summaryrefslogtreecommitdiffstats
path: root/vendor/papergrid/src/grid
diff options
context:
space:
mode:
authorDaniel Baumann <daniel.baumann@progress-linux.org>2024-06-07 05:48:48 +0000
committerDaniel Baumann <daniel.baumann@progress-linux.org>2024-06-07 05:48:48 +0000
commitef24de24a82fe681581cc130f342363c47c0969a (patch)
tree0d494f7e1a38b95c92426f58fe6eaa877303a86c /vendor/papergrid/src/grid
parentReleasing progress-linux version 1.74.1+dfsg1-1~progress7.99u1. (diff)
downloadrustc-ef24de24a82fe681581cc130f342363c47c0969a.tar.xz
rustc-ef24de24a82fe681581cc130f342363c47c0969a.zip
Merging upstream version 1.75.0+dfsg1.
Signed-off-by: Daniel Baumann <daniel.baumann@progress-linux.org>
Diffstat (limited to 'vendor/papergrid/src/grid')
-rw-r--r--vendor/papergrid/src/grid/compact.rs659
-rw-r--r--vendor/papergrid/src/grid/iterable.rs1358
-rw-r--r--vendor/papergrid/src/grid/mod.rs9
-rw-r--r--vendor/papergrid/src/grid/peekable.rs976
4 files changed, 3002 insertions, 0 deletions
diff --git a/vendor/papergrid/src/grid/compact.rs b/vendor/papergrid/src/grid/compact.rs
new file mode 100644
index 000000000..f9536bd80
--- /dev/null
+++ b/vendor/papergrid/src/grid/compact.rs
@@ -0,0 +1,659 @@
+//! The module contains a [`CompactGrid`] structure,
+//! which is a relatively strict grid.
+
+use core::{
+ borrow::Borrow,
+ fmt::{self, Display, Write},
+};
+
+use crate::{
+ color::{Color, StaticColor},
+ colors::{Colors, NoColors},
+ config::{AlignmentHorizontal, Borders, Indent, Line, Sides},
+ dimension::Dimension,
+ records::Records,
+ util::string::string_width,
+};
+
+use crate::config::compact::CompactConfig;
+
+/// Grid provides a set of methods for building a text-based table.
+#[derive(Debug, Clone)]
+pub struct CompactGrid<R, D, G, C> {
+ records: R,
+ config: G,
+ dimension: D,
+ colors: C,
+}
+
+impl<R, D, G> CompactGrid<R, D, G, NoColors> {
+ /// The new method creates a grid instance with default styles.
+ pub fn new(records: R, dimension: D, config: G) -> Self {
+ CompactGrid {
+ records,
+ config,
+ dimension,
+ colors: NoColors::default(),
+ }
+ }
+}
+
+impl<R, D, G, C> CompactGrid<R, D, G, C> {
+ /// Sets colors map.
+ pub fn with_colors<Colors>(self, colors: Colors) -> CompactGrid<R, D, G, Colors> {
+ CompactGrid {
+ records: self.records,
+ config: self.config,
+ dimension: self.dimension,
+ colors,
+ }
+ }
+
+ /// Builds a table.
+ pub fn build<F>(self, mut f: F) -> fmt::Result
+ where
+ R: Records,
+ D: Dimension,
+ C: Colors,
+ G: Borrow<CompactConfig>,
+ F: Write,
+ {
+ if self.records.count_columns() == 0 {
+ return Ok(());
+ }
+
+ let config = self.config.borrow();
+ print_grid(&mut f, self.records, config, &self.dimension, &self.colors)
+ }
+
+ /// Builds a table into string.
+ ///
+ /// Notice that it consumes self.
+ #[cfg(feature = "std")]
+ #[allow(clippy::inherent_to_string)]
+ pub fn to_string(self) -> String
+ where
+ R: Records,
+ D: Dimension,
+ G: Borrow<CompactConfig>,
+ C: Colors,
+ {
+ let mut buf = String::new();
+ self.build(&mut buf).expect("It's guaranteed to never happen otherwise it's considered an stdlib error or impl error");
+ buf
+ }
+}
+
+impl<R, D, G, C> Display for CompactGrid<R, D, G, C>
+where
+ for<'a> &'a R: Records,
+ D: Dimension,
+ G: Borrow<CompactConfig>,
+ C: Colors,
+{
+ fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+ let records = &self.records;
+ let config = self.config.borrow();
+
+ print_grid(f, records, config, &self.dimension, &self.colors)
+ }
+}
+
+fn print_grid<F: Write, R: Records, D: Dimension, C: Colors>(
+ f: &mut F,
+ records: R,
+ cfg: &CompactConfig,
+ dims: &D,
+ colors: &C,
+) -> fmt::Result {
+ let count_columns = records.count_columns();
+ let count_rows = records.hint_count_rows();
+
+ if count_columns == 0 || matches!(count_rows, Some(0)) {
+ return Ok(());
+ }
+
+ let mut records = records.iter_rows().into_iter();
+ let mut next_columns = records.next();
+
+ if next_columns.is_none() {
+ return Ok(());
+ }
+
+ let wtotal = total_width(cfg, dims, count_columns);
+
+ let borders = cfg.get_borders();
+ let bcolors = cfg.get_borders_color();
+
+ let h_chars = create_horizontal(borders);
+ let h_colors = create_horizontal_colors(bcolors);
+
+ let has_horizontal = borders.has_horizontal();
+ let has_horizontal_colors = bcolors.has_horizontal();
+ let has_horizontal_second = cfg.get_first_horizontal_line().is_some();
+
+ let vert = (
+ borders.left.map(|c| (c, bcolors.left)),
+ borders.vertical.map(|c| (c, bcolors.vertical)),
+ borders.right.map(|c| (c, bcolors.right)),
+ );
+
+ let margin = cfg.get_margin();
+ let margin_color = cfg.get_margin_color();
+ let pad = create_padding(cfg);
+ let align = cfg.get_alignment_horizontal();
+ let mar = (
+ (margin.left, margin_color.left),
+ (margin.right, margin_color.right),
+ );
+
+ let widths = (0..count_columns).map(|col| dims.get_width(col));
+
+ let mut new_line = false;
+
+ if margin.top.size > 0 {
+ let wtotal = wtotal + margin.left.size + margin.right.size;
+ print_indent_lines(f, wtotal, margin.top, margin_color.top)?;
+ new_line = true;
+ }
+
+ if borders.has_top() {
+ if new_line {
+ f.write_char('\n')?
+ }
+
+ print_indent2(f, margin.left, margin_color.left)?;
+
+ let chars = create_horizontal_top(borders);
+ if bcolors.has_top() {
+ let chars_color = create_horizontal_top_colors(bcolors);
+ print_split_line_colored(f, chars, chars_color, dims, count_columns)?;
+ } else {
+ print_split_line(f, chars, dims, count_columns)?;
+ }
+
+ print_indent2(f, margin.right, margin_color.right)?;
+
+ new_line = true;
+ }
+
+ let mut row = 0;
+ while let Some(columns) = next_columns {
+ let columns = columns.into_iter();
+ next_columns = records.next();
+
+ if row > 0 && has_horizontal {
+ if new_line {
+ f.write_char('\n')?;
+ }
+
+ print_indent2(f, margin.left, margin_color.left)?;
+
+ if has_horizontal_colors {
+ print_split_line_colored(f, h_chars, h_colors, dims, count_columns)?;
+ } else {
+ print_split_line(f, h_chars, dims, count_columns)?;
+ }
+
+ print_indent2(f, margin.right, margin_color.right)?;
+ } else if row == 1 && has_horizontal_second {
+ if new_line {
+ f.write_char('\n')?;
+ }
+
+ print_indent2(f, margin.left, margin_color.left)?;
+
+ let h_chars = cfg.get_first_horizontal_line().expect("must be here");
+
+ if has_horizontal_colors {
+ print_split_line_colored(f, h_chars, h_colors, dims, count_columns)?;
+ } else {
+ print_split_line(f, h_chars, dims, count_columns)?;
+ }
+
+ print_indent2(f, margin.right, margin_color.right)?;
+ }
+
+ if new_line {
+ f.write_char('\n')?;
+ }
+
+ let columns = columns
+ .enumerate()
+ .map(|(col, text)| (text, colors.get_color((row, col))));
+
+ let widths = widths.clone();
+ print_grid_row(f, columns, widths, mar, pad, vert, align)?;
+
+ new_line = true;
+ row += 1;
+ }
+
+ if borders.has_bottom() {
+ f.write_char('\n')?;
+
+ print_indent2(f, margin.left, margin_color.left)?;
+
+ let chars = create_horizontal_bottom(borders);
+ if bcolors.has_bottom() {
+ let chars_color = create_horizontal_bottom_colors(bcolors);
+ print_split_line_colored(f, chars, chars_color, dims, count_columns)?;
+ } else {
+ print_split_line(f, chars, dims, count_columns)?;
+ }
+
+ print_indent2(f, margin.right, margin_color.right)?;
+ }
+
+ if cfg.get_margin().bottom.size > 0 {
+ f.write_char('\n')?;
+
+ let wtotal = wtotal + margin.left.size + margin.right.size;
+ print_indent_lines(f, wtotal, margin.bottom, margin_color.bottom)?;
+ }
+
+ Ok(())
+}
+
+type ColoredIndent = (Indent, StaticColor);
+
+#[allow(clippy::too_many_arguments)]
+fn print_grid_row<F, I, T, C, D>(
+ f: &mut F,
+ columns: I,
+ widths: D,
+ mar: (ColoredIndent, ColoredIndent),
+ pad: Sides<ColoredIndent>,
+ vert: (BorderChar, BorderChar, BorderChar),
+ align: AlignmentHorizontal,
+) -> fmt::Result
+where
+ F: Write,
+ I: Iterator<Item = (T, Option<C>)>,
+ T: AsRef<str>,
+ C: Color,
+ D: Iterator<Item = usize> + Clone,
+{
+ if pad.top.0.size > 0 {
+ for _ in 0..pad.top.0.size {
+ print_indent2(f, mar.0 .0, mar.0 .1)?;
+ print_columns_empty_colored(f, widths.clone(), vert, pad.top.1)?;
+ print_indent2(f, mar.1 .0, mar.1 .1)?;
+
+ f.write_char('\n')?;
+ }
+ }
+
+ let mut widths1 = widths.clone();
+ let columns = columns.map(move |(text, color)| {
+ let width = widths1.next().expect("must be here");
+ (text, color, width)
+ });
+
+ print_indent2(f, mar.0 .0, mar.0 .1)?;
+ print_row_columns(f, columns, vert, pad, align)?;
+ print_indent2(f, mar.1 .0, mar.1 .1)?;
+
+ for _ in 0..pad.bottom.0.size {
+ f.write_char('\n')?;
+
+ print_indent2(f, mar.0 .0, mar.0 .1)?;
+ print_columns_empty_colored(f, widths.clone(), vert, pad.bottom.1)?;
+ print_indent2(f, mar.1 .0, mar.1 .1)?;
+ }
+
+ Ok(())
+}
+
+fn create_padding(cfg: &CompactConfig) -> Sides<ColoredIndent> {
+ let pad = cfg.get_padding();
+ let pad_colors = cfg.get_padding_color();
+ Sides::new(
+ (pad.left, pad_colors.left),
+ (pad.right, pad_colors.right),
+ (pad.top, pad_colors.top),
+ (pad.bottom, pad_colors.bottom),
+ )
+}
+
+fn create_horizontal(b: &Borders<char>) -> Line<char> {
+ Line::new(b.horizontal.unwrap_or(' '), b.intersection, b.left, b.right)
+}
+
+fn create_horizontal_top(b: &Borders<char>) -> Line<char> {
+ Line::new(
+ b.top.unwrap_or(' '),
+ b.top_intersection,
