000..81c806393
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/github_commits.c
@@ -0,0 +1,181 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <stdlib.h>
+#include <string.h>
+
+#include <curl/curl.h>
+#include <jansson.h>
+
+#define BUFFER_SIZE (256 * 1024) /* 256 KB */
+
+#define URL_FORMAT "https://api.github.com/repos/%s/%s/commits"
+#define URL_SIZE 256
+
+/* Return the offset of the first newline in text or the length of
+ text if there's no newline */
+static int newline_offset(const char *text) {
+ const char *newline = strchr(text, '\n');
+ if (!newline)
+ return strlen(text);
+ else
+ return (int)(newline - text);
+}
+
+struct write_result {
+ char *data;
+ int pos;
+};
+
+static size_t write_response(void *ptr, size_t size, size_t nmemb, void *stream) {
+ struct write_result *result = (struct write_result *)stream;
+
+ if (result->pos + size * nmemb >= BUFFER_SIZE - 1) {
+ fprintf(stderr, "error: too small buffer\n");
+ return 0;
+ }
+
+ memcpy(result->data + result->pos, ptr, size * nmemb);
+ result->pos += size * nmemb;
+
+ return size * nmemb;
+}
+
+static char *request(const char *url) {
+ CURL *curl = NULL;
+ CURLcode status;
+ struct curl_slist *headers = NULL;
+ char *data = NULL;
+ long code;
+
+ curl_global_init(CURL_GLOBAL_ALL);
+ curl = curl_easy_init();
+ if (!curl)
+ goto error;
+
+ data = malloc(BUFFER_SIZE);
+ if (!data)
+ goto error;
+
+ struct write_result write_result = {.data = data, .pos = 0};
+
+ curl_easy_setopt(curl, CURLOPT_URL, url);
+
+ /* GitHub commits API v3 requires a User-Agent header */
+ headers = curl_slist_append(headers, "User-Agent: Jansson-Tutorial");
+ curl_easy_setopt(curl, CURLOPT_HTTPHEADER, headers);
+
+ curl_easy_setopt(curl, CURLOPT_WRITEFUNCTION, write_response);
+ curl_easy_setopt(curl, CURLOPT_WRITEDATA, &write_result);
+
+ status = curl_easy_perform(curl);
+ if (status != 0) {
+ fprintf(stderr, "error: unable to request data from %s:\n", url);
+ fprintf(stderr, "%s\n", curl_easy_strerror(status));
+ goto error;
+ }
+
+ curl_easy_getinfo(curl, CURLINFO_RESPONSE_CODE, &code);
+ if (code != 200) {
+ fprintf(stderr, "error: server responded with code %ld\n", code);
+ goto error;
+ }
+
+ curl_easy_cleanup(curl);
+ curl_slist_free_all(headers);
+ curl_global_cleanup();
+
+ /* zero-terminate the result */
+ data[write_result.pos] = '\0';
+
+ return data;
+
+error:
+ if (data)
+ free(data);
+ if (curl)
+ curl_easy_cleanup(curl);
+ if (headers)
+ curl_slist_free_all(headers);
+ curl_global_cleanup();
+ return NULL;
+}
+
+int main(int argc, char *argv[]) {
+ size_t i;
+ char *text;
+ char url[URL_SIZE];
+
+ json_t *root;
+ json_error_t error;
+
+ if (argc != 3) {
+ fprintf(stderr, "usage: %s USER REPOSITORY\n\n", argv[0]);
+ fprintf(stderr, "List commits at USER's REPOSITORY.\n\n");
+ return 2;
+ }
+
+ snprintf(url, URL_SIZE, URL_FORMAT, argv[1], argv[2]);
+
+ text = request(url);
+ if (!text)
+ return 1;
+
+ root = json_loads(text, 0, &error);
+ free(text);
+
+ if (!root) {
+ fprintf(stderr, "error: on line %d: %s\n", error.line, error.text);
+ return 1;
+ }
+
+ if (!json_is_array(root)) {
+ fprintf(stderr, "error: root is not an array\n");
+ json_decref(root);
+ return 1;
+ }
+
+ for (i = 0; i < json_array_size(root); i++) {
+ json_t *data, *sha, *commit, *message;
+ const char *message_text;
+
+ data = json_array_get(root, i);
+ if (!json_is_object(data)) {
+ fprintf(stderr, "error: commit data %d is not an object\n", (int)(i + 1));
+ json_decref(root);
+ return 1;
+ }
+
+ sha = json_object_get(data, "sha");
+ if (!json_is_string(sha)) {
+ fprintf(stderr, "error: commit %d: sha is not a string\n", (int)(i + 1));
+ json_decref(root);
+ return 1;
+ }
+
+ commit = json_object_get(data, "commit");
+ if (!json_is_object(commit)) {
+ fprintf(stderr, "error: commit %d: commit is not an object\n", (int)(i + 1));
+ json_decref(root);
+ return 1;
+ }
+
+ message = json_object_get(commit, "message");
+ if (!json_is_string(message)) {
+ fprintf(stderr, "error: commit %d: message is not a string\n", (int)(i + 1));
+ json_decref(root);
+ return 1;
+ }
+
+ message_text = json_string_value(message);
+ printf("%.8s %.*s\n", json_string_value(sha), newline_offset(message_text),
+ message_text);
+ }
+
+ json_decref(root);
+ return 0;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/index.rst b/src/fluent-bit/lib/jansson-e23f558/doc/index.rst
new file mode 100644
index 000000000..c679f409b
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/index.rst
@@ -0,0 +1,53 @@
+Jansson Documentation
+=====================
+
+This is the documentation for Jansson_ |release|, last updated |today|.
+
+Introduction
+------------
+
+Jansson_ is a C library for encoding, decoding and manipulating JSON
+data. Its main features and design principles are:
+
+- Simple and intuitive API and data model
+
+- Comprehensive documentation
+
+- No dependencies on other libraries
+
+- Full Unicode support (UTF-8)
+
+- Extensive test suite
+
+Jansson is licensed under the `MIT license`_; see LICENSE in the
+source distribution for details.
+
+Jansson is used in production and its API is stable. It works on
+numerous platforms, including numerous Unix like systems and Windows.
+It's suitable for use on any system, including desktop, server, and
+small embedded systems.
+
+
+.. _`MIT license`: http://www.opensource.org/licenses/mit-license.php
+.. _Jansson: http://www.digip.org/jansson/
+
+Contents
+--------
+
+.. toctree::
+ :maxdepth: 2
+
+ gettingstarted
+ upgrading
+ tutorial
+ conformance
+ threadsafety
+ apiref
+ changes
+
+
+Indices and Tables
+==================
+
+* :ref:`genindex`
+* :ref:`search`
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/threadsafety.rst b/src/fluent-bit/lib/jansson-e23f558/doc/threadsafety.rst
new file mode 100644
index 000000000..0eebb29a9
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/threadsafety.rst
@@ -0,0 +1,82 @@
+.. _thread-safety:
+
+*************
+Thread safety
+*************
+
+Jansson as a library is thread safe and has no mutable global state.
+The only exceptions are the hash function seed and memory allocation
+functions, see below.
+
+There's no locking performed inside Jansson's code. **Read-only**
+access to JSON values shared by multiple threads is safe, but
+**mutating** a JSON value that's shared by multiple threads is not. A
+multithreaded program must perform its own locking if JSON values
+shared by multiple threads are mutated.
+
+However, **reference count manipulation** (:func:`json_incref()`,
+:func:`json_decref()`) is usually thread-safe, and can be performed on
+JSON values that are shared among threads. The thread-safety of
+reference counting can be checked with the
+``JANSSON_THREAD_SAFE_REFCOUNT`` preprocessor constant. Thread-safe
+reference count manipulation is achieved using compiler built-in
+atomic functions, which are available in most modern compilers.
+
+If compiler support is not available (``JANSSON_THREAD_SAFE_REFCOUNT``
+is not defined), it may be very difficult to ensure thread safety of
+reference counting. It's possible to have a reference to a value
+that's also stored inside an array or object in another thread.
+Modifying the container (adding or removing values) may trigger
+concurrent access to such values, as containers manage the reference
+count of their contained values.
+
+
+Hash function seed
+==================
+
+To prevent an attacker from intentionally causing large JSON objects
+with specially crafted keys to perform very slow, the hash function
+used by Jansson is randomized using a seed value. The seed is
+automatically generated on the first explicit or implicit call to
+:func:`json_object()`, if :func:`json_object_seed()` has not been
+called beforehand.
+
+The seed is generated by using operating system's entropy sources if
+they are available (``/dev/urandom``, ``CryptGenRandom()``). The
+initialization is done in as thread safe manner as possible, by using
+architecture specific lockless operations if provided by the platform
+or the compiler.
+
+If you're using threads, it's recommended to autoseed the hashtable
+explicitly before spawning any threads by calling
+``json_object_seed(0)`` , especially if you're unsure whether the
+initialization is thread safe on your platform.
+
+
+Memory allocation functions
+===========================
+
+Memory allocation functions should be set at most once, and only on
+program startup. See :ref:`apiref-custom-memory-allocation`.
+
+
+Locale
+======
+
+Jansson works fine under any locale.
+
+However, if the host program is multithreaded and uses ``setlocale()``
+to switch the locale in one thread while Jansson is currently encoding
+or decoding JSON data in another thread, the result may be wrong or
+the program may even crash.
+
+Jansson uses locale specific functions for certain string conversions
+in the encoder and decoder, and then converts the locale specific
+values to/from the JSON representation. This fails if the locale
+changes between the string conversion and the locale-to-JSON
+conversion. This can only happen in multithreaded programs that use
+``setlocale()``, because ``setlocale()`` switches the locale for all
+running threads, not only the thread that calls ``setlocale()``.
+
+If your program uses ``setlocale()`` as described above, consider
+using the thread-safe ``uselocale()`` instead.
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/tutorial.rst b/src/fluent-bit/lib/jansson-e23f558/doc/tutorial.rst
new file mode 100644
index 000000000..bb7a6c21c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/tutorial.rst
@@ -0,0 +1,288 @@
+.. _tutorial:
+
+********
+Tutorial
+********
+
+.. highlight:: c
+
+In this tutorial, we create a program that fetches the latest commits
+of a repository in GitHub_ over the web. `GitHub API`_ uses JSON, so
+the result can be parsed using Jansson.
+
+To stick to the scope of this tutorial, we will only cover the
+parts of the program related to handling JSON data. For the best user
+experience, the full source code is available:
+:download:`github_commits.c`. To compile it (on Unix-like systems with
+gcc), use the following command::
+
+ gcc -o github_commits github_commits.c -ljansson -lcurl
+
+libcurl_ is used to communicate over the web, so it is required to
+compile the program.
+
+The command line syntax is::
+
+ github_commits USER REPOSITORY
+
+``USER`` is a GitHub user ID and ``REPOSITORY`` is the repository
+name. Please note that the GitHub API is rate limited, so if you run
+the program too many times within a short period of time, the sever
+starts to respond with an error.
+
+.. _GitHub: https://github.com/
+.. _GitHub API: http://developer.github.com/
+.. _libcurl: http://curl.haxx.se/
+
+
+.. _tutorial-github-commits-api:
+
+The GitHub Repo Commits API
+===========================
+
+The `GitHub Repo Commits API`_ is used by sending HTTP requests to
+URLs like ``https://api.github.com/repos/USER/REPOSITORY/commits``,
+where ``USER`` and ``REPOSITORY`` are the GitHub user ID and the name
+of the repository whose commits are to be listed, respectively.
+
+GitHub responds with a JSON array of the following form:
+
+.. code-block:: none
+
+ [
+ {
+ "sha": "<the commit ID>",
+ "commit": {
+ "message": "<the commit message>",
+ <more fields, not important to this tutorial...>
+ },
+ <more fields...>
+ },
+ {
+ "sha": "<the commit ID>",
+ "commit": {
+ "message": "<the commit message>",
+ <more fields...>
+ },
+ <more fields...>
+ },
+ <more commits...>
+ ]
+
+In our program, the HTTP request is sent using the following
+function::
+
+ static char *request(const char *url);
+
+It takes the URL as a parameter, performs a HTTP GET request, and
+returns a newly allocated string that contains the response body. If
+the request fails, an error message is printed to stderr and the
+return value is *NULL*. For full details, refer to :download:`the code
+<github_commits.c>`, as the actual implementation is not important
+here.
+
+.. _GitHub Repo Commits API: http://developer.github.com/v3/repos/commits/
+
+.. _tutorial-the-program:
+
+The Program
+===========
+
+First the includes::
+
+ #include <string.h>
+ #include <jansson.h>
+
+Like all the programs using Jansson, we need to include
+:file:`jansson.h`.
+
+The following definitions are used to build the GitHub API request
+URL::
+
+ #define URL_FORMAT "https://api.github.com/repos/%s/%s/commits"
+ #define URL_SIZE 256
+
+The following function is used when formatting the result to find the
+first newline in the commit message::
+
+ /* Return the offset of the first newline in text or the length of
+ text if there's no newline */
+ static int newline_offset(const char *text)
+ {
+ const char *newline = strchr(text, '\n');
+ if(!newline)
+ return strlen(text);
+ else
+ return (int)(newline - text);
+ }
+
+The main function follows. In the beginning, we first declare a bunch
+of variables and check the command line parameters::
+
+ int main(int argc, char *argv[])
+ {
+ size_t i;
+ char *text;
+ char url[URL_SIZE];
+
+ json_t *root;
+ json_error_t error;
+
+ if(argc != 3)
+ {
+ fprintf(stderr, "usage: %s USER REPOSITORY\n\n", argv[0]);
+ fprintf(stderr, "List commits at USER's REPOSITORY.\n\n");
+ return 2;
+ }
+
+Then we build the request URL using the user and repository names
+given as command line parameters::
+
+ snprintf(url, URL_SIZE, URL_FORMAT, argv[1], argv[2]);
+
+This uses the ``URL_SIZE`` and ``URL_FORMAT`` constants defined above.
+Now we're ready to actually request the JSON data over the web::
+
+ text = request(url);
+ if(!text)
+ return 1;
+
+If an error occurs, our function ``request`` prints the error and
+returns *NULL*, so it's enough to just return 1 from the main
+function.
+
+Next we'll call :func:`json_loads()` to decode the JSON text we got
+as a response::
+
+ root = json_loads(text, 0, &error);
+ free(text);
+
+ if(!root)
+ {
+ fprintf(stderr, "error: on line %d: %s\n", error.line, error.text);
+ return 1;
+ }
+
+We don't need the JSON text anymore, so we can free the ``text``
+variable right after decoding it. If :func:`json_loads()` fails, it
+returns *NULL* and sets error information to the :type:`json_error_t`
+structure given as the second parameter. In this case, our program
+prints the error information out and returns 1 from the main function.
+
+Now we're ready to extract the data out of the decoded JSON response.
+The structure of the response JSON was explained in section
+:ref:`tutorial-github-commits-api`.
+
+We check that the returned value really is an array::
+
+ if(!json_is_array(root))
+ {
+ fprintf(stderr, "error: root is not an array\n");
+ json_decref(root);
+ return 1;
+ }
+
+Then we proceed to loop over all the commits in the array::
+
+ for(i = 0; i < json_array_size(root); i++)
+ {
+ json_t *data, *sha, *commit, *message;
+ const char *message_text;
+
+ data = json_array_get(root, i);
+ if(!json_is_object(data))
+ {
+ fprintf(stderr, "error: commit data %d is not an object\n", i + 1);
+ json_decref(root);
+ return 1;
+ }
+ ...
+
+The function :func:`json_array_size()` returns the size of a JSON
+array. First, we again declare some variables and then extract the
+i'th element of the ``root`` array using :func:`json_array_get()`.
+We also check that the resulting value is a JSON object.
+
+Next we'll extract the commit ID (a hexadecimal SHA-1 sum),
+intermediate commit info object, and the commit message from that
+object. We also do proper type checks::
+
+ sha = json_object_get(data, "sha");
+ if(!json_is_string(sha))
+ {
+ fprintf(stderr, "error: commit %d: sha is not a string\n", i + 1);
+ json_decref(root);
+ return 1;
+ }
+
+ commit = json_object_get(data, "commit");
+ if(!json_is_object(commit))
+ {
+ fprintf(stderr, "error: commit %d: commit is not an object\n", i + 1);
+ json_decref(root);
+ return 1;
+ }
+
+ message = json_object_get(commit, "message");
+ if(!json_is_string(message))
+ {
+ fprintf(stderr, "error: commit %d: message is not a string\n", i + 1);
+ json_decref(root);
+ return 1;
+ }
+ ...
+
+And finally, we'll print the first 8 characters of the commit ID and
+the first line of the commit message. A C-style string is extracted
+from a JSON string using :func:`json_string_value()`::
+
+ message_text = json_string_value(message);
+ printf("%.8s %.*s\n",
+ json_string_value(sha),
+ newline_offset(message_text),
+ message_text);
+ }
+
+After sending the HTTP request, we decoded the JSON text using
+:func:`json_loads()`, remember? It returns a *new reference* to the
+JSON value it decodes. When we're finished with the value, we'll need
+to decrease the reference count using :func:`json_decref()`. This way
+Jansson can release the resources::
+
+ json_decref(root);
+ return 0;
+
+For a detailed explanation of reference counting in Jansson, see
+:ref:`apiref-reference-count` in :ref:`apiref`.
+
+The program's ready, let's test it and view the latest commits in
+Jansson's repository:
+
+.. code-block:: shell
+
+ $ ./github_commits akheron jansson
+ 1581f26a Merge branch '2.3'
+ aabfd493 load: Change buffer_pos to be a size_t
+ bd72efbd load: Avoid unexpected behaviour in macro expansion
+ e8fd3e30 Document and tweak json_load_callback()
+ 873eddaf Merge pull request #60 from rogerz/contrib
+ bd2c0c73 Ignore the binary test_load_callback
+ 17a51a4b Merge branch '2.3'
+ 09c39adc Add json_load_callback to the list of exported symbols
+ cbb80baf Merge pull request #57 from rogerz/contrib
+ 040bd7b0 Add json_load_callback()
+ 2637faa4 Make test stripping locale independent
+ <...>
+
+
+Conclusion
+==========
+
+In this tutorial, we implemented a program that fetches the latest
+commits of a GitHub repository using the GitHub Repo Commits API.
+Jansson was used to decode the JSON response and to extract the commit
+data.
+
+This tutorial only covered a small part of Jansson. For example, we
+did not create or manipulate JSON values at all. Proceed to
+:ref:`apiref` to explore all features of Jansson.
diff --git a/src/fluent-bit/lib/jansson-e23f558/doc/upgrading.rst b/src/fluent-bit/lib/jansson-e23f558/doc/upgrading.rst
new file mode 100644
index 000000000..94ff7de3c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/doc/upgrading.rst
@@ -0,0 +1,76 @@
+.. highlight:: c
+
+******************
+Upgrading from 1.x
+******************
+
+This chapter lists the backwards incompatible changes introduced in
+Jansson 2.0, and the steps that are needed for upgrading your code.
+
+**The incompatibilities are not dramatic.** The biggest change is that
+all decoding functions now require and extra parameter. Most programs
+can be modified to work with 2.0 by adding a ``0`` as the second
+parameter to all calls of :func:`json_loads()`, :func:`json_loadf()`
+and :func:`json_load_file()`.
+
+
+Compatibility
+=============
+
+Jansson 2.0 is backwards incompatible with the Jansson 1.x releases.
+It is ABI incompatible, i.e. all programs dynamically linking to the
+Jansson library need to be recompiled. It's also API incompatible,
+i.e. the source code of programs using Jansson 1.x may need
+modifications to make them compile against Jansson 2.0.
+
+All the 2.x releases are guaranteed to be backwards compatible for
+both ABI and API, so no recompilation or source changes are needed
+when upgrading from 2.x to 2.y.
+
+
+List of Incompatible Changes
+============================
+
+**Decoding flags**
+ For future needs, a ``flags`` parameter was added as the second
+ parameter to all decoding functions, i.e. :func:`json_loads()`,
+ :func:`json_loadf()` and :func:`json_load_file()`. All calls to
+ these functions need to be changed by adding a ``0`` as the second
+ argument. For example::
+
+ /* old code */
+ json_loads(input, &error);
+
+ /* new code */
+ json_loads(input, 0, &error);
+
+
+**Underlying type of JSON integers**
+ The underlying C type of JSON integers has been changed from
+ ``int`` to the widest available signed integer type, i.e.
+ ``long long`` or ``long``, depending on whether
+ ``long long`` is supported on your system or not. This makes
+ the whole 64-bit integer range available on most modern systems.
+
+ ``jansson.h`` has a typedef :type:`json_int_t` to the underlying
+ integer type. ``int`` should still be used in most cases when
+ dealing with smallish JSON integers, as the compiler handles
+ implicit type coercion. Only when the full 64-bit range is needed,
+ :type:`json_int_t` should be explicitly used.
+
+
+**Maximum encoder indentation depth**
+ The maximum argument of the ``JSON_INDENT()`` macro has been
+ changed from 255 to 31, to free up bits from the ``flags``
+ parameter of :func:`json_dumps()`, :func:`json_dumpf()` and
+ :func:`json_dump_file()`. If your code uses a bigger indentation
+ than 31, it needs to be changed.
+
+
+**Unsigned integers in API functions**
+ Version 2.0 unifies unsigned integer usage in the API. All uses of
+ ``unsigned int`` and ``unsigned long`` have been replaced
+ with ``size_t``. This includes flags, container sizes, etc.
+ This should not require source code changes, as both
+ ``unsigned int`` and ``unsigned long`` are usually
+ compatible with ``size_t``.
diff --git a/src/fluent-bit/lib/jansson-e23f558/examples/README.rst b/src/fluent-bit/lib/jansson-e23f558/examples/README.rst
new file mode 100644
index 000000000..a7c5274db
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/examples/README.rst
@@ -0,0 +1,4 @@
+Jansson examples
+================
+
+This directory contains simple example programs that use Jansson.
diff --git a/src/fluent-bit/lib/jansson-e23f558/examples/simple_parse.c b/src/fluent-bit/lib/jansson-e23f558/examples/simple_parse.c
new file mode 100644
index 000000000..a96a0f831
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/examples/simple_parse.c
@@ -0,0 +1,200 @@
+/*
+ * Simple example of parsing and printing JSON using jansson.
+ *
+ * SYNOPSIS:
+ * $ examples/simple_parse
+ * Type some JSON > [true, false, null, 1, 0.0, -0.0, "", {"name": "barney"}]
+ * JSON Array of 8 elements:
+ * JSON True
+ * JSON False
+ * JSON Null
+ * JSON Integer: "1"
+ * JSON Real: 0.000000
+ * JSON Real: -0.000000
+ * JSON String: ""
+ * JSON Object of 1 pair:
+ * JSON Key: "name"
+ * JSON String: "barney"
+ *
+ * Copyright (c) 2014 Robert Poor <rdpoor@gmail.com>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <jansson.h>
+#include <stdio.h>
+#include <stdlib.h>
+
+/* forward refs */
+void print_json(json_t *root);
+void print_json_aux(json_t *element, int indent);
+void print_json_indent(int indent);
+const char *json_plural(size_t count);
+void print_json_object(json_t *element, int indent);
+void print_json_array(json_t *element, int indent);
+void print_json_string(json_t *element, int indent);
+void print_json_integer(json_t *element, int indent);
+void print_json_real(json_t *element, int indent);
+void print_json_true(json_t *element, int indent);
+void print_json_false(json_t *element, int indent);
+void print_json_null(json_t *element, int indent);
+
+void print_json(json_t *root) { print_json_aux(root, 0); }
+
+void print_json_aux(json_t *element, int indent) {
+ switch (json_typeof(element)) {
+ case JSON_OBJECT:
+ print_json_object(element, indent);
+ break;
+ case JSON_ARRAY:
+ print_json_array(element, indent);
+ break;
+ case JSON_STRING:
+ print_json_string(element, indent);
+ break;
+ case JSON_INTEGER:
+ print_json_integer(element, indent);
+ break;
+ case JSON_REAL:
+ print_json_real(element, indent);
+ break;
+ case JSON_TRUE:
+ print_json_true(element, indent);
+ break;
+ case JSON_FALSE:
+ print_json_false(element, indent);
+ break;
+ case JSON_NULL:
+ print_json_null(element, indent);
+ break;
+ default:
+ fprintf(stderr, "unrecognized JSON type %d\n", json_typeof(element));
+ }
+}
+
+void print_json_indent(int indent) {
+ int i;
+ for (i = 0; i < indent; i++) {
+ putchar(' ');
+ }
+}
+
+const char *json_plural(size_t count) { return count == 1 ? "" : "s"; }
+
+void print_json_object(json_t *element, int indent) {
+ size_t size;
+ const char *key;
+ json_t *value;
+
+ print_json_indent(indent);
+ size = json_object_size(element);
+
+ printf("JSON Object of %lld pair%s:\n", (long long)size, json_plural(size));
+ json_object_foreach(element, key, value) {
+ print_json_indent(indent + 2);
+ printf("JSON Key: \"%s\"\n", key);
+ print_json_aux(value, indent + 2);
+ }
+}
+
+void print_json_array(json_t *element, int indent) {
+ size_t i;
+ size_t size = json_array_size(element);
+ print_json_indent(indent);
+
+ printf("JSON Array of %lld element%s:\n", (long long)size, json_plural(size));
+ for (i = 0; i < size; i++) {
+ print_json_aux(json_array_get(element, i), indent + 2);
+ }
+}
+
+void print_json_string(json_t *element, int indent) {
+ print_json_indent(indent);
+ printf("JSON String: \"%s\"\n", json_string_value(element));
+}
+
+void print_json_integer(json_t *element, int indent) {
+ print_json_indent(indent);
+ printf("JSON Integer: \"%" JSON_INTEGER_FORMAT "\"\n", json_integer_value(element));
+}
+
+void print_json_real(json_t *element, int indent) {
+ print_json_indent(indent);
+ printf("JSON Real: %f\n", json_real_value(element));
+}
+
+void print_json_true(json_t *element, int indent) {
+ (void)element;
+ print_json_indent(indent);
+ printf("JSON True\n");
+}
+
+void print_json_false(json_t *element, int indent) {
+ (void)element;
+ print_json_indent(indent);
+ printf("JSON False\n");
+}
+
+void print_json_null(json_t *element, int indent) {
+ (void)element;
+ print_json_indent(indent);
+ printf("JSON Null\n");
+}
+
+/*
+ * Parse text into a JSON object. If text is valid JSON, returns a
+ * json_t structure, otherwise prints and error and returns null.
+ */
+json_t *load_json(const char *text) {
+ json_t *root;
+ json_error_t error;
+
+ root = json_loads(text, 0, &error);
+
+ if (root) {
+ return root;
+ } else {
+ fprintf(stderr, "json error on line %d: %s\n", error.line, error.text);
+ return (json_t *)0;
+ }
+}
+
+/*
+ * Print a prompt and return (by reference) a null-terminated line of
+ * text. Returns NULL on eof or some error.
+ */
+char *read_line(char *line, int max_chars) {
+ printf("Type some JSON > ");
+ fflush(stdout);
+ return fgets(line, max_chars, stdin);
+}
+
+/* ================================================================
+ * main
+ */
+
+#define MAX_CHARS 4096
+
+int main(int argc, char *argv[]) {
+ char line[MAX_CHARS];
+
+ if (argc != 1) {
+ fprintf(stderr, "Usage: %s\n", argv[0]);
+ exit(-1);
+ }
+
+ while (read_line(line, MAX_CHARS) != (char *)NULL) {
+
+ /* parse text into JSON structure */
+ json_t *root = load_json(line);
+
+ if (root) {
+ /* print and release the JSON structure */
+ print_json(root);
+ json_decref(root);
+ }
+ }
+
+ return 0;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/jansson.pc.in b/src/fluent-bit/lib/jansson-e23f558/jansson.pc.in
new file mode 100644
index 000000000..69c9a43ae
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/jansson.pc.in
@@ -0,0 +1,10 @@
+prefix=@prefix@
+exec_prefix=@exec_prefix@
+libdir=@libdir@
+includedir=@includedir@
+
+Name: Jansson
+Description: Library for encoding, decoding and manipulating JSON data
+Version: @VERSION@
+Libs: -L${libdir} -ljansson
+Cflags: -I${includedir}
diff --git a/src/fluent-bit/lib/jansson-e23f558/release.sh b/src/fluent-bit/lib/jansson-e23f558/release.sh
new file mode 100755
index 000000000..c2551f828
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/release.sh
@@ -0,0 +1,70 @@
+#!/bin/sh
+#
+# Use this script to easily make releases of Jansson. It configures
+# the source tree, and builds and signs all tarballs.
+
+die() {
+ echo $1 >&2
+ exit 1
+}
+
+confirm() {
+ local answer
+ read -p "$1 [yN]: " answer
+ [ "$answer" = "Y" -o "$answer" = "y" ] || exit 0
+}
+
+set -e
+[ -f configure.ac ] || die "Must be run at project root directory"
+
+# Determine version
+v=$(grep AC_INIT configure.ac | sed -r 's/.*, \[(.+?)\],.*/\1/')
+[ -n "$v" ] || die "Unable to determine version"
+confirm "Version is $v, proceed?"
+
+# Sanity checks
+vi=$(grep version-info src/Makefile.am | sed 's/^[ \t]*//g' | cut -d" " -f2)
+confirm "Libtool version-info is $vi, proceed?"
+
+r=$(grep 'Released ' CHANGES | head -n 1)
+confirm "Last CHANGES entry says \"$r\", proceed??"
+
+dv=$(grep ^version doc/conf.py | sed -r "s/.*'(.*)'.*/\1/")
+if [ "$dv" != "$v" ]; then
+ die "Documentation version ($dv) doesn't match library version"
+fi
+
+[ -f Makefile ] && make distclean || true
+rm -f jansson-$v.tar.*
+rm -rf jansson-$v-doc
+rm -f jansson-$v-doc.tar.*
+
+autoreconf -fi
+./configure
+
+# Run tests and make gz source tarball
+: ${VALGRIND:=1}
+export VALGRIND
+make distcheck
+
+# Make bzip2 source tarball
+make dist-bzip2
+
+# Sign source tarballs
+for s in gz bz2; do
+ gpg --detach-sign --armor jansson-$v.tar.$s
+done
+
+# Build documentation
+make html
+mv doc/_build/html jansson-$v-doc
+
+# Make and sign documentation tarballs
+for s in gz bz2; do
+ [ $s = gz ] && compress=gzip
+ [ $s = bz2 ] && compress=bzip2
+ tar cf - jansson-$v-doc | $compress -9 -c > jansson-$v-doc.tar.$s
+ gpg --detach-sign --armor jansson-$v-doc.tar.$s
+done
+
+echo "All done"
diff --git a/src/fluent-bit/lib/jansson-e23f558/scripts/clang-format b/src/fluent-bit/lib/jansson-e23f558/scripts/clang-format
new file mode 100755
index 000000000..d46056c94
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/scripts/clang-format
@@ -0,0 +1,3 @@
+#!/bin/bash
+
+find . -type f -a '(' -name '*.c' -o -name '*.h' ')' | xargs clang-format -i
diff --git a/src/fluent-bit/lib/jansson-e23f558/scripts/clang-format-check b/src/fluent-bit/lib/jansson-e23f558/scripts/clang-format-check
new file mode 100755
index 000000000..983e55d97
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/scripts/clang-format-check
@@ -0,0 +1,27 @@
+#!/bin/bash
+
+CLANG_FORMAT=${CLANG_FORMAT:-clang-format}
+CLANG_FORMAT_VERSION=${CLANG_FORMAT_VERSION:-}
+
+if ! type $CLANG_FORMAT >/dev/null || \
+ ! $CLANG_FORMAT --version | grep -q "version ${CLANG_FORMAT_VERSION}"; then
+ # If running tests, mark this test as skipped.
+ exit 77
+fi
+
+errors=0
+paths=$(git ls-files | grep '\.[ch]$')
+for path in $paths; do
+ in=$(cat $path)
+ out=$($CLANG_FORMAT $path)
+
+ if [ "$in" != "$out" ]; then
+ diff -u -L $path -L "$path.formatted" $path - <<<$out
+ errors=1
+ fi
+done
+
+if [ $errors -ne 0 ]; then
+ echo "Formatting errors detected, run ./scripts/clang-format to fix!"
+ exit 1
+fi
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/Makefile.am b/src/fluent-bit/lib/jansson-e23f558/src/Makefile.am
new file mode 100644
index 000000000..63eda3213
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/Makefile.am
@@ -0,0 +1,30 @@
+EXTRA_DIST = jansson.def
+
+include_HEADERS = jansson.h
+nodist_include_HEADERS = jansson_config.h
+
+lib_LTLIBRARIES = libjansson.la
+libjansson_la_SOURCES = \
+ dump.c \
+ error.c \
+ hashtable.c \
+ hashtable.h \
+ hashtable_seed.c \
+ jansson_private.h \
+ load.c \
+ lookup3.h \
+ memory.c \
+ pack_unpack.c \
+ strbuffer.c \
+ strbuffer.h \
+ strconv.c \
+ utf.c \
+ utf.h \
+ value.c \
+ version.c
+libjansson_la_LDFLAGS = \
+ -no-undefined \
+ -export-symbols-regex '^json_|^jansson_' \
+ -version-info 18:0:14 \
+ @JSON_SYMVER_LDFLAGS@ \
+ @JSON_BSYMBOLIC_LDFLAGS@
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/dump.c b/src/fluent-bit/lib/jansson-e23f558/src/dump.c
new file mode 100644
index 000000000..c0fb06e78
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/dump.c
@@ -0,0 +1,490 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#include "jansson_private.h"
+
+#include <assert.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#ifdef HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "jansson.h"
+#include "strbuffer.h"
+#include "utf.h"
+
+#define MAX_INTEGER_STR_LENGTH 100
+#define MAX_REAL_STR_LENGTH 100
+
+#define FLAGS_TO_INDENT(f) ((f)&0x1F)
+#define FLAGS_TO_PRECISION(f) (((f) >> 11) & 0x1F)
+
+struct buffer {
+ const size_t size;
+ size_t used;
+ char *data;
+};
+
+static int dump_to_strbuffer(const char *buffer, size_t size, void *data) {
+ return strbuffer_append_bytes((strbuffer_t *)data, buffer, size);
+}
+
+static int dump_to_buffer(const char *buffer, size_t size, void *data) {
+ struct buffer *buf = (struct buffer *)data;
+
+ if (buf->used + size <= buf->size)
+ memcpy(&buf->data[buf->used], buffer, size);
+
+ buf->used += size;
+ return 0;
+}
+
+static int dump_to_file(const char *buffer, size_t size, void *data) {
+ FILE *dest = (FILE *)data;
+ if (fwrite(buffer, size, 1, dest) != 1)
+ return -1;
+ return 0;
+}
+
+static int dump_to_fd(const char *buffer, size_t size, void *data) {
+#ifdef HAVE_UNISTD_H
+ int *dest = (int *)data;
+ if (write(*dest, buffer, size) == (ssize_t)size)
+ return 0;
+#endif
+ return -1;
+}
+
+/* 32 spaces (the maximum indentation size) */
+static const char whitespace[] = " ";
+
+static int dump_indent(size_t flags, int depth, int space, json_dump_callback_t dump,
+ void *data) {
+ if (FLAGS_TO_INDENT(flags) > 0) {
+ unsigned int ws_count = FLAGS_TO_INDENT(flags), n_spaces = depth * ws_count;
+
+ if (dump("\n", 1, data))
+ return -1;
+
+ while (n_spaces > 0) {
+ int cur_n =
+ n_spaces < sizeof whitespace - 1 ? n_spaces : sizeof whitespace - 1;
+
+ if (dump(whitespace, cur_n, data))
+ return -1;
+
+ n_spaces -= cur_n;
+ }
+ } else if (space && !(flags & JSON_COMPACT)) {
+ return dump(" ", 1, data);
+ }
+ return 0;
+}
+
+static int dump_string(const char *str, size_t len, json_dump_callback_t dump, void *data,
+ size_t flags) {
+ const char *pos, *end, *lim;
+ int32_t codepoint = 0;
+
+ if (dump("\"", 1, data))
+ return -1;
+
+ end = pos = str;
+ lim = str + len;
+ while (1) {
+ const char *text;
+ char seq[13];
+ int length;
+
+ while (end < lim) {
+ end = utf8_iterate(pos, lim - pos, &codepoint);
+ if (!end)
+ return -1;
+
+ /* mandatory escape or control char */
+ if (codepoint == '\\' || codepoint == '"' || codepoint < 0x20)
+ break;
+
+ /* slash */
+ if ((flags & JSON_ESCAPE_SLASH) && codepoint == '/')
+ break;
+
+ /* non-ASCII */
+ if ((flags & JSON_ENSURE_ASCII) && codepoint > 0x7F)
+ break;
+
+ pos = end;
+ }
+
+ if (pos != str) {
+ if (dump(str, pos - str, data))
+ return -1;
+ }
+
+ if (end == pos)
+ break;
+
+ /* handle \, /, ", and control codes */
+ length = 2;
+ switch (codepoint) {
+ case '\\':
+ text = "\\\\";
+ break;
+ case '\"':
+ text = "\\\"";
+ break;
+ case '\b':
+ text = "\\b";
+ break;
+ case '\f':
+ text = "\\f";
+ break;
+ case '\n':
+ text = "\\n";
+ break;
+ case '\r':
+ text = "\\r";
+ break;
+ case '\t':
+ text = "\\t";
+ break;
+ case '/':
+ text = "\\/";
+ break;
+ default: {
+ /* codepoint is in BMP */
+ if (codepoint < 0x10000) {
+ snprintf(seq, sizeof(seq), "\\u%04X", (unsigned int)codepoint);
+ length = 6;
+ }
+
+ /* not in BMP -> construct a UTF-16 surrogate pair */
+ else {
+ int32_t first, last;
+
+ codepoint -= 0x10000;
+ first = 0xD800 | ((codepoint & 0xffc00) >> 10);
+ last = 0xDC00 | (codepoint & 0x003ff);
+
+ snprintf(seq, sizeof(seq), "\\u%04X\\u%04X", (unsigned int)first,
+ (unsigned int)last);
+ length = 12;
+ }
+
+ text = seq;
+ break;
+ }
+ }
+
+ if (dump(text, length, data))
+ return -1;
+
+ str = pos = end;
+ }
+
+ return dump("\"", 1, data);
+}
+
+struct key_len {
+ const char *key;
+ int len;
+};
+
+static int compare_keys(const void *key1, const void *key2) {
+ const struct key_len *k1 = key1;
+ const struct key_len *k2 = key2;
+ const size_t min_size = k1->len < k2->len ? k1->len : k2->len;
+ int res = memcmp(k1->key, k2->key, min_size);
+
+ if (res)
+ return res;
+
+ return k1->len - k2->len;
+}
+
+static int do_dump(const json_t *json, size_t flags, int depth, hashtable_t *parents,
+ json_dump_callback_t dump, void *data) {
+ int embed = flags & JSON_EMBED;
+
+ flags &= ~JSON_EMBED;
+
+ if (!json)
+ return -1;
+
+ switch (json_typeof(json)) {
+ case JSON_NULL:
+ return dump("null", 4, data);
+
+ case JSON_TRUE:
+ return dump("true", 4, data);
+
+ case JSON_FALSE:
+ return dump("false", 5, data);
+
+ case JSON_INTEGER: {
+ char buffer[MAX_INTEGER_STR_LENGTH];
+ int size;
+
+ size = snprintf(buffer, MAX_INTEGER_STR_LENGTH, "%" JSON_INTEGER_FORMAT,
+ json_integer_value(json));
+ if (size < 0 || size >= MAX_INTEGER_STR_LENGTH)
+ return -1;
+
+ return dump(buffer, size, data);
+ }
+
+ case JSON_REAL: {
+ char buffer[MAX_REAL_STR_LENGTH];
+ int size;
+ double value = json_real_value(json);
+
+ size = jsonp_dtostr(buffer, MAX_REAL_STR_LENGTH, value,
+ FLAGS_TO_PRECISION(flags));
+ if (size < 0)
+ return -1;
+
+ return dump(buffer, size, data);
+ }
+
+ case JSON_STRING:
+ return dump_string(json_string_value(json), json_string_length(json), dump,
+ data, flags);
+
+ case JSON_ARRAY: {
+ size_t n;
+ size_t i;
+ /* Space for "0x", double the sizeof a pointer for the hex and a
+ * terminator. */
+ char key[2 + (sizeof(json) * 2) + 1];
+ size_t key_len;
+
+ /* detect circular references */
+ if (jsonp_loop_check(parents, json, key, sizeof(key), &key_len))
+ return -1;
+
+ n = json_array_size(json);
+
+ if (!embed && dump("[", 1, data))
+ return -1;
+ if (n == 0) {
+ hashtable_del(parents, key, key_len);
+ return embed ? 0 : dump("]", 1, data);
+ }
+ if (dump_indent(flags, depth + 1, 0, dump, data))
+ return -1;
+
+ for (i = 0; i < n; ++i) {
+ if (do_dump(json_array_get(json, i), flags, depth + 1, parents, dump,
+ data))
+ return -1;
+
+ if (i < n - 1) {
+ if (dump(",", 1, data) ||
+ dump_indent(flags, depth + 1, 1, dump, data))
+ return -1;
+ } else {
+ if (dump_indent(flags, depth, 0, dump, data))
+ return -1;
+ }
+ }
+
+ hashtable_del(parents, key, key_len);
+ return embed ? 0 : dump("]", 1, data);
+ }
+
+ case JSON_OBJECT: {
+ void *iter;
+ const char *separator;
+ int separator_length;
+ char loop_key[LOOP_KEY_LEN];
+ size_t loop_key_len;
+
+ if (flags & JSON_COMPACT) {
+ separator = ":";
+ separator_length = 1;
+ } else {
+ separator = ": ";
+ separator_length = 2;
+ }
+
+ /* detect circular references */
+ if (jsonp_loop_check(parents, json, loop_key, sizeof(loop_key),
+ &loop_key_len))
+ return -1;
+
+ iter = json_object_iter((json_t *)json);
+
+ if (!embed && dump("{", 1, data))
+ return -1;
+ if (!iter) {
+ hashtable_del(parents, loop_key, loop_key_len);
+ return embed ? 0 : dump("}", 1, data);
+ }
+ if (dump_indent(flags, depth + 1, 0, dump, data))
+ return -1;
+
+ if (flags & JSON_SORT_KEYS) {
+ struct key_len *keys;
+ size_t size, i;
+
+ size = json_object_size(json);
+ keys = jsonp_malloc(size * sizeof(struct key_len));
+ if (!keys)
+ return -1;
+
+ i = 0;
+ while (iter) {
+ struct key_len *keylen = &keys[i];
+
+ keylen->key = json_object_iter_key(iter);
+ keylen->len = json_object_iter_key_len(iter);
+
+ iter = json_object_iter_next((json_t *)json, iter);
+ i++;
+ }
+ assert(i == size);
+
+ qsort(keys, size, sizeof(struct key_len), compare_keys);
+
+ for (i = 0; i < size; i++) {
+ const struct key_len *key;
+ json_t *value;
+
+ key = &keys[i];
+ value = json_object_getn(json, key->key, key->len);
+ assert(value);
+
+ dump_string(key->key, key->len, dump, data, flags);
+ if (dump(separator, separator_length, data) ||
+ do_dump(value, flags, depth + 1, parents, dump, data)) {
+ jsonp_free(keys);
+ return -1;
+ }
+
+ if (i < size - 1) {
+ if (dump(",", 1, data) ||
+ dump_indent(flags, depth + 1, 1, dump, data)) {
+ jsonp_free(keys);
+ return -1;
+ }
+ } else {
+ if (dump_indent(flags, depth, 0, dump, data)) {
+ jsonp_free(keys);
+ return -1;
+ }
+ }
+ }
+
+ jsonp_free(keys);
+ } else {
+ /* Don't sort keys */
+
+ while (iter) {
+ void *next = json_object_iter_next((json_t *)json, iter);
+ const char *key = json_object_iter_key(iter);
+ const size_t key_len = json_object_iter_key_len(iter);
+
+ dump_string(key, key_len, dump, data, flags);
+ if (dump(separator, separator_length, data) ||
+ do_dump(json_object_iter_value(iter), flags, depth + 1, parents,
+ dump, data))
+ return -1;
+
+ if (next) {
+ if (dump(",", 1, data) ||
+ dump_indent(flags, depth + 1, 1, dump, data))
+ return -1;
+ } else {
+ if (dump_indent(flags, depth, 0, dump, data))
+ return -1;
+ }
+
+ iter = next;
+ }
+ }
+
+ hashtable_del(parents, loop_key, loop_key_len);
+ return embed ? 0 : dump("}", 1, data);
+ }
+
+ default:
+ /* not reached */
+ return -1;
+ }
+}
+
+char *json_dumps(const json_t *json, size_t flags) {
+ strbuffer_t strbuff;
+ char *result;
+
+ if (strbuffer_init(&strbuff))
+ return NULL;
+
+ if (json_dump_callback(json, dump_to_strbuffer, (void *)&strbuff, flags))
+ result = NULL;
+ else
+ result = jsonp_strdup(strbuffer_value(&strbuff));
+
+ strbuffer_close(&strbuff);
+ return result;
+}
+
+size_t json_dumpb(const json_t *json, char *buffer, size_t size, size_t flags) {
+ struct buffer buf = {size, 0, buffer};
+
+ if (json_dump_callback(json, dump_to_buffer, (void *)&buf, flags))
+ return 0;
+
+ return buf.used;
+}
+
+int json_dumpf(const json_t *json, FILE *output, size_t flags) {
+ return json_dump_callback(json, dump_to_file, (void *)output, flags);
+}
+
+int json_dumpfd(const json_t *json, int output, size_t flags) {
+ return json_dump_callback(json, dump_to_fd, (void *)&output, flags);
+}
+
+int json_dump_file(const json_t *json, const char *path, size_t flags) {
+ int result;
+
+ FILE *output = fopen(path, "w");
+ if (!output)
+ return -1;
+
+ result = json_dumpf(json, output, flags);
+
+ if (fclose(output) != 0)
+ return -1;
+
+ return result;
+}
+
+int json_dump_callback(const json_t *json, json_dump_callback_t callback, void *data,
+ size_t flags) {
+ int res;
+ hashtable_t parents_set;
+
+ if (!(flags & JSON_ENCODE_ANY)) {
+ if (!json_is_array(json) && !json_is_object(json))
+ return -1;
+ }
+
+ if (hashtable_init(&parents_set))
+ return -1;
+ res = do_dump(json, flags, 0, &parents_set, callback, data);
+ hashtable_close(&parents_set);
+
+ return res;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/error.c b/src/fluent-bit/lib/jansson-e23f558/src/error.c
new file mode 100644
index 000000000..14d0047d9
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/error.c
@@ -0,0 +1,59 @@
+#include "jansson_private.h"
+#include <string.h>
+
+void jsonp_error_init(json_error_t *error, const char *source) {
+ if (error) {
+ error->text[0] = '\0';
+ error->line = -1;
+ error->column = -1;
+ error->position = 0;
+ if (source)
+ jsonp_error_set_source(error, source);
+ else
+ error->source[0] = '\0';
+ }
+}
+
+void jsonp_error_set_source(json_error_t *error, const char *source) {
+ size_t length;
+
+ if (!error || !source)
+ return;
+
+ length = strlen(source);
+ if (length < JSON_ERROR_SOURCE_LENGTH)
+ strncpy(error->source, source, length + 1);
+ else {
+ size_t extra = length - JSON_ERROR_SOURCE_LENGTH + 4;
+ memcpy(error->source, "...", 3);
+ strncpy(error->source + 3, source + extra, length - extra + 1);
+ }
+}
+
+void jsonp_error_set(json_error_t *error, int line, int column, size_t position,
+ enum json_error_code code, const char *msg, ...) {
+ va_list ap;
+
+ va_start(ap, msg);
+ jsonp_error_vset(error, line, column, position, code, msg, ap);
+ va_end(ap);
+}
+
+void jsonp_error_vset(json_error_t *error, int line, int column, size_t position,
+ enum json_error_code code, const char *msg, va_list ap) {
+ if (!error)
+ return;
+
+ if (error->text[0] != '\0') {
+ /* error already set */
+ return;
+ }
+
+ error->line = line;
+ error->column = column;
+ error->position = (int)position;
+
+ vsnprintf(error->text, JSON_ERROR_TEXT_LENGTH - 1, msg, ap);
+ error->text[JSON_ERROR_TEXT_LENGTH - 2] = '\0';
+ error->text[JSON_ERROR_TEXT_LENGTH - 1] = code;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/hashtable.c b/src/fluent-bit/lib/jansson-e23f558/src/hashtable.c
new file mode 100644
index 000000000..5e97f8511
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/hashtable.c
@@ -0,0 +1,340 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <stdlib.h>
+#include <string.h>
+
+#ifdef HAVE_STDINT_H
+#include <stdint.h>
+#endif
+
+#include "hashtable.h"
+#include "jansson_private.h" /* for container_of() */
+#include <jansson_config.h> /* for JSON_INLINE */
+
+#ifndef INITIAL_HASHTABLE_ORDER
+#define INITIAL_HASHTABLE_ORDER 3
+#endif
+
+typedef struct hashtable_list list_t;
+typedef struct hashtable_pair pair_t;
+typedef struct hashtable_bucket bucket_t;
+
+extern volatile uint32_t hashtable_seed;
+
+/* Implementation of the hash function */
+#include "lookup3.h"
+
+#define list_to_pair(list_) container_of(list_, pair_t, list)
+#define ordered_list_to_pair(list_) container_of(list_, pair_t, ordered_list)
+#define hash_str(key, len) ((size_t)hashlittle((key), len, hashtable_seed))
+
+static JSON_INLINE void list_init(list_t *list) {
+ list->next = list;
+ list->prev = list;
+}
+
+static JSON_INLINE void list_insert(list_t *list, list_t *node) {
+ node->next = list;
+ node->prev = list->prev;
+ list->prev->next = node;
+ list->prev = node;
+}
+
+static JSON_INLINE void list_remove(list_t *list) {
+ list->prev->next = list->next;
+ list->next->prev = list->prev;
+}
+
+static JSON_INLINE int bucket_is_empty(hashtable_t *hashtable, bucket_t *bucket) {
+ return bucket->first == &hashtable->list && bucket->first == bucket->last;
+}
+
+static void insert_to_bucket(hashtable_t *hashtable, bucket_t *bucket, list_t *list) {
+ if (bucket_is_empty(hashtable, bucket)) {
+ list_insert(&hashtable->list, list);
+ bucket->first = bucket->last = list;
+ } else {
+ list_insert(bucket->first, list);
+ bucket->first = list;
+ }
+}
+
+static pair_t *hashtable_find_pair(hashtable_t *hashtable, bucket_t *bucket,
+ const char *key, size_t key_len, size_t hash) {
+ list_t *list;
+ pair_t *pair;
+
+ if (bucket_is_empty(hashtable, bucket))
+ return NULL;
+
+ list = bucket->first;
+ while (1) {
+ pair = list_to_pair(list);
+ if (pair->hash == hash && pair->key_len == key_len &&
+ memcmp(pair->key, key, key_len) == 0)
+ return pair;
+
+ if (list == bucket->last)
+ break;
+
+ list = list->next;
+ }
+
+ return NULL;
+}
+
+/* returns 0 on success, -1 if key was not found */
+static int hashtable_do_del(hashtable_t *hashtable, const char *key, size_t key_len,
+ size_t hash) {
+ pair_t *pair;
+ bucket_t *bucket;
+ size_t index;
+
+ index = hash & hashmask(hashtable->order);
+ bucket = &hashtable->buckets[index];
+
+ pair = hashtable_find_pair(hashtable, bucket, key, key_len, hash);
+ if (!pair)
+ return -1;
+
+ if (&pair->list == bucket->first && &pair->list == bucket->last)
+ bucket->first = bucket->last = &hashtable->list;
+
+ else if (&pair->list == bucket->first)
+ bucket->first = pair->list.next;
+
+ else if (&pair->list == bucket->last)
+ bucket->last = pair->list.prev;
+
+ list_remove(&pair->list);
+ list_remove(&pair->ordered_list);
+ json_decref(pair->value);
+
+ jsonp_free(pair);
+ hashtable->size--;
+
+ return 0;
+}
+
+static void hashtable_do_clear(hashtable_t *hashtable) {
+ list_t *list, *next;
+ pair_t *pair;
+
+ for (list = hashtable->list.next; list != &hashtable->list; list = next) {
+ next = list->next;
+ pair = list_to_pair(list);
+ json_decref(pair->value);
+ jsonp_free(pair);
+ }
+}
+
+static int hashtable_do_rehash(hashtable_t *hashtable) {
+ list_t *list, *next;
+ pair_t *pair;
+ size_t i, index, new_size, new_order;
+ struct hashtable_bucket *new_buckets;
+
+ new_order = hashtable->order + 1;
+ new_size = hashsize(new_order);
+
+ new_buckets = jsonp_malloc(new_size * sizeof(bucket_t));
+ if (!new_buckets)
+ return -1;
+
+ jsonp_free(hashtable->buckets);
+ hashtable->buckets = new_buckets;
+ hashtable->order = new_order;
+
+ for (i = 0; i < hashsize(hashtable->order); i++) {
+ hashtable->buckets[i].first = hashtable->buckets[i].last = &hashtable->list;
+ }
+
+ list = hashtable->list.next;
+ list_init(&hashtable->list);
+
+ for (; list != &hashtable->list; list = next) {
+ next = list->next;
+ pair = list_to_pair(list);
+ index = pair->hash % new_size;
+ insert_to_bucket(hashtable, &hashtable->buckets[index], &pair->list);
+ }
+
+ return 0;
+}
+
+int hashtable_init(hashtable_t *hashtable) {
+ size_t i;
+
+ hashtable->size = 0;
+ hashtable->order = INITIAL_HASHTABLE_ORDER;
+ hashtable->buckets = jsonp_malloc(hashsize(hashtable->order) * sizeof(bucket_t));
+ if (!hashtable->buckets)
+ return -1;
+
+ list_init(&hashtable->list);
+ list_init(&hashtable->ordered_list);
+
+ for (i = 0; i < hashsize(hashtable->order); i++) {
+ hashtable->buckets[i].first = hashtable->buckets[i].last = &hashtable->list;
+ }
+
+ return 0;
+}
+
+void hashtable_close(hashtable_t *hashtable) {
+ hashtable_do_clear(hashtable);
+ jsonp_free(hashtable->buckets);
+}
+
+static pair_t *init_pair(json_t *value, const char *key, size_t key_len, size_t hash) {
+ pair_t *pair;
+
+ /* offsetof(...) returns the size of pair_t without the last,
+ flexible member. This way, the correct amount is
+ allocated. */
+
+ if (key_len >= (size_t)-1 - offsetof(pair_t, key)) {
+ /* Avoid an overflow if the key is very long */
+ return NULL;
+ }
+
+ pair = jsonp_malloc(offsetof(pair_t, key) + key_len + 1);
+
+ if (!pair)
+ return NULL;
+
+ pair->hash = hash;
+ memcpy(pair->key, key, key_len);
+ pair->key[key_len] = '\0';
+ pair->key_len = key_len;
+ pair->value = value;
+
+ list_init(&pair->list);
+ list_init(&pair->ordered_list);
+
+ return pair;
+}
+
+int hashtable_set(hashtable_t *hashtable, const char *key, size_t key_len,
+ json_t *value) {
+ pair_t *pair;
+ bucket_t *bucket;
+ size_t hash, index;
+
+ /* rehash if the load ratio exceeds 1 */
+ if (hashtable->size >= hashsize(hashtable->order))
+ if (hashtable_do_rehash(hashtable))
+ return -1;
+
+ hash = hash_str(key, key_len);
+ index = hash & hashmask(hashtable->order);
+ bucket = &hashtable->buckets[index];
+ pair = hashtable_find_pair(hashtable, bucket, key, key_len, hash);
+
+ if (pair) {
+ json_decref(pair->value);
+ pair->value = value;
+ } else {
+ pair = init_pair(value, key, key_len, hash);
+
+ if (!pair)
+ return -1;
+
+ insert_to_bucket(hashtable, bucket, &pair->list);
+ list_insert(&hashtable->ordered_list, &pair->ordered_list);
+
+ hashtable->size++;
+ }
+ return 0;
+}
+
+void *hashtable_get(hashtable_t *hashtable, const char *key, size_t key_len) {
+ pair_t *pair;
+ size_t hash;
+ bucket_t *bucket;
+
+ hash = hash_str(key, key_len);
+ bucket = &hashtable->buckets[hash & hashmask(hashtable->order)];
+
+ pair = hashtable_find_pair(hashtable, bucket, key, key_len, hash);
+ if (!pair)
+ return NULL;
+
+ return pair->value;
+}
+
+int hashtable_del(hashtable_t *hashtable, const char *key, size_t key_len) {
+ size_t hash = hash_str(key, key_len);
+ return hashtable_do_del(hashtable, key, key_len, hash);
+}
+
+void hashtable_clear(hashtable_t *hashtable) {
+ size_t i;
+
+ hashtable_do_clear(hashtable);
+
+ for (i = 0; i < hashsize(hashtable->order); i++) {
+ hashtable->buckets[i].first = hashtable->buckets[i].last = &hashtable->list;
+ }
+
+ list_init(&hashtable->list);
+ list_init(&hashtable->ordered_list);
+ hashtable->size = 0;
+}
+
+void *hashtable_iter(hashtable_t *hashtable) {
+ return hashtable_iter_next(hashtable, &hashtable->ordered_list);
+}
+
+void *hashtable_iter_at(hashtable_t *hashtable, const char *key, size_t key_len) {
+ pair_t *pair;
+ size_t hash;
+ bucket_t *bucket;
+
+ hash = hash_str(key, key_len);
+ bucket = &hashtable->buckets[hash & hashmask(hashtable->order)];
+
+ pair = hashtable_find_pair(hashtable, bucket, key, key_len, hash);
+ if (!pair)
+ return NULL;
+
+ return &pair->ordered_list;
+}
+
+void *hashtable_iter_next(hashtable_t *hashtable, void *iter) {
+ list_t *list = (list_t *)iter;
+ if (list->next == &hashtable->ordered_list)
+ return NULL;
+ return list->next;
+}
+
+void *hashtable_iter_key(void *iter) {
+ pair_t *pair = ordered_list_to_pair((list_t *)iter);
+ return pair->key;
+}
+
+size_t hashtable_iter_key_len(void *iter) {
+ pair_t *pair = ordered_list_to_pair((list_t *)iter);
+ return pair->key_len;
+}
+
+void *hashtable_iter_value(void *iter) {
+ pair_t *pair = ordered_list_to_pair((list_t *)iter);
+ return pair->value;
+}
+
+void hashtable_iter_set(void *iter, json_t *value) {
+ pair_t *pair = ordered_list_to_pair((list_t *)iter);
+
+ json_decref(pair->value);
+ pair->value = value;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/hashtable.h b/src/fluent-bit/lib/jansson-e23f558/src/hashtable.h
new file mode 100644
index 000000000..03a1f5a99
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/hashtable.h
@@ -0,0 +1,186 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef HASHTABLE_H
+#define HASHTABLE_H
+
+#include "jansson.h"
+#include <stdlib.h>
+
+struct hashtable_list {
+ struct hashtable_list *prev;
+ struct hashtable_list *next;
+};
+
+/* "pair" may be a bit confusing a name, but think of it as a
+ key-value pair. In this case, it just encodes some extra data,
+ too */
+struct hashtable_pair {
+ struct hashtable_list list;
+ struct hashtable_list ordered_list;
+ size_t hash;
+ json_t *value;
+ size_t key_len;
+ char key[1];
+};
+
+struct hashtable_bucket {
+ struct hashtable_list *first;
+ struct hashtable_list *last;
+};
+
+typedef struct hashtable {
+ size_t size;
+ struct hashtable_bucket *buckets;
+ size_t order; /* hashtable has pow(2, order) buckets */
+ struct hashtable_list list;
+ struct hashtable_list ordered_list;
+} hashtable_t;
+
+#define hashtable_key_to_iter(key_) \
+ (&(container_of(key_, struct hashtable_pair, key)->ordered_list))
+
+/**
+ * hashtable_init - Initialize a hashtable object
+ *
+ * @hashtable: The (statically allocated) hashtable object
+ *
+ * Initializes a statically allocated hashtable object. The object
+ * should be cleared with hashtable_close when it's no longer used.
