Adding upstream version 1:7.0.4.upstream/1%7.0.4upstream

Signed-off-by: Daniel Baumann <daniel.baumann@progress-linux.org>

307 files changed, 17837 insertions, 0 deletions

diff --git a/vcl/qa/cppunit/BackendTest.cxx b/vcl/qa/cppunit/BackendTest.cxx
new file mode 100644
index 000000000..ff4ed0d87
--- /dev/null
+++ b/vcl/qa/cppunit/BackendTest.cxx
@@ -0,0 +1,599 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ *
+ */
+
+#include <test/bootstrapfixture.hxx>
+
+#include <vcl/bitmap.hxx>
+#include <tools/stream.hxx>
+#include <vcl/graphicfilter.hxx>
+#include <basegfx/matrix/b2dhommatrix.hxx>
+
+#include <test/outputdevice.hxx>
+
+class BackendTest : public test::BootstrapFixture
+{
+    // if enabled - check the result images with:
+    // "xdg-open ./workdir/CppunitTest/vcl_backend_test.test.core/"
+    static constexpr const bool mbExportBitmap = false;
+
+    void exportImage(OUString const& rsFilename, BitmapEx const& rBitmapEx)
+    {
+        if (mbExportBitmap)
+        {
+            BitmapEx aBitmapEx(rBitmapEx);
+            aBitmapEx.Scale(Size(128, 128), BmpScaleFlag::Fast);
+            SvFileStream aStream(rsFilename, StreamMode::WRITE | StreamMode::TRUNC);
+            GraphicFilter::GetGraphicFilter().compressAsPNG(aBitmapEx, aStream);
+        }
+    }
+
+    void exportImage(OUString const& rsFilename, Bitmap const& rBitmap)
+    {
+        if (mbExportBitmap)
+        {
+            Bitmap aBitmap(rBitmap);
+            aBitmap.Scale(Size(128, 128), BmpScaleFlag::Fast);
+            SvFileStream aStream(rsFilename, StreamMode::WRITE | StreamMode::TRUNC);
+            GraphicFilter::GetGraphicFilter().compressAsPNG(aBitmap, aStream);
+        }
+    }
+
+    void exportDevice(const OUString& filename, const VclPtr<VirtualDevice>& device)
+    {
+        if (mbExportBitmap)
+        {
+            BitmapEx aBitmapEx(device->GetBitmap(Point(0, 0), device->GetOutputSizePixel()));
+            SvFileStream aStream(filename, StreamMode::WRITE | StreamMode::TRUNC);
+            GraphicFilter::GetGraphicFilter().compressAsPNG(aBitmapEx, aStream);
+        }
+    }
+
+public:
+    BackendTest()
+        : BootstrapFixture(true, false)
+    {
+    }
+
+    // We need to enable tests ONE BY ONE as they fail because of backend bugs
+    // it is still important to have the test defined so we know the issues
+    // exist and we need to fix them. Consistent behaviour of our backends
+    // is of highest priority.
+
+    static bool assertBackendNameNotEmpty(const OUString& name)
+    {
+        // This ensures that all backends return a valid name.
+        assert(!name.isEmpty());
+        (void)name;
+        return false;
+    }
+
+// Check whether tests should fail depending on which backend is used
+// (not all work). If you want to disable just a specific test
+// for a specific backend, use something like
+// 'if(SHOULD_ASSERT && aOutDevTest.getRenderBackendName() != "skia")'.
+#define SHOULD_ASSERT                                                                              \
+    (assertBackendNameNotEmpty(aOutDevTest.getRenderBackendName())                                 \
+     || aOutDevTest.getRenderBackendName() == "skia")
+
+    void testDrawRectWithRectangle()
+    {
+        vcl::test::OutputDeviceTestRect aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangle(aBitmap);
+        exportImage("01-01_rectangle_test-rectangle.png", aBitmap);
+
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectWithPixel()
+    {
+        vcl::test::OutputDeviceTestPixel aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangle(aBitmap);
+        exportImage("01-02_rectangle_test-pixel.png", aBitmap);
+
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectWithLine()
+    {
+        vcl::test::OutputDeviceTestLine aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangle(aBitmap);
+        exportImage("01-03_rectangle_test-line.png", aBitmap);
+
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectWithPolygon()
+    {
+        vcl::test::OutputDeviceTestPolygon aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangle(aBitmap);
+        exportImage("01-04_rectangle_test-polygon.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectWithPolyLine()
+    {
+        vcl::test::OutputDeviceTestPolyLine aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangle(aBitmap);
+        exportImage("01-05_rectangle_test-polyline.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectWithPolyLineB2D()
+    {
+        vcl::test::OutputDeviceTestPolyLineB2D aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangle(aBitmap);
+        exportImage("01-06_rectangle_test-polyline_b2d.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectWithPolyPolygon()
+    {
+        vcl::test::OutputDeviceTestPolyPolygon aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangle(aBitmap);
+        exportImage("01-07_rectangle_test-polypolygon.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectWithPolyPolygonB2D()
+    {
+        vcl::test::OutputDeviceTestPolyPolygonB2D aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangle(aBitmap);
+        exportImage("01-08_rectangle_test-polypolygon_b2d.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectAAWithRectangle()
+    {
+        vcl::test::OutputDeviceTestRect aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(true);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangleAA(aBitmap);
+        exportImage("02-01_rectangle_AA_test-rectangle.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectAAWithPixel()
+    {
+        vcl::test::OutputDeviceTestPixel aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(true);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangleAA(aBitmap);
+        exportImage("02-02_rectangle_AA_test-pixel.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectAAWithLine()
+    {
+        vcl::test::OutputDeviceTestLine aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(true);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangleAA(aBitmap);
+        exportImage("02-03_rectangle_AA_test-line.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectAAWithPolygon()
+    {
+        vcl::test::OutputDeviceTestPolygon aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(true);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangleAA(aBitmap);
+        exportImage("02-04_rectangle_AA_test-polygon.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectAAWithPolyLine()
+    {
+        vcl::test::OutputDeviceTestPolyLine aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(true);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangleAA(aBitmap);
+        exportImage("02-05_rectangle_AA_test-polyline.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectAAWithPolyLineB2D()
+    {
+        vcl::test::OutputDeviceTestPolyLineB2D aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(true);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangleAA(aBitmap);
+        exportImage("02-06_rectangle_AA_test-polyline_b2d.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectAAWithPolyPolygon()
+    {
+        vcl::test::OutputDeviceTestPolyPolygon aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(true);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangleAA(aBitmap);
+        exportImage("02-07_rectangle_AA_test-polypolygon.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawRectAAWithPolyPolygonB2D()
+    {
+        vcl::test::OutputDeviceTestPolyPolygonB2D aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupRectangle(true);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkRectangleAA(aBitmap);
+        exportImage("02-08_rectangle_AA_test-polypolygon_b2d.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawFilledRectWithRectangle()
+    {
+        vcl::test::OutputDeviceTestRect aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupFilledRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkFilledRectangle(aBitmap, false);
+        exportImage("03-01_filled_rectangle_test-rectangle_noline.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+        aBitmap = aOutDevTest.setupFilledRectangle(true);
+        eResult = vcl::test::OutputDeviceTestCommon::checkFilledRectangle(aBitmap, true);
+        exportImage("03-01_filled_rectangle_test-rectangle_line.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawFilledRectWithPolygon()
+    {
+        vcl::test::OutputDeviceTestPolygon aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupFilledRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkFilledRectangle(aBitmap, false);
+        exportImage("03-02_filled_rectangle_test-polygon_noline.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+        aBitmap = aOutDevTest.setupFilledRectangle(true);
+        eResult = vcl::test::OutputDeviceTestCommon::checkFilledRectangle(aBitmap, true);
+        exportImage("03-02_filled_rectangle_test-polygon_line.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawFilledRectWithPolyPolygon()
+    {
+        vcl::test::OutputDeviceTestPolyPolygon aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupFilledRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkFilledRectangle(aBitmap, false);
+        exportImage("03-03_filled_rectangle_test-polypolygon_noline.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+        aBitmap = aOutDevTest.setupFilledRectangle(true);
+        eResult = vcl::test::OutputDeviceTestCommon::checkFilledRectangle(aBitmap, true);
+        exportImage("03-03_filled_rectangle_test-polypolygon_line.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawFilledRectWithPolyPolygon2D()
+    {
+        vcl::test::OutputDeviceTestPolyPolygonB2D aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupFilledRectangle(false);
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkFilledRectangle(aBitmap, false);
+        exportImage("03-04_filled_rectangle_test-polypolygon_b2d_noline.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+        aBitmap = aOutDevTest.setupFilledRectangle(true);
+        eResult = vcl::test::OutputDeviceTestCommon::checkFilledRectangle(aBitmap, true);
+        exportImage("03-04_filled_rectangle_test-polypolygon_b2d_line.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawDiamondWithPolygon()
+    {
+        vcl::test::OutputDeviceTestPolygon aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupDiamond();
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkDiamond(aBitmap);
+        exportImage("04-01_diamond_test-polygon.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawDiamondWithLine()
+    {
+        vcl::test::OutputDeviceTestLine aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupDiamond();
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkDiamond(aBitmap);
+        exportImage("04-02_diamond_test-line.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawDiamondWithPolyline()
+    {
+        vcl::test::OutputDeviceTestPolyLine aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupDiamond();
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkDiamond(aBitmap);
+        exportImage("04-03_diamond_test-polyline.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawDiamondWithPolylineB2D()
+    {
+        vcl::test::OutputDeviceTestPolyLineB2D aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupDiamond();
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkDiamond(aBitmap);
+        exportImage("04-04_diamond_test-polyline_b2d.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawInvertWithRectangle()
+    {
+        vcl::test::OutputDeviceTestRect aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupInvert_NONE();
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkInvertRectangle(aBitmap);
+        exportImage("05-01_invert_test-rectangle.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawInvertN50WithRectangle()
+    {
+        vcl::test::OutputDeviceTestRect aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupInvert_N50();
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkInvertN50Rectangle(aBitmap);
+        exportImage("05-02_invert_N50_test-rectangle.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawInvertTrackFrameWithRectangle()
+    {
+        vcl::test::OutputDeviceTestRect aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupInvert_TrackFrame();
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkInvertTrackFrameRectangle(aBitmap);
+        exportImage("05-03_invert_TrackFrame_test-rectangle.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawBezierWithPolylineB2D()
+    {
+        vcl::test::OutputDeviceTestPolyLineB2D aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupBezier();
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkBezier(aBitmap);
+        exportImage("06-01_bezier_test-polyline_b2d.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawBezierAAWithPolylineB2D()
+    {
+        vcl::test::OutputDeviceTestPolyLineB2D aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupAABezier();
+        auto eResult = vcl::test::OutputDeviceTestCommon::checkBezier(aBitmap);
+        exportImage("07-01_bezier_AA_test-polyline_b2d.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawBitmap()
+    {
+        vcl::test::OutputDeviceTestBitmap aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupDrawBitmap();
+        exportImage("08-01_bitmap_test.png", aBitmap);
+        auto eResult = vcl::test::OutputDeviceTestBitmap::checkTransformedBitmap(aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawTransformedBitmap()
+    {
+        vcl::test::OutputDeviceTestBitmap aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupDrawTransformedBitmap();
+        auto eResult = vcl::test::OutputDeviceTestBitmap::checkTransformedBitmap(aBitmap);
+        exportImage("08-02_transformed_bitmap_test.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawBitmapExWithAlpha()
+    {
+        vcl::test::OutputDeviceTestBitmap aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupDrawBitmapExWithAlpha();
+        auto eResult = vcl::test::OutputDeviceTestBitmap::checkBitmapExWithAlpha(aBitmap);
+        exportImage("08-03_bitmapex_with_alpha_test.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawMask()
+    {
+        vcl::test::OutputDeviceTestBitmap aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupDrawMask();
+        auto eResult = vcl::test::OutputDeviceTestBitmap::checkMask(aBitmap);
+        exportImage("08-04_mask_test.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawBlend()
+    {
+        vcl::test::OutputDeviceTestBitmap aOutDevTest;
+        BitmapEx aBitmapEx = aOutDevTest.setupDrawBlend();
+        auto eResult = vcl::test::OutputDeviceTestBitmap::checkBlend(aBitmapEx);
+        exportImage("08-05_blend_test.png", aBitmapEx);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDrawXor()
+    {
+        vcl::test::OutputDeviceTestAnotherOutDev aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupXOR();
+        auto eResult = vcl::test::OutputDeviceTestAnotherOutDev::checkXOR(aBitmap);
+        exportImage("08-06_xor_test.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testClipRectangle()
+    {
+        vcl::test::OutputDeviceTestClip aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupClipRectangle();
+        auto eResult = vcl::test::OutputDeviceTestClip::checkClip(aBitmap);
+        exportImage("09-01_clip_rectangle_test.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testClipPolygon()
+    {
+        vcl::test::OutputDeviceTestClip aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupClipPolygon();
+        auto eResult = vcl::test::OutputDeviceTestClip::checkClip(aBitmap);
+        exportImage("09-02_clip_polygon_test.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testClipPolyPolygon()
+    {
+        vcl::test::OutputDeviceTestClip aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupClipPolyPolygon();
+        auto eResult = vcl::test::OutputDeviceTestClip::checkClip(aBitmap);
+        exportImage("09-03_clip_polypolygon_test.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testClipB2DPolyPolygon()
+    {
+        vcl::test::OutputDeviceTestClip aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupClipB2DPolyPolygon();
+        auto eResult = vcl::test::OutputDeviceTestClip::checkClip(aBitmap);
+        exportImage("09-04_clip_b2dpolypolygon_test.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testDashedLine()
+    {
+        vcl::test::OutputDeviceTestLine aOutDevTest;
+        Bitmap aBitmap = aOutDevTest.setupDashedLine();
+        auto eResult = vcl::test::OutputDeviceTestLine::checkDashedLine(aBitmap);
+        exportImage("10-01_dashed_line_test.png", aBitmap);
+        if (SHOULD_ASSERT)
+            CPPUNIT_ASSERT(eResult != vcl::test::TestResult::Failed);
+    }
+
+    void testTdf124848()
+    {
+        ScopedVclPtr<VirtualDevice> device = VclPtr<VirtualDevice>::Create(DeviceFormat::DEFAULT);
+        device->SetOutputSizePixel(Size(100, 100));
+        device->SetBackground(Wallpaper(COL_WHITE));
+        device->Erase();
+        device->SetAntialiasing(AntialiasingFlags::EnableB2dDraw);
+        device->SetLineColor(COL_BLACK);
+        basegfx::B2DHomMatrix matrix;
+        // DrawPolyLine() would apply the whole matrix to the line width, making it negative
+        // in case of a larger rotation.
+        matrix.rotate(M_PI); //180 degrees
+        matrix.translate(100, 100);
+        CPPUNIT_ASSERT(device->DrawPolyLineDirect(matrix,
+                                                  basegfx::B2DPolygon{ { 50, 50 }, { 50, 100 } },
+                                                  100, 0, nullptr, basegfx::B2DLineJoin::Miter));
+        exportDevice("/tmp/tdf124848-1.png", device);
+        // 100px wide line should fill the entire width of the upper half
+        CPPUNIT_ASSERT_EQUAL(COL_BLACK, device->GetPixel(Point(2, 2)));
+
+        // Also check hairline.
+        device->Erase();
+        CPPUNIT_ASSERT(device->DrawPolyLineDirect(matrix,
+                                                  basegfx::B2DPolygon{ { 50, 50 }, { 50, 100 } }, 0,
+                                                  0, nullptr, basegfx::B2DLineJoin::Miter));
+        exportDevice("/tmp/tdf124848-2.png", device);
+        // 1px wide
+        CPPUNIT_ASSERT_EQUAL(COL_BLACK, device->GetPixel(Point(50, 20)));
+        CPPUNIT_ASSERT_EQUAL(COL_WHITE, device->GetPixel(Point(49, 20)));
+        CPPUNIT_ASSERT_EQUAL(COL_WHITE, device->GetPixel(Point(51, 20)));
+    }
+
+    CPPUNIT_TEST_SUITE(BackendTest);
+    CPPUNIT_TEST(testDrawRectWithRectangle);
+    CPPUNIT_TEST(testDrawRectWithPixel);
+    CPPUNIT_TEST(testDrawRectWithLine);
+    CPPUNIT_TEST(testDrawRectWithPolygon);
+    CPPUNIT_TEST(testDrawRectWithPolyLine);
+    CPPUNIT_TEST(testDrawRectWithPolyLineB2D);
+    CPPUNIT_TEST(testDrawRectWithPolyPolygon);
+    CPPUNIT_TEST(testDrawRectWithPolyPolygonB2D);
+
+    CPPUNIT_TEST(testDrawRectAAWithRectangle);
+    CPPUNIT_TEST(testDrawRectAAWithPixel);
+    CPPUNIT_TEST(testDrawRectAAWithLine);
+    CPPUNIT_TEST(testDrawRectAAWithPolygon);
+    CPPUNIT_TEST(testDrawRectAAWithPolyLine);
+    CPPUNIT_TEST(testDrawRectAAWithPolyLineB2D);
+    CPPUNIT_TEST(testDrawRectAAWithPolyPolygon);
+    CPPUNIT_TEST(testDrawRectAAWithPolyPolygonB2D);
+
+    CPPUNIT_TEST(testDrawFilledRectWithRectangle);
+    CPPUNIT_TEST(testDrawFilledRectWithPolygon);
+    CPPUNIT_TEST(testDrawFilledRectWithPolyPolygon);
+    CPPUNIT_TEST(testDrawFilledRectWithPolyPolygon2D);
+
+    CPPUNIT_TEST(testDrawDiamondWithPolygon);
+    CPPUNIT_TEST(testDrawDiamondWithLine);
+    CPPUNIT_TEST(testDrawDiamondWithPolyline);
+    CPPUNIT_TEST(testDrawDiamondWithPolylineB2D);
+
+    CPPUNIT_TEST(testDrawInvertWithRectangle);
+    CPPUNIT_TEST(testDrawInvertN50WithRectangle);
+    CPPUNIT_TEST(testDrawInvertTrackFrameWithRectangle);
+
+    CPPUNIT_TEST(testDrawBezierWithPolylineB2D);
+    CPPUNIT_TEST(testDrawBezierAAWithPolylineB2D);
+
+    CPPUNIT_TEST(testDrawBitmap);
+    CPPUNIT_TEST(testDrawTransformedBitmap);
+    CPPUNIT_TEST(testDrawBitmapExWithAlpha);
+    CPPUNIT_TEST(testDrawMask);
+    CPPUNIT_TEST(testDrawBlend);
+    CPPUNIT_TEST(testDrawXor);
+
+    CPPUNIT_TEST(testClipRectangle);
+    CPPUNIT_TEST(testClipPolygon);
+    CPPUNIT_TEST(testClipPolyPolygon);
+    CPPUNIT_TEST(testClipB2DPolyPolygon);
+
+    CPPUNIT_TEST(testDashedLine);
+
+    CPPUNIT_TEST(testTdf124848);
+
+    CPPUNIT_TEST_SUITE_END();
+};
+
+CPPUNIT_TEST_SUITE_REGISTRATION(BackendTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/BitmapExTest.cxx b/vcl/qa/cppunit/BitmapExTest.cxx
new file mode 100644
index 000000000..23f40f001
--- /dev/null
+++ b/vcl/qa/cppunit/BitmapExTest.cxx
@@ -0,0 +1,113 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+
+#include <vcl/bitmapex.hxx>
+#include <basegfx/matrix/b2dhommatrix.hxx>
+#include <bitmapwriteaccess.hxx>
+#include <svdata.hxx>
+#include <salinst.hxx>
+
+namespace
+{
+class BitmapExTest : public CppUnit::TestFixture
+{
+    void testGetPixelColor24_8();
+    void testGetPixelColor32();
+    void testTransformBitmapEx();
+
+    CPPUNIT_TEST_SUITE(BitmapExTest);
+    CPPUNIT_TEST(testGetPixelColor24_8);
+    CPPUNIT_TEST(testGetPixelColor32);
+    CPPUNIT_TEST(testTransformBitmapEx);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void BitmapExTest::testGetPixelColor24_8()
+{
+    Bitmap aBitmap(Size(3, 3), 24);
+    {
+        BitmapScopedWriteAccess pWriteAccess(aBitmap);
+        pWriteAccess->Erase(Color(0x00, 0x00, 0xFF, 0x00));
+    }
+    AlphaMask aMask(Size(3, 3));
+    {
+        AlphaScopedWriteAccess pWriteAccess(aMask);
+        pWriteAccess->Erase(Color(0x00, 0xAA, 0xAA, 0xAA));
+    }
+
+    BitmapEx aBitmapEx(aBitmap, aMask);
+
+    CPPUNIT_ASSERT_EQUAL(Color(0xAA, 0x00, 0xFF, 0x00), aBitmapEx.GetPixelColor(0, 0));
+}
+
+void BitmapExTest::testGetPixelColor32()
+{
+    // Check backend capabilities and return from the test successfully
+    // if the backend doesn't support 32-bit bitmap
+    auto pBackendCapabilities = ImplGetSVData()->mpDefInst->GetBackendCapabilities();
+    if (!pBackendCapabilities->mbSupportsBitmap32)
+        return;
+
+    Bitmap aBitmap(Size(3, 3), 32);
+    {
+        BitmapScopedWriteAccess pWriteAccess(aBitmap);
+        pWriteAccess->Erase(Color(0xAA, 0x00, 0xFF, 0x00));
+    }
+
+    BitmapEx aBitmapEx(aBitmap);
+
+    CPPUNIT_ASSERT_EQUAL(Color(0xAA, 0x00, 0xFF, 0x00), aBitmapEx.GetPixelColor(0, 0));
+}
+
+void BitmapExTest::testTransformBitmapEx()
+{
+    Bitmap aBitmap(Size(16, 16), 24);
+    {
+        BitmapScopedWriteAccess pWriteAccess(aBitmap);
+        pWriteAccess->Erase(COL_WHITE);
+        for (int i = 0; i < 8; ++i)
+        {
+            for (int j = 0; j < 8; ++j)
+            {
+                pWriteAccess->SetPixel(i, j, COL_BLACK);
+            }
+        }
+    }
+    BitmapEx aBitmapEx(aBitmap);
+
+    basegfx::B2DHomMatrix aMatrix;
+    aMatrix.rotate(M_PI / 2);
+    BitmapEx aTransformed = aBitmapEx.TransformBitmapEx(16, 16, aMatrix);
+    aBitmap = aTransformed.GetBitmap();
+    Bitmap::ScopedReadAccess pAccess(aBitmap);
+    for (int i = 0; i < 16; ++i)
+    {
+        for (int j = 0; j < 16; ++j)
+        {
+            BitmapColor aColor = pAccess->GetPixel(i, j);
+            std::stringstream ss;
+            ss << "Color is expected to be white or black, is '" << aColor.AsRGBHexString() << "'";
+            // Without the accompanying fix in place, this test would have failed with:
+            // - Expression: aColor == COL_WHITE || aColor == COL_BLACK
+            // - Color is expected to be white or black, is 'bfbfbf'
+            // i.e. smoothing introduced noise for a simple 90 deg rotation.
+            CPPUNIT_ASSERT_MESSAGE(ss.str(), aColor == COL_WHITE || aColor == COL_BLACK);
+        }
+    }
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(BitmapExTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/BitmapFilterTest.cxx b/vcl/qa/cppunit/BitmapFilterTest.cxx
new file mode 100644
index 000000000..dddfaf571
--- /dev/null
+++ b/vcl/qa/cppunit/BitmapFilterTest.cxx
@@ -0,0 +1,216 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <test/bootstrapfixture.hxx>
+
+#include <vcl/bitmap.hxx>
+#include <vcl/bitmapaccess.hxx>
+#include <bitmapwriteaccess.hxx>
+
+#include <tools/stream.hxx>
+#include <vcl/graphicfilter.hxx>
+
+#include <vcl/BitmapBasicMorphologyFilter.hxx>
+#include <vcl/BitmapFilterStackBlur.hxx>
+#include <BitmapSymmetryCheck.hxx>
+
+#include <chrono>
+
+namespace
+{
+constexpr bool constWriteResultBitmap(false);
+constexpr bool constEnablePerformanceTest(false);
+
+class BitmapFilterTest : public test::BootstrapFixture
+{
+public:
+    BitmapFilterTest()
+        : test::BootstrapFixture(true, false)
+    {
+    }
+
+    void testBlurCorrectness();
+    void testBasicMorphology();
+    void testPerformance();
+
+    CPPUNIT_TEST_SUITE(BitmapFilterTest);
+    CPPUNIT_TEST(testBlurCorrectness);
+    CPPUNIT_TEST(testBasicMorphology);
+    CPPUNIT_TEST(testPerformance);
+    CPPUNIT_TEST_SUITE_END();
+
+private:
+    OUString getFullUrl(const OUString& sFileName)
+    {
+        return m_directories.getURLFromSrc("vcl/qa/cppunit/data/") + sFileName;
+    }
+
+    BitmapEx loadBitmap(const OUString& sFileName)
+    {
+        Graphic aGraphic;
+        const OUString aURL(getFullUrl(sFileName));
+        SvFileStream aFileStream(aURL, StreamMode::READ);
+        GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+        ErrCode aResult = rFilter.ImportGraphic(aGraphic, aURL, aFileStream);
+        CPPUNIT_ASSERT_EQUAL(ERRCODE_NONE, aResult);
+        return aGraphic.GetBitmapEx();
+    }
+
+    template <class BitmapT> // handle both Bitmap and BitmapEx
+    void savePNG(const OUString& sWhere, const BitmapT& rBmp)
+    {
+        SvFileStream aStream(sWhere, StreamMode::WRITE | StreamMode::TRUNC);
+        GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+        rFilter.compressAsPNG(rBmp, aStream);
+    }
+};
+
+void BitmapFilterTest::testBlurCorrectness()
+{
+    // Setup test bitmap
+    Size aSize(41, 31);
+    Bitmap aBitmap24Bit(aSize, 24);
+
+    ScanlineFormat scanlineFormat = ScanlineFormat::NONE;
+    sal_uInt16 nBPP = aBitmap24Bit.GetBitCount();
+
+    {
+        long aMargin1 = 1;
+        long aMargin2 = 3;
+        BitmapScopedWriteAccess aWriteAccess(aBitmap24Bit);
+        scanlineFormat = aWriteAccess->GetScanlineFormat();
+        aWriteAccess->Erase(COL_WHITE);
+        aWriteAccess->SetLineColor(COL_BLACK);
+
+        tools::Rectangle aRectangle1(aMargin1, aMargin1, aSize.Width() - 1 - aMargin1,
+                                     aSize.Height() - 1 - aMargin1);
+
+        tools::Rectangle aRectangle2(aMargin2, aMargin2, aSize.Width() - 1 - aMargin2,
+                                     aSize.Height() - 1 - aMargin2);
+
+        tools::Rectangle aRectangle3(aSize.Width() / 2, aSize.Height() / 2, aSize.Width() / 2,
+                                     aSize.Height() / 2);
+
+        aWriteAccess->DrawRect(aRectangle1);
+        aWriteAccess->DrawRect(aRectangle2);
+        aWriteAccess->DrawRect(aRectangle3);
+    }
+
+    if (constWriteResultBitmap)
+    {
+        savePNG("~/blurBefore.png", aBitmap24Bit);
+    }
+
+    // Perform blur
+    BitmapFilterStackBlur aBlurFilter(2);
+    aBitmap24Bit = aBlurFilter.filter(aBitmap24Bit);
+
+    // Check the result
+
+    if (constWriteResultBitmap)
+    {
+        savePNG("~/blurAfter.png", aBitmap24Bit);
+    }
+
+    // Check blurred bitmap parameters
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(41), aBitmap24Bit.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(31), aBitmap24Bit.GetSizePixel().Height());
+
+    CPPUNIT_ASSERT_EQUAL(nBPP, aBitmap24Bit.GetBitCount());
+
+    // Check that the bitmap is horizontally and vertically symmetrical
+    CPPUNIT_ASSERT(BitmapSymmetryCheck::check(aBitmap24Bit));
+
+    {
+        Bitmap::ScopedReadAccess aReadAccess(aBitmap24Bit);
+        CPPUNIT_ASSERT_EQUAL(scanlineFormat, aReadAccess->GetScanlineFormat());
+    }
+}
+
+void BitmapFilterTest::testBasicMorphology()
+{
+    const BitmapEx aOrigBitmap = loadBitmap("testBasicMorphology.png");
+    const BitmapEx aRefBitmapDilated1 = loadBitmap("testBasicMorphologyDilated1.png");
+    const BitmapEx aRefBitmapDilated1Eroded1 = loadBitmap("testBasicMorphologyDilated1Eroded1.png");
+    const BitmapEx aRefBitmapDilated2 = loadBitmap("testBasicMorphologyDilated2.png");
+    const BitmapEx aRefBitmapDilated2Eroded1 = loadBitmap("testBasicMorphologyDilated2Eroded1.png");
+
+    BitmapEx aTransformBitmap = aOrigBitmap;
+    BitmapFilter::Filter(aTransformBitmap, BitmapDilateFilter(1));
+    if (constWriteResultBitmap)
+        savePNG("~/Dilated1.png", aTransformBitmap);
+    CPPUNIT_ASSERT_EQUAL(aRefBitmapDilated1.GetChecksum(), aTransformBitmap.GetChecksum());
+    BitmapFilter::Filter(aTransformBitmap, BitmapErodeFilter(1));
+    if (constWriteResultBitmap)
+        savePNG("~/Dilated1Eroded1.png", aTransformBitmap);
+    CPPUNIT_ASSERT_EQUAL(aRefBitmapDilated1Eroded1.GetChecksum(), aTransformBitmap.GetChecksum());
+
+    aTransformBitmap = aOrigBitmap;
+    BitmapFilter::Filter(aTransformBitmap, BitmapDilateFilter(2));
+    if (constWriteResultBitmap)
+        savePNG("~/Dilated2.png", aTransformBitmap);
+    CPPUNIT_ASSERT_EQUAL(aRefBitmapDilated2.GetChecksum(), aTransformBitmap.GetChecksum());
+    BitmapFilter::Filter(aTransformBitmap, BitmapErodeFilter(1));
+    if (constWriteResultBitmap)
+        savePNG("~/Dilated2Eroded1.png", aTransformBitmap);
+    CPPUNIT_ASSERT_EQUAL(aRefBitmapDilated2Eroded1.GetChecksum(), aTransformBitmap.GetChecksum());
+}
+
+void BitmapFilterTest::testPerformance()
+{
+    if (!constEnablePerformanceTest)
+        return;
+
+    Size aSize(4000, 3000); // A rather common picture size
+
+    // Prepare bitmap
+    Bitmap aBigBitmap(aSize, 24);
+    {
+        long aMargin = 500;
+        BitmapScopedWriteAccess aWriteAccess(aBigBitmap);
+        aWriteAccess->Erase(COL_WHITE);
+        aWriteAccess->SetLineColor(COL_BLACK);
+        aWriteAccess->SetFillColor(COL_BLACK);
+        tools::Rectangle aRectangle(aMargin, aMargin, aSize.Width() - 1 - aMargin,
+                                    aSize.Height() - 1 - aMargin);
+
+        aWriteAccess->DrawRect(aRectangle);
+    }
+
+    int nIterations = 10;
+    auto start = std::chrono::high_resolution_clock::now();
+    Bitmap aResult;
+    for (int i = 0; i < nIterations; i++)
+    {
+        BitmapFilterStackBlur aBlurFilter(250);
+        aResult = aBlurFilter.filter(aBigBitmap);
+    }
+    auto end = std::chrono::high_resolution_clock::now();
+    auto elapsed = (end - start) / nIterations;
+
+    if (constWriteResultBitmap)
+    {
+        std::unique_ptr<SvFileStream> pStream(
+            new SvFileStream("~/BlurBigPerformance.png", StreamMode::WRITE | StreamMode::TRUNC));
+        GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+        rFilter.compressAsPNG(aResult, *pStream);
+
+        pStream.reset(new SvFileStream("~/BlurBigPerformance.txt", StreamMode::WRITE));
+        pStream->WriteOString("Blur average time: ");
+        pStream->WriteOString(OString::number(
+            std::chrono::duration_cast<std::chrono::milliseconds>(elapsed).count()));
+        pStream->WriteOString("\n");
+    }
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(BitmapFilterTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/BitmapProcessorTest.cxx b/vcl/qa/cppunit/BitmapProcessorTest.cxx
new file mode 100644
index 000000000..2a628285d
--- /dev/null
+++ b/vcl/qa/cppunit/BitmapProcessorTest.cxx
@@ -0,0 +1,90 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+#include <cppunit/plugin/TestPlugIn.h>
+
+#include <vcl/bitmap.hxx>
+#include <vcl/bitmapaccess.hxx>
+#include <vcl/alpha.hxx>
+
+#include <BitmapDisabledImageFilter.hxx>
+#include <bitmapwriteaccess.hxx>
+
+namespace
+{
+
+class BitmapProcessorTest : public CppUnit::TestFixture
+{
+    void testDisabledImage();
+
+    CPPUNIT_TEST_SUITE(BitmapProcessorTest);
+    CPPUNIT_TEST(testDisabledImage);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void BitmapProcessorTest::testDisabledImage()
+{
+    {
+        Bitmap aBitmap(Size(3, 3), 24);
+        {
+            BitmapScopedWriteAccess pWriteAccess(aBitmap);
+            pWriteAccess->Erase(Color(0x00, 0x00, 0xFF, 0x00));
+        }
+        BitmapEx aBitmapEx(aBitmap);
+        BitmapDisabledImageFilter aDisabledImageFilter;
+        BitmapEx aDisabledBitmapEx(aDisabledImageFilter.execute(aBitmapEx));
+        Bitmap aDisabledBitmap(aDisabledBitmapEx.GetBitmap());
+        {
+            Bitmap::ScopedReadAccess pReadAccess(aDisabledBitmap);
+            Color aColor(pReadAccess->GetPixel(0, 0));
+            CPPUNIT_ASSERT_EQUAL(Color(0x00C5C5C5), aColor);
+        }
+    }
+
+    {
+        Bitmap aBitmap(Size(3, 3), 24);
+        {
+            BitmapScopedWriteAccess pWriteAccess(aBitmap);
+            pWriteAccess->Erase(Color(0x00, 0x00, 0xFF, 0x00));
+        }
+        AlphaMask aMask(Size(3, 3));
+        {
+            AlphaScopedWriteAccess pWriteAccess(aMask);
+            pWriteAccess->Erase(Color(0x00, 0xAA, 0xAA, 0xAA));
+        }
+
+        BitmapEx aBitmapEx(aBitmap, aMask);
+        BitmapDisabledImageFilter aDisabledImageFilter;
+        BitmapEx aDisabledBitmapEx(aDisabledImageFilter.execute(aBitmapEx));
+
+        Bitmap aDisabledBitmap(aDisabledBitmapEx.GetBitmap());
+        {
+            Bitmap::ScopedReadAccess pReadAccess(aDisabledBitmap);
+            Color aColor(pReadAccess->GetPixel(0, 0));
+            CPPUNIT_ASSERT_EQUAL(Color(0x00C5C5C5), aColor);
+        }
+        AlphaMask aDisabledAlphaMask(aDisabledBitmapEx.GetAlpha());
+        {
+            AlphaMask::ScopedReadAccess pReadAccess(aDisabledAlphaMask);
+            Color aColor(pReadAccess->GetPixel(0, 0));
+            CPPUNIT_ASSERT_EQUAL(Color(0x0000AA), aColor);
+        }
+    }
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(BitmapProcessorTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/BitmapScaleTest.cxx b/vcl/qa/cppunit/BitmapScaleTest.cxx
new file mode 100644
index 000000000..b804cd1bf
--- /dev/null
+++ b/vcl/qa/cppunit/BitmapScaleTest.cxx
@@ -0,0 +1,293 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+
+#include <vcl/bitmap.hxx>
+#include <vcl/bitmapaccess.hxx>
+
+#include <tools/stream.hxx>
+#include <vcl/graphicfilter.hxx>
+
+#include <BitmapSymmetryCheck.hxx>
+#include <bitmapwriteaccess.hxx>
+
+namespace
+{
+class BitmapScaleTest : public CppUnit::TestFixture
+{
+    void testScale();
+    void testScale2();
+    void testScaleSymmetry();
+
+    CPPUNIT_TEST_SUITE(BitmapScaleTest);
+    CPPUNIT_TEST(testScale);
+    CPPUNIT_TEST(testScale2);
+    CPPUNIT_TEST(testScaleSymmetry);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+bool checkBitmapColor(Bitmap const& rBitmap, Color const& rExpectedColor)
+{
+    bool bResult = true;
+    Bitmap aBitmap(rBitmap);
+    Bitmap::ScopedReadAccess pReadAccess(aBitmap);
+    long nHeight = pReadAccess->Height();
+    long nWidth = pReadAccess->Width();
+    for (long y = 0; y < nHeight; ++y)
+    {
+        Scanline pScanlineRead = pReadAccess->GetScanline(y);
+        for (long x = 0; x < nWidth; ++x)
+        {
+            Color aColor = pReadAccess->GetPixelFromData(pScanlineRead, x);
+            if (aColor != rExpectedColor)
+                bResult = false;
+        }
+    }
+
+    return bResult;
+}
+
+void assertColorsAreSimilar(int maxDifference, const std::string& message,
+                            const BitmapColor& expected, const BitmapColor& actual)
+{
+    // Check that the two colors match or are reasonably similar.
+    if (expected == actual)
+        return;
+    if (abs(expected.GetRed() - actual.GetRed()) <= maxDifference
+        && abs(expected.GetGreen() - actual.GetGreen()) <= maxDifference
+        && abs(expected.GetBlue() - actual.GetBlue()) <= maxDifference
+        && abs(expected.GetAlpha() - actual.GetAlpha()) <= maxDifference)
+    {
+        return;
+    }
+    CPPUNIT_ASSERT_EQUAL_MESSAGE(message, expected, actual);
+}
+
+void assertColorsAreSimilar(int maxDifference, int line, const BitmapColor& expected,
+                            const BitmapColor& actual)
+{
+    std::stringstream stream;
+    stream << "Line: " << line;
+    assertColorsAreSimilar(maxDifference, stream.str(), expected, actual);
+}
+
+void BitmapScaleTest::testScale()
+{
+    const bool bExportBitmap(false);
+    using tools::Rectangle;
+
+    static const BmpScaleFlag scaleMethods[]
+        = { BmpScaleFlag::Default,     BmpScaleFlag::Fast,    BmpScaleFlag::BestQuality,
+            BmpScaleFlag::Interpolate, BmpScaleFlag::Lanczos, BmpScaleFlag::BiCubic,
+            BmpScaleFlag::BiLinear };
+    for (BmpScaleFlag scaleMethod : scaleMethods)
+    {
+        struct ScaleSize
+        {
+            Size srcSize;
+            Size destSize;
+        };
+        static const ScaleSize scaleSizes[]
+            = { // test no-op
+                { Size(16, 16), Size(16, 16) },
+                // powers of 2 (OpenGL may use texture atlas)
+                { Size(16, 16), Size(14, 14) },
+                { Size(14, 14), Size(16, 16) }, // both upscaling and downscaling
+                // "random" sizes
+                { Size(18, 18), Size(14, 14) },
+                { Size(14, 14), Size(18, 18) },
+                // different x/y ratios
+                { Size(16, 30), Size(14, 18) },
+                { Size(14, 18), Size(16, 30) },
+                // ratio larger than 16 (triggers different paths in some OpenGL algorithms)
+                { Size(18 * 20, 18 * 20), Size(14, 14) },
+                { Size(14, 14), Size(18 * 20, 18 * 20) }
+              };
+        for (const ScaleSize& scaleSize : scaleSizes)
+        {
+            OString testStr = "Testing scale (" + scaleSize.srcSize.toString() + ")->("
+                              + scaleSize.destSize.toString() + "), method "
+                              + OString::number(static_cast<int>(scaleMethod));
+            fprintf(stderr, "%s\n", testStr.getStr());
+            Bitmap bitmap(scaleSize.srcSize, 24);
+            {
+                // Fill each quarter of the source bitmap with a different color,
+                // and center with yet another color.
+                BitmapScopedWriteAccess writeAccess(bitmap);
+                const int halfW = scaleSize.srcSize.getWidth() / 2;
+                const int halfH = scaleSize.srcSize.getHeight() / 2;
+                writeAccess->SetFillColor(COL_GREEN);
+                writeAccess->FillRect(Rectangle(Point(0, 0), Size(halfW, halfH)));
+                writeAccess->SetFillColor(COL_RED);
+                writeAccess->FillRect(Rectangle(Point(0, halfH), Size(halfW, halfH)));
+                writeAccess->SetFillColor(COL_YELLOW);
+                writeAccess->FillRect(Rectangle(Point(halfW, 0), Size(halfW, halfH)));
+                writeAccess->SetFillColor(COL_BLACK);
+                writeAccess->FillRect(Rectangle(Point(halfW, halfH), Size(halfW, halfH)));
+                writeAccess->SetFillColor(COL_BLUE);
+                writeAccess->FillRect(Rectangle(Point(halfW / 2, halfH / 2), Size(halfW, halfH)));
+            }
+            if (bExportBitmap)
+            {
+                SvFileStream aStream("~/scale_before.png", StreamMode::WRITE | StreamMode::TRUNC);
+                GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+                rFilter.compressAsPNG(bitmap, aStream);
+            }
+            CPPUNIT_ASSERT(bitmap.Scale(scaleSize.destSize, scaleMethod));
+            if (bExportBitmap)
+            {
+                SvFileStream aStream("~/scale_after.png", StreamMode::WRITE | StreamMode::TRUNC);
+                GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+                rFilter.compressAsPNG(bitmap, aStream);
+            }
+            CPPUNIT_ASSERT_EQUAL(scaleSize.destSize, bitmap.GetSizePixel());
+            {
+                // Scaling should keep each quarter of the resulting bitmap have the same color,
+                // so check that color in each corner of the result bitmap is the same color,
+                // or reasonably close (some algorithms may alter the color very slightly).
+                BitmapReadAccess readAccess(bitmap);
+                const int lastW = scaleSize.destSize.getWidth() - 1;
+                const int lastH = scaleSize.destSize.getHeight() - 1;
+                assertColorsAreSimilar(2, __LINE__, COL_GREEN, readAccess.GetColor(0, 0));
+                assertColorsAreSimilar(2, __LINE__, COL_RED, readAccess.GetColor(lastH, 0));
+                assertColorsAreSimilar(2, __LINE__, COL_YELLOW, readAccess.GetColor(0, lastW));
+                assertColorsAreSimilar(2, __LINE__, COL_BLACK, readAccess.GetColor(lastH, lastW));
+                assertColorsAreSimilar(2, __LINE__, COL_BLUE,
+                                       readAccess.GetColor(lastH / 2, lastW / 2));
+            }
+        }
+    }
+}
+
+void BitmapScaleTest::testScale2()
+{
+    const bool bExportBitmap(false);
+
+    Bitmap aBitmap24Bit(Size(4096, 4096), 24);
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt16>(24), aBitmap24Bit.GetBitCount());
+    Color aBitmapColor = COL_YELLOW;
+    {
+        BitmapScopedWriteAccess aWriteAccess(aBitmap24Bit);
+        aWriteAccess->Erase(aBitmapColor);
+    }
+
+    if (bExportBitmap)
+    {
+        SvFileStream aStream("scale_before.png", StreamMode::WRITE | StreamMode::TRUNC);
+        GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+        rFilter.compressAsPNG(aBitmap24Bit, aStream);
+    }
+
+    // Scale - 65x65
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(4096), aBitmap24Bit.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(4096), aBitmap24Bit.GetSizePixel().Height());
+    Bitmap aScaledBitmap = aBitmap24Bit;
+    aScaledBitmap.Scale(Size(65, 65));
+
+    if (bExportBitmap)
+    {
+        SvFileStream aStream("scale_after_65x65.png", StreamMode::WRITE | StreamMode::TRUNC);
+        GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+        rFilter.compressAsPNG(aScaledBitmap, aStream);
+    }
+
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(65), aScaledBitmap.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(65), aScaledBitmap.GetSizePixel().Height());
+    CPPUNIT_ASSERT(checkBitmapColor(aScaledBitmap, aBitmapColor));
+
+    // Scale - 64x64
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(4096), aBitmap24Bit.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(4096), aBitmap24Bit.GetSizePixel().Height());
+    aScaledBitmap = aBitmap24Bit;
+    aScaledBitmap.Scale(Size(64, 64));
+
+    if (bExportBitmap)
+    {
+        SvFileStream aStream("scale_after_64x64.png", StreamMode::WRITE | StreamMode::TRUNC);
+        GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+        rFilter.compressAsPNG(aScaledBitmap, aStream);
+    }
+
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(64), aScaledBitmap.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(64), aScaledBitmap.GetSizePixel().Height());
+    CPPUNIT_ASSERT(checkBitmapColor(aScaledBitmap, aBitmapColor));
+
+    // Scale - 63x63
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(4096), aBitmap24Bit.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(4096), aBitmap24Bit.GetSizePixel().Height());
+    aScaledBitmap = aBitmap24Bit;
+    aScaledBitmap.Scale(Size(63, 63));
+
+    if (bExportBitmap)
+    {
+        SvFileStream aStream("scale_after_63x63.png", StreamMode::WRITE | StreamMode::TRUNC);
+        GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+        rFilter.compressAsPNG(aScaledBitmap, aStream);
+    }
+
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(63), aScaledBitmap.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(63), aScaledBitmap.GetSizePixel().Height());
+    CPPUNIT_ASSERT(checkBitmapColor(aScaledBitmap, aBitmapColor));
+}
+
+void BitmapScaleTest::testScaleSymmetry()
+{
+    const bool bExportBitmap(false);
+
+    Bitmap aBitmap24Bit(Size(10, 10), 24);
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt16>(24), aBitmap24Bit.GetBitCount());
+
+    {
+        BitmapScopedWriteAccess aWriteAccess(aBitmap24Bit);
+        aWriteAccess->Erase(COL_WHITE);
+        aWriteAccess->SetLineColor(COL_BLACK);
+        aWriteAccess->DrawRect(tools::Rectangle(1, 1, 8, 8));
+        aWriteAccess->DrawRect(tools::Rectangle(3, 3, 6, 6));
+    }
+
+    BitmapSymmetryCheck aBitmapSymmetryCheck;
+
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(10), aBitmap24Bit.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(10), aBitmap24Bit.GetSizePixel().Height());
+
+    // Check symmetry of the bitmap
+    CPPUNIT_ASSERT(BitmapSymmetryCheck::check(aBitmap24Bit));
+
+    if (bExportBitmap)
+    {
+        SvFileStream aStream("~/scale_before.png", StreamMode::WRITE | StreamMode::TRUNC);
+        GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+        rFilter.compressAsPNG(aBitmap24Bit, aStream);
+    }
+
+    aBitmap24Bit.Scale(2, 2, BmpScaleFlag::Fast);
+
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(20), aBitmap24Bit.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(static_cast<long>(20), aBitmap24Bit.GetSizePixel().Height());
+
+    // After scaling the bitmap should still be symmetrical. This check guarantees that
+    // scaling doesn't misalign the bitmap.
+    CPPUNIT_ASSERT(BitmapSymmetryCheck::check(aBitmap24Bit));
+
+    if (bExportBitmap)
+    {
+        SvFileStream aStream("~/scale_after.png", StreamMode::WRITE | StreamMode::TRUNC);
+        GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+        rFilter.compressAsPNG(aBitmap24Bit, aStream);
+    }
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(BitmapScaleTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/BitmapTest.cxx b/vcl/qa/cppunit/BitmapTest.cxx
new file mode 100644
index 000000000..640c477e3
--- /dev/null
+++ b/vcl/qa/cppunit/BitmapTest.cxx
@@ -0,0 +1,660 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+#include <cppunit/plugin/TestPlugIn.h>
+
+#include <unordered_map>
+
+#include <vcl/bitmap.hxx>
+#include <vcl/bitmapaccess.hxx>
+#include <vcl/virdev.hxx>
+
+#include <rtl/strbuf.hxx>
+#include <config_features.h>
+#if HAVE_FEATURE_OPENGL
+#include <vcl/opengl/OpenGLHelper.hxx>
+#endif
+#include <vcl/skia/SkiaHelper.hxx>
+#include <vcl/BitmapMonochromeFilter.hxx>
+
+#include <bitmapwriteaccess.hxx>
+
+#include <svdata.hxx>
+#include <salinst.hxx>
+#include <bitmap/Octree.hxx>
+
+namespace
+{
+class BitmapTest : public CppUnit::TestFixture
+{
+    void testCreation();
+    void testEmpty();
+    void testMonochrome();
+    void testN4Greyscale();
+    void testN8Greyscale();
+    void testConvert();
+    void testCRC();
+    void testGreyPalette();
+    void testCustom8BitPalette();
+    void testErase();
+    void testBitmap32();
+    void testOctree();
+
+    CPPUNIT_TEST_SUITE(BitmapTest);
+    CPPUNIT_TEST(testCreation);
+    CPPUNIT_TEST(testEmpty);
+    CPPUNIT_TEST(testMonochrome);
+    CPPUNIT_TEST(testConvert);
+    CPPUNIT_TEST(testN4Greyscale);
+    CPPUNIT_TEST(testN8Greyscale);
+    CPPUNIT_TEST(testCRC);
+    CPPUNIT_TEST(testGreyPalette);
+    CPPUNIT_TEST(testCustom8BitPalette);
+    CPPUNIT_TEST(testErase);
+    CPPUNIT_TEST(testBitmap32);
+    CPPUNIT_TEST(testOctree);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void assertColorsAreSimilar(int maxDifference, const std::string& message,
+                            const BitmapColor& expected, const BitmapColor& actual)
+{
+    // Check that the two colors match or are reasonably similar.
+    if (expected == actual)
+        return;
+    if (abs(expected.GetRed() - actual.GetRed()) <= maxDifference
+        && abs(expected.GetGreen() - actual.GetGreen()) <= maxDifference
+        && abs(expected.GetBlue() - actual.GetBlue()) <= maxDifference
+        && abs(expected.GetAlpha() - actual.GetAlpha()) <= maxDifference)
+    {
+        return;
+    }
+    CPPUNIT_ASSERT_EQUAL_MESSAGE(message, expected, actual);
+}
+
+void BitmapTest::testCreation()
+{
+    {
+        Bitmap aBmp;
+        Size aSize = aBmp.GetSizePixel();
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong width", static_cast<long>(0), aSize.Width());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong height", static_cast<long>(0), aSize.Height());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong pref size", Size(), aBmp.GetPrefSize());
+        CPPUNIT_ASSERT_MESSAGE("Not empty", aBmp.IsEmpty());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong bit count", static_cast<sal_uInt16>(0),
+                                     aBmp.GetBitCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong color count", sal_Int64(1), aBmp.GetColorCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong byte size", static_cast<sal_uLong>(0),
+                                     aBmp.GetSizeBytes());
+    }
+
+    {
+        Bitmap aBmp(Size(10, 10), 1);
+        Size aSize = aBmp.GetSizePixel();
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong width", static_cast<long>(10), aSize.Width());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong height", static_cast<long>(10), aSize.Height());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong pref size", Size(), aBmp.GetPrefSize());
+        CPPUNIT_ASSERT_MESSAGE("Empty bitmap", !aBmp.IsEmpty());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong bit count", static_cast<sal_uInt16>(1),
+                                     aBmp.GetBitCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong color count", sal_Int64(2), aBmp.GetColorCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong byte size", static_cast<sal_uLong>(12),
+                                     aBmp.GetSizeBytes());
+    }
+
+    {
+        Bitmap aBmp(Size(10, 10), 4);
+        Size aSize = aBmp.GetSizePixel();
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong width", static_cast<long>(10), aSize.Width());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong height", static_cast<long>(10), aSize.Height());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong pref size", Size(), aBmp.GetPrefSize());
+        CPPUNIT_ASSERT_MESSAGE("Empty bitmap", !aBmp.IsEmpty());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong bit count", static_cast<sal_uInt16>(4),
+                                     aBmp.GetBitCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong color count", sal_Int64(16), aBmp.GetColorCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong byte size", static_cast<sal_uLong>(50),
+                                     aBmp.GetSizeBytes());
+    }
+
+    {
+        Bitmap aBmp(Size(10, 10), 8);
+        Size aSize = aBmp.GetSizePixel();
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong width", static_cast<long>(10), aSize.Width());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong height", static_cast<long>(10), aSize.Height());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong pref size", Size(), aBmp.GetPrefSize());
+        CPPUNIT_ASSERT_MESSAGE("Empty bitmap", !aBmp.IsEmpty());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong bit count", static_cast<sal_uInt16>(8),
+                                     aBmp.GetBitCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong color count", sal_Int64(256), aBmp.GetColorCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong byte size", static_cast<sal_uLong>(100),
+                                     aBmp.GetSizeBytes());
+    }
+
+    {
+        Bitmap aBmp(Size(10, 10), 24);
+        Size aSize = aBmp.GetSizePixel();
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong width", static_cast<long>(10), aSize.Width());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong height", static_cast<long>(10), aSize.Height());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong pref size", Size(), aBmp.GetPrefSize());
+        CPPUNIT_ASSERT_MESSAGE("Empty bitmap", !aBmp.IsEmpty());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong bit count", static_cast<sal_uInt16>(24),
+                                     aBmp.GetBitCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong color count", sal_Int64(16777216),
+                                     aBmp.GetColorCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong byte size", static_cast<sal_uLong>(300),
+                                     aBmp.GetSizeBytes());
+    }
+
+    // Check backend capabilities and return from the test successfully
+    // if the backend doesn't support 32-bit bitmap
+    auto pBackendCapabilities = ImplGetSVData()->mpDefInst->GetBackendCapabilities();
+    if (pBackendCapabilities->mbSupportsBitmap32)
+    {
+        Bitmap aBmp(Size(10, 10), 32);
+        Size aSize = aBmp.GetSizePixel();
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong width", static_cast<long>(10), aSize.Width());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong height", static_cast<long>(10), aSize.Height());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong pref size", Size(), aBmp.GetPrefSize());
+        CPPUNIT_ASSERT_MESSAGE("Empty bitmap", !aBmp.IsEmpty());
+
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong bit count", sal_uInt16(32), aBmp.GetBitCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong color count", sal_Int64(4294967296ull),
+                                     aBmp.GetColorCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong byte size", sal_uLong(400), aBmp.GetSizeBytes());
+    }
+}
+
+void BitmapTest::testEmpty()
+{
+    Bitmap aBitmap(Size(10, 10), 8);
+    aBitmap.Erase(COL_LIGHTGRAYBLUE);
+
+    CPPUNIT_ASSERT(!aBitmap.IsEmpty());
+
+    aBitmap.SetEmpty();
+    CPPUNIT_ASSERT(aBitmap.IsEmpty());
+}
+
+Bitmap createTestBitmap()
+{
+    Bitmap aBmp(Size(4, 4), 24);
+    BitmapWriteAccess aBmpAccess(aBmp);
+
+    // row 1
+    aBmpAccess.SetPixel(0, 0, BitmapColor(COL_BLACK));
+    aBmpAccess.SetPixel(0, 1, BitmapColor(COL_BLUE));
+    aBmpAccess.SetPixel(0, 2, BitmapColor(COL_GREEN));
+    aBmpAccess.SetPixel(0, 3, BitmapColor(COL_CYAN));
+
+    // row 2
+    aBmpAccess.SetPixel(1, 0, BitmapColor(COL_RED));
+    aBmpAccess.SetPixel(1, 1, BitmapColor(COL_MAGENTA));
+    aBmpAccess.SetPixel(1, 2, BitmapColor(COL_BROWN));
+    aBmpAccess.SetPixel(1, 3, BitmapColor(COL_GRAY));
+
+    // row 3
+    aBmpAccess.SetPixel(2, 0, BitmapColor(COL_LIGHTGRAY));
+    aBmpAccess.SetPixel(2, 1, BitmapColor(COL_LIGHTBLUE));
+    aBmpAccess.SetPixel(2, 2, BitmapColor(COL_LIGHTGREEN));
+    aBmpAccess.SetPixel(2, 3, BitmapColor(COL_LIGHTCYAN));
+
+    // row 4
+    aBmpAccess.SetPixel(3, 0, BitmapColor(COL_LIGHTRED));
+    aBmpAccess.SetPixel(3, 1, BitmapColor(COL_LIGHTMAGENTA));
+    aBmpAccess.SetPixel(3, 2, BitmapColor(COL_YELLOW));
+    aBmpAccess.SetPixel(3, 3, BitmapColor(COL_WHITE));
+
+    return aBmp;
+}
+
+void BitmapTest::testMonochrome()
+{
+    Bitmap aBmp = createTestBitmap();
+
+    BitmapEx aBmpEx(aBmp);
+    BitmapFilter::Filter(aBmpEx, BitmapMonochromeFilter(63));
+    aBmp = aBmpEx.GetBitmap();
+    BitmapReadAccess aBmpReadAccess(aBmp);
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Black pixel wrong monochrome value", BitmapColor(COL_BLACK),
+                                 aBmpReadAccess.GetColor(0, 0));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Blue pixel wrong monochrome value", BitmapColor(COL_BLACK),
+                                 aBmpReadAccess.GetColor(0, 1));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Green pixel wrong monochrome value", BitmapColor(COL_WHITE),
+                                 aBmpReadAccess.GetColor(0, 2));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Cyan pixel wrong monochrome value", BitmapColor(COL_WHITE),
+                                 aBmpReadAccess.GetColor(0, 3));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Red pixel wrong monochrome value", BitmapColor(COL_BLACK),
+                                 aBmpReadAccess.GetColor(1, 0));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Magenta pixel wrong monochrome value", BitmapColor(COL_BLACK),
+                                 aBmpReadAccess.GetColor(1, 1));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Brown pixel wrong monochrome value", BitmapColor(COL_WHITE),
+                                 aBmpReadAccess.GetColor(1, 2));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Gray pixel wrong monochrome value", BitmapColor(COL_WHITE),
+                                 aBmpReadAccess.GetColor(1, 3));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light gray pixel wrong monochrome value", BitmapColor(COL_WHITE),
+                                 aBmpReadAccess.GetColor(2, 0));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light blue pixel wrong monochrome value", BitmapColor(COL_BLACK),
+                                 aBmpReadAccess.GetColor(2, 1));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light green pixel wrong monochrome value", BitmapColor(COL_WHITE),
+                                 aBmpReadAccess.GetColor(2, 2));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light cyan pixel wrong monochrome value", BitmapColor(COL_WHITE),
+                                 aBmpReadAccess.GetColor(2, 3));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light red pixel wrong monochrome value", BitmapColor(COL_WHITE),
+                                 aBmpReadAccess.GetColor(3, 0));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light magenta pixel wrong monochrome value",
+                                 BitmapColor(COL_WHITE), aBmpReadAccess.GetColor(3, 1));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Yellow pixel wrong monochrome value", BitmapColor(COL_WHITE),
+                                 aBmpReadAccess.GetColor(3, 2));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("White pixel wrong monochrome value", BitmapColor(COL_WHITE),
+                                 aBmpReadAccess.GetColor(3, 3));
+}
+
+void BitmapTest::testN4Greyscale()
+{
+    Bitmap aBmp = createTestBitmap();
+    BitmapPalette aGreyscalePalette = Bitmap::GetGreyPalette(16);
+
+    aBmp.Convert(BmpConversion::N4BitGreys);
+    BitmapReadAccess aBmpReadAccess(aBmp);
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Black pixel wrong 8-bit greyscale value", aGreyscalePalette[0],
+                                 aBmpReadAccess.GetColor(0, 0));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Blue pixel wrong 8-bit greyscale value", aGreyscalePalette[0],
+                                 aBmpReadAccess.GetColor(0, 1));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Green pixel wrong 8-bit greyscale value", aGreyscalePalette[4],
+                                 aBmpReadAccess.GetColor(0, 2));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Cyan pixel wrong 8-bit greyscale value", aGreyscalePalette[5],
+                                 aBmpReadAccess.GetColor(0, 3));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Red pixel wrong 8-bit greyscale value", aGreyscalePalette[2],
+                                 aBmpReadAccess.GetColor(1, 0));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Magenta pixel wrong 8-bit greyscale value", aGreyscalePalette[3],
+                                 aBmpReadAccess.GetColor(1, 1));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Brown pixel wrong 8-bit greyscale value", aGreyscalePalette[7],
+                                 aBmpReadAccess.GetColor(1, 2));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Gray pixel wrong 8-bit greyscale value", aGreyscalePalette[8],
+                                 aBmpReadAccess.GetColor(1, 3));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light gray pixel wrong 8-bit greyscale value",
+                                 aGreyscalePalette[12], aBmpReadAccess.GetColor(2, 0));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light blue pixel wrong 8-bit greyscale value",
+                                 aGreyscalePalette[1], aBmpReadAccess.GetColor(2, 1));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light green pixel wrong 8-bit greyscale value",
+                                 aGreyscalePalette[9], aBmpReadAccess.GetColor(2, 2));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light cyan pixel wrong 8-bit greyscale value",
+                                 aGreyscalePalette[11], aBmpReadAccess.GetColor(2, 3));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light red pixel wrong 8-bit greyscale value",
+                                 aGreyscalePalette[4], aBmpReadAccess.GetColor(3, 0));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Light magenta pixel wrong 8-bit greyscale value",
+                                 aGreyscalePalette[6], aBmpReadAccess.GetColor(3, 1));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Yellow pixel wrong 8-bit greyscale value", aGreyscalePalette[14],
+                                 aBmpReadAccess.GetColor(3, 2));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("White pixel wrong 8-bit greyscale value", aGreyscalePalette[15],
+                                 aBmpReadAccess.GetColor(3, 3));
+}
+
+void BitmapTest::testN8Greyscale()
+{
+    Bitmap aBmp = createTestBitmap();
+    BitmapPalette aGreyscalePalette = Bitmap::GetGreyPalette(256);
+
+    aBmp.Convert(BmpConversion::N8BitGreys);
+    BitmapReadAccess aBmpReadAccess(aBmp);
+
+    assertColorsAreSimilar(1, "Black pixel wrong 8-bit greyscale value", aGreyscalePalette[0],
+                           aBmpReadAccess.GetColor(0, 0));
+    assertColorsAreSimilar(1, "Blue pixel wrong 8-bit greyscale value", aGreyscalePalette[14],
+                           aBmpReadAccess.GetColor(0, 1));
+    assertColorsAreSimilar(1, "Green pixel wrong 8-bit greyscale value", aGreyscalePalette[75],
+                           aBmpReadAccess.GetColor(0, 2));
+    assertColorsAreSimilar(1, "Cyan pixel wrong 8-bit greyscale value", aGreyscalePalette[89],
+                           aBmpReadAccess.GetColor(0, 3));
+    assertColorsAreSimilar(1, "Red pixel wrong 8-bit greyscale value", aGreyscalePalette[38],
+                           aBmpReadAccess.GetColor(1, 0));
+    assertColorsAreSimilar(1, "Magenta pixel wrong 8-bit greyscale value", aGreyscalePalette[52],
+                           aBmpReadAccess.GetColor(1, 1));
+    assertColorsAreSimilar(1, "Brown pixel wrong 8-bit greyscale value", aGreyscalePalette[114],
+                           aBmpReadAccess.GetColor(1, 2));
+    assertColorsAreSimilar(1, "Gray pixel wrong 8-bit greyscale value", aGreyscalePalette[128],
+                           aBmpReadAccess.GetColor(1, 3));
+    assertColorsAreSimilar(1, "Light gray pixel wrong 8-bit greyscale value",
+                           aGreyscalePalette[192], aBmpReadAccess.GetColor(2, 0));
+    assertColorsAreSimilar(1, "Light blue pixel wrong 8-bit greyscale value", aGreyscalePalette[27],
+                           aBmpReadAccess.GetColor(2, 1));
+    assertColorsAreSimilar(1, "Light green pixel wrong 8-bit greyscale value",
+                           aGreyscalePalette[150], aBmpReadAccess.GetColor(2, 2));
+    assertColorsAreSimilar(1, "Light cyan pixel wrong 8-bit greyscale value",
+                           aGreyscalePalette[178], aBmpReadAccess.GetColor(2, 3));
+    assertColorsAreSimilar(1, "Light red pixel wrong 8-bit greyscale value", aGreyscalePalette[76],
+                           aBmpReadAccess.GetColor(3, 0));
+    assertColorsAreSimilar(1, "Light magenta pixel wrong 8-bit greyscale value",
+                           aGreyscalePalette[104], aBmpReadAccess.GetColor(3, 1));
+    assertColorsAreSimilar(1, "Yellow pixel wrong 8-bit greyscale value", aGreyscalePalette[227],
+                           aBmpReadAccess.GetColor(3, 2));
+    assertColorsAreSimilar(1, "White pixel wrong 8-bit greyscale value", aGreyscalePalette[255],
+                           aBmpReadAccess.GetColor(3, 3));
+}
+
+void BitmapTest::testConvert()
+{
+    Bitmap aBitmap(Size(10, 10), 8);
+
+    aBitmap.Erase(COL_LIGHTGRAYBLUE);
+
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt16>(8), aBitmap.GetBitCount());
+    {
+        Bitmap::ScopedReadAccess pReadAccess(aBitmap);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt16>(8), pReadAccess->GetBitCount());
+#if defined MACOSX || defined IOS
+        //it would be nice to find and change the stride for quartz to be the same as everyone else
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt32>(10), pReadAccess->GetScanlineSize());
+#else
+        if (!SkiaHelper::isVCLSkiaEnabled())
+#if HAVE_FEATURE_OPENGL
+            if (!OpenGLHelper::isVCLOpenGLEnabled())
+#endif
+                CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt32>(12), pReadAccess->GetScanlineSize());
+#endif
+        CPPUNIT_ASSERT(pReadAccess->HasPalette());
+        const BitmapColor& rColor = pReadAccess->GetPaletteColor(pReadAccess->GetPixelIndex(1, 1));
+        CPPUNIT_ASSERT_EQUAL(sal_Int32(204), sal_Int32(rColor.GetRed()));
+        CPPUNIT_ASSERT_EQUAL(sal_Int32(204), sal_Int32(rColor.GetGreen()));
+        CPPUNIT_ASSERT_EQUAL(sal_Int32(255), sal_Int32(rColor.GetBlue()));
+    }
+
+    aBitmap.Convert(BmpConversion::N24Bit);
+
+    CPPUNIT_ASSERT_EQUAL(sal_uInt16(24), aBitmap.GetBitCount());
+    {
+        Bitmap::ScopedReadAccess pReadAccess(aBitmap);
+        // 24 bit Bitmap on SVP backend can now use 24bit RGB everywhere.
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt16>(24), pReadAccess->GetBitCount());
+
+        if (SkiaHelper::isVCLSkiaEnabled()) // aligned to 4 bytes
+            CPPUNIT_ASSERT_EQUAL(sal_uInt32(32), pReadAccess->GetScanlineSize());
+        else
+#if HAVE_FEATURE_OPENGL
+            if (OpenGLHelper::isVCLOpenGLEnabled())
+            CPPUNIT_ASSERT_EQUAL(sal_uInt32(30), pReadAccess->GetScanlineSize());
+        else
+#endif
+#if defined LINUX || defined FREEBSD
+        {
+            CPPUNIT_ASSERT_EQUAL(sal_uInt32(32), pReadAccess->GetScanlineSize());
+        }
+#elif defined(_WIN32)
+        {
+            // GDI Scanlines padded to DWORD multiples, it seems
+            CPPUNIT_ASSERT_EQUAL(sal_uInt32(32), pReadAccess->GetScanlineSize());
+        }
+#else
+        {
+            CPPUNIT_ASSERT_EQUAL(sal_uInt32(30), pReadAccess->GetScanlineSize());
+        }
+#endif
+
+        CPPUNIT_ASSERT(!pReadAccess->HasPalette());
+        Color aColor = pReadAccess->GetPixel(0, 0);
+        CPPUNIT_ASSERT_EQUAL(sal_Int32(204), sal_Int32(aColor.GetRed()));
+        CPPUNIT_ASSERT_EQUAL(sal_Int32(204), sal_Int32(aColor.GetGreen()));
+        CPPUNIT_ASSERT_EQUAL(sal_Int32(255), sal_Int32(aColor.GetBlue()));
+    }
+}
+
+typedef std::unordered_map<sal_uInt64, const char*> CRCHash;
+
+void checkAndInsert(CRCHash& rHash, sal_uInt64 nCRC, const char* pLocation)
+{
+    auto it = rHash.find(nCRC);
+    if (it != rHash.end())
+    {
+        OStringBuffer aBuf("CRC collision between ");
+        aBuf.append(pLocation);
+        aBuf.append(" and ");
+        aBuf.append(it->second);
+        aBuf.append(" hash is 0x");
+        aBuf.append(static_cast<sal_Int64>(nCRC), 16);
+        CPPUNIT_FAIL(aBuf.toString().getStr());
+    }
+    rHash[nCRC] = pLocation;
+}
+
+void checkAndInsert(CRCHash& rHash, Bitmap const& rBmp, const char* pLocation)
+{
+    checkAndInsert(rHash, rBmp.GetChecksum(), pLocation);
+}
+
+Bitmap getAsBitmap(VclPtr<OutputDevice> const& pOut)
+{
+    return pOut->GetBitmap(Point(), pOut->GetOutputSizePixel());
+}
+
+void BitmapTest::testCRC()
+{
+    CRCHash aCRCs;
+
+    Bitmap aBitmap(Size(1023, 759), 24, nullptr);
+    aBitmap.Erase(COL_BLACK);
+    checkAndInsert(aCRCs, aBitmap, "black bitmap");
+    aBitmap.Invert();
+    checkAndInsert(aCRCs, aBitmap, "white bitmap");
+
+    ScopedVclPtrInstance<VirtualDevice> aVDev;
+    aVDev->SetBackground(Wallpaper(COL_WHITE));
+    aVDev->SetOutputSizePixel(Size(1023, 759));
+
+#if 0 // disabled for now - oddly breaks on OS/X - but why ?
+    Bitmap aWhiteCheck = getAsBitmap(aVDev);
+    CPPUNIT_ASSERT(aCRCs.find(aWhiteCheck.GetChecksum()) != aCRCs.end());
+#endif
+
+    // a 1x1 black & white checkerboard
+    aVDev->DrawCheckered(Point(), aVDev->GetOutputSizePixel(), 1, Color(0, 0, 1));
+    Bitmap aChecker = getAsBitmap(aVDev);
+    checkAndInsert(aCRCs, aChecker, "checkerboard");
+    aChecker.Invert();
+    checkAndInsert(aCRCs, aChecker, "inverted checkerboard");
+}
+
+void BitmapTest::testGreyPalette()
+{
+    {
+        BitmapPalette aPalette = Bitmap::GetGreyPalette(2);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong number of palette entries", static_cast<sal_uInt16>(2),
+                                     aPalette.GetEntryCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 1 wrong", BitmapColor(0, 0, 0), aPalette[0]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 2 wrong", BitmapColor(255, 255, 255), aPalette[1]);
+    }
+
+    {
+        BitmapPalette aPalette = Bitmap::GetGreyPalette(4);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong number of palette entries", static_cast<sal_uInt16>(4),
+                                     aPalette.GetEntryCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 1 wrong", BitmapColor(0, 0, 0), aPalette[0]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 2 wrong", BitmapColor(85, 85, 85), aPalette[1]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 3 wrong", BitmapColor(170, 170, 170), aPalette[2]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 4 wrong", BitmapColor(255, 255, 255), aPalette[3]);
+    }
+
+    {
+        BitmapPalette aPalette = Bitmap::GetGreyPalette(16);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong number of palette entries", static_cast<sal_uInt16>(16),
+                                     aPalette.GetEntryCount());
+        // this is a *real* specific number of greys, incremented in units of 17 so may
+        // as well test them all...
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 1 wrong", BitmapColor(0, 0, 0), aPalette[0]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 2 wrong", BitmapColor(17, 17, 17), aPalette[1]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 3 wrong", BitmapColor(34, 34, 34), aPalette[2]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 4 wrong", BitmapColor(51, 51, 51), aPalette[3]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 5 wrong", BitmapColor(68, 68, 68), aPalette[4]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 6 wrong", BitmapColor(85, 85, 85), aPalette[5]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 7 wrong", BitmapColor(102, 102, 102), aPalette[6]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 8 wrong", BitmapColor(119, 119, 119), aPalette[7]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 9 wrong", BitmapColor(136, 136, 136), aPalette[8]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 10 wrong", BitmapColor(153, 153, 153), aPalette[9]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 11 wrong", BitmapColor(170, 170, 170), aPalette[10]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 12 wrong", BitmapColor(187, 187, 187), aPalette[11]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 13 wrong", BitmapColor(204, 204, 204), aPalette[12]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 14 wrong", BitmapColor(221, 221, 221), aPalette[13]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 15 wrong", BitmapColor(238, 238, 238), aPalette[14]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 16 wrong", BitmapColor(255, 255, 255), aPalette[15]);
+    }
+
+    {
+        BitmapPalette aPalette = Bitmap::GetGreyPalette(256);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Wrong number of palette entries",
+                                     static_cast<sal_uInt16>(256), aPalette.GetEntryCount());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 1 wrong", BitmapColor(0, 0, 0), aPalette[0]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 127 wrong", BitmapColor(127, 127, 127), aPalette[127]);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Entry 255 wrong", BitmapColor(255, 255, 255), aPalette[255]);
+    }
+}
+
+void BitmapTest::testCustom8BitPalette()
+{
+    BitmapPalette aCustomPalette;
+    aCustomPalette.SetEntryCount(256);
+    for (sal_uInt16 i = 0; i < 256; i++)
+    {
+        aCustomPalette[i] = BitmapColor(sal_uInt8(i), sal_uInt8(0xCC), sal_uInt8(0x22));
+    }
+    Bitmap aBitmap(Size(3, 2), 8, &aCustomPalette);
+
+    {
+        BitmapScopedWriteAccess pAccess(aBitmap);
+        pAccess->SetPixelIndex(0, 0, 0);
+        pAccess->SetPixelIndex(0, 1, 1);
+        pAccess->SetPixelIndex(0, 2, 2);
+
+        pAccess->SetPixelIndex(1, 0, 253);
+        pAccess->SetPixelIndex(1, 1, 254);
+        pAccess->SetPixelIndex(1, 2, 255);
+    }
+
+    {
+        Bitmap::ScopedReadAccess pAccess(aBitmap);
+        CPPUNIT_ASSERT_EQUAL(0, int(pAccess->GetPixelIndex(0, 0)));
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0xCC, 0x22), pAccess->GetColor(0, 0));
+
+        CPPUNIT_ASSERT_EQUAL(1, int(pAccess->GetPixelIndex(0, 1)));
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x01, 0xCC, 0x22), pAccess->GetColor(0, 1));
+
+        CPPUNIT_ASSERT_EQUAL(2, int(pAccess->GetPixelIndex(0, 2)));
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x02, 0xCC, 0x22), pAccess->GetColor(0, 2));
+
+        CPPUNIT_ASSERT_EQUAL(253, int(pAccess->GetPixelIndex(1, 0)));
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFD, 0xCC, 0x22), pAccess->GetColor(1, 0));
+
+        CPPUNIT_ASSERT_EQUAL(254, int(pAccess->GetPixelIndex(1, 1)));
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFE, 0xCC, 0x22), pAccess->GetColor(1, 1));
+
+        CPPUNIT_ASSERT_EQUAL(255, int(pAccess->GetPixelIndex(1, 2)));
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xCC, 0x22), pAccess->GetColor(1, 2));
+    }
+}
+
+void BitmapTest::testErase()
+{
+    Bitmap aBitmap(Size(3, 3), 24);
+    {
+        BitmapScopedWriteAccess pWriteAccess(aBitmap);
+        pWriteAccess->Erase(Color(0x11, 0x22, 0x33));
+    }
+    {
+        Bitmap::ScopedReadAccess pReadAccess(aBitmap);
+        BitmapColor aColor(pReadAccess->GetPixel(0, 0));
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x11, 0x22, 0x33, 0x00), aColor);
+    }
+}
+
+void BitmapTest::testBitmap32()
+{
+    // Check backend capabilities and return from the test successfully
+    // if the backend doesn't support 32-bit bitmap
+    auto pBackendCapabilities = ImplGetSVData()->mpDefInst->GetBackendCapabilities();
+    if (!pBackendCapabilities->mbSupportsBitmap32)
+        return;
+
+    Bitmap aBitmap(Size(3, 3), 32);
+    {
+        BitmapScopedWriteAccess pWriteAccess(aBitmap);
+        pWriteAccess->Erase(Color(0xFF, 0x11, 0x22, 0x33));
+        pWriteAccess->SetPixel(1, 1, BitmapColor(0x44, 0xFF, 0xBB, 0x00));
+        pWriteAccess->SetPixel(2, 2, BitmapColor(0x99, 0x77, 0x66, 0x55));
+    }
+    {
+        Bitmap::ScopedReadAccess pReadAccess(aBitmap);
+        BitmapColor aColor = pReadAccess->GetPixel(0, 0);
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x00, 0xFF), aColor);
+
+        aColor = pReadAccess->GetPixel(1, 1);
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x44, 0xFF, 0xBB, 0x00), aColor);
+
+        aColor = pReadAccess->GetPixel(2, 2);
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x99, 0x77, 0x66, 0x55), aColor);
+    }
+}
+
+void BitmapTest::testOctree()
+{
+    Size aSize(1000, 100);
+    Bitmap aBitmap(aSize, 24);
+    {
+        BitmapScopedWriteAccess pWriteAccess(aBitmap);
+        for (long y = 0; y < aSize.Height(); ++y)
+        {
+            for (long x = 0; x < aSize.Width(); ++x)
+            {
+                double fPercent = double(x) / double(aSize.Width());
+                pWriteAccess->SetPixel(y, x,
+                                       BitmapColor(255.0 * fPercent, 64.0 + (128.0 * fPercent),
+                                                   255.0 - 255.0 * fPercent));
+            }
+        }
+    }
+
+    {
+        // Reduce to 1 color
+        Bitmap::ScopedReadAccess pAccess(aBitmap);
+        Octree aOctree(*pAccess, 1);
+        auto aBitmapPalette = aOctree.GetPalette();
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(1), aBitmapPalette.GetEntryCount());
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x7e, 0x7f, 0x7f), aBitmapPalette[0]);
+    }
+
+    {
+        // Reduce to 4 color
+        Bitmap::ScopedReadAccess pAccess(aBitmap);
+        Octree aOctree(*pAccess, 4);
+        auto aBitmapPalette = aOctree.GetPalette();
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(4), aBitmapPalette.GetEntryCount());
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x7f, 0x7f, 0x7f), aBitmapPalette[0]);
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x3e, 0x5f, 0xbf), aBitmapPalette[1]);
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0x7f, 0x80, 0x7f), aBitmapPalette[2]);
+        CPPUNIT_ASSERT_EQUAL(BitmapColor(0xbe, 0x9f, 0x3f), aBitmapPalette[3]);
+    }
+
+    {
+        // Reduce to 256 color
+        Bitmap::ScopedReadAccess pAccess(aBitmap);
+        Octree aOctree(*pAccess, 256);
+        auto aBitmapPalette = aOctree.GetPalette();
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(74), aBitmapPalette.GetEntryCount());
+    }
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(BitmapTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/FontFeatureTest.cxx b/vcl/qa/cppunit/FontFeatureTest.cxx
new file mode 100644
index 000000000..e4040f35b
--- /dev/null
+++ b/vcl/qa/cppunit/FontFeatureTest.cxx
@@ -0,0 +1,336 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <test/bootstrapfixture.hxx>
+#include <config_features.h>
+#include <cppunit/TestAssert.h>
+
+#include <vcl/font/Feature.hxx>
+#include <vcl/font/FeatureParser.hxx>
+#include <vcl/virdev.hxx>
+#include <vcl/svapp.hxx>
+
+class FontFeatureTest : public test::BootstrapFixture
+{
+public:
+    FontFeatureTest()
+        : BootstrapFixture(true, false)
+    {
+    }
+
+    void testGetFontFeatures();
+    void testParseFeature();
+
+    CPPUNIT_TEST_SUITE(FontFeatureTest);
+    CPPUNIT_TEST(testGetFontFeatures);
+    CPPUNIT_TEST(testParseFeature);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void FontFeatureTest::testGetFontFeatures()
+{
+#if HAVE_MORE_FONTS
+    ScopedVclPtrInstance<VirtualDevice> aVDev(*Application::GetDefaultDevice(),
+                                              DeviceFormat::DEFAULT, DeviceFormat::DEFAULT);
+    aVDev->SetOutputSizePixel(Size(10, 10));
+
+    OUString aFontName("Linux Libertine G");
+    CPPUNIT_ASSERT(aVDev->IsFontAvailable(aFontName));
+
+    vcl::Font aFont = aVDev->GetFont();
+    aFont.SetFamilyName(aFontName);
+    aFont.SetWeight(FontWeight::WEIGHT_NORMAL);
+    aFont.SetItalic(FontItalic::ITALIC_NORMAL);
+    aFont.SetWidthType(FontWidth::WIDTH_NORMAL);
+    aVDev->SetFont(aFont);
+
+    std::vector<vcl::font::Feature> rFontFeatures;
+    CPPUNIT_ASSERT(aVDev->GetFontFeatures(rFontFeatures));
+
+    // We're interested only in defaults here
+    std::vector<vcl::font::Feature> rDefaultFontFeatures;
+    OUString aFeaturesString;
+    for (vcl::font::Feature const& rFeature : rFontFeatures)
+    {
+        if (rFeature.m_aID.m_aScriptCode == vcl::font::featureCode("DFLT")
+            && rFeature.m_aID.m_aLanguageCode == vcl::font::featureCode("dflt"))
+        {
+            rDefaultFontFeatures.push_back(rFeature);
+            aFeaturesString += vcl::font::featureCodeAsString(rFeature.m_aID.m_aFeatureCode) + " ";
+        }
+    }
+
+    CPPUNIT_ASSERT_EQUAL(size_t(53), rDefaultFontFeatures.size());
+
+    OUString aExpectedFeaturesString = "c2sc case dlig fina frac hlig liga lnum "
+                                       "locl onum pnum sa01 sa02 sa03 sa04 sa05 "
+                                       "sa06 sa07 sa08 salt sinf smcp ss01 ss02 "
+                                       "ss03 sups tnum zero ingl cpsp lith litt "
+                                       "itlc para algn arti circ dash dbls foot "
+                                       "frsp grkn hang lng minu nfsp name quot "
+                                       "texm thou vari caps ligc ";
+
+    CPPUNIT_ASSERT_EQUAL(aExpectedFeaturesString, aFeaturesString);
+
+    // Check C2SC feature
+    {
+        vcl::font::Feature& rFeature = rDefaultFontFeatures[0];
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("c2sc"), rFeature.m_aID.m_aFeatureCode);
+
+        vcl::font::FeatureDefinition& rFracFeatureDefinition = rFeature.m_aDefinition;
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("c2sc"), rFracFeatureDefinition.getCode());
+        CPPUNIT_ASSERT(!rFracFeatureDefinition.getDescription().isEmpty());
+        CPPUNIT_ASSERT_EQUAL(vcl::font::FeatureParameterType::BOOL,
+                             rFracFeatureDefinition.getType());
+
+        CPPUNIT_ASSERT_EQUAL(size_t(0), rFracFeatureDefinition.getEnumParameters().size());
+    }
+
+    // Check FRAC feature
+    {
+        vcl::font::Feature& rFeature = rDefaultFontFeatures[4];
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("frac"), rFeature.m_aID.m_aFeatureCode);
+
+        vcl::font::FeatureDefinition& rFracFeatureDefinition = rFeature.m_aDefinition;
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("frac"), rFracFeatureDefinition.getCode());
+        CPPUNIT_ASSERT(!rFracFeatureDefinition.getDescription().isEmpty());
+        CPPUNIT_ASSERT_EQUAL(vcl::font::FeatureParameterType::ENUM,
+                             rFracFeatureDefinition.getType());
+
+        CPPUNIT_ASSERT_EQUAL(size_t(3), rFracFeatureDefinition.getEnumParameters().size());
+
+        vcl::font::FeatureParameter const& rParameter1
+            = rFracFeatureDefinition.getEnumParameters()[0];
+        CPPUNIT_ASSERT_EQUAL(uint32_t(0), rParameter1.getCode());
+        CPPUNIT_ASSERT(!rParameter1.getDescription().isEmpty());
+
+        vcl::font::FeatureParameter const& rParameter2
+            = rFracFeatureDefinition.getEnumParameters()[1];
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), rParameter2.getCode());
+        CPPUNIT_ASSERT(!rParameter2.getDescription().isEmpty());
+
+        vcl::font::FeatureParameter const& rParameter3
+            = rFracFeatureDefinition.getEnumParameters()[2];
+        CPPUNIT_ASSERT_EQUAL(uint32_t(2), rParameter3.getCode());
+        CPPUNIT_ASSERT(!rParameter2.getDescription().isEmpty());
+    }
+
+    aVDev.disposeAndClear();
+#endif // HAVE_MORE_FONTS
+}
+
+void FontFeatureTest::testParseFeature()
+{
+    { // No font features specified
+        vcl::font::FeatureParser aParser("Font name with no features");
+        CPPUNIT_ASSERT_EQUAL(size_t(0), aParser.getFeatures().size());
+    }
+    { // One feature specified, no value
+        vcl::font::FeatureParser aParser("Font name:abcd");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+    }
+    { // One feature specified, explicit value
+        vcl::font::FeatureParser aParser("Font name:abcd=5");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(5), aFeatures[0].m_nValue);
+    }
+    { // One feature specified, explicit zero value
+        vcl::font::FeatureParser aParser("Font name:abcd=0");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(0), aFeatures[0].m_nValue);
+    }
+    { // One feature specified, using plus prefix
+        vcl::font::FeatureParser aParser("Font name:+abcd");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+    }
+    { // One feature specified, using minus prefix
+        vcl::font::FeatureParser aParser("Font name:-abcd");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(0), aFeatures[0].m_nValue);
+    }
+    { // One feature specified, with empty character range
+        vcl::font::FeatureParser aParser("Font name:abcd[]");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(0), aFeatures[0].m_nStart);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(-1), aFeatures[0].m_nEnd);
+    }
+    { // One feature specified, with empty character range
+        vcl::font::FeatureParser aParser("Font name:abcd[:]");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(0), aFeatures[0].m_nStart);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(-1), aFeatures[0].m_nEnd);
+    }
+    { // One feature specified, with start character range
+        vcl::font::FeatureParser aParser("Font name:abcd[3:]");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(3), aFeatures[0].m_nStart);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(-1), aFeatures[0].m_nEnd);
+    }
+    { // One feature specified, with end character range
+        vcl::font::FeatureParser aParser("Font name:abcd[:3]");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(0), aFeatures[0].m_nStart);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(3), aFeatures[0].m_nEnd);
+    }
+    { // One feature specified, with character range
+        vcl::font::FeatureParser aParser("Font name:abcd[3:6]");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(3), aFeatures[0].m_nStart);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(6), aFeatures[0].m_nEnd);
+    }
+    { // One feature specified, with character range
+        vcl::font::FeatureParser aParser("Font name:abcd[3]");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(3), aFeatures[0].m_nStart);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(4), aFeatures[0].m_nEnd);
+    }
+    { // One feature specified, with character range and value
+        vcl::font::FeatureParser aParser("Font name:abcd[3:6]=2");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(2), aFeatures[0].m_nValue);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(3), aFeatures[0].m_nStart);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(6), aFeatures[0].m_nEnd);
+    }
+    { // One feature specified, with character range and 0 value
+        vcl::font::FeatureParser aParser("Font name:abcd[3:6]=0");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(0), aFeatures[0].m_nValue);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(3), aFeatures[0].m_nStart);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(6), aFeatures[0].m_nEnd);
+    }
+    { // One feature specified, with character range and minus prefix
+        vcl::font::FeatureParser aParser("Font name:-abcd[3:6]");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(0), aFeatures[0].m_nValue);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(3), aFeatures[0].m_nStart);
+        CPPUNIT_ASSERT_EQUAL(static_cast<unsigned int>(6), aFeatures[0].m_nEnd);
+    }
+    { // One feature specified, with CSS on
+        vcl::font::FeatureParser aParser("Font name:\"abcd\" on");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+    }
+    { // One feature specified, with CSS off
+        vcl::font::FeatureParser aParser("Font name:'abcd' off");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(0), aFeatures[0].m_nValue);
+    }
+    { // One feature specified, with CSS value
+        vcl::font::FeatureParser aParser("Font name:\"abcd\" 2");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(2), aFeatures[0].m_nValue);
+    }
+    { // Multiple features specified, no values
+        vcl::font::FeatureParser aParser("Font name:abcd&bcde&efgh");
+        CPPUNIT_ASSERT_EQUAL(size_t(3), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("bcde"), aFeatures[1].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[1].m_nValue);
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("efgh"), aFeatures[2].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[2].m_nValue);
+    }
+    {
+        // Multiple features specified, explicit values
+        // Only 4 char parameter names supported - "toolong" is too long and ignored
+        vcl::font::FeatureParser aParser("Font name:abcd=1&bcde=0&toolong=1&cdef=3");
+        CPPUNIT_ASSERT_EQUAL(size_t(3), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("bcde"), aFeatures[1].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(0), aFeatures[1].m_nValue);
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("cdef"), aFeatures[2].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(3), aFeatures[2].m_nValue);
+    }
+    {
+        // Special case - "lang" is parsed specially and access separately not as a feature.
+
+        vcl::font::FeatureParser aParser("Font name:abcd=1&lang=slo");
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aParser.getFeatures().size());
+        auto aFeatures = aParser.getFeatures();
+
+        CPPUNIT_ASSERT_EQUAL(vcl::font::featureCode("abcd"), aFeatures[0].m_nTag);
+        CPPUNIT_ASSERT_EQUAL(uint32_t(1), aFeatures[0].m_nValue);
+
+        CPPUNIT_ASSERT_EQUAL(OUString("slo"), aParser.getLanguage());
+    }
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(FontFeatureTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/GraphicDescriptorTest.cxx b/vcl/qa/cppunit/GraphicDescriptorTest.cxx
new file mode 100644
index 000000000..4ee5e96ed
--- /dev/null
+++ b/vcl/qa/cppunit/GraphicDescriptorTest.cxx
@@ -0,0 +1,103 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+
+#include <com/sun/star/uno/Sequence.hxx>
+#include <com/sun/star/beans/PropertyValue.hpp>
+
+#include <vcl/graphicfilter.hxx>
+#include <tools/stream.hxx>
+
+using namespace css;
+
+namespace
+{
+class GraphicDescriptorTest : public CppUnit::TestFixture
+{
+    void testDetectPNG();
+    void testDetectJPG();
+    void testDetectGIF();
+
+    CPPUNIT_TEST_SUITE(GraphicDescriptorTest);
+    CPPUNIT_TEST(testDetectPNG);
+    CPPUNIT_TEST(testDetectJPG);
+    CPPUNIT_TEST(testDetectGIF);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+BitmapEx createBitmap()
+{
+    Bitmap aBitmap(Size(100, 100), 24);
+    aBitmap.Erase(COL_LIGHTRED);
+
+    return BitmapEx(aBitmap);
+}
+
+void createBitmapAndExportForType(SvStream& rStream, OUString const& sType)
+{
+    BitmapEx aBitmapEx = createBitmap();
+
+    uno::Sequence<beans::PropertyValue> aFilterData;
+    GraphicFilter& rGraphicFilter = GraphicFilter::GetGraphicFilter();
+    sal_uInt16 nFilterFormat = rGraphicFilter.GetExportFormatNumberForShortName(sType);
+    rGraphicFilter.ExportGraphic(aBitmapEx, "none", rStream, nFilterFormat, &aFilterData);
+
+    rStream.Seek(STREAM_SEEK_TO_BEGIN);
+}
+
+void GraphicDescriptorTest::testDetectPNG()
+{
+    SvMemoryStream aStream;
+    createBitmapAndExportForType(aStream, "png");
+
+    GraphicDescriptor aDescriptor(aStream, nullptr);
+    aDescriptor.Detect(true);
+
+    CPPUNIT_ASSERT_EQUAL(GraphicFileFormat::PNG, aDescriptor.GetFileFormat());
+
+    CPPUNIT_ASSERT_EQUAL(100L, aDescriptor.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(100L, aDescriptor.GetSizePixel().Height());
+}
+
+void GraphicDescriptorTest::testDetectJPG()
+{
+    SvMemoryStream aStream;
+    createBitmapAndExportForType(aStream, "jpg");
+
+    GraphicDescriptor aDescriptor(aStream, nullptr);
+    aDescriptor.Detect(true);
+
+    CPPUNIT_ASSERT_EQUAL(GraphicFileFormat::JPG, aDescriptor.GetFileFormat());
+
+    CPPUNIT_ASSERT_EQUAL(100L, aDescriptor.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(100L, aDescriptor.GetSizePixel().Height());
+}
+
+void GraphicDescriptorTest::testDetectGIF()
+{
+    SvMemoryStream aStream;
+    createBitmapAndExportForType(aStream, "gif");
+
+    GraphicDescriptor aDescriptor(aStream, nullptr);
+    aDescriptor.Detect(true);
+
+    CPPUNIT_ASSERT_EQUAL(GraphicFileFormat::GIF, aDescriptor.GetFileFormat());
+
+    CPPUNIT_ASSERT_EQUAL(100L, aDescriptor.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(100L, aDescriptor.GetSizePixel().Height());
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(GraphicDescriptorTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/GraphicFormatDetectorTest.cxx b/vcl/qa/cppunit/GraphicFormatDetectorTest.cxx
new file mode 100644
index 000000000..1ce516bf5
--- /dev/null
+++ b/vcl/qa/cppunit/GraphicFormatDetectorTest.cxx
@@ -0,0 +1,416 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/extensions/HelperMacros.h>
+#include <unotest/bootstrapfixturebase.hxx>
+
+#include <graphic/GraphicFormatDetector.hxx>
+#include <graphic/DetectorTools.hxx>
+
+#include <tools/stream.hxx>
+
+using namespace css;
+
+namespace
+{
+class GraphicFormatDetectorTest : public test::BootstrapFixtureBase
+{
+    OUString getFullUrl(const OUString& sFileName)
+    {
+        return m_directories.getURLFromSrc("/vcl/qa/cppunit/data/") + sFileName;
+    }
+
+    void testDetectMET();
+    void testDetectBMP();
+    void testDetectWMF();
+    void testDetectPCX();
+    void testDetectJPG();
+    void testDetectPNG();
+    void testDetectGIF();
+    void testDetectPSD();
+    void testDetectTGA();
+    void testDetectTIF();
+    void testDetectXBM();
+    void testDetectXPM();
+    void testDetectSVG();
+    void testDetectSVGZ();
+    void testDetectPDF();
+    void testDetectEPS();
+    void testMatchArray();
+    void testCheckArrayForMatchingStrings();
+
+    CPPUNIT_TEST_SUITE(GraphicFormatDetectorTest);
+    CPPUNIT_TEST(testDetectMET);
+    CPPUNIT_TEST(testDetectBMP);
+    CPPUNIT_TEST(testDetectWMF);
+    CPPUNIT_TEST(testDetectPCX);
+    CPPUNIT_TEST(testDetectJPG);
+    CPPUNIT_TEST(testDetectPNG);
+    CPPUNIT_TEST(testDetectGIF);
+    CPPUNIT_TEST(testDetectPSD);
+    CPPUNIT_TEST(testDetectTGA);
+    CPPUNIT_TEST(testDetectTIF);
+    CPPUNIT_TEST(testDetectXBM);
+    CPPUNIT_TEST(testDetectXPM);
+    CPPUNIT_TEST(testDetectSVG);
+    CPPUNIT_TEST(testDetectSVGZ);
+    CPPUNIT_TEST(testDetectPDF);
+    CPPUNIT_TEST(testDetectEPS);
+    CPPUNIT_TEST(testMatchArray);
+    CPPUNIT_TEST(testCheckArrayForMatchingStrings);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void GraphicFormatDetectorTest::testDetectMET()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.met"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "MET");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkMET());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("MET"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectBMP()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.bmp"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "BMP");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkBMP());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("BMP"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectWMF()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.wmf"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "WMF");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkWMForEMF());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("WMF"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectPCX()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.pcx"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "PCX");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkPCX());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("PCX"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectJPG()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.jpg"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "JPG");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkJPG());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("JPG"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectPNG()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.png"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "PNG");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkPNG());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("PNG"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectGIF()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.gif"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "GIF");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkGIF());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("GIF"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectPSD()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.psd"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "PSD");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkPSD());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("PSD"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectTGA()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.tga"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "TGA");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkTGA());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension("TGA"); // detection is based on extension only
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("TGA"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectTIF()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.tif"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "TIF");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkTIF());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("TIF"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectXBM()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.xbm"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "XBM");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkXBM());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("XBM"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectXPM()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.xpm"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "XPM");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkXPM());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("XPM"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectSVG()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.svg"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "SVG");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkSVG());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("SVG"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectSVGZ()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.svgz"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "SVG");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkSVG());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("SVG"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectPDF()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.pdf"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "PDF");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkPDF());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("PDF"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testDetectEPS()
+{
+    SvFileStream aFileStream(getFullUrl("TypeDetectionExample.eps"), StreamMode::READ);
+    vcl::GraphicFormatDetector aDetector(aFileStream, "EPS");
+
+    CPPUNIT_ASSERT(aDetector.detect());
+    CPPUNIT_ASSERT(aDetector.checkEPS());
+
+    aFileStream.Seek(aDetector.mnStreamPosition);
+
+    OUString rFormatExtension;
+    CPPUNIT_ASSERT(ImpPeekGraphicFormat(aFileStream, rFormatExtension, false));
+    CPPUNIT_ASSERT_EQUAL(OUString("EPS"), rFormatExtension);
+}
+
+void GraphicFormatDetectorTest::testMatchArray()
+{
+    std::string aString("<?xml version=\"1.0\" standalone=\"no\"?>\n"
+                        "<svg width=\"5cm\" height=\"4cm\" version=\"1.1\"\n"
+                        "xmlns=\"http://www.w3.org/2000/svg\">\n"
+                        "</svg>");
+
+    const char* pCompleteStringPointer = aString.c_str();
+    const char* pMatchPointer;
+    int nCheckSize = aString.size();
+
+    // Check beginning of the input string
+    pMatchPointer = vcl::matchArrayWithString(pCompleteStringPointer, nCheckSize, "<?xml");
+    CPPUNIT_ASSERT(pMatchPointer != nullptr);
+    CPPUNIT_ASSERT_EQUAL(0, int(pMatchPointer - pCompleteStringPointer));
+    CPPUNIT_ASSERT_EQUAL(true, OString(pMatchPointer).startsWith("<?xml"));
+
+    // Check middle of the input string
+    pMatchPointer = vcl::matchArrayWithString(aString.c_str(), nCheckSize, "version");
+    CPPUNIT_ASSERT(pMatchPointer != nullptr);
+    CPPUNIT_ASSERT_EQUAL(6, int(pMatchPointer - pCompleteStringPointer));
+    CPPUNIT_ASSERT_EQUAL(true, OString(pMatchPointer).startsWith("version"));
+
+    pMatchPointer = vcl::matchArrayWithString(aString.c_str(), nCheckSize, "<svg");
+    CPPUNIT_ASSERT(pMatchPointer != nullptr);
+    CPPUNIT_ASSERT_EQUAL(38, int(pMatchPointer - pCompleteStringPointer));
+    CPPUNIT_ASSERT_EQUAL(true, OString(pMatchPointer).startsWith("<svg"));
+
+    // Check end of the input string
+    pMatchPointer = vcl::matchArrayWithString(aString.c_str(), nCheckSize, "/svg>");
+    CPPUNIT_ASSERT(pMatchPointer != nullptr);
+    CPPUNIT_ASSERT_EQUAL(119, int(pMatchPointer - pCompleteStringPointer));
+    CPPUNIT_ASSERT_EQUAL(true, OString(pMatchPointer).startsWith("/svg>"));
+
+    // Check that non-existing search string
+    pMatchPointer = vcl::matchArrayWithString(aString.c_str(), nCheckSize, "none");
+    CPPUNIT_ASSERT(pMatchPointer == nullptr);
+}
+
+void GraphicFormatDetectorTest::testCheckArrayForMatchingStrings()
+{
+    std::string aString("<?xml version=\"1.0\" standalone=\"no\"?>\n"
+                        "<svg width=\"5cm\" height=\"4cm\" version=\"1.1\"\n"
+                        "xmlns=\"http://www.w3.org/2000/svg\">\n"
+                        "</svg>");
+    const char* pCompleteStringPointer = aString.c_str();
+    int nCheckSize = aString.size();
+    bool bResult;
+
+    // check beginning string
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize, { "<?xml" });
+    CPPUNIT_ASSERT_EQUAL(true, bResult);
+
+    // check ending string
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize, { "/svg>" });
+    CPPUNIT_ASSERT_EQUAL(true, bResult);
+
+    // check middle string
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize, { "version" });
+    CPPUNIT_ASSERT_EQUAL(true, bResult);
+
+    // check beginning and then ending string
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize,
+                                                { "<?xml", "/svg>" });
+    CPPUNIT_ASSERT_EQUAL(true, bResult);
+
+    // check ending and then beginning string
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize,
+                                                { "/svg>", "<?xml" });
+    CPPUNIT_ASSERT_EQUAL(false, bResult);
+
+    // check middle strings
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize,
+                                                { "version", "<svg" });
+    CPPUNIT_ASSERT_EQUAL(true, bResult);
+
+    // check beginning, middle and ending strings
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize,
+                                                { "<?xml", "version", "<svg", "/svg>" });
+    CPPUNIT_ASSERT_EQUAL(true, bResult);
+
+    // check non-existing
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize, { "none" });
+    CPPUNIT_ASSERT_EQUAL(false, bResult);
+
+    // check non-existing on the beginning
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize,
+                                                { "none", "version", "<svg", "/svg>" });
+    CPPUNIT_ASSERT_EQUAL(false, bResult);
+
+    // check non-existing on the end
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize,
+                                                { "<?xml", "version", "<svg", "none" });
+    CPPUNIT_ASSERT_EQUAL(false, bResult);
+
+    // check non-existing after the end
+    bResult = vcl::checkArrayForMatchingStrings(pCompleteStringPointer, nCheckSize,
+                                                { "<?xml", "/svg>", "none" });
+    CPPUNIT_ASSERT_EQUAL(false, bResult);
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(GraphicFormatDetectorTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/GraphicNativeMetadataTest.cxx b/vcl/qa/cppunit/GraphicNativeMetadataTest.cxx
new file mode 100644
index 000000000..7e5d1adcb
--- /dev/null
+++ b/vcl/qa/cppunit/GraphicNativeMetadataTest.cxx
@@ -0,0 +1,101 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/extensions/HelperMacros.h>
+#include <unotest/bootstrapfixturebase.hxx>
+
+#include <vcl/GraphicNativeMetadata.hxx>
+#include <vcl/graphicfilter.hxx>
+#include <tools/stream.hxx>
+
+using namespace css;
+
+namespace
+{
+class GraphicNativeMetadataTest : public test::BootstrapFixtureBase
+{
+    OUString getFullUrl(const OUString& sFileName)
+    {
+        return m_directories.getURLFromSrc("/vcl/qa/cppunit/data/") + sFileName;
+    }
+
+    void testReadFromGraphic();
+    void testExifRotationJpeg();
+
+    CPPUNIT_TEST_SUITE(GraphicNativeMetadataTest);
+    CPPUNIT_TEST(testReadFromGraphic);
+    CPPUNIT_TEST(testExifRotationJpeg);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void GraphicNativeMetadataTest::testReadFromGraphic()
+{
+    SvFileStream aFileStream(getFullUrl("Exif1_180.jpg"), StreamMode::READ);
+    GraphicFilter& rGraphicFilter = GraphicFilter::GetGraphicFilter();
+
+    // don't load the graphic, but try to get the metadata
+    Graphic aGraphic = rGraphicFilter.ImportUnloadedGraphic(aFileStream);
+
+    {
+        GraphicNativeMetadata aMetadata;
+        aMetadata.read(aFileStream);
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(1800), aMetadata.getRotation());
+        // just the metadata shouldn't make the graphic available
+        CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+    }
+
+    // now load, and it should still work the same
+    {
+        aGraphic.makeAvailable();
+        CPPUNIT_ASSERT_EQUAL(true, aGraphic.isAvailable());
+
+        GraphicNativeMetadata aMetadata;
+        aMetadata.read(aFileStream);
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(1800), aMetadata.getRotation());
+    }
+}
+
+void GraphicNativeMetadataTest::testExifRotationJpeg()
+{
+    {
+        // No rotation in metadata
+        SvFileStream aFileStream(getFullUrl("Exif1.jpg"), StreamMode::READ);
+        GraphicNativeMetadata aMetadata;
+        aMetadata.read(aFileStream);
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(0), aMetadata.getRotation());
+    }
+    {
+        // Rotation 90 degree clock-wise = 270 degree counter-clock-wise
+        SvFileStream aFileStream(getFullUrl("Exif1_090CW.jpg"), StreamMode::READ);
+        GraphicNativeMetadata aMetadata;
+        aMetadata.read(aFileStream);
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(2700), aMetadata.getRotation());
+    }
+    {
+        // Rotation 180 degree
+        SvFileStream aFileStream(getFullUrl("Exif1_180.jpg"), StreamMode::READ);
+        GraphicNativeMetadata aMetadata;
+        aMetadata.read(aFileStream);
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(1800), aMetadata.getRotation());
+    }
+    {
+        // Rotation 270 degree clock-wise = 90 degree counter-clock-wise
+        SvFileStream aFileStream(getFullUrl("Exif1_270CW.jpg"), StreamMode::READ);
+        GraphicNativeMetadata aMetadata;
+        aMetadata.read(aFileStream);
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(900), aMetadata.getRotation());
+    }
+}
+
+} // anonymous namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(GraphicNativeMetadataTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/GraphicTest.cxx b/vcl/qa/cppunit/GraphicTest.cxx
new file mode 100644
index 000000000..6a70ba921
--- /dev/null
+++ b/vcl/qa/cppunit/GraphicTest.cxx
@@ -0,0 +1,435 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <sal/config.h>
+#include <config_oox.h>
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+#include <cppunit/plugin/TestPlugIn.h>
+
+#include <com/sun/star/beans/PropertyValue.hpp>
+
+#include <vcl/bitmapaccess.hxx>
+#include <vcl/graph.hxx>
+#include <vcl/graphicfilter.hxx>
+#include <tools/stream.hxx>
+#include <unotest/directories.hxx>
+#include <comphelper/DirectoryHelper.hxx>
+#include <comphelper/hash.hxx>
+#include <unotools/ucbstreamhelper.hxx>
+
+#include <impgraph.hxx>
+
+#if USE_TLS_NSS
+#include <nss.h>
+#endif
+
+using namespace css;
+
+namespace
+{
+class GraphicTest : public CppUnit::TestFixture
+{
+public:
+    ~GraphicTest();
+
+private:
+    void testUnloadedGraphic();
+    void testUnloadedGraphicLoading();
+    void testUnloadedGraphicWmf();
+    void testUnloadedGraphicAlpha();
+    void testUnloadedGraphicSizeUnit();
+    void testSwapping();
+    void testSwappingVectorGraphic();
+
+    CPPUNIT_TEST_SUITE(GraphicTest);
+    CPPUNIT_TEST(testUnloadedGraphic);
+    CPPUNIT_TEST(testUnloadedGraphicLoading);
+    CPPUNIT_TEST(testUnloadedGraphicWmf);
+    CPPUNIT_TEST(testUnloadedGraphicAlpha);
+    CPPUNIT_TEST(testUnloadedGraphicSizeUnit);
+    CPPUNIT_TEST(testSwapping);
+    CPPUNIT_TEST(testSwappingVectorGraphic);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+GraphicTest::~GraphicTest()
+{
+#if USE_TLS_NSS
+    NSS_Shutdown();
+#endif
+}
+
+BitmapEx createBitmap(bool alpha = false)
+{
+    Bitmap aBitmap(Size(120, 100), 24);
+    aBitmap.Erase(COL_LIGHTRED);
+
+    aBitmap.SetPrefSize(Size(6000, 5000));
+    aBitmap.SetPrefMapMode(MapMode(MapUnit::Map100thMM));
+
+    if (alpha)
+    {
+        sal_uInt8 uAlphaValue = 0x80;
+        AlphaMask aAlphaMask(Size(120, 100), &uAlphaValue);
+
+        return BitmapEx(aBitmap, aAlphaMask);
+    }
+    else
+    {
+        return BitmapEx(aBitmap);
+    }
+}
+
+void createBitmapAndExportForType(SvStream& rStream, OUString const& sType, bool alpha)
+{
+    BitmapEx aBitmapEx = createBitmap(alpha);
+
+    uno::Sequence<beans::PropertyValue> aFilterData;
+    GraphicFilter& rGraphicFilter = GraphicFilter::GetGraphicFilter();
+    sal_uInt16 nFilterFormat = rGraphicFilter.GetExportFormatNumberForShortName(sType);
+    rGraphicFilter.ExportGraphic(aBitmapEx, "none", rStream, nFilterFormat, &aFilterData);
+
+    rStream.Seek(STREAM_SEEK_TO_BEGIN);
+}
+
+Graphic makeUnloadedGraphic(OUString const& sType, bool alpha = false)
+{
+    SvMemoryStream aStream;
+    GraphicFilter& rGraphicFilter = GraphicFilter::GetGraphicFilter();
+    createBitmapAndExportForType(aStream, sType, alpha);
+    return rGraphicFilter.ImportUnloadedGraphic(aStream);
+}
+
+std::string toHexString(const std::vector<unsigned char>& a)
+{
+    std::stringstream aStrm;
+    for (auto& i : a)
+    {
+        aStrm << std::setw(2) << std::setfill('0') << std::hex << static_cast<int>(i);
+    }
+
+    return aStrm.str();
+}
+
+std::unique_ptr<SvStream> createStream(OUString const& rSwapFileURL)
+{
+    std::unique_ptr<SvStream> xStream;
+
+    try
+    {
+        xStream = ::utl::UcbStreamHelper::CreateStream(
+            rSwapFileURL, StreamMode::READWRITE | StreamMode::SHARE_DENYWRITE);
+    }
+    catch (const css::uno::Exception&)
+    {
+    }
+
+    return xStream;
+}
+
+std::vector<unsigned char> calculateHash(std::unique_ptr<SvStream>& rStream)