+ b.top_left,
+ b.top_right,
+ )
+}
+
+fn create_horizontal_bottom(b: &Borders<char>) -> Line<char> {
+ Line::new(
+ b.bottom.unwrap_or(' '),
+ b.bottom_intersection,
+ b.bottom_left,
+ b.bottom_right,
+ )
+}
+
+fn create_horizontal_colors(
+ b: &Borders<StaticColor>,
+) -> (StaticColor, StaticColor, StaticColor, StaticColor) {
+ (
+ b.horizontal.unwrap_or(StaticColor::default()),
+ b.left.unwrap_or(StaticColor::default()),
+ b.intersection.unwrap_or(StaticColor::default()),
+ b.right.unwrap_or(StaticColor::default()),
+ )
+}
+
+fn create_horizontal_top_colors(
+ b: &Borders<StaticColor>,
+) -> (StaticColor, StaticColor, StaticColor, StaticColor) {
+ (
+ b.top.unwrap_or(StaticColor::default()),
+ b.top_left.unwrap_or(StaticColor::default()),
+ b.top_intersection.unwrap_or(StaticColor::default()),
+ b.top_right.unwrap_or(StaticColor::default()),
+ )
+}
+
+fn create_horizontal_bottom_colors(
+ b: &Borders<StaticColor>,
+) -> (StaticColor, StaticColor, StaticColor, StaticColor) {
+ (
+ b.bottom.unwrap_or(StaticColor::default()),
+ b.bottom_left.unwrap_or(StaticColor::default()),
+ b.bottom_intersection.unwrap_or(StaticColor::default()),
+ b.bottom_right.unwrap_or(StaticColor::default()),
+ )
+}
+
+fn total_width<D: Dimension>(cfg: &CompactConfig, dims: &D, count_columns: usize) -> usize {
+ let content_width = total_columns_width(count_columns, dims);
+ let count_verticals = count_verticals(cfg, count_columns);
+
+ content_width + count_verticals
+}
+
+fn total_columns_width<D: Dimension>(count_columns: usize, dims: &D) -> usize {
+ (0..count_columns).map(|i| dims.get_width(i)).sum::<usize>()
+}
+
+fn count_verticals(cfg: &CompactConfig, count_columns: usize) -> usize {
+ assert!(count_columns > 0);
+
+ let count_verticals = count_columns - 1;
+ let borders = cfg.get_borders();
+ borders.has_vertical() as usize * count_verticals
+ + borders.has_left() as usize
+ + borders.has_right() as usize
+}
+
+type BorderChar = Option<(char, Option<StaticColor>)>;
+
+fn print_row_columns<F, I, T, C>(
+ f: &mut F,
+ mut columns: I,
+ borders: (BorderChar, BorderChar, BorderChar),
+ pad: Sides<ColoredIndent>,
+ align: AlignmentHorizontal,
+) -> Result<(), fmt::Error>
+where
+ F: Write,
+ I: Iterator<Item = (T, Option<C>, usize)>,
+ T: AsRef<str>,
+ C: Color,
+{
+ if let Some((c, color)) = borders.0 {
+ print_char(f, c, color)?;
+ }
+
+ if let Some((text, color, width)) = columns.next() {
+ let text = text.as_ref();
+ let text = text.lines().next().unwrap_or("");
+ print_cell(f, text, width, color, (pad.left, pad.right), align)?;
+ }
+
+ for (text, color, width) in columns {
+ if let Some((c, color)) = borders.1 {
+ print_char(f, c, color)?;
+ }
+
+ let text = text.as_ref();
+ let text = text.lines().next().unwrap_or("");
+ print_cell(f, text, width, color, (pad.left, pad.right), align)?;
+ }
+
+ if let Some((c, color)) = borders.2 {
+ print_char(f, c, color)?;
+ }
+
+ Ok(())
+}
+
+fn print_columns_empty_colored<F: Write, I: Iterator<Item = usize>>(
+ f: &mut F,
+ mut columns: I,
+ borders: (BorderChar, BorderChar, BorderChar),
+ color: StaticColor,
+) -> Result<(), fmt::Error> {
+ if let Some((c, color)) = borders.0 {
+ print_char(f, c, color)?;
+ }
+
+ if let Some(width) = columns.next() {
+ color.fmt_prefix(f)?;
+ repeat_char(f, ' ', width)?;
+ color.fmt_suffix(f)?;
+ }
+
+ for width in columns {
+ if let Some((c, color)) = borders.1 {
+ print_char(f, c, color)?;
+ }
+
+ color.fmt_prefix(f)?;
+ repeat_char(f, ' ', width)?;
+ color.fmt_suffix(f)?;
+ }
+
+ if let Some((c, color)) = borders.2 {
+ print_char(f, c, color)?;
+ }
+
+ Ok(())
+}
+
+fn print_cell<F: Write, C: Color>(
+ f: &mut F,
+ text: &str,
+ width: usize,
+ color: Option<C>,
+ (pad_l, pad_r): (ColoredIndent, ColoredIndent),
+ align: AlignmentHorizontal,
+) -> fmt::Result {
+ let available = width - pad_l.0.size - pad_r.0.size;
+
+ let text_width = string_width(text);
+ let (left, right) = if available < text_width {
+ (0, 0)
+ } else {
+ calculate_indent(align, text_width, available)
+ };
+
+ print_indent(f, pad_l.0.fill, pad_l.0.size, pad_l.1)?;
+
+ repeat_char(f, ' ', left)?;
+ print_text(f, text, color)?;
+ repeat_char(f, ' ', right)?;
+
+ print_indent(f, pad_r.0.fill, pad_r.0.size, pad_r.1)?;
+
+ Ok(())
+}
+
+fn print_split_line_colored<F: Write>(
+ f: &mut F,
+ chars: Line<char>,
+ colors: (StaticColor, StaticColor, StaticColor, StaticColor),
+ dimension: impl Dimension,
+ count_columns: usize,
+) -> fmt::Result {
+ let mut used_color = StaticColor::default();
+
+ if let Some(c) = chars.connect1 {
+ colors.1.fmt_prefix(f)?;
+ f.write_char(c)?;
+ used_color = colors.1;
+ }
+
+ let width = dimension.get_width(0);
+ if width > 0 {
+ prepare_coloring(f, &colors.0, &mut used_color)?;
+ repeat_char(f, chars.main, width)?;
+ }
+
+ for col in 1..count_columns {
+ if let Some(c) = &chars.intersection {
+ prepare_coloring(f, &colors.2, &mut used_color)?;
+ f.write_char(*c)?;
+ }
+
+ let width = dimension.get_width(col);
+ if width > 0 {
+ prepare_coloring(f, &colors.0, &mut used_color)?;
+ repeat_char(f, chars.main, width)?;
+ }
+ }
+
+ if let Some(c) = &chars.connect2 {
+ prepare_coloring(f, &colors.3, &mut used_color)?;
+ f.write_char(*c)?;
+ }
+
+ used_color.fmt_suffix(f)?;
+
+ Ok(())
+}
+
+fn print_split_line<F: Write>(
+ f: &mut F,
+ chars: Line<char>,
+ dimension: impl Dimension,
+ count_columns: usize,
+) -> fmt::Result {
+ if let Some(c) = chars.connect1 {
+ f.write_char(c)?;
+ }
+
+ let width = dimension.get_width(0);
+ if width > 0 {
+ repeat_char(f, chars.main, width)?;
+ }
+
+ for col in 1..count_columns {
+ if let Some(c) = chars.intersection {
+ f.write_char(c)?;
+ }
+
+ let width = dimension.get_width(col);
+ if width > 0 {
+ repeat_char(f, chars.main, width)?;
+ }
+ }
+
+ if let Some(c) = chars.connect2 {
+ f.write_char(c)?;
+ }
+
+ Ok(())
+}
+
+fn print_text<F: Write>(f: &mut F, text: &str, clr: Option<impl Color>) -> fmt::Result {
+ match clr {
+ Some(color) => {
+ color.fmt_prefix(f)?;
+ f.write_str(text)?;
+ color.fmt_suffix(f)
+ }
+ None => f.write_str(text),
+ }
+}
+
+fn prepare_coloring<F: Write>(f: &mut F, clr: &StaticColor, used: &mut StaticColor) -> fmt::Result {
+ if *used != *clr {
+ used.fmt_suffix(f)?;
+ clr.fmt_prefix(f)?;
+ *used = *clr;
+ }
+
+ Ok(())
+}
+
+fn calculate_indent(
+ alignment: AlignmentHorizontal,
+ text_width: usize,
+ available: usize,
+) -> (usize, usize) {
+ let diff = available - text_width;
+ match alignment {
+ AlignmentHorizontal::Left => (0, diff),
+ AlignmentHorizontal::Right => (diff, 0),
+ AlignmentHorizontal::Center => {
+ let left = diff / 2;
+ let rest = diff - left;
+ (left, rest)
+ }
+ }
+}
+
+fn repeat_char<F: Write>(f: &mut F, c: char, n: usize) -> fmt::Result {
+ for _ in 0..n {
+ f.write_char(c)?;
+ }
+
+ Ok(())
+}
+
+fn print_char<F: Write>(f: &mut F, c: char, color: Option<StaticColor>) -> fmt::Result {
+ match color {
+ Some(color) => {
+ color.fmt_prefix(f)?;
+ f.write_char(c)?;
+ color.fmt_suffix(f)
+ }
+ None => f.write_char(c),
+ }
+}
+
+fn print_indent_lines<F: Write>(
+ f: &mut F,
+ width: usize,
+ indent: Indent,
+ color: StaticColor,
+) -> fmt::Result {
+ print_indent(f, indent.fill, width, color)?;
+ f.write_char('\n')?;
+
+ for _ in 1..indent.size {
+ f.write_char('\n')?;
+ print_indent(f, indent.fill, width, color)?;
+ }
+
+ Ok(())
+}
+
+fn print_indent<F: Write>(f: &mut F, c: char, n: usize, color: StaticColor) -> fmt::Result {
+ color.fmt_prefix(f)?;
+ repeat_char(f, c, n)?;
+ color.fmt_suffix(f)?;
+
+ Ok(())
+}
+
+fn print_indent2<F: Write>(f: &mut F, indent: Indent, color: StaticColor) -> fmt::Result {
+ print_indent(f, indent.fill, indent.size, color)
+}
diff --git a/vendor/papergrid/src/grid/iterable.rs b/vendor/papergrid/src/grid/iterable.rs
new file mode 100644
index 000000000..c02998b0b
--- /dev/null
+++ b/vendor/papergrid/src/grid/iterable.rs
@@ -0,0 +1,1358 @@
+//! The module contains a [`Grid`] structure.
+
+use std::{
+ borrow::{Borrow, Cow},
+ cmp,
+ collections::BTreeMap,
+ fmt::{self, Write},
+};
+
+use crate::{
+ color::{AnsiColor, Color},
+ colors::Colors,
+ config::{AlignmentHorizontal, AlignmentVertical, Indent, Position, Sides},
+ dimension::Dimension,
+ records::Records,
+ util::string::{count_lines, get_lines, string_width, string_width_multiline, Lines},
+};
+
+use crate::config::spanned::{Formatting, Offset, SpannedConfig};
+
+/// Grid provides a set of methods for building a text-based table.
+#[derive(Debug, Clone)]
+pub struct Grid<R, D, G, C> {
+ records: R,
+ config: G,
+ dimension: D,
+ colors: C,
+}
+
+impl<R, D, G, C> Grid<R, D, G, C> {
+ /// The new method creates a grid instance with default styles.
+ pub fn new(records: R, dimension: D, config: G, colors: C) -> Self {
+ Grid {
+ records,
+ config,
+ dimension,
+ colors,
+ }
+ }
+}
+
+impl<R, D, G, C> Grid<R, D, G, C> {
+ /// Builds a table.
+ pub fn build<F>(self, mut f: F) -> fmt::Result
+ where
+ R: Records,
+ D: Dimension,
+ C: Colors,
+ G: Borrow<SpannedConfig>,
+ F: Write,
+ {
+ if self.records.count_columns() == 0 || self.records.hint_count_rows() == Some(0) {
+ return Ok(());
+ }
+
+ let config = self.config.borrow();
+ print_grid(&mut f, self.records, config, &self.dimension, &self.colors)
+ }
+
+ /// Builds a table into string.