+ *
+ * Returns 0 on success, -1 on error (out of memory).
+ */
+int hashtable_init(hashtable_t *hashtable) JANSSON_ATTRS((warn_unused_result));
+
+/**
+ * hashtable_close - Release all resources used by a hashtable object
+ *
+ * @hashtable: The hashtable
+ *
+ * Destroys a statically allocated hashtable object.
+ */
+void hashtable_close(hashtable_t *hashtable);
+
+/**
+ * hashtable_set - Add/modify value in hashtable
+ *
+ * @hashtable: The hashtable object
+ * @key: The key
+ * @key: The length of key
+ * @serial: For addition order of keys
+ * @value: The value
+ *
+ * If a value with the given key already exists, its value is replaced
+ * with the new value. Value is "stealed" in the sense that hashtable
+ * doesn't increment its refcount but decreases the refcount when the
+ * value is no longer needed.
+ *
+ * Returns 0 on success, -1 on failure (out of memory).
+ */
+int hashtable_set(hashtable_t *hashtable, const char *key, size_t key_len, json_t *value);
+
+/**
+ * hashtable_get - Get a value associated with a key
+ *
+ * @hashtable: The hashtable object
+ * @key: The key
+ * @key: The length of key
+ *
+ * Returns value if it is found, or NULL otherwise.
+ */
+void *hashtable_get(hashtable_t *hashtable, const char *key, size_t key_len);
+
+/**
+ * hashtable_del - Remove a value from the hashtable
+ *
+ * @hashtable: The hashtable object
+ * @key: The key
+ * @key: The length of key
+ *
+ * Returns 0 on success, or -1 if the key was not found.
+ */
+int hashtable_del(hashtable_t *hashtable, const char *key, size_t key_len);
+
+/**
+ * hashtable_clear - Clear hashtable
+ *
+ * @hashtable: The hashtable object
+ *
+ * Removes all items from the hashtable.
+ */
+void hashtable_clear(hashtable_t *hashtable);
+
+/**
+ * hashtable_iter - Iterate over hashtable
+ *
+ * @hashtable: The hashtable object
+ *
+ * Returns an opaque iterator to the first element in the hashtable.
+ * The iterator should be passed to hashtable_iter_* functions.
+ * The hashtable items are not iterated over in any particular order.
+ *
+ * There's no need to free the iterator in any way. The iterator is
+ * valid as long as the item that is referenced by the iterator is not
+ * deleted. Other values may be added or deleted. In particular,
+ * hashtable_iter_next() may be called on an iterator, and after that
+ * the key/value pair pointed by the old iterator may be deleted.
+ */
+void *hashtable_iter(hashtable_t *hashtable);
+
+/**
+ * hashtable_iter_at - Return an iterator at a specific key
+ *
+ * @hashtable: The hashtable object
+ * @key: The key that the iterator should point to
+ * @key: The length of key
+ *
+ * Like hashtable_iter() but returns an iterator pointing to a
+ * specific key.
+ */
+void *hashtable_iter_at(hashtable_t *hashtable, const char *key, size_t key_len);
+
+/**
+ * hashtable_iter_next - Advance an iterator
+ *
+ * @hashtable: The hashtable object
+ * @iter: The iterator
+ *
+ * Returns a new iterator pointing to the next element in the
+ * hashtable or NULL if the whole hastable has been iterated over.
+ */
+void *hashtable_iter_next(hashtable_t *hashtable, void *iter);
+
+/**
+ * hashtable_iter_key - Retrieve the key pointed by an iterator
+ *
+ * @iter: The iterator
+ */
+void *hashtable_iter_key(void *iter);
+
+/**
+ * hashtable_iter_key_len - Retrieve the key length pointed by an iterator
+ *
+ * @iter: The iterator
+ */
+size_t hashtable_iter_key_len(void *iter);
+
+/**
+ * hashtable_iter_value - Retrieve the value pointed by an iterator
+ *
+ * @iter: The iterator
+ */
+void *hashtable_iter_value(void *iter);
+
+/**
+ * hashtable_iter_set - Set the value pointed by an iterator
+ *
+ * @iter: The iterator
+ * @value: The value to set
+ */
+void hashtable_iter_set(void *iter, json_t *value);
+
+#endif
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/hashtable_seed.c b/src/fluent-bit/lib/jansson-e23f558/src/hashtable_seed.c
new file mode 100644
index 000000000..d156b400c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/hashtable_seed.c
@@ -0,0 +1,277 @@
+/* Generate sizeof(uint32_t) bytes of as random data as possible to seed
+ the hash function.
+*/
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <stdio.h>
+#include <time.h>
+
+#ifdef HAVE_STDINT_H
+#include <stdint.h>
+#endif
+
+#ifdef HAVE_FCNTL_H
+#include <fcntl.h>
+#endif
+
+#ifdef HAVE_SCHED_H
+#include <sched.h>
+#endif
+
+#ifdef HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#ifdef HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+
+#ifdef HAVE_SYS_TIME_H
+#include <sys/time.h>
+#endif
+
+#ifdef HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#if defined(_WIN32)
+/* For GetModuleHandle(), GetProcAddress() and GetCurrentProcessId() */
+#include <windows.h>
+#endif
+
+#include "jansson.h"
+
+static uint32_t buf_to_uint32(char *data) {
+ size_t i;
+ uint32_t result = 0;
+
+ for (i = 0; i < sizeof(uint32_t); i++)
+ result = (result << 8) | (unsigned char)data[i];
+
+ return result;
+}
+
+/* /dev/urandom */
+#if !defined(_WIN32) && defined(USE_URANDOM)
+static int seed_from_urandom(uint32_t *seed) {
+ /* Use unbuffered I/O if we have open(), close() and read(). Otherwise
+ fall back to fopen() */
+
+ char data[sizeof(uint32_t)];
+ int ok;
+
+#if defined(HAVE_OPEN) && defined(HAVE_CLOSE) && defined(HAVE_READ)
+ int urandom;
+ urandom = open("/dev/urandom", O_RDONLY);
+ if (urandom == -1)
+ return 1;
+
+ ok = read(urandom, data, sizeof(uint32_t)) == sizeof(uint32_t);
+ close(urandom);
+#else
+ FILE *urandom;
+
+ urandom = fopen("/dev/urandom", "rb");
+ if (!urandom)
+ return 1;
+
+ ok = fread(data, 1, sizeof(uint32_t), urandom) == sizeof(uint32_t);
+ fclose(urandom);
+#endif
+
+ if (!ok)
+ return 1;
+
+ *seed = buf_to_uint32(data);
+ return 0;
+}
+#endif
+
+/* Windows Crypto API */
+#if defined(_WIN32) && defined(USE_WINDOWS_CRYPTOAPI)
+#include <wincrypt.h>
+
+typedef BOOL(WINAPI *CRYPTACQUIRECONTEXTA)(HCRYPTPROV *phProv, LPCSTR pszContainer,
+ LPCSTR pszProvider, DWORD dwProvType,
+ DWORD dwFlags);
+typedef BOOL(WINAPI *CRYPTGENRANDOM)(HCRYPTPROV hProv, DWORD dwLen, BYTE *pbBuffer);
+typedef BOOL(WINAPI *CRYPTRELEASECONTEXT)(HCRYPTPROV hProv, DWORD dwFlags);
+
+static int seed_from_windows_cryptoapi(uint32_t *seed) {
+ HINSTANCE hAdvAPI32 = NULL;
+ CRYPTACQUIRECONTEXTA pCryptAcquireContext = NULL;
+ CRYPTGENRANDOM pCryptGenRandom = NULL;
+ CRYPTRELEASECONTEXT pCryptReleaseContext = NULL;
+ HCRYPTPROV hCryptProv = 0;
+ BYTE data[sizeof(uint32_t)];
+ int ok;
+
+ hAdvAPI32 = GetModuleHandle(TEXT("advapi32.dll"));
+ if (hAdvAPI32 == NULL)
+ return 1;
+
+ pCryptAcquireContext =
+ (CRYPTACQUIRECONTEXTA)GetProcAddress(hAdvAPI32, "CryptAcquireContextA");
+ if (!pCryptAcquireContext)
+ return 1;
+
+ pCryptGenRandom = (CRYPTGENRANDOM)GetProcAddress(hAdvAPI32, "CryptGenRandom");
+ if (!pCryptGenRandom)
+ return 1;
+
+ pCryptReleaseContext =
+ (CRYPTRELEASECONTEXT)GetProcAddress(hAdvAPI32, "CryptReleaseContext");
+ if (!pCryptReleaseContext)
+ return 1;
+
+ if (!pCryptAcquireContext(&hCryptProv, NULL, NULL, PROV_RSA_FULL,
+ CRYPT_VERIFYCONTEXT))
+ return 1;
+
+ ok = pCryptGenRandom(hCryptProv, sizeof(uint32_t), data);
+ pCryptReleaseContext(hCryptProv, 0);
+
+ if (!ok)
+ return 1;
+
+ *seed = buf_to_uint32((char *)data);
+ return 0;
+}
+#endif
+
+/* gettimeofday() and getpid() */
+static int seed_from_timestamp_and_pid(uint32_t *seed) {
+#ifdef HAVE_GETTIMEOFDAY
+ /* XOR of seconds and microseconds */
+ struct timeval tv;
+ gettimeofday(&tv, NULL);
+ *seed = (uint32_t)tv.tv_sec ^ (uint32_t)tv.tv_usec;
+#else
+ /* Seconds only */
+ *seed = (uint32_t)time(NULL);
+#endif
+
+ /* XOR with PID for more randomness */
+#if defined(_WIN32)
+ *seed ^= (uint32_t)GetCurrentProcessId();
+#elif defined(HAVE_GETPID)
+ *seed ^= (uint32_t)getpid();
+#endif
+
+ return 0;
+}
+
+static uint32_t generate_seed() {
+ uint32_t seed = 0;
+ int done = 0;
+
+#if !defined(_WIN32) && defined(USE_URANDOM)
+ if (seed_from_urandom(&seed) == 0)
+ done = 1;
+#endif
+
+#if defined(_WIN32) && defined(USE_WINDOWS_CRYPTOAPI)
+ if (seed_from_windows_cryptoapi(&seed) == 0)
+ done = 1;
+#endif
+
+ if (!done) {
+ /* Fall back to timestamp and PID if no better randomness is
+ available */
+ seed_from_timestamp_and_pid(&seed);
+ }
+
+ /* Make sure the seed is never zero */
+ if (seed == 0)
+ seed = 1;
+
+ return seed;
+}
+
+volatile uint32_t hashtable_seed = 0;
+
+#if defined(HAVE_ATOMIC_BUILTINS) && (defined(HAVE_SCHED_YIELD) || !defined(_WIN32))
+static volatile char seed_initialized = 0;
+
+void json_object_seed(size_t seed) {
+ uint32_t new_seed = (uint32_t)seed;
+
+ if (hashtable_seed == 0) {
+ if (__atomic_test_and_set(&seed_initialized, __ATOMIC_RELAXED) == 0) {
+ /* Do the seeding ourselves */
+ if (new_seed == 0)
+ new_seed = generate_seed();
+
+ __atomic_store_n(&hashtable_seed, new_seed, __ATOMIC_RELEASE);
+ } else {
+ /* Wait for another thread to do the seeding */
+ do {
+#ifdef HAVE_SCHED_YIELD
+ sched_yield();
+#endif
+ } while (__atomic_load_n(&hashtable_seed, __ATOMIC_ACQUIRE) == 0);
+ }
+ }
+}
+#elif defined(HAVE_SYNC_BUILTINS) && (defined(HAVE_SCHED_YIELD) || !defined(_WIN32))
+void json_object_seed(size_t seed) {
+ uint32_t new_seed = (uint32_t)seed;
+
+ if (hashtable_seed == 0) {
+ if (new_seed == 0) {
+ /* Explicit synchronization fences are not supported by the
+ __sync builtins, so every thread getting here has to
+ generate the seed value.
+ */
+ new_seed = generate_seed();
+ }
+
+ do {
+ if (__sync_bool_compare_and_swap(&hashtable_seed, 0, new_seed)) {
+ /* We were the first to seed */
+ break;
+ } else {
+ /* Wait for another thread to do the seeding */
+#ifdef HAVE_SCHED_YIELD
+ sched_yield();
+#endif
+ }
+ } while (hashtable_seed == 0);
+ }
+}
+#elif defined(_WIN32)
+static long seed_initialized = 0;
+void json_object_seed(size_t seed) {
+ uint32_t new_seed = (uint32_t)seed;
+
+ if (hashtable_seed == 0) {
+ if (InterlockedIncrement(&seed_initialized) == 1) {
+ /* Do the seeding ourselves */
+ if (new_seed == 0)
+ new_seed = generate_seed();
+
+ hashtable_seed = new_seed;
+ } else {
+ /* Wait for another thread to do the seeding */
+ do {
+ SwitchToThread();
+ } while (hashtable_seed == 0);
+ }
+ }
+}
+#else
+/* Fall back to a thread-unsafe version */
+void json_object_seed(size_t seed) {
+ uint32_t new_seed = (uint32_t)seed;
+
+ if (hashtable_seed == 0) {
+ if (new_seed == 0)
+ new_seed = generate_seed();
+
+ hashtable_seed = new_seed;
+ }
+}
+#endif
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/jansson.def b/src/fluent-bit/lib/jansson-e23f558/src/jansson.def
new file mode 100644
index 000000000..5c76c2f68
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/jansson.def
@@ -0,0 +1,83 @@
+EXPORTS
+ json_delete
+ json_true
+ json_false
+ json_null
+ json_sprintf
+ json_vsprintf
+ json_string
+ json_stringn
+ json_string_nocheck
+ json_stringn_nocheck
+ json_string_value
+ json_string_length
+ json_string_set
+ json_string_setn
+ json_string_set_nocheck
+ json_string_setn_nocheck
+ json_integer
+ json_integer_value
+ json_integer_set
+ json_real
+ json_real_value
+ json_real_set
+ json_number_value
+ json_array
+ json_array_size
+ json_array_get
+ json_array_set_new
+ json_array_append_new
+ json_array_insert_new
+ json_array_remove
+ json_array_clear
+ json_array_extend
+ json_object
+ json_object_size
+ json_object_get
+ json_object_getn
+ json_object_set_new
+ json_object_setn_new
+ json_object_set_new_nocheck
+ json_object_setn_new_nocheck
+ json_object_del
+ json_object_deln
+ json_object_clear
+ json_object_update
+ json_object_update_existing
+ json_object_update_missing
+ json_object_update_recursive
+ json_object_iter
+ json_object_iter_at
+ json_object_iter_next
+ json_object_iter_key
+ json_object_iter_key_len
+ json_object_iter_value
+ json_object_iter_set_new
+ json_object_key_to_iter
+ json_object_seed
+ json_dumps
+ json_dumpb
+ json_dumpf
+ json_dumpfd
+ json_dump_file
+ json_dump_callback
+ json_loads
+ json_loadb
+ json_loadf
+ json_loadfd
+ json_load_file
+ json_load_callback
+ json_equal
+ json_copy
+ json_deep_copy
+ json_pack
+ json_pack_ex
+ json_vpack_ex
+ json_unpack
+ json_unpack_ex
+ json_vunpack_ex
+ json_set_alloc_funcs
+ json_get_alloc_funcs
+ jansson_version_str
+ jansson_version_cmp
+
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/jansson.h b/src/fluent-bit/lib/jansson-e23f558/src/jansson.h
new file mode 100644
index 000000000..391c85e9c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/jansson.h
@@ -0,0 +1,419 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef JANSSON_H
+#define JANSSON_H
+
+#include <stdarg.h>
+#include <stdio.h>
+#include <stdlib.h> /* for size_t */
+
+#include "jansson_config.h"
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/* version */
+
+#define JANSSON_MAJOR_VERSION 2
+#define JANSSON_MINOR_VERSION 14
+#define JANSSON_MICRO_VERSION 0
+
+/* Micro version is omitted if it's 0 */
+#define JANSSON_VERSION "2.14"
+
+/* Version as a 3-byte hex number, e.g. 0x010201 == 1.2.1. Use this
+ for numeric comparisons, e.g. #if JANSSON_VERSION_HEX >= ... */
+#define JANSSON_VERSION_HEX \
+ ((JANSSON_MAJOR_VERSION << 16) | (JANSSON_MINOR_VERSION << 8) | \
+ (JANSSON_MICRO_VERSION << 0))
+
+/* If __atomic or __sync builtins are available the library is thread
+ * safe for all read-only functions plus reference counting. */
+#if JSON_HAVE_ATOMIC_BUILTINS || JSON_HAVE_SYNC_BUILTINS
+#define JANSSON_THREAD_SAFE_REFCOUNT 1
+#endif
+
+#if defined(__GNUC__) || defined(__clang__)
+#define JANSSON_ATTRS(x) __attribute__(x)
+#else
+#define JANSSON_ATTRS(x)
+#endif
+
+/* types */
+
+typedef enum {
+ JSON_OBJECT,
+ JSON_ARRAY,
+ JSON_STRING,
+ JSON_INTEGER,
+ JSON_REAL,
+ JSON_TRUE,
+ JSON_FALSE,
+ JSON_NULL
+} json_type;
+
+typedef struct json_t {
+ json_type type;
+ volatile size_t refcount;
+} json_t;
+
+#ifndef JANSSON_USING_CMAKE /* disabled if using cmake */
+#if JSON_INTEGER_IS_LONG_LONG
+#ifdef _WIN32
+#define JSON_INTEGER_FORMAT "I64d"
+#else
+#define JSON_INTEGER_FORMAT "lld"
+#endif
+typedef long long json_int_t;
+#else
+#define JSON_INTEGER_FORMAT "ld"
+typedef long json_int_t;
+#endif /* JSON_INTEGER_IS_LONG_LONG */
+#endif
+
+#define json_typeof(json) ((json)->type)
+#define json_is_object(json) ((json) && json_typeof(json) == JSON_OBJECT)
+#define json_is_array(json) ((json) && json_typeof(json) == JSON_ARRAY)
+#define json_is_string(json) ((json) && json_typeof(json) == JSON_STRING)
+#define json_is_integer(json) ((json) && json_typeof(json) == JSON_INTEGER)
+#define json_is_real(json) ((json) && json_typeof(json) == JSON_REAL)
+#define json_is_number(json) (json_is_integer(json) || json_is_real(json))
+#define json_is_true(json) ((json) && json_typeof(json) == JSON_TRUE)
+#define json_is_false(json) ((json) && json_typeof(json) == JSON_FALSE)
+#define json_boolean_value json_is_true
+#define json_is_boolean(json) (json_is_true(json) || json_is_false(json))
+#define json_is_null(json) ((json) && json_typeof(json) == JSON_NULL)
+
+/* construction, destruction, reference counting */
+
+json_t *json_object(void);
+json_t *json_array(void);
+json_t *json_string(const char *value);
+json_t *json_stringn(const char *value, size_t len);
+json_t *json_string_nocheck(const char *value);
+json_t *json_stringn_nocheck(const char *value, size_t len);
+json_t *json_integer(json_int_t value);
+json_t *json_real(double value);
+json_t *json_true(void);
+json_t *json_false(void);
+#define json_boolean(val) ((val) ? json_true() : json_false())
+json_t *json_null(void);
+
+/* do not call JSON_INTERNAL_INCREF or JSON_INTERNAL_DECREF directly */
+#if JSON_HAVE_ATOMIC_BUILTINS
+#define JSON_INTERNAL_INCREF(json) \
+ __atomic_add_fetch(&json->refcount, 1, __ATOMIC_ACQUIRE)
+#define JSON_INTERNAL_DECREF(json) \
+ __atomic_sub_fetch(&json->refcount, 1, __ATOMIC_RELEASE)
+#elif JSON_HAVE_SYNC_BUILTINS
+#define JSON_INTERNAL_INCREF(json) __sync_add_and_fetch(&json->refcount, 1)
+#define JSON_INTERNAL_DECREF(json) __sync_sub_and_fetch(&json->refcount, 1)
+#else
+#define JSON_INTERNAL_INCREF(json) (++json->refcount)
+#define JSON_INTERNAL_DECREF(json) (--json->refcount)
+#endif
+
+static JSON_INLINE json_t *json_incref(json_t *json) {
+ if (json && json->refcount != (size_t)-1)
+ JSON_INTERNAL_INCREF(json);
+ return json;
+}
+
+/* do not call json_delete directly */
+void json_delete(json_t *json);
+
+static JSON_INLINE void json_decref(json_t *json) {
+ if (json && json->refcount != (size_t)-1 && JSON_INTERNAL_DECREF(json) == 0)
+ json_delete(json);
+}
+
+#if defined(__GNUC__) || defined(__clang__)
+static JSON_INLINE void json_decrefp(json_t **json) {
+ if (json) {
+ json_decref(*json);
+ *json = NULL;
+ }
+}
+
+#define json_auto_t json_t __attribute__((cleanup(json_decrefp)))
+#endif
+
+/* error reporting */
+
+#define JSON_ERROR_TEXT_LENGTH 160
+#define JSON_ERROR_SOURCE_LENGTH 80
+
+typedef struct json_error_t {
+ int line;
+ int column;
+ int position;
+ char source[JSON_ERROR_SOURCE_LENGTH];
+ char text[JSON_ERROR_TEXT_LENGTH];
+} json_error_t;
+
+enum json_error_code {
+ json_error_unknown,
+ json_error_out_of_memory,
+ json_error_stack_overflow,
+ json_error_cannot_open_file,
+ json_error_invalid_argument,
+ json_error_invalid_utf8,
+ json_error_premature_end_of_input,
+ json_error_end_of_input_expected,
+ json_error_invalid_syntax,
+ json_error_invalid_format,
+ json_error_wrong_type,
+ json_error_null_character,
+ json_error_null_value,
+ json_error_null_byte_in_key,
+ json_error_duplicate_key,
+ json_error_numeric_overflow,
+ json_error_item_not_found,
+ json_error_index_out_of_range
+};
+
+static JSON_INLINE enum json_error_code json_error_code(const json_error_t *e) {
+ return (enum json_error_code)e->text[JSON_ERROR_TEXT_LENGTH - 1];
+}
+
+/* getters, setters, manipulation */
+
+void json_object_seed(size_t seed);
+size_t json_object_size(const json_t *object);
+json_t *json_object_get(const json_t *object, const char *key)
+ JANSSON_ATTRS((warn_unused_result));
+json_t *json_object_getn(const json_t *object, const char *key, size_t key_len)
+ JANSSON_ATTRS((warn_unused_result));
+int json_object_set_new(json_t *object, const char *key, json_t *value);
+int json_object_setn_new(json_t *object, const char *key, size_t key_len, json_t *value);
+int json_object_set_new_nocheck(json_t *object, const char *key, json_t *value);
+int json_object_setn_new_nocheck(json_t *object, const char *key, size_t key_len,
+ json_t *value);
+int json_object_del(json_t *object, const char *key);
+int json_object_deln(json_t *object, const char *key, size_t key_len);
+int json_object_clear(json_t *object);
+int json_object_update(json_t *object, json_t *other);
+int json_object_update_existing(json_t *object, json_t *other);
+int json_object_update_missing(json_t *object, json_t *other);
+int json_object_update_recursive(json_t *object, json_t *other);
+void *json_object_iter(json_t *object);
+void *json_object_iter_at(json_t *object, const char *key);
+void *json_object_key_to_iter(const char *key);
+void *json_object_iter_next(json_t *object, void *iter);
+const char *json_object_iter_key(void *iter);
+size_t json_object_iter_key_len(void *iter);
+json_t *json_object_iter_value(void *iter);
+int json_object_iter_set_new(json_t *object, void *iter, json_t *value);
+
+#define json_object_foreach(object, key, value) \
+ for (key = json_object_iter_key(json_object_iter(object)); \
+ key && (value = json_object_iter_value(json_object_key_to_iter(key))); \
+ key = json_object_iter_key( \
+ json_object_iter_next(object, json_object_key_to_iter(key))))
+
+#define json_object_keylen_foreach(object, key, key_len, value) \
+ for (key = json_object_iter_key(json_object_iter(object)), \
+ key_len = json_object_iter_key_len(json_object_key_to_iter(key)); \
+ key && (value = json_object_iter_value(json_object_key_to_iter(key))); \
+ key = json_object_iter_key( \
+ json_object_iter_next(object, json_object_key_to_iter(key))), \
+ key_len = json_object_iter_key_len(json_object_key_to_iter(key)))
+
+#define json_object_foreach_safe(object, n, key, value) \
+ for (key = json_object_iter_key(json_object_iter(object)), \
+ n = json_object_iter_next(object, json_object_key_to_iter(key)); \
+ key && (value = json_object_iter_value(json_object_key_to_iter(key))); \
+ key = json_object_iter_key(n), \
+ n = json_object_iter_next(object, json_object_key_to_iter(key)))
+
+#define json_object_keylen_foreach_safe(object, n, key, key_len, value) \
+ for (key = json_object_iter_key(json_object_iter(object)), \
+ n = json_object_iter_next(object, json_object_key_to_iter(key)), \
+ key_len = json_object_iter_key_len(json_object_key_to_iter(key)); \
+ key && (value = json_object_iter_value(json_object_key_to_iter(key))); \
+ key = json_object_iter_key(n), key_len = json_object_iter_key_len(n), \
+ n = json_object_iter_next(object, json_object_key_to_iter(key)))
+
+#define json_array_foreach(array, index, value) \
+ for (index = 0; \
+ index < json_array_size(array) && (value = json_array_get(array, index)); \
+ index++)
+
+static JSON_INLINE int json_object_set(json_t *object, const char *key, json_t *value) {
+ return json_object_set_new(object, key, json_incref(value));
+}
+
+static JSON_INLINE int json_object_setn(json_t *object, const char *key, size_t key_len,
+ json_t *value) {
+ return json_object_setn_new(object, key, key_len, json_incref(value));
+}
+
+static JSON_INLINE int json_object_set_nocheck(json_t *object, const char *key,
+ json_t *value) {
+ return json_object_set_new_nocheck(object, key, json_incref(value));
+}
+
+static JSON_INLINE int json_object_setn_nocheck(json_t *object, const char *key,
+ size_t key_len, json_t *value) {
+ return json_object_setn_new_nocheck(object, key, key_len, json_incref(value));
+}
+
+static JSON_INLINE int json_object_iter_set(json_t *object, void *iter, json_t *value) {
+ return json_object_iter_set_new(object, iter, json_incref(value));
+}
+
+static JSON_INLINE int json_object_update_new(json_t *object, json_t *other) {
+ int ret = json_object_update(object, other);
+ json_decref(other);
+ return ret;
+}
+
+static JSON_INLINE int json_object_update_existing_new(json_t *object, json_t *other) {
+ int ret = json_object_update_existing(object, other);
+ json_decref(other);
+ return ret;
+}
+
+static JSON_INLINE int json_object_update_missing_new(json_t *object, json_t *other) {
+ int ret = json_object_update_missing(object, other);
+ json_decref(other);
+ return ret;
+}
+
+size_t json_array_size(const json_t *array);
+json_t *json_array_get(const json_t *array, size_t index)
+ JANSSON_ATTRS((warn_unused_result));
+int json_array_set_new(json_t *array, size_t index, json_t *value);
+int json_array_append_new(json_t *array, json_t *value);
+int json_array_insert_new(json_t *array, size_t index, json_t *value);
+int json_array_remove(json_t *array, size_t index);
+int json_array_clear(json_t *array);
+int json_array_extend(json_t *array, json_t *other);
+
+static JSON_INLINE int json_array_set(json_t *array, size_t ind, json_t *value) {
+ return json_array_set_new(array, ind, json_incref(value));
+}
+
+static JSON_INLINE int json_array_append(json_t *array, json_t *value) {
+ return json_array_append_new(array, json_incref(value));
+}
+
+static JSON_INLINE int json_array_insert(json_t *array, size_t ind, json_t *value) {
+ return json_array_insert_new(array, ind, json_incref(value));
+}
+
+const char *json_string_value(const json_t *string);
+size_t json_string_length(const json_t *string);
+json_int_t json_integer_value(const json_t *integer);
+double json_real_value(const json_t *real);
+double json_number_value(const json_t *json);
+
+int json_string_set(json_t *string, const char *value);
+int json_string_setn(json_t *string, const char *value, size_t len);
+int json_string_set_nocheck(json_t *string, const char *value);
+int json_string_setn_nocheck(json_t *string, const char *value, size_t len);
+int json_integer_set(json_t *integer, json_int_t value);
+int json_real_set(json_t *real, double value);
+
+/* pack, unpack */
+
+json_t *json_pack(const char *fmt, ...) JANSSON_ATTRS((warn_unused_result));
+json_t *json_pack_ex(json_error_t *error, size_t flags, const char *fmt, ...)
+ JANSSON_ATTRS((warn_unused_result));
+json_t *json_vpack_ex(json_error_t *error, size_t flags, const char *fmt, va_list ap)
+ JANSSON_ATTRS((warn_unused_result));
+
+#define JSON_VALIDATE_ONLY 0x1
+#define JSON_STRICT 0x2
+
+int json_unpack(json_t *root, const char *fmt, ...);
+int json_unpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt, ...);
+int json_vunpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt,
+ va_list ap);
+
+/* sprintf */
+
+json_t *json_sprintf(const char *fmt, ...)
+ JANSSON_ATTRS((warn_unused_result, format(printf, 1, 2)));
+json_t *json_vsprintf(const char *fmt, va_list ap)
+ JANSSON_ATTRS((warn_unused_result, format(printf, 1, 0)));
+
+/* equality */
+
+int json_equal(const json_t *value1, const json_t *value2);
+
+/* copying */
+
+json_t *json_copy(json_t *value) JANSSON_ATTRS((warn_unused_result));
+json_t *json_deep_copy(const json_t *value) JANSSON_ATTRS((warn_unused_result));
+
+/* decoding */
+
+#define JSON_REJECT_DUPLICATES 0x1
+#define JSON_DISABLE_EOF_CHECK 0x2
+#define JSON_DECODE_ANY 0x4
+#define JSON_DECODE_INT_AS_REAL 0x8
+#define JSON_ALLOW_NUL 0x10
+
+typedef size_t (*json_load_callback_t)(void *buffer, size_t buflen, void *data);
+
+json_t *json_loads(const char *input, size_t flags, json_error_t *error)
+ JANSSON_ATTRS((warn_unused_result));
+json_t *json_loadb(const char *buffer, size_t buflen, size_t flags, json_error_t *error)
+ JANSSON_ATTRS((warn_unused_result));
+json_t *json_loadf(FILE *input, size_t flags, json_error_t *error)
+ JANSSON_ATTRS((warn_unused_result));
+json_t *json_loadfd(int input, size_t flags, json_error_t *error)
+ JANSSON_ATTRS((warn_unused_result));
+json_t *json_load_file(const char *path, size_t flags, json_error_t *error)
+ JANSSON_ATTRS((warn_unused_result));
+json_t *json_load_callback(json_load_callback_t callback, void *data, size_t flags,
+ json_error_t *error) JANSSON_ATTRS((warn_unused_result));
+
+/* encoding */
+
+#define JSON_MAX_INDENT 0x1F
+#define JSON_INDENT(n) ((n)&JSON_MAX_INDENT)
+#define JSON_COMPACT 0x20
+#define JSON_ENSURE_ASCII 0x40
+#define JSON_SORT_KEYS 0x80
+#define JSON_PRESERVE_ORDER 0x100
+#define JSON_ENCODE_ANY 0x200
+#define JSON_ESCAPE_SLASH 0x400
+#define JSON_REAL_PRECISION(n) (((n)&0x1F) << 11)
+#define JSON_EMBED 0x10000
+
+typedef int (*json_dump_callback_t)(const char *buffer, size_t size, void *data);
+
+char *json_dumps(const json_t *json, size_t flags) JANSSON_ATTRS((warn_unused_result));
+size_t json_dumpb(const json_t *json, char *buffer, size_t size, size_t flags);
+int json_dumpf(const json_t *json, FILE *output, size_t flags);
+int json_dumpfd(const json_t *json, int output, size_t flags);
+int json_dump_file(const json_t *json, const char *path, size_t flags);
+int json_dump_callback(const json_t *json, json_dump_callback_t callback, void *data,
+ size_t flags);
+
+/* custom memory allocation */
+
+typedef void *(*json_malloc_t)(size_t);
+typedef void (*json_free_t)(void *);
+
+void json_set_alloc_funcs(json_malloc_t malloc_fn, json_free_t free_fn);
+void json_get_alloc_funcs(json_malloc_t *malloc_fn, json_free_t *free_fn);
+
+/* runtime version checking */
+
+const char *jansson_version_str(void);
+int jansson_version_cmp(int major, int minor, int micro);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/jansson_config.h.in b/src/fluent-bit/lib/jansson-e23f558/src/jansson_config.h.in
new file mode 100644
index 000000000..fe692ab4f
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/jansson_config.h.in
@@ -0,0 +1,51 @@
+/*
+ * Copyright (c) 2010-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ *
+ *
+ * This file specifies a part of the site-specific configuration for
+ * Jansson, namely those things that affect the public API in
+ * jansson.h.
+ *
+ * The configure script copies this file to jansson_config.h and
+ * replaces @var@ substitutions by values that fit your system. If you
+ * cannot run the configure script, you can do the value substitution
+ * by hand.
+ */
+
+#ifndef JANSSON_CONFIG_H
+#define JANSSON_CONFIG_H
+
+/* If your compiler supports the inline keyword in C, JSON_INLINE is
+ defined to `inline', otherwise empty. In C++, the inline is always
+ supported. */
+#ifdef __cplusplus
+#define JSON_INLINE inline
+#else
+#define JSON_INLINE @json_inline@
+#endif
+
+/* If your compiler supports the `long long` type and the strtoll()
+ library function, JSON_INTEGER_IS_LONG_LONG is defined to 1,
+ otherwise to 0. */
+#define JSON_INTEGER_IS_LONG_LONG @json_have_long_long@
+
+/* If locale.h and localeconv() are available, define to 1,
+ otherwise to 0. */
+#define JSON_HAVE_LOCALECONV @json_have_localeconv@
+
+/* If __atomic builtins are available they will be used to manage
+ reference counts of json_t. */
+#define JSON_HAVE_ATOMIC_BUILTINS @json_have_atomic_builtins@
+
+/* If __atomic builtins are not available we try using __sync builtins
+ to manage reference counts of json_t. */
+#define JSON_HAVE_SYNC_BUILTINS @json_have_sync_builtins@
+
+/* Maximum recursion depth for parsing JSON input.
+ This limits the depth of e.g. array-within-array constructions. */
+#define JSON_PARSER_MAX_DEPTH 2048
+
+#endif
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/jansson_private.h b/src/fluent-bit/lib/jansson-e23f558/src/jansson_private.h
new file mode 100644
index 000000000..ea2593cde
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/jansson_private.h
@@ -0,0 +1,114 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef JANSSON_PRIVATE_H
+#define JANSSON_PRIVATE_H
+
+#include "hashtable.h"
+#include "jansson.h"
+#include "jansson_private_config.h"
+#include "strbuffer.h"
+#include <stddef.h>
+
+#define container_of(ptr_, type_, member_) \
+ ((type_ *)((char *)ptr_ - offsetof(type_, member_)))
+
+/* On some platforms, max() may already be defined */
+#ifndef max
+#define max(a, b) ((a) > (b) ? (a) : (b))
+#endif
+
+/* va_copy is a C99 feature. In C89 implementations, it's sometimes
+ available as __va_copy. If not, memcpy() should do the trick. */
+#ifndef va_copy
+#ifdef __va_copy
+#define va_copy __va_copy
+#else
+#define va_copy(a, b) memcpy(&(a), &(b), sizeof(va_list))
+#endif
+#endif
+
+typedef struct {
+ json_t json;
+ hashtable_t hashtable;
+} json_object_t;
+
+typedef struct {
+ json_t json;
+ size_t size;
+ size_t entries;
+ json_t **table;
+} json_array_t;
+
+typedef struct {
+ json_t json;
+ char *value;
+ size_t length;
+} json_string_t;
+
+typedef struct {
+ json_t json;
+ double value;
+} json_real_t;
+
+typedef struct {
+ json_t json;
+ json_int_t value;
+} json_integer_t;
+
+#define json_to_object(json_) container_of(json_, json_object_t, json)
+#define json_to_array(json_) container_of(json_, json_array_t, json)
+#define json_to_string(json_) container_of(json_, json_string_t, json)
+#define json_to_real(json_) container_of(json_, json_real_t, json)
+#define json_to_integer(json_) container_of(json_, json_integer_t, json)
+
+/* Create a string by taking ownership of an existing buffer */
+json_t *jsonp_stringn_nocheck_own(const char *value, size_t len);
+
+/* Error message formatting */
+void jsonp_error_init(json_error_t *error, const char *source);
+void jsonp_error_set_source(json_error_t *error, const char *source);
+void jsonp_error_set(json_error_t *error, int line, int column, size_t position,
+ enum json_error_code code, const char *msg, ...);
+void jsonp_error_vset(json_error_t *error, int line, int column, size_t position,
+ enum json_error_code code, const char *msg, va_list ap);
+
+/* Locale independent string<->double conversions */
+int jsonp_strtod(strbuffer_t *strbuffer, double *out);
+int jsonp_dtostr(char *buffer, size_t size, double value, int prec);
+
+/* Wrappers for custom memory functions */
+void *jsonp_malloc(size_t size) JANSSON_ATTRS((warn_unused_result));
+void jsonp_free(void *ptr);
+char *jsonp_strndup(const char *str, size_t length) JANSSON_ATTRS((warn_unused_result));
+char *jsonp_strdup(const char *str) JANSSON_ATTRS((warn_unused_result));
+char *jsonp_strndup(const char *str, size_t len) JANSSON_ATTRS((warn_unused_result));
+
+/* Circular reference check*/
+/* Space for "0x", double the sizeof a pointer for the hex and a terminator. */
+#define LOOP_KEY_LEN (2 + (sizeof(json_t *) * 2) + 1)
+int jsonp_loop_check(hashtable_t *parents, const json_t *json, char *key, size_t key_size,
+ size_t *key_len_out);
+
+/* Windows compatibility */
+#if defined(_WIN32) || defined(WIN32)
+#if defined(_MSC_VER) /* MS compiller */
+#if (_MSC_VER < 1900) && \
+ !defined(snprintf) /* snprintf not defined yet & not introduced */
+#define snprintf _snprintf
+#endif
+#if (_MSC_VER < 1500) && \
+ !defined(vsnprintf) /* vsnprintf not defined yet & not introduced */
+#define vsnprintf(b, c, f, a) _vsnprintf(b, c, f, a)
+#endif
+#else /* Other Windows compiller, old definition */
+#define snprintf _snprintf
+#define vsnprintf _vsnprintf
+#endif
+#endif
+
+#endif
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/load.c b/src/fluent-bit/lib/jansson-e23f558/src/load.c
new file mode 100644
index 000000000..8ae7abd12
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/load.c
@@ -0,0 +1,1106 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#include "jansson_private.h"
+
+#include <assert.h>
+#include <errno.h>
+#include <limits.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#ifdef HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "jansson.h"
+#include "strbuffer.h"
+#include "utf.h"
+
+#define STREAM_STATE_OK 0
+#define STREAM_STATE_EOF -1
+#define STREAM_STATE_ERROR -2
+
+#define TOKEN_INVALID -1
+#define TOKEN_EOF 0
+#define TOKEN_STRING 256
+#define TOKEN_INTEGER 257
+#define TOKEN_REAL 258
+#define TOKEN_TRUE 259
+#define TOKEN_FALSE 260
+#define TOKEN_NULL 261
+
+/* Locale independent versions of isxxx() functions */
+#define l_isupper(c) ('A' <= (c) && (c) <= 'Z')
+#define l_islower(c) ('a' <= (c) && (c) <= 'z')
+#define l_isalpha(c) (l_isupper(c) || l_islower(c))
+#define l_isdigit(c) ('0' <= (c) && (c) <= '9')
+#define l_isxdigit(c) \
+ (l_isdigit(c) || ('A' <= (c) && (c) <= 'F') || ('a' <= (c) && (c) <= 'f'))
+
+/* Read one byte from stream, convert to unsigned char, then int, and
+ return. return EOF on end of file. This corresponds to the
+ behaviour of fgetc(). */
+typedef int (*get_func)(void *data);
+
+typedef struct {
+ get_func get;
+ void *data;
+ char buffer[5];
+ size_t buffer_pos;
+ int state;
+ int line;
+ int column, last_column;
+ size_t position;
+} stream_t;
+
+typedef struct {
+ stream_t stream;
+ strbuffer_t saved_text;
+ size_t flags;
+ size_t depth;
+ int token;
+ union {
+ struct {
+ char *val;
+ size_t len;
+ } string;
+ json_int_t integer;
+ double real;
+ } value;
+} lex_t;
+
+#define stream_to_lex(stream) container_of(stream, lex_t, stream)
+
+/*** error reporting ***/
+
+static void error_set(json_error_t *error, const lex_t *lex, enum json_error_code code,
+ const char *msg, ...) {
+ va_list ap;
+ char msg_text[JSON_ERROR_TEXT_LENGTH];
+ char msg_with_context[JSON_ERROR_TEXT_LENGTH];
+
+ int line = -1, col = -1;
+ size_t pos = 0;
+ const char *result = msg_text;
+
+ if (!error)
+ return;
+
+ va_start(ap, msg);
+ vsnprintf(msg_text, JSON_ERROR_TEXT_LENGTH, msg, ap);
+ msg_text[JSON_ERROR_TEXT_LENGTH - 1] = '\0';
+ va_end(ap);
+
+ if (lex) {
+ const char *saved_text = strbuffer_value(&lex->saved_text);
+
+ line = lex->stream.line;
+ col = lex->stream.column;
+ pos = lex->stream.position;
+
+ if (saved_text && saved_text[0]) {
+ if (lex->saved_text.length <= 20) {
+ snprintf(msg_with_context, JSON_ERROR_TEXT_LENGTH, "%s near '%s'",
+ msg_text, saved_text);
+ msg_with_context[JSON_ERROR_TEXT_LENGTH - 1] = '\0';
+ result = msg_with_context;
+ }
+ } else {
+ if (code == json_error_invalid_syntax) {
+ /* More specific error code for premature end of file. */
+ code = json_error_premature_end_of_input;
+ }
+ if (lex->stream.state == STREAM_STATE_ERROR) {
+ /* No context for UTF-8 decoding errors */
+ result = msg_text;
+ } else {
+ snprintf(msg_with_context, JSON_ERROR_TEXT_LENGTH, "%s near end of file",
+ msg_text);
+ msg_with_context[JSON_ERROR_TEXT_LENGTH - 1] = '\0';
+ result = msg_with_context;
+ }
+ }
+ }
+
+ jsonp_error_set(error, line, col, pos, code, "%s", result);
+}
+
+/*** lexical analyzer ***/
+
+static void stream_init(stream_t *stream, get_func get, void *data) {
+ stream->get = get;
+ stream->data = data;
+ stream->buffer[0] = '\0';
+ stream->buffer_pos = 0;
+
+ stream->state = STREAM_STATE_OK;
+ stream->line = 1;
+ stream->column = 0;
+ stream->position = 0;
+}
+
+static int stream_get(stream_t *stream, json_error_t *error) {
+ int c;
+
+ if (stream->state != STREAM_STATE_OK)
+ return stream->state;
+
+ if (!stream->buffer[stream->buffer_pos]) {
+ c = stream->get(stream->data);
+ if (c == EOF) {
+ stream->state = STREAM_STATE_EOF;
+ return STREAM_STATE_EOF;
+ }
+
+ stream->buffer[0] = c;
+ stream->buffer_pos = 0;
+
+ if (0x80 <= c && c <= 0xFF) {
+ /* multi-byte UTF-8 sequence */
+ size_t i, count;
+
+ count = utf8_check_first(c);
+ if (!count)
+ goto out;
+
+ assert(count >= 2);
+
+ for (i = 1; i < count; i++)
+ stream->buffer[i] = stream->get(stream->data);
+
+ if (!utf8_check_full(stream->buffer, count, NULL))
+ goto out;
+
+ stream->buffer[count] = '\0';
+ } else
+ stream->buffer[1] = '\0';
+ }
+
+ c = stream->buffer[stream->buffer_pos++];
+
+ stream->position++;
+ if (c == '\n') {
+ stream->line++;
+ stream->last_column = stream->column;
+ stream->column = 0;
+ } else if (utf8_check_first(c)) {
+ /* track the Unicode character column, so increment only if
+ this is the first character of a UTF-8 sequence */
+ stream->column++;
+ }
+
+ return c;
+
+out:
+ stream->state = STREAM_STATE_ERROR;
+ error_set(error, stream_to_lex(stream), json_error_invalid_utf8,
+ "unable to decode byte 0x%x", c);
+ return STREAM_STATE_ERROR;
+}
+
+static void stream_unget(stream_t *stream, int c) {
+ if (c == STREAM_STATE_EOF || c == STREAM_STATE_ERROR)
+ return;
+
+ stream->position--;
+ if (c == '\n') {
+ stream->line--;
+ stream->column = stream->last_column;
+ } else if (utf8_check_first(c))
+ stream->column--;
+
+ assert(stream->buffer_pos > 0);
+ stream->buffer_pos--;
+ assert(stream->buffer[stream->buffer_pos] == c);
+}
+
+static int lex_get(lex_t *lex, json_error_t *error) {
+ return stream_get(&lex->stream, error);
+}
+
+static void lex_save(lex_t *lex, int c) { strbuffer_append_byte(&lex->saved_text, c); }
+
+static int lex_get_save(lex_t *lex, json_error_t *error) {
+ int c = stream_get(&lex->stream, error);
+ if (c != STREAM_STATE_EOF && c != STREAM_STATE_ERROR)
+ lex_save(lex, c);
+ return c;
+}
+
+static void lex_unget(lex_t *lex, int c) { stream_unget(&lex->stream, c); }
+
+static void lex_unget_unsave(lex_t *lex, int c) {
+ if (c != STREAM_STATE_EOF && c != STREAM_STATE_ERROR) {
+/* Since we treat warnings as errors, when assertions are turned
+ * off the "d" variable would be set but never used. Which is
+ * treated as an error by GCC.