+{
+    comphelper::Hash aHashEngine(comphelper::HashType::SHA1);
+    const sal_uInt32 nSize(rStream->remainingSize());
+    std::vector<sal_uInt8> aData(nSize);
+    aHashEngine.update(aData.data(), nSize);
+    return aHashEngine.finalize();
+}
+
+bool checkBitmap(Graphic& rGraphic)
+{
+    bool bResult = true;
+
+    Bitmap aBitmap(rGraphic.GetBitmapEx().GetBitmap());
+    {
+        Bitmap::ScopedReadAccess pReadAccess(aBitmap);
+        for (long y = 0; y < rGraphic.GetSizePixel().Height(); y++)
+        {
+            for (long x = 0; x < rGraphic.GetSizePixel().Width(); x++)
+            {
+                if (pReadAccess->HasPalette())
+                {
+                    sal_uInt32 nIndex = pReadAccess->GetPixelIndex(y, x);
+                    Color aColor = pReadAccess->GetPaletteColor(nIndex);
+                    bResult &= (aColor == Color(0xff, 0x00, 0x00));
+                }
+                else
+                {
+                    Color aColor = pReadAccess->GetPixel(y, x);
+                    bResult &= (aColor == Color(0xff, 0x00, 0x00));
+                }
+            }
+        }
+    }
+
+    return bResult;
+}
+
+char const DATA_DIRECTORY[] = "/vcl/qa/cppunit/data/";
+
+void GraphicTest::testUnloadedGraphic()
+{
+    // make unloaded test graphic
+    Graphic aGraphic = makeUnloadedGraphic("png");
+    Graphic aGraphic2 = aGraphic;
+
+    // check available
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic2.isAvailable());
+
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic2.makeAvailable());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.isAvailable());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic2.isAvailable());
+
+    // check GetSizePixel doesn't load graphic
+    aGraphic = makeUnloadedGraphic("png");
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+    CPPUNIT_ASSERT_EQUAL(120L, aGraphic.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(100L, aGraphic.GetSizePixel().Height());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+
+    // check GetPrefSize doesn't load graphic
+    CPPUNIT_ASSERT_EQUAL(6000L, aGraphic.GetPrefSize().Width());
+    CPPUNIT_ASSERT_EQUAL(5000L, aGraphic.GetPrefSize().Height());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+
+    // check GetSizeBytes loads graphic
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+    CPPUNIT_ASSERT(aGraphic.GetSizeBytes() > 0);
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.isAvailable());
+
+    //check Type
+    aGraphic = makeUnloadedGraphic("png");
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+    CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aGraphic.GetType());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.makeAvailable());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.isAvailable());
+    CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aGraphic.GetType());
+}
+
+void GraphicTest::testUnloadedGraphicLoading()
+{
+    const OUString aFormats[] = { "png", "gif", "jpg" };
+
+    for (OUString const& sFormat : aFormats)
+    {
+        Graphic aGraphic = makeUnloadedGraphic(sFormat);
+
+        // check available
+        CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+        CPPUNIT_ASSERT_EQUAL(120L, aGraphic.GetSizePixel().Width());
+        CPPUNIT_ASSERT_EQUAL(100L, aGraphic.GetSizePixel().Height());
+        CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+        CPPUNIT_ASSERT(aGraphic.GetSizeBytes() > 0);
+        CPPUNIT_ASSERT_EQUAL(true, aGraphic.isAvailable());
+
+        if (sFormat != "jpg")
+            CPPUNIT_ASSERT_EQUAL(true, checkBitmap(aGraphic));
+    }
+}
+
+void GraphicTest::testUnloadedGraphicWmf()
+{
+    // Create some in-memory WMF data, set its own preferred size to 99x99.
+    BitmapEx aBitmapEx = createBitmap();
+    SvMemoryStream aStream;
+    GraphicFilter& rGraphicFilter = GraphicFilter::GetGraphicFilter();
+    sal_uInt16 nFilterFormat = rGraphicFilter.GetExportFormatNumberForShortName("wmf");
+    Graphic aGraphic(aBitmapEx);
+    aGraphic.SetPrefSize(Size(99, 99));
+    aGraphic.SetPrefMapMode(MapMode(MapUnit::Map100thMM));
+    rGraphicFilter.ExportGraphic(aGraphic, "none", aStream, nFilterFormat);
+    aStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+    // Now lazy-load this WMF data, with a custom preferred size of 42x42.
+    Size aMtfSize100(42, 42);
+    aGraphic = rGraphicFilter.ImportUnloadedGraphic(aStream, 0, &aMtfSize100);
+    aGraphic.makeAvailable();
+
+    // Without the accompanying fix in place, this test would have failed with:
+    // - Expected: 42x42
+    // - Actual  : 99x99
+    // i.e. the custom preferred size was lost after lazy-load.
+    CPPUNIT_ASSERT_EQUAL(Size(42, 42), aGraphic.GetPrefSize());
+}
+
+void GraphicTest::testUnloadedGraphicAlpha()
+{
+    // make unloaded test graphic with alpha
+    Graphic aGraphic = makeUnloadedGraphic("png", true);
+
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.IsAlpha());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.IsTransparent());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+
+    // make unloaded test graphic without alpha
+    aGraphic = makeUnloadedGraphic("png", false);
+
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.IsAlpha());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.IsTransparent());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+}
+
+void GraphicTest::testUnloadedGraphicSizeUnit()
+{
+    GraphicFilter& rGraphicFilter = GraphicFilter::GetGraphicFilter();
+    test::Directories aDirectories;
+    OUString aURL = aDirectories.getURLFromSrc(DATA_DIRECTORY) + "inch-size.emf";
+    Size aMtfSize100(42, 42);
+    SvFileStream aStream(aURL, StreamMode::READ);
+    Graphic aGraphic = rGraphicFilter.ImportUnloadedGraphic(aStream, 0, &aMtfSize100);
+    aGraphic.makeAvailable();
+
+    // Without the accompanying fix in place, this test would have failed with:
+    // - Expected: 400x363
+    // - Actual  : 42x42
+    // i.e. a mm100 size was used as a hint and the inch size was set for a non-matching unit.
+    CPPUNIT_ASSERT_EQUAL(Size(400, 363), aGraphic.GetPrefSize());
+}
+
+void GraphicTest::testSwapping()
+{
+    // Prepare Graphic from a PNG image first
+    Graphic aGraphic = makeUnloadedGraphic("png");
+
+    CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aGraphic.GetType());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.makeAvailable());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.isAvailable());
+
+    CPPUNIT_ASSERT_EQUAL(120L, aGraphic.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(100L, aGraphic.GetSizePixel().Height());
+
+    BitmapChecksum aChecksumBeforeSwapping = aGraphic.GetChecksum();
+
+    CPPUNIT_ASSERT_EQUAL(sal_uInt32(319), aGraphic.GetGfxLink().GetDataSize());
+
+    // We loaded the Graphic and made it available
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.ImplGetImpGraphic()->isSwappedOut());
+    // Get the declared byte size of the graphic
+    sal_uLong rByteSize = aGraphic.GetSizeBytes();
+    OUString rSwapFileURL = aGraphic.ImplGetImpGraphic()->getSwapFileURL();
+    CPPUNIT_ASSERT_EQUAL(true, rSwapFileURL.isEmpty());
+
+    // Swapping out
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.ImplGetImpGraphic()->swapOut());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.ImplGetImpGraphic()->isSwappedOut());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+
+    // Byte size doesn't change when we swapped out
+    CPPUNIT_ASSERT_EQUAL(rByteSize, aGraphic.GetSizeBytes());
+
+    // Let's check the swap file
+    rSwapFileURL = aGraphic.ImplGetImpGraphic()->getSwapFileURL();
+    CPPUNIT_ASSERT_EQUAL(true, comphelper::DirectoryHelper::fileExists(rSwapFileURL));
+
+    { // Check the swap file content
+        std::unique_ptr<SvStream> xStream = createStream(rSwapFileURL);
+        CPPUNIT_ASSERT_EQUAL(true, bool(xStream));
+
+        // Check size of the stream
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(445), xStream->remainingSize());
+
+        std::vector<unsigned char> aHash = calculateHash(xStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("304f17d9c56e79b95f6c337dab88709d4f9b61f0"),
+                             toHexString(aHash));
+    }
+
+    // Let's swap in
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.makeAvailable());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.isAvailable());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.ImplGetImpGraphic()->isSwappedOut());
+
+    CPPUNIT_ASSERT_EQUAL(aChecksumBeforeSwapping, aGraphic.GetChecksum());
+
+    // File shouldn't be available anymore
+    CPPUNIT_ASSERT_EQUAL(false, comphelper::DirectoryHelper::fileExists(rSwapFileURL));
+
+    // Check the bitmap
+    CPPUNIT_ASSERT_EQUAL(120L, aGraphic.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(100L, aGraphic.GetSizePixel().Height());
+    CPPUNIT_ASSERT_EQUAL(true, checkBitmap(aGraphic));
+    CPPUNIT_ASSERT_EQUAL(true, checkBitmap(aGraphic));
+}
+
+void GraphicTest::testSwappingVectorGraphic()
+{
+    test::Directories aDirectories;
+    OUString aURL = aDirectories.getURLFromSrc(DATA_DIRECTORY) + "SimpleExample.svg";
+    SvFileStream aStream(aURL, StreamMode::READ);
+    GraphicFilter& rGraphicFilter = GraphicFilter::GetGraphicFilter();
+    Graphic aGraphic = rGraphicFilter.ImportUnloadedGraphic(aStream);
+
+    CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aGraphic.GetType());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+
+    // Load the vector graphic
+    CPPUNIT_ASSERT_EQUAL(true, bool(aGraphic.getVectorGraphicData()));
+    CPPUNIT_ASSERT_EQUAL(sal_uInt32(223),
+                         aGraphic.getVectorGraphicData()->getVectorGraphicDataArrayLength());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.isAvailable());
+    CPPUNIT_ASSERT_EQUAL(sal_uInt32(223), aGraphic.GetGfxLink().GetDataSize());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.isAvailable());
+
+    BitmapChecksum aBitmapChecksumBeforeSwapping = aGraphic.GetBitmapEx().GetChecksum();
+
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.ImplGetImpGraphic()->isSwappedOut());
+
+    // Get the declared byte size of the graphic
+    sal_uLong rByteSize = aGraphic.GetSizeBytes();
+    CPPUNIT_ASSERT_EQUAL(sal_uLong(223), rByteSize);
+    OUString rSwapFileURL = aGraphic.ImplGetImpGraphic()->getSwapFileURL();
+    CPPUNIT_ASSERT_EQUAL(true, rSwapFileURL.isEmpty());
+
+    // Swapping out
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.ImplGetImpGraphic()->swapOut());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.ImplGetImpGraphic()->isSwappedOut());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+
+    // Byte size doesn't change when we swapped out
+    // TODO: In case we don't trigger GetBitmapEx (above) the size is 0
+    CPPUNIT_ASSERT_EQUAL(rByteSize, aGraphic.GetSizeBytes());
+
+    // Let's check the swap file
+    rSwapFileURL = aGraphic.ImplGetImpGraphic()->getSwapFileURL();
+    CPPUNIT_ASSERT_EQUAL(true, comphelper::DirectoryHelper::fileExists(rSwapFileURL));
+
+    { // Check the swap file content
+        std::unique_ptr<SvStream> xStream = createStream(rSwapFileURL);
+        CPPUNIT_ASSERT_EQUAL(true, bool(xStream));
+
+        // Check size of the stream
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(349), xStream->remainingSize());
+
+        std::vector<unsigned char> aHash = calculateHash(xStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("88b4c1c359e3cf7be005fbb46c93ffa6de9dcf4a"),
+                             toHexString(aHash));
+    }
+
+    // Let's swap in
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.isAvailable());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.makeAvailable());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.isAvailable());
+    CPPUNIT_ASSERT_EQUAL(false, aGraphic.ImplGetImpGraphic()->isSwappedOut());
+
+    CPPUNIT_ASSERT_EQUAL(aBitmapChecksumBeforeSwapping, aGraphic.GetBitmapEx().GetChecksum());
+
+    // File shouldn't be available anymore
+    CPPUNIT_ASSERT_EQUAL(false, comphelper::DirectoryHelper::fileExists(rSwapFileURL));
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(GraphicTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/ScanlineToolsTest.cxx b/vcl/qa/cppunit/ScanlineToolsTest.cxx
new file mode 100644
index 000000000..bf053d3bc
--- /dev/null
+++ b/vcl/qa/cppunit/ScanlineToolsTest.cxx
@@ -0,0 +1,224 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+
+#include <bitmap/ScanlineTools.hxx>
+
+namespace
+{
+class ScanlineToolsTest : public CppUnit::TestFixture
+{
+    void ScanlineTransformer_32_ARGB();
+    void ScanlineTransformer_24_BGR();
+    void ScanlineTransformer_8bit_Palette();
+    void ScanlineTransformer_4bit_Palette();
+    void ScanlineTransformer_1bit_Palette();
+
+    CPPUNIT_TEST_SUITE(ScanlineToolsTest);
+    CPPUNIT_TEST(ScanlineTransformer_32_ARGB);
+    CPPUNIT_TEST(ScanlineTransformer_24_BGR);
+    CPPUNIT_TEST(ScanlineTransformer_8bit_Palette);
+    CPPUNIT_TEST(ScanlineTransformer_4bit_Palette);
+    CPPUNIT_TEST(ScanlineTransformer_1bit_Palette);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void ScanlineToolsTest::ScanlineTransformer_32_ARGB()
+{
+    BitmapPalette aPalette;
+    std::unique_ptr<vcl::bitmap::ScanlineTransformer> pScanlineTransformer
+        = vcl::bitmap::getScanlineTransformer(32, aPalette);
+
+    std::vector<sal_uInt8> aScanLine(5 * 4, 0); // 5 * 4 BytesPerPixel
+    pScanlineTransformer->startLine(aScanLine.data());
+
+    std::vector<Color> aColors{
+        Color(0, 10, 250, 120),  Color(50, 30, 230, 110), Color(100, 50, 210, 100),
+        Color(150, 70, 190, 90), Color(200, 90, 170, 80),
+    };
+
+    for (Color const& aColor : aColors)
+    {
+        pScanlineTransformer->writePixel(aColor);
+    }
+
+    std::vector<sal_uInt8> aExpectedBytes{ 0,   10,  250, 120, 50,  30, 230, 110, 100, 50,
+                                           210, 100, 150, 70,  190, 90, 200, 90,  170, 80 };
+
+    for (size_t i = 0; i < aScanLine.size(); ++i)
+    {
+        CPPUNIT_ASSERT_EQUAL(int(aExpectedBytes[i]), int(aScanLine[i]));
+    }
+}
+
+void ScanlineToolsTest::ScanlineTransformer_24_BGR()
+{
+    BitmapPalette aPalette;
+    std::unique_ptr<vcl::bitmap::ScanlineTransformer> pScanlineTransformer
+        = vcl::bitmap::getScanlineTransformer(24, aPalette);
+
+    std::vector<sal_uInt8> aScanLine(5 * 3, 0); // 5 * 3 BytesPerPixel
+    pScanlineTransformer->startLine(aScanLine.data());
+
+    std::vector<Color> aColors{
+        Color(0, 10, 250, 120),  Color(50, 30, 230, 110), Color(100, 50, 210, 100),
+        Color(150, 70, 190, 90), Color(200, 90, 170, 80),
+    };
+
+    for (Color const& aColor : aColors)
+    {
+        pScanlineTransformer->writePixel(aColor);
+    }
+
+    std::vector<sal_uInt8> aExpectedBytes{ 120, 250, 10,  110, 230, 30,  100, 210,
+                                           50,  90,  190, 70,  80,  170, 90 };
+
+    for (size_t i = 0; i < aScanLine.size(); ++i)
+    {
+        CPPUNIT_ASSERT_EQUAL(int(aExpectedBytes[i]), int(aScanLine[i]));
+    }
+}
+
+void ScanlineToolsTest::ScanlineTransformer_8bit_Palette()
+{
+    std::vector<Color> aColors{
+        Color(0, 10, 250, 120),  Color(50, 30, 230, 110), Color(100, 50, 210, 100),
+        Color(150, 70, 190, 90), Color(200, 90, 170, 80),
+    };
+
+    BitmapPalette aPalette(256);
+    for (size_t i = 0; i < aColors.size(); ++i)
+        aPalette[i] = aColors[i];
+
+    std::unique_ptr<vcl::bitmap::ScanlineTransformer> pScanlineTransformer
+        = vcl::bitmap::getScanlineTransformer(8, aPalette);
+
+    std::vector<sal_uInt8> aScanLine(5, 0); // 5 * 1 BytesPerPixel
+    pScanlineTransformer->startLine(aScanLine.data());
+
+    for (Color const& aColor : aColors)
+    {
+        pScanlineTransformer->writePixel(aColor);
+    }
+
+    std::vector<sal_uInt8> aExpectedBytes{ 0, 1, 2, 3, 4 };
+
+    for (size_t i = 0; i < aScanLine.size(); ++i)
+    {
+        CPPUNIT_ASSERT_EQUAL(int(aExpectedBytes[i]), int(aScanLine[i]));
+    }
+
+    pScanlineTransformer->startLine(aScanLine.data());
+
+    for (size_t i = 0; i < aColors.size(); ++i)
+    {
+        Color aColor = pScanlineTransformer->readPixel();
+        CPPUNIT_ASSERT_EQUAL(aColors[i], aColor);
+    }
+}
+
+void ScanlineToolsTest::ScanlineTransformer_4bit_Palette()
+{
+    std::vector<Color> aColors{
+        Color(10, 250, 120), Color(30, 230, 110), Color(50, 210, 100),
+        Color(70, 190, 90),  Color(90, 170, 80),  Color(110, 150, 70),
+    };
+
+    BitmapPalette aPalette(16);
+    for (size_t i = 0; i < aColors.size(); ++i)
+    {
+        aPalette[i] = aColors[i];
+    }
+
+    std::unique_ptr<vcl::bitmap::ScanlineTransformer> pScanlineTransformer
+        = vcl::bitmap::getScanlineTransformer(4, aPalette);
+
+    std::vector<sal_uInt8> aScanLine(3, 0); // 6 * 0.5 BytesPerPixel
+    pScanlineTransformer->startLine(aScanLine.data());
+
+    for (Color const& aColor : aColors)
+    {
+        pScanlineTransformer->writePixel(aColor);
+    }
+
+    std::vector<sal_uInt8> aExpectedBytes{ 0x01, 0x23, 0x45 };
+
+    for (size_t i = 0; i < aScanLine.size(); ++i)
+    {
+        CPPUNIT_ASSERT_EQUAL(int(aExpectedBytes[i]), int(aScanLine[i]));
+    }
+
+    pScanlineTransformer->startLine(aScanLine.data());
+
+    for (size_t i = 0; i < aColors.size(); ++i)
+    {
+        Color aColor = pScanlineTransformer->readPixel();
+        CPPUNIT_ASSERT_EQUAL(aColors[i], aColor);
+    }
+}
+
+void ScanlineToolsTest::ScanlineTransformer_1bit_Palette()
+{
+    std::vector<Color> aColors{
+        Color(10, 250, 120), Color(30, 230, 110), Color(50, 210, 100), Color(70, 190, 90),
+        Color(90, 170, 80),  Color(110, 150, 70), Color(130, 130, 60), Color(150, 110, 50),
+        Color(170, 90, 40),  Color(190, 70, 30),  Color(210, 50, 20),  Color(230, 30, 10),
+        Color(250, 10, 0),
+    };
+
+    BitmapPalette aPalette(2);
+    aPalette[0] = Color(10, 250, 120);
+    aPalette[1] = Color(110, 150, 70);
+
+    std::unique_ptr<vcl::bitmap::ScanlineTransformer> pScanlineTransformer
+        = vcl::bitmap::getScanlineTransformer(1, aPalette);
+
+    std::vector<sal_uInt8> aScanLine(2, 0); // 13 * 1/8 BytesPerPixel
+    pScanlineTransformer->startLine(aScanLine.data());
+
+    for (Color const& aColor : aColors)
+    {
+        pScanlineTransformer->writePixel(aColor);
+    }
+
+    std::vector<sal_uInt8> aExpectedBytes{
+        // We expect 3x index 0 and 10x index 1 => 000 111111111
+        0x1f, // 0001 1111
+        0xf8 // 1111 1000
+    };
+
+    for (size_t i = 0; i < aScanLine.size(); ++i)
+    {
+        CPPUNIT_ASSERT_EQUAL(int(aExpectedBytes[i]), int(aScanLine[i]));
+    }
+
+    pScanlineTransformer->startLine(aScanLine.data());
+
+    std::vector<Color> aColorsExpected{
+        Color(10, 250, 120), Color(10, 250, 120), Color(10, 250, 120), Color(110, 150, 70),
+        Color(110, 150, 70), Color(110, 150, 70), Color(110, 150, 70), Color(110, 150, 70),
+        Color(110, 150, 70), Color(110, 150, 70), Color(110, 150, 70), Color(110, 150, 70),
+        Color(110, 150, 70),
+    };
+
+    for (size_t i = 0; i < aColors.size(); ++i)
+    {
+        Color aColor = pScanlineTransformer->readPixel();
+        CPPUNIT_ASSERT_EQUAL(aColorsExpected[i], aColor);
+    }
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(ScanlineToolsTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/TypeSerializerTest.cxx b/vcl/qa/cppunit/TypeSerializerTest.cxx
new file mode 100644
index 000000000..30966700a
--- /dev/null
+++ b/vcl/qa/cppunit/TypeSerializerTest.cxx
@@ -0,0 +1,502 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <sal/config.h>
+#include <config_oox.h>
+#include <config_features.h>
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+#include <cppunit/plugin/TestPlugIn.h>
+
+#include <unotest/directories.hxx>
+#include <vcl/graph.hxx>
+#include <vcl/graphicfilter.hxx>
+#include <vcl/virdev.hxx>
+#include <vcl/gdimtf.hxx>
+#include <comphelper/hash.hxx>
+#include <tools/vcompat.hxx>
+#include <comphelper/fileformat.h>
+
+#include <TypeSerializer.hxx>
+
+#if USE_TLS_NSS
+#include <nss.h>
+#endif
+
+namespace
+{
+constexpr char DATA_DIRECTORY[] = "/vcl/qa/cppunit/data/";
+
+std::vector<unsigned char> calculateHash(SvStream& rStream)
+{
+    rStream.Seek(STREAM_SEEK_TO_BEGIN);
+    comphelper::Hash aHashEngine(comphelper::HashType::SHA1);
+    const sal_uInt32 nSize(rStream.remainingSize());
+    std::vector<sal_uInt8> aData(nSize);
+    aHashEngine.update(aData.data(), nSize);
+    return aHashEngine.finalize();
+}
+
+std::string toHexString(const std::vector<unsigned char>& a)
+{
+    std::stringstream aStrm;
+    for (auto& i : a)
+    {
+        aStrm << std::setw(2) << std::setfill('0') << std::hex << static_cast<int>(i);
+    }
+
+    return aStrm.str();
+}
+
+class TypeSerializerTest : public CppUnit::TestFixture
+{
+public:
+    ~TypeSerializerTest();
+
+private:
+    void testGradient();
+    void testGraphic_Vector();
+    void testGraphic_Bitmap_NoGfxLink();
+    void testGraphic_Animation();
+    void testGraphic_GDIMetaFile();
+
+    CPPUNIT_TEST_SUITE(TypeSerializerTest);
+    CPPUNIT_TEST(testGradient);
+    CPPUNIT_TEST(testGraphic_Vector);
+    CPPUNIT_TEST(testGraphic_Bitmap_NoGfxLink);
+    CPPUNIT_TEST(testGraphic_Animation);
+    CPPUNIT_TEST(testGraphic_GDIMetaFile);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+TypeSerializerTest::~TypeSerializerTest()
+{
+#if USE_TLS_NSS
+    NSS_Shutdown();
+#endif
+}
+
+void TypeSerializerTest::testGradient()
+{
+    Gradient aGradient(GradientStyle::Radial, Color(0xFF, 0x00, 0x00), Color(0x00, 0xFF, 0x00));
+    aGradient.SetAngle(900);
+    aGradient.SetBorder(5);
+    aGradient.SetOfsX(11);
+    aGradient.SetOfsY(12);
+    aGradient.SetStartIntensity(21);
+    aGradient.SetEndIntensity(22);
+    aGradient.SetSteps(30);
+
+    SvMemoryStream aStream;
+    TypeSerializer aSerializer(aStream);
+    aSerializer.writeGradient(aGradient);
+    aStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+    Gradient aReadGradient;
+    aSerializer.readGradient(aReadGradient);
+    CPPUNIT_ASSERT_EQUAL(GradientStyle::Radial, aReadGradient.GetStyle());
+    CPPUNIT_ASSERT_EQUAL(Color(0xFF, 0x00, 0x00), aReadGradient.GetStartColor());
+    CPPUNIT_ASSERT_EQUAL(Color(0x00, 0xFF, 0x00), aReadGradient.GetEndColor());
+    CPPUNIT_ASSERT_EQUAL(sal_uInt16(900), aReadGradient.GetAngle());
+    CPPUNIT_ASSERT_EQUAL(sal_uInt16(5), aReadGradient.GetBorder());
+    CPPUNIT_ASSERT_EQUAL(sal_uInt16(11), aReadGradient.GetOfsX());
+    CPPUNIT_ASSERT_EQUAL(sal_uInt16(12), aReadGradient.GetOfsY());
+    CPPUNIT_ASSERT_EQUAL(sal_uInt16(21), aReadGradient.GetStartIntensity());
+    CPPUNIT_ASSERT_EQUAL(sal_uInt16(22), aReadGradient.GetEndIntensity());
+    CPPUNIT_ASSERT_EQUAL(sal_uInt16(30), aReadGradient.GetSteps());
+}
+
+void TypeSerializerTest::testGraphic_Vector()
+{
+    test::Directories aDirectories;
+    OUString aURL = aDirectories.getURLFromSrc(DATA_DIRECTORY) + "SimpleExample.svg";
+    SvFileStream aStream(aURL, StreamMode::READ);
+    GraphicFilter& rGraphicFilter = GraphicFilter::GetGraphicFilter();
+    Graphic aGraphic = rGraphicFilter.ImportUnloadedGraphic(aStream);
+    aGraphic.makeAvailable();
+    BitmapChecksum aChecksum = aGraphic.getVectorGraphicData()->GetChecksum();
+
+    // Test WriteGraphic - Native Format 5
+    {
+        SvMemoryStream aMemoryStream;
+        aMemoryStream.SetVersion(SOFFICE_FILEFORMAT_50);
+        aMemoryStream.SetCompressMode(SvStreamCompressFlags::NATIVE);
+        WriteGraphic(aMemoryStream, aGraphic);
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(290), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("ee55ab6faa73b61b68bc3d5628d95f0d3c528e2a"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        sal_uInt32 nType;
+        aMemoryStream.ReadUInt32(nType);
+        CPPUNIT_ASSERT_EQUAL(COMPAT_FORMAT('N', 'A', 'T', '5'), nType);
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        ReadGraphic(aMemoryStream, aNewGraphic);
+        CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aNewGraphic.GetType());
+        CPPUNIT_ASSERT_EQUAL(aChecksum, aNewGraphic.getVectorGraphicData()->GetChecksum());
+    }
+
+    // Test WriteGraphic - Normal
+    {
+        SvMemoryStream aMemoryStream;
+        WriteGraphic(aMemoryStream, aGraphic);
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(233), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("c2bed2099ce617f1cc035701de5186f0d43e3064"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        sal_uInt32 nType;
+        aMemoryStream.ReadUInt32(nType);
+        CPPUNIT_ASSERT_EQUAL(createMagic('s', 'v', 'g', '0'), nType);
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        ReadGraphic(aMemoryStream, aNewGraphic);
+        CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aNewGraphic.GetType());
+        CPPUNIT_ASSERT_EQUAL(aChecksum, aNewGraphic.getVectorGraphicData()->GetChecksum());
+    }
+
+    // Test TypeSerializer - Native Format 5
+    {
+        SvMemoryStream aMemoryStream;
+        aMemoryStream.SetVersion(SOFFICE_FILEFORMAT_50);
+        aMemoryStream.SetCompressMode(SvStreamCompressFlags::NATIVE);
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.writeGraphic(aGraphic);
+        }
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(290), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("ee55ab6faa73b61b68bc3d5628d95f0d3c528e2a"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        sal_uInt32 nType;
+        aMemoryStream.ReadUInt32(nType);
+        CPPUNIT_ASSERT_EQUAL(COMPAT_FORMAT('N', 'A', 'T', '5'), nType);
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.readGraphic(aNewGraphic);
+        }
+        CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aNewGraphic.GetType());
+        CPPUNIT_ASSERT_EQUAL(aChecksum, aNewGraphic.getVectorGraphicData()->GetChecksum());
+    }
+
+    // Test TypeSerializer - Normal
+    {
+        SvMemoryStream aMemoryStream;
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.writeGraphic(aGraphic);
+        }
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(233), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("c2bed2099ce617f1cc035701de5186f0d43e3064"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        sal_uInt32 nType;
+        aMemoryStream.ReadUInt32(nType);
+        CPPUNIT_ASSERT_EQUAL(createMagic('s', 'v', 'g', '0'), nType);
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.readGraphic(aNewGraphic);
+        }
+        CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aNewGraphic.GetType());
+        CPPUNIT_ASSERT_EQUAL(aChecksum, aNewGraphic.getVectorGraphicData()->GetChecksum());
+    }
+}
+
+void TypeSerializerTest::testGraphic_Bitmap_NoGfxLink()
+{
+    Bitmap aBitmap(Size(10, 10), 24);
+    aBitmap.Erase(COL_LIGHTGRAYBLUE);
+    BitmapEx aBitmapEx(aBitmap);
+    Graphic aGraphic(aBitmapEx);
+
+    // Test WriteGraphic
+    {
+        SvMemoryStream aMemoryStream;
+        WriteGraphic(aMemoryStream, aGraphic);
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(383), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("da831418499146d51bf245fadf60b9111faa76c2"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        sal_uInt16 nType;
+        aMemoryStream.ReadUInt16(nType);
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(0x4D42), nType); // Magic written with WriteDIBBitmapEx
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        ReadGraphic(aMemoryStream, aNewGraphic);
+        CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aNewGraphic.GetType());
+        CPPUNIT_ASSERT_EQUAL(aBitmapEx.GetChecksum(), aNewGraphic.GetBitmapExRef().GetChecksum());
+    }
+
+    // Test TypeSerializer
+    {
+        SvMemoryStream aMemoryStream;
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.writeGraphic(aGraphic);
+        }
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(383), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("da831418499146d51bf245fadf60b9111faa76c2"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        sal_uInt16 nType;
+        aMemoryStream.ReadUInt16(nType);
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(0x4D42), nType); // Magic written with WriteDIBBitmapEx
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.readGraphic(aNewGraphic);
+        }
+        CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aNewGraphic.GetType());
+        CPPUNIT_ASSERT_EQUAL(aBitmapEx.GetChecksum(), aNewGraphic.GetBitmapExRef().GetChecksum());
+    }
+}
+
+void TypeSerializerTest::testGraphic_Animation()
+{
+    test::Directories aDirectories;
+    OUString aURL = aDirectories.getURLFromSrc(DATA_DIRECTORY) + "123_Numbers.gif";
+    SvFileStream aStream(aURL, StreamMode::READ);
+    GraphicFilter& rGraphicFilter = GraphicFilter::GetGraphicFilter();
+    Graphic aGraphic = rGraphicFilter.ImportUnloadedGraphic(aStream);
+    aGraphic.makeAvailable();
+    CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aGraphic.GetType());
+    CPPUNIT_ASSERT_EQUAL(true, aGraphic.IsAnimated());
+
+    // Test WriteGraphic
+    {
+        SvMemoryStream aMemoryStream;
+        WriteGraphic(aMemoryStream, aGraphic);
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(15167), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("69d0f80832a0aebcbda7ad43ecadf85e99fc1057"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        sal_uInt16 nType;
+        aMemoryStream.ReadUInt16(nType);
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(0x4D42), nType);
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        ReadGraphic(aMemoryStream, aNewGraphic);
+        CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aNewGraphic.GetType());
+        CPPUNIT_ASSERT_EQUAL(true, aNewGraphic.IsAnimated());
+    }
+
+    // Test WriteGraphic - Native Format 5
+    {
+        SvMemoryStream aMemoryStream;
+        aMemoryStream.SetVersion(SOFFICE_FILEFORMAT_50);
+        aMemoryStream.SetCompressMode(SvStreamCompressFlags::NATIVE);
+        WriteGraphic(aMemoryStream, aGraphic);
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(1582), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("da3b9600340fa80a895f2107357e4ab65a9292eb"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        sal_uInt32 nType;
+        aMemoryStream.ReadUInt32(nType);
+        CPPUNIT_ASSERT_EQUAL(COMPAT_FORMAT('N', 'A', 'T', '5'), nType);
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        ReadGraphic(aMemoryStream, aNewGraphic);
+        CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aNewGraphic.GetType());
+        CPPUNIT_ASSERT_EQUAL(true, aNewGraphic.IsAnimated());
+    }
+
+    // Test TypeSerializer
+    {
+        SvMemoryStream aMemoryStream;
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.writeGraphic(aGraphic);
+        }
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(15167), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("69d0f80832a0aebcbda7ad43ecadf85e99fc1057"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        sal_uInt16 nType;
+        aMemoryStream.ReadUInt16(nType);
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(0x4D42), nType);
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.readGraphic(aNewGraphic);
+        }
+        CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aNewGraphic.GetType());
+        CPPUNIT_ASSERT_EQUAL(true, aNewGraphic.IsAnimated());
+    }
+
+    // Test TypeSerializer - Native Format 5
+    {
+        SvMemoryStream aMemoryStream;
+        aMemoryStream.SetVersion(SOFFICE_FILEFORMAT_50);
+        aMemoryStream.SetCompressMode(SvStreamCompressFlags::NATIVE);
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.writeGraphic(aGraphic);
+        }
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(1582), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("da3b9600340fa80a895f2107357e4ab65a9292eb"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        sal_uInt32 nType;
+        aMemoryStream.ReadUInt32(nType);
+        CPPUNIT_ASSERT_EQUAL(COMPAT_FORMAT('N', 'A', 'T', '5'), nType);
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.readGraphic(aNewGraphic);
+        }
+        CPPUNIT_ASSERT_EQUAL(GraphicType::Bitmap, aNewGraphic.GetType());
+        CPPUNIT_ASSERT_EQUAL(true, aNewGraphic.IsAnimated());
+    }
+}
+
+void TypeSerializerTest::testGraphic_GDIMetaFile()
+{
+    GDIMetaFile aGDIMetaFile;
+    {
+        ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+        pVirtualDev->SetConnectMetaFile(&aGDIMetaFile);
+        Size aVDSize(10, 10);
+        pVirtualDev->SetOutputSizePixel(aVDSize);
+        pVirtualDev->SetBackground(Wallpaper(COL_LIGHTRED));
+        pVirtualDev->Erase();
+        pVirtualDev->DrawPixel(Point(4, 4));
+    }
+    Graphic aGraphic(aGDIMetaFile);
+    CPPUNIT_ASSERT_EQUAL(GraphicType::GdiMetafile, aGraphic.GetType());
+
+    // Test WriteGraphic
+    {
+        SvMemoryStream aMemoryStream;
+        WriteGraphic(aMemoryStream, aGraphic);
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(229), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("144c518e5149d61ab4bc34643df820372405d61d"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        char aIdCharArray[7] = { 0, 0, 0, 0, 0, 0, 0 };
+        aMemoryStream.ReadBytes(aIdCharArray, 6);
+        OString sID(aIdCharArray);
+        CPPUNIT_ASSERT_EQUAL(OString("VCLMTF"), sID);
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        ReadGraphic(aMemoryStream, aNewGraphic);
+        CPPUNIT_ASSERT_EQUAL(GraphicType::GdiMetafile, aNewGraphic.GetType());
+    }
+
+    // Test TypeSerializer
+    {
+        SvMemoryStream aMemoryStream;
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.writeGraphic(aGraphic);
+        }
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(229), aMemoryStream.remainingSize());
+        std::vector<unsigned char> aHash = calculateHash(aMemoryStream);
+        CPPUNIT_ASSERT_EQUAL(std::string("144c518e5149d61ab4bc34643df820372405d61d"),
+                             toHexString(aHash));
+
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        char aIdCharArray[7] = { 0, 0, 0, 0, 0, 0, 0 };
+        aMemoryStream.ReadBytes(aIdCharArray, 6);
+        OString sID(aIdCharArray);
+        CPPUNIT_ASSERT_EQUAL(OString("VCLMTF"), sID);
+
+        // Read it back
+        aMemoryStream.Seek(STREAM_SEEK_TO_BEGIN);
+        Graphic aNewGraphic;
+        {
+            TypeSerializer aSerializer(aMemoryStream);
+            aSerializer.readGraphic(aNewGraphic);
+        }
+        CPPUNIT_ASSERT_EQUAL(GraphicType::GdiMetafile, aNewGraphic.GetType());
+    }
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(TypeSerializerTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/app/test_IconThemeInfo.cxx b/vcl/qa/cppunit/app/test_IconThemeInfo.cxx
new file mode 100644
index 000000000..d2e466d89
--- /dev/null
+++ b/vcl/qa/cppunit/app/test_IconThemeInfo.cxx
@@ -0,0 +1,116 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <stdexcept>
+
+#include <rtl/ustring.hxx>
+#include <vcl/IconThemeInfo.hxx>
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+
+using namespace vcl;
+
+class IconThemeInfoTest : public CppUnit::TestFixture
+{
+    void
+    UpperCaseDisplayNameIsReturnedForNonDefaultId();
+
+    void
+    ImagesZipIsNotValid();
+
+    void
+    ImagesColibreZipIsValid();
+
+    void
+    ThemeIdIsDetectedFromFileNameWithUnderscore();
+
+    void
+    ExceptionIsThrownWhenIdCannotBeDetermined1();
+
+    void
+    ExceptionIsThrownWhenIdCannotBeDetermined2();
+
+    // Adds code needed to register the test suite
+    CPPUNIT_TEST_SUITE(IconThemeInfoTest);
+    CPPUNIT_TEST(UpperCaseDisplayNameIsReturnedForNonDefaultId);
+    CPPUNIT_TEST(ThemeIdIsDetectedFromFileNameWithUnderscore);
+    CPPUNIT_TEST(ImagesZipIsNotValid);
+    CPPUNIT_TEST(ImagesColibreZipIsValid);
+    CPPUNIT_TEST(ExceptionIsThrownWhenIdCannotBeDetermined1);
+    CPPUNIT_TEST(ExceptionIsThrownWhenIdCannotBeDetermined2);
+
+    // End of test suite definition
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void
+IconThemeInfoTest::UpperCaseDisplayNameIsReturnedForNonDefaultId()
+{
+    OUString const id("katze");
+    OUString displayName = vcl::IconThemeInfo::ThemeIdToDisplayName(id);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("theme id is properly uppercased", OUString("Katze"), displayName);
+}
+
+void
+IconThemeInfoTest::ImagesZipIsNotValid()
+{
+    bool valid = vcl::IconThemeInfo::UrlCanBeParsed("file://images.zip");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("images.zip is not a valid theme name", false, valid);
+}
+
+void
+IconThemeInfoTest::ImagesColibreZipIsValid()
+{
+    OUString const id("file://images_colibre.zip");
+    bool valid = vcl::IconThemeInfo::UrlCanBeParsed(id);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("images_colibre.zip is a valid theme name", true, valid);
+}
+
+void
+IconThemeInfoTest::ThemeIdIsDetectedFromFileNameWithUnderscore()
+{
+    OUString const fname("images_colibre.zip");
+    OUString sname = vcl::IconThemeInfo::FileNameToThemeId(fname);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("'colibre' theme id is returned for 'images_colibre.zip'", OUString("colibre"), sname);
+}
+
+void
+IconThemeInfoTest::ExceptionIsThrownWhenIdCannotBeDetermined1()
+{
+    bool thrown = false;
+    OUString const fname("images_colibre");
+    try {
+        vcl::IconThemeInfo::FileNameToThemeId(fname);
+    }
+    catch (std::runtime_error&) {
+        thrown = true;
+    }
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Exception was thrown",true, thrown);
+}
+
+void
+IconThemeInfoTest::ExceptionIsThrownWhenIdCannotBeDetermined2()
+{
+    bool thrown = false;
+    OUString const fname("image_colibre.zip");
+    try {
+        vcl::IconThemeInfo::FileNameToThemeId(fname);
+    }
+    catch (std::runtime_error&) {
+        thrown = true;
+    }
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Exception was thrown", true, thrown);
+}
+
+// Put the test suite in the registry
+CPPUNIT_TEST_SUITE_REGISTRATION(IconThemeInfoTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/app/test_IconThemeScanner.cxx b/vcl/qa/cppunit/app/test_IconThemeScanner.cxx
new file mode 100644
index 000000000..f65e70bc6
--- /dev/null
+++ b/vcl/qa/cppunit/app/test_IconThemeScanner.cxx
@@ -0,0 +1,82 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <stdexcept>
+
+#include <rtl/ustring.hxx>
+#include <IconThemeScanner.hxx>
+#include <vcl/IconThemeInfo.hxx>
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+
+class IconThemeScannerTest : public CppUnit::TestFixture
+{
+    void
+    AddedThemeIsFoundById();
+
+    void
+    AddedThemeInfoIsReturned();
+
+    void
+    ExceptionIsThrownIfInvalidInfoIsRequested();
+
+    // Adds code needed to register the test suite
+    CPPUNIT_TEST_SUITE(IconThemeScannerTest);
+    CPPUNIT_TEST(AddedThemeIsFoundById);
+    CPPUNIT_TEST(AddedThemeInfoIsReturned);
+    CPPUNIT_TEST(ExceptionIsThrownIfInvalidInfoIsRequested);
+
+    // End of test suite definition
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void
+IconThemeScannerTest::AddedThemeIsFoundById()
+{
+    vcl::IconThemeScanner scanner;
+    scanner.AddIconThemeByPath("file:://images_katze.zip");
+    OUString id = vcl::IconThemeInfo::FileNameToThemeId("images_katze.zip");
+    bool found = scanner.IconThemeIsInstalled(id);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("icon theme could be added by url", true, found);
+}
+
+void
+IconThemeScannerTest::AddedThemeInfoIsReturned()
+{
+    vcl::IconThemeScanner scanner;
+    OUString theme("file:://images_katze.zip");
+    scanner.AddIconThemeByPath(theme);
+    OUString id = vcl::IconThemeInfo::FileNameToThemeId("images_katze.zip");
+    const vcl::IconThemeInfo& info = scanner.GetIconThemeInfo(id);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("'katze' icon theme is found from id", theme, info.GetUrlToFile());
+}
+
+void
+IconThemeScannerTest::ExceptionIsThrownIfInvalidInfoIsRequested()
+{
+    vcl::IconThemeScanner scanner;
+    scanner.AddIconThemeByPath("file:://images_katze.zip");
+    bool thrown = false;
+    try
+    {
+        scanner.GetIconThemeInfo("hund");
+    }
+    catch (const std::runtime_error&)
+    {
+        thrown = true;
+    }
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Exception is thrown if invalid theme info is requested", true, thrown);
+}
+
+// Put the test suite in the registry
+CPPUNIT_TEST_SUITE_REGISTRATION(IconThemeScannerTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/app/test_IconThemeSelector.cxx b/vcl/qa/cppunit/app/test_IconThemeSelector.cxx
new file mode 100644
index 000000000..69f61c79e
--- /dev/null
+++ b/vcl/qa/cppunit/app/test_IconThemeSelector.cxx
@@ -0,0 +1,183 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <IconThemeSelector.hxx>
+
+#include <vcl/IconThemeInfo.hxx>
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+#include <cppunit/plugin/TestPlugIn.h>
+
+class IconThemeSelectorTest : public CppUnit::TestFixture
+{
+#ifndef _WIN32 //default theme on Windows is Colibre independently from any desktop environment
+    void BreezeIsReturnedForKde5Desktop();
+    void ElementaryIsReturnedForGnomeDesktop();
+    void ThemeIsOverriddenByPreferredTheme();
+    void ThemeIsOverriddenByHighContrastMode();
+    void NotInstalledThemeDoesNotOverride();
+    void InstalledThemeIsFound();
+    void FirstThemeIsReturnedIfRequestedThemeIsNotFound();
+    void FallbackThemeIsReturnedForEmptyInput();
+    void DifferentPreferredThemesAreInequal();
+    void DifferentHighContrastModesAreInequal();
+    static std::vector<vcl::IconThemeInfo> GetFakeInstalledThemes();
+#endif
+
+    // Adds code needed to register the test suite
+    CPPUNIT_TEST_SUITE(IconThemeSelectorTest);
+
+#ifndef _WIN32
+    CPPUNIT_TEST(BreezeIsReturnedForKde5Desktop);
+    CPPUNIT_TEST(ElementaryIsReturnedForGnomeDesktop);
+    CPPUNIT_TEST(ThemeIsOverriddenByPreferredTheme);
+    CPPUNIT_TEST(ThemeIsOverriddenByHighContrastMode);
+    CPPUNIT_TEST(NotInstalledThemeDoesNotOverride);
+    CPPUNIT_TEST(InstalledThemeIsFound);
+    CPPUNIT_TEST(FirstThemeIsReturnedIfRequestedThemeIsNotFound);
+    CPPUNIT_TEST(FallbackThemeIsReturnedForEmptyInput);
+    CPPUNIT_TEST(DifferentPreferredThemesAreInequal);
+    CPPUNIT_TEST(DifferentHighContrastModesAreInequal);
+#endif
+
+    // End of test suite definition
+    CPPUNIT_TEST_SUITE_END();
+};
+
+#ifndef _WIN32
+
+/*static*/ std::vector<vcl::IconThemeInfo>
+IconThemeSelectorTest::GetFakeInstalledThemes()
+{
+    std::vector<vcl::IconThemeInfo> r;
+    vcl::IconThemeInfo a;
+    a.mThemeId = "breeze";
+    r.push_back(a);
+    a.mThemeId = "elementary";
+    r.push_back(a);
+    a.mThemeId = "colibre";
+    r.push_back(a);
+    a.mThemeId = "sifr";
+    r.push_back(a);
+    return r;
+}
+
+void
+IconThemeSelectorTest::BreezeIsReturnedForKde5Desktop()
+{
+    std::vector<vcl::IconThemeInfo> themes = GetFakeInstalledThemes();
+    vcl::IconThemeSelector s;
+    OUString r = s.SelectIconThemeForDesktopEnvironment(themes, "plasma5");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("'breeze' theme is returned for Plasma 5 desktop", OUString("breeze"), r);
+}
+
+void
+IconThemeSelectorTest::ElementaryIsReturnedForGnomeDesktop()
+{
+    std::vector<vcl::IconThemeInfo> themes = GetFakeInstalledThemes();
+    vcl::IconThemeSelector s;
+    OUString r = s.SelectIconThemeForDesktopEnvironment(themes, "gnome");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("'elementary' theme is returned for gnome desktop", OUString("elementary"), r);
+}
+
+void
+IconThemeSelectorTest::ThemeIsOverriddenByPreferredTheme()
+{
+    vcl::IconThemeSelector s;
+    OUString preferred("breeze");
+    s.SetPreferredIconTheme(preferred, false);
+    std::vector<vcl::IconThemeInfo> themes = GetFakeInstalledThemes();
+    OUString selected = s.SelectIconThemeForDesktopEnvironment(themes, "gnome");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("'elementary' theme is overridden by breeze", preferred, selected);
+}
+
+void
+IconThemeSelectorTest::ThemeIsOverriddenByHighContrastMode()
+{
+    vcl::IconThemeSelector s;
+    s.SetUseHighContrastTheme(true);
+    std::vector<vcl::IconThemeInfo> themes = GetFakeInstalledThemes();
+    OUString selected = s.SelectIconTheme(themes, "breeze");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("'breeze' theme is overridden by high contrast mode",
+            OUString("sifr"), selected);
+    s.SetUseHighContrastTheme(false);
+    selected = s.SelectIconTheme(themes, "breeze");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("'breeze' theme is no longer overridden by high contrast mode",
+            OUString("breeze"), selected);
+}
+
+void
+IconThemeSelectorTest::NotInstalledThemeDoesNotOverride()
+{
+    vcl::IconThemeSelector s;
+    s.SetPreferredIconTheme("breeze_foo", false);
+    std::vector<vcl::IconThemeInfo> themes = GetFakeInstalledThemes();
+    OUString selected = s.SelectIconTheme(themes, "colibre");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("'colibre' theme is not overridden by 'breeze_foo'", OUString("colibre"), selected);
+}
+
+void
+IconThemeSelectorTest::InstalledThemeIsFound()
+{
+    vcl::IconThemeSelector s;
+    std::vector<vcl::IconThemeInfo> themes = GetFakeInstalledThemes();
+    OUString selected = s.SelectIconTheme(themes, "colibre");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("'colibre' theme is found", OUString("colibre"), selected);
+}
+
+void
+IconThemeSelectorTest::FirstThemeIsReturnedIfRequestedThemeIsNotFound()
+{
+    vcl::IconThemeSelector s;
+    std::vector<vcl::IconThemeInfo> themes = GetFakeInstalledThemes();
+    OUString selected = s.SelectIconTheme(themes, "breeze_foo");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("'breeze' theme is found", themes.front().GetThemeId(), selected);
+}
+
+void
+IconThemeSelectorTest::FallbackThemeIsReturnedForEmptyInput()
+{
+    vcl::IconThemeSelector s;
+    OUString selected = s.SelectIconTheme(std::vector<vcl::IconThemeInfo>(), "colibre");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("fallback is returned for empty input",
+            OUString(vcl::IconThemeSelector::FALLBACK_ICON_THEME_ID), selected);
+}
+
+void
+IconThemeSelectorTest::DifferentHighContrastModesAreInequal()
+{
+    vcl::IconThemeSelector s1;
+    vcl::IconThemeSelector s2;
+    s1.SetUseHighContrastTheme(true);
+    s2.SetUseHighContrastTheme(false);
+    bool equal = (s1 == s2);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Different high contrast modes are detected as inequal", false, equal);
+}
+
+void
+IconThemeSelectorTest::DifferentPreferredThemesAreInequal()
+{
+    vcl::IconThemeSelector s1;
+    vcl::IconThemeSelector s2;
+    s1.SetPreferredIconTheme("breeze", false);
+    s2.SetUseHighContrastTheme(true);
+    bool equal = (s1 == s2);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Different preferred themes are detected as inequal", false, equal);
+}
+
+#endif
+
+// Put the test suite in the registry
+CPPUNIT_TEST_SUITE_REGISTRATION(IconThemeSelectorTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/bitmapcolor.cxx b/vcl/qa/cppunit/bitmapcolor.cxx
new file mode 100644
index 000000000..eafa4d138
--- /dev/null
+++ b/vcl/qa/cppunit/bitmapcolor.cxx
@@ -0,0 +1,262 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ *
+ * This file incorporates work covered by the following license notice:
+ *
+ *   Licensed to the Apache Software Foundation (ASF) under one or more
+ *   contributor license agreements. See the NOTICE file distributed
+ *   with this work for additional information regarding copyright
+ *   ownership. The ASF licenses this file to you under the Apache
+ *   License, Version 2.0 (the "License"); you may not use this file
+ *   except in compliance with the License. You may obtain a copy of
+ *   the License at http://www.apache.org/licenses/LICENSE-2.0 .
+ */
+
+// bootstrap stuff
+#include <test/bootstrapfixture.hxx>
+
+#include <vcl/BitmapColor.hxx>
+
+namespace
+{
+class BitmapColorTest : public test::BootstrapFixture
+{
+public:
+    BitmapColorTest()
+        : BootstrapFixture(true, false)
+    {
+    }
+
+    void defaultConstructor();
+    void colorValueConstructor();
+    void colorClassConstructor();
+    void setValue();
+    void invert();
+    void getLuminance();
+
+    CPPUNIT_TEST_SUITE(BitmapColorTest);
+    CPPUNIT_TEST(defaultConstructor);
+    CPPUNIT_TEST(colorValueConstructor);
+    CPPUNIT_TEST(colorClassConstructor);
+    CPPUNIT_TEST(setValue);
+    CPPUNIT_TEST(invert);
+    CPPUNIT_TEST(getLuminance);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void BitmapColorTest::defaultConstructor()
+{
+    BitmapColor aBmpColor;
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Red wrong", static_cast<sal_uInt8>(0), aBmpColor.GetRed());
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Green wrong", static_cast<sal_uInt8>(0), aBmpColor.GetGreen());
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Blue wrong", static_cast<sal_uInt8>(0), aBmpColor.GetBlue());
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Alpha wrong", static_cast<sal_uInt8>(0), aBmpColor.GetAlpha());
+}
+
+void BitmapColorTest::colorValueConstructor()
+{
+    {
+        BitmapColor aBmpColor(0, 0, 0);
+
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Red wrong", static_cast<sal_uInt8>(0), aBmpColor.GetRed());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Green wrong", static_cast<sal_uInt8>(0),
+                                     aBmpColor.GetGreen());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Blue wrong", static_cast<sal_uInt8>(0), aBmpColor.GetBlue());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Alpha wrong", static_cast<sal_uInt8>(0),
+                                     aBmpColor.GetAlpha());
+    }
+
+    {
+        BitmapColor aBmpColor(128, 128, 128);
+
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Red wrong", static_cast<sal_uInt8>(128), aBmpColor.GetRed());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Green wrong", static_cast<sal_uInt8>(128),
+                                     aBmpColor.GetGreen());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Blue wrong", static_cast<sal_uInt8>(128),
+                                     aBmpColor.GetBlue());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Alpha wrong", static_cast<sal_uInt8>(0),
+                                     aBmpColor.GetAlpha());
+    }
+
+    {
+        BitmapColor aBmpColor(255, 255, 255);
+
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Red wrong", static_cast<sal_uInt8>(255), aBmpColor.GetRed());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Green wrong", static_cast<sal_uInt8>(255),
+                                     aBmpColor.GetGreen());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Blue wrong", static_cast<sal_uInt8>(255),
+                                     aBmpColor.GetBlue());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Alpha wrong", static_cast<sal_uInt8>(0),
+                                     aBmpColor.GetAlpha());
+    }
+}
+
+void BitmapColorTest::colorClassConstructor()
+{
+    {
+        BitmapColor aBmpColor(Color(0, 0, 0));
+
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Red wrong", static_cast<sal_uInt8>(0), aBmpColor.GetRed());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Green wrong", static_cast<sal_uInt8>(0),
+                                     aBmpColor.GetGreen());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Blue wrong", static_cast<sal_uInt8>(0), aBmpColor.GetBlue());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Alpha wrong", static_cast<sal_uInt8>(0),
+                                     aBmpColor.GetAlpha());
+    }
+
+    {
+        BitmapColor aBmpColor(Color(127, 127, 127));
+
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Red wrong", static_cast<sal_uInt8>(127), aBmpColor.GetRed());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Green wrong", static_cast<sal_uInt8>(127),
+                                     aBmpColor.GetGreen());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Blue wrong", static_cast<sal_uInt8>(127),
+                                     aBmpColor.GetBlue());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Alpha wrong", static_cast<sal_uInt8>(0),
+                                     aBmpColor.GetAlpha());
+    }
+
+    {
+        BitmapColor aBmpColor(Color(255, 255, 255));
+
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Red wrong", static_cast<sal_uInt8>(255), aBmpColor.GetRed());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Green wrong", static_cast<sal_uInt8>(255),
+                                     aBmpColor.GetGreen());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Blue wrong", static_cast<sal_uInt8>(255),
+                                     aBmpColor.GetBlue());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Alpha wrong", static_cast<sal_uInt8>(0),
+                                     aBmpColor.GetAlpha());
+    }
+
+    // Transparency / Alpha
+    {
+        BitmapColor aBmpColor(Color(255, 128, 64, 0));
+
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Red wrong", static_cast<sal_uInt8>(128), aBmpColor.GetRed());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Green wrong", static_cast<sal_uInt8>(64),
+                                     aBmpColor.GetGreen());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Blue wrong", static_cast<sal_uInt8>(0), aBmpColor.GetBlue());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Alpha wrong", static_cast<sal_uInt8>(255),
+                                     aBmpColor.GetAlpha());
+    }
+}
+
+void BitmapColorTest::setValue()
+{
+    BitmapColor aBmpColor;
+
+    aBmpColor.SetRed(127);
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(127), aBmpColor.GetRed());
+
+    aBmpColor.SetGreen(127);
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(127), aBmpColor.GetGreen());
+
+    aBmpColor.SetBlue(127);
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(127), aBmpColor.GetBlue());
+}
+
+void BitmapColorTest::invert()
+{
+    BitmapColor aBmpColor(255, 255, 255);
+    BitmapColor aInvertedColor(aBmpColor);
+    aInvertedColor.Invert();
+
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(0), aInvertedColor.GetRed());
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(0), aInvertedColor.GetGreen());
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(0), aInvertedColor.GetBlue());
+}
+
+void BitmapColorTest::getLuminance()
+{
+    {
+        BitmapColor aBmpColor(COL_BLACK);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(0), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_BLUE);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(14), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_GREEN);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(75), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_CYAN);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(90), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_RED);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(38), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_MAGENTA);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(52), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_BROWN);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(113), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_GRAY);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(128), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_LIGHTGRAY);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(192), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_LIGHTBLUE);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(28), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_LIGHTGREEN);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(150), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_LIGHTCYAN);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(179), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_LIGHTRED);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(75), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_LIGHTMAGENTA);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(104), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_YELLOW);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(226), aBmpColor.GetLuminance());
+    }
+
+    {
+        BitmapColor aBmpColor(COL_WHITE);
+        CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt8>(255), aBmpColor.GetLuminance());
+    }
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(BitmapColorTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/bitmaprender/BitmapRenderTest.cxx b/vcl/qa/cppunit/bitmaprender/BitmapRenderTest.cxx
new file mode 100644
index 000000000..73e3baab9
--- /dev/null
+++ b/vcl/qa/cppunit/bitmaprender/BitmapRenderTest.cxx
@@ -0,0 +1,269 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <test/bootstrapfixture.hxx>
+
+#include <vcl/virdev.hxx>
+#include <vcl/bitmapaccess.hxx>
+#include <vcl/svapp.hxx>
+
+#include <tools/stream.hxx>
+
+#include <vcl/graphicfilter.hxx>
+#include <vcl/filter/PngImageReader.hxx>
+
+#include <svdata.hxx>
+#include <salinst.hxx>
+
+static OUString const gaDataUrl = "/vcl/qa/cppunit/bitmaprender/data/";
+
+class BitmapRenderTest : public test::BootstrapFixture
+{
+    OUString getFullUrl(const OUString& sFileName)
+    {
+        return m_directories.getURLFromSrc(gaDataUrl) + sFileName;
+    }
+
+public:
+    BitmapRenderTest()
+        : BootstrapFixture(true, false)
+    {
+    }
+
+    void testTdf104141();
+    void testTdf113918();
+    void testDrawAlphaBitmapEx();
+    void testAlphaVirtualDevice();
+    void testTdf116888();
+
+    CPPUNIT_TEST_SUITE(BitmapRenderTest);
+    CPPUNIT_TEST(testTdf104141);
+    CPPUNIT_TEST(testTdf113918);
+    CPPUNIT_TEST(testDrawAlphaBitmapEx);
+    CPPUNIT_TEST(testAlphaVirtualDevice);
+    CPPUNIT_TEST(testTdf116888);
+
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void BitmapRenderTest::testTdf104141()
+{
+    ScopedVclPtrInstance<VirtualDevice> pVDev;
+    pVDev->SetOutputSizePixel(Size(400, 400));
+    pVDev->SetBackground(Wallpaper(COL_GREEN));
+    pVDev->Erase();
+
+    // Load animated GIF and draw it on green background
+    GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+    Graphic aGraphic;
+    const OUString aURL(getFullUrl("tdf104141.gif"));
+    SvFileStream aFileStream(aURL, StreamMode::READ);
+    ErrCode bResult = rFilter.ImportGraphic(aGraphic, aURL, aFileStream);
+    CPPUNIT_ASSERT_EQUAL(ERRCODE_NONE, bResult);
+    BitmapEx aBitmap = aGraphic.GetBitmapEx();
+    pVDev->DrawBitmapEx(Point(20, 20), aBitmap);
+
+    // Check drawing results: ensure that it contains transparent
+    // (greenish) pixels
+    const Color aColor = pVDev->GetPixel(Point(21, 21));
+    CPPUNIT_ASSERT(aColor.GetGreen() > 10 * aColor.GetRed()
+                   && aColor.GetGreen() > 10 * aColor.GetBlue());
+}
+
+void BitmapRenderTest::testTdf113918()
+{
+    ScopedVclPtrInstance<VirtualDevice> pVDev;
+    pVDev->SetOutputSizePixel(Size(2480, 3508));
+    pVDev->SetBackground(Wallpaper(COL_GREEN));
+    pVDev->Erase();
+
+    GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+    Graphic aGraphic;
+    const OUString aURL(getFullUrl("tdf113918.png"));
+    SvFileStream aFileStream(aURL, StreamMode::READ);
+    ErrCode bResult = rFilter.ImportGraphic(aGraphic, aURL, aFileStream);
+    CPPUNIT_ASSERT_EQUAL(ERRCODE_NONE, bResult);
+    BitmapEx aBitmap = aGraphic.GetBitmapEx();
+    pVDev->DrawBitmapEx(Point(0, 0), aBitmap);
+
+    // Ensure that image is drawn with white background color from palette
+    CPPUNIT_ASSERT_EQUAL(COL_WHITE, pVDev->GetPixel(Point(21, 21)));
+
+    // Ensure that image is drawn with gray text color from palette
+    const Color aColor = pVDev->GetPixel(Point(1298, 1368));
+    CPPUNIT_ASSERT(aColor.GetGreen() == aColor.GetRed() && aColor.GetGreen() == aColor.GetBlue());
+    CPPUNIT_ASSERT(aColor.GetGreen() > 100);
+}
+
+void BitmapRenderTest::testDrawAlphaBitmapEx()
+{
+    ScopedVclPtrInstance<VirtualDevice> pVDev;
+    pVDev->SetOutputSizePixel(Size(8, 8));
+    pVDev->SetBackground(Wallpaper(COL_WHITE));
+    pVDev->Erase();
+
+    CPPUNIT_ASSERT_EQUAL(COL_WHITE, pVDev->GetPixel(Point(0, 0)));
+    CPPUNIT_ASSERT_EQUAL(COL_WHITE, pVDev->GetPixel(Point(1, 1)));
+    CPPUNIT_ASSERT_EQUAL(COL_WHITE, pVDev->GetPixel(Point(2, 2)));
+
+    SvFileStream aFileStream(getFullUrl("ImageRGBA.png"), StreamMode::READ);
+
+    vcl::PngImageReader aPngReader(aFileStream);
+    BitmapEx aBitmapEx;
+    aPngReader.read(aBitmapEx);
+
+    // Check backend capabilities, if the backend support 32-bit bitmap
+    auto pBackendCapabilities = ImplGetSVData()->mpDefInst->GetBackendCapabilities();
+    if (pBackendCapabilities->mbSupportsBitmap32)
+    {
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(32), aBitmapEx.GetBitmap().GetBitCount());
+    }
+    else
+    {
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(24), aBitmapEx.GetBitmap().GetBitCount());
+        CPPUNIT_ASSERT_EQUAL(true, aBitmapEx.IsAlpha());
+        CPPUNIT_ASSERT_EQUAL(sal_uInt16(8), aBitmapEx.GetAlpha().GetBitCount());
+    }
+
+    // Check the bitmap has pixels we expect
+    CPPUNIT_ASSERT_EQUAL(Color(0xFF, 0x00, 0x00, 0x00), aBitmapEx.GetPixelColor(0, 0));
+    CPPUNIT_ASSERT_EQUAL(Color(0x00, 0xFF, 0xFF, 0x00), aBitmapEx.GetPixelColor(1, 1));
+    CPPUNIT_ASSERT_EQUAL(Color(0x7F, 0x00, 0xFF, 0x00), aBitmapEx.GetPixelColor(2, 2));
+
+    pVDev->DrawBitmapEx(Point(), aBitmapEx);
+
+    CPPUNIT_ASSERT_EQUAL(Color(0x00, 0xFF, 0xFF, 0xFF), pVDev->GetPixel(Point(0, 0)));
+    CPPUNIT_ASSERT_EQUAL(Color(0x00, 0xFF, 0xFF, 0x00), pVDev->GetPixel(Point(1, 1)));
+
+// sometimes on Windows we get rounding error in blending so let's ignore this on Windows for now.
+#if !defined(_WIN32)
+    CPPUNIT_ASSERT_EQUAL(Color(0x00, 0x7F, 0xFF, 0x7F), pVDev->GetPixel(Point(2, 2)));
+#endif
+}
+
+#ifdef _WIN32
+
+namespace
+{
+int deltaColor(BitmapColor aColor1, BitmapColor aColor2)
+{
+    int deltaR = std::abs(aColor1.GetRed() - aColor2.GetRed());
+    int deltaG = std::abs(aColor1.GetGreen() - aColor2.GetGreen());
+    int deltaB = std::abs(aColor1.GetBlue() - aColor2.GetBlue());
+
+    return std::max(std::max(deltaR, deltaG), deltaB);
+}
+}
+
+#endif
+
+void BitmapRenderTest::testAlphaVirtualDevice()
+{
+    // Create an alpha virtual device
+    ScopedVclPtr<VirtualDevice> pAlphaVirtualDevice(VclPtr<VirtualDevice>::Create(
+        *Application::GetDefaultDevice(), DeviceFormat::DEFAULT, DeviceFormat::DEFAULT));
+
+    // Set it up
+    pAlphaVirtualDevice->SetOutputSizePixel(Size(4, 4));
+    pAlphaVirtualDevice->SetBackground(Wallpaper(COL_TRANSPARENT));
+    pAlphaVirtualDevice->Erase();
+
+    // Get a BitmapEx from the VirDev -> Colors should have alpha
+    BitmapEx aBitmap = pAlphaVirtualDevice->GetBitmapEx(Point(), Size(4, 4));
+    CPPUNIT_ASSERT_EQUAL(long(4), aBitmap.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(long(4), aBitmap.GetSizePixel().Height());
+    Color aColor = aBitmap.GetPixelColor(1, 1);
+    CPPUNIT_ASSERT_EQUAL(Color(0xffffffff), aColor);
+
+    // Draw an opaque pixel to the VirDev
+    pAlphaVirtualDevice->DrawPixel(Point(1, 1), Color(0x0022ff55));
+
+    aColor = pAlphaVirtualDevice->GetPixel(Point(1, 1));
+    // Read back the opaque pixel
+#if defined _WIN32
+    CPPUNIT_ASSERT_LESS(6, deltaColor(Color(0x0022ff55), aColor));
+#else
+    CPPUNIT_ASSERT_EQUAL(Color(0x0022ff55), aColor);
+#endif
+
+    // Read back the BitmapEx and check the opaque pixel
+    aBitmap = pAlphaVirtualDevice->GetBitmapEx(Point(), Size(4, 4));
+    CPPUNIT_ASSERT_EQUAL(long(4), aBitmap.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(long(4), aBitmap.GetSizePixel().Height());
+
+    aColor = aBitmap.GetPixelColor(1, 1);
+#if defined _WIN32
+    CPPUNIT_ASSERT_LESS(6, deltaColor(Color(0x0022ff55), aColor));
+#else
+    CPPUNIT_ASSERT_EQUAL(Color(0x0022ff55), aColor);
+#endif
+
+    // Draw an semi-transparent pixel
+    pAlphaVirtualDevice->DrawPixel(Point(0, 0), Color(0x44, 0x22, 0xff, 0x55));
+
+    aColor = pAlphaVirtualDevice->GetPixel(Point(0, 0));
+    // Read back the semi-transparent pixel
+#if defined _WIN32
+    CPPUNIT_ASSERT_LESS(6, deltaColor(Color(0x4422FF55), aColor));
+#else
+    CPPUNIT_ASSERT_EQUAL(Color(0x4422FF55), aColor);
+#endif
+
+    // Read back the BitmapEx and check the semi-transparent pixel
+    aBitmap = pAlphaVirtualDevice->GetBitmapEx(Point(), Size(4, 4));
+    CPPUNIT_ASSERT_EQUAL(long(4), aBitmap.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL(long(4), aBitmap.GetSizePixel().Height());
+
+    aColor = aBitmap.GetPixelColor(0, 0);
+#if defined _WIN32
+    CPPUNIT_ASSERT_LESS(6, deltaColor(Color(0x4422FF55), aColor));
+#else
+    CPPUNIT_ASSERT_EQUAL(Color(0x4422FF55), aColor);
+#endif
+}
+
+void BitmapRenderTest::testTdf116888()
+{
+    // The image is a 8bit image with a non-grayscale palette. In OpenGL mode
+    // pdf export of the image was broken, because OpenGLSalBitmap::ReadTexture()
+    // didn't handle 8bit non-grayscale and moreover OpenGLSalBitmap::AcquireBuffer()
+    // didn't properly release mpUserBuffer after ReadTexture() failure.
+    GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+    Graphic aGraphic;
+    const OUString aURL(getFullUrl("tdf116888.gif"));
+    SvFileStream aFileStream(aURL, StreamMode::READ);
+    ErrCode bResult = rFilter.ImportGraphic(aGraphic, aURL, aFileStream);
+    CPPUNIT_ASSERT_EQUAL(ERRCODE_NONE, bResult);
+    Bitmap aBitmap = aGraphic.GetBitmapEx().GetBitmap();
+    CPPUNIT_ASSERT(!aBitmap.IsEmpty());
+    aBitmap.Scale(0.8, 0.8); // This scaling discards mpUserData,
+    Bitmap::ScopedReadAccess pAccess(aBitmap); // forcing ReadTexture() here.
+    // Check that there is mpUserBuffer content.
+    CPPUNIT_ASSERT(pAccess);
+    const ScanlineFormat eFormat = pAccess->GetScanlineFormat();
+    CPPUNIT_ASSERT_EQUAL(ScanlineFormat::N8BitPal, eFormat);
+    CPPUNIT_ASSERT(!aBitmap.HasGreyPaletteAny());
+    // HACK: Some rendering backends change white to #FEFEFE while scaling for some reason.
+    // That is pretty much white too in practice, so adjust for that.
+    BitmapColor white(COL_WHITE);
+    if (pAccess->GetColor(0, 0) == Color(0xfe, 0xfe, 0xfe))
+        white = Color(0xfe, 0xfe, 0xfe);
+    // Check that the image contents are also valid.
+    CPPUNIT_ASSERT_EQUAL(white, pAccess->GetColor(0, 0));
+    CPPUNIT_ASSERT_EQUAL(white, pAccess->GetColor(0, pAccess->Width() - 1));
+    CPPUNIT_ASSERT_EQUAL(white, pAccess->GetColor(pAccess->Height() - 1, 0));
+    CPPUNIT_ASSERT_EQUAL(BitmapColor(COL_BLACK),
+                         pAccess->GetColor(pAccess->Height() - 1, pAccess->Width() - 1));
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(BitmapRenderTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/bitmaprender/data/ImageRGBA.png b/vcl/qa/cppunit/bitmaprender/data/ImageRGBA.png
new file mode 100644
index 000000000..7a8399293
--- /dev/null
+++ b/vcl/qa/cppunit/bitmaprender/data/ImageRGBA.png
diff --git a/vcl/qa/cppunit/bitmaprender/data/tdf104141.gif b/vcl/qa/cppunit/bitmaprender/data/tdf104141.gif
new file mode 100644
index 000000000..d6390fdaa
--- /dev/null
+++ b/vcl/qa/cppunit/bitmaprender/data/tdf104141.gif
diff --git a/vcl/qa/cppunit/bitmaprender/data/tdf113918.png b/vcl/qa/cppunit/bitmaprender/data/tdf113918.png
new file mode 100644
index 000000000..dd49897d9
--- /dev/null
+++ b/vcl/qa/cppunit/bitmaprender/data/tdf113918.png
diff --git a/vcl/qa/cppunit/bitmaprender/data/tdf116888.gif b/vcl/qa/cppunit/bitmaprender/data/tdf116888.gif
new file mode 100644
index 000000000..295310949
--- /dev/null
+++ b/vcl/qa/cppunit/bitmaprender/data/tdf116888.gif
diff --git a/vcl/qa/cppunit/blocklistparsertest.cxx b/vcl/qa/cppunit/blocklistparsertest.cxx
new file mode 100644
index 000000000..d62568de6
--- /dev/null
+++ b/vcl/qa/cppunit/blocklistparsertest.cxx
@@ -0,0 +1,153 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <sal/types.h>
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/TestFixture.h>
+#include <cppunit/extensions/HelperMacros.h>
+#include <cppunit/plugin/TestPlugIn.h>
+
+#include <unotest/bootstrapfixturebase.hxx>
+
+#include <driverblocklist.hxx>
+
+using namespace DriverBlocklist;
+
+namespace
+{
+
+class BlocklistParserTest : public test::BootstrapFixtureBase
+{
+    void testParse();
+    void testEvaluate();
+
+    CPPUNIT_TEST_SUITE(BlocklistParserTest);
+    CPPUNIT_TEST(testParse);
+    CPPUNIT_TEST(testEvaluate);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void BlocklistParserTest::testParse()
+{
+    std::vector<DriverInfo> aDriveInfos;
+
+    Parser aBlocklistParser(m_directories.getURLFromSrc("vcl/qa/cppunit/") + "test_blocklist_parse.xml",
+        aDriveInfos, VersionType::OpenGL);
+    aBlocklistParser.parse();
+
+    size_t const n = aDriveInfos.size();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(16), n);
+
+    size_t i = 0;
+
+    for (bool bIsWhitelisted : {true, false})
+    {
+        DriverInfo& aDriveInfo = aDriveInfos[i++];
+        CPPUNIT_ASSERT_EQUAL(bIsWhitelisted, aDriveInfo.mbWhitelisted);
+        CPPUNIT_ASSERT_EQUAL(GetVendorId(VendorAll), aDriveInfo.maAdapterVendor); // "all"
+        CPPUNIT_ASSERT_EQUAL(VersionComparisonOp::DRIVER_LESS_THAN, aDriveInfo.meComparisonOp);
+        CPPUNIT_ASSERT_EQUAL(OpenGLVersion(10,20,30,40), aDriveInfo.mnDriverVersion);
+
+        aDriveInfo = aDriveInfos[i++];
+        CPPUNIT_ASSERT_EQUAL(bIsWhitelisted, aDriveInfo.mbWhitelisted);
+        CPPUNIT_ASSERT_EQUAL(GetVendorId(VendorNVIDIA), aDriveInfo.maAdapterVendor);
+        CPPUNIT_ASSERT_EQUAL(VersionComparisonOp::DRIVER_EQUAL, aDriveInfo.meComparisonOp);
+
+        aDriveInfo = aDriveInfos[i++];
+        CPPUNIT_ASSERT_EQUAL(bIsWhitelisted, aDriveInfo.mbWhitelisted);
+        CPPUNIT_ASSERT_EQUAL(GetVendorId(VendorMicrosoft), aDriveInfo.maAdapterVendor);
+        CPPUNIT_ASSERT_EQUAL(VersionComparisonOp::DRIVER_NOT_EQUAL, aDriveInfo.meComparisonOp);
+
+        aDriveInfo = aDriveInfos[i++];
+        CPPUNIT_ASSERT_EQUAL(bIsWhitelisted, aDriveInfo.mbWhitelisted);
+        CPPUNIT_ASSERT_EQUAL(OUString("0xcafe"), aDriveInfo.maAdapterVendor);
+        CPPUNIT_ASSERT_EQUAL(VersionComparisonOp::DRIVER_NOT_EQUAL, aDriveInfo.meComparisonOp);
+
+        aDriveInfo = aDriveInfos[i++];
+        CPPUNIT_ASSERT_EQUAL(bIsWhitelisted, aDriveInfo.mbWhitelisted);
+        CPPUNIT_ASSERT_EQUAL(GetVendorId(VendorAll), aDriveInfo.maAdapterVendor);
+        CPPUNIT_ASSERT_EQUAL(VersionComparisonOp::DRIVER_BETWEEN_EXCLUSIVE, aDriveInfo.meComparisonOp);
+
+        aDriveInfo = aDriveInfos[i++];
+        CPPUNIT_ASSERT_EQUAL(bIsWhitelisted, aDriveInfo.mbWhitelisted);
+        CPPUNIT_ASSERT_EQUAL(GetVendorId(VendorAll), aDriveInfo.maAdapterVendor);
+        CPPUNIT_ASSERT_EQUAL(VersionComparisonOp::DRIVER_BETWEEN_INCLUSIVE, aDriveInfo.meComparisonOp);
+
+        aDriveInfo = aDriveInfos[i++];
+        CPPUNIT_ASSERT_EQUAL(bIsWhitelisted, aDriveInfo.mbWhitelisted);
+        CPPUNIT_ASSERT_EQUAL(GetVendorId(VendorAll), aDriveInfo.maAdapterVendor);
+        CPPUNIT_ASSERT_EQUAL(VersionComparisonOp::DRIVER_BETWEEN_INCLUSIVE_START, aDriveInfo.meComparisonOp);
+
+        aDriveInfo = aDriveInfos[i++];
+        CPPUNIT_ASSERT_EQUAL(bIsWhitelisted, aDriveInfo.mbWhitelisted);
+        CPPUNIT_ASSERT_EQUAL(GetVendorId(VendorAll), aDriveInfo.maAdapterVendor);
+        CPPUNIT_ASSERT_EQUAL(VersionComparisonOp::DRIVER_COMPARISON_IGNORED, aDriveInfo.meComparisonOp);
+    }
+}
+
+void BlocklistParserTest::testEvaluate()
+{
+    std::vector<DriverInfo> aDriveInfos;
+
+    Parser aBlocklistParser(m_directories.getURLFromSrc("vcl/qa/cppunit/") + "test_blocklist_evaluate.xml",
+        aDriveInfos, VersionType::OpenGL);
+    aBlocklistParser.parse();
+
+    OUString vendorAMD = GetVendorId(VendorAMD);
+    OUString vendorNVIDIA = GetVendorId(VendorNVIDIA);
+    OUString vendorIntel = GetVendorId(VendorIntel);
+    OUString vendorMicrosoft = GetVendorId(VendorMicrosoft);
+
+    // Check OS
+    CPPUNIT_ASSERT_EQUAL(false, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.40", vendorNVIDIA, "all", DRIVER_OS_WINDOWS_7));
+    CPPUNIT_ASSERT_EQUAL(false, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.40", vendorNVIDIA, "all", DRIVER_OS_WINDOWS_8));
+    CPPUNIT_ASSERT_EQUAL(false, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.40", vendorNVIDIA, "all", DRIVER_OS_WINDOWS_10));
+
+    // Check generic OS
+    CPPUNIT_ASSERT_EQUAL(false, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.50", vendorMicrosoft, "all", DRIVER_OS_WINDOWS_10));
+    CPPUNIT_ASSERT_EQUAL(true, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.50", vendorMicrosoft, "all", DRIVER_OS_LINUX));
+    CPPUNIT_ASSERT_EQUAL(true, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.50", vendorMicrosoft, "all", DRIVER_OS_OSX_10_7));
+    CPPUNIT_ASSERT_EQUAL(true, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.50", vendorMicrosoft, "all", DRIVER_OS_OSX_10_8));
+
+    // Check Vendors
+    CPPUNIT_ASSERT_EQUAL(true, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.40", vendorMicrosoft, "all", DRIVER_OS_WINDOWS_7));
+    CPPUNIT_ASSERT_EQUAL(true, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.40", vendorMicrosoft, "all", DRIVER_OS_WINDOWS_10));
+
+    // Check Versions
+    CPPUNIT_ASSERT_EQUAL(true, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.39", vendorAMD, "all", DRIVER_OS_WINDOWS_7));
+    CPPUNIT_ASSERT_EQUAL(false, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.40", vendorAMD, "all", DRIVER_OS_WINDOWS_7));
+    CPPUNIT_ASSERT_EQUAL(false, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "10.20.30.41", vendorAMD, "all", DRIVER_OS_WINDOWS_7));
+
+    // Check
+    CPPUNIT_ASSERT_EQUAL(true, FindBlocklistedDeviceInList(
+                                    aDriveInfos, VersionType::OpenGL, "9.17.10.4229", vendorIntel, "all", DRIVER_OS_WINDOWS_7));
+
+
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(BlocklistParserTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/builder/demo.ui b/vcl/qa/cppunit/builder/demo.ui
new file mode 100644
index 000000000..d5784b79f
--- /dev/null
+++ b/vcl/qa/cppunit/builder/demo.ui
@@ -0,0 +1,1960 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!-- Generated with glade 3.22.1 -->
+<interface domain="vcl">
+  <requires lib="gtk+" version="3.18"/>
+  <object class="GtkListStore" id="liststore1">
+    <columns>
+      <!-- column-name gchararray1 -->
+      <column type="gchararray"/>
+    </columns>
+    <data>
+      <row>
+        <col id="0" translatable="no">[None]</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">Normal</col>
+      </row>
+    </data>
+  </object>
+  <object class="GtkListStore" id="liststore2">
+    <columns>
+      <!-- column-name gchararray1 -->
+      <column type="gchararray"/>
+    </columns>
+    <data>
+      <row>
+        <col id="0" translatable="no">1</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">2</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">3</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">4</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">5</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">6</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">7</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">8</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">9</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">10</col>
+      </row>
+      <row>
+        <col id="0" translatable="no">1 - 10</col>
+      </row>
+    </data>
+  </object>
+  <object class="GtkDialog" id="dialog1">
+    <property name="can_focus">False</property>
+    <property name="border_width">5</property>
+    <property name="type_hint">dialog</property>
+    <child>
+      <placeholder/>
+    </child>
+    <child internal-child="vbox">
+      <object class="GtkBox" id="dialog-vbox1">
+        <property name="can_focus">False</property>
+        <property name="orientation">vertical</property>
+        <property name="spacing">2</property>
+        <child internal-child="action_area">
+          <object class="GtkButtonBox" id="dialog-action_area1">
+            <property name="can_focus">False</property>
+            <property name="layout_style">end</property>
+            <child>
+              <object class="GtkButton" id="cancel">
+                <property name="label">gtk-cancel</property>
+                <property name="visible">True</property>
+                <property name="can_focus">True</property>
+                <property name="receives_default">True</property>
+                <property name="use_stock">True</property>
+              </object>
+              <packing>
+                <property name="expand">False</property>
+                <property name="fill">True</property>
+                <property name="position">0</property>
+              </packing>
+            </child>
+            <child>
+              <object class="GtkButton" id="ok">
+                <property name="label">gtk-ok</property>
+                <property name="visible">True</property>
+                <property name="can_focus">True</property>
+                <property name="receives_default">True</property>
+                <property name="use_stock">True</property>
+              </object>
+              <packing>
+                <property name="expand">False</property>
+                <property name="fill">True</property>
+                <property name="position">1</property>
+              </packing>
+            </child>
+          </object>
+          <packing>
+            <property name="expand">False</property>
+            <property name="fill">True</property>
+            <property name="pack_type">end</property>
+            <property name="position">0</property>
+          </packing>
+        </child>
+        <child>
+          <object class="GtkNotebook" id="notebook1">
+            <property name="visible">True</property>
+            <property name="can_focus">True</property>
+            <child>
+              <object class="GtkBox" id="box1">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="orientation">vertical</property>
+                <child>
+                  <object class="GtkGrid" id="grid1">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="row_spacing">4</property>
+                    <property name="column_spacing">2</property>
+                    <property name="row_homogeneous">True</property>
+                    <property name="column_homogeneous">True</property>
+                    <child>
+                      <object class="GtkLabel" id="labelfoo">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">cell 1.1</property>
+                      </object>
+                      <packing>
+                        <property name="left_attach">0</property>
+                        <property name="top_attach">0</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkLabel" id="label4">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">cell 3.3</property>
+                        <property name="xalign">1</property>
+                      </object>
+                      <packing>
+                        <property name="left_attach">2</property>
+                        <property name="top_attach">2</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkLabel" id="label5">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">A label that spans three rows</property>
+                      </object>
+                      <packing>
+                        <property name="left_attach">0</property>
+                        <property name="top_attach">1</property>
+                        <property name="width">3</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <placeholder/>
+                    </child>
+                    <child>
+                      <placeholder/>
+                    </child>
+                    <child>
+                      <placeholder/>
+                    </child>
+                    <child>
+                      <placeholder/>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">True</property>
+                    <property name="fill">True</property>
+                    <property name="position">0</property>
+                  </packing>
+                </child>
+                <child>
+                  <object class="GtkBox" id="box5">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <child>
+                      <object class="GtkSpinButton" id="spinbutton1">
+                        <property name="visible">True</property>
+                        <property name="can_focus">True</property>
+                        <property name="numeric">True</property>
+                      </object>
+                      <packing>
+                        <property name="expand">False</property>
+                        <property name="fill">True</property>
+                        <property name="position">0</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkComboBox" id="combobox1">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                      </object>
+                      <packing>
+                        <property name="expand">True</property>
+                        <property name="fill">True</property>
+                        <property name="position">1</property>
+                      </packing>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">False</property>
+                    <property name="fill">True</property>
+                    <property name="position">1</property>
+                  </packing>
+                </child>
+                <child>
+                  <object class="GtkBox" id="box4">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <child>
+                      <object class="GtkButton" id="button4">
+                        <property name="label" translatable="no">EXPAND</property>
+                        <property name="visible">True</property>
+                        <property name="can_focus">True</property>
+                        <property name="receives_default">True</property>
+                        <property name="tooltip_text" translatable="no">A tooltip example</property>
+                      </object>
+                      <packing>
+                        <property name="expand">True</property>
+                        <property name="fill">True</property>
+                        <property name="position">0</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkButton" id="button5">
+                        <property name="label" translatable="no">FILL</property>
+                        <property name="visible">True</property>
+                        <property name="can_focus">True</property>
+                        <property name="receives_default">True</property>
+                      </object>
+                      <packing>
+                        <property name="expand">False</property>
+                        <property name="fill">True</property>
+                        <property name="position">1</property>
+                      </packing>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">False</property>
+                    <property name="fill">True</property>
+                    <property name="position">2</property>
+                  </packing>
+                </child>
+                <child>
+                  <object class="GtkBox" id="box3">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <child>
+                      <object class="GtkButton" id="button3">
+                        <property name="label" translatable="no">button</property>
+                        <property name="visible">True</property>
+                        <property name="can_focus">True</property>
+                        <property name="receives_default">True</property>
+                      </object>
+                      <packing>
+                        <property name="expand">False</property>
+                        <property name="fill">True</property>
+                        <property name="position">0</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkRadioButton" id="radiobutton1">
+                        <property name="label" translatable="no">radiobutton</property>
+                        <property name="visible">True</property>
+                        <property name="can_focus">True</property>
+                        <property name="receives_default">False</property>
+                        <property name="use_underline">True</property>
+                        <property name="xalign">0</property>
+                        <property name="active">True</property>
+                        <property name="draw_indicator">True</property>
+                      </object>
+                      <packing>
+                        <property name="expand">False</property>
+                        <property name="fill">True</property>
+                        <property name="position">1</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkCheckButton" id="checkbutton1">
+                        <property name="label" translatable="no">checkbutton</property>
+                        <property name="visible">True</property>
+                        <property name="can_focus">True</property>
+                        <property name="receives_default">False</property>
+                        <property name="use_underline">True</property>
+                        <property name="xalign">0</property>
+                        <property name="draw_indicator">True</property>
+                      </object>
+                      <packing>
+                        <property name="expand">False</property>
+                        <property name="fill">True</property>
+                        <property name="position">2</property>
+                      </packing>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">False</property>
+                    <property name="fill">True</property>
+                    <property name="position">3</property>
+                  </packing>
+                </child>
+                <child>
+                  <object class="GtkFrame" id="frame1">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label_xalign">0</property>
+                    <property name="shadow_type">none</property>
+                    <child>
+                      <object class="GtkAlignment" id="alignment1">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="left_padding">12</property>
+                        <child>
+                          <object class="GtkBox" id="box2">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <property name="orientation">vertical</property>
+                            <property name="spacing">6</property>
+                            <property name="homogeneous">True</property>
+                            <child>
+                              <object class="GtkLabel" id="label6">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">left</property>
+                                <property name="xalign">0</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">0</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkLabel" id="label7">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">right</property>
+                                <property name="xalign">1</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">1</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkLabel" id="label8">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">center</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkEntry" id="entry1">
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="activates_default">True</property>
+                                <property name="text" translatable="no">an edit control</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">3</property>
+                              </packing>
+                            </child>
+                          </object>
+                        </child>
+                      </object>
+                    </child>
+                    <child type="label">
+                      <object class="GtkLabel" id="label9">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">Frame Label</property>
+                      </object>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">False</property>
+                    <property name="fill">True</property>
+                    <property name="position">4</property>
+                  </packing>
+                </child>
+              </object>
+            </child>
+            <child type="tab">
+              <object class="GtkLabel" id="Tab1">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="label" translatable="no">page 1</property>
+              </object>
+              <packing>
+                <property name="tab_fill">False</property>
+              </packing>
+            </child>
+            <child>
+              <object class="GtkBox" id="box6">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="orientation">vertical</property>
+                <property name="spacing">10</property>
+                <child>
+                  <object class="GtkFrame" id="frame2">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label_xalign">0</property>
+                    <property name="shadow_type">none</property>
+                    <child>
+                      <object class="GtkAlignment" id="alignment2">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="left_padding">12</property>
+                        <child>
+                          <object class="GtkGrid" id="grid2">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <property name="column_spacing">5</property>
+                            <property name="row_homogeneous">True</property>
+                            <child>
+                              <object class="GtkLabel" id="label2">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">_Number of title pages</property>
+                                <property name="use_underline">True</property>
+                                <property name="mnemonic_widget">NF_PAGE_COUNT</property>
+                                <property name="xalign">0</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">0</property>
+                                <property name="top_attach">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkLabel" id="label3">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">Place title pages at</property>
+                                <property name="xalign">0</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">0</property>
+                                <property name="top_attach">3</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkLabel" id="label10">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">pages</property>
+                                <property name="xalign">0</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">2</property>
+                                <property name="top_attach">2</property>
+                                <property name="width">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkSpinButton" id="NF_PAGE_COUNT">
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="numeric">True</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="top_attach">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkSpinButton" id="NF_PAGE_START">
+                                <property name="visible">True</property>
+                                <property name="sensitive">False</property>
+                                <property name="can_focus">True</property>
+                                <property name="numeric">True</property>
+                                <accessibility>
+                                  <relation type="labelled-by" target="RB_PAGE_START"/>
+                                </accessibility>
+                              </object>
+                              <packing>
+                                <property name="left_attach">2</property>
+                                <property name="top_attach">4</property>
+                                <property name="width">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkRadioButton" id="RB_USE_EXISTING_PAGES">
+                                <property name="label" translatable="no">Converting existing pages to title pages</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="draw_indicator">True</property>
+                                <property name="group">RB_INSERT_NEW_PAGES</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">0</property>
+                                <property name="top_attach">0</property>
+                                <property name="width">4</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkRadioButton" id="RB_INSERT_NEW_PAGES">
+                                <property name="label" translatable="no">Insert new title pages</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="draw_indicator">True</property>
+                                <property name="group">RB_USE_EXISTING_PAGES</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">0</property>
+                                <property name="top_attach">1</property>
+                                <property name="width">4</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkRadioButton" id="RB_DOCUMENT_START">
+                                <property name="label" translatable="no">Document Start</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="draw_indicator">True</property>
+                                <property name="group">RB_PAGE_START</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="top_attach">3</property>
+                                <property name="width">3</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkRadioButton" id="RB_PAGE_START">
+                                <property name="label" translatable="no">Page</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="draw_indicator">True</property>
+                                <property name="group">RB_DOCUMENT_START</property>
+                                <accessibility>
+                                  <relation type="label-for" target="NF_PAGE_START"/>
+                                </accessibility>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="top_attach">4</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <placeholder/>
+                            </child>
+                          </object>
+                        </child>
+                      </object>
+                    </child>
+                    <child type="label">
+                      <object class="GtkLabel" id="label11">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">Make Title Pages</property>
+                      </object>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">True</property>
+                    <property name="fill">True</property>
+                    <property name="position">0</property>
+                  </packing>
+                </child>
+                <child>
+                  <object class="GtkFrame" id="frame3">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label_xalign">0</property>
+                    <property name="shadow_type">none</property>
+                    <child>
+                      <object class="GtkAlignment" id="alignment3">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="left_padding">12</property>
+                        <child>
+                          <object class="GtkBox" id="box7">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <property name="orientation">vertical</property>
+                            <property name="homogeneous">True</property>
+                            <child>
+                              <object class="GtkCheckButton" id="CB_RESTART_NUMBERING">
+                                <property name="label" translatable="no">Reset Page Numbering after title pages</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="draw_indicator">True</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">0</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkBox" id="box8">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <child>
+                                  <object class="GtkLabel" id="FT_PAGE_COUNT">
+                                    <property name="visible">True</property>
+                                    <property name="can_focus">False</property>
+                                    <property name="label" translatable="no">Page number</property>
+                                    <accessibility>
+                                      <relation type="label-for" target="NF_RESTART_NUMBERING"/>
+                                    </accessibility>
+                                  </object>
+                                  <packing>
+                                    <property name="expand">False</property>
+                                    <property name="fill">True</property>
+                                    <property name="position">0</property>
+                                  </packing>
+                                </child>
+                                <child>
+                                  <object class="GtkSpinButton" id="NF_RESTART_NUMBERING">
+                                    <property name="visible">True</property>
+                                    <property name="sensitive">False</property>
+                                    <property name="can_focus">True</property>
+                                    <property name="numeric">True</property>
+                                    <accessibility>
+                                      <relation type="labelled-by" target="FT_PAGE_COUNT"/>
+                                    </accessibility>
+                                  </object>
+                                  <packing>
+                                    <property name="expand">False</property>
+                                    <property name="fill">True</property>
+                                    <property name="position">1</property>
+                                  </packing>
+                                </child>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">1</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkCheckButton" id="CB_SET_PAGE_NUMBER">
+                                <property name="label" translatable="no">Set Page Number for first title page</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="draw_indicator">True</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkBox" id="box9">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <child>
+                                  <object class="GtkLabel" id="FT_PAGE_PAGES">
+                                    <property name="visible">True</property>
+                                    <property name="can_focus">False</property>
+                                    <property name="label" translatable="no">Page number</property>
+                                    <accessibility>
+                                      <relation type="label-for" target="NF_SET_PAGE_NUMBER"/>
+                                    </accessibility>
+                                  </object>
+                                  <packing>
+                                    <property name="expand">False</property>
+                                    <property name="fill">True</property>
+                                    <property name="position">0</property>
+                                  </packing>
+                                </child>
+                                <child>
+                                  <object class="GtkSpinButton" id="NF_SET_PAGE_NUMBER">
+                                    <property name="visible">True</property>
+                                    <property name="sensitive">False</property>
+                                    <property name="can_focus">True</property>
+                                    <property name="numeric">True</property>
+                                    <accessibility>
+                                      <relation type="labelled-by" target="FT_PAGE_PAGES"/>
+                                    </accessibility>
+                                  </object>
+                                  <packing>
+                                    <property name="expand">False</property>
+                                    <property name="fill">True</property>
+                                    <property name="position">1</property>
+                                  </packing>
+                                </child>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">3</property>
+                              </packing>
+                            </child>
+                          </object>
+                        </child>
+                      </object>
+                    </child>
+                    <child type="label">
+                      <object class="GtkLabel" id="label12">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">Page Numbering</property>
+                      </object>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">True</property>
+                    <property name="fill">True</property>
+                    <property name="position">1</property>
+                  </packing>
+                </child>
+                <child>
+                  <object class="GtkFrame" id="frame4">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label_xalign">0</property>
+                    <property name="shadow_type">none</property>
+                    <child>
+                      <object class="GtkAlignment" id="alignment4">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="left_padding">12</property>
+                        <child>
+                          <object class="GtkBox" id="box10">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <child>
+                              <object class="GtkComboBox" id="LB_PAGE_PROPERTIES">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                              </object>
+                              <packing>
+                                <property name="expand">True</property>
+                                <property name="fill">True</property>
+                                <property name="position">0</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkButton" id="PB_PAGE_PROPERTIES">
+                                <property name="label" translatable="no">Edit...</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">True</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">1</property>
+                              </packing>
+                            </child>
+                          </object>
+                        </child>
+                      </object>
+                    </child>
+                    <child type="label">
+                      <object class="GtkLabel" id="label13">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">Edit Page Properties</property>
+                      </object>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">False</property>
+                    <property name="fill">True</property>
+                    <property name="position">2</property>
+                  </packing>
+                </child>
+              </object>
+              <packing>
+                <property name="position">1</property>
+              </packing>
+            </child>
+            <child type="tab">
+              <object class="GtkLabel" id="Tab2">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="label" translatable="no">page 2</property>
+              </object>
+              <packing>
+                <property name="position">1</property>
+                <property name="tab_fill">False</property>
+              </packing>
+            </child>
+            <child>
+              <object class="GtkFrame" id="frame5">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="label_xalign">0</property>
+                <property name="shadow_type">none</property>
+                <child>
+                  <object class="GtkAlignment" id="alignment5">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="left_padding">12</property>
+                    <child>
+                      <object class="GtkBox" id="box11">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="orientation">vertical</property>
+                        <child>
+                          <object class="GtkRadioButton" id="2">
+                            <property name="label" translatable="no">Line break</property>
+                            <property name="visible">True</property>
+                            <property name="can_focus">True</property>
+                            <property name="receives_default">False</property>
+                            <property name="use_underline">True</property>
+                            <property name="xalign">0</property>
+                            <property name="active">True</property>
+                            <property name="draw_indicator">True</property>
+                          </object>
+                          <packing>
+                            <property name="expand">False</property>
+                            <property name="fill">True</property>
+                            <property name="position">0</property>
+                          </packing>
+                        </child>
+                        <child>
+                          <object class="GtkRadioButton" id="3">
+                            <property name="label" translatable="no">Column break</property>
+                            <property name="visible">True</property>
+                            <property name="can_focus">True</property>
+                            <property name="receives_default">False</property>
+                            <property name="use_underline">True</property>
+                            <property name="xalign">0</property>
+                            <property name="draw_indicator">True</property>
+                            <property name="group">2</property>
+                          </object>
+                          <packing>
+                            <property name="expand">False</property>
+                            <property name="fill">True</property>
+                            <property name="position">1</property>
+                          </packing>
+                        </child>
+                        <child>
+                          <object class="GtkRadioButton" id="1">
+                            <property name="label" translatable="no">Page break</property>
+                            <property name="visible">True</property>
+                            <property name="can_focus">True</property>
+                            <property name="receives_default">False</property>
+                            <property name="use_underline">True</property>
+                            <property name="xalign">0</property>
+                            <property name="draw_indicator">True</property>
+                            <property name="group">2</property>
+                          </object>
+                          <packing>
+                            <property name="expand">False</property>
+                            <property name="fill">True</property>
+                            <property name="position">2</property>
+                          </packing>
+                        </child>
+                        <child>
+                          <object class="GtkLabel" id="4">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <property name="label" translatable="no">Style</property>
+                            <property name="mnemonic_widget">5</property>
+                            <property name="xalign">0</property>
+                          </object>
+                          <packing>
+                            <property name="expand">False</property>
+                            <property name="fill">True</property>
+                            <property name="position">3</property>
+                          </packing>
+                        </child>
+                        <child>
+                          <object class="GtkComboBox" id="5">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <property name="model">liststore1</property>
+                          </object>
+                          <packing>
+                            <property name="expand">False</property>
+                            <property name="fill">True</property>
+                            <property name="position">4</property>
+                          </packing>
+                        </child>
+                        <child>
+                          <object class="GtkCheckButton" id="7">
+                            <property name="label" translatable="no">Change page number</property>
+                            <property name="visible">True</property>
+                            <property name="can_focus">True</property>
+                            <property name="receives_default">False</property>
+                            <property name="use_underline">True</property>
+                            <property name="xalign">0</property>
+                            <property name="draw_indicator">True</property>
+                            <accessibility>
+                              <relation type="label-for" target="8"/>
+                            </accessibility>
+                          </object>
+                          <packing>
+                            <property name="expand">False</property>
+                            <property name="fill">True</property>
+                            <property name="position">5</property>
+                          </packing>
+                        </child>
+                        <child>
+                          <object class="GtkBox" id="box12">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <child>