+ ///
+ /// Notice that it consumes self.
+ #[allow(clippy::inherent_to_string)]
+ pub fn to_string(self) -> String
+ where
+ R: Records,
+ D: Dimension,
+ G: Borrow<SpannedConfig>,
+ C: Colors,
+ {
+ let mut buf = String::new();
+ self.build(&mut buf).expect("It's guaranteed to never happen otherwise it's considered an stdlib error or impl error");
+ buf
+ }
+}
+
+fn print_grid<F: Write, R: Records, D: Dimension, C: Colors>(
+ f: &mut F,
+ records: R,
+ cfg: &SpannedConfig,
+ dimension: &D,
+ colors: &C,
+) -> fmt::Result {
+ // spanned version is a bit more complex and 'supposedly' slower,
+ // because spans are considered to be not a general case we are having 2 versions
+ let grid_has_spans = cfg.has_column_spans() || cfg.has_row_spans();
+ if grid_has_spans {
+ print_grid_spanned(f, records, cfg, dimension, colors)
+ } else {
+ print_grid_general(f, records, cfg, dimension, colors)
+ }
+}
+
+fn print_grid_general<F: Write, R: Records, D: Dimension, C: Colors>(
+ f: &mut F,
+ records: R,
+ cfg: &SpannedConfig,
+ dims: &D,
+ colors: &C,
+) -> fmt::Result {
+ let count_columns = records.count_columns();
+
+ let mut totalw = None;
+ let totalh = records
+ .hint_count_rows()
+ .map(|count_rows| total_height(cfg, dims, count_rows));
+
+ let mut records_iter = records.iter_rows().into_iter();
+ let mut next_columns = records_iter.next();
+
+ if next_columns.is_none() {
+ return Ok(());
+ }
+
+ if cfg.get_margin().top.size > 0 {
+ totalw = Some(output_width(cfg, dims, count_columns));
+
+ print_margin_top(f, cfg, totalw.unwrap())?;
+ f.write_char('\n')?;
+ }
+
+ let mut row = 0;
+ let mut line = 0;
+ let mut is_prev_row_skipped = false;
+ let mut buf = None;
+ while let Some(columns) = next_columns {
+ let columns = columns.into_iter();
+ next_columns = records_iter.next();
+ let is_last_row = next_columns.is_none();
+
+ let height = dims.get_height(row);
+ let count_rows = convert_count_rows(row, is_last_row);
+ let has_horizontal = cfg.has_horizontal(row, count_rows);
+ let shape = (count_rows, count_columns);
+
+ if row > 0 && !is_prev_row_skipped && (has_horizontal || height > 0) {
+ f.write_char('\n')?;
+ }
+
+ if has_horizontal {
+ print_horizontal_line(f, cfg, line, totalh, dims, row, shape)?;
+
+ line += 1;
+
+ if height > 0 {
+ f.write_char('\n')?;
+ }
+ }
+
+ if height == 1 {
+ print_single_line_columns(f, columns, cfg, colors, dims, row, line, totalh, shape)?
+ } else if height > 0 {
+ if buf.is_none() {
+ buf = Some(Vec::with_capacity(count_columns));
+ }
+
+ let buf = buf.as_mut().unwrap();
+ print_multiline_columns(
+ f, columns, cfg, colors, dims, height, row, line, totalh, shape, buf,
+ )?;
+
+ buf.clear();
+ }
+
+ if height == 0 && !has_horizontal {
+ is_prev_row_skipped = true;
+ } else {
+ is_prev_row_skipped = false;
+ }
+
+ line += height;
+ row += 1;
+ }
+
+ if cfg.has_horizontal(row, row) {
+ f.write_char('\n')?;
+ let shape = (row, count_columns);
+ print_horizontal_line(f, cfg, line, totalh, dims, row, shape)?;
+ }
+
+ {
+ let margin = cfg.get_margin();
+ if margin.bottom.size > 0 {
+ let totalw = totalw.unwrap_or_else(|| output_width(cfg, dims, count_columns));
+
+ f.write_char('\n')?;
+ print_margin_bottom(f, cfg, totalw)?;
+ }
+ }
+
+ Ok(())
+}
+
+fn output_width<D: Dimension>(cfg: &SpannedConfig, d: D, count_columns: usize) -> usize {
+ let margin = cfg.get_margin();
+ total_width(cfg, &d, count_columns) + margin.left.size + margin.right.size
+}
+
+#[allow(clippy::too_many_arguments)]
+fn print_horizontal_line<F: Write, D: Dimension>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ line: usize,
+ totalh: Option<usize>,
+ dimension: &D,
+ row: usize,
+ shape: (usize, usize),
+) -> fmt::Result {
+ print_margin_left(f, cfg, line, totalh)?;
+ print_split_line(f, cfg, dimension, row, shape)?;
+ print_margin_right(f, cfg, line, totalh)?;
+ Ok(())
+}
+
+#[allow(clippy::too_many_arguments)]
+fn print_multiline_columns<'a, F, I, D, C>(
+ f: &mut F,
+ columns: I,
+ cfg: &'a SpannedConfig,
+ colors: &'a C,
+ dimension: &D,
+ height: usize,
+ row: usize,
+ line: usize,
+ totalh: Option<usize>,
+ shape: (usize, usize),
+ buf: &mut Vec<Cell<I::Item, &'a C::Color>>,
+) -> fmt::Result
+where
+ F: Write,
+ I: Iterator,
+ I::Item: AsRef<str>,
+ D: Dimension,
+ C: Colors,
+{
+ collect_columns(buf, columns, cfg, colors, dimension, height, row);
+ print_columns_lines(f, buf, height, cfg, line, row, totalh, shape)?;
+ Ok(())
+}
+
+#[allow(clippy::too_many_arguments)]
+fn print_single_line_columns<F, I, D, C>(
+ f: &mut F,
+ columns: I,
+ cfg: &SpannedConfig,
+ colors: &C,
+ dims: &D,
+ row: usize,
+ line: usize,
+ totalh: Option<usize>,
+ shape: (usize, usize),
+) -> fmt::Result
+where
+ F: Write,
+ I: Iterator,
+ I::Item: AsRef<str>,
+ D: Dimension,
+ C: Colors,
+{
+ print_margin_left(f, cfg, line, totalh)?;
+
+ for (col, cell) in columns.enumerate() {
+ let pos = (row, col);
+ let width = dims.get_width(col);
+ let color = colors.get_color(pos);
+ print_vertical_char(f, cfg, pos, 0, 1, shape.1)?;
+ print_single_line_column(f, cell.as_ref(), cfg, width, color, pos)?;
+ }
+
+ print_vertical_char(f, cfg, (row, shape.1), 0, 1, shape.1)?;
+
+ print_margin_right(f, cfg, line, totalh)?;
+
+ Ok(())
+}
+
+fn print_single_line_column<F: Write, C: Color>(
+ f: &mut F,
+ text: &str,
+ cfg: &SpannedConfig,
+ width: usize,
+ color: Option<&C>,
+ pos: Position,
+) -> fmt::Result {
+ let pos = pos.into();
+ let pad = cfg.get_padding(pos);
+ let pad_color = cfg.get_padding_color(pos);
+ let fmt = cfg.get_formatting(pos);
+ let space = cfg.get_justification(pos);
+ let space_color = cfg.get_justification_color(pos);
+
+ let (text, text_width) = if fmt.horizontal_trim && !text.is_empty() {
+ let text = string_trim(text);
+ let width = string_width(&text);
+
+ (text, width)
+ } else {
+ let text = Cow::Borrowed(text);
+ let width = string_width_multiline(&text);
+
+ (text, width)
+ };
+
+ let alignment = *cfg.get_alignment_horizontal(pos);
+ let available_width = width - pad.left.size - pad.right.size;
+ let (left, right) = calculate_indent(alignment, text_width, available_width);
+
+ print_padding(f, &pad.left, pad_color.left.as_ref())?;
+
+ print_indent(f, space, left, space_color)?;
+ print_text(f, &text, color)?;
+ print_indent(f, space, right, space_color)?;
+
+ print_padding(f, &pad.right, pad_color.right.as_ref())?;
+
+ Ok(())
+}
+
+#[allow(clippy::too_many_arguments)]
+fn print_columns_lines<T, F: Write, C: Color>(
+ f: &mut F,
+ buf: &mut [Cell<T, C>],
+ height: usize,
+ cfg: &SpannedConfig,
+ line: usize,
+ row: usize,
+ totalh: Option<usize>,
+ shape: (usize, usize),
+) -> fmt::Result {
+ for i in 0..height {
+ let exact_line = line + i;
+
+ print_margin_left(f, cfg, exact_line, totalh)?;
+
+ for (col, cell) in buf.iter_mut().enumerate() {
+ print_vertical_char(f, cfg, (row, col), i, height, shape.1)?;
+ cell.display(f)?;
+ }
+
+ print_vertical_char(f, cfg, (row, shape.1), i, height, shape.1)?;
+
+ print_margin_right(f, cfg, exact_line, totalh)?;
+
+ if i + 1 != height {
+ f.write_char('\n')?;
+ }
+ }
+
+ Ok(())
+}
+
+fn collect_columns<'a, I, D, C>(
+ buf: &mut Vec<Cell<I::Item, &'a C::Color>>,
+ iter: I,
+ cfg: &SpannedConfig,
+ colors: &'a C,
+ dimension: &D,
+ height: usize,
+ row: usize,
+) where
+ I: Iterator,
+ I::Item: AsRef<str>,
+ C: Colors,
+ D: Dimension,
+{
+ let iter = iter.enumerate().map(|(col, cell)| {
+ let pos = (row, col);
+ let width = dimension.get_width(col);
+ let color = colors.get_color(pos);
+ Cell::new(cell, width, height, cfg, color, pos)
+ });
+
+ buf.extend(iter);
+}
+
+fn print_split_line<F: Write, D: Dimension>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ dimension: &D,
+ row: usize,
+ shape: (usize, usize),
+) -> fmt::Result {
+ let mut used_color = None;
+ print_vertical_intersection(f, cfg, (row, 0), shape, &mut used_color)?;
+
+ for col in 0..shape.1 {
+ let width = dimension.get_width(col);
+
+ // general case
+ if width > 0 {
+ let pos = (row, col);
+ let main = cfg.get_horizontal(pos, shape.0);
+ match main {
+ Some(c) => {
+ let clr = cfg.get_horizontal_color(pos, shape.0);
+ prepare_coloring(f, clr, &mut used_color)?;
+ print_horizontal_border(f, cfg, pos, width, c, &used_color)?;
+ }
+ None => repeat_char(f, ' ', width)?,
+ }
+ }
+
+ print_vertical_intersection(f, cfg, (row, col + 1), shape, &mut used_color)?;
+ }
+
+ if let Some(clr) = used_color.take() {
+ clr.fmt_suffix(f)?;
+ }
+
+ Ok(())
+}
+
+fn print_grid_spanned<F: Write, R: Records, D: Dimension, C: Colors>(
+ f: &mut F,
+ records: R,
+ cfg: &SpannedConfig,
+ dims: &D,
+ colors: &C,
+) -> fmt::Result {
+ let count_columns = records.count_columns();
+
+ let total_width = total_width(cfg, dims, count_columns);
+ let margin = cfg.get_margin();
+ let total_width_with_margin = total_width + margin.left.size + margin.right.size;
+
+ let totalh = records
+ .hint_count_rows()
+ .map(|rows| total_height(cfg, dims, rows));
+
+ if margin.top.size > 0 {
+ print_margin_top(f, cfg, total_width_with_margin)?;
+ f.write_char('\n')?;
+ }
+
+ let mut buf = BTreeMap::new();
+
+ let mut records_iter = records.iter_rows().into_iter();
+ let mut next_columns = records_iter.next();
+
+ let mut need_new_line = false;
+ let mut line = 0;
+ let mut row = 0;
+ while let Some(columns) = next_columns {
+ let columns = columns.into_iter();
+ next_columns = records_iter.next();
+ let is_last_row = next_columns.is_none();
+
+ let height = dims.get_height(row);
+ let count_rows = convert_count_rows(row, is_last_row);
+ let shape = (count_rows, count_columns);
+
+ let has_horizontal = cfg.has_horizontal(row, count_rows);
+ if need_new_line && (has_horizontal || height > 0) {
+ f.write_char('\n')?;
+ need_new_line = false;
+ }
+
+ if has_horizontal {
+ print_margin_left(f, cfg, line, totalh)?;
+ print_split_line_spanned(f, &mut buf, cfg, dims, row, shape)?;
+ print_margin_right(f, cfg, line, totalh)?;
+
+ line += 1;
+
+ if height > 0 {
+ f.write_char('\n')?;
+ }
+ }
+
+ print_spanned_columns(
+ f, &mut buf, columns, cfg, colors, dims, height, row, line, totalh, shape,
+ )?;
+
+ if has_horizontal || height > 0 {
+ need_new_line = true;
+ }
+
+ line += height;
+ row += 1;
+ }
+
+ if row > 0 {
+ if cfg.has_horizontal(row, row) {
+ f.write_char('\n')?;
+ let shape = (row, count_columns);
+ print_horizontal_line(f, cfg, line, totalh, dims, row, shape)?;
+ }
+
+ if margin.bottom.size > 0 {
+ f.write_char('\n')?;
+ print_margin_bottom(f, cfg, total_width_with_margin)?;
+ }
+ }
+
+ Ok(())
+}
+
+fn print_split_line_spanned<S, F: Write, D: Dimension, C: Color>(
+ f: &mut F,
+ buf: &mut BTreeMap<usize, (Cell<S, C>, usize, usize)>,
+ cfg: &SpannedConfig,
+ dimension: &D,
+ row: usize,
+ shape: (usize, usize),
+) -> fmt::Result {
+ let mut used_color = None;
+ print_vertical_intersection(f, cfg, (row, 0), shape, &mut used_color)?;
+
+ for col in 0..shape.1 {
+ let pos = (row, col);
+ if cfg.is_cell_covered_by_both_spans(pos) {
+ continue;
+ }
+
+ let width = dimension.get_width(col);
+ let mut col = col;
+ if cfg.is_cell_covered_by_row_span(pos) {
+ // means it's part of other a spanned cell
+ // so. we just need to use line from other cell.