+ */
+#ifndef NDEBUG
+ char d;
+#endif
+ stream_unget(&lex->stream, c);
+#ifndef NDEBUG
+ d =
+#endif
+ strbuffer_pop(&lex->saved_text);
+ assert(c == d);
+ }
+}
+
+static void lex_save_cached(lex_t *lex) {
+ while (lex->stream.buffer[lex->stream.buffer_pos] != '\0') {
+ lex_save(lex, lex->stream.buffer[lex->stream.buffer_pos]);
+ lex->stream.buffer_pos++;
+ lex->stream.position++;
+ }
+}
+
+static void lex_free_string(lex_t *lex) {
+ jsonp_free(lex->value.string.val);
+ lex->value.string.val = NULL;
+ lex->value.string.len = 0;
+}
+
+/* assumes that str points to 'u' plus at least 4 valid hex digits */
+static int32_t decode_unicode_escape(const char *str) {
+ int i;
+ int32_t value = 0;
+
+ assert(str[0] == 'u');
+
+ for (i = 1; i <= 4; i++) {
+ char c = str[i];
+ value <<= 4;
+ if (l_isdigit(c))
+ value += c - '0';
+ else if (l_islower(c))
+ value += c - 'a' + 10;
+ else if (l_isupper(c))
+ value += c - 'A' + 10;
+ else
+ return -1;
+ }
+
+ return value;
+}
+
+static void lex_scan_string(lex_t *lex, json_error_t *error) {
+ int c;
+ const char *p;
+ char *t;
+ int i;
+
+ lex->value.string.val = NULL;
+ lex->token = TOKEN_INVALID;
+
+ c = lex_get_save(lex, error);
+
+ while (c != '"') {
+ if (c == STREAM_STATE_ERROR)
+ goto out;
+
+ else if (c == STREAM_STATE_EOF) {
+ error_set(error, lex, json_error_premature_end_of_input,
+ "premature end of input");
+ goto out;
+ }
+
+ else if (0 <= c && c <= 0x1F) {
+ /* control character */
+ lex_unget_unsave(lex, c);
+ if (c == '\n')
+ error_set(error, lex, json_error_invalid_syntax, "unexpected newline");
+ else
+ error_set(error, lex, json_error_invalid_syntax, "control character 0x%x",
+ c);
+ goto out;
+ }
+
+ else if (c == '\\') {
+ c = lex_get_save(lex, error);
+ if (c == 'u') {
+ c = lex_get_save(lex, error);
+ for (i = 0; i < 4; i++) {
+ if (!l_isxdigit(c)) {
+ error_set(error, lex, json_error_invalid_syntax,
+ "invalid escape");
+ goto out;
+ }
+ c = lex_get_save(lex, error);
+ }
+ } else if (c == '"' || c == '\\' || c == '/' || c == 'b' || c == 'f' ||
+ c == 'n' || c == 'r' || c == 't')
+ c = lex_get_save(lex, error);
+ else {
+ error_set(error, lex, json_error_invalid_syntax, "invalid escape");
+ goto out;
+ }
+ } else
+ c = lex_get_save(lex, error);
+ }
+
+ /* the actual value is at most of the same length as the source
+ string, because:
+ - shortcut escapes (e.g. "\t") (length 2) are converted to 1 byte
+ - a single \uXXXX escape (length 6) is converted to at most 3 bytes
+ - two \uXXXX escapes (length 12) forming an UTF-16 surrogate pair
+ are converted to 4 bytes
+ */
+ t = jsonp_malloc(lex->saved_text.length + 1);
+ if (!t) {
+ /* this is not very nice, since TOKEN_INVALID is returned */
+ goto out;
+ }
+ lex->value.string.val = t;
+
+ /* + 1 to skip the " */
+ p = strbuffer_value(&lex->saved_text) + 1;
+
+ while (*p != '"') {
+ if (*p == '\\') {
+ p++;
+ if (*p == 'u') {
+ size_t length;
+ int32_t value;
+
+ value = decode_unicode_escape(p);
+ if (value < 0) {
+ error_set(error, lex, json_error_invalid_syntax,
+ "invalid Unicode escape '%.6s'", p - 1);
+ goto out;
+ }
+ p += 5;
+
+ if (0xD800 <= value && value <= 0xDBFF) {
+ /* surrogate pair */
+ if (*p == '\\' && *(p + 1) == 'u') {
+ int32_t value2 = decode_unicode_escape(++p);
+ if (value2 < 0) {
+ error_set(error, lex, json_error_invalid_syntax,
+ "invalid Unicode escape '%.6s'", p - 1);
+ goto out;
+ }
+ p += 5;
+
+ if (0xDC00 <= value2 && value2 <= 0xDFFF) {
+ /* valid second surrogate */
+ value =
+ ((value - 0xD800) << 10) + (value2 - 0xDC00) + 0x10000;
+ } else {
+ /* invalid second surrogate */
+ error_set(error, lex, json_error_invalid_syntax,
+ "invalid Unicode '\\u%04X\\u%04X'", value, value2);
+ goto out;
+ }
+ } else {
+ /* no second surrogate */
+ error_set(error, lex, json_error_invalid_syntax,
+ "invalid Unicode '\\u%04X'", value);
+ goto out;
+ }
+ } else if (0xDC00 <= value && value <= 0xDFFF) {
+ error_set(error, lex, json_error_invalid_syntax,
+ "invalid Unicode '\\u%04X'", value);
+ goto out;
+ }
+
+ if (utf8_encode(value, t, &length))
+ assert(0);
+ t += length;
+ } else {
+ switch (*p) {
+ case '"':
+ case '\\':
+ case '/':
+ *t = *p;
+ break;
+ case 'b':
+ *t = '\b';
+ break;
+ case 'f':
+ *t = '\f';
+ break;
+ case 'n':
+ *t = '\n';
+ break;
+ case 'r':
+ *t = '\r';
+ break;
+ case 't':
+ *t = '\t';
+ break;
+ default:
+ assert(0);
+ }
+ t++;
+ p++;
+ }
+ } else
+ *(t++) = *(p++);
+ }
+ *t = '\0';
+ lex->value.string.len = t - lex->value.string.val;
+ lex->token = TOKEN_STRING;
+ return;
+
+out:
+ lex_free_string(lex);
+}
+
+#ifndef JANSSON_USING_CMAKE /* disabled if using cmake */
+#if JSON_INTEGER_IS_LONG_LONG
+#ifdef _MSC_VER /* Microsoft Visual Studio */
+#define json_strtoint _strtoi64
+#else
+#define json_strtoint strtoll
+#endif
+#else
+#define json_strtoint strtol
+#endif
+#endif
+
+static int lex_scan_number(lex_t *lex, int c, json_error_t *error) {
+ const char *saved_text;
+ char *end;
+ double doubleval;
+
+ lex->token = TOKEN_INVALID;
+
+ if (c == '-')
+ c = lex_get_save(lex, error);
+
+ if (c == '0') {
+ c = lex_get_save(lex, error);
+ if (l_isdigit(c)) {
+ lex_unget_unsave(lex, c);
+ goto out;
+ }
+ } else if (l_isdigit(c)) {
+ do
+ c = lex_get_save(lex, error);
+ while (l_isdigit(c));
+ } else {
+ lex_unget_unsave(lex, c);
+ goto out;
+ }
+
+ if (!(lex->flags & JSON_DECODE_INT_AS_REAL) && c != '.' && c != 'E' && c != 'e') {
+ json_int_t intval;
+
+ lex_unget_unsave(lex, c);
+
+ saved_text = strbuffer_value(&lex->saved_text);
+
+ errno = 0;
+ intval = json_strtoint(saved_text, &end, 10);
+ if (errno == ERANGE) {
+ if (intval < 0)
+ error_set(error, lex, json_error_numeric_overflow,
+ "too big negative integer");
+ else
+ error_set(error, lex, json_error_numeric_overflow, "too big integer");
+ goto out;
+ }
+
+ assert(end == saved_text + lex->saved_text.length);
+
+ lex->token = TOKEN_INTEGER;
+ lex->value.integer = intval;
+ return 0;
+ }
+
+ if (c == '.') {
+ c = lex_get(lex, error);
+ if (!l_isdigit(c)) {
+ lex_unget(lex, c);
+ goto out;
+ }
+ lex_save(lex, c);
+
+ do
+ c = lex_get_save(lex, error);
+ while (l_isdigit(c));
+ }
+
+ if (c == 'E' || c == 'e') {
+ c = lex_get_save(lex, error);
+ if (c == '+' || c == '-')
+ c = lex_get_save(lex, error);
+
+ if (!l_isdigit(c)) {
+ lex_unget_unsave(lex, c);
+ goto out;
+ }
+
+ do
+ c = lex_get_save(lex, error);
+ while (l_isdigit(c));
+ }
+
+ lex_unget_unsave(lex, c);
+
+ if (jsonp_strtod(&lex->saved_text, &doubleval)) {
+ error_set(error, lex, json_error_numeric_overflow, "real number overflow");
+ goto out;
+ }
+
+ lex->token = TOKEN_REAL;
+ lex->value.real = doubleval;
+ return 0;
+
+out:
+ return -1;
+}
+
+static int lex_scan(lex_t *lex, json_error_t *error) {
+ int c;
+
+ strbuffer_clear(&lex->saved_text);
+
+ if (lex->token == TOKEN_STRING)
+ lex_free_string(lex);
+
+ do
+ c = lex_get(lex, error);
+ while (c == ' ' || c == '\t' || c == '\n' || c == '\r');
+
+ if (c == STREAM_STATE_EOF) {
+ lex->token = TOKEN_EOF;
+ goto out;
+ }
+
+ if (c == STREAM_STATE_ERROR) {
+ lex->token = TOKEN_INVALID;
+ goto out;
+ }
+
+ lex_save(lex, c);
+
+ if (c == '{' || c == '}' || c == '[' || c == ']' || c == ':' || c == ',')
+ lex->token = c;
+
+ else if (c == '"')
+ lex_scan_string(lex, error);
+
+ else if (l_isdigit(c) || c == '-') {
+ if (lex_scan_number(lex, c, error))
+ goto out;
+ }
+
+ else if (l_isalpha(c)) {
+ /* eat up the whole identifier for clearer error messages */
+ const char *saved_text;
+
+ do
+ c = lex_get_save(lex, error);
+ while (l_isalpha(c));
+ lex_unget_unsave(lex, c);
+
+ saved_text = strbuffer_value(&lex->saved_text);
+
+ if (strcmp(saved_text, "true") == 0)
+ lex->token = TOKEN_TRUE;
+ else if (strcmp(saved_text, "false") == 0)
+ lex->token = TOKEN_FALSE;
+ else if (strcmp(saved_text, "null") == 0)
+ lex->token = TOKEN_NULL;
+ else
+ lex->token = TOKEN_INVALID;
+ }
+
+ else {
+ /* save the rest of the input UTF-8 sequence to get an error
+ message of valid UTF-8 */
+ lex_save_cached(lex);
+ lex->token = TOKEN_INVALID;
+ }
+
+out:
+ return lex->token;
+}
+
+static char *lex_steal_string(lex_t *lex, size_t *out_len) {
+ char *result = NULL;
+ if (lex->token == TOKEN_STRING) {
+ result = lex->value.string.val;
+ *out_len = lex->value.string.len;
+ lex->value.string.val = NULL;
+ lex->value.string.len = 0;
+ }
+ return result;
+}
+
+static int lex_init(lex_t *lex, get_func get, size_t flags, void *data) {
+ stream_init(&lex->stream, get, data);
+ if (strbuffer_init(&lex->saved_text))
+ return -1;
+
+ lex->flags = flags;
+ lex->token = TOKEN_INVALID;
+ return 0;
+}
+
+static void lex_close(lex_t *lex) {
+ if (lex->token == TOKEN_STRING)
+ lex_free_string(lex);
+ strbuffer_close(&lex->saved_text);
+}
+
+/*** parser ***/
+
+static json_t *parse_value(lex_t *lex, size_t flags, json_error_t *error);
+
+static json_t *parse_object(lex_t *lex, size_t flags, json_error_t *error) {
+ json_t *object = json_object();
+ if (!object)
+ return NULL;
+
+ lex_scan(lex, error);
+ if (lex->token == '}')
+ return object;
+
+ while (1) {
+ char *key;
+ size_t len;
+ json_t *value;
+
+ if (lex->token != TOKEN_STRING) {
+ error_set(error, lex, json_error_invalid_syntax, "string or '}' expected");
+ goto error;
+ }
+
+ key = lex_steal_string(lex, &len);
+ if (!key)
+ return NULL;
+ if (memchr(key, '\0', len)) {
+ jsonp_free(key);
+ error_set(error, lex, json_error_null_byte_in_key,
+ "NUL byte in object key not supported");
+ goto error;
+ }
+
+ if (flags & JSON_REJECT_DUPLICATES) {
+ if (json_object_getn(object, key, len)) {
+ jsonp_free(key);
+ error_set(error, lex, json_error_duplicate_key, "duplicate object key");
+ goto error;
+ }
+ }
+
+ lex_scan(lex, error);
+ if (lex->token != ':') {
+ jsonp_free(key);
+ error_set(error, lex, json_error_invalid_syntax, "':' expected");
+ goto error;
+ }
+
+ lex_scan(lex, error);
+ value = parse_value(lex, flags, error);
+ if (!value) {
+ jsonp_free(key);
+ goto error;
+ }
+
+ if (json_object_setn_new_nocheck(object, key, len, value)) {
+ jsonp_free(key);
+ goto error;
+ }
+
+ jsonp_free(key);
+
+ lex_scan(lex, error);
+ if (lex->token != ',')
+ break;
+
+ lex_scan(lex, error);
+ }
+
+ if (lex->token != '}') {
+ error_set(error, lex, json_error_invalid_syntax, "'}' expected");
+ goto error;
+ }
+
+ return object;
+
+error:
+ json_decref(object);
+ return NULL;
+}
+
+static json_t *parse_array(lex_t *lex, size_t flags, json_error_t *error) {
+ json_t *array = json_array();
+ if (!array)
+ return NULL;
+
+ lex_scan(lex, error);
+ if (lex->token == ']')
+ return array;
+
+ while (lex->token) {
+ json_t *elem = parse_value(lex, flags, error);
+ if (!elem)
+ goto error;
+
+ if (json_array_append_new(array, elem)) {
+ goto error;
+ }
+
+ lex_scan(lex, error);
+ if (lex->token != ',')
+ break;
+
+ lex_scan(lex, error);
+ }
+
+ if (lex->token != ']') {
+ error_set(error, lex, json_error_invalid_syntax, "']' expected");
+ goto error;
+ }
+
+ return array;
+
+error:
+ json_decref(array);
+ return NULL;
+}
+
+static json_t *parse_value(lex_t *lex, size_t flags, json_error_t *error) {
+ json_t *json;
+
+ lex->depth++;
+ if (lex->depth > JSON_PARSER_MAX_DEPTH) {
+ error_set(error, lex, json_error_stack_overflow, "maximum parsing depth reached");
+ return NULL;
+ }
+
+ switch (lex->token) {
+ case TOKEN_STRING: {
+ const char *value = lex->value.string.val;
+ size_t len = lex->value.string.len;
+
+ if (!(flags & JSON_ALLOW_NUL)) {
+ if (memchr(value, '\0', len)) {
+ error_set(error, lex, json_error_null_character,
+ "\\u0000 is not allowed without JSON_ALLOW_NUL");
+ return NULL;
+ }
+ }
+
+ json = jsonp_stringn_nocheck_own(value, len);
+ lex->value.string.val = NULL;
+ lex->value.string.len = 0;
+ break;
+ }
+
+ case TOKEN_INTEGER: {
+ json = json_integer(lex->value.integer);
+ break;
+ }
+
+ case TOKEN_REAL: {
+ json = json_real(lex->value.real);
+ break;
+ }
+
+ case TOKEN_TRUE:
+ json = json_true();
+ break;
+
+ case TOKEN_FALSE:
+ json = json_false();
+ break;
+
+ case TOKEN_NULL:
+ json = json_null();
+ break;
+
+ case '{':
+ json = parse_object(lex, flags, error);
+ break;
+
+ case '[':
+ json = parse_array(lex, flags, error);
+ break;
+
+ case TOKEN_INVALID:
+ error_set(error, lex, json_error_invalid_syntax, "invalid token");
+ return NULL;
+
+ default:
+ error_set(error, lex, json_error_invalid_syntax, "unexpected token");
+ return NULL;
+ }
+
+ if (!json)
+ return NULL;
+
+ lex->depth--;
+ return json;
+}
+
+static json_t *parse_json(lex_t *lex, size_t flags, json_error_t *error) {
+ json_t *result;
+
+ lex->depth = 0;
+
+ lex_scan(lex, error);
+ if (!(flags & JSON_DECODE_ANY)) {
+ if (lex->token != '[' && lex->token != '{') {
+ error_set(error, lex, json_error_invalid_syntax, "'[' or '{' expected");
+ return NULL;
+ }
+ }
+
+ result = parse_value(lex, flags, error);
+ if (!result)
+ return NULL;
+
+ if (!(flags & JSON_DISABLE_EOF_CHECK)) {
+ lex_scan(lex, error);
+ if (lex->token != TOKEN_EOF) {
+ error_set(error, lex, json_error_end_of_input_expected,
+ "end of file expected");
+ json_decref(result);
+ return NULL;
+ }
+ }
+
+ if (error) {
+ /* Save the position even though there was no error */
+ error->position = (int)lex->stream.position;
+ }
+
+ return result;
+}
+
+typedef struct {
+ const char *data;
+ size_t pos;
+} string_data_t;
+
+static int string_get(void *data) {
+ char c;
+ string_data_t *stream = (string_data_t *)data;
+ c = stream->data[stream->pos];
+ if (c == '\0')
+ return EOF;
+ else {
+ stream->pos++;
+ return (unsigned char)c;
+ }
+}
+
+json_t *json_loads(const char *string, size_t flags, json_error_t *error) {
+ lex_t lex;
+ json_t *result;
+ string_data_t stream_data;
+
+ jsonp_error_init(error, "<string>");
+
+ if (string == NULL) {
+ error_set(error, NULL, json_error_invalid_argument, "wrong arguments");
+ return NULL;
+ }
+
+ stream_data.data = string;
+ stream_data.pos = 0;
+
+ if (lex_init(&lex, string_get, flags, (void *)&stream_data))
+ return NULL;
+
+ result = parse_json(&lex, flags, error);
+
+ lex_close(&lex);
+ return result;
+}
+
+typedef struct {
+ const char *data;
+ size_t len;
+ size_t pos;
+} buffer_data_t;
+
+static int buffer_get(void *data) {
+ char c;
+ buffer_data_t *stream = data;
+ if (stream->pos >= stream->len)
+ return EOF;
+
+ c = stream->data[stream->pos];
+ stream->pos++;
+ return (unsigned char)c;
+}
+
+json_t *json_loadb(const char *buffer, size_t buflen, size_t flags, json_error_t *error) {
+ lex_t lex;
+ json_t *result;
+ buffer_data_t stream_data;
+
+ jsonp_error_init(error, "<buffer>");
+
+ if (buffer == NULL) {
+ error_set(error, NULL, json_error_invalid_argument, "wrong arguments");
+ return NULL;
+ }
+
+ stream_data.data = buffer;
+ stream_data.pos = 0;
+ stream_data.len = buflen;
+
+ if (lex_init(&lex, buffer_get, flags, (void *)&stream_data))
+ return NULL;
+
+ result = parse_json(&lex, flags, error);
+
+ lex_close(&lex);
+ return result;
+}
+
+json_t *json_loadf(FILE *input, size_t flags, json_error_t *error) {
+ lex_t lex;
+ const char *source;
+ json_t *result;
+
+ if (input == stdin)
+ source = "<stdin>";
+ else
+ source = "<stream>";
+
+ jsonp_error_init(error, source);
+
+ if (input == NULL) {
+ error_set(error, NULL, json_error_invalid_argument, "wrong arguments");
+ return NULL;
+ }
+
+ if (lex_init(&lex, (get_func)fgetc, flags, input))
+ return NULL;
+
+ result = parse_json(&lex, flags, error);
+
+ lex_close(&lex);
+ return result;
+}
+
+static int fd_get_func(int *fd) {
+#ifdef HAVE_UNISTD_H
+ uint8_t c;
+ if (read(*fd, &c, 1) == 1)
+ return c;
+#endif
+ return EOF;
+}
+
+json_t *json_loadfd(int input, size_t flags, json_error_t *error) {
+ lex_t lex;
+ const char *source;
+ json_t *result;
+
+#ifdef HAVE_UNISTD_H
+ if (input == STDIN_FILENO)
+ source = "<stdin>";
+ else
+#endif
+ source = "<stream>";
+
+ jsonp_error_init(error, source);
+
+ if (input < 0) {
+ error_set(error, NULL, json_error_invalid_argument, "wrong arguments");
+ return NULL;
+ }
+
+ if (lex_init(&lex, (get_func)fd_get_func, flags, &input))
+ return NULL;
+
+ result = parse_json(&lex, flags, error);
+
+ lex_close(&lex);
+ return result;
+}
+
+json_t *json_load_file(const char *path, size_t flags, json_error_t *error) {
+ json_t *result;
+ FILE *fp;
+
+ jsonp_error_init(error, path);
+
+ if (path == NULL) {
+ error_set(error, NULL, json_error_invalid_argument, "wrong arguments");
+ return NULL;
+ }
+
+ fp = fopen(path, "rb");
+ if (!fp) {
+ error_set(error, NULL, json_error_cannot_open_file, "unable to open %s: %s", path,
+ strerror(errno));
+ return NULL;
+ }
+
+ result = json_loadf(fp, flags, error);
+
+ fclose(fp);
+ return result;
+}
+
+#define MAX_BUF_LEN 1024
+
+typedef struct {
+ char data[MAX_BUF_LEN];
+ size_t len;
+ size_t pos;
+ json_load_callback_t callback;
+ void *arg;
+} callback_data_t;
+
+static int callback_get(void *data) {
+ char c;
+ callback_data_t *stream = data;
+
+ if (stream->pos >= stream->len) {
+ stream->pos = 0;
+ stream->len = stream->callback(stream->data, MAX_BUF_LEN, stream->arg);
+ if (stream->len == 0 || stream->len == (size_t)-1)
+ return EOF;
+ }
+
+ c = stream->data[stream->pos];
+ stream->pos++;
+ return (unsigned char)c;
+}
+
+json_t *json_load_callback(json_load_callback_t callback, void *arg, size_t flags,
+ json_error_t *error) {
+ lex_t lex;
+ json_t *result;
+
+ callback_data_t stream_data;
+
+ memset(&stream_data, 0, sizeof(stream_data));
+ stream_data.callback = callback;
+ stream_data.arg = arg;
+
+ jsonp_error_init(error, "<callback>");
+
+ if (callback == NULL) {
+ error_set(error, NULL, json_error_invalid_argument, "wrong arguments");
+ return NULL;
+ }
+
+ if (lex_init(&lex, (get_func)callback_get, flags, &stream_data))
+ return NULL;
+
+ result = parse_json(&lex, flags, error);
+
+ lex_close(&lex);
+ return result;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/lookup3.h b/src/fluent-bit/lib/jansson-e23f558/src/lookup3.h
new file mode 100644
index 000000000..9b39aa1ce
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/lookup3.h
@@ -0,0 +1,382 @@
+// clang-format off
+/*
+-------------------------------------------------------------------------------
+lookup3.c, by Bob Jenkins, May 2006, Public Domain.
+
+These are functions for producing 32-bit hashes for hash table lookup.
+hashword(), hashlittle(), hashlittle2(), hashbig(), mix(), and final()
+are externally useful functions. Routines to test the hash are included
+if SELF_TEST is defined. You can use this free for any purpose. It's in
+the public domain. It has no warranty.
+
+You probably want to use hashlittle(). hashlittle() and hashbig()
+hash byte arrays. hashlittle() is is faster than hashbig() on
+little-endian machines. Intel and AMD are little-endian machines.
+On second thought, you probably want hashlittle2(), which is identical to
+hashlittle() except it returns two 32-bit hashes for the price of one.
+You could implement hashbig2() if you wanted but I haven't bothered here.
+
+If you want to find a hash of, say, exactly 7 integers, do
+ a = i1; b = i2; c = i3;
+ mix(a,b,c);
+ a += i4; b += i5; c += i6;
+ mix(a,b,c);
+ a += i7;
+ final(a,b,c);
+then use c as the hash value. If you have a variable length array of
+4-byte integers to hash, use hashword(). If you have a byte array (like
+a character string), use hashlittle(). If you have several byte arrays, or
+a mix of things, see the comments above hashlittle().
+
+Why is this so big? I read 12 bytes at a time into 3 4-byte integers,
+then mix those integers. This is fast (you can do a lot more thorough
+mixing with 12*3 instructions on 3 integers than you can with 3 instructions
+on 1 byte), but shoehorning those bytes into integers efficiently is messy.
+-------------------------------------------------------------------------------
+*/
+
+#include <stdlib.h>
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#ifdef HAVE_STDINT_H
+#include <stdint.h> /* defines uint32_t etc */
+#endif
+
+#ifdef HAVE_SYS_PARAM_H
+#include <sys/param.h> /* attempt to define endianness */
+#endif
+
+#ifdef HAVE_ENDIAN_H
+# include <endian.h> /* attempt to define endianness */
+#endif
+
+/*
+ * My best guess at if you are big-endian or little-endian. This may
+ * need adjustment.
+ */
+#if (defined(__BYTE_ORDER) && defined(__LITTLE_ENDIAN) && \
+ __BYTE_ORDER == __LITTLE_ENDIAN) || \
+ (defined(i386) || defined(__i386__) || defined(__i486__) || \
+ defined(__i586__) || defined(__i686__) || defined(vax) || defined(MIPSEL))
+# define HASH_LITTLE_ENDIAN 1
+# define HASH_BIG_ENDIAN 0
+#elif (defined(__BYTE_ORDER) && defined(__BIG_ENDIAN) && \
+ __BYTE_ORDER == __BIG_ENDIAN) || \
+ (defined(sparc) || defined(POWERPC) || defined(mc68000) || defined(sel))
+# define HASH_LITTLE_ENDIAN 0
+# define HASH_BIG_ENDIAN 1
+#else
+# define HASH_LITTLE_ENDIAN 0
+# define HASH_BIG_ENDIAN 0
+#endif
+
+#define hashsize(n) ((size_t)1<<(n))
+#define hashmask(n) (hashsize(n)-1)
+#define rot(x,k) (((x)<<(k)) | ((x)>>(32-(k))))
+
+/*
+-------------------------------------------------------------------------------
+mix -- mix 3 32-bit values reversibly.
+
+This is reversible, so any information in (a,b,c) before mix() is
+still in (a,b,c) after mix().
+
+If four pairs of (a,b,c) inputs are run through mix(), or through
+mix() in reverse, there are at least 32 bits of the output that
+are sometimes the same for one pair and different for another pair.
+This was tested for:
+* pairs that differed by one bit, by two bits, in any combination
+ of top bits of (a,b,c), or in any combination of bottom bits of
+ (a,b,c).
+* "differ" is defined as +, -, ^, or ~^. For + and -, I transformed
+ the output delta to a Gray code (a^(a>>1)) so a string of 1's (as
+ is commonly produced by subtraction) look like a single 1-bit
+ difference.
+* the base values were pseudorandom, all zero but one bit set, or
+ all zero plus a counter that starts at zero.
+
+Some k values for my "a-=c; a^=rot(c,k); c+=b;" arrangement that
+satisfy this are
+ 4 6 8 16 19 4
+ 9 15 3 18 27 15
+ 14 9 3 7 17 3
+Well, "9 15 3 18 27 15" didn't quite get 32 bits diffing
+for "differ" defined as + with a one-bit base and a two-bit delta. I
+used http://burtleburtle.net/bob/hash/avalanche.html to choose
+the operations, constants, and arrangements of the variables.
+
+This does not achieve avalanche. There are input bits of (a,b,c)
+that fail to affect some output bits of (a,b,c), especially of a. The
+most thoroughly mixed value is c, but it doesn't really even achieve
+avalanche in c.
+
+This allows some parallelism. Read-after-writes are good at doubling
+the number of bits affected, so the goal of mixing pulls in the opposite
+direction as the goal of parallelism. I did what I could. Rotates
+seem to cost as much as shifts on every machine I could lay my hands
+on, and rotates are much kinder to the top and bottom bits, so I used
+rotates.
+-------------------------------------------------------------------------------
+*/
+#define mix(a,b,c) \
+{ \
+ a -= c; a ^= rot(c, 4); c += b; \
+ b -= a; b ^= rot(a, 6); a += c; \
+ c -= b; c ^= rot(b, 8); b += a; \
+ a -= c; a ^= rot(c,16); c += b; \
+ b -= a; b ^= rot(a,19); a += c; \
+ c -= b; c ^= rot(b, 4); b += a; \
+}
+
+/*
+-------------------------------------------------------------------------------
+final -- final mixing of 3 32-bit values (a,b,c) into c
+
+Pairs of (a,b,c) values differing in only a few bits will usually
+produce values of c that look totally different. This was tested for
+* pairs that differed by one bit, by two bits, in any combination
+ of top bits of (a,b,c), or in any combination of bottom bits of
+ (a,b,c).
+* "differ" is defined as +, -, ^, or ~^. For + and -, I transformed
+ the output delta to a Gray code (a^(a>>1)) so a string of 1's (as
+ is commonly produced by subtraction) look like a single 1-bit
+ difference.
+* the base values were pseudorandom, all zero but one bit set, or
+ all zero plus a counter that starts at zero.
+
+These constants passed:
+ 14 11 25 16 4 14 24
+ 12 14 25 16 4 14 24
+and these came close:
+ 4 8 15 26 3 22 24
+ 10 8 15 26 3 22 24
+ 11 8 15 26 3 22 24
+-------------------------------------------------------------------------------
+*/
+#define final(a,b,c) \
+{ \
+ c ^= b; c -= rot(b,14); \
+ a ^= c; a -= rot(c,11); \
+ b ^= a; b -= rot(a,25); \
+ c ^= b; c -= rot(b,16); \
+ a ^= c; a -= rot(c,4); \
+ b ^= a; b -= rot(a,14); \
+ c ^= b; c -= rot(b,24); \
+}
+
+/*
+-------------------------------------------------------------------------------
+hashlittle() -- hash a variable-length key into a 32-bit value
+ k : the key (the unaligned variable-length array of bytes)
+ length : the length of the key, counting by bytes
+ initval : can be any 4-byte value
+Returns a 32-bit value. Every bit of the key affects every bit of
+the return value. Two keys differing by one or two bits will have
+totally different hash values.
+
+The best hash table sizes are powers of 2. There is no need to do
+mod a prime (mod is sooo slow!). If you need less than 32 bits,
+use a bitmask. For example, if you need only 10 bits, do
+ h = (h & hashmask(10));
+In which case, the hash table should have hashsize(10) elements.
+
+If you are hashing n strings (uint8_t **)k, do it like this:
+ for (i=0, h=0; i<n; ++i) h = hashlittle( k[i], len[i], h);
+
+By Bob Jenkins, 2006. bob_jenkins@burtleburtle.net. You may use this
+code any way you wish, private, educational, or commercial. It's free.
+
+Use for hash table lookup, or anything where one collision in 2^^32 is
+acceptable. Do NOT use for cryptographic purposes.
+-------------------------------------------------------------------------------
+*/
+
+static uint32_t hashlittle(const void *key, size_t length, uint32_t initval)
+{
+ uint32_t a,b,c; /* internal state */
+ union { const void *ptr; size_t i; } u; /* needed for Mac Powerbook G4 */
+
+ /* Set up the internal state */
+ a = b = c = 0xdeadbeef + ((uint32_t)length) + initval;
+
+ u.ptr = key;
+ if (HASH_LITTLE_ENDIAN && ((u.i & 0x3) == 0)) {
+ const uint32_t *k = (const uint32_t *)key; /* read 32-bit chunks */
+
+/* Detect Valgrind or AddressSanitizer */
+#ifdef VALGRIND
+# define NO_MASKING_TRICK 1
+#else
+# if defined(__has_feature) /* Clang */
+# if __has_feature(address_sanitizer) /* is ASAN enabled? */
+# define NO_MASKING_TRICK 1
+# endif
+# else
+# if defined(__SANITIZE_ADDRESS__) /* GCC 4.8.x, is ASAN enabled? */
+# define NO_MASKING_TRICK 1
+# endif
+# endif
+#endif
+
+#ifdef NO_MASKING_TRICK
+ const uint8_t *k8;
+#endif
+
+ /*------ all but last block: aligned reads and affect 32 bits of (a,b,c) */
+ while (length > 12)
+ {
+ a += k[0];
+ b += k[1];
+ c += k[2];
+ mix(a,b,c);
+ length -= 12;
+ k += 3;
+ }
+
+ /*----------------------------- handle the last (probably partial) block */
+ /*
+ * "k[2]&0xffffff" actually reads beyond the end of the string, but
+ * then masks off the part it's not allowed to read. Because the
+ * string is aligned, the masked-off tail is in the same word as the
+ * rest of the string. Every machine with memory protection I've seen
+ * does it on word boundaries, so is OK with this. But VALGRIND will
+ * still catch it and complain. The masking trick does make the hash
+ * noticeably faster for short strings (like English words).
+ */
+#ifndef NO_MASKING_TRICK
+
+ switch(length)
+ {
+ case 12: c+=k[2]; b+=k[1]; a+=k[0]; break;
+ case 11: c+=k[2]&0xffffff; b+=k[1]; a+=k[0]; break;
+ case 10: c+=k[2]&0xffff; b+=k[1]; a+=k[0]; break;
+ case 9 : c+=k[2]&0xff; b+=k[1]; a+=k[0]; break;
+ case 8 : b+=k[1]; a+=k[0]; break;
+ case 7 : b+=k[1]&0xffffff; a+=k[0]; break;
+ case 6 : b+=k[1]&0xffff; a+=k[0]; break;
+ case 5 : b+=k[1]&0xff; a+=k[0]; break;
+ case 4 : a+=k[0]; break;
+ case 3 : a+=k[0]&0xffffff; break;
+ case 2 : a+=k[0]&0xffff; break;
+ case 1 : a+=k[0]&0xff; break;
+ case 0 : return c; /* zero length strings require no mixing */
+ }
+
+#else /* make valgrind happy */
+
+ k8 = (const uint8_t *)k;
+ switch(length)
+ {
+ case 12: c+=k[2]; b+=k[1]; a+=k[0]; break;
+ case 11: c+=((uint32_t)k8[10])<<16; /* fall through */
+ case 10: c+=((uint32_t)k8[9])<<8; /* fall through */
+ case 9 : c+=k8[8]; /* fall through */
+ case 8 : b+=k[1]; a+=k[0]; break;
+ case 7 : b+=((uint32_t)k8[6])<<16; /* fall through */
+ case 6 : b+=((uint32_t)k8[5])<<8; /* fall through */
+ case 5 : b+=k8[4]; /* fall through */
+ case 4 : a+=k[0]; break;
+ case 3 : a+=((uint32_t)k8[2])<<16; /* fall through */
+ case 2 : a+=((uint32_t)k8[1])<<8; /* fall through */
+ case 1 : a+=k8[0]; break;
+ case 0 : return c;
+ }
+
+#endif /* !valgrind */
+
+ } else if (HASH_LITTLE_ENDIAN && ((u.i & 0x1) == 0)) {
+ const uint16_t *k = (const uint16_t *)key; /* read 16-bit chunks */
+ const uint8_t *k8;
+
+ /*--------------- all but last block: aligned reads and different mixing */
+ while (length > 12)
+ {
+ a += k[0] + (((uint32_t)k[1])<<16);
+ b += k[2] + (((uint32_t)k[3])<<16);
+ c += k[4] + (((uint32_t)k[5])<<16);
+ mix(a,b,c);
+ length -= 12;
+ k += 6;
+ }
+
+ /*----------------------------- handle the last (probably partial) block */
+ k8 = (const uint8_t *)k;
+ switch(length)
+ {
+ case 12: c+=k[4]+(((uint32_t)k[5])<<16);
+ b+=k[2]+(((uint32_t)k[3])<<16);
+ a+=k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 11: c+=((uint32_t)k8[10])<<16; /* fall through */
+ case 10: c+=k[4];
+ b+=k[2]+(((uint32_t)k[3])<<16);
+ a+=k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 9 : c+=k8[8]; /* fall through */
+ case 8 : b+=k[2]+(((uint32_t)k[3])<<16);
+ a+=k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 7 : b+=((uint32_t)k8[6])<<16; /* fall through */
+ case 6 : b+=k[2];
+ a+=k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 5 : b+=k8[4]; /* fall through */
+ case 4 : a+=k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 3 : a+=((uint32_t)k8[2])<<16; /* fall through */
+ case 2 : a+=k[0];
+ break;
+ case 1 : a+=k8[0];
+ break;
+ case 0 : return c; /* zero length requires no mixing */
+ }
+
+ } else { /* need to read the key one byte at a time */
+ const uint8_t *k = (const uint8_t *)key;
+
+ /*--------------- all but the last block: affect some 32 bits of (a,b,c) */
+ while (length > 12)
+ {
+ a += k[0];
+ a += ((uint32_t)k[1])<<8;
+ a += ((uint32_t)k[2])<<16;
+ a += ((uint32_t)k[3])<<24;
+ b += k[4];
+ b += ((uint32_t)k[5])<<8;
+ b += ((uint32_t)k[6])<<16;
+ b += ((uint32_t)k[7])<<24;
+ c += k[8];
+ c += ((uint32_t)k[9])<<8;
+ c += ((uint32_t)k[10])<<16;
+ c += ((uint32_t)k[11])<<24;
+ mix(a,b,c);
+ length -= 12;
+ k += 12;
+ }
+
+ /*-------------------------------- last block: affect all 32 bits of (c) */
+ switch(length) /* all the case statements fall through */
+ {
+ case 12: c+=((uint32_t)k[11])<<24; /* fall through */
+ case 11: c+=((uint32_t)k[10])<<16; /* fall through */
+ case 10: c+=((uint32_t)k[9])<<8; /* fall through */
+ case 9 : c+=k[8]; /* fall through */
+ case 8 : b+=((uint32_t)k[7])<<24; /* fall through */
+ case 7 : b+=((uint32_t)k[6])<<16; /* fall through */
+ case 6 : b+=((uint32_t)k[5])<<8; /* fall through */
+ case 5 : b+=k[4]; /* fall through */
+ case 4 : a+=((uint32_t)k[3])<<24; /* fall through */
+ case 3 : a+=((uint32_t)k[2])<<16; /* fall through */
+ case 2 : a+=((uint32_t)k[1])<<8; /* fall through */
+ case 1 : a+=k[0];
+ break;
+ case 0 : return c;
+ }
+ }
+
+ final(a,b,c);
+ return c;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/memory.c b/src/fluent-bit/lib/jansson-e23f558/src/memory.c
new file mode 100644
index 000000000..2733035af
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/memory.c
@@ -0,0 +1,61 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ * Copyright (c) 2011-2012 Basile Starynkevitch <basile@starynkevitch.net>
+ *
+ * Jansson is free software; you can redistribute it and/or modify it
+ * under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include <stdlib.h>
+#include <string.h>
+
+#include "jansson.h"
+#include "jansson_private.h"
+
+/* C89 allows these to be macros */
+#undef malloc
+#undef free
+
+/* memory function pointers */
+static json_malloc_t do_malloc = malloc;
+static json_free_t do_free = free;
+
+void *jsonp_malloc(size_t size) {
+ if (!size)
+ return NULL;
+
+ return (*do_malloc)(size);
+}
+
+void jsonp_free(void *ptr) {
+ if (!ptr)
+ return;
+
+ (*do_free)(ptr);
+}
+
+char *jsonp_strdup(const char *str) { return jsonp_strndup(str, strlen(str)); }
+
+char *jsonp_strndup(const char *str, size_t len) {
+ char *new_str;
+
+ new_str = jsonp_malloc(len + 1);
+ if (!new_str)
+ return NULL;
+
+ memcpy(new_str, str, len);
+ new_str[len] = '\0';
+ return new_str;
+}
+
+void json_set_alloc_funcs(json_malloc_t malloc_fn, json_free_t free_fn) {
+ do_malloc = malloc_fn;
+ do_free = free_fn;
+}
+
+void json_get_alloc_funcs(json_malloc_t *malloc_fn, json_free_t *free_fn) {
+ if (malloc_fn)
+ *malloc_fn = do_malloc;
+ if (free_fn)
+ *free_fn = do_free;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/pack_unpack.c b/src/fluent-bit/lib/jansson-e23f558/src/pack_unpack.c
new file mode 100644
index 000000000..a796ed4fe
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/pack_unpack.c
@@ -0,0 +1,936 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ * Copyright (c) 2011-2012 Graeme Smecher <graeme.smecher@mail.mcgill.ca>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "jansson.h"
+#include "jansson_private.h"
+#include "utf.h"
+#include <string.h>
+
+typedef struct {
+ int line;
+ int column;
+ size_t pos;
+ char token;
+} token_t;
+
+typedef struct {
+ const char *start;
+ const char *fmt;
+ token_t prev_token;
+ token_t token;
+ token_t next_token;
+ json_error_t *error;
+ size_t flags;
+ int line;
+ int column;
+ size_t pos;
+ int has_error;
+} scanner_t;
+
+#define token(scanner) ((scanner)->token.token)
+
+static const char *const type_names[] = {"object", "array", "string", "integer",
+ "real", "true", "false", "null"};
+
+#define type_name(x) type_names[json_typeof(x)]
+
+static const char unpack_value_starters[] = "{[siIbfFOon";
+
+static void scanner_init(scanner_t *s, json_error_t *error, size_t flags,
+ const char *fmt) {
+ s->error = error;
+ s->flags = flags;
+ s->fmt = s->start = fmt;
+ memset(&s->prev_token, 0, sizeof(token_t));
+ memset(&s->token, 0, sizeof(token_t));
+ memset(&s->next_token, 0, sizeof(token_t));
+ s->line = 1;
+ s->column = 0;
+ s->pos = 0;
+ s->has_error = 0;
+}
+
+static void next_token(scanner_t *s) {
+ const char *t;
+ s->prev_token = s->token;
+
+ if (s->next_token.line) {
+ s->token = s->next_token;
+ s->next_token.line = 0;
+ return;
+ }
+
+ if (!token(s) && !*s->fmt)
+ return;
+
+ t = s->fmt;
+ s->column++;
+ s->pos++;
+
+ /* skip space and ignored chars */
+ while (*t == ' ' || *t == '\t' || *t == '\n' || *t == ',' || *t == ':') {
+ if (*t == '\n') {
+ s->line++;
+ s->column = 1;
+ } else
+ s->column++;
+
+ s->pos++;
+ t++;
+ }
+
+ s->token.token = *t;
+ s->token.line = s->line;
+ s->token.column = s->column;
+ s->token.pos = s->pos;
+
+ if (*t)
+ t++;
+ s->fmt = t;
+}
+
+static void prev_token(scanner_t *s) {
+ s->next_token = s->token;
+ s->token = s->prev_token;
+}
+
+static void set_error(scanner_t *s, const char *source, enum json_error_code code,
+ const char *fmt, ...) {
+ va_list ap;
+ va_start(ap, fmt);
+
+ jsonp_error_vset(s->error, s->token.line, s->token.column, s->token.pos, code, fmt,
+ ap);
+
+ jsonp_error_set_source(s->error, source);
+
+ va_end(ap);
+}
+
+static json_t *pack(scanner_t *s, va_list *ap);
+
+/* ours will be set to 1 if jsonp_free() must be called for the result
+ afterwards */
+static char *read_string(scanner_t *s, va_list *ap, const char *purpose, size_t *out_len,
+ int *ours, int optional) {
+ char t;
+ strbuffer_t strbuff;
+ const char *str;
+ size_t length;
+
+ next_token(s);
+ t = token(s);
+ prev_token(s);
+
+ *ours = 0;
+ if (t != '#' && t != '%' && t != '+') {
+ /* Optimize the simple case */
+ str = va_arg(*ap, const char *);
+
+ if (!str) {
+ if (!optional) {
+ set_error(s, "<args>", json_error_null_value, "NULL %s", purpose);
+ s->has_error = 1;
+ }
+ return NULL;
+ }
+
+ length = strlen(str);
+
+ if (!utf8_check_string(str, length)) {
+ set_error(s, "<args>", json_error_invalid_utf8, "Invalid UTF-8 %s", purpose);
+ s->has_error = 1;
+ return NULL;
+ }
+
+ *out_len = length;
+ return (char *)str;
+ } else if (optional) {
+ set_error(s, "<format>", json_error_invalid_format,
+ "Cannot use '%c' on optional strings", t);
+ s->has_error = 1;
+
+ return NULL;
+ }
+
+ if (strbuffer_init(&strbuff)) {
+ set_error(s, "<internal>", json_error_out_of_memory, "Out of memory");
+ s->has_error = 1;
+ }
+
+ while (1) {
+ str = va_arg(*ap, const char *);
+ if (!str) {
+ set_error(s, "<args>", json_error_null_value, "NULL %s", purpose);
+ s->has_error = 1;
+ }
+
+ next_token(s);
+
+ if (token(s) == '#') {
+ length = va_arg(*ap, int);
+ } else if (token(s) == '%') {
+ length = va_arg(*ap, size_t);
+ } else {
+ prev_token(s);
+ length = s->has_error ? 0 : strlen(str);
+ }
+
+ if (!s->has_error && strbuffer_append_bytes(&strbuff, str, length) == -1) {
+ set_error(s, "<internal>", json_error_out_of_memory, "Out of memory");
+ s->has_error = 1;
+ }
+
+ next_token(s);
+ if (token(s) != '+') {
+ prev_token(s);
+ break;
+ }
+ }
+
+ if (s->has_error) {
+ strbuffer_close(&strbuff);
+ return NULL;
+ }
+
+ if (!utf8_check_string(strbuff.value, strbuff.length)) {
+ set_error(s, "<args>", json_error_invalid_utf8, "Invalid UTF-8 %s", purpose);
+ strbuffer_close(&strbuff);
+ s->has_error = 1;
+ return NULL;
+ }
+
+ *out_len = strbuff.length;
+ *ours = 1;
+ return strbuffer_steal_value(&strbuff);
+}
+
+static json_t *pack_object(scanner_t *s, va_list *ap) {
+ json_t *object = json_object();
+ next_token(s);
+
+ while (token(s) != '}') {
+ char *key;
+ size_t len;
+ int ours;
+ json_t *value;
+ char valueOptional;
+
+ if (!token(s)) {
+ set_error(s, "<format>", json_error_invalid_format,
+ "Unexpected end of format string");
+ goto error;
+ }
+
+ if (token(s) != 's') {
+ set_error(s, "<format>", json_error_invalid_format,
+ "Expected format 's', got '%c'", token(s));
+ goto error;
+ }
+
+ key = read_string(s, ap, "object key", &len, &ours, 0);
+
+ next_token(s);
+
+ next_token(s);
+ valueOptional = token(s);
+ prev_token(s);
+
+ value = pack(s, ap);
+ if (!value) {
+ if (ours)
+ jsonp_free(key);
+
+ if (valueOptional != '*') {
+ set_error(s, "<args>", json_error_null_value, "NULL object value");
+ s->has_error = 1;
+ }
+
+ next_token(s);
+ continue;
+ }
+
+ if (s->has_error)
+ json_decref(value);
+
+ if (!s->has_error && json_object_set_new_nocheck(object, key, value)) {
+ set_error(s, "<internal>", json_error_out_of_memory,
+ "Unable to add key \"%s\"", key);
+ s->has_error = 1;
+ }
+
+ if (ours)
+ jsonp_free(key);
+
+ next_token(s);
+ }
+
+ if (!s->has_error)
+ return object;
+
+error:
+ json_decref(object);
+ return NULL;
+}
+
+static json_t *pack_array(scanner_t *s, va_list *ap) {
+ json_t *array = json_array();
+ next_token(s);
+
+ while (token(s) != ']') {
+ json_t *value;
+ char valueOptional;
+
+ if (!token(s)) {
+ set_error(s, "<format>", json_error_invalid_format,
+ "Unexpected end of format string");
+ /* Format string errors are unrecoverable. */
+ goto error;
+ }
+
+ next_token(s);
+ valueOptional = token(s);
+ prev_token(s);
+
+ value = pack(s, ap);
+ if (!value) {
+ if (valueOptional != '*') {
+ s->has_error = 1;
+ }
+
+ next_token(s);
+ continue;
+ }
+
+ if (s->has_error)
+ json_decref(value);
+
+ if (!s->has_error && json_array_append_new(array, value)) {
+ set_error(s, "<internal>", json_error_out_of_memory,
+ "Unable to append to array");
+ s->has_error = 1;
+ }
+
+ next_token(s);
+ }
+
+ if (!s->has_error)
+ return array;
+
+error:
+ json_decref(array);
+ return NULL;
+}
+
+static json_t *pack_string(scanner_t *s, va_list *ap) {
+ char *str;
+ char t;
+ size_t len;
+ int ours;
+ int optional;
+
+ next_token(s);
+ t = token(s);
+ optional = t == '?' || t == '*';
+ if (!optional)
+ prev_token(s);
+
+ str = read_string(s, ap, "string", &len, &ours, optional);
+
+ if (!str)
+ return t == '?' && !s->has_error ? json_null() : NULL;
+
+ if (s->has_error) {
+ /* It's impossible to reach this point if ours != 0, do not free str. */
+ return NULL;
+ }
+
+ if (ours)
+ return jsonp_stringn_nocheck_own(str, len);
+
+ return json_stringn_nocheck(str, len);
+}
+
+static json_t *pack_object_inter(scanner_t *s, va_list *ap, int need_incref) {
+ json_t *json;
+ char ntoken;
+
+ next_token(s);
+ ntoken = token(s);
+
+ if (ntoken != '?' && ntoken != '*')
+ prev_token(s);
+
+ json = va_arg(*ap, json_t *);
+
+ if (json)
+ return need_incref ? json_incref(json) : json;
+
+ switch (ntoken) {
+ case '?':
+ return json_null();
+ case '*':
+ return NULL;
+ default:
+ break;
+ }
+
+ set_error(s, "<args>", json_error_null_value, "NULL object");
+ s->has_error = 1;
+ return NULL;
+}
+
+static json_t *pack_integer(scanner_t *s, json_int_t value) {
+ json_t *json = json_integer(value);
+
+ if (!json) {
+ set_error(s, "<internal>", json_error_out_of_memory, "Out of memory");
+ s->has_error = 1;
+ }
+
+ return json;
+}
+
+static json_t *pack_real(scanner_t *s, double value) {
+ /* Allocate without setting value so we can identify OOM error. */
+ json_t *json = json_real(0.0);
+
+ if (!json) {
+ set_error(s, "<internal>", json_error_out_of_memory, "Out of memory");
+ s->has_error = 1;
+
+ return NULL;
+ }
+
+ if (json_real_set(json, value)) {
+ json_decref(json);
+
+ set_error(s, "<args>", json_error_numeric_overflow,
+ "Invalid floating point value");
+ s->has_error = 1;
+
+ return NULL;
+ }
+
+ return json;
+}
+
+static json_t *pack(scanner_t *s, va_list *ap) {
+ switch (token(s)) {
+ case '{':
+ return pack_object(s, ap);
+
+ case '[':
+ return pack_array(s, ap);
+
+ case 's': /* string */
+ return pack_string(s, ap);
+
+ case 'n': /* null */
+ return json_null();
+
+ case 'b': /* boolean */
+ return va_arg(*ap, int) ? json_true() : json_false();
+
+ case 'i': /* integer from int */
+ return pack_integer(s, va_arg(*ap, int));
+
+ case 'I': /* integer from json_int_t */
+ return pack_integer(s, va_arg(*ap, json_int_t));
+
+ case 'f': /* real */
+ return pack_real(s, va_arg(*ap, double));
+
+ case 'O': /* a json_t object; increments refcount */
+ return pack_object_inter(s, ap, 1);
+
+ case 'o': /* a json_t object; doesn't increment refcount */
+ return pack_object_inter(s, ap, 0);
+
+ default:
+ set_error(s, "<format>", json_error_invalid_format,
+ "Unexpected format character '%c'", token(s));
+ s->has_error = 1;
+ return NULL;
+ }
+}
+
+static int unpack(scanner_t *s, json_t *root, va_list *ap);
+
+static int unpack_object(scanner_t *s, json_t *root, va_list *ap) {
+ int ret = -1;
+ int strict = 0;
+ int gotopt = 0;
+
+ /* Use a set (emulated by a hashtable) to check that all object
+ keys are accessed. Checking that the correct number of keys
+ were accessed is not enough, as the same key can be unpacked
+ multiple times.
+ */
+ hashtable_t key_set;
+
+ if (hashtable_init(&key_set)) {
+ set_error(s, "<internal>", json_error_out_of_memory, "Out of memory");
+ return -1;
+ }
+
+ if (root && !json_is_object(root)) {
+ set_error(s, "<validation>", json_error_wrong_type, "Expected object, got %s",
+ type_name(root));
+ goto out;
+ }
+ next_token(s);
+
+ while (token(s) != '}') {
+ const char *key;
+ json_t *value;
+ int opt = 0;
+
+ if (strict != 0) {
+ set_error(s, "<format>", json_error_invalid_format,
+ "Expected '}' after '%c', got '%c'", (strict == 1 ? '!' : '*'),
+ token(s));
+ goto out;
+ }
+
+ if (!token(s)) {
+ set_error(s, "<format>", json_error_invalid_format,
+ "Unexpected end of format string");
+ goto out;
+ }
+
+ if (token(s) == '!' || token(s) == '*') {
+ strict = (token(s) == '!' ? 1 : -1);
+ next_token(s);
+ continue;
+ }
+
+ if (token(s) != 's') {
+ set_error(s, "<format>", json_error_invalid_format,
+ "Expected format 's', got '%c'", token(s));
+ goto out;
+ }
+
+ key = va_arg(*ap, const char *);
+ if (!key) {
+ set_error(s, "<args>", json_error_null_value, "NULL object key");
+ goto out;
+ }
+
+ next_token(s);
+
+ if (token(s) == '?') {
+ opt = gotopt = 1;
+ next_token(s);
+ }
+
+ if (!root) {
+ /* skipping */
+ value = NULL;
+ } else {
+ value = json_object_get(root, key);
+ if (!value && !opt) {
+ set_error(s, "<validation>", json_error_item_not_found,
+ "Object item not found: %s", key);
+ goto out;
+ }
+ }
+
+ if (unpack(s, value, ap))
+ goto out;
+
+ hashtable_set(&key_set, key, strlen(key), json_null());
+ next_token(s);
+ }
+
+ if (strict == 0 && (s->flags & JSON_STRICT))
+ strict = 1;
+
+ if (root && strict == 1) {
+ /* We need to check that all non optional items have been parsed */
+ const char *key;
+ size_t key_len;
+ /* keys_res is 1 for uninitialized, 0 for success, -1 for error. */
+ int keys_res = 1;
+ strbuffer_t unrecognized_keys;
+ json_t *value;
+ long unpacked = 0;
+
+ if (gotopt || json_object_size(root) != key_set.size) {
+ json_object_keylen_foreach(root, key, key_len, value) {
+ if (!hashtable_get(&key_set, key, key_len)) {
+ unpacked++;
+
+ /* Save unrecognized keys for the error message */
+ if (keys_res == 1) {
+ keys_res = strbuffer_init(&unrecognized_keys);
+ } else if (!keys_res) {
+ keys_res = strbuffer_append_bytes(&unrecognized_keys, ", ", 2);
+ }
+
+ if (!keys_res)
+ keys_res =
+ strbuffer_append_bytes(&unrecognized_keys, key, key_len);
+ }
+ }
+ }
+ if (unpacked) {
+ set_error(s, "<validation>", json_error_end_of_input_expected,
+ "%li object item(s) left unpacked: %s", unpacked,
+ keys_res ? "<unknown>" : strbuffer_value(&unrecognized_keys));
+ strbuffer_close(&unrecognized_keys);
+ goto out;
+ }
+ }
+
+ ret = 0;
+
+out:
+ hashtable_close(&key_set);
+ return ret;
+}
+
+static int unpack_array(scanner_t *s, json_t *root, va_list *ap) {
+ size_t i = 0;
+ int strict = 0;
+
+ if (root && !json_is_array(root)) {
+ set_error(s, "<validation>", json_error_wrong_type, "Expected array, got %s",
+ type_name(root));
+ return -1;
+ }
+ next_token(s);
+
+ while (token(s) != ']') {
+ json_t *value;
+
+ if (strict != 0) {
+ set_error(s, "<format>", json_error_invalid_format,
+ "Expected ']' after '%c', got '%c'", (strict == 1 ? '!' : '*'),
+ token(s));
+ return -1;
+ }
+
+ if (!token(s)) {
+ set_error(s, "<format>", json_error_invalid_format,
+ "Unexpected end of format string");
+ return -1;
+ }
+
+ if (token(s) == '!' || token(s) == '*') {
+ strict = (token(s) == '!' ? 1 : -1);
+ next_token(s);
+ continue;
+ }
+
+ if (!strchr(unpack_value_starters, token(s))) {
+ set_error(s, "<format>", json_error_invalid_format,
+ "Unexpected format character '%c'", token(s));
+ return -1;
+ }
+
+ if (!root) {
+ /* skipping */
+ value = NULL;
+ } else {
+ value = json_array_get(root, i);
+ if (!value) {
+ set_error(s, "<validation>", json_error_index_out_of_range,
+ "Array index %lu out of range", (unsigned long)i);
+ return -1;
+ }
+ }
+
+ if (unpack(s, value, ap))
+ return -1;
+
+ next_token(s);
+ i++;
+ }
+
+ if (strict == 0 && (s->flags & JSON_STRICT))
+ strict = 1;
+
+ if (root && strict == 1 && i != json_array_size(root)) {
+ long diff = (long)json_array_size(root) - (long)i;
+ set_error(s, "<validation>", json_error_end_of_input_expected,
+ "%li array item(s) left unpacked", diff);
+ return -1;
+ }
+
+ return 0;
+}
+
+static int unpack(scanner_t *s, json_t *root, va_list *ap) {
+ switch (token(s)) {
+ case '{':
+ return unpack_object(s, root, ap);
+
+ case '[':
+ return unpack_array(s, root, ap);
+
+ case 's':
+ if (root && !json_is_string(root)) {
+ set_error(s, "<validation>", json_error_wrong_type,
+ "Expected string, got %s", type_name(root));
+ return -1;
+ }
+
+ if (!(s->flags & JSON_VALIDATE_ONLY)) {
+ const char **str_target;
+ size_t *len_target = NULL;
+
+ str_target = va_arg(*ap, const char **);
+ if (!str_target) {
+ set_error(s, "<args>", json_error_null_value, "NULL string argument");
+ return -1;
+ }
+
+ next_token(s);
+
+ if (token(s) == '%') {
+ len_target = va_arg(*ap, size_t *);
+ if (!len_target) {
+ set_error(s, "<args>", json_error_null_value,
+ "NULL string length argument");
+ return -1;
+ }
+ } else
+ prev_token(s);
+
+ if (root) {
+ *str_target = json_string_value(root);
+ if (len_target)
+ *len_target = json_string_length(root);
+ }
+ }
+ return 0;
+
+ case 'i':
+ if (root && !json_is_integer(root)) {
+ set_error(s, "<validation>", json_error_wrong_type,
+ "Expected integer, got %s", type_name(root));
+ return -1;
+ }
+
+ if (!(s->flags & JSON_VALIDATE_ONLY)) {
+ int *target = va_arg(*ap, int *);
+ if (root)
+ *target = (int)json_integer_value(root);
+ }
+
+ return 0;
+
+ case 'I':
+ if (root && !json_is_integer(root)) {
+ set_error(s, "<validation>", json_error_wrong_type,
+ "Expected integer, got %s", type_name(root));
+ return -1;
+ }
+
+ if (!(s->flags & JSON_VALIDATE_ONLY)) {
+ json_int_t *target = va_arg(*ap, json_int_t *);
+ if (root)
+ *target = json_integer_value(root);
+ }
+
+ return 0;
+
+ case 'b':
+ if (root && !json_is_boolean(root)) {
+ set_error(s, "<validation>", json_error_wrong_type,
+ "Expected true or false, got %s", type_name(root));
+ return -1;
+ }
+
+ if (!(s->flags & JSON_VALIDATE_ONLY)) {
+ int *target = va_arg(*ap, int *);
+ if (root)
+ *target = json_is_true(root);
+ }
+
+ return 0;
+
+ case 'f':
+ if (root && !json_is_real(root)) {
+ set_error(s, "<validation>", json_error_wrong_type,
+ "Expected real, got %s", type_name(root));
+ return -1;
+ }
+
+ if (!(s->flags & JSON_VALIDATE_ONLY)) {
+ double *target = va_arg(*ap, double *);
+ if (root)
+ *target = json_real_value(root);
+ }
+
+ return 0;
+
+ case 'F':
+ if (root && !json_is_number(root)) {
+ set_error(s, "<validation>", json_error_wrong_type,
+ "Expected real or integer, got %s", type_name(root));
+ return -1;
+ }
+
+ if (!(s->flags & JSON_VALIDATE_ONLY)) {
+ double *target = va_arg(*ap, double *);
+ if (root)
+ *target = json_number_value(root);
+ }
+
+ return 0;
+
+ case 'O':
+ if (root && !(s->flags & JSON_VALIDATE_ONLY))
+ json_incref(root);
+ /* Fall through */
+
+ case 'o':
+ if (!(s->flags & JSON_VALIDATE_ONLY)) {
+ json_t **target = va_arg(*ap, json_t **);
+ if (root)
+ *target = root;
+ }
+
+ return 0;
+
+ case 'n':
+ /* Never assign, just validate */
+ if (root && !json_is_null(root)) {
+ set_error(s, "<validation>", json_error_wrong_type,
+ "Expected null, got %s", type_name(root));
+ return -1;
+ }
+ return 0;
+
+ default:
+ set_error(s, "<format>", json_error_invalid_format,
+ "Unexpected format character '%c'", token(s));
+ return -1;
+ }
+}
+
+json_t *json_vpack_ex(json_error_t *error, size_t flags, const char *fmt, va_list ap) {
+ scanner_t s;
+ va_list ap_copy;
+ json_t *value;
+
+ if (!fmt || !*fmt) {
+ jsonp_error_init(error, "<format>");
+ jsonp_error_set(error, -1, -1, 0, json_error_invalid_argument,
+ "NULL or empty format string");
+ return NULL;
+ }
+ jsonp_error_init(error, NULL);
+
+ scanner_init(&s, error, flags, fmt);
+ next_token(&s);
+
+ va_copy(ap_copy, ap);
+ value = pack(&s, &ap_copy);
+ va_end(ap_copy);
+
+ /* This will cover all situations where s.has_error is true */
+ if (!value)
+ return NULL;
+
+ next_token(&s);
+ if (token(&s)) {
+ json_decref(value);
+ set_error(&s, "<format>", json_error_invalid_format,
+ "Garbage after format string");
+ return NULL;
+ }
+
+ return value;
+}
+
+json_t *json_pack_ex(json_error_t *error, size_t flags, const char *fmt, ...) {
+ json_t *value;
+ va_list ap;
+
+ va_start(ap, fmt);
+ value = json_vpack_ex(error, flags, fmt, ap);
+ va_end(ap);
+
+ return value;
+}
+
+json_t *json_pack(const char *fmt, ...) {
+ json_t *value;
+ va_list ap;
+
+ va_start(ap, fmt);
+ value = json_vpack_ex(NULL, 0, fmt, ap);
+ va_end(ap);
+
+ return value;
+}
+
+int json_vunpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt,
+ va_list ap) {
+ scanner_t s;
+ va_list ap_copy;
+
+ if (!root) {
+ jsonp_error_init(error, "<root>");
+ jsonp_error_set(error, -1, -1, 0, json_error_null_value, "NULL root value");
+ return -1;
+ }
+
+ if (!fmt || !*fmt) {
+ jsonp_error_init(error, "<format>");
+ jsonp_error_set(error, -1, -1, 0, json_error_invalid_argument,
+ "NULL or empty format string");
+ return -1;
+ }
+ jsonp_error_init(error, NULL);
+
+ scanner_init(&s, error, flags, fmt);
+ next_token(&s);
+
+ va_copy(ap_copy, ap);
+ if (unpack(&s, root, &ap_copy)) {
+ va_end(ap_copy);
+ return -1;
+ }
+ va_end(ap_copy);
+
+ next_token(&s);
+ if (token(&s)) {
+ set_error(&s, "<format>", json_error_invalid_format,
+ "Garbage after format string");
+ return -1;
+ }
+
+ return 0;
+}
+
+int json_unpack_ex(json_t *root, json_error_t *error, size_t flags, const char *fmt,
+ ...) {
+ int ret;
+ va_list ap;
+
+ va_start(ap, fmt);
+ ret = json_vunpack_ex(root, error, flags, fmt, ap);
+ va_end(ap);
+
+ return ret;
+}
+
+int json_unpack(json_t *root, const char *fmt, ...) {
+ int ret;
+ va_list ap;
+
+ va_start(ap, fmt);
+ ret = json_vunpack_ex(root, NULL, 0, fmt, ap);
+ va_end(ap);
+
+ return ret;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/strbuffer.c b/src/fluent-bit/lib/jansson-e23f558/src/strbuffer.c
new file mode 100644
index 000000000..d9bcd439d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/strbuffer.c
@@ -0,0 +1,98 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#include "strbuffer.h"
+#include "jansson_private.h"
+#include <stdlib.h>
+#include <string.h>
+
+#define STRBUFFER_MIN_SIZE 16
+#define STRBUFFER_FACTOR 2
+#define STRBUFFER_SIZE_MAX ((size_t)-1)
+
+int strbuffer_init(strbuffer_t *strbuff) {
+ strbuff->size = STRBUFFER_MIN_SIZE;
+ strbuff->length = 0;
+
+ strbuff->value = jsonp_malloc(strbuff->size);
+ if (!strbuff->value)
+ return -1;
+
+ /* initialize to empty */
+ strbuff->value[0] = '\0';
+ return 0;
+}
+
+void strbuffer_close(strbuffer_t *strbuff) {
+ if (strbuff->value)
+ jsonp_free(strbuff->value);
+
+ strbuff->size = 0;
+ strbuff->length = 0;
+ strbuff->value = NULL;
+}
+
+void strbuffer_clear(strbuffer_t *strbuff) {
+ strbuff->length = 0;
+ strbuff->value[0] = '\0';
+}
+
+const char *strbuffer_value(const strbuffer_t *strbuff) { return strbuff->value; }
+
+char *strbuffer_steal_value(strbuffer_t *strbuff) {
+ char *result = strbuff->value;
+ strbuff->value = NULL;
+ return result;
+}
+
+int strbuffer_append_byte(strbuffer_t *strbuff, char byte) {
+ return strbuffer_append_bytes(strbuff, &byte, 1);
+}
+
+int strbuffer_append_bytes(strbuffer_t *strbuff, const char *data, size_t size) {
+ if (size >= strbuff->size - strbuff->length) {
+ size_t new_size;
+ char *new_value;
+
+ /* avoid integer overflow */
+ if (strbuff->size > STRBUFFER_SIZE_MAX / STRBUFFER_FACTOR ||
+ size > STRBUFFER_SIZE_MAX - 1 ||
+ strbuff->length > STRBUFFER_SIZE_MAX - 1 - size)
+ return -1;
+
+ new_size = max(strbuff->size * STRBUFFER_FACTOR, strbuff->length + size + 1);
+
+ new_value = jsonp_malloc(new_size);
+ if (!new_value)
+ return -1;
+
+ memcpy(new_value, strbuff->value, strbuff->length);
+
+ jsonp_free(strbuff->value);
+ strbuff->value = new_value;
+ strbuff->size = new_size;
+ }
+
+ memcpy(strbuff->value + strbuff->length, data, size);
+ strbuff->length += size;
+ strbuff->value[strbuff->length] = '\0';
+
+ return 0;
+}
+
+char strbuffer_pop(strbuffer_t *strbuff) {
+ if (strbuff->length > 0) {
+ char c = strbuff->value[--strbuff->length];
+ strbuff->value[strbuff->length] = '\0';
+ return c;
+ } else
+ return '\0';
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/strbuffer.h b/src/fluent-bit/lib/jansson-e23f558/src/strbuffer.h
new file mode 100644
index 000000000..70f2646df
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/strbuffer.h
@@ -0,0 +1,35 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef STRBUFFER_H
+#define STRBUFFER_H
+
+#include "jansson.h"
+#include <stdlib.h>
+
+typedef struct {
+ char *value;
+ size_t length; /* bytes used */
+ size_t size; /* bytes allocated */
+} strbuffer_t;
+
+int strbuffer_init(strbuffer_t *strbuff) JANSSON_ATTRS((warn_unused_result));
+void strbuffer_close(strbuffer_t *strbuff);
+
+void strbuffer_clear(strbuffer_t *strbuff);
+
+const char *strbuffer_value(const strbuffer_t *strbuff);
+
+/* Steal the value and close the strbuffer */
+char *strbuffer_steal_value(strbuffer_t *strbuff);
+
+int strbuffer_append_byte(strbuffer_t *strbuff, char byte);
+int strbuffer_append_bytes(strbuffer_t *strbuff, const char *data, size_t size);
+
+char strbuffer_pop(strbuffer_t *strbuff);
+
+#endif
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/strconv.c b/src/fluent-bit/lib/jansson-e23f558/src/strconv.c
new file mode 100644
index 000000000..c6f4fd16b
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/strconv.c
@@ -0,0 +1,132 @@
+#include "jansson_private.h"
+#include "strbuffer.h"
+#include <assert.h>
+#include <errno.h>
+#include <math.h>
+#include <stdio.h>
+#include <string.h>
+
+/* need jansson_private_config.h to get the correct snprintf */
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#if JSON_HAVE_LOCALECONV
+#include <locale.h>
+
+/*
+ - This code assumes that the decimal separator is exactly one
+ character.