+                              <object class="GtkSpinButton" id="8">
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <accessibility>
+                                  <relation type="labelled-by" target="7"/>
+                                </accessibility>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">0</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <placeholder/>
+                            </child>
+                          </object>
+                          <packing>
+                            <property name="expand">False</property>
+                            <property name="fill">True</property>
+                            <property name="position">6</property>
+                          </packing>
+                        </child>
+                      </object>
+                    </child>
+                  </object>
+                </child>
+                <child type="label">
+                  <object class="GtkLabel" id="6">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label" translatable="no">Type</property>
+                  </object>
+                </child>
+              </object>
+              <packing>
+                <property name="position">2</property>
+              </packing>
+            </child>
+            <child type="tab">
+              <object class="GtkLabel" id="Tab3">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="label" translatable="no">page 3</property>
+              </object>
+              <packing>
+                <property name="position">2</property>
+                <property name="tab_fill">False</property>
+              </packing>
+            </child>
+            <child>
+              <object class="GtkBox" id="box13">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="homogeneous">True</property>
+                <child>
+                  <object class="GtkFrame" id="frame6">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label_xalign">0</property>
+                    <property name="shadow_type">none</property>
+                    <child>
+                      <object class="GtkAlignment" id="alignment6">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="left_padding">12</property>
+                        <child>
+                          <object class="GtkBox" id="box14">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <property name="orientation">vertical</property>
+                            <child>
+                              <object class="GtkRadioButton" id="15">
+                                <property name="label" translatable="no">Optimal</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="active">True</property>
+                                <property name="draw_indicator">True</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">0</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkRadioButton" id="16">
+                                <property name="label" translatable="no">Fit width and height</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="draw_indicator">True</property>
+                                <property name="group">15</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">1</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkRadioButton" id="17">
+                                <property name="label" translatable="no">Fit width</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="draw_indicator">True</property>
+                                <property name="group">15</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkRadioButton" id="18">
+                                <property name="label" translatable="no">100%</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="draw_indicator">True</property>
+                                <property name="group">15</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">3</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkBox" id="box15">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <child>
+                                  <object class="GtkRadioButton" id="19">
+                                    <property name="label" translatable="no">Variable</property>
+                                    <property name="visible">True</property>
+                                    <property name="can_focus">True</property>
+                                    <property name="receives_default">False</property>
+                                    <property name="use_underline">True</property>
+                                    <property name="xalign">0</property>
+                                    <property name="draw_indicator">True</property>
+                                    <property name="group">15</property>
+                                    <accessibility>
+                                      <relation type="label-for" target="20"/>
+                                    </accessibility>
+                                  </object>
+                                  <packing>
+                                    <property name="expand">False</property>
+                                    <property name="fill">True</property>
+                                    <property name="position">0</property>
+                                  </packing>
+                                </child>
+                                <child>
+                                  <object class="GtkSpinButton" id="20">
+                                    <property name="visible">True</property>
+                                    <property name="can_focus">True</property>
+                                    <accessibility>
+                                      <relation type="labelled-by" target="19"/>
+                                    </accessibility>
+                                  </object>
+                                  <packing>
+                                    <property name="expand">False</property>
+                                    <property name="fill">True</property>
+                                    <property name="position">1</property>
+                                  </packing>
+                                </child>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">4</property>
+                              </packing>
+                            </child>
+                          </object>
+                        </child>
+                      </object>
+                    </child>
+                    <child type="label">
+                      <object class="GtkLabel" id="14">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">Zoom factor</property>
+                      </object>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">False</property>
+                    <property name="fill">True</property>
+                    <property name="position">0</property>
+                  </packing>
+                </child>
+                <child>
+                  <object class="GtkFrame" id="frame7">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label_xalign">0</property>
+                    <property name="shadow_type">none</property>
+                    <child>
+                      <object class="GtkAlignment" id="alignment7">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="left_padding">12</property>
+                        <child>
+                          <object class="GtkBox" id="box16">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <property name="orientation">vertical</property>
+                            <child>
+                              <object class="GtkRadioButton" id="22">
+                                <property name="label" translatable="no">Automatic</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="active">True</property>
+                                <property name="draw_indicator">True</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">0</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkRadioButton" id="23">
+                                <property name="label" translatable="no">Single page</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">False</property>
+                                <property name="use_underline">True</property>
+                                <property name="xalign">0</property>
+                                <property name="draw_indicator">True</property>
+                                <property name="group">22</property>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">1</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkBox" id="box17">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <child>
+                                  <object class="GtkRadioButton" id="24">
+                                    <property name="label" translatable="no">Columns</property>
+                                    <property name="visible">True</property>
+                                    <property name="can_focus">True</property>
+                                    <property name="receives_default">False</property>
+                                    <property name="use_underline">True</property>
+                                    <property name="xalign">0</property>
+                                    <property name="draw_indicator">True</property>
+                                    <property name="group">22</property>
+                                    <accessibility>
+                                      <relation type="label-for" target="25"/>
+                                    </accessibility>
+                                  </object>
+                                  <packing>
+                                    <property name="expand">False</property>
+                                    <property name="fill">True</property>
+                                    <property name="position">0</property>
+                                  </packing>
+                                </child>
+                                <child>
+                                  <object class="GtkSpinButton" id="25">
+                                    <property name="visible">True</property>
+                                    <property name="can_focus">True</property>
+                                    <accessibility>
+                                      <relation type="labelled-by" target="24"/>
+                                    </accessibility>
+                                  </object>
+                                  <packing>
+                                    <property name="expand">False</property>
+                                    <property name="fill">True</property>
+                                    <property name="position">1</property>
+                                  </packing>
+                                </child>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkAlignment" id="alignment8">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="left_padding">10</property>
+                                <child>
+                                  <object class="GtkCheckButton" id="26">
+                                    <property name="label" translatable="no">Book mode</property>
+                                    <property name="visible">True</property>
+                                    <property name="can_focus">True</property>
+                                    <property name="receives_default">False</property>
+                                    <property name="use_underline">True</property>
+                                    <property name="xalign">0</property>
+                                    <property name="draw_indicator">True</property>
+                                  </object>
+                                </child>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">3</property>
+                              </packing>
+                            </child>
+                          </object>
+                        </child>
+                      </object>
+                    </child>
+                    <child type="label">
+                      <object class="GtkLabel" id="21">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">View layout</property>
+                      </object>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">False</property>
+                    <property name="fill">True</property>
+                    <property name="position">1</property>
+                  </packing>
+                </child>
+              </object>
+              <packing>
+                <property name="position">3</property>
+              </packing>
+            </child>
+            <child type="tab">
+              <object class="GtkLabel" id="label1">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="label" translatable="no">page 4</property>
+              </object>
+              <packing>
+                <property name="position">3</property>
+                <property name="tab_fill">False</property>
+              </packing>
+            </child>
+            <child>
+              <object class="GtkBox" id="box18">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="margin_left">10</property>
+                <property name="margin_right">10</property>
+                <child>
+                  <object class="GtkFrame" id="frame8">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label_xalign">0</property>
+                    <property name="shadow_type">none</property>
+                    <child>
+                      <object class="GtkAlignment" id="alignment9">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="left_padding">12</property>
+                        <child>
+                          <object class="GtkTreeView" id="treeview1">
+                            <property name="visible">True</property>
+                            <property name="can_focus">True</property>
+                            <property name="model">liststore2</property>
+                            <property name="headers_visible">False</property>
+                            <property name="search_column">0</property>
+                            <child internal-child="selection">
+                              <object class="GtkTreeSelection" id="treeview-selection3"/>
+                            </child>
+                          </object>
+                        </child>
+                      </object>
+                    </child>
+                    <child type="label">
+                      <object class="GtkLabel" id="label15">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">Level</property>
+                      </object>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">False</property>
+                    <property name="fill">True</property>
+                    <property name="position">0</property>
+                  </packing>
+                </child>
+                <child>
+                  <object class="GtkFrame" id="frame9">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label_xalign">0</property>
+                    <property name="shadow_type">none</property>
+                    <child>
+                      <object class="GtkAlignment" id="alignment10">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="left_padding">12</property>
+                        <child>
+                          <object class="GtkBox" id="box19">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <property name="spacing">10</property>
+                            <child>
+                              <object class="GtkBox" id="box20">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="orientation">vertical</property>
+                                <child>
+                                  <object class="GtkGrid" id="grid3">
+                                    <property name="visible">True</property>
+                                    <property name="can_focus">False</property>
+                                    <property name="column_spacing">10</property>
+                                    <child>
+                                      <object class="GtkLabel" id="label16">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                        <property name="label" translatable="no">Paragraph Style</property>
+                                        <property name="mnemonic_widget">combobox2</property>
+                                        <property name="xalign">0</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">0</property>
+                                        <property name="top_attach">0</property>
+                                        <property name="width">2</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkComboBox" id="combobox2">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">0</property>
+                                        <property name="top_attach">1</property>
+                                        <property name="width">2</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkLabel" id="label17">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                        <property name="label" translatable="no">Number</property>
+                                        <property name="mnemonic_widget">combobox3</property>
+                                        <property name="xalign">0</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">0</property>
+                                        <property name="top_attach">2</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkLabel" id="label18">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                        <property name="label" translatable="no">Character Style</property>
+                                        <property name="mnemonic_widget">combobox4</property>
+                                        <property name="xalign">0</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">0</property>
+                                        <property name="top_attach">3</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkLabel" id="label19">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                        <property name="label" translatable="no">Show sublevels</property>
+                                        <property name="mnemonic_widget">spinbutton2</property>
+                                        <property name="xalign">0</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">0</property>
+                                        <property name="top_attach">4</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkLabel" id="label20">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                        <property name="label" translatable="no">Separator</property>
+                                        <property name="xalign">0</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">0</property>
+                                        <property name="top_attach">5</property>
+                                        <property name="width">2</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkComboBox" id="combobox3">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">1</property>
+                                        <property name="top_attach">2</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkComboBox" id="combobox4">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">1</property>
+                                        <property name="top_attach">3</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkSpinButton" id="spinbutton2">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">True</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">1</property>
+                                        <property name="top_attach">4</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkEntry" id="entry2">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">True</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">1</property>
+                                        <property name="top_attach">6</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkEntry" id="entry3">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">True</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">1</property>
+                                        <property name="top_attach">7</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkSpinButton" id="spinbutton3">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">True</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">1</property>
+                                        <property name="top_attach">8</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkAlignment" id="alignment11">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                        <property name="left_padding">20</property>
+                                        <child>
+                                          <object class="GtkLabel" id="label21">
+                                            <property name="visible">True</property>
+                                            <property name="can_focus">False</property>
+                                            <property name="label" translatable="no">Before</property>
+                                            <property name="mnemonic_widget">entry2</property>
+                                            <property name="xalign">0</property>
+                                          </object>
+                                        </child>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">0</property>
+                                        <property name="top_attach">6</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkAlignment" id="alignment12">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                        <property name="left_padding">20</property>
+                                        <child>
+                                          <object class="GtkLabel" id="label22">
+                                            <property name="visible">True</property>
+                                            <property name="can_focus">False</property>
+                                            <property name="label" translatable="no">After</property>
+                                            <property name="mnemonic_widget">entry3</property>
+                                            <property name="xalign">0</property>
+                                          </object>
+                                        </child>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">0</property>
+                                        <property name="top_attach">7</property>
+                                      </packing>
+                                    </child>
+                                    <child>
+                                      <object class="GtkLabel" id="label23">
+                                        <property name="visible">True</property>
+                                        <property name="can_focus">False</property>
+                                        <property name="label" translatable="no">Start at</property>
+                                        <property name="mnemonic_widget">spinbutton3</property>
+                                        <property name="xalign">0</property>
+                                      </object>
+                                      <packing>
+                                        <property name="left_attach">0</property>
+                                        <property name="top_attach">8</property>
+                                      </packing>
+                                    </child>
+                                  </object>
+                                  <packing>
+                                    <property name="expand">False</property>
+                                    <property name="fill">True</property>
+                                    <property name="position">0</property>
+                                  </packing>
+                                </child>
+                              </object>
+                              <packing>
+                                <property name="expand">False</property>
+                                <property name="fill">True</property>
+                                <property name="position">0</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkDrawingArea" id="drawingarea1">
+                                <property name="width_request">150</property>
+                                <property name="height_request">200</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                              </object>
+                              <packing>
+                                <property name="expand">True</property>
+                                <property name="fill">True</property>
+                                <property name="position">1</property>
+                              </packing>
+                            </child>
+                          </object>
+                        </child>
+                      </object>
+                    </child>
+                    <child type="label">
+                      <object class="GtkLabel" id="label24">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">Numbering</property>
+                      </object>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">True</property>
+                    <property name="fill">True</property>
+                    <property name="position">1</property>
+                  </packing>
+                </child>
+              </object>
+              <packing>
+                <property name="position">4</property>
+              </packing>
+            </child>
+            <child type="tab">
+              <object class="GtkLabel" id="label14">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="label" translatable="no">page 5</property>
+              </object>
+              <packing>
+                <property name="position">4</property>
+                <property name="tab_fill">False</property>
+              </packing>
+            </child>
+            <child>
+              <object class="GtkBox" id="box21">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="margin_left">10</property>
+                <property name="margin_right">10</property>
+                <child>
+                  <object class="GtkFrame" id="frame10">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label_xalign">0</property>
+                    <property name="shadow_type">none</property>
+                    <child>
+                      <object class="GtkAlignment" id="alignment13">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="left_padding">12</property>
+                        <child>
+                          <object class="GtkTreeView" id="treeview2">
+                            <property name="visible">True</property>
+                            <property name="can_focus">True</property>
+                            <property name="model">liststore2</property>
+                            <property name="headers_visible">False</property>
+                            <property name="search_column">0</property>
+                            <child internal-child="selection">
+                              <object class="GtkTreeSelection" id="treeview-selection4"/>
+                            </child>
+                          </object>
+                        </child>
+                      </object>
+                    </child>
+                    <child type="label">
+                      <object class="GtkLabel" id="label26">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">Level</property>
+                      </object>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">False</property>
+                    <property name="fill">True</property>
+                    <property name="position">0</property>
+                  </packing>
+                </child>
+                <child>
+                  <object class="GtkFrame" id="frame11">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label_xalign">0</property>
+                    <property name="shadow_type">none</property>
+                    <child>
+                      <object class="GtkAlignment" id="alignment14">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="left_padding">12</property>
+                        <child>
+                          <object class="GtkGrid" id="grid4">
+                            <property name="visible">True</property>
+                            <property name="can_focus">False</property>
+                            <property name="row_spacing">10</property>
+                            <property name="column_spacing">10</property>
+                            <child>
+                              <object class="GtkLabel" id="label27">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">Numbering followed by</property>
+                                <property name="mnemonic_widget">combobox5</property>
+                                <property name="xalign">0</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">0</property>
+                                <property name="top_attach">0</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkLabel" id="label28">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">Numbering Alignment</property>
+                                <property name="mnemonic_widget">combobox6</property>
+                                <property name="xalign">0</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">0</property>
+                                <property name="top_attach">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkLabel" id="label29">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">Aligned at</property>
+                                <property name="mnemonic_widget">spinbutton6</property>
+                                <property name="xalign">0</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">0</property>
+                                <property name="top_attach">3</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkLabel" id="label30">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">Indent at</property>
+                                <property name="mnemonic_widget">spinbutton4</property>
+                                <property name="xalign">0</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">0</property>
+                                <property name="top_attach">4</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkComboBox" id="combobox5">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="top_attach">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkSpinButton" id="spinbutton4">
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="top_attach">4</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkLabel" id="label31">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="no">at</property>
+                                <property name="mnemonic_widget">spinbutton5</property>
+                                <property name="xalign">1</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">0</property>
+                                <property name="top_attach">1</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkSpinButton" id="spinbutton5">
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="top_attach">1</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkSpinButton" id="spinbutton6">
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="top_attach">3</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkComboBox" id="combobox6">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="top_attach">0</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkDrawingArea" id="drawingarea2">
+                                <property name="width_request">300</property>
+                                <property name="height_request">150</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">0</property>
+                                <property name="top_attach">5</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkButton" id="button6">
+                                <property name="label" translatable="no">Default</property>
+                                <property name="visible">True</property>
+                                <property name="can_focus">True</property>
+                                <property name="receives_default">True</property>
+                                <property name="valign">end</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="top_attach">5</property>
+                              </packing>
+                            </child>
+                          </object>
+                        </child>
+                      </object>
+                    </child>
+                    <child type="label">
+                      <object class="GtkLabel" id="label32">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">Position and spacing</property>
+                      </object>
+                    </child>
+                  </object>
+                  <packing>
+                    <property name="expand">True</property>
+                    <property name="fill">True</property>
+                    <property name="position">1</property>
+                  </packing>
+                </child>
+              </object>
+              <packing>
+                <property name="position">5</property>
+              </packing>
+            </child>
+            <child type="tab">
+              <object class="GtkLabel" id="label25">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="label" translatable="no">page 6</property>
+              </object>
+              <packing>
+                <property name="position">5</property>
+                <property name="tab_fill">False</property>
+              </packing>
+            </child>
+            <child>
+              <object class="GtkExpander" id="expander1">
+                <property name="visible">True</property>
+                <property name="can_focus">True</property>
+                <property name="resize_toplevel">True</property>
+                <child>
+                  <object class="GtkGrid" id="grid5">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="row_spacing">200</property>
+                    <property name="column_spacing">400</property>
+                    <child>
+                      <object class="GtkLabel" id="label34">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">label</property>
+                      </object>
+                      <packing>
+                        <property name="left_attach">0</property>
+                        <property name="top_attach">0</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkLabel" id="label35">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">label</property>
+                      </object>
+                      <packing>
+                        <property name="left_attach">0</property>
+                        <property name="top_attach">1</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkLabel" id="label36">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">label</property>
+                      </object>
+                      <packing>
+                        <property name="left_attach">0</property>
+                        <property name="top_attach">2</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkLabel" id="label37">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">label</property>
+                      </object>
+                      <packing>
+                        <property name="left_attach">1</property>
+                        <property name="top_attach">0</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkLabel" id="label38">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">label</property>
+                      </object>
+                      <packing>
+                        <property name="left_attach">1</property>
+                        <property name="top_attach">1</property>
+                      </packing>
+                    </child>
+                    <child>
+                      <object class="GtkLabel" id="label39">
+                        <property name="visible">True</property>
+                        <property name="can_focus">False</property>
+                        <property name="label" translatable="no">label</property>
+                      </object>
+                      <packing>
+                        <property name="left_attach">1</property>
+                        <property name="top_attach">2</property>
+                      </packing>
+                    </child>
+                  </object>
+                </child>
+                <child type="label">
+                  <object class="GtkLabel" id="label40">
+                    <property name="visible">True</property>
+                    <property name="can_focus">False</property>
+                    <property name="label" translatable="no">Details</property>
+                  </object>
+                </child>
+              </object>
+              <packing>
+                <property name="position">6</property>
+              </packing>
+            </child>
+            <child type="tab">
+              <object class="GtkLabel" id="label33">
+                <property name="visible">True</property>
+                <property name="can_focus">False</property>
+                <property name="label" translatable="no">page 7</property>
+              </object>
+              <packing>
+                <property name="position">6</property>
+                <property name="tab_fill">False</property>
+              </packing>
+            </child>
+          </object>
+          <packing>
+            <property name="expand">True</property>
+            <property name="fill">True</property>
+            <property name="position">1</property>
+          </packing>
+        </child>
+      </object>
+    </child>
+    <action-widgets>
+      <action-widget response="-6">cancel</action-widget>
+      <action-widget response="-5">ok</action-widget>
+    </action-widgets>
+  </object>
+</interface>
diff --git a/vcl/qa/cppunit/canvasbitmaptest.cxx b/vcl/qa/cppunit/canvasbitmaptest.cxx
new file mode 100644
index 000000000..511874a0c
--- /dev/null
+++ b/vcl/qa/cppunit/canvasbitmaptest.cxx
@@ -0,0 +1,773 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ *
+ * This file incorporates work covered by the following license notice:
+ *
+ *   Licensed to the Apache Software Foundation (ASF) under one or more
+ *   contributor license agreements. See the NOTICE file distributed
+ *   with this work for additional information regarding copyright
+ *   ownership. The ASF licenses this file to you under the Apache
+ *   License, Version 2.0 (the "License"); you may not use this file
+ *   except in compliance with the License. You may obtain a copy of
+ *   the License at http://www.apache.org/licenses/LICENSE-2.0 .
+ */
+
+// bootstrap stuff
+#include <test/bootstrapfixture.hxx>
+
+#include <com/sun/star/util/Endianness.hpp>
+#include <com/sun/star/rendering/ColorComponentTag.hpp>
+#include <com/sun/star/rendering/ColorSpaceType.hpp>
+#include <com/sun/star/rendering/RenderingIntent.hpp>
+#include <com/sun/star/rendering/XIntegerReadOnlyBitmap.hpp>
+#include <com/sun/star/rendering/XIntegerBitmapColorSpace.hpp>
+#include <com/sun/star/rendering/XBitmapPalette.hpp>
+
+#include <cppuhelper/implbase.hxx>
+#include <rtl/ref.hxx>
+#include <sal/log.hxx>
+
+#include <vcl/canvastools.hxx>
+#include <vcl/bitmapaccess.hxx>
+#include <vcl/bitmapex.hxx>
+
+#include <canvasbitmap.hxx>
+#include <algorithm>
+#include <bitmapwriteaccess.hxx>
+
+using namespace ::com::sun::star;
+using namespace vcl::unotools;
+
+namespace com::sun::star::rendering
+{
+
+static bool operator==( const RGBColor& rLHS, const ARGBColor& rRHS )
+{
+    return rLHS.Red == rRHS.Red && rLHS.Green == rRHS.Green && rLHS.Blue == rRHS.Blue;
+}
+
+}
+
+namespace
+{
+
+class CanvasBitmapTest : public test::BootstrapFixture
+{
+public:
+    CanvasBitmapTest() : BootstrapFixture(true, false) {}
+
+    void runTest();
+
+    CPPUNIT_TEST_SUITE(CanvasBitmapTest);
+    CPPUNIT_TEST(runTest);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+bool rangeCheck( const rendering::RGBColor& rColor )
+{
+    return rColor.Red < 0.0 || rColor.Red > 1.0 ||
+        rColor.Green < 0.0 || rColor.Green > 1.0 ||
+        rColor.Blue < 0.0 || rColor.Blue > 1.0;
+}
+
+void checkCanvasBitmap( const rtl::Reference<VclCanvasBitmap>& xBmp,
+                        const char*                            msg,
+                        int                                    nOriginalDepth )
+{
+    SAL_INFO("vcl", "Testing " << msg << ", with depth " << nOriginalDepth);
+
+    BitmapEx aContainedBmpEx( xBmp->getBitmapEx() );
+    Bitmap   aContainedBmp( aContainedBmpEx.GetBitmap() );
+    int      nDepth = nOriginalDepth;
+    int      extraBpp = 0;
+
+    {
+        Bitmap::ScopedReadAccess pAcc( aContainedBmp );
+        nDepth = pAcc->GetBitCount();
+        if( pAcc->GetScanlineFormat() == ScanlineFormat::N32BitTcMask )
+            extraBpp = 8; // the format has 8 unused bits
+    }
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Original bitmap size not (200,200)",
+                            Size(200,200), aContainedBmp.GetSizePixel());
+
+    CPPUNIT_ASSERT_MESSAGE( "Original bitmap size via API not (200,200)",
+                            xBmp->getSize().Width == 200 && xBmp->getSize().Height == 200);
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "alpha state mismatch",
+                            aContainedBmpEx.IsTransparent(), bool(xBmp->hasAlpha()));
+
+    CPPUNIT_ASSERT_MESSAGE( "getScaledBitmap() failed",
+                            xBmp->getScaledBitmap( geometry::RealSize2D(500,500), false ).is());
+
+    rendering::IntegerBitmapLayout aLayout;
+    uno::Sequence<sal_Int8> aPixelData = xBmp->getData(aLayout, geometry::IntegerRectangle2D(0,0,1,1));
+
+    const sal_Int32 nExpectedBitsPerPixel(
+        (aContainedBmpEx.IsTransparent() ? std::max(8,nDepth)+8 : nDepth) + extraBpp);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "# scanlines not 1",
+                            static_cast<sal_Int32>(1), aLayout.ScanLines);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "# scanline bytes mismatch",
+                            static_cast<sal_Int32>((nExpectedBitsPerPixel+7)/8), aLayout.ScanLineBytes);
+    CPPUNIT_ASSERT_MESSAGE( "# scanline stride mismatch",
+                            aLayout.ScanLineStride == (nExpectedBitsPerPixel+7)/8 ||
+                            aLayout.ScanLineStride == -(nExpectedBitsPerPixel+7)/8);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "# plane stride not 0",
+                            static_cast<sal_Int32>(0), aLayout.PlaneStride);
+
+    CPPUNIT_ASSERT_MESSAGE( "Color space not there",
+                            aLayout.ColorSpace.is());
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Palette existence does not conform to bitmap",
+                            (nDepth <= 8), aLayout.Palette.is());
+
+    uno::Sequence<sal_Int8> aPixelData2 = xBmp->getPixel( aLayout, geometry::IntegerPoint2D(0,0) );
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "getData and getPixel did not return same amount of data",
+                            aPixelData.getLength(), aPixelData2.getLength());
+
+    aPixelData = xBmp->getData(aLayout, geometry::IntegerRectangle2D(0,0,200,1));
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "# scanlines not 1 for getPixel",
+                            static_cast<sal_Int32>(1), aLayout.ScanLines);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "# scanline bytes mismatch for getPixel",
+                            static_cast<sal_Int32>((200*nExpectedBitsPerPixel+7)/8), aLayout.ScanLineBytes);
+    CPPUNIT_ASSERT_MESSAGE( "# scanline stride mismatch for getPixel",
+                            aLayout.ScanLineStride == (200*nExpectedBitsPerPixel+7)/8 ||
+                            aLayout.ScanLineStride == -(200*nExpectedBitsPerPixel+7)/8);
+
+    uno::Sequence< rendering::RGBColor >  aRGBColors  = xBmp->convertIntegerToRGB( aPixelData );
+    uno::Sequence< rendering::ARGBColor > aARGBColors = xBmp->convertIntegerToARGB( aPixelData );
+
+    const rendering::RGBColor*  pRGBStart ( aRGBColors.getConstArray() );
+    const rendering::RGBColor*  pRGBEnd   ( aRGBColors.getConstArray()+aRGBColors.getLength() );
+    const rendering::ARGBColor* pARGBStart( aARGBColors.getConstArray() );
+    std::pair<const rendering::RGBColor*,
+        const rendering::ARGBColor*> aRes = std::mismatch( pRGBStart, pRGBEnd, pARGBStart );
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "argb and rgb colors are not equal",
+                            pRGBEnd, aRes.first);
+
+    CPPUNIT_ASSERT_MESSAGE( "rgb colors are not within [0,1] range",
+                            std::none_of(pRGBStart,pRGBEnd,&rangeCheck));
+
+    CPPUNIT_ASSERT_DOUBLES_EQUAL_MESSAGE(
+        "First pixel is not white", 1.0, pRGBStart[0].Red, 1E-12);
+    CPPUNIT_ASSERT_DOUBLES_EQUAL_MESSAGE(
+        "First pixel is not white", 1.0, pRGBStart[0].Green, 1E-12);
+    CPPUNIT_ASSERT_DOUBLES_EQUAL_MESSAGE(
+        "First pixel is not white", 1.0, pRGBStart[0].Blue, 1E-12);
+    CPPUNIT_ASSERT_DOUBLES_EQUAL_MESSAGE(
+        "Second pixel is not opaque", 1.0, pARGBStart[1].Alpha, 1E-12);
+    if( aContainedBmpEx.IsTransparent() )
+    {
+        CPPUNIT_ASSERT_EQUAL_MESSAGE( "First pixel is not fully transparent",
+                                0.0, pARGBStart[0].Alpha);
+    }
+
+    CPPUNIT_ASSERT_MESSAGE( "Second pixel is not black",
+                            pRGBStart[1].Red == 0.0 && pRGBStart[1].Green == 0.0 && pRGBStart[1].Blue == 0.0);
+
+    if( nOriginalDepth > 8 )
+    {
+        const Color aCol(COL_GREEN);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE(
+            "Sixth pixel is not green (red component)",
+            vcl::unotools::toDoubleColor(aCol.GetRed()), pRGBStart[5].Red);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE(
+            "Sixth pixel is not green (green component)",
+            vcl::unotools::toDoubleColor(aCol.GetGreen()), pRGBStart[5].Green);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE(
+            "Sixth pixel is not green (blue component)",
+            vcl::unotools::toDoubleColor(aCol.GetBlue()), pRGBStart[5].Blue);
+    }
+    else if( nDepth <= 8 )
+    {
+        uno::Reference<rendering::XBitmapPalette> xPal = xBmp->getPalette();
+        CPPUNIT_ASSERT_MESSAGE( "8bit or less: missing palette",
+                                xPal.is());
+        CPPUNIT_ASSERT_EQUAL_MESSAGE( "Palette incorrect entry count",
+                                static_cast<sal_Int32>(1 << nOriginalDepth), xPal->getNumberOfEntries());
+        uno::Sequence<double> aIndex;
+        CPPUNIT_ASSERT_MESSAGE( "Palette is not read-only",
+                                !xPal->setIndex(aIndex,true,0));
+        CPPUNIT_ASSERT_MESSAGE( "Palette entry 0 is not opaque",
+                                xPal->getIndex(aIndex,0));
+        CPPUNIT_ASSERT_MESSAGE( "Palette has no valid color space",
+                                xPal->getColorSpace().is());
+    }
+
+    CPPUNIT_ASSERT_DOUBLES_EQUAL_MESSAGE(
+        "150th pixel is not white", 1.0, pRGBStart[150].Red, 1E-12);
+    CPPUNIT_ASSERT_DOUBLES_EQUAL_MESSAGE(
+        "150th pixel is not white", 1.0, pRGBStart[150].Green, 1E-12);
+    CPPUNIT_ASSERT_DOUBLES_EQUAL_MESSAGE(
+        "150th pixel is not white", 1.0, pRGBStart[150].Blue, 1E-12);
+
+    if( nOriginalDepth <= 8 )
+        return;
+
+    uno::Sequence<rendering::ARGBColor> aARGBColor(1);
+    uno::Sequence<rendering::RGBColor>  aRGBColor(1);
+    uno::Sequence<sal_Int8> aPixel3, aPixel4;
+
+    const Color aCol(COL_GREEN);
+    aARGBColor[0].Red   = vcl::unotools::toDoubleColor(aCol.GetRed());
+    aARGBColor[0].Green = vcl::unotools::toDoubleColor(aCol.GetGreen());
+    aARGBColor[0].Blue  = vcl::unotools::toDoubleColor(aCol.GetBlue());
+    aARGBColor[0].Alpha = 1.0;
+
+    aRGBColor[0].Red   = vcl::unotools::toDoubleColor(aCol.GetRed());
+    aRGBColor[0].Green = vcl::unotools::toDoubleColor(aCol.GetGreen());
+    aRGBColor[0].Blue  = vcl::unotools::toDoubleColor(aCol.GetBlue());
+
+    aPixel3 = xBmp->convertIntegerFromARGB( aARGBColor );
+    aPixel4 = xBmp->getPixel( aLayout, geometry::IntegerPoint2D(5,0) );
+    CPPUNIT_ASSERT_MESSAGE( "Green pixel from bitmap mismatch with manually converted green pixel",
+                            bool(aPixel3 == aPixel4));
+
+    if( !aContainedBmpEx.IsTransparent() )
+    {
+        aPixel3 = xBmp->convertIntegerFromRGB( aRGBColor );
+        CPPUNIT_ASSERT_MESSAGE( "Green pixel from bitmap mismatch with manually RGB-converted green pixel",
+                                bool(aPixel3 == aPixel4));
+    }
+
+}
+
+class TestBitmap : public cppu::WeakImplHelper< rendering::XIntegerReadOnlyBitmap,
+                                                 rendering::XBitmapPalette,
+                                                 rendering::XIntegerBitmapColorSpace >
+{
+private:
+    geometry::IntegerSize2D        maSize;
+    uno::Sequence<sal_Int8>        maComponentTags;
+    uno::Sequence<sal_Int32>       maComponentBitCounts;
+    rendering::IntegerBitmapLayout maLayout;
+    const sal_Int32                mnBitsPerPixel;
+
+    // XBitmap
+    virtual geometry::IntegerSize2D SAL_CALL getSize() override { return maSize; }
+    virtual sal_Bool SAL_CALL hasAlpha(  ) override { return mnBitsPerPixel != 8; }
+    virtual uno::Reference< rendering::XBitmap > SAL_CALL getScaledBitmap( const geometry::RealSize2D&,
+                                                                           sal_Bool ) override { return this; }
+
+    // XIntegerReadOnlyBitmap
+    virtual uno::Sequence< ::sal_Int8 > SAL_CALL getData( rendering::IntegerBitmapLayout&     bitmapLayout,
+                                                          const geometry::IntegerRectangle2D& rect ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE( "X1 out of bounds", rect.X1 >= 0 );
+        CPPUNIT_ASSERT_MESSAGE( "Y1 out of bounds", rect.Y1 >= 0 );
+        CPPUNIT_ASSERT_MESSAGE( "X2 out of bounds", rect.X2 <= maSize.Width );
+        CPPUNIT_ASSERT_MESSAGE( "Y2 out of bounds", rect.Y2 <= maSize.Height );
+
+        bitmapLayout = getMemoryLayout();
+
+        const sal_Int32 nWidth  = rect.X2-rect.X1;
+        const sal_Int32 nHeight = rect.Y2-rect.Y1;
+        const sal_Int32 nScanlineLen = (nWidth * mnBitsPerPixel + 7)/8;
+        uno::Sequence<sal_Int8> aRes( nScanlineLen * nHeight );
+        sal_Int8* pOut = aRes.getArray();
+
+        bitmapLayout.ScanLines     = nHeight;
+        bitmapLayout.ScanLineBytes =
+        bitmapLayout.ScanLineStride= nScanlineLen;
+
+        if( mnBitsPerPixel == 8 )
+        {
+            for( sal_Int32 y=0; y<nHeight; ++y )
+            {
+                for( sal_Int32 x=0; x<nWidth; ++x )
+                    pOut[ y*nScanlineLen + x ] = sal_Int8(x);
+            }
+        }
+        else
+        {
+            for( sal_Int32 y=0; y<nHeight; ++y )
+            {
+                for( sal_Int32 x=0; x<nWidth; ++x )
+                {
+                    pOut[ y*nScanlineLen + 4*x     ] = sal_Int8(rect.X1);
+                    pOut[ y*nScanlineLen + 4*x + 1 ] = sal_Int8(rect.Y2);
+                    pOut[ y*nScanlineLen + 4*x + 2 ] = sal_Int8(x);
+                    pOut[ y*nScanlineLen + 4*x + 3 ] = sal_Int8(rect.Y1);
+                }
+            }
+        }
+
+        return aRes;
+    }
+
+    virtual uno::Sequence< ::sal_Int8 > SAL_CALL getPixel( rendering::IntegerBitmapLayout&,
+                                                           const geometry::IntegerPoint2D&  ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("getPixel: method not implemented", false);
+        return uno::Sequence< sal_Int8 >();
+    }
+
+    /// @throws uno::RuntimeException
+    uno::Reference< rendering::XBitmapPalette > getPalette(  )
+    {
+        uno::Reference< XBitmapPalette > aRet;
+        if( mnBitsPerPixel == 8 )
+            aRet.set(this);
+        return aRet;
+    }
+
+    virtual rendering::IntegerBitmapLayout SAL_CALL getMemoryLayout(  ) override
+    {
+        rendering::IntegerBitmapLayout aLayout( maLayout );
+
+        const sal_Int32 nScanlineLen = (maSize.Width * mnBitsPerPixel + 7)/8;
+
+        aLayout.ScanLines     = maSize.Height;
+        aLayout.ScanLineBytes =
+        aLayout.ScanLineStride= nScanlineLen;
+        aLayout.Palette = getPalette();
+        aLayout.ColorSpace.set( this );
+
+        return aLayout;
+    }
+
+    // XBitmapPalette
+    virtual sal_Int32 SAL_CALL getNumberOfEntries() override
+    {
+        CPPUNIT_ASSERT_MESSAGE( "Got palette getNumberOfEntries interface call without handing out palette",
+                                getPalette().is() );
+
+        return 255;
+    }
+
+    virtual sal_Bool SAL_CALL getIndex( uno::Sequence< double >& entry,
+                                          ::sal_Int32 nIndex ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE( "Got palette getIndex interface call without handing out palette",
+                                getPalette().is() );
+        CPPUNIT_ASSERT_MESSAGE( "getIndex: index out of range",
+                                nIndex >= 0 && nIndex < 256 );
+        entry = colorToStdColorSpaceSequence(
+            Color(sal_uInt8(nIndex),
+                  sal_uInt8(nIndex),
+                  sal_uInt8(nIndex)) );
+
+        return true; // no palette transparency here.
+    }
+
+    virtual sal_Bool SAL_CALL setIndex( const uno::Sequence< double >&,
+                                          sal_Bool,
+                                          ::sal_Int32 nIndex ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE( "Got palette setIndex interface call without handing out palette",
+                                getPalette().is());
+        CPPUNIT_ASSERT_MESSAGE( "setIndex: index out of range",
+                                nIndex >= 0 && nIndex < 256);
+        return false;
+    }
+
+    struct PaletteColorSpaceHolder: public rtl::StaticWithInit<uno::Reference<rendering::XColorSpace>,
+                                                               PaletteColorSpaceHolder>
+    {
+        uno::Reference<rendering::XColorSpace> operator()()
+        {
+            return vcl::unotools::createStandardColorSpace();
+        }
+    };
+
+    virtual uno::Reference< rendering::XColorSpace > SAL_CALL getColorSpace(  ) override
+    {
+        // this is the method from XBitmapPalette. Return palette color
+        // space here
+        return PaletteColorSpaceHolder::get();
+    }
+
+    // XIntegerBitmapColorSpace
+    virtual ::sal_Int8 SAL_CALL getType(  ) override
+    {
+        return rendering::ColorSpaceType::RGB;
+    }
+
+    virtual uno::Sequence< sal_Int8 > SAL_CALL getComponentTags(  ) override
+    {
+        return maComponentTags;
+    }
+
+    virtual ::sal_Int8 SAL_CALL getRenderingIntent(  ) override
+    {
+        return rendering::RenderingIntent::PERCEPTUAL;
+    }
+
+    virtual uno::Sequence< beans::PropertyValue > SAL_CALL getProperties() override
+    {
+        CPPUNIT_ASSERT_MESSAGE("getProperties: method not implemented", false );
+        return uno::Sequence< ::beans::PropertyValue >();
+    }
+
+    virtual uno::Sequence< double > SAL_CALL convertColorSpace( const uno::Sequence< double >&,
+                                                                const uno::Reference< rendering::XColorSpace >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertColorSpace: method not implemented", false);
+        return uno::Sequence< double >();
+    }
+
+    virtual uno::Sequence< rendering::RGBColor > SAL_CALL convertToRGB( const uno::Sequence< double >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertToRGB: method not implemented", false);
+        return uno::Sequence< rendering::RGBColor >();
+    }
+
+    virtual uno::Sequence< rendering::ARGBColor > SAL_CALL convertToARGB( const uno::Sequence< double >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertToARGB: method not implemented", false);
+        return uno::Sequence< rendering::ARGBColor >();
+    }
+
+    virtual uno::Sequence< rendering::ARGBColor > SAL_CALL convertToPARGB( const uno::Sequence< double >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertToPARGB: method not implemented", false);
+        return uno::Sequence< rendering::ARGBColor >();
+    }
+
+    virtual uno::Sequence< double > SAL_CALL convertFromRGB( const uno::Sequence< rendering::RGBColor >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertFromRGB: method not implemented", false);
+        return uno::Sequence< double >();
+    }
+
+    virtual uno::Sequence< double > SAL_CALL convertFromARGB( const uno::Sequence< rendering::ARGBColor >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertFromARGB: this method is not expected to be called!", false);
+        return uno::Sequence< double >();
+    }
+
+    virtual uno::Sequence< double > SAL_CALL convertFromPARGB( const uno::Sequence< rendering::ARGBColor >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertFromPARGB: this method is not expected to be called!", false);
+        return uno::Sequence< double >();
+    }
+
+    virtual ::sal_Int32 SAL_CALL getBitsPerPixel(  ) override
+    {
+        return mnBitsPerPixel;
+    }
+
+    virtual uno::Sequence< ::sal_Int32 > SAL_CALL getComponentBitCounts(  ) override
+    {
+        return maComponentBitCounts;
+    }
+
+    virtual ::sal_Int8 SAL_CALL getEndianness(  ) override
+    {
+        return util::Endianness::LITTLE;
+    }
+
+    virtual uno::Sequence< double > SAL_CALL convertFromIntegerColorSpace( const uno::Sequence< ::sal_Int8 >& ,
+                                                                           const uno::Reference< rendering::XColorSpace >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertFromIntegerColorSpace: method not implemented", false);
+        return uno::Sequence< double >();
+    }
+
+    virtual uno::Sequence< ::sal_Int8 > SAL_CALL convertToIntegerColorSpace( const uno::Sequence< ::sal_Int8 >& ,
+                                                                             const uno::Reference< rendering::XIntegerBitmapColorSpace >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertToIntegerColorSpace: method not implemented", false);
+        return uno::Sequence< sal_Int8 >();
+    }
+
+    virtual uno::Sequence< rendering::RGBColor > SAL_CALL convertIntegerToRGB( const uno::Sequence< ::sal_Int8 >& deviceColor ) override
+    {
+        const uno::Sequence< rendering::ARGBColor > aTemp( convertIntegerToARGB(deviceColor) );
+        uno::Sequence< rendering::RGBColor > aRes( aTemp.getLength() );
+        std::transform(aTemp.begin(), aTemp.end(), aRes.begin(),
+            [](const rendering::ARGBColor& rColor) {
+                return rendering::RGBColor(rColor.Red,
+                                           rColor.Green,
+                                           rColor.Blue);
+        });
+
+        return aRes;
+    }
+
+    virtual uno::Sequence< rendering::ARGBColor > SAL_CALL convertIntegerToARGB( const uno::Sequence< ::sal_Int8 >& deviceColor ) override
+    {
+        const std::size_t  nLen( deviceColor.getLength() );
+        const sal_Int32 nBytesPerPixel(mnBitsPerPixel == 8 ? 1 : 4);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("number of channels no multiple of pixel element count",
+                               0, static_cast<int>(nLen%nBytesPerPixel));
+
+        uno::Sequence< rendering::ARGBColor > aRes( nLen / nBytesPerPixel );
+
+        if( getPalette().is() )
+        {
+            std::transform(deviceColor.begin(), deviceColor.end(), aRes.begin(),
+                [](sal_Int8 nIn) {
+                    auto fColor = vcl::unotools::toDoubleColor(nIn);
+                    return rendering::ARGBColor(1.0, fColor, fColor, fColor);
+                });
+        }
+        else
+        {
+            rendering::ARGBColor* pOut( aRes.getArray() );
+            for( std::size_t i=0; i<nLen; i+=4 )
+            {
+                *pOut++ = rendering::ARGBColor(
+                    vcl::unotools::toDoubleColor(deviceColor[i+3]),
+                    vcl::unotools::toDoubleColor(deviceColor[i+0]),
+                    vcl::unotools::toDoubleColor(deviceColor[i+1]),
+                    vcl::unotools::toDoubleColor(deviceColor[i+2]));
+            }
+        }
+
+        return aRes;
+    }
+
+    virtual uno::Sequence< rendering::ARGBColor > SAL_CALL convertIntegerToPARGB(
+        const uno::Sequence< ::sal_Int8 >& deviceColor) override
+    {
+        const std::size_t  nLen( deviceColor.getLength() );
+        const sal_Int32 nBytesPerPixel(mnBitsPerPixel == 8 ? 1 : 4);
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("number of channels no multiple of pixel element count",
+                               0, static_cast<int>(nLen%nBytesPerPixel));
+
+        uno::Sequence< rendering::ARGBColor > aRes( nLen / nBytesPerPixel );
+
+        if( getPalette().is() )
+        {
+            std::transform(deviceColor.begin(), deviceColor.end(), aRes.begin(),
+                [](sal_Int8 nIn) {
+                    auto fColor = vcl::unotools::toDoubleColor(nIn);
+                    return rendering::ARGBColor(1.0, fColor, fColor, fColor);
+                });
+        }
+        else
+        {
+            rendering::ARGBColor* pOut( aRes.getArray() );
+            for( std::size_t i=0; i<nLen; i+=4 )
+            {
+                const double fAlpha=vcl::unotools::toDoubleColor(deviceColor[i+3]);
+                *pOut++ = rendering::ARGBColor(
+                    fAlpha,
+                    fAlpha*vcl::unotools::toDoubleColor(deviceColor[i+0]),
+                    fAlpha*vcl::unotools::toDoubleColor(deviceColor[i+1]),
+                    fAlpha*vcl::unotools::toDoubleColor(deviceColor[i+2]));
+            }
+        }
+
+        return aRes;
+    }
+
+    virtual uno::Sequence< ::sal_Int8 > SAL_CALL convertIntegerFromRGB(
+        const uno::Sequence< rendering::RGBColor >&) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertIntegerFromRGB: method not implemented", false);
+        return uno::Sequence< sal_Int8 >();
+    }
+
+    virtual uno::Sequence< ::sal_Int8 > SAL_CALL convertIntegerFromARGB( const uno::Sequence< rendering::ARGBColor >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertIntegerFromARGB: method not implemented", false);
+        return uno::Sequence< sal_Int8 >();
+    }
+
+    virtual uno::Sequence< ::sal_Int8 > SAL_CALL convertIntegerFromPARGB( const uno::Sequence< rendering::ARGBColor >& ) override
+    {
+        CPPUNIT_ASSERT_MESSAGE("convertIntegerFromPARGB: method not implemented", false);
+        return uno::Sequence< sal_Int8 >();
+    }
+
+public:
+    TestBitmap( const geometry::IntegerSize2D& rSize, bool bPalette ) :
+        maSize(rSize),
+        maComponentTags(),
+        maComponentBitCounts(),
+        maLayout(),
+        mnBitsPerPixel( bPalette ? 8 : 32 )
+    {
+        if( bPalette )
+        {
+            maComponentTags.realloc(1);
+            maComponentTags[0] = rendering::ColorComponentTag::INDEX;
+
+            maComponentBitCounts.realloc(1);
+            maComponentBitCounts[0] = 8;
+        }
+        else
+        {
+            maComponentTags.realloc(4);
+            sal_Int8* pTags = maComponentTags.getArray();
+            pTags[0]        = rendering::ColorComponentTag::RGB_BLUE;
+            pTags[1]        = rendering::ColorComponentTag::RGB_GREEN;
+            pTags[2]        = rendering::ColorComponentTag::RGB_RED;
+            pTags[3]        = rendering::ColorComponentTag::ALPHA;
+
+            maComponentBitCounts.realloc(4);
+            sal_Int32* pCounts = maComponentBitCounts.getArray();
+            pCounts[0]         = 8;
+            pCounts[1]         = 8;
+            pCounts[2]         = 8;
+            pCounts[3]         = 8;
+        }
+
+        maLayout.ScanLines      = 0;
+        maLayout.ScanLineBytes  = 0;
+        maLayout.ScanLineStride = 0;
+        maLayout.PlaneStride    = 0;
+        maLayout.ColorSpace.clear();
+        maLayout.Palette.clear();
+        maLayout.IsMsbFirst     = false;
+    }
+};
+
+void CanvasBitmapTest::runTest()
+{
+    static const sal_Int8 lcl_depths[]={1,4,8,24};
+
+    // Testing VclCanvasBitmap wrapper
+
+    for( size_t i=0; i<SAL_N_ELEMENTS(lcl_depths); ++i )
+    {
+        const sal_Int8 nDepth( lcl_depths[i] );
+        Bitmap aBitmap(Size(200,200),nDepth);
+        aBitmap.Erase(COL_WHITE);
+        {
+            BitmapScopedWriteAccess pAcc(aBitmap);
+            if( pAcc.get() )
+            {
+                BitmapColor aBlack(0);
+                BitmapColor aWhite(0);
+                if( pAcc->HasPalette() )
+                {
+                    aBlack.SetIndex( sal::static_int_cast<sal_Int8>(pAcc->GetBestPaletteIndex(BitmapColor(0,0,0))) );
+                    aWhite.SetIndex( sal::static_int_cast<sal_Int8>(pAcc->GetBestPaletteIndex(BitmapColor(255,255,255))) );
+                }
+                else
+                {
+                    aBlack = COL_BLACK;
+                    aWhite = COL_WHITE;
+                }
+                pAcc->SetFillColor(COL_GREEN);
+                pAcc->FillRect(tools::Rectangle(0,0,100,100));
+                pAcc->SetPixel(0,0,aWhite);
+                pAcc->SetPixel(0,1,aBlack);
+                pAcc->SetPixel(0,2,aWhite);
+            }
+        }
+
+        rtl::Reference<VclCanvasBitmap> xBmp( new VclCanvasBitmap(BitmapEx(aBitmap)) );
+
+        checkCanvasBitmap( xBmp, "single bitmap", nDepth );
+
+        Bitmap aMask(Size(200,200),1);
+        aMask.Erase(COL_WHITE);
+        {
+            BitmapScopedWriteAccess pAcc(aMask);
+            if( pAcc.get() )
+            {
+                pAcc->SetFillColor(COL_BLACK);
+                pAcc->FillRect(tools::Rectangle(0,0,100,100));
+                pAcc->SetPixel(0,0,BitmapColor(1));
+                pAcc->SetPixel(0,1,BitmapColor(0));
+                pAcc->SetPixel(0,2,BitmapColor(1));
+            }
+        }
+
+        xBmp.set( new VclCanvasBitmap(BitmapEx(aBitmap,aMask)) );
+
+        checkCanvasBitmap( xBmp, "masked bitmap", nDepth );
+
+        AlphaMask aAlpha(Size(200,200));
+        aAlpha.Erase(255);
+        {
+            BitmapWriteAccess* pAcc = aAlpha.AcquireWriteAccess();
+            if( pAcc )
+            {
+                pAcc->SetFillColor(COL_BLACK);
+                pAcc->FillRect(tools::Rectangle(0,0,100,100));
+                pAcc->SetPixel(0,0,BitmapColor(255));
+                pAcc->SetPixel(0,1,BitmapColor(0));
+                pAcc->SetPixel(0,2,BitmapColor(255));
+                aAlpha.ReleaseAccess(pAcc);
+            }
+        }
+
+        xBmp.set( new VclCanvasBitmap(BitmapEx(aBitmap,aAlpha)) );
+
+        checkCanvasBitmap( xBmp, "alpha bitmap", nDepth );
+    }
+
+    // Testing XBitmap import
+
+    uno::Reference< rendering::XIntegerReadOnlyBitmap > xTestBmp(
+        new TestBitmap( geometry::IntegerSize2D(10,10), true ));
+
+    BitmapEx aBmp = vcl::unotools::bitmapExFromXBitmap(xTestBmp);
+    CPPUNIT_ASSERT_MESSAGE( "Palette bitmap is transparent",
+                            !aBmp.IsTransparent());
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Bitmap does not have size (10,10)",
+                            Size(10,10), aBmp.GetSizePixel());
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Bitmap does not have bitcount of 8",
+                            static_cast<sal_uInt16>(8),  aBmp.GetBitCount());
+    {
+        Bitmap aBitmap = aBmp.GetBitmap();
+        BitmapReadAccess* pBmpAcc   = aBitmap.AcquireReadAccess();
+
+        CPPUNIT_ASSERT_MESSAGE( "Bitmap has invalid BitmapReadAccess",
+                                pBmpAcc );
+
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("(0,0) incorrect content",
+                               BitmapColor(0), pBmpAcc->GetPixel(0,0));
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("(2,2) incorrect content",
+                               BitmapColor(2), pBmpAcc->GetPixel(2,2));
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("(9,2) incorrect content",
+                               BitmapColor(9), pBmpAcc->GetPixel(2,9));
+
+        Bitmap::ReleaseAccess(pBmpAcc);
+    }
+
+    xTestBmp.set( new TestBitmap( geometry::IntegerSize2D(10,10), false ));
+
+    aBmp = vcl::unotools::bitmapExFromXBitmap(xTestBmp);
+    CPPUNIT_ASSERT_MESSAGE( "Palette bitmap is not transparent",
+                            aBmp.IsTransparent());
+    CPPUNIT_ASSERT_MESSAGE( "Palette bitmap has no alpha",
+                            aBmp.IsAlpha());
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Bitmap does not have size (10,10)",
+                            Size(10,10), aBmp.GetSizePixel());
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Bitmap has bitcount of 24",
+                            static_cast<sal_uInt16>(24), aBmp.GetBitCount());
+    {
+        Bitmap aBitmap = aBmp.GetBitmap();
+        BitmapReadAccess* pBmpAcc   = aBitmap.AcquireReadAccess();
+        BitmapReadAccess* pAlphaAcc = aBmp.GetAlpha().AcquireReadAccess();
+
+        CPPUNIT_ASSERT_MESSAGE( "Bitmap has invalid BitmapReadAccess",
+                                pBmpAcc);
+        CPPUNIT_ASSERT_MESSAGE( "Bitmap has invalid alpha BitmapReadAccess",
+                                pAlphaAcc);
+
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("(0,0) incorrect content",
+                               BitmapColor(0,1,0), pBmpAcc->GetPixel(0,0));
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("(0,0) incorrect alpha content",
+                               BitmapColor(255), pAlphaAcc->GetPixel(0,0));
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("(2,2) incorrect content",
+                               BitmapColor(0,3,2), pBmpAcc->GetPixel(2,2));
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("(2,2) incorrect alpha content",
+                               BitmapColor(253), pAlphaAcc->GetPixel(2,2));
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("(9,2) incorrect content",
+                               BitmapColor(0,3,9), pBmpAcc->GetPixel(2,9));
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("(9,2) correct alpha content",
+                               BitmapColor(253), pAlphaAcc->GetPixel(2,9));
+
+        aBmp.GetAlpha().ReleaseAccess(pAlphaAcc);
+        Bitmap::ReleaseAccess(pBmpAcc);
+    }
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(CanvasBitmapTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/complextext.cxx b/vcl/qa/cppunit/complextext.cxx
new file mode 100644
index 000000000..85a5b3991
--- /dev/null
+++ b/vcl/qa/cppunit/complextext.cxx
@@ -0,0 +1,170 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <config_features.h>
+
+#include <ostream>
+#include <vector>
+
+#if HAVE_MORE_FONTS
+// must be declared before inclusion of test/bootstrapfixture.hxx
+static std::ostream& operator<<(std::ostream& rStream, const std::vector<long>& rVec);
+#endif
+#include <test/bootstrapfixture.hxx>
+
+#include <vcl/wrkwin.hxx>
+#include <vcl/virdev.hxx>
+// workaround MSVC2015 issue with std::unique_ptr
+#include <sallayout.hxx>
+#include <salgdi.hxx>
+
+#if HAVE_MORE_FONTS
+static std::ostream& operator<<(std::ostream& rStream, const std::vector<long>& rVec)
+{
+    rStream << "{ ";
+    for (size_t i = 0; i < rVec.size() - 1; i++)
+        rStream << rVec[i] << ", ";
+    rStream << rVec.back();
+    rStream << " }";
+    return rStream;
+}
+#endif
+
+class VclComplexTextTest : public test::BootstrapFixture
+{
+public:
+    VclComplexTextTest() : BootstrapFixture(true, false) {}
+
+    /// Play with font measuring etc.
+    void testArabic();
+    void testKashida();
+    void testTdf95650(); // Windows-only issue
+
+    CPPUNIT_TEST_SUITE(VclComplexTextTest);
+    CPPUNIT_TEST(testArabic);
+    CPPUNIT_TEST(testKashida);
+    CPPUNIT_TEST(testTdf95650);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void VclComplexTextTest::testArabic()
+{
+#if HAVE_MORE_FONTS
+    const unsigned char pOneTwoThreeUTF8[] = {
+        0xd9, 0x88, 0xd8, 0xa7, 0xd8, 0xad, 0xd9, 0x90,
+        0xd8, 0xaf, 0xd9, 0x92, 0x20, 0xd8, 0xa5, 0xd8,
+        0xab, 0xd9, 0x8d, 0xd9, 0x86, 0xd9, 0x8a, 0xd9,
+        0x86, 0x20, 0xd8, 0xab, 0xd9, 0x84, 0xd8, 0xa7,
+        0xd8, 0xab, 0xd8, 0xa9, 0xd9, 0x8c, 0x00
+    };
+    OUString aOneTwoThree( reinterpret_cast<char const *>(pOneTwoThreeUTF8),
+                           SAL_N_ELEMENTS( pOneTwoThreeUTF8 ) - 1,
+                           RTL_TEXTENCODING_UTF8 );
+    ScopedVclPtrInstance<WorkWindow> pWin(static_cast<vcl::Window *>(nullptr));
+    CPPUNIT_ASSERT( pWin );
+
+    vcl::Font aFont("DejaVu Sans", "Book", Size(0, 12));
+
+    OutputDevice *pOutDev = pWin.get();
+    pOutDev->SetFont( aFont );
+
+    // absolute character widths AKA text array.
+    std::vector<long> aRefCharWidths {6,  9,  16, 16, 22, 22, 26, 29, 32, 32,
+                                      36, 40, 49, 53, 56, 63, 63, 66, 72, 72};
+    std::vector<long> aCharWidths(aOneTwoThree.getLength(), 0);
+    long nTextWidth = pOutDev->GetTextArray(aOneTwoThree, aCharWidths.data());
+
+    CPPUNIT_ASSERT_EQUAL(aRefCharWidths, aCharWidths);
+    // this sporadically returns 75 or 74 on some of the windows tinderboxes eg. tb73
+    CPPUNIT_ASSERT_EQUAL(72L, nTextWidth);
+    CPPUNIT_ASSERT_EQUAL(nTextWidth, aCharWidths.back());
+
+    // text advance width and line height
+    CPPUNIT_ASSERT_EQUAL(72L, pOutDev->GetTextWidth(aOneTwoThree));
+    CPPUNIT_ASSERT_EQUAL(14L, pOutDev->GetTextHeight());
+
+    // exact bounding rectangle, not essentially the same as text width/height
+    tools::Rectangle aBoundRect, aTestRect( 0, 1, 71, 15 );
+    pOutDev->GetTextBoundRect(aBoundRect, aOneTwoThree);
+    CPPUNIT_ASSERT_EQUAL(aTestRect, aBoundRect);
+
+#if 0
+    // FIXME: This seems to be wishful thinking, GetTextRect() does not take
+    // rotation into account.
+
+    // normal orientation
+    tools::Rectangle aInput;
+    tools::Rectangle aRect = pOutDev->GetTextRect( aInput, aOneTwoThree );
+
+    // now rotate 270 degrees
+    vcl::Font aRotated( aFont );
+    aRotated.SetOrientation( 2700 );
+    pOutDev->SetFont( aRotated );
+    tools::Rectangle aRectRot = pOutDev->GetTextRect( aInput, aOneTwoThree );
+
+    // Check that we did do the rotation...
+    fprintf( stderr, "%ld %ld %ld %ld\n",
+             aRect.GetWidth(), aRect.GetHeight(),
+             aRectRot.GetWidth(), aRectRot.GetHeight() );
+    CPPUNIT_ASSERT( aRectRot.GetWidth() == aRect.GetHeight() );
+    CPPUNIT_ASSERT( aRectRot.GetHeight() == aRect.GetWidth() );
+#endif
+#endif
+}
+
+void VclComplexTextTest::testKashida()
+{
+#if HAVE_MORE_FONTS
+    // Cache the glyph list of some Arabic text.
+    ScopedVclPtrInstance<VirtualDevice> pOutputDevice;
+    auto aText
+        = OUString::fromUtf8(u8"ﻊﻨﺻﺭ ﺎﻠﻓﻮﺴﻓﻭﺭ ﻊﻨﺻﺭ ﻒﻟﺰﻳ ﺺﻠﺑ. ﺖﺘﻛﻮﻧ ﺎﻟﺩﻭﺭﺓ ﺎﻟﺭﺎﺒﻋﺓ ﻢﻧ ١٥ ﻊﻨﺻﺭ�.");
+    std::unique_ptr<SalLayout> pLayout = pOutputDevice->ImplLayout(
+        aText, 0, aText.getLength(), Point(0, 0), 0, nullptr, SalLayoutFlags::GlyphItemsOnly);
+    const SalLayoutGlyphs* pGlyphs = pLayout->GetGlyphs();
+    if (!pGlyphs)
+        // Failed in some non-interesting ways.
+        return;
+    SalLayoutGlyphs aGlyphs = *pGlyphs;
+
+    // Now lay it out using the cached glyph list.
+    ImplLayoutArgs aLayoutArgs(aText, 0, aText.getLength(), SalLayoutFlags::NONE,
+                               pOutputDevice->GetFont().GetLanguageTag(), nullptr);
+    pLayout = pOutputDevice->GetGraphics()->GetTextLayout(0);
+    CPPUNIT_ASSERT(pLayout->LayoutText(aLayoutArgs, &aGlyphs));
+
+    // Without the accompanying fix in place, this test would have failed with 'assertion failed'.
+    // The kashida justification flag was lost when going via the glyph cache.
+    CPPUNIT_ASSERT(aLayoutArgs.mnFlags & SalLayoutFlags::KashidaJustification);
+#endif
+}
+
+void VclComplexTextTest::testTdf95650()
+{
+    const sal_Unicode pTxt[] = {
+        0x0131, 0x0302, 0x0504, 0x4E44, 0x3031, 0x3030, 0x3531, 0x2D30,
+        0x3037, 0x0706, 0x0908, 0x0B0A, 0x0D0C, 0x0F0E, 0x072E, 0x100A,
+        0x0D11, 0x1312, 0x0105, 0x020A, 0x0512, 0x1403, 0x030C, 0x1528,
+        0x2931, 0x632E, 0x7074, 0x0D20, 0x0E0A, 0x100A, 0xF00D, 0x0D20,
+        0x030A, 0x0C0B, 0x20E0, 0x0A0D
+    };
+    OUString aTxt(pTxt, SAL_N_ELEMENTS(pTxt) - 1);
+    ScopedVclPtrInstance<WorkWindow> pWin(static_cast<vcl::Window *>(nullptr));
+    CPPUNIT_ASSERT(pWin);
+
+    OutputDevice *pOutDev = pWin.get();
+    // Check that the following executes without failing assertion
+    pOutDev->ImplLayout(aTxt, 9, 1, Point(), 0, nullptr, SalLayoutFlags::BiDiRtl);
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(VclComplexTextTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/data/123_Numbers.gif b/vcl/qa/cppunit/data/123_Numbers.gif
new file mode 100644
index 000000000..2e47e28cb
--- /dev/null
+++ b/vcl/qa/cppunit/data/123_Numbers.gif
diff --git a/vcl/qa/cppunit/data/Exif1.jpg b/vcl/qa/cppunit/data/Exif1.jpg
new file mode 100644
index 000000000..a81425e75
--- /dev/null
+++ b/vcl/qa/cppunit/data/Exif1.jpg
diff --git a/vcl/qa/cppunit/data/Exif1_090CW.jpg b/vcl/qa/cppunit/data/Exif1_090CW.jpg
new file mode 100644
index 000000000..bb8a81a16
--- /dev/null
+++ b/vcl/qa/cppunit/data/Exif1_090CW.jpg
diff --git a/vcl/qa/cppunit/data/Exif1_180.jpg b/vcl/qa/cppunit/data/Exif1_180.jpg
new file mode 100644
index 000000000..b18b70f13
--- /dev/null
+++ b/vcl/qa/cppunit/data/Exif1_180.jpg
diff --git a/vcl/qa/cppunit/data/Exif1_270CW.jpg b/vcl/qa/cppunit/data/Exif1_270CW.jpg
new file mode 100644
index 000000000..f10764114
--- /dev/null
+++ b/vcl/qa/cppunit/data/Exif1_270CW.jpg
diff --git a/vcl/qa/cppunit/data/SimpleExample.svg b/vcl/qa/cppunit/data/SimpleExample.svg
new file mode 100644
index 000000000..6890b5456
--- /dev/null
+++ b/vcl/qa/cppunit/data/SimpleExample.svg
@@ -0,0 +1,4 @@
+<svg width="50" height="50" version="1.1" viewBox="0 0 50 50" xmlns="http://www.w3.org/2000/svg">
+ <rect x="0" y="0" width="50" height="50" fill="#aaaaaa"/>
+ <rect x="5" y="5" width="40" height="40" fill="#ff44aa"/>
+</svg>
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.bmp b/vcl/qa/cppunit/data/TypeDetectionExample.bmp
new file mode 100644
index 000000000..5197e42a7
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.bmp
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.eps b/vcl/qa/cppunit/data/TypeDetectionExample.eps
new file mode 100644
index 000000000..7f0db47bc
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.eps
@@ -0,0 +1,82 @@
+%!PS-Adobe-3.0 EPSF-3.0
+%%Creator: cairo 1.16.0 (https://cairographics.org)
+%%CreationDate: Sat May  2 14:29:27 2020
+%%Pages: 1
+%%DocumentData: Clean7Bit
+%%LanguageLevel: 2
+%%BoundingBox: 0 1 7 8
+%%EndComments
+%%BeginProlog
+50 dict begin
+/q { gsave } bind def
+/Q { grestore } bind def
+/cm { 6 array astore concat } bind def
+/w { setlinewidth } bind def
+/J { setlinecap } bind def
+/j { setlinejoin } bind def
+/M { setmiterlimit } bind def
+/d { setdash } bind def
+/m { moveto } bind def
+/l { lineto } bind def
+/c { curveto } bind def
+/h { closepath } bind def
+/re { exch dup neg 3 1 roll 5 3 roll moveto 0 rlineto
+      0 exch rlineto 0 rlineto closepath } bind def
+/S { stroke } bind def
+/f { fill } bind def
+/f* { eofill } bind def
+/n { newpath } bind def
+/W { clip } bind def
+/W* { eoclip } bind def
+/BT { } bind def
+/ET { } bind def
+/BDC { mark 3 1 roll /BDC pdfmark } bind def
+/EMC { mark /EMC pdfmark } bind def
+/cairo_store_point { /cairo_point_y exch def /cairo_point_x exch def } def
+/Tj { show currentpoint cairo_store_point } bind def
+/TJ {
+  {
+    dup
+    type /stringtype eq
+    { show } { -0.001 mul 0 cairo_font_matrix dtransform rmoveto } ifelse
+  } forall
+  currentpoint cairo_store_point
+} bind def
+/cairo_selectfont { cairo_font_matrix aload pop pop pop 0 0 6 array astore
+    cairo_font exch selectfont cairo_point_x cairo_point_y moveto } bind def
+/Tf { pop /cairo_font exch def /cairo_font_matrix where
+      { pop cairo_selectfont } if } bind def
+/Td { matrix translate cairo_font_matrix matrix concatmatrix dup
+      /cairo_font_matrix exch def dup 4 get exch 5 get cairo_store_point
+      /cairo_font where { pop cairo_selectfont } if } bind def
+/Tm { 2 copy 8 2 roll 6 array astore /cairo_font_matrix exch def
+      cairo_store_point /cairo_font where { pop cairo_selectfont } if } bind def
+/g { setgray } bind def
+/rg { setrgbcolor } bind def
+/d1 { setcachedevice } bind def
+/cairo_data_source {
+  CairoDataIndex CairoData length lt
+    { CairoData CairoDataIndex get /CairoDataIndex CairoDataIndex 1 add def }
+    { () } ifelse
+} def
+/cairo_flush_ascii85_file { cairo_ascii85_file status { cairo_ascii85_file flushfile } if } def
+/cairo_image { image cairo_flush_ascii85_file } def
+/cairo_imagemask { imagemask cairo_flush_ascii85_file } def
+%%EndProlog
+%%BeginSetup
+%%EndSetup
+%%Page: 1 1
+%%BeginPageSetup
+%%PageBoundingBox: 0 1 7 8
+%%EndPageSetup
+q 0 1 7 7 rectclip
+1 0 0 -1 0 8 cm q
+0.956863 0.831373 0.266667 rg
+3.75 0.75 m 5.41 0.75 6.75 2.09 6.75 3.75 c 6.75 5.41 5.41 6.75 3.75 6.75
+ c 2.09 6.75 0.75 5.41 0.75 3.75 c 0.75 2.09 2.09 0.75 3.75 0.75 c h
+3.75 0.75 m f
+Q Q
+showpage
+%%Trailer
+end
+%%EOF
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.gif b/vcl/qa/cppunit/data/TypeDetectionExample.gif
new file mode 100644
index 000000000..b33eb4f90
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.gif
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.jpg b/vcl/qa/cppunit/data/TypeDetectionExample.jpg
new file mode 100644
index 000000000..b8436eaa1
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.jpg
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.met b/vcl/qa/cppunit/data/TypeDetectionExample.met
new file mode 100644
index 000000000..7635e841f
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.met
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.pcx b/vcl/qa/cppunit/data/TypeDetectionExample.pcx
new file mode 100644
index 000000000..639323455
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.pcx
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.pdf b/vcl/qa/cppunit/data/TypeDetectionExample.pdf
new file mode 100644
index 000000000..b68bff5e1
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.pdf
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.png b/vcl/qa/cppunit/data/TypeDetectionExample.png
new file mode 100644
index 000000000..f73f5fd74
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.png
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.psd b/vcl/qa/cppunit/data/TypeDetectionExample.psd
new file mode 100644
index 000000000..8282b14fd
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.psd
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.svg b/vcl/qa/cppunit/data/TypeDetectionExample.svg
new file mode 100644
index 000000000..e23e44c23
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.svg
@@ -0,0 +1,4 @@
+<svg width="10" height="10" version="1.1" viewBox="0 0 10 10" xmlns="http://www.w3.org/2000/svg">
+ <rect x="0" y="0" width="10" height="10" fill="#ffffff"/>
+ <rect x="1" y="1" width="8" height="8" fill="#72d1c8"/>
+</svg>
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.svgz b/vcl/qa/cppunit/data/TypeDetectionExample.svgz
new file mode 100644
index 000000000..17c1bcc3c
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.svgz
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.tga b/vcl/qa/cppunit/data/TypeDetectionExample.tga
new file mode 100644
index 000000000..870c88b10
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.tga
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.tif b/vcl/qa/cppunit/data/TypeDetectionExample.tif
new file mode 100644
index 000000000..dc74dc958
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.tif
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.wmf b/vcl/qa/cppunit/data/TypeDetectionExample.wmf
new file mode 100644
index 000000000..7ed706928
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.wmf
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.xbm b/vcl/qa/cppunit/data/TypeDetectionExample.xbm
new file mode 100644
index 000000000..b40d1a45e
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.xbm
@@ -0,0 +1,5 @@
+#define sample_width 10
+#define sample_height 10
+static unsigned char sample_bits[] = {
+   0x00, 0x00, 0xfe, 0x01, 0xfe, 0x01, 0xfe, 0x01, 0xfe, 0x01, 0xfe, 0x01,
+   0xfe, 0x01, 0xfe, 0x01, 0xfe, 0x01, 0x00, 0x00 };
diff --git a/vcl/qa/cppunit/data/TypeDetectionExample.xpm b/vcl/qa/cppunit/data/TypeDetectionExample.xpm
new file mode 100644
index 000000000..7b9b94359
--- /dev/null
+++ b/vcl/qa/cppunit/data/TypeDetectionExample.xpm
@@ -0,0 +1,15 @@
+/* XPM */
+static char * sample_xpm[] = {
+"10 10 2 1",
+" 	c #FFFFFF",
+".	c #72D1C8",
+"          ",
+" ........ ",
+" ........ ",
+" ........ ",
+" ........ ",
+" ........ ",
+" ........ ",
+" ........ ",
+" ........ ",
+"          "};
diff --git a/vcl/qa/cppunit/data/inch-size.emf b/vcl/qa/cppunit/data/inch-size.emf
new file mode 100644
index 000000000..ac5a1b805
--- /dev/null
+++ b/vcl/qa/cppunit/data/inch-size.emf
diff --git a/vcl/qa/cppunit/data/testBasicMorphology.png b/vcl/qa/cppunit/data/testBasicMorphology.png
new file mode 100644
index 000000000..5db565779
--- /dev/null
+++ b/vcl/qa/cppunit/data/testBasicMorphology.png
diff --git a/vcl/qa/cppunit/data/testBasicMorphologyDilated1.png b/vcl/qa/cppunit/data/testBasicMorphologyDilated1.png
new file mode 100644
index 000000000..ba335bab3
--- /dev/null
+++ b/vcl/qa/cppunit/data/testBasicMorphologyDilated1.png
diff --git a/vcl/qa/cppunit/data/testBasicMorphologyDilated1Eroded1.png b/vcl/qa/cppunit/data/testBasicMorphologyDilated1Eroded1.png
new file mode 100644
index 000000000..3b10a949a
--- /dev/null
+++ b/vcl/qa/cppunit/data/testBasicMorphologyDilated1Eroded1.png
diff --git a/vcl/qa/cppunit/data/testBasicMorphologyDilated2.png b/vcl/qa/cppunit/data/testBasicMorphologyDilated2.png
new file mode 100644
index 000000000..30d90757e
--- /dev/null
+++ b/vcl/qa/cppunit/data/testBasicMorphologyDilated2.png
diff --git a/vcl/qa/cppunit/data/testBasicMorphologyDilated2Eroded1.png b/vcl/qa/cppunit/data/testBasicMorphologyDilated2Eroded1.png
new file mode 100644
index 000000000..a506577da
--- /dev/null
+++ b/vcl/qa/cppunit/data/testBasicMorphologyDilated2Eroded1.png
diff --git a/vcl/qa/cppunit/dndtest.cxx b/vcl/qa/cppunit/dndtest.cxx
new file mode 100644
index 000000000..37629239b
--- /dev/null
+++ b/vcl/qa/cppunit/dndtest.cxx
@@ -0,0 +1,311 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ *
+ * This file incorporates work covered by the following license notice:
+ *
+ *   Licensed to the Apache Software Foundation (ASF) under one or more
+ *   contributor license agreements. See the NOTICE file distributed
+ *   with this work for additional information regarding copyright
+ *   ownership. The ASF licenses this file to you under the Apache
+ *   License, Version 2.0 (the "License"); you may not use this file
+ *   except in compliance with the License. You may obtain a copy of
+ *   the License at http://www.apache.org/licenses/LICENSE-2.0 .
+ */
+
+#include <unotest/filters-test.hxx>
+#include <test/bootstrapfixture.hxx>
+
+#include <vcl/event.hxx>
+#include <vcl/svapp.hxx>
+#include <vcl/wrkwin.hxx>
+#include <vcl/lstbox.hxx>
+
+#include <cppuhelper/implbase.hxx>
+
+#include <com/sun/star/lang/XComponent.hpp>
+#include <com/sun/star/datatransfer/XTransferable.hpp>
+#include <com/sun/star/datatransfer/clipboard/XClipboard.hpp>
+#include <com/sun/star/datatransfer/dnd/XDropTarget.hpp>
+#include <com/sun/star/datatransfer/dnd/XDragSourceListener.hpp>
+#include <com/sun/star/datatransfer/dnd/XDropTargetListener.hpp>
+#include <com/sun/star/datatransfer/dnd/XDragGestureRecognizer.hpp>
+#include <com/sun/star/datatransfer/dnd/XDragGestureListener.hpp>
+
+using namespace ::com::sun::star::io;
+using namespace ::com::sun::star::uno;
+using namespace ::com::sun::star::lang;
+using namespace ::com::sun::star::datatransfer;
+using namespace ::com::sun::star::datatransfer::clipboard;
+using namespace ::com::sun::star::datatransfer::dnd;
+
+class MyWin : public WorkWindow
+{
+public:
+                MyWin( vcl::Window* pParent, WinBits nWinStyle );
+
+    void        MouseMove( const MouseEvent& rMEvt );
+    void        MouseButtonDown( const MouseEvent& rMEvt );
+    void        MouseButtonUp( const MouseEvent& rMEvt );
+    void        KeyInput( const KeyEvent& rKEvt );
+    void        KeyUp( const KeyEvent& rKEvt );
+    void        Paint( const Rectangle& rRect );
+    void        Resize();
+};
+
+class MyDragAndDropListener: public ::cppu::WeakImplHelper < XDropTargetListener, XDragGestureListener, XDragSourceListener >
+{
+    vcl::Window * m_pWindow;
+
+public:
+
+    explicit MyDragAndDropListener( vcl::Window * pWindow ) : m_pWindow( pWindow ) {};
+
+    virtual void SAL_CALL dragGestureRecognized( const DragGestureEvent& dge ) throw(RuntimeException);
+    virtual void SAL_CALL drop( const DropTargetDropEvent& dtde ) throw(RuntimeException);
+    virtual void SAL_CALL dragEnter( const DropTargetDragEnterEvent& dtde ) throw(RuntimeException);
+    virtual void SAL_CALL dragExit( const DropTargetEvent& dte ) throw(RuntimeException);
+    virtual void SAL_CALL dragOver( const DropTargetDragEvent& dtde ) throw(RuntimeException);
+    virtual void SAL_CALL dropActionChanged( const DropTargetDragEvent& dtde ) throw(RuntimeException);
+    virtual void SAL_CALL dragDropEnd( const DragSourceDropEvent& dsde ) throw(RuntimeException);
+    virtual void SAL_CALL dragEnter( const DragSourceDragEvent& dsdee ) throw(RuntimeException);
+    virtual void SAL_CALL dragExit( const DragSourceEvent& dse ) throw(RuntimeException);
+    virtual void SAL_CALL dragOver( const DragSourceDragEvent& dsde ) throw(RuntimeException);
+    virtual void SAL_CALL dropActionChanged( const DragSourceDragEvent& dsde ) throw(RuntimeException);
+    virtual void SAL_CALL disposing( const EventObject& eo ) throw(RuntimeException);
+};
+
+class MyInfoBox : public InfoBox
+{
+
+public:
+
+    explicit MyInfoBox( vcl::Window* pParent );
+};
+
+class MyListBox : public ListBox
+{
+
+public:
+
+    explicit MyListBox( vcl::Window* pParent );
+};
+
+class StringTransferable : public ::cppu::WeakImplHelper< XTransferable >
+{
+    const OUString         m_aData;
+    Sequence< DataFlavor > m_aFlavorList;
+
+public:
+    explicit StringTransferable( const OUString& rString ) : m_aData( rString ), m_aFlavorList( 1 )
+    {
+        DataFlavor df;
+
+        df.MimeType = "text/plain;charset=utf-16";
+        df.DataType = cppu::UnoType<OUString>::get();
+
+         m_aFlavorList[0] = df;
+    };
+
+    virtual Any SAL_CALL getTransferData( const DataFlavor& aFlavor ) throw(UnsupportedFlavorException, IOException, RuntimeException);
+    virtual Sequence< DataFlavor > SAL_CALL getTransferDataFlavors(  ) throw(RuntimeException);
+    virtual bool SAL_CALL isDataFlavorSupported( const DataFlavor& aFlavor ) throw(RuntimeException);
+};
+
+class VclDnDTest : public test::BootstrapFixture
+{
+public:
+    VclDnDTest() : BootstrapFixture(true, false) {}
+
+    /// Play with drag and drop
+    void testDnD();
+
+    CPPUNIT_TEST_SUITE(VclDnDTest);
+    CPPUNIT_TEST(testDnD);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void VclDnDTest::testDnD()
+{
+    MyWin aMainWin( NULL, WB_APP | WB_STDWORK );
+    aMainWin.SetText( OUString( "Drag And Drop - Workbench"  ) );
+    aMainWin.Show();
+
+    // test the clipboard code
+    Reference< XClipboard > xClipboard = aMainWin.GetClipboard();
+    CPPUNIT_ASSERT_MESSAGE("System clipboard not available",
+                           xClipboard.is());
+
+    MyInfoBox aInfoBox( &aMainWin );
+    aInfoBox.Execute();
+
+    MyListBox aListBox( &aMainWin );
+    aListBox.setPosSizePixel( 10, 10, 100, 100 );
+    aListBox.InsertEntry( OUString("TestItem"));
+    aListBox.Show();
+}
+
+MyWin::MyWin( vcl::Window* pParent, WinBits nWinStyle ) :
+    WorkWindow( pParent, nWinStyle )
+{
+    Reference< XDropTargetListener > xListener = new MyDragAndDropListener( this );
+
+    Reference< XDropTarget > xDropTarget = GetDropTarget();
+    if( xDropTarget.is() )
+    {
+        xDropTarget->addDropTargetListener( xListener );
+        xDropTarget->setActive( true );
+    }
+
+    Reference< XDragGestureRecognizer > xRecognizer = GetDragGestureRecognizer();
+    if( xRecognizer.is() )
+        xRecognizer->addDragGestureListener( Reference< XDragGestureListener > ( xListener, UNO_QUERY ) );
+}
+
+void MyWin::MouseMove( const MouseEvent& rMEvt )
+{
+    WorkWindow::MouseMove( rMEvt );
+}
+
+void MyWin::MouseButtonDown( const MouseEvent& rMEvt )
+{
+    WorkWindow::MouseButtonDown( rMEvt );
+}
+
+void MyWin::MouseButtonUp( const MouseEvent& rMEvt )
+{
+    WorkWindow::MouseButtonUp( rMEvt );
+}
+
+void MyWin::KeyInput( const KeyEvent& rKEvt )
+{
+    WorkWindow::KeyInput( rKEvt );
+}
+
+void MyWin::KeyUp( const KeyEvent& rKEvt )
+{
+    WorkWindow::KeyUp( rKEvt );
+}
+
+void MyWin::Paint( const Rectangle& rRect )
+{
+    WorkWindow::Paint( rRect );
+}
+
+void MyWin::Resize()
+{
+    WorkWindow::Resize();
+}
+
+void SAL_CALL MyDragAndDropListener::dragGestureRecognized( const DragGestureEvent& dge ) throw(RuntimeException)
+{
+    Reference< XDragSource > xDragSource( dge.DragSource, UNO_QUERY );
+    xDragSource->startDrag( dge, -1, 0, 0, new StringTransferable( OUString("TestString") ), this );
+}
+
+void SAL_CALL MyDragAndDropListener::drop( const DropTargetDropEvent& dtde ) throw(RuntimeException)
+{
+    dtde.Context->dropComplete( true );
+}
+
+void SAL_CALL MyDragAndDropListener::dragEnter( const DropTargetDragEnterEvent& dtdee ) throw(RuntimeException)
+{
+    dtdee.Context->acceptDrag( dtdee.DropAction );
+}
+
+void SAL_CALL MyDragAndDropListener::dragExit( const DropTargetEvent& ) throw(RuntimeException)
+{
+}
+
+void SAL_CALL MyDragAndDropListener::dragOver( const DropTargetDragEvent& dtde ) throw(RuntimeException)
+{
+    dtde.Context->acceptDrag( dtde.DropAction );
+}
+
+void SAL_CALL MyDragAndDropListener::dropActionChanged( const DropTargetDragEvent& dtde ) throw(RuntimeException)
+{
+    dtde.Context->acceptDrag( dtde.DropAction );
+}
+
+void SAL_CALL MyDragAndDropListener::dragDropEnd( const DragSourceDropEvent& ) throw(RuntimeException)
+{
+}
+
+void SAL_CALL MyDragAndDropListener::dragEnter( const DragSourceDragEvent& ) throw(RuntimeException)
+{
+}
+
+void SAL_CALL MyDragAndDropListener::dragExit( const DragSourceEvent& ) throw(RuntimeException)
+{
+}
+
+void SAL_CALL MyDragAndDropListener::dragOver( const DragSourceDragEvent& ) throw(RuntimeException)
+{
+}
+
+void SAL_CALL MyDragAndDropListener::dropActionChanged( const DragSourceDragEvent& ) throw(RuntimeException)
+{
+}
+
+void SAL_CALL MyDragAndDropListener::disposing( const EventObject& ) throw(RuntimeException)
+{
+}
+
+MyInfoBox::MyInfoBox( vcl::Window* pParent ) : InfoBox( pParent,
+    OUString("dragging over this box should result in another window id in the drag log.") )
+{
+    Reference< XDropTargetListener > xListener = new MyDragAndDropListener( this );
+
+    Reference< XDropTarget > xDropTarget = GetDropTarget();
+    if( xDropTarget.is() )
+    {
+        xDropTarget->addDropTargetListener( xListener );
+        xDropTarget->setActive( true );
+    }
+
+    Reference< XDragGestureRecognizer > xRecognizer = GetDragGestureRecognizer();
+    if( xRecognizer.is() )
+        xRecognizer->addDragGestureListener( Reference< XDragGestureListener > ( xListener, UNO_QUERY ) );
+};
+
+MyListBox::MyListBox( vcl::Window* pParent ) : ListBox( pParent )
+{
+    Reference< XDropTargetListener > xListener = new MyDragAndDropListener( this );
+
+    Reference< XDropTarget > xDropTarget = GetDropTarget();
+    if( xDropTarget.is() )
+    {
+        xDropTarget->addDropTargetListener( xListener );
+        xDropTarget->setActive( true );
+    }
+
+    Reference< XDragGestureRecognizer > xRecognizer = GetDragGestureRecognizer();
+    if( xRecognizer.is() )
+        xRecognizer->addDragGestureListener( Reference< XDragGestureListener > ( xListener, UNO_QUERY ) );
+};
+
+Any SAL_CALL StringTransferable::getTransferData( const DataFlavor& )
+    throw(UnsupportedFlavorException, IOException, RuntimeException)
+{
+    return makeAny( m_aData );
+}
+
+Sequence< DataFlavor > SAL_CALL StringTransferable::getTransferDataFlavors(  )
+    throw(RuntimeException)
+{
+    return m_aFlavorList;
+}
+
+bool SAL_CALL StringTransferable::isDataFlavorSupported( const DataFlavor& )
+    throw(RuntimeException)
+{
+    return true;
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(VclDnDTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/errorhandler.cxx b/vcl/qa/cppunit/errorhandler.cxx
new file mode 100644
index 000000000..21c672ac5
--- /dev/null
+++ b/vcl/qa/cppunit/errorhandler.cxx
@@ -0,0 +1,73 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <test/bootstrapfixture.hxx>
+#include <cppunit/TestAssert.h>
+
+#include <vcl/errinf.hxx>
+
+class ErrorHandlerTest;
+
+namespace {
+
+class MockErrorHandler : private ErrorHandler
+{
+    friend ErrorHandlerTest;
+
+protected:
+    virtual bool CreateString(const ErrorInfo *pErrInfo, OUString &rErrString) const override
+    {
+        if (pErrInfo->GetErrorCode().IsDynamic())
+            rErrString = "Dynamic error";
+        else
+            rErrString = "Non-dynamic error";
+
+        return true;
+    }
+};
+
+}
+
+class ErrorHandlerTest : public test::BootstrapFixture
+{
+public:
+    ErrorHandlerTest() : BootstrapFixture(true, false) {}
+
+    void testGetErrorString();
+
+    CPPUNIT_TEST_SUITE(ErrorHandlerTest);
+    CPPUNIT_TEST(testGetErrorString);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void ErrorHandlerTest::testGetErrorString()
+{
+    MockErrorHandler aErrHdlr;
+    std::unique_ptr<ErrorInfo> xErrorInfo;
+    OUString aErrStr;
+
+    CPPUNIT_ASSERT_MESSAGE("GetErrorString(ERRCODE_ABORT, aErrStr) should return false",
+                           !ErrorHandler::GetErrorString(ERRCODE_ABORT, aErrStr));
+    // normally protected, but MockErrorHandler is a friend of this class
+    xErrorInfo = ErrorInfo::GetErrorInfo(ERRCODE_ABORT);
+    aErrHdlr.CreateString(xErrorInfo.get(), aErrStr);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("error message should be non-dynamic", OUString("Non-dynamic error"), aErrStr);
+
+    CPPUNIT_ASSERT_MESSAGE("GetErrorString(ERRCODE_NONE, aErrStr) should return false",
+                           !ErrorHandler::GetErrorString(ERRCODE_NONE, aErrStr));
+    xErrorInfo = ErrorInfo::GetErrorInfo(ERRCODE_NONE);
+    aErrHdlr.CreateString(xErrorInfo.get(), aErrStr);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("error message should be non-dynamic", OUString("Non-dynamic error"), aErrStr);
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(ErrorHandlerTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/filter/ipdf/data/dict-array-dict.pdf b/vcl/qa/cppunit/filter/ipdf/data/dict-array-dict.pdf
new file mode 100644
index 000000000..73de3117b
--- /dev/null
+++ b/vcl/qa/cppunit/filter/ipdf/data/dict-array-dict.pdf
@@ -0,0 +1,55 @@
+%PDF-1.7
+% ò¤ô
+1 0 obj <<
+  /Type /Catalog
+  /Pages 2 0 R
+>>
+endobj
+2 0 obj <<
+  /Type /Pages
+  /MediaBox [0 0 200 300]
+  /Count 1
+  /Kids [3 0 R]
+>>
+endobj
+3 0 obj <<
+  /Type /Page
+  /Parent 2 0 R
+  /Contents 4 0 R
+  /Key[<</InnerKey 42>>]
+>>
+endobj
+4 0 obj <<
+  /Length 188
+>>
+stream
+q
+0 0 0 rg
+0 290 10 10 re B*
+10 150 50 30 re B*
+0 0 1 rg
+190 290 10 10 re B*
+70 232 50 30 re B*
+0 1 0 rg
+190 0 10 10 re B*
+130 150 50 30 re B*
+1 0 0 rg
+0 0 10 10 re B*
+70 67 50 30 re B*
+Q
+endstream
+endobj
+xref
+0 5
+0000000000 65535 f 
+0000000015 00000 n 
+0000000068 00000 n 
+0000000157 00000 n 
+0000000251 00000 n 
+trailer <<
+  /Root 1 0 R
+  /Size 5
+>>
+startxref
+491
+%%EOF
diff --git a/vcl/qa/cppunit/filter/ipdf/ipdf.cxx b/vcl/qa/cppunit/filter/ipdf/ipdf.cxx
new file mode 100644
index 000000000..0f94f3276
--- /dev/null
+++ b/vcl/qa/cppunit/filter/ipdf/ipdf.cxx
@@ -0,0 +1,73 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <test/bootstrapfixture.hxx>
+#include <unotest/macros_test.hxx>
+
+#include <com/sun/star/drawing/XDrawPagesSupplier.hpp>
+#include <com/sun/star/drawing/XDrawView.hpp>
+#include <com/sun/star/frame/Desktop.hpp>
+#include <com/sun/star/security/XCertificate.hpp>
+#include <com/sun/star/view/XSelectionSupplier.hpp>
+#include <com/sun/star/xml/crypto/SEInitializer.hpp>
+
+#include <comphelper/propertyvalue.hxx>
+#include <osl/file.hxx>
+#include <unotools/tempfile.hxx>
+#include <sfx2/sfxbasemodel.hxx>
+#include <svx/svdview.hxx>
+#include <sfx2/viewsh.hxx>
+#include <sfx2/objsh.hxx>
+#include <vcl/filter/PDFiumLibrary.hxx>
+#include <vcl/filter/pdfdocument.hxx>
+
+using namespace ::com::sun::star;
+
+namespace
+{
+char const DATA_DIRECTORY[] = "/vcl/qa/cppunit/filter/ipdf/data/";
+}
+
+/// Covers vcl/source/filter/ipdf/ fixes.
+class VclFilterIpdfTest : public test::BootstrapFixture, public unotest::MacrosTest
+{
+public:
+    void setUp() override;
+};
+
+void VclFilterIpdfTest::setUp()
+{
+    test::BootstrapFixture::setUp();
+
+    mxDesktop.set(frame::Desktop::create(mxComponentContext));
+}
+
+CPPUNIT_TEST_FIXTURE(VclFilterIpdfTest, testDictArrayDict)
+{
+    // Load a file that has markup like this:
+    // 3 0 obj <<
+    //   /Key[<</InnerKey 42>>]
+    // >>
+    OUString aSourceURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "dict-array-dict.pdf";
+    SvFileStream aFile(aSourceURL, StreamMode::READ);
+    vcl::filter::PDFDocument aDocument;
+    CPPUNIT_ASSERT(aDocument.Read(aFile));
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT(!aPages.empty());
+    vcl::filter::PDFObjectElement* pPage = aPages[0];
+    auto pKey = dynamic_cast<vcl::filter::PDFArrayElement*>(pPage->Lookup("Key"));
+
+    // Without the accompanying fix in place, this test would have failed, because the value of Key
+    // was a dictionary element, not an array element.
+    CPPUNIT_ASSERT(pKey);
+}
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/font.cxx b/vcl/qa/cppunit/font.cxx
new file mode 100644
index 000000000..e99bf12a5
--- /dev/null
+++ b/vcl/qa/cppunit/font.cxx
@@ -0,0 +1,161 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <test/bootstrapfixture.hxx>
+#include <cppunit/TestAssert.h>
+
+#include <vcl/font.hxx>
+
+class VclFontTest : public test::BootstrapFixture
+{
+public:
+    VclFontTest() : BootstrapFixture(true, false) {}
+
+    void testName();
+    void testWeight();
+    void testWidthType();
+    void testPitch();
+    void testItalic();
+    void testAlignment();
+    void testQuality();
+    void testSymbolFlagAndCharSet();
+
+    CPPUNIT_TEST_SUITE(VclFontTest);
+    CPPUNIT_TEST(testName);
+    CPPUNIT_TEST(testWeight);
+    CPPUNIT_TEST(testWidthType);
+    CPPUNIT_TEST(testPitch);
+    CPPUNIT_TEST(testItalic);
+    CPPUNIT_TEST(testAlignment);
+    CPPUNIT_TEST(testQuality);
+    CPPUNIT_TEST(testSymbolFlagAndCharSet);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void VclFontTest::testName()
+{
+    vcl::Font aFont;
+
+    CPPUNIT_ASSERT_MESSAGE( "Family name should be empty", aFont.GetFamilyName().isEmpty());
+    CPPUNIT_ASSERT_MESSAGE( "Style name should be empty", aFont.GetStyleName().isEmpty());
+    aFont.SetFamilyName("Test family name");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Family name should not be empty", OUString("Test family name"), aFont.GetFamilyName());
+    aFont.SetStyleName("Test style name");
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Style name should not be empty", OUString("Test style name"), aFont.GetStyleName());
+}
+
+void VclFontTest::testWeight()
+{
+    vcl::Font aFont;
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Weight should be WEIGHT_DONTKNOW", FontWeight::WEIGHT_DONTKNOW, aFont.GetWeight());
+
+    aFont.SetWeight(FontWeight::WEIGHT_BLACK);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Weight should be WEIGHT_BLACK", FontWeight::WEIGHT_BLACK, aFont.GetWeight());
+}
+
+void VclFontTest::testWidthType()
+{
+    vcl::Font aFont;
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Font width should be WIDTH_DONTKNOW", FontWidth::WIDTH_DONTKNOW, aFont.GetWidthType());
+
+    aFont.SetWidthType(FontWidth::WIDTH_EXPANDED);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Font width should be EXPANDED", FontWidth::WIDTH_EXPANDED, aFont.GetWidthType());
+}
+
+void VclFontTest::testItalic()
+{
+    vcl::Font aFont;
+
+    // shouldn't this be set to ITALIC_DONTKNOW? currently it defaults to ITALIC_NONE
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Italic should be ITALIC_NONE", FontItalic::ITALIC_NONE, aFont.GetItalic());
+
+    aFont.SetItalic(FontItalic::ITALIC_NORMAL);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Italic should be EXPANDED", FontItalic::ITALIC_NORMAL, aFont.GetItalic());
+}
+
+
+void VclFontTest::testAlignment()
+{
+    vcl::Font aFont;
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Text alignment should be ALIGN_TOP", TextAlign::ALIGN_TOP, aFont.GetAlignment());
+
+    aFont.SetAlignment(TextAlign::ALIGN_BASELINE);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Text alignment should be ALIGN_BASELINE", TextAlign::ALIGN_BASELINE, aFont.GetAlignment());
+}
+
+
+void VclFontTest::testPitch()
+{
+    vcl::Font aFont;
+
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Pitch should be PITCH_DONTKNOW", FontPitch::PITCH_DONTKNOW, aFont.GetPitch());
+
+    aFont.SetPitch(FontPitch::PITCH_FIXED);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Pitch should be PITCH_FIXED", FontPitch::PITCH_FIXED, aFont.GetPitch());
+}
+
+void VclFontTest::testQuality()
+{
+    vcl::Font aFont;
+
+    CPPUNIT_ASSERT_EQUAL( int(0), aFont.GetQuality() );
+
+    aFont.SetQuality( 100 );
+    CPPUNIT_ASSERT_EQUAL( int(100), aFont.GetQuality() );
+
+    aFont.IncreaseQualityBy( 50 );
+    CPPUNIT_ASSERT_EQUAL( int(150), aFont.GetQuality() );
+
+    aFont.DecreaseQualityBy( 100 );
+    CPPUNIT_ASSERT_EQUAL( int(50), aFont.GetQuality() );
+}
+
+
+void VclFontTest::testSymbolFlagAndCharSet()
+{
+    // default constructor should set scalable flag to false
+    vcl::Font aFont;
+
+    CPPUNIT_ASSERT_MESSAGE( "Should not be seen as a symbol font after default constructor called", !aFont.IsSymbolFont() );
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Character set should be RTL_TEXTENCODING_DONTKNOW after default constructor called",
+                            RTL_TEXTENCODING_DONTKNOW, aFont.GetCharSet() );
+
+    aFont.SetSymbolFlag(true);
+
+    CPPUNIT_ASSERT_MESSAGE( "Test 1: Symbol font flag should be on", aFont.IsSymbolFont() );
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Test 1: Character set should be RTL_TEXTENCODING_SYMBOL",
+                            RTL_TEXTENCODING_SYMBOL, aFont.GetCharSet() );
+
+    aFont.SetSymbolFlag(false);
+
+    CPPUNIT_ASSERT_MESSAGE( "Test 2: Symbol font flag should be off", !aFont.IsSymbolFont() );
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Test 2: Character set should be RTL_TEXTENCODING_DONTKNOW",
+                            RTL_TEXTENCODING_DONTKNOW, aFont.GetCharSet() );
+
+    aFont.SetCharSet( RTL_TEXTENCODING_SYMBOL );
+
+    CPPUNIT_ASSERT_MESSAGE( "Test 3: Symbol font flag should be on", aFont.IsSymbolFont() );
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Test 3: Character set should be RTL_TEXTENCODING_SYMBOL",
+                            RTL_TEXTENCODING_SYMBOL, aFont.GetCharSet() );
+
+    aFont.SetCharSet( RTL_TEXTENCODING_UNICODE );
+
+    CPPUNIT_ASSERT_MESSAGE( "Test 4: Symbol font flag should be off", !aFont.IsSymbolFont() );
+    CPPUNIT_ASSERT_EQUAL_MESSAGE( "Test 4: Character set should be RTL_TEXTENCODING_UNICODE",
+                            RTL_TEXTENCODING_UNICODE, aFont.GetCharSet() );
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(VclFontTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/fontcharmap.cxx b/vcl/qa/cppunit/fontcharmap.cxx
new file mode 100644
index 000000000..b9d0d8c21
--- /dev/null
+++ b/vcl/qa/cppunit/fontcharmap.cxx
@@ -0,0 +1,45 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <test/bootstrapfixture.hxx>
+
+#include <vcl/fontcharmap.hxx>
+
+class VclFontCharMapTest : public test::BootstrapFixture
+{
+public:
+    VclFontCharMapTest() : BootstrapFixture(true, false) {}
+
+    void testDefaultFontCharMap();
+
+    CPPUNIT_TEST_SUITE(VclFontCharMapTest);
+    CPPUNIT_TEST(testDefaultFontCharMap);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void VclFontCharMapTest::testDefaultFontCharMap()
+{
+    FontCharMapRef xfcmap( new FontCharMap() ); // gets default map
+
+    CPPUNIT_ASSERT( xfcmap->IsDefaultMap() );
+
+    sal_uInt32 nStartBMPPlane = xfcmap->GetFirstChar();
+    sal_uInt32 nStartSupBMPPlane = xfcmap->GetNextChar(0xD800);
+    sal_uInt32 nEndBMPPlane = xfcmap->GetLastChar();
+
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt32>(0x0020), nStartBMPPlane);
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt32>(0xE000), nStartSupBMPPlane);
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt32>(0xFFF0-1), nEndBMPPlane);
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(VclFontCharMapTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/fontmetric.cxx b/vcl/qa/cppunit/fontmetric.cxx
new file mode 100644
index 000000000..4a3f476c2
--- /dev/null
+++ b/vcl/qa/cppunit/fontmetric.cxx
@@ -0,0 +1,138 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <test/bootstrapfixture.hxx>
+#include <cppunit/TestAssert.h>
+
+#include <vcl/metric.hxx>
+
+class VclFontMetricTest : public test::BootstrapFixture
+{
+public:
+    VclFontMetricTest() : BootstrapFixture(true, false) {}
+
+    void testFullstopCenteredFlag();
+    void testSpacings();
+    void testSlant();
+    void testBulletOffset();
+    void testEqualityOperator();
+
+    CPPUNIT_TEST_SUITE(VclFontMetricTest);