+
+ let (cell, _, _) = buf.get_mut(&col).unwrap();
+ cell.display(f)?;
+
+ // We need to use a correct right split char.
+ let original_row = closest_visible_row(cfg, pos).unwrap();
+ if let Some(span) = cfg.get_column_span((original_row, col)) {
+ col += span - 1;
+ }
+ } else if width > 0 {
+ // general case
+ let main = cfg.get_horizontal(pos, shape.0);
+ match main {
+ Some(c) => {
+ let clr = cfg.get_horizontal_color(pos, shape.0);
+ prepare_coloring(f, clr, &mut used_color)?;
+ print_horizontal_border(f, cfg, pos, width, c, &used_color)?;
+ }
+ None => repeat_char(f, ' ', width)?,
+ }
+ }
+
+ print_vertical_intersection(f, cfg, (row, col + 1), shape, &mut used_color)?;
+ }
+
+ if let Some(clr) = used_color.take() {
+ clr.fmt_suffix(f)?;
+ }
+
+ Ok(())
+}
+
+fn print_vertical_intersection<'a, F: fmt::Write>(
+ f: &mut F,
+ cfg: &'a SpannedConfig,
+ pos: Position,
+ shape: (usize, usize),
+ used_color: &mut Option<&'a AnsiColor<'static>>,
+) -> fmt::Result {
+ match cfg.get_intersection(pos, shape) {
+ Some(c) => {
+ let clr = cfg.get_intersection_color(pos, shape);
+ prepare_coloring(f, clr, used_color)?;
+ f.write_char(c)
+ }
+ None => Ok(()),
+ }
+}
+
+#[allow(clippy::too_many_arguments, clippy::type_complexity)]
+fn print_spanned_columns<'a, F, I, D, C>(
+ f: &mut F,
+ buf: &mut BTreeMap<usize, (Cell<I::Item, &'a C::Color>, usize, usize)>,
+ iter: I,
+ cfg: &SpannedConfig,
+ colors: &'a C,
+ dimension: &D,
+ this_height: usize,
+ row: usize,
+ line: usize,
+ totalh: Option<usize>,
+ shape: (usize, usize),
+) -> fmt::Result
+where
+ F: Write,
+ I: Iterator,
+ I::Item: AsRef<str>,
+ D: Dimension,
+ C: Colors,
+{
+ if this_height == 0 {
+ // it's possible that we dont show row but it contains an actual cell which will be
+ // rendered after all cause it's a rowspanned
+
+ let mut skip = 0;
+ for (col, cell) in iter.enumerate() {
+ if skip > 0 {
+ skip -= 1;
+ continue;
+ }
+
+ if let Some((_, _, colspan)) = buf.get(&col) {
+ skip = *colspan - 1;
+ continue;
+ }
+
+ let pos = (row, col);
+ let rowspan = cfg.get_row_span(pos).unwrap_or(1);
+ if rowspan < 2 {
+ continue;
+ }
+
+ let height = if rowspan > 1 {
+ range_height(cfg, dimension, row, row + rowspan, shape.0)
+ } else {
+ this_height
+ };
+
+ let colspan = cfg.get_column_span(pos).unwrap_or(1);
+ skip = colspan - 1;
+ let width = if colspan > 1 {
+ range_width(cfg, dimension, col, col + colspan, shape.1)
+ } else {
+ dimension.get_width(col)
+ };
+
+ let color = colors.get_color(pos);
+ let cell = Cell::new(cell, width, height, cfg, color, pos);
+
+ buf.insert(col, (cell, rowspan, colspan));
+ }
+
+ buf.retain(|_, (_, rowspan, _)| {
+ *rowspan -= 1;
+ *rowspan != 0
+ });
+
+ return Ok(());
+ }
+
+ let mut skip = 0;
+ for (col, cell) in iter.enumerate() {
+ if skip > 0 {
+ skip -= 1;
+ continue;
+ }
+
+ if let Some((_, _, colspan)) = buf.get(&col) {
+ skip = *colspan - 1;
+ continue;
+ }
+
+ let pos = (row, col);
+ let colspan = cfg.get_column_span(pos).unwrap_or(1);
+ skip = colspan - 1;
+
+ let width = if colspan > 1 {
+ range_width(cfg, dimension, col, col + colspan, shape.1)
+ } else {
+ dimension.get_width(col)
+ };
+
+ let rowspan = cfg.get_row_span(pos).unwrap_or(1);
+ let height = if rowspan > 1 {
+ range_height(cfg, dimension, row, row + rowspan, shape.0)
+ } else {
+ this_height
+ };
+
+ let color = colors.get_color(pos);
+ let cell = Cell::new(cell, width, height, cfg, color, pos);
+
+ buf.insert(col, (cell, rowspan, colspan));
+ }
+
+ for i in 0..this_height {
+ let exact_line = line + i;
+ let cell_line = i;
+
+ print_margin_left(f, cfg, exact_line, totalh)?;
+
+ for (&col, (cell, _, _)) in buf.iter_mut() {
+ print_vertical_char(f, cfg, (row, col), cell_line, this_height, shape.1)?;
+ cell.display(f)?;
+ }
+
+ print_vertical_char(f, cfg, (row, shape.1), cell_line, this_height, shape.1)?;
+
+ print_margin_right(f, cfg, exact_line, totalh)?;
+
+ if i + 1 != this_height {
+ f.write_char('\n')?;
+ }
+ }
+
+ buf.retain(|_, (_, rowspan, _)| {
+ *rowspan -= 1;
+ *rowspan != 0
+ });
+
+ Ok(())
+}
+
+fn print_horizontal_border<F: Write>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ pos: Position,
+ width: usize,
+ c: char,
+ used_color: &Option<&AnsiColor<'static>>,
+) -> fmt::Result {
+ if !cfg.is_overridden_horizontal(pos) {
+ return repeat_char(f, c, width);
+ }
+
+ for i in 0..width {
+ let c = cfg.lookup_horizontal_char(pos, i, width).unwrap_or(c);
+ match cfg.lookup_horizontal_color(pos, i, width) {
+ Some(color) => match used_color {
+ Some(clr) => {
+ clr.fmt_suffix(f)?;
+ color.fmt_prefix(f)?;
+ f.write_char(c)?;
+ color.fmt_suffix(f)?;
+ clr.fmt_prefix(f)?;
+ }
+ None => {
+ color.fmt_prefix(f)?;
+ f.write_char(c)?;
+ color.fmt_suffix(f)?;
+ }
+ },
+ _ => f.write_char(c)?,
+ }
+ }
+
+ Ok(())
+}
+
+struct Cell<T, C> {
+ lines: LinesIter<T>,
+ width: usize,
+ indent_top: usize,
+ indent_left: Option<usize>,
+ alignh: AlignmentHorizontal,
+ fmt: Formatting,
+ pad: Sides<Indent>,
+ pad_color: Sides<Option<AnsiColor<'static>>>,
+ color: Option<C>,
+ justification: (char, Option<AnsiColor<'static>>),
+}
+
+impl<T, C> Cell<T, C>
+where
+ T: AsRef<str>,
+{
+ fn new(
+ text: T,
+ width: usize,
+ height: usize,
+ cfg: &SpannedConfig,
+ color: Option<C>,
+ pos: Position,
+ ) -> Cell<T, C> {
+ let fmt = *cfg.get_formatting(pos.into());
+ let pad = cfg.get_padding(pos.into());
+ let pad_color = cfg.get_padding_color(pos.into()).clone();
+ let alignh = *cfg.get_alignment_horizontal(pos.into());
+ let alignv = *cfg.get_alignment_vertical(pos.into());
+ let justification = (
+ cfg.get_justification(pos.into()),
+ cfg.get_justification_color(pos.into()).cloned(),
+ );
+
+ let (count_lines, skip) = if fmt.vertical_trim {
+ let (len, top, _) = count_empty_lines(text.as_ref());
+ (len, top)
+ } else {
+ (count_lines(text.as_ref()), 0)
+ };
+
+ let indent_top = top_indent(&pad, alignv, count_lines, height);
+
+ let mut indent_left = None;
+ if !fmt.allow_lines_alignment {
+ let text_width = get_text_width(text.as_ref(), fmt.horizontal_trim);
+ let available = width - pad.left.size - pad.right.size;
+ indent_left = Some(calculate_indent(alignh, text_width, available).0);
+ }
+
+ let mut lines = LinesIter::new(text);
+ for _ in 0..skip {
+ let _ = lines.lines.next();
+ }
+
+ Self {
+ lines,
+ indent_left,
+ indent_top,
+ width,
+ alignh,
+ fmt,
+ pad,
+ pad_color,
+ color,
+ justification,
+ }
+ }
+}
+
+impl<T, C> Cell<T, C>
+where
+ C: Color,
+{
+ fn display<F: Write>(&mut self, f: &mut F) -> fmt::Result {
+ if self.indent_top > 0 {
+ self.indent_top -= 1;
+ print_padding_n(f, &self.pad.top, self.pad_color.top.as_ref(), self.width)?;
+ return Ok(());
+ }
+
+ let line = match self.lines.lines.next() {
+ Some(line) => line,
+ None => {
+ let color = self.pad_color.bottom.as_ref();
+ print_padding_n(f, &self.pad.bottom, color, self.width)?;
+ return Ok(());
+ }
+ };
+
+ let line = if self.fmt.horizontal_trim && !line.is_empty() {
+ string_trim(&line)
+ } else {
+ line
+ };
+
+ let line_width = string_width(&line);
+ let available_width = self.width - self.pad.left.size - self.pad.right.size;
+
+ let (left, right) = if self.fmt.allow_lines_alignment {
+ calculate_indent(self.alignh, line_width, available_width)
+ } else {
+ let left = self.indent_left.expect("must be here");
+ (left, available_width - line_width - left)
+ };
+
+ let (justification, justification_color) =
+ (self.justification.0, self.justification.1.as_ref());
+
+ print_padding(f, &self.pad.left, self.pad_color.left.as_ref())?;
+
+ print_indent(f, justification, left, justification_color)?;
+ print_text(f, &line, self.color.as_ref())?;
+ print_indent(f, justification, right, justification_color)?;
+
+ print_padding(f, &self.pad.right, self.pad_color.right.as_ref())?;
+
+ Ok(())
+ }
+}
+
+struct LinesIter<C> {
+ _cell: C,
+ /// SAFETY: IT'S NOT SAFE TO KEEP THE 'static REFERENCES AROUND AS THEY ARE NOT 'static in reality AND WILL BE DROPPED
+ _text: &'static str,
+ /// SAFETY: IT'S NOT SAFE TO KEEP THE 'static REFERENCES AROUND AS THEY ARE NOT 'static in reality AND WILL BE DROPPED
+ lines: Lines<'static>,
+}
+
+impl<C> LinesIter<C> {
+ fn new(cell: C) -> Self
+ where
+ C: AsRef<str>,
+ {
+ // We want to not allocate a String/Vec.