+
+ - If setlocale() is called by another thread between the call to
+ localeconv() and the call to sprintf() or strtod(), the result may
+ be wrong. setlocale() is not thread-safe and should not be used
+ this way. Multi-threaded programs should use uselocale() instead.
+*/
+
+static void to_locale(strbuffer_t *strbuffer) {
+ const char *point;
+ char *pos;
+
+ point = localeconv()->decimal_point;
+ if (*point == '.') {
+ /* No conversion needed */
+ return;
+ }
+
+ pos = strchr(strbuffer->value, '.');
+ if (pos)
+ *pos = *point;
+}
+
+static void from_locale(char *buffer) {
+ const char *point;
+ char *pos;
+
+ point = localeconv()->decimal_point;
+ if (*point == '.') {
+ /* No conversion needed */
+ return;
+ }
+
+ pos = strchr(buffer, *point);
+ if (pos)
+ *pos = '.';
+}
+#endif
+
+int jsonp_strtod(strbuffer_t *strbuffer, double *out) {
+ double value;
+ char *end;
+
+#if JSON_HAVE_LOCALECONV
+ to_locale(strbuffer);
+#endif
+
+ errno = 0;
+ value = strtod(strbuffer->value, &end);
+ assert(end == strbuffer->value + strbuffer->length);
+
+ if ((value == HUGE_VAL || value == -HUGE_VAL) && errno == ERANGE) {
+ /* Overflow */
+ return -1;
+ }
+
+ *out = value;
+ return 0;
+}
+
+int jsonp_dtostr(char *buffer, size_t size, double value, int precision) {
+ int ret;
+ char *start, *end;
+ size_t length;
+
+ if (precision == 0)
+ precision = 17;
+
+ ret = snprintf(buffer, size, "%.*g", precision, value);
+ if (ret < 0)
+ return -1;
+
+ length = (size_t)ret;
+ if (length >= size)
+ return -1;
+
+#if JSON_HAVE_LOCALECONV
+ from_locale(buffer);
+#endif
+
+ /* Make sure there's a dot or 'e' in the output. Otherwise
+ a real is converted to an integer when decoding */
+ if (strchr(buffer, '.') == NULL && strchr(buffer, 'e') == NULL) {
+ if (length + 3 >= size) {
+ /* No space to append ".0" */
+ return -1;
+ }
+ buffer[length] = '.';
+ buffer[length + 1] = '0';
+ buffer[length + 2] = '\0';
+ length += 2;
+ }
+
+ /* Remove leading '+' from positive exponent. Also remove leading
+ zeros from exponents (added by some printf() implementations) */
+ start = strchr(buffer, 'e');
+ if (start) {
+ start++;
+ end = start + 1;
+
+ if (*start == '-')
+ start++;
+
+ while (*end == '0')
+ end++;
+
+ if (end != start) {
+ memmove(start, end, length - (size_t)(end - buffer));
+ length -= (size_t)(end - start);
+ }
+ }
+
+ return (int)length;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/utf.c b/src/fluent-bit/lib/jansson-e23f558/src/utf.c
new file mode 100644
index 000000000..28b2f7d38
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/utf.c
@@ -0,0 +1,159 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "utf.h"
+#include <string.h>
+
+int utf8_encode(int32_t codepoint, char *buffer, size_t *size) {
+ if (codepoint < 0)
+ return -1;
+ else if (codepoint < 0x80) {
+ buffer[0] = (char)codepoint;
+ *size = 1;
+ } else if (codepoint < 0x800) {
+ buffer[0] = 0xC0 + ((codepoint & 0x7C0) >> 6);
+ buffer[1] = 0x80 + ((codepoint & 0x03F));
+ *size = 2;
+ } else if (codepoint < 0x10000) {
+ buffer[0] = 0xE0 + ((codepoint & 0xF000) >> 12);
+ buffer[1] = 0x80 + ((codepoint & 0x0FC0) >> 6);
+ buffer[2] = 0x80 + ((codepoint & 0x003F));
+ *size = 3;
+ } else if (codepoint <= 0x10FFFF) {
+ buffer[0] = 0xF0 + ((codepoint & 0x1C0000) >> 18);
+ buffer[1] = 0x80 + ((codepoint & 0x03F000) >> 12);
+ buffer[2] = 0x80 + ((codepoint & 0x000FC0) >> 6);
+ buffer[3] = 0x80 + ((codepoint & 0x00003F));
+ *size = 4;
+ } else
+ return -1;
+
+ return 0;
+}
+
+size_t utf8_check_first(char byte) {
+ unsigned char u = (unsigned char)byte;
+
+ if (u < 0x80)
+ return 1;
+
+ if (0x80 <= u && u <= 0xBF) {
+ /* second, third or fourth byte of a multi-byte
+ sequence, i.e. a "continuation byte" */
+ return 0;
+ } else if (u == 0xC0 || u == 0xC1) {
+ /* overlong encoding of an ASCII byte */
+ return 0;
+ } else if (0xC2 <= u && u <= 0xDF) {
+ /* 2-byte sequence */
+ return 2;
+ }
+
+ else if (0xE0 <= u && u <= 0xEF) {
+ /* 3-byte sequence */
+ return 3;
+ } else if (0xF0 <= u && u <= 0xF4) {
+ /* 4-byte sequence */
+ return 4;
+ } else { /* u >= 0xF5 */
+ /* Restricted (start of 4-, 5- or 6-byte sequence) or invalid
+ UTF-8 */
+ return 0;
+ }
+}
+
+size_t utf8_check_full(const char *buffer, size_t size, int32_t *codepoint) {
+ size_t i;
+ int32_t value = 0;
+ unsigned char u = (unsigned char)buffer[0];
+
+ if (size == 2) {
+ value = u & 0x1F;
+ } else if (size == 3) {
+ value = u & 0xF;
+ } else if (size == 4) {
+ value = u & 0x7;
+ } else
+ return 0;
+
+ for (i = 1; i < size; i++) {
+ u = (unsigned char)buffer[i];
+
+ if (u < 0x80 || u > 0xBF) {
+ /* not a continuation byte */
+ return 0;
+ }
+
+ value = (value << 6) + (u & 0x3F);
+ }
+
+ if (value > 0x10FFFF) {
+ /* not in Unicode range */
+ return 0;
+ }
+
+ else if (0xD800 <= value && value <= 0xDFFF) {
+ /* invalid code point (UTF-16 surrogate halves) */
+ return 0;
+ }
+
+ else if ((size == 2 && value < 0x80) || (size == 3 && value < 0x800) ||
+ (size == 4 && value < 0x10000)) {
+ /* overlong encoding */
+ return 0;
+ }
+
+ if (codepoint)
+ *codepoint = value;
+
+ return 1;
+}
+
+const char *utf8_iterate(const char *buffer, size_t bufsize, int32_t *codepoint) {
+ size_t count;
+ int32_t value;
+
+ if (!bufsize)
+ return buffer;
+
+ count = utf8_check_first(buffer[0]);
+ if (count <= 0)
+ return NULL;
+
+ if (count == 1)
+ value = (unsigned char)buffer[0];
+ else {
+ if (count > bufsize || !utf8_check_full(buffer, count, &value))
+ return NULL;
+ }
+
+ if (codepoint)
+ *codepoint = value;
+
+ return buffer + count;
+}
+
+int utf8_check_string(const char *string, size_t length) {
+ size_t i;
+
+ for (i = 0; i < length; i++) {
+ size_t count = utf8_check_first(string[i]);
+ if (count == 0)
+ return 0;
+ else if (count > 1) {
+ if (count > length - i)
+ return 0;
+
+ if (!utf8_check_full(&string[i], count, NULL))
+ return 0;
+
+ i += count - 1;
+ }
+ }
+
+ return 1;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/utf.h b/src/fluent-bit/lib/jansson-e23f558/src/utf.h
new file mode 100644
index 000000000..5db99df67
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/utf.h
@@ -0,0 +1,28 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef UTF_H
+#define UTF_H
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <stddef.h>
+#ifdef HAVE_STDINT_H
+#include <stdint.h>
+#endif
+
+int utf8_encode(int32_t codepoint, char *buffer, size_t *size);
+
+size_t utf8_check_first(char byte);
+size_t utf8_check_full(const char *buffer, size_t size, int32_t *codepoint);
+const char *utf8_iterate(const char *buffer, size_t size, int32_t *codepoint);
+
+int utf8_check_string(const char *string, size_t length);
+
+#endif
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/value.c b/src/fluent-bit/lib/jansson-e23f558/src/value.c
new file mode 100644
index 000000000..d5a11fe51
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/value.c
@@ -0,0 +1,1120 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <math.h>
+#include <stddef.h>
+#include <stdlib.h>
+#include <string.h>
+
+#ifdef HAVE_STDINT_H
+#include <stdint.h>
+#endif
+
+#include "hashtable.h"
+#include "jansson.h"
+#include "jansson_private.h"
+#include "utf.h"
+
+/* Work around nonstandard isnan() and isinf() implementations */
+#ifndef isnan
+#ifndef __sun
+static JSON_INLINE int isnan(double x) { return x != x; }
+#endif
+#endif
+#ifndef isinf
+static JSON_INLINE int isinf(double x) { return !isnan(x) && isnan(x - x); }
+#endif
+
+json_t *do_deep_copy(const json_t *json, hashtable_t *parents);
+
+static JSON_INLINE void json_init(json_t *json, json_type type) {
+ json->type = type;
+ json->refcount = 1;
+}
+
+int jsonp_loop_check(hashtable_t *parents, const json_t *json, char *key, size_t key_size,
+ size_t *key_len_out) {
+ size_t key_len = snprintf(key, key_size, "%p", json);
+
+ if (key_len_out)
+ *key_len_out = key_len;
+
+ if (hashtable_get(parents, key, key_len))
+ return -1;
+
+ return hashtable_set(parents, key, key_len, json_null());
+}
+
+/*** object ***/
+
+extern volatile uint32_t hashtable_seed;
+
+json_t *json_object(void) {
+ json_object_t *object = jsonp_malloc(sizeof(json_object_t));
+ if (!object)
+ return NULL;
+
+ if (!hashtable_seed) {
+ /* Autoseed */
+ json_object_seed(0);
+ }
+
+ json_init(&object->json, JSON_OBJECT);
+
+ if (hashtable_init(&object->hashtable)) {
+ jsonp_free(object);
+ return NULL;
+ }
+
+ return &object->json;
+}
+
+static void json_delete_object(json_object_t *object) {
+ hashtable_close(&object->hashtable);
+ jsonp_free(object);
+}
+
+size_t json_object_size(const json_t *json) {
+ json_object_t *object;
+
+ if (!json_is_object(json))
+ return 0;
+
+ object = json_to_object(json);
+ return object->hashtable.size;
+}
+
+json_t *json_object_get(const json_t *json, const char *key) {
+ if (!key)
+ return NULL;
+
+ return json_object_getn(json, key, strlen(key));
+}
+
+json_t *json_object_getn(const json_t *json, const char *key, size_t key_len) {
+ json_object_t *object;
+
+ if (!key || !json_is_object(json))
+ return NULL;
+
+ object = json_to_object(json);
+ return hashtable_get(&object->hashtable, key, key_len);
+}
+
+int json_object_set_new_nocheck(json_t *json, const char *key, json_t *value) {
+ if (!key) {
+ json_decref(value);
+ return -1;
+ }
+ return json_object_setn_new_nocheck(json, key, strlen(key), value);
+}
+
+int json_object_setn_new_nocheck(json_t *json, const char *key, size_t key_len,
+ json_t *value) {
+ json_object_t *object;
+
+ if (!value)
+ return -1;
+
+ if (!key || !json_is_object(json) || json == value) {
+ json_decref(value);
+ return -1;
+ }
+ object = json_to_object(json);
+
+ if (hashtable_set(&object->hashtable, key, key_len, value)) {
+ json_decref(value);
+ return -1;
+ }
+
+ return 0;
+}
+
+int json_object_set_new(json_t *json, const char *key, json_t *value) {
+ if (!key) {
+ json_decref(value);
+ return -1;
+ }
+
+ return json_object_setn_new(json, key, strlen(key), value);
+}
+
+int json_object_setn_new(json_t *json, const char *key, size_t key_len, json_t *value) {
+ if (!key || !utf8_check_string(key, key_len)) {
+ json_decref(value);
+ return -1;
+ }
+
+ return json_object_setn_new_nocheck(json, key, key_len, value);
+}
+
+int json_object_del(json_t *json, const char *key) {
+ if (!key)
+ return -1;
+
+ return json_object_deln(json, key, strlen(key));
+}
+
+int json_object_deln(json_t *json, const char *key, size_t key_len) {
+ json_object_t *object;
+
+ if (!key || !json_is_object(json))
+ return -1;
+
+ object = json_to_object(json);
+ return hashtable_del(&object->hashtable, key, key_len);
+}
+
+int json_object_clear(json_t *json) {
+ json_object_t *object;
+
+ if (!json_is_object(json))
+ return -1;
+
+ object = json_to_object(json);
+ hashtable_clear(&object->hashtable);
+
+ return 0;
+}
+
+int json_object_update(json_t *object, json_t *other) {
+ const char *key;
+ size_t key_len;
+ json_t *value;
+
+ if (!json_is_object(object) || !json_is_object(other))
+ return -1;
+
+ json_object_keylen_foreach(other, key, key_len, value) {
+ if (json_object_setn_nocheck(object, key, key_len, value))
+ return -1;
+ }
+
+ return 0;
+}
+
+int json_object_update_existing(json_t *object, json_t *other) {
+ const char *key;
+ size_t key_len;
+ json_t *value;
+
+ if (!json_is_object(object) || !json_is_object(other))
+ return -1;
+
+ json_object_keylen_foreach(other, key, key_len, value) {
+ if (json_object_getn(object, key, key_len))
+ json_object_setn_nocheck(object, key, key_len, value);
+ }
+
+ return 0;
+}
+
+int json_object_update_missing(json_t *object, json_t *other) {
+ const char *key;
+ size_t key_len;
+ json_t *value;
+
+ if (!json_is_object(object) || !json_is_object(other))
+ return -1;
+
+ json_object_keylen_foreach(other, key, key_len, value) {
+ if (!json_object_getn(object, key, key_len))
+ json_object_setn_nocheck(object, key, key_len, value);
+ }
+
+ return 0;
+}
+
+int do_object_update_recursive(json_t *object, json_t *other, hashtable_t *parents) {
+ const char *key;
+ size_t key_len;
+ json_t *value;
+ char loop_key[LOOP_KEY_LEN];
+ int res = 0;
+ size_t loop_key_len;
+
+ if (!json_is_object(object) || !json_is_object(other))
+ return -1;
+
+ if (jsonp_loop_check(parents, other, loop_key, sizeof(loop_key), &loop_key_len))
+ return -1;
+
+ json_object_keylen_foreach(other, key, key_len, value) {
+ json_t *v = json_object_getn(object, key, key_len);
+
+ if (json_is_object(v) && json_is_object(value)) {
+ if (do_object_update_recursive(v, value, parents)) {
+ res = -1;
+ break;
+ }
+ } else {
+ if (json_object_setn_nocheck(object, key, key_len, value)) {
+ res = -1;
+ break;
+ }
+ }
+ }
+
+ hashtable_del(parents, loop_key, loop_key_len);
+
+ return res;
+}
+
+int json_object_update_recursive(json_t *object, json_t *other) {
+ int res;
+ hashtable_t parents_set;
+
+ if (hashtable_init(&parents_set))
+ return -1;
+ res = do_object_update_recursive(object, other, &parents_set);
+ hashtable_close(&parents_set);
+
+ return res;
+}
+
+void *json_object_iter(json_t *json) {
+ json_object_t *object;
+
+ if (!json_is_object(json))
+ return NULL;
+
+ object = json_to_object(json);
+ return hashtable_iter(&object->hashtable);
+}
+
+void *json_object_iter_at(json_t *json, const char *key) {
+ json_object_t *object;
+
+ if (!key || !json_is_object(json))
+ return NULL;
+
+ object = json_to_object(json);
+ return hashtable_iter_at(&object->hashtable, key, strlen(key));
+}
+
+void *json_object_iter_next(json_t *json, void *iter) {
+ json_object_t *object;
+
+ if (!json_is_object(json) || iter == NULL)
+ return NULL;
+
+ object = json_to_object(json);
+ return hashtable_iter_next(&object->hashtable, iter);
+}
+
+const char *json_object_iter_key(void *iter) {
+ if (!iter)
+ return NULL;
+
+ return hashtable_iter_key(iter);
+}
+
+size_t json_object_iter_key_len(void *iter) {
+ if (!iter)
+ return 0;
+
+ return hashtable_iter_key_len(iter);
+}
+
+json_t *json_object_iter_value(void *iter) {
+ if (!iter)
+ return NULL;
+
+ return (json_t *)hashtable_iter_value(iter);
+}
+
+int json_object_iter_set_new(json_t *json, void *iter, json_t *value) {
+ if (!json_is_object(json) || !iter || !value) {
+ json_decref(value);
+ return -1;
+ }
+
+ hashtable_iter_set(iter, value);
+ return 0;
+}
+
+void *json_object_key_to_iter(const char *key) {
+ if (!key)
+ return NULL;
+
+ return hashtable_key_to_iter(key);
+}
+
+static int json_object_equal(const json_t *object1, const json_t *object2) {
+ const char *key;
+ size_t key_len;
+ const json_t *value1, *value2;
+
+ if (json_object_size(object1) != json_object_size(object2))
+ return 0;
+
+ json_object_keylen_foreach((json_t *)object1, key, key_len, value1) {
+ value2 = json_object_getn(object2, key, key_len);
+
+ if (!json_equal(value1, value2))
+ return 0;
+ }
+
+ return 1;
+}
+
+static json_t *json_object_copy(json_t *object) {
+ json_t *result;
+
+ const char *key;
+ size_t key_len;
+ json_t *value;
+
+ result = json_object();
+ if (!result)
+ return NULL;
+
+ json_object_keylen_foreach(object, key, key_len, value)
+ json_object_setn_nocheck(result, key, key_len, value);
+
+ return result;
+}
+
+static json_t *json_object_deep_copy(const json_t *object, hashtable_t *parents) {
+ json_t *result;
+ void *iter;
+ char loop_key[LOOP_KEY_LEN];
+ size_t loop_key_len;
+
+ if (jsonp_loop_check(parents, object, loop_key, sizeof(loop_key), &loop_key_len))
+ return NULL;
+
+ result = json_object();
+ if (!result)
+ goto out;
+
+ /* Cannot use json_object_foreach because object has to be cast
+ non-const */
+ iter = json_object_iter((json_t *)object);
+ while (iter) {
+ const char *key;
+ size_t key_len;
+ const json_t *value;
+ key = json_object_iter_key(iter);
+ key_len = json_object_iter_key_len(iter);
+ value = json_object_iter_value(iter);
+
+ if (json_object_setn_new_nocheck(result, key, key_len,
+ do_deep_copy(value, parents))) {
+ json_decref(result);
+ result = NULL;
+ break;
+ }
+ iter = json_object_iter_next((json_t *)object, iter);
+ }
+
+out:
+ hashtable_del(parents, loop_key, loop_key_len);
+
+ return result;
+}
+
+/*** array ***/
+
+json_t *json_array(void) {
+ json_array_t *array = jsonp_malloc(sizeof(json_array_t));
+ if (!array)
+ return NULL;
+ json_init(&array->json, JSON_ARRAY);
+
+ array->entries = 0;
+ array->size = 8;
+
+ array->table = jsonp_malloc(array->size * sizeof(json_t *));
+ if (!array->table) {
+ jsonp_free(array);
+ return NULL;
+ }
+
+ return &array->json;
+}
+
+static void json_delete_array(json_array_t *array) {
+ size_t i;
+
+ for (i = 0; i < array->entries; i++)
+ json_decref(array->table[i]);
+
+ jsonp_free(array->table);
+ jsonp_free(array);
+}
+
+size_t json_array_size(const json_t *json) {
+ if (!json_is_array(json))
+ return 0;
+
+ return json_to_array(json)->entries;
+}
+
+json_t *json_array_get(const json_t *json, size_t index) {
+ json_array_t *array;
+ if (!json_is_array(json))
+ return NULL;
+ array = json_to_array(json);
+
+ if (index >= array->entries)
+ return NULL;
+
+ return array->table[index];
+}
+
+int json_array_set_new(json_t *json, size_t index, json_t *value) {
+ json_array_t *array;
+
+ if (!value)
+ return -1;
+
+ if (!json_is_array(json) || json == value) {
+ json_decref(value);
+ return -1;
+ }
+ array = json_to_array(json);
+
+ if (index >= array->entries) {
+ json_decref(value);
+ return -1;
+ }
+
+ json_decref(array->table[index]);
+ array->table[index] = value;
+
+ return 0;
+}
+
+static void array_move(json_array_t *array, size_t dest, size_t src, size_t count) {
+ memmove(&array->table[dest], &array->table[src], count * sizeof(json_t *));
+}
+
+static void array_copy(json_t **dest, size_t dpos, json_t **src, size_t spos,
+ size_t count) {
+ memcpy(&dest[dpos], &src[spos], count * sizeof(json_t *));
+}
+
+static json_t **json_array_grow(json_array_t *array, size_t amount, int copy) {
+ size_t new_size;
+ json_t **old_table, **new_table;
+
+ if (array->entries + amount <= array->size)
+ return array->table;
+
+ old_table = array->table;
+
+ new_size = max(array->size + amount, array->size * 2);
+ new_table = jsonp_malloc(new_size * sizeof(json_t *));
+ if (!new_table)
+ return NULL;
+
+ array->size = new_size;
+ array->table = new_table;
+
+ if (copy) {
+ array_copy(array->table, 0, old_table, 0, array->entries);
+ jsonp_free(old_table);
+ return array->table;
+ }
+
+ return old_table;
+}
+
+int json_array_append_new(json_t *json, json_t *value) {
+ json_array_t *array;
+
+ if (!value)
+ return -1;
+
+ if (!json_is_array(json) || json == value) {
+ json_decref(value);
+ return -1;
+ }
+ array = json_to_array(json);
+
+ if (!json_array_grow(array, 1, 1)) {
+ json_decref(value);
+ return -1;
+ }
+
+ array->table[array->entries] = value;
+ array->entries++;
+
+ return 0;
+}
+
+int json_array_insert_new(json_t *json, size_t index, json_t *value) {
+ json_array_t *array;
+ json_t **old_table;
+
+ if (!value)
+ return -1;
+
+ if (!json_is_array(json) || json == value) {
+ json_decref(value);
+ return -1;
+ }
+ array = json_to_array(json);
+
+ if (index > array->entries) {
+ json_decref(value);
+ return -1;
+ }
+
+ old_table = json_array_grow(array, 1, 0);
+ if (!old_table) {
+ json_decref(value);
+ return -1;
+ }
+
+ if (old_table != array->table) {
+ array_copy(array->table, 0, old_table, 0, index);
+ array_copy(array->table, index + 1, old_table, index, array->entries - index);
+ jsonp_free(old_table);
+ } else
+ array_move(array, index + 1, index, array->entries - index);
+
+ array->table[index] = value;
+ array->entries++;
+
+ return 0;
+}
+
+int json_array_remove(json_t *json, size_t index) {
+ json_array_t *array;
+
+ if (!json_is_array(json))
+ return -1;
+ array = json_to_array(json);
+
+ if (index >= array->entries)
+ return -1;
+
+ json_decref(array->table[index]);
+
+ /* If we're removing the last element, nothing has to be moved */
+ if (index < array->entries - 1)
+ array_move(array, index, index + 1, array->entries - index - 1);
+
+ array->entries--;
+
+ return 0;
+}
+
+int json_array_clear(json_t *json) {
+ json_array_t *array;
+ size_t i;
+
+ if (!json_is_array(json))
+ return -1;
+ array = json_to_array(json);
+
+ for (i = 0; i < array->entries; i++)
+ json_decref(array->table[i]);
+
+ array->entries = 0;
+ return 0;
+}
+
+int json_array_extend(json_t *json, json_t *other_json) {
+ json_array_t *array, *other;
+ size_t i;
+
+ if (!json_is_array(json) || !json_is_array(other_json))
+ return -1;
+ array = json_to_array(json);
+ other = json_to_array(other_json);
+
+ if (!json_array_grow(array, other->entries, 1))
+ return -1;
+
+ for (i = 0; i < other->entries; i++)
+ json_incref(other->table[i]);
+
+ array_copy(array->table, array->entries, other->table, 0, other->entries);
+
+ array->entries += other->entries;
+ return 0;
+}
+
+static int json_array_equal(const json_t *array1, const json_t *array2) {
+ size_t i, size;
+
+ size = json_array_size(array1);
+ if (size != json_array_size(array2))
+ return 0;
+
+ for (i = 0; i < size; i++) {
+ json_t *value1, *value2;
+
+ value1 = json_array_get(array1, i);
+ value2 = json_array_get(array2, i);
+
+ if (!json_equal(value1, value2))
+ return 0;
+ }
+
+ return 1;
+}
+
+static json_t *json_array_copy(json_t *array) {
+ json_t *result;
+ size_t i;
+
+ result = json_array();
+ if (!result)
+ return NULL;
+
+ for (i = 0; i < json_array_size(array); i++)
+ json_array_append(result, json_array_get(array, i));
+
+ return result;
+}
+
+static json_t *json_array_deep_copy(const json_t *array, hashtable_t *parents) {
+ json_t *result;
+ size_t i;
+ char loop_key[LOOP_KEY_LEN];
+ size_t loop_key_len;
+
+ if (jsonp_loop_check(parents, array, loop_key, sizeof(loop_key), &loop_key_len))
+ return NULL;
+
+ result = json_array();
+ if (!result)
+ goto out;
+
+ for (i = 0; i < json_array_size(array); i++) {
+ if (json_array_append_new(result,
+ do_deep_copy(json_array_get(array, i), parents))) {
+ json_decref(result);
+ result = NULL;
+ break;
+ }
+ }
+
+out:
+ hashtable_del(parents, loop_key, loop_key_len);
+
+ return result;
+}
+
+/*** string ***/
+
+static json_t *string_create(const char *value, size_t len, int own) {
+ char *v;
+ json_string_t *string;
+
+ if (!value)
+ return NULL;
+
+ if (own)
+ v = (char *)value;
+ else {
+ v = jsonp_strndup(value, len);
+ if (!v)
+ return NULL;
+ }
+
+ string = jsonp_malloc(sizeof(json_string_t));
+ if (!string) {
+ jsonp_free(v);
+ return NULL;
+ }
+ json_init(&string->json, JSON_STRING);
+ string->value = v;
+ string->length = len;
+
+ return &string->json;
+}
+
+json_t *json_string_nocheck(const char *value) {
+ if (!value)
+ return NULL;
+
+ return string_create(value, strlen(value), 0);
+}
+
+json_t *json_stringn_nocheck(const char *value, size_t len) {
+ return string_create(value, len, 0);
+}
+
+/* this is private; "steal" is not a public API concept */
+json_t *jsonp_stringn_nocheck_own(const char *value, size_t len) {
+ return string_create(value, len, 1);
+}
+
+json_t *json_string(const char *value) {
+ if (!value)
+ return NULL;
+
+ return json_stringn(value, strlen(value));
+}
+
+json_t *json_stringn(const char *value, size_t len) {
+ if (!value || !utf8_check_string(value, len))
+ return NULL;
+
+ return json_stringn_nocheck(value, len);
+}
+
+const char *json_string_value(const json_t *json) {
+ if (!json_is_string(json))
+ return NULL;
+
+ return json_to_string(json)->value;
+}
+
+size_t json_string_length(const json_t *json) {
+ if (!json_is_string(json))
+ return 0;
+
+ return json_to_string(json)->length;
+}
+
+int json_string_set_nocheck(json_t *json, const char *value) {
+ if (!value)
+ return -1;
+
+ return json_string_setn_nocheck(json, value, strlen(value));
+}
+
+int json_string_setn_nocheck(json_t *json, const char *value, size_t len) {
+ char *dup;
+ json_string_t *string;
+
+ if (!json_is_string(json) || !value)
+ return -1;
+
+ dup = jsonp_strndup(value, len);
+ if (!dup)
+ return -1;
+
+ string = json_to_string(json);
+ jsonp_free(string->value);
+ string->value = dup;
+ string->length = len;
+
+ return 0;
+}
+
+int json_string_set(json_t *json, const char *value) {
+ if (!value)
+ return -1;
+
+ return json_string_setn(json, value, strlen(value));
+}
+
+int json_string_setn(json_t *json, const char *value, size_t len) {
+ if (!value || !utf8_check_string(value, len))
+ return -1;
+
+ return json_string_setn_nocheck(json, value, len);
+}
+
+static void json_delete_string(json_string_t *string) {
+ jsonp_free(string->value);
+ jsonp_free(string);
+}
+
+static int json_string_equal(const json_t *string1, const json_t *string2) {
+ json_string_t *s1, *s2;
+
+ s1 = json_to_string(string1);
+ s2 = json_to_string(string2);
+ return s1->length == s2->length && !memcmp(s1->value, s2->value, s1->length);
+}
+
+static json_t *json_string_copy(const json_t *string) {
+ json_string_t *s;
+
+ s = json_to_string(string);
+ return json_stringn_nocheck(s->value, s->length);
+}
+
+json_t *json_vsprintf(const char *fmt, va_list ap) {
+ json_t *json = NULL;
+ int length;
+ char *buf;
+ va_list aq;
+ va_copy(aq, ap);
+
+ length = vsnprintf(NULL, 0, fmt, ap);
+ if (length < 0)
+ goto out;
+ if (length == 0) {
+ json = json_string("");
+ goto out;
+ }
+
+ buf = jsonp_malloc((size_t)length + 1);
+ if (!buf)
+ goto out;
+
+ vsnprintf(buf, (size_t)length + 1, fmt, aq);
+ if (!utf8_check_string(buf, length)) {
+ jsonp_free(buf);
+ goto out;
+ }
+
+ json = jsonp_stringn_nocheck_own(buf, length);
+
+out:
+ va_end(aq);
+ return json;
+}
+
+json_t *json_sprintf(const char *fmt, ...) {
+ json_t *result;
+ va_list ap;
+
+ va_start(ap, fmt);
+ result = json_vsprintf(fmt, ap);
+ va_end(ap);
+
+ return result;
+}
+
+/*** integer ***/
+
+json_t *json_integer(json_int_t value) {
+ json_integer_t *integer = jsonp_malloc(sizeof(json_integer_t));
+ if (!integer)
+ return NULL;
+ json_init(&integer->json, JSON_INTEGER);
+
+ integer->value = value;
+ return &integer->json;
+}
+
+json_int_t json_integer_value(const json_t *json) {
+ if (!json_is_integer(json))
+ return 0;
+
+ return json_to_integer(json)->value;
+}
+
+int json_integer_set(json_t *json, json_int_t value) {
+ if (!json_is_integer(json))
+ return -1;
+
+ json_to_integer(json)->value = value;
+
+ return 0;
+}
+
+static void json_delete_integer(json_integer_t *integer) { jsonp_free(integer); }
+
+static int json_integer_equal(const json_t *integer1, const json_t *integer2) {
+ return json_integer_value(integer1) == json_integer_value(integer2);
+}
+
+static json_t *json_integer_copy(const json_t *integer) {
+ return json_integer(json_integer_value(integer));
+}
+
+/*** real ***/
+
+json_t *json_real(double value) {
+ json_real_t *real;
+
+ if (isnan(value) || isinf(value))
+ return NULL;
+
+ real = jsonp_malloc(sizeof(json_real_t));
+ if (!real)
+ return NULL;
+ json_init(&real->json, JSON_REAL);
+
+ real->value = value;
+ return &real->json;
+}
+
+double json_real_value(const json_t *json) {
+ if (!json_is_real(json))
+ return 0;
+
+ return json_to_real(json)->value;
+}
+
+int json_real_set(json_t *json, double value) {
+ if (!json_is_real(json) || isnan(value) || isinf(value))
+ return -1;
+
+ json_to_real(json)->value = value;
+
+ return 0;
+}
+
+static void json_delete_real(json_real_t *real) { jsonp_free(real); }
+
+static int json_real_equal(const json_t *real1, const json_t *real2) {
+ return json_real_value(real1) == json_real_value(real2);
+}
+
+static json_t *json_real_copy(const json_t *real) {
+ return json_real(json_real_value(real));
+}
+
+/*** number ***/
+
+double json_number_value(const json_t *json) {
+ if (json_is_integer(json))
+ return (double)json_integer_value(json);
+ else if (json_is_real(json))
+ return json_real_value(json);
+ else
+ return 0.0;
+}
+
+/*** simple values ***/
+
+json_t *json_true(void) {
+ static json_t the_true = {JSON_TRUE, (size_t)-1};
+ return &the_true;
+}
+
+json_t *json_false(void) {
+ static json_t the_false = {JSON_FALSE, (size_t)-1};
+ return &the_false;
+}
+
+json_t *json_null(void) {
+ static json_t the_null = {JSON_NULL, (size_t)-1};
+ return &the_null;
+}
+
+/*** deletion ***/
+
+void json_delete(json_t *json) {
+ if (!json)
+ return;
+
+ switch (json_typeof(json)) {
+ case JSON_OBJECT:
+ json_delete_object(json_to_object(json));
+ break;
+ case JSON_ARRAY:
+ json_delete_array(json_to_array(json));
+ break;
+ case JSON_STRING:
+ json_delete_string(json_to_string(json));
+ break;
+ case JSON_INTEGER:
+ json_delete_integer(json_to_integer(json));
+ break;
+ case JSON_REAL:
+ json_delete_real(json_to_real(json));
+ break;
+ default:
+ return;
+ }
+
+ /* json_delete is not called for true, false or null */
+}
+
+/*** equality ***/
+
+int json_equal(const json_t *json1, const json_t *json2) {
+ if (!json1 || !json2)
+ return 0;
+
+ if (json_typeof(json1) != json_typeof(json2))
+ return 0;
+
+ /* this covers true, false and null as they are singletons */
+ if (json1 == json2)
+ return 1;
+
+ switch (json_typeof(json1)) {
+ case JSON_OBJECT:
+ return json_object_equal(json1, json2);
+ case JSON_ARRAY:
+ return json_array_equal(json1, json2);
+ case JSON_STRING:
+ return json_string_equal(json1, json2);
+ case JSON_INTEGER:
+ return json_integer_equal(json1, json2);
+ case JSON_REAL:
+ return json_real_equal(json1, json2);
+ default:
+ return 0;
+ }
+}
+
+/*** copying ***/
+
+json_t *json_copy(json_t *json) {
+ if (!json)
+ return NULL;
+
+ switch (json_typeof(json)) {
+ case JSON_OBJECT:
+ return json_object_copy(json);
+ case JSON_ARRAY:
+ return json_array_copy(json);
+ case JSON_STRING:
+ return json_string_copy(json);
+ case JSON_INTEGER:
+ return json_integer_copy(json);
+ case JSON_REAL:
+ return json_real_copy(json);
+ case JSON_TRUE:
+ case JSON_FALSE:
+ case JSON_NULL:
+ return json;
+ default:
+ return NULL;
+ }
+}
+
+json_t *json_deep_copy(const json_t *json) {
+ json_t *res;
+ hashtable_t parents_set;
+
+ if (hashtable_init(&parents_set))
+ return NULL;
+ res = do_deep_copy(json, &parents_set);
+ hashtable_close(&parents_set);
+
+ return res;
+}
+
+json_t *do_deep_copy(const json_t *json, hashtable_t *parents) {
+ if (!json)
+ return NULL;
+
+ switch (json_typeof(json)) {
+ case JSON_OBJECT:
+ return json_object_deep_copy(json, parents);
+ case JSON_ARRAY:
+ return json_array_deep_copy(json, parents);
+ /* for the rest of the types, deep copying doesn't differ from
+ shallow copying */
+ case JSON_STRING:
+ return json_string_copy(json);
+ case JSON_INTEGER:
+ return json_integer_copy(json);
+ case JSON_REAL:
+ return json_real_copy(json);
+ case JSON_TRUE:
+ case JSON_FALSE:
+ case JSON_NULL:
+ return (json_t *)json;
+ default:
+ return NULL;
+ }
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/src/version.c b/src/fluent-bit/lib/jansson-e23f558/src/version.c
new file mode 100644
index 000000000..f1026af14
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/src/version.c
@@ -0,0 +1,28 @@
+/*
+ * Copyright (c) 2019 Sean Bright <sean.bright@gmail.com>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#include "jansson.h"
+
+const char *jansson_version_str(void) { return JANSSON_VERSION; }
+
+int jansson_version_cmp(int major, int minor, int micro) {
+ int diff;
+
+ if ((diff = JANSSON_MAJOR_VERSION - major)) {
+ return diff;
+ }
+
+ if ((diff = JANSSON_MINOR_VERSION - minor)) {
+ return diff;
+ }
+
+ return JANSSON_MICRO_VERSION - micro;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/.gitignore b/src/fluent-bit/lib/jansson-e23f558/test/.gitignore
new file mode 100644
index 000000000..6a33dea39
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/.gitignore
@@ -0,0 +1,20 @@
+logs
+bin/json_process
+suites/api/test_array
+suites/api/test_chaos
+suites/api/test_copy
+suites/api/test_cpp
+suites/api/test_dump
+suites/api/test_dump_callback
+suites/api/test_equal
+suites/api/test_load
+suites/api/test_load_callback
+suites/api/test_loadb
+suites/api/test_memory_funcs
+suites/api/test_number
+suites/api/test_object
+suites/api/test_pack
+suites/api/test_simple
+suites/api/test_sprintf
+suites/api/test_unpack
+suites/api/test_version
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/Makefile.am b/src/fluent-bit/lib/jansson-e23f558/test/Makefile.am
new file mode 100644
index 000000000..344d18d7e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/Makefile.am
@@ -0,0 +1,10 @@
+SUBDIRS = bin suites ossfuzz
+EXTRA_DIST = scripts run-suites
+
+TESTS = run-suites
+TESTS_ENVIRONMENT = \
+ top_srcdir=$(top_srcdir) \
+ top_builddir=$(top_builddir)
+
+clean-local:
+ rm -rf logs
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/bin/Makefile.am b/src/fluent-bit/lib/jansson-e23f558/test/bin/Makefile.am
new file mode 100644
index 000000000..63b6dce7e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/bin/Makefile.am
@@ -0,0 +1,5 @@
+check_PROGRAMS = json_process
+
+AM_CPPFLAGS = -I$(top_builddir)/src -I$(top_srcdir)/src
+LDFLAGS = -static # for speed and Valgrind
+LDADD = $(top_builddir)/src/libjansson.la
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/bin/json_process.c b/src/fluent-bit/lib/jansson-e23f558/test/bin/json_process.c
new file mode 100644
index 000000000..fc98543fc
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/bin/json_process.c
@@ -0,0 +1,366 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <ctype.h>
+#include <jansson.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+
+#ifdef HAVE_LOCALE_H
+#include <locale.h>
+#endif
+
+#if _WIN32
+#include <fcntl.h> /* for _O_BINARY */
+#include <io.h> /* for _setmode() */
+
+static const char dir_sep = '\\';
+#else
+static const char dir_sep = '/';
+#endif
+
+struct config {
+ int indent;
+ int compact;
+ int preserve_order;
+ int ensure_ascii;
+ int sort_keys;
+ int strip;
+ int use_env;
+ int have_hashseed;
+ int hashseed;
+ int precision;
+} conf;
+
+#define l_isspace(c) ((c) == ' ' || (c) == '\n' || (c) == '\r' || (c) == '\t')
+
+/* Return a pointer to the first non-whitespace character of str.
+ Modifies str so that all trailing whitespace characters are
+ replaced by '\0'. */
+static const char *strip(char *str) {
+ size_t length;
+ char *result = str;
+ while (*result && l_isspace(*result))
+ result++;
+
+ length = strlen(result);
+ if (length == 0)
+ return result;
+
+ while (l_isspace(result[length - 1]))
+ result[--length] = '\0';
+
+ return result;
+}
+
+static char *loadfile(FILE *file) {
+ size_t fsize, ret;
+ char *buf;
+
+ fseek(file, 0, SEEK_END);
+ fsize = ftell(file);
+ fseek(file, 0, SEEK_SET);
+
+ buf = malloc(fsize + 1);
+ ret = fread(buf, 1, fsize, file);
+ if (ret != fsize)
+ exit(1);
+ buf[fsize] = '\0';
+
+ return buf;
+}
+
+static void read_conf(FILE *conffile) {
+ char *buffer, *line, *val;
+
+ buffer = loadfile(conffile);
+ for (line = strtok(buffer, "\r\n"); line; line = strtok(NULL, "\r\n")) {
+ if (!strncmp(line, "export ", 7))
+ continue;
+ val = strchr(line, '=');
+ if (!val) {
+ printf("invalid configuration line\n");
+ break;
+ }
+ *val++ = '\0';
+
+ if (!strcmp(line, "JSON_INDENT"))
+ conf.indent = atoi(val);
+ if (!strcmp(line, "JSON_COMPACT"))
+ conf.compact = atoi(val);
+ if (!strcmp(line, "JSON_ENSURE_ASCII"))
+ conf.ensure_ascii = atoi(val);
+ if (!strcmp(line, "JSON_PRESERVE_ORDER"))
+ conf.preserve_order = atoi(val);
+ if (!strcmp(line, "JSON_SORT_KEYS"))
+ conf.sort_keys = atoi(val);
+ if (!strcmp(line, "JSON_REAL_PRECISION"))
+ conf.precision = atoi(val);
+ if (!strcmp(line, "STRIP"))
+ conf.strip = atoi(val);
+ if (!strcmp(line, "HASHSEED")) {
+ conf.have_hashseed = 1;
+ conf.hashseed = atoi(val);
+ } else {
+ conf.have_hashseed = 0;
+ }
+ }
+
+ free(buffer);
+}
+
+static int cmpfile(const char *str, const char *path, const char *fname) {
+ char filename[1024], *buffer;
+ int ret;
+ FILE *file;
+
+ sprintf(filename, "%s%c%s", path, dir_sep, fname);
+ file = fopen(filename, "rb");
+ if (!file) {
+ if (conf.strip)
+ strcat(filename, ".strip");
+ else
+ strcat(filename, ".normal");
+ file = fopen(filename, "rb");
+ }
+ if (!file) {
+ printf("Error: test result file could not be opened.\n");
+ exit(1);
+ }
+
+ buffer = loadfile(file);
+ if (strcmp(buffer, str) != 0)
+ ret = 1;
+ else
+ ret = 0;
+ free(buffer);
+ fclose(file);
+
+ return ret;
+}
+
+int use_conf(char *test_path) {
+ int ret;
+ size_t flags = 0;
+ char filename[1024], errstr[1024];
+ char *buffer;
+ FILE *infile, *conffile;
+ json_t *json;
+ json_error_t error;
+
+ sprintf(filename, "%s%cinput", test_path, dir_sep);
+ if (!(infile = fopen(filename, "rb"))) {
+ fprintf(stderr, "Could not open \"%s\"\n", filename);
+ return 2;
+ }
+
+ sprintf(filename, "%s%cenv", test_path, dir_sep);
+ conffile = fopen(filename, "rb");
+ if (conffile) {
+ read_conf(conffile);
+ fclose(conffile);
+ }
+
+ if (conf.indent < 0 || conf.indent > 31) {
+ fprintf(stderr, "invalid value for JSON_INDENT: %d\n", conf.indent);
+ fclose(infile);
+ return 2;
+ }
+ if (conf.indent)
+ flags |= JSON_INDENT(conf.indent);
+
+ if (conf.compact)
+ flags |= JSON_COMPACT;
+
+ if (conf.ensure_ascii)
+ flags |= JSON_ENSURE_ASCII;
+
+ if (conf.preserve_order)
+ flags |= JSON_PRESERVE_ORDER;
+
+ if (conf.sort_keys)
+ flags |= JSON_SORT_KEYS;
+
+ if (conf.precision < 0 || conf.precision > 31) {
+ fprintf(stderr, "invalid value for JSON_REAL_PRECISION: %d\n", conf.precision);
+ fclose(infile);
+ return 2;
+ }
+ if (conf.precision)
+ flags |= JSON_REAL_PRECISION(conf.precision);
+
+ if (conf.have_hashseed)
+ json_object_seed(conf.hashseed);
+
+ if (conf.strip) {
+ /* Load to memory, strip leading and trailing whitespace */
+ buffer = loadfile(infile);
+ json = json_loads(strip(buffer), 0, &error);
+ free(buffer);
+ } else
+ json = json_loadf(infile, 0, &error);
+
+ fclose(infile);
+
+ if (!json) {
+ sprintf(errstr, "%d %d %d\n%s\n", error.line, error.column, error.position,
+ error.text);
+
+ ret = cmpfile(errstr, test_path, "error");
+ return ret;
+ }
+
+ buffer = json_dumps(json, flags);
+ ret = cmpfile(buffer, test_path, "output");
+ free(buffer);
+ json_decref(json);
+
+ return ret;
+}
+
+static int getenv_int(const char *name) {
+ char *value, *end;
+ long result;
+
+ value = getenv(name);
+ if (!value)
+ return 0;
+
+ result = strtol(value, &end, 10);
+ if (*end != '\0')
+ return 0;
+
+ return (int)result;
+}
+
+int use_env() {
+ int indent, precision;
+ size_t flags = 0;
+ json_t *json;
+ json_error_t error;
+
+#ifdef _WIN32
+ /* On Windows, set stdout and stderr to binary mode to avoid
+ outputting DOS line terminators */
+ _setmode(_fileno(stdout), _O_BINARY);
+ _setmode(_fileno(stderr), _O_BINARY);
+#endif
+
+ indent = getenv_int("JSON_INDENT");
+ if (indent < 0 || indent > 31) {
+ fprintf(stderr, "invalid value for JSON_INDENT: %d\n", indent);
+ return 2;
+ }
+ if (indent > 0)
+ flags |= JSON_INDENT(indent);
+
+ if (getenv_int("JSON_COMPACT") > 0)
+ flags |= JSON_COMPACT;
+
+ if (getenv_int("JSON_ENSURE_ASCII"))
+ flags |= JSON_ENSURE_ASCII;
+
+ if (getenv_int("JSON_PRESERVE_ORDER"))
+ flags |= JSON_PRESERVE_ORDER;
+
+ if (getenv_int("JSON_SORT_KEYS"))
+ flags |= JSON_SORT_KEYS;
+
+ precision = getenv_int("JSON_REAL_PRECISION");
+ if (precision < 0 || precision > 31) {
+ fprintf(stderr, "invalid value for JSON_REAL_PRECISION: %d\n", precision);
+ return 2;
+ }
+
+ if (getenv("HASHSEED"))
+ json_object_seed(getenv_int("HASHSEED"));
+
+ if (precision > 0)
+ flags |= JSON_REAL_PRECISION(precision);
+
+ if (getenv_int("STRIP")) {
+ /* Load to memory, strip leading and trailing whitespace */
+ size_t size = 0, used = 0;
+ char *buffer = NULL, *buf_ck = NULL;
+
+ while (1) {
+ size_t count;
+
+ size = (size == 0 ? 128 : size * 2);
+ buf_ck = realloc(buffer, size);
+ if (!buf_ck) {
+ fprintf(stderr, "Unable to allocate %d bytes\n", (int)size);
+ free(buffer);
+ return 1;
+ }
+ buffer = buf_ck;
+
+ count = fread(buffer + used, 1, size - used, stdin);
+ if (count < size - used) {
+ buffer[used + count] = '\0';
+ break;
+ }
+ used += count;
+ }
+
+ json = json_loads(strip(buffer), 0, &error);
+ free(buffer);
+ } else
+ json = json_loadf(stdin, 0, &error);
+
+ if (!json) {
+ fprintf(stderr, "%d %d %d\n%s\n", error.line, error.column, error.position,
+ error.text);
+ return 1;
+ }
+
+ json_dumpf(json, stdout, flags);
+ json_decref(json);
+
+ return 0;
+}
+
+int main(int argc, char *argv[]) {
+ int i;
+ char *test_path = NULL;
+
+#ifdef HAVE_SETLOCALE
+ setlocale(LC_ALL, "");
+#endif
+
+ if (argc < 2) {
+ goto usage;
+ }
+
+ for (i = 1; i < argc; i++) {
+ if (!strcmp(argv[i], "--strip"))
+ conf.strip = 1;
+ else if (!strcmp(argv[i], "--env"))
+ conf.use_env = 1;
+ else
+ test_path = argv[i];
+ }
+
+ if (conf.use_env)
+ return use_env();
+ else {
+ if (!test_path)
+ goto usage;
+
+ return use_conf(test_path);
+ }
+
+usage:
+ fprintf(stderr, "argc =%d\n", argc);
+ fprintf(stderr, "usage: %s [--strip] [--env] test_dir\n", argv[0]);
+ return 2;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/.gitignore b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/.gitignore
new file mode 100644
index 000000000..7fbb8677b
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/.gitignore
@@ -0,0 +1 @@
+json_load_dump_fuzzer
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/Makefile.am b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/Makefile.am
new file mode 100644
index 000000000..a2e802e86
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/Makefile.am
@@ -0,0 +1,32 @@
+AM_CPPFLAGS = -I$(top_builddir)/src -I$(top_srcdir)/src
+LDADD = $(top_builddir)/src/libjansson.la
+
+if USE_OSSFUZZ_FLAG
+FUZZ_FLAG = $(LIB_FUZZING_ENGINE)
+else
+if USE_OSSFUZZ_STATIC
+LDADD += $(LIB_FUZZING_ENGINE)
+FUZZ_FLAG =
+else
+LDADD += libstandaloneengine.a
+FUZZ_FLAG =
+endif
+endif
+
+noinst_PROGRAMS =
+noinst_LIBRARIES =
+
+if USE_OSSFUZZERS
+noinst_PROGRAMS += \
+ json_load_dump_fuzzer
+
+noinst_LIBRARIES += \
+ libstandaloneengine.a
+endif
+
+json_load_dump_fuzzer_SOURCES = json_load_dump_fuzzer.cc testinput.h
+json_load_dump_fuzzer_CXXFLAGS = $(AM_CXXFLAGS) $(FUZZ_FLAG)
+json_load_dump_fuzzer_LDFLAGS = $(AM_LDFLAGS) -static
+
+libstandaloneengine_a_SOURCES = standaloneengine.cc
+libstandaloneengine_a_CXXFLAGS = $(AM_CXXFLAGS)
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/json_load_dump_fuzzer.cc b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/json_load_dump_fuzzer.cc
new file mode 100644
index 000000000..bc3844e75
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/json_load_dump_fuzzer.cc
@@ -0,0 +1,132 @@
+#include <stdint.h>
+#include <stdlib.h>
+#include <sys/types.h>
+#include <inttypes.h>
+
+#include "jansson.h"
+
+static int enable_diags;
+
+#define FUZZ_DEBUG(FMT, ...) \
+ if (enable_diags) \
+ { \
+ fprintf(stderr, FMT, ##__VA_ARGS__); \
+ fprintf(stderr, "\n"); \
+ }
+
+
+static int json_dump_counter(const char *buffer, size_t size, void *data)
+{
+ uint64_t *counter = reinterpret_cast<uint64_t *>(data);
+ *counter += size;
+ return 0;
+}
+
+
+#define NUM_COMMAND_BYTES (sizeof(size_t) + sizeof(size_t) + 1)
+
+#define FUZZ_DUMP_CALLBACK 0x00
+#define FUZZ_DUMP_STRING 0x01
+
+extern "C" int LLVMFuzzerTestOneInput(const uint8_t *data, size_t size)
+{
+ json_error_t error;
+ unsigned char dump_mode;
+
+ // Enable or disable diagnostics based on the FUZZ_VERBOSE environment flag.