+    CPPUNIT_TEST(testFullstopCenteredFlag);
+    CPPUNIT_TEST(testSpacings);
+    CPPUNIT_TEST(testSlant);
+    CPPUNIT_TEST(testBulletOffset);
+    CPPUNIT_TEST(testEqualityOperator);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void VclFontMetricTest::testFullstopCenteredFlag()
+{
+    // default constructor should set scalable flag to false
+    FontMetric aFontMetric;
+
+    CPPUNIT_ASSERT_MESSAGE( "Fullstop centered flag should be false after default constructor called", !aFontMetric.IsFullstopCentered() );
+
+    aFontMetric.SetFullstopCenteredFlag(true);
+
+    CPPUNIT_ASSERT_MESSAGE( "Fullstop centered flag should be true", aFontMetric.IsFullstopCentered() );
+}
+
+void VclFontMetricTest::testSpacings()
+{
+    // default constructor should set scalable flag to false
+    FontMetric aFontMetric;
+
+    CPPUNIT_ASSERT_EQUAL( 0L, aFontMetric.GetAscent() );
+    CPPUNIT_ASSERT_EQUAL( 0L, aFontMetric.GetDescent() );
+    CPPUNIT_ASSERT_EQUAL( 0L, aFontMetric.GetExternalLeading() );
+    CPPUNIT_ASSERT_EQUAL( 0L, aFontMetric.GetInternalLeading() );
+    CPPUNIT_ASSERT_EQUAL( 0L, aFontMetric.GetLineHeight() );
+
+
+    aFontMetric.SetAscent( 100 );
+    CPPUNIT_ASSERT_EQUAL( 100L, aFontMetric.GetAscent() );
+
+    aFontMetric.SetDescent( 100 );
+    CPPUNIT_ASSERT_EQUAL( 100L, aFontMetric.GetDescent() );
+
+    aFontMetric.SetExternalLeading( 100 );
+    CPPUNIT_ASSERT_EQUAL( 100L, aFontMetric.GetExternalLeading() );
+
+    aFontMetric.SetInternalLeading( 100 );
+    CPPUNIT_ASSERT_EQUAL( 100L, aFontMetric.GetInternalLeading() );
+
+    aFontMetric.SetLineHeight( 100 );
+    CPPUNIT_ASSERT_EQUAL( 100L, aFontMetric.GetLineHeight() );
+}
+
+void VclFontMetricTest::testSlant()
+{
+    // default constructor should set scalable flag to false
+    FontMetric aFontMetric;
+
+    CPPUNIT_ASSERT_EQUAL( 0L, aFontMetric.GetSlant() );
+
+    aFontMetric.SetSlant( 45 );
+    CPPUNIT_ASSERT_EQUAL( 45L, aFontMetric.GetSlant() );
+}
+
+void VclFontMetricTest::testBulletOffset()
+{
+    // default constructor should set scalable flag to false
+    FontMetric aFontMetric;
+
+    CPPUNIT_ASSERT_EQUAL( 0L, aFontMetric.GetBulletOffset() );
+
+    aFontMetric.SetBulletOffset( 45 );
+    CPPUNIT_ASSERT_EQUAL(  45L, aFontMetric.GetBulletOffset() );
+}
+
+void VclFontMetricTest::testEqualityOperator()
+{
+    // default constructor should set scalable flag to false
+    FontMetric aLhs, aRhs;
+
+    aLhs.SetFullstopCenteredFlag(true);
+    aRhs.SetFullstopCenteredFlag(true);
+    CPPUNIT_ASSERT_MESSAGE( "Fullstop centered flag set same, aLhs == aRhs failed", aLhs.operator ==(aRhs) );
+    CPPUNIT_ASSERT_MESSAGE( "Fullstop centered flag set same, aLhs != aRhs succeeded", !aLhs.operator !=(aRhs) );
+
+    aLhs.SetExternalLeading(10);
+    aRhs.SetExternalLeading(10);
+    CPPUNIT_ASSERT_MESSAGE( "External leading set same, aLHS == aRhs failed", aLhs.operator ==(aRhs) );
+    CPPUNIT_ASSERT_MESSAGE( "External leading set same, aLHS != aRhs succeeded", !aLhs.operator !=(aRhs) );
+
+    aLhs.SetInternalLeading(10);
+    aRhs.SetInternalLeading(10);
+    CPPUNIT_ASSERT_MESSAGE( "Internal leading set same, aLHS == aRhs failed", aLhs.operator ==(aRhs) );
+    CPPUNIT_ASSERT_MESSAGE( "Internal leading set same, aLHS != aRhs succeeded", !aLhs.operator !=(aRhs) );
+
+    aLhs.SetAscent( 100 );
+    aRhs.SetAscent( 100 );
+    CPPUNIT_ASSERT_MESSAGE( "Ascent set same, aLHS == aRhs failed", aLhs.operator ==(aRhs) );
+    CPPUNIT_ASSERT_MESSAGE( "Ascent set same, aLHS != aRhs succeeded", !aLhs.operator !=(aRhs) );
+
+    aLhs.SetDescent( 100 );
+    aRhs.SetDescent( 100 );
+    CPPUNIT_ASSERT_MESSAGE( "Descent set same, aLHS == aRhs failed", aLhs.operator ==(aRhs));
+    CPPUNIT_ASSERT_MESSAGE( "Descent set same, aLHS != aRhs succeeded", !aLhs.operator !=(aRhs) );
+
+    aLhs.SetSlant( 100 );
+    aRhs.SetSlant( 100 );
+    CPPUNIT_ASSERT_MESSAGE( "Slant set same, aLHS == aRhs failed", aLhs.operator ==(aRhs));
+    CPPUNIT_ASSERT_MESSAGE( "Slant set same, aLHS != aRhs succeeded", !aLhs.operator !=(aRhs) );
+}
+
+
+CPPUNIT_TEST_SUITE_REGISTRATION(VclFontMetricTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/gen/data/tdf121120.png b/vcl/qa/cppunit/gen/data/tdf121120.png
new file mode 100644
index 000000000..8e48fba38
--- /dev/null
+++ b/vcl/qa/cppunit/gen/data/tdf121120.png
diff --git a/vcl/qa/cppunit/gen/gen.cxx b/vcl/qa/cppunit/gen/gen.cxx
new file mode 100644
index 000000000..dfcfaa997
--- /dev/null
+++ b/vcl/qa/cppunit/gen/gen.cxx
@@ -0,0 +1,116 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <com/sun/star/frame/Desktop.hpp>
+
+#include <comphelper/processfactory.hxx>
+#include <sfx2/app.hxx>
+#include <sfx2/objsh.hxx>
+#include <sfx2/sfxbasemodel.hxx>
+#include <test/unoapi_test.hxx>
+#include <vcl/bitmapaccess.hxx>
+#include <vcl/gdimtf.hxx>
+#include <vcl/virdev.hxx>
+
+using namespace com::sun::star;
+
+/// This test uses the gen backend (i.e. intentionally not the svp one, which is the default.)
+class GenTest : public UnoApiTest
+{
+public:
+    GenTest()
+        : UnoApiTest("/vcl/qa/cppunit/gen/data/")
+    {
+    }
+
+    virtual void setUp() override
+    {
+        UnoApiTest::setUp();
+        mxDesktop.set(
+            frame::Desktop::create(comphelper::getComponentContext(getMultiServiceFactory())));
+        SfxApplication::GetOrCreate();
+    };
+
+    virtual void tearDown() override
+    {
+        if (mxComponent.is())
+        {
+            closeDocument(mxComponent);
+            mxComponent->dispose();
+        }
+        UnoApiTest::tearDown();
+    };
+
+    Bitmap load(const char* pName)
+    {
+        OUString aFileURL;
+        createFileURL(OUString::createFromAscii(pName), aFileURL);
+        mxComponent = loadFromDesktop(aFileURL, "com.sun.star.drawing.DrawingDocument");
+        SfxBaseModel* pModel = dynamic_cast<SfxBaseModel*>(mxComponent.get());
+        CPPUNIT_ASSERT(pModel);
+        SfxObjectShell* pShell = pModel->GetObjectShell();
+        std::shared_ptr<GDIMetaFile> xMetaFile = pShell->GetPreviewMetaFile();
+        BitmapEx aResultBitmap;
+        CPPUNIT_ASSERT(xMetaFile->CreateThumbnail(aResultBitmap));
+        return aResultBitmap.GetBitmap();
+    }
+
+    uno::Reference<lang::XComponent> mxComponent;
+};
+
+CPPUNIT_TEST_FIXTURE(GenTest, testTdf121120)
+{
+    Bitmap aBitmap = load("tdf121120.png");
+    Bitmap::ScopedReadAccess pAccess(aBitmap);
+    const Size& rSize = aBitmap.GetSizePixel();
+    Color aColor(pAccess->GetPixel(rSize.getHeight() / 2, rSize.getWidth() / 2));
+    // Without the accompanying fix in place, this test would have failed with 'Expected: 255;
+    // Actual  : 1'. I.e. center of the preview (which has the background color) was ~black, not
+    // white.
+    CPPUNIT_ASSERT_EQUAL(0xff, int(aColor.GetRed()));
+    CPPUNIT_ASSERT_EQUAL(0xff, int(aColor.GetBlue()));
+    CPPUNIT_ASSERT_EQUAL(0xff, int(aColor.GetGreen()));
+}
+
+/// Test that drawing a line preview to a bitmap is not lost.
+CPPUNIT_TEST_FIXTURE(GenTest, testTdf107966)
+{
+    // Set up the virtual device: white background.
+    ScopedVclPtr<VirtualDevice> pVirtualDevice(VclPtr<VirtualDevice>::Create());
+    pVirtualDevice->SetLineColor();
+    MapMode aMapMode;
+    aMapMode.SetMapUnit(MapUnit::MapTwip);
+    pVirtualDevice->SetMapMode(aMapMode);
+    pVirtualDevice->SetOutputSizePixel(Size(90, 15));
+    pVirtualDevice->SetFillColor(Color(255, 255, 255));
+    pVirtualDevice->DrawRect(tools::Rectangle(Point(), Size(1350, 225)));
+    pVirtualDevice->SetFillColor(Color(0, 0, 0));
+    AntialiasingFlags nOldAA = pVirtualDevice->GetAntialiasing();
+    pVirtualDevice->SetAntialiasing(nOldAA & ~AntialiasingFlags::EnableB2dDraw);
+
+    // Paint a black polygon on it.
+    basegfx::B2DPolygon aPolygon;
+    aPolygon.append(basegfx::B2DPoint(0, 15));
+    aPolygon.append(basegfx::B2DPoint(1350, 15));
+    aPolygon.append(basegfx::B2DPoint(1350, 0));
+    aPolygon.append(basegfx::B2DPoint(0, 0));
+    pVirtualDevice->DrawPolygon(aPolygon);
+
+    // Make sure that the polygon is visible.
+    Bitmap aBitmap = pVirtualDevice->GetBitmap(Point(), Size(1350, 15));
+    Bitmap::ScopedReadAccess pAccess(aBitmap);
+    Color aPixel(pAccess->GetPixel(0, 0));
+    // Without the accompanying fix in place, this test would have failed with 'Expected: 000000;
+    // Actual: ffffff', i.e. the top left pixel was white, not black.
+    CPPUNIT_ASSERT_EQUAL(OUString("000000"), aPixel.AsRGBHexString());
+}
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/graphicfilter/data/README b/vcl/qa/cppunit/graphicfilter/data/README
new file mode 100644
index 000000000..2cc9fb3cb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/README
@@ -0,0 +1,7 @@
+Files with the string 'CVE' in their name are encrypted to avoid
+problems with virus checkers on source code download.; use:
+
+mdecrypt --bare -a arcfour -o hex -k 435645 -s 3 foo.doc # to unencrypt
+mcrypt --bare -a arcfour -o hex -k 435645 -s 3   foo.doc # to create new tests
+
+to get access to the plain files for manual testing.
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/.gitignore b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2004-0691-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2004-0691-1.bmp
new file mode 100644
index 000000000..d77db5782
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2004-0691-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2006-0006-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2006-0006-1.bmp
new file mode 100644
index 000000000..4cfbdfff8
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2006-0006-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2007-2244-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2007-2244-1.bmp
new file mode 100644
index 000000000..289cf8c0e
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2007-2244-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2007-3741-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2007-3741-1.bmp
new file mode 100644
index 000000000..84ac054db
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2007-3741-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2007-3741-2.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2007-3741-2.bmp
new file mode 100644
index 000000000..a6aed5983
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2007-3741-2.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2008-1097-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2008-1097-1.bmp
new file mode 100644
index 000000000..76aaecf97
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2008-1097-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2008-5870-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2008-5870-1.bmp
new file mode 100644
index 000000000..d223dde28
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2008-5870-1.bmp
@@ -0,0 +1 @@
+î¬.Gx©ŠKØ�'seë2Ï~°Œè.G1Ì-”è‚#á›ø1†Y!ðÜÊ¢/ÙDVñ
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2016-10504-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2016-10504-1.bmp
new file mode 100644
index 000000000..b733b2484
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/CVE-2016-10504-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/EDB-24743-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/EDB-24743-1.bmp
new file mode 100644
index 000000000..2b58d1035
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/EDB-24743-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/EDB-24743-4.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/EDB-24743-4.bmp
new file mode 100644
index 000000000..cfe7e40f6
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/EDB-24743-4.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/afl-sample-bad-rle-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/afl-sample-bad-rle-1.bmp
new file mode 100644
index 000000000..1ca6e0008
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/afl-sample-bad-rle-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/crash-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/crash-1.bmp
new file mode 100644
index 000000000..84b6c35c8
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/crash-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/fail/nodict-compress.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/nodict-compress.bmp
new file mode 100644
index 000000000..a75d6ebae
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/fail/nodict-compress.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/indeterminate/.gitignore b/vcl/qa/cppunit/graphicfilter/data/bmp/indeterminate/.gitignore
new file mode 100644
index 000000000..583b009c7
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/indeterminate/.gitignore
@@ -0,0 +1 @@
+*.wmf-*
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/pass/.gitignore b/vcl/qa/cppunit/graphicfilter/data/bmp/pass/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/pass/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/pass/CVE-2014-1947-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/pass/CVE-2014-1947-1.bmp
new file mode 100644
index 000000000..3815a1c13
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/pass/CVE-2014-1947-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/bmp/pass/EDB-22680-1.bmp b/vcl/qa/cppunit/graphicfilter/data/bmp/pass/EDB-22680-1.bmp
new file mode 100644
index 000000000..88b11ad57
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/bmp/pass/EDB-22680-1.bmp
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/fail/.gitignore b/vcl/qa/cppunit/graphicfilter/data/emf/fail/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/fail/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/fail/CVE-2004-0209-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/fail/CVE-2004-0209-1.emf
new file mode 100644
index 000000000..a511da43a
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/fail/CVE-2004-0209-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/fail/CVE-2008-1083-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/fail/CVE-2008-1083-1.emf
new file mode 100644
index 000000000..dd57d9102
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/fail/CVE-2008-1083-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/fail/CVE-2009-1217-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/fail/CVE-2009-1217-1.emf
new file mode 100644
index 000000000..8fa6e9377
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/fail/CVE-2009-1217-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/fail/crash-2.emf b/vcl/qa/cppunit/graphicfilter/data/emf/fail/crash-2.emf
new file mode 100644
index 000000000..6adabec8b
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/fail/crash-2.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/fail/crash-3.emf b/vcl/qa/cppunit/graphicfilter/data/emf/fail/crash-3.emf
new file mode 100644
index 000000000..92da5f05a
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/fail/crash-3.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/fail/fdo71307-2.emf b/vcl/qa/cppunit/graphicfilter/data/emf/fail/fdo71307-2.emf
new file mode 100644
index 000000000..b89db21c2
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/fail/fdo71307-2.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/fail/hang-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/fail/hang-1.emf
new file mode 100644
index 000000000..634fccdc0
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/fail/hang-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/fail/hang-2.emf b/vcl/qa/cppunit/graphicfilter/data/emf/fail/hang-2.emf
new file mode 100644
index 000000000..e3baf3bfa
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/fail/hang-2.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/fail/slow-moveclip-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/fail/slow-moveclip-1.emf
new file mode 100644
index 000000000..ef4c6a009
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/fail/slow-moveclip-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/indeterminate/.gitignore b/vcl/qa/cppunit/graphicfilter/data/emf/indeterminate/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/indeterminate/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/.gitignore b/vcl/qa/cppunit/graphicfilter/data/emf/pass/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2008-1087-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2008-1087-1.emf
new file mode 100644
index 000000000..c71739a50
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2008-1087-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2008-2245-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2008-2245-1.emf
new file mode 100644
index 000000000..746e85e84
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2008-2245-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0168-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0168-1.emf
new file mode 100644
index 000000000..fbd546cb0
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0168-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0168-2.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0168-2.emf
new file mode 100644
index 000000000..40f24b41d
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0168-2.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0169-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0169-1.emf
new file mode 100644
index 000000000..dcc2a66f7
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0169-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0169-2.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0169-2.emf
new file mode 100644
index 000000000..b82444a97
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0169-2.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0169-3.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0169-3.emf
new file mode 100644
index 000000000..8e67ce5ae
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0169-3.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0170-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0170-1.emf
new file mode 100644
index 000000000..b17ce7061
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-0170-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-3301-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-3301-1.emf
new file mode 100644
index 000000000..0991bba4f
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-3301-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-3303-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-3303-1.emf
new file mode 100644
index 000000000..78d030daa
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-3303-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-3304-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-3304-1.emf
new file mode 100644
index 000000000..fadbb7516
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/CVE-2016-3304-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/crash-1.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/crash-1.emf
new file mode 100644
index 000000000..bbc0285db
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/crash-1.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/crash-2.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/crash-2.emf
new file mode 100644
index 000000000..a52213238
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/crash-2.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/emf/pass/fdo38580-3.emf b/vcl/qa/cppunit/graphicfilter/data/emf/pass/fdo38580-3.emf
new file mode 100644
index 000000000..0af6c749b
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/emf/pass/fdo38580-3.emf
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/fail/.gitignore b/vcl/qa/cppunit/graphicfilter/data/gif/fail/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/fail/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/fail/CVE-2007-3958-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/fail/CVE-2007-3958-1.gif
new file mode 100644
index 000000000..7e84566e9
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/fail/CVE-2007-3958-1.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/fail/CVE-2008-5937-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/fail/CVE-2008-5937-1.gif
new file mode 100644
index 000000000..cbefd0162
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/fail/CVE-2008-5937-1.gif
@@ -0,0 +1 @@
+””&‡VâusØ�[eë21oæ�X
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/fail/EBD-36334-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/fail/EBD-36334-1.gif
new file mode 100644
index 000000000..a8f51b6ef
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/fail/EBD-36334-1.gif
@@ -0,0 +1,2 @@
+””&X©=ŠÜØ�¿;ekbÎ�~§6à*^1Ì.”Ä„#᛾fLt�€wüO zØâjA÷–
F®H�T©Øî
+ÞeŸ€Ô ?AäUõa�ŒÈ»L*ÖVÉqd¦&ó`©6~�[­ŠÓ…j™ÜæÏøªÖ`¦µo§D9ëÚ.>4ùÓ
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/fail/EBD-36335-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/fail/EBD-36335-1.gif
new file mode 100644
index 000000000..8f0f4fdb7
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/fail/EBD-36335-1.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/fail/EDB-23279-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/fail/EDB-23279-1.gif
new file mode 100644
index 000000000..d81d3b084
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/fail/EDB-23279-1.gif
@@ -0,0 +1 @@
+””&H©1ŠÎØ�'[ek2Î�™~Ømé®ß1L-h£a[^¦Î.Þð!7¢/&»VOÊ»·BB^ïuËÃî±³È2k]YnEå�G)qâ¿
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/fail/too-small-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/fail/too-small-1.gif
new file mode 100644
index 000000000..26b35e63b
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/fail/too-small-1.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/indeterminate/.gitignore b/vcl/qa/cppunit/graphicfilter/data/gif/indeterminate/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/indeterminate/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/.gitignore b/vcl/qa/cppunit/graphicfilter/data/gif/pass/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2007-6715-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2007-6715-1.gif
new file mode 100644
index 000000000..63426f9d8
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2007-6715-1.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2008-3013-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2008-3013-1.gif
new file mode 100644
index 000000000..e92a316e4
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2008-3013-1.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2011-2131-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2011-2131-1.gif
new file mode 100644
index 000000000..190c7b079
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2011-2131-1.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2012-0282-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2012-0282-1.gif
new file mode 100644
index 000000000..cf4f30c21
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/CVE-2012-0282-1.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/EDB-19333-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/pass/EDB-19333-1.gif
new file mode 100644
index 000000000..53d2ca01e
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/EDB-19333-1.gif
@@ -0,0 +1 @@
+””&t©Š};�'[ek2Î�™~Ømé®ß1L-h£a[^¦Î.Þð!7¢/&»VOÊ»·BB^ïuËÃî±³È2k]Ynyå°G)‹Ê¿˜ð…‘jkš×Bà:Š’åå¢d#|åµÀu«\#ÑL—®í¢�¡µê@Eßý�˜
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/afl-sample-short-read-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/pass/afl-sample-short-read-1.gif
new file mode 100644
index 000000000..7cb2a03d5
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/afl-sample-short-read-1.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/afl-sample-short-read-2.gif b/vcl/qa/cppunit/graphicfilter/data/gif/pass/afl-sample-short-read-2.gif
new file mode 100644
index 000000000..cddbdc357
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/afl-sample-short-read-2.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/crash-1.gif b/vcl/qa/cppunit/graphicfilter/data/gif/pass/crash-1.gif
new file mode 100644
index 000000000..860f9e1d8
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/crash-1.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/crash-2.gif b/vcl/qa/cppunit/graphicfilter/data/gif/pass/crash-2.gif
new file mode 100644
index 000000000..b7265f807
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/crash-2.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/gif/pass/sf_3e0068c9b19bb548826bed0599f65745-15940-minimized.gif b/vcl/qa/cppunit/graphicfilter/data/gif/pass/sf_3e0068c9b19bb548826bed0599f65745-15940-minimized.gif
new file mode 100644
index 000000000..47f5d4341
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/gif/pass/sf_3e0068c9b19bb548826bed0599f65745-15940-minimized.gif
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/fail/.gitignore b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-1.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-1.jpg
new file mode 100644
index 000000000..c03c8529c
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-1.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-2.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-2.jpg
new file mode 100644
index 000000000..1a24da322
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-2.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-3.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-3.jpg
new file mode 100644
index 000000000..794ff52e4
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-3.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-4.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-4.jpg
new file mode 100644
index 000000000..8911646fa
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-4.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-5.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-5.jpg
new file mode 100644
index 000000000..c5373df43
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-1097-5.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-5314-1.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-5314-1.jpg
new file mode 100644
index 000000000..33bbe9b5f
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/CVE-2008-5314-1.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/fail/crash-1.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/crash-1.jpg
new file mode 100644
index 000000000..e783bd33e
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/fail/crash-1.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/indeterminate/.gitignore b/vcl/qa/cppunit/graphicfilter/data/jpg/indeterminate/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/indeterminate/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/pass/.gitignore b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-1.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-1.jpg
new file mode 100644
index 000000000..3d9481aca
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-1.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-2.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-2.jpg
new file mode 100644
index 000000000..5eb27ffb5
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-2.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-3.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-3.jpg
new file mode 100644
index 000000000..4917f207f
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-3.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-4.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-4.jpg
new file mode 100644
index 000000000..9d26db005
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-4.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-5.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-5.jpg
new file mode 100644
index 000000000..bc668d3e3
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2004-0200-5.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2017-9614-1.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2017-9614-1.jpg
new file mode 100644
index 000000000..675881f36
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/CVE-2017-9614-1.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/pass/EDB-24743-2.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/EDB-24743-2.jpg
new file mode 100644
index 000000000..01e7fe16f
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/EDB-24743-2.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/pass/EDB-24743-3.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/EDB-24743-3.jpg
new file mode 100644
index 000000000..4753ed8db
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/EDB-24743-3.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/jpg/pass/fatalerror-1.jpg b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/fatalerror-1.jpg
new file mode 100644
index 000000000..c6ee53505
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/jpg/pass/fatalerror-1.jpg
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/fail/.gitignore b/vcl/qa/cppunit/graphicfilter/data/png/fail/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/fail/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2004-0597-1.png b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2004-0597-1.png
new file mode 100644
index 000000000..fa90a296f
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2004-0597-1.png
@@ -0,0 +1,3 @@
+Àœë#Mb£Š}ÕÔo7ë2ÎË~X¨á.^TÿwBè„!õ›žf1±°ƒÿ»±sé
‘tšùgšça2bA±Õð‡ÁËHbè—"8àî|†ìeGf­S$N0nI€Öªõ
+Ôç0"ð—JG°zÀ¤Ü¢(s?d)À"Ëÿ‘GE¢×F¯–9~}–ÇrÕ	
TÎ�p?áÅÂ*¿ìò·¥ckµ$E"ŒXï¯8á¾=2±T_3³v¿™#é–á$Hh4«‰JÑKi�ÝŠJÿ&7r…ú€…Ï=uŠ¯ù69KÙjãûäÎçè�ÿëWh{‘é½Ï$·
dVÅÜ[îÐЖ™Êy\à%Žº%†Ç¾H®meÛÃÞ+
“Á}€ÀgXI¡2ñ>‰*Ä«õ&ù˜Õú›Í·
)†Ì¸6ÔpU‚TjODhÙ�¶1™éù�-ÄÔ<WµŒUR±�Kø591Òþ¦«M“„?
+~˜æ*Nr¡Ìu;µãÀkh©ÉXˆÔà{Ö�ßÔ¤»' Ó�w©ìF[—ÛÒKèRÓf§y›‹O¹¨%0´©iháx׃�‹€wz¿4dT.¥@ŒXm4¦Þi¤íô÷pçð¬Z¼¾^±ßy‘˜ÝÂЯú`®ºÎ_YŸ¬?  …t‹uw�4\kÁd¬J~m˜‹gú`<2ìl²Ñn¦�ÒãùÞ*ð
òök h*n÷„w7ƒ‘!“YIßP+hK†Ø*Ôž`õ?Ëâç˜ü
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2005-0633-1.png b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2005-0633-1.png
new file mode 100644
index 000000000..d0644d139
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2005-0633-1.png
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2006-7210-1.png b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2006-7210-1.png
new file mode 100644
index 000000000..9b30cc38c
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2006-7210-1.png
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2007-2365-1.png b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2007-2365-1.png
new file mode 100644
index 000000000..b9ff67bb8
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2007-2365-1.png
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2009-1511-1.png b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2009-1511-1.png
new file mode 100644
index 000000000..592fda10a
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2009-1511-1.png
@@ -0,0 +1 @@
+Àœë#Mb£Š}ÕÔo7ë2Í�~\íá._舄Ã{ÜÚß'p|&êFàà¨/û§§‚ô¬
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2016-0951-2.png b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2016-0951-2.png
new file mode 100644
index 000000000..38899f733
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2016-0951-2.png
@@ -0,0 +1 @@
+Àœë#Mb£Š}ÕÔo7ë2ΰ~XÍù.^@Jäiè„#åüß+p¨�%çHh¢/Ù¦ô‹0!0õ‚
òþõ{�Ã¥ï¶
Œ[¦ÜB…]2ÓŒ*[»@Κâæ}¾{` RötÔ´Ž|}ø·Ï3ëÁ€N=aè‰DúITÇgI‰ã�!³…Ò¨C]Ë�õÍÀ†ûïÚ	 åˆíEr–GOXÕö°9ò	Ì“øˆÏ^Œ;²0/Aî±ìî)¢O²"vg Ó�º¹jõ”�«1•»èá¨{b*[¼›o:�Ù–ƒw*^_ˉœöi8˜¨¼d°q?]þ0Û}È´‰
á$õ}Ñê|6Es0
”x%mL¤ à-Àm¹÷÷ë:ÓÒÄæ
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2016-0952-2.png b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2016-0952-2.png
new file mode 100644
index 000000000..5494ca00e
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/fail/CVE-2016-0952-2.png
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/fail/EDB-34720-1.png b/vcl/qa/cppunit/graphicfilter/data/png/fail/EDB-34720-1.png
new file mode 100644
index 000000000..3165f2c5e
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/fail/EDB-34720-1.png
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/fail/afl-sample-Z_NEED_DICT.png b/vcl/qa/cppunit/graphicfilter/data/png/fail/afl-sample-Z_NEED_DICT.png
new file mode 100644
index 000000000..db8e7a834
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/fail/afl-sample-Z_NEED_DICT.png
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/indeterminate/.gitignore b/vcl/qa/cppunit/graphicfilter/data/png/indeterminate/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/indeterminate/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/pass/.gitignore b/vcl/qa/cppunit/graphicfilter/data/png/pass/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/pass/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/pass/CVE-2016-0951-1.png b/vcl/qa/cppunit/graphicfilter/data/png/pass/CVE-2016-0951-1.png
new file mode 100644
index 000000000..b5e6220dc
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/pass/CVE-2016-0951-1.png
@@ -0,0 +1 @@
+Àœë#Mb£Š}ÕÔo7ë2Ε~Xèë._ÁÍãâè„#åüß+p¨�±çHh¢/ÙG%òƒL¹¹Ö69lÂî±µ˜R?Y‘Š’¼¸Ö�æôÑ)RÈ�€ôAÙólþ�7½„*…’[�.óïþ{òýH
–Þá‚ÒçZ#á£
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/pass/CVE-2016-0952-1.png b/vcl/qa/cppunit/graphicfilter/data/png/pass/CVE-2016-0952-1.png
new file mode 100644
index 000000000..7848d5ad5
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/pass/CVE-2016-0952-1.png
@@ -0,0 +1 @@
+Àœë#Mb£Š}ÕÔo7ë2Δ~Xéè._ló!©è„#åüß+p¨�%çHh¢/ÙG%òƒL¹¹Ö69lÂ˜R?¦nCG³x¥öP¹¢&ŒØ�Èœîs0­ÄÉÈ-	C¤Ê99$8ôênœ;GF£Ô¾c
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/pass/afl-sample-IDAT.png b/vcl/qa/cppunit/graphicfilter/data/png/pass/afl-sample-IDAT.png
new file mode 100644
index 000000000..b116a92ec
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/pass/afl-sample-IDAT.png
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/pass/black.png b/vcl/qa/cppunit/graphicfilter/data/png/pass/black.png
new file mode 100644
index 000000000..cbba93bed
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/pass/black.png
diff --git a/vcl/qa/cppunit/graphicfilter/data/png/pass/invalid-chunk.png b/vcl/qa/cppunit/graphicfilter/data/png/pass/invalid-chunk.png
new file mode 100644
index 000000000..1c45c7689
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/png/pass/invalid-chunk.png
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/fail/.gitignore b/vcl/qa/cppunit/graphicfilter/data/svm/fail/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/fail/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-1.svm b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-1.svm
new file mode 100644
index 000000000..2fce465f7
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-1.svm
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-2.svm b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-2.svm
new file mode 100644
index 000000000..1b3cd1416
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-2.svm
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-3.svm b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-3.svm
new file mode 100644
index 000000000..b4afeb09f
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-3.svm
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-4.svm b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-4.svm
new file mode 100644
index 000000000..c2f14d4a0
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-4.svm
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-5.svm b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-5.svm
new file mode 100644
index 000000000..835e7f668
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-5.svm
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-6.svm b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-6.svm
new file mode 100644
index 000000000..8d6d94e12
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/fail/mapmode-6.svm
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/fail/ofz7165-1.svm b/vcl/qa/cppunit/graphicfilter/data/svm/fail/ofz7165-1.svm
new file mode 100644
index 000000000..ad722ea13
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/fail/ofz7165-1.svm
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/indeterminate/.gitignore b/vcl/qa/cppunit/graphicfilter/data/svm/indeterminate/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/indeterminate/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/pass/.gitignore b/vcl/qa/cppunit/graphicfilter/data/svm/pass/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/pass/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/svm/pass/leak-1.svm b/vcl/qa/cppunit/graphicfilter/data/svm/pass/leak-1.svm
new file mode 100644
index 000000000..14dbea080
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/svm/pass/leak-1.svm
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/.gitignore b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2005-2123-1.wmf-0.009-676 b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2005-2123-1.wmf-0.009-676
new file mode 100644
index 000000000..49d3ddf28
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2005-2123-1.wmf-0.009-676
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2005-2124-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2005-2124-1.wmf
new file mode 100644
index 000000000..ac546ce5b
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2005-2124-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2005-4560-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2005-4560-1.wmf
new file mode 100644
index 000000000..aab34004e
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2005-4560-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2006-0143-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2006-0143-1.wmf
new file mode 100644
index 000000000..b68b7403c
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2006-0143-1.wmf
@@ -0,0 +1 @@
+HUÛ¬.DZ©Š|Ød[eë2Ë�~Sïb&[1Ì-kèÀg¥ßÚ"uZJjÞë<í‘êweƒù»·üÿâŠ�ÏÂî±¼
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2006-0143-2.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2006-0143-2.wmf
new file mode 100644
index 000000000..370abe0e2
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2006-0143-2.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2007-1238-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2007-1238-1.wmf
new file mode 100644
index 000000000..10da32742
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2007-1238-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2007-1245-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2007-1245-1.wmf
new file mode 100644
index 000000000..10da32742
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/CVE-2007-1245-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-1.wmf
new file mode 100644
index 000000000..87319c2d4
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-2.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-2.wmf
new file mode 100644
index 000000000..ff20cad78
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-2.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-3.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-3.wmf
new file mode 100644
index 000000000..20a70fa67
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-3.wmf
@@ -0,0 +1,5 @@
+HUÒ¬BGx©Š}ؘؤ`{3Î�§~§é._1Ì,´Ê„"àšžf[Ch!64¢/ÙLV°Ê@H½½¡Îs0=3±¼Èk]ÙiuåC)�N¯F—)­#™É°
�‹ð�ÅÁ÷-hK§DŽ�z8ôê
+Õ~	"
–Þ¤†Ñ‚�³‚!>øø¼Šù¯iŸÐHh“‚×®¦cCß�¨?j‡‡aC	°Ùε
+®¨#êBqŒoìb뀜
Ûa6œTâ_‰–ljWõ+¦³ o'”P¨eSÑ%­^̈�«%
©'™…æÅ_VÇKpJ62AFéÔÅ<+q‰›³Iˆjbö¶n}
{êgÌÆ"–û!ˆk[3ÀA²Ã+t}s
+¢-·�Ò>m=÷÷¢~��HZ…§(¾®Þ”Òßfß[ÿcŒ ¬36œ§‹Š†_G¯„ߎ\äÉV@BzyâGßd2Înƒ‡‹)|3	Ã�Žcz™¼îâD�÷‰¿Ýæ2_æ¨&pN‘xø9YÝXDž`ýFh¿4+·õC^§b×Ë?o
+@ÖƒˆqÂ
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-4.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-4.wmf
new file mode 100644
index 000000000..045f1f45e
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/RC4-hang-4.wmf
@@ -0,0 +1,3 @@
+ž˜6.Gx©ŠGÓ;>³eë2Î�	8Yíà-Ñ1Ì-‘èŠ#ᛞv5."Þ2¢/Ùf_°ÔL½B¡ÎŒÏÄê±´Èi]YowÙ¼(ŽçKP¹
+)W`1a¨%#X„mi×-ã
+HŽ‘n<ônÕ~		–ÖáË•©Œ¡Z!>
Ø|xíHf}ÐHœôx;ºëcCa�¹?jlG‘CLO9VƵ$˜è#äBq—]a¦Ök
Ý.²w°Åx”}þ†ˆÆùº¤ß c„461ŠJ‘pHŽÑ«!©'f‡æ¥7VÇWpJp2AFvGÍ<7jú
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/bitcount-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/bitcount-1.wmf
new file mode 100644
index 000000000..2ec88066f
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/bitcount-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/exttextout-2.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/exttextout-2.wmf
new file mode 100644
index 000000000..02c72ad88
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/exttextout-2.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/facename-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/facename-1.wmf
new file mode 100644
index 000000000..29c534fdc
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/facename-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/ofz5942-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/ofz5942-1.wmf
new file mode 100644
index 000000000..f9a72867c
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/ofz5942-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/fail/seek-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/seek-1.wmf
new file mode 100644
index 000000000..e2fac1523
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/fail/seek-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/indeterminate/.gitignore b/vcl/qa/cppunit/graphicfilter/data/wmf/indeterminate/.gitignore
new file mode 100644
index 000000000..583b009c7
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/indeterminate/.gitignore
@@ -0,0 +1 @@
+*.wmf-*
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/pass/.gitignore b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2005-2123-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2005-2123-1.wmf
new file mode 100644
index 000000000..e70664e64
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2005-2123-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2006-4071-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2006-4071-1.wmf
new file mode 100644
index 000000000..cdb09c6b2
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2006-4071-1.wmf
@@ -0,0 +1 @@
+HUÛ¬.DZ©Š¡üI2
ÆwÉ�~¤ïé._1Ì-œè„#™žf1.!Þ0¢/Ù¸T¸ÊDH½½¡N�ÏÂî±¼
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2007-1090-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2007-1090-1.wmf
new file mode 100644
index 000000000..7864da572
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2007-1090-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2015-0848-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2015-0848-1.wmf
new file mode 100644
index 000000000..1512a2256
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/CVE-2015-0848-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/pass/exttextout-1.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/exttextout-1.wmf
new file mode 100644
index 000000000..365a247a7
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/exttextout-1.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/wmf/pass/noheader.wmf b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/noheader.wmf
new file mode 100644
index 000000000..bfd7e20de
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/wmf/pass/noheader.wmf
diff --git a/vcl/qa/cppunit/graphicfilter/data/xbm/fail/.gitignore b/vcl/qa/cppunit/graphicfilter/data/xbm/fail/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/xbm/fail/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/xbm/fail/crash-1.xbm b/vcl/qa/cppunit/graphicfilter/data/xbm/fail/crash-1.xbm
new file mode 100644
index 000000000..9d2a43470
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/xbm/fail/crash-1.xbm
@@ -0,0 +1,12 @@
+#define?te_width 31
+#define te_height = {
+   0x0e, 0x20, 0x02, 0x38, 0x11, 0x70, 0x07, 0x 0x44,
+   0x11, 1x2e, 0x3a, 0x44, 0x8e, 0x24, 0x92, 0x38, 0xdf, 0x25, 0xd2,0x7d,
+   0x91, 0x24 0x92, 0x44, 0x95: 0x24, 0x92, 0x54, 0xf5, 0x7f, 0xff, 0x57,
+   0x95, 0x24, 0x92, 0x54, 0x95, 0x 4,54, 0x95, 0x24, 0x92, 0x54,
+   0x95, 0x24,x54, 0x95, 0x24, 0x92, 0x54, 0x95, 0x24, 0x92, 0x54,
+   0x95, 0x24, 0x92, 0x54, 0x95, 0x24, 0x92,0x54, 0x95, 0x24, 0x92, 0x54,
+   0x95, 0x24,ÏÏÏÏÏÏÏ 0x92, 0x54, 0x95, 0x24, 0x92, 0x54, 0xf5, 0x7f, 0xff, 0x57,
+   0x95,0x24, 0x92, 0x54, 0x95, 0x24, 0x92, 0x54, 0, 0x54, 0xf5, 0xd= {
+ 25, 0xd2, 0x7d,
+0x00, 0x7c };
\ No newline at end of file
diff --git a/vcl/qa/cppunit/graphicfilter/data/xbm/indeterminate/.gitignore b/vcl/qa/cppunit/graphicfilter/data/xbm/indeterminate/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/xbm/indeterminate/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/xbm/pass/.gitignore b/vcl/qa/cppunit/graphicfilter/data/xbm/pass/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/xbm/pass/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/xbm/pass/grafix4.xbm b/vcl/qa/cppunit/graphicfilter/data/xbm/pass/grafix4.xbm
new file mode 100644
index 000000000..aad9f0305
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/xbm/pass/grafix4.xbm
@@ -0,0 +1,2011 @@
+#define Grafix1_width 485
+#define Grafix1_height 395
+static char Grafix1_bits[] = {
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 
+   0x07, 0x00, 0x1c, 0xfc, 0x80, 0x81, 0x03, 0x30, 0x70, 0x00, 0x00, 0x00, 
+   0xe0, 0x00, 0x0c, 0xdc, 0x00, 0x70, 0x00, 0x37, 0x07, 0x00, 0x38, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x80, 0x01, 0x00, 
+   0x00, 0x06, 0x00, 0x18, 0xd6, 0x80, 0xc1, 0x02, 0x30, 0x58, 0x00, 0x00, 
+   0x00, 0xb0, 0x00, 0x0c, 0xd6, 0x00, 0x60, 0x80, 0x35, 0x06, 0x00, 0x30, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x80, 0x01, 
+   0x00, 0x00, 0x06, 0x00, 0x18, 0xc2, 0x00, 0x40, 0x00, 0x00, 0x08, 0x00, 
+   0x00, 0x00, 0x10, 0x00, 0x00, 0x02, 0x00, 0x60, 0x80, 0x00, 0x06, 0x00, 
+   0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x80, 
+   0x01, 0x00, 0x00, 0x06, 0x00, 0x18, 0xc3, 0x00, 0x60, 0x00, 0x00, 0x0c, 
+   0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 0x03, 0x00, 0x60, 0xc0, 0x00, 0x06, 
+   0x00, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x58, 
+   0xf0, 0xe1, 0x63, 0xc1, 0x87, 0x0f, 0x9f, 0xcf, 0xcc, 0xf1, 0xe1, 0x3b, 
+   0x3e, 0xe0, 0x01, 0x0e, 0x7f, 0xf8, 0x8e, 0xef, 0xe0, 0x63, 0xe6, 0x3b, 
+   0xe6, 0xe0, 0x33, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x64, 0x98, 0x99, 0x91, 0x61, 0x66, 0x86, 0x19, 0xc3, 0x9e, 0x61, 0x98, 
+   0x31, 0x0c, 0x30, 0x03, 0x8c, 0x19, 0x66, 0x0c, 0xc3, 0x98, 0x61, 0xcf, 
+   0x30, 0x46, 0x98, 0xb1, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x4c, 0x8c, 0x19, 0x31, 0x31, 0x66, 0xc4, 0x18, 0xc3, 0x99, 0x61, 
+   0x18, 0x31, 0x0c, 0x18, 0x00, 0xd8, 0x18, 0x46, 0x0c, 0xc3, 0x18, 0xe1, 
+   0xcc, 0x30, 0x26, 0x18, 0x71, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x1c, 0x8c, 0x19, 0x71, 0x30, 0x66, 0xc4, 0x18, 0xc3, 0x98, 
+   0x61, 0x18, 0x31, 0x0c, 0x18, 0x00, 0x70, 0x18, 0x46, 0x0c, 0xc3, 0x18, 
+   0x61, 0xcc, 0x30, 0x16, 0x18, 0x31, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x38, 0x8c, 0x99, 0xe1, 0x30, 0x66, 0xc6, 0x18, 0xc3, 
+   0x98, 0x61, 0x98, 0x31, 0x0c, 0x18, 0x00, 0x70, 0x18, 0x66, 0x0c, 0xc3, 
+   0x98, 0x61, 0xcc, 0x30, 0x1e, 0x98, 0x31, 0x06, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x70, 0x8c, 0xf1, 0xc0, 0x31, 0xc6, 0xc3, 0x18, 
+   0xc3, 0x98, 0x61, 0xf0, 0x30, 0x0c, 0x18, 0x00, 0x70, 0x18, 0x3c, 0x0c, 
+   0xc3, 0xf0, 0x60, 0xcc, 0x30, 0x36, 0xf0, 0x30, 0x06, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x64, 0x8c, 0x11, 0x90, 0x31, 0x46, 0xc0, 
+   0x18, 0xc3, 0x98, 0x61, 0x10, 0x30, 0x0c, 0x18, 0x00, 0xd8, 0x18, 0x04, 
+   0x0c, 0xc3, 0x10, 0x60, 0xcc, 0x30, 0x66, 0x10, 0x30, 0x06, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x4c, 0x98, 0xf1, 0x31, 0x61, 0xc6, 
+   0x87, 0x19, 0xc3, 0x98, 0x61, 0xf0, 0x31, 0x0c, 0x30, 0x03, 0x8c, 0x19, 
+   0x7c, 0x0c, 0xc3, 0xf0, 0x61, 0xcc, 0x30, 0xc6, 0xf0, 0x31, 0x06, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x34, 0xf0, 0xf3, 0xd7, 0xc0, 
+   0xcf, 0x1f, 0xbf, 0xe7, 0xb9, 0xf1, 0xf0, 0x37, 0x1e, 0xe0, 0x01, 0x86, 
+   0x3f, 0xfc, 0x8d, 0xc7, 0xf0, 0xf7, 0xfc, 0x31, 0xc7, 0xf1, 0x7f, 0x0e, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x08, 0x06, 
+   0x00, 0x20, 0x18, 0x00, 0x00, 0x80, 0x01, 0x08, 0x36, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x82, 0x0d, 0xc0, 0x08, 0x06, 0x00, 0x30, 0x00, 0x08, 0x06, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x18, 
+   0x04, 0x00, 0x60, 0x10, 0x00, 0x00, 0x80, 0x01, 0x18, 0x34, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x06, 0x0d, 0xc0, 0x18, 0x04, 0x00, 0x30, 0x00, 0x18, 
+   0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x38, 0x02, 0x00, 0xe0, 0x08, 0x00, 0x00, 0xe0, 0x00, 0x38, 0x1e, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x8e, 0x07, 0x70, 0x38, 0x02, 0x00, 0x1c, 0x00, 
+   0x38, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0xf0, 0x01, 0x00, 0xc0, 0x07, 0x00, 0x00, 0x60, 0x00, 0xf0, 0x0d, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0x03, 0x30, 0xf0, 0x01, 0x00, 0x0c, 
+   0x00, 0xf0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x80, 0xff, 0x0f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0xff, 0x7f, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0xfc, 0x55, 0x55, 0x55, 0x55, 0xfd, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1f, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0xbc, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0x03, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x7c, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0xf5, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0xb8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0x1a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x80, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x70, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x1e, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xbe, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x01, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x70, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x0d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xab, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xea, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x70, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x0e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x80, 0xab, 0xaa, 0xaa, 0xff, 0xff, 0xff, 0xff, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x60, 0x00, 0x80, 0x7f, 0x44, 0x44, 0x44, 0xc4, 0x7f, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x50, 0x55, 0x7f, 0x77, 0x77, 0x77, 0x77, 0x77, 0xf7, 
+   0x5f, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x01, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x0c, 0xfe, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0xf1, 0x0f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0xfa, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xfa, 0xaf, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x0e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x47, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x1d, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0xdf, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xfd, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xdc, 0x45, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x0f, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0xe3, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xfa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x3a, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x70, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x91, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8e, 0xdc, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0x5d, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x01, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x45, 
+   0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0xe4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 
+   0xa2, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x0a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x1c, 0x71, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x0d, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x8b, 0xd8, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x7d, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x75, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0xe0, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x01, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x38, 0x22, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xae, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x16, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x19, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x89, 0xe8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xea, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x6a, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x60, 0x44, 0x74, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0xc4, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x01, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x38, 0x22, 0x7a, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x07, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0x11, 0x17, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x89, 0x88, 0xab, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 0x44, 0xc4, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x01, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x22, 0x62, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x57, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1c, 0x11, 0x19, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x0d, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8b, 0x88, 
+   0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xba, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x3a, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x44, 
+   0xc4, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x64, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 
+   0x22, 0x62, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0xff, 0xff, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0xf7, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x03, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x10, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0xff, 0x11, 0x11, 0x1d, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x88, 0x88, 0xac, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xea, 0x89, 0x88, 0x88, 0xe8, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x3a, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x44, 0x44, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x7c, 0x44, 0x44, 0x44, 0x44, 0x46, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x23, 0xa2, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0x23, 0x22, 0x22, 0x22, 0x22, 0xae, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xba, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x0e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x11, 0xd1, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x79, 0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0xc0, 0x88, 0xe8, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0x8f, 0x88, 0x88, 0x88, 0x88, 0x88, 0xd8, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x60, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 0x44, 0x54, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0xe4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x01, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0xe8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x38, 0x22, 0xae, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x3a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0xa2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xae, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x06, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x16, 0x11, 0x13, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x17, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x50, 0x0d, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x89, 0xc8, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x89, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0x7d, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x75, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x30, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x44, 0x74, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x74, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0xc4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x01, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0xa0, 0xea, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x22, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x03, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x11, 
+   0x17, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x17, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x15, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x40, 0x55, 
+   0x0d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x88, 
+   0x88, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x89, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdc, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x75, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x74, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x0c, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x80, 0xaa, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x26, 0xa2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2e, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x13, 0x19, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x80, 0xaa, 0xaa, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x80, 0x89, 0xac, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xea, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xb8, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x44, 0x47, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x64, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x64, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x55, 0x55, 0x75, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x60, 0xe2, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x3f, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x62, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0xf7, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x35, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x80, 0x03, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x15, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x51, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0xaa, 0xaa, 0xaa, 0x0e, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x98, 0xb8, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x8b, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0xc8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x30, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x44, 0x46, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x54, 0x55, 0x55, 
+   0xd5, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x22, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xd1, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x31, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0xa8, 
+   0xaa, 0xaa, 0xaa, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0xa8, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x8e, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xab, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x1a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x5c, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x46, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x46, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x50, 0x55, 0x55, 0x55, 0xf5, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x76, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x23, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x76, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x35, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0x00, 0x00, 
+   0x30, 0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x15, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x01, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0xa0, 0xaa, 0xaa, 0xaa, 0xaa, 0x1e, 0x00, 0x00, 0x00, 
+   0x00, 0x98, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0xa8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x00, 0x00, 
+   0x00, 0x00, 0x6c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x74, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x54, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0xa0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x01, 
+   0x00, 0x00, 0x00, 0xbc, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x2a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0xa2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x01, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x06, 0x00, 0x00, 0x00, 0x16, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x17, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x51, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x02, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x40, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x1d, 0x00, 0x00, 0x80, 0xdf, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0x5d, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x03, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x60, 0x00, 0x00, 0x60, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x80, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x01, 0x00, 0xb8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0x6a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0x0a, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x06, 0x00, 0x44, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x15, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x1d, 0x00, 0xd7, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x9d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xd8, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x15, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x80, 0x60, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x54, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x01, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x6a, 0xe0, 0xba, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x26, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xe2, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x11, 0x10, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x13, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x54, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x5f, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x89, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0xdf, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x0e, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0xa8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xb1, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x6a, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0xb2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x40, 0x60, 0x12, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0xd1, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x01, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0xa8, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x3a, 0x80, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x8a, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xaf, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xba, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x01, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x0c, 0x00, 0x47, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x5c, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x50, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x03, 0x80, 0x76, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x62, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x03, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0xc0, 0x00, 0x80, 0x19, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x13, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0xa0, 0xaa, 0xaa, 0xaa, 0xaa, 0x3a, 0x00, 0xc0, 0xa8, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0xbc, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x06, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 0x00, 0x40, 0xc4, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x4f, 0x44, 0x44, 
+   0x44, 0xc4, 0x47, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x40, 0x55, 0x55, 0x55, 0x55, 0x03, 0x00, 0x20, 0x22, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x62, 0x37, 0x22, 
+   0x22, 0x22, 0x22, 0x7e, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x0d, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x01, 0x00, 0x30, 0x11, 
+   0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x51, 
+   0x11, 0x11, 0x11, 0x11, 0xd1, 0x17, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x80, 0xaa, 0xaa, 0xaa, 0x6a, 0x00, 0x00, 0x90, 
+   0x88, 0xac, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x9a, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xae, 
+   0xea, 0x88, 0x88, 0x88, 0x88, 0x88, 0xf8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x1a, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 
+   0x50, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 
+   0x45, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x47, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x55, 0x55, 0x55, 0x05, 0x00, 
+   0x00, 0x28, 0x22, 0x72, 0x77, 0x77, 0x77, 0x77, 0x77, 0x2f, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x62, 0x77, 0xf7, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x7a, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x15, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x03, 
+   0x00, 0x00, 0x18, 0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 0x15, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x31, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x13, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x80, 0xaa, 0xaa, 0xea, 
+   0x00, 0x00, 0x00, 0x88, 0x88, 0xc8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x8e, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0xb8, 0xaa, 0xaa, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0xac, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x2a, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x30, 0x00, 0x00, 0x00, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x4c, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x74, 0x44, 0x44, 0x44, 0x44, 0x44, 0x14, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0xaa, 
+   0xaa, 0x0a, 0x00, 0x00, 0x00, 0x26, 0x22, 0x22, 0xab, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0xaa, 0xaa, 0xaa, 0x23, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0xa2, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xba, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x6a, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x12, 0x11, 0x11, 0x13, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x3d, 0x11, 0x11, 0x11, 0x11, 0x31, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x54, 0xd5, 0x01, 0x00, 0x00, 0x00, 0x8a, 0x88, 0x88, 0xdc, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 0x89, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0xc8, 0xdd, 0xdd, 0xdd, 0xdd, 0x7d, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x46, 0x44, 0x44, 0x4c, 
+   0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x47, 0x44, 0x44, 0x44, 0x24, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0xa8, 0x1a, 0x00, 0x00, 0x00, 0x00, 0x23, 0x22, 0x22, 
+   0xba, 0xaa, 0xaa, 0xaa, 0x6a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xb2, 0xaa, 0xaa, 0xaa, 0x23, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xae, 0xaa, 0xaa, 0xaa, 
+   0xea, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x01, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x00, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x11, 0x11, 
+   0x11, 0x51, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0xd0, 0x01, 0x00, 0x00, 0x00, 0x80, 0x89, 
+   0x88, 0x88, 0xe8, 0xdd, 0xdd, 0xdd, 0xdd, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdc, 0xdd, 0xdd, 
+   0xdd, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xe8, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x03, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x80, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x46, 0x44, 
+   0x44, 0x44, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 
+   0x45, 0x44, 0x44, 0xc4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x02, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 
+   0x80, 0x22, 0x22, 0x22, 0xe2, 0xaa, 0xaa, 0xaa, 0x2a, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xab, 
+   0xaa, 0xaa, 0xaa, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x06, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x40, 0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 
+   0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x15, 0x11, 0x11, 0x11, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x04, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0xc0, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 0xbd, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0xc8, 0xdd, 0xdd, 0xdd, 0xdd, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0xd8, 0xdd, 0xdd, 0xdd, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x05, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x40, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x64, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x64, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x54, 0x44, 0x44, 0x44, 0x01, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x22, 0x22, 0x22, 0x22, 0xab, 0xaa, 0xaa, 
+   0x3a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0xb2, 0xaa, 0xaa, 0xaa, 0xaa, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x11, 0x11, 0x11, 0x11, 0x13, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x19, 0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x11, 0x03, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xa0, 0x88, 0x88, 0x88, 0x88, 0xaa, 
+   0xaa, 0xaa, 0x9a, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0xa8, 0xaa, 0xaa, 0xaa, 0xaa, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xc8, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x50, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 
+   0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x22, 0x22, 0x22, 
+   0x22, 0x76, 0x77, 0x77, 0x2f, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x76, 0x77, 0x77, 0x77, 0x77, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0x77, 0x77, 
+   0x77, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x15, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x11, 0x11, 
+   0x11, 0x11, 0x19, 0x11, 0x11, 0x19, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x11, 
+   0x11, 0x11, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0xa8, 0xaa, 0xaa, 0x8a, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xea, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0xab, 0xaa, 0xaa, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x4c, 
+   0x44, 0x44, 0x44, 0x44, 0x54, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x45, 0x44, 0x44, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x28, 0x22, 0x22, 0x22, 0x22, 0x72, 0x77, 0x77, 0x2f, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x62, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x77, 0x77, 0x77, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x35, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x14, 0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x19, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x51, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x40, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x8c, 0x88, 0x88, 0x88, 0x88, 0xa8, 0xaa, 0xaa, 0x8a, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xa8, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0x6a, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 0x44, 0x44, 0x4c, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x0c, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x26, 0x22, 0x22, 0x22, 0x22, 0x62, 0x77, 0x77, 
+   0x2f, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x76, 0x77, 0x77, 0x77, 0x77, 0x37, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x77, 0x77, 0x77, 0x5f, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x12, 0x11, 0x11, 0x11, 0x11, 0x51, 0x11, 
+   0x11, 0x19, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x13, 0x11, 0x11, 0x11, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0x88, 0x88, 0x88, 0x88, 0xc8, 
+   0xaa, 0xaa, 0x8a, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xaa, 0xaa, 0xaa, 0xba, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x46, 0x44, 0x44, 0x44, 0x44, 
+   0xc4, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x54, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x46, 0x44, 0x44, 
+   0x14, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0xa2, 0xaa, 0xaa, 0x2a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0xe2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x3a, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xaa, 0xaa, 
+   0xaa, 0xba, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x01, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x13, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x13, 
+   0x11, 0x11, 0x11, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0x8d, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xd8, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0x9d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0xde, 0xdd, 0xdd, 0x5d, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x01, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x46, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x46, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x54, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x46, 0x44, 0x44, 0x14, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x01, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0xaa, 0xaa, 0x2a, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xae, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x3a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x02, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x15, 0x11, 0x19, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x13, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x19, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x13, 0x11, 0x11, 0x31, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x02, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdc, 0xdd, 0x8d, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0x8d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 0x7d, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x05, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x4c, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x24, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0xaa, 0xaa, 
+   0x2a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x06, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x19, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x51, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x31, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0xd8, 0xdd, 0x8d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0xe8, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x8d, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 0x7d, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x0d, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x45, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x64, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x54, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 
+   0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x23, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0xa2, 0xaa, 0x3a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x26, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xab, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x51, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x15, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x15, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x31, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x89, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0xc8, 0xaa, 0x9a, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x8e, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x0a, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x45, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x54, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0xc4, 0x44, 0x44, 0x44, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x10, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x77, 0x37, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0xe2, 0x77, 0x77, 0x77, 0x77, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x15, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x51, 0x11, 0x11, 0x11, 0x31, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x10, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xaa, 0x9a, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xc8, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0xc8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x1a, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x54, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x24, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x7a, 
+   0x37, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x72, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0xf7, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x62, 0x77, 0x77, 0x77, 0x77, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x35, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x11, 0x31, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0xa8, 0xea, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0xa8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xa8, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x45, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x64, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 0x44, 0x44, 0x44, 
+   0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x23, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x62, 0x77, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x76, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x37, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x72, 0x77, 0x77, 
+   0x77, 0x77, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x35, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x91, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x31, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x89, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xab, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xa8, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x6a, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x45, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc6, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x54, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x4c, 0x44, 0x44, 0x44, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x40, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xae, 0x23, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0xe2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x2a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x6a, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x15, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x15, 0x11, 0x11, 0x11, 0x31, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x40, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x8a, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xe8, 0x8b, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xe8, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0x8d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0xde, 0xdd, 0xdd, 0xdd, 0x5d, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x54, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x46, 0x44, 0x44, 0x44, 0x14, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0xa2, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0xab, 0xaa, 0xaa, 0xaa, 0xba, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x15, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x8e, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdc, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x89, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 0xdd, 0x5d, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x46, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 
+   0x14, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x3a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xe2, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x14, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0xd9, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 0x11, 0x11, 
+   0x11, 0x11, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8c, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xd8, 0x8b, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xbd, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xe8, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0x5d, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0xd5, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x54, 0x4c, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 
+   0x44, 0x44, 0x44, 0x44, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x80, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x24, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0x3a, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0xa2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x3a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0xb2, 0xaa, 0xaa, 0xaa, 0xaa, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x18, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x31, 0x51, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xe8, 
+   0xaa, 0x89, 0x88, 0x88, 0x88, 0x88, 0xb8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x8a, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0xa8, 0xaa, 0xaa, 0xaa, 0xaa, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x48, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x46, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x04, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x30, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0xe2, 0x77, 0x3f, 0x22, 0x22, 0x22, 0x22, 0x76, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x27, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x76, 0x77, 0x77, 0x77, 0x77, 0x57, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x91, 0x11, 0xf1, 0x11, 0x11, 0x11, 0x11, 0x15, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x13, 0x11, 0x11, 0x11, 0x11, 0x03, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x90, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0xab, 0xaa, 0x8f, 0x88, 0x88, 0x88, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x8a, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x5c, 0x44, 0x44, 0x44, 0x45, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x44, 0x44, 
+   0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x77, 0x77, 0x77, 0x22, 0x22, 0xa2, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x23, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x13, 0x11, 0x91, 0x11, 0x11, 
+   0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xac, 0xaa, 0xaa, 0x8e, 
+   0x88, 0xc8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xa8, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 
+   0x74, 0x44, 0x64, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x54, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x80, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x40, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x7a, 0x77, 
+   0x77, 0xf7, 0x27, 0x62, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0xf7, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x7a, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0xd5, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x80, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x39, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x51, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x19, 0x11, 0x11, 0x11, 0x11, 0x91, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x80, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0xa8, 0xaa, 0xaa, 0xaa, 0xea, 0xb8, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xea, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0xac, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x64, 0x44, 0x44, 0x44, 0x44, 0x4f, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x64, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0xe2, 0xaa, 0xaa, 0xaa, 0xaa, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0x2a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x51, 0x11, 0x11, 0x11, 0x11, 0xf5, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8a, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0xc8, 0xdd, 0xdd, 0xdd, 0xdd, 0x8d, 0xdf, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x9d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0xc8, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x7d, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x46, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x46, 0x7c, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x54, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x74, 0x44, 0x44, 0x44, 0x44, 0x44, 0x24, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x27, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0xab, 0xaa, 0xaa, 0xaa, 0x23, 
+   0xa2, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x3a, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xba, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x6a, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 0x14, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 
+   0x11, 0x11, 0x3d, 0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x15, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x70, 0x8d, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdf, 0xdd, 0xdd, 
+   0xdd, 0x88, 0x88, 0xc8, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x8d, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdf, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0x5d, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 
+   0x54, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x46, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x5e, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x40, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0xa8, 0x3a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xae, 
+   0xaa, 0xaa, 0x6a, 0x22, 0x22, 0x22, 0xe2, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xe2, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x2a, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x06, 0x38, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x19, 0x11, 0x11, 0x51, 0x11, 0x11, 0x11, 0x11, 0x1f, 0x11, 0x11, 0x11, 
+   0x15, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x80, 0x57, 0xbd, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0xd8, 0xdd, 0xdd, 0xbd, 0x88, 0x88, 0x88, 0x88, 0xf8, 0xdd, 0xdd, 
+   0xdd, 0x8d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdc, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x35, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0xc0, 0x00, 0x70, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x54, 0x44, 0x44, 0x64, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x47, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x47, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x02, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0xe0, 0xaa, 0x6a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0xa2, 0xaa, 0xaa, 0x3a, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0xfa, 0xaa, 0xaa, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0xe2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xab, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x60, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x1f, 0x11, 0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x01, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0xa0, 0xaa, 0xea, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0xe8, 0xaa, 0xaa, 0x8a, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0xe8, 0xab, 0x8a, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x1a, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x40, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x7e, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0xc4, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x50, 0x55, 0xd5, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xe2, 0x77, 0x77, 0x27, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xe2, 0x3f, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x7a, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x15, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x80, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x15, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0xf3, 0x1f, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0xd1, 0x17, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x51, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xb0, 0xaa, 0xaa, 
+   0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xab, 0xaa, 
+   0x8e, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xaa, 0xfa, 0x8f, 
+   0x88, 0x88, 0x88, 0x88, 0xbe, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x1a, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 
+   0x80, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 
+   0x44, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x46, 0x44, 
+   0xfc, 0xff, 0x7f, 0xe4, 0xff, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x14, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x08, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x50, 
+   0x55, 0xd5, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x77, 0x77, 0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x76, 
+   0x77, 0x77, 0x77, 0xf7, 0x7f, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x0d, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x10, 0x00, 0x00, 0x15, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x08, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0xb0, 0xaa, 0xaa, 0x8d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0xac, 0xaa, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x06, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x10, 0x00, 0x00, 0x49, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x4c, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x50, 0x55, 0x55, 0x31, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x7a, 0xf7, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x57, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x05, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x12, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x03, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0xb0, 0xaa, 0xaa, 0xa2, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xa8, 0xea, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xab, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x02, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x42, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xb0, 0xaa, 0xaa, 0x42, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xe2, 0x6a, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x01, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x84, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 0x31, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x50, 0x55, 0x55, 
+   0x85, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xc8, 0xbd, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0x7d, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 
+   0x00, 0x08, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 
+   0x64, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x14, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x80, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xb0, 
+   0xaa, 0xaa, 0x0a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0xa2, 0x3a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xab, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xba, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x10, 0x00, 0x00, 0x08, 0x14, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x40, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x50, 0x55, 0x55, 0x0d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x8d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x10, 0x00, 0x00, 0x08, 0x50, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x4e, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0xb0, 0xaa, 0xaa, 0x0a, 0x20, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x26, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0xa2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x08, 0x20, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x15, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x01, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x70, 0x55, 0x55, 0x15, 0xc0, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x8c, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x15, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x10, 0x80, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xa0, 0xaa, 0xaa, 0x1a, 0x00, 
+   0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x2a, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x10, 
+   0x00, 0x12, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x13, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xa0, 0xaa, 0xaa, 
+   0x1a, 0x00, 0x8c, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x9a, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x06, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x20, 0x00, 0x58, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x65, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x02, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 
+   0x55, 0x55, 0x35, 0x00, 0x20, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x37, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x03, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x20, 0x00, 0x40, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x31, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x91, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x01, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0xa0, 0xaa, 0xaa, 0x2a, 0x00, 0x80, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0xea, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xea, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0x01, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x20, 0x00, 0x00, 0x45, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x60, 0x55, 0x55, 0x35, 0x00, 0x00, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x62, 0xf7, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0xa2, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x20, 0x00, 0x00, 0x14, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x51, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0xa0, 0xaa, 0xaa, 0x2a, 0x00, 0x00, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xa8, 0xaa, 0x89, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xae, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x40, 0x00, 0x00, 
+   0x50, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 0x44, 0x45, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x02, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x55, 0x55, 0x55, 0x00, 
+   0x00, 0x20, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x72, 0x77, 0x23, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x15, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x40, 
+   0x00, 0x00, 0xc0, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x13, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xaa, 0xaa, 
+   0x6a, 0x00, 0x00, 0x80, 0x89, 0x88, 0x88, 0x88, 0x88, 0x88, 0xb8, 0xaa, 
+   0x8a, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 
+   0x00, 0x40, 0x00, 0x00, 0x00, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x14, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 
+   0xaa, 0xaa, 0x6a, 0x00, 0x00, 0x00, 0x2c, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0xaa, 0xaa, 0x26, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x02, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x40, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x10, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x15, 0x11, 0x15, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x02, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x40, 0x55, 0x55, 0x55, 0x00, 0x00, 0x00, 0xa0, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0xdc, 0xdd, 0x8d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x01, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x40, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x40, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x46, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0xc4, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0xc0, 0xaa, 0xaa, 0xaa, 0x00, 0x00, 0x00, 0x80, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0xaa, 0xaa, 0x2a, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0xa2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xea, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 
+   0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x19, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x31, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x55, 0x55, 0xd5, 0x00, 0x00, 0x00, 
+   0x00, 0x8c, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0x8d, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0x5d, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x35, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x80, 0x00, 0x00, 
+   0x00, 0x00, 0x4c, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x4c, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0xaa, 0xaa, 0xaa, 0x00, 
+   0x00, 0x00, 0x00, 0x30, 0x22, 0x22, 0x22, 0xe2, 0xaa, 0xaa, 0x2a, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x1a, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 
+   0x01, 0x00, 0x00, 0x00, 0x60, 0x11, 0x11, 0x11, 0x31, 0x11, 0x11, 0x19, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 0x01, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x55, 0x55, 
+   0x55, 0x01, 0x00, 0x00, 0x00, 0x80, 0x89, 0x88, 0x88, 0xf8, 0xdd, 0xdd, 
+   0x8d, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdd, 0xdd, 0xdd, 
+   0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0x5d, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x05, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 
+   0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x46, 0x44, 0x44, 0x54, 0x44, 
+   0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xc4, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x34, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 
+   0xaa, 0xaa, 0xaa, 0x01, 0x00, 0x00, 0x00, 0x00, 0x2c, 0x22, 0x22, 0xaa, 
+   0xaa, 0xaa, 0x2a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xa2, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xae, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x02, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x80, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x10, 0x11, 0x11, 
+   0x19, 0x11, 0x11, 0x19, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x91, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x03, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x01, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x80, 0xaa, 0xaa, 0xaa, 0x01, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x88, 
+   0x88, 0xac, 0xaa, 0xaa, 0x8a, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xab, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 
+   0x45, 0x44, 0x46, 0x44, 0x44, 0x4c, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x64, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x40, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x55, 0x55, 0x55, 0x03, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x26, 0x22, 0x77, 0x77, 0x77, 0x2f, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x5f, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x35, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x18, 0x91, 0x11, 0x11, 0x11, 0x19, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xab, 0xaa, 0xaa, 0x06, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0xe0, 0xc8, 0xaa, 0xaa, 0xaa, 0x8e, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x04, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x80, 0x75, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x64, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x55, 0x55, 0x55, 0x05, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7e, 0x77, 0x77, 0x77, 0x27, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x77, 0x77, 0x77, 0x77, 0x77, 
+   0x77, 0x77, 0x77, 0x5f, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 
+   0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1c, 0x11, 0x11, 0x11, 0x15, 
+   0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xaa, 0xaa, 
+   0xaa, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xea, 0xaa, 0xaa, 0xaa, 
+   0x8e, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xab, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 
+   0x00, 0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x47, 0x44, 
+   0x44, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x45, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x34, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x56, 0x55, 0x55, 0x0d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x55, 0x7d, 
+   0x77, 0x77, 0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x77, 
+   0x77, 0x77, 0x77, 0x77, 0x77, 0x77, 0x5f, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x35, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x02, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 
+   0x30, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x03, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0xaa, 0xaa, 0xaa, 0x1a, 0x00, 0x00, 0x00, 0x00, 0x00, 0xa0, 
+   0xaa, 0xea, 0xab, 0xaa, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x18, 0x00, 0x00, 0x4e, 0xc4, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 
+   0x44, 0x44, 0x46, 0x44, 0x44, 0x44, 0x44, 0x44, 0x1c, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0xaa, 0xaa, 0xaa, 0x6a, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0xac, 0xaa, 0xaa, 0xfa, 0x6a, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 
+   0x22, 0x22, 0x22, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xab, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x03, 0x00, 0x00, 0x80, 0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x11, 0x11, 0x11, 0x11, 0x13, 0x11, 0x11, 0x11, 0x11, 0x71, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x54, 0x55, 0x55, 0x55, 0x01, 0x00, 
+   0x00, 0x00, 0x80, 0x55, 0x55, 0x55, 0x55, 0xbd, 0x88, 0x88, 0x88, 0x88, 
+   0x88, 0x88, 0x88, 0x88, 0x88, 0xde, 0xdd, 0xdd, 0xdd, 0xdd, 0x5f, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 0x01, 
+   0x00, 0x00, 0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0xc2, 0x45, 0x44, 0x44, 
+   0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0xe4, 0x01, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xac, 0xaa, 0xaa, 0xaa, 
+   0x06, 0x00, 0x00, 0x00, 0xb8, 0xaa, 0xaa, 0xaa, 0xaa, 0x01, 0x3e, 0x22, 
+   0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0x22, 0xae, 0xaa, 0xaa, 0xaa, 0xbe, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 
+   0x00, 0x18, 0x00, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x60, 0x00, 0xe0, 
+   0x13, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x11, 0x15, 0x11, 0x11, 0xf1, 
+   0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x58, 0x55, 
+   0x55, 0x55, 0x35, 0x00, 0x00, 0x80, 0x55, 0x55, 0x55, 0x55, 0x1f, 0x00, 
+   0x00, 0xfc, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0x88, 0xdc, 0xdd, 0xdd, 
+   0x5f, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x1d, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 
+   0x00, 0x00, 0x00, 0xc0, 0x03, 0x00, 0x7c, 0x00, 0x00, 0x00, 0x80, 0x01, 
+   0x00, 0x00, 0x80, 0x4f, 0x44, 0x44, 0x44, 0x44, 0x44, 0x44, 0x4c, 0x44, 
+   0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0xa8, 0xaa, 0xaa, 0xaa, 0xaa, 0x3e, 0xc0, 0xab, 0xaa, 0xaa, 0xaa, 0x6a, 
+   0x00, 0x00, 0x00, 0x00, 0xf0, 0x23, 0x22, 0x22, 0x22, 0x22, 0x22, 0xaa, 
+   0xea, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x02, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x3f, 0x00, 0x00, 0x00, 0x00, 
+   0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7e, 0x11, 0x11, 0x11, 0x11, 0x11, 
+   0x99, 0x1f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x58, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0xff, 0x88, 0x88, 0x88, 
+   0x88, 0x7f, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x80, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0xff, 0xff, 
+   0xff, 0x7f, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0xb0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0xb0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x2a, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xa0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0xa0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x0a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xa0, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x3a, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x6a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x40, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x05, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x0d, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x80, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x01, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x03, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x80, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x35, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0xab, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xac, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x56, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x35, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x58, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x75, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0xac, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x06, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0xb0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x58, 0x55, 0x55, 0x55, 0x55, 0xd5, 0x01, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x70, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0xa8, 0xaa, 0xaa, 0xaa, 0xaa, 0x0a, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0xa0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x6a, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x04, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x50, 0x55, 0x55, 0x55, 0x55, 
+   0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x0d, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0xaa, 0xaa, 
+   0xaa, 0x3a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x03, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 
+   0x00, 0x00, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 
+   0xaa, 0xaa, 0xaa, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xab, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0x3a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x01, 0x00, 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x56, 0x55, 0x35, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x57, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x18, 0x80, 0x0f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0xe0, 0x7f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x54, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x15, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xac, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x02, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x58, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x75, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xb0, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x06, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x01, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0xa0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x6a, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x40, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x0d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x55, 0x55, 0x55, 0x55, 
+   0x55, 0x55, 0x55, 0x55, 0x1d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xae, 0xaa, 
+   0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x58, 0x55, 0x55, 0x55, 0x55, 0x55, 0x55, 0x1d, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0xb0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xea, 0x01, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0xc0, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0x07, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x00, 0xc0, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x56, 0x55, 0x55, 0x55, 0x3d, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x00, 
+   0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xb8, 0xaa, 0xaa, 
+   0xea, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 0x00, 
+   0x00, 0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 
+   0x7f, 0xf5, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0xc0, 0x1f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20};
diff --git a/vcl/qa/cppunit/graphicfilter/data/xpm/fail/.gitignore b/vcl/qa/cppunit/graphicfilter/data/xpm/fail/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/xpm/fail/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/xpm/fail/gentoo22729-1.xpm b/vcl/qa/cppunit/graphicfilter/data/xpm/fail/gentoo22729-1.xpm
new file mode 100644
index 000000000..ca2d777a1
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/xpm/fail/gentoo22729-1.xpm
diff --git a/vcl/qa/cppunit/graphicfilter/data/xpm/indeterminate/.gitignore b/vcl/qa/cppunit/graphicfilter/data/xpm/indeterminate/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/xpm/indeterminate/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/xpm/pass/.gitignore b/vcl/qa/cppunit/graphicfilter/data/xpm/pass/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/xpm/pass/.gitignore
diff --git a/vcl/qa/cppunit/graphicfilter/data/xpm/pass/tdf111925-1.xpm b/vcl/qa/cppunit/graphicfilter/data/xpm/pass/tdf111925-1.xpm
new file mode 100644
index 000000000..b5eab3e33
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/data/xpm/pass/tdf111925-1.xpm
@@ -0,0 +1,306 @@
+/* XPM */