+ // It's currently not possible due to a lifetime issues. (It's known as self-referential struct)
+ //
+ // Here we change the lifetime of text.
+ //
+ // # Safety
+ //
+ // It must be safe because the referenced string and the references are dropped at the same time.
+ // And the referenced String is guaranteed to not be changed.
+ let text = cell.as_ref();
+ let text = unsafe {
+ std::str::from_utf8_unchecked(std::slice::from_raw_parts(text.as_ptr(), text.len()))
+ };
+
+ let lines = get_lines(text);
+
+ Self {
+ _cell: cell,
+ _text: text,
+ lines,
+ }
+ }
+}
+
+fn print_text<F: Write>(f: &mut F, text: &str, clr: Option<impl Color>) -> fmt::Result {
+ match clr {
+ Some(color) => {
+ color.fmt_prefix(f)?;
+ f.write_str(text)?;
+ color.fmt_suffix(f)
+ }
+ None => f.write_str(text),
+ }
+}
+
+fn prepare_coloring<'a, 'b, F: Write>(
+ f: &mut F,
+ clr: Option<&'a AnsiColor<'b>>,
+ used_color: &mut Option<&'a AnsiColor<'b>>,
+) -> fmt::Result {
+ match clr {
+ Some(clr) => match used_color.as_mut() {
+ Some(used_clr) => {
+ if **used_clr != *clr {
+ used_clr.fmt_suffix(f)?;
+ clr.fmt_prefix(f)?;
+ *used_clr = clr;
+ }
+ }
+ None => {
+ clr.fmt_prefix(f)?;
+ *used_color = Some(clr);
+ }
+ },
+ None => {
+ if let Some(clr) = used_color.take() {
+ clr.fmt_suffix(f)?
+ }
+ }
+ }
+
+ Ok(())
+}
+
+fn top_indent(
+ padding: &Sides<Indent>,
+ alignment: AlignmentVertical,
+ cell_height: usize,
+ available: usize,
+) -> usize {
+ let height = available - padding.top.size;
+ let indent = indent_from_top(alignment, height, cell_height);
+
+ indent + padding.top.size
+}
+
+fn indent_from_top(alignment: AlignmentVertical, available: usize, real: usize) -> usize {
+ match alignment {
+ AlignmentVertical::Top => 0,
+ AlignmentVertical::Bottom => available - real,
+ AlignmentVertical::Center => (available - real) / 2,
+ }
+}
+
+fn calculate_indent(
+ alignment: AlignmentHorizontal,
+ text_width: usize,
+ available: usize,
+) -> (usize, usize) {
+ let diff = available - text_width;
+ match alignment {
+ AlignmentHorizontal::Left => (0, diff),
+ AlignmentHorizontal::Right => (diff, 0),
+ AlignmentHorizontal::Center => {
+ let left = diff / 2;
+ let rest = diff - left;
+ (left, rest)
+ }
+ }
+}
+
+fn repeat_char<F: Write>(f: &mut F, c: char, n: usize) -> fmt::Result {
+ for _ in 0..n {
+ f.write_char(c)?;
+ }
+
+ Ok(())
+}
+
+fn print_vertical_char<F: Write>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ pos: Position,
+ line: usize,
+ count_lines: usize,
+ count_columns: usize,
+) -> fmt::Result {
+ let symbol = match cfg.get_vertical(pos, count_columns) {
+ Some(c) => c,
+ None => return Ok(()),
+ };
+
+ let symbol = cfg
+ .is_overridden_vertical(pos)
+ .then(|| cfg.lookup_vertical_char(pos, line, count_lines))
+ .flatten()
+ .unwrap_or(symbol);
+
+ match cfg.get_vertical_color(pos, count_columns) {
+ Some(clr) => {
+ clr.fmt_prefix(f)?;
+ f.write_char(symbol)?;
+ clr.fmt_suffix(f)?;
+ }
+ None => f.write_char(symbol)?,
+ }
+
+ Ok(())
+}
+
+fn print_margin_top<F: Write>(f: &mut F, cfg: &SpannedConfig, width: usize) -> fmt::Result {
+ let indent = cfg.get_margin().top;
+ let offset = cfg.get_margin_offset().top;
+ let color = cfg.get_margin_color();
+ let color = color.top.as_ref();
+ print_indent_lines(f, &indent, &offset, color, width)
+}
+
+fn print_margin_bottom<F: Write>(f: &mut F, cfg: &SpannedConfig, width: usize) -> fmt::Result {
+ let indent = cfg.get_margin().bottom;
+ let offset = cfg.get_margin_offset().bottom;
+ let color = cfg.get_margin_color();
+ let color = color.bottom.as_ref();
+ print_indent_lines(f, &indent, &offset, color, width)
+}
+
+fn print_margin_left<F: Write>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ line: usize,
+ height: Option<usize>,
+) -> fmt::Result {
+ let indent = cfg.get_margin().left;
+ let offset = cfg.get_margin_offset().left;
+ let color = cfg.get_margin_color();
+ let color = color.left.as_ref();
+ print_margin_vertical(f, indent, offset, color, line, height)
+}
+
+fn print_margin_right<F: Write>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ line: usize,
+ height: Option<usize>,
+) -> fmt::Result {
+ let indent = cfg.get_margin().right;
+ let offset = cfg.get_margin_offset().right;
+ let color = cfg.get_margin_color();
+ let color = color.right.as_ref();
+ print_margin_vertical(f, indent, offset, color, line, height)
+}
+
+fn print_margin_vertical<F: Write>(
+ f: &mut F,
+ indent: Indent,
+ offset: Offset,
+ color: Option<&AnsiColor<'_>>,
+ line: usize,
+ height: Option<usize>,
+) -> fmt::Result {
+ if indent.size == 0 {
+ return Ok(());
+ }
+
+ match offset {
+ Offset::Begin(mut offset) => {
+ if let Some(max) = height {
+ offset = cmp::min(offset, max);
+ }
+
+ if line >= offset {
+ print_indent(f, indent.fill, indent.size, color)?;
+ } else {
+ repeat_char(f, ' ', indent.size)?;
+ }
+ }
+ Offset::End(mut offset) => {
+ if let Some(max) = height {
+ offset = cmp::min(offset, max);
+ let pos = max - offset;
+
+ if line >= pos {
+ repeat_char(f, ' ', indent.size)?;
+ } else {
+ print_indent(f, indent.fill, indent.size, color)?;
+ }
+ } else {
+ print_indent(f, indent.fill, indent.size, color)?;
+ }
+ }
+ }
+
+ Ok(())
+}
+
+fn print_indent_lines<F: Write>(
+ f: &mut F,
+ indent: &Indent,
+ offset: &Offset,
+ color: Option<&AnsiColor<'_>>,
+ width: usize,
+) -> fmt::Result {
+ if indent.size == 0 {
+ return Ok(());
+ }
+
+ let (start_offset, end_offset) = match offset {
+ Offset::Begin(start) => (*start, 0),
+ Offset::End(end) => (0, *end),
+ };
+
+ let start_offset = std::cmp::min(start_offset, width);
+ let end_offset = std::cmp::min(end_offset, width);
+ let indent_size = width - start_offset - end_offset;
+
+ for i in 0..indent.size {
+ if start_offset > 0 {
+ repeat_char(f, ' ', start_offset)?;
+ }
+
+ if indent_size > 0 {
+ print_indent(f, indent.fill, indent_size, color)?;
+ }
+
+ if end_offset > 0 {
+ repeat_char(f, ' ', end_offset)?;
+ }
+
+ if i + 1 != indent.size {
+ f.write_char('\n')?;
+ }
+ }
+
+ Ok(())
+}
+
+fn print_padding<F: Write>(f: &mut F, pad: &Indent, color: Option<&AnsiColor<'_>>) -> fmt::Result {
+ print_indent(f, pad.fill, pad.size, color)
+}
+
+fn print_padding_n<F: Write>(
+ f: &mut F,
+ pad: &Indent,
+ color: Option<&AnsiColor<'_>>,
+ n: usize,
+) -> fmt::Result {
+ print_indent(f, pad.fill, n, color)
+}
+
+fn print_indent<F: Write>(
+ f: &mut F,
+ c: char,
+ n: usize,
+ color: Option<&AnsiColor<'_>>,
+) -> fmt::Result {
+ if n == 0 {
+ return Ok(());
+ }
+
+ match color {
+ Some(color) => {
+ color.fmt_prefix(f)?;
+ repeat_char(f, c, n)?;
+ color.fmt_suffix(f)
+ }
+ None => repeat_char(f, c, n),
+ }
+}
+
+fn range_width(
+ cfg: &SpannedConfig,
+ d: impl Dimension,
+ start: usize,
+ end: usize,
+ max: usize,
+) -> usize {
+ let count_borders = count_verticals_in_range(cfg, start, end, max);
+ let range_width = (start..end).map(|col| d.get_width(col)).sum::<usize>();
+
+ count_borders + range_width
+}
+
+fn range_height(
+ cfg: &SpannedConfig,
+ d: impl Dimension,
+ from: usize,
+ end: usize,
+ max: usize,
+) -> usize {
+ let count_borders = count_horizontals_in_range(cfg, from, end, max);
+ let range_width = (from..end).map(|col| d.get_height(col)).sum::<usize>();
+
+ count_borders + range_width
+}
+
+fn count_horizontals_in_range(cfg: &SpannedConfig, from: usize, end: usize, max: usize) -> usize {
+ (from + 1..end)
+ .map(|i| cfg.has_horizontal(i, max) as usize)
+ .sum()
+}
+
+fn count_verticals_in_range(cfg: &SpannedConfig, start: usize, end: usize, max: usize) -> usize {
+ (start..end)
+ .skip(1)
+ .map(|i| cfg.has_vertical(i, max) as usize)
+ .sum()
+}
+
+fn closest_visible_row(cfg: &SpannedConfig, mut pos: Position) -> Option<usize> {
+ loop {
+ if cfg.is_cell_visible(pos) {
+ return Some(pos.0);
+ }
+
+ if pos.0 == 0 {
+ return None;
+ }
+
+ pos.0 -= 1;
+ }
+}
+
+fn convert_count_rows(row: usize, is_last: bool) -> usize {
+ if is_last {
+ row + 1
+ } else {
+ row + 2
+ }
+}
+
+/// Trims a string.