+ enable_diags = (getenv("FUZZ_VERBOSE") != NULL);
+
+ FUZZ_DEBUG("Input data length: %zd", size);
+
+ if (size < NUM_COMMAND_BYTES)
+ {
+ return 0;
+ }
+
+ // Use the first sizeof(size_t) bytes as load flags.
+ size_t load_flags = *(const size_t*)data;
+ data += sizeof(size_t);
+
+ FUZZ_DEBUG("load_flags: 0x%zx\n"
+ "& JSON_REJECT_DUPLICATES = 0x%zx\n"
+ "& JSON_DECODE_ANY = 0x%zx\n"
+ "& JSON_DISABLE_EOF_CHECK = 0x%zx\n"
+ "& JSON_DECODE_INT_AS_REAL = 0x%zx\n"
+ "& JSON_ALLOW_NUL = 0x%zx\n",
+ load_flags,
+ load_flags & JSON_REJECT_DUPLICATES,
+ load_flags & JSON_DECODE_ANY,
+ load_flags & JSON_DISABLE_EOF_CHECK,
+ load_flags & JSON_DECODE_INT_AS_REAL,
+ load_flags & JSON_ALLOW_NUL);
+
+ // Use the next sizeof(size_t) bytes as dump flags.
+ size_t dump_flags = *(const size_t*)data;
+ data += sizeof(size_t);
+
+ FUZZ_DEBUG("dump_flags: 0x%zx\n"
+ "& JSON_MAX_INDENT = 0x%zx\n"
+ "& JSON_COMPACT = 0x%zx\n"
+ "& JSON_ENSURE_ASCII = 0x%zx\n"
+ "& JSON_SORT_KEYS = 0x%zx\n"
+ "& JSON_PRESERVE_ORDER = 0x%zx\n"
+ "& JSON_ENCODE_ANY = 0x%zx\n"
+ "& JSON_ESCAPE_SLASH = 0x%zx\n"
+ "& JSON_REAL_PRECISION = 0x%zx\n"
+ "& JSON_EMBED = 0x%zx\n",
+ dump_flags,
+ dump_flags & JSON_MAX_INDENT,
+ dump_flags & JSON_COMPACT,
+ dump_flags & JSON_ENSURE_ASCII,
+ dump_flags & JSON_SORT_KEYS,
+ dump_flags & JSON_PRESERVE_ORDER,
+ dump_flags & JSON_ENCODE_ANY,
+ dump_flags & JSON_ESCAPE_SLASH,
+ ((dump_flags >> 11) & 0x1F) << 11,
+ dump_flags & JSON_EMBED);
+
+ // Use the next byte as the dump mode.
+ dump_mode = data[0];
+ data++;
+
+ FUZZ_DEBUG("dump_mode: 0x%x", (unsigned int)dump_mode);
+
+ // Remove the command bytes from the size total.
+ size -= NUM_COMMAND_BYTES;
+
+ // Attempt to load the remainder of the data with the given load flags.
+ const char* text = reinterpret_cast<const char *>(data);
+ json_t* jobj = json_loadb(text, size, load_flags, &error);
+
+ if (jobj == NULL)
+ {
+ return 0;
+ }
+
+ if (dump_mode & FUZZ_DUMP_STRING)
+ {
+ // Dump as a string. Remove indents so that we don't run out of memory.
+ char *out = json_dumps(jobj, dump_flags & ~JSON_MAX_INDENT);
+ if (out != NULL)
+ {
+ free(out);
+ }
+ }
+ else
+ {
+ // Default is callback mode.
+ //
+ // Attempt to dump the loaded json object with the given dump flags.
+ uint64_t counter = 0;
+
+ json_dump_callback(jobj, json_dump_counter, &counter, dump_flags);
+ FUZZ_DEBUG("Counter function counted %" PRIu64 " bytes.", counter);
+ }
+
+ if (jobj)
+ {
+ json_decref(jobj);
+ }
+
+ return 0;
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/ossfuzz.sh b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/ossfuzz.sh
new file mode 100755
index 000000000..59740c253
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/ossfuzz.sh
@@ -0,0 +1,30 @@
+#!/bin/bash -eu
+
+# This script is called by the oss-fuzz main project when compiling the fuzz
+# targets. This script is regression tested by travisoss.sh.
+
+# Save off the current folder as the build root.
+export BUILD_ROOT=$PWD
+
+echo "CC: $CC"
+echo "CXX: $CXX"
+echo "LIB_FUZZING_ENGINE: $LIB_FUZZING_ENGINE"
+echo "CFLAGS: $CFLAGS"
+echo "CXXFLAGS: $CXXFLAGS"
+echo "OUT: $OUT"
+
+export MAKEFLAGS+="-j$(nproc)"
+
+# Install dependencies
+apt-get -y install automake libtool
+
+# Compile the fuzzer.
+autoreconf -i
+./configure --enable-ossfuzzers
+make
+
+# Copy the fuzzer to the output directory.
+cp -v test/ossfuzz/json_load_dump_fuzzer $OUT/
+
+# Zip up all input files to use as a test corpus
+find test/suites -name "input" -print | zip $OUT/json_load_dump_fuzzer_seed_corpus.zip -@
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/standaloneengine.cc b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/standaloneengine.cc
new file mode 100644
index 000000000..175360e4a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/standaloneengine.cc
@@ -0,0 +1,74 @@
+#include <stdint.h>
+#include <stdio.h>
+#include <stdlib.h>
+
+#include "testinput.h"
+
+/**
+ * Main procedure for standalone fuzzing engine.
+ *
+ * Reads filenames from the argument array. For each filename, read the file
+ * into memory and then call the fuzzing interface with the data.
+ */
+int main(int argc, char **argv)
+{
+ int ii;
+ for(ii = 1; ii < argc; ii++)
+ {
+ FILE *infile;
+ printf("[%s] ", argv[ii]);
+
+ /* Try and open the file. */
+ infile = fopen(argv[ii], "rb");
+ if(infile)
+ {
+ uint8_t *buffer = NULL;
+ size_t buffer_len;
+
+ printf("Opened.. ");
+
+ /* Get the length of the file. */
+ fseek(infile, 0L, SEEK_END);
+ buffer_len = ftell(infile);
+
+ /* Reset the file indicator to the beginning of the file. */
+ fseek(infile, 0L, SEEK_SET);
+
+ /* Allocate a buffer for the file contents. */
+ buffer = (uint8_t *)calloc(buffer_len, sizeof(uint8_t));
+ if(buffer)
+ {
+ /* Read all the text from the file into the buffer. */
+ fread(buffer, sizeof(uint8_t), buffer_len, infile);
+ printf("Read %zu bytes, fuzzing.. ", buffer_len);
+
+ /* Call the fuzzer with the data. */
+ LLVMFuzzerTestOneInput(buffer, buffer_len);
+
+ printf("complete !!");
+
+ /* Free the buffer as it's no longer needed. */
+ free(buffer);
+ buffer = NULL;
+ }
+ else
+ {
+ fprintf(stderr,
+ "[%s] Failed to allocate %zu bytes \n",
+ argv[ii],
+ buffer_len);
+ }
+
+ /* Close the file as it's no longer needed. */
+ fclose(infile);
+ infile = NULL;
+ }
+ else
+ {
+ /* Failed to open the file. Maybe wrong name or wrong permissions? */
+ fprintf(stderr, "[%s] Open failed. \n", argv[ii]);
+ }
+
+ printf("\n");
+ }
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/testinput.h b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/testinput.h
new file mode 100644
index 000000000..6ab9b515e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/testinput.h
@@ -0,0 +1,3 @@
+#include <inttypes.h>
+
+extern "C" int LLVMFuzzerTestOneInput(const uint8_t *data, size_t size);
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/travisoss.sh b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/travisoss.sh
new file mode 100755
index 000000000..ddcfa075a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/ossfuzz/travisoss.sh
@@ -0,0 +1,38 @@
+#!/bin/bash
+
+set -ex
+
+PROJECT_NAME=jansson
+
+# Clone the oss-fuzz repository
+git clone https://github.com/google/oss-fuzz.git /tmp/ossfuzz
+
+if [[ ! -d /tmp/ossfuzz/projects/${PROJECT_NAME} ]]
+then
+ echo "Could not find the ${PROJECT_NAME} project in ossfuzz"
+
+ # Exit with a success code while the jansson project is not expected to exist
+ # on oss-fuzz.
+ exit 0
+fi
+
+# Work out which repo to clone from, inside Docker
+if [[ ${TRAVIS_PULL_REQUEST} != "false" ]]
+then
+ # Pull-request branch
+ REPO=${TRAVIS_PULL_REQUEST_SLUG}
+ BRANCH=${TRAVIS_PULL_REQUEST_BRANCH}
+else
+ # Push build.
+ REPO=${TRAVIS_REPO_SLUG}
+ BRANCH=${TRAVIS_BRANCH}
+fi
+
+# Modify the oss-fuzz Dockerfile so that we're checking out the current branch on travis.
+sed -i "s@https://github.com/akheron/jansson.git@-b ${BRANCH} https://github.com/${REPO}.git@" /tmp/ossfuzz/projects/${PROJECT_NAME}/Dockerfile
+
+# Try and build the fuzzers
+pushd /tmp/ossfuzz
+python infra/helper.py build_image --pull ${PROJECT_NAME}
+python infra/helper.py build_fuzzers ${PROJECT_NAME}
+popd
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/run-suites b/src/fluent-bit/lib/jansson-e23f558/test/run-suites
new file mode 100755
index 000000000..fd1b89b5a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/run-suites
@@ -0,0 +1,50 @@
+#!/bin/sh
+
+while [ -n "$1" ]; do
+ suite=$1
+ if [ -x $top_srcdir/test/suites/$suite/run ]; then
+ SUITES="$SUITES $suite"
+ else
+ echo "No such suite: $suite"
+ exit 1
+ fi
+ shift
+done
+
+if [ -z "$SUITES" ]; then
+ suitedirs=$top_srcdir/test/suites/*
+ for suitedir in $suitedirs; do
+ if [ -d $suitedir ]; then
+ SUITES="$SUITES `basename $suitedir`"
+ fi
+ done
+fi
+
+[ -z "$STOP" ] && STOP=0
+
+suites_srcdir=$top_srcdir/test/suites
+suites_builddir=suites
+scriptdir=$top_srcdir/test/scripts
+logdir=logs
+bindir=bin
+export suites_srcdir suites_builddir scriptdir logdir bindir
+
+passed=0
+failed=0
+for suite in $SUITES; do
+ echo "Suite: $suite"
+ if $suites_srcdir/$suite/run $suite; then
+ passed=`expr $passed + 1`
+ else
+ failed=`expr $failed + 1`
+ [ $STOP -eq 1 ] && break
+ fi
+done
+
+if [ $failed -gt 0 ]; then
+ echo "$failed of `expr $passed + $failed` test suites failed"
+ exit 1
+else
+ echo "$passed test suites passed"
+ rm -rf $logdir
+fi
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/scripts/run-tests.sh b/src/fluent-bit/lib/jansson-e23f558/test/scripts/run-tests.sh
new file mode 100644
index 000000000..f980a7657
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/scripts/run-tests.sh
@@ -0,0 +1,100 @@
+# Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+die() {
+ echo "$1" >&2
+ exit 1
+}
+
+[ -n "$1" ] || die "Usage: $0 suite-name"
+[ -n "$bindir" ] || die "Set bindir"
+[ -n "$logdir" ] || die "Set logdir"
+[ -n "$scriptdir" ] || die "Set scriptdir"
+[ -n "$suites_srcdir" ] || die "Set suites_srcdir"
+[ -n "$suites_builddir" ] || die "Set suites_builddir"
+
+json_process=$bindir/json_process
+
+suite_name=$1
+suite_srcdir=$suites_srcdir/$suite_name
+suite_builddir=$suites_builddir/$suite_name
+suite_log=$logdir/$suite_name
+
+[ -z "$VERBOSE" ] && VERBOSE=0
+[ -z "$STOP" ] && STOP=0
+
+. $scriptdir/valgrind.sh
+
+rm -rf $suite_log
+mkdir -p $suite_log
+
+for test_path in $suite_srcdir/*; do
+ test_name=$(basename $test_path)
+ test_builddir=$suite_builddir/$test_name
+ test_log=$suite_log/$test_name
+
+ [ "$test_name" = "run" ] && continue
+ is_test || continue
+
+ rm -rf $test_log
+ mkdir -p $test_log
+ if [ $VERBOSE -eq 1 ]; then
+ printf '%s... ' "$test_name"
+ fi
+
+ run_test
+ case $? in
+ 0)
+ # Success
+ if [ $VERBOSE -eq 1 ]; then
+ printf 'ok\n'
+ else
+ printf '.'
+ fi
+ rm -rf $test_log
+ ;;
+
+ 77)
+ # Skip
+ if [ $VERBOSE -eq 1 ]; then
+ printf 'skipped\n'
+ else
+ printf 'S'
+ fi
+ rm -rf $test_log
+ ;;
+
+ *)
+ # Failure
+ if [ $VERBOSE -eq 1 ]; then
+ printf 'FAILED\n'
+ else
+ printf 'F'
+ fi
+
+ [ $STOP -eq 1 ] && break
+ ;;
+ esac
+done
+
+if [ $VERBOSE -eq 0 ]; then
+ printf '\n'
+fi
+
+if [ -n "$(ls -A $suite_log)" ]; then
+ for test_log in $suite_log/*; do
+ test_name=$(basename $test_log)
+ test_path=$suite_srcdir/$test_name
+ echo "================================================================="
+ echo "$suite_name/$test_name"
+ echo "================================================================="
+ show_error
+ echo
+ done
+ echo "================================================================="
+ exit 1
+else
+ rm -rf $suite_log
+fi
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/scripts/valgrind.sh b/src/fluent-bit/lib/jansson-e23f558/test/scripts/valgrind.sh
new file mode 100644
index 000000000..afbdcee15
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/scripts/valgrind.sh
@@ -0,0 +1,35 @@
+# Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+[ -z "$VALGRIND" ] && VALGRIND=0
+
+VALGRIND_CMDLINE="valgrind --leak-check=full --show-reachable=yes --track-origins=yes -q"
+
+if [ $VALGRIND -eq 1 ]; then
+ test_runner="$VALGRIND_CMDLINE"
+ json_process="$VALGRIND_CMDLINE $json_process"
+else
+ test_runner=""
+fi
+
+valgrind_check() {
+ if [ $VALGRIND -eq 1 ]; then
+ # Check for Valgrind error output. The valgrind option
+ # --error-exitcode is not enough because Valgrind doesn't
+ # think unfreed allocs are errors.
+ if grep -E -q '^==[0-9]+== ' $1; then
+ touch $test_log/valgrind_error
+ return 1
+ fi
+ fi
+}
+
+valgrind_show_error() {
+ if [ $VALGRIND -eq 1 -a -f $test_log/valgrind_error ]; then
+ echo "valgrind detected an error"
+ return 0
+ fi
+ return 1
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/.gitattributes b/src/fluent-bit/lib/jansson-e23f558/test/suites/.gitattributes
new file mode 100644
index 000000000..68d88612c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/.gitattributes
@@ -0,0 +1,2 @@
+api/ text=auto
+* text eol=lf \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/Makefile.am b/src/fluent-bit/lib/jansson-e23f558/test/suites/Makefile.am
new file mode 100644
index 000000000..a53eb07f1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/Makefile.am
@@ -0,0 +1,2 @@
+SUBDIRS = api
+EXTRA_DIST = invalid invalid-unicode valid
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/Makefile.am b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/Makefile.am
new file mode 100644
index 000000000..2bc638b82
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/Makefile.am
@@ -0,0 +1,42 @@
+EXTRA_DIST = run check-exports
+
+check_PROGRAMS = \
+ test_array \
+ test_chaos \
+ test_copy \
+ test_dump \
+ test_dump_callback \
+ test_equal \
+ test_fixed_size \
+ test_load \
+ test_load_callback \
+ test_loadb \
+ test_memory_funcs \
+ test_number \
+ test_object \
+ test_pack \
+ test_simple \
+ test_sprintf \
+ test_unpack \
+ test_version
+
+test_array_SOURCES = test_array.c util.h
+test_chaos_SOURCES = test_chaos.c util.h
+test_copy_SOURCES = test_copy.c util.h
+test_dump_SOURCES = test_dump.c util.h
+test_dump_callback_SOURCES = test_dump_callback.c util.h
+test_fixed_size_SOURCES = test_fixed_size.c util.h
+test_load_SOURCES = test_load.c util.h
+test_loadb_SOURCES = test_loadb.c util.h
+test_memory_funcs_SOURCES = test_memory_funcs.c util.h
+test_number_SOURCES = test_number.c util.h
+test_object_SOURCES = test_object.c util.h
+test_pack_SOURCES = test_pack.c util.h
+test_simple_SOURCES = test_simple.c util.h
+test_sprintf_SOURCES = test_sprintf.c util.h
+test_unpack_SOURCES = test_unpack.c util.h
+test_version_SOURCES = test_version.c util.h
+
+AM_CPPFLAGS = -I$(top_builddir)/src -I$(top_srcdir)/src
+LDFLAGS = -static # for speed and Valgrind
+LDADD = $(top_builddir)/src/libjansson.la
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/check-exports b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/check-exports
new file mode 100755
index 000000000..5c82064c1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/check-exports
@@ -0,0 +1,23 @@
+#!/bin/sh
+#
+# This test checks that libjansson.so exports the correct symbols.
+#
+
+SOFILE="../src/.libs/libjansson.so"
+
+# The list of symbols, which the shared object should export, is read
+# from the def file, which is used in Windows builds
+grep 'json_\|jansson_' $top_srcdir/src/jansson.def \
+ | sed -e 's/ //g' \
+ | sort \
+ >$test_log/exports
+
+nm -D $SOFILE >/dev/null >$test_log/symbols 2>/dev/null \
+ || exit 77 # Skip if "nm -D" doesn't seem to work
+
+grep ' [DT] ' $test_log/symbols | cut -d' ' -f3 | grep -v '^_' | sed 's/@@libjansson.*//' | sort >$test_log/output
+
+if ! cmp -s $test_log/exports $test_log/output; then
+ diff -u $test_log/exports $test_log/output >&2
+ exit 1
+fi
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/run b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/run
new file mode 100755
index 000000000..0c017bca6
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/run
@@ -0,0 +1,36 @@
+#!/bin/sh
+#
+# Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+is_test() {
+ case "$test_name" in
+ *.c|check-exports)
+ return 0
+ ;;
+ *)
+ return 1
+ ;;
+ esac
+}
+
+run_test() {
+ if [ "$test_name" = "check-exports" ]; then
+ test_log=$test_log $test_path >$test_log/stdout 2>$test_log/stderr
+ else
+ $test_runner $suite_builddir/${test_name%.c} \
+ >$test_log/stdout \
+ 2>$test_log/stderr \
+ || return 1
+ valgrind_check $test_log/stderr || return 1
+ fi
+}
+
+show_error() {
+ valgrind_show_error && return
+ cat $test_log/stderr
+}
+
+. $top_srcdir/test/scripts/run-tests.sh
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_array.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_array.c
new file mode 100644
index 000000000..e5d9d1a19
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_array.c
@@ -0,0 +1,484 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+
+static void test_misc(void) {
+ json_t *array, *five, *seven, *value;
+ size_t i;
+
+ array = json_array();
+ five = json_integer(5);
+ seven = json_integer(7);
+
+ if (!array)
+ fail("unable to create array");
+ if (!five || !seven)
+ fail("unable to create integer");
+
+ if (json_array_size(array) != 0)
+ fail("empty array has nonzero size");
+
+ if (!json_array_append(array, NULL))
+ fail("able to append NULL");
+
+ if (json_array_append(array, five))
+ fail("unable to append");
+
+ if (json_array_size(array) != 1)
+ fail("wrong array size");
+
+ value = json_array_get(array, 0);
+ if (!value)
+ fail("unable to get item");
+ if (value != five)
+ fail("got wrong value");
+
+ if (json_array_append(array, seven))
+ fail("unable to append value");
+
+ if (json_array_size(array) != 2)
+ fail("wrong array size");
+
+ value = json_array_get(array, 1);
+ if (!value)
+ fail("unable to get item");
+ if (value != seven)
+ fail("got wrong value");
+
+ if (json_array_set(array, 0, seven))
+ fail("unable to set value");
+
+ if (!json_array_set(array, 0, NULL))
+ fail("able to set NULL");
+
+ if (json_array_size(array) != 2)
+ fail("wrong array size");
+
+ value = json_array_get(array, 0);
+ if (!value)
+ fail("unable to get item");
+ if (value != seven)
+ fail("got wrong value");
+
+ if (json_array_get(array, 2) != NULL)
+ fail("able to get value out of bounds");
+
+ if (!json_array_set(array, 2, seven))
+ fail("able to set value out of bounds");
+
+ for (i = 2; i < 30; i++) {
+ if (json_array_append(array, seven))
+ fail("unable to append value");
+
+ if (json_array_size(array) != i + 1)
+ fail("wrong array size");
+ }
+
+ for (i = 0; i < 30; i++) {
+ value = json_array_get(array, i);
+ if (!value)
+ fail("unable to get item");
+ if (value != seven)
+ fail("got wrong value");
+ }
+
+ if (json_array_set_new(array, 15, json_integer(123)))
+ fail("unable to set new value");
+
+ value = json_array_get(array, 15);
+ if (!json_is_integer(value) || json_integer_value(value) != 123)
+ fail("json_array_set_new works incorrectly");
+
+ if (!json_array_set_new(array, 15, NULL))
+ fail("able to set_new NULL value");
+
+ if (json_array_append_new(array, json_integer(321)))
+ fail("unable to append new value");
+
+ value = json_array_get(array, json_array_size(array) - 1);
+ if (!json_is_integer(value) || json_integer_value(value) != 321)
+ fail("json_array_append_new works incorrectly");
+
+ if (!json_array_append_new(array, NULL))
+ fail("able to append_new NULL value");
+
+ json_decref(five);
+ json_decref(seven);
+ json_decref(array);
+}
+
+static void test_insert(void) {
+ json_t *array, *five, *seven, *eleven, *value;
+ int i;
+
+ array = json_array();
+ five = json_integer(5);
+ seven = json_integer(7);
+ eleven = json_integer(11);
+
+ if (!array)
+ fail("unable to create array");
+ if (!five || !seven || !eleven)
+ fail("unable to create integer");
+
+ if (!json_array_insert(array, 1, five))
+ fail("able to insert value out of bounds");
+
+ if (json_array_insert(array, 0, five))
+ fail("unable to insert value in an empty array");
+
+ if (json_array_get(array, 0) != five)
+ fail("json_array_insert works incorrectly");
+
+ if (json_array_size(array) != 1)
+ fail("array size is invalid after insertion");
+
+ if (json_array_insert(array, 1, seven))
+ fail("unable to insert value at the end of an array");
+
+ if (json_array_get(array, 0) != five)
+ fail("json_array_insert works incorrectly");
+
+ if (json_array_get(array, 1) != seven)
+ fail("json_array_insert works incorrectly");
+
+ if (json_array_size(array) != 2)
+ fail("array size is invalid after insertion");
+
+ if (json_array_insert(array, 1, eleven))
+ fail("unable to insert value in the middle of an array");
+
+ if (json_array_get(array, 0) != five)
+ fail("json_array_insert works incorrectly");
+
+ if (json_array_get(array, 1) != eleven)
+ fail("json_array_insert works incorrectly");
+
+ if (json_array_get(array, 2) != seven)
+ fail("json_array_insert works incorrectly");
+
+ if (json_array_size(array) != 3)
+ fail("array size is invalid after insertion");
+
+ if (json_array_insert_new(array, 2, json_integer(123)))
+ fail("unable to insert value in the middle of an array");
+
+ value = json_array_get(array, 2);
+ if (!json_is_integer(value) || json_integer_value(value) != 123)
+ fail("json_array_insert_new works incorrectly");
+
+ if (json_array_size(array) != 4)
+ fail("array size is invalid after insertion");
+
+ for (i = 0; i < 20; i++) {
+ if (json_array_insert(array, 0, seven))
+ fail("unable to insert value at the beginning of an array");
+ }
+
+ for (i = 0; i < 20; i++) {
+ if (json_array_get(array, i) != seven)
+ fail("json_aray_insert works incorrectly");
+ }
+
+ if (json_array_size(array) != 24)
+ fail("array size is invalid after loop insertion");
+
+ json_decref(five);
+ json_decref(seven);
+ json_decref(eleven);
+ json_decref(array);
+}
+
+static void test_remove(void) {
+ json_t *array, *five, *seven;
+ int i;
+
+ array = json_array();
+ five = json_integer(5);
+ seven = json_integer(7);
+
+ if (!array)
+ fail("unable to create array");
+ if (!five)
+ fail("unable to create integer");
+ if (!seven)
+ fail("unable to create integer");
+
+ if (!json_array_remove(array, 0))
+ fail("able to remove an unexisting index");
+
+ if (json_array_append(array, five))
+ fail("unable to append");
+
+ if (!json_array_remove(array, 1))
+ fail("able to remove an unexisting index");
+
+ if (json_array_remove(array, 0))
+ fail("unable to remove");
+
+ if (json_array_size(array) != 0)
+ fail("array size is invalid after removing");
+
+ if (json_array_append(array, five) || json_array_append(array, seven) ||
+ json_array_append(array, five) || json_array_append(array, seven))
+ fail("unable to append");
+
+ if (json_array_remove(array, 2))
+ fail("unable to remove");
+
+ if (json_array_size(array) != 3)
+ fail("array size is invalid after removing");
+
+ if (json_array_get(array, 0) != five || json_array_get(array, 1) != seven ||
+ json_array_get(array, 2) != seven)
+ fail("remove works incorrectly");
+
+ json_decref(array);
+
+ array = json_array();
+ for (i = 0; i < 4; i++) {
+ json_array_append(array, five);
+ json_array_append(array, seven);
+ }
+ if (json_array_size(array) != 8)
+ fail("unable to append 8 items to array");
+
+ /* Remove an element from a "full" array. */
+ json_array_remove(array, 5);
+
+ json_decref(five);
+ json_decref(seven);
+ json_decref(array);
+}
+
+static void test_clear(void) {
+ json_t *array, *five, *seven;
+ int i;
+
+ array = json_array();
+ five = json_integer(5);
+ seven = json_integer(7);
+
+ if (!array)
+ fail("unable to create array");
+ if (!five || !seven)
+ fail("unable to create integer");
+
+ for (i = 0; i < 10; i++) {
+ if (json_array_append(array, five))
+ fail("unable to append");
+ }
+ for (i = 0; i < 10; i++) {
+ if (json_array_append(array, seven))
+ fail("unable to append");
+ }
+
+ if (json_array_size(array) != 20)
+ fail("array size is invalid after appending");
+
+ if (json_array_clear(array))
+ fail("unable to clear");
+
+ if (json_array_size(array) != 0)
+ fail("array size is invalid after clearing");
+
+ json_decref(five);
+ json_decref(seven);
+ json_decref(array);
+}
+
+static void test_extend(void) {
+ json_t *array1, *array2, *five, *seven;
+ int i;
+
+ array1 = json_array();
+ array2 = json_array();
+ five = json_integer(5);
+ seven = json_integer(7);
+
+ if (!array1 || !array2)
+ fail("unable to create array");
+ if (!five || !seven)
+ fail("unable to create integer");
+
+ for (i = 0; i < 10; i++) {
+ if (json_array_append(array1, five))
+ fail("unable to append");
+ }
+ for (i = 0; i < 10; i++) {
+ if (json_array_append(array2, seven))
+ fail("unable to append");
+ }
+
+ if (json_array_size(array1) != 10 || json_array_size(array2) != 10)
+ fail("array size is invalid after appending");
+
+ if (json_array_extend(array1, array2))
+ fail("unable to extend");
+
+ for (i = 0; i < 10; i++) {
+ if (json_array_get(array1, i) != five)
+ fail("invalid array contents after extending");
+ }
+ for (i = 10; i < 20; i++) {
+ if (json_array_get(array1, i) != seven)
+ fail("invalid array contents after extending");
+ }
+
+ json_decref(five);
+ json_decref(seven);
+ json_decref(array1);
+ json_decref(array2);
+}
+
+static void test_circular() {
+ json_t *array1, *array2;
+
+ /* the simple cases are checked */
+
+ array1 = json_array();
+ if (!array1)
+ fail("unable to create array");
+
+ if (json_array_append(array1, array1) == 0)
+ fail("able to append self");
+
+ if (json_array_insert(array1, 0, array1) == 0)
+ fail("able to insert self");
+
+ if (json_array_append_new(array1, json_true()))
+ fail("failed to append true");
+
+ if (json_array_set(array1, 0, array1) == 0)
+ fail("able to set self");
+
+ json_decref(array1);
+
+ /* create circular references */
+
+ array1 = json_array();
+ array2 = json_array();
+ if (!array1 || !array2)
+ fail("unable to create array");
+
+ if (json_array_append(array1, array2) || json_array_append(array2, array1))
+ fail("unable to append");
+
+ /* circularity is detected when dumping */
+ if (json_dumps(array1, 0) != NULL)
+ fail("able to dump circulars");
+
+ /* decref twice to deal with the circular references */
+ json_decref(array1);
+ json_decref(array2);
+ json_decref(array1);
+}
+
+static void test_array_foreach() {
+ size_t index;
+ json_t *array1, *array2, *value;
+
+ array1 = json_pack("[sisisi]", "foo", 1, "bar", 2, "baz", 3);
+ array2 = json_array();
+
+ json_array_foreach(array1, index, value) { json_array_append(array2, value); }
+
+ if (!json_equal(array1, array2))
+ fail("json_array_foreach failed to iterate all elements");
+
+ json_decref(array1);
+ json_decref(array2);
+}
+
+static void test_bad_args(void) {
+ json_t *arr = json_array();
+ json_t *num = json_integer(1);
+
+ if (!arr || !num)
+ fail("failed to create required objects");
+
+ if (json_array_size(NULL) != 0)
+ fail("NULL array has nonzero size");
+ if (json_array_size(num) != 0)
+ fail("non-array has nonzero array size");
+
+ if (json_array_get(NULL, 0))
+ fail("json_array_get did not return NULL for non-array");
+ if (json_array_get(num, 0))
+ fail("json_array_get did not return NULL for non-array");
+
+ if (!json_array_set_new(NULL, 0, json_incref(num)))
+ fail("json_array_set_new did not return error for non-array");
+ if (!json_array_set_new(num, 0, json_incref(num)))
+ fail("json_array_set_new did not return error for non-array");
+ if (!json_array_set_new(arr, 0, NULL))
+ fail("json_array_set_new did not return error for NULL value");
+ if (!json_array_set_new(arr, 0, json_incref(arr)))
+ fail("json_array_set_new did not return error for value == array");
+
+ if (!json_array_remove(NULL, 0))
+ fail("json_array_remove did not return error for non-array");
+ if (!json_array_remove(num, 0))
+ fail("json_array_remove did not return error for non-array");
+
+ if (!json_array_clear(NULL))
+ fail("json_array_clear did not return error for non-array");
+ if (!json_array_clear(num))
+ fail("json_array_clear did not return error for non-array");
+
+ if (!json_array_append_new(NULL, json_incref(num)))
+ fail("json_array_append_new did not return error for non-array");
+ if (!json_array_append_new(num, json_incref(num)))
+ fail("json_array_append_new did not return error for non-array");
+ if (!json_array_append_new(arr, NULL))
+ fail("json_array_append_new did not return error for NULL value");
+ if (!json_array_append_new(arr, json_incref(arr)))
+ fail("json_array_append_new did not return error for value == array");
+
+ if (!json_array_insert_new(NULL, 0, json_incref(num)))
+ fail("json_array_insert_new did not return error for non-array");
+ if (!json_array_insert_new(num, 0, json_incref(num)))
+ fail("json_array_insert_new did not return error for non-array");
+ if (!json_array_insert_new(arr, 0, NULL))
+ fail("json_array_insert_new did not return error for NULL value");
+ if (!json_array_insert_new(arr, 0, json_incref(arr)))
+ fail("json_array_insert_new did not return error for value == array");
+
+ if (!json_array_extend(NULL, arr))
+ fail("json_array_extend did not return error for first argument "
+ "non-array");
+ if (!json_array_extend(num, arr))
+ fail("json_array_extend did not return error for first argument "
+ "non-array");
+ if (!json_array_extend(arr, NULL))
+ fail("json_array_extend did not return error for second argument "
+ "non-array");
+ if (!json_array_extend(arr, num))
+ fail("json_array_extend did not return error for second argument "
+ "non-array");
+
+ if (num->refcount != 1)
+ fail("unexpected reference count on num");
+ if (arr->refcount != 1)
+ fail("unexpected reference count on arr");
+
+ json_decref(num);
+ json_decref(arr);
+}
+
+static void run_tests() {
+ test_misc();
+ test_insert();
+ test_remove();
+ test_clear();
+ test_extend();
+ test_circular();
+ test_array_foreach();
+ test_bad_args();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_chaos.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_chaos.c
new file mode 100644
index 000000000..8687243ed
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_chaos.c
@@ -0,0 +1,168 @@
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#include "util.h"
+#include <jansson.h>
+#include <stdio.h>
+#include <string.h>
+
+static int chaos_pos = 0;
+static int chaos_fail = 0;
+#define CHAOS_MAX_FAILURE 100
+
+void *chaos_malloc(size_t size) {
+ if (chaos_pos == chaos_fail)
+ return NULL;
+
+ chaos_pos++;
+
+ return malloc(size);
+}
+
+void chaos_free(void *obj) { free(obj); }
+
+/* Test all potential allocation failures. */
+#define chaos_loop(condition, code, cleanup) \
+ { \
+ chaos_pos = chaos_fail = 0; \
+ while (condition) { \
+ if (chaos_fail > CHAOS_MAX_FAILURE) \
+ fail("too many chaos failures"); \
+ code chaos_pos = 0; \
+ chaos_fail++; \
+ } \
+ cleanup \
+ }
+
+#define chaos_loop_new_value(json, initcall) \
+ chaos_loop(!json, json = initcall;, json_decref(json); json = NULL;)
+
+int test_unpack() {
+ int ret = -1;
+ int v1;
+ int v2;
+ json_error_t error;
+ json_t *root = json_pack("{s:i, s:i, s:i, s:i}", "n1", 1, "n2", 2, "n3", 3, "n4", 4);
+
+ if (!root)
+ return -1;
+
+ if (!json_unpack_ex(root, &error, JSON_STRICT, "{s:i, s:i}", "n1", &v1, "n2", &v2))
+ fail("Unexpected success");
+
+ if (json_error_code(&error) != json_error_end_of_input_expected) {
+ if (json_error_code(&error) != json_error_out_of_memory)
+ fail("Unexpected error code");
+
+ goto out;
+ }
+
+ if (strcmp(error.text, "2 object item(s) left unpacked: n3, n4"))
+ goto out;
+
+ ret = 0;
+
+out:
+ json_decref(root);
+ return ret;
+}
+
+int dump_chaos_callback(const char *buffer, size_t size, void *data) {
+ json_t *obj = json_object();
+
+ (void)buffer;
+ (void)size;
+ (void)data;
+
+ if (!obj)
+ return -1;
+
+ json_decref(obj);
+
+ return 0;
+}
+
+static void test_chaos() {
+ json_malloc_t orig_malloc;
+ json_free_t orig_free;
+ json_t *json = NULL;
+ json_t *obj = json_object();
+ json_t *arr1 = json_array();
+ json_t *arr2 = json_array();
+ json_t *txt = json_string("test");
+ json_t *intnum = json_integer(1);
+ json_t *dblnum = json_real(0.5);
+ char *dumptxt = NULL;
+ json_t *dumpobj = json_pack("{s:[iiis], s:s}", "key1", 1, 2, 3, "txt", "key2", "v2");
+ int keyno;
+
+ if (!obj || !arr1 || !arr2 || !txt || !intnum || !dblnum || !dumpobj)
+ fail("failed to allocate basic objects");
+
+ json_get_alloc_funcs(&orig_malloc, &orig_free);
+ json_set_alloc_funcs(chaos_malloc, chaos_free);
+
+ chaos_loop_new_value(json, json_pack("{s:s}", "key", "value"));
+ chaos_loop_new_value(json, json_pack("{s:[]}", "key"));
+ chaos_loop_new_value(json, json_pack("[biIf]", 1, 1, (json_int_t)1, 1.0));
+ chaos_loop_new_value(json, json_pack("[s*,s*]", "v1", "v2"));
+ chaos_loop_new_value(json, json_pack("o", json_incref(txt)));
+ chaos_loop_new_value(json, json_pack("O", txt));
+ chaos_loop_new_value(json, json_pack("s++", "a", "long string to force realloc",
+ "another long string to force yet another "
+ "reallocation of the string because "
+ "that's what we are testing."));
+
+ chaos_loop(test_unpack(), , );
+
+ chaos_loop(json_dump_callback(dumpobj, dump_chaos_callback, NULL, JSON_INDENT(1)),
+ , );
+ chaos_loop(json_dump_callback(dumpobj, dump_chaos_callback, NULL,
+ JSON_INDENT(1) | JSON_SORT_KEYS),
+ , );
+ chaos_loop(!dumptxt, dumptxt = json_dumps(dumpobj, JSON_COMPACT);, free(dumptxt);
+ dumptxt = NULL;);
+
+ chaos_loop_new_value(json, json_copy(obj));
+ chaos_loop_new_value(json, json_deep_copy(obj));
+
+ chaos_loop_new_value(json, json_copy(arr1));
+ chaos_loop_new_value(json, json_deep_copy(arr1));
+
+ chaos_loop_new_value(json, json_copy(txt));
+ chaos_loop_new_value(json, json_copy(intnum));
+ chaos_loop_new_value(json, json_copy(dblnum));
+
+#define JSON_LOAD_TXT "{\"n\":[1,2,3,4,5,6,7,8,9,10]}"
+ chaos_loop_new_value(json, json_loads(JSON_LOAD_TXT, 0, NULL));
+ chaos_loop_new_value(json, json_loadb(JSON_LOAD_TXT, strlen(JSON_LOAD_TXT), 0, NULL));
+
+ chaos_loop_new_value(json, json_sprintf("%s", "string"));
+
+ for (keyno = 0; keyno < 100; ++keyno) {
+#if !defined(_MSC_VER) || _MSC_VER >= 1900
+ /* Skip this test on old Windows compilers. */
+ char testkey[10];
+
+ snprintf(testkey, sizeof(testkey), "test%d", keyno);
+ chaos_loop(json_object_set_new_nocheck(obj, testkey, json_object()), , );
+#endif
+ chaos_loop(json_array_append_new(arr1, json_null()), , );
+ chaos_loop(json_array_insert_new(arr2, 0, json_null()), , );
+ }
+
+ chaos_loop(json_array_extend(arr1, arr2), , );
+ chaos_loop(json_string_set_nocheck(txt, "test"), , );
+
+ json_set_alloc_funcs(orig_malloc, orig_free);
+ json_decref(obj);
+ json_decref(arr1);
+ json_decref(arr2);
+ json_decref(txt);
+ json_decref(intnum);
+ json_decref(dblnum);
+ json_decref(dumpobj);
+}
+
+static void run_tests() { test_chaos(); }
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_copy.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_copy.c
new file mode 100644
index 000000000..656d98dd7
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_copy.c
@@ -0,0 +1,375 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <string.h>
+
+static void test_copy_simple(void) {
+ json_t *value, *copy;
+
+ if (json_copy(NULL))
+ fail("copying NULL doesn't return NULL");
+
+ /* true */
+ value = json_true();
+ copy = json_copy(value);
+ if (value != copy)
+ fail("copying true failed");
+ json_decref(value);
+ json_decref(copy);
+
+ /* false */
+ value = json_false();
+ copy = json_copy(value);
+ if (value != copy)
+ fail("copying false failed");
+ json_decref(value);
+ json_decref(copy);
+
+ /* null */
+ value = json_null();
+ copy = json_copy(value);
+ if (value != copy)
+ fail("copying null failed");
+ json_decref(value);
+ json_decref(copy);
+
+ /* string */
+ value = json_string("foo");
+ if (!value)
+ fail("unable to create a string");
+ copy = json_copy(value);
+ if (!copy)
+ fail("unable to copy a string");
+ if (copy == value)
+ fail("copying a string doesn't copy");
+ if (!json_equal(copy, value))
+ fail("copying a string produces an inequal copy");
+ if (value->refcount != 1 || copy->refcount != 1)
+ fail("invalid refcounts");
+ json_decref(value);
+ json_decref(copy);
+
+ /* integer */
+ value = json_integer(543);
+ if (!value)
+ fail("unable to create an integer");
+ copy = json_copy(value);
+ if (!copy)
+ fail("unable to copy an integer");
+ if (copy == value)
+ fail("copying an integer doesn't copy");
+ if (!json_equal(copy, value))
+ fail("copying an integer produces an inequal copy");
+ if (value->refcount != 1 || copy->refcount != 1)
+ fail("invalid refcounts");
+ json_decref(value);
+ json_decref(copy);
+
+ /* real */
+ value = json_real(123e9);
+ if (!value)
+ fail("unable to create a real");
+ copy = json_copy(value);
+ if (!copy)
+ fail("unable to copy a real");
+ if (copy == value)
+ fail("copying a real doesn't copy");
+ if (!json_equal(copy, value))
+ fail("copying a real produces an inequal copy");
+ if (value->refcount != 1 || copy->refcount != 1)
+ fail("invalid refcounts");
+ json_decref(value);
+ json_decref(copy);
+}
+
+static void test_deep_copy_simple(void) {
+ json_t *value, *copy;
+
+ if (json_deep_copy(NULL))
+ fail("deep copying NULL doesn't return NULL");
+
+ /* true */
+ value = json_true();
+ copy = json_deep_copy(value);
+ if (value != copy)
+ fail("deep copying true failed");
+ json_decref(value);
+ json_decref(copy);
+
+ /* false */
+ value = json_false();
+ copy = json_deep_copy(value);
+ if (value != copy)
+ fail("deep copying false failed");
+ json_decref(value);
+ json_decref(copy);
+
+ /* null */
+ value = json_null();
+ copy = json_deep_copy(value);
+ if (value != copy)
+ fail("deep copying null failed");
+ json_decref(value);
+ json_decref(copy);
+
+ /* string */
+ value = json_string("foo");
+ if (!value)
+ fail("unable to create a string");
+ copy = json_deep_copy(value);
+ if (!copy)
+ fail("unable to deep copy a string");
+ if (copy == value)
+ fail("deep copying a string doesn't copy");
+ if (!json_equal(copy, value))
+ fail("deep copying a string produces an inequal copy");
+ if (value->refcount != 1 || copy->refcount != 1)
+ fail("invalid refcounts");
+ json_decref(value);
+ json_decref(copy);
+
+ /* integer */
+ value = json_integer(543);
+ if (!value)
+ fail("unable to create an integer");
+ copy = json_deep_copy(value);
+ if (!copy)
+ fail("unable to deep copy an integer");
+ if (copy == value)
+ fail("deep copying an integer doesn't copy");
+ if (!json_equal(copy, value))
+ fail("deep copying an integer produces an inequal copy");
+ if (value->refcount != 1 || copy->refcount != 1)
+ fail("invalid refcounts");
+ json_decref(value);
+ json_decref(copy);
+
+ /* real */
+ value = json_real(123e9);
+ if (!value)
+ fail("unable to create a real");
+ copy = json_deep_copy(value);
+ if (!copy)
+ fail("unable to deep copy a real");
+ if (copy == value)
+ fail("deep copying a real doesn't copy");
+ if (!json_equal(copy, value))
+ fail("deep copying a real produces an inequal copy");
+ if (value->refcount != 1 || copy->refcount != 1)
+ fail("invalid refcounts");
+ json_decref(value);
+ json_decref(copy);
+}
+
+static void test_copy_array(void) {
+ const char *json_array_text = "[1, \"foo\", 3.141592, {\"foo\": \"bar\"}]";
+
+ json_t *array, *copy;
+ size_t i;
+
+ array = json_loads(json_array_text, 0, NULL);
+ if (!array)
+ fail("unable to parse an array");
+
+ copy = json_copy(array);
+ if (!copy)
+ fail("unable to copy an array");
+ if (copy == array)
+ fail("copying an array doesn't copy");
+ if (!json_equal(copy, array))
+ fail("copying an array produces an inequal copy");
+
+ for (i = 0; i < json_array_size(copy); i++) {
+ if (json_array_get(array, i) != json_array_get(copy, i))
+ fail("copying an array modifies its elements");
+ }
+
+ json_decref(array);
+ json_decref(copy);
+}
+
+static void test_deep_copy_array(void) {
+ const char *json_array_text = "[1, \"foo\", 3.141592, {\"foo\": \"bar\"}]";
+
+ json_t *array, *copy;
+ size_t i;
+
+ array = json_loads(json_array_text, 0, NULL);
+ if (!array)
+ fail("unable to parse an array");
+
+ copy = json_deep_copy(array);
+ if (!copy)
+ fail("unable to deep copy an array");
+ if (copy == array)
+ fail("deep copying an array doesn't copy");
+ if (!json_equal(copy, array))
+ fail("deep copying an array produces an inequal copy");
+
+ for (i = 0; i < json_array_size(copy); i++) {
+ if (json_array_get(array, i) == json_array_get(copy, i))
+ fail("deep copying an array doesn't copy its elements");
+ }
+
+ json_decref(array);
+ json_decref(copy);
+}
+
+static void test_copy_object(void) {
+ const char *json_object_text =
+ "{\"foo\": \"bar\", \"a\": 1, \"b\": 3.141592, \"c\": [1,2,3,4]}";
+
+ const char *keys[] = {"foo", "a", "b", "c"};
+ int i;
+
+ json_t *object, *copy;
+ void *iter;
+
+ object = json_loads(json_object_text, 0, NULL);
+ if (!object)
+ fail("unable to parse an object");
+
+ copy = json_copy(object);
+ if (!copy)
+ fail("unable to copy an object");
+ if (copy == object)
+ fail("copying an object doesn't copy");
+ if (!json_equal(copy, object))
+ fail("copying an object produces an inequal copy");
+
+ i = 0;
+ iter = json_object_iter(object);
+ while (iter) {
+ const char *key;
+ json_t *value1, *value2;
+
+ key = json_object_iter_key(iter);
+ value1 = json_object_iter_value(iter);
+ value2 = json_object_get(copy, key);
+
+ if (value1 != value2)
+ fail("copying an object modifies its items");
+
+ if (strcmp(key, keys[i]) != 0)
+ fail("copying an object doesn't preserve key order");
+
+ iter = json_object_iter_next(object, iter);
+ i++;
+ }
+
+ json_decref(object);
+ json_decref(copy);
+}
+
+static void test_deep_copy_object(void) {
+ const char *json_object_text =
+ "{\"foo\": \"bar\", \"a\": 1, \"b\": 3.141592, \"c\": [1,2,3,4]}";
+
+ const char *keys[] = {"foo", "a", "b", "c"};
+ int i;
+
+ json_t *object, *copy;
+ void *iter;
+
+ object = json_loads(json_object_text, 0, NULL);
+ if (!object)
+ fail("unable to parse an object");
+
+ copy = json_deep_copy(object);
+ if (!copy)
+ fail("unable to deep copy an object");
+ if (copy == object)
+ fail("deep copying an object doesn't copy");
+ if (!json_equal(copy, object))
+ fail("deep copying an object produces an inequal copy");
+
+ i = 0;
+ iter = json_object_iter(object);
+ while (iter) {
+ const char *key;
+ json_t *value1, *value2;
+
+ key = json_object_iter_key(iter);
+ value1 = json_object_iter_value(iter);
+ value2 = json_object_get(copy, key);
+
+ if (value1 == value2)
+ fail("deep copying an object doesn't copy its items");
+
+ if (strcmp(key, keys[i]) != 0)
+ fail("deep copying an object doesn't preserve key order");
+
+ iter = json_object_iter_next(object, iter);
+ i++;
+ }
+
+ json_decref(object);
+ json_decref(copy);
+}
+
+static void test_deep_copy_circular_references(void) {
+ /* Construct a JSON object/array with a circular reference:
+
+ object: {"a": {"b": {"c": <circular reference to $.a>}}}
+ array: [[[<circular reference to the $[0] array>]]]
+
+ Deep copy it, remove the circular reference and deep copy again.
+ */
+
+ json_t *json;
+ json_t *copy;
+
+ json = json_object();
+ json_object_set_new(json, "a", json_object());
+ json_object_set_new(json_object_get(json, "a"), "b", json_object());
+ json_object_set(json_object_get(json_object_get(json, "a"), "b"), "c",
+ json_object_get(json, "a"));
+
+ copy = json_deep_copy(json);
+ if (copy)
+ fail("json_deep_copy copied a circular reference!");
+
+ json_object_del(json_object_get(json_object_get(json, "a"), "b"), "c");
+
+ copy = json_deep_copy(json);
+ if (!copy)
+ fail("json_deep_copy failed!");
+
+ json_decref(copy);
+ json_decref(json);
+
+ json = json_array();
+ json_array_append_new(json, json_array());
+ json_array_append_new(json_array_get(json, 0), json_array());
+ json_array_append(json_array_get(json_array_get(json, 0), 0),
+ json_array_get(json, 0));
+
+ copy = json_deep_copy(json);
+ if (copy)
+ fail("json_deep_copy copied a circular reference!");
+
+ json_array_remove(json_array_get(json_array_get(json, 0), 0), 0);
+
+ copy = json_deep_copy(json);
+ if (!copy)
+ fail("json_deep_copy failed!");
+
+ json_decref(copy);
+ json_decref(json);
+}
+
+static void run_tests() {
+ test_copy_simple();
+ test_deep_copy_simple();
+ test_copy_array();
+ test_deep_copy_array();
+ test_copy_object();
+ test_deep_copy_object();
+ test_deep_copy_circular_references();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_dump.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_dump.c
new file mode 100644
index 000000000..e8cb51962
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_dump.c
@@ -0,0 +1,311 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "jansson_private_config.h"
+
+#include <jansson.h>
+#include <string.h>
+#ifdef HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include "util.h"
+#ifdef __MINGW32__
+#include <fcntl.h>
+#define pipe(fds) _pipe(fds, 1024, _O_BINARY)
+#endif
+
+static int encode_null_callback(const char *buffer, size_t size, void *data) {
+ (void)buffer;
+ (void)size;
+ (void)data;
+ return 0;
+}
+
+static void encode_null() {
+ if (json_dumps(NULL, JSON_ENCODE_ANY) != NULL)
+ fail("json_dumps didn't fail for NULL");
+
+ if (json_dumpb(NULL, NULL, 0, JSON_ENCODE_ANY) != 0)
+ fail("json_dumpb didn't fail for NULL");
+
+ if (json_dumpf(NULL, stderr, JSON_ENCODE_ANY) != -1)
+ fail("json_dumpf didn't fail for NULL");
+
+#ifdef HAVE_UNISTD_H
+ if (json_dumpfd(NULL, STDERR_FILENO, JSON_ENCODE_ANY) != -1)
+ fail("json_dumpfd didn't fail for NULL");
+#endif
+
+ /* Don't test json_dump_file to avoid creating a file */
+
+ if (json_dump_callback(NULL, encode_null_callback, NULL, JSON_ENCODE_ANY) != -1)
+ fail("json_dump_callback didn't fail for NULL");
+}
+
+static void encode_twice() {
+ /* Encode an empty object/array, add an item, encode again */
+
+ json_t *json;
+ char *result;
+
+ json = json_object();
+ result = json_dumps(json, 0);
+ if (!result || strcmp(result, "{}"))
+ fail("json_dumps failed");
+ free(result);
+
+ json_object_set_new(json, "foo", json_integer(5));
+ result = json_dumps(json, 0);
+ if (!result || strcmp(result, "{\"foo\": 5}"))
+ fail("json_dumps failed");
+ free(result);
+
+ json_decref(json);
+
+ json = json_array();
+ result = json_dumps(json, 0);
+ if (!result || strcmp(result, "[]"))
+ fail("json_dumps failed");
+ free(result);
+
+ json_array_append_new(json, json_integer(5));
+ result = json_dumps(json, 0);
+ if (!result || strcmp(result, "[5]"))
+ fail("json_dumps failed");
+ free(result);
+
+ json_decref(json);
+}
+
+static void circular_references() {
+ /* Construct a JSON object/array with a circular reference:
+
+ object: {"a": {"b": {"c": <circular reference to $.a>}}}
+ array: [[[<circular reference to the $[0] array>]]]
+
+ Encode it, remove the circular reference and encode again.