+static char * example_xpm[] = {

+"150 100 203 2",

+"  	c #E6DECA",

+". 	c #E5DDC9",

+"+ 	c #E4DCC8",

+"@ 	c #E3DBC7",

+"# 	c #E3DAC5",

+"$ 	c #E2D9C4",

+"% 	c #E1D8C3",

+"& 	c #E1D7C1",

+"* 	c #DFD6C1",

+"= 	c #DFD5BF",

+"- 	c #DED4BE",

+"; 	c #DDD3BD",

+"> 	c #DDD2BB",

+", 	c #DCD1BA",

+"' 	c #DBCFB9",

+") 	c #DACFB8",

+"! 	c #D9CDB7",

+"~ 	c #D8CDB6",

+"{ 	c #D6CAB2",

+"] 	c #D7CBB3",

+"^ 	c #D7CCB5",

+"/ 	c #D5C9B1",

+"( 	c #D4C8B0",

+"_ 	c #D3C7AF",

+": 	c #D3C6AD",

+"< 	c #D2C5AC",

+"[ 	c #D1C3AB",

+"} 	c #D0C2AA",

+"| 	c #CFC1A9",

+"1 	c #CEC0A8",

+"2 	c #CDBFA7",

+"3 	c #CBBDA5",

+"4 	c #CCBEA6",

+"5 	c #CABBA2",

+"6 	c #C9BAA1",

+"7 	c #CBBCA3",

+"8 	c #C8B9A0",

+"9 	c #C7B89F",

+"0 	c #C6B79E",

+"a 	c #C5B69D",

+"b 	c #C5B59B",

+"c 	c #C4B49A",

+"d 	c #C3B399",

+"e 	c #C2B298",

+"f 	c #C1B197",

+"g 	c #C0B096",

+"h 	c #BFAF95",

+"i 	c #BEAE94",

+"j 	c #BDAD93",

+"k 	c #BDAC91",

+"l 	c #BCAB90",

+"m 	c #BBAA8F",

+"n 	c #BAA98E",

+"o 	c #B9A88D",

+"p 	c #B2A186",

+"q 	c #B3A287",

+"r 	c #B8A78C",

+"s 	c #B6A58A",

+"t 	c #B2A084",

+"u 	c #B09E82",

+"v 	c #AF9D81",

+"w 	c #B5A489",

+"x 	c #7F6B4B",

+"y 	c #5F4E2D",

+"z 	c #5E4D2C",

+"A 	c #614F2D",

+"B 	c #A39175",

+"C 	c #9D8B6F",

+"D 	c #978265",

+"E 	c #927E5E",

+"F 	c #8C7858",

+"G 	c #857151",

+"H 	c #7A6746",

+"I 	c #776443",

+"J 	c #887454",

+"K 	c #E7DFCB",

+"L 	c #1E1800",

+"M 	c #161100",

+"N 	c #221B00",

+"O 	c #AB997D",

+"P 	c #9A876A",

+"Q 	c #948060",

+"R 	c #8A7656",

+"S 	c #816D4D",

+"T 	c #796645",

+"U 	c #715E3D",

+"V 	c #685534",

+"W 	c #584826",

+"X 	c #725F3E",

+"Y 	c #B19F83",

+"Z 	c #E8E0CC",

+"` 	c #B7A68B",

+" .	c #120F00",

+"..	c #000000",

+"+.	c #AC9A7E",

+"@.	c #937F5F",

+"#.	c #826E4E",

+"$.	c #6F5D3D",

+"%.	c #E9E1CD",

+"&.	c #AD9B7F",

+"*.	c #9B896D",

+"=.	c #847050",

+"-.	c #7A6848",

+";.	c #6A5838",

+">.	c #61502F",

+",.	c #5B4A29",

+"'.	c #746140",

+").	c #AE9C80",

+"!.	c #968164",

+"~.	c #8E7A5A",

+"{.	c #897555",

+"].	c #8B7757",

+"^.	c #836F4F",

+"/.	c #7D6949",

+"(.	c #9F8D71",

+"_.	c #907C5C",

+":.	c #A9977B",

+"<.	c #A08E72",

+"[.	c #9A8568",

+"}.	c #988366",

+"|.	c #A29074",

+"1.	c #9B886B",

+"2.	c #958161",

+"3.	c #695635",

+"4.	c #665534",

+"5.	c #756241",

+"6.	c #9C8A6E",

+"7.	c #625130",

+"8.	c #766342",

+"9.	c #6B5939",

+"0.	c #7E6A4A",

+"a.	c #6A5736",

+"b.	c #786544",

+"c.	c #A79579",

+"d.	c #998467",

+"e.	c #B4A388",

+"f.	c #A59377",

+"g.	c #493A13",

+"h.	c #3A2D00",

+"i.	c #413509",

+"j.	c #362B00",

+"k.	c #6D5B3B",

+"l.	c #52431E",

+"m.	c #382D00",

+"n.	c #282000",

+"o.	c #403306",

+"p.	c #5D4C2B",

+"q.	c #73603F",

+"r.	c #4A3B14",

+"s.	c #1A1500",

+"t.	c #544422",

+"u.	c #8F7B5B",

+"v.	c #7C6948",

+"w.	c #51421D",

+"x.	c #3C3000",

+"y.	c #534321",

+"z.	c #241C00",

+"A.	c #3E3202",

+"B.	c #655433",

+"C.	c #574725",

+"D.	c #50411C",

+"E.	c #53441F",

+"F.	c #6E5C3C",

+"G.	c #554523",

+"H.	c #4D3F19",

+"I.	c #4F3F19",

+"J.	c #A49276",

+"K.	c #A8967A",

+"L.	c #302600",

+"M.	c #473911",

+"N.	c #0E0B00",

+"O.	c #3F3203",

+"P.	c #080600",

+"Q.	c #42340A",

+"R.	c #4B3C15",

+"S.	c #43350B",

+"T.	c #877353",

+"U.	c #5C4B2A",

+"V.	c #46370E",

+"W.	c #4C3E18",

+"X.	c #322700",

+"Y.	c #50401A",

+"Z.	c #645332",

+"`.	c #2A2100",

+" +	c #2E2500",

+".+	c #645230",

+"++	c #A69478",

+"@+	c #867252",

+"#+	c #5A4826",

+"$+	c #463810",

+"%+	c #A18F73",

+"&+	c #806C4C",

+"*+	c #403204",

+"=+	c #413407",

+"-+	c #9E8C70",

+";+	c #958263",

+">+	c #AA987C",

+",+	c #5A4928",

+"'+	c #564624",

+")+	c #4C3D16",

+"!+	c #483912",

+"~+	c #6C5A3A",

+"{+	c #8D7959",

+"                                                                                                                                                                                                                                                                                                            ",

+"                                                        .                                                                 . . . . . . . . . . . .                           . . . . . . . . . . . .                           . . . . . . . . . . . . . .             . .                                   ",

+"                              . .           . . . . . . . . .                               . .                   . . . . . . . . . . . . . . . . . . . .           . . . . . . . . . . . . . . . . . . . .           . . . . . . . . . . . . . . . . . . . . . . .         . .                             ",

+"                          . . .       . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . + + + + + + + . . . . . . . . . . . . . . . . . . + + + + + + + . . . . . . . . . . . . . . . . . . + + + + + + + + + + + . . . . + . . .       . .                         ",

+"                      . .     . . . . + . . . . . . . . . . . . . . . . . . . . . . . . + + + + + + + + . . . + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + @ @ @ @ @ @ @ @ + + + + + + + . . . . . .     . .                     ",

+"                    . .   . . . + . + + + @ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + @ @ @ @ @ @ # # # # # # # # # # @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ # # # # # # # # # # @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ # # # # # # # # # # # # # # @ @ @ @ + @ + + . + . .   . .                   ",

+"                  . .   . . + . + + + + @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ # # # # # # # # # # # # # # # # $ $ $ $ $ % % % % $ $ $ $ $ # # # # # # # # # # # $ $ $ $ $ $ % % % $ $ $ $ $ # # # # # # # # # # # $ $ $ $ % % % % % % % % % $ $ % $ # # # @ @ @ + + + . . . . . .                 ",

+"              . . . . . + . + @ + @ @ # # # # $ $ $ $ $ $ $ # # # # # # # # # # # $ $ $ $ $ $ $ $ $ $ $ $ $ $ $ $ % % % & & & & * * * * * * & & & & % % % $ $ $ $ $ % % % % & & & * * * * * * & & & & % % % $ $ $ $ $ % % % & & & * * * * * = = * * * * & & & % % $ $ # # @ @ + + . + . . . .               ",

+"              . . . . + + + + @ @ # # $ $ % % % % % % % % % % % % % $ $ $ % % % % % % & & & & & & & & & & & & & & * * * = * = = = = = = = = = * * = * * * & & & & & * * * = * * = = = = = = = = * * = * * * & & & & & * * * = * = = = - - - - - - - - = = * = * * & % % $ # # # @ @ + + . . . .             ",

+"            . . . . + + @ @ @ # # % % % & & & * * * * * * * * * & & & & & & * * * * = * * * * * * * * * * * * = * = - - ; ; > ; > > , > > > > ; ; - - = = * * * * * = = - - ; ; > ; > > > > ; > ; ; - - = = * * * * * = = - - - ; ; > , ' ' ' ' ' , , > > - - - = * * & & % $ # # @ + + + . . . .           ",

+"          . . . . + + @ @ # # $ % & & = = * = = = - - - - = = = = = = = = = = = - - - - ; ; ; ; ; ; ; ; ; ; ; ; ; > , ' ' ) ) ) ! ! ! ! ! ! ! ) ' ' , > > ; - - - ; > > , ' ) ) ! ! ! ! ! ! ! ! ) ' ' , > > ; - - ; ; > > , ) ) ) ! ! ! ! ~ ~ ~ ! ! ! ! ) ) ' > ; - = * * & % $ # # @ + + + . . . .         ",

+"        . . . . + + + # # $ % % & * * = - ; ; ; > > , , > > > ; > ; ; ; ; > ; > , ' ' ) ) ) ) ) ) ) ) ) ) ) ) ) ! ! ! ! ~ ~ { { { { { { { { ] ~ ~ ! ! ) ) ) ) ) ) ' ) ! ! ~ ~ ^ ] { { { { / { { ~ ~ ! ! ) ) ) ) ) ) ) ! ! ) ~ ^ ^ { { / { { / { { / { ] ^ ~ ! ! ) ' ; ; = * * & % $ # # + + + .   . .       ",

+"        . . . + + @ @ # $ % & = * = ; > , ) ) ) ! ! ! ! ! ! ! ! ) ) ) ) ) ! ! ! ) ! ! ~ ~ ^ ^ ^ ^ ^ ^ ~ ~ ~ ^ ^ ] { / { / ( ( _ _ _ ( _ _ : ( ( / { { ] ^ ^ ~ ~ ~ ~ ^ { { { / ( ( _ _ _ _ _ _ ( / / { { ] ^ ^ ~ ~ ~ ~ ^ { { { / ( _ _ _ : _ _ : _ _ _ ( / / { { ~ ! ) ' > - = * & % $ # @ @ + + . . .       ",

+"      . . . . . @ @ # $ % * * = - ; , ) ! ! ~ ^ ^ { { ] ] { ^ ^ ~ ~ ~ ~ ^ ^ ] { / { { / / ( _ ( _ ( ( ( ( ( ( _ _ _ _ _ < [ [ [ } | | | } [ < < : _ _ ( / / / { / ( ( _ _ _ < [ [ [ } } } } } [ [ : _ _ ( / / / { / ( ( _ _ _ < [ } } 1 | | | | 1 1 } [ < : _ / { ] ~ ! ) > ; * * & % # # @ + + .   .       ",

+"      . . . + + @ @ # % & * * - > ' ) ! ~ { / / / / ( ( ( ( ( / ( ( ( / ( ( _ _ ( _ : [ [ [ [ < < [ [ [ [ [ [ < [ } 1 1 1 2 2 2 3 3 3 3 3 2 2 1 | | [ [ < : _ _ _ _ < < [ 1 | 2 2 2 2 3 3 2 1 2 1 | | [ [ < : _ _ _ _ < < } | 1 1 2 3 3 4 3 3 4 3 3 2 2 | | < < _ ( { ^ ! ) , - * * & $ # # + + + . . .     ",

+"      . . . + @ # $ $ & * = ; > ' ) ~ { { ( _ _ : < [ [ [ [ [ [ < < < [ [ [ [ [ | | | 1 2 2 2 1 2 2 2 2 1 1 2 2 2 2 3 4 5 5 6 5 6 6 6 6 6 6 5 7 4 2 1 1 | | | | | | 1 2 1 3 3 5 5 5 5 5 6 5 5 7 5 4 2 1 1 | | | | | | 1 2 2 4 5 7 5 5 8 8 6 8 8 6 5 5 5 4 2 2 | [ : ( { ] ! ) , - = * % $ # @ @ . .   .     ",

+"    . . . + + @ # $ % * * - ; ) ! ] { / ( < [ [ | | | 1 1 1 1 1 1 1 1 1 2 2 1 2 3 3 5 5 5 5 5 6 6 5 5 7 5 5 5 5 5 5 8 6 9 0 0 a a 0 0 a 0 0 9 9 8 5 5 7 3 3 4 4 3 4 3 7 5 5 8 9 0 0 0 0 0 0 0 9 6 5 5 5 7 3 3 4 4 3 4 3 7 5 5 6 8 0 0 0 a b a a a 0 9 9 6 7 3 2 1 [ < ( { ] ) ' > = * & % # @ + + + . . .   ",

+"    .   . . @ # $ $ % * = ; ' ! ] { ( _ < | 1 2 2 3 3 3 3 7 7 7 7 3 5 7 5 5 6 5 8 8 9 9 0 0 0 0 0 0 0 0 0 0 0 0 0 0 b a c c d c c e c c d c b a 0 9 8 6 8 5 5 5 5 8 6 8 9 0 a b c c d d d c c c a 0 9 8 6 8 5 5 5 5 8 6 8 9 0 a b c d d e e e c c c c 0 9 9 5 7 4 1 } < ( { ~ ) ' ; = * % $ # @ + + . . .   ",

+"    . . + + + @ $ % & * - , ) ~ { ( : < | 1 3 5 5 5 5 6 8 8 8 8 8 8 9 9 0 0 0 a b a b c c d c c c c d d c c d c c d d f f f g g g g g g g f e d c c c b 0 0 0 0 0 0 a b c c d e e g f g f g e e d c c a b 0 0 0 0 0 0 a b c c d f g g g g g g g g f d c b 0 9 6 5 4 1 | < ( ] ~ ) , = * & $ # @ + + + .   . ",

+"  . . . + + @ # $ % * = ; ) ~ ] ( : } 1 4 7 5 8 0 9 0 0 a a a b b a b c c c d e d f f f g g g g g g g g g g g g g h h i i i j j j j j j i h h g g e c d c c c b c c d d e g g h h i h h i h g g f f e d c c b c c c c d d e f g h h i i j j i i i g g g c c 0 9 8 5 4 1 < _ / ^ ) , - = * % $ # @ + + .   . ",

+"  . . . . @ # # % * * ; , ) ^ / _ [ 1 4 7 5 8 0 0 a c c d d d e d f e f f f g g i i i i j j j j j j j j j j j j k j j k l k l l l l l k k j j i i g g f f g e e f g g g h h i j j j k k j j j j i i h g f f g e e f g g g h h j j j j l k l j j j j h h f e b a 9 5 7 2 } : ( ] ! ) ; = * % $ @ @ + . .   . ",

+"  .   . + + @ $ % * * ; ' ! ] ( : } 4 3 5 9 0 b d d e f g g g g g h i i j j j j j j k l m l l l l l m l l l l l m m m m n m m m m m m m m l m k j j i h i h h h i h h i j j k k l l m m l l l k k j j i h i h h h i h h j j k j k l m m m m l l k k j i g f d c a 8 5 3 1 [ ( { ^ ' , - & & % # @ + . .   . ",

+"  . . + + @ # $ % * = , ' ^ { ( [ | 3 5 8 0 b c e g g i i j j j j k k k l k m m m m m n m n m n m n m m n n m m m m m n n n n n n n n m m m m l k l j j j j j j j j j j k k m l m m m m m m m m l l k j j j j j j j j j j k k l m m m m m m m m m k j i h g e c b 0 5 3 1 } _ ( ] ! , ; = & % $ @ + + . . . ",

+"  . . + + @ # $ & & = , ) ^ ( : [ 1 7 5 0 b d e g h i j l k m l l m m m n m m m n n m m n n n o o o n n o o o n o n n n n n o o n n m m n m m m m m m l k k k k k l k l l m m m m m m m m m m m m m l l l l k l k k l k l l m m m m m m m m m m m l k j i h f c c a 9 7 4 | : ( ] ! ' ; = & % # @ + + + . . ",

+"  . . + + @ # $ & * - , ) ] ( [ | 2 5 8 0 c e g h j j k m m m n n m n n n n n n n n n n n n n n m n n n m n n n n n m m n m m m m m m m m m m m m m m m m m m l m m l m m m m m m m m m m m m m m m m m m m m m l m m l m m m m m m m m m m m m m l k j j h g d c a 8 5 3 1 [ _ ] ~ ' ; = * % $ # @ + + . . ",

+". . . . @ @ # % * = - ' ~ / ( < 1 4 6 0 b e f g j j l l m m m n n n o n n n m m n m m m m m m m l m m m m m m m m m m l m m m l l m m m m m m m m m m m m m m m m m m m m l m m m m m m m m m m m m m m m m m m m m m m m m l m m l l l l m m l l l k j j h g f d b 0 6 7 1 [ _ / ^ ' , = & & $ @ @ + . .   ",

+". . . . + @ $ % * = > ' ~ / ( } 1 7 6 0 c e g h j k l m m n n n n n n m m m m m l l k k k j j j j j j j k k k k k j j j j j j j j j k k k l m m m m m m m m m m m m l m l l l k k k k l l l l m m m m m m m m m m m m l m l k l k k k k k l l k k k j j j i g f d c 0 5 3 1 } : / ^ ) , - * % $ # @ + . .   ",

+". . . . + @ # % * = , ' ~ / : } 1 7 8 0 c e g i j k l m m n n m m m m m l k k j j i i h g g g g g g g g g g h h g g g g g g g g h i i j j j k k l m m m m m m m m l k k k j j j j j j j j j k k l l m m m m m m m m l k k k j j j j j j j j j j j j j j i h g g d c 0 9 5 4 | < ( ] ! ' - * & % # @ + . .   ",

+".   . + + # $ % & = , ' ^ / < | 1 5 9 b c f g i j k l m m m m m l l k j j i h g g g e d d d d c c c c c d d d d d d d c c d d d e e g g g h j j j k l k l l k k k k j j j h h g g g h g h i i j j k k k l l l k k k k j i i h h h g g g h g h h i i j i i h g f d c a 9 6 3 | < _ { ~ ' ; * * % # # + + + . ",

+".   . + + # $ & & = , ' ^ ( : | 4 5 9 a c e g i j j k k l l k k j i h h g f e d c c a 0 0 0 0 9 9 9 9 0 0 0 0 0 0 0 0 0 0 0 a a b c c d e g g h i i j j j j j j j i h h g g f e e e e f f g g h i i j j j j j j j j i h g g f f e f e e f f g g g h g h h g g f e c 0 9 5 4 1 [ _ / ^ ) , = & & $ @ @ + . . ",

+".   . + @ @ $ % & - , ' ^ ( : 1 2 5 9 a c e g h i j j j j j i i g g f e c b a 0 9 8 5 5 5 5 7 7 7 7 7 7 7 7 5 5 5 5 5 5 5 5 6 8 9 9 0 a c c d e g g g i h h h h g g f e d c c b c b c c c d d e g g g h h h h h h g g f e d c c c b c c c c d e f g g g g g g f d c b 9 8 7 2 | < / ^ ) , - * & $ # @ + + . ",

+".   . + @ @ # % & = , ! ] ( < | 4 5 9 a c e f g h i i h h h g f e d b a 0 9 6 5 7 4 2 2 1 1 | | | | | | | | 1 1 1 1 1 1 2 2 4 3 7 5 6 8 0 0 b c c e e f f f f e e d c b a 0 0 0 9 9 0 0 0 a b c c d e f g f f f e e d c c a a 0 0 0 0 0 0 a b c d d e f g g f f d d b 0 6 5 4 | < ( ] ~ ' ; * * % $ # @ + + ",

+". . + + @ @ $ & * - , ! ] ( < | 2 5 8 0 c d e g g g g g f e e c b 0 9 8 5 3 4 1 1 | [ < : : _ _ ( ( ( ( _ _ _ _ : : < < < } } | 1 2 4 7 5 6 9 0 a b c c c c c b b a 0 9 8 6 5 5 5 5 5 5 8 8 9 0 0 a c c c c c c b b 0 0 9 8 8 6 5 5 5 6 8 9 9 a b c d d f f f e d c b 0 8 5 3 1 [ ( / ^ ' , - * & $ # @ + + ",

+". . + + @ @ $ & * - , ! { ( : 1 2 5 8 0 b c d e e f e e d c a 0 8 6 5 3 1 1 } < _ ( ( / { ] ^ ] ] ] ] ] ] ] { { ] { { / ( ( _ : < } | 1 4 3 5 5 8 9 9 0 0 0 0 0 8 8 5 5 7 3 4 2 2 2 2 4 3 7 5 6 6 8 0 0 0 0 0 0 9 8 8 5 5 7 3 3 4 4 3 3 7 5 5 9 0 a b c d d e e d c c a 9 5 7 2 | < / ] ! ' - = * % $ # @ + ",

+". . + + @ # $ & & - , ! ] / : 1 4 5 6 0 a c c d d c c c b 0 9 6 5 3 1 | [ : ( ( ] ^ ~ ! ) ) ' ) ' ' ' ' ) ) ) ' ) ) ! ~ ^ ^ ] { ( ( : [ } 1 2 4 7 7 5 5 5 5 5 5 3 3 2 2 1 1 } | } } | | 1 1 2 4 3 7 5 5 5 5 5 5 5 3 3 2 2 1 | | | | | 1 1 4 7 5 6 0 0 b c d d e d c c a 0 8 5 4 | [ _ / ^ ) , - * & $ $ @ + ",

+". . + + @ # $ & & = , ! ] ( : | 2 7 8 9 a b c c c c a 0 0 8 5 3 2 1 [ : ( / ] ~ ! ' , , > ; ; - - - - - - - ; ; ; > > , , ' ! ! ^ { / ( _ < } } 1 1 1 2 2 2 1 1 1 | } [ < : _ _ ( _ _ : < < } | | 1 2 2 2 2 2 1 1 1 | | [ < : : : : < < } 1 1 3 5 6 9 0 b c c d d d c b 0 8 6 3 2 | < ( ] ! ) ; = * % $ $ @ ",

+". . + + @ # $ % & = , ! { / : | 2 7 5 9 0 a b b a a 0 9 6 5 4 1 } : ( / ] ~ ) ' > - - = * & & & % % % % & & & & * * = = - ; > , ) ! ~ ] { ( _ _ < [ } } } } [ [ < _ _ ( ( / / { { { / / / ( _ : : < [ } } } } } [ < : _ ( ( ( ( ( ( ( ( _ < } 1 4 5 5 9 0 a c c c c c b a 0 6 7 4 | } ( ( ] ) ' - * & % $ # ",

+". . + + @ # $ % & = , ! ] / : | 1 3 5 9 0 0 0 a 0 9 8 5 7 4 1 } : ( { ^ ) ' > - = * & % $ # # # # @ @ # # # # # $ $ % % & * = - ; > ' ! ~ ^ ] / ( ( ( ( ( ( ( ( ( / { ] ^ ^ ~ ~ ~ ~ ~ ^ ] ^ { / ( ( ( ( ( ( ( ( ( ( / { { ] ( ( ( ( ( / ( _ : [ 1 4 5 6 0 0 b c c c c c b 0 9 5 3 1 } < ( ] ^ ) ; = * & $ # ",

+". . + + @ # $ & & = , ! ] / : | 2 5 6 9 0 a a a a 0 9 5 3 1 [ : ( ] ~ ' , - = & % $ # @ @ + + + . . . . + + + + + @ @ # $ $ % & = - ; > , ) ! ~ ^ ] ] ] { ] ] ^ ^ ~ ! ) ' , , ' , ' , , ' ) ! ~ ^ ^ ] ] { { ] ] ^ ^ ~ ! ! | m p q q m 1 { / ( : [ 1 3 5 8 0 0 b c c c c b 0 0 8 5 3 1 } _ ( ^ ) ' ; = * % $ ",

+". . + + @ @ $ & & = , ! ] / : 2 a i m r s q t u v v w b 1 } : ( ] ~ ' > - = % % # @ + . .                       . . . + + @ # $ % & * = ; > , , ' ' ) ) ) ) ' ' , > , > ; ; - - - - - ; ; > , ' , ' ' ) ) ) ) ' ' , , > ' j x y z A x l ] ^ / ( < | 1 3 5 9 0 a b c c c c b a 8 6 3 2 } [ ( ] ^ ) ; = * % $ ",

+". . + + @ @ $ & * - , ) ] / : 6 t B C D E F G x H I J s 1 < ( / ~ ) , - * % # # + . .   K K K K K K K K K K K K K       . . + @ # $ % & & * = - ; ; ; > > > ; ; - - = = * * & & & & & * * = = - - ; ; > > > > ; ; - - = , s y L M N A w ^ ) ^ / _ < 1 4 7 6 0 a b c c c c b 0 9 8 7 4 1 [ _ / ] ) , - * & $ ",

+".   . + @ @ # % & = , ! ^ / : 0 O P Q R S T U V y W X Y 1 _ ( ] ) , ; * % $ @ + .   K K Z Z Z Z Z Z Z Z Z Z Z Z Z Z K K K   . . + @ @ # $ % % & & * * * * * * * & & % % $ $ $ $ # $ $ $ $ % % & & * * * * * * * * & & % - ` z  ...M y s ) ' ! ] ( : } 1 3 6 9 0 b c c c c c a 0 9 5 3 1 } < ( ] ! ' ; = * & ",

+".   . + @ # $ % & = , ) ~ / : 9 +.P @.R #.T $.V z W X Y 1 ( / ~ ' > - & $ # + .   K K Z Z %.%.%.%.%.%.%.%.%.%.%.Z Z Z Z K K K     . + + @ @ # # $ $ $ $ $ $ $ $ # # # @ @ @ @ + + @ @ @ @ # # # $ $ $ $ $ $ $ $ $ $ # # * r z  ...M z s ' > ' ~ { ( [ | 4 5 8 0 a c c c c c c 0 0 6 7 4 1 [ _ ] ^ ' , = * % ",

+".   . + + # $ % & = > ' ~ / _ 9 &.*.Q F =.-.X ;.>.,.'.t | ( ] ! , - * % # @ . .   K Z Z %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%.Z Z Z K K       . . + + + @ @ @ @ @ @ + + + + . . . . . . . . . . . + + + @ @ @ @ @ @ @ @ + + + % o y  ...M y ` > - , ! ] ( : } 2 7 6 0 a c c d d c b a 0 8 5 4 1 [ _ ( ] ) , - * & ",

+".   . . + # # % & * > ' ~ ] ( 8 ).C !.~.{.].{.^./.H R r [ / ^ ) > - & % # + .   K Z Z %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%.Z Z Z Z K K K       . . . . . . . . . .                             . . . . . . . . . . . . . $ n y  ...M y r ; - > ) ~ / _ } 1 3 6 9 0 b c c d c d a 0 8 5 3 2 | : / ^ ! ' - * & ",

+". . . . + @ # % & * > , ! ] ( 6 v (.D _.Q :.q q p p r 6 < _ / ^ ! ' = $ # + . . . + + . .   Z Z Z K   . . .   K K . . . . . Z K K K + + @ @ @ . . @ # # # + .   . + @ @ @ .     K K     @ @ @ @ @ + + @ # # # @ .     K @ m y  ...M y r - = ; ' ^ / < 1 3 5 9 0 b c d d d c c b 0 0 5 3 1 } : / ] ) ' ; = & ",

+". . . . @ @ # % & * > , ~ ] ( 5 Y <.[.@.}.s 9 6 5 7 4 | 1 g ` w s l 2 ; @ + . & [ g l l h 2 & Z   * } c j h 9 / ^ b l l l a > Z Z > b m m m c ) ; | e j d [ * + * } d j c _ $ K K Z K , b m m m c ! ; 1 f j e | - +     @ m A  ...M y r - * - ' ~ _ 5 j q u u q m g d d d c c b 0 0 5 3 1 } : / ^ ! ' ; = & ",

+"  . . + + @ # $ & * - , ! ] ( 5 q |.1.2.[.r 9 6 5 7 1 | 0 <.H 3.4.5.6.5 & + % 3 *.X >.7.8.B ( . , k !.I V 9.S (.O 0.7.A 7.^.a     a ^.7.A 7.S r o !.I a.T *.0 { j !.b.;.H (.4 @ Z %.  a ^.7.A 7.S o r Q 5.3.b.!.j ,   K + m A  ...M A o = & - , ( d c.~.T X I G d.&.l f d c c b 0 0 5 3 1 } : / ] ) ' ; = & ",

+"  . . + + @ @ $ % * = , ) ~ / 3 e.f.C !.d.&.s s e.n 8 } 3 O 5.g.h.i.9.:.( $ ( c.4.j.M h.k.t , - n ^.l.m.L n.o.p.q.r.M  .L 7.k . . k 7.L  .s.t.u.v.w.m.N x.y D :.=.y.m.z.A.B.c.^ K %.. k 7.L  .s.C.@.0.D.j.N m.E.G l = Z + m A  ...M A o = * - ^ e [.F.G.H.I.E.z $.R J.m e c b c 0 9 5 3 2 | : / ^ ! ' - * & ",

+"  .   . + + # # % & = > , ! { 4 ` K.(.[.2.2.E F J @.m [ < c }.p.A.L.M.x n ( r H o.N.s.y.d.| $ 5 u.I.s.........z.O.N .... .A l . . l A  ...P.x.t.Q.M ....P.m.,.;.R.L ....P.S.T.5   %.. l A  ...P.o.U.M.s.......L D.E 3 . . m A  ...M A o * * ; 3 C V M.i.V.R.D.t.p.9.J K.j c c a 9 9 5 3 1 [ _ ( ] ' , = & & ",

+"  . . . . @ @ $ % & * ; , ! ] 1 o O |.1.2.~.G v.5.=.s } _ [ r =.W.X.X.t.@.p _.Y.M N.Q.S h & > v Z.n.......P.N.N.N....... .A l . . l A  ..... .z.s.P.......N.`.m.N P....... +U f . %.. l A  .....M  +L N.P.......`.V p - + l A  ...M A o * * ~ w I M.A.S.y.B.a.>.z .+5.Q q d c 0 9 6 5 2 1 < _ ] ^ ' , = * % ",

+"  . . . + + @ # % & & - , ' ^ } l &.++C D _.T.0.8.@+s | _ ( 4 c.9.o.`.m.A #.p.`.P. +4.O ! . < !.W.N...N.h.D.#+D.h.N..... .A l . . l A  .....N $+l.V.L ......N M.E.$+N ....s.Z.j . %.. l A  ..... .x.w.#+D.m.N...N.I.d._ @ l A  ...M A o * = 1 1.W x.A.D.x C C ^.V Z.F.@+:.h a 0 8 5 3 2 } < ( ] ! ' ; = * & ",

+"    . . + + @ # $ % & * ; , ! [ i Y :.%+[.@.].#.H J ` [ ( / / c Q C.X.z.x.g.m.N.s.D.2.4 +   9 &+*+P...m.;.*.v *.a.m..... .A l . . l A  ...P.$+=.(.^.V.P...P.M.@+%+@+M.P... .>.l . %.. l A  .....m.9.6.v 1.3.j...P.=+^.8 # l A  ...M A o * - c G g.m.*+z *.j l *.X 4.k.&+(.k 0 9 6 5 4 1 [ _ / ^ ) ' - * & $ ",

+"    .   . . + @ $ % & & - , ) : g q +.B -+C P ;+_.}.k [ ( / ~ ( s /.$+z.L s. .N.=+v.m & Z . f $. +..N.I.d.4 ; 4 d.I.N... .A l . . l A  ... .W O } >+W  ... .W O [ O W  ... .A l . %.. l A  ...N.Y.[.2 ; 3 }.I.N...L.X e # l A  ...M A o * ; k '.i.j.*+z D +.O d.X V F./.[.n 0 0 5 3 2 | < _ / ^ ' , - * & % ",

+"    . . . + + @ @ $ % & = > ' ( d s v c.c.` i j m i 7 : / ] ~ ! 1 %+y j.s. .N.z.p.J.{ K Z . j 4.L .. .,+Y = K = Y ,+ ... .A l . . l A  ... .y o = o y  ... .y o = o y  ... .A l . %.. l A  ... .,.t = K = Y ,+ ...N V i $ l A  ...M A o * ; o a.x.j.A.R..+F.X $.4.V $./.!.r 0 6 5 4 1 [ < ( ^ ! ' ; = * & $ ",

+"    . . . + + @ # $ % & * ; , ( c r u :.O e 1 | | | < _ / ] ~ ) / q U O.L M N.j.F.r * Z Z . k .+s... .z ` # Z # ` z  ... .A l . . l A  ... .A m $ m A  ... .A m $ m A  ... .A l . %.. l A  ... .z r # Z # ` z  ...s..+j $ l A  ...M A o * ; r 4.m.j.A.Q.R.D.'+p..+a.X /.;+o 0 5 5 2 1 [ ( / ^ ) , ; = & % $ ",

+"      . . . + + @ $ % & * = , / b o p O &.c | [ < < _ ( / ] ! ) 1 %+A j.L M N.z.p.J.{ K Z . j V N .. .#+v - K = u ,+ ... .A l . . l A  ... .A l $ l A  ... .A l $ l A  ... .A l . %.. l A  ... .,+Y = K - v #+ ...N V j $ l A  ...M A o * ; o 9.A.j.A.R..+F.'.b./.S J ~.-+l 9 5 7 2 | : ( / ^ ' , = * & % # ",

+"      .   . . @ @ # $ & * = > ] 0 m q +.&.c | | } [ [ _ ( ] ~ ( ` 0.M.`.n.X.L N.=+v.m & Z . e X L...N.H.!.7 - 4 }.I.N... .A l . . l A  ... .A l $ l A  ... .A l $ l A  ... .A l . %.. l A  ...N.I.}.2 - 7 !.H.N...L.X e # l A  ...M A o * - j I Q.j.o.p.2.O v u u v t q o c 6 5 4 2 } : ( { ~ ' , = * & % # ",

+"      . . . + @ @ # $ % & * > ] 0 m q &.+.m f h j l g 2 / ] ] b ;+#+h.L.M.p.M.L L D.2.4 +   8 ^.=+P...j.V P v *.;.m..... .A l . . l A  ... .A l $ l A  ... .A l $ l A  ... .A l . %.. l A  .....m.;.*.v P V j...P.=+^.6 # l A  ...M A o * - a {.)+m.o.,.;+n a e o t Y q m b 6 5 3 1 } _ ( ] ^ ' ; = * & $ $ ",

+"      . . . + @ @ # $ % & * > ] 0 m q +.++f.<.P ;+_.d.h ( { 1 :.F.S.X.i.F.}.I =+N. +4.O !   : }.I.N...N.m.D.#+w.h.N..... .A l . . l A  ... .A l $ l A  ... .A l $ l A  ... .A l . %.. l A  ..... .x.w.#+D.m.N... .Y.[._ @ l A  ...M A o * = | -+,.A.*+H.q.[.:.f.D {.{.@.++h 6 5 4 2 } : ( { ^ ' , = * & $ # ",

+"      .   . . @ @ # $ & * = > ] 0 m q +.B *.2.F =.-.{.o : < o @+w.A.x.p.1.f |.z n.N.Q.S i * > t 4.n.......P.N. .N....... .A l . . l A  ... .A l $ l A  ... .A l $ l A  ... .A l . %.. l A  .....s.j.N  .P.......L.;.q - @ m A  ...M A o = = ~ r -.r.o.S.D.Z.U '.U F.5.{.c.f 8 5 7 2 } < ( / ^ ' > - & & % # ",

+"      . . . + + @ $ % & * = , / b n p >+|.P @.].S T J r } b P .+S.O.I.T.g ! c R r. .s.y.}.1 % 5 _.Y.s.......P. +Q.n..... .A l . . l A  ... .A m % m A  ... .A m % m A  ... .A l . %.. l A  ...P.i.>.g.s.......N E.Q 3 @ @ m y  ...M y r - = > 4 %+9.g.S.!+H.y.,+7.9.v.D w b 9 5 7 2 1 [ _ / ^ ' , - * & % $ ",

+"    . . . + + @ # $ % & * ; ' ( c r Y :.%+[.@.R S T T.r 7 ).H D.i.M.X ).] % ! t $.x.M h.~+Y ' ; n =.w.j.L n.i.7.T W.s. .L 7.k . . l 7.L  .L 7.l % l 7.L  .L 7.l % l 7.L  .L 7.k . %.+ m A  ... .'+Q 0.Y.X.N h.t.J j -   @ m >.L  .N >.o - = > ^ c 6.'.#+D.D.t.z ;.-.Q ).g 0 0 6 5 4 1 } : / ] ! ' ; = * & # ",

+"    . . . + + @ @ $ % & = > ' / 9 k s u >+B *.D E F !.l b B &+F.;.I -+5 ; % & 1 (.X A >.5.|.: # ! m 2.5.4.9.^.B &.0.7.A 7.^.b . . b #.7.A 7.#.c $ c #.7.A 7.#.c $ c #.7.A 7.^.b . Z + m A  ... .z v s E X V I D j ' @ + # c S >.y >.S g ; - , ! ( c O E /.5.5.0.{+C t i c a 0 8 5 3 2 | < _ / ^ ' , - * & % ",

+"    .   . . @ @ # % & * - , ! ] < 4 5 0 d g j m n r k 5 4 f r w s m 7 ! * & % ; } i r o k 5 ; + # > 2 f l j 0 ( { c m m m c '     ' c m m m c ) + ) c n m m c ) + ) c m m m c '   K @ m y  ... .y r ~ 4 g k f 1 ; @ @ @ @ ~ e r r r g / - ; , ~ ] : 5 j w Y v Y e.l f c c c 0 0 9 5 4 1 } _ / ] ) ' ; = & % ",

+"    . . . + + @ # % * = - , ! ] / _ [ 1 1 4 3 3 3 4 4 1 [ < : ( / ^ ) > ; = = * * - = = = & $ $ $ % & & & & % # # % $ $ $ $ + + + + $ $ % % % @ @ # & & & & % @ @ @ $ $ $ $ $ + + . $ n y  ... .y r * % * * * & % $ % $ % % - - ; ; , ; , ' ) ^ / _ } 2 5 8 0 b c c c d c c a 0 9 6 3 4 1 [ ( ] ^ ) ; = * & ",

+"  . . . + + @ # $ & & = , ' ~ ] ( : [ | 1 4 4 3 4 4 1 1 } < ( / ] ~ ' , ; ; - = * * & & & % % % % % % $ $ $ # # # @ @ @ + + + + + + @ @ @ @ # # # # $ $ $ # # # # @ @ @ + + + + + + % r y  ... .z r = $ % % % % % % & & & & * * = = ; > , ) ~ { ( : [ 1 3 5 8 0 a c c d c c c a a 9 6 3 1 } _ ( ] ) , - * & ",

+"  . . . + @ # # $ & * - , ) ^ / ( : | 1 4 3 7 5 7 7 3 2 1 } < ( / ] ^ ! ) ' , , > > ; ; ; - - - - = = = * * * & % % % $ $ $ # # $ $ $ $ % % & & & * * * * * & & & % % $ $ # # # # # = r z  ... .z s > = = = - - - - - ; ; ; > > , , ) ! ~ ^ / ( : [ 1 4 7 8 0 a c d d e e d d c a 9 8 7 1 } < ( ] ! ' - * * ",

+"  . . . . + @ $ % & * ; , ! ] ( : [ | 2 4 7 5 5 5 5 7 4 2 1 } : _ ( { ] ^ ~ ! ) ) ) ' ' ' ' ' ' ' , , , > > ; - - = = * * & & & & * * * = = - - ; ; ; ; ; ; ; - - = * * & & & & & & ; s z  ... .z e.! > , , , ' ' ' , ' ' ' ) ) ! ! ^ ^ { ( ( : [ | 2 7 5 9 a b c e f f f f d c c a 9 5 4 1 < _ ] ~ ' ; * * ",

+"  .   . + + @ # % * = > , ~ { ( : } 1 4 7 5 5 8 8 6 5 5 3 4 1 | [ : _ ( / / { ] ] ] ^ ^ ^ ^ ^ ^ ~ ~ ~ ! ) ) ' , , , > > ; ; ; ; ; ; ; > , , , , ' ' ' ' ' ' ' , , , > ; ; - - - - - ' w y L  .N y q ] ! ! ~ ~ ^ ^ ^ ^ ^ ^ ^ ] ] { { / ( ( : < } 1 2 7 5 9 0 b d e f g g g g f e c b 0 6 3 2 } _ ( ] ' , - * ",

+"  . . + + @ # $ % & = > ' ~ { _ [ | 1 3 5 8 8 8 9 9 8 6 5 5 3 2 1 | } [ < : : _ _ ( ( ( ( ( ( ( ( ( / / { ] ] ^ ~ ! ! ) ' ' ' ' ' ' ) ) ! ~ ^ ^ ] ] ^ ^ ^ ] ^ ^ ~ ! ) ' , , > > > > ! k x z p.z /.n ( { / / ( ( ( ( ( ( ( ( ( _ : : < [ } } 1 2 4 7 6 9 0 b c d f g g h g g g e c b 0 8 3 1 } : / ^ ) , - * ",

+"  . . + + @ # $ & & - , ) ~ { _ [ 1 3 7 6 8 0 0 0 0 0 9 8 6 5 7 7 4 2 1 1 1 | | } } } } } } } [ [ < < : : _ ( ( / / { ] ] ^ ^ ^ ^ ^ ] { / ( / ( ( ( ( ( ( ( ( / / { ] ^ ~ ! ~ ! ! ~ ~ 1 n t Y u r 5 : _ : < [ [ } } } [ } } } | 1 1 1 1 2 4 7 5 5 9 0 a c c e f g g h i h g g e d c a 8 7 2 | < ( ] ! ' ; * ",

+"  . . + + @ # $ % * = , ) ~ / _ [ 1 3 5 6 0 0 0 b b b a 0 0 9 8 6 5 5 5 7 7 7 7 3 3 4 3 3 3 4 4 4 2 1 1 1 | } } < : : _ ( ( ( ( ( ( _ : : < [ } | } } } } } } < : : _ ( / / / { { / ( ( [ } } 1 1 | 1 1 1 1 2 4 4 3 3 3 3 3 3 7 3 7 7 5 6 6 9 0 0 a c c e g g h i j j i i h g f d c 0 8 5 4 1 < ( ] ! ' - * ",

+"  . . + + @ @ $ % * = , ' ^ / _ [ 2 3 5 8 0 a b c c c c c b b a a 0 0 0 9 9 9 9 9 8 8 9 9 8 8 8 6 5 6 5 5 7 3 4 2 1 1 | } | } } | } | 1 1 1 2 4 4 3 3 3 3 4 4 2 1 1 } [ [ : : _ _ : < [ [ | | 1 2 3 7 5 5 6 6 8 8 9 9 9 9 9 9 0 9 0 0 0 0 a b c c d e f g h i j j j j j i i g f e c a 0 5 4 1 [ ( ] ! ' - * ",

+"  . . + + @ @ $ % * = , ) ^ / _ } 2 7 5 8 0 b c d d e e e d d d c c c c c c c b c c c c b b b a b a 0 0 0 9 8 6 5 5 5 3 4 3 4 4 3 4 3 7 5 5 5 6 8 8 8 8 6 8 5 5 7 3 4 2 1 1 | | | | 1 1 2 4 3 5 5 6 9 0 0 0 a a b b c c b c c c c c c d d d e f g g h h i j j j k k j j j j g g e c b 8 5 3 1 [ ( ] ! ' - * ",

+"  . . + + @ # $ & * - , ) ^ / : | 1 7 5 9 0 c d e f f g g g g g f f g f g g f g g f f f f f f f f e e d c c b b a 0 0 9 8 6 8 8 6 8 9 9 0 0 0 a b b b b a a 0 0 8 6 5 5 7 3 4 4 4 4 3 7 5 6 8 9 0 a b c c d e f f f g g f g g g g g g h g h i i i j j j k k l l l l l k j j h f f c 0 9 5 4 | [ ( ] ) ' - * ",

+"  . . + + @ # $ & & - , ) ^ / : [ 2 7 5 0 0 c e f g g h h h i i h i i i i i i i i i i i i i j i i i h g g f f e d c c c b b b b b b c c d d d e f f e e e d d c c a 0 0 9 6 6 6 6 6 8 8 0 a a c c e f g g g h i i i j j j j j j j j j j j j k k k k l l m m m m l l m k j j g g e c 0 8 7 2 } : / ^ ) ' - * ",

+"  . . + + @ # $ % & = , ' ~ / _ [ 1 3 5 9 a c d g g h i j j j j j k k k k l l l l l m m m m l l l k k j j j j i h g g g g f e e f g g g g g h i i i i i h h g g f d d c b a 0 a a 0 b b c c e f g g i j j k k k l l l m m m m m m m m m m m m m m m m m n m m m m m k k j i g f c b 0 6 5 1 | _ ( ^ ) ' - & ",

+"  .   . + + @ # % * = , , ^ { _ [ 1 4 5 9 a c e g h i j j k l l l m m m m m m m m n m m m m m n m m m m l m l k k j j j i j i i j i j j j k j k k k k k j j j i h g f f e d c d d c d e f g g h i j k k l m m m m n m n n m n n n n o n n n o n n n n n n n n m m m k k i h g e c a 0 5 7 2 [ : / ] ) , - * ",

+"  . . . . + @ $ % * * ; ' ~ ] ( < | 2 5 8 0 c d g h j j k l l m m n n n n o o o o o o r o o r r o o o o n m n n m m m l l l k k l l m l m m m m m m m m m m l k j j i i g g g g g g g g h i j k l l m m n n n o o r o r r r r r r r r r o o r r r o o o o m m m m k j j i g f d b 0 8 5 4 | : ( { ! ) , = * ",

+"  . . . + @ # # % & * - , ) ^ / _ } 2 5 8 0 b d f g i j l l m m m n o o o o o r r o r r r r r r r o o o o o o o n n m n n n m m n m m n n n n n n n n m m m m l l k j j j i i i i i j j j k k m m m m n o o o r r r r r r r r r r r r o o r o o o n n n m m m m k j j h g g e c a 9 5 3 1 [ : ( ] ! , ; = & ",

+"  . . . + + @ # $ & * - > ) ^ / _ < 1 3 5 9 b c e g h j l l m m m n n n o o o o o o o n o n n n n n n n n o n n n n o o o o n n o o o o n o n n n n n n n m m m m l k k k j j j j j k k l l m l m m m m m m n m n m n n n n o o o o n n n m n m m m m m m l k j j h h g f e c 0 9 8 7 2 1 < ( { ^ ) , - * & ",

+"    . . + + + @ $ % * = ; ' ! ] ( < | 2 7 8 0 b d f h i j k m m n m m n m m m m m n m m m m m m m m m m m n m n m n n o n o n n o n n n n n n n m n m m m m m m m l l l l l l l l l l l l l l m l m m m m m m m m m m m m m m m m m l m l m l m k k l k k j j j h g g e c b a 9 6 5 4 1 } : ( { ) ) ; = * & ",

+"    .   . . @ # # % * * - , ' ^ ( : [ 1 3 5 8 0 c d g g j j k k l m l l m l l m k l l k k l l l k k l k l m l m m m m n m m n n m m m m m m m m l l m l l k l l l m l l l m l l l l l l l l m l m l k k l k k j k j k l j j j j j j j j j j j j i j i h h g g f f e c b b 0 9 5 7 4 1 } < ( ] ! ! ' - * * % ",

+"    . . . + + @ # $ & * = ; ) ! ^ ( : | 1 3 8 0 b c e g h i j j j j j k k k j i j j i h i h h h g i h i j i j j j j k k k k k k l k k l k j k j j j j j j j j j j k l k l l l l l l l k k k j k j j j i i i i h g g g h g g g h h h h g g g g g g g f e e d c c c b 0 0 9 6 7 4 1 | < < ( { ~ ) ' - = * & $ ",

+"    . . . + + + @ # $ * * - , ) ^ { ( [ | 4 5 6 0 b c f f g g i i i h h g g g g f e e e f d d d e d f e g f f g g g g i h i i i i j h g g g g g g g g g g h g h i i j k j k k l m k k j j j j h g g g g f e e e c d c d c c c d d d d d c c c c c b b c a 0 0 9 0 6 6 5 5 4 2 1 | < _ ( { ~ ) ) ; = * & % # ",

+"      . . . + + @ # $ & * * ; ' ! ] ( : [ 1 4 5 8 0 a c c d e g g f g e e d d c b a a a 0 0 0 0 0 0 0 a 0 b b c c c d c d e e e e e d d c c c c c c c d c c e g f h g h j j j j j j j j h h g f f d c b b a 0 0 0 0 0 0 9 9 9 9 0 0 0 0 0 9 9 0 8 8 8 9 5 5 6 5 5 7 3 2 1 | | < : _ / { ~ ! ' ; - * * % $ # ",

+"      . . . + + + @ # % & * = ; ) ~ ] ( _ } 1 3 5 9 9 a b c c d c c c c c 0 0 0 9 8 8 6 6 5 6 5 5 6 5 6 6 6 8 8 0 0 0 0 0 0 b b 0 0 0 0 0 0 9 9 9 9 9 9 a a b b c e d f g g h h h h g g e e c c b a 0 0 9 6 5 5 6 7 5 5 5 5 5 5 7 7 7 7 7 7 3 3 3 3 3 3 2 2 2 2 1 1 1 [ [ < _ _ / / ^ ~ ! ' ; = * * % $ $ # ",

+"        .   . + + @ # $ % & * ; ' ) ^ ] ( : } 2 3 5 5 9 0 a 0 0 a 0 0 9 8 6 6 5 5 3 3 3 2 2 2 2 2 2 2 2 2 3 3 3 7 5 5 5 5 6 5 5 6 5 5 5 5 5 5 5 5 5 7 5 5 6 8 9 0 a c c e f g f f g d c c b a 0 9 8 5 5 7 3 4 2 2 2 1 1 1 1 1 1 1 1 1 1 1 | | | 1 1 | 1 } } [ [ [ : : _ ( / / { ^ ! ! ) , ; - * * % $ # @ @ ",

+"        . . . + + @ # $ $ & * * ; ' ) ] { ( : } 1 4 5 5 6 9 8 8 9 6 6 5 7 3 3 2 2 | 1 } [ [ [ } } } [ [ } [ } 1 1 | 1 1 1 1 2 2 1 1 1 1 1 1 1 1 1 1 1 2 2 4 7 5 5 6 9 a a b c c c c b a a 0 8 6 5 7 4 1 | | } [ [ [ < [ : : : : : : : : : : _ _ _ _ _ _ : _ _ ( ( { { { ] ~ ! ! ! ' , ; - * = & % $ # @ @ @ ",

+"          . . . + + + @ # % & * = ; ) ! ] { ( : } 1 2 4 7 7 5 5 7 7 4 4 1 1 | [ [ : _ _ ( ( / ( / / ( ( ( _ ( _ _ _ _ : : : : : : : : : : _ _ _ : : < [ [ | | 1 4 3 5 6 8 9 0 0 0 0 9 8 5 5 3 2 1 | | < < _ _ ( / / { / { { { { / / / / / / / { { { { { ] { ^ ~ ~ ! ! ! ! ) ' , ; - = * = * & % $ $ @ @ @ . ",

+"          . . . . . + @ # $ % * * - ; ' ! ] / ( < [ | 1 1 2 1 2 1 2 1 | [ [ : _ / / { { ] ^ ^ ~ ~ ~ ~ ~ ^ ^ ^ ] { / { / / { { { { { / / / / / / { / / / _ _ < [ } 1 4 3 7 5 5 5 5 5 5 7 3 4 1 } [ < _ ( / { ] { ~ ~ ! ~ ! ! ! ! ! ! ! ! ! ! ! ! ! ! ! ! ! ) ) ) ' ) ' , > ; ; = = * = * & % $ $ # # @ + . + ",

+"            . . . . . @ @ # $ % & * = , ) ! ] { ( _ < < [ | | | [ < [ : ( / { { ^ ! ! ! ) ) ) ' ' ' ' ' ) ' ) ) ) ! ! ! ! ! ! ! ! ! ! ! ! ! ! ! ! ! ! ~ { { / _ _ < | | 1 1 4 3 3 4 1 1 | [ < _ ( { / ~ ! ! ! ) ) ' , , > > > > > > > > > > > > > > > > > ; ; ; ; - - - = = = * * & % % $ $ # @ @ @ + . . . ",

+"              .   . + + + # # $ % & * - , ) ! ~ { / ( ( _ _ < : _ ( _ / { { ~ ! ! ) , > ; - - - = - = - - - ; ; ; ; > > ; > > > > > > ; ; ; ; > > , ' ) ! ! ^ { / ( _ < < [ | | | | [ < < _ ( { { ~ ! ) ' , ; ; ; - - - = = = = = = = = = = = = = = = = = * * * = = * * * & & % % $ $ # # @ @ + @ + . . .   ",

+"                .   . + + + @ # $ & * * - > ' ! ~ ] { { / / / / { { ] ^ ! ! ' ' ; - - * * = * * * * * * * * * = = = * * = = = = = = = * * * = = = - - ; > ' ) ) ~ ] { / ( _ _ _ _ _ _ ( { { ] ~ ! ' , ; - = = * * & * & & & & & & & & & & & & & & & & & & & & % % % % % $ $ $ $ # # # @ @ + @ + . + . .   . ",

+"                . . . . . + @ @ # $ & * * - ; ' ) ! ! ~ ^ ] ] ^ ~ ! ) ) ' , ; - = * * * % % % % % % % % % % % % % % % & & & & & & & & & & & & & & & * * = - ; , ' ! ! ~ ] { { { { { { ] ~ ! ! ) , ; - * * & & & % % % $ $ $ $ $ $ $ $ $ $ $ $ $ $ $ $ $ $ $ $ $ # # # # # # @ @ @ @ + @ + + . + . .   . .   ",

+"                  . . . . . + @ @ # $ & * * = - ; ' ) ) ! ! ! ! ) ' ' > - = = = * & $ $ $ # # # # # # # # # # # # # # # $ $ $ $ $ $ $ $ $ $ $ $ $ % % & * = = = - > , ) ! ) ! ! ! ! ) ) ) , > - = * * & % % # # # # # @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ + + + + + + + . . . . .     . .     ",

+"                    .   . . . + @ @ # $ % & * * = - ; ; > > > > ; ; - = = = * & % $ # # @ @ @ @ @ + + + + + @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ @ # # $ $ % & & * * - ; ; > , ' ' ' ' , > ; ; = * * & % % $ # # @ @ @ + + + + + + + + + + + + + + + + + + + + + + + + + + + . . . . + . . .       . .         ",

+"                      .   . + . + @ @ $ $ % & & * * = = - - - - = = * * & & % # # # @ @ + + + + . . . . . . . + + + + + + + + + + + + + + + + + + @ @ # # $ % % & * * * = - - ; ; - - = * * * & % % $ # @ @ + + + + . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .         . .             ",