+fn string_trim(text: &str) -> Cow<'_, str> {
+ #[cfg(feature = "color")]
+ {
+ ansi_str::AnsiStr::ansi_trim(text)
+ }
+
+ #[cfg(not(feature = "color"))]
+ {
+ text.trim().into()
+ }
+}
+
+fn total_width<D: Dimension>(cfg: &SpannedConfig, dimension: &D, count_columns: usize) -> usize {
+ (0..count_columns)
+ .map(|i| dimension.get_width(i))
+ .sum::<usize>()
+ + cfg.count_vertical(count_columns)
+}
+
+fn total_height<D: Dimension>(cfg: &SpannedConfig, dimension: &D, count_rows: usize) -> usize {
+ (0..count_rows)
+ .map(|i| dimension.get_height(i))
+ .sum::<usize>()
+ + cfg.count_horizontal(count_rows)
+}
+
+fn count_empty_lines(cell: &str) -> (usize, usize, usize) {
+ let mut len = 0;
+ let mut top = 0;
+ let mut bottom = 0;
+ let mut top_check = true;
+
+ for line in get_lines(cell) {
+ let is_empty = line.trim().is_empty();
+ if top_check {
+ if is_empty {
+ top += 1;
+ } else {
+ len = 1;
+ top_check = false;
+ }
+
+ continue;
+ }
+
+ if is_empty {
+ bottom += 1;
+ } else {
+ len += bottom + 1;
+ bottom = 0;
+ }
+ }
+
+ (len, top, bottom)
+}
+
+fn get_text_width(text: &str, trim: bool) -> usize {
+ if trim {
+ get_lines(text)
+ .map(|line| string_width(line.trim()))
+ .max()
+ .unwrap_or(0)
+ } else {
+ string_width_multiline(text)
+ }
+}
+
+#[cfg(test)]
+mod tests {
+ // use crate::util::string_width;
+
+ use super::*;
+
+ // #[test]
+ // fn horizontal_alignment_test() {
+ // use std::fmt;
+
+ // struct F<'a>(&'a str, AlignmentHorizontal, usize);
+
+ // impl fmt::Display for F<'_> {
+ // fn fmt(&self, f: &mut impl fmt::Write) -> fmt::Result {
+ // let (left, right) = calculate_indent(self.1, string_width(self.0), self.2);
+ // print_text_formatted(f, &self.0, 4, Option::<&AnsiColor<'_>>::None)
+ // }
+ // }
+
+ // assert_eq!(F("AAA", AlignmentHorizontal::Right, 4).to_string(), " AAA");
+ // assert_eq!(F("AAA", AlignmentHorizontal::Left, 4).to_string(), "AAA ");
+ // assert_eq!(F("AAA", AlignmentHorizontal::Center, 4).to_string(), "AAA ");
+ // assert_eq!(F("🎩", AlignmentHorizontal::Center, 4).to_string(), " 🎩 ");
+ // assert_eq!(F("🎩", AlignmentHorizontal::Center, 3).to_string(), "🎩 ");
+
+ // #[cfg(feature = "color")]
+ // {
+ // use owo_colors::OwoColorize;
+ // let text = "Colored Text".red().to_string();
+ // assert_eq!(
+ // F(&text, AlignmentHorizontal::Center, 15).to_string(),
+ // format!(" {} ", text)
+ // );
+ // }
+ // }
+
+ #[test]
+ fn vertical_alignment_test() {
+ use AlignmentVertical::*;
+
+ assert_eq!(indent_from_top(Bottom, 1, 1), 0);
+ assert_eq!(indent_from_top(Top, 1, 1), 0);
+ assert_eq!(indent_from_top(Center, 1, 1), 0);
+ assert_eq!(indent_from_top(Bottom, 3, 1), 2);
+ assert_eq!(indent_from_top(Top, 3, 1), 0);
+ assert_eq!(indent_from_top(Center, 3, 1), 1);
+ assert_eq!(indent_from_top(Center, 4, 1), 1);
+ }
+
+ #[test]
+ fn count_empty_lines_test() {
+ assert_eq!(count_empty_lines("\n\nsome text\n\n\n"), (1, 2, 3));
+ assert_eq!(count_empty_lines("\n\nsome\ntext\n\n\n"), (2, 2, 3));
+ assert_eq!(count_empty_lines("\n\nsome\nsome\ntext\n\n\n"), (3, 2, 3));
+ assert_eq!(count_empty_lines("\n\n\n\n"), (0, 5, 0));
+ }
+}
diff --git a/vendor/papergrid/src/grid/mod.rs b/vendor/papergrid/src/grid/mod.rs
new file mode 100644
index 000000000..ba3db33bd
--- /dev/null
+++ b/vendor/papergrid/src/grid/mod.rs
@@ -0,0 +1,9 @@
+//! Module contains a list of backends for pretty print tables.
+
+pub mod compact;
+
+#[cfg(feature = "std")]
+pub mod iterable;
+
+#[cfg(feature = "std")]
+pub mod peekable;
diff --git a/vendor/papergrid/src/grid/peekable.rs b/vendor/papergrid/src/grid/peekable.rs
new file mode 100644
index 000000000..ee7877293
--- /dev/null
+++ b/vendor/papergrid/src/grid/peekable.rs
@@ -0,0 +1,976 @@
+//! The module contains a [`PeekableGrid`] structure.
+
+use core::borrow::Borrow;
+use std::{
+ borrow::Cow,
+ cmp,
+ fmt::{self, Write},
+};
+
+use crate::{
+ color::{AnsiColor, Color},
+ colors::Colors,
+ config::spanned::{Formatting, Offset, SpannedConfig},
+ config::{AlignmentHorizontal, AlignmentVertical, Indent, Position, Sides},
+ dimension::Dimension,
+ records::{ExactRecords, PeekableRecords, Records},
+ util::string::string_width,
+};
+
+/// Grid provides a set of methods for building a text-based table.
+#[derive(Debug, Clone)]
+pub struct PeekableGrid<R, G, D, C> {
+ records: R,
+ config: G,
+ dimension: D,
+ colors: C,
+}
+
+impl<R, G, D, C> PeekableGrid<R, G, D, C> {
+ /// The new method creates a grid instance with default styles.
+ pub fn new(records: R, config: G, dimension: D, colors: C) -> Self {
+ PeekableGrid {
+ records,
+ config,
+ dimension,
+ colors,
+ }
+ }
+}
+
+impl<R, G, D, C> PeekableGrid<R, G, D, C> {
+ /// Builds a table.
+ pub fn build<F>(self, mut f: F) -> fmt::Result
+ where
+ R: Records + PeekableRecords + ExactRecords,
+ D: Dimension,
+ C: Colors,
+ G: Borrow<SpannedConfig>,
+ F: Write,
+ {
+ if self.records.count_columns() == 0 || self.records.hint_count_rows() == Some(0) {
+ return Ok(());
+ }
+
+ let config = self.config.borrow();
+ print_grid(&mut f, self.records, config, &self.dimension, &self.colors)
+ }
+
+ /// Builds a table into string.
+ ///
+ /// Notice that it consumes self.
+ #[allow(clippy::inherent_to_string)]
+ pub fn to_string(self) -> String
+ where
+ R: Records + PeekableRecords + ExactRecords,
+ D: Dimension,
+ G: Borrow<SpannedConfig>,
+ C: Colors,
+ {
+ let mut buf = String::new();
+ self.build(&mut buf).expect("It's guaranteed to never happen otherwise it's considered an stdlib error or impl error");
+ buf
+ }
+}
+
+fn print_grid<F: Write, R: Records + PeekableRecords + ExactRecords, D: Dimension, C: Colors>(
+ f: &mut F,
+ records: R,
+ cfg: &SpannedConfig,
+ dimension: &D,
+ colors: &C,
+) -> fmt::Result {
+ if cfg.has_column_spans() || cfg.has_row_spans() {
+ build_grid_spanned(f, &records, cfg, dimension, colors)
+ } else {
+ build_grid(f, &records, cfg, dimension, colors)
+ }
+}
+
+fn build_grid<F: Write, R: Records + PeekableRecords + ExactRecords, D: Dimension, C: Colors>(
+ f: &mut F,
+ records: &R,
+ cfg: &SpannedConfig,
+ dimension: &D,
+ colors: &C,
+) -> fmt::Result {
+ let shape = (records.count_rows(), records.count_columns());
+
+ let total_width = total_width(cfg, dimension, shape.1);
+ let total_width_with_margin =
+ total_width + cfg.get_margin().left.size + cfg.get_margin().right.size;
+
+ let total_height = total_height(cfg, dimension, shape.0);
+
+ if cfg.get_margin().top.size > 0 {
+ print_margin_top(f, cfg, total_width_with_margin)?;
+ f.write_char('\n')?;
+ }
+
+ let mut table_line = 0;
+ let mut prev_empty_horizontal = false;
+ for row in 0..shape.0 {
+ let height = dimension.get_height(row);
+
+ if cfg.has_horizontal(row, shape.0) {
+ if prev_empty_horizontal {
+ f.write_char('\n')?;
+ }
+
+ print_margin_left(f, cfg, table_line, total_height)?;
+ print_split_line(f, cfg, dimension, row, shape)?;
+ print_margin_right(f, cfg, table_line, total_height)?;
+
+ if height > 0 {
+ f.write_char('\n')?;
+ prev_empty_horizontal = false;
+ } else {
+ prev_empty_horizontal = true;
+ }
+
+ table_line += 1;
+ } else if height > 0 && prev_empty_horizontal {
+ f.write_char('\n')?;
+ prev_empty_horizontal = false;
+ }
+
+ for i in 0..height {
+ print_margin_left(f, cfg, table_line, total_height)?;
+
+ for col in 0..records.count_columns() {
+ print_vertical_char(f, cfg, (row, col), i, height, shape.1)?;
+
+ let width = dimension.get_width(col);
+ print_cell_line(f, records, cfg, colors, width, height, (row, col), i)?;
+
+ let is_last_column = col + 1 == records.count_columns();
+ if is_last_column {
+ print_vertical_char(f, cfg, (row, col + 1), i, height, shape.1)?;
+ }
+ }
+
+ print_margin_right(f, cfg, table_line, total_height)?;
+
+ let is_last_line = i + 1 == height;
+ let is_last_row = row + 1 == records.count_rows();
+ if !(is_last_line && is_last_row) {
+ f.write_char('\n')?;
+ }
+
+ table_line += 1;
+ }
+ }
+
+ if cfg.has_horizontal(shape.0, shape.0) {
+ f.write_char('\n')?;
+ print_margin_left(f, cfg, table_line, total_height)?;
+ print_split_line(f, cfg, dimension, records.count_rows(), shape)?;
+ print_margin_right(f, cfg, table_line, total_height)?;
+ }
+
+ if cfg.get_margin().bottom.size > 0 {
+ f.write_char('\n')?;
+ print_margin_bottom(f, cfg, total_width_with_margin)?;
+ }
+
+ Ok(())
+}
+
+fn print_split_line<F: Write, D: Dimension>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ dimension: &D,
+ row: usize,
+ shape: (usize, usize),
+) -> fmt::Result {
+ let mut used_color = None;
+ print_vertical_intersection(f, cfg, (row, 0), shape, &mut used_color)?;
+
+ for col in 0..shape.1 {
+ let width = dimension.get_width(col);
+
+ // general case
+ if width > 0 {
+ let pos = (row, col);
+ let main = cfg.get_horizontal(pos, shape.0);
+ match main {
+ Some(c) => {
+ let clr = cfg.get_horizontal_color(pos, shape.0);
+ prepare_coloring(f, clr, &mut used_color)?;
+ print_horizontal_border(f, cfg, pos, width, c, &used_color)?;
+ }
+ None => repeat_char(f, ' ', width)?,
+ }
+ }
+
+ print_vertical_intersection(f, cfg, (row, col + 1), shape, &mut used_color)?;
+ }
+
+ if let Some(clr) = used_color.take() {
+ clr.fmt_suffix(f)?;
+ }
+
+ Ok(())
+}
+
+fn print_vertical_intersection<'a, F: fmt::Write>(
+ f: &mut F,
+ cfg: &'a SpannedConfig,
+ pos: Position,
+ shape: (usize, usize),
+ used_color: &mut Option<&'a AnsiColor<'static>>,
+) -> fmt::Result {
+ match cfg.get_intersection(pos, shape) {
+ Some(c) => {
+ let clr = cfg.get_intersection_color(pos, shape);
+ prepare_coloring(f, clr, used_color)?;
+ f.write_char(c)
+ }
+ None => Ok(()),
+ }
+}
+
+fn prepare_coloring<'a, 'b, F: Write>(
+ f: &mut F,
+ clr: Option<&'a AnsiColor<'b>>,
+ used_color: &mut Option<&'a AnsiColor<'b>>,
+) -> fmt::Result {
+ match clr {
+ Some(clr) => match used_color.as_mut() {
+ Some(used_clr) => {
+ if **used_clr != *clr {
+ used_clr.fmt_suffix(f)?;
+ clr.fmt_prefix(f)?;
+ *used_clr = clr;
+ }
+ }
+ None => {
+ clr.fmt_prefix(f)?;
+ *used_color = Some(clr);
+ }
+ },
+ None => {
+ if let Some(clr) = used_color.take() {
+ clr.fmt_suffix(f)?