+ */
+
+ json_t *json;
+ char *result;
+
+ json = json_object();
+ json_object_set_new(json, "a", json_object());
+ json_object_set_new(json_object_get(json, "a"), "b", json_object());
+ json_object_set(json_object_get(json_object_get(json, "a"), "b"), "c",
+ json_object_get(json, "a"));
+
+ if (json_dumps(json, 0))
+ fail("json_dumps encoded a circular reference!");
+
+ json_object_del(json_object_get(json_object_get(json, "a"), "b"), "c");
+
+ result = json_dumps(json, 0);
+ if (!result || strcmp(result, "{\"a\": {\"b\": {}}}"))
+ fail("json_dumps failed!");
+ free(result);
+
+ json_decref(json);
+
+ json = json_array();
+ json_array_append_new(json, json_array());
+ json_array_append_new(json_array_get(json, 0), json_array());
+ json_array_append(json_array_get(json_array_get(json, 0), 0),
+ json_array_get(json, 0));
+
+ if (json_dumps(json, 0))
+ fail("json_dumps encoded a circular reference!");
+
+ json_array_remove(json_array_get(json_array_get(json, 0), 0), 0);
+
+ result = json_dumps(json, 0);
+ if (!result || strcmp(result, "[[[]]]"))
+ fail("json_dumps failed!");
+ free(result);
+
+ json_decref(json);
+}
+
+static void encode_other_than_array_or_object() {
+ /* Encoding anything other than array or object should only
+ * succeed if the JSON_ENCODE_ANY flag is used */
+
+ json_t *json;
+ char *result;
+
+ json = json_string("foo");
+ if (json_dumps(json, 0) != NULL)
+ fail("json_dumps encoded a string!");
+ if (json_dumpf(json, NULL, 0) == 0)
+ fail("json_dumpf encoded a string!");
+ if (json_dumpfd(json, -1, 0) == 0)
+ fail("json_dumpfd encoded a string!");
+
+ result = json_dumps(json, JSON_ENCODE_ANY);
+ if (!result || strcmp(result, "\"foo\"") != 0)
+ fail("json_dumps failed to encode a string with JSON_ENCODE_ANY");
+
+ free(result);
+ json_decref(json);
+
+ json = json_integer(42);
+ if (json_dumps(json, 0) != NULL)
+ fail("json_dumps encoded an integer!");
+ if (json_dumpf(json, NULL, 0) == 0)
+ fail("json_dumpf encoded an integer!");
+ if (json_dumpfd(json, -1, 0) == 0)
+ fail("json_dumpfd encoded an integer!");
+
+ result = json_dumps(json, JSON_ENCODE_ANY);
+ if (!result || strcmp(result, "42") != 0)
+ fail("json_dumps failed to encode an integer with JSON_ENCODE_ANY");
+
+ free(result);
+ json_decref(json);
+}
+
+static void escape_slashes() {
+ /* Test dump escaping slashes */
+
+ json_t *json;
+ char *result;
+
+ json = json_object();
+ json_object_set_new(json, "url", json_string("https://github.com/akheron/jansson"));
+
+ result = json_dumps(json, 0);
+ if (!result || strcmp(result, "{\"url\": \"https://github.com/akheron/jansson\"}"))
+ fail("json_dumps failed to not escape slashes");
+
+ free(result);
+
+ result = json_dumps(json, JSON_ESCAPE_SLASH);
+ if (!result ||
+ strcmp(result, "{\"url\": \"https:\\/\\/github.com\\/akheron\\/jansson\"}"))
+ fail("json_dumps failed to escape slashes");
+
+ free(result);
+ json_decref(json);
+}
+
+static void encode_nul_byte() {
+ json_t *json;
+ char *result;
+
+ json = json_stringn("nul byte \0 in string", 20);
+ result = json_dumps(json, JSON_ENCODE_ANY);
+ if (!result || memcmp(result, "\"nul byte \\u0000 in string\"", 27))
+ fail("json_dumps failed to dump an embedded NUL byte");
+
+ free(result);
+ json_decref(json);
+}
+
+static void dump_file() {
+ json_t *json;
+ int result;
+
+ result = json_dump_file(NULL, "", 0);
+ if (result != -1)
+ fail("json_dump_file succeeded with invalid args");
+
+ json = json_object();
+ result = json_dump_file(json, "json_dump_file.json", 0);
+ if (result != 0)
+ fail("json_dump_file failed");
+
+ json_decref(json);
+ remove("json_dump_file.json");
+}
+
+static void dumpb() {
+ char buf[2];
+ json_t *obj;
+ size_t size;
+
+ obj = json_object();
+
+ size = json_dumpb(obj, buf, sizeof(buf), 0);
+ if (size != 2 || strncmp(buf, "{}", 2))
+ fail("json_dumpb failed");
+
+ json_decref(obj);
+ obj = json_pack("{s:s}", "foo", "bar");
+
+ size = json_dumpb(obj, buf, sizeof(buf), JSON_COMPACT);
+ if (size != 13)
+ fail("json_dumpb size check failed");
+
+ json_decref(obj);
+}
+
+static void dumpfd() {
+#ifdef HAVE_UNISTD_H
+ int fds[2] = {-1, -1};
+ json_t *a, *b;
+
+ if (pipe(fds))
+ fail("pipe() failed");
+
+ a = json_pack("{s:s}", "foo", "bar");
+
+ if (json_dumpfd(a, fds[1], 0))
+ fail("json_dumpfd() failed");
+ close(fds[1]);
+
+ b = json_loadfd(fds[0], 0, NULL);
+ if (!b)
+ fail("json_loadfd() failed");
+ close(fds[0]);
+
+ if (!json_equal(a, b))
+ fail("json_equal() failed for fd test");
+
+ json_decref(a);
+ json_decref(b);
+#endif
+}
+
+static void embed() {
+ static const char *plains[] = {"{\"bar\":[],\"foo\":{}}", "[[],{}]", "{}", "[]",
+ NULL};
+
+ size_t i;
+
+ for (i = 0; plains[i]; i++) {
+ const char *plain = plains[i];
+ json_t *parse = NULL;
+ char *embed = NULL;
+ size_t psize = 0;
+ size_t esize = 0;
+
+ psize = strlen(plain) - 2;
+ embed = calloc(1, psize);
+ parse = json_loads(plain, 0, NULL);
+ esize =
+ json_dumpb(parse, embed, psize, JSON_COMPACT | JSON_SORT_KEYS | JSON_EMBED);
+ json_decref(parse);
+ if (esize != psize)
+ fail("json_dumpb(JSON_EMBED) returned an invalid size");
+ if (strncmp(plain + 1, embed, esize) != 0)
+ fail("json_dumps(JSON_EMBED) returned an invalid value");
+ free(embed);
+ }
+}
+
+static void run_tests() {
+ encode_null();
+ encode_twice();
+ circular_references();
+ encode_other_than_array_or_object();
+ escape_slashes();
+ encode_nul_byte();
+ dump_file();
+ dumpb();
+ dumpfd();
+ embed();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_dump_callback.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_dump_callback.c
new file mode 100644
index 000000000..80ea00845
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_dump_callback.c
@@ -0,0 +1,82 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <stdlib.h>
+#include <string.h>
+
+struct my_sink {
+ char *buf;
+ size_t off;
+ size_t cap;
+};
+
+static int my_writer(const char *buffer, size_t len, void *data) {
+ struct my_sink *s = data;
+ if (len > s->cap - s->off) {
+ return -1;
+ }
+ memcpy(s->buf + s->off, buffer, len);
+ s->off += len;
+ return 0;
+}
+
+static void run_tests() {
+ struct my_sink s;
+ json_t *json;
+ const char str[] = "[\"A\", {\"B\": \"C\", \"e\": false}, 1, null, \"foo\"]";
+ char *dumped_to_string;
+
+ json = json_loads(str, 0, NULL);
+ if (!json) {
+ fail("json_loads failed");
+ }
+
+ dumped_to_string = json_dumps(json, 0);
+ if (!dumped_to_string) {
+ json_decref(json);
+ fail("json_dumps failed");
+ }
+
+ s.off = 0;
+ s.cap = strlen(dumped_to_string);
+ s.buf = malloc(s.cap);
+ if (!s.buf) {
+ json_decref(json);
+ free(dumped_to_string);
+ fail("malloc failed");
+ }
+
+ if (json_dump_callback(json, my_writer, &s, 0) == -1) {
+ json_decref(json);
+ free(dumped_to_string);
+ free(s.buf);
+ fail("json_dump_callback failed on an exact-length sink buffer");
+ }
+
+ if (strncmp(dumped_to_string, s.buf, s.off) != 0) {
+ json_decref(json);
+ free(dumped_to_string);
+ free(s.buf);
+ fail("json_dump_callback and json_dumps did not produce identical "
+ "output");
+ }
+
+ s.off = 1;
+ if (json_dump_callback(json, my_writer, &s, 0) != -1) {
+ json_decref(json);
+ free(dumped_to_string);
+ free(s.buf);
+ fail("json_dump_callback succeeded on a short buffer when it should "
+ "have failed");
+ }
+
+ json_decref(json);
+ free(dumped_to_string);
+ free(s.buf);
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_equal.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_equal.c
new file mode 100644
index 000000000..d068b7bf8
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_equal.c
@@ -0,0 +1,202 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+
+static void test_equal_simple() {
+ json_t *value1, *value2;
+
+ if (json_equal(NULL, NULL))
+ fail("json_equal fails for two NULLs");
+
+ value1 = json_true();
+ if (json_equal(value1, NULL) || json_equal(NULL, value1))
+ fail("json_equal fails for NULL");
+
+ /* this covers true, false and null as they are singletons */
+ if (!json_equal(value1, value1))
+ fail("identical objects are not equal");
+ json_decref(value1);
+
+ /* integer */
+ value1 = json_integer(1);
+ value2 = json_integer(1);
+ if (!value1 || !value2)
+ fail("unable to create integers");
+ if (!json_equal(value1, value2))
+ fail("json_equal fails for two equal integers");
+ json_decref(value2);
+
+ value2 = json_integer(2);
+ if (!value2)
+ fail("unable to create an integer");
+ if (json_equal(value1, value2))
+ fail("json_equal fails for two inequal integers");
+
+ json_decref(value1);
+ json_decref(value2);
+
+ /* real */
+ value1 = json_real(1.2);
+ value2 = json_real(1.2);
+ if (!value1 || !value2)
+ fail("unable to create reals");
+ if (!json_equal(value1, value2))
+ fail("json_equal fails for two equal reals");
+ json_decref(value2);
+
+ value2 = json_real(3.141592);
+ if (!value2)
+ fail("unable to create an real");
+ if (json_equal(value1, value2))
+ fail("json_equal fails for two inequal reals");
+
+ json_decref(value1);
+ json_decref(value2);
+
+ /* string */
+ value1 = json_string("foo");
+ value2 = json_string("foo");
+ if (!value1 || !value2)
+ fail("unable to create strings");
+ if (!json_equal(value1, value2))
+ fail("json_equal fails for two equal strings");
+ json_decref(value2);
+
+ value2 = json_string("bar");
+ if (!value2)
+ fail("unable to create an string");
+ if (json_equal(value1, value2))
+ fail("json_equal fails for two inequal strings");
+ json_decref(value2);
+
+ value2 = json_string("bar2");
+ if (!value2)
+ fail("unable to create an string");
+ if (json_equal(value1, value2))
+ fail("json_equal fails for two inequal length strings");
+
+ json_decref(value1);
+ json_decref(value2);
+}
+
+static void test_equal_array() {
+ json_t *array1, *array2;
+
+ array1 = json_array();
+ array2 = json_array();
+ if (!array1 || !array2)
+ fail("unable to create arrays");
+
+ if (!json_equal(array1, array2))
+ fail("json_equal fails for two empty arrays");
+
+ json_array_append_new(array1, json_integer(1));
+ json_array_append_new(array2, json_integer(1));
+ json_array_append_new(array1, json_string("foo"));
+ json_array_append_new(array2, json_string("foo"));
+ json_array_append_new(array1, json_integer(2));
+ json_array_append_new(array2, json_integer(2));
+ if (!json_equal(array1, array2))
+ fail("json_equal fails for two equal arrays");
+
+ json_array_remove(array2, 2);
+ if (json_equal(array1, array2))
+ fail("json_equal fails for two inequal arrays");
+
+ json_array_append_new(array2, json_integer(3));
+ if (json_equal(array1, array2))
+ fail("json_equal fails for two inequal arrays");
+
+ json_decref(array1);
+ json_decref(array2);
+}
+
+static void test_equal_object() {
+ json_t *object1, *object2;
+
+ object1 = json_object();
+ object2 = json_object();
+ if (!object1 || !object2)
+ fail("unable to create objects");
+
+ if (!json_equal(object1, object2))
+ fail("json_equal fails for two empty objects");
+
+ json_object_set_new(object1, "a", json_integer(1));
+ json_object_set_new(object2, "a", json_integer(1));
+ json_object_set_new(object1, "b", json_string("foo"));
+ json_object_set_new(object2, "b", json_string("foo"));
+ json_object_set_new(object1, "c", json_integer(2));
+ json_object_set_new(object2, "c", json_integer(2));
+ if (!json_equal(object1, object2))
+ fail("json_equal fails for two equal objects");
+
+ json_object_del(object2, "c");
+ if (json_equal(object1, object2))
+ fail("json_equal fails for two inequal objects");
+
+ json_object_set_new(object2, "c", json_integer(3));
+ if (json_equal(object1, object2))
+ fail("json_equal fails for two inequal objects");
+
+ json_object_del(object2, "c");
+ json_object_set_new(object2, "d", json_integer(2));
+ if (json_equal(object1, object2))
+ fail("json_equal fails for two inequal objects");
+
+ json_decref(object1);
+ json_decref(object2);
+}
+
+static void test_equal_complex() {
+ json_t *value1, *value2, *value3;
+
+ const char *complex_json = "{"
+ " \"integer\": 1, "
+ " \"real\": 3.141592, "
+ " \"string\": \"foobar\", "
+ " \"true\": true, "
+ " \"object\": {"
+ " \"array-in-object\": [1,true,\"foo\",{}],"
+ " \"object-in-object\": {\"foo\": \"bar\"}"
+ " },"
+ " \"array\": [\"foo\", false, null, 1.234]"
+ "}";
+
+ value1 = json_loads(complex_json, 0, NULL);
+ value2 = json_loads(complex_json, 0, NULL);
+ value3 = json_loads(complex_json, 0, NULL);
+ if (!value1 || !value2)
+ fail("unable to parse JSON");
+ if (!json_equal(value1, value2))
+ fail("json_equal fails for two equal objects");
+
+ json_array_set_new(
+ json_object_get(json_object_get(value2, "object"), "array-in-object"), 1,
+ json_false());
+ if (json_equal(value1, value2))
+ fail("json_equal fails for two inequal objects");
+
+ json_object_set_new(
+ json_object_get(json_object_get(value3, "object"), "object-in-object"), "foo",
+ json_string("baz"));
+ if (json_equal(value1, value3))
+ fail("json_equal fails for two inequal objects");
+
+ json_decref(value1);
+ json_decref(value2);
+ json_decref(value3);
+}
+
+static void run_tests() {
+ test_equal_simple();
+ test_equal_array();
+ test_equal_object();
+ test_equal_complex();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_fixed_size.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_fixed_size.c
new file mode 100644
index 000000000..4ae9e079c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_fixed_size.c
@@ -0,0 +1,228 @@
+/*
+ * Copyright (c) 2020 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <string.h>
+
+static void test_keylen_iterator(json_t *object) {
+ const char key1[] = {'t', 'e', 's', 't', '1'};
+ const char key2[] = {'t', 'e', 's', 't'};
+ const char key3[] = {'t', 'e', 's', '\0', 't'};
+ const char key4[] = {'t', 'e', 's', 't', '\0'};
+ const char *reference_keys[] = {key1, key2, key3, key4};
+ const size_t reference_keys_len[] = {sizeof(key1), sizeof(key2), sizeof(key3),
+ sizeof(key4)};
+ size_t index = 0;
+ json_t *value;
+ const char *key;
+ size_t keylen;
+
+ json_object_keylen_foreach(object, key, keylen, value) {
+ if (keylen != reference_keys_len[index])
+ fail("invalid key len in iterator");
+ if (memcmp(key, reference_keys[index], reference_keys_len[index]) != 0)
+ fail("invalid key in iterator");
+
+ index++;
+ }
+}
+
+static void test_keylen(void) {
+ json_t *obj = json_object();
+ const char key[] = {'t', 'e', 's', 't', '1'};
+ const char key2[] = {'t', 'e', 's', 't'};
+ const char key3[] = {'t', 'e', 's', '\0', 't'};
+ const char key4[] = {'t', 'e', 's', 't', '\0'};
+
+ if (json_object_size(obj) != 0)
+ fail("incorrect json");
+
+ json_object_set_new_nocheck(obj, "test1", json_true());
+
+ if (json_object_size(obj) != 1)
+ fail("incorrect json");
+
+ if (json_object_getn(obj, key, sizeof(key)) != json_true())
+ fail("json_object_getn failed");
+
+ if (json_object_getn(obj, key2, sizeof(key2)) != NULL)
+ fail("false positive json_object_getn by key2");
+
+ if (json_object_setn_nocheck(obj, key2, sizeof(key2), json_false()))
+ fail("json_object_setn_nocheck for key2 failed");
+
+ if (json_object_size(obj) != 2)
+ fail("incorrect json");
+
+ if (json_object_get(obj, "test") != json_false())
+ fail("json_object_setn_nocheck for key2 failed");
+
+ if (json_object_getn(obj, key2, sizeof(key2)) != json_false())
+ fail("json_object_getn by key 2 failed");
+
+ if (json_object_getn(obj, key3, sizeof(key3)) != NULL)
+ fail("false positive json_object_getn by key3");
+
+ if (json_object_setn_nocheck(obj, key3, sizeof(key3), json_false()))
+ fail("json_object_setn_nocheck for key3 failed");
+
+ if (json_object_size(obj) != 3)
+ fail("incorrect json");
+
+ if (json_object_getn(obj, key3, sizeof(key3)) != json_false())
+ fail("json_object_getn by key 3 failed");
+
+ if (json_object_getn(obj, key4, sizeof(key4)) != NULL)
+ fail("false positive json_object_getn by key3");
+
+ if (json_object_setn_nocheck(obj, key4, sizeof(key4), json_false()))
+ fail("json_object_setn_nocheck for key3 failed");
+
+ if (json_object_size(obj) != 4)
+ fail("incorrect json");
+
+ test_keylen_iterator(obj);
+
+ if (json_object_getn(obj, key4, sizeof(key4)) != json_false())
+ fail("json_object_getn by key 3 failed");
+
+ if (json_object_size(obj) != 4)
+ fail("incorrect json");
+
+ if (json_object_deln(obj, key4, sizeof(key4)))
+ fail("json_object_deln failed");
+ if (json_object_getn(obj, key4, sizeof(key4)) != NULL)
+ fail("json_object_deln failed");
+ if (json_object_size(obj) != 3)
+ fail("incorrect json");
+
+ if (json_object_deln(obj, key3, sizeof(key3)))
+ fail("json_object_deln failed");
+ if (json_object_getn(obj, key3, sizeof(key3)) != NULL)
+ fail("json_object_deln failed");
+ if (json_object_size(obj) != 2)
+ fail("incorrect json");
+
+ if (json_object_deln(obj, key2, sizeof(key2)))
+ fail("json_object_deln failed");
+ if (json_object_getn(obj, key2, sizeof(key2)) != NULL)
+ fail("json_object_deln failed");
+ if (json_object_size(obj) != 1)
+ fail("incorrect json");
+
+ if (json_object_deln(obj, key, sizeof(key)))
+ fail("json_object_deln failed");
+ if (json_object_getn(obj, key, sizeof(key)) != NULL)
+ fail("json_object_deln failed");
+ if (json_object_size(obj) != 0)
+ fail("incorrect json");
+
+ json_decref(obj);
+}
+
+static void test_invalid_keylen(void) {
+ json_t *obj = json_object();
+ json_t *empty_obj = json_object();
+ const char key[] = {'t', 'e', 's', 't', '1'};
+
+ json_object_set_new_nocheck(obj, "test1", json_true());
+
+ if (json_object_getn(NULL, key, sizeof(key)) != NULL)
+ fail("json_object_getn on NULL failed");
+
+ if (json_object_getn(obj, NULL, sizeof(key)) != NULL)
+ fail("json_object_getn on NULL failed");
+
+ if (json_object_getn(obj, key, 0) != NULL)
+ fail("json_object_getn on NULL failed");
+
+ if (!json_object_setn_new(obj, NULL, sizeof(key), json_true()))
+ fail("json_object_setn_new with NULL key failed");
+
+ if (!json_object_setn_new_nocheck(obj, NULL, sizeof(key), json_true()))
+ fail("json_object_setn_new_nocheck with NULL key failed");
+
+ if (!json_object_del(obj, NULL))
+ fail("json_object_del with NULL failed");
+
+ if (!json_object_deln(empty_obj, key, sizeof(key)))
+ fail("json_object_deln with empty object failed");
+
+ if (!json_object_deln(obj, key, sizeof(key) - 1))
+ fail("json_object_deln with incomplete key failed");
+
+ json_decref(obj);
+ json_decref(empty_obj);
+}
+
+static void test_binary_keys(void) {
+ json_t *obj = json_object();
+ int key1 = 0;
+ int key2 = 1;
+
+ json_object_setn_nocheck(obj, (const char *)&key1, sizeof(key1), json_true());
+ json_object_setn_nocheck(obj, (const char *)&key2, sizeof(key2), json_true());
+
+ if (!json_is_true(json_object_getn(obj, (const char *)&key1, sizeof(key1))))
+ fail("cannot get integer key1");
+
+ if (!json_is_true(json_object_getn(obj, (const char *)&key1, sizeof(key2))))
+ fail("cannot get integer key2");
+
+ if (json_object_size(obj) != 2)
+ fail("binary object size missmatch");
+
+ if (json_object_deln(obj, (const char *)&key1, sizeof(key1)))
+ fail("cannot del integer key1");
+
+ if (json_object_size(obj) != 1)
+ fail("binary object size missmatch");
+
+ if (json_object_deln(obj, (const char *)&key2, sizeof(key2)))
+ fail("cannot del integer key2");
+
+ if (json_object_size(obj) != 0)
+ fail("binary object size missmatch");
+
+ json_decref(obj);
+}
+
+static void test_dump_order(void) {
+ json_t *obj = json_object();
+ char key1[] = {'k', '\0', '-', '2'};
+ char key2[] = {'k', '\0', '-', '1'};
+ const char expected_sorted_str[] =
+ "{\"k\\u0000-1\": \"first\", \"k\\u0000-2\": \"second\"}";
+ const char expected_nonsorted_str[] =
+ "{\"k\\u0000-2\": \"second\", \"k\\u0000-1\": \"first\"}";
+ char *out;
+
+ json_object_setn_new_nocheck(obj, key1, sizeof(key1), json_string("second"));
+ json_object_setn_new_nocheck(obj, key2, sizeof(key2), json_string("first"));
+
+ out = malloc(512);
+
+ json_dumpb(obj, out, 512, 0);
+
+ if (memcmp(expected_nonsorted_str, out, sizeof(expected_nonsorted_str) - 1) != 0)
+ fail("preserve order failed");
+
+ json_dumpb(obj, out, 512, JSON_SORT_KEYS);
+ if (memcmp(expected_sorted_str, out, sizeof(expected_sorted_str) - 1) != 0)
+ fail("utf-8 sort failed");
+
+ free(out);
+ json_decref(obj);
+}
+
+static void run_tests() {
+ test_keylen();
+ test_invalid_keylen();
+ test_binary_keys();
+ test_dump_order();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_load.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_load.c
new file mode 100644
index 000000000..1c64b0c8d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_load.c
@@ -0,0 +1,238 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <string.h>
+
+static void file_not_found() {
+ json_t *json;
+ json_error_t error;
+ char *pos;
+
+ json = json_load_file("/path/to/nonexistent/file.json", 0, &error);
+ if (json)
+ fail("json_load_file returned non-NULL for a nonexistent file");
+ if (error.line != -1)
+ fail("json_load_file returned an invalid line number");
+
+ /* The error message is locale specific, only check the beginning
+ of the error message. */
+
+ pos = strchr(error.text, ':');
+ if (!pos)
+ fail("json_load_file returne an invalid error message");
+
+ *pos = '\0';
+
+ if (strcmp(error.text, "unable to open /path/to/nonexistent/file.json") != 0)
+ fail("json_load_file returned an invalid error message");
+ if (json_error_code(&error) != json_error_cannot_open_file)
+ fail("json_load_file returned an invalid error code");
+}
+
+static void very_long_file_name() {
+ json_t *json;
+ json_error_t error;
+
+ json = json_load_file("aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa",
+ 0, &error);
+ if (json)
+ fail("json_load_file returned non-NULL for a nonexistent file");
+ if (error.line != -1)
+ fail("json_load_file returned an invalid line number");
+
+ if (strncmp(error.source, "...aaa", 6) != 0)
+ fail("error source was set incorrectly");
+ if (json_error_code(&error) != json_error_cannot_open_file)
+ fail("error code was set incorrectly");
+}
+
+static void reject_duplicates() {
+ json_error_t error;
+
+ if (json_loads("{\"foo\": 1, \"foo\": 2}", JSON_REJECT_DUPLICATES, &error))
+ fail("json_loads did not detect a duplicate key");
+ check_error(json_error_duplicate_key, "duplicate object key near '\"foo\"'",
+ "<string>", 1, 16, 16);
+}
+
+static void disable_eof_check() {
+ json_error_t error;
+ json_t *json;
+
+ const char *text = "{\"foo\": 1} garbage";
+
+ if (json_loads(text, 0, &error))
+ fail("json_loads did not detect garbage after JSON text");
+ check_error(json_error_end_of_input_expected, "end of file expected near 'garbage'",
+ "<string>", 1, 18, 18);
+
+ json = json_loads(text, JSON_DISABLE_EOF_CHECK, &error);
+ if (!json)
+ fail("json_loads failed with JSON_DISABLE_EOF_CHECK");
+
+ json_decref(json);
+}
+
+static void decode_any() {
+ json_t *json;
+ json_error_t error;
+
+ json = json_loads("\"foo\"", JSON_DECODE_ANY, &error);
+ if (!json || !json_is_string(json))
+ fail("json_load decoded any failed - string");
+ json_decref(json);
+
+ json = json_loads("42", JSON_DECODE_ANY, &error);
+ if (!json || !json_is_integer(json))
+ fail("json_load decoded any failed - integer");
+ json_decref(json);
+
+ json = json_loads("true", JSON_DECODE_ANY, &error);
+ if (!json || !json_is_true(json))
+ fail("json_load decoded any failed - boolean");
+ json_decref(json);
+
+ json = json_loads("null", JSON_DECODE_ANY, &error);
+ if (!json || !json_is_null(json))
+ fail("json_load decoded any failed - null");
+ json_decref(json);
+}
+
+static void decode_int_as_real() {
+ json_t *json;
+ json_error_t error;
+
+#if JSON_INTEGER_IS_LONG_LONG
+ const char *imprecise;
+ json_int_t expected;
+#endif
+
+ char big[311];
+
+ json = json_loads("42", JSON_DECODE_INT_AS_REAL | JSON_DECODE_ANY, &error);
+ if (!json || !json_is_real(json) || json_real_value(json) != 42.0)
+ fail("json_load decode int as real failed - int");
+ json_decref(json);
+
+#if JSON_INTEGER_IS_LONG_LONG
+ /* This number cannot be represented exactly by a double */
+ imprecise = "9007199254740993";
+ expected = 9007199254740992ll;
+
+ json = json_loads(imprecise, JSON_DECODE_INT_AS_REAL | JSON_DECODE_ANY, &error);
+ if (!json || !json_is_real(json) || expected != (json_int_t)json_real_value(json))
+ fail("json_load decode int as real failed - expected imprecision");
+ json_decref(json);
+#endif
+
+ /* 1E309 overflows. Here we create 1E309 as a decimal number, i.e.
+ 1000...(309 zeroes)...0. */
+ big[0] = '1';
+ memset(big + 1, '0', 309);
+ big[310] = '\0';
+
+ json = json_loads(big, JSON_DECODE_INT_AS_REAL | JSON_DECODE_ANY, &error);
+ if (json || strcmp(error.text, "real number overflow") != 0 ||
+ json_error_code(&error) != json_error_numeric_overflow)
+ fail("json_load decode int as real failed - expected overflow");
+ json_decref(json);
+}
+
+static void allow_nul() {
+ const char *text = "\"nul byte \\u0000 in string\"";
+ const char *expected = "nul byte \0 in string";
+ size_t len = 20;
+ json_t *json;
+
+ json = json_loads(text, JSON_ALLOW_NUL | JSON_DECODE_ANY, NULL);
+ if (!json || !json_is_string(json))
+ fail("unable to decode embedded NUL byte");
+
+ if (json_string_length(json) != len)
+ fail("decoder returned wrong string length");
+
+ if (memcmp(json_string_value(json), expected, len + 1))
+ fail("decoder returned wrong string content");
+
+ json_decref(json);
+}
+
+static void load_wrong_args() {
+ json_t *json;
+ json_error_t error;
+
+ json = json_loads(NULL, 0, &error);
+ if (json)
+ fail("json_loads should return NULL if the first argument is NULL");
+
+ json = json_loadb(NULL, 0, 0, &error);
+ if (json)
+ fail("json_loadb should return NULL if the first argument is NULL");
+
+ json = json_loadf(NULL, 0, &error);
+ if (json)
+ fail("json_loadf should return NULL if the first argument is NULL");
+
+ json = json_loadfd(-1, 0, &error);
+ if (json)
+ fail("json_loadfd should return NULL if the first argument is < 0");
+
+ json = json_load_file(NULL, 0, &error);
+ if (json)
+ fail("json_load_file should return NULL if the first argument is NULL");
+}
+
+static void position() {
+ json_t *json;
+ size_t flags = JSON_DISABLE_EOF_CHECK;
+ json_error_t error;
+
+ json = json_loads("{\"foo\": \"bar\"}", 0, &error);
+ if (error.position != 14)
+ fail("json_loads returned a wrong position");
+ json_decref(json);
+
+ json = json_loads("{\"foo\": \"bar\"} baz quux", flags, &error);
+ if (error.position != 14)
+ fail("json_loads returned a wrong position");
+ json_decref(json);
+}
+
+static void error_code() {
+ json_error_t error;
+ json_t *json = json_loads("[123] garbage", 0, &error);
+ if (json != NULL)
+ fail("json_loads returned not NULL");
+ if (strlen(error.text) >= JSON_ERROR_TEXT_LENGTH)
+ fail("error.text longer than expected");
+ if (json_error_code(&error) != json_error_end_of_input_expected)
+ fail("json_loads returned incorrect error code");
+
+ json = json_loads("{\"foo\": ", 0, &error);
+ if (json != NULL)
+ fail("json_loads returned not NULL");
+ if (strlen(error.text) >= JSON_ERROR_TEXT_LENGTH)
+ fail("error.text longer than expected");
+ if (json_error_code(&error) != json_error_premature_end_of_input)
+ fail("json_loads returned incorrect error code");
+}
+
+static void run_tests() {
+ file_not_found();
+ very_long_file_name();
+ reject_duplicates();
+ disable_eof_check();
+ decode_any();
+ decode_int_as_real();
+ allow_nul();
+ load_wrong_args();
+ position();
+ error_code();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_load_callback.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_load_callback.c
new file mode 100644
index 000000000..b292fcf42
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_load_callback.c
@@ -0,0 +1,77 @@
+/*
+ * Copyright (c) 2009-2011 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <stdlib.h>
+#include <string.h>
+
+struct my_source {
+ const char *buf;
+ size_t off;
+ size_t cap;
+};
+
+static const char my_str[] = "[\"A\", {\"B\": \"C\", \"e\": false}, 1, null, \"foo\"]";
+
+static size_t greedy_reader(void *buf, size_t buflen, void *arg) {
+ struct my_source *s = arg;
+ if (buflen > s->cap - s->off)
+ buflen = s->cap - s->off;
+ if (buflen > 0) {
+ memcpy(buf, s->buf + s->off, buflen);
+ s->off += buflen;
+ return buflen;
+ } else {
+ return 0;
+ }
+}
+
+static void run_tests() {
+ struct my_source s;
+ json_t *json;
+ json_error_t error;
+
+ s.off = 0;
+ s.cap = strlen(my_str);
+ s.buf = my_str;
+
+ json = json_load_callback(greedy_reader, &s, 0, &error);
+
+ if (!json)
+ fail("json_load_callback failed on a valid callback");
+ json_decref(json);
+
+ s.off = 0;
+ s.cap = strlen(my_str) - 1;
+ s.buf = my_str;
+
+ json = json_load_callback(greedy_reader, &s, 0, &error);
+ if (json) {
+ json_decref(json);
+ fail("json_load_callback should have failed on an incomplete stream, "
+ "but it didn't");
+ }
+ if (strcmp(error.source, "<callback>") != 0) {
+ fail("json_load_callback returned an invalid error source");
+ }
+ if (strcmp(error.text, "']' expected near end of file") != 0) {
+ fail("json_load_callback returned an invalid error message for an "
+ "unclosed top-level array");
+ }
+
+ json = json_load_callback(NULL, NULL, 0, &error);
+ if (json) {
+ json_decref(json);
+ fail("json_load_callback should have failed on NULL load callback, but "
+ "it didn't");
+ }
+ if (strcmp(error.text, "wrong arguments") != 0) {
+ fail("json_load_callback returned an invalid error message for a NULL "
+ "load callback");
+ }
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_loadb.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_loadb.c
new file mode 100644
index 000000000..2cd88fef3
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_loadb.c
@@ -0,0 +1,37 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <string.h>
+
+static void run_tests() {
+ json_t *json;
+ json_error_t error;
+ const char str[] = "[\"A\", {\"B\": \"C\"}, 1, 2, 3]garbage";
+ size_t len = strlen(str) - strlen("garbage");
+
+ json = json_loadb(str, len, 0, &error);
+ if (!json) {
+ fail("json_loadb failed on a valid JSON buffer");
+ }
+ json_decref(json);
+
+ json = json_loadb(str, len - 1, 0, &error);
+ if (json) {
+ json_decref(json);
+ fail("json_loadb should have failed on an incomplete buffer, but it "
+ "didn't");
+ }
+ if (error.line != 1) {
+ fail("json_loadb returned an invalid line number on fail");
+ }
+ if (strcmp(error.text, "']' expected near end of file") != 0) {
+ fail("json_loadb returned an invalid error message for an unclosed "
+ "top-level array");
+ }
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_memory_funcs.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_memory_funcs.c
new file mode 100644
index 000000000..4fd616654
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_memory_funcs.c
@@ -0,0 +1,115 @@
+#include <jansson.h>
+#include <string.h>
+
+#include "util.h"
+
+static int malloc_called = 0;
+static int free_called = 0;
+static size_t malloc_used = 0;
+
+/* helpers */
+static void create_and_free_complex_object() {
+ json_t *obj;
+
+ obj = json_pack("{s:i,s:n,s:b,s:b,s:{s:s},s:[i,i,i]}", "foo", 42, "bar", "baz", 1,
+ "qux", 0, "alice", "bar", "baz", "bob", 9, 8, 7);
+
+ json_decref(obj);
+}
+
+static void create_and_free_object_with_oom() {
+ int i;
+ char key[4];
+ json_t *obj = json_object();
+
+ for (i = 0; i < 10; i++) {
+ snprintf(key, sizeof key, "%d", i);
+ json_object_set_new(obj, key, json_integer(i));
+ }
+
+ json_decref(obj);
+}
+
+static void *my_malloc(size_t size) {
+ malloc_called = 1;
+ return malloc(size);
+}
+
+static void my_free(void *ptr) {
+ free_called = 1;
+ free(ptr);
+}
+
+static void test_simple() {
+ json_malloc_t mfunc = NULL;
+ json_free_t ffunc = NULL;
+
+ json_set_alloc_funcs(my_malloc, my_free);
+ json_get_alloc_funcs(&mfunc, &ffunc);
+ create_and_free_complex_object();
+
+ if (malloc_called != 1 || free_called != 1 || mfunc != my_malloc || ffunc != my_free)
+ fail("Custom allocation failed");
+}
+
+static void *oom_malloc(size_t size) {
+ if (malloc_used + size > 800)
+ return NULL;
+
+ malloc_used += size;
+ return malloc(size);
+}
+
+static void oom_free(void *ptr) {
+ free_called++;
+ free(ptr);
+}
+
+static void test_oom() {
+ free_called = 0;
+ json_set_alloc_funcs(oom_malloc, oom_free);
+ create_and_free_object_with_oom();
+
+ if (free_called == 0)
+ fail("Allocation with OOM failed");
+}
+
+/*
+ Test the secure memory functions code given in the API reference
+ documentation, but by using plain memset instead of
+ guaranteed_memset().
+*/
+
+static void *secure_malloc(size_t size) {
+ /* Store the memory area size in the beginning of the block */
+ void *ptr = malloc(size + 8);
+ *((size_t *)ptr) = size;
+ return (char *)ptr + 8;
+}
+
+static void secure_free(void *ptr) {
+ size_t size;
+
+ ptr = (char *)ptr - 8;
+ size = *((size_t *)ptr);
+
+ /*guaranteed_*/ memset(ptr, 0, size + 8);
+ free(ptr);
+}
+
+static void test_secure_funcs(void) {
+ json_set_alloc_funcs(secure_malloc, secure_free);
+ create_and_free_complex_object();
+}
+
+static void test_bad_args(void) {
+ /* The result of this test is not crashing. */
+ json_get_alloc_funcs(NULL, NULL);
+}
+
+static void run_tests() {
+ test_simple();
+ test_secure_funcs();
+ test_oom();
+ test_bad_args();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_number.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_number.c
new file mode 100644
index 000000000..2a22a67d3
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_number.c
@@ -0,0 +1,123 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <math.h>
+
+#ifdef INFINITY
+// This test triggers "warning C4756: overflow in constant arithmetic"
+// in Visual Studio. This warning is triggered here by design, so disable it.
+// (This can only be done on function level so we keep these tests separate)
+#ifdef _MSC_VER
+#pragma warning(push)
+#pragma warning(disable : 4756)
+#endif
+static void test_inifity() {
+ json_t *real = json_real(INFINITY);
+ if (real != NULL)
+ fail("could construct a real from Inf");
+
+ real = json_real(1.0);
+ if (json_real_set(real, INFINITY) != -1)
+ fail("could set a real to Inf");
+
+ if (json_real_value(real) != 1.0)
+ fail("real value changed unexpectedly");
+
+ json_decref(real);
+#ifdef _MSC_VER
+#pragma warning(pop)
+#endif
+}
+#endif // INFINITY
+
+static void test_bad_args(void) {
+ json_t *txt = json_string("test");
+
+ if (json_integer_value(NULL) != 0)
+ fail("json_integer_value did not return 0 for non-integer");
+ if (json_integer_value(txt) != 0)
+ fail("json_integer_value did not return 0 for non-integer");
+
+ if (!json_integer_set(NULL, 0))
+ fail("json_integer_set did not return error for non-integer");
+ if (!json_integer_set(txt, 0))
+ fail("json_integer_set did not return error for non-integer");
+
+ if (json_real_value(NULL) != 0.0)
+ fail("json_real_value did not return 0.0 for non-real");
+ if (json_real_value(txt) != 0.0)
+ fail("json_real_value did not return 0.0 for non-real");
+
+ if (!json_real_set(NULL, 0.0))
+ fail("json_real_set did not return error for non-real");
+ if (!json_real_set(txt, 0.0))
+ fail("json_real_set did not return error for non-real");
+
+ if (json_number_value(NULL) != 0.0)
+ fail("json_number_value did not return 0.0 for non-numeric");
+ if (json_number_value(txt) != 0.0)
+ fail("json_number_value did not return 0.0 for non-numeric");
+
+ if (txt->refcount != 1)
+ fail("unexpected reference count for txt");
+
+ json_decref(txt);
+}
+
+static void run_tests() {
+ json_t *integer, *real;
+ json_int_t i;
+ double d;
+
+ integer = json_integer(5);
+ real = json_real(100.1);
+
+ if (!integer)
+ fail("unable to create integer");
+ if (!real)
+ fail("unable to create real");
+
+ i = json_integer_value(integer);
+ if (i != 5)
+ fail("wrong integer value");
+
+ d = json_real_value(real);
+ if (d != 100.1)
+ fail("wrong real value");
+
+ d = json_number_value(integer);
+ if (d != 5.0)
+ fail("wrong number value");
+ d = json_number_value(real);
+ if (d != 100.1)
+ fail("wrong number value");
+
+ json_decref(integer);
+ json_decref(real);
+
+#ifdef NAN
+ real = json_real(NAN);
+ if (real != NULL)
+ fail("could construct a real from NaN");
+
+ real = json_real(1.0);
+ if (json_real_set(real, NAN) != -1)
+ fail("could set a real to NaN");
+
+ if (json_real_value(real) != 1.0)
+ fail("real value changed unexpectedly");
+
+ json_decref(real);
+#endif
+
+#ifdef INFINITY
+ test_inifity();
+#endif
+ test_bad_args();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_object.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_object.c
new file mode 100644
index 000000000..331edf229
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_object.c
@@ -0,0 +1,797 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <string.h>
+
+static void test_clear() {
+ json_t *object, *ten;
+
+ object = json_object();
+ ten = json_integer(10);
+
+ if (!object)
+ fail("unable to create object");
+ if (!ten)
+ fail("unable to create integer");
+
+ if (json_object_set(object, "a", ten) || json_object_set(object, "b", ten) ||
+ json_object_set(object, "c", ten) || json_object_set(object, "d", ten) ||
+ json_object_set(object, "e", ten))
+ fail("unable to set value");
+
+ if (json_object_size(object) != 5)
+ fail("invalid size");
+
+ json_object_clear(object);
+
+ if (json_object_size(object) != 0)
+ fail("invalid size after clear");
+
+ json_decref(ten);
+ json_decref(object);
+}
+
+static void test_update() {
+ json_t *object, *other, *nine, *ten;
+
+ object = json_object();
+ other = json_object();
+
+ nine = json_integer(9);
+ ten = json_integer(10);
+
+ if (!object || !other)
+ fail("unable to create object");
+ if (!nine || !ten)
+ fail("unable to create integer");
+
+ /* update an empty object with an empty object */
+
+ if (json_object_update(object, other))
+ fail("unable to update an empty object with an empty object");
+
+ if (json_object_size(object) != 0)
+ fail("invalid size after update");
+
+ if (json_object_size(other) != 0)
+ fail("invalid size for updater after update");
+
+ /* update an empty object with a nonempty object */
+
+ if (json_object_set(other, "a", ten) || json_object_set(other, "b", ten) ||
+ json_object_set(other, "c", ten) || json_object_set(other, "d", ten) ||
+ json_object_set(other, "e", ten))
+ fail("unable to set value");
+
+ if (json_object_update(object, other))
+ fail("unable to update an empty object");
+
+ if (json_object_size(object) != 5)
+ fail("invalid size after update");
+
+ if (json_object_get(object, "a") != ten || json_object_get(object, "b") != ten ||
+ json_object_get(object, "c") != ten || json_object_get(object, "d") != ten ||
+ json_object_get(object, "e") != ten)
+ fail("update works incorrectly");
+
+ /* perform the same update again */
+
+ if (json_object_update(object, other))
+ fail("unable to update a non-empty object");
+
+ if (json_object_size(object) != 5)
+ fail("invalid size after update");
+
+ if (json_object_get(object, "a") != ten || json_object_get(object, "b") != ten ||
+ json_object_get(object, "c") != ten || json_object_get(object, "d") != ten ||
+ json_object_get(object, "e") != ten)
+ fail("update works incorrectly");
+
+ /* update a nonempty object with a nonempty object with both old
+ and new keys */
+
+ if (json_object_clear(other))
+ fail("clear failed");
+
+ if (json_object_set(other, "a", nine) || json_object_set(other, "b", nine) ||
+ json_object_set(other, "f", nine) || json_object_set(other, "g", nine) ||
+ json_object_set(other, "h", nine))
+ fail("unable to set value");
+
+ if (json_object_update(object, other))
+ fail("unable to update a nonempty object");
+
+ if (json_object_size(object) != 8)
+ fail("invalid size after update");
+
+ if (json_object_get(object, "a") != nine || json_object_get(object, "b") != nine ||
+ json_object_get(object, "f") != nine || json_object_get(object, "g") != nine ||
+ json_object_get(object, "h") != nine)
+ fail("update works incorrectly");
+
+ /* update_new check */
+ if (json_object_clear(object))
+ fail("clear failed");
+
+ if (json_object_set(object, "a", ten) || json_object_set(object, "b", ten) ||
+ json_object_set(object, "c", ten) || json_object_set(object, "d", ten) ||
+ json_object_set(object, "e", ten))
+ fail("unable to set value");
+
+ if (json_object_update_new(
+ object, json_pack("{s:O, s:O, s:O}", "b", nine, "f", nine, "g", nine)))
+ fail("unable to update_new a nonempty object");
+
+ if (json_object_size(object) != 7)
+ fail("invalid size after update_new");
+
+ if (json_object_get(object, "a") != ten || json_object_get(object, "b") != nine ||
+ json_object_get(object, "c") != ten || json_object_get(object, "d") != ten ||
+ json_object_get(object, "e") != ten || json_object_get(object, "f") != nine ||
+ json_object_get(object, "g") != nine)
+ fail("update_new works incorrectly");
+
+ json_decref(nine);
+ json_decref(ten);
+ json_decref(other);
+ json_decref(object);
+}
+
+static void test_set_many_keys() {
+ json_t *object, *value;
+ const char *keys = "abcdefghijklmnopqrstuvwxyz";
+ char buf[2];
+ size_t i;
+
+ object = json_object();
+ if (!object)
+ fail("unable to create object");
+
+ value = json_string("a");
+ if (!value)
+ fail("unable to create string");
+
+ buf[1] = '\0';
+ for (i = 0; i < strlen(keys); i++) {
+ buf[0] = keys[i];
+ if (json_object_set(object, buf, value))
+ fail("unable to set object key");
+ }
+
+ json_decref(object);
+ json_decref(value);
+}
+
+static void test_conditional_updates() {
+ json_t *object, *other;
+
+ object = json_pack("{sisi}", "foo", 1, "bar", 2);
+ other = json_pack("{sisi}", "foo", 3, "baz", 4);
+
+ if (json_object_update_existing(object, other))
+ fail("json_object_update_existing failed");
+
+ if (json_object_size(object) != 2)
+ fail("json_object_update_existing added new items");
+
+ if (json_integer_value(json_object_get(object, "foo")) != 3)
+ fail("json_object_update_existing failed to update existing key");
+
+ if (json_integer_value(json_object_get(object, "bar")) != 2)
+ fail("json_object_update_existing updated wrong key");
+
+ json_decref(object);
+
+ /* json_object_update_existing_new check */
+ object = json_pack("{sisi}", "foo", 1, "bar", 2);
+
+ if (json_object_update_existing_new(object, json_pack("{sisi}", "foo", 3, "baz", 4)))
+ fail("json_object_update_existing_new failed");
+
+ if (json_object_size(object) != 2)
+ fail("json_object_update_existing_new added new items");
+
+ if (json_integer_value(json_object_get(object, "foo")) != 3)
+ fail("json_object_update_existing_new failed to update existing key");
+
+ if (json_integer_value(json_object_get(object, "bar")) != 2)
+ fail("json_object_update_existing_new updated wrong key");
+
+ json_decref(object);
+
+ object = json_pack("{sisi}", "foo", 1, "bar", 2);
+
+ if (json_object_update_missing(object, other))
+ fail("json_object_update_missing failed");
+
+ if (json_object_size(object) != 3)
+ fail("json_object_update_missing didn't add new items");
+
+ if (json_integer_value(json_object_get(object, "foo")) != 1)
+ fail("json_object_update_missing updated existing key");
+
+ if (json_integer_value(json_object_get(object, "bar")) != 2)
+ fail("json_object_update_missing updated wrong key");
+
+ if (json_integer_value(json_object_get(object, "baz")) != 4)
+ fail("json_object_update_missing didn't add new items");
+
+ json_decref(object);
+
+ /* json_object_update_missing_new check */
+ object = json_pack("{sisi}", "foo", 1, "bar", 2);
+
+ if (json_object_update_missing_new(object, json_pack("{sisi}", "foo", 3, "baz", 4)))
+ fail("json_object_update_missing_new failed");
+
+ if (json_object_size(object) != 3)
+ fail("json_object_update_missing_new didn't add new items");
+
+ if (json_integer_value(json_object_get(object, "foo")) != 1)
+ fail("json_object_update_missing_new updated existing key");
+
+ if (json_integer_value(json_object_get(object, "bar")) != 2)
+ fail("json_object_update_missing_new updated wrong key");
+
+ if (json_integer_value(json_object_get(object, "baz")) != 4)
+ fail("json_object_update_missing_new didn't add new items");
+
+ json_decref(object);
+ json_decref(other);
+}
+
+static void test_recursive_updates() {
+ json_t *invalid, *object, *other, *barBefore, *barAfter;
+
+ invalid = json_integer(42);
+
+ object = json_pack("{sis{si}}", "foo", 1, "bar", "baz", 2);
+ other = json_pack("{sisisi}", "foo", 3, "bar", 4, "baz", 5);
+
+ if (!json_object_update_recursive(invalid, other))
+ fail("json_object_update_recursive accepted non-object argument");
+
+ json_decref(invalid);
+
+ if (json_object_update_recursive(object, other))
+ fail("json_object_update_recursive failed");
+
+ if (json_object_size(object) != 3)
+ fail("invalid size after update");
+
+ if (json_integer_value(json_object_get(object, "foo")) != 3)
+ fail("json_object_update_recursive failed to update existing key");
+
+ if (json_integer_value(json_object_get(object, "bar")) != 4)
+ fail("json_object_update_recursive failed to overwrite object");
+
+ if (json_integer_value(json_object_get(object, "baz")) != 5)
+ fail("json_object_update_recursive didn't add new item");
+
+ json_decref(object);
+ json_decref(other);
+
+ object = json_pack("{sis{si}}", "foo", 1, "bar", "baz", 2);
+ other = json_pack("{s{si}}", "bar", "baz", 3);
+ barBefore = json_object_get(object, "bar");
+
+ if (!barBefore)
+ fail("can't get bar object before json_object_update_recursive");
+
+ if (json_object_update_recursive(object, other))
+ fail("json_object_update_recursive failed");
+
+ if (json_object_size(object) != 2)
+ fail("invalid size after update");
+
+ if (!json_object_get(object, "foo"))
+ fail("json_object_update_recursive removed existing key");
+
+ if (json_integer_value(json_object_get(json_object_get(object, "bar"), "baz")) != 3)
+ fail("json_object_update_recursive failed to update nested value");
+
+ barAfter = json_object_get(object, "bar");
+ if (!barAfter)
+ fail("can't get bar object after json_object_update_recursive");
+
+ if (barBefore != barAfter)
+ fail("bar object reference changed after json_object_update_recursive");
+
+ json_decref(object);
+ json_decref(other);
+
+ /* check circular reference */
+ object = json_pack("{s{s{s{si}}}}", "foo", "bar", "baz", "xxx", 2);
+ other = json_pack("{s{s{si}}}", "foo", "bar", "baz", 2);
+ json_object_set(json_object_get(json_object_get(other, "foo"), "bar"), "baz",
+ json_object_get(other, "foo"));
+
+ if (!json_object_update_recursive(object, other))
+ fail("json_object_update_recursive update a circular reference!");
+
+ json_object_set_new(json_object_get(json_object_get(other, "foo"), "bar"), "baz",
+ json_integer(1));
+
+ if (json_object_update_recursive(object, other))
+ fail("json_object_update_recursive failed!");
+
+ json_decref(object);
+ json_decref(other);
+}
+
+static void test_circular() {
+ json_t *object1, *object2;
+
+ object1 = json_object();
+ object2 = json_object();
+ if (!object1 || !object2)
+ fail("unable to create object");
+
+ /* the simple case is checked */
+ if (json_object_set(object1, "a", object1) == 0)
+ fail("able to set self");
+
+ /* create circular references */
+ if (json_object_set(object1, "a", object2) || json_object_set(object2, "a", object1))
+ fail("unable to set value");
+
+ /* circularity is detected when dumping */
+ if (json_dumps(object1, 0) != NULL)
+ fail("able to dump circulars");
+
+ /* decref twice to deal with the circular references */
+ json_decref(object1);
+ json_decref(object2);
+ json_decref(object1);
+}
+
+static void test_set_nocheck() {
+ json_t *object, *string;
+
+ object = json_object();
+ string = json_string("bar");
+
+ if (!object)
+ fail("unable to create object");
+ if (!string)
+ fail("unable to create string");
+
+ if (json_object_set_nocheck(object, "foo", string))
+ fail("json_object_set_nocheck failed");
+ if (json_object_get(object, "foo") != string)
+ fail("json_object_get after json_object_set_nocheck failed");
+
+ /* invalid UTF-8 in key */
+ if (json_object_set_nocheck(object, "a\xefz", string))
+ fail("json_object_set_nocheck failed for invalid UTF-8");
+ if (json_object_get(object, "a\xefz") != string)
+ fail("json_object_get after json_object_set_nocheck failed");
+
+ if (json_object_set_new_nocheck(object, "bax", json_integer(123)))
+ fail("json_object_set_new_nocheck failed");
+ if (json_integer_value(json_object_get(object, "bax")) != 123)
+ fail("json_object_get after json_object_set_new_nocheck failed");
+
+ /* invalid UTF-8 in key */
+ if (json_object_set_new_nocheck(object, "asdf\xfe", json_integer(321)))
+ fail("json_object_set_new_nocheck failed for invalid UTF-8");
+ if (json_integer_value(json_object_get(object, "asdf\xfe")) != 321)
+ fail("json_object_get after json_object_set_new_nocheck failed");
+
+ json_decref(string);
+ json_decref(object);
+}
+
+static void test_iterators() {
+ json_t *object, *foo, *bar, *baz;
+ void *iter;
+
+ if (json_object_iter(NULL))
+ fail("able to iterate over NULL");
+
+ if (json_object_iter_next(NULL, NULL))
+ fail("able to increment an iterator on a NULL object");
+
+ object = json_object();
+ foo = json_string("foo");
+ bar = json_string("bar");
+ baz = json_string("baz");
+ if (!object || !foo || !bar || !baz)
+ fail("unable to create values");
+
+ if (json_object_iter_next(object, NULL))
+ fail("able to increment a NULL iterator");
+
+ if (json_object_set(object, "a", foo) || json_object_set(object, "b", bar) ||
+ json_object_set(object, "c", baz))
+ fail("unable to populate object");
+
+ iter = json_object_iter(object);
+ if (!iter)
+ fail("unable to get iterator");
+ if (strcmp(json_object_iter_key(iter), "a") != 0)
+ fail("iterating doesn't yield keys in order");
+ if (json_object_iter_value(iter) != foo)
+ fail("iterating doesn't yield values in order");
+
+ iter = json_object_iter_next(object, iter);
+ if (!iter)
+ fail("unable to increment iterator");
+ if (strcmp(json_object_iter_key(iter), "b") != 0)
+ fail("iterating doesn't yield keys in order");
+ if (json_object_iter_value(iter) != bar)
+ fail("iterating doesn't yield values in order");
+
+ iter = json_object_iter_next(object, iter);
+ if (!iter)
+ fail("unable to increment iterator");
+ if (strcmp(json_object_iter_key(iter), "c") != 0)
+ fail("iterating doesn't yield keys in order");
+ if (json_object_iter_value(iter) != baz)
+ fail("iterating doesn't yield values in order");
+
+ if (json_object_iter_next(object, iter) != NULL)
+ fail("able to iterate over the end");
+
+ if (json_object_iter_at(object, "foo"))
+ fail("json_object_iter_at() succeeds for non-existent key");
+
+ iter = json_object_iter_at(object, "b");
+ if (!iter)
+ fail("json_object_iter_at() fails for an existing key");
+
+ if (strcmp(json_object_iter_key(iter), "b"))
+ fail("iterating failed: wrong key");
+ if (json_object_iter_value(iter) != bar)
+ fail("iterating failed: wrong value");
+
+ if (json_object_iter_set(object, iter, baz))
+ fail("unable to set value at iterator");
+
+ if (strcmp(json_object_iter_key(iter), "b"))
+ fail("json_object_iter_key() fails after json_object_iter_set()");
+ if (json_object_iter_value(iter) != baz)
+ fail("json_object_iter_value() fails after json_object_iter_set()");
+ if (json_object_get(object, "b") != baz)
+ fail("json_object_get() fails after json_object_iter_set()");
+
+ json_decref(object);
+ json_decref(foo);
+ json_decref(bar);
+ json_decref(baz);
+}
+
+static void test_misc() {
+ json_t *object, *string, *other_string, *value;
+
+ object = json_object();
+ string = json_string("test");
+ other_string = json_string("other");
+
+ if (!object)
+ fail("unable to create object");
+ if (!string || !other_string)
+ fail("unable to create string");
+
+ if (json_object_get(object, "a"))
+ fail("value for nonexisting key");
+
+ if (json_object_set(object, "a", string))
+ fail("unable to set value");
+
+ if (!json_object_set(object, NULL, string))
+ fail("able to set NULL key");
+
+ if (json_object_del(object, "a"))
+ fail("unable to del the only key");
+
+ if (json_object_set(object, "a", string))
+ fail("unable to set value");
+
+ if (!json_object_set(object, "a", NULL))
+ fail("able to set NULL value");
+
+ /* invalid UTF-8 in key */
+ if (!json_object_set(object, "a\xefz", string))
+ fail("able to set invalid unicode key");
+
+ value = json_object_get(object, "a");
+ if (!value)
+ fail("no value for existing key");
+ if (value != string)
+ fail("got different value than what was added");
+
+ /* "a", "lp" and "px" collide in a five-bucket hashtable */
+ if (json_object_set(object, "b", string) || json_object_set(object, "lp", string) ||
+ json_object_set(object, "px", string))
+ fail("unable to set value");
+
+ value = json_object_get(object, "a");
+ if (!value)
+ fail("no value for existing key");
+ if (value != string)
+ fail("got different value than what was added");
+
+ if (json_object_set(object, "a", other_string))
+ fail("unable to replace an existing key");
+
+ value = json_object_get(object, "a");
+ if (!value)
+ fail("no value for existing key");
+ if (value != other_string)
+ fail("got different value than what was set");
+
+ if (!json_object_del(object, "nonexisting"))
+ fail("able to delete a nonexisting key");
+
+ if (json_object_del(object, "px"))
+ fail("unable to delete an existing key");
+
+ if (json_object_del(object, "a"))
+ fail("unable to delete an existing key");
+
+ if (json_object_del(object, "lp"))
+ fail("unable to delete an existing key");
+
+ /* add many keys to initiate rehashing */
+
+ if (json_object_set(object, "a", string))
+ fail("unable to set value");
+
+ if (json_object_set(object, "lp", string))
+ fail("unable to set value");
+
+ if (json_object_set(object, "px", string))
+ fail("unable to set value");
+
+ if (json_object_set(object, "c", string))
+ fail("unable to set value");
+
+ if (json_object_set(object, "d", string))
+ fail("unable to set value");
+
+ if (json_object_set(object, "e", string))
+ fail("unable to set value");
+
+ if (json_object_set_new(object, "foo", json_integer(123)))
+ fail("unable to set new value");
+
+ value = json_object_get(object, "foo");
+ if (!json_is_integer(value) || json_integer_value(value) != 123)
+ fail("json_object_set_new works incorrectly");
+
+ if (!json_object_set_new(object, NULL, json_integer(432)))
+ fail("able to set_new NULL key");
+
+ if (!json_object_set_new(object, "foo", NULL))
+ fail("able to set_new NULL value");
+
+ json_decref(string);
+ json_decref(other_string);
+ json_decref(object);
+}
+
+static void test_preserve_order() {
+ json_t *object;
+ char *result;
+
+ const char *expected = "{\"foobar\": 1, \"bazquux\": 6, \"lorem ipsum\": "
+ "3, \"sit amet\": 5, \"helicopter\": 7}";
+
+ object = json_object();
+
+ json_object_set_new(object, "foobar", json_integer(1));
+ json_object_set_new(object, "bazquux", json_integer(2));
+ json_object_set_new(object, "lorem ipsum", json_integer(3));
+ json_object_set_new(object, "dolor", json_integer(4));
+ json_object_set_new(object, "sit amet", json_integer(5));
+
+ /* changing a value should preserve the order */
+ json_object_set_new(object, "bazquux", json_integer(6));
+
+ /* deletion shouldn't change the order of others */
+ json_object_del(object, "dolor");
+
+ /* add a new item just to make sure */
+ json_object_set_new(object, "helicopter", json_integer(7));
+
+ result = json_dumps(object, JSON_PRESERVE_ORDER);
+
+ if (strcmp(expected, result) != 0) {
+ fprintf(stderr, "%s != %s", expected, result);
+ fail("JSON_PRESERVE_ORDER doesn't work");
+ }
+
+ free(result);
+ json_decref(object);
+}
+
+static void test_object_foreach() {
+ const char *key;
+ json_t *object1, *object2, *value;
+
+ object1 = json_pack("{sisisi}", "foo", 1, "bar", 2, "baz", 3);
+ object2 = json_object();
+
+ json_object_foreach(object1, key, value) json_object_set(object2, key, value);
+
+ if (!json_equal(object1, object2))
+ fail("json_object_foreach failed to iterate all key-value pairs");
+
+ json_decref(object1);
+ json_decref(object2);
+}
+
+static void test_object_foreach_safe() {
+ const char *key;
+ void *tmp;
+ json_t *object, *value;
+
+ object = json_pack("{sisisi}", "foo", 1, "bar", 2, "baz", 3);
+
+ json_object_foreach_safe(object, tmp, key, value) { json_object_del(object, key); }
+
+ if (json_object_size(object) != 0)
+ fail("json_object_foreach_safe failed to iterate all key-value pairs");
+
+ json_decref(object);
+}
+
+static void test_bad_args(void) {
+ json_t *obj = json_object();
+ json_t *num = json_integer(1);
+ void *iter;
+
+ if (!obj || !num)
+ fail("failed to allocate test objects");
+
+ if (json_object_set(obj, "testkey", json_null()))
+ fail("failed to set testkey on object");
+
+ iter = json_object_iter(obj);
+ if (!iter)
+ fail("failed to retrieve test iterator");
+
+ if (json_object_size(NULL) != 0)
+ fail("json_object_size with non-object argument returned non-zero");
+ if (json_object_size(num) != 0)
+ fail("json_object_size with non-object argument returned non-zero");
+
+ if (json_object_get(NULL, "test") != NULL)
+ fail("json_object_get with non-object argument returned non-NULL");
+ if (json_object_get(num, "test") != NULL)
+ fail("json_object_get with non-object argument returned non-NULL");
+ if (json_object_get(obj, NULL) != NULL)
+ fail("json_object_get with NULL key returned non-NULL");
+
+ if (!json_object_set_new_nocheck(NULL, "test", json_null()))
+ fail("json_object_set_new_nocheck with non-object argument did not "
+ "return error");
+ if (!json_object_set_new_nocheck(num, "test", json_null()))
+ fail("json_object_set_new_nocheck with non-object argument did not "
+ "return error");
+ if (!json_object_set_new_nocheck(obj, "test", json_incref(obj)))
+ fail("json_object_set_new_nocheck with object == value did not return "
+ "error");
+ if (!json_object_set_new_nocheck(obj, NULL, json_object()))
+ fail("json_object_set_new_nocheck with NULL key did not return error");
+
+ if (!json_object_del(NULL, "test"))
+ fail("json_object_del with non-object argument did not return error");
+ if (!json_object_del(num, "test"))
+ fail("json_object_del with non-object argument did not return error");
+ if (!json_object_del(obj, NULL))
+ fail("json_object_del with NULL key did not return error");
+
+ if (!json_object_clear(NULL))
+ fail("json_object_clear with non-object argument did not return error");
+ if (!json_object_clear(num))
+ fail("json_object_clear with non-object argument did not return error");
+
+ if (!json_object_update(NULL, obj))
+ fail("json_object_update with non-object first argument did not return "
+ "error");
+ if (!json_object_update(num, obj))
+ fail("json_object_update with non-object first argument did not return "
+ "error");
+ if (!json_object_update(obj, NULL))
+ fail("json_object_update with non-object second argument did not "
+ "return error");
+ if (!json_object_update(obj, num))
+ fail("json_object_update with non-object second argument did not "
+ "return error");
+
+ if (!json_object_update_existing(NULL, obj))
+ fail("json_object_update_existing with non-object first argument did "
+ "not return error");
+ if (!json_object_update_existing(num, obj))
+ fail("json_object_update_existing with non-object first argument did "
+ "not return error");
+ if (!json_object_update_existing(obj, NULL))
+ fail("json_object_update_existing with non-object second argument did "
+ "not return error");
+ if (!json_object_update_existing(obj, num))
+ fail("json_object_update_existing with non-object second argument did "
+ "not return error");
+
+ if (!json_object_update_missing(NULL, obj))
+ fail("json_object_update_missing with non-object first argument did "
+ "not return error");
+ if (!json_object_update_missing(num, obj))
+ fail("json_object_update_missing with non-object first argument did "
+ "not return error");
+ if (!json_object_update_missing(obj, NULL))
+ fail("json_object_update_missing with non-object second argument did "
+ "not return error");
+ if (!json_object_update_missing(obj, num))
+ fail("json_object_update_missing with non-object second argument did "
+ "not return error");
+
+ if (json_object_iter(NULL) != NULL)
+ fail("json_object_iter with non-object argument returned non-NULL");
+ if (json_object_iter(num) != NULL)
+ fail("json_object_iter with non-object argument returned non-NULL");
+
+ if (json_object_iter_at(NULL, "test") != NULL)
+ fail("json_object_iter_at with non-object argument returned non-NULL");
+ if (json_object_iter_at(num, "test") != NULL)
+ fail("json_object_iter_at with non-object argument returned non-NULL");
+ if (json_object_iter_at(obj, NULL) != NULL)
+ fail("json_object_iter_at with NULL iter returned non-NULL");
+
+ if (json_object_iter_next(obj, NULL) != NULL)
+ fail("json_object_iter_next with NULL iter returned non-NULL");
+ if (json_object_iter_next(num, iter) != NULL)
+ fail("json_object_iter_next with non-object argument returned non-NULL");
+
+ if (json_object_iter_key(NULL) != NULL)
+ fail("json_object_iter_key with NULL iter returned non-NULL");
+
+ if (json_object_key_to_iter(NULL) != NULL)
+ fail("json_object_key_to_iter with NULL iter returned non-NULL");
+
+ if (json_object_iter_value(NULL) != NULL)
+ fail("json_object_iter_value with NULL iter returned non-NULL");
+
+ if (!json_object_iter_set_new(NULL, iter, json_incref(num)))
+ fail("json_object_iter_set_new with non-object argument did not return "
+ "error");
+ if (!json_object_iter_set_new(num, iter, json_incref(num)))
+ fail("json_object_iter_set_new with non-object argument did not return "
+ "error");
+ if (!json_object_iter_set_new(obj, NULL, json_incref(num)))
+ fail("json_object_iter_set_new with NULL iter did not return error");
+ if (!json_object_iter_set_new(obj, iter, NULL))
+ fail("json_object_iter_set_new with NULL value did not return error");
+
+ if (obj->refcount != 1)
+ fail("unexpected reference count for obj");
+
+ if (num->refcount != 1)
+ fail("unexpected reference count for num");
+
+ json_decref(obj);
+ json_decref(num);
+}
+
+static void run_tests() {
+ test_misc();
+ test_clear();
+ test_update();
+ test_set_many_keys();
+ test_conditional_updates();
+ test_recursive_updates();
+ test_circular();
+ test_set_nocheck();
+ test_iterators();
+ test_preserve_order();
+ test_object_foreach();
+ test_object_foreach_safe();
+ test_bad_args();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_pack.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_pack.c
new file mode 100644
index 000000000..865f60b68
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_pack.c
@@ -0,0 +1,547 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ * Copyright (c) 2010-2012 Graeme Smecher <graeme.smecher@mail.mcgill.ca>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <jansson_config.h>
+
+#include "util.h"
+#include <jansson.h>
+#include <math.h>
+#include <stdio.h>
+#include <string.h>
+
+#ifdef INFINITY
+// This test triggers "warning C4756: overflow in constant arithmetic"
+// in Visual Studio. This warning is triggered here by design, so disable it.