+"                      . .   . + . + + @ # # $ % % & * * * * * * & * & % % $ $ # @ @ @ + + + . . . . . . . . . . . . . . . . . . . . . . . . . + + + + @ @ # # $ % % & * * = * * * * = * * & % % $ # # @ @ + + + + . . . . . . . . . . . . . . . . . . . . . . . . . . . .             . .                   "};

diff --git a/vcl/qa/cppunit/graphicfilter/filters-test.cxx b/vcl/qa/cppunit/graphicfilter/filters-test.cxx
new file mode 100644
index 000000000..26f743cfa
--- /dev/null
+++ b/vcl/qa/cppunit/graphicfilter/filters-test.cxx
@@ -0,0 +1,181 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <unotest/filters-test.hxx>
+#include <test/bootstrapfixture.hxx>
+
+#include <comphelper/fileformat.h>
+
+#include <vcl/graphicfilter.hxx>
+#include <tools/stream.hxx>
+#include <com/sun/star/beans/PropertyValue.hpp>
+
+using namespace ::com::sun::star;
+
+/* Implementation of Filters test */
+
+class VclFiltersTest :
+    public test::FiltersTest,
+    public test::BootstrapFixture
+{
+    std::unique_ptr<GraphicFilter> mpGraphicFilter;
+public:
+    VclFiltersTest() :
+        BootstrapFixture(true, false),
+        mpGraphicFilter(new GraphicFilter(false))
+    {}
+
+    virtual bool load(const OUString &,
+        const OUString &rURL, const OUString &,
+        SfxFilterFlags, SotClipboardFormatId, unsigned int) override;
+
+    void checkExportImport(const OUString& aFilterShortName);
+
+    /**
+     * Ensure CVEs remain unbroken
+     */
+    void testCVEs();
+
+    void testScaling();
+    void testExportImport();
+
+    CPPUNIT_TEST_SUITE(VclFiltersTest);
+    CPPUNIT_TEST(testCVEs);
+    CPPUNIT_TEST(testScaling);
+    CPPUNIT_TEST(testExportImport);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+bool VclFiltersTest::load(const OUString &,
+    const OUString &rURL, const OUString &,
+    SfxFilterFlags, SotClipboardFormatId, unsigned int)
+{
+    SvFileStream aFileStream(rURL, StreamMode::READ);
+    Graphic aGraphic;
+    bool bRetval(ERRCODE_NONE == mpGraphicFilter->ImportGraphic(aGraphic, rURL, aFileStream));
+
+    if (!bRetval)
+    {
+        // if error occurred, we are done
+        return bRetval;
+    }
+
+    // if not and we have an embedded Vector Graphic Data, trigger it's interpretation
+    // to check for error. Graphic with VectorGraphicData (Svg/Emf/Wmf) load without error
+    // as long as one of the three types gets detected. Thus, cycles like load/save in
+    // other format will work (what may be wanted). For the test framework it was indirectly
+    // intended to trigger an error when load in the sense of deep data interpretation fails,
+    // so we need to trigger this here
+    if (aGraphic.getVectorGraphicData())
+    {
+        if (aGraphic.getVectorGraphicData()->getRange().isEmpty())
+        {
+            // invalid file or file with no content
+            return false;
+        }
+    }
+
+    return true;
+}
+
+void VclFiltersTest::testScaling()
+{
+    for (BmpScaleFlag i = BmpScaleFlag::Default; i <= BmpScaleFlag::BiLinear; i = static_cast<BmpScaleFlag>(static_cast<int>(i) + 1))
+    {
+        Bitmap aBitmap( Size( 413, 409 ), 24 );
+        BitmapEx aBitmapEx( aBitmap );
+
+        fprintf( stderr, "scale with type %d\n", int( i ) );
+        CPPUNIT_ASSERT( aBitmapEx.Scale( 0.1937046, 0.193154, i ) );
+        Size aAfter( aBitmapEx.GetSizePixel() );
+        fprintf( stderr, "size %ld, %ld\n", aAfter.Width(), aAfter.Height() );
+        CPPUNIT_ASSERT( labs (aAfter.Height() - aAfter.Width()) <= 1 );
+    }
+}
+
+void VclFiltersTest::checkExportImport(const OUString& aFilterShortName)
+{
+    Bitmap aBitmap( Size( 100, 100 ), 24 );
+    aBitmap.Erase(COL_WHITE);
+
+    SvMemoryStream aStream;
+    aStream.SetVersion( SOFFICE_FILEFORMAT_CURRENT );
+
+    css::uno::Sequence< css::beans::PropertyValue > aFilterData( 3 );
+    aFilterData[ 0 ].Name = "Interlaced";
+    aFilterData[ 0 ].Value <<= sal_Int32(0);
+    aFilterData[ 1 ].Name = "Compression";
+    aFilterData[ 1 ].Value <<= sal_Int32(1);
+    aFilterData[ 2 ].Name = "Quality";
+    aFilterData[ 2 ].Value <<= sal_Int32(90);
+
+    sal_uInt16 aFilterType = mpGraphicFilter->GetExportFormatNumberForShortName(aFilterShortName);
+    mpGraphicFilter->ExportGraphic( aBitmap, OUString(), aStream, aFilterType, &aFilterData );
+
+    CPPUNIT_ASSERT(aStream.Tell() > 0);
+
+    aStream.Seek( STREAM_SEEK_TO_BEGIN );
+
+    Graphic aLoadedGraphic;
+    mpGraphicFilter->ImportGraphic( aLoadedGraphic, OUString(), aStream );
+
+    BitmapEx aLoadedBitmapEx = aLoadedGraphic.GetBitmapEx();
+    Size aSize = aLoadedBitmapEx.GetSizePixel();
+
+    CPPUNIT_ASSERT_EQUAL(100L, aSize.Width());
+    CPPUNIT_ASSERT_EQUAL(100L, aSize.Height());
+}
+
+void VclFiltersTest::testExportImport()
+{
+    fprintf(stderr, "Check ExportImport JPG\n");
+    checkExportImport("jpg");
+    fprintf(stderr, "Check ExportImport PNG\n");
+    checkExportImport("png");
+    fprintf(stderr, "Check ExportImport BMP\n");
+    checkExportImport("bmp");
+}
+
+void VclFiltersTest::testCVEs()
+{
+#ifndef DISABLE_CVE_TESTS
+    testDir(OUString(),
+        m_directories.getURLFromSrc("/vcl/qa/cppunit/graphicfilter/data/wmf/"));
+
+    testDir(OUString(),
+        m_directories.getURLFromSrc("/vcl/qa/cppunit/graphicfilter/data/emf/"));
+
+    testDir(OUString(),
+        m_directories.getURLFromSrc("/vcl/qa/cppunit/graphicfilter/data/png/"));
+
+    testDir(OUString(),
+        m_directories.getURLFromSrc("/vcl/qa/cppunit/graphicfilter/data/jpg/"));
+
+    testDir(OUString(),
+        m_directories.getURLFromSrc("/vcl/qa/cppunit/graphicfilter/data/gif/"));
+
+    testDir(OUString(),
+        m_directories.getURLFromSrc("/vcl/qa/cppunit/graphicfilter/data/bmp/"));
+
+    testDir(OUString(),
+        m_directories.getURLFromSrc("/vcl/qa/cppunit/graphicfilter/data/xbm/"));
+
+    testDir(OUString(),
+        m_directories.getURLFromSrc("/vcl/qa/cppunit/graphicfilter/data/xpm/"));
+
+    testDir(OUString(),
+        m_directories.getURLFromSrc("/vcl/qa/cppunit/graphicfilter/data/svm/"));
+#endif
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(VclFiltersTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/jpeg/JpegReaderTest.cxx b/vcl/qa/cppunit/jpeg/JpegReaderTest.cxx
new file mode 100644
index 000000000..a5c0d9e95
--- /dev/null
+++ b/vcl/qa/cppunit/jpeg/JpegReaderTest.cxx
@@ -0,0 +1,167 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ *
+ */
+
+#include <unotest/bootstrapfixturebase.hxx>
+#include <vcl/graphicfilter.hxx>
+#include <bitmapwriteaccess.hxx>
+#include <tools/stream.hxx>
+
+static OUString const gaDataUrl("/vcl/qa/cppunit/jpeg/data/");
+
+class JpegReaderTest : public test::BootstrapFixtureBase
+{
+    OUString getFullUrl(const OUString& sFileName)
+    {
+        return m_directories.getURLFromSrc(gaDataUrl) + sFileName;
+    }
+
+    Graphic loadJPG(const OUString& aURL);
+
+public:
+    void testReadRGB();
+    void testReadGray();
+    void testReadCMYK();
+
+    CPPUNIT_TEST_SUITE(JpegReaderTest);
+    CPPUNIT_TEST(testReadRGB);
+    CPPUNIT_TEST(testReadGray);
+    CPPUNIT_TEST(testReadCMYK);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+static int deltaColor(BitmapColor aColor1, BitmapColor aColor2)
+{
+    int deltaR = std::abs(aColor1.GetRed()   - aColor2.GetRed());
+    int deltaG = std::abs(aColor1.GetGreen() - aColor2.GetGreen());
+    int deltaB = std::abs(aColor1.GetBlue()  - aColor2.GetBlue());
+
+    return std::max(std::max(deltaR, deltaG), deltaB);
+}
+
+static bool checkRect(Bitmap& rBitmap, int aLayerNumber, long nAreaHeight, long nAreaWidth, Color aExpectedColor, int nMaxDelta)
+{
+    BitmapScopedWriteAccess pAccess(rBitmap);
+
+    long nWidth  = std::min(nAreaWidth,  pAccess->Width());
+    long nHeight = std::min(nAreaHeight, pAccess->Height());
+
+    long firstX = 0 + aLayerNumber;
+    long firstY = 0 + aLayerNumber;
+
+    long lastX = nWidth  - 1 - aLayerNumber;
+    long lastY = nHeight - 1 - aLayerNumber;
+
+    int delta;
+
+    for (long y = firstY; y <= lastY; y++)
+    {
+        Color aColorFirst = pAccess->GetPixel(y, firstX);
+        delta = deltaColor(aColorFirst, aExpectedColor);
+        if (delta > nMaxDelta)
+            return false;
+
+        Color aColorLast = pAccess->GetPixel(y, lastX);
+        delta = deltaColor(aColorLast, aExpectedColor);
+        if (delta > nMaxDelta)
+            return false;
+    }
+    for (long x = firstX; x <= lastX; x++)
+    {
+        Color aColorFirst = pAccess->GetPixel(firstY, x);
+        delta = deltaColor(aColorFirst, aExpectedColor);
+        if (delta > nMaxDelta)
+            return false;
+
+        Color aColorLast  = pAccess->GetPixel(lastY, x);
+        delta = deltaColor(aColorLast, aExpectedColor);
+        if (delta > nMaxDelta)
+            return false;
+    }
+    return true;
+}
+
+static int getNumberOfImageComponents(const Graphic& rGraphic)
+{
+    GfxLink aLink = rGraphic.GetGfxLink();
+    SvMemoryStream aMemoryStream(const_cast<sal_uInt8*>(aLink.GetData()), aLink.GetDataSize(),
+                                 StreamMode::READ | StreamMode::WRITE);
+    GraphicDescriptor aDescriptor(aMemoryStream, nullptr);
+    CPPUNIT_ASSERT(aDescriptor.Detect(true));
+    return aDescriptor.GetNumberOfImageComponents();
+}
+
+Graphic JpegReaderTest::loadJPG(const OUString& aURL)
+{
+    GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+    Graphic aGraphic;
+    SvFileStream aFileStream(aURL, StreamMode::READ);
+    ErrCode bResult = rFilter.ImportGraphic(aGraphic, aURL, aFileStream);
+    CPPUNIT_ASSERT_EQUAL(ERRCODE_NONE, bResult);
+    return aGraphic;
+}
+
+void JpegReaderTest::testReadRGB()
+{
+    Graphic aGraphic = loadJPG(getFullUrl("JPEGTestRGB.jpeg"));
+    Bitmap aBitmap = aGraphic.GetBitmapEx().GetBitmap();
+    Size aSize = aBitmap.GetSizePixel();
+    CPPUNIT_ASSERT_EQUAL(12L, aSize.Width());
+    CPPUNIT_ASSERT_EQUAL(12L, aSize.Height());
+
+    int nMaxDelta = 1; // still acceptable color error
+    CPPUNIT_ASSERT(checkRect(aBitmap, 0, 8, 8, Color(0xff, 0xff, 0xff), nMaxDelta));
+    CPPUNIT_ASSERT(checkRect(aBitmap, 1, 8, 8, Color(0xff, 0x00, 0x00), nMaxDelta));
+    CPPUNIT_ASSERT(checkRect(aBitmap, 2, 8, 8, Color(0x00, 0xff, 0x00), nMaxDelta));
+    CPPUNIT_ASSERT(checkRect(aBitmap, 3, 8, 8, Color(0x00, 0x00, 0xff), nMaxDelta));
+
+    CPPUNIT_ASSERT_EQUAL(3, getNumberOfImageComponents(aGraphic));
+}
+
+void JpegReaderTest::testReadGray()
+{
+    Graphic aGraphic = loadJPG(getFullUrl("JPEGTestGray.jpeg"));
+    Bitmap aBitmap = aGraphic.GetBitmapEx().GetBitmap();
+    Size aSize = aBitmap.GetSizePixel();
+    CPPUNIT_ASSERT_EQUAL(12L, aSize.Width());
+    CPPUNIT_ASSERT_EQUAL(12L, aSize.Height());
+
+    aBitmap.Convert(BmpConversion::N24Bit); // convert to 24bit so we don't need to deal with palette
+
+    int nMaxDelta = 1;
+    CPPUNIT_ASSERT(checkRect(aBitmap, 0, 8, 8, Color(0xff, 0xff, 0xff), nMaxDelta));
+    CPPUNIT_ASSERT(checkRect(aBitmap, 1, 8, 8, Color(0x36, 0x36, 0x36), nMaxDelta));
+    CPPUNIT_ASSERT(checkRect(aBitmap, 2, 8, 8, Color(0xb6, 0xb6, 0xb6), nMaxDelta));
+    CPPUNIT_ASSERT(checkRect(aBitmap, 3, 8, 8, Color(0x12, 0x12, 0x12), nMaxDelta));
+
+    CPPUNIT_ASSERT_EQUAL(1, getNumberOfImageComponents(aGraphic));
+}
+
+void JpegReaderTest::testReadCMYK()
+{
+    Graphic aGraphic = loadJPG(getFullUrl("JPEGTestCMYK.jpeg"));
+    Bitmap aBitmap = aGraphic.GetBitmapEx().GetBitmap();
+    Size aSize = aBitmap.GetSizePixel();
+    CPPUNIT_ASSERT_EQUAL(12L, aSize.Width());
+    CPPUNIT_ASSERT_EQUAL(12L, aSize.Height());
+
+    int maxDelta = 1;
+    CPPUNIT_ASSERT(checkRect(aBitmap, 0, 8, 8, Color(0xff, 0xff, 0xff), maxDelta));
+    CPPUNIT_ASSERT(checkRect(aBitmap, 1, 8, 8, Color(0xff, 0x00, 0x00), maxDelta));
+    CPPUNIT_ASSERT(checkRect(aBitmap, 2, 8, 8, Color(0x00, 0xff, 0x00), maxDelta));
+    CPPUNIT_ASSERT(checkRect(aBitmap, 3, 8, 8, Color(0x00, 0x00, 0xff), maxDelta));
+
+    CPPUNIT_ASSERT_EQUAL(4, getNumberOfImageComponents(aGraphic));
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(JpegReaderTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/jpeg/JpegWriterTest.cxx b/vcl/qa/cppunit/jpeg/JpegWriterTest.cxx
new file mode 100644
index 000000000..b4d9d2460
--- /dev/null
+++ b/vcl/qa/cppunit/jpeg/JpegWriterTest.cxx
@@ -0,0 +1,105 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ *
+ */
+
+#include <unotest/bootstrapfixturebase.hxx>
+#include <vcl/graphicfilter.hxx>
+#include <vcl/bitmapaccess.hxx>
+#include <tools/stream.hxx>
+
+static OUString const gaDataUrl("/vcl/qa/cppunit/jpeg/data/");
+
+class JpegWriterTest : public test::BootstrapFixtureBase
+{
+    OUString getFullUrl(const OUString& sFileName)
+    {
+        return m_directories.getURLFromSrc(gaDataUrl) + sFileName;
+    }
+
+    BitmapEx load(const OUString& aURL);
+    BitmapEx roundtripJPG(const BitmapEx& bitmap);
+    BitmapEx roundtripJPG(const OUString& aURL);
+
+public:
+    void testWrite8BitGrayscale();
+    void testWrite8BitNonGrayscale();
+
+    CPPUNIT_TEST_SUITE(JpegWriterTest);
+    CPPUNIT_TEST(testWrite8BitGrayscale);
+    CPPUNIT_TEST(testWrite8BitNonGrayscale);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+BitmapEx JpegWriterTest::load(const OUString& aURL)
+{
+    GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+    Graphic aGraphic;
+    SvFileStream aFileStream(aURL, StreamMode::READ);
+    ErrCode bResult = rFilter.ImportGraphic(aGraphic, aURL, aFileStream);
+    CPPUNIT_ASSERT_EQUAL(ERRCODE_NONE, bResult);
+    return aGraphic.GetBitmapEx();
+}
+
+BitmapEx JpegWriterTest::roundtripJPG(const OUString& aURL) { return roundtripJPG(load(aURL)); }
+
+BitmapEx JpegWriterTest::roundtripJPG(const BitmapEx& bitmap)
+{
+    SvMemoryStream stream;
+    GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+    sal_uInt16 exportFormatJPG = rFilter.GetExportFormatNumberForShortName(JPG_SHORTNAME);
+    Graphic aExportGraphic(bitmap);
+    ErrCode bResult = rFilter.ExportGraphic(aExportGraphic, "memory", stream, exportFormatJPG);
+    CPPUNIT_ASSERT_EQUAL(ERRCODE_NONE, bResult);
+    stream.Seek(0);
+    Graphic aImportGraphic;
+    sal_uInt16 importFormatJPG = rFilter.GetImportFormatNumberForShortName(JPG_SHORTNAME);
+    bResult = rFilter.ImportGraphic(aImportGraphic, "memory", stream, importFormatJPG);
+    CPPUNIT_ASSERT_EQUAL(ERRCODE_NONE, bResult);
+    return aImportGraphic.GetBitmapEx();
+}
+
+void JpegWriterTest::testWrite8BitGrayscale()
+{
+    Bitmap bitmap = roundtripJPG(getFullUrl("8BitGrayscale.jpg")).GetBitmap();
+    Bitmap::ScopedReadAccess access(bitmap);
+    const ScanlineFormat format = access->GetScanlineFormat();
+    // Check that it's still 8bit grayscale.
+    CPPUNIT_ASSERT_EQUAL(ScanlineFormat::N8BitPal, format);
+    CPPUNIT_ASSERT(bitmap.HasGreyPalette8Bit());
+    // Check that the content is valid.
+    CPPUNIT_ASSERT_EQUAL(BitmapColor(COL_WHITE), access->GetColor(0, 0));
+    CPPUNIT_ASSERT_EQUAL(BitmapColor(COL_WHITE), access->GetColor(0, access->Width() - 1));
+    CPPUNIT_ASSERT_EQUAL(BitmapColor(COL_WHITE), access->GetColor(access->Height() - 1, 0));
+    CPPUNIT_ASSERT_EQUAL(BitmapColor(COL_BLACK),
+                         access->GetColor(access->Height() - 1, access->Width() - 1));
+}
+
+void JpegWriterTest::testWrite8BitNonGrayscale()
+{
+    Bitmap bitmap = roundtripJPG(getFullUrl("8BitNonGrayscale.gif")).GetBitmap();
+    Bitmap::ScopedReadAccess access(bitmap);
+    const ScanlineFormat format = access->GetScanlineFormat();
+    // Check that it's still 8bit grayscale.
+    CPPUNIT_ASSERT_EQUAL(ScanlineFormat::N8BitPal, format);
+    // The original image has grayscale palette, just with entries in a different order.
+    // Do not check for grayscale 8bit, the roundtrip apparently fixes that. What's important
+    // is the content.
+    CPPUNIT_ASSERT(bitmap.HasGreyPaletteAny());
+    // CPPUNIT_ASSERT(bitmap.HasGreyPalette8Bit());
+    // Check that the content is valid.
+    CPPUNIT_ASSERT_EQUAL(BitmapColor(COL_WHITE), access->GetColor(0, 0));
+    CPPUNIT_ASSERT_EQUAL(BitmapColor(COL_WHITE), access->GetColor(0, access->Width() - 1));
+    CPPUNIT_ASSERT_EQUAL(BitmapColor(COL_WHITE), access->GetColor(access->Height() - 1, 0));
+    CPPUNIT_ASSERT_EQUAL(BitmapColor(COL_BLACK),
+                         access->GetColor(access->Height() - 1, access->Width() - 1));
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(JpegWriterTest);
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/jpeg/data/8BitGrayscale.jpg b/vcl/qa/cppunit/jpeg/data/8BitGrayscale.jpg
new file mode 100644
index 000000000..91541e4a8
--- /dev/null
+++ b/vcl/qa/cppunit/jpeg/data/8BitGrayscale.jpg
diff --git a/vcl/qa/cppunit/jpeg/data/8BitNonGrayscale.gif b/vcl/qa/cppunit/jpeg/data/8BitNonGrayscale.gif
new file mode 100644
index 000000000..295310949
--- /dev/null
+++ b/vcl/qa/cppunit/jpeg/data/8BitNonGrayscale.gif
diff --git a/vcl/qa/cppunit/jpeg/data/JPEGTestCMYK.jpeg b/vcl/qa/cppunit/jpeg/data/JPEGTestCMYK.jpeg
new file mode 100644
index 000000000..81cca025e
--- /dev/null
+++ b/vcl/qa/cppunit/jpeg/data/JPEGTestCMYK.jpeg
diff --git a/vcl/qa/cppunit/jpeg/data/JPEGTestGray.jpeg b/vcl/qa/cppunit/jpeg/data/JPEGTestGray.jpeg
new file mode 100644
index 000000000..014825f42
--- /dev/null
+++ b/vcl/qa/cppunit/jpeg/data/JPEGTestGray.jpeg
diff --git a/vcl/qa/cppunit/jpeg/data/JPEGTestRGB.jpeg b/vcl/qa/cppunit/jpeg/data/JPEGTestRGB.jpeg
new file mode 100644
index 000000000..3cfe1dda2
--- /dev/null
+++ b/vcl/qa/cppunit/jpeg/data/JPEGTestRGB.jpeg
diff --git a/vcl/qa/cppunit/lifecycle.cxx b/vcl/qa/cppunit/lifecycle.cxx
new file mode 100644
index 000000000..a4a3f5d9e
--- /dev/null
+++ b/vcl/qa/cppunit/lifecycle.cxx
@@ -0,0 +1,357 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <test/bootstrapfixture.hxx>
+
+#include <vcl/wrkwin.hxx>
+#include <vcl/edit.hxx>
+#include <vcl/toolkit/button.hxx>
+#include <vcl/toolkit/combobox.hxx>
+#include <vcl/toolkit/dialog.hxx>
+#include <vcl/toolkit/field.hxx>
+#include <vcl/virdev.hxx>
+#include <vcl/tabctrl.hxx>
+#include <vcl/layout.hxx>
+#include <vcl/scheduler.hxx>
+#include <com/sun/star/awt/XWindow.hpp>
+#include <com/sun/star/awt/XWindowPeer.hpp>
+#include <com/sun/star/lang/XComponent.hpp>
+
+class LifecycleTest : public test::BootstrapFixture
+{
+    void testWidgets(vcl::Window *pParent);
+
+public:
+    LifecycleTest() : BootstrapFixture(true, false) {}
+
+    void testCast();
+    void testVirtualDevice();
+    void testMultiDispose();
+    void testIsolatedWidgets();
+    void testParentedWidgets();
+    void testChildDispose();
+    void testPostDispose();
+    void testFocus();
+    void testLeakage();
+    void testToolkit();
+
+    CPPUNIT_TEST_SUITE(LifecycleTest);
+    CPPUNIT_TEST(testCast);
+    CPPUNIT_TEST(testVirtualDevice);
+    CPPUNIT_TEST(testMultiDispose);
+    CPPUNIT_TEST(testIsolatedWidgets);
+    CPPUNIT_TEST(testParentedWidgets);
+    CPPUNIT_TEST(testChildDispose);
+    CPPUNIT_TEST(testPostDispose);
+    CPPUNIT_TEST(testFocus);
+    CPPUNIT_TEST(testLeakage);
+    CPPUNIT_TEST(testToolkit);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+// A compile time sanity check
+void LifecycleTest::testCast()
+{
+    ScopedVclPtrInstance< PushButton > xButton( nullptr, 0 );
+    ScopedVclPtr<vcl::Window> xWindow(xButton);
+
+    ScopedVclPtrInstance< MetricField > xField( nullptr, 0 );
+    ScopedVclPtr<SpinField> xSpin(xField);
+    ScopedVclPtr<Edit> xEdit(xField);
+
+// the following line should NOT compile
+//    VclPtr<PushButton> xButton2(xWindow);
+}
+
+void LifecycleTest::testVirtualDevice()
+{
+    VclPtr<VirtualDevice> pVDev = VclPtr< VirtualDevice >::Create();
+    ScopedVclPtrInstance< VirtualDevice > pVDev2;
+    VclPtrInstance<VirtualDevice> pVDev3;
+    VclPtrInstance<VirtualDevice> pVDev4(DeviceFormat::BITMASK);
+    CPPUNIT_ASSERT(!!pVDev && !!pVDev2 && !!pVDev3 && !!pVDev4);
+    pVDev.disposeAndClear();
+    pVDev4.disposeAndClear();
+}
+
+void LifecycleTest::testMultiDispose()
+{
+    VclPtrInstance<WorkWindow> xWin(nullptr, WB_APP|WB_STDWORK);
+    CPPUNIT_ASSERT(xWin.get() != nullptr);
+    xWin->disposeOnce();
+    xWin->disposeOnce();
+    xWin->disposeOnce();
+    CPPUNIT_ASSERT(!xWin->GetWindow(GetWindowType::Parent));
+    CPPUNIT_ASSERT(!xWin->GetChild(0));
+    CPPUNIT_ASSERT_EQUAL(static_cast<sal_uInt16>(0), xWin->GetChildCount());
+}
+
+void LifecycleTest::testWidgets(vcl::Window *pParent)
+{
+    {
+        ScopedVclPtrInstance< PushButton > aPtr( pParent );
+        (void)aPtr; // silence unused variable warning
+    }
+    {
+        ScopedVclPtrInstance< OKButton > aPtr( pParent );
+        (void)aPtr; // silence unused variable warning
+    }
+    {
+        ScopedVclPtrInstance< CancelButton > aPtr( pParent );
+        (void)aPtr; // silence unused variable warning
+    }
+    {
+        ScopedVclPtrInstance< HelpButton > aPtr( pParent );
+        (void)aPtr; // silence unused variable warning
+    }
+
+    // Some widgets really insist on adoption.
+    if (pParent)
+    {
+        {
+            ScopedVclPtrInstance< CheckBox > aPtr( pParent );
+            (void)aPtr; // silence unused variable warning
+        }
+        {
+            ScopedVclPtrInstance< Edit > aPtr( pParent );
+            (void)aPtr; // silence unused variable warning
+        }
+        {
+            ScopedVclPtrInstance< ComboBox > aPtr( pParent );
+            (void)aPtr; // silence unused variable warning
+        }
+        {
+            ScopedVclPtrInstance< RadioButton > aPtr( pParent );
+            (void)aPtr; // silence unused variable warning
+        }
+    }
+}
+
+void LifecycleTest::testIsolatedWidgets()
+{
+    testWidgets(nullptr);
+}
+
+void LifecycleTest::testParentedWidgets()
+{
+    ScopedVclPtrInstance<WorkWindow> xWin(nullptr, WB_APP|WB_STDWORK);
+    CPPUNIT_ASSERT(xWin.get() != nullptr);
+    xWin->Show();
+    testWidgets(xWin);
+}
+
+namespace {
+
+class DisposableChild : public vcl::Window
+{
+public:
+    explicit DisposableChild(vcl::Window *pParent) : vcl::Window(pParent) {}
+    virtual ~DisposableChild() override
+    {
+        disposeOnce();
+    }
+};
+
+}
+
+void LifecycleTest::testChildDispose()
+{
+    VclPtrInstance<WorkWindow> xWin(nullptr, WB_APP|WB_STDWORK);
+    CPPUNIT_ASSERT(xWin.get() != nullptr);
+    VclPtrInstance< DisposableChild > xChild( xWin.get() );
+    xWin->Show();
+    xChild->disposeOnce();
+    xWin->disposeOnce();
+}
+
+void LifecycleTest::testPostDispose()
+{
+    VclPtrInstance<WorkWindow> xWin(nullptr, WB_APP|WB_STDWORK);
+    xWin->disposeOnce();
+
+    // check selected methods continue to work post-dispose
+    CPPUNIT_ASSERT(!xWin->GetParent());
+    xWin->Show();
+    CPPUNIT_ASSERT(!xWin->IsReallyShown());
+    CPPUNIT_ASSERT(!xWin->IsEnabled());
+    CPPUNIT_ASSERT(!xWin->IsInputEnabled());
+    CPPUNIT_ASSERT(!xWin->GetChild(0));
+    CPPUNIT_ASSERT(!xWin->GetWindow(GetWindowType::Parent));
+}
+
+namespace {
+
+class FocusCrashPostDispose : public TabControl
+{
+public:
+    explicit FocusCrashPostDispose(vcl::Window *pParent) :
+        TabControl(pParent, 0)
+    {
+    }
+    virtual bool PreNotify( NotifyEvent& ) override
+    {
+        return false;
+    }
+    virtual bool EventNotify( NotifyEvent& ) override
+    {
+        return false;
+    }
+    virtual void GetFocus() override
+    {
+        CPPUNIT_FAIL("get focus");
+    }
+    virtual void LoseFocus() override
+    {
+        CPPUNIT_FAIL("this should never be called");
+    }
+};
+
+}
+
+void LifecycleTest::testFocus()
+{
+    ScopedVclPtrInstance<WorkWindow> xWin(nullptr, WB_APP|WB_STDWORK);
+    ScopedVclPtrInstance< FocusCrashPostDispose > xChild(xWin);
+    xWin->Show();
+    xChild->GrabFocus();
+    // process asynchronous ToTop
+    Scheduler::ProcessTaskScheduling();
+    // FIXME: really awful to test focus issues without showing windows.
+    // CPPUNIT_ASSERT(xChild->HasFocus());
+}
+
+namespace {
+
+template <class vcl_type>
+class LeakTestClass : public vcl_type
+{
+    bool &mrDeleted;
+public:
+    template<typename... Arg>
+        LeakTestClass(bool &bDeleted, Arg &&... arg) :
+            vcl_type(std::forward<Arg>(arg)...),
+            mrDeleted(bDeleted)
+    {
+        mrDeleted = false;
+    }
+    ~LeakTestClass()
+    {
+        mrDeleted = true;
+    }
+};
+
+class LeakTestObject
+{
+    bool                mbDeleted;
+    VclPtr<vcl::Window> mxRef;
+    void               *mpRef;
+    LeakTestObject()
+        : mbDeleted(false)
+        , mpRef(nullptr)
+    {
+    }
+public:
+    template<typename vcl_type, typename... Arg> static LeakTestObject *
+        Create(Arg &&... arg)
+    {
+        LeakTestObject *pNew = new LeakTestObject();
+        pNew->mxRef = VclPtr< LeakTestClass< vcl_type > >::Create( pNew->mbDeleted,
+                                                                   std::forward<Arg>(arg)...);
+        pNew->mpRef = static_cast<void *>(static_cast<vcl::Window *>(pNew->mxRef));
+        return pNew;
+    }
+    const VclPtr<vcl::Window>& getRef() const { return mxRef; }
+    void disposeAndClear()
+    {
+        mxRef.disposeAndClear();
+    }
+    void assertDeleted()
+    {
+        if (!mbDeleted)
+        {
+            OUStringBuffer aMsg = "Type '";
+            vcl::Window *pWin = static_cast<vcl::Window *>(mpRef);
+            aMsg.appendAscii(typeid(*pWin).name());
+            aMsg.append("' not freed after dispose");
+            CPPUNIT_FAIL(OUStringToOString(aMsg.makeStringAndClear(),
+                                           RTL_TEXTENCODING_UTF8).getStr());
+        }
+    }
+};
+
+}
+
+void LifecycleTest::testLeakage()
+{
+    std::vector<LeakTestObject *> aObjects;
+
+    // Create objects
+    aObjects.push_back(LeakTestObject::Create<WorkWindow>(nullptr, WB_APP|WB_STDWORK));
+    VclPtr<vcl::Window> xParent = aObjects.back()->getRef();
+
+    aObjects.push_back(LeakTestObject::Create<PushButton>(xParent));
+    aObjects.push_back(LeakTestObject::Create<OKButton>(xParent));
+    aObjects.push_back(LeakTestObject::Create<CancelButton>(xParent));
+    aObjects.push_back(LeakTestObject::Create<HelpButton>(xParent));
+    aObjects.push_back(LeakTestObject::Create<CheckBox>(xParent));
+    aObjects.push_back(LeakTestObject::Create<Edit>(xParent));
+    aObjects.push_back(LeakTestObject::Create<ComboBox>(xParent));
+    aObjects.push_back(LeakTestObject::Create<RadioButton>(xParent));
+
+    { // something that looks like a dialog
+        aObjects.push_back(LeakTestObject::Create<Dialog>(xParent,WB_CLIPCHILDREN|WB_MOVEABLE|WB_3DLOOK|WB_CLOSEABLE|WB_SIZEABLE));
+        VclPtr<vcl::Window> xDlgParent = aObjects.back()->getRef();
+        aObjects.push_back(LeakTestObject::Create<VclVBox>(xDlgParent));
+        VclPtr<vcl::Window> xVBox = aObjects.back()->getRef();
+        aObjects.push_back(LeakTestObject::Create<VclVButtonBox>(xVBox));
+    }
+
+    aObjects.push_back(LeakTestObject::Create<Dialog>(xParent, "PrintProgressDialog", "vcl/ui/printprogressdialog.ui"));
+    xParent.clear();
+
+    for (auto i = aObjects.rbegin(); i != aObjects.rend(); ++i)
+        (*i)->getRef()->Show();
+
+    for (auto i = aObjects.rbegin(); i != aObjects.rend(); ++i)
+        (*i)->disposeAndClear();
+
+    for (auto i = aObjects.begin(); i != aObjects.end(); ++i)
+        (*i)->assertDeleted();
+
+    for (auto i = aObjects.begin(); i != aObjects.end(); ++i)
+        delete *i;
+}
+
+void LifecycleTest::testToolkit()
+{
+    LeakTestObject *pVclWin = LeakTestObject::Create<WorkWindow>(nullptr, WB_APP|WB_STDWORK);
+    css::uno::Reference<css::awt::XWindow> xWindow(pVclWin->getRef()->GetComponentInterface(), css::uno::UNO_QUERY);
+    CPPUNIT_ASSERT(xWindow.is());
+
+    // test UNO dispose
+    css::uno::Reference<css::lang::XComponent> xWinComponent = xWindow;
+    CPPUNIT_ASSERT(xWinComponent.is());
+    CPPUNIT_ASSERT(!pVclWin->getRef()->IsDisposed());
+    xWinComponent->dispose();
+    CPPUNIT_ASSERT(pVclWin->getRef()->IsDisposed());
+
+    // test UNO cleanup
+    xWinComponent.clear();
+    xWindow.clear();
+    pVclWin->disposeAndClear();
+    pVclWin->assertDeleted();
+
+    delete pVclWin;
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(LifecycleTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/mnemonic.cxx b/vcl/qa/cppunit/mnemonic.cxx
new file mode 100644
index 000000000..e870e1d29
--- /dev/null
+++ b/vcl/qa/cppunit/mnemonic.cxx
@@ -0,0 +1,57 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <sal/config.h>
+
+#include <o3tl/cppunittraitshelper.hxx>
+#include <test/bootstrapfixture.hxx>
+#include <cppunit/TestAssert.h>
+
+#include <vcl/mnemonic.hxx>
+
+class VclMnemonicTest : public test::BootstrapFixture
+{
+public:
+    VclMnemonicTest() : BootstrapFixture(true, false) {}
+
+    void testMnemonic();
+
+    CPPUNIT_TEST_SUITE(VclMnemonicTest);
+    CPPUNIT_TEST(testMnemonic);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void VclMnemonicTest::testMnemonic()
+{
+    MnemonicGenerator aGenerator;
+
+    {
+        OUString sResult = aGenerator.CreateMnemonic(u"ßa");
+        CPPUNIT_ASSERT_EQUAL(u'~', sResult[1]);
+    }
+
+    {
+        const sal_Unicode TEST[] = { 0x4E00, 'b' };
+        OUString sResult = aGenerator.CreateMnemonic(OUString(TEST, SAL_N_ELEMENTS(TEST)));
+        CPPUNIT_ASSERT_EQUAL(u'~', sResult[1]);
+    }
+
+    {
+        const sal_Unicode TEST[] = { 0x4E00 };
+        OUString sResult = aGenerator.CreateMnemonic(OUString(TEST, SAL_N_ELEMENTS(TEST)));
+        CPPUNIT_ASSERT_EQUAL(OUString("(~C)"), sResult.copy(sResult.getLength() - 4));
+    }
+
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(VclMnemonicTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/outdev.cxx b/vcl/qa/cppunit/outdev.cxx
new file mode 100644
index 000000000..e99a35f67
--- /dev/null
+++ b/vcl/qa/cppunit/outdev.cxx
@@ -0,0 +1,291 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <test/bootstrapfixture.hxx>
+
+#include <vcl/print.hxx>
+#include <vcl/virdev.hxx>
+#include <vcl/window.hxx>
+#include <vcl/bitmapaccess.hxx>
+#include <vcl/gdimtf.hxx>
+#include <vcl/metaact.hxx>
+#include <bitmapwriteaccess.hxx>
+#include <bufferdevice.hxx>
+#include <window.h>
+
+#include <basegfx/matrix/b2dhommatrix.hxx>
+
+class VclOutdevTest : public test::BootstrapFixture
+{
+public:
+    VclOutdevTest() : BootstrapFixture(true, false) {}
+
+    void testVirtualDevice();
+    void testUseAfterDispose();
+    void testPrinterBackgroundColor();
+    void testWindowBackgroundColor();
+    void testGetReadableFontColorPrinter();
+    void testGetReadableFontColorWindow();
+    void testDrawTransformedBitmapEx();
+    void testDrawTransformedBitmapExFlip();
+    void testRTL();
+    void testRTLGuard();
+
+    CPPUNIT_TEST_SUITE(VclOutdevTest);
+    CPPUNIT_TEST(testVirtualDevice);
+    CPPUNIT_TEST(testUseAfterDispose);
+    CPPUNIT_TEST(testPrinterBackgroundColor);
+    CPPUNIT_TEST(testWindowBackgroundColor);
+    CPPUNIT_TEST(testGetReadableFontColorPrinter);
+    CPPUNIT_TEST(testGetReadableFontColorWindow);
+    CPPUNIT_TEST(testDrawTransformedBitmapEx);
+    CPPUNIT_TEST(testDrawTransformedBitmapExFlip);
+    CPPUNIT_TEST(testRTL);
+    CPPUNIT_TEST(testRTLGuard);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void VclOutdevTest::testGetReadableFontColorPrinter()
+{
+    ScopedVclPtrInstance<Printer> pPrinter;
+    CPPUNIT_ASSERT_EQUAL(pPrinter->GetReadableFontColor(COL_WHITE, COL_WHITE), COL_BLACK);
+}
+
+void VclOutdevTest::testGetReadableFontColorWindow()
+{
+    ScopedVclPtrInstance<vcl::Window> pWindow(nullptr, WB_APP | WB_STDWORK);
+    CPPUNIT_ASSERT_EQUAL(pWindow->GetReadableFontColor(COL_WHITE, COL_BLACK), COL_WHITE);
+    CPPUNIT_ASSERT_EQUAL(pWindow->GetReadableFontColor(COL_WHITE, COL_WHITE), COL_BLACK);
+    CPPUNIT_ASSERT_EQUAL(pWindow->GetReadableFontColor(COL_BLACK, COL_BLACK), COL_WHITE);
+}
+
+void VclOutdevTest::testPrinterBackgroundColor()
+{
+    ScopedVclPtrInstance<Printer> pPrinter;
+    CPPUNIT_ASSERT_EQUAL(pPrinter->GetBackgroundColor(), COL_WHITE);
+}
+
+void VclOutdevTest::testWindowBackgroundColor()
+{
+    ScopedVclPtrInstance<vcl::Window> pWindow(nullptr, WB_APP | WB_STDWORK);
+    pWindow->SetBackground(Wallpaper(COL_WHITE));
+    CPPUNIT_ASSERT_EQUAL(pWindow->GetBackgroundColor(), COL_WHITE);
+}
+
+void VclOutdevTest::testVirtualDevice()
+{
+    ScopedVclPtrInstance< VirtualDevice > pVDev;
+    pVDev->SetOutputSizePixel(Size(32,32));
+    pVDev->SetBackground(Wallpaper(COL_WHITE));
+
+    CPPUNIT_ASSERT_EQUAL(pVDev->GetBackgroundColor(), COL_WHITE);
+
+    pVDev->Erase();
+    pVDev->DrawPixel(Point(1,2),COL_BLUE);
+    pVDev->DrawPixel(Point(31,30),COL_RED);
+
+    Size aSize = pVDev->GetOutputSizePixel();
+    CPPUNIT_ASSERT_EQUAL(Size(32,32), aSize);
+
+    Bitmap aBmp = pVDev->GetBitmap(Point(),aSize);
+
+#if 0
+    OUString rFileName("/tmp/foo-unx.png");
+    try {
+        vcl::PNGWriter aWriter( aBmp );
+        SvFileStream sOutput( rFileName, StreamMode::WRITE );
+        aWriter.Write( sOutput );
+        sOutput.Close();
+    } catch (...) {
+        SAL_WARN("vcl", "Error writing png to " << rFileName);
+    }
+#endif
+
+    CPPUNIT_ASSERT_EQUAL(COL_WHITE, pVDev->GetPixel(Point(0,0)));
+#if !defined _WIN32 //TODO: various failures on Windows tinderboxes
+    CPPUNIT_ASSERT_EQUAL(COL_BLUE, pVDev->GetPixel(Point(1,2)));
+    CPPUNIT_ASSERT_EQUAL(COL_RED, pVDev->GetPixel(Point(31,30)));
+#endif
+    CPPUNIT_ASSERT_EQUAL(COL_WHITE, pVDev->GetPixel(Point(30,31)));
+
+    // Gotcha: y and x swap for BitmapReadAccess: deep joy.
+    Bitmap::ScopedReadAccess pAcc(aBmp);
+    CPPUNIT_ASSERT_EQUAL(COL_WHITE, static_cast<Color>(pAcc->GetPixel(0,0)));
+#if !defined _WIN32 //TODO: various failures on Windows tinderboxes
+    CPPUNIT_ASSERT_EQUAL(COL_BLUE, static_cast<Color>(pAcc->GetPixel(2,1)));
+    CPPUNIT_ASSERT_EQUAL(COL_RED, static_cast<Color>(pAcc->GetPixel(30,31)));
+#endif
+    CPPUNIT_ASSERT_EQUAL(COL_WHITE, static_cast<Color>(pAcc->GetPixel(31,30)));
+
+#if 0
+    VclPtr<vcl::Window> pWin = VclPtr<WorkWindow>::Create( (vcl::Window *)nullptr );
+    CPPUNIT_ASSERT( pWin );
+    OutputDevice *pOutDev = pWin.get();
+#endif
+}
+
+void VclOutdevTest::testUseAfterDispose()
+{
+    // Create a virtual device, enable map mode then dispose it.
+    ScopedVclPtrInstance<VirtualDevice> pVDev;
+
+    pVDev->EnableMapMode();
+
+    pVDev->disposeOnce();
+
+    // Make sure that these don't crash after dispose.
+    pVDev->GetInverseViewTransformation();
+
+    pVDev->GetViewTransformation();
+}
+
+void VclOutdevTest::testDrawTransformedBitmapEx()
+{
+    // Create a virtual device, and connect a metafile to it.
+    // Also create a 16x16 bitmap.
+    ScopedVclPtrInstance<VirtualDevice> pVDev;
+    Bitmap aBitmap(Size(16, 16), 24);
+    {
+        // Fill the top left quarter with black.
+        BitmapScopedWriteAccess pWriteAccess(aBitmap);
+        pWriteAccess->Erase(COL_WHITE);
+        for (int i = 0; i < 8; ++i)
+        {
+            for (int j = 0; j < 8; ++j)
+            {
+                pWriteAccess->SetPixel(j, i, COL_BLACK);
+            }
+        }
+    }
+    BitmapEx aBitmapEx(aBitmap);
+    basegfx::B2DHomMatrix aMatrix;
+    aMatrix.scale(8, 8);
+    // Rotate 90 degrees clockwise, so the black part goes to the top right.
+    aMatrix.rotate(M_PI / 2);
+    GDIMetaFile aMtf;
+    aMtf.Record(pVDev.get());
+
+    // Draw the rotated bitmap on the vdev.
+    pVDev->DrawTransformedBitmapEx(aMatrix, aBitmapEx);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aMtf.GetActionSize());
+    MetaAction* pAction = aMtf.GetAction(0);
+    CPPUNIT_ASSERT_EQUAL(MetaActionType::BMPEXSCALE, pAction->GetType());
+    auto pBitmapAction = static_cast<MetaBmpExScaleAction*>(pAction);
+    const BitmapEx& rBitmapEx = pBitmapAction->GetBitmapEx();
+    Size aTransformedSize = rBitmapEx.GetSizePixel();
+    // Without the accompanying fix in place, this test would have failed with:
+    // - Expected: 16x16
+    // - Actual  : 8x8
+    // I.e. the bitmap before scaling was already scaled down, just because it was rotated.
+    CPPUNIT_ASSERT_EQUAL(Size(16, 16), aTransformedSize);
+
+    aBitmap = rBitmapEx.GetBitmap();
+    Bitmap::ScopedReadAccess pAccess(aBitmap);
+    for (int i = 0; i < 16; ++i)
+    {
+        for (int j = 0; j < 16; ++j)
+        {
+            BitmapColor aColor = pAccess->GetPixel(j, i);
+            Color aExpected = i >= 8 && j < 8 ? COL_BLACK : COL_WHITE;
+            std::stringstream ss;
+            ss << "Color is expected to be ";
+            ss << ((aExpected == COL_WHITE) ? "white" : "black");
+            ss << ", is " << aColor.AsRGBHexString();
+            ss << " (row " << j << ", col " << i << ")";
+            // Without the accompanying fix in place, this test would have failed with:
+            // - Expected: c[00000000]
+            // - Actual  : c[ffffff00]
+            // - Color is expected to be black, is ffffff (row 0, col 8)
+            // i.e. the top right quarter of the image was not fully black, there was a white first
+            // row.
+            CPPUNIT_ASSERT_EQUAL_MESSAGE(ss.str(), aExpected, Color(aColor));
+        }
+    }
+}
+
+void VclOutdevTest::testDrawTransformedBitmapExFlip()
+{
+    // Create a virtual device, and connect a metafile to it.
+    // Also create a 16x16 bitmap.
+    ScopedVclPtrInstance<VirtualDevice> pVDev;
+    Bitmap aBitmap(Size(16, 16), 24);
+    {
+        // Fill the top left quarter with black.
+        BitmapScopedWriteAccess pWriteAccess(aBitmap);
+        pWriteAccess->Erase(COL_WHITE);
+        for (int i = 0; i < 8; ++i)
+        {
+            for (int j = 0; j < 8; ++j)
+            {
+                pWriteAccess->SetPixel(j, i, COL_BLACK);
+            }
+        }
+    }
+    BitmapEx aBitmapEx(aBitmap);
+    basegfx::B2DHomMatrix aMatrix;
+    // Negative y scale: bitmap should be upside down, so the black part goes to the bottom left.
+    aMatrix.scale(8, -8);
+    // Rotate 90 degrees clockwise, so the black part goes back to the top left.
+    aMatrix.rotate(M_PI / 2);
+    GDIMetaFile aMtf;
+    aMtf.Record(pVDev.get());
+
+    // Draw the scaled and rotated bitmap on the vdev.
+    pVDev->DrawTransformedBitmapEx(aMatrix, aBitmapEx);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aMtf.GetActionSize());
+    MetaAction* pAction = aMtf.GetAction(0);
+    CPPUNIT_ASSERT_EQUAL(MetaActionType::BMPEXSCALE, pAction->GetType());
+    auto pBitmapAction = static_cast<MetaBmpExScaleAction*>(pAction);
+    const BitmapEx& rBitmapEx = pBitmapAction->GetBitmapEx();
+
+    aBitmap = rBitmapEx.GetBitmap();
+    Bitmap::ScopedReadAccess pAccess(aBitmap);
+    int nX = 8 * 0.25;
+    int nY = 8 * 0.25;
+    BitmapColor aColor = pAccess->GetPixel(nY, nX);
+    std::stringstream ss;
+    ss << "Color is expected to be black, is " << aColor.AsRGBHexString();
+    ss << " (row " << nY << ", col " << nX << ")";
+    // Without the accompanying fix in place, this test would have failed with:
+    // - Expected: c[00000000]
+    // - Actual  : c[ffffff00]
+    // - Color is expected to be black, is ffffff (row 2, col 2)
+    // i.e. the top left quarter of the image was not black, due to a missing flip.
+    CPPUNIT_ASSERT_EQUAL_MESSAGE(ss.str(), COL_BLACK, Color(aColor));
+}
+
+void VclOutdevTest::testRTL()
+{
+    ScopedVclPtrInstance<vcl::Window> pWindow(nullptr, WB_APP | WB_STDWORK);
+    pWindow->EnableRTL();
+    vcl::RenderContext& rRenderContext = *pWindow;
+    vcl::BufferDevice pBuffer(pWindow, rRenderContext);
+
+    // Without the accompanying fix in place, this test would have failed, because the RTL status
+    // from pWindow was not propagated to pBuffer.
+    CPPUNIT_ASSERT(pBuffer->IsRTLEnabled());
+}
+
+void VclOutdevTest::testRTLGuard()
+{
+    ScopedVclPtrInstance<vcl::Window> pWindow(nullptr, WB_APP | WB_STDWORK);
+    pWindow->EnableRTL();
+    pWindow->RequestDoubleBuffering(true);
+    ImplFrameData* pFrameData = pWindow->ImplGetWindowImpl()->mpFrameData;
+    vcl::PaintBufferGuard aGuard(pFrameData, pWindow);
+    // Without the accompanying fix in place, this test would have failed, because the RTL status
+    // from pWindow was not propagated to aGuard.
+    CPPUNIT_ASSERT(aGuard.GetRenderContext()->IsRTLEnabled());
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(VclOutdevTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/pdfexport/data/6m-wide.odg b/vcl/qa/cppunit/pdfexport/data/6m-wide.odg
new file mode 100644
index 000000000..49fb9bfff
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/6m-wide.odg
diff --git a/vcl/qa/cppunit/pdfexport/data/SimpleMultiPagePDF.pdf b/vcl/qa/cppunit/pdfexport/data/SimpleMultiPagePDF.pdf
new file mode 100644
index 000000000..af665fcba
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/SimpleMultiPagePDF.pdf
diff --git a/vcl/qa/cppunit/pdfexport/data/forcepoint71.key b/vcl/qa/cppunit/pdfexport/data/forcepoint71.key
new file mode 100644
index 000000000..716fe5848
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/forcepoint71.key
diff --git a/vcl/qa/cppunit/pdfexport/data/link-wrong-page.odp b/vcl/qa/cppunit/pdfexport/data/link-wrong-page.odp
new file mode 100644
index 000000000..b6787aff6
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/link-wrong-page.odp
diff --git a/vcl/qa/cppunit/pdfexport/data/pdf-image-resource-inline-xobject-ref.pdf b/vcl/qa/cppunit/pdfexport/data/pdf-image-resource-inline-xobject-ref.pdf
new file mode 100644
index 000000000..739a80c47
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/pdf-image-resource-inline-xobject-ref.pdf
diff --git a/vcl/qa/cppunit/pdfexport/data/reduce-image.fodt b/vcl/qa/cppunit/pdfexport/data/reduce-image.fodt
new file mode 100644
index 000000000..b5737ae27
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/reduce-image.fodt
@@ -0,0 +1,29 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<office:document xmlns:grddl="http://www.w3.org/2003/g/data-view#" xmlns:xhtml="http://www.w3.org/1999/xhtml" xmlns:css3t="http://www.w3.org/TR/css3-text/" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:formx="urn:openoffice:names:experimental:ooxml-odf-interop:xmlns:form:1.0" xmlns:xforms="http://www.w3.org/2002/xforms" xmlns:dom="http://www.w3.org/2001/xml-events" xmlns:script="urn:oasis:names:tc:opendocument:xmlns:script:1.0" xmlns:form="urn:oasis:names:tc:opendocument:xmlns:form:1.0" xmlns:math="http://www.w3.org/1998/Math/MathML" xmlns:field="urn:openoffice:names:experimental:ooo-ms-interop:xmlns:field:1.0" xmlns:of="urn:oasis:names:tc:opendocument:xmlns:of:1.2" xmlns:oooc="http://openoffice.org/2004/calc" xmlns:ooow="http://openoffice.org/2004/writer" xmlns:config="urn:oasis:names:tc:opendocument:xmlns:config:1.0" xmlns:tableooo="http://openoffice.org/2009/table" xmlns:text="urn:oasis:names:tc:opendocument:xmlns:text:1.0" xmlns:calcext="urn:org:documentfoundation:names:experimental:calc:xmlns:calcext:1.0" xmlns:fo="urn:oasis:names:tc:opendocument:xmlns:xsl-fo-compatible:1.0" xmlns:dc="http://purl.org/dc/elements/1.1/" xmlns:office="urn:oasis:names:tc:opendocument:xmlns:office:1.0" xmlns:loext="urn:org:documentfoundation:names:experimental:office:xmlns:loext:1.0" xmlns:xlink="http://www.w3.org/1999/xlink" xmlns:ooo="http://openoffice.org/2004/office" xmlns:table="urn:oasis:names:tc:opendocument:xmlns:table:1.0" xmlns:meta="urn:oasis:names:tc:opendocument:xmlns:meta:1.0" xmlns:officeooo="http://openoffice.org/2009/office" xmlns:style="urn:oasis:names:tc:opendocument:xmlns:style:1.0" xmlns:drawooo="http://openoffice.org/2010/draw" xmlns:draw="urn:oasis:names:tc:opendocument:xmlns:drawing:1.0" xmlns:dr3d="urn:oasis:names:tc:opendocument:xmlns:dr3d:1.0" xmlns:svg="urn:oasis:names:tc:opendocument:xmlns:svg-compatible:1.0" xmlns:chart="urn:oasis:names:tc:opendocument:xmlns:chart:1.0" xmlns:rpt="http://openoffice.org/2005/report" xmlns:number="urn:oasis:names:tc:opendocument:xmlns:datastyle:1.0" office:version="1.2" office:mimetype="application/vnd.oasis.opendocument.text">
+  <office:styles>
+    <style:default-style style:family="graphic">
+    </style:default-style>
+    <style:style style:name="Graphics" style:family="graphic">
+    </style:style>
+  </office:styles>
+  <office:automatic-styles>
+    <style:style style:name="fr1" style:family="graphic" style:parent-style-name="Graphics">
+      <style:graphic-properties style:run-through="foreground" style:horizontal-pos="center" style:horizontal-rel="paragraph" style:mirror="none" fo:clip="rect(0cm, 0cm, 0cm, 0cm)" draw:luminance="0%" draw:contrast="0%" draw:red="0%" draw:green="0%" draw:blue="0%" draw:gamma="100%" draw:color-inversion="false" draw:image-opacity="100%" draw:color-mode="standard"/>
+    </style:style>
+  </office:automatic-styles>
+  <office:body>
+    <office:text>
+      <text:p text:style-name="Standard"><draw:frame draw:style-name="fr1" draw:name="Image1" text:anchor-type="char" svg:width="0.041cm" svg:height="0.041cm" draw:z-index="0"><draw:image loext:mime-type="image/png"><office:binary-data>iVBORw0KGgoAAAANSUhEUgAAAKAAAACgCAYAAACLz2ctAAAABmJLR0QA/wD/AP+gvaeTAAAA
+       CXBIWXMAAAsTAAALEwEAmpwYAAAAB3RJTUUH5AEVDCUTfvEVdAAAAYhJREFUeNrt3bEJwzAQ
+       htFckjLreP8Bso5bc2lTpBDG4kfkvQUE5uNUGEnV3TdIufsECBABggARIAgQAYIAESAIEAGC
+       ABEgCBABggARIAgQAYIAESAIEAGCABEgCBABggARIHx7phZ+vF9D13Id217WXW9dExBbMAgQ
+       AYIAESAIEAGCABEgCBABIkAQIAIEASJAECAChKnq6hfTR88gsKarz46YgNiCESAIEAGCABEg
+       CBABwlSx27FStzHxW+oPlgmILRgBggARIAgQAYIAESAIEAGCABEgCBABggARIAgQAYIAESAI
+       EAGCABEgCBABggARIAgQAYIAESACBAEiQBAgAgQBIkAQIAIEASJAECACBAEiQBAgi4u9mJ56
+       oRsTEASIAEGACBABggARIAiQP1LdmR8So39Cjm0v6663rgmILRgEiABBgAgQBIgAQYAIEASI
+       ABEgCBABggARIAgQAcJUsTMhYAIiQAQIAkSAIEAECAJEgCBABAgCRIAgQAQIAkSAIEAECKd9
+       AEYENxB/sygQAAAAAElFTkSuQmCC
+      </office:binary-data></draw:image></draw:frame></text:p>
+    </office:text>
+  </office:body>
+</office:document>
diff --git a/vcl/qa/cppunit/pdfexport/data/reduce-small-image.fodt b/vcl/qa/cppunit/pdfexport/data/reduce-small-image.fodt
new file mode 100644
index 000000000..99ff22746
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/reduce-small-image.fodt
@@ -0,0 +1,21 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<office:document xmlns:grddl="http://www.w3.org/2003/g/data-view#" xmlns:xhtml="http://www.w3.org/1999/xhtml" xmlns:css3t="http://www.w3.org/TR/css3-text/" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:formx="urn:openoffice:names:experimental:ooxml-odf-interop:xmlns:form:1.0" xmlns:xforms="http://www.w3.org/2002/xforms" xmlns:dom="http://www.w3.org/2001/xml-events" xmlns:script="urn:oasis:names:tc:opendocument:xmlns:script:1.0" xmlns:form="urn:oasis:names:tc:opendocument:xmlns:form:1.0" xmlns:math="http://www.w3.org/1998/Math/MathML" xmlns:field="urn:openoffice:names:experimental:ooo-ms-interop:xmlns:field:1.0" xmlns:of="urn:oasis:names:tc:opendocument:xmlns:of:1.2" xmlns:oooc="http://openoffice.org/2004/calc" xmlns:ooow="http://openoffice.org/2004/writer" xmlns:config="urn:oasis:names:tc:opendocument:xmlns:config:1.0" xmlns:tableooo="http://openoffice.org/2009/table" xmlns:text="urn:oasis:names:tc:opendocument:xmlns:text:1.0" xmlns:calcext="urn:org:documentfoundation:names:experimental:calc:xmlns:calcext:1.0" xmlns:fo="urn:oasis:names:tc:opendocument:xmlns:xsl-fo-compatible:1.0" xmlns:dc="http://purl.org/dc/elements/1.1/" xmlns:office="urn:oasis:names:tc:opendocument:xmlns:office:1.0" xmlns:loext="urn:org:documentfoundation:names:experimental:office:xmlns:loext:1.0" xmlns:xlink="http://www.w3.org/1999/xlink" xmlns:ooo="http://openoffice.org/2004/office" xmlns:table="urn:oasis:names:tc:opendocument:xmlns:table:1.0" xmlns:meta="urn:oasis:names:tc:opendocument:xmlns:meta:1.0" xmlns:officeooo="http://openoffice.org/2009/office" xmlns:style="urn:oasis:names:tc:opendocument:xmlns:style:1.0" xmlns:drawooo="http://openoffice.org/2010/draw" xmlns:draw="urn:oasis:names:tc:opendocument:xmlns:drawing:1.0" xmlns:dr3d="urn:oasis:names:tc:opendocument:xmlns:dr3d:1.0" xmlns:svg="urn:oasis:names:tc:opendocument:xmlns:svg-compatible:1.0" xmlns:chart="urn:oasis:names:tc:opendocument:xmlns:chart:1.0" xmlns:rpt="http://openoffice.org/2005/report" xmlns:number="urn:oasis:names:tc:opendocument:xmlns:datastyle:1.0" office:version="1.2" office:mimetype="application/vnd.oasis.opendocument.text">
+  <office:styles>
+    <style:default-style style:family="graphic">
+    </style:default-style>
+    <style:style style:name="Graphics" style:family="graphic">
+    </style:style>
+  </office:styles>
+  <office:automatic-styles>
+    <style:style style:name="fr1" style:family="graphic" style:parent-style-name="Graphics">
+      <style:graphic-properties style:run-through="foreground" style:horizontal-pos="center" style:horizontal-rel="paragraph" style:mirror="none" fo:clip="rect(0cm, 0cm, 0cm, 0cm)" draw:luminance="0%" draw:contrast="0%" draw:red="0%" draw:green="0%" draw:blue="0%" draw:gamma="100%" draw:color-inversion="false" draw:image-opacity="100%" draw:color-mode="standard"/>
+    </style:style>
+  </office:automatic-styles>
+  <office:body>
+    <office:text>
+      <text:p text:style-name="Standard"><draw:frame draw:style-name="fr1" draw:name="Image1" text:anchor-type="char" svg:width="0.041cm" svg:height="0.041cm" draw:z-index="0"><draw:image loext:mime-type="image/png"><office:binary-data>iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAYAAAAf8/9hAAAAMklEQVR42mP4//8/AyWYYXAZ
+       wHSK+z8pbOoaAJIgBWM1gFh/jxqAxwCKYmHgE9KAZSYAhK3Dgc2FxfUAAAAASUVORK5CYII=
+      </office:binary-data></draw:image></draw:frame></text:p>
+    </office:text>
+  </office:body>
+</office:document>
diff --git a/vcl/qa/cppunit/pdfexport/data/softhyphen_pdf.odt b/vcl/qa/cppunit/pdfexport/data/softhyphen_pdf.odt
new file mode 100644
index 000000000..ecd779537
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/softhyphen_pdf.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf105093.odp b/vcl/qa/cppunit/pdfexport/data/tdf105093.odp
new file mode 100644
index 000000000..82ce29cda
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf105093.odp
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf105461.odp b/vcl/qa/cppunit/pdfexport/data/tdf105461.odp
new file mode 100644
index 000000000..9c86a3bd7
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf105461.odp
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf105954.odt b/vcl/qa/cppunit/pdfexport/data/tdf105954.odt
new file mode 100644
index 000000000..ba5c96de6
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf105954.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf106059.odt b/vcl/qa/cppunit/pdfexport/data/tdf106059.odt
new file mode 100644
index 000000000..a2c180378
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf106059.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf106206.odt b/vcl/qa/cppunit/pdfexport/data/tdf106206.odt
new file mode 100644
index 000000000..3581157de
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf106206.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf106693.odt b/vcl/qa/cppunit/pdfexport/data/tdf106693.odt
new file mode 100644
index 000000000..a2c180378
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf106693.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf106702.odt b/vcl/qa/cppunit/pdfexport/data/tdf106702.odt
new file mode 100644
index 000000000..da3b7e814
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf106702.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf106972-pdf17.odt b/vcl/qa/cppunit/pdfexport/data/tdf106972-pdf17.odt
new file mode 100644
index 000000000..d46c93dff
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf106972-pdf17.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf106972.odt b/vcl/qa/cppunit/pdfexport/data/tdf106972.odt
new file mode 100644
index 000000000..3fa76c49f
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf106972.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf107013.odt b/vcl/qa/cppunit/pdfexport/data/tdf107013.odt
new file mode 100644
index 000000000..644e65c6d
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf107013.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf107018.odt b/vcl/qa/cppunit/pdfexport/data/tdf107018.odt
new file mode 100644
index 000000000..3bfc7b2d7
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf107018.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf107089.odt b/vcl/qa/cppunit/pdfexport/data/tdf107089.odt
new file mode 100644
index 000000000..5aaaab944
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf107089.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf107868.odt b/vcl/qa/cppunit/pdfexport/data/tdf107868.odt
new file mode 100644
index 000000000..8309f4b87
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf107868.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf108963.odp b/vcl/qa/cppunit/pdfexport/data/tdf108963.odp
new file mode 100644
index 000000000..246c0c72a
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf108963.odp
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf109143.odt b/vcl/qa/cppunit/pdfexport/data/tdf109143.odt
new file mode 100644
index 000000000..7d9afa378
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf109143.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf113143.odp b/vcl/qa/cppunit/pdfexport/data/tdf113143.odp
new file mode 100644
index 000000000..5f8a1b10e
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf113143.odp
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf115117-1.odt b/vcl/qa/cppunit/pdfexport/data/tdf115117-1.odt
new file mode 100644
index 000000000..63fe82946
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf115117-1.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf115117-2.odt b/vcl/qa/cppunit/pdfexport/data/tdf115117-2.odt
new file mode 100644
index 000000000..c1e1f6d43
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf115117-2.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf115262.ods b/vcl/qa/cppunit/pdfexport/data/tdf115262.ods
new file mode 100644
index 000000000..b401a74ce
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf115262.ods
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf115967.odt b/vcl/qa/cppunit/pdfexport/data/tdf115967.odt
new file mode 100644
index 000000000..39f4ce178
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf115967.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf118244_radioButtonGroup.odt b/vcl/qa/cppunit/pdfexport/data/tdf118244_radioButtonGroup.odt
new file mode 100644
index 000000000..caabc4987
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf118244_radioButtonGroup.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf121615.odt b/vcl/qa/cppunit/pdfexport/data/tdf121615.odt
new file mode 100644
index 000000000..7d2a87cf0
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf121615.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf121962.odt b/vcl/qa/cppunit/pdfexport/data/tdf121962.odt
new file mode 100644
index 000000000..a831b1136
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf121962.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf128630.odp b/vcl/qa/cppunit/pdfexport/data/tdf128630.odp
new file mode 100644
index 000000000..d216504b7
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf128630.odp
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf66597-1.odt b/vcl/qa/cppunit/pdfexport/data/tdf66597-1.odt
new file mode 100644
index 000000000..7fecc55c6
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf66597-1.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf66597-2.odt b/vcl/qa/cppunit/pdfexport/data/tdf66597-2.odt
new file mode 100644
index 000000000..3d7b5e59c
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf66597-2.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf66597-3.odt b/vcl/qa/cppunit/pdfexport/data/tdf66597-3.odt
new file mode 100644
index 000000000..6db91fe81
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf66597-3.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf99680-2.odt b/vcl/qa/cppunit/pdfexport/data/tdf99680-2.odt
new file mode 100644
index 000000000..47c370004
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf99680-2.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/tdf99680.odt b/vcl/qa/cppunit/pdfexport/data/tdf99680.odt
new file mode 100644
index 000000000..de12f9baa
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/tdf99680.odt
diff --git a/vcl/qa/cppunit/pdfexport/data/toc-link.fodt b/vcl/qa/cppunit/pdfexport/data/toc-link.fodt
new file mode 100644
index 000000000..ab29e88a4
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/data/toc-link.fodt
@@ -0,0 +1,45 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<office:document xmlns:office="urn:oasis:names:tc:opendocument:xmlns:office:1.0" xmlns:style="urn:oasis:names:tc:opendocument:xmlns:style:1.0" xmlns:text="urn:oasis:names:tc:opendocument:xmlns:text:1.0" xmlns:fo="urn:oasis:names:tc:opendocument:xmlns:xsl-fo-compatible:1.0" xmlns:xlink="http://www.w3.org/1999/xlink" office:version="1.2" office:mimetype="application/vnd.oasis.opendocument.text">
+  <office:styles>
+    <style:style style:name="Standard" style:family="paragraph" style:class="text"/>
+    <style:style style:name="Heading" style:family="paragraph" style:parent-style-name="Standard" style:next-style-name="Text_20_body" style:class="text"/>
+    <style:style style:name="Heading_20_1" style:display-name="Heading 1" style:family="paragraph" style:parent-style-name="Heading" style:default-outline-level="1" style:class="text">
+      <style:paragraph-properties fo:margin-top="0.423cm" fo:margin-bottom="0.212cm"/>
+    </style:style>
+    <style:style style:name="Contents_20_Heading" style:display-name="Contents Heading" style:family="paragraph" style:parent-style-name="Heading" style:class="index"/>
+    <style:style style:name="Contents_20_1" style:display-name="Contents 1" style:family="paragraph" style:parent-style-name="Index" style:class="index">
+      <style:paragraph-properties fo:margin-left="0cm" fo:margin-right="0cm" fo:text-indent="0cm" style:auto-text-indent="false"/>
+    </style:style>
+    <style:style style:name="Index_20_Link" style:display-name="Index Link" style:family="text"/>
+  </office:styles>
+  <office:automatic-styles>
+    <style:style style:name="Sect1" style:family="section"/>
+    <style:page-layout style:name="pm1">
+      <style:page-layout-properties fo:page-width="21.59cm" fo:page-height="27.94cm" fo:margin-top="2cm" fo:margin-bottom="2cm" fo:margin-left="2cm" fo:margin-right="2cm"/>
+    </style:page-layout>
+  </office:automatic-styles>
+  <office:master-styles>
+    <style:master-page style:name="Standard" style:page-layout-name="pm1"/>
+  </office:master-styles>
+  <office:body>
+    <office:text>
+      <text:table-of-content text:style-name="Sect1" text:protected="true" text:name="Table of Contents">
+        <text:table-of-content-source text:outline-level="10">
+          <text:index-title-template text:style-name="Contents_20_Heading">Table of Contents</text:index-title-template>
+          <text:table-of-content-entry-template text:outline-level="1" text:style-name="Contents_20_1">
+            <text:index-entry-link-start/>
+            <text:index-entry-text/>
+            <text:index-entry-link-end/>
+          </text:table-of-content-entry-template>
+        </text:table-of-content-source>
+        <text:index-body>
+          <text:index-title text:style-name="Sect1" text:name="Table of Contents_Head">
+            <text:p text:style-name="Contents_20_Heading">Table of Contents</text:p>
+          </text:index-title>
+          <text:p text:style-name="Contents_20_1"><text:a xlink:type="simple" xlink:href="#__RefHeading_Toc">Heading 1<text:tab/>1</text:a></text:p>
+        </text:index-body>
+      </text:table-of-content>
+      <text:h text:style-name="Heading_20_1" text:outline-level="1"><text:bookmark-start text:name="__RefHeading_Toc"/>Heading 1<text:bookmark-end text:name="__RefHeading_Toc"/></text:h>
+    </office:text>
+  </office:body>
+</office:document>
diff --git a/vcl/qa/cppunit/pdfexport/pdfexport.cxx b/vcl/qa/cppunit/pdfexport/pdfexport.cxx
new file mode 100644
index 000000000..fe402b4ed
--- /dev/null
+++ b/vcl/qa/cppunit/pdfexport/pdfexport.cxx
@@ -0,0 +1,2295 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <sal/config.h>
+
+#include <memory>
+#include <type_traits>
+
+#include <config_features.h>
+
+#include <com/sun/star/frame/Desktop.hpp>
+#include <com/sun/star/frame/XStorable.hpp>
+#include <com/sun/star/view/XPrintable.hpp>
+#include <com/sun/star/text/XDocumentIndexesSupplier.hpp>
+#include <com/sun/star/util/XRefreshable.hpp>
+#include <com/sun/star/beans/XPropertySet.hpp>
+#include <com/sun/star/drawing/XShape.hpp>
+#include <com/sun/star/text/XTextDocument.hpp>
+#include <com/sun/star/document/XFilter.hpp>
+#include <com/sun/star/document/XExporter.hpp>
+#include <com/sun/star/io/XOutputStream.hpp>
+
+#include <comphelper/scopeguard.hxx>
+#include <comphelper/processfactory.hxx>
+#include <comphelper/propertysequence.hxx>
+#include <test/bootstrapfixture.hxx>
+#include <unotest/macros_test.hxx>
+#include <unotools/mediadescriptor.hxx>
+#include <unotools/tempfile.hxx>
+#include <vcl/filter/pdfdocument.hxx>
+#include <tools/zcodec.hxx>
+#include <fpdf_edit.h>
+#include <fpdf_text.h>
+#include <fpdf_doc.h>
+#include <fpdfview.h>
+#include <vcl/graphicfilter.hxx>
+#include <basegfx/matrix/b2dhommatrix.hxx>
+#include <unotools/streamwrap.hxx>
+
+#include <vcl/filter/PDFiumLibrary.hxx>
+
+using namespace ::com::sun::star;
+
+static std::ostream& operator<<(std::ostream& rStrm, const Color& rColor)
+{
+    rStrm << "Color: R:" << static_cast<int>(rColor.GetRed())
+          << " G:" << static_cast<int>(rColor.GetGreen())
+          << " B:" << static_cast<int>(rColor.GetBlue())
+          << " A:" << static_cast<int>(rColor.GetTransparency());
+    return rStrm;
+}
+
+namespace
+{
+
+struct CloseDocument {
+    void operator ()(FPDF_DOCUMENT doc) {
+        if (doc != nullptr) {
+            FPDF_CloseDocument(doc);
+        }
+    }
+};
+
+using DocumentHolder =
+    std::unique_ptr<typename std::remove_pointer<FPDF_DOCUMENT>::type, CloseDocument>;
+
+struct ClosePage {
+    void operator ()(FPDF_PAGE page) {
+        if (page != nullptr) {
+            FPDF_ClosePage(page);
+        }
+    }
+};
+
+using PageHolder =
+    std::unique_ptr<typename std::remove_pointer<FPDF_PAGE>::type, ClosePage>;
+
+/// Tests the PDF export filter.
+class PdfExportTest : public test::BootstrapFixture, public unotest::MacrosTest
+{
+    uno::Reference<lang::XComponent> mxComponent;
+    utl::TempFile maTempFile;
+    SvMemoryStream maMemory;
+    // Export the document as PDF, then parse it with PDFium.
+    DocumentHolder exportAndParse(const OUString& rURL, const utl::MediaDescriptor& rDescriptor);
+    std::shared_ptr<vcl::pdf::PDFium> mpPDFium;
+
+public:
+    PdfExportTest();
+    virtual void setUp() override;
+    virtual void tearDown() override;
+    void saveAsPDF(const OUString& rFile);
+    void load(const OUString& rFile, vcl::filter::PDFDocument& rDocument);
+    /// Tests that a pdf image is roundtripped back to PDF as a vector format.
+    void testTdf106059();
+    /// Tests that text highlight from Impress is not lost.
+    void testTdf105461();
+    void testTdf107868();
+    /// Tests that embedded video from Impress is not exported as a linked one.
+    void testTdf105093();
+    /// Tests export of non-PDF images.
+    void testTdf106206();
+    /// Tests export of PDF images without reference XObjects.
+    void testTdf106693();
+    void testForcePoint71();
+    void testTdf106972();
+    void testTdf106972Pdf17();
+    void testSofthyphenPos();
+    void testTdf107013();
+    void testTdf107018();
+    void testTdf107089();
+    void testTdf99680();
+    void testTdf99680_2();
+    void testTdf108963();
+    void testTdf118244_radioButtonGroup();
+    /// Test writing ToUnicode CMAP for LTR ligatures.
+    void testTdf115117_1();
+    /// Text extracting LTR text with ligatures.
+    void testTdf115117_1a();
+    /// Test writing ToUnicode CMAP for RTL ligatures.
+    void testTdf115117_2();
+    /// Test extracting RTL text with ligatures.
+    void testTdf115117_2a();
+    /// Test writing ToUnicode CMAP for doubly encoded glyphs.
+    void testTdf66597_1();
+    /// Test writing ActualText for RTL many to one glyph to Unicode mapping.
+    void testTdf66597_2();
+    /// Test writing ActualText for LTR many to one glyph to Unicode mapping.
+    void testTdf66597_3();
+    void testTdf109143();
+    void testTdf105954();
+    void testTdf128630();
+    void testTdf106702();
+    void testTdf113143();
+    void testTdf115262();
+    void testTdf121962();
+    void testTdf115967();
+    void testTdf121615();
+    void testTocLink();
+    void testPdfImageResourceInlineXObjectRef();
+    void testReduceSmallImage();
+    void testReduceImage();
+    void testLinkWrongPage();
+    void testLargePage();
+    void testVersion15();
+    void testDefaultVersion();
+    void testMultiPagePDF();
+
+
+    CPPUNIT_TEST_SUITE(PdfExportTest);
+    CPPUNIT_TEST(testTdf106059);
+    CPPUNIT_TEST(testTdf105461);
+    CPPUNIT_TEST(testTdf107868);
+    CPPUNIT_TEST(testTdf105093);
+    CPPUNIT_TEST(testTdf106206);
+    CPPUNIT_TEST(testTdf106693);
+    CPPUNIT_TEST(testForcePoint71);
+    CPPUNIT_TEST(testTdf106972);
+    CPPUNIT_TEST(testTdf106972Pdf17);
+    CPPUNIT_TEST(testSofthyphenPos);
+    CPPUNIT_TEST(testTdf107013);
+    CPPUNIT_TEST(testTdf107018);
+    CPPUNIT_TEST(testTdf107089);
+    CPPUNIT_TEST(testTdf99680);
+    CPPUNIT_TEST(testTdf99680_2);
+    CPPUNIT_TEST(testTdf108963);
+    CPPUNIT_TEST(testTdf118244_radioButtonGroup);
+    CPPUNIT_TEST(testTdf115117_1);
+    CPPUNIT_TEST(testTdf115117_1a);
+    CPPUNIT_TEST(testTdf115117_2);
+    CPPUNIT_TEST(testTdf115117_2a);
+    CPPUNIT_TEST(testTdf66597_1);
+    CPPUNIT_TEST(testTdf66597_2);
+    CPPUNIT_TEST(testTdf66597_3);
+    CPPUNIT_TEST(testTdf109143);
+    CPPUNIT_TEST(testTdf105954);
+    CPPUNIT_TEST(testTdf128630);
+    CPPUNIT_TEST(testTdf106702);
+    CPPUNIT_TEST(testTdf113143);
+    CPPUNIT_TEST(testTdf115262);
+    CPPUNIT_TEST(testTdf121962);
+    CPPUNIT_TEST(testTdf115967);
+    CPPUNIT_TEST(testTdf121615);
+    CPPUNIT_TEST(testTocLink);
+    CPPUNIT_TEST(testPdfImageResourceInlineXObjectRef);
+    CPPUNIT_TEST(testReduceSmallImage);
+    CPPUNIT_TEST(testReduceImage);
+    CPPUNIT_TEST(testLinkWrongPage);
+    CPPUNIT_TEST(testLargePage);
+    CPPUNIT_TEST(testVersion15);
+    CPPUNIT_TEST(testDefaultVersion);
+    CPPUNIT_TEST(testMultiPagePDF);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+PdfExportTest::PdfExportTest()
+{
+    maTempFile.EnableKillingFile();
+}
+
+DocumentHolder PdfExportTest::exportAndParse(const OUString& rURL, const utl::MediaDescriptor& rDescriptor)
+{
+    // Import the bugdoc and export as PDF.
+    mxComponent = loadFromDesktop(rURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    xStorable->storeToURL(maTempFile.GetURL(), rDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result with pdfium.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    maMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(
+        FPDF_LoadMemDocument(maMemory.GetData(), maMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+    return pPdfDocument;
+}
+
+void PdfExportTest::setUp()
+{
+    test::BootstrapFixture::setUp();
+
+    mxDesktop.set(frame::Desktop::create(mxComponentContext));
+
+    mpPDFium = vcl::pdf::PDFiumLibrary::get();
+}
+
+void PdfExportTest::tearDown()
+{
+    if (mxComponent.is())
+        mxComponent->dispose();
+
+    test::BootstrapFixture::tearDown();
+}
+
+char const DATA_DIRECTORY[] = "/vcl/qa/cppunit/pdfexport/data/";
+
+void PdfExportTest::saveAsPDF(const OUString& rFile)
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + rFile;
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+}
+
+void PdfExportTest::load(const OUString& rFile, vcl::filter::PDFDocument& rDocument)
+{
+    saveAsPDF(rFile);
+
+    // Parse the export result.
+    SvFileStream aStream(maTempFile.GetURL(), StreamMode::READ);
+    CPPUNIT_ASSERT(rDocument.Read(aStream));
+}
+
+void PdfExportTest::testTdf106059()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf106059.odt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    // Explicitly enable the usage of the reference XObject markup.
+    uno::Sequence<beans::PropertyValue> aFilterData( comphelper::InitPropertySequence({
+        {"UseReferenceXObject", uno::Any(true) }
+    }));
+    aMediaDescriptor["FilterData"] <<= aFilterData;
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result.
+    vcl::filter::PDFDocument aDocument;
+    SvFileStream aStream(maTempFile.GetURL(), StreamMode::READ);
+    CPPUNIT_ASSERT(aDocument.Read(aStream));
+
+    // Assert that the XObject in the page resources dictionary is a reference XObject.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    // The document has one page.
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+    vcl::filter::PDFObjectElement* pResources = aPages[0]->LookupObject("Resources");
+    CPPUNIT_ASSERT(pResources);
+    auto pXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pResources->Lookup("XObject"));
+    CPPUNIT_ASSERT(pXObjects);
+    // The page has one image.
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pXObjects->GetItems().size());
+    vcl::filter::PDFObjectElement* pReferenceXObject = pXObjects->LookupObject(pXObjects->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pReferenceXObject);
+    // The image is a reference XObject.
+    // This dictionary key was missing, so the XObject wasn't a reference one.
+    CPPUNIT_ASSERT(pReferenceXObject->Lookup("Ref"));
+}
+
+void PdfExportTest::testTdf106693()
+{
+    vcl::filter::PDFDocument aDocument;
+    load("tdf106693.odt", aDocument);
+
+    // Assert that the XObject in the page resources dictionary is a form XObject.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    // The document has one page.
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+    vcl::filter::PDFObjectElement* pResources = aPages[0]->LookupObject("Resources");
+    CPPUNIT_ASSERT(pResources);
+    auto pXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pResources->Lookup("XObject"));
+    CPPUNIT_ASSERT(pXObjects);
+    // The page has one image.
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pXObjects->GetItems().size());
+    vcl::filter::PDFObjectElement* pXObject = pXObjects->LookupObject(pXObjects->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pXObject);
+    // The image is a form XObject.
+    auto pSubtype = dynamic_cast<vcl::filter::PDFNameElement*>(pXObject->Lookup("Subtype"));
+    CPPUNIT_ASSERT(pSubtype);
+    CPPUNIT_ASSERT_EQUAL(OString("Form"), pSubtype->GetValue());
+    // This failed: UseReferenceXObject was ignored and Ref was always created.
+    CPPUNIT_ASSERT(!pXObject->Lookup("Ref"));
+
+    // Assert that the form object refers to an inner form object, not a
+    // bitmap.
+    auto pInnerResources = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObject->Lookup("Resources"));
+    CPPUNIT_ASSERT(pInnerResources);
+    auto pInnerXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pInnerResources->LookupElement("XObject"));
+    CPPUNIT_ASSERT(pInnerXObjects);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pInnerXObjects->GetItems().size());
+    vcl::filter::PDFObjectElement* pInnerXObject = pInnerXObjects->LookupObject(pInnerXObjects->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pInnerXObject);
+    auto pInnerSubtype = dynamic_cast<vcl::filter::PDFNameElement*>(pInnerXObject->Lookup("Subtype"));
+    CPPUNIT_ASSERT(pInnerSubtype);
+    // This failed: this was Image (bitmap), not Form (vector).
+    CPPUNIT_ASSERT_EQUAL(OString("Form"), pInnerSubtype->GetValue());
+}
+
+void PdfExportTest::testTdf105461()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf105461.odp";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result with pdfium.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    SvMemoryStream aMemory;
+    aMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(FPDF_LoadMemDocument(aMemory.GetData(), aMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+
+    // The document has one page.
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+
+    // Make sure there is a filled rectangle inside.
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    int nYellowPathCount = 0;
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPdfPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        if (FPDFPageObj_GetType(pPdfPageObject) != FPDF_PAGEOBJ_PATH)
+            continue;
+
+        unsigned int nRed = 0, nGreen = 0, nBlue = 0, nAlpha = 0;
+        FPDFPageObj_GetFillColor(pPdfPageObject, &nRed, &nGreen, &nBlue, &nAlpha);
+        if (Color(nRed, nGreen, nBlue) == COL_YELLOW)
+            ++nYellowPathCount;
+    }
+
+    // This was 0, the page contained no yellow paths.
+    CPPUNIT_ASSERT_EQUAL(1, nYellowPathCount);
+}
+
+void PdfExportTest::testTdf107868()
+{
+    // No need to run it on Windows, since it would use GDI printing, and not trigger PDF export
+    // which is the intent of the test.
+// FIXME: Why does this fail on macOS?
+#if !defined MACOSX && !defined _WIN32
+
+    // Import the bugdoc and print to PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf107868.odt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    uno::Reference<view::XPrintable> xPrintable(mxComponent, uno::UNO_QUERY);
+    CPPUNIT_ASSERT(xPrintable.is());
+    uno::Sequence<beans::PropertyValue> aOptions(comphelper::InitPropertySequence(
+    {
+        {"FileName", uno::makeAny(maTempFile.GetURL())},
+        {"Wait", uno::makeAny(true)}
+    }));
+    xPrintable->print(aOptions);
+
+    // Parse the export result with pdfium.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    SvMemoryStream aMemory;
+    aMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(FPDF_LoadMemDocument(aMemory.GetData(), aMemory.GetSize(), /*password=*/nullptr));
+    if (!pPdfDocument)
+        // Printing to PDF failed in a non-interesting way, e.g. CUPS is not
+        // running, there is no printer defined, etc.
+        return;
+
+    // The document has one page.
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+
+    // Make sure there is no filled rectangle inside.
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    int nWhitePathCount = 0;
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPdfPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        if (FPDFPageObj_GetType(pPdfPageObject) != FPDF_PAGEOBJ_PATH)
+            continue;
+
+        unsigned int nRed = 0, nGreen = 0, nBlue = 0, nAlpha = 0;
+        FPDFPageObj_GetFillColor(pPdfPageObject, &nRed, &nGreen, &nBlue, &nAlpha);
+        if (Color(nRed, nGreen, nBlue) == COL_WHITE)
+            ++nWhitePathCount;
+    }
+
+    // This was 4, the page contained 4 white paths at problematic positions.
+    CPPUNIT_ASSERT_EQUAL(0, nWhitePathCount);
+#endif
+}
+
+void PdfExportTest::testTdf105093()
+{
+    vcl::filter::PDFDocument aDocument;
+    load("tdf105093.odp", aDocument);
+
+    // The document has one page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+
+    // Get page annotations.
+    auto pAnnots = dynamic_cast<vcl::filter::PDFArrayElement*>(aPages[0]->Lookup("Annots"));
+    CPPUNIT_ASSERT(pAnnots);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pAnnots->GetElements().size());
+    auto pAnnotReference = dynamic_cast<vcl::filter::PDFReferenceElement*>(pAnnots->GetElements()[0]);
+    CPPUNIT_ASSERT(pAnnotReference);
+    vcl::filter::PDFObjectElement* pAnnot = pAnnotReference->LookupObject();
+    CPPUNIT_ASSERT(pAnnot);
+    CPPUNIT_ASSERT_EQUAL(OString("Annot"), static_cast<vcl::filter::PDFNameElement*>(pAnnot->Lookup("Type"))->GetValue());
+
+    // Get the Action -> Rendition -> MediaClip -> FileSpec.
+    auto pAction = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pAnnot->Lookup("A"));
+    CPPUNIT_ASSERT(pAction);
+    auto pRendition = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pAction->LookupElement("R"));
+    CPPUNIT_ASSERT(pRendition);
+    auto pMediaClip = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pRendition->LookupElement("C"));
+    CPPUNIT_ASSERT(pMediaClip);
+    auto pFileSpec = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pMediaClip->LookupElement("D"));
+    CPPUNIT_ASSERT(pFileSpec);
+    // Make sure the filespec refers to an embedded file.
+    // This key was missing, the embedded video was handled as a linked one.
+    CPPUNIT_ASSERT(pFileSpec->LookupElement("EF"));
+}
+
+void PdfExportTest::testTdf106206()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf106206.odt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result.
+    vcl::filter::PDFDocument aDocument;
+    SvFileStream aStream(maTempFile.GetURL(), StreamMode::READ);
+    CPPUNIT_ASSERT(aDocument.Read(aStream));
+
+    // The document has one page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+
+    // The page has a stream.
+    vcl::filter::PDFObjectElement* pContents = aPages[0]->LookupObject("Contents");
+    CPPUNIT_ASSERT(pContents);
+    vcl::filter::PDFStreamElement* pStream = pContents->GetStream();
+    CPPUNIT_ASSERT(pStream);
+    SvMemoryStream& rObjectStream = pStream->GetMemory();
+    // Uncompress it.
+    SvMemoryStream aUncompressed;
+    ZCodec aZCodec;
+    aZCodec.BeginCompression();
+    rObjectStream.Seek(0);
+    aZCodec.Decompress(rObjectStream, aUncompressed);
+    CPPUNIT_ASSERT(aZCodec.EndCompression());
+
+    // Make sure there is an image reference there.
+    OString aImage("/Im");
+    auto pStart = static_cast<const char*>(aUncompressed.GetData());
+    const char* pEnd = pStart + aUncompressed.GetSize();
+    auto it = std::search(pStart, pEnd, aImage.getStr(), aImage.getStr() + aImage.getLength());
+    CPPUNIT_ASSERT(it != pEnd);
+
+    // And also that it's not an invalid one.
+    OString aInvalidImage("/Im0");
+    it = std::search(pStart, pEnd, aInvalidImage.getStr(), aInvalidImage.getStr() + aInvalidImage.getLength());
+    // This failed, object #0 was referenced.
+    CPPUNIT_ASSERT(bool(it == pEnd));
+}
+
+void PdfExportTest::testTdf109143()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf109143.odt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result.
+    vcl::filter::PDFDocument aDocument;
+    SvFileStream aStream(maTempFile.GetURL(), StreamMode::READ);
+    CPPUNIT_ASSERT(aDocument.Read(aStream));
+
+    // The document has one page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+
+    // Get access to the only image on the only page.
+    vcl::filter::PDFObjectElement* pResources = aPages[0]->LookupObject("Resources");
+    CPPUNIT_ASSERT(pResources);
+    auto pXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pResources->Lookup("XObject"));
+    CPPUNIT_ASSERT(pXObjects);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pXObjects->GetItems().size());
+    vcl::filter::PDFObjectElement* pXObject = pXObjects->LookupObject(pXObjects->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pXObject);
+
+    // Make sure it's re-compressed.
+    auto pLength = dynamic_cast<vcl::filter::PDFNumberElement*>(pXObject->Lookup("Length"));
+    CPPUNIT_ASSERT(pLength);
+    int nLength = pLength->GetValue();
+    // This failed: cropped TIFF-in-JPEG wasn't re-compressed, so crop was
+    // lost. Size was 59416, now is 11827.
+    CPPUNIT_ASSERT(nLength < 50000);
+}
+
+void PdfExportTest::testTdf106972()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf106972.odt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result.
+    vcl::filter::PDFDocument aDocument;
+    SvFileStream aStream(maTempFile.GetURL(), StreamMode::READ);
+    CPPUNIT_ASSERT(aDocument.Read(aStream));
+
+    // Get access to the only form object on the only page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+    vcl::filter::PDFObjectElement* pResources = aPages[0]->LookupObject("Resources");
+    CPPUNIT_ASSERT(pResources);
+    auto pXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pResources->Lookup("XObject"));
+    CPPUNIT_ASSERT(pXObjects);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pXObjects->GetItems().size());
+    vcl::filter::PDFObjectElement* pXObject = pXObjects->LookupObject(pXObjects->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pXObject);
+
+    // Get access to the only image inside the form object.