+ }
+ }
+ }
+
+ Ok(())
+}
+
+fn print_vertical_char<F: Write>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ pos: Position,
+ line: usize,
+ count_lines: usize,
+ count_columns: usize,
+) -> fmt::Result {
+ let symbol = match cfg.get_vertical(pos, count_columns) {
+ Some(c) => c,
+ None => return Ok(()),
+ };
+
+ let symbol = cfg
+ .is_overridden_vertical(pos)
+ .then(|| cfg.lookup_vertical_char(pos, line, count_lines))
+ .flatten()
+ .unwrap_or(symbol);
+
+ match cfg.get_vertical_color(pos, count_columns) {
+ Some(clr) => {
+ clr.fmt_prefix(f)?;
+ f.write_char(symbol)?;
+ clr.fmt_suffix(f)?;
+ }
+ None => f.write_char(symbol)?,
+ }
+
+ Ok(())
+}
+
+fn build_grid_spanned<
+ F: Write,
+ R: Records + PeekableRecords + ExactRecords,
+ D: Dimension,
+ C: Colors,
+>(
+ f: &mut F,
+ records: &R,
+ cfg: &SpannedConfig,
+ dims: &D,
+ colors: &C,
+) -> fmt::Result {
+ let shape = (records.count_rows(), records.count_columns());
+
+ let total_width = total_width(cfg, dims, shape.1);
+ let total_width_with_margin =
+ total_width + cfg.get_margin().left.size + cfg.get_margin().right.size;
+
+ let total_height = total_height(cfg, dims, shape.0);
+
+ if cfg.get_margin().top.size > 0 {
+ print_margin_top(f, cfg, total_width_with_margin)?;
+ f.write_char('\n')?;
+ }
+
+ let mut table_line = 0;
+ let mut prev_empty_horizontal = false;
+ for row in 0..records.count_rows() {
+ let count_lines = dims.get_height(row);
+
+ if cfg.has_horizontal(row, shape.0) {
+ if prev_empty_horizontal {
+ f.write_char('\n')?;
+ }
+
+ print_margin_left(f, cfg, table_line, total_height)?;
+ print_split_line_spanned(f, records, cfg, dims, colors, row, shape)?;
+ print_margin_right(f, cfg, table_line, total_height)?;
+
+ if count_lines > 0 {
+ f.write_char('\n')?;
+ prev_empty_horizontal = false;
+ } else {
+ prev_empty_horizontal = true;
+ }
+
+ table_line += 1;
+ } else if count_lines > 0 && prev_empty_horizontal {
+ f.write_char('\n')?;
+ prev_empty_horizontal = false;
+ }
+
+ for i in 0..count_lines {
+ print_margin_left(f, cfg, table_line, total_height)?;
+
+ for col in 0..records.count_columns() {
+ if cfg.is_cell_covered_by_both_spans((row, col)) {
+ continue;
+ }
+
+ if cfg.is_cell_covered_by_column_span((row, col)) {
+ let is_last_column = col + 1 == records.count_columns();
+ if is_last_column {
+ print_vertical_char(f, cfg, (row, col + 1), i, count_lines, shape.1)?;
+ }
+
+ continue;
+ }
+
+ print_vertical_char(f, cfg, (row, col), i, count_lines, shape.1)?;
+
+ if cfg.is_cell_covered_by_row_span((row, col)) {
+ // means it's part of other a spanned cell
+ // so. we just need to use line from other cell.
+ let original_row = closest_visible_row(cfg, (row, col)).unwrap();
+
+ // considering that the content will be printed instead horizontal lines so we can skip some lines.
+ let mut skip_lines = (original_row..row)
+ .map(|i| dims.get_height(i))
+ .sum::<usize>();
+
+ skip_lines += (original_row + 1..=row)
+ .map(|row| cfg.has_horizontal(row, shape.0) as usize)
+ .sum::<usize>();
+
+ let line = i + skip_lines;
+ let pos = (original_row, col);
+
+ let width = get_cell_width(cfg, dims, pos, shape.1);
+ let height = get_cell_height(cfg, dims, pos, shape.0);
+
+ print_cell_line(f, records, cfg, colors, width, height, pos, line)?;
+ } else {
+ let width = get_cell_width(cfg, dims, (row, col), shape.1);
+ let height = get_cell_height(cfg, dims, (row, col), shape.0);
+ print_cell_line(f, records, cfg, colors, width, height, (row, col), i)?;
+ }
+
+ let is_last_column = col + 1 == records.count_columns();
+ if is_last_column {
+ print_vertical_char(f, cfg, (row, col + 1), i, count_lines, shape.1)?;
+ }
+ }
+
+ print_margin_right(f, cfg, table_line, total_height)?;
+
+ let is_last_line = i + 1 == count_lines;
+ let is_last_row = row + 1 == records.count_rows();
+ if !(is_last_line && is_last_row) {
+ f.write_char('\n')?;
+ }
+
+ table_line += 1;
+ }
+ }
+
+ if cfg.has_horizontal(shape.0, shape.0) {
+ f.write_char('\n')?;
+ print_margin_left(f, cfg, table_line, total_height)?;
+ print_split_line(f, cfg, dims, records.count_rows(), shape)?;
+ print_margin_right(f, cfg, table_line, total_height)?;
+ }
+
+ if cfg.get_margin().bottom.size > 0 {
+ f.write_char('\n')?;
+ print_margin_bottom(f, cfg, total_width_with_margin)?;
+ }
+
+ Ok(())
+}
+
+fn print_split_line_spanned<
+ F: Write,
+ R: Records + ExactRecords + PeekableRecords,
+ D: Dimension,
+ C: Colors,
+>(
+ f: &mut F,
+ records: &R,
+ cfg: &SpannedConfig,
+ dims: &D,
+ colors: &C,
+ row: usize,
+ shape: (usize, usize),
+) -> fmt::Result {
+ let mut used_color = None;
+ print_vertical_intersection(f, cfg, (row, 0), shape, &mut used_color)?;
+
+ for col in 0..shape.1 {
+ let pos = (row, col);
+ if cfg.is_cell_covered_by_both_spans(pos) {
+ continue;
+ }
+
+ if cfg.is_cell_covered_by_row_span(pos) {
+ // means it's part of other a spanned cell
+ // so. we just need to use line from other cell.
+
+ let original_row = closest_visible_row(cfg, (row, col)).unwrap();
+
+ // considering that the content will be printed instead horizontal lines so we can skip some lines.
+ let mut skip_lines = (original_row..row)
+ .map(|i| dims.get_height(i))
+ .sum::<usize>();
+
+ // skip horizontal lines
+ if row > 0 {
+ skip_lines += (original_row..row - 1)
+ .map(|row| cfg.has_horizontal(row + 1, shape.0) as usize)
+ .sum::<usize>();
+ }
+
+ let pos = (original_row, col);
+ let height = get_cell_height(cfg, dims, pos, shape.0);
+ let width = get_cell_width(cfg, dims, pos, shape.1);
+ let line = skip_lines;
+
+ print_cell_line(f, records, cfg, colors, width, height, pos, line)?;
+
+ // We need to use a correct right split char.