+// (This can only be done on function level so we keep these tests separate)
+#ifdef _MSC_VER
+#pragma warning(push)
+#pragma warning(disable : 4756)
+#endif
+static void test_inifity() {
+ json_error_t error;
+
+ if (json_pack_ex(&error, 0, "f", INFINITY))
+ fail("json_pack infinity incorrectly succeeded");
+ check_error(json_error_numeric_overflow, "Invalid floating point value", "<args>", 1,
+ 1, 1);
+
+ if (json_pack_ex(&error, 0, "[f]", INFINITY))
+ fail("json_pack infinity array element incorrectly succeeded");
+ check_error(json_error_numeric_overflow, "Invalid floating point value", "<args>", 1,
+ 2, 2);
+
+ if (json_pack_ex(&error, 0, "{s:f}", "key", INFINITY))
+ fail("json_pack infinity object value incorrectly succeeded");
+ check_error(json_error_numeric_overflow, "Invalid floating point value", "<args>", 1,
+ 4, 4);
+
+#ifdef _MSC_VER
+#pragma warning(pop)
+#endif
+}
+#endif // INFINITY
+
+static void run_tests() {
+ json_t *value;
+ int i;
+ char buffer[4] = {'t', 'e', 's', 't'};
+ json_error_t error;
+
+ /*
+ * Simple, valid json_pack cases
+ */
+ /* true */
+ value = json_pack("b", 1);
+ if (!json_is_true(value))
+ fail("json_pack boolean failed");
+ if (value->refcount != (size_t)-1)
+ fail("json_pack boolean refcount failed");
+ json_decref(value);
+
+ /* false */
+ value = json_pack("b", 0);
+ if (!json_is_false(value))
+ fail("json_pack boolean failed");
+ if (value->refcount != (size_t)-1)
+ fail("json_pack boolean refcount failed");
+ json_decref(value);
+
+ /* null */
+ value = json_pack("n");
+ if (!json_is_null(value))
+ fail("json_pack null failed");
+ if (value->refcount != (size_t)-1)
+ fail("json_pack null refcount failed");
+ json_decref(value);
+
+ /* integer */
+ value = json_pack("i", 1);
+ if (!json_is_integer(value) || json_integer_value(value) != 1)
+ fail("json_pack integer failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack integer refcount failed");
+ json_decref(value);
+
+ /* integer from json_int_t */
+ value = json_pack("I", (json_int_t)555555);
+ if (!json_is_integer(value) || json_integer_value(value) != 555555)
+ fail("json_pack json_int_t failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack integer refcount failed");
+ json_decref(value);
+
+ /* real */
+ value = json_pack("f", 1.0);
+ if (!json_is_real(value) || json_real_value(value) != 1.0)
+ fail("json_pack real failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack real refcount failed");
+ json_decref(value);
+
+ /* string */
+ value = json_pack("s", "test");
+ if (!json_is_string(value) || strcmp("test", json_string_value(value)))
+ fail("json_pack string failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack string refcount failed");
+ json_decref(value);
+
+ /* nullable string (defined case) */
+ value = json_pack("s?", "test");
+ if (!json_is_string(value) || strcmp("test", json_string_value(value)))
+ fail("json_pack nullable string (defined case) failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack nullable string (defined case) refcount failed");
+ json_decref(value);
+
+ /* nullable string (NULL case) */
+ value = json_pack("s?", NULL);
+ if (!json_is_null(value))
+ fail("json_pack nullable string (NULL case) failed");
+ if (value->refcount != (size_t)-1)
+ fail("json_pack nullable string (NULL case) refcount failed");
+ json_decref(value);
+
+ /* nullable string concatenation */
+ if (json_pack_ex(&error, 0, "s?+", "test", "ing"))
+ fail("json_pack failed to catch invalid format 's?+'");
+ check_error(json_error_invalid_format, "Cannot use '+' on optional strings",
+ "<format>", 1, 2, 2);
+
+ /* nullable string with integer length */
+ if (json_pack_ex(&error, 0, "s?#", "test", 4))
+ fail("json_pack failed to catch invalid format 's?#'");
+ check_error(json_error_invalid_format, "Cannot use '#' on optional strings",
+ "<format>", 1, 2, 2);
+
+ /* string and length (int) */
+ value = json_pack("s#", "test asdf", 4);
+ if (!json_is_string(value) || strcmp("test", json_string_value(value)))
+ fail("json_pack string and length failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack string and length refcount failed");
+ json_decref(value);
+
+ /* string and length (size_t) */
+ value = json_pack("s%", "test asdf", (size_t)4);
+ if (!json_is_string(value) || strcmp("test", json_string_value(value)))
+ fail("json_pack string and length failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack string and length refcount failed");
+ json_decref(value);
+
+ /* string and length (int), non-NUL terminated string */
+ value = json_pack("s#", buffer, 4);
+ if (!json_is_string(value) || strcmp("test", json_string_value(value)))
+ fail("json_pack string and length (int) failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack string and length (int) refcount failed");
+ json_decref(value);
+
+ /* string and length (size_t), non-NUL terminated string */
+ value = json_pack("s%", buffer, (size_t)4);
+ if (!json_is_string(value) || strcmp("test", json_string_value(value)))
+ fail("json_pack string and length (size_t) failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack string and length (size_t) refcount failed");
+ json_decref(value);
+
+ /* string concatenation */
+ if (json_pack("s+", "test", NULL))
+ fail("json_pack string concatenation succeeded with NULL string");
+
+ value = json_pack("s++", "te", "st", "ing");
+ if (!json_is_string(value) || strcmp("testing", json_string_value(value)))
+ fail("json_pack string concatenation failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack string concatenation refcount failed");
+ json_decref(value);
+
+ /* string concatenation and length (int) */
+ value = json_pack("s#+#+", "test", 1, "test", 2, "test");
+ if (!json_is_string(value) || strcmp("ttetest", json_string_value(value)))
+ fail("json_pack string concatenation and length (int) failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack string concatenation and length (int) refcount failed");
+ json_decref(value);
+
+ /* string concatenation and length (size_t) */
+ value = json_pack("s%+%+", "test", (size_t)1, "test", (size_t)2, "test");
+ if (!json_is_string(value) || strcmp("ttetest", json_string_value(value)))
+ fail("json_pack string concatenation and length (size_t) failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack string concatenation and length (size_t) refcount "
+ "failed");
+ json_decref(value);
+
+ /* empty object */
+ value = json_pack("{}", 1.0);
+ if (!json_is_object(value) || json_object_size(value) != 0)
+ fail("json_pack empty object failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack empty object refcount failed");
+ json_decref(value);
+
+ /* empty list */
+ value = json_pack("[]", 1.0);
+ if (!json_is_array(value) || json_array_size(value) != 0)
+ fail("json_pack empty list failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack empty list failed");
+ json_decref(value);
+
+ /* non-incref'd object */
+ value = json_pack("o", json_integer(1));
+ if (!json_is_integer(value) || json_integer_value(value) != 1)
+ fail("json_pack object failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack integer refcount failed");
+ json_decref(value);
+
+ /* non-incref'd nullable object (defined case) */
+ value = json_pack("o?", json_integer(1));
+ if (!json_is_integer(value) || json_integer_value(value) != 1)
+ fail("json_pack nullable object (defined case) failed");
+ if (value->refcount != (size_t)1)
+ fail("json_pack nullable object (defined case) refcount failed");
+ json_decref(value);
+
+ /* non-incref'd nullable object (NULL case) */
+ value = json_pack("o?", NULL);
+ if (!json_is_null(value))
+ fail("json_pack nullable object (NULL case) failed");
+ if (value->refcount != (size_t)-1)
+ fail("json_pack nullable object (NULL case) refcount failed");
+ json_decref(value);
+
+ /* incref'd object */
+ value = json_pack("O", json_integer(1));
+ if (!json_is_integer(value) || json_integer_value(value) != 1)
+ fail("json_pack object failed");
+ if (value->refcount != (size_t)2)
+ fail("json_pack integer refcount failed");
+ json_decref(value);
+ json_decref(value);
+
+ /* incref'd nullable object (defined case) */
+ value = json_pack("O?", json_integer(1));
+ if (!json_is_integer(value) || json_integer_value(value) != 1)
+ fail("json_pack incref'd nullable object (defined case) failed");
+ if (value->refcount != (size_t)2)
+ fail("json_pack incref'd nullable object (defined case) refcount "
+ "failed");
+ json_decref(value);
+ json_decref(value);
+
+ /* incref'd nullable object (NULL case) */
+ value = json_pack("O?", NULL);
+ if (!json_is_null(value))
+ fail("json_pack incref'd nullable object (NULL case) failed");
+ if (value->refcount != (size_t)-1)
+ fail("json_pack incref'd nullable object (NULL case) refcount failed");
+
+ /* simple object */
+ value = json_pack("{s:[]}", "foo");
+ if (!json_is_object(value) || json_object_size(value) != 1)
+ fail("json_pack array failed");
+ if (!json_is_array(json_object_get(value, "foo")))
+ fail("json_pack array failed");
+ if (json_object_get(value, "foo")->refcount != (size_t)1)
+ fail("json_pack object refcount failed");
+ json_decref(value);
+
+ /* object with complex key */
+ value = json_pack("{s+#+: []}", "foo", "barbar", 3, "baz");
+ if (!json_is_object(value) || json_object_size(value) != 1)
+ fail("json_pack array failed");
+ if (!json_is_array(json_object_get(value, "foobarbaz")))
+ fail("json_pack array failed");
+ if (json_object_get(value, "foobarbaz")->refcount != (size_t)1)
+ fail("json_pack object refcount failed");
+ json_decref(value);
+
+ /* object with optional members */
+ value = json_pack("{s:s,s:o,s:O}", "a", NULL, "b", NULL, "c", NULL);
+ if (value)
+ fail("json_pack object optional incorrectly succeeded");
+
+ value = json_pack("{s:**}", "a", NULL);
+ if (value)
+ fail("json_pack object optional invalid incorrectly succeeded");
+
+ if (json_pack_ex(&error, 0, "{s:i*}", "a", 1))
+ fail("json_pack object optional invalid incorrectly succeeded");
+ check_error(json_error_invalid_format, "Expected format 's', got '*'", "<format>", 1,
+ 5, 5);
+
+ value = json_pack("{s:s*,s:o*,s:O*}", "a", NULL, "b", NULL, "c", NULL);
+ if (!json_is_object(value) || json_object_size(value) != 0)
+ fail("json_pack object optional failed");
+ json_decref(value);
+
+ value = json_pack("{s:s*}", "key", "\xff\xff");
+ if (value)
+ fail("json_pack object optional with invalid UTF-8 incorrectly "
+ "succeeded");
+
+ if (json_pack_ex(&error, 0, "{s: s*#}", "key", "test", 1))
+ fail("json_pack failed to catch invalid format 's*#'");
+ check_error(json_error_invalid_format, "Cannot use '#' on optional strings",
+ "<format>", 1, 6, 6);
+
+ if (json_pack_ex(&error, 0, "{s: s*+}", "key", "test", "ing"))
+ fail("json_pack failed to catch invalid format 's*+'");
+ check_error(json_error_invalid_format, "Cannot use '+' on optional strings",
+ "<format>", 1, 6, 6);
+
+ /* simple array */
+ value = json_pack("[i,i,i]", 0, 1, 2);
+ if (!json_is_array(value) || json_array_size(value) != 3)
+ fail("json_pack object failed");
+ for (i = 0; i < 3; i++) {
+ if (!json_is_integer(json_array_get(value, i)) ||
+ json_integer_value(json_array_get(value, i)) != i)
+
+ fail("json_pack integer array failed");
+ }
+ json_decref(value);
+
+ /* simple array with optional members */
+ value = json_pack("[s,o,O]", NULL, NULL, NULL);
+ if (value)
+ fail("json_pack array optional incorrectly succeeded");
+
+ if (json_pack_ex(&error, 0, "[i*]", 1))
+ fail("json_pack array optional invalid incorrectly succeeded");
+ check_error(json_error_invalid_format, "Unexpected format character '*'", "<format>",
+ 1, 3, 3);
+
+ value = json_pack("[**]", NULL);
+ if (value)
+ fail("json_pack array optional invalid incorrectly succeeded");
+ value = json_pack("[s*,o*,O*]", NULL, NULL, NULL);
+ if (!json_is_array(value) || json_array_size(value) != 0)
+ fail("json_pack array optional failed");
+ json_decref(value);
+
+#ifdef NAN
+ /* Invalid float values */
+ if (json_pack_ex(&error, 0, "f", NAN))
+ fail("json_pack NAN incorrectly succeeded");
+ check_error(json_error_numeric_overflow, "Invalid floating point value", "<args>", 1,
+ 1, 1);
+
+ if (json_pack_ex(&error, 0, "[f]", NAN))
+ fail("json_pack NAN array element incorrectly succeeded");
+ check_error(json_error_numeric_overflow, "Invalid floating point value", "<args>", 1,
+ 2, 2);
+
+ if (json_pack_ex(&error, 0, "{s:f}", "key", NAN))
+ fail("json_pack NAN object value incorrectly succeeded");
+ check_error(json_error_numeric_overflow, "Invalid floating point value", "<args>", 1,
+ 4, 4);
+#endif
+
+#ifdef INFINITY
+ test_inifity();
+#endif
+
+ /* Whitespace; regular string */
+ value = json_pack(" s\t ", "test");
+ if (!json_is_string(value) || strcmp("test", json_string_value(value)))
+ fail("json_pack string (with whitespace) failed");
+ json_decref(value);
+
+ /* Whitespace; empty array */
+ value = json_pack("[ ]");
+ if (!json_is_array(value) || json_array_size(value) != 0)
+ fail("json_pack empty array (with whitespace) failed");
+ json_decref(value);
+
+ /* Whitespace; array */
+ value = json_pack("[ i , i, i ] ", 1, 2, 3);
+ if (!json_is_array(value) || json_array_size(value) != 3)
+ fail("json_pack array (with whitespace) failed");
+ json_decref(value);
+
+ /*
+ * Invalid cases
+ */
+
+ /* newline in format string */
+ if (json_pack_ex(&error, 0, "{\n\n1"))
+ fail("json_pack failed to catch invalid format '1'");
+ check_error(json_error_invalid_format, "Expected format 's', got '1'", "<format>", 3,
+ 1, 4);
+
+ /* mismatched open/close array/object */
+ if (json_pack_ex(&error, 0, "[}"))
+ fail("json_pack failed to catch mismatched '}'");
+ check_error(json_error_invalid_format, "Unexpected format character '}'", "<format>",
+ 1, 2, 2);
+
+ if (json_pack_ex(&error, 0, "{]"))
+ fail("json_pack failed to catch mismatched ']'");
+ check_error(json_error_invalid_format, "Expected format 's', got ']'", "<format>", 1,
+ 2, 2);
+
+ /* missing close array */
+ if (json_pack_ex(&error, 0, "["))
+ fail("json_pack failed to catch missing ']'");
+ check_error(json_error_invalid_format, "Unexpected end of format string", "<format>",
+ 1, 2, 2);
+
+ /* missing close object */
+ if (json_pack_ex(&error, 0, "{"))
+ fail("json_pack failed to catch missing '}'");
+ check_error(json_error_invalid_format, "Unexpected end of format string", "<format>",
+ 1, 2, 2);
+
+ /* garbage after format string */
+ if (json_pack_ex(&error, 0, "[i]a", 42))
+ fail("json_pack failed to catch garbage after format string");
+ check_error(json_error_invalid_format, "Garbage after format string", "<format>", 1,
+ 4, 4);
+
+ if (json_pack_ex(&error, 0, "ia", 42))
+ fail("json_pack failed to catch garbage after format string");
+ check_error(json_error_invalid_format, "Garbage after format string", "<format>", 1,
+ 2, 2);
+
+ /* NULL string */
+ if (json_pack_ex(&error, 0, "s", NULL))
+ fail("json_pack failed to catch null argument string");
+ check_error(json_error_null_value, "NULL string", "<args>", 1, 1, 1);
+
+ /* + on its own */
+ if (json_pack_ex(&error, 0, "+", NULL))
+ fail("json_pack failed to a lone +");
+ check_error(json_error_invalid_format, "Unexpected format character '+'", "<format>",
+ 1, 1, 1);
+
+ /* Empty format */
+ if (json_pack_ex(&error, 0, ""))
+ fail("json_pack failed to catch empty format string");
+ check_error(json_error_invalid_argument, "NULL or empty format string", "<format>",
+ -1, -1, 0);
+
+ /* NULL format */
+ if (json_pack_ex(&error, 0, NULL))
+ fail("json_pack failed to catch NULL format string");
+ check_error(json_error_invalid_argument, "NULL or empty format string", "<format>",
+ -1, -1, 0);
+
+ /* NULL key */
+ if (json_pack_ex(&error, 0, "{s:i}", NULL, 1))
+ fail("json_pack failed to catch NULL key");
+ check_error(json_error_null_value, "NULL object key", "<args>", 1, 2, 2);
+
+ /* NULL value followed by object still steals the object's ref */
+ value = json_incref(json_object());
+ if (json_pack_ex(&error, 0, "{s:s,s:o}", "badnull", NULL, "dontleak", value))
+ fail("json_pack failed to catch NULL value");
+ check_error(json_error_null_value, "NULL string", "<args>", 1, 4, 4);
+ if (value->refcount != (size_t)1)
+ fail("json_pack failed to steal reference after error.");
+ json_decref(value);
+
+ /* More complicated checks for row/columns */
+ if (json_pack_ex(&error, 0, "{ {}: s }", "foo"))
+ fail("json_pack failed to catch object as key");
+ check_error(json_error_invalid_format, "Expected format 's', got '{'", "<format>", 1,
+ 3, 3);
+
+ /* Complex object */
+ if (json_pack_ex(&error, 0, "{ s: {}, s:[ii{} }", "foo", "bar", 12, 13))
+ fail("json_pack failed to catch missing ]");
+ check_error(json_error_invalid_format, "Unexpected format character '}'", "<format>",
+ 1, 19, 19);
+
+ /* Complex array */
+ if (json_pack_ex(&error, 0, "[[[[[ [[[[[ [[[[ }]]]] ]]]] ]]]]]"))
+ fail("json_pack failed to catch extra }");
+ check_error(json_error_invalid_format, "Unexpected format character '}'", "<format>",
+ 1, 21, 21);
+
+ /* Invalid UTF-8 in object key */
+ if (json_pack_ex(&error, 0, "{s:i}", "\xff\xff", 42))
+ fail("json_pack failed to catch invalid UTF-8 in an object key");
+ check_error(json_error_invalid_utf8, "Invalid UTF-8 object key", "<args>", 1, 2, 2);
+
+ /* Invalid UTF-8 in a string */
+ if (json_pack_ex(&error, 0, "{s:s}", "foo", "\xff\xff"))
+ fail("json_pack failed to catch invalid UTF-8 in a string");
+ check_error(json_error_invalid_utf8, "Invalid UTF-8 string", "<args>", 1, 4, 4);
+
+ /* Invalid UTF-8 in an optional '?' string */
+ if (json_pack_ex(&error, 0, "{s:s?}", "foo", "\xff\xff"))
+ fail("json_pack failed to catch invalid UTF-8 in an optional '?' "
+ "string");
+ check_error(json_error_invalid_utf8, "Invalid UTF-8 string", "<args>", 1, 5, 5);
+
+ /* Invalid UTF-8 in an optional '*' string */
+ if (json_pack_ex(&error, 0, "{s:s*}", "foo", "\xff\xff"))
+ fail("json_pack failed to catch invalid UTF-8 in an optional '*' "
+ "string");
+ check_error(json_error_invalid_utf8, "Invalid UTF-8 string", "<args>", 1, 5, 5);
+
+ /* Invalid UTF-8 in a concatenated key */
+ if (json_pack_ex(&error, 0, "{s+:i}", "\xff\xff", "concat", 42))
+ fail("json_pack failed to catch invalid UTF-8 in an object key");
+ check_error(json_error_invalid_utf8, "Invalid UTF-8 object key", "<args>", 1, 3, 3);
+
+ if (json_pack_ex(&error, 0, "{s:o}", "foo", NULL))
+ fail("json_pack failed to catch nullable object");
+ check_error(json_error_null_value, "NULL object", "<args>", 1, 4, 4);
+
+ if (json_pack_ex(&error, 0, "{s:O}", "foo", NULL))
+ fail("json_pack failed to catch nullable incref object");
+ check_error(json_error_null_value, "NULL object", "<args>", 1, 4, 4);
+
+ if (json_pack_ex(&error, 0, "{s+:o}", "foo", "bar", NULL))
+ fail("json_pack failed to catch non-nullable object value");
+ check_error(json_error_null_value, "NULL object", "<args>", 1, 5, 5);
+
+ if (json_pack_ex(&error, 0, "[1s", "Hi"))
+ fail("json_pack failed to catch invalid format");
+ check_error(json_error_invalid_format, "Unexpected format character '1'", "<format>",
+ 1, 2, 2);
+
+ if (json_pack_ex(&error, 0, "[1s+", "Hi", "ya"))
+ fail("json_pack failed to catch invalid format");
+ check_error(json_error_invalid_format, "Unexpected format character '1'", "<format>",
+ 1, 2, 2);
+
+ if (json_pack_ex(&error, 0, "[so]", NULL, json_object()))
+ fail("json_pack failed to catch NULL value");
+ check_error(json_error_null_value, "NULL string", "<args>", 1, 2, 2);
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_simple.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_simple.c
new file mode 100644
index 000000000..7a3f6b7bf
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_simple.c
@@ -0,0 +1,287 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <string.h>
+
+static void test_bad_args(void) {
+ json_t *num = json_integer(1);
+ json_t *txt = json_string("test");
+
+ if (!num || !txt)
+ fail("failed to allocate test objects");
+
+ if (json_string_nocheck(NULL) != NULL)
+ fail("json_string_nocheck with NULL argument did not return NULL");
+ if (json_stringn_nocheck(NULL, 0) != NULL)
+ fail("json_stringn_nocheck with NULL argument did not return NULL");
+ if (json_string(NULL) != NULL)
+ fail("json_string with NULL argument did not return NULL");
+ if (json_stringn(NULL, 0) != NULL)
+ fail("json_stringn with NULL argument did not return NULL");
+
+ if (json_string_length(NULL) != 0)
+ fail("json_string_length with non-string argument did not return 0");
+ if (json_string_length(num) != 0)
+ fail("json_string_length with non-string argument did not return 0");
+
+ if (json_string_value(NULL) != NULL)
+ fail("json_string_value with non-string argument did not return NULL");
+ if (json_string_value(num) != NULL)
+ fail("json_string_value with non-string argument did not return NULL");
+
+ if (!json_string_setn_nocheck(NULL, "", 0))
+ fail("json_string_setn with non-string argument did not return error");
+ if (!json_string_setn_nocheck(num, "", 0))
+ fail("json_string_setn with non-string argument did not return error");
+ if (!json_string_setn_nocheck(txt, NULL, 0))
+ fail("json_string_setn_nocheck with NULL value did not return error");
+
+ if (!json_string_set_nocheck(txt, NULL))
+ fail("json_string_set_nocheck with NULL value did not return error");
+ if (!json_string_set(txt, NULL))
+ fail("json_string_set with NULL value did not return error");
+ if (!json_string_setn(txt, NULL, 0))
+ fail("json_string_setn with NULL value did not return error");
+
+ if (num->refcount != 1)
+ fail("unexpected reference count for num");
+ if (txt->refcount != 1)
+ fail("unexpected reference count for txt");
+
+ json_decref(num);
+ json_decref(txt);
+}
+
+/* Call the simple functions not covered by other tests of the public API */
+static void run_tests() {
+ json_t *value;
+
+ value = json_boolean(1);
+ if (!json_is_true(value))
+ fail("json_boolean(1) failed");
+ json_decref(value);
+
+ value = json_boolean(-123);
+ if (!json_is_true(value))
+ fail("json_boolean(-123) failed");
+ json_decref(value);
+
+ value = json_boolean(0);
+ if (!json_is_false(value))
+ fail("json_boolean(0) failed");
+ if (json_boolean_value(value) != 0)
+ fail("json_boolean_value failed");
+ json_decref(value);
+
+ value = json_integer(1);
+ if (json_typeof(value) != JSON_INTEGER)
+ fail("json_typeof failed");
+
+ if (json_is_object(value))
+ fail("json_is_object failed");
+
+ if (json_is_array(value))
+ fail("json_is_array failed");
+
+ if (json_is_string(value))
+ fail("json_is_string failed");
+
+ if (!json_is_integer(value))
+ fail("json_is_integer failed");
+
+ if (json_is_real(value))
+ fail("json_is_real failed");
+
+ if (!json_is_number(value))
+ fail("json_is_number failed");
+
+ if (json_is_true(value))
+ fail("json_is_true failed");
+
+ if (json_is_false(value))
+ fail("json_is_false failed");
+
+ if (json_is_boolean(value))
+ fail("json_is_boolean failed");
+
+ if (json_is_null(value))
+ fail("json_is_null failed");
+
+ json_decref(value);
+
+ value = json_string("foo");
+ if (!value)
+ fail("json_string failed");
+ if (strcmp(json_string_value(value), "foo"))
+ fail("invalid string value");
+ if (json_string_length(value) != 3)
+ fail("invalid string length");
+
+ if (json_string_set(value, "barr"))
+ fail("json_string_set failed");
+ if (strcmp(json_string_value(value), "barr"))
+ fail("invalid string value");
+ if (json_string_length(value) != 4)
+ fail("invalid string length");
+
+ if (json_string_setn(value, "hi\0ho", 5))
+ fail("json_string_set failed");
+ if (memcmp(json_string_value(value), "hi\0ho\0", 6))
+ fail("invalid string value");
+ if (json_string_length(value) != 5)
+ fail("invalid string length");
+
+ json_decref(value);
+
+ value = json_string(NULL);
+ if (value)
+ fail("json_string(NULL) failed");
+
+ /* invalid UTF-8 */
+ value = json_string("a\xefz");
+ if (value)
+ fail("json_string(<invalid utf-8>) failed");
+
+ value = json_string_nocheck("foo");
+ if (!value)
+ fail("json_string_nocheck failed");
+ if (strcmp(json_string_value(value), "foo"))
+ fail("invalid string value");
+ if (json_string_length(value) != 3)
+ fail("invalid string length");
+
+ if (json_string_set_nocheck(value, "barr"))
+ fail("json_string_set_nocheck failed");
+ if (strcmp(json_string_value(value), "barr"))
+ fail("invalid string value");
+ if (json_string_length(value) != 4)
+ fail("invalid string length");
+
+ if (json_string_setn_nocheck(value, "hi\0ho", 5))
+ fail("json_string_set failed");
+ if (memcmp(json_string_value(value), "hi\0ho\0", 6))
+ fail("invalid string value");
+ if (json_string_length(value) != 5)
+ fail("invalid string length");
+
+ json_decref(value);
+
+ /* invalid UTF-8 */
+ value = json_string_nocheck("qu\xff");
+ if (!value)
+ fail("json_string_nocheck failed");
+ if (strcmp(json_string_value(value), "qu\xff"))
+ fail("invalid string value");
+ if (json_string_length(value) != 3)
+ fail("invalid string length");
+
+ if (json_string_set_nocheck(value, "\xfd\xfe\xff"))
+ fail("json_string_set_nocheck failed");
+ if (strcmp(json_string_value(value), "\xfd\xfe\xff"))
+ fail("invalid string value");
+ if (json_string_length(value) != 3)
+ fail("invalid string length");
+
+ json_decref(value);
+
+ value = json_integer(123);
+ if (!value)
+ fail("json_integer failed");
+ if (json_integer_value(value) != 123)
+ fail("invalid integer value");
+ if (json_number_value(value) != 123.0)
+ fail("invalid number value");
+
+ if (json_integer_set(value, 321))
+ fail("json_integer_set failed");
+ if (json_integer_value(value) != 321)
+ fail("invalid integer value");
+ if (json_number_value(value) != 321.0)
+ fail("invalid number value");
+
+ json_decref(value);
+
+ value = json_real(123.123);
+ if (!value)
+ fail("json_real failed");
+ if (json_real_value(value) != 123.123)
+ fail("invalid integer value");
+ if (json_number_value(value) != 123.123)
+ fail("invalid number value");
+
+ if (json_real_set(value, 321.321))
+ fail("json_real_set failed");
+ if (json_real_value(value) != 321.321)
+ fail("invalid real value");
+ if (json_number_value(value) != 321.321)
+ fail("invalid number value");
+
+ json_decref(value);
+
+ value = json_true();
+ if (!value)
+ fail("json_true failed");
+ json_decref(value);
+
+ value = json_false();
+ if (!value)
+ fail("json_false failed");
+ json_decref(value);
+
+ value = json_null();
+ if (!value)
+ fail("json_null failed");
+ json_decref(value);
+
+ /* Test reference counting on singletons (true, false, null) */
+ value = json_true();
+ if (value->refcount != (size_t)-1)
+ fail("refcounting true works incorrectly");
+ json_decref(value);
+ if (value->refcount != (size_t)-1)
+ fail("refcounting true works incorrectly");
+ json_incref(value);
+ if (value->refcount != (size_t)-1)
+ fail("refcounting true works incorrectly");
+
+ value = json_false();
+ if (value->refcount != (size_t)-1)
+ fail("refcounting false works incorrectly");
+ json_decref(value);
+ if (value->refcount != (size_t)-1)
+ fail("refcounting false works incorrectly");
+ json_incref(value);
+ if (value->refcount != (size_t)-1)
+ fail("refcounting false works incorrectly");
+
+ value = json_null();
+ if (value->refcount != (size_t)-1)
+ fail("refcounting null works incorrectly");
+ json_decref(value);
+ if (value->refcount != (size_t)-1)
+ fail("refcounting null works incorrectly");
+ json_incref(value);
+ if (value->refcount != (size_t)-1)
+ fail("refcounting null works incorrectly");
+
+#ifdef json_auto_t
+ value = json_string("foo");
+ {
+ json_auto_t *test = json_incref(value);
+ /* Use test so GCC doesn't complain it is unused. */
+ if (!json_is_string(test))
+ fail("value type check failed");
+ }
+ if (value->refcount != 1)
+ fail("automatic decrement failed");
+ json_decref(value);
+#endif
+
+ test_bad_args();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_sprintf.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_sprintf.c
new file mode 100644
index 000000000..60a0b601d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_sprintf.c
@@ -0,0 +1,29 @@
+#include "util.h"
+#include <jansson.h>
+#include <string.h>
+
+static void test_sprintf() {
+ json_t *s = json_sprintf("foo bar %d", 42);
+ if (!s)
+ fail("json_sprintf returned NULL");
+ if (!json_is_string(s))
+ fail("json_sprintf didn't return a JSON string");
+ if (strcmp(json_string_value(s), "foo bar 42"))
+ fail("json_sprintf generated an unexpected string");
+
+ json_decref(s);
+
+ s = json_sprintf("%s", "");
+ if (!s)
+ fail("json_sprintf returned NULL");
+ if (!json_is_string(s))
+ fail("json_sprintf didn't return a JSON string");
+ if (json_string_length(s) != 0)
+ fail("string is not empty");
+ json_decref(s);
+
+ if (json_sprintf("%s", "\xff\xff"))
+ fail("json_sprintf unexpected success with invalid UTF");
+}
+
+static void run_tests() { test_sprintf(); }
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_unpack.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_unpack.c
new file mode 100644
index 000000000..139ec6f7b
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_unpack.c
@@ -0,0 +1,431 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ * Copyright (c) 2010-2012 Graeme Smecher <graeme.smecher@mail.mcgill.ca>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <stdio.h>
+#include <string.h>
+
+static void run_tests() {
+ json_t *j, *j2;
+ int i1, i2, i3;
+ json_int_t I1;
+ int rv;
+ size_t z;
+ double f;
+ char *s;
+
+ json_error_t error;
+
+ /*
+ * Simple, valid json_pack cases
+ */
+
+ /* true */
+ rv = json_unpack(json_true(), "b", &i1);
+ if (rv || !i1)
+ fail("json_unpack boolean failed");
+
+ /* false */
+ rv = json_unpack(json_false(), "b", &i1);
+ if (rv || i1)
+ fail("json_unpack boolean failed");
+
+ /* null */
+ if (json_unpack(json_null(), "n"))
+ fail("json_unpack null failed");
+
+ /* integer */
+ j = json_integer(42);
+ rv = json_unpack(j, "i", &i1);
+ if (rv || i1 != 42)
+ fail("json_unpack integer failed");
+ json_decref(j);
+
+ /* json_int_t */
+ j = json_integer(5555555);
+ rv = json_unpack(j, "I", &I1);
+ if (rv || I1 != 5555555)
+ fail("json_unpack json_int_t failed");
+ json_decref(j);
+
+ /* real */
+ j = json_real(1.7);
+ rv = json_unpack(j, "f", &f);
+ if (rv || f != 1.7)
+ fail("json_unpack real failed");
+ json_decref(j);
+
+ /* number */
+ j = json_integer(12345);
+ rv = json_unpack(j, "F", &f);
+ if (rv || f != 12345.0)
+ fail("json_unpack (real or) integer failed");
+ json_decref(j);
+
+ j = json_real(1.7);
+ rv = json_unpack(j, "F", &f);
+ if (rv || f != 1.7)
+ fail("json_unpack real (or integer) failed");
+ json_decref(j);
+
+ /* string */
+ j = json_string("foo");
+ rv = json_unpack(j, "s", &s);
+ if (rv || strcmp(s, "foo"))
+ fail("json_unpack string failed");
+ json_decref(j);
+
+ /* string with length (size_t) */
+ j = json_string("foo");
+ rv = json_unpack(j, "s%", &s, &z);
+ if (rv || strcmp(s, "foo") || z != 3)
+ fail("json_unpack string with length (size_t) failed");
+ json_decref(j);
+
+ /* empty object */
+ j = json_object();
+ if (json_unpack(j, "{}"))
+ fail("json_unpack empty object failed");
+ json_decref(j);
+
+ /* empty list */
+ j = json_array();
+ if (json_unpack(j, "[]"))
+ fail("json_unpack empty list failed");
+ json_decref(j);
+
+ /* non-incref'd object */
+ j = json_object();
+ rv = json_unpack(j, "o", &j2);
+ if (rv || j2 != j || j->refcount != 1)
+ fail("json_unpack object failed");
+ json_decref(j);
+
+ /* incref'd object */
+ j = json_object();
+ rv = json_unpack(j, "O", &j2);
+ if (rv || j2 != j || j->refcount != 2)
+ fail("json_unpack object failed");
+ json_decref(j);
+ json_decref(j);
+
+ /* simple object */
+ j = json_pack("{s:i}", "foo", 42);
+ rv = json_unpack(j, "{s:i}", "foo", &i1);
+ if (rv || i1 != 42)
+ fail("json_unpack simple object failed");
+ json_decref(j);
+
+ /* simple array */
+ j = json_pack("[iii]", 1, 2, 3);
+ rv = json_unpack(j, "[i,i,i]", &i1, &i2, &i3);
+ if (rv || i1 != 1 || i2 != 2 || i3 != 3)
+ fail("json_unpack simple array failed");
+ json_decref(j);
+
+ /* object with many items & strict checking */
+ j = json_pack("{s:i, s:i, s:i}", "a", 1, "b", 2, "c", 3);
+ rv = json_unpack(j, "{s:i, s:i, s:i}", "a", &i1, "b", &i2, "c", &i3);
+ if (rv || i1 != 1 || i2 != 2 || i3 != 3)
+ fail("json_unpack object with many items failed");
+ json_decref(j);
+
+ /*
+ * Invalid cases
+ */
+
+ j = json_integer(42);
+ if (!json_unpack_ex(j, &error, 0, "z"))
+ fail("json_unpack succeeded with invalid format character");
+ check_error(json_error_invalid_format, "Unexpected format character 'z'", "<format>",
+ 1, 1, 1);
+
+ if (!json_unpack_ex(NULL, &error, 0, "[i]"))
+ fail("json_unpack succeeded with NULL root");
+ check_error(json_error_null_value, "NULL root value", "<root>", -1, -1, 0);
+ json_decref(j);
+
+ /* mismatched open/close array/object */
+ j = json_pack("[]");
+ if (!json_unpack_ex(j, &error, 0, "[}"))
+ fail("json_unpack failed to catch mismatched ']'");
+ check_error(json_error_invalid_format, "Unexpected format character '}'", "<format>",
+ 1, 2, 2);
+ json_decref(j);
+
+ j = json_pack("{}");
+ if (!json_unpack_ex(j, &error, 0, "{]"))
+ fail("json_unpack failed to catch mismatched '}'");
+ check_error(json_error_invalid_format, "Expected format 's', got ']'", "<format>", 1,
+ 2, 2);
+ json_decref(j);
+
+ /* missing close array */
+ j = json_pack("[]");
+ if (!json_unpack_ex(j, &error, 0, "["))
+ fail("json_unpack failed to catch missing ']'");
+ check_error(json_error_invalid_format, "Unexpected end of format string", "<format>",
+ 1, 2, 2);
+ json_decref(j);
+
+ /* missing close object */
+ j = json_pack("{}");
+ if (!json_unpack_ex(j, &error, 0, "{"))
+ fail("json_unpack failed to catch missing '}'");
+ check_error(json_error_invalid_format, "Unexpected end of format string", "<format>",
+ 1, 2, 2);
+ json_decref(j);
+
+ /* garbage after format string */
+ j = json_pack("[i]", 42);
+ if (!json_unpack_ex(j, &error, 0, "[i]a", &i1))
+ fail("json_unpack failed to catch garbage after format string");
+ check_error(json_error_invalid_format, "Garbage after format string", "<format>", 1,
+ 4, 4);
+ json_decref(j);
+
+ j = json_integer(12345);
+ if (!json_unpack_ex(j, &error, 0, "ia", &i1))
+ fail("json_unpack failed to catch garbage after format string");
+ check_error(json_error_invalid_format, "Garbage after format string", "<format>", 1,
+ 2, 2);
+ json_decref(j);
+
+ /* NULL format string */
+ j = json_pack("[]");
+ if (!json_unpack_ex(j, &error, 0, NULL))
+ fail("json_unpack failed to catch null format string");
+ check_error(json_error_invalid_argument, "NULL or empty format string", "<format>",
+ -1, -1, 0);
+ json_decref(j);
+
+ /* NULL string pointer */
+ j = json_string("foobie");
+ if (!json_unpack_ex(j, &error, 0, "s", NULL))
+ fail("json_unpack failed to catch null string pointer");
+ check_error(json_error_null_value, "NULL string argument", "<args>", 1, 1, 1);
+ json_decref(j);
+
+ /* invalid types */
+ j = json_integer(42);
+ j2 = json_string("foo");
+ if (!json_unpack_ex(j, &error, 0, "s"))
+ fail("json_unpack failed to catch invalid type");
+ check_error(json_error_wrong_type, "Expected string, got integer", "<validation>", 1,
+ 1, 1);
+
+ if (!json_unpack_ex(j, &error, 0, "n"))
+ fail("json_unpack failed to catch invalid type");
+ check_error(json_error_wrong_type, "Expected null, got integer", "<validation>", 1, 1,
+ 1);
+
+ if (!json_unpack_ex(j, &error, 0, "b"))
+ fail("json_unpack failed to catch invalid type");
+ check_error(json_error_wrong_type, "Expected true or false, got integer",
+ "<validation>", 1, 1, 1);
+
+ if (!json_unpack_ex(j2, &error, 0, "i"))
+ fail("json_unpack failed to catch invalid type");
+ check_error(json_error_wrong_type, "Expected integer, got string", "<validation>", 1,
+ 1, 1);
+
+ if (!json_unpack_ex(j2, &error, 0, "I"))
+ fail("json_unpack failed to catch invalid type");
+ check_error(json_error_wrong_type, "Expected integer, got string", "<validation>", 1,
+ 1, 1);
+
+ if (!json_unpack_ex(j, &error, 0, "f"))
+ fail("json_unpack failed to catch invalid type");
+ check_error(json_error_wrong_type, "Expected real, got integer", "<validation>", 1, 1,
+ 1);
+
+ if (!json_unpack_ex(j2, &error, 0, "F"))
+ fail("json_unpack failed to catch invalid type");
+ check_error(json_error_wrong_type, "Expected real or integer, got string",
+ "<validation>", 1, 1, 1);
+
+ if (!json_unpack_ex(j, &error, 0, "[i]"))
+ fail("json_unpack failed to catch invalid type");
+ check_error(json_error_wrong_type, "Expected array, got integer", "<validation>", 1,
+ 1, 1);
+
+ if (!json_unpack_ex(j, &error, 0, "{si}", "foo"))
+ fail("json_unpack failed to catch invalid type");
+ check_error(json_error_wrong_type, "Expected object, got integer", "<validation>", 1,
+ 1, 1);
+
+ json_decref(j);
+ json_decref(j2);
+
+ /* Array index out of range */
+ j = json_pack("[i]", 1);
+ if (!json_unpack_ex(j, &error, 0, "[ii]", &i1, &i2))
+ fail("json_unpack failed to catch index out of array bounds");
+ check_error(json_error_index_out_of_range, "Array index 1 out of range",
+ "<validation>", 1, 3, 3);
+ json_decref(j);
+
+ /* NULL object key */
+ j = json_pack("{si}", "foo", 42);
+ if (!json_unpack_ex(j, &error, 0, "{si}", NULL, &i1))
+ fail("json_unpack failed to catch null string pointer");
+ check_error(json_error_null_value, "NULL object key", "<args>", 1, 2, 2);
+ json_decref(j);
+
+ /* Object key not found */
+ j = json_pack("{si}", "foo", 42);
+ if (!json_unpack_ex(j, &error, 0, "{si}", "baz", &i1))
+ fail("json_unpack failed to catch null string pointer");
+ check_error(json_error_item_not_found, "Object item not found: baz", "<validation>",
+ 1, 3, 3);
+ json_decref(j);
+
+ /*
+ * Strict validation
+ */
+
+ j = json_pack("[iii]", 1, 2, 3);
+ rv = json_unpack(j, "[iii!]", &i1, &i2, &i3);
+ if (rv || i1 != 1 || i2 != 2 || i3 != 3)
+ fail("json_unpack array with strict validation failed");
+ json_decref(j);
+
+ j = json_pack("[iii]", 1, 2, 3);
+ if (!json_unpack_ex(j, &error, 0, "[ii!]", &i1, &i2))
+ fail("json_unpack array with strict validation failed");
+ check_error(json_error_end_of_input_expected, "1 array item(s) left unpacked",
+ "<validation>", 1, 5, 5);
+ json_decref(j);
+
+ /* Like above, but with JSON_STRICT instead of '!' format */
+ j = json_pack("[iii]", 1, 2, 3);
+ if (!json_unpack_ex(j, &error, JSON_STRICT, "[ii]", &i1, &i2))
+ fail("json_unpack array with strict validation failed");
+ check_error(json_error_end_of_input_expected, "1 array item(s) left unpacked",
+ "<validation>", 1, 4, 4);
+ json_decref(j);
+
+ j = json_pack("{s:s, s:i}", "foo", "bar", "baz", 42);
+ rv = json_unpack(j, "{sssi!}", "foo", &s, "baz", &i1);
+ if (rv || strcmp(s, "bar") != 0 || i1 != 42)
+ fail("json_unpack object with strict validation failed");
+ json_decref(j);
+
+ /* Unpack the same item twice */
+ j = json_pack("{s:s, s:i, s:b}", "foo", "bar", "baz", 42, "quux", 1);
+ if (!json_unpack_ex(j, &error, 0, "{s:s,s:s!}", "foo", &s, "foo", &s))
+ fail("json_unpack object with strict validation failed");
+ {
+ const char *possible_errors[] = {"2 object item(s) left unpacked: baz, quux",
+ "2 object item(s) left unpacked: quux, baz"};
+ check_errors(json_error_end_of_input_expected, possible_errors, 2, "<validation>",
+ 1, 10, 10);
+ }
+ json_decref(j);
+
+ j = json_pack("[i,{s:i,s:n},[i,i]]", 1, "foo", 2, "bar", 3, 4);
+ if (json_unpack_ex(j, NULL, JSON_STRICT | JSON_VALIDATE_ONLY, "[i{sisn}[ii]]", "foo",
+ "bar"))
+ fail("json_unpack complex value with strict validation failed");
+ json_decref(j);
+
+ /* ! and * must be last */
+ j = json_pack("[ii]", 1, 2);
+ if (!json_unpack_ex(j, &error, 0, "[i!i]", &i1, &i2))
+ fail("json_unpack failed to catch ! in the middle of an array");
+ check_error(json_error_invalid_format, "Expected ']' after '!', got 'i'", "<format>",
+ 1, 4, 4);
+
+ if (!json_unpack_ex(j, &error, 0, "[i*i]", &i1, &i2))
+ fail("json_unpack failed to catch * in the middle of an array");
+ check_error(json_error_invalid_format, "Expected ']' after '*', got 'i'", "<format>",
+ 1, 4, 4);
+ json_decref(j);
+
+ j = json_pack("{sssi}", "foo", "bar", "baz", 42);
+ if (!json_unpack_ex(j, &error, 0, "{ss!si}", "foo", &s, "baz", &i1))
+ fail("json_unpack failed to catch ! in the middle of an object");
+ check_error(json_error_invalid_format, "Expected '}' after '!', got 's'", "<format>",
+ 1, 5, 5);
+
+ if (!json_unpack_ex(j, &error, 0, "{ss*si}", "foo", &s, "baz", &i1))
+ fail("json_unpack failed to catch ! in the middle of an object");
+ check_error(json_error_invalid_format, "Expected '}' after '*', got 's'", "<format>",
+ 1, 5, 5);
+ json_decref(j);
+
+ /* Error in nested object */
+ j = json_pack("{s{snsn}}", "foo", "bar", "baz");
+ if (!json_unpack_ex(j, &error, 0, "{s{sn!}}", "foo", "bar"))
+ fail("json_unpack nested object with strict validation failed");
+ check_error(json_error_end_of_input_expected, "1 object item(s) left unpacked: baz",
+ "<validation>", 1, 7, 7);
+ json_decref(j);
+
+ /* Error in nested array */
+ j = json_pack("[[ii]]", 1, 2);
+ if (!json_unpack_ex(j, &error, 0, "[[i!]]", &i1))
+ fail("json_unpack nested array with strict validation failed");
+ check_error(json_error_end_of_input_expected, "1 array item(s) left unpacked",
+ "<validation>", 1, 5, 5);
+ json_decref(j);
+
+ /* Optional values */
+ j = json_object();
+ i1 = 0;
+ if (json_unpack(j, "{s?i}", "foo", &i1))
+ fail("json_unpack failed for optional key");
+ if (i1 != 0)
+ fail("json_unpack unpacked an optional key");
+ json_decref(j);
+
+ i1 = 0;
+ j = json_pack("{si}", "foo", 42);
+ if (json_unpack(j, "{s?i}", "foo", &i1))
+ fail("json_unpack failed for an optional value");
+ if (i1 != 42)
+ fail("json_unpack failed to unpack an optional value");
+ json_decref(j);
+
+ j = json_object();
+ i1 = i2 = i3 = 0;
+ if (json_unpack(j, "{s?[ii]s?{s{si}}}", "foo", &i1, &i2, "bar", "baz", "quux", &i3))
+ fail("json_unpack failed for complex optional values");
+ if (i1 != 0 || i2 != 0 || i3 != 0)
+ fail("json_unpack unexpectedly unpacked something");
+ json_decref(j);
+
+ j = json_pack("{s{si}}", "foo", "bar", 42);
+ if (json_unpack(j, "{s?{s?i}}", "foo", "bar", &i1))
+ fail("json_unpack failed for complex optional values");
+ if (i1 != 42)
+ fail("json_unpack failed to unpack");
+ json_decref(j);
+
+ /* Combine ? and ! */
+ j = json_pack("{si}", "foo", 42);
+ i1 = i2 = 0;
+ if (json_unpack(j, "{sis?i!}", "foo", &i1, "bar", &i2))
+ fail("json_unpack failed for optional values with strict mode");
+ if (i1 != 42)
+ fail("json_unpack failed to unpack");
+ if (i2 != 0)
+ fail("json_unpack failed to unpack");
+ json_decref(j);
+
+ /* But don't compensate a missing key with an optional one. */
+ j = json_pack("{sisi}", "foo", 42, "baz", 43);
+ i1 = i2 = i3 = 0;
+ if (!json_unpack_ex(j, &error, 0, "{sis?i!}", "foo", &i1, "bar", &i2))
+ fail("json_unpack failed for optional values with strict mode and "
+ "compensation");
+ check_error(json_error_end_of_input_expected, "1 object item(s) left unpacked: baz",
+ "<validation>", 1, 8, 8);
+ json_decref(j);
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_version.c b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_version.c
new file mode 100644
index 000000000..05e0e9614
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/test_version.c
@@ -0,0 +1,61 @@
+/*
+ * Copyright (c) 2019 Sean Bright <sean.bright@gmail.com>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#include "util.h"
+#include <jansson.h>
+#include <string.h>
+
+static void test_version_str(void) {
+ if (strcmp(jansson_version_str(), JANSSON_VERSION)) {
+ fail("jansson_version_str returned invalid version string");
+ }
+}
+
+static void test_version_cmp() {
+ if (jansson_version_cmp(JANSSON_MAJOR_VERSION, JANSSON_MINOR_VERSION,
+ JANSSON_MICRO_VERSION)) {
+ fail("jansson_version_cmp equality check failed");
+ }
+
+ if (jansson_version_cmp(JANSSON_MAJOR_VERSION - 1, 0, 0) <= 0) {
+ fail("jansson_version_cmp less than check failed");
+ }
+
+ if (JANSSON_MINOR_VERSION) {
+ if (jansson_version_cmp(JANSSON_MAJOR_VERSION, JANSSON_MINOR_VERSION - 1,
+ JANSSON_MICRO_VERSION) <= 0) {
+ fail("jansson_version_cmp less than check failed");
+ }
+ }
+
+ if (JANSSON_MICRO_VERSION) {
+ if (jansson_version_cmp(JANSSON_MAJOR_VERSION, JANSSON_MINOR_VERSION,
+ JANSSON_MICRO_VERSION - 1) <= 0) {
+ fail("jansson_version_cmp less than check failed");
+ }
+ }
+
+ if (jansson_version_cmp(JANSSON_MAJOR_VERSION + 1, JANSSON_MINOR_VERSION,
+ JANSSON_MICRO_VERSION) >= 0) {
+ fail("jansson_version_cmp greater than check failed");
+ }
+
+ if (jansson_version_cmp(JANSSON_MAJOR_VERSION, JANSSON_MINOR_VERSION + 1,
+ JANSSON_MICRO_VERSION) >= 0) {
+ fail("jansson_version_cmp greater than check failed");
+ }
+
+ if (jansson_version_cmp(JANSSON_MAJOR_VERSION, JANSSON_MINOR_VERSION,
+ JANSSON_MICRO_VERSION + 1) >= 0) {
+ fail("jansson_version_cmp greater than check failed");
+ }
+}
+
+static void run_tests() {
+ test_version_str();
+ test_version_cmp();
+}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/api/util.h b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/util.h
new file mode 100644
index 000000000..d964c4930
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/api/util.h
@@ -0,0 +1,93 @@
+/*
+ * Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+ *
+ * Jansson is free software; you can redistribute it and/or modify
+ * it under the terms of the MIT license. See LICENSE for details.