+    auto pFormResources = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObject->Lookup("Resources"));
+    CPPUNIT_ASSERT(pFormResources);
+    auto pImages = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pFormResources->LookupElement("XObject"));
+    CPPUNIT_ASSERT(pImages);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pImages->GetItems().size());
+    vcl::filter::PDFObjectElement* pImage = pImages->LookupObject(pImages->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pImage);
+
+    // Assert resources of the image.
+    auto pImageResources = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pImage->Lookup("Resources"));
+    CPPUNIT_ASSERT(pImageResources);
+    // This failed: the PDF image had no Font resource.
+    CPPUNIT_ASSERT(pImageResources->LookupElement("Font"));
+}
+
+void PdfExportTest::testTdf106972Pdf17()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf106972-pdf17.odt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result.
+    vcl::filter::PDFDocument aDocument;
+    SvFileStream aStream(maTempFile.GetURL(), StreamMode::READ);
+    CPPUNIT_ASSERT(aDocument.Read(aStream));
+
+    // Get access to the only image on the only page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+    vcl::filter::PDFObjectElement* pResources = aPages[0]->LookupObject("Resources");
+    CPPUNIT_ASSERT(pResources);
+    auto pXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pResources->Lookup("XObject"));
+    CPPUNIT_ASSERT(pXObjects);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pXObjects->GetItems().size());
+    vcl::filter::PDFObjectElement* pXObject = pXObjects->LookupObject(pXObjects->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pXObject);
+
+    // Assert that we now attempt to preserve the original PDF data, even if
+    // the original input was PDF >= 1.4.
+    CPPUNIT_ASSERT(pXObject->Lookup("Resources"));
+}
+
+void PdfExportTest::testSofthyphenPos()
+{
+    // No need to run it on Windows, since it would use GDI printing, and not trigger PDF export
+    // which is the intent of the test.
+// FIXME: Why does this fail on macOS?
+#if !defined MACOSX && !defined _WIN32
+
+    // Import the bugdoc and print to PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "softhyphen_pdf.odt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    uno::Reference<view::XPrintable> xPrintable(mxComponent, uno::UNO_QUERY);
+    CPPUNIT_ASSERT(xPrintable.is());
+    uno::Sequence<beans::PropertyValue> aOptions(comphelper::InitPropertySequence(
+    {
+        {"FileName", uno::makeAny(maTempFile.GetURL())},
+        {"Wait", uno::makeAny(true)}
+    }));
+    xPrintable->print(aOptions);
+
+    // Parse the export result with pdfium.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    SvMemoryStream aMemory;
+    aMemory.WriteStream(aFile);
+    if (aFile.bad() || !aMemory.GetSize())
+    {
+        // Printing to PDF failed in a non-interesting way, e.g. CUPS is not
+        // running, there is no printer defined, etc.
+        return;
+    }
+    DocumentHolder pPdfDocument(FPDF_LoadMemDocument(aMemory.GetData(), aMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument);
+
+    // The document has one page.
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+
+    // tdf#96892 incorrect fractional part of font size caused soft-hyphen to
+    // be positioned inside preceding text (incorrect = 11.1, correct = 11.05)
+
+    // there are 3 texts currently, for line 1, soft-hyphen, line 2
+    bool haveText(false);
+
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPdfPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        CPPUNIT_ASSERT_EQUAL(FPDF_PAGEOBJ_TEXT, FPDFPageObj_GetType(pPdfPageObject));
+        haveText = true;
+        double const size(FPDFTextObj_GetFontSize(pPdfPageObject));
+        CPPUNIT_ASSERT_DOUBLES_EQUAL(11.05, size, 1E-06);
+    }
+
+    CPPUNIT_ASSERT(haveText);
+#endif
+}
+
+void PdfExportTest::testTdf107013()
+{
+    vcl::filter::PDFDocument aDocument;
+    load("tdf107013.odt", aDocument);
+
+    // Get access to the only image on the only page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+    vcl::filter::PDFObjectElement* pResources = aPages[0]->LookupObject("Resources");
+    CPPUNIT_ASSERT(pResources);
+    auto pXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pResources->Lookup("XObject"));
+    CPPUNIT_ASSERT(pXObjects);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pXObjects->GetItems().size());
+    vcl::filter::PDFObjectElement* pXObject = pXObjects->LookupObject(pXObjects->GetItems().begin()->first);
+    // This failed, the reference to the image was created, but not the image.
+    CPPUNIT_ASSERT(pXObject);
+}
+
+void PdfExportTest::testTdf107018()
+{
+    vcl::filter::PDFDocument aDocument;
+    load("tdf107018.odt", aDocument);
+
+    // Get access to the only image on the only page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+    vcl::filter::PDFObjectElement* pResources = aPages[0]->LookupObject("Resources");
+    CPPUNIT_ASSERT(pResources);
+    auto pXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pResources->Lookup("XObject"));
+    CPPUNIT_ASSERT(pXObjects);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pXObjects->GetItems().size());
+    vcl::filter::PDFObjectElement* pXObject = pXObjects->LookupObject(pXObjects->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pXObject);
+
+    // Get access to the form object inside the image.
+    auto pXObjectResources = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObject->Lookup("Resources"));
+    CPPUNIT_ASSERT(pXObjectResources);
+    auto pXObjectForms = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObjectResources->LookupElement("XObject"));
+    CPPUNIT_ASSERT(pXObjectForms);
+    vcl::filter::PDFObjectElement* pForm = pXObjectForms->LookupObject(pXObjectForms->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pForm);
+
+    // Get access to Resources -> Font -> F1 of the form.
+    auto pFormResources = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pForm->Lookup("Resources"));
+    CPPUNIT_ASSERT(pFormResources);
+    auto pFonts = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pFormResources->LookupElement("Font"));
+    CPPUNIT_ASSERT(pFonts);
+    auto pF1Ref = dynamic_cast<vcl::filter::PDFReferenceElement*>(pFonts->LookupElement("F1"));
+    CPPUNIT_ASSERT(pF1Ref);
+    vcl::filter::PDFObjectElement* pF1 = pF1Ref->LookupObject();
+    CPPUNIT_ASSERT(pF1);
+
+    // Check that Foo -> Bar of the font is of type Pages.
+    auto pFontFoo = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pF1->Lookup("Foo"));
+    CPPUNIT_ASSERT(pFontFoo);
+    auto pBar = dynamic_cast<vcl::filter::PDFReferenceElement*>(pFontFoo->LookupElement("Bar"));
+    CPPUNIT_ASSERT(pBar);
+    vcl::filter::PDFObjectElement* pObject = pBar->LookupObject();
+    CPPUNIT_ASSERT(pObject);
+    auto pName = dynamic_cast<vcl::filter::PDFNameElement*>(pObject->Lookup("Type"));
+    CPPUNIT_ASSERT(pName);
+    // This was "XObject", reference in a nested dictionary wasn't updated when
+    // copying the page stream of a PDF image.
+    CPPUNIT_ASSERT_EQUAL(OString("Pages"), pName->GetValue());
+}
+
+void PdfExportTest::testTdf107089()
+{
+    vcl::filter::PDFDocument aDocument;
+    load("tdf107089.odt", aDocument);
+
+    // Get access to the only image on the only page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+    vcl::filter::PDFObjectElement* pResources = aPages[0]->LookupObject("Resources");
+    CPPUNIT_ASSERT(pResources);
+    auto pXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pResources->Lookup("XObject"));
+    CPPUNIT_ASSERT(pXObjects);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pXObjects->GetItems().size());
+    vcl::filter::PDFObjectElement* pXObject = pXObjects->LookupObject(pXObjects->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pXObject);
+
+    // Get access to the form object inside the image.
+    auto pXObjectResources = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObject->Lookup("Resources"));
+    CPPUNIT_ASSERT(pXObjectResources);
+    auto pXObjectForms = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObjectResources->LookupElement("XObject"));
+    CPPUNIT_ASSERT(pXObjectForms);
+    vcl::filter::PDFObjectElement* pForm = pXObjectForms->LookupObject(pXObjectForms->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pForm);
+
+    // Make sure 'Hello' is part of the form object's stream.
+    vcl::filter::PDFStreamElement* pStream = pForm->GetStream();
+    CPPUNIT_ASSERT(pStream);
+    SvMemoryStream aObjectStream;
+    ZCodec aZCodec;
+    aZCodec.BeginCompression();
+    pStream->GetMemory().Seek(0);
+    aZCodec.Decompress(pStream->GetMemory(), aObjectStream);
+    CPPUNIT_ASSERT(aZCodec.EndCompression());
+    aObjectStream.Seek(0);
+    OString aHello("Hello");
+    auto pStart = static_cast<const char*>(aObjectStream.GetData());
+    const char* pEnd = pStart + aObjectStream.GetSize();
+    auto it = std::search(pStart, pEnd, aHello.getStr(), aHello.getStr() + aHello.getLength());
+    // This failed, 'Hello' was part only a mixed compressed/uncompressed stream, i.e. garbage.
+    CPPUNIT_ASSERT(it != pEnd);
+}
+
+void PdfExportTest::testTdf99680()
+{
+    vcl::filter::PDFDocument aDocument;
+    load("tdf99680.odt", aDocument);
+
+    // The document has one page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+
+    // The page 1 has a stream.
+    vcl::filter::PDFObjectElement* pContents = aPages[0]->LookupObject("Contents");
+    CPPUNIT_ASSERT(pContents);
+    vcl::filter::PDFStreamElement* pStream = pContents->GetStream();
+    CPPUNIT_ASSERT(pStream);
+    SvMemoryStream& rObjectStream = pStream->GetMemory();
+
+    // Uncompress it.
+    SvMemoryStream aUncompressed;
+    ZCodec aZCodec;
+    aZCodec.BeginCompression();
+    rObjectStream.Seek(0);
+    aZCodec.Decompress(rObjectStream, aUncompressed);
+    CPPUNIT_ASSERT(aZCodec.EndCompression());
+
+    // tdf#130150 See infos in task - short: tdf#99680 was not the
+    // correct fix, so empty clip regions are valid - allow again in tests
+    //      Make sure there are no empty clipping regions.
+    //      OString aEmptyRegion("0 0 m h W* n");
+    //      auto it = std::search(pStart, pEnd, aEmptyRegion.getStr(), aEmptyRegion.getStr() + aEmptyRegion.getLength());
+    //      CPPUNIT_ASSERT_EQUAL_MESSAGE("Empty clipping region detected!", it, pEnd);
+
+    // Count save graphic state (q) and restore (Q) operators
+    // and ensure their amount is equal
+    auto pStart = static_cast<const char*>(aUncompressed.GetData());
+    const char* pEnd = pStart + aUncompressed.GetSize();
+    size_t nSaveCount = std::count(pStart, pEnd, 'q');
+    size_t nRestoreCount = std::count(pStart, pEnd, 'Q');
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("Save/restore graphic state operators count mismatch!", nSaveCount, nRestoreCount);
+}
+
+void PdfExportTest::testTdf99680_2()
+{
+    vcl::filter::PDFDocument aDocument;
+    load("tdf99680-2.odt", aDocument);
+
+    // For each document page
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(3), aPages.size());
+    for (size_t nPageNr = 0; nPageNr < aPages.size(); nPageNr++)
+    {
+        // Get page contents and stream.
+        vcl::filter::PDFObjectElement* pContents = aPages[nPageNr]->LookupObject("Contents");
+        CPPUNIT_ASSERT(pContents);
+        vcl::filter::PDFStreamElement* pStream = pContents->GetStream();
+        CPPUNIT_ASSERT(pStream);
+        SvMemoryStream& rObjectStream = pStream->GetMemory();
+
+        // Uncompress the stream.
+        SvMemoryStream aUncompressed;
+        ZCodec aZCodec;
+        aZCodec.BeginCompression();
+        rObjectStream.Seek(0);
+        aZCodec.Decompress(rObjectStream, aUncompressed);
+        CPPUNIT_ASSERT(aZCodec.EndCompression());
+
+        // tdf#130150 See infos in task - short: tdf#99680 was not the
+        // correct fix, so empty clip regions are valid - allow again in tests
+        //      Make sure there are no empty clipping regions.
+        //      OString aEmptyRegion("0 0 m h W* n");
+        //      auto it = std::search(pStart, pEnd, aEmptyRegion.getStr(), aEmptyRegion.getStr() + aEmptyRegion.getLength());
+        //      CPPUNIT_ASSERT_EQUAL_MESSAGE("Empty clipping region detected!", it, pEnd);
+
+        // Count save graphic state (q) and restore (Q) operators
+        // and ensure their amount is equal
+        auto pStart = static_cast<const char*>(aUncompressed.GetData());
+        const char* pEnd = pStart + aUncompressed.GetSize();
+        size_t nSaveCount = std::count(pStart, pEnd, 'q');
+        size_t nRestoreCount = std::count(pStart, pEnd, 'Q');
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Save/restore graphic state operators count mismatch!", nSaveCount, nRestoreCount);
+    }
+}
+
+void PdfExportTest::testTdf108963()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf108963.odp";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result with pdfium.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    SvMemoryStream aMemory;
+    aMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(FPDF_LoadMemDocument(aMemory.GetData(), aMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+
+    // The document has one page.
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+
+    // FIXME: strangely this fails on some Win systems after a pdfium update, expected: 793.7; actual: 793
+#if !defined _WIN32
+    // Test page size (28x15.75 cm, was 1/100th mm off, tdf#112690)
+    // bad: MediaBox[0 0 793.672440944882 446.428346456693]
+    // good: MediaBox[0 0 793.700787401575 446.456692913386]
+    const double aWidth = FPDF_GetPageWidth(pPdfPage.get());
+    CPPUNIT_ASSERT_DOUBLES_EQUAL(793.7, aWidth, 0.01);
+    const double aHeight = FPDF_GetPageHeight(pPdfPage.get());
+    CPPUNIT_ASSERT_DOUBLES_EQUAL(446.46, aHeight, 0.01);
+
+    // Make sure there is a filled rectangle inside.
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    int nYellowPathCount = 0;
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPdfPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        if (FPDFPageObj_GetType(pPdfPageObject) != FPDF_PAGEOBJ_PATH)
+            continue;
+
+        unsigned int nRed = 0, nGreen = 0, nBlue = 0, nAlpha = 0;
+        FPDFPageObj_GetFillColor(pPdfPageObject, &nRed, &nGreen, &nBlue, &nAlpha);
+        if (Color(nRed, nGreen, nBlue) == COL_YELLOW)
+        {
+            ++nYellowPathCount;
+            // The path described a yellow rectangle, but it was not rotated.
+            int nSegments = FPDFPath_CountSegments(pPdfPageObject);
+            CPPUNIT_ASSERT_EQUAL(5, nSegments);
+            FPDF_PATHSEGMENT pSegment = FPDFPath_GetPathSegment(pPdfPageObject, 0);
+            CPPUNIT_ASSERT_EQUAL(FPDF_SEGMENT_MOVETO, FPDFPathSegment_GetType(pSegment));
+            float fX = 0;
+            float fY = 0;
+            FPDFPathSegment_GetPoint(pSegment, &fX, &fY);
+            CPPUNIT_ASSERT_EQUAL(245395, static_cast<int>(round(fX * 1000)));
+            CPPUNIT_ASSERT_EQUAL(244261, static_cast<int>(round(fY * 1000)));
+            CPPUNIT_ASSERT(!FPDFPathSegment_GetClose(pSegment));
+
+            pSegment = FPDFPath_GetPathSegment(pPdfPageObject, 1);
+            CPPUNIT_ASSERT_EQUAL(FPDF_SEGMENT_LINETO, FPDFPathSegment_GetType(pSegment));
+            FPDFPathSegment_GetPoint(pSegment, &fX, &fY);
+            CPPUNIT_ASSERT_EQUAL(275102, static_cast<int>(round(fX * 1000)));
+            CPPUNIT_ASSERT_EQUAL(267618, static_cast<int>(round(fY * 1000)));
+            CPPUNIT_ASSERT(!FPDFPathSegment_GetClose(pSegment));
+
+            pSegment = FPDFPath_GetPathSegment(pPdfPageObject, 2);
+            CPPUNIT_ASSERT_EQUAL(FPDF_SEGMENT_LINETO, FPDFPathSegment_GetType(pSegment));
+            FPDFPathSegment_GetPoint(pSegment, &fX, &fY);
+            CPPUNIT_ASSERT_EQUAL(287518, static_cast<int>(round(fX * 1000)));
+            CPPUNIT_ASSERT_EQUAL(251829, static_cast<int>(round(fY * 1000)));
+            CPPUNIT_ASSERT(!FPDFPathSegment_GetClose(pSegment));
+
+            pSegment = FPDFPath_GetPathSegment(pPdfPageObject, 3);
+            CPPUNIT_ASSERT_EQUAL(FPDF_SEGMENT_LINETO, FPDFPathSegment_GetType(pSegment));
+            FPDFPathSegment_GetPoint(pSegment, &fX, &fY);
+            CPPUNIT_ASSERT_EQUAL(257839, static_cast<int>(round(fX * 1000)));
+            CPPUNIT_ASSERT_EQUAL(228472, static_cast<int>(round(fY * 1000)));
+            CPPUNIT_ASSERT(!FPDFPathSegment_GetClose(pSegment));
+
+            pSegment = FPDFPath_GetPathSegment(pPdfPageObject, 4);
+            CPPUNIT_ASSERT_EQUAL(FPDF_SEGMENT_LINETO, FPDFPathSegment_GetType(pSegment));
+            FPDFPathSegment_GetPoint(pSegment, &fX, &fY);
+            CPPUNIT_ASSERT_EQUAL(245395, static_cast<int>(round(fX * 1000)));
+            CPPUNIT_ASSERT_EQUAL(244261, static_cast<int>(round(fY * 1000)));
+            CPPUNIT_ASSERT(FPDFPathSegment_GetClose(pSegment));
+        }
+    }
+
+    CPPUNIT_ASSERT_EQUAL(1, nYellowPathCount);
+#endif
+}
+
+void PdfExportTest::testTdf118244_radioButtonGroup()
+{
+    vcl::filter::PDFDocument aDocument;
+    load("tdf118244_radioButtonGroup.odt", aDocument);
+
+    // The document has one page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+
+    // There are eight radio buttons.
+    auto pAnnots = dynamic_cast<vcl::filter::PDFArrayElement*>(aPages[0]->Lookup("Annots"));
+    CPPUNIT_ASSERT(pAnnots);
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("# of radio buttons",static_cast<size_t>(8), pAnnots->GetElements().size());
+
+    sal_uInt32 nRadioGroups = 0;
+    for ( const auto& aElement : aDocument.GetElements() )
+    {
+        auto pObject = dynamic_cast<vcl::filter::PDFObjectElement*>(aElement.get());
+        if ( !pObject )
+            continue;
+        auto pType = dynamic_cast<vcl::filter::PDFNameElement*>(pObject->Lookup("FT"));
+        if ( pType && pType->GetValue() == "Btn" )
+        {
+            auto pKids = dynamic_cast<vcl::filter::PDFArrayElement*>(pObject->Lookup("Kids"));
+            if ( pKids )
+            {
+                size_t expectedSize = 2;
+                ++nRadioGroups;
+                if ( nRadioGroups == 3 )
+                    expectedSize = 3;
+                CPPUNIT_ASSERT_EQUAL(expectedSize, pKids->GetElements().size());
+            }
+        }
+    }
+    CPPUNIT_ASSERT_EQUAL_MESSAGE("# of radio groups", sal_uInt32(3), nRadioGroups);
+}
+
+// This requires Carlito font, if it is missing the test will most likely
+// fail.
+void PdfExportTest::testTdf115117_1()
+{
+#if HAVE_MORE_FONTS
+    vcl::filter::PDFDocument aDocument;
+    load("tdf115117-1.odt", aDocument);
+
+    vcl::filter::PDFObjectElement* pToUnicode = nullptr;
+
+    // Get access to ToUnicode of the first font
+    for (const auto& aElement : aDocument.GetElements())
+    {
+        auto pObject = dynamic_cast<vcl::filter::PDFObjectElement*>(aElement.get());
+        if (!pObject)
+            continue;
+        auto pType = dynamic_cast<vcl::filter::PDFNameElement*>(pObject->Lookup("Type"));
+        if (pType && pType->GetValue() == "Font")
+        {
+            auto pToUnicodeRef = dynamic_cast<vcl::filter::PDFReferenceElement*>(pObject->Lookup("ToUnicode"));
+            CPPUNIT_ASSERT(pToUnicodeRef);
+            pToUnicode = pToUnicodeRef->LookupObject();
+            break;
+        }
+    }
+
+    CPPUNIT_ASSERT(pToUnicode);
+    auto pStream = pToUnicode->GetStream();
+    CPPUNIT_ASSERT(pStream);
+    SvMemoryStream aObjectStream;
+    ZCodec aZCodec;
+    aZCodec.BeginCompression();
+    pStream->GetMemory().Seek(0);
+    aZCodec.Decompress(pStream->GetMemory(), aObjectStream);
+    CPPUNIT_ASSERT(aZCodec.EndCompression());
+    aObjectStream.Seek(0);
+    // The first values, <01> <02> etc., are glyph ids, they might change order
+    // if we changed how font subsets are created.
+    // The second values, <00740069> etc., are Unicode code points in hex,
+    // <00740069> is U+0074 and U+0069 i.e. "ti" which is a ligature in
+    // Carlito/Calibri. This test is failing if any of the second values
+    // changed which means we are not detecting ligatures and writing CMAP
+    // entries for them correctly. If glyph order in the subset changes then
+    // the order here will changes and the PDF has to be carefully inspected to
+    // ensure that the new values are correct before updating the string below.
+    OString aCmap("9 beginbfchar\n"
+                  "<01> <00740069>\n"
+                  "<02> <0020>\n"
+                  "<03> <0074>\n"
+                  "<04> <0065>\n"
+                  "<05> <0073>\n"
+                  "<06> <00660069>\n"
+                  "<07> <0066006C>\n"
+                  "<08> <006600660069>\n"
+                  "<09> <00660066006C>\n"
+                  "endbfchar");
+    auto pStart = static_cast<const char*>(aObjectStream.GetData());
+    const char* pEnd = pStart + aObjectStream.GetSize();
+    auto it = std::search(pStart, pEnd, aCmap.getStr(), aCmap.getStr() + aCmap.getLength());
+    CPPUNIT_ASSERT(it != pEnd);
+#endif
+}
+
+// This requires DejaVu Sans font, if it is missing the test will most likely
+// fail.
+void PdfExportTest::testTdf115117_2()
+{
+#if HAVE_MORE_FONTS
+    // See the comments in testTdf115117_1() for explanation.
+
+    vcl::filter::PDFDocument aDocument;
+    load("tdf115117-2.odt", aDocument);
+
+    vcl::filter::PDFObjectElement* pToUnicode = nullptr;
+
+    for (const auto& aElement : aDocument.GetElements())
+    {
+        auto pObject = dynamic_cast<vcl::filter::PDFObjectElement*>(aElement.get());
+        if (!pObject)
+            continue;
+        auto pType = dynamic_cast<vcl::filter::PDFNameElement*>(pObject->Lookup("Type"));
+        if (pType && pType->GetValue() == "Font")
+        {
+            auto pToUnicodeRef = dynamic_cast<vcl::filter::PDFReferenceElement*>(pObject->Lookup("ToUnicode"));
+            CPPUNIT_ASSERT(pToUnicodeRef);
+            pToUnicode = pToUnicodeRef->LookupObject();
+            break;
+        }
+    }
+
+    CPPUNIT_ASSERT(pToUnicode);
+    auto pStream = pToUnicode->GetStream();
+    CPPUNIT_ASSERT(pStream);
+    SvMemoryStream aObjectStream;
+    ZCodec aZCodec;
+    aZCodec.BeginCompression();
+    pStream->GetMemory().Seek(0);
+    aZCodec.Decompress(pStream->GetMemory(), aObjectStream);
+    CPPUNIT_ASSERT(aZCodec.EndCompression());
+    aObjectStream.Seek(0);
+    OString aCmap("7 beginbfchar\n"
+                  "<01> <06440627>\n"
+                  "<02> <0020>\n"
+                  "<03> <0641>\n"
+                  "<04> <0642>\n"
+                  "<05> <0648>\n"
+                  "<06> <06440627>\n"
+                  "<07> <0628>\n"
+                  "endbfchar");
+    auto pStart = static_cast<const char*>(aObjectStream.GetData());
+    const char* pEnd = pStart + aObjectStream.GetSize();
+    auto it = std::search(pStart, pEnd, aCmap.getStr(), aCmap.getStr() + aCmap.getLength());
+    CPPUNIT_ASSERT(it != pEnd);
+#endif
+}
+
+void PdfExportTest::testTdf115117_1a()
+{
+#if HAVE_MORE_FONTS
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf115117-1.odt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result with pdfium.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    SvMemoryStream aMemory;
+    aMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(FPDF_LoadMemDocument(aMemory.GetData(), aMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+
+    // The document has one page.
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+
+    auto pPdfTextPage = FPDFText_LoadPage(pPdfPage.get());
+    CPPUNIT_ASSERT(pPdfTextPage);
+
+    // Extract the text from the page. This pdfium API is a bit higher level
+    // than we want and might apply heuristic that give false positive, but it
+    // is a good approximation in addition to the check in testTdf115117_1().
+    int nChars = FPDFText_CountChars(pPdfTextPage);
+    CPPUNIT_ASSERT_EQUAL(44, nChars);
+
+    OUString aExpectedText = "ti ti test ti\r\nti test fi fl ffi ffl test fi";
+    std::vector<sal_uInt32> aChars(nChars);
+    for (int i = 0; i < nChars; i++)
+        aChars[i] = FPDFText_GetUnicode(pPdfTextPage, i);
+    OUString aActualText(aChars.data(), aChars.size());
+    CPPUNIT_ASSERT_EQUAL(aExpectedText, aActualText);
+
+    FPDFText_ClosePage(pPdfTextPage);
+#endif
+}
+
+void PdfExportTest::testTdf115117_2a()
+{
+#if HAVE_MORE_FONTS
+    // See the comments in testTdf115117_1a() for explanation.
+
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf115117-2.odt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result with pdfium.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    SvMemoryStream aMemory;
+    aMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(FPDF_LoadMemDocument(aMemory.GetData(), aMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+
+    // The document has one page.
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+
+    auto pPdfTextPage = FPDFText_LoadPage(pPdfPage.get());
+    CPPUNIT_ASSERT(pPdfTextPage);
+
+    int nChars = FPDFText_CountChars(pPdfTextPage);
+    CPPUNIT_ASSERT_EQUAL(13, nChars);
+
+    OUString aExpectedText = u"\u0627\u0644 \u0628\u0627\u0644 \u0648\u0642\u0641 \u0627\u0644";
+    std::vector<sal_uInt32> aChars(nChars);
+    for (int i = 0; i < nChars; i++)
+        aChars[i] = FPDFText_GetUnicode(pPdfTextPage, i);
+    OUString aActualText(aChars.data(), aChars.size());
+    CPPUNIT_ASSERT_EQUAL(aExpectedText, aActualText);
+
+    FPDFText_ClosePage(pPdfTextPage);
+#endif
+}
+
+void PdfExportTest::testTdf66597_1()
+{
+#if HAVE_MORE_FONTS
+    // This requires Amiri font, if it is missing the test will fail.
+    vcl::filter::PDFDocument aDocument;
+    load("tdf66597-1.odt", aDocument);
+
+    {
+        // Get access to ToUnicode of the first font
+        vcl::filter::PDFObjectElement* pToUnicode = nullptr;
+        for (const auto& aElement : aDocument.GetElements())
+        {
+            auto pObject = dynamic_cast<vcl::filter::PDFObjectElement*>(aElement.get());
+            if (!pObject)
+                continue;
+            auto pType = dynamic_cast<vcl::filter::PDFNameElement*>(pObject->Lookup("Type"));
+            if (pType && pType->GetValue() == "Font")
+            {
+                auto pName = dynamic_cast<vcl::filter::PDFNameElement*>(pObject->Lookup("BaseFont"));
+                auto aName = pName->GetValue().copy(7); // skip the subset id
+                CPPUNIT_ASSERT_EQUAL_MESSAGE("Unexpected font name", OString("Amiri-Regular"), aName);
+
+                auto pToUnicodeRef = dynamic_cast<vcl::filter::PDFReferenceElement*>(pObject->Lookup("ToUnicode"));
+                CPPUNIT_ASSERT(pToUnicodeRef);
+                pToUnicode = pToUnicodeRef->LookupObject();
+                break;
+            }
+        }
+
+        CPPUNIT_ASSERT(pToUnicode);
+        auto pStream = pToUnicode->GetStream();
+        CPPUNIT_ASSERT(pStream);
+        SvMemoryStream aObjectStream;
+        ZCodec aZCodec;
+        aZCodec.BeginCompression();
+        pStream->GetMemory().Seek(0);
+        aZCodec.Decompress(pStream->GetMemory(), aObjectStream);
+        CPPUNIT_ASSERT(aZCodec.EndCompression());
+        aObjectStream.Seek(0);
+        // The <01> is glyph id, <0020> is code point.
+        // The document has three characters <space><nbspace><space>, but the font
+        // reuses the same glyph for space and nbspace so we should have a single
+        // CMAP entry for the space, and nbspace will be handled with ActualText
+        // (tested above).
+        std::string aCmap("1 beginbfchar\n"
+                          "<01> <0020>\n"
+                          "endbfchar");
+        std::string aData(static_cast<const char*>(aObjectStream.GetData()), aObjectStream.GetSize());
+        auto nPos = aData.find(aCmap);
+        CPPUNIT_ASSERT(nPos != std::string::npos);
+    }
+
+    {
+        auto aPages = aDocument.GetPages();
+        CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+        // Get page contents and stream.
+        auto pContents = aPages[0]->LookupObject("Contents");
+        CPPUNIT_ASSERT(pContents);
+        auto pStream = pContents->GetStream();
+        CPPUNIT_ASSERT(pStream);
+        auto& rObjectStream = pStream->GetMemory();
+
+        // Uncompress the stream.
+        SvMemoryStream aUncompressed;
+        ZCodec aZCodec;
+        aZCodec.BeginCompression();
+        rObjectStream.Seek(0);
+        aZCodec.Decompress(rObjectStream, aUncompressed);
+        CPPUNIT_ASSERT(aZCodec.EndCompression());
+
+        // Make sure the expected ActualText is present.
+        std::string aData(static_cast<const char*>(aUncompressed.GetData()), aUncompressed.GetSize());
+
+        std::string aActualText("/Span<</ActualText<");
+        size_t nCount = 0;
+        size_t nPos = 0;
+        while ((nPos = aData.find(aActualText, nPos)) != std::string::npos)
+        {
+            nCount++;
+            nPos += aActualText.length();
+        }
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("The should be one ActualText entry!", static_cast<size_t>(1), nCount);
+
+        aActualText = "/Span<</ActualText<FEFF00A0>>>";
+        nPos = aData.find(aActualText);
+        CPPUNIT_ASSERT_MESSAGE("ActualText not found!", nPos != std::string::npos);
+    }
+#endif
+}
+
+// This requires Reem Kufi font, if it is missing the test will fail.
+void PdfExportTest::testTdf66597_2()
+{
+#if HAVE_MORE_FONTS
+    vcl::filter::PDFDocument aDocument;
+    load("tdf66597-2.odt", aDocument);
+
+    {
+        // Get access to ToUnicode of the first font
+        vcl::filter::PDFObjectElement* pToUnicode = nullptr;
+        for (const auto& aElement : aDocument.GetElements())
+        {
+            auto pObject = dynamic_cast<vcl::filter::PDFObjectElement*>(aElement.get());
+            if (!pObject)
+                continue;
+            auto pType = dynamic_cast<vcl::filter::PDFNameElement*>(pObject->Lookup("Type"));
+            if (pType && pType->GetValue() == "Font")
+            {
+                auto pName = dynamic_cast<vcl::filter::PDFNameElement*>(pObject->Lookup("BaseFont"));
+                auto aName = pName->GetValue().copy(7); // skip the subset id
+                CPPUNIT_ASSERT_EQUAL_MESSAGE("Unexpected font name", OString("ReemKufi-Regular"), aName);
+
+                auto pToUnicodeRef = dynamic_cast<vcl::filter::PDFReferenceElement*>(pObject->Lookup("ToUnicode"));
+                CPPUNIT_ASSERT(pToUnicodeRef);
+                pToUnicode = pToUnicodeRef->LookupObject();
+                break;
+            }
+        }
+
+        CPPUNIT_ASSERT(pToUnicode);
+        auto pStream = pToUnicode->GetStream();
+        CPPUNIT_ASSERT(pStream);
+        SvMemoryStream aObjectStream;
+        ZCodec aZCodec;
+        aZCodec.BeginCompression();
+        pStream->GetMemory().Seek(0);
+        aZCodec.Decompress(pStream->GetMemory(), aObjectStream);
+        CPPUNIT_ASSERT(aZCodec.EndCompression());
+        aObjectStream.Seek(0);
+        std::string aCmap("8 beginbfchar\n"
+                          "<02> <0632>\n"
+                          "<03> <0020>\n"
+                          "<04> <0648>\n"
+                          "<05> <0647>\n"
+                          "<06> <062F>\n"
+                          "<08> <062C>\n"
+                          "<09> <0628>\n"
+                          "<0B> <0623>\n"
+                          "endbfchar");
+        std::string aData(static_cast<const char*>(aObjectStream.GetData()), aObjectStream.GetSize());
+        auto nPos = aData.find(aCmap);
+        CPPUNIT_ASSERT(nPos != std::string::npos);
+    }
+
+    {
+        auto aPages = aDocument.GetPages();
+        CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+        // Get page contents and stream.
+        auto pContents = aPages[0]->LookupObject("Contents");
+        CPPUNIT_ASSERT(pContents);
+        auto pStream = pContents->GetStream();
+        CPPUNIT_ASSERT(pStream);
+        auto& rObjectStream = pStream->GetMemory();
+
+        // Uncompress the stream.
+        SvMemoryStream aUncompressed;
+        ZCodec aZCodec;
+        aZCodec.BeginCompression();
+        rObjectStream.Seek(0);
+        aZCodec.Decompress(rObjectStream, aUncompressed);
+        CPPUNIT_ASSERT(aZCodec.EndCompression());
+
+        // Make sure the expected ActualText is present.
+        std::string aData(static_cast<const char*>(aUncompressed.GetData()), aUncompressed.GetSize());
+
+        std::vector<std::string> aCodes({ "0632", "062C", "0628", "0623" });
+        std::string aActualText("/Span<</ActualText<");
+        size_t nCount = 0;
+        size_t nPos = 0;
+        while ((nPos = aData.find(aActualText, nPos)) != std::string::npos)
+        {
+            nCount++;
+            nPos += aActualText.length();
+        }
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Number of ActualText entries does not match!", aCodes.size(), nCount);
+
+        for (const auto& aCode : aCodes)
+        {
+            aActualText = "/Span<</ActualText<FEFF" + aCode + ">>>";
+            nPos = aData.find(aActualText);
+            CPPUNIT_ASSERT_MESSAGE("ActualText not found for " + aCode, nPos != std::string::npos);
+        }
+    }
+#endif
+}
+
+// This requires Gentium Basic font, if it is missing the test will fail.
+void PdfExportTest::testTdf66597_3()
+{
+#if HAVE_MORE_FONTS
+    vcl::filter::PDFDocument aDocument;
+    load("tdf66597-3.odt", aDocument);
+
+    {
+        // Get access to ToUnicode of the first font
+        vcl::filter::PDFObjectElement* pToUnicode = nullptr;
+        for (const auto& aElement : aDocument.GetElements())
+        {
+            auto pObject = dynamic_cast<vcl::filter::PDFObjectElement*>(aElement.get());
+            if (!pObject)
+                continue;
+            auto pType = dynamic_cast<vcl::filter::PDFNameElement*>(pObject->Lookup("Type"));
+            if (pType && pType->GetValue() == "Font")
+            {
+                auto pName = dynamic_cast<vcl::filter::PDFNameElement*>(pObject->Lookup("BaseFont"));
+                auto aName = pName->GetValue().copy(7); // skip the subset id
+                CPPUNIT_ASSERT_EQUAL_MESSAGE("Unexpected font name", OString("GentiumBasic"), aName);
+
+                auto pToUnicodeRef = dynamic_cast<vcl::filter::PDFReferenceElement*>(pObject->Lookup("ToUnicode"));
+                CPPUNIT_ASSERT(pToUnicodeRef);
+                pToUnicode = pToUnicodeRef->LookupObject();
+                break;
+            }
+        }
+
+        CPPUNIT_ASSERT(pToUnicode);
+        auto pStream = pToUnicode->GetStream();
+        CPPUNIT_ASSERT(pStream);
+        SvMemoryStream aObjectStream;
+        ZCodec aZCodec;
+        aZCodec.BeginCompression();
+        pStream->GetMemory().Seek(0);
+        aZCodec.Decompress(pStream->GetMemory(), aObjectStream);
+        CPPUNIT_ASSERT(aZCodec.EndCompression());
+        aObjectStream.Seek(0);
+        std::string aCmap("2 beginbfchar\n"
+                          "<01> <1ECB0331030B>\n"
+                          "<05> <0020>\n"
+                          "endbfchar");
+        std::string aData(static_cast<const char*>(aObjectStream.GetData()), aObjectStream.GetSize());
+        auto nPos = aData.find(aCmap);
+        CPPUNIT_ASSERT(nPos != std::string::npos);
+    }
+
+    {
+        auto aPages = aDocument.GetPages();
+        CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+        // Get page contents and stream.
+        auto pContents = aPages[0]->LookupObject("Contents");
+        CPPUNIT_ASSERT(pContents);
+        auto pStream = pContents->GetStream();
+        CPPUNIT_ASSERT(pStream);
+        auto& rObjectStream = pStream->GetMemory();
+
+        // Uncompress the stream.
+        SvMemoryStream aUncompressed;
+        ZCodec aZCodec;
+        aZCodec.BeginCompression();
+        rObjectStream.Seek(0);
+        aZCodec.Decompress(rObjectStream, aUncompressed);
+        CPPUNIT_ASSERT(aZCodec.EndCompression());
+
+        // Make sure the expected ActualText is present.
+        std::string aData(static_cast<const char*>(aUncompressed.GetData()), aUncompressed.GetSize());
+
+        std::string aActualText("/Span<</ActualText<FEFF1ECB0331030B>>>");
+        size_t nCount = 0;
+        size_t nPos = 0;
+        while ((nPos = aData.find(aActualText, nPos)) != std::string::npos)
+        {
+            nCount++;
+            nPos += aActualText.length();
+        }
+        CPPUNIT_ASSERT_EQUAL_MESSAGE("Number of ActualText entries does not match!", static_cast<size_t>(4), nCount);
+    }
+#endif
+}
+
+void PdfExportTest::testTdf105954()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf105954.odt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    uno::Sequence<beans::PropertyValue> aFilterData(comphelper::InitPropertySequence(
+        { { "ReduceImageResolution", uno::Any(true) },
+          { "MaxImageResolution", uno::Any(static_cast<sal_Int32>(300)) } }));
+    aMediaDescriptor["FilterData"] <<= aFilterData;
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result with pdfium.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    SvMemoryStream aMemory;
+    aMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(
+        FPDF_LoadMemDocument(aMemory.GetData(), aMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+
+    // The document has one page.
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+
+    // There is a single image on the page.
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    CPPUNIT_ASSERT_EQUAL(1, nPageObjectCount);
+
+    // Check width of the image.
+    FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), /*index=*/0);
+    FPDF_IMAGEOBJ_METADATA aMeta;
+    CPPUNIT_ASSERT(FPDFImageObj_GetImageMetadata(pPageObject, pPdfPage.get(), &aMeta));
+    // This was 2000, i.e. the 'reduce to 300 DPI' request was ignored.
+    // This is now around 238 (228 on macOS).
+    CPPUNIT_ASSERT_LESS(static_cast<unsigned int>(250), aMeta.width);
+}
+
+void PdfExportTest::testTdf128630()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf128630.odp";
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("impress_pdf_Export");
+    DocumentHolder pPdfDocument = exportAndParse(aURL, aMediaDescriptor);
+
+    // The document has one page.
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+
+    // Assert the aspect ratio of the only bitmap on the page.
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        if (FPDFPageObj_GetType(pPageObject) != FPDF_PAGEOBJ_IMAGE)
+            continue;
+
+        FPDF_BITMAP pBitmap = FPDFImageObj_GetBitmap(pPageObject);
+        CPPUNIT_ASSERT(pBitmap);
+        int nWidth = FPDFBitmap_GetWidth(pBitmap);
+        int nHeight = FPDFBitmap_GetHeight(pBitmap);
+        FPDFBitmap_Destroy(pBitmap);
+        // Without the accompanying fix in place, this test would have failed with:
+        // assertion failed
+        // - Expression: nWidth != nHeight
+        // i.e. the bitmap lost its custom aspect ratio during export.
+        CPPUNIT_ASSERT(nWidth != nHeight);
+    }
+}
+
+void PdfExportTest::testTdf106702()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf106702.odt";
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    auto pPdfDocument = exportAndParse(aURL, aMediaDescriptor);
+
+    // The document has two pages.
+    CPPUNIT_ASSERT_EQUAL(2, FPDF_GetPageCount(pPdfDocument.get()));
+
+    // First page already has the correct image position.
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+    int nExpected = 0;
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        if (FPDFPageObj_GetType(pPageObject) != FPDF_PAGEOBJ_IMAGE)
+            continue;
+
+        float fLeft = 0, fBottom = 0, fRight = 0, fTop = 0;
+        FPDFPageObj_GetBounds(pPageObject, &fLeft, &fBottom, &fRight, &fTop);
+        nExpected = fTop;
+        break;
+    }
+
+    // Second page had an incorrect image position.
+    pPdfPage.reset(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/1));
+    CPPUNIT_ASSERT(pPdfPage.get());
+    int nActual = 0;
+    nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        if (FPDFPageObj_GetType(pPageObject) != FPDF_PAGEOBJ_IMAGE)
+            continue;
+
+        float fLeft = 0, fBottom = 0, fRight = 0, fTop = 0;
+        FPDFPageObj_GetBounds(pPageObject, &fLeft, &fBottom, &fRight, &fTop);
+        nActual = fTop;
+        break;
+    }
+
+    // This failed, vertical pos is 818 points, was 1674 (outside visible page
+    // bounds).
+    CPPUNIT_ASSERT_EQUAL(nExpected, nActual);
+}
+
+void PdfExportTest::testTdf113143()
+{
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf113143.odp";
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("impress_pdf_Export");
+    uno::Sequence<beans::PropertyValue> aFilterData(comphelper::InitPropertySequence({
+        { "ExportNotesPages", uno::Any(true) },
+        // ReduceImageResolution is on by default and that hides the bug we
+        // want to test.
+        { "ReduceImageResolution", uno::Any(false) },
+        // Set a custom PDF version.
+        { "SelectPdfVersion", uno::makeAny(static_cast<sal_Int32>(16)) },
+    }));
+    aMediaDescriptor["FilterData"] <<= aFilterData;
+    auto pPdfDocument = exportAndParse(aURL, aMediaDescriptor);
+
+    // The document has two pages.
+    CPPUNIT_ASSERT_EQUAL(2, FPDF_GetPageCount(pPdfDocument.get()));
+
+    // First has the original (larger) image.
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+    int nLarger = 0;
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        if (FPDFPageObj_GetType(pPageObject) != FPDF_PAGEOBJ_IMAGE)
+            continue;
+
+        float fLeft = 0, fBottom = 0, fRight = 0, fTop = 0;
+        FPDFPageObj_GetBounds(pPageObject, &fLeft, &fBottom, &fRight, &fTop);
+        nLarger = fRight - fLeft;
+        break;
+    }
+
+    // Second page has the scaled (smaller) image.
+    pPdfPage.reset(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/1));
+    CPPUNIT_ASSERT(pPdfPage.get());
+    int nSmaller = 0;
+    nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        if (FPDFPageObj_GetType(pPageObject) != FPDF_PAGEOBJ_IMAGE)
+            continue;
+
+        float fLeft = 0, fBottom = 0, fRight = 0, fTop = 0;
+        FPDFPageObj_GetBounds(pPageObject, &fLeft, &fBottom, &fRight, &fTop);
+        nSmaller = fRight - fLeft;
+        break;
+    }
+
+    // This failed, both were 319, now nSmaller is 169.
+    CPPUNIT_ASSERT_LESS(nLarger, nSmaller);
+
+    // The following check used to fail in the past, header was "%PDF-1.5":
+    maMemory.Seek(0);
+    OString aExpectedHeader("%PDF-1.6");
+    OString aHeader(read_uInt8s_ToOString(maMemory, aExpectedHeader.getLength()));
+    CPPUNIT_ASSERT_EQUAL(aExpectedHeader, aHeader);
+}
+
+void PdfExportTest::testForcePoint71()
+{
+    // I just care it doesn't crash
+    saveAsPDF("forcepoint71.key");
+}
+
+void PdfExportTest::testTdf115262()
+{
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf115262.ods";
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("calc_pdf_Export");
+    auto pPdfDocument = exportAndParse(aURL, aMediaDescriptor);
+    CPPUNIT_ASSERT_EQUAL(8, FPDF_GetPageCount(pPdfDocument.get()));
+
+    // Get the 6th page.
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/5));
+    CPPUNIT_ASSERT(pPdfPage.get());
+
+    // Look up the position of the first image and the 400th row.
+    FPDF_TEXTPAGE pTextPage = FPDFText_LoadPage(pPdfPage.get());
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    int nFirstImageTop = 0;
+    int nRowTop = 0;
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        float fLeft = 0, fBottom = 0, fRight = 0, fTop = 0;
+        FPDFPageObj_GetBounds(pPageObject, &fLeft, &fBottom, &fRight, &fTop);
+
+        if (FPDFPageObj_GetType(pPageObject) == FPDF_PAGEOBJ_IMAGE)
+        {
+            nFirstImageTop = fTop;
+        }
+        else if (FPDFPageObj_GetType(pPageObject) == FPDF_PAGEOBJ_TEXT)
+        {
+            unsigned long nTextSize = FPDFTextObj_GetText(pPageObject, pTextPage, nullptr, 0);
+            std::vector<sal_Unicode> aText(nTextSize);
+            FPDFTextObj_GetText(pPageObject, pTextPage, aText.data(), nTextSize);
+            OUString sText(aText.data(), nTextSize / 2 - 1);
+            if (sText == "400")
+                nRowTop = fTop;
+        }
+    }
+    // Make sure that the top of the "400" is below the top of the image (in
+    // bottom-right-corner-based PDF coordinates).
+    // This was: expected less than 144, actual is 199.
+    CPPUNIT_ASSERT_LESS(nFirstImageTop, nRowTop);
+    FPDFText_ClosePage(pTextPage);
+}
+
+void PdfExportTest::testTdf121962()
+{
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf121962.odt";
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    auto pPdfDocument = exportAndParse(aURL, aMediaDescriptor);
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+
+    // Get the first page
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+    FPDF_TEXTPAGE pTextPage = FPDFText_LoadPage(pPdfPage.get());
+
+    // Make sure the table sum is displayed as "0", not faulty expression.
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        if (FPDFPageObj_GetType(pPageObject) != FPDF_PAGEOBJ_TEXT)
+            continue;
+        unsigned long nTextSize = FPDFTextObj_GetText(pPageObject, pTextPage, nullptr, 0);
+        std::vector<sal_Unicode> aText(nTextSize);
+        FPDFTextObj_GetText(pPageObject, pTextPage, aText.data(), nTextSize);
+        OUString sText(aText.data(), nTextSize / 2 - 1);
+        CPPUNIT_ASSERT(sText != "** Expression is faulty **");
+    }
+
+    FPDFText_ClosePage(pTextPage);
+}
+
+void PdfExportTest::testTdf115967()
+{
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "tdf115967.odt";
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    auto pPdfDocument = exportAndParse(aURL, aMediaDescriptor);
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+
+    // Get the first page
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+    FPDF_TEXTPAGE pTextPage = FPDFText_LoadPage(pPdfPage.get());
+
+    // Make sure the elements inside a formula in a RTL document are exported
+    // LTR ( m=750abc ) and not RTL ( m=057cba )
+    int nPageObjectCount = FPDFPage_CountObjects(pPdfPage.get());
+    OUString sText;
+    for (int i = 0; i < nPageObjectCount; ++i)
+    {
+        FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), i);
+        if (FPDFPageObj_GetType(pPageObject) != FPDF_PAGEOBJ_TEXT)
+            continue;
+        unsigned long nTextSize = FPDFTextObj_GetText(pPageObject, pTextPage, nullptr, 2);
+        std::vector<sal_Unicode> aText(nTextSize);
+        FPDFTextObj_GetText(pPageObject, pTextPage, aText.data(), nTextSize);
+        OUString sChar(aText.data(), nTextSize / 2 - 1);
+        sText += sChar.trim();
+    }
+    CPPUNIT_ASSERT_EQUAL(OUString("m=750abc"), sText);
+
+    FPDFText_ClosePage(pTextPage);
+}
+
+void PdfExportTest::testTdf121615()
+{
+    vcl::filter::PDFDocument aDocument;
+    load("tdf121615.odt", aDocument);
+
+    // The document has one page.
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), aPages.size());
+
+    // Get access to the only image on the only page.
+    vcl::filter::PDFObjectElement* pResources = aPages[0]->LookupObject("Resources");
+    CPPUNIT_ASSERT(pResources);
+    auto pXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pResources->Lookup("XObject"));
+    CPPUNIT_ASSERT(pXObjects);
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(1), pXObjects->GetItems().size());
+    vcl::filter::PDFObjectElement* pXObject = pXObjects->LookupObject(pXObjects->GetItems().begin()->first);
+    CPPUNIT_ASSERT(pXObject);
+    vcl::filter::PDFStreamElement* pStream = pXObject->GetStream();
+    CPPUNIT_ASSERT(pStream);
+    SvMemoryStream& rObjectStream = pStream->GetMemory();
+
+    // Load the embedded image.
+    rObjectStream.Seek( 0 );
+    GraphicFilter& rFilter = GraphicFilter::GetGraphicFilter();
+    Graphic aGraphic;
+    sal_uInt16 format;
+    ErrCode bResult = rFilter.ImportGraphic(aGraphic, OUString( "import" ), rObjectStream,
+        GRFILTER_FORMAT_DONTKNOW, &format);
+    CPPUNIT_ASSERT_EQUAL(ERRCODE_NONE, bResult);
+
+    // The image should be grayscale 8bit JPEG.
+    sal_uInt16 jpegFormat = rFilter.GetImportFormatNumberForShortName( JPG_SHORTNAME );
+    CPPUNIT_ASSERT( jpegFormat != GRFILTER_FORMAT_NOTFOUND );
+    CPPUNIT_ASSERT_EQUAL( jpegFormat, format );
+    BitmapEx aBitmap = aGraphic.GetBitmapEx();
+    CPPUNIT_ASSERT_EQUAL( 200L, aBitmap.GetSizePixel().Width());
+    CPPUNIT_ASSERT_EQUAL( 300L, aBitmap.GetSizePixel().Height());
+    CPPUNIT_ASSERT_EQUAL( 8, int(aBitmap.GetBitCount()));
+    // tdf#121615 was caused by broken handling of data width with 8bit color,
+    // so the test image has some black in the bottomright corner, check it's there
+    CPPUNIT_ASSERT_EQUAL( COL_WHITE, aBitmap.GetPixelColor( 0, 0 ));
+    CPPUNIT_ASSERT_EQUAL( COL_WHITE, aBitmap.GetPixelColor( 0, 299 ));
+    CPPUNIT_ASSERT_EQUAL( COL_WHITE, aBitmap.GetPixelColor( 199, 0 ));
+    CPPUNIT_ASSERT_EQUAL( COL_BLACK, aBitmap.GetPixelColor( 199, 299 ));
+}
+
+void PdfExportTest::testTocLink()
+{
+    // Load the Writer document.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "toc-link.fodt";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    // Update the ToC.
+    uno::Reference<text::XDocumentIndexesSupplier> xDocumentIndexesSupplier(mxComponent,
+                                                                            uno::UNO_QUERY);
+    CPPUNIT_ASSERT(xDocumentIndexesSupplier.is());
+
+    uno::Reference<util::XRefreshable> xToc(
+        xDocumentIndexesSupplier->getDocumentIndexes()->getByIndex(0), uno::UNO_QUERY);
+    CPPUNIT_ASSERT(xToc.is());
+
+    xToc->refresh();
+
+    // Save as PDF.
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    maMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(
+        FPDF_LoadMemDocument(maMemory.GetData(), maMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+
+    // Ensure there is a link on the first page (in the ToC).
+    int nStartPos = 0;
+    FPDF_LINK pLinkAnnot = nullptr;
+    // Without the accompanying fix in place, this test would have failed, as FPDFLink_Enumerate()
+    // returned false, as the page contained no links.
+    CPPUNIT_ASSERT(FPDFLink_Enumerate(pPdfPage.get(), &nStartPos, &pLinkAnnot));
+}
+
+void PdfExportTest::testReduceSmallImage()
+{
+    // Load the Writer document.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "reduce-small-image.fodt";
+    mxComponent = loadFromDesktop(aURL);
+
+    // Save as PDF.
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the PDF: get the image.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    maMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(
+    FPDF_LoadMemDocument(maMemory.GetData(), maMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+    CPPUNIT_ASSERT_EQUAL(1, FPDFPage_CountObjects(pPdfPage.get()));
+    FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), 0);
+    CPPUNIT_ASSERT_EQUAL(FPDF_PAGEOBJ_IMAGE, FPDFPageObj_GetType(pPageObject));
+
+    // Make sure we don't scale down a tiny bitmap.
+    FPDF_BITMAP pBitmap = FPDFImageObj_GetBitmap(pPageObject);
+    CPPUNIT_ASSERT(pBitmap);
+    int nWidth = FPDFBitmap_GetWidth(pBitmap);
+    int nHeight = FPDFBitmap_GetHeight(pBitmap);
+    FPDFBitmap_Destroy(pBitmap);
+    // Without the accompanying fix in place, this test would have failed with:
+    // - Expected: 16
+    // - Actual  : 6
+    // i.e. the image was scaled down to 300 DPI, even if it had tiny size.
+    CPPUNIT_ASSERT_EQUAL(16, nWidth);
+    CPPUNIT_ASSERT_EQUAL(16, nHeight);
+}
+
+void PdfExportTest::testReduceImage()
+{
+    // Load the Writer document.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "reduce-image.fodt";
+    mxComponent = loadFromDesktop(aURL);
+
+    // Save as PDF.
+    uno::Reference<css::lang::XMultiServiceFactory> xFactory = getMultiServiceFactory();
+    uno::Reference<document::XFilter> xFilter(
+        xFactory->createInstance("com.sun.star.document.PDFFilter"), uno::UNO_QUERY);
+    uno::Reference<document::XExporter> xExporter(xFilter, uno::UNO_QUERY);
+    xExporter->setSourceDocument(mxComponent);
+
+    SvFileStream aOutputStream(maTempFile.GetURL(), StreamMode::WRITE);
+    uno::Reference<io::XOutputStream> xOutputStream(new utl::OStreamWrapper(aOutputStream));
+
+    uno::Sequence<beans::PropertyValue> aFilterData(
+        comphelper::InitPropertySequence({ { "ReduceImageResolution", uno::Any(false) } }));
+
+    // This is intentionally in an "unlucky" order, output stream comes before filter data.
+    uno::Sequence<beans::PropertyValue> aDescriptor(comphelper::InitPropertySequence({
+        { "FilterName", uno::Any(OUString("writer_pdf_Export")) },
+        { "OutputStream", uno::Any(xOutputStream) },
+        { "FilterData", uno::Any(aFilterData) },
+    }));
+    xFilter->filter(aDescriptor);
+    aOutputStream.Close();
+
+    // Parse the PDF: get the image.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    maMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(
+        FPDF_LoadMemDocument(maMemory.GetData(), maMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+    CPPUNIT_ASSERT_EQUAL(1, FPDFPage_CountObjects(pPdfPage.get()));
+    FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), 0);
+    CPPUNIT_ASSERT_EQUAL(FPDF_PAGEOBJ_IMAGE, FPDFPageObj_GetType(pPageObject));
+
+    // Make sure we don't scale down a bitmap.
+    FPDF_BITMAP pBitmap = FPDFImageObj_GetBitmap(pPageObject);
+    CPPUNIT_ASSERT(pBitmap);
+    int nWidth = FPDFBitmap_GetWidth(pBitmap);
+    int nHeight = FPDFBitmap_GetHeight(pBitmap);
+    FPDFBitmap_Destroy(pBitmap);
+    // Without the accompanying fix in place, this test would have failed with:
+    // - Expected: 160
+    // - Actual  : 6
+    // i.e. the image was scaled down even with ReduceImageResolution=false.
+    CPPUNIT_ASSERT_EQUAL(160, nWidth);
+    CPPUNIT_ASSERT_EQUAL(160, nHeight);
+}
+
+bool HasLinksOnPage(PageHolder& pPdfPage)
+{
+    int nStartPos = 0;
+    FPDF_LINK pLinkAnnot = nullptr;
+    return FPDFLink_Enumerate(pPdfPage.get(), &nStartPos, &pLinkAnnot);
+}
+
+void PdfExportTest::testLinkWrongPage()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "link-wrong-page.odp";
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("impress_pdf_Export");
+    DocumentHolder pPdfDocument = exportAndParse(aURL, aMediaDescriptor);
+
+    // The document has 2 pages.
+    CPPUNIT_ASSERT_EQUAL(2, FPDF_GetPageCount(pPdfDocument.get()));
+
+    // First page should have 1 link (2nd slide, 1st was hidden).
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+
+    // Without the accompanying fix in place, this test would have failed, as the link of the first
+    // page went to the second page due to the hidden first slide.
+    CPPUNIT_ASSERT(HasLinksOnPage(pPdfPage));
+
+    // Second page should have no links (3rd slide).
+    PageHolder pPdfPage2(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/1));
+    CPPUNIT_ASSERT(pPdfPage2.get());
+    CPPUNIT_ASSERT(!HasLinksOnPage(pPdfPage2));
+}
+
+void PdfExportTest::testLargePage()
+{
+    // Import the bugdoc and export as PDF.
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "6m-wide.odg";
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("draw_pdf_Export");
+    DocumentHolder pPdfDocument = exportAndParse(aURL, aMediaDescriptor);
+
+    // The document has 1 page.
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+
+    // Check the value (not the unit) of the page size.
+    FS_SIZEF aSize;
+    FPDF_GetPageSizeByIndexF(pPdfDocument.get(), 0, &aSize);
+    // Without the accompanying fix in place, this test would have failed with:
+    // - Expected: 8503.94
+    // - Actual  : 17007.875
+    // i.e. the value for 600 cm was larger than the 14 400 limit set in the spec.
+    CPPUNIT_ASSERT_DOUBLES_EQUAL(8503.94, static_cast<double>(aSize.width), 0.01);
+}
+
+void PdfExportTest::testPdfImageResourceInlineXObjectRef()
+{
+    // Create an empty document.
+    mxComponent = loadFromDesktop("private:factory/swriter");
+    CPPUNIT_ASSERT(mxComponent.is());
+    uno::Reference<text::XTextDocument> xTextDocument(mxComponent, uno::UNO_QUERY);
+    uno::Reference<text::XText> xText = xTextDocument->getText();
+    uno::Reference<text::XTextCursor> xCursor = xText->createTextCursor();
+
+    // Insert the PDF image.
+    uno::Reference<lang::XMultiServiceFactory> xFactory(mxComponent, uno::UNO_QUERY);
+    uno::Reference<beans::XPropertySet> xGraphicObject(
+        xFactory->createInstance("com.sun.star.text.TextGraphicObject"), uno::UNO_QUERY);
+    OUString aURL
+        = m_directories.getURLFromSrc(DATA_DIRECTORY) + "pdf-image-resource-inline-xobject-ref.pdf";
+    xGraphicObject->setPropertyValue("GraphicURL", uno::makeAny(aURL));
+    uno::Reference<drawing::XShape> xShape(xGraphicObject, uno::UNO_QUERY);
+    xShape->setSize(awt::Size(1000, 1000));
+    uno::Reference<text::XTextContent> xTextContent(xGraphicObject, uno::UNO_QUERY);
+    xText->insertTextContent(xCursor->getStart(), xTextContent, /*bAbsorb=*/false);
+
+    // Save as PDF.
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    maMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(
+        FPDF_LoadMemDocument(maMemory.GetData(), maMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+    CPPUNIT_ASSERT_EQUAL(1, FPDF_GetPageCount(pPdfDocument.get()));
+
+    // Make sure that the page -> form -> form has a child image.
+    PageHolder pPdfPage(FPDF_LoadPage(pPdfDocument.get(), /*page_index=*/0));
+    CPPUNIT_ASSERT(pPdfPage.get());
+    CPPUNIT_ASSERT_EQUAL(1, FPDFPage_CountObjects(pPdfPage.get()));
+    FPDF_PAGEOBJECT pPageObject = FPDFPage_GetObject(pPdfPage.get(), 0);
+    CPPUNIT_ASSERT_EQUAL(FPDF_PAGEOBJ_FORM, FPDFPageObj_GetType(pPageObject));
+    // 2: white background and the actual object.
+    CPPUNIT_ASSERT_EQUAL(2, FPDFFormObj_CountObjects(pPageObject));
+    FPDF_PAGEOBJECT pFormObject = FPDFFormObj_GetObject(pPageObject, 1);
+    CPPUNIT_ASSERT_EQUAL(FPDF_PAGEOBJ_FORM, FPDFPageObj_GetType(pFormObject));
+    // Without the accompanying fix in place, this test would have failed with:
+    // - Expected: 1
+    // - Actual  : 0
+    // i.e. the sub-form was missing its image.
+    CPPUNIT_ASSERT_EQUAL(1, FPDFFormObj_CountObjects(pFormObject));
+
+    // Check if the inner form object (original page object in the pdf image) has the correct
+    // rotation.
+    FPDF_PAGEOBJECT pInnerFormObject = FPDFFormObj_GetObject(pFormObject, 0);
+    CPPUNIT_ASSERT_EQUAL(FPDF_PAGEOBJ_FORM, FPDFPageObj_GetType(pInnerFormObject));
+    CPPUNIT_ASSERT_EQUAL(1, FPDFFormObj_CountObjects(pInnerFormObject));
+    FPDF_PAGEOBJECT pImage = FPDFFormObj_GetObject(pInnerFormObject, 0);
+    CPPUNIT_ASSERT_EQUAL(FPDF_PAGEOBJ_IMAGE, FPDFPageObj_GetType(pImage));
+    FS_MATRIX aMatrix;
+    FPDFFormObj_GetMatrix(pInnerFormObject, &aMatrix);
+    basegfx::B2DHomMatrix aMat{ aMatrix.a, aMatrix.c, aMatrix.e, aMatrix.b, aMatrix.d, aMatrix.f };
+    basegfx::B2DTuple aScale;
+    basegfx::B2DTuple aTranslate;
+    double fRotate = 0;
+    double fShearX = 0;
+    aMat.decompose(aScale, aTranslate, fRotate, fShearX);
+    int nRotateDeg = basegfx::rad2deg(fRotate);
+    // Without the accompanying fix in place, this test would have failed with:
+    // - Expected: -90
+    // - Actual  : 0
+    // i.e. rotation was lost on pdf export.
+    CPPUNIT_ASSERT_EQUAL(-90, nRotateDeg);
+}
+
+void PdfExportTest::testDefaultVersion()
+{
+    // Create an empty document.
+    mxComponent = loadFromDesktop("private:factory/swriter");
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    // Save as PDF.
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    maMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(
+        FPDF_LoadMemDocument(maMemory.GetData(), maMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+    int nFileVersion = 0;
+    FPDF_GetFileVersion(pPdfDocument.get(), &nFileVersion);
+    CPPUNIT_ASSERT_EQUAL(16, nFileVersion);
+}
+
+void PdfExportTest::testVersion15()
+{
+    // Create an empty document.
+    mxComponent = loadFromDesktop("private:factory/swriter");
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    // Save as PDF.
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    uno::Sequence<beans::PropertyValue> aFilterData(comphelper::InitPropertySequence(
+        { { "SelectPdfVersion", uno::makeAny(static_cast<sal_Int32>(15)) } }));
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    aMediaDescriptor["FilterData"] <<= aFilterData;
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result.
+    SvFileStream aFile(maTempFile.GetURL(), StreamMode::READ);
+    maMemory.WriteStream(aFile);
+    DocumentHolder pPdfDocument(
+        FPDF_LoadMemDocument(maMemory.GetData(), maMemory.GetSize(), /*password=*/nullptr));
+    CPPUNIT_ASSERT(pPdfDocument.get());
+    int nFileVersion = 0;
+    FPDF_GetFileVersion(pPdfDocument.get(), &nFileVersion);
+    CPPUNIT_ASSERT_EQUAL(15, nFileVersion);
+}
+
+// Check round-trip of importing and exporting the PDF with PDFium filter,
+// which imports the PDF document as multiple PDFs as graphic object.
+// Each page in the document has one PDF graphic object which content is
+// the corresponding page in the PDF. When such a document is exported,
+// the PDF graphic gets embedded into the exported PDF document (as a
+// Form XObject).
+void PdfExportTest::testMultiPagePDF()
+{
+// setenv only works on unix based systems
+#ifndef _WIN32
+    // We need to enable PDFium import (and make sure to disable after the test)
+    bool bResetEnvVar = false;
+    if (getenv("LO_IMPORT_USE_PDFIUM") == nullptr)
+    {
+        bResetEnvVar = true;
+        setenv("LO_IMPORT_USE_PDFIUM", "1", false);
+    }
+    comphelper::ScopeGuard aPDFiumEnvVarGuard([&]() {
+        if (bResetEnvVar)
+            unsetenv("LO_IMPORT_USE_PDFIUM");
+    });
+
+    // Load the PDF and save as PDF
+    OUString aURL = m_directories.getURLFromSrc(DATA_DIRECTORY) + "SimpleMultiPagePDF.pdf";
+    mxComponent = loadFromDesktop(aURL);
+    CPPUNIT_ASSERT(mxComponent.is());
+
+    uno::Reference<frame::XStorable> xStorable(mxComponent, uno::UNO_QUERY);
+    utl::MediaDescriptor aMediaDescriptor;
+    aMediaDescriptor["FilterName"] <<= OUString("writer_pdf_Export");
+    xStorable->storeToURL(maTempFile.GetURL(), aMediaDescriptor.getAsConstPropertyValueList());
+
+    // Parse the export result.
+    vcl::filter::PDFDocument aDocument;
+    SvFileStream aStream(maTempFile.GetURL(), StreamMode::READ);
+    CPPUNIT_ASSERT(aDocument.Read(aStream));
+
+    std::vector<vcl::filter::PDFObjectElement*> aPages = aDocument.GetPages();
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(3), aPages.size());
+
+    vcl::filter::PDFObjectElement* pResources = aPages[0]->LookupObject("Resources");
+    CPPUNIT_ASSERT(pResources);
+
+    auto pXObjects = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pResources->Lookup("XObject"));
+    CPPUNIT_ASSERT(pXObjects);
+
+    CPPUNIT_ASSERT_EQUAL(static_cast<size_t>(3), pXObjects->GetItems().size()); // 3 PDFs as Form XObjects
+
+    std::vector<OString> rIDs;
+    for (auto const & rPair : pXObjects->GetItems()) {
+        rIDs.push_back(rPair.first);
+    }
+
+    // Let's check the embedded PDF pages - just make sure the size differs,
+    // which should indicate we don't have 3 times the same page.
+
+    {   // embedded PDF page 1
+        vcl::filter::PDFObjectElement* pXObject1 = pXObjects->LookupObject(rIDs[0]);
+        CPPUNIT_ASSERT(pXObject1);
+        CPPUNIT_ASSERT_EQUAL(OString("Im19"), rIDs[0]);
+
+        auto pSubtype1 = dynamic_cast<vcl::filter::PDFNameElement*>(pXObject1->Lookup("Subtype"));
+        CPPUNIT_ASSERT(pSubtype1);
+        CPPUNIT_ASSERT_EQUAL(OString("Form"), pSubtype1->GetValue());
+
+        auto pXObjectResources = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObject1->Lookup("Resources"));
+        CPPUNIT_ASSERT(pXObjectResources);
+        auto pXObjectForms = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObjectResources->LookupElement("XObject"));
+        CPPUNIT_ASSERT(pXObjectForms);
+        vcl::filter::PDFObjectElement* pForm = pXObjectForms->LookupObject(pXObjectForms->GetItems().begin()->first);
+        CPPUNIT_ASSERT(pForm);
+
+        vcl::filter::PDFStreamElement* pStream = pForm->GetStream();
+        CPPUNIT_ASSERT(pStream);
+        SvMemoryStream& rObjectStream = pStream->GetMemory();
+        rObjectStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        // Just check that the size of the page stream is what is expected.
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(230), rObjectStream.remainingSize());
+    }
+
+    {   // embedded PDF page 2
+        vcl::filter::PDFObjectElement* pXObject2 = pXObjects->LookupObject(rIDs[1]);
+        CPPUNIT_ASSERT(pXObject2);
+        CPPUNIT_ASSERT_EQUAL(OString("Im34"), rIDs[1]);
+
+        auto pSubtype2 = dynamic_cast<vcl::filter::PDFNameElement*>(pXObject2->Lookup("Subtype"));
+        CPPUNIT_ASSERT(pSubtype2);
+        CPPUNIT_ASSERT_EQUAL(OString("Form"), pSubtype2->GetValue());
+
+        auto pXObjectResources = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObject2->Lookup("Resources"));
+        CPPUNIT_ASSERT(pXObjectResources);
+        auto pXObjectForms = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObjectResources->LookupElement("XObject"));
+        CPPUNIT_ASSERT(pXObjectForms);
+        vcl::filter::PDFObjectElement* pForm = pXObjectForms->LookupObject(pXObjectForms->GetItems().begin()->first);
+        CPPUNIT_ASSERT(pForm);
+
+        vcl::filter::PDFStreamElement* pStream = pForm->GetStream();
+        CPPUNIT_ASSERT(pStream);
+        SvMemoryStream& rObjectStream = pStream->GetMemory();
+        rObjectStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        // Just check that the size of the page stream is what is expected
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(309), rObjectStream.remainingSize());
+    }
+
+    {   // embedded PDF page 3
+        vcl::filter::PDFObjectElement* pXObject3 = pXObjects->LookupObject(rIDs[2]);
+        CPPUNIT_ASSERT(pXObject3);
+        CPPUNIT_ASSERT_EQUAL(OString("Im4"), rIDs[2]);
+
+        auto pSubtype3 = dynamic_cast<vcl::filter::PDFNameElement*>(pXObject3->Lookup("Subtype"));
+        CPPUNIT_ASSERT(pSubtype3);
+        CPPUNIT_ASSERT_EQUAL(OString("Form"), pSubtype3->GetValue());
+
+        auto pXObjectResources = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObject3->Lookup("Resources"));
+        CPPUNIT_ASSERT(pXObjectResources);
+        auto pXObjectForms = dynamic_cast<vcl::filter::PDFDictionaryElement*>(pXObjectResources->LookupElement("XObject"));
+        CPPUNIT_ASSERT(pXObjectForms);
+        vcl::filter::PDFObjectElement* pForm = pXObjectForms->LookupObject(pXObjectForms->GetItems().begin()->first);
+        CPPUNIT_ASSERT(pForm);
+
+        vcl::filter::PDFStreamElement* pStream = pForm->GetStream();
+        CPPUNIT_ASSERT(pStream);
+        SvMemoryStream& rObjectStream = pStream->GetMemory();
+        rObjectStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+        // Just check that the size of the page stream is what is expected
+        CPPUNIT_ASSERT_EQUAL(sal_uInt64(193), rObjectStream.remainingSize());
+    }
+#endif
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(PdfExportTest);
+
+}
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/png/PngFilterTest.cxx b/vcl/qa/cppunit/png/PngFilterTest.cxx
new file mode 100644
index 000000000..c304ee9d3
--- /dev/null
+++ b/vcl/qa/cppunit/png/PngFilterTest.cxx
@@ -0,0 +1,193 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ *
+ * This file incorporates work covered by the following license notice:
+ *
+ *   Licensed to the Apache Software Foundation (ASF) under one or more
+ *   contributor license agreements. See the NOTICE file distributed
+ *   with this work for additional information regarding copyright
+ *   ownership. The ASF licenses this file to you under the Apache
+ *   License, Version 2.0 (the "License"); you may not use this file
+ *   except in compliance with the License. You may obtain a copy of
+ *   the License at http://www.apache.org/licenses/LICENSE-2.0 .
+ */
+
+#include <test/bootstrapfixture.hxx>
+#include <tools/stream.hxx>
+#include <vcl/filter/PngImageReader.hxx>
+#include <vcl/bitmapaccess.hxx>
+#include <vcl/alpha.hxx>
+
+using namespace css;
+
+class PngFilterTest : public test::BootstrapFixture
+{
+    OUString maDataUrl;
+
+    OUString getFullUrl(const OUString& sFileName)
+    {
+        return m_directories.getURLFromSrc(maDataUrl) + sFileName;
+    }
+
+public:
+    PngFilterTest()
+        : BootstrapFixture(true, false)
+        , maDataUrl("/vcl/qa/cppunit/png/data/")
+    {
+    }
+
+    void testPng();
+
+    CPPUNIT_TEST_SUITE(PngFilterTest);
+    CPPUNIT_TEST(testPng);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void PngFilterTest::testPng()
+{
+    for (const OUString& aFileName : { OUString("rect-1bit-pal.png") })
+    {
+        SvFileStream aFileStream(getFullUrl(aFileName), StreamMode::READ);
+
+        vcl::PngImageReader aPngReader(aFileStream);
+        BitmapEx aBitmapEx;
+        aPngReader.read(aBitmapEx);
+
+        Bitmap aBitmap = aBitmapEx.GetBitmap();
+        {
+            Bitmap::ScopedReadAccess pAccess(aBitmap);
+            CPPUNIT_ASSERT_EQUAL(4L, pAccess->Width());
+            CPPUNIT_ASSERT_EQUAL(4L, pAccess->Height());
+
+            if (pAccess->GetBitCount() == 24 || pAccess->GetBitCount() == 32)
+            {
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(0, 0));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(3, 3));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(3, 0));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(0, 3));
+
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x00, 0x00), pAccess->GetPixel(1, 1));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x00, 0x00), pAccess->GetPixel(1, 2));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x00, 0x00), pAccess->GetPixel(2, 1));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x00, 0x00), pAccess->GetPixel(2, 2));
+            }
+            else
+            {
+                CPPUNIT_ASSERT_MESSAGE("Bitmap is not 24 or 32 bit.", false);
+            }
+        }
+    }
+    for (const OUString& aFileName :
+         { OUString("color-rect-8bit-RGB.png"), OUString("color-rect-4bit-pal.png") })
+    {
+        SvFileStream aFileStream(getFullUrl(aFileName), StreamMode::READ);
+
+        vcl::PngImageReader aPngReader(aFileStream);
+        BitmapEx aBitmapEx;
+        aPngReader.read(aBitmapEx);
+
+        Bitmap aBitmap = aBitmapEx.GetBitmap();
+        {
+            Bitmap::ScopedReadAccess pAccess(aBitmap);
+            CPPUNIT_ASSERT_EQUAL(4L, pAccess->Width());
+            CPPUNIT_ASSERT_EQUAL(4L, pAccess->Height());
+            if (pAccess->GetBitCount() == 24 || pAccess->GetBitCount() == 32)
+            {
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(0, 0));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(3, 3));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(3, 0));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(0, 3));
+
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0x00, 0x00, 0x00), pAccess->GetPixel(1, 1));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0xFF, 0x00, 0x00), pAccess->GetPixel(1, 2));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0xFF, 0x00), pAccess->GetPixel(2, 1));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0x00, 0x00), pAccess->GetPixel(2, 2));
+            }
+            else
+            {
+                CPPUNIT_ASSERT_MESSAGE("Bitmap is not 24 or 32 bit.", false);
+            }
+        }
+    }
+    for (const OUString& aFileName : { OUString("alpha-rect-8bit-RGBA.png") })
+    {
+        SvFileStream aFileStream(getFullUrl(aFileName), StreamMode::READ);
+
+        vcl::PngImageReader aPngReader(aFileStream);
+        BitmapEx aBitmapEx;
+        aPngReader.read(aBitmapEx);
+
+        Bitmap aBitmap = aBitmapEx.GetBitmap();
+        {
+            Bitmap::ScopedReadAccess pAccess(aBitmap);
+            CPPUNIT_ASSERT_EQUAL(4L, pAccess->Width());
+            CPPUNIT_ASSERT_EQUAL(4L, pAccess->Height());
+
+            if (pAccess->GetBitCount() == 24)
+            {
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(0, 0));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(3, 3));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(3, 0));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x00), pAccess->GetPixel(0, 3));
+
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0x00, 0x00, 0x00), pAccess->GetPixel(1, 1));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0xFF, 0x00, 0x00), pAccess->GetPixel(1, 2));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0xFF, 0x00), pAccess->GetPixel(2, 1));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0x00, 0x00), pAccess->GetPixel(2, 2));
+
+                AlphaMask aAlpha = aBitmapEx.GetAlpha();
+                {
+                    AlphaMask::ScopedReadAccess pAlphaAccess(aAlpha);
+                    CPPUNIT_ASSERT_EQUAL(sal_uInt16(8), pAlphaAccess->GetBitCount());
+                    CPPUNIT_ASSERT_EQUAL(4L, pAlphaAccess->Width());
+                    CPPUNIT_ASSERT_EQUAL(4L, pAlphaAccess->Height());
+
+                    CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x80, 0x00),
+                                         pAlphaAccess->GetPixel(0, 0));
+                    CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x80, 0x00),
+                                         pAlphaAccess->GetPixel(3, 3));
+                    CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x80, 0x00),
+                                         pAlphaAccess->GetPixel(3, 0));
+                    CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x80, 0x00),
+                                         pAlphaAccess->GetPixel(0, 3));
+
+                    CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x40, 0x00),
+                                         pAlphaAccess->GetPixel(1, 1));
+                    CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0xC0, 0x00),
+                                         pAlphaAccess->GetPixel(1, 2));
+                    CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0xC0, 0x00),
+                                         pAlphaAccess->GetPixel(2, 1));
+                    CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0x40, 0x00),
+                                         pAlphaAccess->GetPixel(2, 2));
+                }
+            }
+            else if (pAccess->GetBitCount() == 32)
+            {
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x80), pAccess->GetPixel(0, 0));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x80), pAccess->GetPixel(3, 3));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x80), pAccess->GetPixel(3, 0));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0xFF, 0x80), pAccess->GetPixel(0, 3));
+
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0x00, 0x00, 0x40), pAccess->GetPixel(1, 1));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0xFF, 0x00, 0xC0), pAccess->GetPixel(1, 2));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0x00, 0x00, 0xFF, 0xC0), pAccess->GetPixel(2, 1));
+                CPPUNIT_ASSERT_EQUAL(BitmapColor(0xFF, 0xFF, 0x00, 0x40), pAccess->GetPixel(2, 2));
+            }
+            else
+            {
+                CPPUNIT_ASSERT_MESSAGE("Bitmap is not 24 or 32 bit.", false);
+            }
+        }
+    }
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(PngFilterTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/png/data/alpha-rect-8bit-RGBA.png b/vcl/qa/cppunit/png/data/alpha-rect-8bit-RGBA.png
new file mode 100644
index 000000000..1e90e1a6c
--- /dev/null
+++ b/vcl/qa/cppunit/png/data/alpha-rect-8bit-RGBA.png
diff --git a/vcl/qa/cppunit/png/data/color-rect-4bit-pal.png b/vcl/qa/cppunit/png/data/color-rect-4bit-pal.png
new file mode 100644
index 000000000..740eede51
--- /dev/null
+++ b/vcl/qa/cppunit/png/data/color-rect-4bit-pal.png
diff --git a/vcl/qa/cppunit/png/data/color-rect-8bit-RGB.png b/vcl/qa/cppunit/png/data/color-rect-8bit-RGB.png
new file mode 100644
index 000000000..727859d8a
--- /dev/null
+++ b/vcl/qa/cppunit/png/data/color-rect-8bit-RGB.png
diff --git a/vcl/qa/cppunit/png/data/rect-1bit-pal.png b/vcl/qa/cppunit/png/data/rect-1bit-pal.png
new file mode 100644
index 000000000..cf7ac3e7c
--- /dev/null
+++ b/vcl/qa/cppunit/png/data/rect-1bit-pal.png
diff --git a/vcl/qa/cppunit/svm/data/arc.svm b/vcl/qa/cppunit/svm/data/arc.svm
new file mode 100644
index 000000000..5d443a704
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/arc.svm
diff --git a/vcl/qa/cppunit/svm/data/bitmapexs.svm b/vcl/qa/cppunit/svm/data/bitmapexs.svm
new file mode 100644
index 000000000..f6860bdff
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/bitmapexs.svm
diff --git a/vcl/qa/cppunit/svm/data/bitmaps.svm b/vcl/qa/cppunit/svm/data/bitmaps.svm
new file mode 100644
index 000000000..bf42f1bae
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/bitmaps.svm
diff --git a/vcl/qa/cppunit/svm/data/chord.svm b/vcl/qa/cppunit/svm/data/chord.svm
new file mode 100644
index 000000000..7c7136eed
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/chord.svm
diff --git a/vcl/qa/cppunit/svm/data/clipregion.svm b/vcl/qa/cppunit/svm/data/clipregion.svm
new file mode 100644
index 000000000..aa0d277fe
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/clipregion.svm
diff --git a/vcl/qa/cppunit/svm/data/ellipse.svm b/vcl/qa/cppunit/svm/data/ellipse.svm
new file mode 100644
index 000000000..369e4292c
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/ellipse.svm
diff --git a/vcl/qa/cppunit/svm/data/fillcolor.svm b/vcl/qa/cppunit/svm/data/fillcolor.svm
new file mode 100644
index 000000000..8e1a826c4
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/fillcolor.svm
diff --git a/vcl/qa/cppunit/svm/data/gradient.svm b/vcl/qa/cppunit/svm/data/gradient.svm
new file mode 100644
index 000000000..68811e065
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/gradient.svm
diff --git a/vcl/qa/cppunit/svm/data/hatch.svm b/vcl/qa/cppunit/svm/data/hatch.svm
new file mode 100644
index 000000000..4e6bdf638
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/hatch.svm
diff --git a/vcl/qa/cppunit/svm/data/line.svm b/vcl/qa/cppunit/svm/data/line.svm
new file mode 100644
index 000000000..67441ec92
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/line.svm
diff --git a/vcl/qa/cppunit/svm/data/linecolor.svm b/vcl/qa/cppunit/svm/data/linecolor.svm
new file mode 100644
index 000000000..2cba7f734
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/linecolor.svm
diff --git a/vcl/qa/cppunit/svm/data/masks.svm b/vcl/qa/cppunit/svm/data/masks.svm
new file mode 100644
index 000000000..b9e777930
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/masks.svm
diff --git a/vcl/qa/cppunit/svm/data/overlinecolor.svm b/vcl/qa/cppunit/svm/data/overlinecolor.svm
new file mode 100644
index 000000000..10cd773fb
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/overlinecolor.svm
diff --git a/vcl/qa/cppunit/svm/data/pie.svm b/vcl/qa/cppunit/svm/data/pie.svm
new file mode 100644
index 000000000..1eaf67447
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/pie.svm
diff --git a/vcl/qa/cppunit/svm/data/pixel.svm b/vcl/qa/cppunit/svm/data/pixel.svm
new file mode 100644
index 000000000..dc15ab8f0
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/pixel.svm
diff --git a/vcl/qa/cppunit/svm/data/point.svm b/vcl/qa/cppunit/svm/data/point.svm
new file mode 100644
index 000000000..5b5c3731b
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/point.svm
diff --git a/vcl/qa/cppunit/svm/data/polygon.svm b/vcl/qa/cppunit/svm/data/polygon.svm
new file mode 100644
index 000000000..162ccfd9c
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/polygon.svm
diff --git a/vcl/qa/cppunit/svm/data/polyline.svm b/vcl/qa/cppunit/svm/data/polyline.svm
new file mode 100644