+ let mut col = col;
+ if let Some(span) = cfg.get_column_span(pos) {
+ col += span - 1;
+ }
+
+ print_vertical_intersection(f, cfg, (row, col + 1), shape, &mut used_color)?;
+
+ continue;
+ }
+
+ let width = dims.get_width(col);
+ if width > 0 {
+ // general case
+ let main = cfg.get_horizontal(pos, shape.0);
+ match main {
+ Some(c) => {
+ let clr = cfg.get_horizontal_color(pos, shape.0);
+ prepare_coloring(f, clr, &mut used_color)?;
+ print_horizontal_border(f, cfg, pos, width, c, &used_color)?;
+ }
+ None => repeat_char(f, ' ', width)?,
+ }
+ }
+
+ print_vertical_intersection(f, cfg, (row, col + 1), shape, &mut used_color)?;
+ }
+
+ if let Some(clr) = used_color {
+ clr.fmt_suffix(f)?;
+ }
+
+ Ok(())
+}
+
+fn print_horizontal_border<F: Write>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ pos: Position,
+ width: usize,
+ c: char,
+ used_color: &Option<&AnsiColor<'static>>,
+) -> fmt::Result {
+ if !cfg.is_overridden_horizontal(pos) {
+ return repeat_char(f, c, width);
+ }
+
+ for i in 0..width {
+ let c = cfg.lookup_horizontal_char(pos, i, width).unwrap_or(c);
+ match cfg.lookup_horizontal_color(pos, i, width) {
+ Some(color) => match used_color {
+ Some(clr) => {
+ clr.fmt_suffix(f)?;
+ color.fmt_prefix(f)?;
+ f.write_char(c)?;
+ color.fmt_suffix(f)?;
+ clr.fmt_prefix(f)?;
+ }
+ None => {
+ color.fmt_prefix(f)?;
+ f.write_char(c)?;
+ color.fmt_suffix(f)?;
+ }
+ },
+ _ => f.write_char(c)?,
+ }
+ }
+
+ Ok(())
+}
+
+#[allow(clippy::too_many_arguments)]
+fn print_cell_line<F: Write, R: Records + PeekableRecords + ExactRecords, C: Colors>(
+ f: &mut F,
+ records: &R,
+ cfg: &SpannedConfig,
+ colors: &C,
+ width: usize,
+ height: usize,
+ pos: Position,
+ line: usize,
+) -> fmt::Result {
+ let entity = pos.into();
+
+ let mut cell_height = records.count_lines(pos);
+ let formatting = *cfg.get_formatting(entity);
+ if formatting.vertical_trim {
+ cell_height -=
+ count_empty_lines_at_start(records, pos) + count_empty_lines_at_end(records, pos);
+ }
+
+ if cell_height > height {
+ // it may happen if the height estimation decide so
+ cell_height = height;
+ }
+
+ let pad = cfg.get_padding(entity);
+ let pad_color = cfg.get_padding_color(entity);
+ let alignment = cfg.get_alignment_vertical(entity);
+ let indent = top_indent(&pad, *alignment, cell_height, height);
+ if indent > line {
+ return print_indent(f, pad.top.fill, width, pad_color.top.as_ref());
+ }
+
+ let mut index = line - indent;
+ let cell_has_this_line = cell_height > index;
+ if !cell_has_this_line {
+ // happens when other cells have bigger height
+ return print_indent(f, pad.bottom.fill, width, pad_color.bottom.as_ref());
+ }
+
+ if formatting.vertical_trim {
+ let empty_lines = count_empty_lines_at_start(records, pos);
+ index += empty_lines;
+
+ if index > records.count_lines(pos) {
+ return print_indent(f, pad.top.fill, width, pad_color.top.as_ref());
+ }
+ }
+
+ print_indent(f, pad.left.fill, pad.left.size, pad_color.left.as_ref())?;
+
+ let width = width - pad.left.size - pad.right.size;
+ let alignment = *cfg.get_alignment_horizontal(entity);
+ let justification = (
+ cfg.get_justification(entity),
+ cfg.get_justification_color(entity),
+ );
+ let color = colors.get_color(pos);
+ print_line(
+ f,
+ records,
+ pos,
+ index,
+ alignment,
+ formatting,
+ color,
+ justification,
+ width,
+ )?;
+
+ print_indent(f, pad.right.fill, pad.right.size, pad_color.right.as_ref())?;
+
+ Ok(())
+}
+
+#[allow(clippy::too_many_arguments)]
+fn print_line<F: Write, R: Records + PeekableRecords, C: Color>(
+ f: &mut F,
+ records: &R,
+ pos: Position,
+ index: usize,
+ alignment: AlignmentHorizontal,
+ formatting: Formatting,
+ color: Option<C>,
+ justification: (char, Option<&AnsiColor<'_>>),
+ available: usize,
+) -> fmt::Result {
+ let line = records.get_line(pos, index);
+ let (line, line_width) = if formatting.horizontal_trim {
+ let line = string_trim(line);
+ let width = string_width(&line);
+ (line, width)
+ } else {
+ let width = records.get_line_width(pos, index);
+ (Cow::Borrowed(line), width)
+ };
+
+ if formatting.allow_lines_alignment {
+ let (left, right) = calculate_indent(alignment, line_width, available);
+ return print_text_with_pad(f, &line, color, justification, left, right);
+ }
+
+ let cell_width = if formatting.horizontal_trim {
+ (0..records.count_lines(pos))
+ .map(|i| records.get_line(pos, i))
+ .map(|line| string_width(line.trim()))
+ .max()
+ .unwrap_or_default()
+ } else {
+ records.get_width(pos)
+ };
+
+ let (left, right) = calculate_indent(alignment, cell_width, available);
+ print_text_with_pad(f, &line, color, justification, left, right)?;
+
+ // todo: remove me
+ let rest_width = cell_width - line_width;
+ repeat_char(f, ' ', rest_width)?;
+
+ Ok(())
+}
+
+fn print_text_with_pad<F: Write, C: Color>(
+ f: &mut F,
+ text: &str,
+ color: Option<C>,
+ justification: (char, Option<&AnsiColor<'_>>),
+ left: usize,
+ right: usize,
+) -> fmt::Result {
+ print_indent(f, justification.0, left, justification.1)?;
+ print_text(f, text, color)?;
+ print_indent(f, justification.0, right, justification.1)?;
+ Ok(())
+}
+
+fn print_text<F: Write, C: Color>(f: &mut F, text: &str, clr: Option<C>) -> fmt::Result {
+ match clr {
+ Some(color) => {
+ color.fmt_prefix(f)?;
+ f.write_str(text)?;
+ color.fmt_suffix(f)
+ }
+ None => f.write_str(text),
+ }
+}
+
+fn top_indent(
+ pad: &Sides<Indent>,
+ alignment: AlignmentVertical,
+ cell_height: usize,
+ available: usize,
+) -> usize {
+ let height = available - pad.top.size;
+ let indent = indent_from_top(alignment, height, cell_height);
+
+ indent + pad.top.size
+}
+
+fn indent_from_top(alignment: AlignmentVertical, available: usize, real: usize) -> usize {
+ match alignment {
+ AlignmentVertical::Top => 0,
+ AlignmentVertical::Bottom => available - real,
+ AlignmentVertical::Center => (available - real) / 2,
+ }
+}
+
+fn calculate_indent(
+ alignment: AlignmentHorizontal,
+ text_width: usize,
+ available: usize,
+) -> (usize, usize) {
+ let diff = available - text_width;
+ match alignment {
+ AlignmentHorizontal::Left => (0, diff),
+ AlignmentHorizontal::Right => (diff, 0),
+ AlignmentHorizontal::Center => {
+ let left = diff / 2;
+ let rest = diff - left;
+ (left, rest)
+ }
+ }
+}
+
+fn repeat_char<F: Write>(f: &mut F, c: char, n: usize) -> fmt::Result {
+ for _ in 0..n {
+ f.write_char(c)?;
+ }
+
+ Ok(())
+}
+
+fn count_empty_lines_at_end<R>(records: &R, pos: Position) -> usize
+where
+ R: Records + PeekableRecords,
+{
+ (0..records.count_lines(pos))
+ .map(|i| records.get_line(pos, i))
+ .rev()
+ .take_while(|l| l.trim().is_empty())
+ .count()
+}
+
+fn count_empty_lines_at_start<R>(records: &R, pos: Position) -> usize
+where
+ R: Records + PeekableRecords,
+{
+ (0..records.count_lines(pos))
+ .map(|i| records.get_line(pos, i))
+ .take_while(|s| s.trim().is_empty())
+ .count()
+}
+
+fn total_width<D: Dimension>(cfg: &SpannedConfig, dimension: &D, count_columns: usize) -> usize {
+ (0..count_columns)
+ .map(|i| dimension.get_width(i))
+ .sum::<usize>()
+ + cfg.count_vertical(count_columns)
+}
+
+fn total_height<D: Dimension>(cfg: &SpannedConfig, dimension: &D, count_rows: usize) -> usize {
+ (0..count_rows)
+ .map(|i| dimension.get_height(i))
+ .sum::<usize>()
+ + cfg.count_horizontal(count_rows)
+}
+
+fn print_margin_top<F: Write>(f: &mut F, cfg: &SpannedConfig, width: usize) -> fmt::Result {
+ let indent = cfg.get_margin().top;
+ let offset = cfg.get_margin_offset().top;
+ let color = cfg.get_margin_color();
+ let color = color.top.as_ref();
+ print_indent_lines(f, &indent, &offset, color, width)
+}
+
+fn print_margin_bottom<F: Write>(f: &mut F, cfg: &SpannedConfig, width: usize) -> fmt::Result {
+ let indent = cfg.get_margin().bottom;
+ let offset = cfg.get_margin_offset().bottom;
+ let color = cfg.get_margin_color();
+ let color = color.bottom.as_ref();
+ print_indent_lines(f, &indent, &offset, color, width)
+}
+
+fn print_margin_left<F: Write>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ line: usize,
+ height: usize,
+) -> fmt::Result {
+ let indent = cfg.get_margin().left;
+ let offset = cfg.get_margin_offset().left;
+ let color = cfg.get_margin_color();
+ let color = color.left.as_ref();
+ print_margin_vertical(f, indent, offset, color, line, height)
+}
+
+fn print_margin_right<F: Write>(
+ f: &mut F,
+ cfg: &SpannedConfig,
+ line: usize,
+ height: usize,
+) -> fmt::Result {
+ let indent = cfg.get_margin().right;
+ let offset = cfg.get_margin_offset().right;
+ let color = cfg.get_margin_color();
+ let color = color.right.as_ref();
+ print_margin_vertical(f, indent, offset, color, line, height)
+}
+
+fn print_margin_vertical<F: Write>(
+ f: &mut F,
+ indent: Indent,
+ offset: Offset,
+ color: Option<&AnsiColor<'_>>,
+ line: usize,
+ height: usize,
+) -> fmt::Result {
+ if indent.size == 0 {
+ return Ok(());
+ }
+
+ match offset {
+ Offset::Begin(offset) => {
+ let offset = cmp::min(offset, height);
+ if line >= offset {
+ print_indent(f, indent.fill, indent.size, color)?;
+ } else {
+ repeat_char(f, ' ', indent.size)?;
+ }
+ }
+ Offset::End(offset) => {
+ let offset = cmp::min(offset, height);
+ let pos = height - offset;
+
+ if line >= pos {
+ repeat_char(f, ' ', indent.size)?;
+ } else {
+ print_indent(f, indent.fill, indent.size, color)?;
+ }
+ }
+ }
+
+ Ok(())
+}
+
+fn print_indent_lines<F: Write>(
+ f: &mut F,
+ indent: &Indent,
+ offset: &Offset,
+ color: Option<&AnsiColor<'_>>,
+ width: usize,
+) -> fmt::Result {
+ if indent.size == 0 {
+ return Ok(());
+ }
+
+ let (start_offset, end_offset) = match offset {
+ Offset::Begin(start) => (*start, 0),
+ Offset::End(end) => (0, *end),
+ };
+
+ let start_offset = std::cmp::min(start_offset, width);
+ let end_offset = std::cmp::min(end_offset, width);
+ let indent_size = width - start_offset - end_offset;
+
+ for i in 0..indent.size {
+ if start_offset > 0 {
+ repeat_char(f, ' ', start_offset)?;
+ }
+
+ if indent_size > 0 {
+ print_indent(f, indent.fill, indent_size, color)?;
+ }
+
+ if end_offset > 0 {
+ repeat_char(f, ' ', end_offset)?;
+ }
+
+ if i + 1 != indent.size {
+ f.write_char('\n')?;
+ }
+ }
+
+ Ok(())
+}
+
+fn print_indent<F: Write, C: Color>(f: &mut F, c: char, n: usize, color: Option<C>) -> fmt::Result {
+ if n == 0 {
+ return Ok(());
+ }
+
+ match color {
+ Some(color) => {
+ color.fmt_prefix(f)?;
+ repeat_char(f, c, n)?;
+ color.fmt_suffix(f)
+ }
+ None => repeat_char(f, c, n),
+ }
+}
+
+fn get_cell_width<D: Dimension>(cfg: &SpannedConfig, dims: &D, pos: Position, max: usize) -> usize {
+ match cfg.get_column_span(pos) {
+ Some(span) => {
+ let start = pos.1;
+ let end = pos.1 + span;
+ range_width(dims, start, end) + count_verticals_range(cfg, start, end, max)
+ }
+ None => dims.get_width(pos.1),
+ }
+}
+
+fn range_width<D: Dimension>(dims: &D, start: usize, end: usize) -> usize {
+ (start..end).map(|col| dims.get_width(col)).sum::<usize>()
+}
+
+fn count_verticals_range(cfg: &SpannedConfig, start: usize, end: usize, max: usize) -> usize {
+ (start + 1..end)
+ .map(|i| cfg.has_vertical(i, max) as usize)
+ .sum()
+}
+
+fn get_cell_height<D: Dimension>(
+ cfg: &SpannedConfig,
+ dims: &D,
+ pos: Position,
+ max: usize,
+) -> usize {
+ match cfg.get_row_span(pos) {
+ Some(span) => {
+ let start = pos.0;
+ let end = pos.0 + span;
+ range_height(dims, start, end) + count_horizontals_range(cfg, start, end, max)
+ }
+ None => dims.get_height(pos.0),
+ }
+}
+
+fn range_height<D: Dimension>(dims: &D, start: usize, end: usize) -> usize {
+ (start..end).map(|col| dims.get_height(col)).sum::<usize>()
+}
+
+fn count_horizontals_range(cfg: &SpannedConfig, start: usize, end: usize, max: usize) -> usize {
+ (start + 1..end)
+ .map(|i| cfg.has_horizontal(i, max) as usize)
+ .sum()
+}
+
+fn closest_visible_row(cfg: &SpannedConfig, mut pos: Position) -> Option<usize> {
+ loop {
+ if cfg.is_cell_visible(pos) {
+ return Some(pos.0);
+ }
+
+ if pos.0 == 0 {
+ return None;
+ }
+
+ pos.0 -= 1;
+ }
+}
+
+/// Trims a string.
+fn string_trim(text: &str) -> Cow<'_, str> {
+ #[cfg(feature = "color")]
+ {
+ ansi_str::AnsiStr::ansi_trim(text)
+ }
+
+ #[cfg(not(feature = "color"))]
+ {
+ text.trim().into()
+ }
+}