+ */
+
+#ifndef UTIL_H
+#define UTIL_H
+
+#ifdef HAVE_CONFIG_H
+#include <jansson_private_config.h>
+#endif
+
+#include <stdio.h>
+#include <stdlib.h>
+#if HAVE_LOCALE_H
+#include <locale.h>
+#endif
+
+#include <jansson.h>
+
+#define failhdr fprintf(stderr, "%s:%d: ", __FILE__, __LINE__)
+
+#define fail(msg) \
+ do { \
+ failhdr; \
+ fprintf(stderr, "%s\n", msg); \
+ exit(1); \
+ } while (0)
+
+/* Assumes json_error_t error */
+#define check_errors(code_, texts_, num_, source_, line_, column_, position_) \
+ do { \
+ int i_, found_ = 0; \
+ if (json_error_code(&error) != code_) { \
+ failhdr; \
+ fprintf(stderr, "code: %d != %d\n", json_error_code(&error), code_); \
+ exit(1); \
+ } \
+ for (i_ = 0; i_ < num_; i_++) { \
+ if (strcmp(error.text, texts_[i_]) == 0) { \
+ found_ = 1; \
+ break; \
+ } \
+ } \
+ if (!found_) { \
+ failhdr; \
+ if (num_ == 1) { \
+ fprintf(stderr, "text: \"%s\" != \"%s\"\n", error.text, texts_[0]); \
+ } else { \
+ fprintf(stderr, "text: \"%s\" does not match\n", error.text); \
+ } \
+ exit(1); \
+ } \
+ if (strcmp(error.source, source_) != 0) { \
+ failhdr; \
+ \
+ fprintf(stderr, "source: \"%s\" != \"%s\"\n", error.source, source_); \
+ exit(1); \
+ } \
+ if (error.line != line_) { \
+ failhdr; \
+ fprintf(stderr, "line: %d != %d\n", error.line, line_); \
+ exit(1); \
+ } \
+ if (error.column != column_) { \
+ failhdr; \
+ fprintf(stderr, "column: %d != %d\n", error.column, column_); \
+ exit(1); \
+ } \
+ if (error.position != position_) { \
+ failhdr; \
+ fprintf(stderr, "position: %d != %d\n", error.position, position_); \
+ exit(1); \
+ } \
+ } while (0)
+
+/* Assumes json_error_t error */
+#define check_error(code_, text_, source_, line_, column_, position_) \
+ check_errors(code_, &text_, 1, source_, line_, column_, position_)
+
+static void run_tests();
+
+int main() {
+#ifdef HAVE_SETLOCALE
+ setlocale(LC_ALL, "");
+#endif
+ run_tests();
+ return 0;
+}
+
+#endif
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/array/input
new file mode 100644
index 000000000..44e2ace7e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/array/input
@@ -0,0 +1 @@
+[1, 2]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/array/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/array/output
new file mode 100644
index 000000000..fd8ef0957
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/array/output
@@ -0,0 +1 @@
+[1, 2] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/env
new file mode 100644
index 000000000..4474aaf14
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/env
@@ -0,0 +1,2 @@
+JSON_COMPACT=1
+export JSON_COMPACT
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/input
new file mode 100644
index 000000000..44e2ace7e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/input
@@ -0,0 +1 @@
+[1, 2]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/output
new file mode 100644
index 000000000..3169929f6
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-array/output
@@ -0,0 +1 @@
+[1,2] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/env
new file mode 100644
index 000000000..93cb33dda
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/env
@@ -0,0 +1,3 @@
+JSON_COMPACT=1
+HASHSEED=1
+export JSON_COMPACT HASHSEED
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/input
new file mode 100644
index 000000000..062e54fb4
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/input
@@ -0,0 +1 @@
+{"a": 1, "b": 2}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/output
new file mode 100644
index 000000000..73a5d70e3
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/compact-object/output
@@ -0,0 +1 @@
+{"a":1,"b":2} \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/env
new file mode 100644
index 000000000..1b7b3e3f9
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/env
@@ -0,0 +1,2 @@
+JSON_ENSURE_ASCII=1
+export JSON_ENSURE_ASCII
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/input
new file mode 100644
index 000000000..69469cef5
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/input
@@ -0,0 +1,8 @@
+[
+ "foo",
+ "å ä ö",
+ "foo åä",
+ "åä foo",
+ "å foo ä",
+ "clef g: 𝄞"
+]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/output
new file mode 100644
index 000000000..94fa79d2d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/ensure-ascii/output
@@ -0,0 +1 @@
+["foo", "\u00E5 \u00E4 \u00F6", "foo \u00E5\u00E4", "\u00E5\u00E4 foo", "\u00E5 foo \u00E4", "clef g: \uD834\uDD1E"] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/env
new file mode 100644
index 000000000..d220f837c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/env
@@ -0,0 +1,2 @@
+JSON_INDENT=4
+export JSON_INDENT
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/input
new file mode 100644
index 000000000..44e2ace7e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/input
@@ -0,0 +1 @@
+[1, 2]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/output
new file mode 100644
index 000000000..c57d705ba
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-array/output
@@ -0,0 +1,4 @@
+[
+ 1,
+ 2
+] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/env
new file mode 100644
index 000000000..78fbfcc2e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/env
@@ -0,0 +1,3 @@
+JSON_INDENT=4
+JSON_COMPACT=1
+export JSON_INDENT JSON_COMPACT
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/input
new file mode 100644
index 000000000..44e2ace7e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/input
@@ -0,0 +1 @@
+[1, 2]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/output
new file mode 100644
index 000000000..c57d705ba
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-array/output
@@ -0,0 +1,4 @@
+[
+ 1,
+ 2
+] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/env
new file mode 100644
index 000000000..c73acc179
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/env
@@ -0,0 +1,4 @@
+JSON_INDENT=4
+JSON_COMPACT=1
+HASHSEED=1
+export JSON_INDENT JSON_COMPACT HASHSEED
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/input
new file mode 100644
index 000000000..062e54fb4
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/input
@@ -0,0 +1 @@
+{"a": 1, "b": 2}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/output
new file mode 100644
index 000000000..9cc42948d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-compact-object/output
@@ -0,0 +1,4 @@
+{
+ "a":1,
+ "b":2
+} \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/env
new file mode 100644
index 000000000..961558ca2
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/env
@@ -0,0 +1,3 @@
+JSON_INDENT=4
+HASHSEED=1
+export JSON_INDENT HASHSEED
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/input
new file mode 100644
index 000000000..062e54fb4
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/input
@@ -0,0 +1 @@
+{"a": 1, "b": 2}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/output
new file mode 100644
index 000000000..0fbddba44
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/indent-object/output
@@ -0,0 +1,4 @@
+{
+ "a": 1,
+ "b": 2
+} \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/env
new file mode 100644
index 000000000..9120b0351
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/env
@@ -0,0 +1,2 @@
+HASHSEED=1
+export HASHSEED
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/input
new file mode 100644
index 000000000..062e54fb4
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/input
@@ -0,0 +1 @@
+{"a": 1, "b": 2}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/output
new file mode 100644
index 000000000..ecd219f72
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/object/output
@@ -0,0 +1 @@
+{"a": 1, "b": 2} \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/env
new file mode 100644
index 000000000..4d9d20659
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/env
@@ -0,0 +1,2 @@
+JSON_PRESERVE_ORDER=1
+export JSON_PRESERVE_ORDER
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/input
new file mode 100644
index 000000000..27bcf18a0
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/input
@@ -0,0 +1 @@
+{"foo": 1, "bar": 2, "asdf": 3, "deadbeef": 4, "badc0ffee": 5, "qwerty": 6}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/output
new file mode 100644
index 000000000..7a443f684
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/preserve-order/output
@@ -0,0 +1 @@
+{"foo": 1, "bar": 2, "asdf": 3, "deadbeef": 4, "badc0ffee": 5, "qwerty": 6} \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/env
new file mode 100644
index 000000000..9c52cbcd6
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/env
@@ -0,0 +1,2 @@
+JSON_REAL_PRECISION=4
+export JSON_REAL_PRECISION
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/input
new file mode 100644
index 000000000..e291165c1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/input
@@ -0,0 +1 @@
+[1.23456789, 1.0, 1.0000000000000002]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/output
new file mode 100644
index 000000000..f273c73e5
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/real-precision/output
@@ -0,0 +1 @@
+[1.235, 1.0, 1.0] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/run b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/run
new file mode 100755
index 000000000..5db7d5e5c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/run
@@ -0,0 +1,32 @@
+#!/bin/sh
+#
+# Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+is_test() {
+ test -d $test_path
+}
+
+run_test() {
+ (
+ if [ -f $test_path/env ]; then
+ . $test_path/env
+ fi
+ $json_process --env <$test_path/input >$test_log/stdout 2>$test_log/stderr
+ )
+ valgrind_check $test_log/stderr || return 1
+ cmp -s $test_path/output $test_log/stdout
+}
+
+show_error() {
+ valgrind_show_error && return
+
+ echo "EXPECTED OUTPUT:"
+ nl -bn $test_path/output
+ echo "ACTUAL OUTPUT:"
+ nl -bn $test_log/stdout
+}
+
+. $top_srcdir/test/scripts/run-tests.sh
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/env
new file mode 100644
index 000000000..3ef24cb7b
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/env
@@ -0,0 +1,2 @@
+JSON_SORT_KEYS=1
+export JSON_SORT_KEYS
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/input
new file mode 100644
index 000000000..66951d6b0
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/input
@@ -0,0 +1 @@
+{"foo": 1, "bar": 2, "baz": 3, "quux": 4}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/output
new file mode 100644
index 000000000..132d9df31
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/encoding-flags/sort-keys/output
@@ -0,0 +1 @@
+{"bar": 2, "baz": 3, "foo": 1, "quux": 4} \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/encoded-surrogate-half/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/encoded-surrogate-half/error
new file mode 100644
index 000000000..762d2c4b1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/encoded-surrogate-half/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xed near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/encoded-surrogate-half/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/encoded-surrogate-half/input
new file mode 100644
index 000000000..515dd933c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/encoded-surrogate-half/input
@@ -0,0 +1 @@
+[" <-- encoded surrogate half"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-after-backslash/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-after-backslash/error
new file mode 100644
index 000000000..b16dc171e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-after-backslash/error
@@ -0,0 +1,2 @@
+1 3 3
+unable to decode byte 0xe5 near '"\'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-after-backslash/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-after-backslash/input
new file mode 100644
index 000000000..57c8beef6
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-after-backslash/input
@@ -0,0 +1 @@
+["\"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-array/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-array/error
new file mode 100644
index 000000000..be15386df
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-array/error
@@ -0,0 +1,2 @@
+1 1 1
+unable to decode byte 0xe5
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-array/input
new file mode 100644
index 000000000..ebefcd6f8
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-array/input
@@ -0,0 +1 @@
+[]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/error
new file mode 100644
index 000000000..01b447639
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/error
@@ -0,0 +1,2 @@
+1 4 4
+unable to decode byte 0xe5 near '123'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/input
new file mode 100644
index 000000000..e512f9ae0
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-bigger-int/input
@@ -0,0 +1 @@
+[123]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-escape/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-escape/error
new file mode 100644
index 000000000..c13583dd8
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-escape/error
@@ -0,0 +1,2 @@
+1 4 4
+unable to decode byte 0xe5 near '"\u'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-escape/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-escape/input
new file mode 100644
index 000000000..2b271b82f
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-escape/input
@@ -0,0 +1 @@
+["\u"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-exponent/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-exponent/error
new file mode 100644
index 000000000..c7b20b7a2
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-exponent/error
@@ -0,0 +1,2 @@
+1 4 4
+unable to decode byte 0xe5 near '1e1'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-exponent/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-exponent/input
new file mode 100644
index 000000000..d8e83c595
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-exponent/input
@@ -0,0 +1 @@
+[1e1]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-identifier/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-identifier/error
new file mode 100644
index 000000000..33dfc2324
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-identifier/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xe5 near 'a'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-identifier/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-identifier/input
new file mode 100644
index 000000000..ef038514a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-identifier/input
@@ -0,0 +1 @@
+[a]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-int/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-int/error
new file mode 100644
index 000000000..8f08970c1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-int/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xe5 near '0'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-int/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-int/input
new file mode 100644
index 000000000..371226e4c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-int/input
@@ -0,0 +1 @@
+[0]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/error
new file mode 100644
index 000000000..b7660e327
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/error
@@ -0,0 +1,2 @@
+1 3 3
+unable to decode byte 0xe5 near '1e'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/input
new file mode 100644
index 000000000..17fc29c90
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-real-after-e/input
@@ -0,0 +1 @@
+[1e]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-string/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-string/error
new file mode 100644
index 000000000..0b7039a52
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-string/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xe5 near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-string/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-string/input
new file mode 100644
index 000000000..00b79c0af
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/invalid-utf-8-in-string/input
@@ -0,0 +1 @@
+[" <-- invalid UTF-8"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-invalid-utf-8/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-invalid-utf-8/error
new file mode 100644
index 000000000..8e9a51119
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-invalid-utf-8/error
@@ -0,0 +1,2 @@
+1 0 0
+unable to decode byte 0xe5
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-invalid-utf-8/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-invalid-utf-8/input
new file mode 100644
index 000000000..eb8079699
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-invalid-utf-8/input
@@ -0,0 +1 @@
+
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-utf-8-continuation-byte/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-utf-8-continuation-byte/error
new file mode 100644
index 000000000..86bbad3c8
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-utf-8-continuation-byte/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0x81 near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-utf-8-continuation-byte/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-utf-8-continuation-byte/input
new file mode 100644
index 000000000..62a26b6fb
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/lone-utf-8-continuation-byte/input
@@ -0,0 +1 @@
+[""]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/not-in-unicode-range/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/not-in-unicode-range/error
new file mode 100644
index 000000000..d07ccb3e5
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/not-in-unicode-range/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xf4 near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/not-in-unicode-range/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/not-in-unicode-range/input
new file mode 100644
index 000000000..1216186a7
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/not-in-unicode-range/input
@@ -0,0 +1 @@
+[""]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-3-byte-encoding/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-3-byte-encoding/error
new file mode 100644
index 000000000..8a05abaed
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-3-byte-encoding/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xe0 near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-3-byte-encoding/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-3-byte-encoding/input
new file mode 100644
index 000000000..0bf909f7b
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-3-byte-encoding/input
@@ -0,0 +1 @@
+[" <-- overlong encoding"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-4-byte-encoding/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-4-byte-encoding/error
new file mode 100644
index 000000000..7e19c5fe4
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-4-byte-encoding/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xf0 near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-4-byte-encoding/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-4-byte-encoding/input
new file mode 100644
index 000000000..c6b631350
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-4-byte-encoding/input
@@ -0,0 +1 @@
+[" <-- overlong encoding"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-ascii-encoding/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-ascii-encoding/error
new file mode 100644
index 000000000..1d382edd7
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-ascii-encoding/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xc1 near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-ascii-encoding/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-ascii-encoding/input
new file mode 100644
index 000000000..ef6e10a34
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/overlong-ascii-encoding/input
@@ -0,0 +1 @@
+[""]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/restricted-utf-8/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/restricted-utf-8/error
new file mode 100644
index 000000000..d018f5ff3
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/restricted-utf-8/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xfd near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/restricted-utf-8/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/restricted-utf-8/input
new file mode 100644
index 000000000..ba6017002
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/restricted-utf-8/input
@@ -0,0 +1 @@
+[""]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/run b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/run
new file mode 100755
index 000000000..369c43da5
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/run
@@ -0,0 +1,27 @@
+#!/bin/sh
+#
+# Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+is_test() {
+ test -d $test_path
+}
+
+run_test() {
+ $json_process --env <$test_path/input >$test_log/stdout 2>$test_log/stderr
+ valgrind_check $test_log/stderr || return 1
+ cmp -s $test_path/error $test_log/stderr
+}
+
+show_error() {
+ valgrind_show_error && return
+
+ echo "EXPECTED ERROR:"
+ nl -bn $test_path/error
+ echo "ACTUAL ERROR:"
+ nl -bn $test_log/stderr
+}
+
+. $top_srcdir/test/scripts/run-tests.sh
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/truncated-utf-8/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/truncated-utf-8/error
new file mode 100644
index 000000000..8a05abaed
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/truncated-utf-8/error
@@ -0,0 +1,2 @@
+1 2 2
+unable to decode byte 0xe0 near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/truncated-utf-8/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/truncated-utf-8/input
new file mode 100644
index 000000000..bce9e18bf
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid-unicode/truncated-utf-8/input
@@ -0,0 +1 @@
+[" <-- truncated UTF-8"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/apostrophe/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/apostrophe/error
new file mode 100644
index 000000000..79bb2a0eb
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/apostrophe/error
@@ -0,0 +1,2 @@
+1 2 2
+invalid token near '''
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/apostrophe/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/apostrophe/input
new file mode 100644
index 000000000..f2dd4d224
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/apostrophe/input
@@ -0,0 +1 @@
+['
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/ascii-unicode-identifier/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/ascii-unicode-identifier/error
new file mode 100644
index 000000000..a4d814280
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/ascii-unicode-identifier/error
@@ -0,0 +1,2 @@
+1 1 1
+'[' or '{' expected near 'a'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/ascii-unicode-identifier/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/ascii-unicode-identifier/input
new file mode 100644
index 000000000..c2c0208ed
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/ascii-unicode-identifier/input
@@ -0,0 +1 @@
+aå
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/brace-comma/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/brace-comma/error
new file mode 100644
index 000000000..ce046213c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/brace-comma/error
@@ -0,0 +1,2 @@
+1 2 2
+string or '}' expected near ','
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/brace-comma/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/brace-comma/input
new file mode 100644
index 000000000..74a6628d4
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/brace-comma/input
@@ -0,0 +1 @@
+{,
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-comma/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-comma/error
new file mode 100644
index 000000000..ce0a912bf
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-comma/error
@@ -0,0 +1,2 @@
+1 2 2
+unexpected token near ','
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-comma/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-comma/input
new file mode 100644
index 000000000..5b911f11d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-comma/input
@@ -0,0 +1 @@
+[,
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/error.normal
new file mode 100644
index 000000000..0248b114a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/error.normal
@@ -0,0 +1,2 @@
+2 0 4
+']' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/error.strip
new file mode 100644
index 000000000..f89b38fcb
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/error.strip
@@ -0,0 +1,2 @@
+1 3 3
+']' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/input
new file mode 100644
index 000000000..874691b1d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/bracket-one-comma/input
@@ -0,0 +1 @@
+[1,
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/empty/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/empty/error
new file mode 100644
index 000000000..f45da6f82
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/empty/error
@@ -0,0 +1,2 @@
+1 0 0
+'[' or '{' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/empty/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/empty/input
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/empty/input
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-array/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-array/error
new file mode 100644
index 000000000..cae86c246
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-array/error
@@ -0,0 +1,2 @@
+1 4 4
+unexpected token near ']'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-array/input
new file mode 100644
index 000000000..e8b1a170f
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-array/input
@@ -0,0 +1 @@
+[1,]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-multiline-array/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-multiline-array/error
new file mode 100644
index 000000000..5baeea447
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-multiline-array/error
@@ -0,0 +1,2 @@
+6 1 17
+unexpected token near ']'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-multiline-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-multiline-array/input
new file mode 100644
index 000000000..bcb2a7526
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/extra-comma-in-multiline-array/input
@@ -0,0 +1,6 @@
+[1,
+2,
+3,
+4,
+5,
+]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-after-newline/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-after-newline/error
new file mode 100644
index 000000000..5d2dec374
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-after-newline/error
@@ -0,0 +1,2 @@
+2 3 11
+end of file expected near 'foo'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-after-newline/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-after-newline/input
new file mode 100644
index 000000000..3614ac78f
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-after-newline/input
@@ -0,0 +1,2 @@
+[1,2,3]
+foo
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-at-the-end/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-at-the-end/error
new file mode 100644
index 000000000..cdd817572
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-at-the-end/error
@@ -0,0 +1,2 @@
+1 10 10
+end of file expected near 'foo'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-at-the-end/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-at-the-end/input
new file mode 100644
index 000000000..55aee53d2
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/garbage-at-the-end/input
@@ -0,0 +1 @@
+[1,2,3]foo
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/integer-starting-with-zero/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/integer-starting-with-zero/error
new file mode 100644
index 000000000..64e0536aa
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/integer-starting-with-zero/error
@@ -0,0 +1,2 @@
+1 2 2
+invalid token near '0'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/integer-starting-with-zero/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/integer-starting-with-zero/input
new file mode 100644
index 000000000..12f67e2c2
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/integer-starting-with-zero/input
@@ -0,0 +1 @@
+[012]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-escape/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-escape/error
new file mode 100644
index 000000000..d9863f73b
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-escape/error
@@ -0,0 +1,2 @@
+1 4 4
+invalid escape near '"\a'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-escape/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-escape/input
new file mode 100644
index 000000000..64c7b70d9
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-escape/input
@@ -0,0 +1 @@
+["\a <-- invalid escape"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-identifier/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-identifier/error
new file mode 100644
index 000000000..496c6aba2
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-identifier/error
@@ -0,0 +1,2 @@
+1 5 5
+invalid token near 'troo'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-identifier/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-identifier/input
new file mode 100644
index 000000000..3d2860da1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-identifier/input
@@ -0,0 +1 @@
+[troo
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-integer/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-integer/error
new file mode 100644
index 000000000..f2526c51e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-integer/error
@@ -0,0 +1,2 @@
+1 8 8
+']' expected near 'foo'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-integer/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-integer/input
new file mode 100644
index 000000000..6196980ec
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-integer/input
@@ -0,0 +1 @@
+[-123foo]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-real/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-real/error
new file mode 100644
index 000000000..933158ae5
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-real/error
@@ -0,0 +1,2 @@
+1 12 12
+']' expected near 'foo'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-real/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-real/input
new file mode 100644
index 000000000..3c763d334
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-negative-real/input
@@ -0,0 +1 @@
+[-123.123foo]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-second-surrogate/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-second-surrogate/error
new file mode 100644
index 000000000..e5a2359e6
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-second-surrogate/error
@@ -0,0 +1,2 @@
+1 62 62
+invalid Unicode '\uD888\u3210'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-second-surrogate/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-second-surrogate/input
new file mode 100644
index 000000000..b21453f6f
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-second-surrogate/input
@@ -0,0 +1 @@
+["\uD888\u3210 (first surrogate and invalid second surrogate)"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-unicode-escape/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-unicode-escape/error
new file mode 100644
index 000000000..221c762eb
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-unicode-escape/error
@@ -0,0 +1,2 @@
+1 5 5
+invalid escape near '"\uq'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-unicode-escape/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-unicode-escape/input
new file mode 100644
index 000000000..f381e85b8
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/invalid-unicode-escape/input
@@ -0,0 +1 @@
+["\uqqqq <-- invalid unicode escape"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/error.normal
new file mode 100644
index 000000000..00dc765b9
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/error.normal
@@ -0,0 +1,2 @@
+2 0 2
+string or '}' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/error.strip
new file mode 100644
index 000000000..bb1c04745
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/error.strip
@@ -0,0 +1,2 @@
+1 1 1
+string or '}' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/input
new file mode 100644
index 000000000..98232c64f
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-brace/input
@@ -0,0 +1 @@
+{
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/error.normal
new file mode 100644
index 000000000..f463928f8
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/error.normal
@@ -0,0 +1,2 @@
+2 0 2
+']' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/error.strip
new file mode 100644
index 000000000..2bc07ea0c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/error.strip
@@ -0,0 +1,2 @@
+1 1 1
+']' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/input
new file mode 100644
index 000000000..558ed37d9
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-open-bracket/input
@@ -0,0 +1 @@
+[
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-second-surrogate/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-second-surrogate/error
new file mode 100644
index 000000000..bc5f34e11
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-second-surrogate/error
@@ -0,0 +1,2 @@
+1 40 40
+invalid Unicode '\uDFAA'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-second-surrogate/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-second-surrogate/input
new file mode 100644
index 000000000..328e35c82
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/lone-second-surrogate/input
@@ -0,0 +1 @@
+["\uDFAA (second surrogate on it's own)"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/minus-sign-without-number/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/minus-sign-without-number/error
new file mode 100644
index 000000000..b3a78b978
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/minus-sign-without-number/error
@@ -0,0 +1,2 @@
+1 2 2
+invalid token near '-'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/minus-sign-without-number/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/minus-sign-without-number/input
new file mode 100644
index 000000000..033788355
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/minus-sign-without-number/input
@@ -0,0 +1 @@
+[-foo]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/negative-integer-starting-with-zero/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/negative-integer-starting-with-zero/error
new file mode 100644
index 000000000..36adc34b4
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/negative-integer-starting-with-zero/error
@@ -0,0 +1,2 @@
+1 3 3
+invalid token near '-0'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/negative-integer-starting-with-zero/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/negative-integer-starting-with-zero/input
new file mode 100644
index 000000000..6fbb7a2f8
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/negative-integer-starting-with-zero/input
@@ -0,0 +1 @@
+[-012]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-object-key/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-object-key/error
new file mode 100644
index 000000000..3ec685b5d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-object-key/error
@@ -0,0 +1,2 @@
+1 15 15
+NUL byte in object key not supported near '"foo\u0000bar"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-object-key/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-object-key/input
new file mode 100644
index 000000000..593f0f67f
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-object-key/input
@@ -0,0 +1 @@
+{"foo\u0000bar": 42} \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/error
new file mode 100644
index 000000000..45f9bd817
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/error
@@ -0,0 +1,2 @@
+1 12 12
+control character 0x0 near '"null byte '
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/input
new file mode 100644
index 000000000..268d1f194
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/input
Binary files differ
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/nostrip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/nostrip
new file mode 100644
index 000000000..80f4bf761
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-in-string/nostrip
@@ -0,0 +1,2 @@
+The embedded NULL byte breaks json_loads(), which is used instead of
+json_loadf() in the stripped tests.
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/error
new file mode 100644
index 000000000..44d4def92
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/error
@@ -0,0 +1,2 @@
+1 2 2
+invalid token near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/input
new file mode 100644
index 000000000..aa550eb0c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/input
Binary files differ
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/nostrip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/nostrip
new file mode 100644
index 000000000..80f4bf761
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-byte-outside-string/nostrip
@@ -0,0 +1,2 @@
+The embedded NULL byte breaks json_loads(), which is used instead of
+json_loadf() in the stripped tests.
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-escape-in-string/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-escape-in-string/error
new file mode 100644
index 000000000..3f5c8c6ca
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-escape-in-string/error
@@ -0,0 +1,2 @@
+1 33 33
+\u0000 is not allowed without JSON_ALLOW_NUL
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-escape-in-string/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-escape-in-string/input
new file mode 100644
index 000000000..dbc9c9a99
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null-escape-in-string/input
@@ -0,0 +1 @@
+["null escape \u0000 not allowed"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null/error
new file mode 100644
index 000000000..1f5d46490
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null/error
@@ -0,0 +1,2 @@
+1 4 4
+'[' or '{' expected near 'null'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null/input
new file mode 100644
index 000000000..19765bd50
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/null/input
@@ -0,0 +1 @@
+null
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-apostrophes/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-apostrophes/error
new file mode 100644
index 000000000..23fab01f6
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-apostrophes/error
@@ -0,0 +1,2 @@
+1 2 2
+string or '}' expected near '''
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-apostrophes/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-apostrophes/input
new file mode 100644
index 000000000..52b290574
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-apostrophes/input
@@ -0,0 +1 @@
+{'a'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-garbage-at-end/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-garbage-at-end/error
new file mode 100644
index 000000000..06c4ec1c2
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-garbage-at-end/error
@@ -0,0 +1,2 @@
+1 12 12
+'}' expected near '123'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-garbage-at-end/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-garbage-at-end/input
new file mode 100644
index 000000000..62c19d742
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-garbage-at-end/input
@@ -0,0 +1 @@
+{"a":"a" 123}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/error.normal
new file mode 100644
index 000000000..0248b114a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/error.normal
@@ -0,0 +1,2 @@
+2 0 4
+']' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/error.strip
new file mode 100644
index 000000000..f89b38fcb
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/error.strip
@@ -0,0 +1,2 @@
+1 3 3
+']' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/input
new file mode 100644
index 000000000..ca9ec378e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-in-unterminated-array/input
@@ -0,0 +1 @@
+[{}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/error.normal
new file mode 100644
index 000000000..78d84f7b7
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/error.normal
@@ -0,0 +1,2 @@
+2 0 5
+':' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/error.strip
new file mode 100644
index 000000000..528e266d2
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/error.strip
@@ -0,0 +1,2 @@
+1 4 4
+':' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/input
new file mode 100644
index 000000000..107e6265c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-colon/input
@@ -0,0 +1 @@
+{"a"
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/error.normal
new file mode 100644
index 000000000..47ad902dd
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/error.normal
@@ -0,0 +1,2 @@
+2 0 6
+unexpected token near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/error.strip
new file mode 100644
index 000000000..b36c5e2bc
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/error.strip
@@ -0,0 +1,2 @@
+1 5 5
+unexpected token near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/input
new file mode 100644
index 000000000..f68f26269
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-no-value/input
@@ -0,0 +1 @@
+{"a":
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/error.normal
new file mode 100644
index 000000000..2ad76d473
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/error.normal
@@ -0,0 +1,2 @@
+1 7 7
+unexpected newline near '"a'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/error.strip
new file mode 100644
index 000000000..385afb534
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/error.strip
@@ -0,0 +1,2 @@
+1 7 7
+premature end of input near '"a'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/input
new file mode 100644
index 000000000..b854d7e18
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/object-unterminated-value/input
@@ -0,0 +1 @@
+{"a":"a
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-garbage-after-e/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-garbage-after-e/error
new file mode 100644
index 000000000..b40ffa9b5
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-garbage-after-e/error
@@ -0,0 +1,2 @@
+1 3 3
+invalid token near '1e'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-garbage-after-e/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-garbage-after-e/input
new file mode 100644
index 000000000..6a945ac0f
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-garbage-after-e/input
@@ -0,0 +1 @@
+[1ea]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-negative-overflow/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-negative-overflow/error
new file mode 100644
index 000000000..d7f8e412d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-negative-overflow/error
@@ -0,0 +1,2 @@
+1 15 15
+real number overflow near '-123123e100000'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-negative-overflow/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-negative-overflow/input
new file mode 100644
index 000000000..b5bd21c46
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-negative-overflow/input
@@ -0,0 +1 @@
+[-123123e100000]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-positive-overflow/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-positive-overflow/error
new file mode 100644
index 000000000..55883c981
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-positive-overflow/error
@@ -0,0 +1,2 @@
+1 14 14
+real number overflow near '123123e100000'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-positive-overflow/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-positive-overflow/input
new file mode 100644
index 000000000..524e53b31
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-positive-overflow/input
@@ -0,0 +1 @@
+[123123e100000]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-e/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-e/error
new file mode 100644
index 000000000..b40ffa9b5
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-e/error
@@ -0,0 +1,2 @@
+1 3 3
+invalid token near '1e'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-e/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-e/input
new file mode 100644
index 000000000..1d67b7b82
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-e/input
@@ -0,0 +1 @@
+[1e]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-point/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-point/error
new file mode 100644
index 000000000..db972e8e1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-point/error
@@ -0,0 +1,2 @@
+1 3 3
+invalid token near '1.'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-point/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-point/input
new file mode 100644
index 000000000..b652b3fe0
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/real-truncated-at-point/input
@@ -0,0 +1 @@
+[1.]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/recursion-depth/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/recursion-depth/error
new file mode 100644
index 000000000..11e0537ff
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/recursion-depth/error
@@ -0,0 +1,2 @@
+1 2049 2049
+maximum parsing depth reached near '['
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/recursion-depth/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/recursion-depth/input
new file mode 100644
index 000000000..bfa47d9d1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/recursion-depth/input
@@ -0,0 +1 @@
+[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/run b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/run
new file mode 100755
index 000000000..d1d490c63
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/run
@@ -0,0 +1,57 @@
+#!/bin/sh
+#
+# Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+is_test() {
+ test -d $test_path
+}
+
+do_run() {
+ variant=$1
+ s=".$1"
+
+ strip=0
+ if [ "$variant" = "strip" ]; then
+ # This test should not be stripped
+ [ -f $test_path/nostrip ] && return
+ strip=1
+ fi
+
+ STRIP=$strip $json_process --env \
+ <$test_path/input >$test_log/stdout$s 2>$test_log/stderr$s
+ valgrind_check $test_log/stderr$s || return 1
+
+ ref=error
+ [ -f $test_path/error$s ] && ref=error$s
+
+ if ! cmp -s $test_path/$ref $test_log/stderr$s; then
+ echo $variant > $test_log/variant
+ return 1
+ fi
+}
+
+run_test() {
+ do_run normal && do_run strip
+}
+
+show_error() {
+ valgrind_show_error && return
+
+ read variant < $test_log/variant
+ s=".$variant"
+
+ echo "VARIANT: $variant"
+
+ echo "EXPECTED ERROR:"
+ ref=error
+ [ -f $test_path/error$s ] && ref=error$s
+ nl -bn $test_path/$ref
+
+ echo "ACTUAL ERROR:"
+ nl -bn $test_log/stderr$s
+}
+
+. $top_srcdir/test/scripts/run-tests.sh
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/tab-character-in-string/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/tab-character-in-string/error
new file mode 100644
index 000000000..9e2f76ed2
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/tab-character-in-string/error
@@ -0,0 +1,2 @@
+1 2 2
+control character 0x9 near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/tab-character-in-string/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/tab-character-in-string/input
new file mode 100644
index 000000000..3ebae0953
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/tab-character-in-string/input
@@ -0,0 +1 @@
+[" <-- tab character"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-negative-integer/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-negative-integer/error
new file mode 100644
index 000000000..a0640b9a9
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-negative-integer/error
@@ -0,0 +1,2 @@
+1 32 32
+too big negative integer
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-negative-integer/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-negative-integer/input
new file mode 100644
index 000000000..d6c26f1cf
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-negative-integer/input
@@ -0,0 +1 @@
+[-123123123123123123123123123123]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-positive-integer/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-positive-integer/error
new file mode 100644
index 000000000..3bdbefd53
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-positive-integer/error
@@ -0,0 +1,2 @@
+1 31 31
+too big integer
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-positive-integer/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-positive-integer/input
new file mode 100644
index 000000000..27c855399
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/too-big-positive-integer/input
@@ -0,0 +1 @@
+[123123123123123123123123123123]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/truncated-unicode-surrogate/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/truncated-unicode-surrogate/error
new file mode 100644
index 000000000..1b99f061a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/truncated-unicode-surrogate/error
@@ -0,0 +1,2 @@
+1 46 46
+invalid Unicode '\uDADA'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/truncated-unicode-surrogate/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/truncated-unicode-surrogate/input
new file mode 100644
index 000000000..2b340f4ad
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/truncated-unicode-surrogate/input
@@ -0,0 +1 @@
+["\uDADA (first surrogate without the second)"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unicode-identifier/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unicode-identifier/error
new file mode 100644
index 000000000..178b0dd4d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unicode-identifier/error
@@ -0,0 +1,2 @@
+1 1 2
+'[' or '{' expected near 'å'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unicode-identifier/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unicode-identifier/input
new file mode 100644
index 000000000..aad321caf
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unicode-identifier/input
@@ -0,0 +1 @@
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/error.normal
new file mode 100644
index 000000000..5b19804bc
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/error.normal
@@ -0,0 +1,2 @@
+2 0 3
+string or '}' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/error.strip
new file mode 100644
index 000000000..da2bb22f1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/error.strip
@@ -0,0 +1,2 @@
+1 2 2
+string or '}' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/input
new file mode 100644
index 000000000..cd9dc6482
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array-and-object/input
@@ -0,0 +1 @@
+[{
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/error.normal
new file mode 100644
index 000000000..8025ed1b0
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/error.normal
@@ -0,0 +1,2 @@
+2 0 5
+']' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/error.strip
new file mode 100644
index 000000000..495d0f7c4
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/error.strip
@@ -0,0 +1,2 @@
+1 4 4
+']' expected near end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/input
new file mode 100644
index 000000000..727ee8106
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-array/input
@@ -0,0 +1 @@
+["a"
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/error.normal
new file mode 100644
index 000000000..3d646abda
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/error.normal
@@ -0,0 +1,2 @@
+1 2 2
+unexpected newline near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/error.strip
new file mode 100644
index 000000000..94f194715
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/error.strip
@@ -0,0 +1,2 @@
+1 2 2
+premature end of input near '"'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/input
new file mode 100644
index 000000000..4117452de
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-empty-key/input
@@ -0,0 +1 @@
+{"
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/error.normal
new file mode 100644
index 000000000..5f09b77da
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/error.normal
@@ -0,0 +1,2 @@
+1 3 3
+unexpected newline near '"a'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/error.strip
new file mode 100644
index 000000000..8b6bec430
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/error.strip
@@ -0,0 +1,2 @@
+1 3 3
+premature end of input near '"a'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/input
new file mode 100644
index 000000000..705948c64
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-key/input
@@ -0,0 +1 @@
+{"a
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-object-and-array/error b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-object-and-array/error
new file mode 100644
index 000000000..ed97be73e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-object-and-array/error
@@ -0,0 +1,2 @@
+1 2 2
+string or '}' expected near '['
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-object-and-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-object-and-array/input
new file mode 100644
index 000000000..da35a8620
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-object-and-array/input
@@ -0,0 +1 @@
+{[
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/error.normal b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/error.normal
new file mode 100644
index 000000000..5f09b77da
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/error.normal
@@ -0,0 +1,2 @@
+1 3 3
+unexpected newline near '"a'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/error.strip b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/error.strip
new file mode 100644
index 000000000..8b6bec430
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/error.strip
@@ -0,0 +1,2 @@
+1 3 3
+premature end of input near '"a'
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/input
new file mode 100644
index 000000000..38ab6b04c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/invalid/unterminated-string/input
@@ -0,0 +1 @@
+["a
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/env b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/env
new file mode 100644
index 000000000..bd89eff9d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/env
@@ -0,0 +1 @@
+JSON_SORT_KEYS=1 \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/input
new file mode 100644
index 000000000..1b9bbb949
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/input
@@ -0,0 +1,5 @@
+[1,2,3,4,
+"a", "b", "c",
+{"foo": "bar", "core": "dump"},
+true, false, true, true, null, false
+]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/output
new file mode 100644
index 000000000..7aefe5642
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/complex-array/output
@@ -0,0 +1 @@
+[1, 2, 3, 4, "a", "b", "c", {"core": "dump", "foo": "bar"}, true, false, true, true, null, false] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-array/input
new file mode 100644
index 000000000..fe51488c7
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-array/input
@@ -0,0 +1 @@
+[]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-array/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-array/output
new file mode 100644
index 000000000..0637a088a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-array/output
@@ -0,0 +1 @@
+[] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object-in-array/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object-in-array/input
new file mode 100644
index 000000000..93d51406d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object-in-array/input
@@ -0,0 +1 @@
+[{}]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object-in-array/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object-in-array/output
new file mode 100644
index 000000000..ee1aac42b
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object-in-array/output
@@ -0,0 +1 @@
+[{}] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object/input
new file mode 100644
index 000000000..0967ef424
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object/input
@@ -0,0 +1 @@
+{}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object/output
new file mode 100644
index 000000000..9e26dfeeb
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-object/output
@@ -0,0 +1 @@
+{} \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-string/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-string/input
new file mode 100644
index 000000000..66a1e1856
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-string/input
@@ -0,0 +1 @@
+[""]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-string/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-string/output
new file mode 100644
index 000000000..93b6be2bc
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/empty-string/output
@@ -0,0 +1 @@
+[""] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/escaped-utf-control-char/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/escaped-utf-control-char/input
new file mode 100644
index 000000000..9a98545c0
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/escaped-utf-control-char/input
@@ -0,0 +1 @@
+["\u0012 escaped control character"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/escaped-utf-control-char/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/escaped-utf-control-char/output
new file mode 100644
index 000000000..07221b78d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/escaped-utf-control-char/output
@@ -0,0 +1 @@
+["\u0012 escaped control character"] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/false/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/false/input
new file mode 100644
index 000000000..434365202
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/false/input
@@ -0,0 +1 @@
+[false]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/false/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/false/output
new file mode 100644
index 000000000..67b2f0760
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/false/output
@@ -0,0 +1 @@
+[false] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-int/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-int/input
new file mode 100644
index 000000000..a96d5cdb3
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-int/input
@@ -0,0 +1 @@
+[-123]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-int/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-int/output
new file mode 100644
index 000000000..8e30f8bd9
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-int/output
@@ -0,0 +1 @@
+[-123] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-one/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-one/input
new file mode 100644
index 000000000..2363a1ac0
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-one/input
@@ -0,0 +1 @@
+[-1]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-one/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-one/output
new file mode 100644
index 000000000..99d21a2a0
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-one/output
@@ -0,0 +1 @@
+[-1] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-zero/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-zero/input
new file mode 100644
index 000000000..40fc49c71
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-zero/input
@@ -0,0 +1 @@
+[-0]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-zero/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-zero/output
new file mode 100644
index 000000000..6e7ea636e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/negative-zero/output
@@ -0,0 +1 @@
+[0] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/null/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/null/input
new file mode 100644
index 000000000..62864b313
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/null/input
@@ -0,0 +1 @@
+[null]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/null/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/null/output
new file mode 100644
index 000000000..500db4a86
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/null/output
@@ -0,0 +1 @@
+[null] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/one-byte-utf-8/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/one-byte-utf-8/input
new file mode 100644
index 000000000..8bda4685d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/one-byte-utf-8/input
@@ -0,0 +1 @@
+["\u002c one-byte UTF-8"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/one-byte-utf-8/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/one-byte-utf-8/output
new file mode 100644
index 000000000..c33d250ff
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/one-byte-utf-8/output
@@ -0,0 +1 @@
+[", one-byte UTF-8"] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-negative-exponent/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-negative-exponent/input
new file mode 100644
index 000000000..1e9fa5153
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-negative-exponent/input
@@ -0,0 +1 @@
+[1E-2]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-negative-exponent/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-negative-exponent/output
new file mode 100644
index 000000000..75b9ef92c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-negative-exponent/output
@@ -0,0 +1 @@
+[0.01] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-positive-exponent/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-positive-exponent/input
new file mode 100644
index 000000000..6a6ab9337
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-positive-exponent/input
@@ -0,0 +1 @@
+[1E+2]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-positive-exponent/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-positive-exponent/output
new file mode 100644
index 000000000..d8ff702a1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e-positive-exponent/output
@@ -0,0 +1 @@
+[100.0] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e/input
new file mode 100644
index 000000000..e70322356
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e/input
@@ -0,0 +1 @@
+[1E22]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e/output
new file mode 100644
index 000000000..9a739f21f
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-capital-e/output
@@ -0,0 +1 @@
+[1e22] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-exponent/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-exponent/input
new file mode 100644
index 000000000..b2a69b9a3
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-exponent/input
@@ -0,0 +1 @@
+[123e45]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-exponent/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-exponent/output
new file mode 100644
index 000000000..5ffc7196d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-exponent/output
@@ -0,0 +1 @@
+[1.2299999999999999e47] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-fraction-exponent/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-fraction-exponent/input
new file mode 100644
index 000000000..0c1660d1e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-fraction-exponent/input
@@ -0,0 +1 @@
+[123.456e78]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-fraction-exponent/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-fraction-exponent/output
new file mode 100644
index 000000000..66a3c8186
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-fraction-exponent/output
@@ -0,0 +1 @@
+[1.23456e80] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-negative-exponent/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-negative-exponent/input
new file mode 100644
index 000000000..daa4af932
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-negative-exponent/input
@@ -0,0 +1 @@
+[1e-2]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-negative-exponent/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-negative-exponent/output
new file mode 100644
index 000000000..75b9ef92c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-negative-exponent/output
@@ -0,0 +1 @@
+[0.01] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-positive-exponent/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-positive-exponent/input
new file mode 100644
index 000000000..f3780773a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-positive-exponent/input
@@ -0,0 +1 @@
+[1e+2]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-positive-exponent/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-positive-exponent/output
new file mode 100644
index 000000000..d8ff702a1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-positive-exponent/output
@@ -0,0 +1 @@
+[100.0] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-subnormal-number/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-subnormal-number/input
new file mode 100644
index 000000000..df6065345
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-subnormal-number/input
@@ -0,0 +1 @@
+[1.8011670033376514e-308]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-subnormal-number/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-subnormal-number/output
new file mode 100644
index 000000000..e6b0a58e8
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-subnormal-number/output
@@ -0,0 +1 @@
+[1.8011670033376514e-308] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-underflow/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-underflow/input
new file mode 100644
index 000000000..dc709960a
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-underflow/input
@@ -0,0 +1 @@
+[123e-10000000]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-underflow/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-underflow/output
new file mode 100644
index 000000000..92df1df1d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/real-underflow/output
@@ -0,0 +1 @@
+[0.0] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/run b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/run
new file mode 100755
index 000000000..d99548960
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/run
@@ -0,0 +1,56 @@
+#!/bin/sh
+#
+# Copyright (c) 2009-2016 Petri Lehtinen <petri@digip.org>
+#
+# Jansson is free software; you can redistribute it and/or modify
+# it under the terms of the MIT license. See LICENSE for details.
+
+JSON_SORT_KEYS=1
+export JSON_SORT_KEYS
+
+is_test() {
+ test -d $test_path
+}
+
+do_run() {
+ variant=$1
+ s=".$1"
+
+ strip=0
+ [ "$variant" = "strip" ] && strip=1
+
+ STRIP=$strip $json_process --env \
+ <$test_path/input >$test_log/stdout$s 2>$test_log/stderr$s
+ valgrind_check $test_log/stderr$s || return 1
+
+ ref=output
+ [ -f $test_path/output$s ] && ref=output$s
+
+ if ! cmp -s $test_path/$ref $test_log/stdout$s; then
+ echo $variant > $test_log/variant
+ return 1
+ fi
+}
+
+run_test() {
+ do_run normal && do_run strip
+}
+
+show_error() {
+ valgrind_show_error && return
+
+ read variant < $test_log/variant
+ s=".$variant"
+
+ echo "VARIANT: $variant"
+
+ echo "EXPECTED OUTPUT:"
+ ref=output
+ [ -f $test_path/output$s ] && ref=output$s
+ nl -bn $test_path/$ref
+
+ echo "ACTUAL OUTPUT:"
+ nl -bn $test_log/stdout$s
+}
+
+. $top_srcdir/test/scripts/run-tests.sh
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/short-string/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/short-string/input
new file mode 100644
index 000000000..0c3426d4c
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/short-string/input
@@ -0,0 +1 @@
+["a"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/short-string/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/short-string/output
new file mode 100644
index 000000000..eac5f7b46
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/short-string/output
@@ -0,0 +1 @@
+["a"] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-ascii-string/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-ascii-string/input
new file mode 100644
index 000000000..929b215c1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-ascii-string/input
@@ -0,0 +1 @@
+["abcdefghijklmnopqrstuvwxyz1234567890 "]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-ascii-string/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-ascii-string/output
new file mode 100644
index 000000000..90358ab70
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-ascii-string/output
@@ -0,0 +1 @@
+["abcdefghijklmnopqrstuvwxyz1234567890 "] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-0/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-0/input
new file mode 100644
index 000000000..111bb8686
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-0/input
@@ -0,0 +1 @@
+[0]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-0/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-0/output
new file mode 100644
index 000000000..6e7ea636e
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-0/output
@@ -0,0 +1 @@
+[0] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-1/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-1/input
new file mode 100644
index 000000000..7660873d1
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-1/input
@@ -0,0 +1 @@
+[1]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-1/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-1/output
new file mode 100644
index 000000000..bace2a0be
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-1/output
@@ -0,0 +1 @@
+[1] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-123/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-123/input
new file mode 100644
index 000000000..3214bfe58
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-123/input
@@ -0,0 +1 @@
+[123]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-123/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-123/output
new file mode 100644
index 000000000..e47f69afc
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-int-123/output
@@ -0,0 +1 @@
+[123] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-object/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-object/input
new file mode 100644
index 000000000..a34fb4907
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-object/input
@@ -0,0 +1 @@
+{"a":[]}
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-object/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-object/output
new file mode 100644
index 000000000..982abe826
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-object/output
@@ -0,0 +1 @@
+{"a": []} \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-real/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-real/input
new file mode 100644
index 000000000..0fed7df36
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-real/input
@@ -0,0 +1 @@
+[123.456789]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-real/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-real/output
new file mode 100644
index 000000000..b02878e5f
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/simple-real/output
@@ -0,0 +1 @@
+[123.456789] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/string-escapes/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/string-escapes/input
new file mode 100644
index 000000000..d994564d3
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/string-escapes/input
@@ -0,0 +1 @@
+["\"\\\/\b\f\n\r\t"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/string-escapes/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/string-escapes/output
new file mode 100644
index 000000000..ca5c1c658
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/string-escapes/output
@@ -0,0 +1 @@
+["\"\\/\b\f\n\r\t"] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/three-byte-utf-8/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/three-byte-utf-8/input
new file mode 100644
index 000000000..ccc0bfa57
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/three-byte-utf-8/input
@@ -0,0 +1 @@
+["\u0821 three-byte UTF-8"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/three-byte-utf-8/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/three-byte-utf-8/output
new file mode 100644
index 000000000..c44d124e7
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/three-byte-utf-8/output
@@ -0,0 +1 @@
+["ࠡ three-byte UTF-8"] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/true/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/true/input
new file mode 100644
index 000000000..29513c491
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/true/input
@@ -0,0 +1 @@
+[true]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/true/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/true/output
new file mode 100644
index 000000000..de601e305
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/true/output
@@ -0,0 +1 @@
+[true] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/two-byte-utf-8/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/two-byte-utf-8/input
new file mode 100644
index 000000000..05ae854b5
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/two-byte-utf-8/input
@@ -0,0 +1 @@
+["\u0123 two-byte UTF-8"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/two-byte-utf-8/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/two-byte-utf-8/output
new file mode 100644
index 000000000..1f0988d94
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/two-byte-utf-8/output
@@ -0,0 +1 @@
+["ģ two-byte UTF-8"] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-8-string/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-8-string/input
new file mode 100644
index 000000000..20dc64a45
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-8-string/input
@@ -0,0 +1 @@
+["€þıœəßð some utf-8 ĸʒ×ŋµåäö𝄞"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-8-string/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-8-string/output
new file mode 100644
index 000000000..53728650d
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-8-string/output
@@ -0,0 +1 @@
+["€þıœəßð some utf-8 ĸʒ×ŋµåäö𝄞"] \ No newline at end of file
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-surrogate-four-byte-encoding/input b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-surrogate-four-byte-encoding/input
new file mode 100644
index 000000000..c598b4172
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-surrogate-four-byte-encoding/input
@@ -0,0 +1 @@
+["\uD834\uDD1E surrogate, four-byte UTF-8"]
diff --git a/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-surrogate-four-byte-encoding/output b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-surrogate-four-byte-encoding/output
new file mode 100644
index 000000000..fa806d254
--- /dev/null
+++ b/src/fluent-bit/lib/jansson-e23f558/test/suites/valid/utf-surrogate-four-byte-encoding/output
@@ -0,0 +1 @@
+["𝄞 surrogate, four-byte UTF-8"] \ No newline at end of file