index 000000000..9139da371
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/polyline.svm
diff --git a/vcl/qa/cppunit/svm/data/polypolygon.svm b/vcl/qa/cppunit/svm/data/polypolygon.svm
new file mode 100644
index 000000000..ea01bd14a
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/polypolygon.svm
diff --git a/vcl/qa/cppunit/svm/data/pushpop.svm b/vcl/qa/cppunit/svm/data/pushpop.svm
new file mode 100644
index 000000000..d5ab6e80a
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/pushpop.svm
diff --git a/vcl/qa/cppunit/svm/data/rasterop.svm b/vcl/qa/cppunit/svm/data/rasterop.svm
new file mode 100644
index 000000000..ac9f796c2
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/rasterop.svm
diff --git a/vcl/qa/cppunit/svm/data/rect.svm b/vcl/qa/cppunit/svm/data/rect.svm
new file mode 100644
index 000000000..8c398b572
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/rect.svm
diff --git a/vcl/qa/cppunit/svm/data/roundrect.svm b/vcl/qa/cppunit/svm/data/roundrect.svm
new file mode 100644
index 000000000..aa0ca3e29
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/roundrect.svm
diff --git a/vcl/qa/cppunit/svm/data/strecthtext.svm b/vcl/qa/cppunit/svm/data/strecthtext.svm
new file mode 100644
index 000000000..f6dcb5fba
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/strecthtext.svm
diff --git a/vcl/qa/cppunit/svm/data/text.svm b/vcl/qa/cppunit/svm/data/text.svm
new file mode 100644
index 000000000..37da7f598
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/text.svm
diff --git a/vcl/qa/cppunit/svm/data/textalign.svm b/vcl/qa/cppunit/svm/data/textalign.svm
new file mode 100644
index 000000000..091c49876
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/textalign.svm
diff --git a/vcl/qa/cppunit/svm/data/textarray.svm b/vcl/qa/cppunit/svm/data/textarray.svm
new file mode 100644
index 000000000..7863b03ce
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/textarray.svm
diff --git a/vcl/qa/cppunit/svm/data/textcolor.svm b/vcl/qa/cppunit/svm/data/textcolor.svm
new file mode 100644
index 000000000..f55b3ccd7
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/textcolor.svm
diff --git a/vcl/qa/cppunit/svm/data/textfillecolor.svm b/vcl/qa/cppunit/svm/data/textfillecolor.svm
new file mode 100644
index 000000000..52a4f29f3
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/textfillecolor.svm
diff --git a/vcl/qa/cppunit/svm/data/textline.svm b/vcl/qa/cppunit/svm/data/textline.svm
new file mode 100644
index 000000000..1d8517823
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/textline.svm
diff --git a/vcl/qa/cppunit/svm/data/textlinecolor.svm b/vcl/qa/cppunit/svm/data/textlinecolor.svm
new file mode 100644
index 000000000..786dfc465
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/textlinecolor.svm
diff --git a/vcl/qa/cppunit/svm/data/textrectangle.svm b/vcl/qa/cppunit/svm/data/textrectangle.svm
new file mode 100644
index 000000000..62c424d6a
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/textrectangle.svm
diff --git a/vcl/qa/cppunit/svm/data/transparent.svm b/vcl/qa/cppunit/svm/data/transparent.svm
new file mode 100644
index 000000000..40864b90a
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/transparent.svm
diff --git a/vcl/qa/cppunit/svm/data/wallpaper.svm b/vcl/qa/cppunit/svm/data/wallpaper.svm
new file mode 100644
index 000000000..8fca8c31f
--- /dev/null
+++ b/vcl/qa/cppunit/svm/data/wallpaper.svm
diff --git a/vcl/qa/cppunit/svm/svmtest.cxx b/vcl/qa/cppunit/svm/svmtest.cxx
new file mode 100644
index 000000000..413c3b7f6
--- /dev/null
+++ b/vcl/qa/cppunit/svm/svmtest.cxx
@@ -0,0 +1,1684 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ *
+ */
+
+#include <test/bootstrapfixture.hxx>
+#include <test/xmltesttools.hxx>
+#include <vcl/gdimtf.hxx>
+#include <vcl/gradient.hxx>
+#include <vcl/hatch.hxx>
+#include <vcl/lineinfo.hxx>
+#include <vcl/virdev.hxx>
+#include <bitmapwriteaccess.hxx>
+#include <vcl/pngwrite.hxx>
+
+#include <config_features.h>
+#if HAVE_FEATURE_OPENGL
+#include <vcl/opengl/OpenGLHelper.hxx>
+#endif
+#include <vcl/skia/SkiaHelper.hxx>
+
+using namespace css;
+
+class SvmTest : public test::BootstrapFixture, public XmlTestTools
+{
+    OUString maDataUrl;
+
+    OUString getFullUrl(const OUString& sFileName)
+    {
+        return m_directories.getURLFromSrc(maDataUrl) + sFileName;
+    }
+
+    void checkRendering(ScopedVclPtrInstance<VirtualDevice> const & pVirtualDev, const GDIMetaFile& rMetaFile);
+
+    // write GDI Metafile to a file in data directory
+    // only use this for new tests to create the svm file
+    void writeToFile(GDIMetaFile& rMetaFile, OUString const & rName);
+
+    GDIMetaFile writeAndReadStream(GDIMetaFile& rMetaFile, OUString const & rName = OUString());
+
+    GDIMetaFile readFile(const OUString& sName);
+
+    xmlDocUniquePtr dumpMeta(const GDIMetaFile& rMetaFile);
+
+    void checkVirtualDevice(const xmlDocUniquePtr& pDoc);
+    void checkErase(const xmlDocUniquePtr& pDoc);
+
+    void checkPixel(const GDIMetaFile& rMetaFile);
+    void testPixel();
+
+    void checkPoint(const GDIMetaFile& rMetaFile);
+    void testPoint();
+
+    void checkLine(const GDIMetaFile& rMetaFile);
+    void testLine();
+
+    void checkRect(const GDIMetaFile& rMetaFile);
+    void testRect();
+
+    void checkRoundRect(const GDIMetaFile& rMetaFile);
+    void testRoundRect();
+
+    void checkEllipse(const GDIMetaFile& rMetaFile);
+    void testEllipse();
+
+    void checkArc(const GDIMetaFile& rMetaFile);
+    void testArc();
+
+    void checkPie(const GDIMetaFile& rMetaFile);
+    void testPie();
+
+    void checkChord(const GDIMetaFile& rMetaFile);
+    void testChord();
+
+    void checkPolyLine(const GDIMetaFile& rMetaFile);
+    void testPolyLine();
+
+    void checkPolygon(const GDIMetaFile& rMetaFile);
+    void testPolygon();
+
+    void checkPolyPolygon(const GDIMetaFile& rMetaFile);
+    void testPolyPolygon();
+
+    void checkText(const GDIMetaFile& rMetaFile);
+    void testText();
+
+    void checkTextArray(const GDIMetaFile& rMetaFile);
+    void testTextArray();
+
+    void checkStrechText(const GDIMetaFile& rMetaFile);
+    void testStrechText();
+
+    void checkTextRect(const GDIMetaFile& rMetaFile);
+    void testTextRect();
+
+    void checkTextLine(const GDIMetaFile& rMetaFile);
+    void testTextLine();
+
+    void checkBitmaps(const GDIMetaFile& rMetaFile);
+    void testBitmaps();
+
+    void checkBitmapExs(const GDIMetaFile& rMetaFile);
+    void testBitmapExs();
+
+    void checkMasks(const GDIMetaFile& rMetaFile);
+    void testMasks();
+
+    void checkGradient(const GDIMetaFile& rMetaFile);
+    void testGradient();
+
+    //void checkGradientEx(const GDIMetaFile& rMetaFile);
+    void testGradientEx();
+
+    void checkHatch(const GDIMetaFile& rMetaFile);
+    void testHatch();
+
+    void checkWallpaper(const GDIMetaFile& rMetaFile);
+    void testWallpaper();
+
+    void checkClipRegion(const GDIMetaFile& rMetaFile);
+    void testClipRegion();
+
+    //void checkIntersectRectClipRegion(const GDIMetaFile& rMetaFile);
+    void testIntersectRectClipRegion();
+
+    //void checkIntersectRegionClipRegion(const GDIMetaFile& rMetaFile);
+    void testIntersectRegionClipRegion();
+
+    //void checkMoveClipRegion(const GDIMetaFile& rMetaFile);
+    void testMoveClipRegion();
+
+    void checkLineColor(const GDIMetaFile& rMetaFile);
+    void testLineColor();
+
+    void checkFillColor(const GDIMetaFile& rMetaFile);
+    void testFillColor();
+
+    void checkTextColor(const GDIMetaFile& rMetaFile);
+    void testTextColor();
+
+    void checkTextFillColor(const GDIMetaFile& rMetaFile);
+    void testTextFillColor();
+
+    void checkTextLineColor(const GDIMetaFile& rMetaFile);
+    void testTextLineColor();
+
+    void checkOverLineColor(const GDIMetaFile& rMetaFile);
+    void testOverLineColor();
+
+    void checkTextAlign(const GDIMetaFile& rMetaFile);
+    void testTextAlign();
+
+    //void checkMapMode(const GDIMetaFile& rMetaFile);
+    void testMapMode();
+
+    //void checkFont(const GDIMetaFile& rMetaFile);
+    void testFont();
+
+    void checkPushPop(const GDIMetaFile& rMetaFile);
+    void testPushPop();
+
+    void checkRasterOp(const GDIMetaFile& rMetaFile);
+    void testRasterOp();
+
+    void checkTransparent(const GDIMetaFile& rMetaFile);
+    void testTransparent();
+
+    //void checkFloatTransparent(const GDIMetaFile& rMetaFile);
+    void testFloatTransparent();
+
+    //void checkEPS(const GDIMetaFile& rMetaFile);
+    void testEPS();
+
+    //void checkRefPoint(const GDIMetaFile& rMetaFile);
+    void testRefPoint();
+
+    //void checkComment(const GDIMetaFile& rMetaFile);
+    void testComment();
+
+    //void checkLayoutMode(const GDIMetaFile& rMetaFile);
+    void testLayoutMode();
+
+    //void checkTextLanguage(const GDIMetaFile& rMetaFile);
+    void testTextLanguage();
+
+public:
+    SvmTest()
+        : BootstrapFixture(true, false)
+        , maDataUrl("/vcl/qa/cppunit/svm/data/")
+    {}
+
+    CPPUNIT_TEST_SUITE(SvmTest);
+    CPPUNIT_TEST(testPixel);
+    CPPUNIT_TEST(testPoint);
+    CPPUNIT_TEST(testLine);
+    CPPUNIT_TEST(testRect);
+    CPPUNIT_TEST(testRoundRect);
+    CPPUNIT_TEST(testEllipse);
+    CPPUNIT_TEST(testArc);
+    CPPUNIT_TEST(testPie);
+    CPPUNIT_TEST(testChord);
+    CPPUNIT_TEST(testPolyLine);
+    CPPUNIT_TEST(testPolygon);
+    CPPUNIT_TEST(testPolyPolygon);
+    CPPUNIT_TEST(testText);
+    CPPUNIT_TEST(testTextArray);
+    CPPUNIT_TEST(testStrechText);
+    CPPUNIT_TEST(testTextRect);
+    CPPUNIT_TEST(testTextLine);
+    CPPUNIT_TEST(testBitmaps); // BMP, BMPSCALE, BMPSCALEPART
+    CPPUNIT_TEST(testBitmapExs); // BMPEX, BMPEXSCALE, BMPEXSCALEPART
+    CPPUNIT_TEST(testMasks); // MASK, MASKSCALE, MASKSCALEPART
+    CPPUNIT_TEST(testGradient);
+    CPPUNIT_TEST(testGradientEx);
+    CPPUNIT_TEST(testHatch);
+    CPPUNIT_TEST(testWallpaper);
+    CPPUNIT_TEST(testClipRegion);
+    CPPUNIT_TEST(testIntersectRectClipRegion);
+    CPPUNIT_TEST(testIntersectRegionClipRegion);
+    CPPUNIT_TEST(testMoveClipRegion);
+    CPPUNIT_TEST(testLineColor);
+    CPPUNIT_TEST(testFillColor);
+    CPPUNIT_TEST(testTextColor);
+    CPPUNIT_TEST(testTextFillColor);
+    CPPUNIT_TEST(testTextLineColor);
+    CPPUNIT_TEST(testOverLineColor);
+    CPPUNIT_TEST(testTextAlign);
+    CPPUNIT_TEST(testMapMode);
+    CPPUNIT_TEST(testFont);
+    CPPUNIT_TEST(testPushPop);
+    CPPUNIT_TEST(testRasterOp);
+    CPPUNIT_TEST(testTransparent);
+    CPPUNIT_TEST(testFloatTransparent);
+    CPPUNIT_TEST(testEPS);
+    CPPUNIT_TEST(testRefPoint);
+    CPPUNIT_TEST(testComment);
+    CPPUNIT_TEST(testLayoutMode);
+    CPPUNIT_TEST(testTextLanguage);
+
+    CPPUNIT_TEST_SUITE_END();
+};
+
+static void setupBaseVirtualDevice(VirtualDevice& rDevice, GDIMetaFile& rMeta)
+{
+    rDevice.SetConnectMetaFile(&rMeta);
+    Size aVDSize(10, 10);
+    rDevice.SetOutputSizePixel(aVDSize);
+    rDevice.SetBackground(Wallpaper(COL_LIGHTRED));
+    rDevice.Erase();
+}
+
+void SvmTest::checkRendering(ScopedVclPtrInstance<VirtualDevice> const & pVirtualDev, const GDIMetaFile& rMetaFile)
+{
+    BitmapEx aSourceBitmapEx = pVirtualDev->GetBitmapEx(Point(), Size(10, 10));
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDevResult;
+    const_cast<GDIMetaFile&>(rMetaFile).Play(pVirtualDevResult.get());
+    BitmapEx aResultBitmapEx = pVirtualDev->GetBitmapEx(Point(), Size(10, 10));
+
+    const bool bWriteCompareBitmap = false;
+
+    if (bWriteCompareBitmap)
+    {
+        utl::TempFile aTempFile;
+        aTempFile.EnableKillingFile();
+
+        {
+            SvFileStream aStream(aTempFile.GetURL() + ".source.png", StreamMode::WRITE | StreamMode::TRUNC);
+            vcl::PNGWriter aPNGWriter(aSourceBitmapEx);
+            aPNGWriter.Write(aStream);
+        }
+        {
+            SvFileStream aStream(aTempFile.GetURL() + ".result.png", StreamMode::WRITE | StreamMode::TRUNC);
+            vcl::PNGWriter aPNGWriter(aResultBitmapEx);
+            aPNGWriter.Write(aStream);
+        }
+    }
+    CPPUNIT_ASSERT_EQUAL(aSourceBitmapEx.GetChecksum(), aResultBitmapEx.GetChecksum());
+}
+
+static GDIMetaFile readMetafile(const OUString& rUrl)
+{
+    GDIMetaFile aResultMetafile;
+    SvFileStream aFileStream(rUrl, StreamMode::READ);
+    aFileStream.Seek(STREAM_SEEK_TO_BEGIN);
+    aResultMetafile.Read(aFileStream);
+    return aResultMetafile;
+}
+
+static void writeMetaFile(GDIMetaFile& rInputMetafile, const OUString& rUrl)
+{
+    SvFileStream aFileStream(rUrl, StreamMode::WRITE);
+    aFileStream.Seek(STREAM_SEEK_TO_BEGIN);
+    rInputMetafile.Write(aFileStream);
+    aFileStream.Close();
+}
+
+void SvmTest::writeToFile(GDIMetaFile& rMetaFile, OUString const & rName)
+{
+    if (rName.isEmpty())
+        return;
+    OUString sFilePath = getFullUrl(rName);
+    writeMetaFile(rMetaFile, sFilePath);
+}
+
+GDIMetaFile SvmTest::writeAndReadStream(GDIMetaFile& rMetaFile, OUString const & rName)
+{
+    if (!rName.isEmpty())
+        writeToFile(rMetaFile, rName);
+
+    SvMemoryStream aStream;
+    rMetaFile.Write(aStream);
+    aStream.Seek(STREAM_SEEK_TO_BEGIN);
+
+    GDIMetaFile aResultMetafile;
+    aResultMetafile.Read(aStream);
+    return aResultMetafile;
+}
+
+GDIMetaFile SvmTest::readFile(const OUString& sName)
+{
+    OUString sFilePath = getFullUrl(sName);
+    return readMetafile(sFilePath);
+}
+
+xmlDocUniquePtr SvmTest::dumpMeta(const GDIMetaFile& rMetaFile)
+{
+    MetafileXmlDump dumper;
+    xmlDocUniquePtr pDoc = dumpAndParse(dumper, rMetaFile);
+    CPPUNIT_ASSERT (pDoc);
+
+    checkVirtualDevice(pDoc);
+    checkErase(pDoc);
+
+    return pDoc;
+}
+
+void SvmTest::checkVirtualDevice(const xmlDocUniquePtr& pDoc)
+{
+    assertXPath(pDoc, "/metafile/linecolor[1]", "color", "#000000");
+    assertXPath(pDoc, "/metafile/fillcolor[1]", "color", "#ffffff");
+
+    assertXPathAttrs(pDoc, "/metafile/rect[1]", {
+        {"left", "0"},  {"top", "0"},
+        {"right", "9"}, {"bottom", "9"}
+    });
+
+    assertXPath(pDoc, "/metafile/linecolor[2]", "color", "#000000");
+    assertXPath(pDoc, "/metafile/fillcolor[2]", "color", "#ffffff");
+}
+
+void SvmTest::checkErase(const xmlDocUniquePtr& pDoc)
+{
+    assertXPath(pDoc, "/metafile/linecolor[3]", "color", "#000000");
+    assertXPath(pDoc, "/metafile/fillcolor[3]", "color", "#ff0000");
+
+    assertXPathAttrs(pDoc, "/metafile/rect[2]", {
+        {"left", "0"},  {"top", "0"},
+        {"right", "9"}, {"bottom", "9"}
+    });
+}
+
+void SvmTest::checkPixel(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/pixel[1]", {
+        {"x", "8"}, {"y", "1"}, {"color", "#008000"},
+    });
+
+    assertXPathAttrs(pDoc, "/metafile/pixel[2]", {
+        {"x", "1"}, {"y", "8"}, {"color", "#000080"},
+    });
+}
+
+void SvmTest::testPixel()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->DrawPixel(Point(8, 1), COL_GREEN);
+    pVirtualDev->DrawPixel(Point(1, 8), COL_BLUE);
+
+    checkPixel(writeAndReadStream(aGDIMetaFile));
+    checkPixel(readFile("pixel.svm"));
+}
+
+void SvmTest::checkPoint(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/point[1]", {
+        {"x", "4"}, {"y", "4"}
+    });
+}
+
+void SvmTest::testPoint()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->DrawPixel(Point(4, 4));
+
+    checkPoint(writeAndReadStream(aGDIMetaFile));
+    checkPoint(readFile("point.svm"));
+}
+
+void SvmTest::checkLine(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/line[1]", {
+        {"startx", "1"}, {"starty", "1"},
+        {"endx", "8"},   {"endy", "8"},
+    });
+
+    assertXPathAttrs(pDoc, "/metafile/line[1]", {
+        {"style", "solid"}, {"width", "0"},
+        {"dashlen", "0"},   {"dashcount", "0"},
+        {"dotlen", "0"},    {"dotcount", "0"},
+        {"distance", "0"},
+        {"join", "round"},  {"cap", "butt"}
+    });
+
+    assertXPathAttrs(pDoc, "/metafile/line[2]", {
+        {"startx", "1"}, {"starty", "8"},
+        {"endx", "8"},   {"endy", "1"},
+    });
+
+    assertXPathAttrs(pDoc, "/metafile/line[2]", {
+        {"style", "dash"},  {"width", "7"},
+        {"dashlen", "5"},   {"dashcount", "4"},
+        {"dotlen", "3"},    {"dotcount", "2"},
+        {"distance", "1"},
+        {"join", "miter"},  {"cap", "round"}
+    });
+}
+
+void SvmTest::testLine()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->DrawLine(Point(1, 1), Point(8, 8));
+    LineInfo aLineInfo(LineStyle::Dash, 7);
+    aLineInfo.SetDashLen(5);
+    aLineInfo.SetDashCount(4);
+    aLineInfo.SetDotLen(3);
+    aLineInfo.SetDotCount(2);
+    aLineInfo.SetDistance(1);
+    aLineInfo.SetLineJoin(basegfx::B2DLineJoin::Miter);
+    aLineInfo.SetLineCap(css::drawing::LineCap_ROUND);
+    pVirtualDev->DrawLine(Point(1, 8), Point(8, 1), aLineInfo);
+
+    checkLine(writeAndReadStream(aGDIMetaFile));
+    checkLine(readFile("line.svm"));
+}
+
+void SvmTest::checkRect(const GDIMetaFile& rMetaFile)
+{
+
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPath(pDoc, "/metafile/linecolor[5]", "color", "#123456");
+    assertXPath(pDoc, "/metafile/fillcolor[5]", "color", "#654321");
+
+    assertXPathAttrs(pDoc, "/metafile/rect[3]", {
+        {"left", "1"}, {"top", "2"},
+        {"right", "4"},   {"bottom", "5"},
+    });
+}
+
+void SvmTest::testRect()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetLineColor(Color(0x123456));
+    pVirtualDev->SetFillColor(Color(0x654321));
+
+    pVirtualDev->DrawRect(tools::Rectangle(Point(1, 2), Size(4, 4)));
+
+    checkRect(writeAndReadStream(aGDIMetaFile));
+    checkRect(readFile("rect.svm"));
+}
+
+void SvmTest::checkRoundRect(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPath(pDoc, "/metafile/linecolor[5]", "color", "#123456");
+    assertXPath(pDoc, "/metafile/fillcolor[5]", "color", "#654321");
+
+    assertXPathAttrs(pDoc, "/metafile/roundrect[1]", {
+        {"left", "1"}, {"top", "2"},
+        {"right", "4"},   {"bottom", "5"},
+        {"horizontalround", "1"}, {"verticalround", "2"}
+    });
+}
+
+void SvmTest::testRoundRect()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetLineColor(Color(0x123456));
+    pVirtualDev->SetFillColor(Color(0x654321));
+
+    pVirtualDev->DrawRect(tools::Rectangle(Point(1, 2), Size(4, 4)), 1, 2);
+
+    checkRoundRect(writeAndReadStream(aGDIMetaFile));
+    checkRoundRect(readFile("roundrect.svm"));
+}
+
+void SvmTest::checkEllipse(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPath(pDoc, "/metafile/linecolor[5]", "color", "#123456");
+    assertXPath(pDoc, "/metafile/fillcolor[5]", "color", "#654321");
+
+    assertXPathAttrs(pDoc, "/metafile/ellipse[1]", {
+        {"left", "1"}, {"top", "2"},
+        {"right", "4"},   {"bottom", "5"},
+    });
+}
+
+void SvmTest::testEllipse()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetLineColor(Color(0x123456));
+    pVirtualDev->SetFillColor(Color(0x654321));
+
+    pVirtualDev->DrawEllipse(tools::Rectangle(Point(1, 2), Size(4, 4)));
+
+    checkEllipse(writeAndReadStream(aGDIMetaFile));
+    checkEllipse(readFile("ellipse.svm"));
+}
+
+void SvmTest::checkArc(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPath(pDoc, "/metafile/linecolor[5]", "color", "#123456");
+    assertXPath(pDoc, "/metafile/fillcolor[5]", "color", "#654321");
+
+    assertXPathAttrs(pDoc, "/metafile/arc[1]", {
+        {"left",  "1"}, {"top",    "2"},
+        {"right", "4"}, {"bottom", "5"},
+
+        {"startx", "10"}, {"starty", "11"},
+        {"endx",   "12"}, {"endy",   "13"},
+    });
+}
+
+void SvmTest::testArc()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetLineColor(Color(0x123456));
+    pVirtualDev->SetFillColor(Color(0x654321));
+
+    pVirtualDev->DrawArc(tools::Rectangle(Point(1, 2), Size(4, 4)), Point(10, 11), Point(12, 13));
+
+    checkArc(writeAndReadStream(aGDIMetaFile));
+    checkArc(readFile("arc.svm"));
+}
+
+void SvmTest::checkPie(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPath(pDoc, "/metafile/linecolor[5]", "color", "#123456");
+    assertXPath(pDoc, "/metafile/fillcolor[5]", "color", "#654321");
+
+    assertXPathAttrs(pDoc, "/metafile/pie[1]", {
+        {"left",  "11"}, {"top",    "12"},
+        {"right", "14"}, {"bottom", "15"},
+
+        {"startx", "20"}, {"starty", "21"},
+        {"endx",   "22"}, {"endy",   "23"},
+    });
+}
+
+void SvmTest::testPie()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetLineColor(Color(0x123456));
+    pVirtualDev->SetFillColor(Color(0x654321));
+
+    pVirtualDev->DrawPie(tools::Rectangle(Point(11, 12), Size(4, 4)), Point(20, 21), Point(22, 23));
+
+    checkPie(writeAndReadStream(aGDIMetaFile));
+    checkPie(readFile("pie.svm"));
+}
+
+void SvmTest::checkChord(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPath(pDoc, "/metafile/linecolor[5]", "color", "#123456");
+    assertXPath(pDoc, "/metafile/fillcolor[5]", "color", "#654321");
+
+    assertXPathAttrs(pDoc, "/metafile/chord[1]", {
+        {"left",  "21"}, {"top",    "22"},
+        {"right", "24"}, {"bottom", "25"},
+
+        {"startx", "30"}, {"starty", "31"},
+        {"endx",   "32"}, {"endy",   "33"},
+    });
+}
+
+void SvmTest::testChord()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetLineColor(Color(0x123456));
+    pVirtualDev->SetFillColor(Color(0x654321));
+
+    pVirtualDev->DrawChord(tools::Rectangle(Point(21, 22), Size(4, 4)), Point(30, 31), Point(32, 33));
+
+    checkChord(writeAndReadStream(aGDIMetaFile));
+    checkChord(readFile("chord.svm"));
+}
+
+void SvmTest::checkPolyLine(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/polyline[1]", {
+        {"style", "solid"}, {"width", "0"},
+        {"dashlen", "0"},   {"dashcount", "0"},
+        {"dotlen", "0"},    {"dotcount", "0"},
+        {"distance", "0"},
+        {"join", "round"},  {"cap", "butt"}
+    });
+
+    assertXPathAttrs(pDoc, "/metafile/polyline[1]/point[1]", {{"x", "1"}, {"y", "8"}});
+    assertXPathAttrs(pDoc, "/metafile/polyline[1]/point[2]", {{"x", "2"}, {"y", "7"}});
+    assertXPathAttrs(pDoc, "/metafile/polyline[1]/point[3]", {{"x", "3"}, {"y", "6"}});
+
+    assertXPathAttrs(pDoc, "/metafile/polyline[2]", {
+        {"style", "dash"},  {"width", "7"},
+        {"dashlen", "5"},   {"dashcount", "4"},
+        {"dotlen", "3"},    {"dotcount", "2"},
+        {"distance", "1"},
+        {"join", "miter"},  {"cap", "round"}
+    });
+    assertXPathAttrs(pDoc, "/metafile/polyline[2]/point[1]", {{"x", "8"}, {"y", "1"}, {"flags", "normal"}});
+    assertXPathAttrs(pDoc, "/metafile/polyline[2]/point[2]", {{"x", "7"}, {"y", "2"}, {"flags", "control"}});
+    assertXPathAttrs(pDoc, "/metafile/polyline[2]/point[3]", {{"x", "6"}, {"y", "3"}, {"flags", "smooth"}});
+    assertXPathAttrs(pDoc, "/metafile/polyline[2]/point[4]", {{"x", "5"}, {"y", "4"}, {"flags", "symmetric"}});
+}
+
+void SvmTest::testPolyLine()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    tools::Polygon aPolygon(3);
+    aPolygon.SetPoint(Point(1, 8), 0);
+    aPolygon.SetPoint(Point(2, 7), 1);
+    aPolygon.SetPoint(Point(3, 6), 2);
+
+    pVirtualDev->DrawPolyLine(aPolygon);
+
+    tools::Polygon aPolygonWithControl(4);
+    aPolygonWithControl.SetPoint(Point(8, 1), 0);
+    aPolygonWithControl.SetPoint(Point(7, 2), 1);
+    aPolygonWithControl.SetPoint(Point(6, 3), 2);
+    aPolygonWithControl.SetPoint(Point(5, 4), 3);
+
+    aPolygonWithControl.SetFlags(0, PolyFlags::Normal);
+    aPolygonWithControl.SetFlags(1, PolyFlags::Control);
+    aPolygonWithControl.SetFlags(2, PolyFlags::Smooth);
+    aPolygonWithControl.SetFlags(3, PolyFlags::Symmetric);
+
+    LineInfo aLineInfo(LineStyle::Dash, 7);
+    aLineInfo.SetDashLen(5);
+    aLineInfo.SetDashCount(4);
+    aLineInfo.SetDotLen(3);
+    aLineInfo.SetDotCount(2);
+    aLineInfo.SetDistance(1);
+    aLineInfo.SetLineJoin(basegfx::B2DLineJoin::Miter);
+    aLineInfo.SetLineCap(css::drawing::LineCap_ROUND);
+
+    pVirtualDev->DrawPolyLine(aPolygonWithControl, aLineInfo);
+
+    checkPolyLine(writeAndReadStream(aGDIMetaFile));
+    checkPolyLine(readFile("polyline.svm"));
+}
+
+void SvmTest::checkPolygon(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/polygon[1]/point[1]", {{"x", "1"}, {"y", "8"}});
+    assertXPathAttrs(pDoc, "/metafile/polygon[1]/point[2]", {{"x", "2"}, {"y", "7"}});
+    assertXPathAttrs(pDoc, "/metafile/polygon[1]/point[3]", {{"x", "3"}, {"y", "6"}});
+
+    assertXPathAttrs(pDoc, "/metafile/polygon[2]/point[1]", {{"x", "8"}, {"y", "1"}, {"flags", "normal"}});
+    assertXPathAttrs(pDoc, "/metafile/polygon[2]/point[2]", {{"x", "7"}, {"y", "2"}, {"flags", "control"}});
+    assertXPathAttrs(pDoc, "/metafile/polygon[2]/point[3]", {{"x", "6"}, {"y", "3"}, {"flags", "smooth"}});
+    assertXPathAttrs(pDoc, "/metafile/polygon[2]/point[4]", {{"x", "5"}, {"y", "4"}, {"flags", "symmetric"}});
+}
+
+void SvmTest::testPolygon()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    tools::Polygon aPolygon(3);
+    aPolygon.SetPoint(Point(1, 8), 0);
+    aPolygon.SetPoint(Point(2, 7), 1);
+    aPolygon.SetPoint(Point(3, 6), 2);
+
+    pVirtualDev->DrawPolygon(aPolygon);
+
+    tools::Polygon aPolygonWithControl(4);
+    aPolygonWithControl.SetPoint(Point(8, 1), 0);
+    aPolygonWithControl.SetPoint(Point(7, 2), 1);
+    aPolygonWithControl.SetPoint(Point(6, 3), 2);
+    aPolygonWithControl.SetPoint(Point(5, 4), 3);
+
+    aPolygonWithControl.SetFlags(0, PolyFlags::Normal);
+    aPolygonWithControl.SetFlags(1, PolyFlags::Control);
+    aPolygonWithControl.SetFlags(2, PolyFlags::Smooth);
+    aPolygonWithControl.SetFlags(3, PolyFlags::Symmetric);
+
+    pVirtualDev->DrawPolygon(aPolygonWithControl);
+
+    checkPolygon(writeAndReadStream(aGDIMetaFile));
+    checkPolygon(readFile("polygon.svm"));
+}
+
+void SvmTest::checkPolyPolygon(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/polypolygon[1]/polygon[1]/point[1]", {{"x", "1"}, {"y", "8"}});
+    assertXPathAttrs(pDoc, "/metafile/polypolygon[1]/polygon[1]/point[2]", {{"x", "2"}, {"y", "7"}});
+    assertXPathAttrs(pDoc, "/metafile/polypolygon[1]/polygon[1]/point[3]", {{"x", "3"}, {"y", "6"}});
+
+    assertXPathAttrs(pDoc, "/metafile/polypolygon[1]/polygon[2]/point[1]", {{"x", "8"}, {"y", "1"}, {"flags", "normal"}});
+    assertXPathAttrs(pDoc, "/metafile/polypolygon[1]/polygon[2]/point[2]", {{"x", "7"}, {"y", "2"}, {"flags", "control"}});
+    assertXPathAttrs(pDoc, "/metafile/polypolygon[1]/polygon[2]/point[3]", {{"x", "6"}, {"y", "3"}, {"flags", "smooth"}});
+    assertXPathAttrs(pDoc, "/metafile/polypolygon[1]/polygon[2]/point[4]", {{"x", "5"}, {"y", "4"}, {"flags", "symmetric"}});
+}
+
+void SvmTest::testPolyPolygon()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    tools::Polygon aPolygon(3);
+    aPolygon.SetPoint(Point(1, 8), 0);
+    aPolygon.SetPoint(Point(2, 7), 1);
+    aPolygon.SetPoint(Point(3, 6), 2);
+
+    tools::Polygon aPolygonWithControl(4);
+    aPolygonWithControl.SetPoint(Point(8, 1), 0);
+    aPolygonWithControl.SetPoint(Point(7, 2), 1);
+    aPolygonWithControl.SetPoint(Point(6, 3), 2);
+    aPolygonWithControl.SetPoint(Point(5, 4), 3);
+
+    aPolygonWithControl.SetFlags(0, PolyFlags::Normal);
+    aPolygonWithControl.SetFlags(1, PolyFlags::Control);
+    aPolygonWithControl.SetFlags(2, PolyFlags::Smooth);
+    aPolygonWithControl.SetFlags(3, PolyFlags::Symmetric);
+
+    tools::PolyPolygon aPolyPolygon(2);
+    aPolyPolygon.Insert(aPolygon);
+    aPolyPolygon.Insert(aPolygonWithControl);
+
+    pVirtualDev->DrawPolyPolygon(aPolyPolygon);
+
+    checkPolyPolygon(writeAndReadStream(aGDIMetaFile));
+    checkPolyPolygon(readFile("polypolygon.svm"));
+}
+
+void SvmTest::checkText(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/text[1]", {
+        {"x", "4"}, {"y", "6"}, {"index", "1"}, {"length", "2"},
+    });
+
+    assertXPathContent(pDoc, "/metafile/text[1]/textcontent", "xABC");
+}
+
+void SvmTest::testText()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->DrawText(Point(4,6), "xABC", 1, 2);
+
+    checkText(writeAndReadStream(aGDIMetaFile));
+    checkText(readFile("text.svm"));
+}
+
+void SvmTest::checkTextArray(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/textarray[1]", {
+        {"x", "4"}, {"y", "6"}, {"index", "1"}, {"length", "4"},
+    });
+    assertXPathContent(pDoc, "/metafile/textarray[1]/dxarray", "15 20 25 ");
+    assertXPathContent(pDoc, "/metafile/textarray[1]/text", "123456");
+}
+
+void SvmTest::testTextArray()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+    long const aDX[] = { 10, 15, 20, 25, 30, 35 };
+    pVirtualDev->DrawTextArray(Point(4,6), "123456", aDX, 1, 4);
+
+    checkTextArray(writeAndReadStream(aGDIMetaFile));
+    checkTextArray(readFile("textarray.svm"));
+}
+
+void SvmTest::checkStrechText(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/stretchtext[1]", {
+        {"x", "4"}, {"y", "6"}, {"index", "1"}, {"length", "4"}, {"width", "10"}
+    });
+
+    assertXPathContent(pDoc, "/metafile/stretchtext[1]/textcontent", "123456");
+}
+
+void SvmTest::testStrechText()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+    pVirtualDev->DrawStretchText(Point(4,6), 10, "123456", 1, 4);
+
+    checkStrechText(writeAndReadStream(aGDIMetaFile));
+    checkStrechText(readFile("strecthtext.svm"));
+}
+
+void SvmTest::checkTextRect(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/textrect[1]", {
+        {"left", "0"}, {"top", "0"}, {"right", "4"}, {"bottom", "4"}
+    });
+    assertXPathContent(pDoc, "/metafile/textrect[1]/textcontent", "123456");
+    assertXPathContent(pDoc, "/metafile/textrect[1]/style", "Center");
+}
+
+void SvmTest::testTextRect()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+    pVirtualDev->DrawText(tools::Rectangle(Point(0,0), Size(5,5)), "123456", DrawTextFlags::Center);
+
+    checkTextRect(writeAndReadStream(aGDIMetaFile));
+    checkTextRect(readFile("textrectangle.svm"));
+}
+
+void SvmTest::checkTextLine(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/textline[1]", {
+        {"x", "4"}, {"y", "6"}, {"width", "10"},
+        {"strikeout", "single"}, {"underline", "single"}, {"overline", "single"}
+    });
+}
+
+void SvmTest::testTextLine()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+    pVirtualDev->DrawTextLine(Point(4,6), 10, STRIKEOUT_SINGLE, LINESTYLE_SINGLE, LINESTYLE_SINGLE);
+
+    checkTextLine(writeAndReadStream(aGDIMetaFile));
+    checkTextLine(readFile("textline.svm"));
+}
+
+void SvmTest::checkBitmaps(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    if (SkiaHelper::isVCLSkiaEnabled())
+        return; // TODO SKIA using CRCs is broken (the idea of it)
+
+    OUString crc1 = "b8dee5da";
+    OUString crc2 = "281fc589";
+    OUString crc3 = "5e01ddcc";
+#if HAVE_FEATURE_OPENGL
+    if (OpenGLHelper::isVCLOpenGLEnabled())
+    {
+        // OpenGL uses a different scaling algorithm and also a different RGB order.
+        crc1 = "5e01ddcc";
+        crc2 = "281fc589";
+        crc3 = "b8dee5da";
+    }
+#endif
+
+    assertXPathAttrs(pDoc, "/metafile/bmp[1]", {{"x", "1"}, {"y", "2"}, {"crc", crc1}});
+    assertXPathAttrs(pDoc, "/metafile/bmpscale[1]", {
+        {"x", "1"}, {"y", "2"}, {"width", "3"}, {"height", "4"}, {"crc", crc2}
+    });
+    assertXPathAttrs(pDoc, "/metafile/bmpscalepart[1]", {
+        {"destx", "1"}, {"desty", "2"}, {"destwidth", "3"}, {"destheight", "4"},
+        {"srcx", "2"},  {"srcy", "1"},  {"srcwidth", "4"},  {"srcheight", "3"},
+        {"crc", crc3}
+    });
+}
+
+void SvmTest::testBitmaps()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    Bitmap aBitmap1(Size(4,4), 24);
+    {
+        BitmapScopedWriteAccess pAccess(aBitmap1);
+        pAccess->Erase(COL_RED);
+    }
+    Bitmap aBitmap2(Size(4,4), 24);
+    {
+        BitmapScopedWriteAccess pAccess(aBitmap2);
+        pAccess->Erase(COL_GREEN);
+    }
+    Bitmap aBitmap3(Size(4,4), 24);
+    {
+        BitmapScopedWriteAccess pAccess(aBitmap3);
+        pAccess->Erase(COL_BLUE);
+    }
+    pVirtualDev->DrawBitmap(Point(1, 2), aBitmap1);
+    pVirtualDev->DrawBitmap(Point(1, 2), Size(3, 4), aBitmap2);
+    pVirtualDev->DrawBitmap(Point(1, 2), Size(3, 4), Point(2, 1), Size(4, 3), aBitmap3);
+
+    {
+        GDIMetaFile aReloadedGDIMetaFile = writeAndReadStream(aGDIMetaFile);
+        checkBitmaps(aReloadedGDIMetaFile);
+        checkRendering(pVirtualDev, aReloadedGDIMetaFile);
+    }
+    {
+        GDIMetaFile aFileGDIMetaFile = readFile("bitmaps.svm");
+        checkBitmaps(aFileGDIMetaFile);
+        checkRendering(pVirtualDev, aFileGDIMetaFile);
+    }
+}
+
+void SvmTest::checkBitmapExs(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    if (SkiaHelper::isVCLSkiaEnabled())
+        return; // TODO SKIA using CRCs is broken (the idea of it)
+
+    std::vector<OUString> aExpectedCRC;
+
+#if HAVE_FEATURE_OPENGL
+    if (OpenGLHelper::isVCLOpenGLEnabled())
+    {
+        aExpectedCRC.insert(aExpectedCRC.end(),
+        {
+            "08feb5d3",
+            "281fc589",
+            "b8dee5da",
+            "4df0e464",
+            "7d3a8da3",
+            "1426653b",
+            "4fd547df",
+            "71efc447",
+        });
+    }
+    else
+#endif
+    {
+        aExpectedCRC.insert(aExpectedCRC.end(),
+        {
+            "d8377d4f",
+            "281fc589",
+            "5e01ddcc",
+            "4df0e464",
+            "34434a50",
+            "d1736327",
+            "b37875c2",
+            "a85d44b8",
+        });
+    }
+
+    assertXPathAttrs(pDoc, "/metafile/bmpex[1]", {
+        {"x", "1"}, {"y", "1"}, {"crc", aExpectedCRC[0]}, {"transparenttype", "bitmap"}
+    });
+    assertXPathAttrs(pDoc, "/metafile/bmpexscale[1]", {
+        {"x", "5"}, {"y", "0"}, {"width", "2"}, {"height", "3"},
+        {"crc", aExpectedCRC[1]}, {"transparenttype", "bitmap"}
+    });
+    assertXPathAttrs(pDoc, "/metafile/bmpexscalepart[1]", {
+        {"destx", "7"}, {"desty", "1"}, {"destwidth", "2"}, {"destheight", "2"},
+        {"srcx", "0"},  {"srcy", "0"},  {"srcwidth", "3"},  {"srcheight", "4"},
+        {"crc", aExpectedCRC[2]}, {"transparenttype", "bitmap"}
+    });
+
+#ifndef MACOSX
+    assertXPathAttrs(pDoc, "/metafile/bmpex[2]", {
+        {"x", "6"}, {"y", "6"}, {"crc", aExpectedCRC[3]}, {"transparenttype", "bitmap"}
+    });
+    assertXPathAttrs(pDoc, "/metafile/bmpex[3]", {
+        {"x", "0"}, {"y", "6"}, {"crc", aExpectedCRC[4]}, {"transparenttype", "bitmap"}
+    });
+    assertXPathAttrs(pDoc, "/metafile/bmpex[4]", {
+        {"x", "2"}, {"y", "6"}, {"crc", aExpectedCRC[5]}, {"transparenttype", "bitmap"}
+    });
+    assertXPathAttrs(pDoc, "/metafile/bmpex[5]", {
+        {"x", "0"}, {"y", "8"}, {"crc", aExpectedCRC[6]}, {"transparenttype", "bitmap"}
+    });
+    assertXPathAttrs(pDoc, "/metafile/bmpex[6]", {
+        {"x", "2"}, {"y", "8"}, {"crc", aExpectedCRC[7]}, {"transparenttype", "bitmap"}
+    });
+#endif
+}
+
+void SvmTest::testBitmapExs()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    // DrawBitmapEx
+    {
+        Bitmap aBitmap(Size(4,4), 24);
+        {
+            BitmapScopedWriteAccess pAccess(aBitmap);
+            pAccess->Erase(COL_YELLOW);
+        }
+
+        pVirtualDev->DrawBitmapEx(Point(1, 1), BitmapEx(aBitmap, COL_WHITE));
+    }
+
+    // DrawBitmapEx - Scale
+    {
+        Bitmap aBitmap(Size(4,4), 24);
+        {
+            BitmapScopedWriteAccess pAccess(aBitmap);
+            pAccess->Erase(COL_GREEN);
+        }
+        pVirtualDev->DrawBitmapEx(Point(5, 0), Size(2, 3), BitmapEx(aBitmap, COL_WHITE));
+    }
+
+    // DrawBitmapEx - Scale - Part
+    {
+        Bitmap aBitmap(Size(4,4), 24);
+        {
+            BitmapScopedWriteAccess pAccess(aBitmap);
+            pAccess->Erase(COL_BLUE);
+        }
+        pVirtualDev->DrawBitmapEx(Point(7, 1), Size(2, 2), Point(0, 0), Size(3, 4), BitmapEx(aBitmap, COL_WHITE));
+    }
+
+    // DrawBitmapEx - 50% transparent
+    {
+        Bitmap aBitmap(Size(4, 4), 24);
+        AlphaMask aAlpha(Size(4, 4));
+        {
+            BitmapScopedWriteAccess pAccess(aBitmap);
+            pAccess->Erase(COL_MAGENTA);
+
+            AlphaScopedWriteAccess pAlphaAccess(aAlpha);
+            pAlphaAccess->Erase(Color(128, 128, 128));
+        }
+        pVirtualDev->DrawBitmapEx(Point(6, 6), BitmapEx(aBitmap, aAlpha));
+    }
+
+    // DrawBitmapEx - 1-bit
+    {
+        Bitmap aBitmap(Size(2, 2), 24);
+        {
+            BitmapScopedWriteAccess pAccess(aBitmap);
+            pAccess->Erase(COL_MAGENTA);
+        }
+        aBitmap.Convert(BmpConversion::N1BitThreshold);
+        pVirtualDev->DrawBitmapEx(Point(0, 6), BitmapEx(aBitmap, COL_WHITE));
+    }
+
+    // DrawBitmapEx - 4-bit
+    {
+        Bitmap aBitmap(Size(2, 2), 24);
+        {
+            BitmapScopedWriteAccess pAccess(aBitmap);
+            pAccess->Erase(COL_MAGENTA);
+        }
+        aBitmap.Convert(BmpConversion::N4BitColors);
+        pVirtualDev->DrawBitmapEx(Point(2, 6), BitmapEx(aBitmap, COL_WHITE));
+    }
+
+    // DrawBitmapEx - 8-bit Color
+    {
+        Bitmap aBitmap(Size(2, 2), 24);
+        {
+            BitmapScopedWriteAccess pAccess(aBitmap);
+            pAccess->Erase(COL_MAGENTA);
+        }
+        aBitmap.Convert(BmpConversion::N8BitColors);
+        pVirtualDev->DrawBitmapEx(Point(0, 8), BitmapEx(aBitmap, COL_WHITE));
+    }
+
+    // DrawBitmapEx - 8-bit Grey
+    {
+        Bitmap aBitmap(Size(2, 2), 24);
+        {
+            BitmapScopedWriteAccess pAccess(aBitmap);
+            pAccess->Erase(COL_MAGENTA);
+        }
+        aBitmap.Convert(BmpConversion::N8BitGreys);
+        pVirtualDev->DrawBitmapEx(Point(2, 8), BitmapEx(aBitmap, COL_WHITE));
+    }
+
+    {
+        GDIMetaFile aReloadedGDIMetaFile = writeAndReadStream(aGDIMetaFile);
+        checkBitmapExs(aReloadedGDIMetaFile);
+        checkRendering(pVirtualDev, aReloadedGDIMetaFile);
+    }
+    {
+        GDIMetaFile aFileGDIMetaFile = readFile("bitmapexs.svm");
+        checkBitmapExs(aFileGDIMetaFile);
+        checkRendering(pVirtualDev, aFileGDIMetaFile);
+    }
+}
+
+void SvmTest::checkMasks(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/mask[1]", {
+        {"x", "1"}, {"y", "2"},
+        {"color", "#000000"}
+    });
+    assertXPathAttrs(pDoc, "/metafile/maskscale[1]", {
+        {"x", "1"}, {"y", "2"}, {"width", "3"}, {"height", "4"},
+        {"color", "#000000"}
+    });
+    assertXPathAttrs(pDoc, "/metafile/maskscalepart[1]", {
+        {"destx", "1"}, {"desty", "2"}, {"destwidth", "3"}, {"destheight", "4"},
+        {"srcx", "2"},  {"srcy", "1"},  {"srcwidth", "4"},  {"srcheight", "3"},
+        {"color", "#ff0000"}
+    });
+}
+
+// TODO: Masks are kind-of special - we don't persist the color attribute (it is
+// always #000000) of the meta-action (which is wrong), but rely on alpha to do
+// the right thing.
+void SvmTest::testMasks()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    Bitmap aBitmap1(Size(4,4), 24);
+    {
+        BitmapScopedWriteAccess pAccess(aBitmap1);
+        pAccess->Erase(COL_RED);
+    }
+    Bitmap aBitmap2(Size(4,4), 24);
+    {
+        BitmapScopedWriteAccess pAccess(aBitmap2);
+        pAccess->Erase(COL_GREEN);
+    }
+    Bitmap aBitmap3(Size(4,4), 24);
+    {
+        BitmapScopedWriteAccess pAccess(aBitmap3);
+        pAccess->Erase(COL_BLUE);
+    }
+
+    pVirtualDev->DrawMask(Point(1, 2), aBitmap1, COL_LIGHTRED);
+    pVirtualDev->DrawMask(Point(1, 2), Size(3, 4), aBitmap2, COL_LIGHTRED);
+    pVirtualDev->DrawMask(Point(1, 2), Size(3, 4), Point(2, 1), Size(4, 3), aBitmap3, COL_LIGHTRED, MetaActionType::MASKSCALEPART);
+
+    checkMasks(writeAndReadStream(aGDIMetaFile));
+    checkMasks(readFile("masks.svm"));
+}
+
+void SvmTest::checkGradient(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/gradient[1]", {
+        {"style", "Linear"},
+        {"startcolor", "#ffffff"},
+        {"endcolor", "#000000"},
+        {"angle", "0"},
+        {"border", "0"},
+        {"offsetx", "50"},
+        {"offsety", "50"},
+        {"startintensity", "100"},
+        {"endintensity", "100"},
+        {"steps", "0"},
+    });
+    assertXPathAttrs(pDoc, "/metafile/gradient[1]/rectangle", {
+        {"left", "1"},
+        {"top", "2"},
+        {"right", "4"},
+        {"bottom", "6"},
+    });
+
+    assertXPathAttrs(pDoc, "/metafile/gradient[2]", {
+        {"style", "Radial"},
+        {"startcolor", "#ff0000"},
+        {"endcolor", "#00ff00"},
+        {"angle", "55"},
+        {"border", "10"},
+        {"offsetx", "22"},
+        {"offsety", "24"},
+        {"startintensity", "4"},
+        {"endintensity", "14"},
+        {"steps", "64"},
+    });
+    assertXPathAttrs(pDoc, "/metafile/gradient[2]/rectangle", {
+        {"left", "3"},
+        {"top", "4"},
+        {"right", "3"},
+        {"bottom", "5"},
+    });
+}
+
+void SvmTest::testGradient()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    tools::Rectangle aRectangle(Point(1, 2), Size(4,5));
+
+    Gradient aGradient(GradientStyle::Linear, COL_WHITE, COL_BLACK);
+    pVirtualDev->DrawGradient(aRectangle, aGradient);
+
+    tools::Rectangle aRectangle2(Point(3, 4), Size(1,2));
+
+    Gradient aGradient2;
+    aGradient2.SetStyle(GradientStyle::Radial);
+    aGradient2.SetStartColor(COL_LIGHTRED);
+    aGradient2.SetEndColor(COL_LIGHTGREEN);
+    aGradient2.SetAngle(55);
+    aGradient2.SetBorder(10);
+    aGradient2.SetOfsX(22);
+    aGradient2.SetOfsY(24);
+    aGradient2.SetStartIntensity(4);
+    aGradient2.SetEndIntensity(14);
+    aGradient2.SetSteps(64);
+    pVirtualDev->DrawGradient(aRectangle2, aGradient2);
+
+    checkGradient(writeAndReadStream(aGDIMetaFile));
+    checkGradient(readFile("gradient.svm"));
+}
+
+void SvmTest::testGradientEx()
+{}
+
+void SvmTest::checkHatch(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/hatch[1]/polygon/point[1]", {
+        {"x", "1"}, {"y", "8"},
+    });
+    assertXPathAttrs(pDoc, "/metafile/hatch[1]/polygon/point[2]", {
+        {"x", "2"}, {"y", "7"},
+    });
+    assertXPathAttrs(pDoc, "/metafile/hatch[1]/polygon/point[3]", {
+        {"x", "3"}, {"y", "6"},
+    });
+
+    assertXPathAttrs(pDoc, "/metafile/hatch[1]/hatch", {
+        {"style", "Single"},
+        {"color", "#ffff00"},
+        {"distance", "15"},
+        {"angle", "900"},
+    });
+}
+
+void SvmTest::testHatch()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    tools::Polygon aPolygon(3);
+    aPolygon.SetPoint(Point(1, 8), 0);
+    aPolygon.SetPoint(Point(2, 7), 1);
+    aPolygon.SetPoint(Point(3, 6), 2);
+
+    tools::PolyPolygon aPolyPolygon(1);
+    aPolyPolygon.Insert(aPolygon);
+
+    Hatch aHatch(HatchStyle::Single, COL_YELLOW, 15, 900);
+
+    pVirtualDev->DrawHatch(aPolyPolygon, aHatch);
+
+    checkHatch(writeAndReadStream(aGDIMetaFile));
+    checkHatch(readFile("hatch.svm"));
+}
+
+void SvmTest::checkWallpaper(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    // Funny enough - we don't serialize the rectangle of the wallpaper so it's always EMPTY
+    assertXPathAttrs(pDoc, "/metafile/wallpaper[1]",
+    {
+        {"left", "0"},
+        {"top", "0"},
+        {"right", "empty"},
+        {"bottom", "empty"},
+    });
+
+    assertXPathAttrs(pDoc, "/metafile/wallpaper[1]/wallpaper",
+    {
+        {"color", "#00ff00"},
+        {"style", "Tile"},
+        {"fixed", "true"},
+        {"scrollable", "true"},
+    });
+}
+
+void SvmTest::testWallpaper()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    Wallpaper aWallpaper(COL_LIGHTGREEN);
+    pVirtualDev->DrawWallpaper(tools::Rectangle(Point(1, 1), Size(3, 3)), aWallpaper);
+
+    checkWallpaper(writeAndReadStream(aGDIMetaFile));
+    checkWallpaper(readFile("wallpaper.svm"));
+}
+
+void SvmTest::checkClipRegion(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/clipregion[1]", {
+        {"left", "2"},
+        {"top", "2"},
+        {"right", "5"},
+        {"bottom", "5"},
+    });
+}
+
+void SvmTest::testClipRegion()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    vcl::Region aRegion(tools::Rectangle(Point(2, 2), Size(4, 4)));
+
+    // TODO
+    // explicit Region(const tools::Polygon& rPolygon);
+    // explicit Region(const tools::PolyPolygon& rPolyPoly);
+    // explicit Region(const basegfx::B2DPolyPolygon&);
+    pVirtualDev->SetClipRegion(aRegion);
+
+    checkClipRegion(writeAndReadStream(aGDIMetaFile));
+    checkClipRegion(readFile("clipregion.svm"));
+}
+
+void SvmTest::testIntersectRectClipRegion()
+{}
+void SvmTest::testIntersectRegionClipRegion()
+{}
+void SvmTest::testMoveClipRegion()
+{}
+
+void SvmTest::checkLineColor(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/push/linecolor[1]", {
+        {"color", "#654321"},
+    });
+}
+
+void SvmTest::testLineColor()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->Push();
+    pVirtualDev->SetLineColor(Color(0x654321));
+    pVirtualDev->Pop();
+
+    checkLineColor(writeAndReadStream(aGDIMetaFile));
+    checkLineColor(readFile("linecolor.svm"));
+}
+
+void SvmTest::checkFillColor(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/push/fillcolor[1]", {
+        {"color", "#456789"},
+    });
+}
+
+void SvmTest::testFillColor()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->Push();
+    pVirtualDev->SetFillColor(Color(0x456789));
+    pVirtualDev->Pop();
+
+    checkFillColor(writeAndReadStream(aGDIMetaFile));
+    checkFillColor(readFile("fillcolor.svm"));
+}
+
+void SvmTest::checkTextColor(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/textcolor[1]", {
+        {"color", "#123456"},
+    });
+}
+
+void SvmTest::testTextColor()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetTextColor(Color(0x123456));
+
+    checkTextColor(writeAndReadStream(aGDIMetaFile));
+    checkTextColor(readFile("textcolor.svm"));
+}
+
+void SvmTest::checkTextFillColor(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/textfillcolor[1]", {
+        {"color", "#234567"},
+    });
+}
+
+void SvmTest::testTextFillColor()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetTextFillColor(Color(0x234567));
+
+    checkTextFillColor(writeAndReadStream(aGDIMetaFile));
+    checkTextFillColor(readFile("textfillecolor.svm"));
+}
+
+void SvmTest::checkTextLineColor(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/textlinecolor[1]", {
+        {"color", "#345678"},
+    });
+}
+
+void SvmTest::testTextLineColor()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetTextLineColor(Color(0x345678));
+
+    checkTextLineColor(writeAndReadStream(aGDIMetaFile));
+    checkTextLineColor(readFile("textlinecolor.svm"));
+}
+
+void SvmTest::checkOverLineColor(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/push/overlinecolor[1]", {
+        {"color", "#345678"},
+    });
+}
+
+void SvmTest::testOverLineColor()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->Push();
+    pVirtualDev->SetOverlineColor(Color(0x345678));
+    pVirtualDev->Pop();
+
+    checkOverLineColor(writeAndReadStream(aGDIMetaFile));
+    checkOverLineColor(readFile("overlinecolor.svm"));
+}
+
+void SvmTest::checkTextAlign(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/textalign[1]", {
+        {"align", "bottom"},
+    });
+}
+
+void SvmTest::testTextAlign()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetTextAlign(TextAlign::ALIGN_BOTTOM);
+
+    checkTextAlign(writeAndReadStream(aGDIMetaFile));
+    checkTextAlign(readFile("textalign.svm"));
+}
+
+void SvmTest::testMapMode()
+{}
+void SvmTest::testFont()
+{}
+
+void SvmTest::checkPushPop(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/push[1]", {{"flags", "PushAll"}});
+    assertXPathAttrs(pDoc, "/metafile/push[1]/linecolor[1]", {{"color", "#800000"}});
+    assertXPathAttrs(pDoc, "/metafile/push[1]/line[1]", {
+        {"startx", "4"}, {"starty", "4"},
+        {"endx", "6"},   {"endy", "6"},
+    });
+    assertXPathAttrs(pDoc, "/metafile/push[1]/push[1]", {{"flags", "PushLineColor, PushFillColor"}});
+    assertXPathAttrs(pDoc, "/metafile/push[1]/push[1]/line[1]", {
+        {"startx", "5"}, {"starty", "5"},
+        {"endx", "7"},   {"endy", "7"},
+    });
+}
+
+void SvmTest::testPushPop()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetLineColor(COL_YELLOW);
+    pVirtualDev->Push();
+    pVirtualDev->SetLineColor(COL_RED);
+    pVirtualDev->DrawLine(Point(4,4), Point(6,6));
+    pVirtualDev->Push(PushFlags::FILLCOLOR | PushFlags::LINECOLOR);
+    pVirtualDev->SetLineColor(COL_LIGHTRED);
+    pVirtualDev->DrawLine(Point(5,5), Point(7,7));
+    pVirtualDev->Pop();
+    pVirtualDev->Pop();
+    pVirtualDev->DrawLine(Point(1,1), Point(8,8));
+
+    checkPushPop(writeAndReadStream(aGDIMetaFile));
+    checkPushPop(readFile("pushpop.svm"));
+}
+
+void SvmTest::checkRasterOp(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/rasterop[1]", {
+        {"operation", "xor"},
+    });
+}
+
+void SvmTest::testRasterOp()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    pVirtualDev->SetRasterOp(RasterOp::Xor);
+
+    checkRasterOp(writeAndReadStream(aGDIMetaFile));
+    checkRasterOp(readFile("rasterop.svm"));
+}
+
+void SvmTest::checkTransparent(const GDIMetaFile& rMetaFile)
+{
+    xmlDocUniquePtr pDoc = dumpMeta(rMetaFile);
+
+    assertXPathAttrs(pDoc, "/metafile/transparent[1]", {
+        {"transparence", "50"},
+    });
+
+    assertXPathAttrs(pDoc, "/metafile/transparent[1]/polygon/point[1]", {
+        {"x", "1"}, {"y", "8"},
+    });
+    assertXPathAttrs(pDoc, "/metafile/transparent[1]/polygon/point[2]", {
+        {"x", "2"}, {"y", "7"},
+    });
+    assertXPathAttrs(pDoc, "/metafile/transparent[1]/polygon/point[3]", {
+        {"x", "3"}, {"y", "6"},
+    });
+}
+
+void SvmTest::testTransparent()
+{
+    GDIMetaFile aGDIMetaFile;
+    ScopedVclPtrInstance<VirtualDevice> pVirtualDev;
+    setupBaseVirtualDevice(*pVirtualDev, aGDIMetaFile);
+
+    tools::Polygon aPolygon(3);
+    aPolygon.SetPoint(Point(1, 8), 0);
+    aPolygon.SetPoint(Point(2, 7), 1);
+    aPolygon.SetPoint(Point(3, 6), 2);
+
+    tools::PolyPolygon aPolyPolygon(1);
+    aPolyPolygon.Insert(aPolygon);
+
+    pVirtualDev->DrawTransparent(aPolygon, 50);
+
+    CPPUNIT_ASSERT(aGDIMetaFile.HasTransparentActions());
+    checkTransparent(writeAndReadStream(aGDIMetaFile));
+    checkTransparent(readFile("transparent.svm"));
+}
+
+void SvmTest::testFloatTransparent()
+{}
+
+void SvmTest::testEPS()
+{}
+
+void SvmTest::testRefPoint()
+{}
+
+void SvmTest::testComment()
+{}
+
+void SvmTest::testLayoutMode()
+{}
+
+void SvmTest::testTextLanguage()
+{}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(SvmTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/test_blocklist_evaluate.xml b/vcl/qa/cppunit/test_blocklist_evaluate.xml
new file mode 100644
index 000000000..d7b72d6d8
--- /dev/null
+++ b/vcl/qa/cppunit/test_blocklist_evaluate.xml
@@ -0,0 +1,46 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!--
+* This file is part of the LibreOffice project.
+*
+* This Source Code Form is subject to the terms of the Mozilla Public
+* License, v. 2.0. If a copy of the MPL was not distributed with this
+* file, You can obtain one at http://mozilla.org/MPL/2.0/.
+-->
+
+<!--
+    entry attributes:
+    os - "all", "7", "8", "8_1", "10", "windows", "linux", "osx_10_5", "osx_10_6", "osx_10_7", "osx_10_8", "osx"
+    vendor - "all", "intel", "amd", "nvidia", "microsoft"
+    compare - "less", "less_equal", "greater", "greater_equal", "equal", "not_equal", "between_exclusive", "between_inclusive", "between_inclusive_start"
+    version
+    minVersion
+    maxVersion
+-->
+
+<root>
+    <whitelist>
+    </whitelist>
+    <blacklist>
+
+        <entry os="all" vendor="amd" compare="less" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+
+        <entry os="all" vendor="microsoft" compare="equal" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+
+        <entry os="all" vendor="intel" compare="less" version="10.18.14.4264">
+            <device id="all"/>
+        </entry>
+
+        <entry os="osx" vendor="microsoft" compare="equal" version="10.20.30.50">
+            <device id="all"/>
+        </entry>
+
+        <entry os="linux" vendor="microsoft" compare="equal" version="10.20.30.50">
+            <device id="all"/>
+        </entry>
+
+    </blacklist>
+</root>
diff --git a/vcl/qa/cppunit/test_blocklist_parse.xml b/vcl/qa/cppunit/test_blocklist_parse.xml
new file mode 100644
index 000000000..f9af4cb54
--- /dev/null
+++ b/vcl/qa/cppunit/test_blocklist_parse.xml
@@ -0,0 +1,63 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!--
+* This file is part of the LibreOffice project.
+*
+* This Source Code Form is subject to the terms of the Mozilla Public
+* License, v. 2.0. If a copy of the MPL was not distributed with this
+* file, You can obtain one at http://mozilla.org/MPL/2.0/.
+-->
+
+<root>
+    <whitelist>
+        <entry os="all" vendor="all" compare="less" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="7" vendor="nvidia" compare="equal" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="8" vendor="microsoft" compare="not_equal" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="8" vendor="0xcafe" compare="not_equal" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="8_1" compare="between_exclusive" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="10" compare="between_inclusive" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="all" compare="between_inclusive_start" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="all">
+            <device id="all"/>
+        </entry>
+    </whitelist>
+    <blacklist>
+        <entry os="all" vendor="all" compare="less" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="7" vendor="nvidia" compare="equal" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="8" vendor="microsoft" compare="not_equal" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="8" vendor="0xcafe" compare="not_equal" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="8_1" compare="between_exclusive" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="10" compare="between_inclusive" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="all" compare="between_inclusive_start" version="10.20.30.40">
+            <device id="all"/>
+        </entry>
+        <entry os="all">
+            <device id="all"/>
+        </entry>
+    </blacklist>
+</root>
diff --git a/vcl/qa/cppunit/timer.cxx b/vcl/qa/cppunit/timer.cxx
new file mode 100644
index 000000000..4071cd0fd
--- /dev/null
+++ b/vcl/qa/cppunit/timer.cxx
@@ -0,0 +1,566 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+/*
+ * Timers are evil beasts across platforms...
+ */
+
+#include <test/bootstrapfixture.hxx>
+
+#include <osl/thread.hxx>
+#include <chrono>
+
+#include <vcl/timer.hxx>
+#include <vcl/idle.hxx>
+#include <vcl/svapp.hxx>
+#include <vcl/scheduler.hxx>
+#include <svdata.hxx>
+#include <salinst.hxx>
+
+// #define TEST_WATCHDOG
+
+// Enables timer tests that appear to provoke windows under load unduly.
+//#define TEST_TIMERPRECISION
+
+namespace {
+
+/// Avoid our timer tests just wedging the build if they fail.
+class WatchDog : public osl::Thread
+{
+    sal_Int32 mnSeconds;
+public:
+    explicit WatchDog(sal_Int32 nSeconds) :
+        Thread(),
+        mnSeconds( nSeconds )
+    {
+        create();
+    }
+    virtual void SAL_CALL run() override
+    {
+        osl::Thread::wait( std::chrono::seconds(mnSeconds) );
+        fprintf(stderr, "ERROR: WatchDog timer thread expired, failing the test!\n");
+        fflush(stderr);
+        CPPUNIT_ASSERT_MESSAGE("watchdog triggered", false);
+    }
+};
+
+}
+
+static WatchDog * aWatchDog = new WatchDog( 120 ); // random high number in secs
+
+class TimerTest : public test::BootstrapFixture
+{
+public:
+    TimerTest() : BootstrapFixture(true, false) {}
+
+    void testIdle();
+    void testIdleMainloop();
+#ifdef TEST_WATCHDOG
+    void testWatchdog();
+#endif
+    void testDurations();
+#ifdef TEST_TIMERPRECISION
+    void testAutoTimer();
+    void testMultiAutoTimers();
+#endif
+    void testAutoTimerStop();
+    void testNestedTimer();
+    void testSlowTimerCallback();
+    void testTriggerIdleFromIdle();
+    void testInvokedReStart();
+    void testPriority();
+    void testRoundRobin();
+
+    CPPUNIT_TEST_SUITE(TimerTest);
+    CPPUNIT_TEST(testIdle);
+    CPPUNIT_TEST(testIdleMainloop);
+#ifdef TEST_WATCHDOG
+    CPPUNIT_TEST(testWatchdog);
+#endif
+    CPPUNIT_TEST(testDurations);
+#ifdef TEST_TIMERPRECISION
+    CPPUNIT_TEST(testAutoTimer);
+    CPPUNIT_TEST(testMultiAutoTimers);
+#endif
+    CPPUNIT_TEST(testAutoTimerStop);
+    CPPUNIT_TEST(testNestedTimer);
+    CPPUNIT_TEST(testSlowTimerCallback);
+    CPPUNIT_TEST(testTriggerIdleFromIdle);
+    CPPUNIT_TEST(testInvokedReStart);
+    CPPUNIT_TEST(testPriority);
+    CPPUNIT_TEST(testRoundRobin);
+
+    CPPUNIT_TEST_SUITE_END();
+};
+
+#ifdef TEST_WATCHDOG
+void TimerTest::testWatchdog()
+{
+    // out-wait the watchdog.
+    osl::Thread::wait( std::chrono::seconds(12) );
+}
+#endif
+
+namespace {
+
+class IdleBool : public Idle
+{
+    bool &mrBool;
+public:
+    explicit IdleBool( bool &rBool ) :
+        Idle( "IdleBool" ), mrBool( rBool )
+    {
+        SetPriority( TaskPriority::LOWEST );
+        Start();
+        mrBool = false;
+    }
+    virtual void Invoke() override
+    {
+        mrBool = true;
+        Application::EndYield();
+    }
+};
+
+}
+
+void TimerTest::testIdle()
+{
+    bool bTriggered = false;
+    IdleBool aTest( bTriggered );
+    Scheduler::ProcessEventsToIdle();
+    CPPUNIT_ASSERT_MESSAGE("idle triggered", bTriggered);
+}
+
+void TimerTest::testIdleMainloop()
+{
+    bool bTriggered = false;
+    IdleBool aTest( bTriggered );
+    // coverity[loop_top] - Application::Yield allows the timer to fire and toggle bDone
+    while (!bTriggered)
+    {
+        ImplSVData* pSVData = ImplGetSVData();
+
+        // can't test this via Application::Yield since this
+        // also processes all tasks directly via the scheduler.
+        pSVData->maAppData.mnDispatchLevel++;
+        pSVData->mpDefInst->DoYield(true, false);
+        pSVData->maAppData.mnDispatchLevel--;
+    }
+    CPPUNIT_ASSERT_MESSAGE("mainloop idle triggered", bTriggered);
+}
+
+namespace {
+
+class TimerBool : public Timer
+{
+    bool &mrBool;
+public:
+    TimerBool( sal_uLong nMS, bool &rBool ) :
+        Timer( "TimerBool" ), mrBool( rBool )
+    {
+        SetTimeout( nMS );
+        Start();
+        mrBool = false;
+    }
+    virtual void Invoke() override
+    {
+        mrBool = true;
+        Application::EndYield();
+    }
+};
+
+}
+
+void TimerTest::testDurations()
+{
+    static const sal_uLong aDurations[] = { 0, 1, 500, 1000 };
+    for (size_t i = 0; i < SAL_N_ELEMENTS( aDurations ); i++)
+    {
+        bool bDone = false;
+        TimerBool aTimer( aDurations[i], bDone );
+        // coverity[loop_top] - Application::Yield allows the timer to fire and toggle bDone
+        while( !bDone )
+        {
+            Application::Yield();
+        }
+    }
+}
+
+namespace {
+
+class AutoTimerCount : public AutoTimer
+{
+    sal_Int32 &mrCount;
+    const sal_Int32 mnMaxCount;
+
+public:
+    AutoTimerCount( sal_uLong nMS, sal_Int32 &rCount,
+                    const sal_Int32 nMaxCount = -1 )
+        : AutoTimer( "AutoTimerCount" )
+        , mrCount( rCount )
+        , mnMaxCount( nMaxCount )
+    {
+        SetTimeout( nMS );
+        Start();
+        mrCount = 0;
+    }
+
+    virtual void Invoke() override
+    {
+        ++mrCount;
+        CPPUNIT_ASSERT( mnMaxCount < 0 || mrCount <= mnMaxCount );
+        if ( mrCount == mnMaxCount )
+            Stop();
+    }
+};
+
+}
+
+#ifdef TEST_TIMERPRECISION
+
+void TimerTest::testAutoTimer()
+{
+    const sal_Int32 nDurationMs = 30;
+    const sal_Int32 nEventsCount = 5;
+    const double exp = (nDurationMs * nEventsCount);
+
+    sal_Int32 nCount = 0;
+    std::ostringstream msg;
+
+    // Repeat when we have random latencies.
+    // This is expected on non-realtime OSes.
+    for (int i = 0; i < 10; ++i)
+    {
+        const auto start = std::chrono::high_resolution_clock::now();
+        nCount = 0;
+        AutoTimerCount aCount(nDurationMs, nCount);
+        while (nCount < nEventsCount) {
+            Application::Yield();
+        }
+
+        const auto end = std::chrono::high_resolution_clock::now();
+        double dur = std::chrono::duration<double, std::milli>(end - start).count();
+
+        msg << std::setprecision(2) << std::fixed
+            << "periodic multi-timer - dur: "
+            << dur << " (" << exp << ") ms." << std::endl;
+
+        // +/- 20% should be reasonable enough a margin.
+        if (dur >= (exp * 0.8) && dur <= (exp * 1.2))
+        {
+            // Success.
+            return;
+        }
+    }
+
+    CPPUNIT_FAIL(msg.str().c_str());
+}
+
+void TimerTest::testMultiAutoTimers()
+{
+    // The behavior of the timers change drastically
+    // when multiple timers are present.
+    // The worst, in my tests, is when two
+    // timers with 1ms period exist with a
+    // third of much longer period.
+
+    const sal_Int32 nDurationMsX = 5;
+    const sal_Int32 nDurationMsY = 10;
+    const sal_Int32 nDurationMs = 40;
+    const sal_Int32 nEventsCount = 5;
+    const double exp = (nDurationMs * nEventsCount);
+    const double expX = (exp / nDurationMsX);
+    const double expY = (exp / nDurationMsY);
+
+    sal_Int32 nCountX = 0;
+    sal_Int32 nCountY = 0;
+    sal_Int32 nCount = 0;
+    std::ostringstream msg;
+
+    // Repeat when we have random latencies.
+    // This is expected on non-realtime OSes.
+    for (int i = 0; i < 10; ++i)
+    {
+        nCountX = 0;
+        nCountY = 0;
+        nCount = 0;
+
+        const auto start = std::chrono::high_resolution_clock::now();
+        AutoTimerCount aCountX(nDurationMsX, nCountX);
+        AutoTimerCount aCountY(nDurationMsY, nCountY);
+
+        AutoTimerCount aCount(nDurationMs, nCount);
+        // coverity[loop_top] - Application::Yield allows the timer to fire and toggle nCount
+        while (nCount < nEventsCount) {
+            Application::Yield();
+        }
+
+        const auto end = std::chrono::high_resolution_clock::now();
+        double dur = std::chrono::duration<double, std::milli>(end - start).count();
+
+        msg << std::setprecision(2) << std::fixed << "periodic multi-timer - dur: "
+            << dur << " (" << exp << ") ms, nCount: " << nCount
+            << " (" << nEventsCount << "), nCountX: " << nCountX
+            << " (" << expX << "), nCountY: " << nCountY
+            << " (" << expY << ")." << std::endl;
+
+        // +/- 20% should be reasonable enough a margin.
+        if (dur >= (exp * 0.8) && dur <= (exp * 1.2) &&
+            nCountX >= (expX * 0.8) && nCountX <= (expX * 1.2) &&
+            nCountY >= (expY * 0.8) && nCountY <= (expY * 1.2))
+        {
+            // Success.
+            return;
+        }
+    }
+
+    CPPUNIT_FAIL(msg.str().c_str());
+}
+#endif // TEST_TIMERPRECISION
+
+void TimerTest::testAutoTimerStop()
+{
+    sal_Int32 nTimerCount = 0;
+    const sal_Int32 nMaxCount = 5;
+    AutoTimerCount aAutoTimer( 0, nTimerCount, nMaxCount );
+    // coverity[loop_top] - Application::Yield allows the timer to fire and increment TimerCount
+    while (nMaxCount != nTimerCount)
+        Application::Yield();
+    CPPUNIT_ASSERT( !aAutoTimer.IsActive() );
+    CPPUNIT_ASSERT( !Application::Reschedule() );
+}
+
+namespace {
+
+class YieldTimer : public Timer
+{
+public:
+    explicit YieldTimer( sal_uLong nMS ) : Timer( "YieldTimer" )
+    {
+        SetTimeout( nMS );
+        Start();
+    }
+    virtual void Invoke() override
+    {
+        for (int i = 0; i < 100; i++)
+            Application::Yield();
+    }
+};
+
+}
+
+void TimerTest::testNestedTimer()
+{
+    sal_Int32 nCount = 0;
+    YieldTimer aCount(5);
+    AutoTimerCount aCountUp( 3, nCount );
+    // coverity[loop_top] - Application::Yield allows the timer to fire and increment nCount
+    while (nCount < 20)
+        Application::Yield();
+}
+
+namespace {
+
+class SlowCallbackTimer : public Timer
+{
+    bool &mbSlow;
+public:
+    SlowCallbackTimer( sal_uLong nMS, bool &bBeenSlow ) :
+        Timer( "SlowCallbackTimer" ), mbSlow( bBeenSlow )
+    {
+        SetTimeout( nMS );
+        Start();
+        mbSlow = false;
+    }
+    virtual void Invoke() override
+    {
+        osl::Thread::wait( std::chrono::seconds(1) );
+        mbSlow = true;
+    }
+};
+
+}
+
+void TimerTest::testSlowTimerCallback()
+{
+    bool bBeenSlow = false;
+    sal_Int32 nCount = 0;
+    AutoTimerCount aHighFreq(1, nCount);
+    SlowCallbackTimer aSlow(250, bBeenSlow);
+    // coverity[loop_top] - Application::Yield allows the timer to fire and toggle bBeenSlow
+    while (!bBeenSlow)
+        Application::Yield();
+    // coverity[loop_top] - Application::Yield allows the timer to fire and increment nCount
+    while (nCount < 200)
+        Application::Yield();
+}
+
+namespace {
+
+class TriggerIdleFromIdle : public Idle
+{
+    bool* mpTriggered;
+    TriggerIdleFromIdle* mpOther;
+public:
+    explicit TriggerIdleFromIdle( bool* pTriggered, TriggerIdleFromIdle* pOther ) :
+        Idle( "TriggerIdleFromIdle" ), mpTriggered(pTriggered), mpOther(pOther)
+    {
+    }
+    virtual void Invoke() override
+    {
+        Start();
+        if (mpOther)
+            mpOther->Start();
+        Application::Yield();
+        if (mpTriggered)
+            *mpTriggered = true;
+    }
+};
+
+}
+
+void TimerTest::testTriggerIdleFromIdle()
+{
+    bool bTriggered1 = false;
+    bool bTriggered2 = false;
+    TriggerIdleFromIdle aTest2( &bTriggered2, nullptr );
+    TriggerIdleFromIdle aTest1( &bTriggered1, &aTest2 );
+    aTest1.Start();
+    Application::Yield();
+    CPPUNIT_ASSERT_MESSAGE("idle not triggered", bTriggered1);
+    CPPUNIT_ASSERT_MESSAGE("idle not triggered", bTriggered2);
+}
+
+namespace {
+
+class IdleInvokedReStart : public Idle
+{
+    sal_Int32 &mrCount;
+public:
+    IdleInvokedReStart( sal_Int32 &rCount )
+        : Idle( "IdleInvokedReStart" ), mrCount( rCount )
+    {
+        Start();
+    }
+    virtual void Invoke() override
+    {
+        mrCount++;
+        if ( mrCount < 2 )
+            Start();
+    }
+};
+
+}
+
+void TimerTest::testInvokedReStart()
+{
+    sal_Int32 nCount = 0;
+    IdleInvokedReStart aIdle( nCount );
+    Scheduler::ProcessEventsToIdle();
+    CPPUNIT_ASSERT_EQUAL( sal_Int32(2), nCount );
+}
+
+namespace {
+
+class IdleSerializer : public Idle
+{
+    sal_uInt32 mnPosition;
+    sal_uInt32 &mrProcesed;
+public:
+    IdleSerializer(const char *pDebugName, TaskPriority ePrio,
+                   sal_uInt32 nPosition, sal_uInt32 &rProcesed)
+        : Idle( pDebugName )
+        , mnPosition( nPosition )
+        , mrProcesed( rProcesed )
+    {
+        SetPriority(ePrio);
+        Start();
+    }
+    virtual void Invoke() override
+    {
+        ++mrProcesed;
+        CPPUNIT_ASSERT_EQUAL_MESSAGE( "Ignored prio", mnPosition, mrProcesed );
+    }
+};
+
+}
+
+void TimerTest::testPriority()
+{
+    // scope, so tasks are deleted
+    {
+        // Start: 1st Idle low, 2nd high
+        sal_uInt32 nProcessed = 0;
+        IdleSerializer aLowPrioIdle("IdleSerializer LowPrio",
+                                    TaskPriority::LOWEST, 2, nProcessed);
+        IdleSerializer aHighPrioIdle("IdleSerializer HighPrio",
+                                     TaskPriority::HIGHEST, 1, nProcessed);
+        Scheduler::ProcessEventsToIdle();
+        CPPUNIT_ASSERT_EQUAL_MESSAGE( "Not all idles processed", sal_uInt32(2), nProcessed );
+    }
+
+    {
+        // Start: 1st Idle high, 2nd low
+        sal_uInt32 nProcessed = 0;
+        IdleSerializer aHighPrioIdle("IdleSerializer HighPrio",
+                                     TaskPriority::HIGHEST, 1, nProcessed);
+        IdleSerializer aLowPrioIdle("IdleSerializer LowPrio",
+                                    TaskPriority::LOWEST, 2, nProcessed);
+        Scheduler::ProcessEventsToIdle();
+        CPPUNIT_ASSERT_EQUAL_MESSAGE( "Not all idles processed", sal_uInt32(2), nProcessed );
+    }
+}
+
+namespace {
+
+class TestAutoIdleRR : public AutoIdle
+{
+    sal_uInt32 &mrCount;
+
+    DECL_LINK( IdleRRHdl, Timer *, void );
+
+public:
+    TestAutoIdleRR( sal_uInt32 &rCount,
+                    const char *pDebugName )
+        : AutoIdle( pDebugName )
+        , mrCount( rCount )
+    {
+        CPPUNIT_ASSERT_EQUAL( sal_uInt32(0), mrCount );
+        SetInvokeHandler( LINK( this, TestAutoIdleRR, IdleRRHdl ) );
+        Start();
+    }
+};
+
+}
+
+IMPL_LINK_NOARG(TestAutoIdleRR, IdleRRHdl, Timer *, void)
+{
+    ++mrCount;
+    if ( mrCount == 3 )
+        Stop();
+}
+
+void TimerTest::testRoundRobin()
+{
+    sal_uInt32 nCount1 = 0, nCount2 = 0;
+    TestAutoIdleRR aIdle1( nCount1, "TestAutoIdleRR aIdle1" ),
+                   aIdle2( nCount2, "TestAutoIdleRR aIdle2" );
+    while ( Application::Reschedule() )
+    {
+        CPPUNIT_ASSERT( nCount1 == nCount2 || nCount1 - 1 == nCount2 );
+        CPPUNIT_ASSERT( nCount1 <= 3 );
+        CPPUNIT_ASSERT( nCount2 <= 3 );
+    }
+    CPPUNIT_ASSERT( 3 == nCount1 && 3 == nCount2 );
+}
+
+CPPUNIT_TEST_SUITE_REGISTRATION(TimerTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/widgetdraw/WidgetDefinitionReaderTest.cxx b/vcl/qa/cppunit/widgetdraw/WidgetDefinitionReaderTest.cxx
new file mode 100644
index 000000000..d5d0167b7
--- /dev/null
+++ b/vcl/qa/cppunit/widgetdraw/WidgetDefinitionReaderTest.cxx
@@ -0,0 +1,132 @@
+/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- */
+/*
+ * This file is part of the LibreOffice project.
+ *
+ * This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/.
+ */
+
+#include <cppunit/TestAssert.h>
+#include <cppunit/extensions/HelperMacros.h>
+#include <cppunit/plugin/TestPlugIn.h>
+#include <unotest/bootstrapfixturebase.hxx>
+
+#include <widgetdraw/WidgetDefinitionReader.hxx>
+
+namespace
+{
+static OUString const gaDataUrl("/vcl/qa/cppunit/widgetdraw/data/");
+
+class WidgetDefinitionReaderTest : public test::BootstrapFixtureBase
+{
+private:
+    OUString getFullUrl(const OUString& sFileName)
+    {
+        return m_directories.getURLFromSrc(gaDataUrl) + sFileName;
+    }
+
+public:
+    void testRead();
+    void testReadSettings();
+
+    CPPUNIT_TEST_SUITE(WidgetDefinitionReaderTest);
+    CPPUNIT_TEST(testRead);
+    CPPUNIT_TEST(testReadSettings);
+    CPPUNIT_TEST_SUITE_END();
+};
+
+void WidgetDefinitionReaderTest::testReadSettings()
+{
+    {
+        vcl::WidgetDefinition aDefinition;
+        vcl::WidgetDefinitionReader aReader(getFullUrl("definitionSettings1.xml"), getFullUrl(""));
+        CPPUNIT_ASSERT(aReader.read(aDefinition));
+        CPPUNIT_ASSERT_EQUAL(OString(""), aDefinition.mpSettings->msCenteredTabs);
+    }
+
+    {
+        vcl::WidgetDefinition aDefinition;
+        vcl::WidgetDefinitionReader aReader(getFullUrl("definitionSettings2.xml"), getFullUrl(""));
+        CPPUNIT_ASSERT(aReader.read(aDefinition));
+        CPPUNIT_ASSERT_EQUAL(OString("true"), aDefinition.mpSettings->msCenteredTabs);
+    }
+
+    {
+        vcl::WidgetDefinition aDefinition;
+        vcl::WidgetDefinitionReader aReader(getFullUrl("definitionSettings3.xml"), getFullUrl(""));
+        CPPUNIT_ASSERT(aReader.read(aDefinition));
+        CPPUNIT_ASSERT_EQUAL(OString("true"), aDefinition.mpSettings->msNoActiveTabTextRaise);
+        CPPUNIT_ASSERT_EQUAL(OString("false"), aDefinition.mpSettings->msCenteredTabs);
+        CPPUNIT_ASSERT_EQUAL(OString("0"), aDefinition.mpSettings->msListBoxEntryMargin);
+        CPPUNIT_ASSERT_EQUAL(OString("10"), aDefinition.mpSettings->msDefaultFontSize);
+        CPPUNIT_ASSERT_EQUAL(OString("16"), aDefinition.mpSettings->msTitleHeight);
+        CPPUNIT_ASSERT_EQUAL(OString("12"), aDefinition.mpSettings->msFloatTitleHeight);
+        CPPUNIT_ASSERT_EQUAL(OString("15"),
+                             aDefinition.mpSettings->msListBoxPreviewDefaultLogicWidth);
+        CPPUNIT_ASSERT_EQUAL(OString("7"),
+                             aDefinition.mpSettings->msListBoxPreviewDefaultLogicHeight);
+    }
+}
+
+void WidgetDefinitionReaderTest::testRead()
+{
+    vcl::WidgetDefinition aDefinition;
+
+    vcl::WidgetDefinitionReader aReader(getFullUrl("definition1.xml"), getFullUrl(""));
+    CPPUNIT_ASSERT(aReader.read(aDefinition));
+
+    CPPUNIT_ASSERT_EQUAL(OUString("123456"), aDefinition.mpStyle->maFaceColor.AsRGBHexString());
+    CPPUNIT_ASSERT_EQUAL(OUString("234567"), aDefinition.mpStyle->maCheckedColor.AsRGBHexString());
+    CPPUNIT_ASSERT_EQUAL(OUString("345678"), aDefinition.mpStyle->maLightColor.AsRGBHexString());
+
+    CPPUNIT_ASSERT_EQUAL(OUString("ffffff"),
+                         aDefinition.mpStyle->maVisitedLinkColor.AsRGBHexString());
+    CPPUNIT_ASSERT_EQUAL(OUString("ffffff"), aDefinition.mpStyle->maToolTextColor.AsRGBHexString());
+    CPPUNIT_ASSERT_EQUAL(OUString("ffffff"), aDefinition.mpStyle->maFontColor.AsRGBHexString());
+
+    // Pushbutton
+    {
+        ControlState eState
+            = ControlState::DEFAULT | ControlState::ENABLED | ControlState::ROLLOVER;
+        std::vector<std::shared_ptr<vcl::WidgetDefinitionState>> aStates
+            = aDefinition.getDefinition(ControlType::Pushbutton, ControlPart::Entire)
+                  ->getStates(ControlType::Pushbutton, ControlPart::Entire, eState,
+                              PushButtonValue());
+
+        CPPUNIT_ASSERT_EQUAL(size_t(2), aStates.size());
+
+        CPPUNIT_ASSERT_EQUAL(size_t(2), aStates[0]->mpWidgetDrawActions.size());
+        CPPUNIT_ASSERT_EQUAL(vcl::WidgetDrawActionType::RECTANGLE,
+                             aStates[0]->mpWidgetDrawActions[0]->maType);
+        CPPUNIT_ASSERT_EQUAL(vcl::WidgetDrawActionType::LINE,
+                             aStates[0]->mpWidgetDrawActions[1]->maType);
+    }
+
+    // Radiobutton
+    {
+        std::vector<std::shared_ptr<vcl::WidgetDefinitionState>> aStates
+            = aDefinition.getDefinition(ControlType::Radiobutton, ControlPart::Entire)
+                  ->getStates(ControlType::Radiobutton, ControlPart::Entire, ControlState::NONE,
+                              ImplControlValue(ButtonValue::On));
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aStates.size());
+        CPPUNIT_ASSERT_EQUAL(size_t(2), aStates[0]->mpWidgetDrawActions.size());
+    }
+
+    {
+        std::vector<std::shared_ptr<vcl::WidgetDefinitionState>> aStates
+            = aDefinition.getDefinition(ControlType::Radiobutton, ControlPart::Entire)
+                  ->getStates(ControlType::Radiobutton, ControlPart::Entire, ControlState::NONE,
+                              ImplControlValue(ButtonValue::Off));
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aStates.size());
+        CPPUNIT_ASSERT_EQUAL(size_t(1), aStates[0]->mpWidgetDrawActions.size());
+    }
+}
+
+} // namespace
+
+CPPUNIT_TEST_SUITE_REGISTRATION(WidgetDefinitionReaderTest);
+
+CPPUNIT_PLUGIN_IMPLEMENT();
+
+/* vim:set shiftwidth=4 softtabstop=4 expandtab: */
diff --git a/vcl/qa/cppunit/widgetdraw/data/definition1.xml b/vcl/qa/cppunit/widgetdraw/data/definition1.xml
new file mode 100644
index 000000000..041e8fc24
--- /dev/null
+++ b/vcl/qa/cppunit/widgetdraw/data/definition1.xml
@@ -0,0 +1,82 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<widgets>
+    <style>
+        <faceColor value="#123456"/>
+        <checkedColor value="#234567"/>
+        <lightColor value="#345678"/>
+        <lightBorderColor value="#FFFFFF"/>
+        <shadowColor value="#FFFFFF"/>
+        <darkShadowColor value="#FFFFFF"/>
+        <buttonTextColor value="#FFFFFF"/>
+        <buttonRolloverTextColor value="#FFFFFF"/>
+        <radioCheckTextColor value="#FFFFFF"/>
+        <groupTextColor value="#FFFFFF"/>
+        <labelTextColor value="#FFFFFF"/>
+        <windowColor value="#FFFFFF"/>
+        <windowTextColor value="#FFFFFF"/>
+        <dialogColor value="#FFFFFF"/>
+        <dialogTextColor value="#FFFFFF"/>
+        <workspaceColor value="#FFFFFF"/>
+        <monoColor value="#FFFFFF"/>
+        <fieldColor value="#FFFFFF"/>
+        <fieldTextColor value="#FFFFFF"/>
+        <fieldRolloverTextColor value="#FFFFFF"/>
+        <activeColor value="#FFFFFF"/>
+        <activeTextColor value="#FFFFFF"/>
+        <activeBorderColor value="#FFFFFF"/>
+        <deactiveColor value="#FFFFFF"/>
+        <deactiveTextColor value="#FFFFFF"/>
+        <deactiveBorderColor value="#FFFFFF"/>
+        <menuColor value="#FFFFFF"/>
+        <menuBarColor value="#FFFFFF"/>
+        <menuBarRolloverColor value="#FFFFFF"/>
+        <menuBorderColor value="#FFFFFF"/>
+        <menuTextColor value="#FFFFFF"/>
+        <menuBarTextColor value="#FFFFFF"/>
+        <menuBarRolloverTextColor value="#FFFFFF"/>
+        <menuBarHighlightTextColor value="#FFFFFF"/>
+        <menuHighlightColor value="#FFFFFF"/>
+        <menuHighlightTextColor value="#FFFFFF"/>
+        <highlightColor value="#FFFFFF"/>
+        <highlightTextColor value="#FFFFFF"/>
+        <activeTabColor value="#FFFFFF"/>
+        <inactiveTabColor value="#FFFFFF"/>
+        <tabTextColor value="#FFFFFF"/>
+        <tabRolloverTextColor value="#FFFFFF"/>
+        <tabHighlightTextColor value="#FFFFFF"/>
+        <disableColor value="#FFFFFF"/>
+        <helpColor value="#FFFFFF"/>
+        <helpTextColor value="#FFFFFF"/>
+        <linkColor value="#FFFFFF"/>
+        <visitedLinkColor value="#FFFFFF"/>
+        <toolTextColor value="#FFFFFF"/>
+        <fontColor value="#FFFFFF"/>
+    </style>
+    <pushbutton>
+        <part value="Entire">
+            <state enabled="any" focused="any" pressed="any" rollover="any" default="any" selected="any" button-value="any">
+                <rect stroke="#808080" fill="#FFFFFF" stroke-width="1.0" rx="5" ry="5" margin="1"/>
+                <line stroke="#808080" fill="#808080" stroke-width="1.0"/>
+            </state>
+            <state enabled="true" focused="any" pressed="any" rollover="true" default="true" selected="any" button-value="any">
+                <rect stroke="#808080" fill="#808080" stroke-width="1.0" rx="5" ry="5" margin="1"/>
+            </state>
+        </part>
+        <part value="Focus">
+            <state enabled="any" focused="any" pressed="any" rollover="any" default="any" selected="any" button-value="any">
+                <rect stroke="#808080" fill="#FFFFFF" stroke-width="1.0" rx="5" ry="5" margin="1"/>
+            </state>
+        </part>
+    </pushbutton>
+    <radiobutton>
+        <part value="Entire">
+            <state enabled="any" focused="any" pressed="any" rollover="any" default="any" selected="any" button-value="false">
+                <rect stroke="#007AFF" fill="#FFFFFF" stroke-width="1" margin="0"/>
+            </state>
+            <state enabled="any" focused="any" pressed="any" rollover="any" default="any" selected="any" button-value="true">
+                <rect stroke="#007AFF" fill="#FFFFFF" stroke-width="1" margin="0"/>
+                <rect stroke="#007AFF" fill="#007AFF" stroke-width="1" margin="3"/>
+            </state>
+        </part>
+    </radiobutton>
+</widgets>
diff --git a/vcl/qa/cppunit/widgetdraw/data/definitionSettings1.xml b/vcl/qa/cppunit/widgetdraw/data/definitionSettings1.xml
new file mode 100644
index 000000000..9ca7f894f
--- /dev/null
+++ b/vcl/qa/cppunit/widgetdraw/data/definitionSettings1.xml
@@ -0,0 +1,5 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<widgets>
+    <settings>
+    </settings>
+</widgets>
diff --git a/vcl/qa/cppunit/widgetdraw/data/definitionSettings2.xml b/vcl/qa/cppunit/widgetdraw/data/definitionSettings2.xml
new file mode 100644
index 000000000..0d6d6e111
--- /dev/null
+++ b/vcl/qa/cppunit/widgetdraw/data/definitionSettings2.xml
@@ -0,0 +1,6 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<widgets>
+    <settings>
+        <centeredTabs value="true"/>
+    </settings>
+</widgets>
diff --git a/vcl/qa/cppunit/widgetdraw/data/definitionSettings3.xml b/vcl/qa/cppunit/widgetdraw/data/definitionSettings3.xml
new file mode 100644
index 000000000..9ad88dd54
--- /dev/null
+++ b/vcl/qa/cppunit/widgetdraw/data/definitionSettings3.xml
@@ -0,0 +1,13 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<widgets>
+    <settings>
+        <noActiveTabTextRaise value="true"/>
+        <centeredTabs value="false"/>
+        <listBoxEntryMargin value="0"/>
+        <defaultFontSize value="10"/>
+        <titleHeight value="16"/>
+        <floatTitleHeight value="12"/>
+        <listBoxPreviewDefaultLogicWidth value="15"/>
+        <listBoxPreviewDefaultLogicHeight value="7"/>
+    </settings>
+</widgets>